axelloft1

Op kick off gui roblox

Jun 25th, 2020
4,833
Never
Not a member of Pastebin yet? Sign Up, it unlocks many cool features!
  1. --[[
  2. Op kick off gui By axelloft1
  3. ]]
  4. return(function(llIIlIIlIllIlIIIIlI,IIllllIlIIIIIlIlII,lIllIlIlIIIll)local IllIIIlIlIlIIIlIIlIl=string.char;local IIlllllIlIllIIIll=string.sub;local IlllllIlIllI=table.concat;local llIllIIllIlII=math.ldexp;local IIlIlIlllIIIlIlIIll=getfenv or function()return _ENV end;local IlIIIIllIlII=select;local lIlIllllIIIlIl=unpack or table.unpack;local lIIIIIllIlIIIlllIIIlIII=tonumber;local function llIlllIIlIIlIIIlIlIlI(llIIlIIlIllIlIIIIlI)local IIllllIlllIl,IIIllIlll,IlIIlllI="","",{}local lIlIllllIIIlIl=256;local lIIlllIIllI={}for IIllllIlIIIIIlIlII=0,lIlIllllIIIlIl-1 do lIIlllIIllI[IIllllIlIIIIIlIlII]=IllIIIlIlIlIIIlIIlIl(IIllllIlIIIIIlIlII)end;local IIllllIlIIIIIlIlII=1;local function lIIIlIlIIIlIllI()local IIllllIlllIl=lIIIIIllIlIIIlllIIIlIII(IIlllllIlIllIIIll(llIIlIIlIllIlIIIIlI,IIllllIlIIIIIlIlII,IIllllIlIIIIIlIlII),36)IIllllIlIIIIIlIlII=IIllllIlIIIIIlIlII+1;local IIIllIlll=lIIIIIllIlIIIlllIIIlIII(IIlllllIlIllIIIll(llIIlIIlIllIlIIIIlI,IIllllIlIIIIIlIlII,IIllllIlIIIIIlIlII+IIllllIlllIl-1),36)IIllllIlIIIIIlIlII=IIllllIlIIIIIlIlII+IIllllIlllIl;return IIIllIlll end;IIllllIlllIl=IllIIIlIlIlIIIlIIlIl(lIIIlIlIIIlIllI())IlIIlllI[1]=IIllllIlllIl;while IIllllIlIIIIIlIlII<#llIIlIIlIllIlIIIIlI do local IIllllIlIIIIIlIlII=lIIIlIlIIIlIllI()if lIIlllIIllI[IIllllIlIIIIIlIlII]then IIIllIlll=lIIlllIIllI[IIllllIlIIIIIlIlII]else IIIllIlll=IIllllIlllIl..IIlllllIlIllIIIll(IIllllIlllIl,1,1)end;lIIlllIIllI[lIlIllllIIIlIl]=IIllllIlllIl..IIlllllIlIllIIIll(IIIllIlll,1,1)IlIIlllI[#IlIIlllI+1],IIllllIlllIl,lIlIllllIIIlIl=IIIllIlll,IIIllIlll,lIlIllllIIIlIl+1 end;return table.concat(IlIIlllI)end;local lIIIIIllIlIIIlllIIIlIII=llIlllIIlIIlIIIlIlIlI('21H22227522221U2761321021L21Q21721021521B22222127621021B21P22221V2761P21521K21B21B2101D21R1Z2222272761C21K21721327H21T27921321721921B1821R21Q21Q21121027O2761U21B21E21Q1621721421B21222222528L28N21Q1821121E22221S28X28O28E28G28I2222262761428528727621421F21721E28T21221121821Q23F2222242761Q21727T21021Q29A27621929E28V29T21221721F21B21K21L222288275162112152172121Q2A52A721K22221Y2761T2171Z21Q1C21121K191Y1Z21221A28K2752AJ2A62A827X27Z21W2761G27A21A28N1821B1Y21721O1Z2AV29Z2751F21021R2132A32751P1Z2142121Z21021927I2761829V22222I2C22172151X21921K21121R21021A1921129M21K23D29R2762CH2CJ2CL28W2752182CC2131O1D1827J2762D022222K2C72C92CB2CD2CF1U28427B21M29V27V21521F2212182DI2DJ24C2392AN2C22AV2BD2AW2CI2AV23D2CZ27624Q2111A22221X2DO21K2DQ2BU21C21B1Q1Z29K28U2782B321121L2AS2BK28J2812751V1E1Z21323C22125I22D21121724Z1726O2392211H24I21726I22D1R23X2DM29B2BT1Z2E62DV2761Z1A2FC2752382DZ2942751E21B21L21M21221B2A121A2112FG2222562EY2D11A2DY2BS2221S1Z2EF2BW21B2202752AO2751C2AH21L21B1P27D2132BY2172FV132DZ2EJ2221328A28C22222L27621K21421E21721L2GF21Q1Z21A23422T22T23J23C23D23C23I23F23723G23623H2E02792102182BY2AS2GG2GI2GK2FV24Q2FY2D124A2HU27623U2142DZ2F82222AU29X2222B92BT2CD21K27G1P27E21L2902B02BM22228M28O2C52HK2HM2102HO22Y2GH2852GK29329521Q2CO2DT2772IV2E521B2FV23I2DZ21Z2IM2HN21Q21B2D91Z2C922122J24421S26I25V25V23N2DM22G2J72IO2J922Y2JB2C921L1Y21129Y2FK2I32GE2JA21K2JC1X2B22II21K21R2K12K32CM2751B2152H321O27H2GV2752GX2GZ2H121B2H32H52H72H92HB2HD23623723F23J2AB28L2K72HP2IS2102172G22AQ2121X29021E22124U23D22T1A21U26E2462HX2761J2DZ22J2A42C82BG2CI2DQ2IX2CK2HJ2B32A527G2JV2B02A82IJ2JX2CN2BX2C922Y1Y2A827H2D12JY2M227R2AH21B21A2202232FV22U2DZ2AC2II28Y1T28421M21M2MG28027Q2MT2MG2FG23U1I2DZ29S2BT2MX2H52MV2KC2MS2122DG2D126I2182FF2D12752FF2JF2JH2JJ24J2DM22M2761B2N921F2IQ2N522Y23022Y1821F2DC2H12FV23H2DZ2C62752MD21Q2CC1X21B2LT2CQ2CN27T21A2AS21L22124R26P21Y25M1W26U24U2LJ275192MM2761D2JW2BH213182LX2K42GB22229H22Y29J29L29N29P2FV2372DZ2D32O628Y2GH2O92K12ID2DC29W2DF2N72II2AS2FQ2FG1A21B2DZ2EC2221D29V28528I2B12P3112K322Y29N21822Y21927Y2IH152MT21022122Z26U22N1A23D23D24H2DM2KI2222KK2H02H22H42H62H823C23C2HH23J23623623G23C2PO1929M2GF2GU2GW2GY2QS2KN2QU2KQ2QX2QZ23723D2KW2IU2751D2KN1P2A82BJ27G2DN2O621P27U2102RP21K2RR27H27P2RU2RW27A2182112KY2BN2H02BY2192GH21F2FQ2IH2BU27L2LV2221F2SA2BZ2EM27T2KE2EH2PO27A1528F2IH2OW2AH2PO2SX2122R42N32221927T2172J92K51E2842192A12G72IL275172CD2GF29728H21023F1E21121P28J2CR22221528I27L2KE2FG25M2NE2RL2222TH21R2GF2BO2J92AM2JY2U32GF1621B2BI27H2I221P2AR29Y2I72I32BY21A1C1Z2A92IW2AY2IG2JY2IR2GJ2L32B72IZ2O62K22D52QB2P32JS1X2JU2JW2UY2T327R2CC2122122DH26T26L25X1H2352492EY25S2JJ2VO26B2EY2QH2QJ2QL2VL22126324G25Y25X2JJ2VQ2221J2CZ22G22927622327622Y2NG2G92JN2222W92FV2752G92WD2752W92W92752WB2WF2WQ2WK2222G92I22W82WT2WX2WE2G92WN2222WP2WJ2WY27527J2WV2WI2WX2WS27J2X12WP27J27J2WS29B2GP2762XG2X529Z2XD27529B29B2WS2812T32762XR2XM2812XO2MV2812WS29S2XU2752Y12XM29S2XZ2Y32XM28W2XJ27529S2X42WE28W2XZ28W28W2WS2782YD2A32YG2752782XZ2782782WS27P2YO2YV2XM27P2XZ27P27P2WS2942TS2762Z42XM2942XZ2942942WS2882Y42IU2YQ2KY2XZ2882882WS2AO2PW2762ZN2XM2AO2XZ2AO2AO2WS2J62ZH2ZX2XM2J62XZ2J62J62WS2B92ZH31062XM2B92XZ2B92B92WS2E12YO310F2XM2E12XZ2E12E12WS2C62YO310O2WX23E2D027P2942WE2C62P32WP2C62C62J631112IL2B931152C62E12WE2JN2O52D02C62JN2G9311D2KY311F275311K2WO311L2IL2LN311822222H2TF2752LN2C6310U2WQ27P2NO2O52W92MN310Y2D22WA311O2C62GV22G2KX2LN22A27622G22F2222JN312E2752WE311T312K311E311S2WX312222222N2IL311Y2W922B222228312I311O2PE2X231282R92WE2LN22E312F312L2223139313B312Q313D312P311T311H2WL2222W7311X313K312H312E312522D31272IL2C62WS311Q313A3131312O312M22222Z313Y2NO312O2762C62NO313J2WQ22C2IL313R313T31122XM312D313Y2JN22X313Y312N31442222322NG3148312R313K22W312V2X927P2332TF2G92882W931253133311R312A311V2223140313B315A312Q3146311O313I3150312T314W2WX312Y3130311Y2G9313P31312IL313S311N313U314H3159314J315W313E311T230314O315E2IL3149315H314C311M2C6315S3134315U313W315Y315Q314K314M316E2WE2NO231314R22231652O52G9314V313N2WX22Q22222R222311Y27J27P22O2TF27J2ZS3154314F2IL31572223138315X313G3141313G3147312Q314A27J312U3168222316A311R316D315C2JN22P316H315C2NO317R2D1314S317H222316R316X2X622222U22222V318129Z27P22S2TF29B3174313231763129315Q317A312L2KX2JN317C2J6311T317E315F314T29Z317J318729B312Y22T315Q3169318F315V311Y316F316I275314N313E3145316M316O2XP2223167318Y317L3190317O315X29Q315Z3194316N222317V312P319A29Z318031252WE316B314G2R4311R2CL2O529B2R4316S29B23I222318K318E315T314G3178314I313E312J317S316M315G31A022223G315J29B2HI236318728127P2372TF281318D2IL3155313531AB313C317B316H318P2IL31AH2Y5315I316S281318W319E317M3135316D3192311B319L311T23431623199318R281319D314E31A92IL319H31AD222319J315Q3196315Q317U31BL314A281319S311O319U311R319X3135319Z31B631A231AP22231A5235319E31AX315U31AZ317P31BH316E317F31B52MV31AK31B822231AN318729S27P23A2TF29S31AV2C631CH31AA318H31B031BT317C319531D5313H312R2AO29S318T22G11315R319G31D431CK315C31BI31BK317W319M314A29S31BO311O31BC316C31DJ315X319O3141317T319N31C031CY317Z315J29S31843186311Y28W27P23B2TF28W2ZS31E9222238316V31CG319031AZ31D7313131EN318O31AG318R28W31DE31DT31DI3137319L31AE319K31BJ319731CM311O319Q28W31DS31DH31BQ313V31DW31BT31DY31D831E0319O317F31F531E4316S28W316U316W31EG31842DM311Y27827P2O42YR2KY2G931FR31EH31EJ317531F93136315831EN318L31B231ER314A27831EU31F8319V31BR31FB319331FD315D314O31FG31F4318R278318031FY31FM318727831FP31872Z32221B2TF27P31EF27527P31EI316W31G131GD318G31EX31G531D9317D31G831GY31B731GU22231BA31BP31H6315V318X31BT31402KX311T18312F281319831DO319Q27P31F7318Z31G231BS31931931AF31F231GK3164318R27P31C3314D319031C7315U31C928K31CB31H5315631GF31BG31DL31F331B431I72221E315J27P1F2I331HF31A51D31EK31G231CJ315X31IL31632C631CO27P31CQ31HF122GQ31HF2HI1031HF31DG13318729427P162TF29431D0312631IZ31D431H931EP31D931CN318R294318T311Y29431HH31EV31HZ31IJ315B316H31HQ31F231J331DP31JL319C31IA31GC317N31K331311731I331BY31E131HU31JV31FJ319E31C5313531IC314G31IE29431CB31JY31CD2221431IY31HJ31J031HM31KI31JU314A29431J731KW2HI314Q311Y28827P152TF2ZM310T27528831H331L031II31EX31AO31BT1Q312F31HO31JT31AS31J4318R28831GB31D131EL31JQ31B1319K31B331LW314A288313M3187288312H1R31BB31EW315831DK316H1O31DN319P31LX31KB317K31DU314G31I031BG314L319K31FF31E22O528831I9311M31HJ31KR2IL31IE28831KV31LJ31KX1P31LM31AY31KF31EZ31BW31IM31M631LG31AJ315J2882HI1U31NA31CI31M231D631G731DO31CO2881V315J2AO27P1S2TF2AO31JN31D2317731NP319331JS31M5317G31O031HE311Y2AO312Y316131OC222315P31HI31KE31EX31MH319K1T31MK31FH318R2AO31HX319F31K231OL315X31MT31NE31E01I31MW2GA31KN319T31IB31HJ1J31OA31N62DN31A51G31NN31D3312B3179316I2WB31ND31DZ31HC2O52AO31L831P32HI1H31PE31O431H831M331NE31O831CO2AO31NV316S2AO1M315W311Y2J627P1N2TF2J6315231PT31H731G431PW31HB31NS318R2J631JX2752J631OE31ME31OV31MG315X1K31KI316J314P31P22222J631MZ315Q31N131HJ1L31QA22231PA2J631A521631QD31G331PH31OM31OZ31PM31QM31NI316S2J631LA31RB31EM31QG31D831PY31QJ22231Q131872J631Q4312E311Y2B927P2L42O52B931QC31IH31NB31PV31NQ31M431RG2I631OB2752B931QO31OJ31BD31D421431J131QU27531HT31ML314A2B931OT31MP31GE31OW31BT314Q31MU314O31SW31SO2TF2B931GO31SD31832TT31872E127P2B122I2AO2E131QC23E314C2E131LL31S531NO31S731O631NR31DA314A2E131QL2HJ31SF31K131HJ316D31SJ31L331SX31K731QX2E131SR31MF31RD315X31SZ31PL31F231SZ31OQ31TP31KN311Y2E131GQ31UE31T527H31253110313521831932C031DO311G31D41Y313T2LN2LN2WS2JN31MD319K31KP312Q311T27Z2WP311T311T1W31KJ31V12NO2NO2K42WP31VB22228U2WE312U31633133313E2GV31632LN2GV2G9313Y2WQ314131DU31V62XM31SN31VI22231OY2WE2D3315C2GV316L2D1311T31VQ2TF2JN314V311T31BG2BR2D1319U315331D831VV31O931QV315C312U31W127531W3313Y2GV316131W72R9314A31WB312Q31BG28J315T311C2222S727631652D1312U2LN313E2D331WF2D02JN2D32G931V52IL31X5275312U31VR2D02D331XA315Q2GV31X12D031W82WX31X62NG31XL31XY31263133312W31FZ31JG31Y321M31JA2WE2GV317M312U2GV31W92WE312E315C312Y31WP312Z319L2W731WU2D02GV2W7314A316Q2R92WP2GV2B921N316B31YD2QQ29R31J9312Y313K2F82NO31T431XX2X931Z831R1319M2752E127631842GV312Y2W922Y27P2GV2E131YX22Y29431YZ2AM22431Z22WQ2W931Z527631ZE31SM276311T31ZA2UK31ZC31XW27531ZG31HG2WQ31ZK2R927J31ZO31ZQ2R931ZS31ZU2X02C132052FC31Z62UZ3200320P32072R931ZI2X231ZL2IZ320E2R92GV320H32092XC320K320N320M2762ZQ320N320N31T531ZH320A320V29S320X31ZR31Z1320929B2WG320Q2XU320N2Z7320N312U31ZF320S321C2R928W321F320G321H312Y2XY3213276321M276321O276321Q320R321B31ZJ320V288321W320Z321Y2CM2W931VR320N31VL320N2S231ZD321S31WI2R931CH31YZ2WS312E2AA313E312Y322V315Q3130322Y2762GV3130322T31JO316B31YG2XM312Y317C2KX3130323B313L31JT314V312E31YQ320U32092B929Y31ZP3209312Y32102W72YI31XW320N3204320N2QP31T5312Y2W7322A32092E1323N31JZ3209323R2IZ322H320Q31ZZ3205323Y31843240321T312Y27J3245323P31Z031ZT323F2Z1323U2XK2D0323X2D0324F323F3242312Y29S324K312Y323Q321H2W72ZB324Q2YE324S3232324U32093241323K312Y2783250324732532ZK3256320O324D325A324G324X2A3325G3252324N2W72ZU325K3225275324E325B324H31SB21R2X23246325S31J92W73103325K323W2763146324V325C320B312Y2E13263323O3251324M326731SB324A3205324C320N326D3260325P27J326J3265326M323F310L325K3215275326T325O325D2CM326X324L32482C6326P320N32233274325N324W32772783279326L32482LN327D32163258327G321R3276326G2A3327L325H325T3131327P275325X31CM326E2WQ22231BJ326L312L31AO313021O2D0318X3130324A2242R431302282212WM29A2T3328L31ZW2T31I328M312I328B2RT2X231I2328K31QY316B3290311727532902C62WP329027N2WE31392922D1323D320632093130313E313031UL31YK31303114329531YK311727P32962X22883299315Q313921C2NG329F2WS313021F313T329K31KX276329027531WU313022T328U31PD2262T332AD2W923E31HQ2AO31PC222230311T312U1E328U31JG32AG27632AS3153328W32A42YE2JN313032AX2XV2T332B422G32AZ2WA294329W31PG313921D2D0314V32A129R32B231IP328U2XP32B6328U32B831YK32B02X23186329032BF2WE2W731DU2W7323J329B22221I313Y315P313E314C21J313Y313S316332BY318R3130314V31YM311T2NO22N32AT328O3226328U328I320913328U328R279328U32AV31XL328U323O3130312Y329A2KX32BE32BG31YK31392G922432BK32CK2X132CW312T32CY329S320932BW29B32CD315T32C02XM313921G32C5319L314C274313E32CB2NG32CD314A32CF323F2WV32DB2753143313K31D8325732242762G42G62FQ2WJ31ZW2762FP2A62IH2UH2AS2WH2J52D031W62D131922WR2NG2X132EQ321K2D131XN2WP2D02X82WX322P31B6313E2W92ZH2X92X1324R27532EU320K2D032F832222D02TS32EA2BV32EC319B27532EG32A42UG2UI32EL2MI329132AW31XY32FB31XN2WW315T2D02FV320J319U2IH2WE2W92YO32F72WC27632FB2ZH2DV32FW32ES31XY2FC32FH2G532FJ2G82WT2W92Z7320432GA32FD329G32E53187313K2FV32FE27632FX32GR2NG32GH32E932GJ2G72MI31VR32GO32FV32GR32GZ328632GU2WQ2WH31Y032HB32GT32G032FG32H332EB32GL32FS32H82NG32GE2D132ET32GR32GW32HG31Y032GX32FC2G232FI32H522332H72D032GP32FA32HA32GF32I72WW32HF31XY32HH32HC2D0324C2I22A12862G22B42AL2AA2MN2AE2AG2AI2AK2A82K52AX2PZ2KE32IU2I22M22D12FV23E32EM2BT27D21K2U732IM32IU2QP2IR32J82A832IW28432IY21K2VB1Z21M21Q2AA2UK2UO2CF2UO2UQ2AX2AZ2B12J62KC29X2G52N5122C82K432JX31GW32JZ1P32K132K32G22FM27C2CC32A42PW122BQ27E2112H42K52L61X32K827U2B131DY1C32FY316B2D031XH32H132KV2XV31Y031XY2XZ2D028131YN2IU32F532CM275325532DD325V31QW32GT32AK27628128W32BQ32GT22Y31VL2IZ32EY2Z832KZ32LA315Q315132HW32D82D0312U328N32DD32LY32L9327I32LK32HC22Y2DZ2D027832LP31H132LR2DN32MA32FT32KW328631UA32BA2MB312I2KX2G92P331E42X932D8319U314Z32DC2T332MT27532MI2WO322M31P3323O2D032JX317132G832LE2D122Y323Y31SB2WW2XZ328N281311I327132HS32L22D02MN2GR28B2OB2DS2LU2WV32MY32MX31ZV31472P3328N314232KU32H031N727532NM28C2OC2IH32N72D1314Q32NX2C532NW328632E432IF32NZ32NL2GS32NO2CP32O632NS31QW32OA31TB32NC32E332NZ32OG28932NN32O532NR31Y032O932HC32OP313K2WN32OE32HY32F832OH32OV32NP2CL32OX31XY32OZ2X132P132NU32NY32HI32OT32O232OI32OW2D032OM32PD32NV32OQ32PH32OF32HI32P732O432P932OL32OY32PG32OB32PR32P432NJ2ZR32OU32PW32OK32PB2NG32PP311L32OC32P332OS32PU32Q632OJ2IY32Q932O832Q032PF32NX32Q332I932O12GQ32PL32PX32QK32PN32QM32QD32OR32PI32QG32PK32P832Q832QW32PC32QX32Q232QF32IF32PV32QI32NQ32R532QA32R732P232QZ32PT222');local IIllllIlIIIIIlIlII=(bit or bit32);local IlIIlllI=IIllllIlIIIIIlIlII and IIllllIlIIIIIlIlII.bxor or function(IIllllIlIIIIIlIlII,IIIllIlll)local IIllllIlllIl,IlIIlllI,IIlllllIlIllIIIll=1,0,10 while IIllllIlIIIIIlIlII>0 and IIIllIlll>0 do local lIIlllIIllI,IIlllllIlIllIIIll=IIllllIlIIIIIlIlII%2,IIIllIlll%2 if lIIlllIIllI~=IIlllllIlIllIIIll then IlIIlllI=IlIIlllI+IIllllIlllIl end IIllllIlIIIIIlIlII,IIIllIlll,IIllllIlllIl=(IIllllIlIIIIIlIlII-lIIlllIIllI)/2,(IIIllIlll-IIlllllIlIllIIIll)/2,IIllllIlllIl*2 end if IIllllIlIIIIIlIlII<IIIllIlll then IIllllIlIIIIIlIlII=IIIllIlll end while IIllllIlIIIIIlIlII>0 do local IIIllIlll=IIllllIlIIIIIlIlII%2 if IIIllIlll>0 then IlIIlllI=IlIIlllI+IIllllIlllIl end IIllllIlIIIIIlIlII,IIllllIlllIl=(IIllllIlIIIIIlIlII-IIIllIlll)/2,IIllllIlllIl*2 end return IlIIlllI end local function IIIllIlll(IIllllIlllIl,IIllllIlIIIIIlIlII,IIIllIlll)if IIIllIlll then local IIllllIlIIIIIlIlII=(IIllllIlllIl/2^(IIllllIlIIIIIlIlII-1))%2^((IIIllIlll-1)-(IIllllIlIIIIIlIlII-1)+1);return IIllllIlIIIIIlIlII-IIllllIlIIIIIlIlII%1;else local IIllllIlIIIIIlIlII=2^(IIllllIlIIIIIlIlII-1);return(IIllllIlllIl%(IIllllIlIIIIIlIlII+IIllllIlIIIIIlIlII)>=IIllllIlIIIIIlIlII)and 1 or 0;end;end;local IIllllIlIIIIIlIlII=1;local function IIllllIlllIl()local lIIlllIIllI,IIlllllIlIllIIIll,IIIllIlll,IIllllIlllIl=llIIlIIlIllIlIIIIlI(lIIIIIllIlIIIlllIIIlIII,IIllllIlIIIIIlIlII,IIllllIlIIIIIlIlII+3);lIIlllIIllI=IlIIlllI(lIIlllIIllI,74)IIlllllIlIllIIIll=IlIIlllI(IIlllllIlIllIIIll,74)IIIllIlll=IlIIlllI(IIIllIlll,74)IIllllIlllIl=IlIIlllI(IIllllIlllIl,74)IIllllIlIIIIIlIlII=IIllllIlIIIIIlIlII+4;return(IIllllIlllIl*16777216)+(IIIllIlll*65536)+(IIlllllIlIllIIIll*256)+lIIlllIIllI;end;local function lIIIlIlIIIlIllI()local IIllllIlllIl=IlIIlllI(llIIlIIlIllIlIIIIlI(lIIIIIllIlIIIlllIIIlIII,IIllllIlIIIIIlIlII,IIllllIlIIIIIlIlII),74);IIllllIlIIIIIlIlII=IIllllIlIIIIIlIlII+1;return IIllllIlllIl;end;local function lIIlllIIllI()local IIllllIlllIl,IIIllIlll=llIIlIIlIllIlIIIIlI(lIIIIIllIlIIIlllIIIlIII,IIllllIlIIIIIlIlII,IIllllIlIIIIIlIlII+2);IIllllIlllIl=IlIIlllI(IIllllIlllIl,74)IIIllIlll=IlIIlllI(IIIllIlll,74)IIllllIlIIIIIlIlII=IIllllIlIIIIIlIlII+2;return(IIIllIlll*256)+IIllllIlllIl;end;local function IIIIllIlIlll()local IlIIlllI=IIllllIlllIl();local IIllllIlIIIIIlIlII=IIllllIlllIl();local IIlllllIlIllIIIll=1;local IlIIlllI=(IIIllIlll(IIllllIlIIIIIlIlII,1,20)*(2^32))+IlIIlllI;local IIllllIlllIl=IIIllIlll(IIllllIlIIIIIlIlII,21,31);local IIllllIlIIIIIlIlII=((-1)^IIIllIlll(IIllllIlIIIIIlIlII,32));if(IIllllIlllIl==0)then if(IlIIlllI==0)then return IIllllIlIIIIIlIlII*0;else IIllllIlllIl=1;IIlllllIlIllIIIll=0;end;elseif(IIllllIlllIl==2047)then return(IlIIlllI==0)and(IIllllIlIIIIIlIlII*(1/0))or(IIllllIlIIIIIlIlII*(0/0));end;return llIllIIllIlII(IIllllIlIIIIIlIlII,IIllllIlllIl-1023)*(IIlllllIlIllIIIll+(IlIIlllI/(2^52)));end;local llIlllIIlIIlIIIlIlIlI=IIllllIlllIl;local function llIllIIllIlII(IIllllIlllIl)local IIIllIlll;if(not IIllllIlllIl)then IIllllIlllIl=llIlllIIlIIlIIIlIlIlI();if(IIllllIlllIl==0)then return'';end;end;IIIllIlll=IIlllllIlIllIIIll(lIIIIIllIlIIIlllIIIlIII,IIllllIlIIIIIlIlII,IIllllIlIIIIIlIlII+IIllllIlllIl-1);IIllllIlIIIIIlIlII=IIllllIlIIIIIlIlII+IIllllIlllIl;local IIllllIlllIl={}for IIllllIlIIIIIlIlII=1,#IIIllIlll do IIllllIlllIl[IIllllIlIIIIIlIlII]=IllIIIlIlIlIIIlIIlIl(IlIIlllI(llIIlIIlIllIlIIIIlI(IIlllllIlIllIIIll(IIIllIlll,IIllllIlIIIIIlIlII,IIllllIlIIIIIlIlII)),74))end return IlllllIlIllI(IIllllIlllIl);end;local IIllllIlIIIIIlIlII=IIllllIlllIl;local function IlllllIlIllI(...)return{...},IlIIIIllIlII('#',...)end local function llIlllIIlIIlIIIlIlIlI()local IllIIIlIlIlIIIlIIlIl={};local lIIIIIllIlIIIlllIIIlIII={};local IIllllIlIIIIIlIlII={};local llIIlIIlIllIlIIIIlI={[#{{305;405;152;685};"1 + 1 = 111";}]=lIIIIIllIlIIIlllIIIlIII,[#{{313;373;993;3};"1 + 1 = 111";"1 + 1 = 111";}]=nil,[#{{642;763;993;168};"1 + 1 = 111";{181;217;294;279};{362;329;83;864};}]=IIllllIlIIIIIlIlII,[#{"1 + 1 = 111";}]=IllIIIlIlIlIIIlIIlIl,};local IIllllIlIIIIIlIlII=IIllllIlllIl()local IlIIlllI={}for IIIllIlll=1,IIllllIlIIIIIlIlII do local IIllllIlllIl=lIIIlIlIIIlIllI();local IIllllIlIIIIIlIlII;if(IIllllIlllIl==2)then IIllllIlIIIIIlIlII=(lIIIlIlIIIlIllI()~=0);elseif(IIllllIlllIl==3)then IIllllIlIIIIIlIlII=IIIIllIlIlll();elseif(IIllllIlllIl==0)then IIllllIlIIIIIlIlII=llIllIIllIlII();end;IlIIlllI[IIIllIlll]=IIllllIlIIIIIlIlII;end;llIIlIIlIllIlIIIIlI[3]=lIIIlIlIIIlIllI();for llIIlIIlIllIlIIIIlI=1,IIllllIlllIl()do local IIllllIlIIIIIlIlII=lIIIlIlIIIlIllI();if(IIIllIlll(IIllllIlIIIIIlIlII,1,1)==0)then local IIlllllIlIllIIIll=IIIllIlll(IIllllIlIIIIIlIlII,2,3);local lIlIllllIIIlIl=IIIllIlll(IIllllIlIIIIIlIlII,4,6);local IIllllIlIIIIIlIlII={lIIlllIIllI(),lIIlllIIllI(),nil,nil};if(IIlllllIlIllIIIll==0)then IIllllIlIIIIIlIlII[#("d0D")]=lIIlllIIllI();IIllllIlIIIIIlIlII[#("CB7t")]=lIIlllIIllI();elseif(IIlllllIlIllIIIll==1)then IIllllIlIIIIIlIlII[#("giu")]=IIllllIlllIl();elseif(IIlllllIlIllIIIll==2)then IIllllIlIIIIIlIlII[#("D3V")]=IIllllIlllIl()-(2^16)elseif(IIlllllIlIllIIIll==3)then IIllllIlIIIIIlIlII[#("EzN")]=IIllllIlllIl()-(2^16)IIllllIlIIIIIlIlII[#("Mx9u")]=lIIlllIIllI();end;if(IIIllIlll(lIlIllllIIIlIl,1,1)==1)then IIllllIlIIIIIlIlII[#("sX")]=IlIIlllI[IIllllIlIIIIIlIlII[#("d5")]]end if(IIIllIlll(lIlIllllIIIlIl,2,2)==1)then IIllllIlIIIIIlIlII[#("BVm")]=IlIIlllI[IIllllIlIIIIIlIlII[#{"1 + 1 = 111";{385;575;830;923};{546;635;162;533};}]]end if(IIIllIlll(lIlIllllIIIlIl,3,3)==1)then IIllllIlIIIIIlIlII[#("qKmT")]=IlIIlllI[IIllllIlIIIIIlIlII[#("gObT")]]end IllIIIlIlIlIIIlIIlIl[llIIlIIlIllIlIIIIlI]=IIllllIlIIIIIlIlII;end end;for IIllllIlIIIIIlIlII=1,IIllllIlllIl()do lIIIIIllIlIIIlllIIIlIII[IIllllIlIIIIIlIlII-1]=llIlllIIlIIlIIIlIlIlI();end;return llIIlIIlIllIlIIIIlI;end;local function lIIIlIlIIIlIllI(IIllllIlIIIIIlIlII,llIIlIIlIllIlIIIIlI,IIlllllIlIllIIIll)IIllllIlIIIIIlIlII=(IIllllIlIIIIIlIlII==true and llIlllIIlIIlIIIlIlIlI())or IIllllIlIIIIIlIlII;return(function(...)local IlIIlllI=IIllllIlIIIIIlIlII[1];local lIIlllIIllI=IIllllIlIIIIIlIlII[3];local IllIIIlIlIlIIIlIIlIl=IIllllIlIIIIIlIlII[2];local IIllllIlIIIIIlIlII=IlllllIlIllI local IIllllIlllIl=1;local IIllllIlIIIIIlIlII=-1;local llIllIIllIlII={};local llIlllIIlIIlIIIlIlIlI={...};local IlIIIIllIlII=IlIIIIllIlII('#',...)-1;local lIIIIIllIlIIIlllIIIlIII={};local IIIllIlll={};for IIllllIlIIIIIlIlII=0,IlIIIIllIlII do if(IIllllIlIIIIIlIlII>=lIIlllIIllI)then llIllIIllIlII[IIllllIlIIIIIlIlII-lIIlllIIllI]=llIlllIIlIIlIIIlIlIlI[IIllllIlIIIIIlIlII+1];else IIIllIlll[IIllllIlIIIIIlIlII]=llIlllIIlIIlIIIlIlIlI[IIllllIlIIIIIlIlII+#{{346;380;129;857};}];end;end;local IIllllIlIIIIIlIlII=IlIIIIllIlII-lIIlllIIllI+1 local IIllllIlIIIIIlIlII;local lIIlllIIllI;while true do IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("k")];if lIIlllIIllI<=#("XWRjfxWf9IAZhv6BkxIi6v9HVJxniNyAUaWQU")then if lIIlllIIllI<=#("gW1y7L9CI5kvQ1im4B")then if lIIlllIIllI<=#("kyGaI7xk")then if lIIlllIIllI<=#{{242;444;672;677};{866;14;631;703};"1 + 1 = 111";}then if lIIlllIIllI<=#("R")then if lIIlllIIllI==#("")then for IIllllIlIIIIIlIlII=IIllllIlIIIIIlIlII[#("pg")],IIllllIlIIIIIlIlII[#("Rcr")]do IIIllIlll[IIllllIlIIIIIlIlII]=nil;end;else IIIllIlll[IIllllIlIIIIIlIlII[#("8g")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("GaF")]];end;elseif lIIlllIIllI==#("Wq")then IIIllIlll[IIllllIlIIIIIlIlII[#{"1 + 1 = 111";{427;454;342;80};}]][IIllllIlIIIIIlIlII[#("tI4")]]=IIllllIlIIIIIlIlII[#("WMKz")];else IIIllIlll[IIllllIlIIIIIlIlII[#("ty")]]=(IIllllIlIIIIIlIlII[#("Ik1")]~=0);end;elseif lIIlllIIllI<=#("zyItb")then if lIIlllIIllI==#("dW6G")then local lIIlllIIllI;IIIllIlll[IIllllIlIIIIIlIlII[#("TY")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("y5C")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("jd")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("sp9")]][IIllllIlIIIIIlIlII[#("eYR0")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("It")]]=IIllllIlIIIIIlIlII[#("QPF")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("VJ")]]=IIllllIlIIIIIlIlII[#("jEU")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Or")]]=IIllllIlIIIIIlIlII[#("gLf")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("CL")]]=IIllllIlIIIIIlIlII[#{{283;651;741;936};"1 + 1 = 111";"1 + 1 = 111";}];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("mu")]IIIllIlll[lIIlllIIllI]=IIIllIlll[lIIlllIIllI](lIlIllllIIIlIl(IIIllIlll,lIIlllIIllI+1,IIllllIlIIIIIlIlII[#("yll")]))IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Se")]][IIllllIlIIIIIlIlII[#("F8c")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("FMUn")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIllllIlllIl=IIllllIlIIIIIlIlII[#("3rR")];else local lIIlllIIllI;IIIllIlll[IIllllIlIIIIIlIlII[#("UU")]]=IIllllIlIIIIIlIlII[#("FJJ")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("b9")]IIIllIlll[lIIlllIIllI]=IIIllIlll[lIIlllIIllI](lIlIllllIIIlIl(IIIllIlll,lIIlllIIllI+1,IIllllIlIIIIIlIlII[#("chp")]))IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Q1")]][IIllllIlIIIIIlIlII[#("F8z")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("2ryd")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("9V")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("XXI")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("2j")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("fXd")]][IIllllIlIIIIIlIlII[#("ZvaI")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("qG")]]=IIllllIlIIIIIlIlII[#("P9W")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("VF")]]=IIllllIlIIIIIlIlII[#("ddP")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("st")]]=IIllllIlIIIIIlIlII[#("MoN")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Fh")]]=IIllllIlIIIIIlIlII[#("XFM")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("gh")]IIIllIlll[lIIlllIIllI]=IIIllIlll[lIIlllIIllI](lIlIllllIIIlIl(IIIllIlll,lIIlllIIllI+1,IIllllIlIIIIIlIlII[#("bNa")]))IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#{{23;997;465;216};{39;523;850;842};}]][IIllllIlIIIIIlIlII[#("iA7")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("LNVY")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("PA")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("Xuh")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("xH")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("Bfl")]][IIllllIlIIIIIlIlII[#("pGpC")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("0e")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("oSK")]][IIllllIlIIIIIlIlII[#("Z0JM")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("vO")]][IIllllIlIIIIIlIlII[#("WDz")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("YQj2")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("zK")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("CJn")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("A5")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("vHd")]][IIllllIlIIIIIlIlII[#("PZ94")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("f7")]]=IIllllIlIIIIIlIlII[#("ka5")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("mC")]]=IIllllIlIIIIIlIlII[#("Wt0")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("9G")]]=IIllllIlIIIIIlIlII[#("cxt")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("UJ")]IIIllIlll[lIIlllIIllI]=IIIllIlll[lIIlllIIllI](lIlIllllIIIlIl(IIIllIlll,lIIlllIIllI+1,IIllllIlIIIIIlIlII[#("57q")]))IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("1t")]][IIllllIlIIIIIlIlII[#("dGN")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("Zp7b")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Bm")]][IIllllIlIIIIIlIlII[#{{861;654;930;731};"1 + 1 = 111";{727;554;15;8};}]]=IIllllIlIIIIIlIlII[#("AMcN")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("A3")]][IIllllIlIIIIIlIlII[#("obr")]]=IIllllIlIIIIIlIlII[#("Bd21")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("q4")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("lRd")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("06")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("rZH")]][IIllllIlIIIIIlIlII[#("8xrY")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("tg")]]=IIllllIlIIIIIlIlII[#("kTt")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("TR")]]=IIllllIlIIIIIlIlII[#("1uD")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("nK")]]=IIllllIlIIIIIlIlII[#("jQd")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";}]IIIllIlll[lIIlllIIllI]=IIIllIlll[lIIlllIIllI](lIlIllllIIIlIl(IIIllIlll,lIIlllIIllI+1,IIllllIlIIIIIlIlII[#("rRm")]))IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("3y")]][IIllllIlIIIIIlIlII[#("48y")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("cSWM")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#{"1 + 1 = 111";{464;600;986;393};}]][IIllllIlIIIIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]]=IIllllIlIIIIIlIlII[#("imi0")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("7E")]][IIllllIlIIIIIlIlII[#("cpd")]]=IIllllIlIIIIIlIlII[#("VO1d")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("V7")]][IIllllIlIIIIIlIlII[#("tdB")]]=IIllllIlIIIIIlIlII[#("9Ini")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("R9")]][IIllllIlIIIIIlIlII[#{"1 + 1 = 111";{434;11;325;294};"1 + 1 = 111";}]]=IIllllIlIIIIIlIlII[#("mY6F")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#{{829;364;224;439};{327;457;192;626};}]][IIllllIlIIIIIlIlII[#("lSn")]]=IIIllIlll[IIllllIlIIIIIlIlII[#{{95;630;179;265};{634;469;328;657};"1 + 1 = 111";"1 + 1 = 111";}]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("OvA")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("UQ")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("7Wr")]][IIllllIlIIIIIlIlII[#("rIk4")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("sa")]]=IIllllIlIIIIIlIlII[#("Fnv")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("IO")]]=IIllllIlIIIIIlIlII[#("CEk")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Qq")]]=IIllllIlIIIIIlIlII[#("HJ2")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("WH")]IIIllIlll[lIIlllIIllI]=IIIllIlll[lIIlllIIllI](lIlIllllIIIlIl(IIIllIlll,lIIlllIIllI+1,IIllllIlIIIIIlIlII[#("rhe")]))IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("8X")]][IIllllIlIIIIIlIlII[#{"1 + 1 = 111";{470;542;567;106};{274;817;968;768};}]]=IIIllIlll[IIllllIlIIIIIlIlII[#("gEvh")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("43")]][IIllllIlIIIIIlIlII[#("t2O")]]=IIllllIlIIIIIlIlII[#("mElG")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("vI")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("UYA")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("kb")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("6OX")]][IIllllIlIIIIIlIlII[#("XlYS")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("jx")]]=IIllllIlIIIIIlIlII[#("7J0")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("ba")]]=IIllllIlIIIIIlIlII[#("ShO")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIllllIlIIIIIlIlII[#("QJX")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Lk")]]=IIllllIlIIIIIlIlII[#("0Ls")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";}]IIIllIlll[lIIlllIIllI]=IIIllIlll[lIIlllIIllI](lIlIllllIIIlIl(IIIllIlll,lIIlllIIllI+1,IIllllIlIIIIIlIlII[#("qtt")]))IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Kf")]][IIllllIlIIIIIlIlII[#("R0k")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("Aij0")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("N5")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("KjJ")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("G1")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("dr1")]][IIllllIlIIIIIlIlII[#("nWrL")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIllllIlIIIIIlIlII[#("WMP")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("dz")]]=IIllllIlIIIIIlIlII[#("r8y")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("ph")]]=IIllllIlIIIIIlIlII[#("siW")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("kz")]]=IIllllIlIIIIIlIlII[#("fbv")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("9O")]IIIllIlll[lIIlllIIllI]=IIIllIlll[lIIlllIIllI](lIlIllllIIIlIl(IIIllIlll,lIIlllIIllI+1,IIllllIlIIIIIlIlII[#("F3M")]))IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Ot")]][IIllllIlIIIIIlIlII[#("tXI")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("u5Ei")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Yy")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("yoH")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Sr")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("Ia2")]][IIllllIlIIIIIlIlII[#("nD6v")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("MW")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("R40")]][IIllllIlIIIIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";{990;849;564;822};{23;438;987;480};}]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("DI")]][IIllllIlIIIIIlIlII[#("6Ko")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("TMBi")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("oN")]][IIllllIlIIIIIlIlII[#("6mR")]]=IIllllIlIIIIIlIlII[#("J9KB")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("SX")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("ezG")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Mz")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("XAi")]][IIllllIlIIIIIlIlII[#("jyui")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Ku")]]=IIllllIlIIIIIlIlII[#("PoJ")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#{{652;557;335;570};"1 + 1 = 111";}]]=IIllllIlIIIIIlIlII[#("eIu")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("IK")]]=IIllllIlIIIIIlIlII[#{"1 + 1 = 111";{396;304;400;154};"1 + 1 = 111";}];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("B8")]IIIllIlll[lIIlllIIllI]=IIIllIlll[lIIlllIIllI](lIlIllllIIIlIl(IIIllIlll,lIIlllIIllI+1,IIllllIlIIIIIlIlII[#("qye")]))IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("fS")]][IIllllIlIIIIIlIlII[#("kin")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("tlV8")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("AG")]][IIllllIlIIIIIlIlII[#("PtQ")]]=IIllllIlIIIIIlIlII[#("radQ")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("9B")]][IIllllIlIIIIIlIlII[#("g9c")]]=IIllllIlIIIIIlIlII[#("tpDP")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("OX")]][IIllllIlIIIIIlIlII[#("S8W")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("ncke")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("36")]][IIllllIlIIIIIlIlII[#("2ST")]]=IIllllIlIIIIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Wr")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("v1j")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Eb")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("ol0")]][IIllllIlIIIIIlIlII[#("vvd0")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Nn")]]=IIllllIlIIIIIlIlII[#("Nys")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIllllIlIIIIIlIlII[#("tvy")];end;elseif lIIlllIIllI<=#("Igv3Ku")then IIllllIlllIl=IIllllIlIIIIIlIlII[#("mmF")];elseif lIIlllIIllI==#("WsBLB8x")then if(IIIllIlll[IIllllIlIIIIIlIlII[#("Ed")]]==IIllllIlIIIIIlIlII[#("ZiX1")])then IIllllIlllIl=IIllllIlllIl+1;else IIllllIlllIl=IIllllIlIIIIIlIlII[#("JB2")];end;else do return end;end;elseif lIIlllIIllI<=#("v3PoLx5vcyMdF")then if lIIlllIIllI<=#("FkBOTH9mxg")then if lIIlllIIllI>#("Qa8hY7J7J")then local IIllllIlllIl=IIllllIlIIIIIlIlII[#("cc")];local IlIIlllI=IIIllIlll[IIllllIlIIIIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];IIIllIlll[IIllllIlllIl+1]=IlIIlllI;IIIllIlll[IIllllIlllIl]=IlIIlllI[IIllllIlIIIIIlIlII[#("tBhj")]];else IIIllIlll[IIllllIlIIIIIlIlII[#("Fj")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("cAB")]][IIllllIlIIIIIlIlII[#("TJUa")]];end;elseif lIIlllIIllI<=#{"1 + 1 = 111";"1 + 1 = 111";{185;181;868;678};{341;825;12;261};{748;991;591;972};"1 + 1 = 111";{844;377;243;612};"1 + 1 = 111";"1 + 1 = 111";{521;681;149;863};"1 + 1 = 111";}then local llIIlIIlIllIlIIIIlI;local lIIlllIIllI;lIIlllIIllI=IIllllIlIIIIIlIlII[#("bs")];llIIlIIlIllIlIIIIlI=IIIllIlll[IIllllIlIIIIIlIlII[#("PNY")]];IIIllIlll[lIIlllIIllI+1]=llIIlIIlIllIlIIIIlI;IIIllIlll[lIIlllIIllI]=llIIlIIlIllIlIIIIlI[IIllllIlIIIIIlIlII[#("tH4S")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("YN")]]=IIllllIlIIIIIlIlII[#("9ZR")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("h6")]IIIllIlll[lIIlllIIllI]=IIIllIlll[lIIlllIIllI](lIlIllllIIIlIl(IIIllIlll,lIIlllIIllI+1,IIllllIlIIIIIlIlII[#("DIF")]))IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("RuP")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("Dm")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("nW")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("Kh6")]][IIllllIlIIIIIlIlII[#{{376;587;608;492};"1 + 1 = 111";"1 + 1 = 111";{536;853;838;561};}]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("K6")]]=(not IIIllIlll[IIllllIlIIIIIlIlII[#("mx2")]]);IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];if(IIIllIlll[IIllllIlIIIIIlIlII[#("QD")]]==IIllllIlIIIIIlIlII[#("7cxz")])then IIllllIlllIl=IIllllIlllIl+1;else IIllllIlllIl=IIllllIlIIIIIlIlII[#("8e2")];end;elseif lIIlllIIllI>#{"1 + 1 = 111";{351;119;705;167};"1 + 1 = 111";"1 + 1 = 111";{146;560;407;130};"1 + 1 = 111";{790;520;178;50};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}then local lIIlllIIllI;IIIllIlll[IIllllIlIIIIIlIlII[#("BZ")]]=IIllllIlIIIIIlIlII[#("1xf")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("iF")]IIIllIlll[lIIlllIIllI]=IIIllIlll[lIIlllIIllI](lIlIllllIIIlIl(IIIllIlll,lIIlllIIllI+1,IIllllIlIIIIIlIlII[#("7Uc")]))IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("BM")]][IIllllIlIIIIIlIlII[#("IeP")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("57ma")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("9y")]][IIllllIlIIIIIlIlII[#("Gc3")]]=IIllllIlIIIIIlIlII[#("lCL5")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("1U")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#{{711;918;160;914};"1 + 1 = 111";"1 + 1 = 111";}]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("IQ")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("Q83")]][IIllllIlIIIIIlIlII[#("W5bK")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("6F")]]=IIllllIlIIIIIlIlII[#("DVv")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Gh")]]=IIllllIlIIIIIlIlII[#("U2u")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("rq")]]=IIllllIlIIIIIlIlII[#("7WL")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("3C")]]=IIllllIlIIIIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";{190;424;206;400};}];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#{"1 + 1 = 111";{662;607;706;655};}]IIIllIlll[lIIlllIIllI]=IIIllIlll[lIIlllIIllI](lIlIllllIIIlIl(IIIllIlll,lIIlllIIllI+1,IIllllIlIIIIIlIlII[#("s8Y")]))IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("AL")]][IIllllIlIIIIIlIlII[#("DKj")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("cMiF")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("zQ")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("E29")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("KR")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("QRo")]][IIllllIlIIIIIlIlII[#("ZBuW")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("WD")]]=IIllllIlIIIIIlIlII[#("ElT")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Uv")]]=IIllllIlIIIIIlIlII[#("zU6")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#{"1 + 1 = 111";{738;443;330;439};}]]=IIllllIlIIIIIlIlII[#("UUA")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("IT")]]=IIllllIlIIIIIlIlII[#("BYI")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("n4")]IIIllIlll[lIIlllIIllI]=IIIllIlll[lIIlllIIllI](lIlIllllIIIlIl(IIIllIlll,lIIlllIIllI+1,IIllllIlIIIIIlIlII[#("zC2")]))IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("D0")]][IIllllIlIIIIIlIlII[#("jzB")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("N1S8")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("gH")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("LlY")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Px")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("3Go")]][IIllllIlIIIIIlIlII[#("qdSQ")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("fC")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("ISM")]][IIllllIlIIIIIlIlII[#("VvTR")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Gj")]][IIllllIlIIIIIlIlII[#("IIH")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("259t")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";}]][IIllllIlIIIIIlIlII[#("cjU")]]=IIllllIlIIIIIlIlII[#("klQV")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("6T")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("kBT")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("LI")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("tuA")]][IIllllIlIIIIIlIlII[#("v42h")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("pJ")]]=IIllllIlIIIIIlIlII[#("ZHT")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Ze")]]=IIllllIlIIIIIlIlII[#{{394;418;812;374};{889;123;187;223};"1 + 1 = 111";}];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#{{251;172;89;139};"1 + 1 = 111";}]]=IIllllIlIIIIIlIlII[#("6dV")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("U6")]IIIllIlll[lIIlllIIllI]=IIIllIlll[lIIlllIIllI](lIlIllllIIIlIl(IIIllIlll,lIIlllIIllI+1,IIllllIlIIIIIlIlII[#("Gjk")]))IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("3D")]][IIllllIlIIIIIlIlII[#("lqf")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("FMBB")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("kg")]][IIllllIlIIIIIlIlII[#("4tP")]]=IIllllIlIIIIIlIlII[#("uTMj")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";}]][IIllllIlIIIIIlIlII[#{"1 + 1 = 111";{299;719;629;259};{106;163;862;115};}]]=IIllllIlIIIIIlIlII[#("Smub")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("2Y")]][IIllllIlIIIIIlIlII[#("DhI")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("Q2BX")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("pq")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("g9B")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("jq")]]=IIIllIlll[IIllllIlIIIIIlIlII[#{{125;294;169;287};"1 + 1 = 111";"1 + 1 = 111";}]][IIllllIlIIIIIlIlII[#("3CaF")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("d1")]]=IIllllIlIIIIIlIlII[#("7tL")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("s1")]]=IIllllIlIIIIIlIlII[#("yGn")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("U0")]]=IIllllIlIIIIIlIlII[#{"1 + 1 = 111";{595;93;823;860};"1 + 1 = 111";}];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("Ex")]IIIllIlll[lIIlllIIllI]=IIIllIlll[lIIlllIIllI](lIlIllllIIIlIl(IIIllIlll,lIIlllIIllI+1,IIllllIlIIIIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]))IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("DV")]][IIllllIlIIIIIlIlII[#("2TC")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("Bl6i")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("ky")]][IIllllIlIIIIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";{902;643;413;225};}]]=IIllllIlIIIIIlIlII[#("xlLc")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("NW")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("Fmi")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Jv")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("SiV")]][IIllllIlIIIIIlIlII[#{"1 + 1 = 111";{541;511;992;452};"1 + 1 = 111";{107;773;722;215};}]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("bx")]]=IIllllIlIIIIIlIlII[#("Uy3")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("IJ")]]=IIllllIlIIIIIlIlII[#("SQM")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("SJ")]]=IIllllIlIIIIIlIlII[#("ES4")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("FR")]]=IIllllIlIIIIIlIlII[#("OFt")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";}]IIIllIlll[lIIlllIIllI]=IIIllIlll[lIIlllIIllI](lIlIllllIIIlIl(IIIllIlll,lIIlllIIllI+1,IIllllIlIIIIIlIlII[#("O6j")]))IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("lA")]][IIllllIlIIIIIlIlII[#("eEL")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("itZm")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("WV")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("IXE")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("OA")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("xRs")]][IIllllIlIIIIIlIlII[#("70Om")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#{{139;419;695;347};{514;843;873;505};}]]=IIllllIlIIIIIlIlII[#("nYt")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("DG")]]=IIllllIlIIIIIlIlII[#("PUW")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("IE")]]=IIllllIlIIIIIlIlII[#("gtJ")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("xr")]]=IIllllIlIIIIIlIlII[#("Hrj")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("mm")]IIIllIlll[lIIlllIIllI]=IIIllIlll[lIIlllIIllI](lIlIllllIIIlIl(IIIllIlll,lIIlllIIllI+1,IIllllIlIIIIIlIlII[#{{561;140;438;828};"1 + 1 = 111";{200;989;209;946};}]))IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("GV")]][IIllllIlIIIIIlIlII[#("9GL")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("DDeT")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("t7")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("Xxc")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIIllIlll[IIllllIlIIIIIlIlII[#("lBV")]][IIllllIlIIIIIlIlII[#("cM5b")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("sC")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("zXp")]][IIllllIlIIIIIlIlII[#("iXET")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("vX")]][IIllllIlIIIIIlIlII[#("kC2")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("HMs8")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Oy")]][IIllllIlIIIIIlIlII[#("j7i")]]=IIllllIlIIIIIlIlII[#("UKAB")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("T2")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("4l9")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("4p")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("NEr")]][IIllllIlIIIIIlIlII[#("JNX6")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#{"1 + 1 = 111";{991;591;196;213};}]]=IIllllIlIIIIIlIlII[#("ZHh")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Ik")]]=IIllllIlIIIIIlIlII[#("mde")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("g9")]]=IIllllIlIIIIIlIlII[#("S1a")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("aq")]IIIllIlll[lIIlllIIllI]=IIIllIlll[lIIlllIIllI](lIlIllllIIIlIl(IIIllIlll,lIIlllIIllI+1,IIllllIlIIIIIlIlII[#("IXa")]))IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Dt")]][IIllllIlIIIIIlIlII[#("btZ")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("LHT8")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("8H")]][IIllllIlIIIIIlIlII[#("T7M")]]=IIllllIlIIIIIlIlII[#("4g1r")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("ej")]][IIllllIlIIIIIlIlII[#{"1 + 1 = 111";{146;906;178;504};"1 + 1 = 111";}]]=IIllllIlIIIIIlIlII[#{"1 + 1 = 111";{337;665;142;102};"1 + 1 = 111";{962;353;807;65};}];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";}]][IIllllIlIIIIIlIlII[#("yVs")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("u0fD")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("6T")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("i96")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("IE")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("QJO")]][IIllllIlIIIIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";{609;133;682;362};{847;237;519;944};}]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("XM")]]=IIllllIlIIIIIlIlII[#("yKm")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("V3")]]=IIllllIlIIIIIlIlII[#("7En")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#{{450;128;414;972};"1 + 1 = 111";}]]=IIllllIlIIIIIlIlII[#("kqo")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("Gm")]IIIllIlll[lIIlllIIllI]=IIIllIlll[lIIlllIIllI](lIlIllllIIIlIl(IIIllIlll,lIIlllIIllI+1,IIllllIlIIIIIlIlII[#("O1b")]))else IIIllIlll[IIllllIlIIIIIlIlII[#("iv")]][IIllllIlIIIIIlIlII[#("5ft")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("2dOD")]];end;elseif lIIlllIIllI<=#("v6nnBdg5DvdTSZ3")then if lIIlllIIllI==#("32iZLXk2Oktgh6")then IIIllIlll[IIllllIlIIIIIlIlII[#("Kk")]]=llIIlIIlIllIlIIIIlI[IIllllIlIIIIIlIlII[#("SD4")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#{"1 + 1 = 111";{505;448;874;661};}]][IIllllIlIIIIIlIlII[#("IrG")]]=IIllllIlIIIIIlIlII[#("AY9J")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("cZ")]]=llIIlIIlIllIlIIIIlI[IIllllIlIIIIIlIlII[#("0id")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#{{874;272;997;777};"1 + 1 = 111";}]][IIllllIlIIIIIlIlII[#("QSc")]]=IIllllIlIIIIIlIlII[#("MdFW")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("FM")]]=(IIllllIlIIIIIlIlII[#("Vte")]~=0);IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];llIIlIIlIllIlIIIIlI[IIllllIlIIIIIlIlII[#("MoB")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("zJ")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];do return end;else local lIIlllIIllI;lIIlllIIllI=IIllllIlIIIIIlIlII[#("4m")]IIIllIlll[lIIlllIIllI](lIlIllllIIIlIl(IIIllIlll,lIIlllIIllI+1,IIllllIlIIIIIlIlII[#("H9d")]))IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("ES")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("7e6")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Cg")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("opz")]][IIllllIlIIIIIlIlII[#("AUb7")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("8I")]]=IIllllIlIIIIIlIlII[#("QpU")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("M9")]]=IIllllIlIIIIIlIlII[#("7Pr")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("kv")]]=IIllllIlIIIIIlIlII[#{"1 + 1 = 111";{823;505;64;858};"1 + 1 = 111";}];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("Zc")]IIIllIlll[lIIlllIIllI]=IIIllIlll[lIIlllIIllI](lIlIllllIIIlIl(IIIllIlll,lIIlllIIllI+1,IIllllIlIIIIIlIlII[#("Y2g")]))IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("8U")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("aAV")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("AX")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("cWA")]][IIllllIlIIIIIlIlII[#("VsNn")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("pv")]]=IIllllIlIIIIIlIlII[#("noL")];end;elseif lIIlllIIllI<=#("JKaIQHfe4kjUCmBe")then IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("mDn")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("ch")]];elseif lIIlllIIllI>#("6mpPzstJWvKqT9YHS")then if IIIllIlll[IIllllIlIIIIIlIlII[#("6n")]]then IIllllIlllIl=IIllllIlllIl+1;else IIllllIlllIl=IIllllIlIIIIIlIlII[#("sgE")];end;else IIIllIlll[IIllllIlIIIIIlIlII[#("1g")]]=(IIllllIlIIIIIlIlII[#("Jz6")]~=0);end;elseif lIIlllIIllI<=#("iRqmTXXoPCdSPmf3k5Q8krR93kF")then if lIIlllIIllI<=#("kkumTTsyjUEC1kO1GeRyk0")then if lIIlllIIllI<=#("20Ut1arsIs9dEg0864RT")then if lIIlllIIllI==#("Cog9OZDZDhNuvCx8ABx")then if(IIIllIlll[IIllllIlIIIIIlIlII[#("Nd")]]==IIllllIlIIIIIlIlII[#("THu4")])then IIllllIlllIl=IIllllIlllIl+1;else IIllllIlllIl=IIllllIlIIIIIlIlII[#("7z4")];end;else IIIllIlll[IIllllIlIIIIIlIlII[#("zd")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("vhD")]];end;elseif lIIlllIIllI>#("B5j1hjVPfVEEgzBMOtnkY")then local lIIlllIIllI;local IIlllllIlIllIIIll;IIIllIlll[IIllllIlIIIIIlIlII[#("iv")]]=IIIllIlll[IIllllIlIIIIIlIlII[#{{898;792;280;696};"1 + 1 = 111";"1 + 1 = 111";}]][IIllllIlIIIIIlIlII[#("e05J")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("4t")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("E53")]][IIllllIlIIIIIlIlII[#{{373;208;846;343};"1 + 1 = 111";"1 + 1 = 111";{958;507;110;629};}]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIlllllIlIllIIIll=IIllllIlIIIIIlIlII[#("3J")];lIIlllIIllI=IIIllIlll[IIllllIlIIIIIlIlII[#("ZmB")]];IIIllIlll[IIlllllIlIllIIIll+1]=lIIlllIIllI;IIIllIlll[IIlllllIlIllIIIll]=lIIlllIIllI[IIllllIlIIIIIlIlII[#("SaSj")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("W5")]]=IIllllIlIIIIIlIlII[#("eGZ")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIlllllIlIllIIIll=IIllllIlIIIIIlIlII[#("2e")]IIIllIlll[IIlllllIlIllIIIll]=IIIllIlll[IIlllllIlIllIIIll](lIlIllllIIIlIl(IIIllIlll,IIlllllIlIllIIIll+1,IIllllIlIIIIIlIlII[#("InN")]))IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];if not IIIllIlll[IIllllIlIIIIIlIlII[#("1l")]]then IIllllIlllIl=IIllllIlllIl+1;else IIllllIlllIl=IIllllIlIIIIIlIlII[#("zLd")];end;else local lIIlllIIllI;local IIlllllIlIllIIIll;IIIllIlll[IIllllIlIIIIIlIlII[#("86")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("DYG")]][IIllllIlIIIIIlIlII[#("rutN")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("uP")]]=IIllllIlIIIIIlIlII[#("2Pl")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("St")]]=IIllllIlIIIIIlIlII[#("VFX")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("em")]]=IIllllIlIIIIIlIlII[#("3y5")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("eK")]]=IIllllIlIIIIIlIlII[#("nLQ")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIlllllIlIllIIIll=IIllllIlIIIIIlIlII[#("Fq")]IIIllIlll[IIlllllIlIllIIIll]=IIIllIlll[IIlllllIlIllIIIll](lIlIllllIIIlIl(IIIllIlll,IIlllllIlIllIIIll+1,IIllllIlIIIIIlIlII[#("7n2")]))IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("pv")]][IIllllIlIIIIIlIlII[#("Jkm")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("KGT5")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#{{408;663;732;479};"1 + 1 = 111";}]]=IIIllIlll[IIllllIlIIIIIlIlII[#("EVR")]][IIllllIlIIIIIlIlII[#("JBBH")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIlllllIlIllIIIll=IIllllIlIIIIIlIlII[#("gj")];lIIlllIIllI=IIIllIlll[IIllllIlIIIIIlIlII[#("q8x")]];IIIllIlll[IIlllllIlIllIIIll+1]=lIIlllIIllI;IIIllIlll[IIlllllIlIllIIIll]=lIIlllIIllI[IIllllIlIIIIIlIlII[#("2EfC")]];end;elseif lIIlllIIllI<=#("ekxThOE9GDt29Heo2EeYTSOj")then if lIIlllIIllI>#("6bUufnmc708Fycglgoajoz4")then local IIllllIlIIIIIlIlII=IIllllIlIIIIIlIlII[#("Q9")]IIIllIlll[IIllllIlIIIIIlIlII]=IIIllIlll[IIllllIlIIIIIlIlII](IIIllIlll[IIllllIlIIIIIlIlII+1])else IIIllIlll[IIllllIlIIIIIlIlII[#{"1 + 1 = 111";{600;246;892;215};}]]=IIIllIlll[IIllllIlIIIIIlIlII[#("zpa")]][IIllllIlIIIIIlIlII[#("Vi6Q")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("3A")]]=llIIlIIlIllIlIIIIlI[IIllllIlIIIIIlIlII[#("au7")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("0Y")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("S60")]][IIllllIlIIIIIlIlII[#("7u5v")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Il")]][IIllllIlIIIIIlIlII[#("sqE")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("VLEM")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];do return end;end;elseif lIIlllIIllI<=#("zBTgaUxHnGlNTOBphZcQfUEC7")then if IIIllIlll[IIllllIlIIIIIlIlII[#{{894;329;401;915};{688;340;360;657};}]]then IIllllIlllIl=IIllllIlllIl+1;else IIllllIlllIl=IIllllIlIIIIIlIlII[#("5RN")];end;elseif lIIlllIIllI==#("NENa8Hgm6PEfbmECr20DCCYVbA")then llIIlIIlIllIlIIIIlI[IIllllIlIIIIIlIlII[#("6fe")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("HS")]];else local llIIlIIlIllIlIIIIlI;local lIIlllIIllI;IIIllIlll[IIllllIlIIIIIlIlII[#("Vx")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("DdN")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("CL")]]=IIIllIlll[IIllllIlIIIIIlIlII[#{{124;143;549;626};"1 + 1 = 111";"1 + 1 = 111";}]][IIllllIlIIIIIlIlII[#("znRs")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Sq")]]=IIllllIlIIIIIlIlII[#("bp7")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("2n")]IIIllIlll[lIIlllIIllI]=IIIllIlll[lIIlllIIllI](IIIllIlll[lIIlllIIllI+1])IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Db")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("KFv")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("nG")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("qtS")]][IIllllIlIIIIIlIlII[#("Jh94")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("hl")]]=IIllllIlIIIIIlIlII[#("tc0")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("KP")]IIIllIlll[lIIlllIIllI]=IIIllIlll[lIIlllIIllI](IIIllIlll[lIIlllIIllI+1])IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("WS")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("r3C")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("bS")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("uiT")]][IIllllIlIIIIIlIlII[#("Ab2O")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("mJ")]]=IIllllIlIIIIIlIlII[#("ltS")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("75")]IIIllIlll[lIIlllIIllI]=IIIllIlll[lIIlllIIllI](IIIllIlll[lIIlllIIllI+1])IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("og")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("S7V")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("bk")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("t6i")]][IIllllIlIIIIIlIlII[#("o4pK")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("u8")]]=IIllllIlIIIIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("ke")]IIIllIlll[lIIlllIIllI]=IIIllIlll[lIIlllIIllI](IIIllIlll[lIIlllIIllI+1])IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("RW")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("va7")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("5A")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("xBy")]][IIllllIlIIIIIlIlII[#("jzNN")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("kl")]]=IIllllIlIIIIIlIlII[#("mzT")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("uQ")]IIIllIlll[lIIlllIIllI]=IIIllIlll[lIIlllIIllI](IIIllIlll[lIIlllIIllI+1])IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("QR")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("9dK")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("CQ")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("GNW")]][IIllllIlIIIIIlIlII[#("pKyW")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("dG")]]=IIllllIlIIIIIlIlII[#("Xy5")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("R8")]IIIllIlll[lIIlllIIllI]=IIIllIlll[lIIlllIIllI](IIIllIlll[lIIlllIIllI+1])IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("qf")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("JBt")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#{{816;332;390;874};"1 + 1 = 111";}]]=IIIllIlll[IIllllIlIIIIIlIlII[#("3X4")]][IIllllIlIIIIIlIlII[#("86Z3")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("2M")]]=IIllllIlIIIIIlIlII[#("Pbn")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("9u")]IIIllIlll[lIIlllIIllI]=IIIllIlll[lIIlllIIllI](IIIllIlll[lIIlllIIllI+1])IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("cq")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("kg7")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("5W")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("6rU")]][IIllllIlIIIIIlIlII[#{"1 + 1 = 111";{919;267;416;236};{505;317;881;17};{167;219;934;43};}]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("44")]]=IIllllIlIIIIIlIlII[#("nZs")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("rv")]IIIllIlll[lIIlllIIllI]=IIIllIlll[lIIlllIIllI](IIIllIlll[lIIlllIIllI+1])IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("L2")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("vqH")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("6g")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("T7N")]][IIllllIlIIIIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";{108;566;986;56};"1 + 1 = 111";}]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("d9")]]=IIllllIlIIIIIlIlII[#("fOe")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("3P")]IIIllIlll[lIIlllIIllI]=IIIllIlll[lIIlllIIllI](IIIllIlll[lIIlllIIllI+1])IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Gk")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("g9G")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("bD")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("F7p")]][IIllllIlIIIIIlIlII[#("5DrM")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#{"1 + 1 = 111";{585;806;616;105};}]]=IIllllIlIIIIIlIlII[#("ZpS")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("Nz")]IIIllIlll[lIIlllIIllI]=IIIllIlll[lIIlllIIllI](IIIllIlll[lIIlllIIllI+1])IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Ei")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("Qct")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("xX")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("OMf")]][IIllllIlIIIIIlIlII[#("0v3W")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#{{670;683;587;424};{584;4;933;824};}]]=IIllllIlIIIIIlIlII[#("idb")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("Hz")]IIIllIlll[lIIlllIIllI]=IIIllIlll[lIIlllIIllI](IIIllIlll[lIIlllIIllI+1])IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("y5")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("qpc")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("e5")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("zpo")]][IIllllIlIIIIIlIlII[#("aKeP")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("hj")]]=IIllllIlIIIIIlIlII[#("cbN")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("0z")]IIIllIlll[lIIlllIIllI]=IIIllIlll[lIIlllIIllI](IIIllIlll[lIIlllIIllI+1])IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("X2")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("WtY")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("xd")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("KuB")]][IIllllIlIIIIIlIlII[#("8Tma")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("g8")]]=IIllllIlIIIIIlIlII[#("Ig9")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("3C")]IIIllIlll[lIIlllIIllI]=IIIllIlll[lIIlllIIllI](IIIllIlll[lIIlllIIllI+1])IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("ZR")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("Oht")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("T4")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("JuX")]][IIllllIlIIIIIlIlII[#("Dm8L")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("K9")]]=IIllllIlIIIIIlIlII[#{{989;750;60;797};{202;665;433;276};"1 + 1 = 111";}];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("JN")]IIIllIlll[lIIlllIIllI]=IIIllIlll[lIIlllIIllI](IIIllIlll[lIIlllIIllI+1])IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Jj")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("5JJ")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("bG")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("amx")]][IIllllIlIIIIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("WO")]]=IIllllIlIIIIIlIlII[#("zxT")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("hK")]IIIllIlll[lIIlllIIllI]=IIIllIlll[lIIlllIIllI](IIIllIlll[lIIlllIIllI+1])IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("MM")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("YYj")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("eB")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("M5f")]][IIllllIlIIIIIlIlII[#("axCd")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("3F")]]=IIllllIlIIIIIlIlII[#("pud")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("Ho")]IIIllIlll[lIIlllIIllI]=IIIllIlll[lIIlllIIllI](IIIllIlll[lIIlllIIllI+1])IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("jy")]][IIllllIlIIIIIlIlII[#("6V7")]]=IIllllIlIIIIIlIlII[#("WsV1")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("5p")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("nK8")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("0n")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("kJv")]][IIllllIlIIIIIlIlII[#{"1 + 1 = 111";{147;652;825;910};{551;458;772;585};"1 + 1 = 111";}]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("4Y")]]=IIIllIlll[IIllllIlIIIIIlIlII[#{{887;558;996;712};{167;403;914;186};{926;991;961;112};}]][IIllllIlIIIIIlIlII[#{{281;14;217;589};{283;420;940;545};"1 + 1 = 111";"1 + 1 = 111";}]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("3e")];llIIlIIlIllIlIIIIlI=IIIllIlll[IIllllIlIIIIIlIlII[#("Uus")]];IIIllIlll[lIIlllIIllI+1]=llIIlIIlIllIlIIIIlI;IIIllIlll[lIIlllIIllI]=llIIlIIlIllIlIIIIlI[IIllllIlIIIIIlIlII[#{{356;68;750;459};{782;120;813;532};{414;616;166;616};"1 + 1 = 111";}]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("og")]]=IIllllIlIIIIIlIlII[#("z9P")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("oS")]IIIllIlll[lIIlllIIllI]=IIIllIlll[lIIlllIIllI](lIlIllllIIIlIl(IIIllIlll,lIIlllIIllI+1,IIllllIlIIIIIlIlII[#("laB")]))IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("qg")]][IIllllIlIIIIIlIlII[#{{599;986;802;211};{898;968;949;430};{776;663;562;129};}]]=IIIllIlll[IIllllIlIIIIIlIlII[#("SFQI")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("VF")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("FrN")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("uQ")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("oQA")]][IIllllIlIIIIIlIlII[#("SbuL")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("eb")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("zZj")]][IIllllIlIIIIIlIlII[#("Nha7")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("H2")]][IIllllIlIIIIIlIlII[#("Dib")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("Q7u7")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("a0")]][IIllllIlIIIIIlIlII[#("ZTA")]]=IIllllIlIIIIIlIlII[#("AkJI")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("ur")]][IIllllIlIIIIIlIlII[#("cX2")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("TaPH")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("QS")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("gmF")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("bl")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("i6g")]][IIllllIlIIIIIlIlII[#("evY7")]];end;elseif lIIlllIIllI<=#("nCP6rizg24nHOGHSWVcXZmOCMLFklQ28")then if lIIlllIIllI<=#("k3UqSm6NgLIeum64Tc98MHaYmuROn")then if lIIlllIIllI>#("mbo8ENWBeJgkTMgyqyIpCO2a7N26")then local lIIlllIIllI;IIIllIlll[IIllllIlIIIIIlIlII[#("8P")]]=IIllllIlIIIIIlIlII[#("KVG")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Ps")]]=IIllllIlIIIIIlIlII[#("o0g")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("h3")]IIIllIlll[lIIlllIIllI]=IIIllIlll[lIIlllIIllI](lIlIllllIIIlIl(IIIllIlll,lIIlllIIllI+1,IIllllIlIIIIIlIlII[#{{123;759;491;356};"1 + 1 = 111";{485;849;475;288};}]))IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("6k")]][IIllllIlIIIIIlIlII[#("0Aq")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("qMnz")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("0G")]][IIllllIlIIIIIlIlII[#{{907;368;484;890};{60;266;702;71};"1 + 1 = 111";}]]=IIllllIlIIIIIlIlII[#("LTC5")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("g0")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#{"1 + 1 = 111";{244;164;930;326};"1 + 1 = 111";}]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("9x")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("AQi")]][IIllllIlIIIIIlIlII[#("7Ski")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("uo")]]=IIllllIlIIIIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";{640;580;21;393};}];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("A4")]]=IIllllIlIIIIIlIlII[#("T8P")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("VK")]]=IIllllIlIIIIIlIlII[#("MHH")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("FU")]IIIllIlll[lIIlllIIllI]=IIIllIlll[lIIlllIIllI](lIlIllllIIIlIl(IIIllIlll,lIIlllIIllI+1,IIllllIlIIIIIlIlII[#("Nu9")]))IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("mv")]][IIllllIlIIIIIlIlII[#("5sg")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("7KdT")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#{{953;937;688;901};"1 + 1 = 111";}]][IIllllIlIIIIIlIlII[#("5Co")]]=IIllllIlIIIIIlIlII[#("I5iJ")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("xz")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("TcK")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("1d")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("nYe")]][IIllllIlIIIIIlIlII[#("SxXu")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("NE")]]=IIllllIlIIIIIlIlII[#("Re4")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("XK")]]=IIllllIlIIIIIlIlII[#("YA0")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("bb")]]=IIllllIlIIIIIlIlII[#("VKC")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("jN")]]=IIllllIlIIIIIlIlII[#("imB")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("io")]IIIllIlll[lIIlllIIllI]=IIIllIlll[lIIlllIIllI](lIlIllllIIIlIl(IIIllIlll,lIIlllIIllI+1,IIllllIlIIIIIlIlII[#("d9X")]))IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("hx")]][IIllllIlIIIIIlIlII[#("JDf")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("qsc7")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("1C")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("7mS")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("BO")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("yiE")]][IIllllIlIIIIIlIlII[#("eU6M")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Hx")]]=IIllllIlIIIIIlIlII[#("C8s")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("dM")]]=IIllllIlIIIIIlIlII[#("BqU")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("nE")]]=IIllllIlIIIIIlIlII[#("Cp5")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("KX")]]=IIllllIlIIIIIlIlII[#("9Wt")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("O7")]IIIllIlll[lIIlllIIllI]=IIIllIlll[lIIlllIIllI](lIlIllllIIIlIl(IIIllIlll,lIIlllIIllI+1,IIllllIlIIIIIlIlII[#("MuC")]))IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";}]][IIllllIlIIIIIlIlII[#("b79")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("RTOi")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Fc")]][IIllllIlIIIIIlIlII[#("9lV")]]=IIllllIlIIIIIlIlII[#{{88;854;852;466};{9;36;77;595};"1 + 1 = 111";"1 + 1 = 111";}];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("LM")]][IIllllIlIIIIIlIlII[#("RkD")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("Esfq")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("up")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("fN9")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#{{526;653;84;448};{569;663;296;726};}]]=IIIllIlll[IIllllIlIIIIIlIlII[#("43Y")]][IIllllIlIIIIIlIlII[#("vDOO")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("ql")]]=IIllllIlIIIIIlIlII[#("prP")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Mq")]]=IIllllIlIIIIIlIlII[#("HTT")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("B8")]]=IIllllIlIIIIIlIlII[#("2md")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("16")]IIIllIlll[lIIlllIIllI]=IIIllIlll[lIIlllIIllI](lIlIllllIIIlIl(IIIllIlll,lIIlllIIllI+1,IIllllIlIIIIIlIlII[#{{41;952;908;374};"1 + 1 = 111";{807;799;350;278};}]))IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("pJ")]][IIllllIlIIIIIlIlII[#("8eJ")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("n5gG")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("7D")]][IIllllIlIIIIIlIlII[#("GhY")]]=IIllllIlIIIIIlIlII[#("OPm5")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("st")]][IIllllIlIIIIIlIlII[#("Wtp")]]=IIllllIlIIIIIlIlII[#("nOBz")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("R6")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("XjM")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("C6")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("HP8")]][IIllllIlIIIIIlIlII[#("ZraH")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("pS")]]=IIllllIlIIIIIlIlII[#("sQS")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("4I")]]=IIllllIlIIIIIlIlII[#("CLT")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Js")]]=IIllllIlIIIIIlIlII[#("gA5")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Kc")]]=IIllllIlIIIIIlIlII[#("0Fl")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("Xg")]IIIllIlll[lIIlllIIllI]=IIIllIlll[lIIlllIIllI](lIlIllllIIIlIl(IIIllIlll,lIIlllIIllI+1,IIllllIlIIIIIlIlII[#("tIq")]))IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("sN")]][IIllllIlIIIIIlIlII[#("EyH")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("20Mc")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("Dxy")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#{{219;265;764;687};"1 + 1 = 111";}]]=IIIllIlll[IIllllIlIIIIIlIlII[#("KuH")]][IIllllIlIIIIIlIlII[#("7nWG")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Nx")]]=IIllllIlIIIIIlIlII[#{"1 + 1 = 111";{331;624;103;113};"1 + 1 = 111";}];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("NJ")]]=IIllllIlIIIIIlIlII[#("xsX")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("nk")]]=IIllllIlIIIIIlIlII[#("zsk")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Dl")]]=IIllllIlIIIIIlIlII[#("zAG")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("d6")]IIIllIlll[lIIlllIIllI]=IIIllIlll[lIIlllIIllI](lIlIllllIIIlIl(IIIllIlll,lIIlllIIllI+1,IIllllIlIIIIIlIlII[#("7Wz")]))IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("QR")]][IIllllIlIIIIIlIlII[#("y1p")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("Mfs9")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Zx")]][IIllllIlIIIIIlIlII[#("jFW")]]=IIllllIlIIIIIlIlII[#{{464;74;376;984};"1 + 1 = 111";"1 + 1 = 111";{705;84;951;862};}];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("SF")]][IIllllIlIIIIIlIlII[#{"1 + 1 = 111";{808;177;946;273};{138;873;132;800};}]]=IIllllIlIIIIIlIlII[#("uNL4")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Ey")]][IIllllIlIIIIIlIlII[#("34K")]]=IIIllIlll[IIllllIlIIIIIlIlII[#{{476;125;194;263};{888;970;947;72};{987;202;141;606};"1 + 1 = 111";}]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("G3")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("s4D")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("RF")]]=IIIllIlll[IIllllIlIIIIIlIlII[#{{176;727;261;683};"1 + 1 = 111";{222;867;511;694};}]][IIllllIlIIIIIlIlII[#("eDh4")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Jq")]]=IIllllIlIIIIIlIlII[#("nkY")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Y5")]]=IIllllIlIIIIIlIlII[#{{803;267;892;429};{140;765;42;134};{280;861;211;191};}];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("vv")]]=IIllllIlIIIIIlIlII[#("5IN")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("vu")]IIIllIlll[lIIlllIIllI]=IIIllIlll[lIIlllIIllI](lIlIllllIIIlIl(IIIllIlll,lIIlllIIllI+1,IIllllIlIIIIIlIlII[#("Yri")]))IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("np")]][IIllllIlIIIIIlIlII[#("HRS")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("ytdL")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("R2")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("yzD")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("X4")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("ZT8")]][IIllllIlIIIIIlIlII[#("A3Qc")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("x5")]]=IIllllIlIIIIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Ci")]]=IIllllIlIIIIIlIlII[#{"1 + 1 = 111";{336;330;704;108};{826;608;903;516};}];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("6S")]]=IIllllIlIIIIIlIlII[#("RSp")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("UV")]]=IIllllIlIIIIIlIlII[#("pg0")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("5E")]IIIllIlll[lIIlllIIllI]=IIIllIlll[lIIlllIIllI](lIlIllllIIIlIl(IIIllIlll,lIIlllIIllI+1,IIllllIlIIIIIlIlII[#("qk8")]))IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("n1")]][IIllllIlIIIIIlIlII[#{{63;150;451;242};"1 + 1 = 111";"1 + 1 = 111";}]]=IIIllIlll[IIllllIlIIIIIlIlII[#("huCs")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("GE")]][IIllllIlIIIIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";{408;448;862;399};}]]=IIllllIlIIIIIlIlII[#("mjbi")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";}]][IIllllIlIIIIIlIlII[#("Sto")]]=IIllllIlIIIIIlIlII[#("ooR7")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("tp")]][IIllllIlIIIIIlIlII[#("gRF")]]=IIIllIlll[IIllllIlIIIIIlIlII[#{{542;940;425;878};"1 + 1 = 111";"1 + 1 = 111";{7;429;674;606};}]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("MY")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("tLq")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#{{970;621;769;255};{583;803;375;539};}]]=IIIllIlll[IIllllIlIIIIIlIlII[#("Kjk")]][IIllllIlIIIIIlIlII[#("i7yo")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("vl")]]=IIllllIlIIIIIlIlII[#("CKh")];else IIIllIlll[IIllllIlIIIIIlIlII[#("tx")]]=IIllllIlIIIIIlIlII[#("Jhn")];end;elseif lIIlllIIllI<=#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{281;458;918;148};"1 + 1 = 111";{698;816;383;260};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{591;155;191;221};"1 + 1 = 111";{64;510;178;425};"1 + 1 = 111";{229;360;751;301};"1 + 1 = 111";{480;476;671;563};{247;872;241;592};{214;760;157;958};"1 + 1 = 111";{434;874;910;154};{950;507;709;305};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{813;122;461;564};}then local llIIlIIlIllIlIIIIlI;local lIIlllIIllI;IIIllIlll[IIllllIlIIIIIlIlII[#("IA")]][IIllllIlIIIIIlIlII[#("V7r")]]=IIllllIlIIIIIlIlII[#("BIHY")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("LM")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("4ly")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("ns")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("r1q")]][IIllllIlIIIIIlIlII[#("C7Ip")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("aE")]]=IIllllIlIIIIIlIlII[#("Eha")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#{{720;903;375;513};"1 + 1 = 111";}]]=IIllllIlIIIIIlIlII[#("Mra")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("8Z")]]=IIllllIlIIIIIlIlII[#("3nB")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("Rh")]IIIllIlll[lIIlllIIllI]=IIIllIlll[lIIlllIIllI](lIlIllllIIIlIl(IIIllIlll,lIIlllIIllI+1,IIllllIlIIIIIlIlII[#("AOL")]))IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("dt")]][IIllllIlIIIIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]]=IIIllIlll[IIllllIlIIIIIlIlII[#("FByc")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("pX")]][IIllllIlIIIIIlIlII[#("fJx")]]=IIllllIlIIIIIlIlII[#("4C9G")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("eJ")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("AWN")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("t4")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("nED")]][IIllllIlIIIIIlIlII[#("iNgH")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("87")]]=IIllllIlIIIIIlIlII[#("3Xv")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#{"1 + 1 = 111";{935;891;839;262};}]]=IIllllIlIIIIIlIlII[#("KJP")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Lg")]]=IIllllIlIIIIIlIlII[#("gIV")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("vM")]]=IIllllIlIIIIIlIlII[#("GPr")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("ad")]IIIllIlll[lIIlllIIllI]=IIIllIlll[lIIlllIIllI](lIlIllllIIIlIl(IIIllIlll,lIIlllIIllI+1,IIllllIlIIIIIlIlII[#("KtK")]))IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("kx")]][IIllllIlIIIIIlIlII[#("LQr")]]=IIIllIlll[IIllllIlIIIIIlIlII[#{{212;451;303;567};"1 + 1 = 111";{411;197;403;881};"1 + 1 = 111";}]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("XN")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("V1i")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("4F")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("O2C")]][IIllllIlIIIIIlIlII[#("j7nK")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Tu")]]=IIllllIlIIIIIlIlII[#("VST")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Ti")]]=IIllllIlIIIIIlIlII[#("sqE")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("DR")]]=IIllllIlIIIIIlIlII[#("Z9D")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("F4")]]=IIllllIlIIIIIlIlII[#("XZN")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("xL")]IIIllIlll[lIIlllIIllI]=IIIllIlll[lIIlllIIllI](lIlIllllIIIlIl(IIIllIlll,lIIlllIIllI+1,IIllllIlIIIIIlIlII[#("FxI")]))IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Yg")]][IIllllIlIIIIIlIlII[#("3Qh")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("OMmk")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#{{801;347;322;960};{191;647;725;225};}]][IIllllIlIIIIIlIlII[#("FBJ")]]=IIllllIlIIIIIlIlII[#("qRC9")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Kp")]][IIllllIlIIIIIlIlII[#("BZM")]]=IIllllIlIIIIIlIlII[#("PiDF")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("p4")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("gvV")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("6G")];llIIlIIlIllIlIIIIlI=IIIllIlll[IIllllIlIIIIIlIlII[#("6O7")]];IIIllIlll[lIIlllIIllI+1]=llIIlIIlIllIlIIIIlI;IIIllIlll[lIIlllIIllI]=llIIlIIlIllIlIIIIlI[IIllllIlIIIIIlIlII[#("R81R")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("pe")]]=IIllllIlIIIIIlIlII[#("066")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("6O")]IIIllIlll[lIIlllIIllI]=IIIllIlll[lIIlllIIllI](lIlIllllIIIlIl(IIIllIlll,lIIlllIIllI+1,IIllllIlIIIIIlIlII[#("nVg")]))IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("61")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("ozu")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("n2")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("tJG")]][IIllllIlIIIIIlIlII[#("YCaT")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("UF")]]=IIllllIlIIIIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("qX")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("SVm")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("D9")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("ynB")]][IIllllIlIIIIIlIlII[#{{928;251;141;216};"1 + 1 = 111";"1 + 1 = 111";{650;598;541;787};}]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("n8")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("dZX")]][IIllllIlIIIIIlIlII[#("InXp")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("zj")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("Aoc")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#{{176;91;83;948};"1 + 1 = 111";}]]=IIIllIlll[IIllllIlIIIIIlIlII[#("TF9")]][IIllllIlIIIIIlIlII[#("roYK")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("HH")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("tME")]][IIllllIlIIIIIlIlII[#("Clh7")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("sp")]]=IIllllIlIIIIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";{459;866;69;11};}];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("2B")]]=(IIllllIlIIIIIlIlII[#("0Qm")]~=0);IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("q2")]]=IIllllIlIIIIIlIlII[#("GeM")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("eS")]IIIllIlll[lIIlllIIllI]=IIIllIlll[lIIlllIIllI](lIlIllllIIIlIl(IIIllIlll,lIIlllIIllI+1,IIllllIlIIIIIlIlII[#{{306;530;387;677};{435;551;708;161};"1 + 1 = 111";}]))IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("XZ")]]={};IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("L8")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("uP2")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("BD")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("LF1")]][IIllllIlIIIIIlIlII[#("U5qu")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Vb")]]=IIllllIlIIIIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#{{989;99;212;193};"1 + 1 = 111";}]]=IIllllIlIIIIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("H2")]]=IIllllIlIIIIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("SQ")]]=IIllllIlIIIIIlIlII[#{"1 + 1 = 111";{465;289;66;506};"1 + 1 = 111";}];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("TC")]IIIllIlll[lIIlllIIllI]=IIIllIlll[lIIlllIIllI](lIlIllllIIIlIl(IIIllIlll,lIIlllIIllI+1,IIllllIlIIIIIlIlII[#("Mxt")]))IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("tz")]][IIllllIlIIIIIlIlII[#("M7n")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("kfGa")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("q9A")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("Ym")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("rj")]]={};IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("7M")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("UeA")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("uD")]]=IIIllIlll[IIllllIlIIIIIlIlII[#{"1 + 1 = 111";{616;377;403;700};{65;686;342;3};}]][IIllllIlIIIIIlIlII[#("mMEg")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("if")]]=IIllllIlIIIIIlIlII[#("tg3")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIllllIlIIIIIlIlII[#("HHX")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Tl")]]=IIllllIlIIIIIlIlII[#("ClR")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("DU")]]=IIllllIlIIIIIlIlII[#("eFW")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#{{841;689;352;764};"1 + 1 = 111";}]IIIllIlll[lIIlllIIllI]=IIIllIlll[lIIlllIIllI](lIlIllllIIIlIl(IIIllIlll,lIIlllIIllI+1,IIllllIlIIIIIlIlII[#("kGD")]))IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#{"1 + 1 = 111";{207;96;472;560};}]][IIllllIlIIIIIlIlII[#("tKZ")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("exSl")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("84u")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("Fr")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("TN")];llIIlIIlIllIlIIIIlI=IIIllIlll[IIllllIlIIIIIlIlII[#("VFJ")]];IIIllIlll[lIIlllIIllI+1]=llIIlIIlIllIlIIIIlI;IIIllIlll[lIIlllIIllI]=llIIlIIlIllIlIIIIlI[IIllllIlIIIIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{180;466;416;650};}]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("zD")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("2sd")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("ZS")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("ElY")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("jl")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#{"1 + 1 = 111";{331;358;350;175};"1 + 1 = 111";}]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("3K")]IIIllIlll[lIIlllIIllI]=IIIllIlll[lIIlllIIllI](lIlIllllIIIlIl(IIIllIlll,lIIlllIIllI+1,IIllllIlIIIIIlIlII[#{"1 + 1 = 111";{36;588;403;375};"1 + 1 = 111";}]))IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("re")];llIIlIIlIllIlIIIIlI=IIIllIlll[IIllllIlIIIIIlIlII[#("rlZ")]];IIIllIlll[lIIlllIIllI+1]=llIIlIIlIllIlIIIIlI;IIIllIlll[lIIlllIIllI]=llIIlIIlIllIlIIIIlI[IIllllIlIIIIIlIlII[#("DkrC")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("bK")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("xD8")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Eu")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("rvj")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("gC")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("lKW")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("oD")]IIIllIlll[lIIlllIIllI]=IIIllIlll[lIIlllIIllI](lIlIllllIIIlIl(IIIllIlll,lIIlllIIllI+1,IIllllIlIIIIIlIlII[#("MpJ")]))IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("60")]]=(IIllllIlIIIIIlIlII[#("BqU")]~=0);IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("6z")]]=(IIllllIlIIIIIlIlII[#("Rzy")]~=0);IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];for IIllllIlIIIIIlIlII=IIllllIlIIIIIlIlII[#("Wp")],IIllllIlIIIIIlIlII[#("pTp")]do IIIllIlll[IIllllIlIIIIIlIlII]=nil;end;IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#{"1 + 1 = 111";{219;598;121;239};}]][IIllllIlIIIIIlIlII[#{"1 + 1 = 111";{288;178;721;617};{322;12;639;691};}]]=IIllllIlIIIIIlIlII[#("Nucs")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("7s")]][IIllllIlIIIIIlIlII[#("PLe")]]=IIllllIlIIIIIlIlII[#("i585")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("L7")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("usn")]];elseif lIIlllIIllI>#("V0xRdYWIoKI4PohjPChGZEopsmmBRYx")then local lIIlllIIllI;IIIllIlll[IIllllIlIIIIIlIlII[#("Cl")]]=IIllllIlIIIIIlIlII[#("bl2")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("EE")]]=IIllllIlIIIIIlIlII[#("3xD")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("vo")]IIIllIlll[lIIlllIIllI]=IIIllIlll[lIIlllIIllI](lIlIllllIIIlIl(IIIllIlll,lIIlllIIllI+1,IIllllIlIIIIIlIlII[#{"1 + 1 = 111";{731;820;152;953};{752;153;971;224};}]))IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Zs")]][IIllllIlIIIIIlIlII[#{"1 + 1 = 111";{26;37;308;977};"1 + 1 = 111";}]]=IIIllIlll[IIllllIlIIIIIlIlII[#("DRWq")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#{{142;674;524;720};"1 + 1 = 111";}]][IIllllIlIIIIIlIlII[#("ftF")]]=IIllllIlIIIIIlIlII[#("QVRS")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("xn")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("gjs")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("m6")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("Omr")]][IIllllIlIIIIIlIlII[#("eE56")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("gG")]]=IIllllIlIIIIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("ZP")]]=IIllllIlIIIIIlIlII[#("cN8")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("TH")]]=IIllllIlIIIIIlIlII[#("GWU")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#{{44;110;184;338};"1 + 1 = 111";}]IIIllIlll[lIIlllIIllI]=IIIllIlll[lIIlllIIllI](lIlIllllIIIlIl(IIIllIlll,lIIlllIIllI+1,IIllllIlIIIIIlIlII[#("qmL")]))IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("cX")]][IIllllIlIIIIIlIlII[#("q4h")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("zSGU")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("KD")]][IIllllIlIIIIIlIlII[#("tgt")]]=IIllllIlIIIIIlIlII[#("9Xe2")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("EK")]][IIllllIlIIIIIlIlII[#{{218;97;679;375};{252;980;96;380};{428;362;555;865};}]]=IIllllIlIIIIIlIlII[#("2JlW")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("l7")]][IIllllIlIIIIIlIlII[#("3W7")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("jzXI")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("dr")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("eC1")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("nL")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("vQ8")]][IIllllIlIIIIIlIlII[#("UJ6m")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIllllIlIIIIIlIlII[#("1VD")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIllllIlIIIIIlIlII[#("JMr")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("jO")]]=IIllllIlIIIIIlIlII[#("IWZ")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("bM")]IIIllIlll[lIIlllIIllI]=IIIllIlll[lIIlllIIllI](lIlIllllIIIlIl(IIIllIlll,lIIlllIIllI+1,IIllllIlIIIIIlIlII[#("eCR")]))IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("p5")]][IIllllIlIIIIIlIlII[#{{876;358;696;380};"1 + 1 = 111";"1 + 1 = 111";}]]=IIIllIlll[IIllllIlIIIIIlIlII[#("SDKq")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Hb")]][IIllllIlIIIIIlIlII[#("LgM")]]=IIllllIlIIIIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";{689;405;859;547};"1 + 1 = 111";}];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("8W")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("ZdY")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("8T")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("uvk")]][IIllllIlIIIIIlIlII[#("BzoK")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("a4")]]=IIllllIlIIIIIlIlII[#("5s8")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("2W")]]=IIllllIlIIIIIlIlII[#("OaB")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("uF")]]=IIllllIlIIIIIlIlII[#("yht")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("6Q")]]=IIllllIlIIIIIlIlII[#("6mM")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("EC")]IIIllIlll[lIIlllIIllI]=IIIllIlll[lIIlllIIllI](lIlIllllIIIlIl(IIIllIlll,lIIlllIIllI+1,IIllllIlIIIIIlIlII[#("UXz")]))IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("LB")]][IIllllIlIIIIIlIlII[#("vMn")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("PN44")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("ID")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("jTE")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("C6")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("XDJ")]][IIllllIlIIIIIlIlII[#("gK58")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIIllIlll[IIllllIlIIIIIlIlII[#("LoZ")]][IIllllIlIIIIIlIlII[#{{797;273;14;72};{170;320;167;215};"1 + 1 = 111";"1 + 1 = 111";}]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Hp")]][IIllllIlIIIIIlIlII[#("DiA")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("ZWtZ")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("vo")]][IIllllIlIIIIIlIlII[#("9h9")]]=IIllllIlIIIIIlIlII[#("HmXZ")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("PK")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("WFX")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("hr")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("Cle")]][IIllllIlIIIIIlIlII[#("EE10")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("CQ")]]=IIllllIlIIIIIlIlII[#("6po")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Ws")]]=IIllllIlIIIIIlIlII[#("fnz")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Qc")]]=IIllllIlIIIIIlIlII[#("G6z")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("ty")]IIIllIlll[lIIlllIIllI]=IIIllIlll[lIIlllIIllI](lIlIllllIIIlIl(IIIllIlll,lIIlllIIllI+1,IIllllIlIIIIIlIlII[#("JiG")]))IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("5A")]][IIllllIlIIIIIlIlII[#("y0j")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("Vjn5")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("yI")]][IIllllIlIIIIIlIlII[#("xK4")]]=IIllllIlIIIIIlIlII[#("gPbH")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("HT")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("MT8")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("fX")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("52c")]][IIllllIlIIIIIlIlII[#("iILp")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("hK")]]=IIllllIlIIIIIlIlII[#("zao")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("BZ")]]=IIllllIlIIIIIlIlII[#("9FQ")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("cD")]]=IIllllIlIIIIIlIlII[#("UFs")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("7g")]IIIllIlll[lIIlllIIllI]=IIIllIlll[lIIlllIIllI](lIlIllllIIIlIl(IIIllIlll,lIIlllIIllI+1,IIllllIlIIIIIlIlII[#{{197;615;76;82};{240;659;416;366};{139;578;611;786};}]))IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("1Q")]][IIllllIlIIIIIlIlII[#("8go")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("CbRf")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("WD")]][IIllllIlIIIIIlIlII[#("bDk")]]=IIllllIlIIIIIlIlII[#("PeA6")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Rn")]][IIllllIlIIIIIlIlII[#("uaR")]]=IIllllIlIIIIIlIlII[#("C0fS")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("DB")]][IIllllIlIIIIIlIlII[#("oT9")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("NSeQ")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("zq")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("3WG")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIIllIlll[IIllllIlIIIIIlIlII[#("3kR")]][IIllllIlIIIIIlIlII[#("GDCG")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Nv")]]=IIllllIlIIIIIlIlII[#("j30")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("1P")]]=IIllllIlIIIIIlIlII[#("r0F")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Xp")]]=IIllllIlIIIIIlIlII[#("XuQ")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("Sr")]IIIllIlll[lIIlllIIllI]=IIIllIlll[lIIlllIIllI](lIlIllllIIIlIl(IIIllIlll,lIIlllIIllI+1,IIllllIlIIIIIlIlII[#("NBL")]))IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("m8")]][IIllllIlIIIIIlIlII[#("02a")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("jUXa")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("EH")]][IIllllIlIIIIIlIlII[#("Ysa")]]=IIllllIlIIIIIlIlII[#("9LHB")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("uU")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Vz")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("JyU")]][IIllllIlIIIIIlIlII[#("CWWU")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("yO")]]=IIllllIlIIIIIlIlII[#("zvC")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Nc")]]=IIllllIlIIIIIlIlII[#("Mse")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("ZL")]]=IIllllIlIIIIIlIlII[#("FiJ")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Lt")]]=IIllllIlIIIIIlIlII[#("cka")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("39")]IIIllIlll[lIIlllIIllI]=IIIllIlll[lIIlllIIllI](lIlIllllIIIlIl(IIIllIlll,lIIlllIIllI+1,IIllllIlIIIIIlIlII[#("lKS")]))IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#{{79;867;362;992};{837;575;246;17};}]][IIllllIlIIIIIlIlII[#{"1 + 1 = 111";{629;50;245;524};{231;137;566;566};}]]=IIIllIlll[IIllllIlIIIIIlIlII[#("QUqY")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("q8")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("3Zv")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("6q")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("QJ9")]][IIllllIlIIIIIlIlII[#("qKtu")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("F5")]]=IIllllIlIIIIIlIlII[#("K2A")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("jg")]]=IIllllIlIIIIIlIlII[#("8Dt")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("r2")]]=IIllllIlIIIIIlIlII[#("XGD")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("sD")]]=IIllllIlIIIIIlIlII[#("Tf8")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";}]IIIllIlll[lIIlllIIllI]=IIIllIlll[lIIlllIIllI](lIlIllllIIIlIl(IIIllIlll,lIIlllIIllI+1,IIllllIlIIIIIlIlII[#("OSU")]))IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("P2")]][IIllllIlIIIIIlIlII[#("PTO")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("AD5a")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("dM")]][IIllllIlIIIIIlIlII[#("rLo")]]=IIllllIlIIIIIlIlII[#("9Jl7")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("JL")]][IIllllIlIIIIIlIlII[#("7CZ")]]=IIllllIlIIIIIlIlII[#("4rzB")];else llIIlIIlIllIlIIIIlI[IIllllIlIIIIIlIlII[#("jju")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("1B")]];end;elseif lIIlllIIllI<=#("u2Ir5qxePpkhqjN10t3QgGbqLgz0Mu0Am7")then if lIIlllIIllI==#("XQ0nzfd0Jtg9iKuKx5QEZ1rQY1HDtAU4t")then do return end;else local IIllllIlllIl=IIllllIlIIIIIlIlII[#("cE")]IIIllIlll[IIllllIlllIl]=IIIllIlll[IIllllIlllIl](lIlIllllIIIlIl(IIIllIlll,IIllllIlllIl+1,IIllllIlIIIIIlIlII[#("UTE")]))end;elseif lIIlllIIllI<=#("ZlagFLdPC7EhqpqVDEGDU5zjzHJKGjJmPHU")then IIIllIlll[IIllllIlIIIIIlIlII[#("OC")]]=llIIlIIlIllIlIIIIlI[IIllllIlIIIIIlIlII[#("qkn")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Ri")]][IIllllIlIIIIIlIlII[#("pzh")]]=IIllllIlIIIIIlIlII[#("0sO7")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("ZQ")]]=llIIlIIlIllIlIIIIlI[IIllllIlIIIIIlIlII[#("0b9")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("as")]][IIllllIlIIIIIlIlII[#("YaU")]]=IIllllIlIIIIIlIlII[#("16td")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("YL")]]=(IIllllIlIIIIIlIlII[#("nU9")]~=0);IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];llIIlIIlIllIlIIIIlI[IIllllIlIIIIIlIlII[#("nGK")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("bv")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];do return end;elseif lIIlllIIllI>#("KqBfBkAtlQKqlJ6qy014W0R7cDirzrDTGglm")then IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("QHG")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("aM")]];else IIIllIlll[IIllllIlIIIIIlIlII[#{"1 + 1 = 111";{15;572;942;673};}]]=llIIlIIlIllIlIIIIlI[IIllllIlIIIIIlIlII[#("UXK")]];end;elseif lIIlllIIllI<=#{"1 + 1 = 111";{655;685;358;535};"1 + 1 = 111";"1 + 1 = 111";{662;4;318;961};{684;276;785;443};{797;961;259;15};{576;958;476;700};"1 + 1 = 111";"1 + 1 = 111";{963;622;879;312};"1 + 1 = 111";"1 + 1 = 111";{251;869;161;470};{111;788;150;569};{793;382;980;510};{628;692;150;718};"1 + 1 = 111";{326;56;874;462};"1 + 1 = 111";"1 + 1 = 111";{704;446;253;548};{486;979;394;710};{124;647;239;528};"1 + 1 = 111";{192;774;987;113};{343;435;911;257};"1 + 1 = 111";{273;667;978;359};{379;429;423;288};{702;58;7;747};"1 + 1 = 111";{37;834;185;442};"1 + 1 = 111";{895;342;241;674};{48;186;489;960};"1 + 1 = 111";"1 + 1 = 111";{426;968;619;413};{22;347;489;77};{879;514;660;460};{566;170;863;802};{282;349;792;240};{412;754;236;631};"1 + 1 = 111";{190;31;119;178};{247;512;541;951};"1 + 1 = 111";"1 + 1 = 111";{650;463;888;250};"1 + 1 = 111";{542;792;312;348};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}then if lIIlllIIllI<=#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{197;546;154;634};"1 + 1 = 111";{615;882;785;607};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{510;565;321;853};{263;332;335;416};{488;998;110;731};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{229;940;52;80};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{752;139;598;639};{488;431;242;10};{193;376;313;801};{639;29;642;843};"1 + 1 = 111";"1 + 1 = 111";{890;908;912;610};{745;127;859;259};"1 + 1 = 111";{59;75;799;489};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{69;524;192;641};{930;135;892;393};{133;638;830;912};"1 + 1 = 111";{884;576;919;948};"1 + 1 = 111";{817;655;645;84};"1 + 1 = 111";{869;579;261;45};"1 + 1 = 111";"1 + 1 = 111";{886;405;365;384};"1 + 1 = 111";}then if lIIlllIIllI<=#("PmeLcggnSutN4sB7PvCsqPEgdfJefpDZY6i3qteHC")then if lIIlllIIllI<=#("bOokKLWY5oIsx9S7I7HchD2FY7jIRvr50UOZ12F")then if lIIlllIIllI==#("rqtnqGKiksWgaAzIVUvNBogK6NCNv2gPCJU0iO")then if not IIIllIlll[IIllllIlIIIIIlIlII[#("Y6")]]then IIllllIlllIl=IIllllIlllIl+1;else IIllllIlllIl=IIllllIlIIIIIlIlII[#("obS")];end;else local lIlIllllIIIlIl;local lIIlllIIllI;IIIllIlll[IIllllIlIIIIIlIlII[#("ms")]]=llIIlIIlIllIlIIIIlI[IIllllIlIIIIIlIlII[#("F9A")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("fp")]][IIllllIlIIIIIlIlII[#("DC6")]]=IIllllIlIIIIIlIlII[#("VlOf")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("FO")]]=llIIlIIlIllIlIIIIlI[IIllllIlIIIIIlIlII[#("D1h")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#{"1 + 1 = 111";{508;50;836;145};}]][IIllllIlIIIIIlIlII[#("AF7")]]=IIllllIlIIIIIlIlII[#("KACY")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#{{246;700;384;457};{567;341;505;896};}]]=llIIlIIlIllIlIIIIlI[IIllllIlIIIIIlIlII[#{{391;741;580;603};{72;490;600;869};"1 + 1 = 111";}]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("kc")];lIlIllllIIIlIl=IIIllIlll[IIllllIlIIIIIlIlII[#("L28")]];IIIllIlll[lIIlllIIllI+1]=lIlIllllIIIlIl;IIIllIlll[lIIlllIIllI]=lIlIllllIIIlIl[IIllllIlIIIIIlIlII[#{"1 + 1 = 111";{871;340;515;658};"1 + 1 = 111";"1 + 1 = 111";}]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("lU")]IIIllIlll[lIIlllIIllI](IIIllIlll[lIIlllIIllI+1])IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#{{162;139;818;360};{332;61;616;130};}]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("3Jc")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#{{940;812;614;155};{248;870;672;773};}]]=IIllllIlIIIIIlIlII[#{"1 + 1 = 111";{25;593;986;332};{287;986;387;987};}];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("uz")]IIIllIlll[lIIlllIIllI](IIIllIlll[lIIlllIIllI+1])IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("U2")]]=llIIlIIlIllIlIIIIlI[IIllllIlIIIIIlIlII[#("spu")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("XM")]][IIllllIlIIIIIlIlII[#("ug4")]]=IIllllIlIIIIIlIlII[#("2KYY")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];do return end;end;elseif lIIlllIIllI==#("sybxzJl5BvfehH2HckUrOd6WsmhPCPIAhGcoA2Sa")then if(IIIllIlll[IIllllIlIIIIIlIlII[#("Z5")]]~=IIllllIlIIIIIlIlII[#("yv0R")])then IIllllIlllIl=IIllllIlllIl+1;else IIllllIlllIl=IIllllIlIIIIIlIlII[#("KO2")];end;else IIIllIlll[IIllllIlIIIIIlIlII[#{{541;22;119;680};"1 + 1 = 111";}]]={};end;elseif lIIlllIIllI<=#("SbqqY8iKbSQzxKpBoemCGDVYP6MENgjCTG6cQGEn8eA")then if lIIlllIIllI>#("1aU5XYkYGJoopDL1xO75InP0OmVTK8DCdY6PmQRZ6v")then IIIllIlll[IIllllIlIIIIIlIlII[#("GA")]]=llIIlIIlIllIlIIIIlI[IIllllIlIIIIIlIlII[#("zxj")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("V4")]][IIllllIlIIIIIlIlII[#("0Kj")]]=IIllllIlIIIIIlIlII[#("75xL")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("3f")]]=llIIlIIlIllIlIIIIlI[IIllllIlIIIIIlIlII[#("G73")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("vN")]][IIllllIlIIIIIlIlII[#("bR9")]]=IIllllIlIIIIIlIlII[#("Ej2B")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("tm")]]=(IIllllIlIIIIIlIlII[#("z3E")]~=0);IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];llIIlIIlIllIlIIIIlI[IIllllIlIIIIIlIlII[#("juZ")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("Kh")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];do return end;else local IIllllIlIIIIIlIlII=IIllllIlIIIIIlIlII[#("Gk")]IIIllIlll[IIllllIlIIIIIlIlII](IIIllIlll[IIllllIlIIIIIlIlII+1])end;elseif lIIlllIIllI<=#("krRWm4M0uhEzOu4qKdCnIfXkCH6PR7h9msFJ6BIY8hht")then local IIllllIlllIl=IIllllIlIIIIIlIlII[#("C1")]IIIllIlll[IIllllIlllIl](lIlIllllIIIlIl(IIIllIlll,IIllllIlllIl+1,IIllllIlIIIIIlIlII[#("jTP")]))elseif lIIlllIIllI==#("zstszgWEhyeFHtQ86jy9Flu0uuiFNoA7DLdoNxr0vFf4A")then local lIIlllIIllI;IIIllIlll[IIllllIlIIIIIlIlII[#("0s")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("lTj")]][IIllllIlIIIIIlIlII[#{{566;69;68;794};{125;276;689;370};{69;979;443;724};{880;721;774;719};}]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Yu")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("ajt")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("ph")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("zWm")]][IIllllIlIIIIIlIlII[#("F0Lv")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("dE")]]=IIllllIlIIIIIlIlII[#("5Kq")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Ll")]]=IIllllIlIIIIIlIlII[#("xSm")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("gC")]]=IIllllIlIIIIIlIlII[#("gax")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Sz")]]=IIllllIlIIIIIlIlII[#("jFP")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("aE")]IIIllIlll[lIIlllIIllI]=IIIllIlll[lIIlllIIllI](lIlIllllIIIlIl(IIIllIlll,lIIlllIIllI+1,IIllllIlIIIIIlIlII[#{"1 + 1 = 111";{581;551;254;114};{115;720;233;362};}]))IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("4o")]][IIllllIlIIIIIlIlII[#("4G6")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("kWdl")]];else IIIllIlll[IIllllIlIIIIIlIlII[#("0I")]]=llIIlIIlIllIlIIIIlI[IIllllIlIIIIIlIlII[#("X6N")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Sd")]][IIllllIlIIIIIlIlII[#("yDF")]]=IIllllIlIIIIIlIlII[#("qhGu")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("G5")]]=llIIlIIlIllIlIIIIlI[IIllllIlIIIIIlIlII[#("QMC")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Ie")]][IIllllIlIIIIIlIlII[#("dDX")]]=IIllllIlIIIIIlIlII[#("Av6F")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Sf")]]=(IIllllIlIIIIIlIlII[#("GcH")]~=0);IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];llIIlIIlIllIlIIIIlI[IIllllIlIIIIIlIlII[#("vDX")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("Up")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];do return end;end;elseif lIIlllIIllI<=#{"1 + 1 = 111";"1 + 1 = 111";{841;590;733;69};{452;511;126;246};{371;103;851;789};{432;758;403;925};{74;202;910;738};"1 + 1 = 111";{223;762;139;757};"1 + 1 = 111";{526;411;567;245};"1 + 1 = 111";{729;549;559;660};{304;627;402;265};{553;306;181;498};"1 + 1 = 111";{373;218;868;417};{198;263;851;872};{211;353;651;681};"1 + 1 = 111";{328;227;569;381};{225;181;552;646};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{559;665;289;438};"1 + 1 = 111";"1 + 1 = 111";{746;968;789;273};{248;933;784;355};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{601;826;121;376};{838;207;476;312};"1 + 1 = 111";{596;45;627;673};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{935;300;34;535};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{882;945;917;605};{729;845;237;666};"1 + 1 = 111";}then if lIIlllIIllI<=#("5scE1BEDfmRdfGdRj6OdPG33yzjljOPIx3FgnBjmsUxbBEVW")then if lIIlllIIllI>#{{781;751;507;811};{261;826;790;857};{230;940;139;597};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{921;463;157;212};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{912;566;651;674};"1 + 1 = 111";{936;209;161;66};{613;106;530;825};"1 + 1 = 111";{412;602;681;584};{438;56;83;53};"1 + 1 = 111";{570;445;365;286};{438;254;211;365};"1 + 1 = 111";{768;660;227;187};"1 + 1 = 111";{923;982;867;37};"1 + 1 = 111";"1 + 1 = 111";{149;563;19;659};"1 + 1 = 111";"1 + 1 = 111";{35;969;37;139};{467;56;622;641};{392;330;819;180};"1 + 1 = 111";{35;931;995;656};{317;589;850;847};{773;32;870;594};"1 + 1 = 111";{330;85;843;29};{93;133;426;858};{240;521;216;808};}then local IllIIIlIlIlIIIlIIlIl=IllIIIlIlIlIIIlIIlIl[IIllllIlIIIIIlIlII[#("Eo8")]];local lIlIllllIIIlIl;local lIIlllIIllI={};lIlIllllIIIlIl=lIllIlIlIIIll({},{__index=function(IIllllIlllIl,IIllllIlIIIIIlIlII)local IIllllIlIIIIIlIlII=lIIlllIIllI[IIllllIlIIIIIlIlII];return IIllllIlIIIIIlIlII[1][IIllllIlIIIIIlIlII[2]];end,__newindex=function(IIIllIlll,IIllllIlIIIIIlIlII,IIllllIlllIl)local IIllllIlIIIIIlIlII=lIIlllIIllI[IIllllIlIIIIIlIlII]IIllllIlIIIIIlIlII[1][IIllllIlIIIIIlIlII[2]]=IIllllIlllIl;end;});for IIlllllIlIllIIIll=1,IIllllIlIIIIIlIlII[#("Od0E")]do IIllllIlllIl=IIllllIlllIl+1;local IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];if IIllllIlIIIIIlIlII[#("v")]==20 then lIIlllIIllI[IIlllllIlIllIIIll-1]={IIIllIlll,IIllllIlIIIIIlIlII[#("Qf7")]};else lIIlllIIllI[IIlllllIlIllIIIll-1]={llIIlIIlIllIlIIIIlI,IIllllIlIIIIIlIlII[#("OEJ")]};end;lIIIIIllIlIIIlllIIIlIII[#lIIIIIllIlIIIlllIIIlIII+1]=lIIlllIIllI;end;IIIllIlll[IIllllIlIIIIIlIlII[#("c9")]]=lIIIlIlIIIlIllI(IllIIIlIlIlIIIlIIlIl,lIlIllllIIIlIl,IIlllllIlIllIIIll);else local IIllllIlIIIIIlIlII=IIllllIlIIIIIlIlII[#("ez")]IIIllIlll[IIllllIlIIIIIlIlII]=IIIllIlll[IIllllIlIIIIIlIlII]()end;elseif lIIlllIIllI<=#("5ErWJVjqujaYMpHQlZ3m30Yc404pxzeGVFoykieM6kqJg8TZj")then IIIllIlll[IIllllIlIIIIIlIlII[#("5U")]]=llIIlIIlIllIlIIIIlI[IIllllIlIIIIIlIlII[#("fup")]];elseif lIIlllIIllI==#("j2bXHfQo2T1435eEdhbiFcUrqTKp66gef7pmF77iS6qvUcquEM")then if not IIIllIlll[IIllllIlIIIIIlIlII[#("TZ")]]then IIllllIlllIl=IIllllIlllIl+1;else IIllllIlllIl=IIllllIlIIIIIlIlII[#("FVa")];end;else local IIllllIlIIIIIlIlII=IIllllIlIIIIIlIlII[#("X3")]IIIllIlll[IIllllIlIIIIIlIlII](IIIllIlll[IIllllIlIIIIIlIlII+1])end;elseif lIIlllIIllI<=#("MYa5ghTHYFBs6MWY5Q28gj2BIWzIoCoVubFqecjeWBiOrNuU7nvPM")then if lIIlllIIllI==#("YC5KxtTlrxqP84gGU3HXmQboi5COKbfKiRmduEPZvKiWxMPAOCED")then IIIllIlll[IIllllIlIIIIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=(not IIIllIlll[IIllllIlIIIIIlIlII[#("cga")]]);else IIIllIlll[IIllllIlIIIIIlIlII[#("ru")]]=IIllllIlIIIIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];end;elseif lIIlllIIllI<=#("ZBiBQCC2eMqqRHrRckpnRCMHo1GpbaiINBtpeNOcn6q81FQfySLqno")then local IIllllIlIIIIIlIlII=IIllllIlIIIIIlIlII[#("2f")]IIIllIlll[IIllllIlIIIIIlIlII]=IIIllIlll[IIllllIlIIIIIlIlII](IIIllIlll[IIllllIlIIIIIlIlII+1])elseif lIIlllIIllI==#("xZLlY5l0eETOpmbMAHmaVlNQUlA1sA1tza7BEB0hbfmFh1A3vflUboQ")then IIIllIlll[IIllllIlIIIIIlIlII[#("GJ")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("9VA")]];else IIIllIlll[IIllllIlIIIIIlIlII[#("Ja")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("ihz")]];end;elseif lIIlllIIllI<=#("l4BNFtIOMAoppLi8Qe8P9iI3VHGmohrjuWpJamNRII3SMkOV7md7palcvI18YuAEh")then if lIIlllIIllI<=#{{296;108;661;978};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{527;531;820;1};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{421;814;421;298};"1 + 1 = 111";"1 + 1 = 111";{56;718;584;104};"1 + 1 = 111";"1 + 1 = 111";{714;50;112;38};{625;52;556;432};"1 + 1 = 111";{856;407;989;309};{229;398;812;414};"1 + 1 = 111";{909;18;753;262};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{112;316;2;881};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{772;378;29;297};{340;627;339;56};{48;691;27;794};{856;821;453;182};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{196;879;450;775};{512;27;679;618};{601;427;482;809};"1 + 1 = 111";"1 + 1 = 111";{511;739;97;557};"1 + 1 = 111";"1 + 1 = 111";{108;682;787;953};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}then if lIIlllIIllI<=#("Xz3t0qUtSu1XFZ4AZASkdKZiTaXvQqqbSBSKaA7oH7xTnL47qkeTOvenKU")then if lIIlllIIllI==#("0DzOCdZfehtzzCDOgmf5hf0eFlIyvvFaqZhVit4PyF0Z6VPqlS8aEYDUN")then local lIIlllIIllI;lIIlllIIllI=IIllllIlIIIIIlIlII[#("Up")]IIIllIlll[lIIlllIIllI]=IIIllIlll[lIIlllIIllI](lIlIllllIIIlIl(IIIllIlll,lIIlllIIllI+1,IIllllIlIIIIIlIlII[#("Eg5")]))IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("R2")]][IIllllIlIIIIIlIlII[#("Pd4")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("vYfE")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("1V")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("4xx")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("BW")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("X2Q")]][IIllllIlIIIIIlIlII[#("7DSC")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("eW")]]=IIllllIlIIIIIlIlII[#("CpD")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#{{822;218;474;39};{966;685;191;161};}]]=IIllllIlIIIIIlIlII[#("o4l")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Oy")]]=IIllllIlIIIIIlIlII[#{"1 + 1 = 111";{300;313;444;183};"1 + 1 = 111";}];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("6C")]IIIllIlll[lIIlllIIllI]=IIIllIlll[lIIlllIIllI](lIlIllllIIIlIl(IIIllIlll,lIIlllIIllI+1,IIllllIlIIIIIlIlII[#("enr")]))IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("sk")]][IIllllIlIIIIIlIlII[#("5gj")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("HUFf")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("PI")]][IIllllIlIIIIIlIlII[#("ZA2")]]=IIllllIlIIIIIlIlII[#("l1kU")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("ux")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("lBj")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("k9")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("rze")]][IIllllIlIIIIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Lg")]]=IIllllIlIIIIIlIlII[#("eZ2")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#{{425;558;376;304};"1 + 1 = 111";}]]=IIllllIlIIIIIlIlII[#("Pb3")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("z1")]]=IIllllIlIIIIIlIlII[#("54g")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("gX")]]=IIllllIlIIIIIlIlII[#("NbF")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("kT")]IIIllIlll[lIIlllIIllI]=IIIllIlll[lIIlllIIllI](lIlIllllIIIlIl(IIIllIlll,lIIlllIIllI+1,IIllllIlIIIIIlIlII[#("fzp")]))IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("m5")]][IIllllIlIIIIIlIlII[#("TrW")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("B9Ln")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("OX")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("sz")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("UvU")]][IIllllIlIIIIIlIlII[#("B9gU")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("um")]]=IIllllIlIIIIIlIlII[#{{75;819;965;175};"1 + 1 = 111";{391;88;905;687};}];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("tf")]]=IIllllIlIIIIIlIlII[#("vys")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("K4")]]=IIllllIlIIIIIlIlII[#("mJD")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Gm")]]=IIllllIlIIIIIlIlII[#("ttx")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("iW")]IIIllIlll[lIIlllIIllI]=IIIllIlll[lIIlllIIllI](lIlIllllIIIlIl(IIIllIlll,lIIlllIIllI+1,IIllllIlIIIIIlIlII[#("5DU")]))IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("aH")]][IIllllIlIIIIIlIlII[#("jzx")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("vQKn")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("vl")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("d0H")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("MF")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("1f0")]][IIllllIlIIIIIlIlII[#("XAeg")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("ah")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("jbJ")]][IIllllIlIIIIIlIlII[#("P11f")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("hG")]][IIllllIlIIIIIlIlII[#("mqu")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("X2gA")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Wr")]][IIllllIlIIIIIlIlII[#("fvD")]]=IIllllIlIIIIIlIlII[#("Tq1X")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("uG")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("Z0S")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Cf")]]=IIIllIlll[IIllllIlIIIIIlIlII[#{{188;220;354;643};{916;344;648;28};{439;937;427;20};}]][IIllllIlIIIIIlIlII[#("82FU")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("jG")]]=IIllllIlIIIIIlIlII[#("M05")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("GO")]]=IIllllIlIIIIIlIlII[#("6cl")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("ld")]]=IIllllIlIIIIIlIlII[#("0gc")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("QN")]IIIllIlll[lIIlllIIllI]=IIIllIlll[lIIlllIIllI](lIlIllllIIIlIl(IIIllIlll,lIIlllIIllI+1,IIllllIlIIIIIlIlII[#("T4V")]))IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("m7")]][IIllllIlIIIIIlIlII[#("Uc7")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("IOU0")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("tT")]][IIllllIlIIIIIlIlII[#("icX")]]=IIllllIlIIIIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";{523;705;682;862};{742;740;140;503};}];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("yt")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("6m7")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("8C")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("iEf")]][IIllllIlIIIIIlIlII[#("6JBL")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("LU")]]=IIllllIlIIIIIlIlII[#("nJ6")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("6Y")]]=IIllllIlIIIIIlIlII[#("f7x")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("PJ")]]=IIllllIlIIIIIlIlII[#("e01")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("Zl")]IIIllIlll[lIIlllIIllI]=IIIllIlll[lIIlllIIllI](lIlIllllIIIlIl(IIIllIlll,lIIlllIIllI+1,IIllllIlIIIIIlIlII[#("svB")]))IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Df")]][IIllllIlIIIIIlIlII[#("fzs")]]=IIIllIlll[IIllllIlIIIIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("rZ")]][IIllllIlIIIIIlIlII[#{{111;923;496;814};"1 + 1 = 111";"1 + 1 = 111";}]]=IIllllIlIIIIIlIlII[#("I3QF")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";}]][IIllllIlIIIIIlIlII[#("diP")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("eZWQ")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("6J")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("e8v")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Fa")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("bl3")]][IIllllIlIIIIIlIlII[#("55tt")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Jd")]]=IIllllIlIIIIIlIlII[#("7Cn")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Yl")]]=IIllllIlIIIIIlIlII[#("QXK")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#{"1 + 1 = 111";{207;951;424;713};}]]=IIllllIlIIIIIlIlII[#("kYE")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("Mp")]IIIllIlll[lIIlllIIllI]=IIIllIlll[lIIlllIIllI](lIlIllllIIIlIl(IIIllIlll,lIIlllIIllI+1,IIllllIlIIIIIlIlII[#("Vch")]))IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("2a")]][IIllllIlIIIIIlIlII[#("kbY")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("bgab")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#{{227;826;922;644};"1 + 1 = 111";}]][IIllllIlIIIIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]]=IIllllIlIIIIIlIlII[#("F5qk")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("H1")]][IIllllIlIIIIIlIlII[#("rMf")]]=IIllllIlIIIIIlIlII[#("k0qX")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("1g")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("EE7")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("4Q")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("Cq7")]][IIllllIlIIIIIlIlII[#("0x80")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("FP")]]=IIllllIlIIIIIlIlII[#("lFx")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("LC")]]=IIllllIlIIIIIlIlII[#("N1z")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Dg")]]=IIllllIlIIIIIlIlII[#("Oe8")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Qb")]]=IIllllIlIIIIIlIlII[#{{196;544;554;481};"1 + 1 = 111";"1 + 1 = 111";}];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#{"1 + 1 = 111";{54;611;165;140};}]IIIllIlll[lIIlllIIllI]=IIIllIlll[lIIlllIIllI](lIlIllllIIIlIl(IIIllIlll,lIIlllIIllI+1,IIllllIlIIIIIlIlII[#("x2V")]))IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("5P")]][IIllllIlIIIIIlIlII[#("lqF")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("O7ot")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("YA")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#{{728;95;740;799};"1 + 1 = 111";{973;374;192;268};}]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Yh")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("0xi")]][IIllllIlIIIIIlIlII[#("RFr4")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("I7")]]=IIllllIlIIIIIlIlII[#("eEJ")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("jR")]]=IIllllIlIIIIIlIlII[#("OKz")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("r3")]]=IIllllIlIIIIIlIlII[#("7ar")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("eb")]]=IIllllIlIIIIIlIlII[#("Odp")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("Tb")]IIIllIlll[lIIlllIIllI]=IIIllIlll[lIIlllIIllI](lIlIllllIIIlIl(IIIllIlll,lIIlllIIllI+1,IIllllIlIIIIIlIlII[#("r8U")]))IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Cz")]][IIllllIlIIIIIlIlII[#("GyB")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("aohE")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Kh")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("9sH")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("V5")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("cSz")]][IIllllIlIIIIIlIlII[#("DgEt")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("D6")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("5E7")]][IIllllIlIIIIIlIlII[#("NMGl")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("4f")]][IIllllIlIIIIIlIlII[#("cGu")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("oI9S")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("IQ")]][IIllllIlIIIIIlIlII[#("EmM")]]=IIllllIlIIIIIlIlII[#{"1 + 1 = 111";{647;257;174;382};"1 + 1 = 111";{759;497;222;549};}];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("ad")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("9rA")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Ot")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("o6z")]][IIllllIlIIIIIlIlII[#("d1Rc")]];else for IIllllIlIIIIIlIlII=IIllllIlIIIIIlIlII[#("Iz")],IIllllIlIIIIIlIlII[#("NJ8")]do IIIllIlll[IIllllIlIIIIIlIlII]=nil;end;end;elseif lIIlllIIllI==#("ipGCTSNthKuRFWsBIMpaiUGqmOyFHDvxhZkOi5WhmNNf5EmmRcq1ENlzUop")then if(IIIllIlll[IIllllIlIIIIIlIlII[#("FH")]]~=IIllllIlIIIIIlIlII[#("9Nx0")])then IIllllIlllIl=IIllllIlllIl+1;else IIllllIlllIl=IIllllIlIIIIIlIlII[#("cOQ")];end;else IIllllIlllIl=IIllllIlIIIIIlIlII[#("cpG")];end;elseif lIIlllIIllI<=#{"1 + 1 = 111";"1 + 1 = 111";{531;236;541;200};{230;555;131;981};"1 + 1 = 111";{632;107;486;52};"1 + 1 = 111";{268;257;238;157};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{544;322;514;941};"1 + 1 = 111";{906;647;185;987};"1 + 1 = 111";{385;583;933;680};"1 + 1 = 111";"1 + 1 = 111";{439;362;966;30};"1 + 1 = 111";"1 + 1 = 111";{34;951;120;378};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{610;288;372;527};"1 + 1 = 111";"1 + 1 = 111";{414;368;95;120};{845;464;545;464};{303;825;20;236};{237;943;626;518};{485;190;947;218};{850;446;664;635};{950;403;883;899};{900;81;271;765};{770;687;12;121};{641;391;724;885};{198;782;174;938};{836;482;286;872};"1 + 1 = 111";"1 + 1 = 111";{393;640;770;979};{391;357;429;982};"1 + 1 = 111";{99;635;701;851};"1 + 1 = 111";{707;583;563;798};{238;651;775;832};"1 + 1 = 111";"1 + 1 = 111";{250;233;406;422};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{306;286;701;606};{830;949;193;237};{639;136;939;145};}then if lIIlllIIllI>#{{879;972;219;70};{705;10;15;584};"1 + 1 = 111";{963;78;172;697};"1 + 1 = 111";"1 + 1 = 111";{510;470;444;214};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{757;462;741;604};{812;362;655;591};"1 + 1 = 111";{466;434;143;651};{598;759;686;499};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{890;86;924;889};"1 + 1 = 111";"1 + 1 = 111";{701;228;516;775};"1 + 1 = 111";{387;497;841;379};"1 + 1 = 111";{578;387;22;809};"1 + 1 = 111";"1 + 1 = 111";{391;545;864;218};{113;507;526;460};{482;718;244;60};"1 + 1 = 111";{31;401;372;350};"1 + 1 = 111";"1 + 1 = 111";{359;151;365;900};{166;5;878;635};{114;366;826;604};"1 + 1 = 111";{818;294;787;179};"1 + 1 = 111";{822;875;172;678};"1 + 1 = 111";{931;945;909;252};{208;463;36;599};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{686;519;556;887};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{772;349;503;524};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{810;969;730;181};{586;926;118;334};"1 + 1 = 111";}then IIIllIlll[IIllllIlIIIIIlIlII[#("3m")]]={};else IIIllIlll[IIllllIlIIIIIlIlII[#("Wv")]][IIllllIlIIIIIlIlII[#("Mas")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("5SWX")]];end;elseif lIIlllIIllI<=#("dNDE8BZABYMFG5s3EAugheJ0vzzzl67Vxi8HpcVqTmeiOc4jdo4vVJ19eNhJcAn")then IIIllIlll[IIllllIlIIIIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=(not IIIllIlll[IIllllIlIIIIIlIlII[#("f2Z")]]);elseif lIIlllIIllI==#("01ix7WNCPdy4aAlsFpv6bL9Yr9CM4mos8JrW4HmqLCRSk68PCYdXeqDp2tf7tbIC")then local lIIlllIIllI;local IIlllllIlIllIIIll;IIIllIlll[IIllllIlIIIIIlIlII[#{{482;190;382;115};{378;722;419;30};}]]=IIIllIlll[IIllllIlIIIIIlIlII[#("N7f")]][IIllllIlIIIIIlIlII[#("T3PB")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#{"1 + 1 = 111";{904;219;302;534};}]]=IIIllIlll[IIllllIlIIIIIlIlII[#("Vp5")]][IIllllIlIIIIIlIlII[#("cCd7")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Gx")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("234")]][IIllllIlIIIIIlIlII[#("iGKY")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIlllllIlIllIIIll=IIllllIlIIIIIlIlII[#("oG")];lIIlllIIllI=IIIllIlll[IIllllIlIIIIIlIlII[#("tGP")]];IIIllIlll[IIlllllIlIllIIIll+1]=lIIlllIIllI;IIIllIlll[IIlllllIlIllIIIll]=lIIlllIIllI[IIllllIlIIIIIlIlII[#("eVdb")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIlllllIlIllIIIll=IIllllIlIIIIIlIlII[#("US")]IIIllIlll[IIlllllIlIllIIIll](IIIllIlll[IIlllllIlIllIIIll+1])else local IIllllIlIIIIIlIlII=IIllllIlIIIIIlIlII[#("tY")]IIIllIlll[IIllllIlIIIIIlIlII]=IIIllIlll[IIllllIlIIIIIlIlII]()end;elseif lIIlllIIllI<=#("f6Bizz8cevK4qNuaXjfiCnSgc4KBo6K4o3faIGcAfU953uLRV7H1Dsx1nugFZHYhVPPyIt")then if lIIlllIIllI<=#("qhQdSnXmRs3QrASC5GnWmzIKI52jnQmiBEpUXpPNBhAl61GScnU2uHp1JfFWvN9bgUp")then if lIIlllIIllI==#("j8OQ0Kvf9xORzkg96uX3nylRU3rXiyflMTIeJdbUlk2lBYxlG9fV6vKVX757rI7LrD")then IIIllIlll[IIllllIlIIIIIlIlII[#{"1 + 1 = 111";{421;113;229;565};}]][IIllllIlIIIIIlIlII[#("Fqt")]]=IIllllIlIIIIIlIlII[#("LABY")];else local llIIlIIlIllIlIIIIlI;local lIIlllIIllI;IIIllIlll[IIllllIlIIIIIlIlII[#("pq")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("Z9U")]][IIllllIlIIIIIlIlII[#("apQ3")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("7K")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("QyJ")]][IIllllIlIIIIIlIlII[#("HWln")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Wi")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("8qJ")]][IIllllIlIIIIIlIlII[#("QrdD")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("oa")];llIIlIIlIllIlIIIIlI=IIIllIlll[IIllllIlIIIIIlIlII[#("hNp")]];IIIllIlll[lIIlllIIllI+1]=llIIlIIlIllIlIIIIlI;IIIllIlll[lIIlllIIllI]=llIIlIIlIllIlIIIIlI[IIllllIlIIIIIlIlII[#("MYTs")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Gm")]]=IIllllIlIIIIIlIlII[#("DP6")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("Dy")]IIIllIlll[lIIlllIIllI]=IIIllIlll[lIIlllIIllI](lIlIllllIIIlIl(IIIllIlll,lIIlllIIllI+1,IIllllIlIIIIIlIlII[#("T8D")]))IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Pb")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("uA5")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#{"1 + 1 = 111";{625;83;399;683};"1 + 1 = 111";}]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIIllIlll[IIllllIlIIIIIlIlII[#("IB6")]][IIllllIlIIIIIlIlII[#("EdIe")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("RC")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("m1N")]][IIllllIlIIIIIlIlII[#("jPU1")]];end;elseif lIIlllIIllI<=#{{40;919;509;793};"1 + 1 = 111";{928;55;305;730};"1 + 1 = 111";{307;652;562;661};"1 + 1 = 111";{809;266;163;62};{318;391;428;628};{484;557;578;153};"1 + 1 = 111";{115;261;212;737};"1 + 1 = 111";{560;860;755;30};"1 + 1 = 111";{303;187;703;512};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{320;379;814;456};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{957;577;97;264};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{428;557;292;713};{595;318;905;731};{861;778;413;49};{534;433;409;71};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{868;887;230;496};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{44;727;69;94};{816;597;42;3};{45;568;251;250};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{162;647;868;975};"1 + 1 = 111";{161;105;594;310};"1 + 1 = 111";{353;96;196;527};"1 + 1 = 111";{431;414;207;508};{259;491;856;139};{451;659;463;192};{171;958;998;713};"1 + 1 = 111";"1 + 1 = 111";{997;978;549;876};{827;123;692;207};"1 + 1 = 111";{825;77;798;494};"1 + 1 = 111";"1 + 1 = 111";}then local lIlIllllIIIlIl;local lIIlllIIllI;IIIllIlll[IIllllIlIIIIIlIlII[#("5e")]]=llIIlIIlIllIlIIIIlI[IIllllIlIIIIIlIlII[#("R6T")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("rI")]][IIllllIlIIIIIlIlII[#("tI9")]]=IIllllIlIIIIIlIlII[#("tD1b")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Ms")]]=llIIlIIlIllIlIIIIlI[IIllllIlIIIIIlIlII[#("q92")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("bU")];lIlIllllIIIlIl=IIIllIlll[IIllllIlIIIIIlIlII[#("uHP")]];IIIllIlll[lIIlllIIllI+1]=lIlIllllIIIlIl;IIIllIlll[lIIlllIIllI]=lIlIllllIIIlIl[IIllllIlIIIIIlIlII[#("WWjH")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("da")]IIIllIlll[lIIlllIIllI](IIIllIlll[lIIlllIIllI+1])IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("3n")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("GK3")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("R0")]]=IIllllIlIIIIIlIlII[#("CDO")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("DZ")]IIIllIlll[lIIlllIIllI](IIIllIlll[lIIlllIIllI+1])IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#{{814;786;674;374};{673;443;520;662};}]]=llIIlIIlIllIlIIIIlI[IIllllIlIIIIIlIlII[#{"1 + 1 = 111";{164;957;47;256};{953;782;834;847};}]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";}]][IIllllIlIIIIIlIlII[#("QMD")]]=IIllllIlIIIIIlIlII[#("vtvC")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("of")]]=llIIlIIlIllIlIIIIlI[IIllllIlIIIIIlIlII[#("cJf")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("nt")]][IIllllIlIIIIIlIlII[#("o1Z")]]=IIllllIlIIIIIlIlII[#{{530;295;942;624};{761;351;523;144};"1 + 1 = 111";"1 + 1 = 111";}];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];do return end;elseif lIIlllIIllI==#("HXJf3uMNHE5hNqxz76T2iUTVDksKQ9SyWKPDome4n4rq2MMtRCriJuSWeYNSbb6IVIudM")then local IIllllIlllIl=IIllllIlIIIIIlIlII[#("oo")]IIIllIlll[IIllllIlllIl]=IIIllIlll[IIllllIlllIl](lIlIllllIIIlIl(IIIllIlll,IIllllIlllIl+1,IIllllIlIIIIIlIlII[#("AnZ")]))else IIIllIlll[IIllllIlIIIIIlIlII[#("V0")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("dZE")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIIllIlll[IIllllIlIIIIIlIlII[#{{298;411;898;492};{671;642;224;85};"1 + 1 = 111";}]][IIllllIlIIIIIlIlII[#("WQhB")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Yp")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("8v5")]][IIllllIlIIIIIlIlII[#("6SLP")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("ES")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("rRa")]][IIllllIlIIIIIlIlII[#("2but")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];llIIlIIlIllIlIIIIlI[IIllllIlIIIIIlIlII[#("Usa")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("89")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("gD")]]=llIIlIIlIllIlIIIIlI[IIllllIlIIIIIlIlII[#("GqX")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("lK")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("B2M")]][IIllllIlIIIIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";{144;113;73;425};{525;808;695;70};}]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];if(IIIllIlll[IIllllIlIIIIIlIlII[#("Fm")]]~=IIllllIlIIIIIlIlII[#("0Plf")])then IIllllIlllIl=IIllllIlllIl+1;else IIllllIlllIl=IIllllIlIIIIIlIlII[#("Vf0")];end;end;elseif lIIlllIIllI<=#("jV1ZOnDC30J92nSKYC13yBJx2m8TGuqJSXsGqUQFsN5WjbjS0lT3mSGSlF6CpT6JK9rf5lse")then if lIIlllIIllI==#("xKVGXn0cp3tLyx9qKuWXnpKQxmjUeXP3OgZiVmzqfz90M7lNrYv0GrJhaeiKdf8DoB6rH0G")then IIIllIlll[IIllllIlIIIIIlIlII[#("QX")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("Os8")]][IIllllIlIIIIIlIlII[#{"1 + 1 = 111";{493;774;26;979};{937;184;889;668};{726;633;235;566};}]];else local IllIIIlIlIlIIIlIIlIl=IllIIIlIlIlIIIlIIlIl[IIllllIlIIIIIlIlII[#("pX5")]];local lIlIllllIIIlIl;local lIIlllIIllI={};lIlIllllIIIlIl=lIllIlIlIIIll({},{__index=function(IIllllIlllIl,IIllllIlIIIIIlIlII)local IIllllIlIIIIIlIlII=lIIlllIIllI[IIllllIlIIIIIlIlII];return IIllllIlIIIIIlIlII[1][IIllllIlIIIIIlIlII[2]];end,__newindex=function(IIIllIlll,IIllllIlIIIIIlIlII,IIllllIlllIl)local IIllllIlIIIIIlIlII=lIIlllIIllI[IIllllIlIIIIIlIlII]IIllllIlIIIIIlIlII[1][IIllllIlIIIIIlIlII[2]]=IIllllIlllIl;end;});for IIlllllIlIllIIIll=1,IIllllIlIIIIIlIlII[#("CeiH")]do IIllllIlllIl=IIllllIlllIl+1;local IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];if IIllllIlIIIIIlIlII[#("8")]==20 then lIIlllIIllI[IIlllllIlIllIIIll-1]={IIIllIlll,IIllllIlIIIIIlIlII[#("E1O")]};else lIIlllIIllI[IIlllllIlIllIIIll-1]={llIIlIIlIllIlIIIIlI,IIllllIlIIIIIlIlII[#("N2F")]};end;lIIIIIllIlIIIlllIIIlIII[#lIIIIIllIlIIIlllIIIlIII+1]=lIIlllIIllI;end;IIIllIlll[IIllllIlIIIIIlIlII[#("I0")]]=lIIIlIlIIIlIllI(IllIIIlIlIlIIIlIIlIl,lIlIllllIIIlIl,IIlllllIlIllIIIll);end;elseif lIIlllIIllI<=#("5FRYpUezbGDpBYxxISiQeYm9BHLka4gBs85aKU1qaTJINTbAdKUYSZshrRySi4zhAb6C3xWX0")then local IIllllIlllIl=IIllllIlIIIIIlIlII[#("LO")]IIIllIlll[IIllllIlllIl](lIlIllllIIIlIl(IIIllIlll,IIllllIlllIl+1,IIllllIlIIIIIlIlII[#("0pd")]))elseif lIIlllIIllI==#("QuoPxRGkgAjrTDQXS3xjiguChMWJHRY670j82NuQm7X87isDWfO2BRTK9WIV46OzMnt2tS4fJQ")then local IIllllIlllIl=IIllllIlIIIIIlIlII[#("15")];local IlIIlllI=IIIllIlll[IIllllIlIIIIIlIlII[#("njZ")]];IIIllIlll[IIllllIlllIl+1]=IlIIlllI;IIIllIlll[IIllllIlllIl]=IlIIlllI[IIllllIlIIIIIlIlII[#("NuAg")]];else local lIIlllIIllI;IIIllIlll[IIllllIlIIIIIlIlII[#("u6")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("bSK")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("U2")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("DC1")]][IIllllIlIIIIIlIlII[#("dkEq")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("U5")]]=IIllllIlIIIIIlIlII[#("FRJ")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Fp")]]=IIllllIlIIIIIlIlII[#("Snt")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#{{910;856;387;316};{707;113;997;631};}]]=IIllllIlIIIIIlIlII[#("xAk")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Qc")]]=IIllllIlIIIIIlIlII[#("Ngi")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("cp")]IIIllIlll[lIIlllIIllI]=IIIllIlll[lIIlllIIllI](lIlIllllIIIlIl(IIIllIlll,lIIlllIIllI+1,IIllllIlIIIIIlIlII[#("xeY")]))IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("j0")]][IIllllIlIIIIIlIlII[#("cTa")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("u8cz")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Mq")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("DlV")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("J3")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("nci")]][IIllllIlIIIIIlIlII[#("vQS7")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#{{591;983;815;173};"1 + 1 = 111";}]]=IIllllIlIIIIIlIlII[#{{437;518;369;774};{389;415;619;853};"1 + 1 = 111";}];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#{"1 + 1 = 111";{748;129;424;492};}]]=IIllllIlIIIIIlIlII[#("sFZ")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("cC")]]=IIllllIlIIIIIlIlII[#("5gU")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("5V")]]=IIllllIlIIIIIlIlII[#("9jj")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("rl")]IIIllIlll[lIIlllIIllI]=IIIllIlll[lIIlllIIllI](lIlIllllIIIlIl(IIIllIlll,lIIlllIIllI+1,IIllllIlIIIIIlIlII[#("JaG")]))IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("JD")]][IIllllIlIIIIIlIlII[#("OvZ")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("hFcA")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("04")]][IIllllIlIIIIIlIlII[#("RfG")]]=IIllllIlIIIIIlIlII[#("pMMn")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("uY")]][IIllllIlIIIIIlIlII[#("DWT")]]=IIllllIlIIIIIlIlII[#("X3Ym")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("vl")]][IIllllIlIIIIIlIlII[#("riP")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("3a5n")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";}]][IIllllIlIIIIIlIlII[#("5mp")]]=IIllllIlIIIIIlIlII[#("Pk5T")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("pl")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("pkK")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIIllIlll[IIllllIlIIIIIlIlII[#("8mF")]][IIllllIlIIIIIlIlII[#("lPQg")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("bD")]]=IIllllIlIIIIIlIlII[#("c08")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("tO")]]=IIllllIlIIIIIlIlII[#("HUy")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("6h")]]=IIllllIlIIIIIlIlII[#("5yo")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("v1")]IIIllIlll[lIIlllIIllI]=IIIllIlll[lIIlllIIllI](lIlIllllIIIlIl(IIIllIlll,lIIlllIIllI+1,IIllllIlIIIIIlIlII[#("9rk")]))IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("rd")]][IIllllIlIIIIIlIlII[#("xAG")]]=IIIllIlll[IIllllIlIIIIIlIlII[#{{144;360;162;3};"1 + 1 = 111";"1 + 1 = 111";{736;826;901;45};}]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("QT")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("Er9")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("CL")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("UNi")]][IIllllIlIIIIIlIlII[#("hr9u")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("zp")]]=IIllllIlIIIIIlIlII[#("W3Y")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("BQ")]]=IIllllIlIIIIIlIlII[#("KmE")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("fP")]]=IIllllIlIIIIIlIlII[#("XHY")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("oQ")]]=IIllllIlIIIIIlIlII[#("Ub6")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("AI")]IIIllIlll[lIIlllIIllI]=IIIllIlll[lIIlllIIllI](lIlIllllIIIlIl(IIIllIlll,lIIlllIIllI+1,IIllllIlIIIIIlIlII[#("8c2")]))IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";}]][IIllllIlIIIIIlIlII[#("aAK")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("BIpB")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("by")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("ROZ")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("l9")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("0MC")]][IIllllIlIIIIIlIlII[#("CkZ8")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Be")]]=IIllllIlIIIIIlIlII[#("L52")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#{{164;742;263;435};"1 + 1 = 111";}]]=IIllllIlIIIIIlIlII[#{"1 + 1 = 111";{179;196;754;334};"1 + 1 = 111";}];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("dj")]]=IIllllIlIIIIIlIlII[#("YIv")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("XN")]]=IIllllIlIIIIIlIlII[#("M8g")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("T2")]IIIllIlll[lIIlllIIllI]=IIIllIlll[lIIlllIIllI](lIlIllllIIIlIl(IIIllIlll,lIIlllIIllI+1,IIllllIlIIIIIlIlII[#("uCy")]))IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("p1")]][IIllllIlIIIIIlIlII[#("VlD")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("uUFy")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("4g")]][IIllllIlIIIIIlIlII[#("tpW")]]=IIllllIlIIIIIlIlII[#("6JtU")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("c2")]][IIllllIlIIIIIlIlII[#("xTW")]]=IIllllIlIIIIIlIlII[#("K5Fi")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Xq")]][IIllllIlIIIIIlIlII[#("e46")]]=IIllllIlIIIIIlIlII[#{"1 + 1 = 111";{732;346;42;130};{303;796;250;353};"1 + 1 = 111";}];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("TB")]][IIllllIlIIIIIlIlII[#("i47")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("MbKY")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Nn")]][IIllllIlIIIIIlIlII[#("zfj")]]=IIllllIlIIIIIlIlII[#("g4El")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("qa")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("eU6")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("qq")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("IxA")]][IIllllIlIIIIIlIlII[#("a0Sh")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIllllIlIIIIIlIlII[#("oUi")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("PM")]]=IIllllIlIIIIIlIlII[#("CHS")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("XR")]]=IIllllIlIIIIIlIlII[#("8RA")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("sV")]IIIllIlll[lIIlllIIllI]=IIIllIlll[lIIlllIIllI](lIlIllllIIIlIl(IIIllIlll,lIIlllIIllI+1,IIllllIlIIIIIlIlII[#{{733;419;887;511};"1 + 1 = 111";{423;426;512;121};}]))IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("oq")]][IIllllIlIIIIIlIlII[#("brt")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("a2Xn")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("iy")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("Ejs")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Ib")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("bbq")]][IIllllIlIIIIIlIlII[#{"1 + 1 = 111";{433;449;253;396};"1 + 1 = 111";{27;397;680;513};}]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("pu")]]=IIllllIlIIIIIlIlII[#("scy")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Uj")]]=IIllllIlIIIIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";{834;812;254;599};}];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("6C")]]=IIllllIlIIIIIlIlII[#("WGx")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("v9")]]=IIllllIlIIIIIlIlII[#("lNp")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("vX")]IIIllIlll[lIIlllIIllI]=IIIllIlll[lIIlllIIllI](lIlIllllIIIlIl(IIIllIlll,lIIlllIIllI+1,IIllllIlIIIIIlIlII[#("QeP")]))IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Oy")]][IIllllIlIIIIIlIlII[#("9pS")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("Fdhy")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("L9")]][IIllllIlIIIIIlIlII[#("c94")]]=IIllllIlIIIIIlIlII[#("TALQ")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("IA")]][IIllllIlIIIIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]]=IIllllIlIIIIIlIlII[#("tjQo")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("Qz")]][IIllllIlIIIIIlIlII[#("pib")]]=IIllllIlIIIIIlIlII[#("cehF")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("xi")]][IIllllIlIIIIIlIlII[#("sAV")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("Unyz")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("zS")]][IIllllIlIIIIIlIlII[#("mA5")]]=IIllllIlIIIIIlIlII[#{"1 + 1 = 111";{259;735;733;445};"1 + 1 = 111";"1 + 1 = 111";}];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("X2")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("4Ro")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("X5")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("4L9")]][IIllllIlIIIIIlIlII[#("NWY9")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("F1")]]=IIllllIlIIIIIlIlII[#("vvL")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("W7")]]=IIllllIlIIIIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";{839;712;899;693};}];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("52")]]=IIllllIlIIIIIlIlII[#("C24")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];lIIlllIIllI=IIllllIlIIIIIlIlII[#("7F")]IIIllIlll[lIIlllIIllI]=IIIllIlll[lIIlllIIllI](lIlIllllIIIlIl(IIIllIlll,lIIlllIIllI+1,IIllllIlIIIIIlIlII[#("i5x")]))IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#{{169;595;183;545};{608;552;925;575};}]][IIllllIlIIIIIlIlII[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]]=IIIllIlll[IIllllIlIIIIIlIlII[#("dXgd")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#{{760;763;913;599};{111;276;842;950};}]][IIllllIlIIIIIlIlII[#("tpS")]]=IIllllIlIIIIIlIlII[#("LobU")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("dd")]]=IIlllllIlIllIIIll[IIllllIlIIIIIlIlII[#("tmv")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("DJ")]]=IIIllIlll[IIllllIlIIIIIlIlII[#("Udk")]][IIllllIlIIIIIlIlII[#("0lJG")]];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("q6")]]=IIllllIlIIIIIlIlII[#("EBf")];IIllllIlllIl=IIllllIlllIl+1;IIllllIlIIIIIlIlII=IlIIlllI[IIllllIlllIl];IIIllIlll[IIllllIlIIIIIlIlII[#("xI")]]=IIllllIlIIIIIlIlII[#("I8K")];end;IIllllIlllIl=IIllllIlllIl+1;end;end);end;return lIIIlIlIIIlIllI(true,{},IIlIlIlllIIIlIlIIll())();end)(string.byte,table.insert,setmetatable);
RAW Paste Data