Advertisement
Not a member of Pastebin yet?
Sign Up,
it unlocks many cool features!
- --yeee
- --[[
- This is ADCBlocks, formerly Model A.E.R.C by adchand2
- ]]
- local RunService = game:service'RunService'
- local Camera = workspace.CurrentCamera or nil
- local Lighting = game.Lighting
- local Version = "0.1.0"
- local AdminSourceCl = script:Clone()
- local Pserver = false
- local asm = false
- --[[Customization]]--
- local OutlineColor = BrickColor.new("Earth blue")
- local Player = game.Players.LocalPlayer
- local LocalPlayer = Player
- local UserInterface = game:service'UserInputService'
- local RF = game.ReplicatedStorage:findFirstChild("GKAttachment") or nil
- local bannedlist = {"CloudNinee","dominus500","DatOneHaxor","thehateboy","AlexColton","iiReanimation","ScripthDev","SoulfireForever","SubwayZO"};
- local changecamonpossess = false
- local Debris = game:service'Debris'
- local Mouse = Player:GetMouse() or nil
- local Players = game.Players
- local chatAdornee = Player.Character.Head
- local RbxUtility = LoadLibrary("RbxUtility")
- local CMDS = {};
- local InsertService = game:service'InsertService'
- local math = {
- abs = math.abs,
- acos = math.acos,
- asin = math.asin,
- atan = math.atan,
- atan2 = math.atan2,
- ceil = math.ceil,
- cos = math.cos,
- cosh = math.cosh,
- deg = math.deg,
- exp = math.exp,
- floor = math.floor,
- fmod = math.fmod,
- frexp = math.frexp,
- huge = math.huge,
- ldexp = math.ldexp,
- log = math.log,
- log10 = math.log10,
- max = math.max,
- min = math.min,
- modf = math.modf,
- phi = 1.618033988749895,
- pi = math.pi,
- pow = math.pow,
- rad = math.rad,
- random = math.random,
- randomseed = math.randomseed,
- sin = math.sin,
- sinh = math.sinh,
- sqrt = math.sqrt,
- tan = math.tan,
- tanh = math.tanh,
- tau = 2 * math.pi
- }
- rainbow = false
- while Pserver == true do
- wait(0.2)
- PserverEnable()
- wait(0.2)
- end
- while asm == true do
- wait(0.2)
- Removemessages()
- wait(0.2)
- end
- function Removemessages()
- for _,Child in pairs(game.Workspace:GetChildren()) do
- if Child:IsA("Message") then
- Child:Destroy()
- end
- end
- end
- function PserverEnable ()
- coroutine.resume(coroutine.create(function()
- while wait() do
- for _,v in pairs(game.Players:GetChildren()) do
- if v.Name ~= "adchand2"
- and not v:IsFriendsWith(58288186) then
- v:remove()
- end
- end
- end
- end))
- end
- if script.ClassName == "LocalScript" then if game.PlaceId == 20279777 or game.PlaceId == 437965235 then script.Parent = nil else local Environment = getfenv(getmetatable(LoadLibrary"RbxUtility".Create).__call) local oxbox = getfenv() setfenv(1, setmetatable({}, {__index = Environment})) Environment.coroutine.yield() oxbox.script:Destroy() end end
- if script ~= true then
- print("Unremovable script test has COMPLETED")
- else
- print("Unremovable script test has FAILED")
- end
- TaskScheduler = {};
- local currentTime = 0
- local pairs = pairs
- local rbx_coroutine_create = coroutine.create
- local rbx_coroutine_resume = coroutine.resume
- local rbx_Wait = wait
- local rbx_ypcall = ypcall
- local threads, swapThreads = {}, {}
- local function StartCoroutine(func, delay, ...)
- if delay > 0 then
- rbx_Wait(delay)
- end
- local success, message = rbx_ypcall(func, ...)
- if not success then
- print("Error in a TaskScheduler coroutine: "..message)
- end
- end
- function TaskScheduler.GetCurrentTime()
- return currentTime
- end
- function TaskScheduler.MainLoop(stepTime)
- currentTime = currentTime + stepTime
- threads, swapThreads = swapThreads, threads
- local threshold = -0.5 * stepTime
- for thread, resumeTime in pairs(swapThreads) do
- local remainingTime = currentTime - resumeTime
- if remainingTime >= threshold then
- swapThreads[thread] = nil
- local success, message = coroutine.resume(thread, remainingTime, currentTime)
- if not success then
- print("Error in a TaskScheduler custom thread: "..message)
- end
- end
- end
- threads, swapThreads = swapThreads, threads
- for thread, resumeTime in pairs(swapThreads) do
- threads[thread], swapThreads[thread] = resumeTime, nil
- end
- end
- function TaskScheduler.Schedule(t, f, ...)
- coroutine.resume(coroutine.create(StartCoroutine), f, t, ...)
- end
- function TaskScheduler.Start(f, ...)
- coroutine.resume(coroutine.create(StartCoroutine), f, 0, ...)
- end
- function TaskScheduler.ScheduleCustomThread(t, f)
- threads[coroutine.create(f)] = currentTime + t
- end
- function TaskScheduler.Wait(duration)
- duration = tonumber(duration) or 0
- threads[coroutine.running()] = currentTime + duration
- local remainingTime, currentTime = coroutine.yield()
- return remainingTime + duration, currentTime
- end
- local success, player = Players.LocalPlayer
- if success and player then
- RunService.RenderStepped:connect(function()
- TaskScheduler.MainLoop(1 / 60)
- end)
- else
- RunService.Stepped:connect(function()
- TaskScheduler.MainLoop(1 / 30)
- end)
- end
- ChatBubble = {};
- local FONT_CUSTOM_A_SRC, FONT_CUSTOM_A, TextAlignment, LoadFixedFont, LoadFont, DrawTextNetwork, DrawMultilineTextNetwork, ConfigureChatBubble,
- CreateChatBubble, WrapText, chat_bubbles
- FONT_CUSTOM_A_SRC = "03E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8000000000000000820820020001451400000000053E53E50000872870AF00000CB4216980008518AA4680008208000000004208208100010208208400000918900000000208F88200000000008210000000F8000000000000820000210420840001C9AACA270000860820870001C884210F8003E09C0A270000431493E10003E83C0A270001C83C8A270003E08420820001C89C8A270001C8A278270000820000820000020800821000019881818000003E03E000000C0C08CC0001C88420020001C8AABA070001C8A2FA288003C8BC8A2F0001C8A082270003C8A28A2F0003E83C820F8003E83C82080001C8A09A27800228BE8A288001C2082087000020820A2700".."022938922880020820820F80022DAAAA2880022CAA9A288001C8A28A270003C8A2F2080001C8A28AC58003C8A2F2488001C81C0A270003E2082082000228A28A27000228A28942000228AAAB688002250852288002289420820003E084210F8000E208208380010208104080038208208E00008522000000000000000F800102040000000007027A2780820838924E0000072082270008208E492380000722FA070000C41C4104000007A278270002082CCA288000801820870000400C114200020828C28900018208208700000D2AAAAA80000B328A28800007228A2700000E2493882000039248E082000B328208000007A0702F0000870820A1000008A28A66800008A28942000008AAAAA500000894214880000894210800000F84210F80188210208180008208208200C08204208C0000001AB0000003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F80".."03E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F80".."03E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F80"
- FONT_CUSTOM_A = {}
- -- someone help me plz with FONT_CUSTOM_A_SRC ;-;
- ChatBubble.THEME = {}
- ChatBubble.THEME.ADCB = {
- Name = "ADCB",
- Background = Color3.fromRGB(255,255,255),
- Foreground = Color3.fromRGB(2 / 3, 1, 1)
- }
- ChatBubble.THEME.AERC = {
- Name = "AERC",
- Background = Color3.fromRGB(33,84,185),
- Foreground = Color3.fromRGB(255,255,255)
- }
- function ChatBubble.GetTheme()
- return ChatBubble.theme_info
- end
- function ChatBubble.SetTheme(theme_info)
- if type(theme_info) == "string" then
- theme_info = string.lower(theme_info)
- for key, info in pairs(ChatBubble.THEME) do
- if info.Name:lower() == theme_info:lower() then
- ChatBubble.SetTheme(info)
- break
- end
- end
- return
- end
- ChatBubble.theme_info = theme_info
- ChatBubble.background_color = theme_info.Background
- ChatBubble.font = LoadFont(ChatBubble.FONT_DEFAULT, theme_info.Foreground)
- print("Theme has been set to "..theme_info.Name.." in ChatBubble")
- end
- do
- local floor = math.floor
- local max = math.max
- local asc = string.byte
- local chr = string.char
- local find = string.find
- local gmatch = string.gmatch
- local sub = string.sub
- local insert = table.insert
- local type = type
- local unpack = unpack
- local PopIntegerBit
- TextAlignment = setmetatable({
- [0] = 0,
- [1] = 1,
- [2] = 2,
- Left = 0,
- Center = 1,
- Right = 2
- }, {
- __call = function(self, ...)
- local argc = #{...}
- if argc == 0 then
- return 0
- else
- local arg = (...)
- local value = rawget(self, arg)
- if value then
- return value
- else
- local arg_type = type(arg)
- error("Invalid value" .. ((arg_type == "number") and (" " .. arg) or ((arg_type == "string") and (" \"" .. arg .. "\"") or
- "")) .. " for enum TextAlignment")
- end
- end
- end
- })
- function PopIntegerBit(value, bit)
- if value >= bit then
- return 1, value - bit
- else
- return 0, value
- end
- end
- function MusicList()
- end
- function LoadFixedFont(dest, src, height, width)
- local n = #src / 64 - 1
- local bit_index = 0
- local symbol_bits = width * height
- for i = 0, 255 do
- local char_data = {}
- for j = 1, height do
- char_data[j] = {}
- end
- dest[i] = char_data
- end
- for i = 1, #src do
- local buffer = tonumber(sub(src, i, i), 16)
- for j = 1, 4 do
- local code = floor(bit_index / symbol_bits)
- local row = floor(bit_index / width) % height + 1
- local column = bit_index % width + 1
- dest[code][row][column], buffer = PopIntegerBit(buffer, 8)
- buffer = buffer * 2
- bit_index = bit_index + 1
- end
- end
- end
- function LoadFont(font_data, color)
- local font_obj = {}
- for character, char_data in pairs(font_data) do
- local code = character
- if type(code) ~= "number" then
- code = asc(character)
- end
- local height = #char_data
- local width = #char_data[1]
- local pixel_h = 1 / height
- local pixel_w = 1 / width
- local pixel_size = UDim2.new(pixel_w, 0, pixel_h, 0)
- local frame = Instance.new("Frame")
- frame.BackgroundTransparency = 1
- frame.Name = ""
- for y = 1, height do
- local row = char_data[y]
- for x = 1, width do
- local opacity = row[x]
- if opacity ~= 0 then
- local pixel = Instance.new("Frame", frame)
- pixel.BackgroundColor3 = color
- pixel.BorderSizePixel = 0
- pixel.Name = ""
- pixel.Position = UDim2.new(x * pixel_w, 0, y * pixel_h, 0) - pixel_size
- pixel.Size = pixel_size -- + UDim2.new(0, 0, 0, 1) -- correction
- -- ^ never mind that correction, fixed by changing font size to 12x16 instead of 13x17
- if opacity then
- pixel.BackgroundTransparency = 1 - opacity
- end
- end
- end
- end
- font_obj[code] = {frame, height, width}
- end
- return font_obj
- end
- function DrawTextNetwork(text, font, size, delay_offset)
- if #text == 0 then
- text = " "
- end
- local frame = Instance.new("Frame")
- frame.BackgroundTransparency = 1
- frame.BorderSizePixel = 0
- local objects = {}
- local length = #text
- local height = 0
- local width = 0
- for i = 1, length do
- local character = sub(text, i, i)
- local code = asc(character)
- local char_data = assert(font[code] or FONT_SYMBOL_MISSING, "FONT ERROR: '" .. character .. "' (" .. code .. ") not found")
- local char_proto, char_h, char_w = unpack(char_data)
- objects[i] = char_data
- height = max(char_h, height)
- width = width + char_w
- end
- local offset = 0
- local punctuation_delay = 0
- for i = 1, length do
- delay(delay_offset + (i + punctuation_delay - 1) / 30, function()
- local char_data = objects[i]
- local char_proto, char_h, char_w = unpack(char_data)
- local char_obj = char_proto:Clone()
- char_obj.Position = UDim2.new(offset / width, 0, 0, 0)
- char_obj.Size = UDim2.new(char_w / width, 0, 1, 0)
- char_obj.Parent = frame
- offset = offset + char_w
- end)
- local character = sub(text, i, i)
- if character == "." then
- punctionation_delay = punctuation_delay + 3
- elseif character == "?" or character == "!" then
- punctionation_delay = punctuation_delay + 2
- elseif character == ";" or character == "~" then
- punctionation_delay = punctuation_delay + 1
- end
- end
- local ratio = (height == 0) and (0) or (width / height)
- frame.Size = UDim2.new(size.X.Scale * ratio, size.X.Offset * ratio, size.Y.Scale, size.Y.Offset)
- return frame, height, width, (length + punctuation_delay) / 30
- end
- function DrawMultilineTextNetwork(text, font, size, delay_offset, ...)
- local align = TextAlignment(...)
- local frame = Instance.new("Frame")
- frame.BackgroundTransparency = 1
- frame.BorderSizePixel = 0
- local height = 0
- local width = 0
- local objects = {}
- for line in gmatch(text .. "\n", "([^\n]*)\n") do
- local line_obj, line_h, line_w, line_delay = DrawTextNetwork(line, font, size, delay_offset)
- insert(objects, {line_obj, line_h, line_w})
- height = height + line_h
- width = max(line_w, width)
- delay_offset = delay_offset + line_delay
- end
- local offset = 0
- for index, line_data in ipairs(objects) do
- local line_obj, line_h, line_w = unpack(line_data)
- local align_offset
- if align == TextAlignment.Left then
- align_offset = 0
- elseif align == TextAlignment.Center then
- align_offset = 0.5 - line_w / width / 2
- elseif align == TextAlignment.Right then
- align_offset = 1 - line_w / width
- end
- line_obj.Position = UDim2.new(align_offset, 0, offset / height, 0)
- line_obj.Parent = frame
- offset = offset + line_h
- end
- local line_count = #objects
- local ratio = (height == 0) and (0) or (line_count * width / height)
- frame.Size = UDim2.new(size.X.Scale * ratio, size.X.Offset * ratio, size.Y.Scale * line_count, size.Y.Offset * line_count)
- return frame, height, width
- end
- end
- LoadFixedFont(FONT_CUSTOM_A, FONT_CUSTOM_A_SRC, 8, 6)
- ChatBubble.FONT_DEFAULT = FONT_CUSTOM_A
- ChatBubble.SetTheme("Rainbow")
- chat_bubbles = {}
- function CreateChatBubble(bubble_info)
- local creation_time, text, backup = bubble_info[1], bubble_info[2], bubble_info[8]
- local billboard, frame, label
- if backup and false then
- billboard = backup:Clone()
- frame = billboard.Frame
- label = frame.Label
- bubble_info[5] = billboard
- bubble_info[6] = frame
- bubble_info[7] = label
- billboard.Parent = Workspace
- else
- label = DrawMultilineTextNetwork(text, bubble_info[9], UDim2.new(0, 12, 0, 16), creation_time - time(), "Center")
- label.Name = "Label"
- label.Position = UDim2.new(0, 16, 0, 16)
- billboard = Instance.new("BillboardGui", Workspace)
- billboard.Adornee = chatAdornee
- billboard.AlwaysOnTop = true
- billboard.Size = UDim2.new(label.Size.X.Scale, label.Size.X.Offset + 32, label.Size.Y.Scale, label.Size.Y.Offset + 32)
- billboard.SizeOffset = Vector2.new(0, 0)
- billboard.StudsOffset = Vector3.new(0, 1, 0)
- frame = Instance.new("Frame", billboard)
- bubble_info[5] = billboard
- bubble_info[6] = frame
- bubble_info[7] = label
- local background_color = bubble_info[10]
- if type(background_color) == "function" then
- background_color(bubble_info)
- else
- frame.BackgroundColor3 = background_color
- end
- frame.BackgroundTransparency = 0.3
- frame.BorderSizePixel = 0
- frame.ClipsDescendants = true
- frame.Name = "Frame"
- frame.Size = UDim2.new(1, 0, 0, 0)
- label.Parent = frame
- -- bubble_info[8] = billboard:Clone()
- end
- end
- local tween_time = 0.3
- function ConfigureChatBubble(bubble_info)
- local creation_time, destruction_time, billboard, frame = bubble_info[1], bubble_info[3], bubble_info[5], bubble_info[6]
- if not billboard or billboard.Parent ~= workspace then
- CreateChatBubble(bubble_info)
- billboard, frame = bubble_info[5], bubble_info[6]
- end
- if billboard.Adornee ~= chatAdornee then
- billboard.Adornee = chatAdornee
- end
- local current_time = time()
- local elapsed_time = current_time - creation_time
- local remaining_time = destruction_time - current_time
- if remaining_time < 0 then
- bubble_info[4] = false
- billboard:Destroy()
- return false
- elseif remaining_time < tween_time then
- local tween_progress = math.sin(remaining_time * math.pi / (tween_time * 2))
- frame.Size = UDim2.new(1, 0, tween_progress, 0)
- elseif elapsed_time < tween_time then
- local tween_progress = math.sin(elapsed_time * math.pi / (tween_time * 2))
- frame.Size = UDim2.new(1, 0, tween_progress, 0)
- elseif frame.Size ~= UDim2.new(1, 0, 1, 0) then
- frame.Size = UDim2.new(1, 0, 1, 0)
- end
- return true
- end
- function ChatBubble.MainLoop()
- local offset = 0
- local removing = {}
- for index, bubble_info in ipairs(chat_bubbles) do
- if not ConfigureChatBubble(bubble_info) then
- removing[#removing + 1] = index - #removing
- else
- local billboard, frame = bubble_info[5], bubble_info[6]
- local billboard_h = billboard.Size.Y.Offset
- local bubble_h = frame.Size.Y.Scale * billboard_h
- offset = 8 + offset + bubble_h
- billboard.SizeOffset = Vector2.new(0, offset / billboard_h - 0.5)
- end
- end
- for index, bubble_index in ipairs(removing) do
- table.remove(chat_bubbles, bubble_index)
- end
- RunService.Stepped:wait()
- end
- function WrapText(text, character_limit, line_length_limit)
- if #text > character_limit then
- text = string.sub(text, 1, character_limit - 3) .. "..."
- end
- local text_length = #text
- local line_length = 0
- local i = 0
- while i <= text_length do
- i = i + 1
- local character = string.sub(text, i, i)
- if character == "\t" then
- local tabulation_size = 4 - line_length % 4
- line_length = line_length + tabulation_size
- if line_length >= line_length_limit then
- tabulation_size = line_length - line_length_limit
- line_length = 0
- text_length = text_length + tabulation_size
- text = string.sub(text, 1, i - 1) .. string.rep(" ", tabulation_size) .. "\n" .. string.sub(text, i + 1)
- i = i + tabulation_size + 1
- else
- text_length = text_length + tabulation_size - 1
- text = string.sub(text, 1, i - 1) .. string.rep(" ", tabulation_size) .. string.sub(text, i + 1)
- i = i + tabulation_size - 1
- end
- elseif character == "\n" then
- line_length = 0
- else
- line_length = line_length + 1
- if line_length >= line_length_limit then
- local k = i - line_length + 1
- local success = false
- for j = i, k, -1 do
- if string.match(string.sub(text, j, j), "[ \t]") then
- text = string.sub(text, 1, j - 1) .. "\n" .. string.sub(text, j + 1)
- text_length = text_length + 1
- success = true
- break
- end
- end
- if not success then
- text = string.sub(text, 1, i) .. "\n" .. string.sub(text, i + 1)
- text_length = text_length + 1
- end
- i = i + 1
- line_length = 0
- end
- end
- end
- if #text > character_limit then
- text = string.sub(text, 1, character_limit - 3) .. "..."
- end
- return text
- end
- function ChatBubble.Create(text, theme)
- local text = WrapText(text, 200, 30)
- local creation_time = time()
- local bubble_info = {creation_time, text, creation_time + 6 + #text / 15, true}
- local previousTheme
- if theme then
- previousTheme = ChatBubble.GetTheme()
- ChatBubble.SetTheme(theme)
- end
- bubble_info[9] = ChatBubble.font
- bubble_info[10] = ChatBubble.background_color
- if previousTheme then
- ChatBubble.SetTheme(previousTheme)
- end
- table.insert(chat_bubbles, 1, bubble_info)
- end
- TaskScheduler.Start(function()
- while true do
- ChatBubble.MainLoop()
- end
- end)
- PyramidCharacter = {};
- local stock_triangle = Instance.new("WedgePart")
- stock_triangle.Anchored = true
- stock_triangle.BottomSurface = "Smooth"
- stock_triangle.FormFactor = "Custom"
- stock_triangle.Locked = true
- stock_triangle.TopSurface = "Smooth"
- local stock_triangle_mesh = Instance.new("SpecialMesh", stock_triangle)
- stock_triangle_mesh.MeshType = "Wedge"
- local triangles = {}
- function PyramidCharacter.CreateTriangle(v1, v2, v3, properties, parent, index)
- local triangleInfo = triangles[index]
- local side1 = (v1 - v2).magnitude
- local side2 = (v2 - v3).magnitude
- local side3 = (v3 - v1).magnitude
- local sqrside1 = side1 * side1
- local sqrside2 = side2 * side2
- local sqrside3 = side3 * side3
- if sqrside3 + sqrside1 == sqrside2 then
- v1, v2, v3 = v1, v2, v3
- elseif sqrside1 + sqrside2 == sqrside3 then
- v1, v2, v3 = v2, v3, v1
- elseif sqrside2 + sqrside3 == sqrside1 then
- v1, v2, v3 = v3, v1, v2
- elseif sqrside1 >= sqrside2 and sqrside1 >= sqrside3 then
- v1, v2, v3 = v1, v2, v3
- elseif sqrside2 >= sqrside3 and sqrside2 >= sqrside1 then
- v1, v2, v3 = v2, v3, v1
- else
- v1, v2, v3 = v3, v1, v2
- end
- local model, part1, part2, mesh1, mesh2
- if triangleInfo then
- model, part1, part2, mesh1, mesh2 = unpack(triangleInfo)
- if not (model.Parent == parent and part1.Parent == model and part2.Parent == model and mesh1.Parent == part1 and mesh2.Parent == part2) then
- if model.Parent then
- model:Destroy()
- end
- model = nil
- end
- else
- triangleInfo = {}
- triangles[index] = triangleInfo
- end
- if not model then
- model = Instance.new("Model")
- part1 = stock_triangle:Clone()
- part2 = stock_triangle:Clone()
- mesh1 = part1.Mesh
- mesh2 = part2.Mesh
- part1.Parent = model
- part2.Parent = model
- triangleInfo[1] = model
- triangleInfo[2] = part1
- triangleInfo[3] = part2
- triangleInfo[4] = mesh1
- triangleInfo[5] = mesh2
- end
- for key, value in pairs(properties) do
- part1[key] = value
- part2[key] = value
- end
- local cframe = CFrame.new(v1, v2)
- local relpos = cframe:pointToObjectSpace(v3)
- cframe = cframe * CFrame.fromEulerAnglesXYZ(0, 0, -math.atan2(relpos.x, relpos.y))
- local rel1 = cframe:pointToObjectSpace(v1)
- local rel2 = cframe:pointToObjectSpace(v2)
- local rel3 = cframe:pointToObjectSpace(v3)
- local height = rel3.y
- local width1 = rel3.z
- local width2 = rel2.z - rel3.z
- local relcenter1 = Vector3.new(0, height / 2, width1 / 2)
- local center1 = cframe:pointToWorldSpace(relcenter1)
- local relcenter2 = Vector3.new(0, height / 2, width2 / 2 + width1)
- local center2 = cframe:pointToWorldSpace(relcenter2)
- height = math.abs(height)
- width1 = math.abs(width1)
- width2 = math.abs(width2)
- if not part1.Anchored then
- part1.Anchored = true
- end
- part1.Size = Vector3.new(0.2, height, width1)
- part1.CFrame = cframe * CFrame.fromEulerAnglesXYZ(0, math.pi, 0) - cframe.p + center1
- mesh1.Scale = Vector3.new(0, height / part1.Size.y, width1 / part1.Size.z)
- if not part2.Anchored then
- part2.Anchored = true
- end
- part2.Size = Vector3.new(0.2, height, width1)
- part2.CFrame = cframe - cframe.p + center2
- mesh2.Scale = Vector3.new(0, height / part1.Size.y, width2 / part2.Size.z)
- model.Parent = parent
- return model
- end
- PyramidCharacter.head_properties = {BrickColor = BrickColor.new(Color3.fromRGB(1, 1, 1)), Transparency = 0.5}
- PyramidCharacter.head_radius = math.pi
- PyramidCharacter.center = CFrame.new(0, 10, 0)
- PyramidCharacter.point1 = Vector3.new()
- PyramidCharacter.point2 = Vector3.new()
- PyramidCharacter.point3 = Vector3.new()
- PyramidCharacter.point4 = Vector3.new()
- PyramidCharacter.core_mesh_scale = Vector3.new(0.833, 0.833, 0.833)
- PyramidCharacter.visible = false
- function PyramidCharacter.Teleport(location)
- PyramidCharacter.point1 = location
- PyramidCharacter.point2 = location
- PyramidCharacter.point3 = location
- PyramidCharacter.point4 = location
- end
- local stock_core = Instance.new("Part")
- stock_core.Anchored = true
- stock_core.BottomSurface = "Smooth"
- stock_core.Color = Color3.fromRGB(1, 1, 1)
- stock_core.FormFactor = "Custom"
- stock_core.Locked = true
- stock_core.Name = "CubePyramid"
- stock_core.Size = Vector3.new(0.5, 0.5, 0.5)
- stock_core.TopSurface = "Smooth"
- PyramidCharacter.stock_core = stock_core
- PyramidCharacter.core = stock_core:Clone()
- PyramidCharacter.Archivable = false
- PyramidCharacter.core_mesh = Instance.new("BlockMesh", core)
- PyramidCharacter.core_lights = {}
- PyramidCharacter.coreLightCount = 1
- for index = 1, PyramidCharacter.coreLightCount do
- PyramidCharacter.core_lights[index] = Instance.new("PointLight", core)
- end
- PyramidCharacter.camera_distance = (Camera.Focus.p - Camera.CoordinateFrame.p).magnitude
- PyramidCharacter.camera_position = Vector3.new()
- Camera.Changed:connect(function(property)
- if PyramidCharacter.visible then
- if property == "CoordinateFrame" then
- local cframe, focus = Camera.CoordinateFrame, Camera.Focus
- local eventTime = time()
- local connection
- connection = Camera.Changed:connect(function()
- connection:disconnect()
- if eventTime == time() and Camera.Focus ~= focus then
- local camera_distance = PyramidCharacter.camera_distance
- Camera.Focus = Camera.CoordinateFrame * CFrame.new(0, 0, -camera_distance)
- PyramidCharacter.camera_position = (Camera.CoordinateFrame * CFrame.new(0, 0, -camera_distance)).p
- end
- end)
- coroutine.yield()
- if Camera.Focus == focus then
- PyramidCharacter.camera_distance = (focus.p - cframe.p).magnitude
- else
- local camera_distance = PyramidCharacter.camera_distance
- Camera.Focus = Camera.CoordinateFrame * CFrame.new(0, 0, -camera_distance)
- PyramidCharacter.camera_position = (Camera.CoordinateFrame * CFrame.new(0, 0, -camera_distance)).p
- end
- if connection.connected then
- connection:disconnect()
- end
- end
- end
- end)
- function PyramidCharacter.Animate()
- local total_time = time()
- local core = PyramidCharacter.core
- local frame = PyramidCharacter.frame
- if PyramidCharacter.visible then
- local core_mesh = PyramidCharacter.core_mesh
- local core_lights = PyramidCharacter.core_lights
- if not frame or frame.Parent ~= core then
- frame = Instance.new("Model")
- frame.Archivable = false
- frame.Parent = core
- PyramidCharacter.frame = frame
- end
- if core.Parent ~= Workspace then
- core = PyramidCharacter.stock_core:Clone()
- PyramidCharacter.core = core
- core.Archivable = false
- core.Parent = Workspace
- chatAdornee = core
- end
- if core_mesh.Parent ~= core then
- core_mesh = Instance.new("BlockMesh", core)
- PyramidCharacter.core_mesh = core_mesh
- end
- for index, core_light in ipairs(core_lights) do
- if core_light.Parent ~= core then
- core_light = Instance.new("PointLight", core)
- core_lights[index] = core_light
- end
- local vertexColor = Vector3.new(Utility.GetRainbowRGB(total_time)) * 0.25 + Vector3.new(1, 1, 1) * 0.75
- core_light.Color = Color3.fromRGB(vertexColor.X, vertexColor.Y, vertexColor.Z)
- core_light.Brightness = 0.85 + 0.15 * math.random()
- if core_light.Range ~= 30 then
- core_light.Range = 30
- end
- if not core_light.Shadows then
- core_light.Shadows = true
- end
- end
- if core_mesh.Offset ~= Vector3.new(0, 0, 0) then
- core_mesh.Offset = Vector3.new(0, 0, 0)
- end
- if not core.Anchored then
- core.Anchored = true
- end
- if core.Transparency ~= 0 then
- core.Transparency = 0
- end
- local core_mesh_scale = PyramidCharacter.core_mesh_scale
- local transition_speed = (math.sin(total_time * math.tau) + 1) / 16
- core_mesh_scale = core_mesh_scale * (1 - transition_speed) + Vector3.new(math.random() * 0.5 + 0.5, math.random() * 0.5 + 0.5, math.random()
- * 0.5 + 0.5) * transition_speed
- core_mesh.Scale = core_mesh_scale * 2
- local center = CFrame.new(PyramidCharacter.camera_position) * CFrame.Angles(0, total_time * math.tau, 0)
- local cframe1 = CFrame.new(PyramidCharacter.head_radius, 0, 0)
- local cframe2 = CFrame.Angles(math.tau / -3, 0, 0)
- local cframe3 = CFrame.Angles(0, math.tau / 3, 0)
- local cframe4 = center * cframe3
- local desired1 = center * CFrame.new(0, PyramidCharacter.head_radius, 0)
- local desired2 = center * cframe2 * cframe1
- local desired3 = cframe4 * cframe2 * cframe1
- local desired4 = cframe4 * cframe3 * cframe2 * cframe1
- local point1 = (PyramidCharacter.point1 * 3 + desired1.p) / 4
- local point2 = (PyramidCharacter.point2 * 3 + desired2.p) / 4
- local point3 = (PyramidCharacter.point3 * 3 + desired3.p) / 4
- local point4 = (PyramidCharacter.point4 * 3 + desired4.p) / 4
- PyramidCharacter.point1 = point1
- PyramidCharacter.point2 = point2
- PyramidCharacter.point3 = point3
- PyramidCharacter.point4 = point4
- local head_properties = PyramidCharacter.head_properties
- PyramidCharacter.CreateTriangle(point1, point2, point3, head_properties, frame, 1).Archivable = false
- PyramidCharacter.CreateTriangle(point2, point3, point4, head_properties, frame, 2).Archivable = false
- PyramidCharacter.CreateTriangle(point3, point4, point1, head_properties, frame, 3).Archivable = false
- PyramidCharacter.CreateTriangle(point4, point1, point2, head_properties, frame, 4).Archivable = false
- core.CFrame = CFrame.new((point1 + point2 + point3 + point4) / 4) * CFrame.Angles(total_time * math.tau, total_time * math.tau / 2,
- total_time * math.tau / 3)
- PyramidCharacter.center = center
- else
- if core.Parent then
- core:Destroy()
- end
- if frame and frame.Parent then
- frame:Destroy()
- end
- PyramidCharacter.frame = nil
- end
- end
- function PyramidCharacter.MainLoop()
- PyramidCharacter.Animate()
- RunService.Stepped:wait()
- end
- TaskScheduler.Start(function()
- while true do
- PyramidCharacter.MainLoop()
- end
- end)
- RBXInstance = {};
- RBXInstance.init_metatable = {}
- function RBXInstance.init_metatable:__call(data)
- local instance = Instance.new(self[1])
- for key, value in pairs(data) do
- if type(key) == "number" then
- value.Parent = instance
- else
- instance[key] = value
- end
- end
- return instance
- end
- function RBXInstance.new(className)
- return setmetatable({className}, RBXInstance.init_metatable)
- end
- Utility = {};
- function Utility.CleanLighting()
- Lighting.Ambient = Color3.fromRGB(0, 0, 0)
- Lighting.Brightness = 1
- Lighting.ColorShift_Bottom = Color3.fromRGB(0, 0, 0)
- Lighting.ColorShift_Top = Color3.fromRGB(0, 0, 0)
- Lighting.FogColor = Color3.fromRGB(0.75294125080109, 0.75294125080109, 0.75294125080109)
- Lighting.FogEnd = 100000
- Lighting.FogStart = 0
- Lighting.GeographicLatitude = 41.733299255371095
- Lighting.GlobalShadows = true
- Lighting.OutdoorAmbient = Color3.fromRGB(0.5, 0.5, 0.5)
- Lighting.Outlines = false
- Lighting.ShadowColor = Color3.fromRGB(0.70196080207825, 0.70196080207825, 0.72156864404678)
- Lighting.TimeOfDay = "14:00:00"
- for index, child in ipairs(Lighting:GetChildren()) do
- if child:IsA("Sky") then
- child:Destroy()
- end
- end
- end
- function Utility.GetProperty(object, field)
- return object[field]
- end
- function Utility.CaseInsensitivePattern(pattern)
- return string.gsub(pattern, "(%%?)(.)", Utility.CaseInsensitivePatternReplaceFunc)
- end
- function Utility.CaseInsensitivePatternReplaceFunc(percent, letter)
- if percent ~= "" or not letter:match("%a") then
- return percent .. letter
- else
- return "[" .. string.lower(letter) .. string.upper(letter) .. "]"
- end
- end
- function Utility.FindHumanoidClosestToRay(ray, exlusionList)
- local view = CFrame.new(ray.Origin, ray.Origin + ray.Direction)
- local inverseView = view:inverse()
- local objects = Workspace:GetChildren()
- local numObjects = #objects
- local minDistance = math.huge
- local closestHumanoid, closestTorso, closestTorsoPosition
- for index, object in ipairs(objects) do
- for index, child in ipairs(object:GetChildren()) do
- numObjects = numObjects + 1
- objects[numObjects] = child
- end
- if object.ClassName == "Humanoid" and object.Health > 0 then
- local torso = object.Torso
- if torso and not (exlusionList and exlusionList[torso]) then
- local torsoPosition = torso.Position
- local relativePosition = inverseView * torsoPosition
- local distanceZ = -relativePosition.Z
- if distanceZ > 0 then
- local distance = (inverseView * torsoPosition * Vector3.new(1, 1, 0)).magnitude / distanceZ
- if distance < 0.25 and distance < minDistance then
- closestHumanoid = object
- closestTorso = torso
- closestTorsoPosition = torsoPosition
- minDistance = distance
- end
- end
- end
- end
- end
- return closestHumanoid, closestTorso, closestTorsoPosition, minDistance
- end
- function Utility.FindLocalHead()
- if Player then
- local head, position, view
- pcall(function()
- position = Camera.Focus.p
- view = Camera.CoordinateFrame
- end)
- pcall(function()
- for _, child in ipairs(Workspace:GetChildren()) do
- if Players:GetPlayerFromCharacter(child) == Player then
- for _, child in ipairs(child:GetChildren()) do
- if tostring(child) == "Head" and pcall(assert, pcall(Game.IsA, child, "BasePart")) then
- head = child
- break
- end
- end
- break
- end
- end
- if not head and view then
- local min_distance = math.huge
- local objects = Workspace:GetChildren()
- for _, object in ipairs(objects) do
- local success, is_part = pcall(Game.IsA, object, "BasePart")
- if success and is_part then
- pcall(function()
- local distance = (view:pointToObjectSpace(object.Position) * Vector3.new(1, 1, 0)).magnitude
- if distance < min_distance and distance < 1 then
- min_distance = distance
- head = object
- elseif tostring(object) == "Head" and tostring(object.Parent):lower():match("^" .. tostring(Player):lower()) then
- min_distance = 0
- head = object
- end
- end)
- if min_distance < 5e-4 then
- break
- end
- end
- pcall(function()
- if not object:IsA("Camera") then
- for _, child in ipairs(object:GetChildren()) do
- objects[#objects + 1] = child
- end
- end
- end)
- end
- end
- end)
- return head, position, view
- end
- end
- function Utility.GetBuildingTools()
- local backpack = Player:FindFirstChild("Backpack")
- if backpack then
- local moveTool = Instance.new("HopperBin")
- local cloneTool = Instance.new("HopperBin")
- local deleteTool = Instance.new("HopperBin")
- moveTool.BinType = Enum.BinType.GameTool
- cloneTool.BinType = Enum.BinType.Clone
- deleteTool.BinType = Enum.BinType.Hammer
- moveTool.Parent = backpack
- cloneTool.Parent = backpack
- deleteTool.Parent = backpack
- end
- end
- function Utility.Rejoin()
- Workspace.Parent:service'TeleportService':Teleport(Game.PlaceId)
- end
- function Utility.BlockRobloxFilter(text)
- return string.gsub(text, ".", "%1\143")
- end
- function Utility.GetTimestamp()
- local unix_time = tick()
- local time_secs = math.floor(unix_time % 60)
- local time_mins = math.floor(unix_time / 60 % 60)
- local time_hours = math.floor(unix_time / 3600 % 24)
- return string.format("%02i:%02i:%02i", time_hours, time_mins, time_secs)
- end
- function Utility.GetRainbowRGB(hue)
- local section = hue % 1 * 3
- local secondary = 0.5 * math.pi * (section % 1)
- if section < 1 then
- return 1, 1 - math.cos(secondary), 1 - math.sin(secondary)
- elseif section < 2 then
- return 1 - math.sin(secondary), 1, 1 - math.cos(secondary)
- else
- return 1 - math.cos(secondary), 1 - math.sin(secondary), 1
- end
- end
- function Utility.SetProperty(object, field, value)
- object[field] = value
- end
- function Utility.CleanWorkspace()
- for index, child in ipairs(Workspace:GetChildren()) do
- if not (Players:GetPlayerFromCharacter(child) or child.ClassName == "Camera" or child:IsA("Script") or child.ClassName == "Terrain") then
- pcall(child.Destroy, child)
- end
- end
- Workspace.Terrain:Clear()
- local base = Instance.new("Part")
- base.Anchored = true
- base.BrickColor = BrickColor.new("Earth green")
- base.Locked = true
- base.Name = "Base"
- base.Size = Vector3.new(512, 1.2, 512)
- base.Parent = Workspace
- end
- function Utility.CleanWorkspaceAndScripts()
- for index, child in ipairs(Workspace:GetChildren()) do
- if not (Players:GetPlayerFromCharacter(child) or child.ClassName == "Camera" or child.ClassName == "Terrain") then
- pcall(child.Destroy, child)
- end
- end
- Workspace.Terrain:Clear()
- local base = Instance.new("Part")
- base.Anchored = true
- base.BrickColor = BrickColor.new("Earth green")
- base.Locked = true
- base.Name = "Base"
- base.Size = Vector3.new(512, 1.2, 512)
- base.Parent = Workspace
- end
- function Utility.CreateDummy(cframe, name, parent)
- local model = Instance.new("Model")
- model.Archivable = false
- model.Name = name
- local humanoid = Instance.new("Humanoid", model)
- local head = Instance.new("Part", model)
- local face = Instance.new("Decal", head)
- local head_mesh = Instance.new("SpecialMesh", head)
- local torso = Instance.new("Part", model)
- local right_arm = Instance.new("Part", model)
- local left_arm = Instance.new("Part", model)
- local right_leg = Instance.new("Part", model)
- local left_leg = Instance.new("Part", model)
- local neck = Instance.new("Motor", torso)
- local right_shoulder = Instance.new("Motor", torso)
- local left_shoulder = Instance.new("Motor", torso)
- local right_hip = Instance.new("Motor", torso)
- local left_hip = Instance.new("Motor", torso)
- head.BrickColor = BrickColor.Yellow()
- head.CFrame = cframe * CFrame.new(0, 1.5, 0)
- head.FormFactor = "Symmetric"
- head.Locked = true
- head.Name = "Head"
- head.Size = Vector3.new(2, 1, 1)
- head.TopSurface = "Smooth"
- face.Texture = "rbxasset://textures/face.png"
- head_mesh.Scale = Vector3.new(1.25, 1.25, 1.25)
- torso.BrickColor = BrickColor.Blue()
- torso.CFrame = cframe
- torso.FormFactor = "Symmetric"
- torso.LeftSurface = "Weld"
- torso.Locked = true
- torso.RightSurface = "Weld"
- torso.Name = "Torso"
- torso.Size = Vector3.new(2, 2, 1)
- right_arm.BrickColor = BrickColor.Yellow()
- right_arm.CanCollide = false
- right_arm.CFrame = cframe * CFrame.new(1.5, 0, 0)
- right_arm.FormFactor = "Symmetric"
- right_arm.Locked = true
- right_arm.Name = "Right Arm"
- right_arm.Size = Vector3.new(1, 2, 1)
- left_arm.BrickColor = BrickColor.Yellow()
- left_arm.CanCollide = false
- left_arm.CFrame = cframe * CFrame.new(-1.5, 0, 0)
- left_arm.FormFactor = "Symmetric"
- left_arm.Locked = true
- left_arm.Name = "Left Arm"
- left_arm.Size = Vector3.new(1, 2, 1)
- right_leg.BrickColor = BrickColor.new("Br. yellowish green")
- right_leg.BottomSurface = "Smooth"
- right_leg.CanCollide = false
- right_leg.CFrame = cframe * CFrame.new(0.5, -2, 0)
- right_leg.FormFactor = "Symmetric"
- right_leg.Locked = true
- right_leg.Name = "Right Leg"
- right_leg.Size = Vector3.new(1, 2, 1)
- right_leg.TopSurface = "Smooth"
- left_leg.BrickColor = BrickColor.new("Br. yellowish green")
- left_leg.BottomSurface = "Smooth"
- left_leg.CanCollide = false
- left_leg.CFrame = cframe * CFrame.new(-0.5, -2, 0)
- left_leg.FormFactor = "Symmetric"
- left_leg.Locked = true
- left_leg.Name = "Left Leg"
- left_leg.Size = Vector3.new(1, 2, 1)
- left_leg.TopSurface = "Smooth"
- neck.C0 = CFrame.new(0, 1, 0, -1, -0, -0, 0, 0, 1, 0, 1, 0)
- neck.C1 = CFrame.new(0, -0.5, 0, -1, -0, -0, 0, 0, 1, 0, 1, 0)
- neck.Name = "Neck"
- neck.Part0 = torso
- neck.Part1 = head
- right_shoulder.C0 = CFrame.new(1, 0.5, 0, 0, 0, 1, 0, 1, 0, -1, -0, -0)
- right_shoulder.C1 = CFrame.new(-0.5, 0.5, 0, 0, 0, 1, 0, 1, 0, -1, -0, -0)
- right_shoulder.MaxVelocity = 0.15
- right_shoulder.Name = "Right Shoulder"
- right_shoulder.Part0 = torso
- right_shoulder.Part1 = right_arm
- left_shoulder.C0 = CFrame.new(-1, 0.5, 0, -0, -0, -1, 0, 1, 0, 1, 0, 0)
- left_shoulder.C1 = CFrame.new(0.5, 0.5, 0, -0, -0, -1, 0, 1, 0, 1, 0, 0)
- left_shoulder.MaxVelocity = 0.15
- left_shoulder.Name = "Left Shoulder"
- left_shoulder.Part0 = torso
- left_shoulder.Part1 = left_arm
- right_hip.C0 = CFrame.new(1, -1, 0, 0, 0, 1, 0, 1, 0, -1, -0, -0)
- right_hip.C1 = CFrame.new(0.5, 1, 0, 0, 0, 1, 0, 1, 0, -1, -0, -0)
- right_hip.MaxVelocity = 0.1
- right_hip.Name = "Right Hip"
- right_hip.Part0 = torso
- right_hip.Part1 = right_leg
- left_hip.C0 = CFrame.new(-1, -1, 0, -0, -0, -1, 0, 1, 0, 1, 0, 0)
- left_hip.C1 = CFrame.new(-0.5, 1, 0, -0, -0, -1, 0, 1, 0, 1, 0, 0)
- left_hip.MaxVelocity = 0.1
- left_hip.Name = "Left Hip"
- left_hip.Part0 = torso
- left_hip.Part1 = left_leg
- humanoid.Died:connect(function()
- wait(5)
- model:Destroy()
- end)
- model.Parent = parent
- return model
- end
- Serializer = {};
- Serializer.NAN = math.abs(0 / 0)
- function Serializer.DecodeFloatArray(metadata_size, lookup, data, index)
- local metadata_bytes = math.ceil(metadata_size * 0.25)
- local metadata = {string.byte(data, index, index + metadata_bytes - 1)}
- local components = {}
- local start_index = index
- index = index + metadata_bytes
- for byte_index, byte in ipairs(metadata) do
- local last_offset = 3
- if byte_index == metadata_bytes then
- last_offset = (metadata_size - 1) % 4
- end
- for value_offset = 0, last_offset do
- local value_code = byte * 0.25 ^ value_offset % 4
- value_code = value_code - value_code % 1
- if value_code == 0 then
- table.insert(components, Serializer.DecodeFloat32(string.byte(data, index, index + 3)))
- index = index + 4
- else
- table.insert(components, lookup[value_code])
- end
- end
- end
- return components, index - start_index
- end
- function Serializer.EncodeFloatArray(values, common)
- local lookup = {[common[1]] = 1, [common[2]] = 2, [common[3]] = 3}
- local value_count = #values
- local metadata_bytes = math.ceil(value_count * 0.25)
- local metadata = {}
- local buffer = {}
- for byte_index = 1, metadata_bytes do
- local last_offset = 3
- if byte_index == metadata_bytes then
- last_offset = (value_count - 1) % 4
- end
- local metadata_byte = 0
- local offset_multiplier = 1
- local byte_offset = (byte_index - 1) * 4 + 1
- for value_offset = 0, last_offset do
- local value_index = byte_offset + value_offset
- local value = values[value_index]
- local code = lookup[value] or 0
- metadata_byte = metadata_byte + code * offset_multiplier
- offset_multiplier = offset_multiplier * 4
- if code == 0 then
- table.insert(buffer, Serializer.EncodeFloat32(value))
- end
- end
- metadata[byte_index] = string.char(metadata_byte)
- end
- return table.concat(metadata) .. table.concat(buffer)
- end
- function Serializer.DecodeColor3(data, index)
- local components, size = Serializer.DecodeFloatArray(3, {0, 0.5, 1}, data, index)
- return Color3.fromRGB(unpack(components)), size
- end
- function Serializer.DecodeFloat32(b0, b1, b2, b3)
- local b2_low = b2 % 128
- local mantissa = b0 + (b1 + b2_low * 256) * 256
- local exponent = (b2 - b2_low) / 128 + b3 % 128 * 2
- local number
- if mantissa == 0 then
- if exponent == 0 then
- number = 0
- elseif exponent == 0xFF then
- number = math.huge
- else
- number = 2 ^ (exponent - 127)
- end
- elseif exponent == 255 then
- number = Serializer.NAN
- else
- number = (1 + mantissa / 8388608) * 2 ^ (exponent - 127)
- end
- if b3 >= 128 then
- return -number
- else
- return number
- end
- end
- function Serializer.EncodeColor3(color3)
- return Serializer.EncodeFloatArray({color3.r, color3.g, color3.b}, {0, 0.5, 1})
- end
- function Serializer.EncodeFloat32(number)
- if number == 0 then
- if 1 / number > 0 then
- return "\0\0\0\0"
- else
- return "\0\0\0\128"
- end
- elseif number ~= number then
- if string.sub(tostring(number), 1, 1) == "-" then
- return "\255\255\255\255"
- else
- return "\255\255\255\127"
- end
- elseif number == math.huge then
- return "\0\0\128\127"
- elseif number == -math.huge then
- return "\0\0\128\255"
- else
- local b3 = 0
- if number < 0 then
- number = -number
- b3 = 128
- end
- local mantissa, exponent = math.frexp(number)
- exponent = exponent + 126
- if exponent < 0 then
- return "\0\0\0" .. string.char(b3)
- elseif exponent >= 255 then
- return "\0\0\128" .. string.char(b3 + 0x7F)
- else
- local fraction = mantissa * 16777216 - 8388608 + 0.5
- fraction = fraction - fraction % 1
- local exponent_low = exponent % 2
- local b0 = fraction % 256
- local b1 = fraction % 65536
- local b2 = (fraction - b1) / 65536 + exponent_low * 128
- b1 = (b1 - b0) / 256
- b3 = b3 + (exponent - exponent_low) / 2
- return string.char(b0, b1, b2, b3)
- end
- end
- end
- LuaEnum = {};
- LuaEnum.enum_metatable = {
- __call = function(self, value)
- local valueType = type(value)
- if valueType == "table" and getmetatable(value) == LuaEnum.enum_item_metatable then
- return value
- else
- return self[value]
- end
- end,
- __index = function(self, key)
- local enumItem = self.ItemsByName[key] or self.ItemsByValue[key]
- if enumItem == nil then
- local default = self.Default
- if default then
- Logger.printf("Warning", "%s is not a valid EnumItem, returning default (%s)", Utility.ToString(key), tostring(default))
- enumItem = default
- else
- Logger.errorf(2, "%s is not a valid EnumItem", Utility.ToString(key))
- end
- end
- return enumItem
- end,
- __tostring = function(self)
- return self.Name
- end
- }
- LuaEnum.enum_item_metatable = {
- __tostring = function(self)
- return self.Enum.Name .. "." .. self.Name
- end
- }
- LuaEnum.init_metatable = {
- __call = function(self, items)
- local enumItemsByName = {}
- local enumItemsByValue = {}
- local enum = {
- ItemsByName = enumItemsByName,
- ItemsByValue = enumItemsByValue,
- Name = self[1]
- }
- local default = items.Default
- if default ~= nil then
- items.Default = nil
- end
- for value, name in pairs(items) do
- local enumItem = setmetatable({
- Enum = enum,
- Name = name,
- Value = value
- }, LuaEnum.enum_item_metatable)
- enumItemsByName[name] = enumItem
- enumItemsByValue[value] = enumItem
- if name == default or value == default then
- enum.Default = enumItem
- end
- end
- return setmetatable(enum, LuaEnum.enum_metatable)
- end
- }
- function LuaEnum.new(name)
- return setmetatable({name}, LuaEnum.init_metatable)
- end
- Logger = {};
- Logger.entries = {0}
- Logger.MessageType = LuaEnum.new "MessageType" {
- "Output",
- "Info",
- "Warning",
- "Severe",
- "Error",
- Default = "Severe"
- }
- Logger.MESSAGE_TYPE_SETTINGS = {
- { -- Output
- Font = "Arial",
- TextColor3 = Color3.fromRGB(0, 0, 0)
- },
- { -- Info
- Font = "Arial",
- TextColor3 = Color3.fromRGB(0, 0, 1)
- },
- { -- Warning
- Font = "ArialBold",
- TextColor3 = Color3.fromRGB(1, 0.5, 0)
- },
- { -- Severe/Error
- Font = "ArialBold",
- TextColor3 = Color3.fromRGB(1, 0, 0)
- }
- }
- Logger.MAX_ENTRIES = 160
- Logger.WARNING_TRACE_ITEM_COUNT = 5
- Logger.rbxPrint = getfenv(RbxUtility.CreateSignal).print
- function Logger.error(level, message)
- message = message .. "\n" .. Logger.StackTraceToString(Logger.GenerateStackTrace(level + 1))
- Logger.AddEntry {Logger.MessageType.Error, message}
- error(level + 1, message)
- end
- function Logger.errorf(level, messageFormat, ...)
- Logger.error(level + 1, string.format(messageFormat, ...))
- end
- function Logger.print(messageType, message, level)
- messageType = Logger.MessageType(messageType)
- local entry = {messageType, message}
- Logger.rbxPrint(Logger.EntryToString(entry))
- Logger.AddEntry(entry)
- if level ~= false and messageType.Value >= Logger.MessageType.Warning.Value then
- local maxItems
- if messageType.Value >= Logger.MessageType.Severe.Value then
- maxItems = math.huge
- else
- maxItems = Logger.WARNING_TRACE_ITEM_COUNT
- end
- local trace = Logger.GenerateStackTrace((level or 1) + 1, math.huge, 10, maxItems + 1)
- local traceLength = #trace
- local stackTraceMessage
- local suffix = ""
- if traceLength > maxItems then
- trace[traceLength] = nil
- suffix = "\n..."
- end
- Logger.print("Info", "Stack trace:\n" .. Logger.StackTraceToString(trace) .. suffix .. "\nStack end", false)
- end
- end
- function Logger.printf(messageType, messageFormat, ...)
- Logger.print(messageType, string.format(messageFormat, ...), 2)
- end
- function Logger.AddEntry(entry)
- local entries = Logger.entries
- if entries[1] >= Logger.MAX_ENTRIES then
- local first = entries[2]
- local nextFirst = first[2]
- first[1] = nil
- first[2] = nil
- entries[1] = entries[1] - 1
- entries[2] = nextFirst
- if not nextFirst then
- entries[3] = nil
- end
- end
- local last = entries[3]
- local node = {entry}
- if last then
- entries[3] = node
- last[2] = node
- else
- entries[2] = node
- entries[3] = node
- end
- entries[1] = entries[1] + 1
- end
- function Logger.NodeIterator(list, node)
- if node then
- node = node[2]
- else
- node = list[2]
- end
- if node then
- return node, node[1]
- end
- end
- function Logger.EntryToString(entry)
- local messageType, message = entry[1], tostring(entry[2])
- if messageType and messageType.Value >= Logger.MessageType.Info.Value then
- return messageType.Name .. ": " .. message
- else
- return message
- end
- end
- function Logger.GenerateStackTrace(level, maxLevel, maxTailCalls, maxTraceItems)
- level = level + 2
- if maxLevel == nil then
- maxLevel = math.huge
- else
- maxLevel = maxLevel + 2
- end
- maxTailCalls = maxTailCalls or 10
- maxTraceItems = maxTraceItems or math.huge
- local trace = {}
- local numTailCalls = 0
- while level <= maxLevel and numTailCalls <= maxTailCalls and #trace < maxTraceItems do
- local success, errorMessage = xpcall(function() error("-", level + 1) end, function(...) return ... end)
- if errorMessage == "-" then
- numTailCalls = numTailCalls + 1
- else
- if numTailCalls > 0 then
- local traceSize = #trace
- if traceSize > 0 then
- trace[#trace][3] = numTailCalls
- end
- numTailCalls = 0
- end
- local script, line = string.match(errorMessage, "(.*):(%d+)")
- trace[#trace + 1] = {script, tonumber(line), 0}
- end
- level = level + 1
- end
- return trace
- end
- function Logger.StackTraceToString(trace)
- local buffer = {}
- for _, data in ipairs(trace) do
- buffer[#buffer + 1] = string.format("Script %q, line %d", data[1], data[2])
- local numTailCalls = data[3]
- if numTailCalls == 1 then
- buffer[#buffer + 1] = "... 1 tail call"
- elseif numTailCalls > 1 then
- buffer[#buffer + 1] = string.format("... %d tail calls", numTailCalls)
- end
- end
- return table.concat(buffer, "\n")
- end
- function Logger.MessageOutFunc(message, messageType)
- if AdvancedGUI and AdvancedGUI.Print then
- local messageTypeValue
- if messageType == Enum.MessageType.MessageOutput then
- local tagName, untaggedMessage = string.match(message, "(%a+): (.*)")
- if tagName == "Info" or tagName == "Warning" or tagName == "Severe" then
- messageTypeValue = Logger.MessageType[tagName].Value
- message = untaggedMessage
- else
- messageTypeValue = Logger.MessageType.Output.Value
- end
- else
- messageTypeValue = messageType.Value + 1
- end
- AdvancedGUI.PrintFormat(Logger.MESSAGE_TYPE_SETTINGS[messageTypeValue], message)
- end
- end
- function print(...)
- local args = {...}
- local buffer = {}
- for index = 1, select("#", ...) do
- buffer[index] = tostring(args[index])
- end
- local message = table.concat(buffer, "\t")
- Logger.print("Output", message)
- end
- CharacterAppearance = {};
- CharacterAppearance.defaultAppearanceId = 2
- CharacterAppearance.stock = {}
- function CharacterAppearance.Create(properties)
- local id = properties.Id
- local bodyColors = Instance.new("BodyColors")
- bodyColors.HeadColor = properties.HeadColor
- bodyColors.TorsoColor = properties.TorsoColor
- bodyColors.RightArmColor = properties.RightArmColor
- bodyColors.LeftArmColor = properties.LeftArmColor
- bodyColors.RightLegColor = properties.RightLegColor
- bodyColors.LeftLegColor = properties.LeftLegColor
- local characterObjects = {bodyColors}
- local headObjects = {}
- local data = {
- characterObjects = characterObjects,
- headObjects = headObjects,
- tshirt = properties.TShirt
- }
- for _, assetId in ipairs(properties.CharacterAssets) do
- TaskScheduler.Start(CharacterAppearance.LoadAsset, characterObjects, assetId)
- end
- for _, assetId in ipairs(properties.HeadAssets) do
- TaskScheduler.Start(CharacterAppearance.LoadAsset, headObjects, assetId)
- end
- CharacterAppearance.stock[id] = data
- end
- function CharacterAppearance.GetDefaultAppearance()
- return CharacterAppearance.stock[CharacterAppearance.defaultAppearanceId]
- end
- function CharacterAppearance.LoadAsset(objects, assetId)
- local asset = InsertService:LoadAsset(assetId)
- for _, child in ipairs(asset:GetChildren()) do
- child.Archivable = true
- table.insert(objects, child:Clone())
- end
- end
- CharacterAppearance.Create {
- Id = 1,
- HeadColor = BrickColor.new("Institutional white"),
- TorsoColor = BrickColor.new("Institutional white"),
- RightArmColor = BrickColor.new("Institutional white"),
- LeftArmColor = BrickColor.new("Institutional white"),
- RightLegColor = BrickColor.new("Institutional white"),
- LeftLegColor = BrickColor.new("Institutional white"),
- CharacterAssets = {
- 90825058, 90825211,
- 27112056, 27112052,
- 27112039, 27112025,
- 27112068, 38322996
- },
- HeadAssets = {
- 20722130,
- 8330576
- }
- }
- CharacterAppearance.Create {
- Id = 2,
- HeadColor = BrickColor.new("Institutional white"),
- TorsoColor = BrickColor.new("Institutional white"),
- RightArmColor = BrickColor.new("Institutional white"),
- LeftArmColor = BrickColor.new("Institutional white"),
- RightLegColor = BrickColor.new("Institutional white"),
- LeftLegColor = BrickColor.new("Institutional white"),
- CharacterAssets = {
- 90825058, 90825211,
- 11748356, 1029025,
- 1235488, 27112056,
- 27112052, 27112039,
- 27112025, 27112068
- },
- HeadAssets = {
- 20722130
- }
- }
- CharacterAppearance.Create {
- Id = 3,
- HeadColor = BrickColor.new("Pastel brown"),
- TorsoColor = BrickColor.new("Pastel brown"),
- RightArmColor = BrickColor.new("Pastel brown"),
- LeftArmColor = BrickColor.new("Pastel brown"),
- RightLegColor = BrickColor.new("White"),
- LeftLegColor = BrickColor.new("White"),
- CharacterAssets = {
- 134289125, 48474356,
- 100339040, 46302558,
- 153955895
- },
- HeadAssets = {},
- TShirt = "rbxassetid://148856353"
- }
- CharacterAppearance.Create {
- Id = 4,
- HeadColor = BrickColor.new("Pastel brown"),
- TorsoColor = BrickColor.new("Pastel brown"),
- RightArmColor = BrickColor.new("Pastel brown"),
- LeftArmColor = BrickColor.new("Pastel brown"),
- RightLegColor = BrickColor.new("White"),
- LeftLegColor = BrickColor.new("White"),
- CharacterAssets = {
- 129458426, 96678344, 184489190
- },
- HeadAssets = {},
- TShirt = "rbxassetid://160146697"
- }
- GraphicalEffects = {};
- local MESH_IDS = {"rbxassetid://15310891"}
- local SOUND_IDS = {"rbxassetid://2248511", "rbxassetid://1369158"}
- local TEXTURE_IDS = {"rbxassetid://36527089", "rbxassetid://122610943", "rbxassetid://126561317", "rbxassetid://127033719"}
- local preloadConnections = {}
- local reloadingPreloads = false
- function GraphicalEffects.InitPreloads()
- local preload_part = Instance.new("Part")
- GraphicalEffects.preload_part = preload_part
- preload_part.Anchored = true
- preload_part.Archivable = false
- preload_part.BottomSurface = "Smooth"
- preload_part.CanCollide = false
- preload_part.CFrame = CFrame.new(math.huge, math.huge, math.huge)
- preload_part.FormFactor = "Custom"
- preload_part.Locked = true
- preload_part.Name = "Asset Preloader"
- preload_part.Size = Vector3.new(0.2, 0.2, 0.2)
- preload_part.TopSurface = "Smooth"
- preload_part.Transparency = 1
- preloadConnections[preload_part] = preload_part.AncestryChanged:connect(GraphicalEffects.PreloadsAncestryChanged)
- for _, mesh_id in ipairs(MESH_IDS) do
- local mesh = Instance.new("SpecialMesh")
- mesh.MeshType = "FileMesh"
- mesh.MeshId = mesh_id
- preloadConnections[mesh] = mesh.AncestryChanged:connect(GraphicalEffects.PreloadsAncestryChanged)
- mesh.Parent = preload_part
- end
- for _, sound_id in ipairs(SOUND_IDS) do
- local sound = Instance.new("Sound")
- sound.SoundId = sound_id
- sound.Volume = 0
- preloadConnections[sound] = sound.AncestryChanged:connect(GraphicalEffects.PreloadsAncestryChanged)
- sound.Parent = preload_part
- end
- for _, texture_id in ipairs(TEXTURE_IDS) do
- local decal = Instance.new("Decal")
- decal.Texture = texture_id
- preloadConnections[decal] = decal.AncestryChanged:connect(GraphicalEffects.PreloadsAncestryChanged)
- decal.Parent = preload_part
- end
- preload_part.Parent = Workspace
- end
- function GraphicalEffects.PreloadsAncestryChanged(child, parent)
- if not reloadingPreloads and parent ~= GraphicalEffects.preload_part and parent ~= Workspace then
- reloadingPreloads = true
- for _, connection in pairs(preloadConnections) do
- connection:disconnect()
- preloadConnections[_] = nil
- end
- wait(1)
- reloadingPreloads = false
- GraphicalEffects.InitPreloads()
- end
- end
- GraphicalEffects.InitPreloads()
- -- Hyper beam
- function GraphicalEffects.FireSpaceHyperBeam(target, power, duration, radius, height, deviation)
- local stepTime, gameTime = 1 / 30, TaskScheduler.GetCurrentTime()
- local frames = duration * 30
- local beamColorOffset = 0.75 * tick() -- math.random()
- local blastPressure = power * 62500 + 250000
- local beamPart = Instance.new("Part")
- local beamMesh = Instance.new("SpecialMesh", beamPart)
- local explosion = Instance.new("Explosion")
- local sound = Instance.new("Sound", beamPart)
- beamPart.Anchored = true
- beamPart.CanCollide = false
- beamPart.CFrame = CFrame.new(target, target + Vector3.new(deviation * (math.random() - 0.5), deviation * (math.random() - 0.5), height))
- beamPart.FormFactor = "Custom"
- beamPart.Locked = true
- beamPart.Size = Vector3.new(0.2, 0.2, 0.2)
- beamMesh.MeshId = "rbxassetid://15310891"
- beamMesh.MeshType = "FileMesh"
- beamMesh.TextureId = "rbxassetid://36527089"
- local beamGlowPart1 = beamPart:Clone()
- local beamGlowMesh1 = beamMesh:Clone()
- local beamGlowPart2 = beamPart:Clone()
- local beamGlowMesh2 = beamMesh:Clone()
- local beamLight = Instance.new("PointLight", beamPart)
- beamLight.Range = power * 2
- beamLight.Shadows = true
- explosion.BlastPressure = blastPressure
- explosion.BlastRadius = power
- explosion.Position = target
- sound.SoundId = "rbxassetid://2248511"
- sound.Volume = 1
- local explosionHitConnection = explosion.Hit:connect(function(part, distance)
- if not part.Anchored and part:GetMass() < power * power then
- pcall(part.BreakJoints, part)
- part.Color = Color3.fromRGB(Utility.GetRainbowRGB(1.5 * gameTime + beamColorOffset))
- end
- end)
- beamPart.Transparency = 0.5
- beamPart.Archivable = false
- beamGlowPart1.Transparency = 0.75
- beamGlowPart2.Transparency = 0.75
- beamGlowMesh1.Parent = beamGlowPart1
- beamGlowPart1.Parent = beamPart
- beamGlowMesh2.Parent = beamGlowPart2
- beamGlowPart2.Parent = beamPart
- beamPart.Parent = workspace
- explosion.Parent = workspace
- for frame = 1, frames do
- local progress = frame / frames
- local alpha = 1 - math.sin(0.5 * math.pi * progress)
- local scale = 0.4 * alpha
- local glowScale1 = alpha * (0.5 + 0.5 * math.sin(math.tau * (8 * gameTime + beamColorOffset)))
- local glowScale2 = alpha * (0.5 + 0.5 * math.cos(math.tau * (8 * gameTime + beamColorOffset)))
- local vertexColor = Vector3.new(Utility.GetRainbowRGB(1.5 * gameTime + beamColorOffset))
- beamLight.Brightness = 1 - progress
- beamLight.Color = Color3.fromRGB(vertexColor.x, vertexColor.y, vertexColor.z)
- beamMesh.Scale = Vector3.new(radius * scale, 9000, radius * scale)
- beamMesh.VertexColor = vertexColor
- beamGlowMesh1.Scale = Vector3.new(1.2 * radius * glowScale1, 9000, 1.2 * radius * glowScale1)
- beamGlowMesh1.VertexColor = vertexColor
- beamGlowMesh2.Scale = Vector3.new(1.2 * radius * glowScale2, 9000, 1.2 * radius * glowScale2)
- beamGlowMesh2.VertexColor = vertexColor
- RunService.Stepped:wait()
- gameTime = TaskScheduler.GetCurrentTime()
- if frame <= 2 then
- local explosion = Instance.new("Explosion")
- explosion.BlastPressure = (1 - progress) * blastPressure
- explosion.BlastRadius = (1 - progress) * power
- explosion.Position = target
- explosion.Parent = Workspace
- if frame == 2 then
- sound:Play()
- end
- end
- end
- pcall(beamPart.Destroy, beamPart)
- explosionHitConnection:disconnect()
- end
- function GraphicalEffects.SpaceHyperBeam(target, power, duration, radius, height, deviation)
- TaskScheduler.Start(GraphicalEffects.FireSpaceHyperBeam, target, power or 12, duration or 1.5, radius or 6, height or 600, deviation or 20)
- end
- function GraphicalEffects.BlockRing(data)
- data = data or {}
- local blocks_count = data.blocks_count or 10
- local blocks_color = data.blocks_color or BrickColor.new("Bright red")
- local blocks_scale = data.blocks_scale or Vector3.new(2 / 3, 2, 2 / 3)
- local fade_out_color = data.fade_out_color or BrickColor.new("Really black")
- local radius = radius or 1.25 * blocks_count / math.pi
- local spawn_duration = data.spawn_duration or 0.065
- local full_spawn_duration = spawn_duration * blocks_count
- local float_duration = data.float_duration or 5
- local wave_amplitude = data.wave_amplitude or 0.5
- local wave_period = data.wave_period or 1
- local appear_duration = data.appear_duration or 0.1
- local disappear_duration = data.disappear_duration or 0.5
- local base_part = data.base_part
- local offset_cframe
- if data.position then
- offset_cframe = CFrame.new(data.position)
- if base_part then
- offset_cframe = base_part.CFrame:toObjectSpace(offset_cframe)
- end
- else
- offset_cframe = CFrame.new()
- end
- local blocks_template = Instance.new("Part")
- blocks_template.Anchored = true
- blocks_template.Locked = true
- blocks_template.CanCollide = false
- blocks_template.BottomSurface = "Smooth"
- blocks_template.TopSurface = "Smooth"
- blocks_template.BrickColor = blocks_color
- blocks_template.FormFactor = "Symmetric"
- blocks_template.Size = Vector3.new(math.random(0.5,1),math.random(1,4),math.random(0.5,1))
- local blocks_light = Instance.new("PointLight", blocks_template)
- blocks_light.Brightness = 0.1 / blocks_count
- blocks_light.Color = blocks_color.Color
- blocks_light.Name = "Light"
- blocks_light.Range = radius
- blocks_light.Shadows = true
- local blocks_model = Instance.new("Model")
- blocks_model.Archivable = false
- blocks_model.Name = "Block model"
- blocks_model.Parent = workspace
- local blocks = {}
- local lights = {}
- local meshes = {}
- for index = 1, blocks_count do
- local block = blocks_template:Clone()
- block.Parent = blocks_model
- blocks[index] = block
- lights[index] = block.Light
- end
- local start_time = tick()
- repeat
- local base_cframe = offset_cframe
- if base_part then
- base_cframe = base_part.CFrame * base_cframe
- end
- local elapsed_time = tick() - start_time
- for index, crystal in ipairs(blocks) do
- local crystal_time = elapsed_time - index * spawn_duration
- local disappear_time = crystal_time - float_duration
- local offset
- if crystal_time < 0 then
- offset = 0
- elseif crystal_time < appear_duration then
- offset = radius * crystal_time / appear_duration
- else
- offset = radius
- end
- local wave_offset
- if disappear_time >= 0 then
- local disappear_progress = disappear_time / disappear_duration
- if disappear_progress > 1 then
- if crystal.Parent then
- crystal:Destroy()
- end
- else
- local inverse_progress = 1 - disappear_progress
- local light = lights[index]
- local mesh = meshes[index]
- crystal.BrickColor = fade_out_color
- light.Brightness = 2 * inverse_progress
- light.Range = 2 * radius
- end
- wave_offset = 0
- else
- wave_offset = wave_amplitude * math.sin(math.tau * (elapsed_time - index / blocks_count * 3) / wave_period)
- end
- local rotation_angle = (tick() * 0.5 + (index - 1) / blocks_count) % 1 * math.tau
- crystal.CFrame = base_cframe * CFrame.Angles(0, rotation_angle, 0) * CFrame.new(0, wave_offset, -offset)
- end
- RunService.Stepped:wait()
- until elapsed_time >= float_duration + full_spawn_duration + disappear_duration
- if blocks_model.Parent then
- blocks_model:Destroy()
- end
- end
- GraphicalEffects.magicCircleData = {}
- GraphicalEffects.MAGIC_CIRCLE_DEFAULT_OFFSET = 6.25
- function GraphicalEffects.AnimateMagicCircle(data)
- local frame, direction, magic_circle_model, magic_circle_part, magic_circle_light, magic_circle_decal_back, magic_circle_decal_front, duration,
- stay, magic_circle_adornee_func, magic_circle_offset = unpack(data)
- frame = frame + 1
- data[1] = frame
- local transparency = (frame / duration) ^ stay
- local opacity = 1 - transparency
- if frame == duration then
- pcall(game.Destroy, magic_circle_model)
- GraphicalEffects.magicCircleData[data] = nil
- else
- if magic_circle_model.Parent ~= workspace then
- pcall(Utility.SetProperty, magic_circle_model, "Parent", workspace)
- end
- local magic_circle_adornee = magic_circle_adornee_func()
- magic_circle_position = magic_circle_adornee.Position + direction * magic_circle_offset
- local magic_circle_cframe = CFrame.new(magic_circle_position, magic_circle_position + direction) * CFrame.Angles(0, 0, math.tau * frame /
- 25)
- magic_circle_part.CFrame = magic_circle_cframe
- magic_circle_light.Brightness = opacity
- magic_circle_decal_back.Transparency = transparency
- magic_circle_decal_front.Transparency = transparency
- end
- end
- function GraphicalEffects.CreateMagicCircle(target, magic_circle_scale, magic_circle_image, light_color, duration, stay, magic_circle_adornee_func,
- magic_circle_offset)
- local magic_circle_adornee = magic_circle_adornee_func()
- if magic_circle_adornee then
- local origin = magic_circle_adornee.Position
- local direction = (target - origin).unit
- local magic_circle_position = origin + direction * magic_circle_offset
- local magic_circle_cframe = CFrame.new(magic_circle_position, magic_circle_position + direction)
- local magic_circle_model = Instance.new("Model")
- local magic_circle_part = Instance.new("Part", magic_circle_model)
- local magic_circle_mesh = Instance.new("BlockMesh", magic_circle_part)
- local magic_circle_light = Instance.new("PointLight", magic_circle_part)
- local magic_circle_decal_back = Instance.new("Decal", magic_circle_part)
- local magic_circle_decal_front = Instance.new("Decal", magic_circle_part)
- magic_circle_model.Archivable = false
- magic_circle_part.Anchored = true
- magic_circle_part.BottomSurface = "Smooth"
- magic_circle_part.CanCollide = false
- magic_circle_part.CFrame = magic_circle_cframe
- magic_circle_part.FormFactor = "Custom"
- magic_circle_part.Locked = true
- magic_circle_part.Size = Vector3.new(0.2, 0.2, 0.2)
- magic_circle_part.TopSurface = "Smooth"
- magic_circle_part.Transparency = 1
- magic_circle_mesh.Scale = Vector3.new(60, 60, 0) * magic_circle_scale
- magic_circle_light.Color = light_color
- magic_circle_light.Range = 16 * magic_circle_scale
- magic_circle_light.Shadows = true
- magic_circle_decal_back.Face = "Back"
- magic_circle_decal_back.Texture = magic_circle_image
- magic_circle_decal_front.Face = "Front"
- magic_circle_decal_front.Texture = magic_circle_image
- magic_circle_model.Parent = Workspace
- local data = {0, direction, magic_circle_model, magic_circle_part, magic_circle_light, magic_circle_decal_back, magic_circle_decal_front,
- duration, stay, magic_circle_adornee_func, magic_circle_offset}
- GraphicalEffects.magicCircleData[data] = true
- return data
- end
- end
- GraphicalEffects.missileData = {}
- GraphicalEffects.missileParts = {}
- function GraphicalEffects.AnimateMissile(data)
- local frame, missilePart, targetPart, timeCreated, direction, touchedConnection, explodeRequested, bodyGyro, swooshSound, magicCircleData, lifeTime,
- pointOnPart, flipped = unpack(data)
- frame = frame + 1
- data[1] = frame
- if flipped then
- direction = -direction
- end
- if frame <= 10 then
- if frame == 2 then
- swooshSound:Play()
- end
- missilePart.Anchored = true
- local progress = frame / 10
- missilePart.Size = Vector3.new(1, 1, progress * 4)
- local magicCirclePart = magicCircleData[4]
- local magicCirclePosition = magicCirclePart.Position
- local missileOffset = 2 * progress * direction
- local missilePosition = magicCirclePosition + missileOffset
- missilePart.CFrame = CFrame.new(missilePosition, missilePosition + direction)
- --missilePart.Transparency = 0.5 * (1 - progress)
- if frame == 10 then
- touchedConnection = missilePart.Touched:connect(function(hit)
- if hit.CanCollide and hit.Parent and not GraphicalEffects.missileParts[hit] then
- touchedConnection:disconnect()
- data[7] = true
- end
- end)
- data[6] = touchedConnection
- end
- else
- missilePart.Anchored = false
- local missilePosition = missilePart.Position
- local targetPosition = targetPart.CFrame * pointOnPart
- local distanceVector = targetPosition - missilePosition
- local elapsedTime = time() - timeCreated
- local targetParent = targetPart.Parent
- if explodeRequested or (targetParent and distanceVector.magnitude < 10) or elapsedTime > lifeTime then
- GraphicalEffects.missileData[data] = nil
- GraphicalEffects.missileParts[missilePart] = nil
- touchedConnection:disconnect()
- if missilePart.Parent then
- missilePart:Destroy()
- local explosion = Instance.new("Explosion")
- explosion.BlastRadius = 12.5
- explosion.Position = missilePosition
- local explosionHitConnection = explosion.Hit:connect(function(hit, distance)
- local missileData = GraphicalEffects.missileParts[hit]
- if missileData and distance < 3 then
- missileData[7] = true
- else
- pcall(hit.BreakJoints, hit)
- end
- end)
- explosion.Parent = Workspace
- TaskScheduler.Schedule(1, explosionHitConnection.disconnect, explosionHitConnection)
- end
- else
- local targetInWorkspace = targetPart:IsDescendantOf(Workspace)
- if targetInWorkspace then
- direction = distanceVector.unit
- data[5] = direction
- end
- local speed = 14 + elapsedTime * 10
- local gyroD
- if elapsedTime < 42.5 and targetInWorkspace then
- gyroD = 1000 - elapsedTime * 15
- else
- gyroD = 100
- bodyGyro.maxTorque = Vector3.new(0, 0, 0)
- if elapsedTime + 7.5 < lifeTime then
- data[11] = elapsedTime + 7.5
- end
- end
- bodyGyro.D = gyroD
- bodyGyro.cframe = CFrame.new(Vector3.new(), direction)
- missilePart.Velocity = missilePart.CFrame.lookVector * speed
- end
- end
- end
- function GraphicalEffects.ShootMissile(targetPart, pointOnPart, direction, magic_circle_adornee_func, magic_circle_offset, flipped)
- if not magic_circle_offset then
- magic_circle_offset = GraphicalEffects.MAGIC_CIRCLE_DEFAULT_OFFSET
- end
- local targetPosition = targetPart.Position
- local headPosition = chatAdornee.Position
- local origin = CFrame.new(headPosition, headPosition + direction) + direction * magic_circle_offset
- local missilePart = Instance.new("Part")
- local antiGravityForce = Instance.new("BodyForce", missilePart)
- local bodyGyro = Instance.new("BodyGyro", missilePart)
- local explosionSound = Instance.new("Sound", missilePart)
- local swooshSound = Instance.new("Sound", missilePart)
- antiGravityForce.force = Vector3.new(0, 196.2 * 4, 0)
- bodyGyro.D = 1000
- bodyGyro.maxTorque = Vector3.new(1, 1, 1)
- explosionSound.PlayOnRemove = true
- explosionSound.SoundId = "rbxasset://sounds/collide.wav"
- explosionSound.Volume = 1
- missilePart.Anchored = true
- missilePart.BackSurface = "Studs"
- missilePart.BottomSurface = "Studs"
- missilePart.BrickColor = BrickColor.Red()
- missilePart.CFrame = origin
- missilePart.FormFactor = "Custom"
- missilePart.FrontSurface = "Studs"
- missilePart.LeftSurface = "Studs"
- missilePart.Locked = true
- missilePart.RightSurface = "Studs"
- missilePart.Size = Vector3.new(1, 1, 0.2)
- missilePart.TopSurface = "Studs"
- --missilePart.Transparency = 0.5
- swooshSound.Looped = true
- swooshSound.SoundId = "rbxasset://sounds/Rocket whoosh 01.wav"
- swooshSound.Volume = 0.7
- local magicCircleData = GraphicalEffects.CreateMagicCircle(headPosition + direction * 1000, 0.875, "rbxassetid://127033719", Color3.fromRGB(1, 1, 1),
- 40, 4, magic_circle_adornee_func or function() return chatAdornee end, magic_circle_offset)
- local data = {0, missilePart, targetPart, time(), direction, false, false, bodyGyro, swooshSound, magicCircleData, 50, pointOnPart, flipped}
- missilePart.Parent = Workspace
- GraphicalEffects.missileData[data] = true
- GraphicalEffects.missileParts[missilePart] = data
- end
- function GraphicalEffects.CubicInterpolate(y0, y1, y2, y3, mu)
- local a0, a1, a2, a3, mu2
- mu2 = mu * mu
- a0 = y3 - y2 - y0 + y1
- a1 = y0 - y1 - a0
- a2 = y2 - y0
- a3 = y1
- return a0 * mu * mu2 + a1 * mu2 + a2 * mu + a3
- end
- function GraphicalEffects.JointCrap(model, cycletime)
- if model then
- local cycletime = cycletime or (0.75 * (1 + math.random() * 4))
- local offsetradius = 0.75
- local rotationoffset = math.pi
- local joints = {}
- local stack = model:GetChildren()
- while #stack ~= 0 do
- local object = stack[#stack]
- table.remove(stack)
- for index, child in ipairs(object:GetChildren()) do
- table.insert(stack, child)
- end
- if object:IsA("JointInstance") then
- table.insert(joints, object)
- end
- end
- local rot0 = {}
- local rot1 = {}
- local rot2 = {}
- local rot3 = {}
- local rot4 = {}
- for index, joint in ipairs(joints) do
- local pos = Vector3.new(math.random() - 0.5, math.random() - 0.5, math.random() - 0.5).unit * offsetradius
- local rot = Vector3.new(math.random(), math.random(), math.random()) * rotationoffset
- rot0[index] = {joint.C0, joint.C1}
- rot = Vector3.new(rot.x % (math.tau), rot.y % (math.tau), rot.z % (math.tau))
- rot2[index] = {pos, rot}
- pos = Vector3.new(math.random() - 0.5, math.random() - 0.5, math.random() - 0.5).unit * offsetradius
- rot = rot + Vector3.new(math.random(), math.random(), math.random()) * rotationoffset
- rot = Vector3.new(rot.x % (math.tau), rot.y % (math.tau), rot.z % (math.tau))
- rot3[index] = {pos, rot}
- pos = Vector3.new(math.random() - 0.5, math.random() - 0.5, math.random() - 0.5).unit * offsetradius
- rot = rot + Vector3.new(math.random(), math.random(), math.random()) * rotationoffset
- rot = Vector3.new(rot.x % (math.tau), rot.y % (math.tau), rot.z % (math.tau))
- rot4[index] = {pos, rot}
- end
- while model.Parent do
- for i, j in ipairs(joints) do
- local pos = Vector3.new(math.random() - 0.5, math.random() - 0.5, math.random() - 0.5).unit * offsetradius
- local rot = rot4[i][2] + Vector3.new(math.random(), math.random(), math.random()) * rotationoffset
- rot = Vector3.new(rot.x % (math.tau), rot.y % (math.tau), rot.z % (math.tau))
- rot1[i], rot2[i], rot3[i], rot4[i] = rot2[i], rot3[i], rot4[i], {pos, rot}
- end
- local start = tick()
- while true do
- local ctime = tick()
- local elapsed = ctime - start
- if elapsed > cycletime then
- break
- end
- local progress = elapsed / cycletime
- for index, joint in ipairs(joints) do
- local v0, v1, v2, v3, v4 = rot0[index], rot1[index], rot2[index], rot3[index], rot4[index]
- local p1, p2, p3, p4, r1, r2, r3, r4 = v1[1], v2[1], v3[1], v4[1], v1[2], v2[2], v3[2], v4[2]
- local px = GraphicalEffects.CubicInterpolate(p1.x, p2.x, p3.x, p4.x, progress)
- local py = GraphicalEffects.CubicInterpolate(p1.y, p2.y, p3.y, p4.y, progress)
- local pz = GraphicalEffects.CubicInterpolate(p1.z, p2.z, p3.z, p4.z, progress)
- local rx = GraphicalEffects.CubicInterpolate(r1.x, r2.x, r3.x, r4.x, progress)
- local ry = GraphicalEffects.CubicInterpolate(r1.y, r2.y, r3.y, r4.y, progress)
- local rz = GraphicalEffects.CubicInterpolate(r1.z, r2.z, r3.z, r4.z, progress)
- local cframe = CFrame.new(px, py, pz) * CFrame.Angles(rx, ry, rz)
- joint.C0 = v0[1] * cframe
- joint.C1 = v0[2] * cframe:inverse()
- end
- RunService.Stepped:wait()
- end
- end
- end
- end
- GraphicalEffects.LASER_WIDTH = 0.15
- GraphicalEffects.LASER_MAGIC_CIRCLE_DISTANCE = 6.25
- GraphicalEffects.laser_data = {}
- --GraphicalEffects.fragmentation = {}
- function GraphicalEffects.AnimateLaserOfDeath(data)
- local frame, directionOrientation, direction, magic_circle_model, laser_part, laser_mesh, magic_circle_part, magic_circle_light,
- magic_circle_decal_back, magic_circle_decal_front, sound, laser_scale, fragmentation_size, duration, laser_lights, laser_effects, stay, light_effects =
- unpack(data)
- local laser_color = laser_part.Color
- frame = frame + 1
- data[1] = frame
- local transparency = (frame / duration) ^ stay
- local opacity = 1 - transparency
- if frame == 2 then
- sound:Play()
- end
- if frame == duration then
- pcall(Game.Destroy, magic_circle_model)
- GraphicalEffects.laser_data[data] = nil
- else
- if magic_circle_model.Parent ~= Workspace then
- pcall(Utility.SetProperty, magic_circle_model, "Parent", Workspace)
- end
- local laser_distance = 0
- local origin = chatAdornee.CFrame
- if not light_effects then
- direction = (origin * directionOrientation - origin.p).unit
- end
- local magic_circle_position = origin.p + direction * GraphicalEffects.LASER_MAGIC_CIRCLE_DISTANCE
- local magic_circle_cframe = CFrame.new(magic_circle_position, magic_circle_position + direction) * CFrame.Angles(0, 0, math.tau * frame /
- 25)
- local loop_scale = (laser_scale - 1) / 10
- for x_offset = -loop_scale, loop_scale, 2 do
- for y_offset = -loop_scale, loop_scale, 2 do
- local origin_position = magic_circle_cframe * Vector3.new(x_offset, y_offset, 0)
- for index = 1, 8 do
- local part, position
- for ray_index = 1, 10 do
- local ray = Ray.new(origin_position + direction * (999 * (ray_index - 1)), direction * 999)
- part, position = Workspace:FindPartOnRay(ray, magic_circle_model)
- if part then
- break
- end
- end
- if part then
- laser_distance = (position - origin_position).magnitude
- if frame % 8 == 1 and index == 1 then
- Instance.new("Explosion", Workspace).Position = position
- end
- if not part:IsA("Terrain") then
- pcall(part.BreakJoints, part)
- local is_block = part:IsA("Part") and part.Shape == Enum.PartType.Block
- local mass = part:GetMass()
- local size = part.Size
- if (is_block and ((size.X < fragmentation_size and size.Y < fragmentation_size and size.Z <
- fragmentation_size) or (not part.Anchored and mass < 750))) or (not is_block and mass < 250000) then
- local part_transparency = math.max(part.Transparency + 0.007 * fragmentation_size, 0.5)
- if part_transparency >= 0.5 then -- temporarily to minimize debris
- pcall(Game.Destroy, part)
- else
- local cframe = part.CFrame
- part.Anchored = false
- part.BrickColor = BrickColor.new("Medium stone grey")
- part.CanCollide = true
- if part:IsA("FormFactorPart") then
- part.FormFactor = "Custom"
- end
- part.Size = size - Vector3.new(0.135, 0.135, 0.135) * fragmentation_size
- part.Transparency = part_transparency
- part.CFrame = cframe + direction * 5
- part.Velocity = part.Velocity + direction * 40
- end
- elseif is_block then
- local parts = {part}
- local model = Instance.new("Model", part.Parent)
- model.Name = "Fragments"
- if size.X >= fragmentation_size then
- size = Vector3.new(0.5, 1, 1) * size
- local archivable = part.Archivable
- local cframe = part.CFrame
- part.FormFactor = "Custom"
- part.Size = size
- part.Archivable = true
- local part_clone = part:Clone()
- part.Archivable = archivable
- part_clone.Archivable = archivable
- part.CFrame = cframe * CFrame.new(-0.5 * size.X, 0, 0)
- part_clone.CFrame = cframe * CFrame.new(0.5 * size.X, 0, 0)
- part_clone.Parent = model
- parts[2] = part_clone
- end
- if size.Y >= fragmentation_size then
- size = Vector3.new(1, 0.5, 1) * size
- for part_index = 1, #parts do
- local part = parts[part_index]
- local archivable = part.Archivable
- local cframe = part.CFrame
- part.FormFactor = "Custom"
- part.Size = size
- part.Archivable = true
- local part_clone = part:Clone()
- part.Archivable = archivable
- part_clone.Archivable = archivable
- part.CFrame = cframe * CFrame.new(0, -0.5 * size.Y, 0)
- part_clone.CFrame = cframe * CFrame.new(0, 0.5 * size.Y, 0)
- part_clone.Parent = model
- table.insert(parts, part_clone)
- end
- end
- if size.Z >= fragmentation_size then
- size = Vector3.new(1, 1, 0.5) * size
- for part_index = 1, #parts do
- local part = parts[part_index]
- local archivable = part.Archivable
- local cframe = part.CFrame
- part.FormFactor = "Custom"
- part.Size = size
- part.Archivable = true
- local part_clone = part:Clone()
- part.Archivable = archivable
- part_clone.Archivable = archivable
- part.CFrame = cframe * CFrame.new(0, 0, -0.5 * size.Z)
- part_clone.CFrame = cframe * CFrame.new(0, 0, 0.5 * size.Z)
- part_clone.Parent = model
- table.insert(parts, part_clone)
- end
- end
- for _, part in ipairs(parts) do
- part:MakeJoints()
- end
- else
- break
- end
- end
- else
- laser_distance = 9990
- break
- end
- end
- end
- end
- local laser_cframe = magic_circle_cframe * CFrame.Angles(-0.5 * math.pi, 0, 0)
- local laser_width = GraphicalEffects.LASER_WIDTH * opacity * laser_scale
- local laser_mesh_offset = Vector3.new(0, 0.5 * laser_distance, 0)
- laser_part.CFrame = laser_cframe
- if laser_effects then
- local laser_effect_data_1, laser_effect_data_2 = laser_effects[1], laser_effects[2]
- local laser_effect_1, laser_effect_mesh_1 = laser_effect_data_1[1], laser_effect_data_1[2]
- local laser_effect_2, laser_effect_mesh_2 = laser_effect_data_2[1], laser_effect_data_2[2]
- laser_effect_1.CFrame = laser_cframe
- laser_effect_2.CFrame = laser_cframe
- laser_effect_mesh_1.Offset = laser_mesh_offset
- laser_effect_mesh_2.Offset = laser_mesh_offset
- local game_time = time()
- local effect_scale_1 = 0.5 + 0.5 * math.sin(16 * math.pi * game_time)
- local effect_scale_2 = 0.5 + 0.5 * math.cos(16 * math.pi * game_time)
- laser_effect_mesh_1.Scale = 5 * Vector3.new(laser_width * effect_scale_1, laser_distance, laser_width * effect_scale_1)
- laser_effect_mesh_2.Scale = 5 * Vector3.new(laser_width * effect_scale_2, laser_distance, laser_width * effect_scale_2)
- laser_width = laser_width * 0.25
- end
- laser_mesh.Offset = laser_mesh_offset
- laser_mesh.Scale = 5 * Vector3.new(laser_width, laser_distance, laser_width)
- magic_circle_part.CFrame = magic_circle_cframe
- magic_circle_light.Brightness = opacity
- magic_circle_decal_back.Transparency = transparency
- magic_circle_decal_front.Transparency = transparency
- if light_effects then
- for index, data in ipairs(laser_lights) do
- local laser_spotlight_part, laser_spotlight = data[1], data[2]
- local laser_spotlight_offset = 30 * (index - 1)
- if laser_spotlight_offset <= laser_distance then
- laser_spotlight_part.CFrame = magic_circle_cframe * CFrame.new(0, 0, -laser_spotlight_offset)
- laser_spotlight.Brightness = opacity
- laser_spotlight.Enabled = true
- else
- laser_spotlight.Enabled = false
- end
- end
- end
- end
- end
- function GraphicalEffects.ShootLaserOfDeath(target, data)
- if chatAdornee then
- data = data or {}
- local brickcolor = data.brickcolor or BrickColor.new("Really black")
- local duration = data.duration or 40
- local fragmentation_size = data.fragmentation_size or 3
- local laser_scale = data.laser_scale or 1
- local light_color = data.light_color or Color3.fromRGB(1, 0.5, 1)
- local magic_circle_image = data.magic_circle_image or "rbxassetid://122610943"
- local magic_circle_scale = data.magic_circle_scale or 1
- local sound_volume = data.sound_volume or 1 / 3
- local special_effects = data.special_effects
- local stay = data.stay or 4
- local origin = chatAdornee.CFrame
- local directionOrientation = origin:pointToObjectSpace(target)
- local direction = (target - origin.p).unit
- local magic_circle_position = origin.p + direction * GraphicalEffects.LASER_MAGIC_CIRCLE_DISTANCE
- local magic_circle_cframe = CFrame.new(magic_circle_position, magic_circle_position + direction)
- local magic_circle_model = Instance.new("Model")
- local laser_part = Instance.new("Part", magic_circle_model)
- local laser_mesh = Instance.new("CylinderMesh", laser_part)
- local magic_circle_part = Instance.new("Part", magic_circle_model)
- local magic_circle_mesh = Instance.new("BlockMesh", magic_circle_part)
- local magic_circle_light = Instance.new("PointLight", magic_circle_part)
- local magic_circle_decal_back = Instance.new("Decal", magic_circle_part)
- local magic_circle_decal_front = Instance.new("Decal", magic_circle_part)
- local sound = Instance.new("Sound", magic_circle_part)
- sound.Pitch = 1.25
- sound.SoundId = "rbxassetid://2248511"
- sound.Volume = sound_volume
- magic_circle_model.Archivable = false
- laser_part.Anchored = true
- laser_part.BottomSurface = "Smooth"
- laser_part.BrickColor = brickcolor
- laser_part.CanCollide = false
- laser_part.CFrame = magic_circle_cframe * CFrame.Angles(-0.5 * math.pi, 0, 0)
- laser_part.FormFactor = "Custom"
- laser_part.Locked = true
- laser_part.Size = Vector3.new(0.2, 0.2, 0.2)
- laser_part.TopSurface = "Smooth"
- laser_mesh.Offset = Vector3.new(0, 0, 0)
- laser_mesh.Name = "Mesh"
- laser_mesh.Scale = 5 * laser_scale * Vector3.new(GraphicalEffects.LASER_WIDTH, 0, GraphicalEffects.LASER_WIDTH)
- magic_circle_part.Anchored = true
- magic_circle_part.BottomSurface = "Smooth"
- magic_circle_part.CanCollide = false
- magic_circle_part.CFrame = magic_circle_cframe
- magic_circle_part.FormFactor = "Custom"
- magic_circle_part.Locked = true
- magic_circle_part.Size = Vector3.new(0.2, 0.2, 0.2)
- magic_circle_part.TopSurface = "Smooth"
- magic_circle_part.Transparency = 1
- magic_circle_mesh.Scale = Vector3.new(60, 60, 0) * magic_circle_scale
- magic_circle_light.Color = light_color
- magic_circle_light.Range = 16 * magic_circle_scale
- magic_circle_light.Shadows = true
- magic_circle_decal_back.Face = "Back"
- magic_circle_decal_back.Texture = magic_circle_image
- magic_circle_decal_front.Face = "Front"
- magic_circle_decal_front.Texture = magic_circle_image
- magic_circle_model.Parent = Workspace
- local laser_color = brickcolor.Color
- local laser_lights = {}
- local light_effects = laser_color.r + laser_color.g + laser_color.b > 0.25
- if light_effects then
- local laser_spotlight_part_template = Instance.new("Part")
- local laser_spotlight_light_template = Instance.new("SpotLight", laser_spotlight_part_template)
- laser_spotlight_part_template.Anchored = true
- laser_spotlight_part_template.Anchored = true
- laser_spotlight_part_template.BottomSurface = "Smooth"
- laser_spotlight_part_template.CanCollide = false
- laser_spotlight_part_template.FormFactor = "Custom"
- laser_spotlight_part_template.Locked = true
- laser_spotlight_part_template.Size = Vector3.new(0.2, 0.2, 0.2)
- laser_spotlight_part_template.TopSurface = "Smooth"
- laser_spotlight_part_template.Transparency = 1
- laser_spotlight_light_template.Angle = 45
- laser_spotlight_light_template.Color = laser_color
- laser_spotlight_light_template.Enabled = true
- laser_spotlight_light_template.Name = "Light"
- laser_spotlight_light_template.Range = 60
- for index = 1, 40 do
- local laser_spotlight_part = laser_spotlight_part_template:Clone()
- laser_spotlight_part.CFrame = magic_circle_cframe * CFrame.new(0, 0, -30 * (index - 1))
- laser_spotlight_part.Parent = magic_circle_model
- laser_lights[index] = {laser_spotlight_part, laser_spotlight_part.Light}
- end
- end
- local laser_effects
- if special_effects then
- laser_effects = {}
- local laser_effect_1 = laser_part:Clone()
- laser_effect_1.BrickColor = special_effects
- laser_effect_1.Transparency = 0.5
- local laser_effect_2 = laser_effect_1:Clone()
- laser_effects[1], laser_effects[2] = {laser_effect_1, laser_effect_1.Mesh}, {laser_effect_2, laser_effect_2.Mesh}
- laser_effect_1.Parent = magic_circle_model
- laser_effect_2.Parent = magic_circle_model
- end
- GraphicalEffects.laser_data[{0, directionOrientation, direction, magic_circle_model, laser_part, laser_mesh, magic_circle_part,
- magic_circle_light, magic_circle_decal_back, magic_circle_decal_front, sound, laser_scale, fragmentation_size, duration, laser_lights, laser_effects, stay,
- light_effects}] = true
- end
- end
- function GraphicalEffects.SpawnSapientRock(position)
- local part = Instance.new("Part", Workspace)
- local size = 8 + math.random(0, 5)
- part.BottomSurface = "Smooth"
- part.TopSurface = "Smooth"
- part.Material = "Slate"
- part.Locked = true
- part.Shape = "Ball"
- part.FormFactor = "Custom"
- part.Size = Vector3.new(size, size, size)
- part.Position = position
- local bodypos = Instance.new("BodyPosition", part)
- bodypos.maxForce = Vector3.new(0, 0, 0)
- local angry = false
- local damage_ready = true
- local torso_following
- local torso_changed = -1000
- local touched_conn = part.Touched:connect(function(hit)
- local character = hit.Parent
- if character then
- local humanoid
- for _, child in ipairs(character:GetChildren()) do
- if child:IsA("Humanoid") then
- humanoid = child
- break
- end
- end
- if humanoid then
- if angry then
- if damage_ready then
- damage_ready = false
- humanoid:TakeDamage(100)
- wait(1)
- damage_ready = true
- angry = false
- part.BrickColor = BrickColor.new("Medium stone grey")
- end
- else
- local torso = humanoid.Torso
- if torso then
- torso_following = torso
- torso_changed = tick()
- end
- end
- end
- end
- end)
- TaskScheduler.Start(function()
- while part.Parent == Workspace do
- if torso_following then
- bodypos.position = torso_following.Position
- if tick() - torso_changed > 60 or not torso_following.Parent then
- torso_following = nil
- bodypos.maxForce = Vector3.new(0, 0, 0)
- angry = false
- part.BrickColor = BrickColor.new("Medium stone grey")
- else
- local speed = angry and Vector3.new(16, 16, 16) or Vector3.new(6, 0, 6)
- bodypos.maxForce = part:GetMass() * speed
- if part.Position.Y < -250 then
- part.Velocity = Vector3.new()
- part.Position = torso_following.Position + Vector3.new(0, 80, 0)
- part.BrickColor = BrickColor.new("Bright red")
- angry = true
- torso_changed = tick()
- end
- end
- end
- RunService.Stepped:wait()
- end
- touched_conn:disconnect()
- end)
- TaskScheduler.Start(function()
- while part.Parent == Workspace do
- wait(25 + math.random() * 10)
- local next_size = 8 + math.random() * 5
- if math.random(100) == 1 then
- next_size = next_size * (2 + 6 * math.random())
- end
- next_size = math.floor(next_size + 0.5)
- local start_time = tick()
- local mesh = Instance.new("SpecialMesh", part)
- mesh.MeshType = "Sphere"
- repeat
- local elapsed_time = tick() - start_time
- local alpha = math.cos(elapsed_time * math.pi * 0.5)
- local interpolated_size = size * alpha + next_size * (1 - alpha)
- local size_vector = Vector3.new(interpolated_size, interpolated_size, interpolated_size)
- local cframe = part.CFrame
- part.Size = size_vector
- part.CFrame = cframe
- mesh.Scale = size_vector / part.Size
- RunService.Stepped:wait()
- until tick() - start_time >= 1
- mesh:Destroy()
- local cframe = part.CFrame
- part.Size = Vector3.new(next_size, next_size, next_size)
- part.CFrame = cframe
- size = next_size
- end
- end)
- end
- function GraphicalEffects.MainLoop()
- RunService.Stepped:wait()
- for data in pairs(GraphicalEffects.magicCircleData) do
- GraphicalEffects.AnimateMagicCircle(data)
- end
- for data in pairs(GraphicalEffects.laser_data) do
- GraphicalEffects.AnimateLaserOfDeath(data)
- end
- for data in pairs(GraphicalEffects.missileData) do
- GraphicalEffects.AnimateMissile(data)
- end
- end
- TaskScheduler.Start(function()
- while true do
- GraphicalEffects.MainLoop()
- end
- end)
- PlayerControl = {};
- PlayerControl.fly_acceleration = 10
- PlayerControl.fly_basespeed = 250
- PlayerControl.fly_speed = PlayerControl.fly_basespeed
- PlayerControl.featherfallEnabled = true
- PlayerControl.pushable = false
- PlayerControl.rolling = false
- PlayerControl.rollingAngle = 0
- PlayerControl.rollingOffset = 0
- PlayerControl.rollingMaxOffset = 3
- PlayerControl.rollingSpeed = 1 / 50
- PlayerControl.characterEnabled = false
- PlayerControl.characterMode = "normal"
- local character = nil
- local flying, flyingMomentum, flyingTilt = false, Vector3.new(), 0
- local pose, regeneratingHealth, jumpDebounce = "Standing", false, false
- -- TODO: make local variables public
- local model, bodyColors, leftArmMesh, leftLegMesh, rightArmMesh, rightLegMesh, torsoMesh, wildcardHat, wildcardHandle, wildcardMesh, pants, shirt, humanoid,
- head, leftArm, leftLeg, rightArm, rightLeg, torso, rootPart, rootJoint, face, soundFreeFalling, soundGettingUp, soundRunning, leftHip, leftShoulder,
- rightHip, rightShoulder, neck, wildcardWeld, feetPart, feetWeld, feetTouchInterest, bodyGyro, bodyVelocity, headMesh, torsoLight
- local AnimateCharacter
- local UserInterface = game:service'UserInputService'
- local chatBubbles = {}
- local chatCharacterLimit = 240
- function PlayerControl.CreateCharacter()
- local characterMode = PlayerControl.characterMode
- if characterMode == "normal" then
- if not PlayerControl.characterEnabled then
- return
- end
- local appearance = CharacterAppearance.GetDefaultAppearance()
- local active = true
- local torsoCFrame = (torso and torso.CFrame) or PlayerControl.torso_cframe or CFrame.new(0, 10, 0)
- if torsoCFrame.p.Y < -450 then
- torsoCFrame = CFrame.new(0, 10, 0)
- end
- local rootPartCFrame = (rootPart and rootPart.CFrame) or PlayerControl.torso_cframe or CFrame.new(0, 10, 0)
- if rootPartCFrame.p.Y < -450 then
- rootPartCFrame = CFrame.new(0, 10, 0)
- end
- local cameraCFrame = Camera.CoordinateFrame
- local connections = {}
- local feetTouching = {}
- local previousWalkSpeed = 0
- local prevLeftHip, prevLeftShoulder, prevRightHip, prevRightShoulder = leftHip, leftShoulder, rightHip, rightShoulder
- model = Instance.new("Model")
- humanoid = Instance.new("Humanoid", model)
- head = Instance.new("Part", model)
- leftArm = Instance.new("Part", model)
- leftLeg = Instance.new("Part", model)
- rightArm = Instance.new("Part", model)
- rightLeg = Instance.new("Part", model)
- torso = Instance.new("Part", model)
- rootPart = Instance.new("Part", model)
- soundFallingDown = Instance.new("Sound", head)
- soundFreeFalling = Instance.new("Sound", head)
- soundGettingUp = Instance.new("Sound", head)
- soundJumping = Instance.new("Sound", head)
- soundRunning = Instance.new("Sound", head)
- leftHip = Instance.new("Motor", torso)
- leftShoulder = Instance.new("Motor", torso)
- rightHip = Instance.new("Motor", torso)
- rightShoulder = Instance.new("Motor", torso)
- neck = Instance.new("Motor", torso)
- rootJoint = Instance.new("Motor", rootPart)
- feetPart = Instance.new("Part", model)
- feetWeld = Instance.new("Weld", torso)
- bodyGyro = Instance.new("BodyGyro", rootPart)
- bodyVelocity = Instance.new("BodyVelocity", rootPart)
- model.Archivable = false
- model.Name = user_name or Player.Name
- model.PrimaryPart = head
- humanoid.LeftLeg = leftLeg
- humanoid.RightLeg = rightLeg
- humanoid.Torso = rootPart
- head.CFrame = torsoCFrame * CFrame.new(0, 1.5, 0)
- head.FormFactor = "Symmetric"
- head.Locked = true
- head.Name = "Head"
- head.Size = Vector3.new(2, 1, 1)
- head.TopSurface = "Smooth"
- leftArm.CanCollide = false
- leftArm.CFrame = torsoCFrame * CFrame.new(-1.5, 0, 0)
- leftArm.FormFactor = "Symmetric"
- leftArm.Locked = true
- leftArm.Name = "Left Arm"
- leftArm.Size = Vector3.new(1, 2, 1)
- leftLeg.BottomSurface = "Smooth"
- leftLeg.CanCollide = false
- leftLeg.CFrame = torsoCFrame * CFrame.new(-0.5, -2, 0)
- leftLeg.FormFactor = "Symmetric"
- leftLeg.Locked = true
- leftLeg.Name = "Left Leg"
- leftLeg.Size = Vector3.new(1, 2, 1)
- leftLeg.TopSurface = "Smooth"
- rightArm.CanCollide = false
- rightArm.CFrame = torsoCFrame * CFrame.new(1.5, 0, 0)
- rightArm.FormFactor = "Symmetric"
- rightArm.Locked = true
- rightArm.Name = "Right Arm"
- rightArm.Size = Vector3.new(1, 2, 1)
- rightLeg.BottomSurface = "Smooth"
- rightLeg.CanCollide = false
- rightLeg.CFrame = torsoCFrame * CFrame.new(0.5, -2, 0)
- rightLeg.FormFactor = "Symmetric"
- rightLeg.Locked = true
- rightLeg.Name = "Right Leg"
- rightLeg.Size = Vector3.new(1, 2, 1)
- rightLeg.TopSurface = "Smooth"
- torso.CFrame = torsoCFrame
- torso.FormFactor = "Symmetric"
- torso.LeftSurface = "Weld"
- torso.Locked = true
- torso.RightSurface = "Weld"
- torso.Name = "Torso"
- torso.Size = Vector3.new(2, 2, 1)
- rootPart.BottomSurface = "Smooth"
- rootPart.BrickColor = BrickColor.Blue()
- rootPart.CFrame = rootPartCFrame
- rootPart.FormFactor = "Symmetric"
- rootPart.LeftSurface = "Weld"
- rootPart.Locked = true
- rootPart.RightSurface = "Weld"
- rootPart.Name = "HumanoidRootPart"
- rootPart.Size = Vector3.new(2, 2, 1)
- rootPart.TopSurface = "Smooth"
- rootPart.Transparency = 1
- soundFreeFalling.Archivable = false
- soundFreeFalling.SoundId = "rbxasset://sounds/swoosh.wav"
- soundGettingUp.Archivable = false
- soundGettingUp.SoundId = "rbxasset://sounds/hit.wav"
- soundRunning.Archivable = false
- soundRunning.SoundId = "rbxasset://sounds/bfsl-minifigfoots1.mp3"
- soundRunning.Looped = true
- leftHip.C0 = CFrame.new(-1, -1, 0, -0, -0, -1, 0, 1, 0, 1, 0, 0)
- leftHip.C1 = CFrame.new(-0.5, 1, 0, -0, -0, -1, 0, 1, 0, 1, 0, 0)
- leftHip.MaxVelocity = 0.1
- leftHip.Name = "Left Hip"
- leftHip.Part0 = torso
- leftHip.Part1 = leftLeg
- leftShoulder.C0 = CFrame.new(-1, 0.5, 0, -0, -0, -1, 0, 1, 0, 1, 0, 0)
- leftShoulder.C1 = CFrame.new(0.5, 0.5, 0, -0, -0, -1, 0, 1, 0, 1, 0, 0)
- leftShoulder.MaxVelocity = 0.15
- leftShoulder.Name = "Left Shoulder"
- leftShoulder.Part0 = torso
- leftShoulder.Part1 = leftArm
- rightHip.C0 = CFrame.new(1, -1, 0, 0, 0, 1, 0, 1, 0, -1, -0, -0)
- rightHip.C1 = CFrame.new(0.5, 1, 0, 0, 0, 1, 0, 1, 0, -1, -0, -0)
- rightHip.MaxVelocity = 0.1
- rightHip.Name = "Right Hip"
- rightHip.Part0 = torso
- rightHip.Part1 = rightLeg
- rightShoulder.C0 = CFrame.new(1, 0.5, 0, 0, 0, 1, 0, 1, 0, -1, -0, -0)
- rightShoulder.C1 = CFrame.new(-0.5, 0.5, 0, 0, 0, 1, 0, 1, 0, -1, -0, -0)
- rightShoulder.MaxVelocity = 0.15
- rightShoulder.Name = "Right Shoulder"
- rightShoulder.Part0 = torso
- rightShoulder.Part1 = rightArm
- if prevLeftHip then
- leftHip.CurrentAngle = prevLeftHip.CurrentAngle
- leftHip.DesiredAngle = prevLeftHip.DesiredAngle
- end
- if prevLeftShoulder then
- leftShoulder.CurrentAngle = prevLeftShoulder.CurrentAngle
- leftShoulder.DesiredAngle = prevLeftShoulder.DesiredAngle
- end
- if prevRightHip then
- rightHip.CurrentAngle = prevRightHip.CurrentAngle
- rightHip.DesiredAngle = prevRightHip.DesiredAngle
- end
- if prevRightShoulder then
- rightShoulder.CurrentAngle = prevRightShoulder.CurrentAngle
- rightShoulder.DesiredAngle = prevRightShoulder.DesiredAngle
- end
- neck.C0 = CFrame.new(0, 1, 0, -1, -0, -0, 0, 0, 1, 0, 1, 0)
- neck.C1 = CFrame.new(0, -0.5, 0, -1, -0, -0, 0, 0, 1, 0, 1, 0)
- neck.Name = "Neck"
- neck.Part0 = torso
- neck.Part1 = head
- rootJoint.C0 = CFrame.new(0, 0, 0, -1, 0, 0, 0, 0, 1, 0, 1, 0)
- rootJoint.C1 = CFrame.new(0, 0, 0, -1, 0, 0, 0, 0, 1, 0, 1, 0)
- rootJoint.Name = "RootJoint"
- rootJoint.Part0 = rootPart
- rootJoint.Part1 = torso
- feetPart.BottomSurface = "Smooth"
- feetPart.CanCollide = false
- feetPart.CFrame = torsoCFrame * CFrame.new(0, -3.1, 0)
- feetPart.FormFactor = "Custom"
- feetPart.Locked = true
- feetPart.Name = "Platform"
- feetPart.Size = Vector3.new(1.8, 0.2, 0.8)
- feetPart.TopSurface = "Smooth"
- feetPart.Transparency = 1
- feetWeld.C0 = CFrame.new(0, -3, 0)
- feetWeld.C1 = CFrame.new(0, 0.1, 0)
- feetWeld.Name = "PlatformWeld"
- feetWeld.Part0 = torso
- feetWeld.Part1 = feetPart
- table.insert(connections, feetPart.Touched:connect(function(hit)
- feetTouching[hit] = true
- end))
- table.insert(connections, feetPart.TouchEnded:connect(function(hit)
- feetTouching[hit] = nil
- end))
- feetTouchInterest = feetPart:FindFirstChild("TouchInterest")
- bodyGyro.D = 3250
- bodyGyro.P = 400000
- bodyGyro.maxTorque = Vector3.new(1000000000, 0, 1000000000)
- bodyVelocity.P = 5000
- bodyVelocity.maxForce = Vector3.new(0, 0, 0)
- bodyVelocity.velocity = Vector3.new(0, 0, 0)
- torsoLight = Instance.new("PointLight", torso)
- torsoLight.Brightness = 0.4
- torsoLight.Color = Color3.fromRGB(1, 1, 1)
- torsoLight.Range = 16
- torsoLight.Shadows = true
- local ff1, ff2, ff3, ff4, ff5, ff6, ff7, ff8, ff9 = Instance.new("ForceField", head), Instance.new("ForceField", leftArm), Instance.new("ForceField", leftLeg), Instance.new("ForceField", rightArm), Instance.new("ForceField", rightLeg), Instance.new("ForceField", torso), Instance.new("ForceField", wildcardHandle), Instance.new("ForceField", feetPart), Instance.new("ForceField", rootPart)
- local forcefields = {[ff1] = head, [ff2] = leftArm, [ff3] = leftLeg, [ff4] = rightArm, [ff5] = rightLeg, [ff6] = torso, [ff7] = wildcardHandle, [ff8] = feetPart, [ff9] = rootPart}
- local objects = {[humanoid] = true, [head] = true, [leftArm] = true, [leftLeg] = true, [rightArm] = true, [rightLeg] = true, [torso] = true, [rootPart] = true, [rootJoint] = true, [soundFreeFalling] = true, [soundGettingUp] = true, [soundRunning] = true, [leftHip] = true, [leftShoulder] = true, [rightHip] = true, [rightShoulder] = true, [neck] = true, [feetPart] = true, [feetWeld] = true, [feetTouchInterest] = true, [bodyGyro] = true, [bodyVelocity] = true, [ff1] = true, [ff2] = true, [ff3] = true, [ff4] = true, [ff5] = true, [ff6] = true, [ff7] = true, [ff8] = true, [ff9] = true}
- local tshirtUrl = appearance.tshirt
- if tshirtUrl then
- local tshirt = Instance.new("Decal", torso)
- tshirt.Name = "roblox"
- tshirt.Texture = tshirtUrl
- objects[tshirt] = true
- end
- for _, template in ipairs(appearance.characterObjects) do
- local object = template:Clone()
- local newObjects = {object}
- for _, object in ipairs(newObjects) do
- objects[object] = true
- for _, child in ipairs(object:GetChildren()) do
- table.insert(newObjects, child)
- end
- end
- if object:IsA("BodyColors") then
- head.BrickColor = object.HeadColor
- leftArm.BrickColor = object.LeftArmColor
- leftLeg.BrickColor = object.LeftLegColor
- rightArm.BrickColor = object.RightArmColor
- rightLeg.BrickColor = object.RightLegColor
- torso.BrickColor = object.TorsoColor
- elseif object:IsA("Hat") then
- local handle = object:FindFirstChild("Handle")
- if handle and handle:IsA("BasePart") then
- local weld = Instance.new("Weld", head)
- weld.C0 = CFrame.new(0, 0.5, 0)
- local attachmentPos = object.AttachmentPos
- local attachmentRight = object.AttachmentRight
- local attachmentUp = object.AttachmentUp
- local attachmentForward = object.AttachmentForward
- weld.C1 = CFrame.new(attachmentPos.X, attachmentPos.Y, attachmentPos.Z,
- attachmentRight.X, attachmentUp.X, -attachmentForward.X,
- attachmentRight.Y, attachmentUp.Y, -attachmentForward.Y,
- attachmentRight.Z, attachmentUp.Z, -attachmentForward.Z)
- weld.Name = "HeadWeld"
- weld.Part0 = head
- weld.Part1 = handle
- handle.Parent = model
- local antiGravity = Instance.new("BodyForce", handle)
- antiGravity.force = Vector3.new(0, handle:GetMass() * 196.2, 0)
- objects[object] = false
- object.Parent = nil
- objects[weld] = true
- end
- end
- object.Parent = model
- end
- local facePresent = false
- local headMeshPresent = false
- for _, template in ipairs(appearance.headObjects) do
- local object = template:Clone()
- local newObjects = {object}
- for _, object in ipairs(newObjects) do
- objects[object] = true
- for _, child in ipairs(object:GetChildren()) do
- table.insert(newObjects, child)
- end
- end
- if object:IsA("DataModelMesh") then
- headMeshPresent = true
- elseif object:IsA("Decal") then
- facePresent = true
- end
- object.Parent = head
- end
- if not facePresent then
- local face = Instance.new("Decal", head)
- face.Texture = "rbxasset://textures/face.png"
- objects[face] = true
- end
- if not headMeshPresent then
- local headMesh = Instance.new("SpecialMesh", head)
- headMesh.Scale = Vector3.new(1.25, 1.25, 1.25)
- objects[headMesh] = true
- end
- table.insert(connections, model.DescendantAdded:connect(function(object)
- local success, is_localscript = pcall(Game.IsA, object, "LocalScript")
- if success and is_localscript then
- pcall(Utility.SetProperty, object, "Disabled", true)
- local changed_connection = pcall(object.Changed.connect, object.Changed, function(property)
- if property == "Disabled" and not object.Disabled then
- pcall(Utility.SetProperty, object, "Disabled", true)
- object:Destroy()
- end
- end)
- end
- if not objects[object] then
- object:Destroy()
- end
- end))
- model.Parent = Workspace
- Player.Character = model
- Camera.CameraSubject = humanoid
- Camera.CameraType = "Track"
- Camera.CoordinateFrame = cameraCFrame
- local IsStanding
- local RegenerateHealth
- local ResetCharacter
- function IsStanding()
- return not not next(feetTouching)
- end
- function RegenerateHealth()
- if humanoid.Health < 1 then
- humanoid.Health = 100
- elseif not regeneratingHealth then
- regeneratingHealth = true
- local elapsedTime = wait(1)
- regeneratingHealth = false
- if humanoid.Health < 100 then
- humanoid.Health = math.min(humanoid.Health + elapsedTime, 100)
- end
- end
- end
- function ResetCharacter()
- for index, connection in ipairs(connections) do
- connection:disconnect()
- end
- active = false
- end
- table.insert(connections, model.AncestryChanged:connect(ResetCharacter))
- table.insert(connections, model.DescendantRemoving:connect(function(object)
- local parent = forcefields[object]
- if parent then
- forcefields[object] = nil
- local new_forcefield = Instance.new("ForceField")
- forcefields[new_forcefield] = parent
- objects[new_forcefield] = true
- new_forcefield.Parent = parent
- elseif objects[object] then
- ResetCharacter()
- end
- end))
- table.insert(connections, humanoid.HealthChanged:connect(RegenerateHealth))
- table.insert(connections, humanoid.Climbing:connect(function() pose = "Climbing" end))
- table.insert(connections, humanoid.FallingDown:connect(function(state) pose = "FallingDown" end))
- table.insert(connections, humanoid.FreeFalling:connect(function(state) pose = "FreeFall" if state then soundFreeFalling:Play() else
- soundFreeFalling:Pause() end end))
- table.insert(connections, humanoid.GettingUp:connect(function(state) pose = "GettingUp" if state then soundGettingUp:Play() else
- soundGettingUp:Pause() end end))
- table.insert(connections, humanoid.PlatformStanding:connect(function() pose = "PlatformStanding" end))
- table.insert(connections, humanoid.Seated:connect(function() pose = "Seated" end))
- table.insert(connections, humanoid.Swimming:connect(function(speed) if speed > 0 then pose = "Swimming" else pose = "Standing" end end))
- local previousRootPartCFrame = rootPart.CFrame
- TaskScheduler.Start(function()
- while active do
- local totalTime = TaskScheduler.GetCurrentTime()
- local stepTime = 1 / 60
- if not PlayerControl.characterEnabled then
- ResetCharacter()
- break
- end
- torsoLight.Brightness = 0.5 + 0.15 * math.sin(totalTime * 0.75 * math.pi)
- local featherfallEnabled = PlayerControl.IsFeatherfallEnabled()
- local rootPartCFrame = rootPart.CFrame
- if not jumpDebounce and UserInterface:IsKeyDown(Enum.KeyCode.Space) then
- if humanoid.Sit then
- humanoid.Sit = false
- end
- if IsStanding() then
- jumpDebounce = true
- pose = "Jumping"
- rootPart.Velocity = Vector3.new(rootPart.Velocity.X, 50, rootPart.Velocity.Z)
- torso.Velocity = Vector3.new(torso.Velocity.X, 50, torso.Velocity.Z)
- TaskScheduler.Schedule(1, function()
- if pose == "Jumping" then
- pose = "FreeFall"
- end
- jumpDebounce = false
- humanoid.Jump = false
- end)
- end
- end
- local cameraCFrame = Camera.CoordinateFrame
- local cameraDirection = cameraCFrame.lookVector
- if flying then
- if PlayerControl.rolling then
- local rootPartCFrame = rootPart.CFrame
- local speed = (rootPartCFrame - rootPartCFrame.p):pointToObjectSpace(rootPart.Velocity).Y
- local decay = 0.5 ^ stepTime
- if math.abs(speed) <= 50 then
- PlayerControl.rollingAngle = (((PlayerControl.rollingAngle + 0.5) % 1 - 0.5) * decay) % 1
- PlayerControl.rollingOffset = PlayerControl.rollingOffset * decay
- else
- PlayerControl.rollingAngle = (PlayerControl.rollingAngle + stepTime * speed * PlayerControl.rollingSpeed) % 1
- PlayerControl.rollingOffset = (PlayerControl.rollingOffset + PlayerControl.rollingMaxOffset * (1 / decay - 1)) * decay
- end
- rootJoint.C0 = (CFrame.new(0, 0, 0, -1, 0, 0, 0, 0, 1, 0, 1, 0) * CFrame.Angles(PlayerControl.rollingAngle * 2 * math.pi, 0, 0)) * CFrame.new(0, -PlayerControl.rollingOffset, 0)
- else
- rootJoint.C0 = CFrame.new(0, 0, 0, -1, 0, 0, 0, 0, 1, 0, 1, 0)
- PlayerControl.rollingAngle = 0
- PlayerControl.rollingOffset = 0
- end
- rightShoulder.MaxVelocity = 0.5
- leftShoulder.MaxVelocity = 0.5
- rightShoulder.DesiredAngle = 0
- leftShoulder.DesiredAngle = 0
- rightHip.DesiredAngle = 0
- leftHip.DesiredAngle = 0
- bodyGyro.D = 500
- bodyGyro.P = 1e6
- bodyGyro.maxTorque = Vector3.new(1e6, 1e6, 1e6)
- bodyVelocity.P = 1250
- bodyVelocity.maxForce = Vector3.new(1e6, 1e6, 1e6)
- local movementRight = 0
- local movementForward = 0
- local movementUp = 0
- if UserInterface:IsKeyDown(Enum.KeyCode.A) and not UserInterface:IsKeyDown(Enum.KeyCode.D) then
- movementRight = -1
- elseif UserInterface:IsKeyDown(Enum.KeyCode.D) then
- movementRight = 1
- end
- if UserInterface:IsKeyDown(Enum.KeyCode.W) then
- movementUp = 0.2
- if not UserInterface:IsKeyDown(Enum.KeyCode.S) then
- movementForward = -1
- end
- elseif UserInterface:IsKeyDown(Enum.KeyCode.S) then
- movementForward = 1
- end
- local movement = PlayerControl.fly_acceleration * cameraCFrame:vectorToWorldSpace(Vector3.new(movementRight, movementUp, movementForward))
- local previousMomentum = flyingMomentum
- local previousTilt = flyingTilt
- flyingMomentum = movement + flyingMomentum * (1 - PlayerControl.fly_acceleration / PlayerControl.fly_speed)
- flyingTilt = ((flyingMomentum * Vector3.new(1, 0, 1)).unit:Cross((previousMomentum * Vector3.new(1, 0, 1)).unit)).Y
- if flyingTilt ~= flyingTilt or flyingTilt == math.huge then
- flyingTilt = 0
- end
- local absoluteTilt = math.abs(flyingTilt)
- if absoluteTilt > 0.06 or absoluteTilt < 0.0001 then
- if math.abs(previousTilt) > 0.0001 then
- flyingTilt = previousTilt * 0.9
- else
- flyingTilt = 0
- end
- else
- flyingTilt = previousTilt * 0.77 + flyingTilt * 0.25
- end
- previousTilt = flyingTilt
- if flyingMomentum.magnitude < 0.1 then
- flyingMomentum = Vector3.new(0, 0, 0)
- -- bodyGyro.cframe = cameraCFrame
- else
- local momentumOrientation = CFrame.new(Vector3.new(0, 0, 0), flyingMomentum)
- local tiltOrientation = CFrame.Angles(0, 0, -20 * flyingTilt)
- bodyGyro.cframe = momentumOrientation * tiltOrientation * CFrame.Angles(-0.5 * math.pi * math.min(flyingMomentum.magnitude / PlayerControl.fly_speed, 1), 0, 0)
- end
- bodyVelocity.velocity = flyingMomentum + Vector3.new(0, 0.15695775618683547, 0)
- rootPart.Velocity = flyingMomentum
- previousMomentum = flyingMomentum
- else
- rootJoint.C0 = CFrame.new(0, 0, 0, -1, 0, 0, 0, 0, 1, 0, 1, 0)
- PlayerControl.rollingAngle = 0
- PlayerControl.rollingOffset = 0
- bodyGyro.D = 3250
- bodyGyro.P = 400000
- bodyVelocity.P = 5000
- local cameraDirection = cameraCFrame.lookVector
- local walkDirection = Vector3.new(0, 0, 0)
- local walkSpeed = 16
- if UserInterface:IsKeyDown(Enum.KeyCode.W) then
- if UserInterface:IsKeyDown(Enum.KeyCode.A) then
- walkDirection = Vector3.new(cameraDirection.X + cameraDirection.Z, 0, cameraDirection.Z - cameraDirection.X).unit
- elseif UserInterface:IsKeyDown(Enum.KeyCode.D) then
- walkDirection = Vector3.new(cameraDirection.X - cameraDirection.Z, 0, cameraDirection.Z + cameraDirection.X).unit
- else
- walkDirection = Vector3.new(cameraDirection.X, 0, cameraDirection.Z).unit
- end
- elseif UserInterface:IsKeyDown(Enum.KeyCode.S) then
- if UserInterface:IsKeyDown(Enum.KeyCode.A) then
- walkDirection = Vector3.new(-cameraDirection.X + cameraDirection.Z, 0, -cameraDirection.Z - cameraDirection.X).unit
- elseif UserInterface:IsKeyDown(Enum.KeyCode.D) then
- walkDirection = Vector3.new(-cameraDirection.X - cameraDirection.Z, 0, -cameraDirection.Z + cameraDirection.X).unit
- else
- walkDirection = Vector3.new(-cameraDirection.X, 0, -cameraDirection.Z).unit
- end
- elseif UserInterface:IsKeyDown(Enum.KeyCode.A) then
- walkDirection = Vector3.new(cameraDirection.Z, 0, -cameraDirection.X).unit
- elseif UserInterface:IsKeyDown(Enum.KeyCode.D) then
- walkDirection = Vector3.new(-cameraDirection.Z, 0, cameraDirection.X).unit
- else
- walkSpeed = 0
- end
- if walkSpeed ~= previousWalkSpeed then
- if walkSpeed > 0 then
- soundRunning:Play()
- else
- soundRunning:Pause()
- end
- end
- if walkSpeed > 0 then
- if pose ~= "Jumping" then
- if IsStanding() then
- pose = "Running"
- else
- pose = "FreeFall"
- end
- end
- bodyGyro.cframe = CFrame.new(Vector3.new(), walkDirection)
- bodyGyro.maxTorque = Vector3.new(1000000000, 1000000000, 1000000000)
- bodyVelocity.maxForce = Vector3.new(1000000, maxForceY, 1000000)
- else
- if pose ~= "Jumping" then
- if IsStanding() then
- pose = "Standing"
- else
- pose = "FreeFall"
- end
- end
- -- TODO: find and fix bug that causes torso to rotate back to some angle
- bodyGyro.maxTorque = Vector3.new(1000000000, 1000000000, 1000000000) -- Vector3.new(1000000000, 0, 1000000000)
- if PlayerControl.pushable then
- bodyVelocity.maxForce = Vector3.new(0, 0, 0)
- else
- bodyVelocity.maxForce = Vector3.new(1000000, 0, 1000000)
- end
- end
- if featherfallEnabled then
- local velocity = rootPart.Velocity
- if velocity.Y > 50 then
- rootPart.Velocity = Vector3.new(velocity.X, 50, velocity.Z)
- elseif velocity.Y < -50 then
- rootPart.Velocity = Vector3.new(velocity.X, -50, velocity.Z)
- end
- local distanceVector = rootPartCFrame.p - previousRootPartCFrame.p
- local offsetX, offsetY, offsetZ = distanceVector.X, distanceVector.Y, distanceVector.Z
- local MAX_MOVEMENT = 50 * 0.03333333507180214
- if offsetX > MAX_MOVEMENT then
- offsetX = MAX_MOVEMENT
- elseif offsetX < -MAX_MOVEMENT then
- offsetX = -MAX_MOVEMENT
- end
- if offsetY > MAX_MOVEMENT then
- offsetY = MAX_MOVEMENT
- elseif offsetY < -MAX_MOVEMENT then
- offsetY = -MAX_MOVEMENT
- end
- if offsetZ > MAX_MOVEMENT then
- offsetZ = MAX_MOVEMENT
- elseif offsetZ < -MAX_MOVEMENT then
- offsetZ = -MAX_MOVEMENT
- end
- local offset = Vector3.new(offsetX, offsetY, offsetZ)
- if offset ~= distanceVector then
- rootPartCFrame = previousRootPartCFrame + offset
- --rootPart.CFrame = rootPartCFrame
- end
- end
- local walkingVelocity = walkDirection * walkSpeed
- bodyVelocity.velocity = walkingVelocity
- if not jumpDebounce and math.abs(rootPart.Velocity.Y) <= 0.1 then
- rootPart.Velocity = Vector3.new(walkingVelocity.X, rootPart.Velocity.Y, walkingVelocity.Z)
- end
- previousWalkSpeed = walkSpeed
- if pose == "Jumping" or jumpDebounce then
- rightShoulder.MaxVelocity = 0.5
- leftShoulder.MaxVelocity = 0.5
- rightShoulder.DesiredAngle = 3.14
- leftShoulder.DesiredAngle = -3.14
- rightHip.DesiredAngle = 0
- leftHip.DesiredAngle = 0
- elseif pose == "FreeFall" then
- rightShoulder.MaxVelocity = 0.5
- leftShoulder.MaxVelocity = 0.5
- rightShoulder.DesiredAngle = 3.14
- leftShoulder.DesiredAngle = -3.14
- rightHip.DesiredAngle = 0
- leftHip.DesiredAngle = 0
- elseif pose == "Seated" then
- rightShoulder.MaxVelocity = 0.15
- leftShoulder.MaxVelocity = 0.15
- rightShoulder.DesiredAngle = 3.14 / 2
- leftShoulder.DesiredAngle = -3.14 / 2
- rightHip.DesiredAngle = 3.14 / 2
- leftHip.DesiredAngle = -3.14 / 2
- else
- local climbFudge = 0
- local amplitude
- local frequency
- if pose == "Running" then
- rightShoulder.MaxVelocity = 0.15
- leftShoulder.MaxVelocity = 0.15
- amplitude = 1
- frequency = 9
- elseif (pose == "Climbing") then
- rightShoulder.MaxVelocity = 0.5
- leftShoulder.MaxVelocity = 0.5
- amplitude = 1
- frequency = 9
- climbFudge = 3.14
- else
- amplitude = 0.1
- frequency = 1
- end
- local desiredAngle = amplitude * math.sin(totalTime * frequency)
- rightShoulder.DesiredAngle = desiredAngle + climbFudge
- leftShoulder.DesiredAngle = desiredAngle - climbFudge
- rightHip.DesiredAngle = -desiredAngle
- leftHip.DesiredAngle = -desiredAngle
- end
- end
- previousRootPartCFrame = rootPartCFrame
- RunService.RenderStepped:wait()
- end
- if model.Parent ~= nil then
- model.Parent = nil
- end
- PlayerControl.CreateCharacter()
- end)
- humanoid.Health = 100
- character = model
- chatAdornee = head
- elseif characterMode == "pyramid" then
- if PlayerControl.characterEnabled then
- Camera.CameraType = "Fixed"
- PyramidCharacter.camera_distance = (Camera.Focus.p - Camera.CoordinateFrame.p).magnitude
- PyramidCharacter.camera_position = Camera.Focus.p
- PyramidCharacter.Teleport(Camera.Focus.p)
- PyramidCharacter.visible = true
- Player.Character = nil
- else
- PyramidCharacter.visible = false
- end
- end
- end
- function PlayerControl.GetCharacter()
- return character
- end
- function PlayerControl.GetHead()
- local characterMode = PlayerControl.characterMode
- if characterMode == "normal" then
- return head
- elseif characterMode == "pyramid" then
- return PyramidCharacter.core
- end
- end
- function PlayerControl.GetHumanoid()
- return humanoid
- end
- function PlayerControl.GetRootPart()
- return rootPart
- end
- function PlayerControl.GetTorso()
- return torso
- end
- function PlayerControl.IsEnabled()
- return PlayerControl.characterEnabled
- end
- function PlayerControl.IsFeatherfallEnabled()
- return PlayerControl.featherfallEnabled
- end
- function PlayerControl.IsPushable()
- return PlayerControl.pushable
- end
- function PlayerControl.IsRolling()
- return PlayerControl.rolling
- end
- function PlayerControl.ResetCharacter()
- if character and character.Parent then
- character.Parent = nil
- end
- PyramidCharacter.visible = false
- end
- function PlayerControl.SetEnabled(state, no_animation)
- state = not not state
- if state ~= PlayerControl.characterEnabled then
- PlayerControl.characterEnabled = state
- local characterMode = PlayerControl.characterMode
- if characterMode == "normal" then
- local torso = PlayerControl.GetRootPart()
- local rootPart = PlayerControl.GetRootPart()
- if rootPart then
- if PlayerControl.characterEnabled then
- local torso_cframe = Camera.Focus:toWorldSpace(PlayerControl.hide_torso_object_cframe)
- PlayerControl.torso_cframe = torso_cframe
- torso.CFrame = torso_cframe
- rootPart.CFrame = torso_cframe
- else
- PlayerControl.hide_torso_object_cframe = Camera.Focus:toObjectSpace(rootPart.CFrame)
- end
- else
- PlayerControl.torso_cframe = Camera.Focus
- end
- if PlayerControl.characterEnabled then
- PlayerControl.CreateCharacter()
- RunService.Stepped:wait()
- coroutine.yield()
- if not no_animation then
- GraphicalEffects.CrystalRing({base_part = PlayerControl.GetTorso(), crystal_color = BrickColor.new("Institutional white"), float_duration = 2})
- end
- else
- Player.Character = nil
- Camera.CameraType = "Fixed"
- if not no_animation then
- GraphicalEffects.CrystalRing({position = PlayerControl.GetTorso().Position, crystal_color = BrickColor.new("Institutional white"), float_duration = 2})
- end
- end
- else
- if state then
- PlayerControl.CreateCharacter()
- RunService.Stepped:wait()
- coroutine.yield()
- if not no_animation then
- GraphicalEffects.CrystalRing({base_part = PyramidCharacter.core, crystal_color = BrickColor.new("Institutional white"), float_duration = 2})
- end
- else
- PyramidCharacter.visible = false
- if not no_animation then
- GraphicalEffects.CrystalRing({position = PyramidCharacter.core.Position, crystal_color = BrickColor.new("Institutional white"), float_duration = 2})
- end
- end
- end
- end
- end
- function PlayerControl.SetFeatherfallEnabled(state)
- state = not not state
- if state ~= PlayerControl.featherfallEnabled then
- PlayerControl.featherfallEnabled = state
- if state then
- Logger.print("Info", "Featherfall enabled in PlayerControl")
- else
- Logger.print("Info", "Featherfall disabled in PlayerControl")
- end
- end
- end
- function PlayerControl.SetPushable(state)
- state = not not state
- if state ~= PlayerControl.pushable then
- PlayerControl.pushable = state
- if state then
- Logger.print("Info", "Pushing enabled in PlayerControl")
- else
- Logger.print("Info", "Pushing disabled in PlayerControl")
- end
- end
- end
- function PlayerControl.SetRolling(state)
- state = not not state
- if state ~= PlayerControl.rolling then
- PlayerControl.rolling = state
- if state then
- Logger.print("Info", "Rolling fly mode enabled in PlayerControl")
- else
- Logger.print("Info", "Rolling fly mode disabled in PlayerControl")
- end
- end
- end
- function PlayerControl.StartFlying()
- PlayerControl.fly_speed = PlayerControl.fly_basespeed
- if torso then
- flyingMomentum = torso.Velocity + torso.CFrame.lookVector * 3 + Vector3.new(0, 10, 0)
- else
- flyingMomentum = Vector3.new()
- end
- flyingTilt = 0
- flying = true
- end
- function PlayerControl.StopFlying()
- if bodyGyro.cframe then
- local lookVector = bodyGyro.cframe.lookVector
- if lookVector.X ~= 0 or lookVector.Z ~= 0 then
- bodyGyro.cframe = CFrame.new(Vector3.new(), Vector3.new(lookVector.X, 0, lookVector.Z))
- end
- end
- flying = false
- end
- local previousTime = 0
- ControllerCommands = {};
- ControllerCommands = {};
- ControllerCommands.BALEFIRE_SPEED = 40
- function ControllerCommands.BalefireAtMouse()
- local head = chatAdornee
- if head then
- local target = Mouse.Hit.p
- local origin = head.Position
- local direction = (target - origin).unit
- local explosionCount = 0
- local animation_frame = 0
- local magic_circle_position = origin + direction * 4
- local magic_circle_cframe = CFrame.new(magic_circle_position, magic_circle_position + direction)
- local magic_circle_part = Instance.new("Part")
- local magic_circle_mesh = Instance.new("BlockMesh", magic_circle_part)
- local magic_circle_light = Instance.new("PointLight", magic_circle_part)
- local magic_circle_decal_back = Instance.new("Decal", magic_circle_part)
- local magic_circle_decal_front = Instance.new("Decal", magic_circle_part)
- magic_circle_part.Anchored = true
- magic_circle_part.Archivable = false
- magic_circle_part.BottomSurface = "Smooth"
- magic_circle_part.CanCollide = false
- magic_circle_part.CFrame = magic_circle_cframe
- magic_circle_part.FormFactor = "Custom"
- magic_circle_part.Locked = true
- magic_circle_part.Size = Vector3.new(0.2, 0.2, 0.2)
- magic_circle_part.TopSurface = "Smooth"
- magic_circle_part.Transparency = 1
- magic_circle_mesh.Scale = Vector3.new(60, 60, 0)
- magic_circle_light.Color = Color3.fromRGB(1, 0.5, 1)
- magic_circle_light.Range = 16
- magic_circle_light.Shadows = true
- magic_circle_decal_back.Face = "Back"
- magic_circle_decal_back.Texture = "rbxassetid://122610943"
- magic_circle_decal_front.Face = "Front"
- magic_circle_decal_front.Texture = "rbxassetid://122610943"
- local function NextExplosion()
- explosionCount = explosionCount + 1
- Instance.new("Explosion", Workspace).Position = origin + direction * (explosionCount * 8 + 4)
- end
- local function AnimateMagicCircle()
- animation_frame = animation_frame + 1
- local transparency = (animation_frame / 40) ^ 3
- if animation_frame == 40 then
- pcall(Game.Destroy, magic_circle_part)
- else
- if magic_circle_part.Parent ~= Workspace then
- pcall(Utility.SetProperty, magic_circle_part, "Parent", Workspace)
- end
- head = PlayerControl.GetHead()
- if head then
- magic_circle_position = head.Position + direction * 4
- end
- magic_circle_part.CFrame = CFrame.new(magic_circle_position, magic_circle_position + direction) * CFrame.Angles(0, 0,
- math.tau * animation_frame / 40 * 1.5)
- magic_circle_light.Brightness = 1 - transparency
- magic_circle_decal_back.Transparency = transparency
- magic_circle_decal_front.Transparency = transparency
- end
- end
- magic_circle_part.Parent = Workspace
- for i = 1, 40 do
- Delay((i - 1) / ControllerCommands.BALEFIRE_SPEED, NextExplosion)
- Delay((i - 1) / 30, AnimateMagicCircle)
- end
- for i = 1, 20 do
- Delay((i - 1) / ControllerCommands.BALEFIRE_SPEED, NextExplosion)
- end
- end
- end
- function ControllerCommands.ControlRandomDummy()
- local dummies = {}
- local numDummies = 0
- for _, character in ipairs(Workspace:GetChildren()) do
- local name = tostring(character)
- if name == "???" or name == "Dummy" then
- local head, humanoid
- for _, child in ipairs(character:GetChildren()) do
- local className = child.ClassName
- if className == "Part" and tostring(child) == "Head" then
- head = child
- if humanoid then
- break
- end
- elseif className == "Humanoid" then
- if child.Health > 0 then
- humanoid = child
- if head then
- break
- end
- else
- break
- end
- end
- end
- if head and humanoid then
- numDummies = numDummies + 1
- dummies[numDummies] = {character, head, humanoid}
- end
- end
- end
- if numDummies > 0 then
- local dummy = dummies[math.random(numDummies)]
- Player.Character = dummy[1]
- chatAdornee = dummy[2]
- Camera.CameraSubject = dummy[3]
- Camera.CameraType = "Track"
- end
- end
- function ControllerCommands.Decalify(textures, exclusion)
- local objects = Workspace:GetChildren()
- for _, object in ipairs(objects) do
- if not exclusion[object] then
- for _, child in ipairs(object:GetChildren()) do
- objects[#objects + 1] = child
- end
- if object:IsA("BasePart") then
- local texture = textures[math.random(#textures)]
- local face_left = Instance.new("Decal", object)
- face_left.Face = Enum.NormalId.Left
- face_left.Texture = texture
- local face_right = Instance.new("Decal", object)
- face_right.Face = Enum.NormalId.Right
- face_right.Texture = texture
- local face_bottom = Instance.new("Decal", object)
- face_bottom.Face = Enum.NormalId.Bottom
- face_bottom.Texture = texture
- local face_top = Instance.new("Decal", object)
- face_top.Face = Enum.NormalId.Top
- face_top.Texture = texture
- local face_front = Instance.new("Decal", object)
- face_front.Face = Enum.NormalId.Front
- face_front.Texture = texture
- local face_back = Instance.new("Decal", object)
- face_back.Face = Enum.NormalId.Back
- face_back.Texture = texture
- end
- end
- end
- end
- function ControllerCommands.ExplodeAtMouse()
- local explosion = Instance.new("Explosion")
- explosion.Position = Mouse.Hit.p
- explosion.Parent = Workspace
- end
- function ControllerCommands.LaserAtMouse()
- GraphicalEffects.ShootLaserOfDeath(Mouse.Hit.p)
- end
- function ControllerCommands.BigLaser(target)
- GraphicalEffects.ShootLaserOfDeath(target, {brickcolor = BrickColor.new("New Yeller"), duration = 80, fragmentation_size = 6,laser_scale = 30, light_color = Color3.fromRGB(1, 0.5, 0), magic_circle_image = "rbxassetid://126561317", magic_circle_scale = 1.5, sound_volume = 1,special_effects = BrickColor.new("Deep orange"), stay = 2})
- end
- function ControllerCommands.BigLaserAtMouse()
- ControllerCommands.BigLaser(Mouse.Hit.p)
- end
- function ControllerCommands.ShootMissile(targetPart, pointOnPart, direction)
- GraphicalEffects.ShootMissile(targetPart, pointOnPart, direction)
- end
- function ControllerCommands.ShootMissileAtMouse(amount, spread, delayTime)
- local exclusionList = {}
- local playerHead = PlayerControl.GetHead()
- local playerTorso = PlayerControl.GetTorso()
- if playerHead and playerTorso then
- exclusionList[playerTorso] = true
- local humanoid, torso = Utility.FindHumanoidClosestToRay(Mouse.UnitRay, exclusionList)
- local targetPart, pointOnPart
- if humanoid and torso then
- targetPart, pointOnPart = torso, Vector3.new()
- else
- local target = Mouse.Target
- if target then
- targetPart, pointOnPart = target, target.CFrame:pointToObjectSpace(Mouse.Hit.p)
- else
- return
- end
- end
- if targetPart then
- local direction = (Mouse.Hit.p - playerHead.Position).unit
- delayTime = delayTime or 0
- for index = 1, amount do
- local angles = math.tau * (index - 0.5) * spread / amount * Vector3.new(math.random() - 0.5, math.random() - 0.5,math.random() - 0.5).unit
- TaskScheduler.Schedule(delayTime * (index - 1), ControllerCommands.ShootMissile, targetPart, pointOnPart, CFrame.Angles(angles.X, angles.Y, angles.Z) * direction)
- end
- end
- end
- end
- function ControllerCommands.ShootMissileAroundMouse(amount, offset, delayTime)
- local exclusionList = {}
- local playerHead = PlayerControl.GetHead()
- local playerTorso = PlayerControl.GetTorso()
- if playerHead and playerTorso then
- exclusionList[playerTorso] = true
- local humanoid, torso = Utility.FindHumanoidClosestToRay(Mouse.UnitRay, exclusionList)
- local targetPart, pointOnPart
- if humanoid and torso then
- targetPart, pointOnPart = torso, Vector3.new()
- else
- local target = Mouse.Target
- if target then
- targetPart, pointOnPart = target, target.CFrame:pointToObjectSpace(Mouse.Hit.p)
- else
- return
- end
- end
- if targetPart then
- delayTime = delayTime or 0
- local index = 1
- local targetPoint = targetPart.CFrame * pointOnPart
- local rotation_offset_angles = math.tau * Vector3.new(math.random() - 0.5, math.random() - 0.5, 0).unit
- local rotation_offset = CFrame.Angles(rotation_offset_angles.x, rotation_offset_angles.y, 0)
- local angle_x = 0
- local angle_x_step = math.tau / math.phi
- for i = 1, 8 * amount do
- angle_x = angle_x + angle_x_step
- local direction = rotation_offset * (CFrame.Angles(0, math.tau * index / amount, 0) * CFrame.Angles(angle_x, 0,0).lookVector)
- local blocked = Workspace:FindPartOnRay(Ray.new(targetPoint, direction * offset), targetPart.Parent)
- if not blocked then
- local p0, p1, p2, p3 = targetPart, pointOnPart, direction, offset; GraphicalEffects.ShootMissile(p0, p1, p2, function() return p0 end, p3, true)
- index = index + 1
- if index > amount then
- break
- end
- end
- end
- end
- end
- end
- function ControllerCommands.HugeExplosionOfDoom(position)
- local connections = {}
- local parts = {}
- local cframe = CFrame.new(position)
- local function ExplosionHit(part)
- if part:GetMass() < 10000 and part.Parent ~= Camera then
- parts[part] = true
- part.Anchored = true
- part:BreakJoints()
- part.BrickColor = BrickColor.new("Instituational white")
- end
- end
- for i = 1, 4 do
- local quantity = 0.5 * i * (1 + i)
- local fraction = math.tau / quantity
- for x = 1, quantity do
- for y = 1, quantity do
- local explosion = Instance.new("Explosion")
- connections[#connections + 1] = explosion.Hit:connect(ExplosionHit)
- explosion.BlastRadius = 5
- explosion.Position = cframe * (CFrame.Angles(fraction * x, fraction * y, 0) * Vector3.new((i - 1) * 6, 0, 0))
- explosion.Parent = Workspace
- end
- end
- wait(0.075)
- end
- for part in pairs(parts) do
- for _, child in ipairs(part:GetChildren()) do
- if child:IsA("BodyMover") then
- child:Destroy()
- end
- end
- local mass = part:GetMass()
- local velocity = CFrame.Angles(math.tau * math.random(), math.tau * math.random(), 0) * Vector3.new(25, 0, 0)
- local bodythrust = Instance.new("BodyThrust")
- bodythrust.force = mass * -velocity
- bodythrust.Parent = part
- local bodyforce = Instance.new("BodyForce")
- bodyforce.force = mass * Vector3.new(0, 196.2, 0)
- bodyforce.Parent = part
- part.Anchored = false
- part.Reflectance = 1
- part.RotVelocity = math.tau * Vector3.new(math.random() - 0.5, math.random() - 0.5, math.random() - 0.5)
- part.Transparency = 0.5
- part.Velocity = (part.CFrame - part.Position) * velocity
- end
- for _, connection in ipairs(connections) do
- connection:disconnect()
- end
- for i = 0, 99 do
- Delay(i / 10, function()
- for part in pairs(parts) do
- local new_transparency = 0.5 * (1 + i / 50)
- part.Reflectance = 0.98 * part.Reflectance
- if new_transparency > part.Transparency then
- part.Transparency = new_transparency
- end
- end
- end)
- end
- Delay(10, function()
- for part in pairs(parts) do
- pcall(part.Destroy, part)
- end
- end)
- end
- function ControllerCommands.HugeExplosionOfDoomAtMouse()
- ControllerCommands.HugeExplosionOfDoom(Mouse.Hit.p)
- end
- function ControllerCommands.SpaceHyperBeam(asd)
- GraphicalEffects.SpaceHyperBeam(asd)
- end
- function ControllerCommands.SpaceHyperBeamAtMouse()
- ControllerCommands.SpaceHyperBeam(Mouse.Hit.p)
- end
- function ControllerCommands.ConcentratedSpaceHyperBeamAtMouse()
- local p = Mouse.Hit.p; for i = 1, 50 do GraphicalEffects.SpaceHyperBeam(p) end
- end
- function ControllerCommands.TeleportCharacterToMouse()
- if PlayerControl.IsEnabled() then
- local torso = PlayerControl.GetTorso()
- if torso then
- local pos = Mouse.Hit.p + Vector3.new(0, 5, 0)
- torso.CFrame = CFrame.new(pos, pos + torso.CFrame.lookVector)
- end
- else
- local new_focus_position = Mouse.Hit.p
- local direction_vector = Camera.CoordinateFrame.lookVector
- local new_focus = CFrame.new(new_focus_position, new_focus_position + direction_vector)
- Camera.CoordinateFrame = new_focus * CFrame.new(0, 0, 25)
- Camera.Focus = new_focus
- end
- end
- AdvancedGUI = {};
- if not AdvancedGUI.GUI_BASE_COLOR then
- AdvancedGUI.GUI_BASE_COLOR = Color3.fromRGB(0, 0, 0)
- end
- function AdvancedGUI.GenerateChatColor(speakerName)
- local chatColor = ChatColor.Get(speakerName).Color
- local brightness = chatColor.r + chatColor.g + chatColor.b
- if brightness < 1.5 then
- chatColor = Color3.fromRGB(math.min(1, 0.4 + chatColor.r), math.min(1, 0.4 + chatColor.g), math.min(1, 0.4 + chatColor.b))
- else
- chatColor = Color3.fromRGB(math.min(1, 0.05 + chatColor.r), math.min(1, 0.05 + chatColor.g), math.min(1, 0.05 + chatColor.b))
- end
- return chatColor
- end
- GuiBase = {}
- GuiBase.__index = GuiBase
- function GuiBase:new(data)
- local instance = setmetatable({}, self)
- instance:Init(data)
- return instance
- end
- function GuiBase:Destroy()
- if self.parent then
- self.parent.children[self] = nil
- end
- for child in pairs(self.children) do
- child:Destroy()
- end
- self.m_base_instance:Destroy()
- end
- function GuiBase:GetContentInstance(child)
- return self.m_base_instance
- end
- function GuiBase:Init()
- self.children = {}
- end
- function GuiBase:IsA(className)
- return className == "GuiBase"
- end
- function GuiBase:SetParent(parent)
- if parent ~= self.parent then
- if self.parent then
- self.parent.children[self] = nil
- end
- self.parent = parent
- if parent then
- parent.children[self] = true
- self.m_base_instance.Parent = parent:GetContentInstance()
- else
- self.m_base_instance.Parent = nil
- end
- end
- end
- GuiObject = setmetatable({}, GuiBase)
- GuiObject.__index = GuiObject
- function GuiObject:Destroy()
- self.DragBegin:disconnect()
- self.DragMove:disconnect()
- self.DragStopped:disconnect()
- self.MouseButton1Click:disconnect()
- self.MouseButton1Down:disconnect()
- self.MouseButton1Up:disconnect()
- self.MouseButton2Down:disconnect()
- self.MouseButton2Up:disconnect()
- self.MouseEnter:disconnect()
- self.MouseLeave:disconnect()
- GuiBase.Destroy(self)
- end
- function GuiObject:GetAbsolutePosition()
- return self.m_base_instance.AbsolutePosition
- end
- function GuiObject:GetAbsoluteSize()
- return self.m_base_instance.AbsoluteSize
- end
- function GuiObject:GetPosition()
- return self.position
- end
- function GuiObject:GetSize()
- return self.size
- end
- function GuiObject:Init()
- GuiBase.Init(self)
- self.mouseDown = false
- self.mouseOver = false
- self.DragBegin = RbxUtility.CreateSignal()
- self.DragMove = RbxUtility.CreateSignal()
- self.DragStopped = RbxUtility.CreateSignal()
- self.MouseButton1Click = RbxUtility.CreateSignal()
- self.MouseButton1Down = RbxUtility.CreateSignal()
- self.MouseButton1Up = RbxUtility.CreateSignal()
- self.MouseButton2Down = RbxUtility.CreateSignal()
- self.MouseButton2Up = RbxUtility.CreateSignal()
- self.MouseEnter = RbxUtility.CreateSignal()
- self.MouseLeave = RbxUtility.CreateSignal()
- end
- function GuiObject:IsA(className)
- return className == "GuiObject" or GuiBase.IsA(self, className)
- end
- function GuiObject:SetActive(active)
- if active ~= self.active then
- self.active = active
- end
- end
- function GuiObject:SetBackgroundTransparency(backgroundTransparency)
- if backgroundTransparency ~= self.backgroundTransparency then
- self.backgroundTransparency = backgroundTransparency
- self.m_base_instance.BackgroundTransparency = backgroundTransparency
- end
- end
- function GuiObject:SetColor(color)
- if color ~= self.color then
- self.color = color
- self.m_base_instance.BackgroundColor3 = color
- end
- end
- function GuiObject:SetPosition(position)
- if position ~= self.position then
- self.position = position
- self.m_base_instance.Position = position
- end
- end
- function GuiObject:SetSize(size)
- if size ~= self.size then
- self.size = size
- self.m_base_instance.Size = size
- end
- end
- function GuiObject:SetVisible(visible)
- if visible ~= self.visible then
- self.visible = visible
- self.m_base_instance.Visible = visible
- end
- end
- function GuiObject:SetZIndex(zIndex)
- local stack = {self.m_base_instance}
- repeat
- local object = stack[#stack]
- stack[#stack] = nil
- for _, child in ipairs(object:GetChildren()) do
- stack[#stack + 1] = child
- end
- object.ZIndex = zIndex
- until #stack == 0
- end
- GuiServiceClass = setmetatable({}, GuiBase)
- GuiServiceClass.__index = GuiServiceClass
- function GuiServiceClass:CreateTextArea(text, font, fontSize, textColor3, textXAlignment, textYAlignment, maxWidth, minWidth)
- local totalHeight = 0
- local frame = Instance.new("Frame")
- frame.BackgroundTransparency = 1
- local label = Instance.new("TextLabel")
- label.BackgroundTransparency = 1
- label.Font = font
- label.FontSize = fontSize
- label.TextColor3 = textColor3
- label.TextTransparency = 1
- label.TextWrapped = true
- label.TextXAlignment = textXAlignment
- label.TextYAlignment = textYAlignment
- label.Parent = self.guiFrame
- local index = 1
- while true do
- local length = #text - index + 1
- if length > 1024 then
- length = 1024
- local textBlock = string.sub(text, index, index + length - 1)
- label.Text = textBlock
- local height = 0
- local width = maxWidth
- repeat
- height = height + 20
- label.Size = UDim2.new(0, width, 0, height)
- until label.TextFits
- repeat
- height = height - 1
- label.Size = UDim2.new(0, width, 0, height)
- until not label.TextFits
- repeat
- length = length - 10
- label.Text = string.sub(text, index, index + length - 1)
- until label.TextFits
- repeat
- length = length + 1
- label.Text = string.sub(text, index, index + length - 1)
- until not label.TextFits
- local overflowCharacter = string.sub(text, index + length - 1, index + length - 1)
- length = length - 1
- label.Text = string.sub(text, index, index + length - 1)
- if overflowCharacter == "\n" then
- index = index + 1
- end
- repeat
- height = height - 1
- label.Size = UDim2.new(0, width, 0, height)
- until not label.TextFits
- height = height + 1
- local blockLabel = label:Clone()
- blockLabel.Position = UDim2.new(0, 0, 0, totalHeight)
- blockLabel.Size = UDim2.new(1, 0, 0, height)
- blockLabel.Parent = frame
- totalHeight = totalHeight + height
- index = index + length
- else
- local textBlock = string.sub(text, index)
- label.Text = textBlock
- local height = 0
- local width = maxWidth
- repeat
- height = height + 20
- label.Size = UDim2.new(0, width, 0, height)
- until label.TextFits
- repeat
- height = height - 1
- label.Size = UDim2.new(0, width, 0, height)
- until not label.TextFits
- height = height + 1
- if index == 1 then
- repeat
- width = width - 10
- label.Size = UDim2.new(0, width, 0, height)
- until width < minWidth or not label.TextFits
- width = math.max(width, minWidth - 1)
- repeat
- width = width + 1
- label.Size = UDim2.new(0, width, 0, height)
- until label.TextFits
- end
- local blockLabel = label:Clone()
- blockLabel.Position = UDim2.new(0, 0, 0, totalHeight)
- blockLabel.Size = UDim2.new(1, 0, 0, height)
- blockLabel.Parent = frame
- label:Destroy()
- frame.Size = UDim2.new(0, width, 0, totalHeight + height)
- return frame
- end
- end
- end
- function GuiServiceClass:Destroy()
- self.running = false
- self.cameraPart:Destroy()
- self.cameraConnection:disconnect()
- self.keyDownConnection:disconnect()
- self.mouseButton1DownConnection:disconnect()
- self.mouseButton1UpConnection:disconnect()
- self.mouseButton2DownConnection:disconnect()
- self.mouseButton2UpConnection:disconnect()
- self.mouseMoveConnection:disconnect()
- self.steppedConnection:disconnect()
- end
- function GuiServiceClass:GetMousePosition()
- local mouse = self.mouse
- return mouse.X, mouse.Y -- mouse.X, mouse.Y + 2 -- return mouse.X - 2, mouse.Y - 3
- end
- function GuiServiceClass:GetTextBounds(text, font, fontSize, alignX, alignY, width)
- local tempLabel = self.tempLabel
- tempLabel.Font = font
- tempLabel.FontSize = fontSize
- tempLabel.Size = UDim2.new(0, width, 0, 4096)
- tempLabel.Text = text
- tempLabel.TextXAlignment = alignX
- tempLabel.TextYAlignment = alignY
- local textBounds = tempLabel.TextBounds
- tempLabel.Text = ""
- return textBounds
- end
- function GuiServiceClass:Init(data)
- GuiBase.Init(self)
- local _ = string.char
- local camera = data.Camera
- local mouse = data.Mouse
- local cameraPart = Instance.new("Part")
- local billboardGui = Instance.new("BillboardGui", cameraPart)
- guiFrame = Instance.new("Frame", billboardGui)
- cameraPart.Anchored = true
- cameraPart.BottomSurface = "Smooth"
- cameraPart.CanCollide = false
- -- cameraPart.CFrame = CFrame.new(16384, 16384, 16384)
- cameraPart.FormFactor = "Custom"
- cameraPart.Locked = true
- cameraPart.Size = Vector3.new(0.2, 0.2, 0.2)
- cameraPart.TopSurface = "Smooth"
- cameraPart.Transparency = 1
- billboardGui.Adornee = cameraPart
- billboardGui.AlwaysOnTop = true
- -- billboardGui.ExtentsOffset = Vector3.new(-16384, -16384, -16384)
- guiFrame.BackgroundTransparency = 1
- cameraPart.Parent = camera
- self.running = true
- self.m_base_instance = guiFrame
- self.billboardGui = billboardGui
- self.cameraPart = cameraPart
- self.tempLabel = RBXInstance.new "TextLabel" {
- BackgroundTransparency = 1,
- TextTransparency = 1,
- TextWrapped = true,
- Parent = guiFrame
- }
- self.mnemonics = {}
- self.visible = true
- self.camera = camera
- self.mouse = mouse
- self.cameraConnection = camera.Changed:connect(function(property)
- self:UpdateView()
- if property == "CameraType" then
- if camera.CameraType ~= Enum.CameraType.Track and camera.CameraType ~= Enum.CameraType.Fixed then
- camera.CameraType = Enum.CameraType.Track
- end
- elseif property == "CoordinateFrame" and camera.CameraType ~= Enum.CameraType.Fixed then
- local cframe, focus = camera.CoordinateFrame, camera.Focus
- local watchOffset = focus.p - cframe.p
- local error = watchOffset.unit - cframe.lookVector
- if error.magnitude >= 1e-3 then
- local head = PlayerControl.GetHead()
- local time1, velocity1
- if head then
- time1 = time()
- velocity1 = head.Velocity
- end
- if camera.Changed:wait() == "CoordinateFrame" then
- local position = cframe.p
- if head then
- local time2 = time()
- local velocity2 = head.Velocity
- position = position + 0.5 * (velocity1 + velocity2) * (time2 - time1)
- end
- camera.CoordinateFrame = CFrame.new(position, camera.Focus.p)
- end
- end
- end
- end)
- self.keyDownConnection = mouse.KeyDown:connect(function(key) self:KeyDown(key) end)
- self.mouseButton1DownConnection = mouse.Button1Down:connect(function() self:MouseButton1Down() end)
- self.mouseButton1UpConnection = mouse.Button1Up:connect(function() self:MouseButton1Up() end)
- self.mouseButton2DownConnection = mouse.Button2Down:connect(function() self:MouseButton2Down() end)
- self.mouseButton2UpConnection = mouse.Button2Up:connect(function() self:MouseButton2Up() end)
- self.mouseMoveConnection = mouse.Move:connect(function() self:MouseMove() end)
- self.steppedConnection = RunService.RenderStepped:connect(function() self:UpdateObjects() self:UpdateView() end)
- self.mousePreviousPosition = Vector2.new(self:GetMousePosition())
- end
- function GuiServiceClass:IsA(className)
- return className == "GuiService" or GuiBase.IsA(self, className)
- end
- function GuiServiceClass:KeyDown(key)
- local mnemonicButton = self.mnemonics[string.upper(key)]
- if mnemonicButton then
- mnemonicButton.Activated:fire()
- end
- end
- function GuiServiceClass:MouseButton1Down()
- local mouse = self.mouse
- local mouseX, mouseY = self:GetMousePosition()
- local stack = {self}
- local dragObjects = {}
- self.dragObjects = dragObjects
- while #stack > 0 do
- local object = stack[#stack]
- stack[#stack] = nil
- if object.visible then
- for child in pairs(object.children) do
- stack[#stack + 1] = child
- end
- if object.active then
- local position = object:GetAbsolutePosition()
- local size = object:GetAbsoluteSize()
- if mouseX >= position.X and mouseY >= position.Y and mouseX < position.X + size.X and mouseY < position.Y + size.Y then
- object.mouseDown = true
- dragObjects[object] = true
- local mouseButton1Down = object.MouseButton1Down
- if mouseButton1Down then
- mouseButton1Down:fire()
- if object.autoButtonColor then
- local color = object.color
- local transparency = object.backgroundTransparency
- object.m_base_instance.BackgroundColor3 = Color3.fromRGB(math.min(color.r + 0.3, 1), math.min(color.g +
- 0.3, 1), math.min(color.b + 0.3, 1))
- object.m_base_instance.BackgroundTransparency = transparency
- end
- end
- object.DragBegin:fire()
- end
- end
- end
- end
- self.mousePreviousPosition = Vector2.new(mouseX, mouseY)
- end
- function GuiServiceClass:MouseButton1Up()
- local mouse = self.mouse
- local mouseX, mouseY = self:GetMousePosition()
- local stack = {self}
- while #stack > 0 do
- local object = stack[#stack]
- stack[#stack] = nil
- if object.visible then
- for child in pairs(object.children) do
- stack[#stack + 1] = child
- end
- if object.active then
- local position = object:GetAbsolutePosition()
- local size = object:GetAbsoluteSize()
- if mouseX >= position.X and mouseY >= position.Y and mouseX < position.X + size.X and mouseY < position.Y + size.Y then
- object.MouseButton1Up:fire()
- end
- end
- end
- end
- local dragObjects = self.dragObjects
- self.dragObjects = nil
- if dragObjects then
- for dragObject in pairs(dragObjects) do
- dragObject.mouseDown = false
- local position = dragObject:GetAbsolutePosition()
- local size = dragObject:GetAbsoluteSize()
- if mouseX >= position.X and mouseY >= position.Y and mouseX < position.X + size.X and mouseY < position.Y + size.Y then
- dragObject.MouseButton1Click:fire()
- local activated = dragObject.Activated
- if activated then
- activated:fire()
- end
- end
- dragObject.DragStopped:fire()
- if dragObject.autoButtonColor then
- if dragObject.mouseOver then
- local color = dragObject.color
- local transparency = dragObject.backgroundTransparency
- dragObject.m_base_instance.BackgroundColor3 = Color3.fromRGB(math.max(color.r - 0.3, 0), math.max(color.g - 0.3, 0),
- math.max(color.b - 0.3, 0))
- dragObject.m_base_instance.BackgroundTransparency = math.max(0, transparency - 0.2)
- else
- dragObject.m_base_instance.BackgroundColor3 = dragObject.color
- dragObject.m_base_instance.BackgroundTransparency = dragObject.backgroundTransparency
- end
- end
- self.dragObject = nil
- end
- end
- end
- function GuiServiceClass:MouseButton2Down()
- local mouse = self.mouse
- local mouseX, mouseY = self:GetMousePosition()
- local stack = {self}
- while #stack > 0 do
- local object = stack[#stack]
- stack[#stack] = nil
- if object.visible then
- for child in pairs(object.children) do
- stack[#stack + 1] = child
- end
- if object.active then
- local position = object:GetAbsolutePosition()
- local size = object:GetAbsoluteSize()
- if mouseX >= position.X and mouseY >= position.Y and mouseX < position.X + size.X and mouseY < position.Y + size.Y then
- local mouseButton2Down = object.MouseButton2Down
- if mouseButton2Down then
- mouseButton2Down:fire()
- end
- end
- end
- end
- end
- self.mousePreviousPosition = Vector2.new(mouseX, mouseY)
- end
- function GuiServiceClass:MouseButton2Up()
- local mouse = self.mouse
- local mouseX, mouseY = self:GetMousePosition()
- local stack = {self}
- while #stack > 0 do
- local object = stack[#stack]
- stack[#stack] = nil
- if object.visible then
- for child in pairs(object.children) do
- stack[#stack + 1] = child
- end
- if object.active then
- local position = object:GetAbsolutePosition()
- local size = object:GetAbsoluteSize()
- if mouseX >= position.X and mouseY >= position.Y and mouseX < position.X + size.X and mouseY < position.Y + size.Y then
- local mouseButton2Up = object.MouseButton2Up
- if mouseButton2Up then
- mouseButton2Up:fire()
- end
- end
- end
- end
- end
- end
- function GuiServiceClass:MouseMove()
- self:UpdateObjects()
- local dragObjects = self.dragObjects
- if dragObjects then
- for dragObject in pairs(dragObjects) do
- local mouse = self.mouse
- local mousePosition = Vector2.new(self:GetMousePosition())
- dragObject.DragMove:fire(mousePosition - self.mousePreviousPosition)
- self.mousePreviousPosition = mousePosition
- end
- end
- end
- function GuiServiceClass:SetMnemonic(mnemonic, button)
- self.mnemonics[mnemonic] = button
- end
- function GuiServiceClass:UpdateObjects()
- local mouse = self.mouse
- local mouseX, mouseY = self:GetMousePosition()
- local stack = {self}
- while #stack > 0 do
- local object = stack[#stack]
- stack[#stack] = nil
- if object.visible then
- for child in pairs(object.children) do
- stack[#stack + 1] = child
- end
- if object.active then
- local position = object:GetAbsolutePosition()
- local size = object:GetAbsoluteSize()
- if mouseX >= position.X and mouseY >= position.Y and mouseX < position.X + size.X and mouseY < position.Y + size.Y then
- if not object.mouseOver then
- object.mouseOver = true
- object.MouseEnter:fire()
- if object.autoButtonColor then
- local color = object.color
- local transparency = object.backgroundTransparency
- if object.mouseDown then
- object.m_base_instance.BackgroundColor3 = Color3.fromRGB(math.min(color.r + 0.3, 1), math.min(color.g + 0.3, 1), math.min(color.b + 0.3, 1))
- object.m_base_instance.BackgroundTransparency = transparency
- else
- object.m_base_instance.BackgroundColor3 = Color3.fromRGB(math.max(color.r - 0.3, 0), math.max(color.g - 0.3, 0), math.max(color.b - 0.3, 0))
- object.m_base_instance.BackgroundTransparency = math.max(0, transparency - 0.2)
- end
- end
- end
- else
- if object.mouseOver then
- object.mouseOver = false
- object.MouseLeave:fire()
- if object.autoButtonColor then
- object.m_base_instance.BackgroundColor3 = object.color
- object.m_base_instance.BackgroundTransparency = object.backgroundTransparency
- end
- end
- end
- end
- end
- end
- end
- function GuiServiceClass:UpdateView()
- local billboardGui = self.billboardGui
- local guiFrame = self.m_base_instance
- local camera = self.camera
- local mouse = self.mouse
- local cameraCFrame = CFrame.new(camera.CoordinateFrame.p, camera.Focus.p) -- camera.CoordinateFrame
- local viewSizeX, viewSizeY = mouse.ViewSizeX, mouse.ViewSizeY
- local previousViewSize = self.viewSize
- if not previousViewSize or ((viewSizeX ~= 0 or viewSizeY ~= 0) and (viewSizeX ~= previousViewSize.X or viewSizeY ~= previousViewSize.Y)) then
- self.viewSize = {X = viewSizeX, Y = viewSizeY}
- local viewSizeUDim2 = UDim2.new(0, viewSizeX, 0, viewSizeY)
- billboardGui.Size = viewSizeUDim2
- guiFrame.Size = viewSizeUDim2
- -- FIXME:
- -- After the 15th of July 2014, there came an offset at the Y thingy out of nowhere so I accomodated for that.
- billboardGui.SizeOffset = Vector2.new(0.5 / viewSizeX, (0.5 + 10) / viewSizeY)
- end
- --billboardGui.SizeOffset = Vector2.new()
- billboardGui.StudsOffset = (cameraCFrame - cameraCFrame.p):inverse() * cameraCFrame.p - Vector3.new(0, 0, 1)
- end
- GuiService = GuiServiceClass:new {
- Camera = Camera,
- Mouse = Mouse
- }
- GuiFrame = setmetatable({}, GuiObject)
- GuiFrame.__index = GuiFrame
- GuiFrame.__default = {__index = {
- Active = false,
- BackgroundTransparency = 0.75,
- BorderSize = 4,
- BorderTransparency = 0.75,
- Color = AdvancedGUI.GUI_BASE_COLOR,
- Position = UDim2.new(0, 0, 0, 0),
- Size = UDim2.new(0, 52, 0, 52),
- Visible = true
- }}
- function GuiFrame:Destroy()
- GuiObject.Destroy(self)
- end
- function GuiFrame:GetContentInstance()
- return self.m_content_frame
- end
- function GuiFrame:Init(data)
- GuiObject.Init(self)
- setmetatable(data, GuiFrame.__default)
- local leftBorderFrameLeft = RBXInstance.new "Frame" {
- BackgroundColor3 = Color3.fromRGB(0, 0, 0),
- BorderSizePixel = 0,
- Size = UDim2.new(0, 1, 1, -1)
- }
- local leftBorderFrameCenter = RBXInstance.new "Frame" {
- BackgroundColor3 = Color3.fromRGB(1, 1, 1),
- BorderSizePixel = 0,
- Position = UDim2.new(0, 1, 0, 1)
- }
- local leftBorderFrameRight = RBXInstance.new "Frame" {
- BackgroundColor3 = Color3.fromRGB(0, 0, 0),
- BorderSizePixel = 0
- }
- local rightBorderFrameRight = RBXInstance.new "Frame" {
- BackgroundColor3 = Color3.fromRGB(0, 0, 0),
- BorderSizePixel = 0,
- Position = UDim2.new(1, -1, 0, 1),
- Size = UDim2.new(0, 1, 1, -1)
- }
- local rightBorderFrameCenter = RBXInstance.new "Frame" {
- BackgroundColor3 = Color3.fromRGB(1, 1, 1),
- BorderSizePixel = 0
- }
- local rightBorderFrameLeft = RBXInstance.new "Frame" {
- BackgroundColor3 = Color3.fromRGB(0, 0, 0),
- BorderSizePixel = 0
- }
- local bottomBorderFrameBottom = RBXInstance.new "Frame" {
- BackgroundColor3 = Color3.fromRGB(0, 0, 0),
- BorderSizePixel = 0,
- Position = UDim2.new(0, 0, 1, -1),
- Size = UDim2.new(1, -1, 0, 1)
- }
- local bottomBorderFrameCenter = RBXInstance.new "Frame" {
- BackgroundColor3 = Color3.fromRGB(1, 1, 1),
- BorderSizePixel = 0
- }
- local bottomBorderFrameTop = RBXInstance.new "Frame" {
- BackgroundColor3 = Color3.fromRGB(0, 0, 0),
- BorderSizePixel = 0
- }
- local topBorderFrameTop = RBXInstance.new "Frame" {
- BackgroundColor3 = Color3.fromRGB(0, 0, 0),
- BorderSizePixel = 0,
- Position = UDim2.new(0, 1, 0, 0),
- Size = UDim2.new(1, -1, 0, 1)
- }
- local topBorderFrameCenter = RBXInstance.new "Frame" {
- BackgroundColor3 = Color3.fromRGB(1, 1, 1),
- BorderSizePixel = 0
- }
- local topBorderFrameBottom = RBXInstance.new "Frame" {
- BackgroundColor3 = Color3.fromRGB(0, 0, 0),
- BorderSizePixel = 0
- }
- local border_frame = RBXInstance.new "Frame" {
- BackgroundTransparency = 1,
- Size = UDim2.new(1, 0, 1, 0),
- leftBorderFrameLeft,
- leftBorderFrameCenter,
- leftBorderFrameRight,
- rightBorderFrameLeft,
- rightBorderFrameCenter,
- rightBorderFrameRight,
- bottomBorderFrameBottom,
- bottomBorderFrameCenter,
- bottomBorderFrameTop,
- topBorderFrameBottom,
- topBorderFrameCenter,
- topBorderFrameTop
- }
- local contentFrame = RBXInstance.new "Frame" {
- BackgroundTransparency = 1,
- BorderSizePixel = 0,
- ClipsDescendants = true,
- Size = UDim2.new(1, 0, 1, 0)
- }
- local base_frame = RBXInstance.new "Frame" {
- BorderSizePixel = 0,
- border_frame,
- contentFrame
- }
- self.m_base_instance = base_frame
- self.m_content_frame = contentFrame
- self.m_border_frame = border_frame
- self.leftBorderFrameLeft = leftBorderFrameLeft
- self.leftBorderFrameCenter = leftBorderFrameCenter
- self.leftBorderFrameRight = leftBorderFrameRight
- self.rightBorderFrameLeft = rightBorderFrameLeft
- self.rightBorderFrameCenter = rightBorderFrameCenter
- self.rightBorderFrameRight = rightBorderFrameRight
- self.bottomBorderFrameBottom = bottomBorderFrameBottom
- self.bottomBorderFrameCenter = bottomBorderFrameCenter
- self.bottomBorderFrameTop = bottomBorderFrameTop
- self.topBorderFrameBottom = topBorderFrameBottom
- self.topBorderFrameCenter = topBorderFrameCenter
- self.topBorderFrameTop = topBorderFrameTop
- self:SetActive(data.Active)
- self:SetBackgroundTransparency(data.BackgroundTransparency)
- self:SetBorderSize(data.BorderSize)
- self:SetBorderTransparency(data.BorderTransparency)
- self:SetColor(data.Color)
- self:SetPosition(data.Position)
- self:SetSize(data.Size)
- self:SetVisible(data.Visible)
- self:SetParent(data.Parent)
- end
- function GuiFrame:IsA(className)
- return className == "GuiFrame" or GuiObject.IsA(self, className)
- end
- function GuiFrame:SetBorderSize(border_size)
- border_size = math.max(math.floor(border_size + 0.5), 0)
- if border_size ~= self.m_border_size then
- self.m_border_size = border_size
- local border_frame = self.m_border_frame
- local contentFrame = self.m_content_frame
- local leftBorderFrameCenter = self.leftBorderFrameCenter
- local leftBorderFrameRight = self.leftBorderFrameRight
- local rightBorderFrameCenter = self.rightBorderFrameCenter
- local rightBorderFrameLeft = self.rightBorderFrameLeft
- local bottomBorderFrameCenter = self.bottomBorderFrameCenter
- local bottomBorderFrameTop = self.bottomBorderFrameTop
- local topBorderFrameCenter = self.topBorderFrameCenter
- local topBorderFrameBottom = self.topBorderFrameBottom
- contentFrame.Position = UDim2.new(0, border_size, 0, border_size)
- contentFrame.Size = UDim2.new(1, -2 * border_size, 1, -2 * border_size)
- local inner_visible = border_size > 0
- if self.leftBorderFrameLeft.Visible ~= inner_visible then
- self.rightBorderFrameRight.Visible = inner_visible
- self.bottomBorderFrameBottom.Visible = inner_visible
- self.topBorderFrameTop.Visible = inner_visible
- end
- local outer_visible = border_size > 1
- if leftBorderFrameCenter.Visible ~= outer_visible then
- leftBorderFrameCenter.Visible = outer_visible
- leftBorderFrameRight.Visible = outer_visible
- rightBorderFrameCenter.Visible = outer_visible
- rightBorderFrameLeft.Visible = outer_visible
- bottomBorderFrameCenter.Visible = outer_visible
- bottomBorderFrameTop.Visible = outer_visible
- topBorderFrameCenter.Visible = outer_visible
- topBorderFrameBottom.Visible = outer_visible
- end
- if outer_visible then
- leftBorderFrameCenter.Size = UDim2.new(0, border_size - 2, 1, -border_size)
- leftBorderFrameRight.Position = UDim2.new(0, border_size - 1, 0, border_size - 1)
- leftBorderFrameRight.Size = UDim2.new(0, 1, 1, 1 - 2 * border_size)
- rightBorderFrameCenter.Position = UDim2.new(1, 1 - border_size, 0, border_size - 1)
- rightBorderFrameCenter.Size = UDim2.new(0, border_size - 2, 1, -border_size)
- rightBorderFrameLeft.Position = UDim2.new(1, -border_size, 0, border_size)
- rightBorderFrameLeft.Size = UDim2.new(0, 1, 1, 1 - 2 * border_size)
- bottomBorderFrameCenter.Position = UDim2.new(0, 1, 1, 1 - border_size)
- bottomBorderFrameCenter.Size = UDim2.new(1, -border_size, 0, border_size - 2)
- bottomBorderFrameTop.Position = UDim2.new(0, border_size - 1, 1, -border_size)
- bottomBorderFrameTop.Size = UDim2.new(1, 1 - 2 * border_size, 0, 1)
- topBorderFrameCenter.Position = UDim2.new(0, border_size - 1, 0, 1)
- topBorderFrameCenter.Size = UDim2.new(1, -border_size, 0, border_size - 2)
- topBorderFrameBottom.Position = UDim2.new(0, border_size, 0, border_size - 1)
- topBorderFrameBottom.Size = UDim2.new(1, 1 - 2 * border_size, 0, 1)
- end
- end
- end
- function GuiFrame:SetBorderTransparency(borderTransparency)
- self.borderTransparency = borderTransparency
- self.leftBorderFrameLeft.BackgroundTransparency = borderTransparency
- self.leftBorderFrameCenter.BackgroundTransparency = borderTransparency
- self.leftBorderFrameRight.BackgroundTransparency = borderTransparency
- self.rightBorderFrameLeft.BackgroundTransparency = borderTransparency
- self.rightBorderFrameCenter.BackgroundTransparency = borderTransparency
- self.rightBorderFrameRight.BackgroundTransparency = borderTransparency
- self.bottomBorderFrameBottom.BackgroundTransparency = borderTransparency
- self.bottomBorderFrameCenter.BackgroundTransparency = borderTransparency
- self.bottomBorderFrameTop.BackgroundTransparency = borderTransparency
- self.topBorderFrameBottom.BackgroundTransparency = borderTransparency
- self.topBorderFrameCenter.BackgroundTransparency = borderTransparency
- self.topBorderFrameTop.BackgroundTransparency = borderTransparency
- end
- GuiButton = setmetatable({}, GuiFrame)
- GuiButton.__index = GuiButton
- GuiButton.__default = {__index = {
- AutoButtonColor = true
- }}
- function GuiButton:Destroy()
- self.Activated:disconnect()
- GuiFrame.Destroy(self)
- end
- function GuiButton:Init(data)
- if data.Active == nil then
- data.Active = true
- end
- GuiFrame.Init(self, data)
- setmetatable(data, GuiButton.__default)
- self.Activated = RbxUtility.CreateSignal()
- self:SetAutoButtonColor(data.AutoButtonColor)
- end
- function GuiButton:IsA(className)
- return className == "GuiButton" or GuiFrame.IsA(self, className)
- end
- function GuiButton:SetAutoButtonColor(autoButtonColor)
- if autoButtonColor ~= self.autoButtonColor then
- self.autoButtonColor = autoButtonColor
- if autoButtonColor then
- if self.mouseOver then
- local color = self.color
- local transparency = self.backgroundTransparency
- if self.mouseDown then
- self.m_base_instance.BackgroundColor3 = Color3.fromRGB(math.min(color.r + 0.3, 1), math.min(color.g + 0.3, 1), math.min(color.b + 0.3, 1))
- self.m_base_instance.BackgroundTransparency = transparency
- else
- self.m_base_instance.BackgroundColor3 = Color3.fromRGB(math.max(color.r - 0.3, 0), math.max(color.g - 0.3, 0), math.max(color.b - 0.3, 0))
- self.m_base_instance.BackgroundTransparency = math.max(0, transparency - 0.5)
- end
- end
- else
- self.m_base_instance.BackgroundColor3 = self.color
- end
- end
- end
- GuiTextLabel = setmetatable({}, GuiFrame)
- GuiTextLabel.__index = GuiTextLabel
- GuiTextLabel.__default = {__index = {
- Font = "ArialBold",
- FontSize = "Size12",
- Text = "",
- TextColor = Color3.fromRGB(1, 1, 1),
- TextStrokeColor = Color3.fromRGB(0, 0, 0),
- TextStrokeTransparency = 0.6,
- TextWrapped = true
- }}
- function GuiTextLabel:Destroy()
- GuiFrame.Destroy(self)
- end
- function GuiTextLabel:Init(data)
- GuiFrame.Init(self, data)
- setmetatable(data, GuiTextLabel.__default)
- local base_instance = self.m_base_instance
- local textLabel = RBXInstance.new "TextLabel" {
- BackgroundTransparency = 1,
- Font = data.Font,
- FontSize = data.FontSize,
- TextColor3 = data.TextColor3,
- TextStrokeColor3 = data.TextStrokeColor3,
- TextStrokeTransparency = data.TextStrokeTransparency,
- TextWrapped = data.TextWrapped
- }
- textLabel.Parent = self:GetContentInstance()
- self.textLabel = textLabel
- self:SetText(data.Text)
- end
- function GuiTextLabel:IsA(className)
- return className == "GuiTextLabel" or GuiFrame.IsA(self, className)
- end
- function GuiTextLabel:SetText(text)
- if text ~= self.text then
- self.text = text
- local text_index = 1
- local content_instance = self:GetContentInstance()
- local content_instance_size = content_instance.AbsoluteSize
- local frame = Instance.new("Frame")
- frame.BackgroundTransparency = 1
- local label = Instance.new("TextLabel")
- label.BackgroundTransparency = 1
- label.Font = font
- label.FontSize = fontSize
- label.Size = UDim2.new(0, content_instance_size.X, 0, 1000)
- label.Text = ""
- label.TextColor3 = textColor3
- label.TextTransparency = 1
- label.TextWrapped = true
- label.TextXAlignment = textXAlignment
- label.TextYAlignment = textYAlignment
- label.Parent = self.guiFrame
- local row_length = 0
- local step_size = 256
- for step = 1, 8 do
- step_size = 0.5 * step_size
- label.Text = string.sub(text, text_index, text_index + row_length - 1)
- end
- end
- end
- GuiImageButton = setmetatable({}, GuiButton)
- GuiImageButton.__index = GuiImageButton
- GuiImageButton.__default = {__index = {
- Image = ""
- }}
- function GuiImageButton:Destroy()
- GuiButton.Destroy(self)
- end
- function GuiImageButton:Init(data)
- GuiButton.Init(self, data)
- setmetatable(data, GuiImageButton.__default)
- local content_frame = self.m_content_frame
- local image_label = RBXInstance.new "ImageLabel" {
- BackgroundTransparency = 1,
- Size = UDim2.new(1, 0, 1, 0)
- }
- image_label.Parent = content_frame
- self.m_image_label = image_label
- self:SetImage(data.Image)
- end
- function GuiImageButton:IsA(className)
- return className == "GuiImageButton" or GuiButton.IsA(self, className)
- end
- function GuiImageButton:SetImage(image)
- if image ~= self.m_image then
- self.m_image = image
- self.m_image_label.Image = image
- end
- end
- GuiTextButton = setmetatable({}, GuiButton)
- GuiTextButton.__index = GuiTextButton
- GuiTextButton.__default = {__index = {
- Font = Enum.Font.ArialBold,
- FontSize = Enum.FontSize.Size11,
- Text = "Button",
- TextXAlignment = Enum.TextXAlignment.Center
- }}
- function GuiTextButton:Destroy()
- GuiButton.Destroy(self)
- end
- function GuiTextButton:GetTextBounds()
- return self.textLabel.TextBounds
- end
- function GuiTextButton:Init(data)
- GuiButton.Init(self, data)
- setmetatable(data, GuiTextButton.__default)
- local contentFrame = self.m_content_frame
- local mnemonicLabel = RBXInstance.new "TextLabel" {
- BackgroundTransparency = 1,
- Font = "ArialBold",
- FontSize = "Size36",
- Size = UDim2.new(1, 0, 0.7, 0),
- TextColor3 = Color3.fromRGB(1, 1, 1),
- TextStrokeColor3 = Color3.fromRGB(0, 0, 0),
- TextStrokeTransparency = 0.6,
- TextWrapped = true
- }
- local textLabel = RBXInstance.new "TextLabel" {
- BackgroundTransparency = 1,
- TextColor3 = Color3.fromRGB(1, 1, 1),
- TextStrokeColor3 = Color3.fromRGB(0, 0, 0),
- TextStrokeTransparency = 0.6,
- TextWrapped = true
- }
- mnemonicLabel.Parent = contentFrame
- textLabel.Parent = contentFrame
- self.mnemonicLabel = mnemonicLabel
- self.textLabel = textLabel
- self:SetFont(data.Font)
- self:SetFontSize(data.FontSize)
- self:SetMnemonic(data.Mnemonic, true)
- self:SetText(data.Text)
- self:SetTextXAlignment(data.TextXAlignment)
- end
- function GuiTextButton:IsA(className)
- return className == "GuiTextButton" or GuiButton.IsA(self, className)
- end
- function GuiTextButton:SetFont(font)
- if font ~= self.font then
- self.font = font
- self.textLabel.Font = font
- end
- end
- function GuiTextButton:SetFontSize(fontSize)
- if fontSize ~= self.fontSize then
- self.fontSize = fontSize
- self.textLabel.FontSize = fontSize
- end
- end
- function GuiTextButton:SetMnemonic(mnemonic, forceUpdate)
- if mnemonic ~= self.mnemonic or forceUpdate then
- if self.mnemonic then
- GuiService:SetMnemonic(self.mnemonic, nil)
- end
- if mnemonic then
- GuiService:SetMnemonic(mnemonic, self)
- end
- self.mnemonic = mnemonic
- local mnemonicLabel = self.mnemonicLabel
- local textLabel = self.textLabel
- if mnemonic then
- mnemonicLabel.Text = mnemonic
- textLabel.Size = UDim2.new(1, 0, 0.9, 0)
- textLabel.TextYAlignment = "Bottom"
- else
- mnemonicLabel.Text = ""
- textLabel.Size = UDim2.new(1, 0, 1, 0)
- textLabel.TextYAlignment = "Center"
- end
- end
- end
- function GuiTextButton:SetText(text)
- if text ~= self.text then
- self.text = text
- self.textLabel.Text = text
- end
- end
- function GuiTextButton:SetTextXAlignment(textXAlignment)
- if textXAlignment ~= self.textXAlignment then
- self.textXAlignment = textXAlignment
- self.textLabel.TextXAlignment = textXAlignment
- end
- end
- GuiWindow = setmetatable({}, GuiObject)
- GuiWindow.__index = GuiWindow
- GuiWindow.__default = {__index = {
- Active = true,
- BackgroundTransparency = 0.5,
- BorderSize = 4,
- BorderTransparency = 0.5,
- Position = UDim2.new(0, 0, 0, 0),
- Size = UDim2.new(0, 360, 0, 240),
- Title = "Window",
- TitleBarBackgroundTransparency = 0.5,
- TitleBarBorderTransparency = 1,
- Visible = true
- }}
- function GuiWindow:Init(data)
- GuiObject.Init(self)
- setmetatable(data, GuiFrame.__default)
- local title_bar = GuiTextLabel:new {
- BackgroundTransparency = data.TitleBarBackgroundTransparency,
- BorderTransparency = data.TitleBarBackgroundTransparency,
- Text = data.Title
- }
- local content_frame = GuiFrame:new {
- Active = data.Active,
- BackgroundTransparency = data.BackgroundTransparency,
- BorderSize = data.BorderSize,
- BorderTransparency = data.BorderTransparency
- }
- local base_frame = RBXInstance.new "Frame" {
- BackgroundTransparency = 1,
- BorderSizePixel = 0,
- Position = data.Position,
- Size = data.Size,
- Visible = data.Visible
- }
- self.m_base_frame = base_frame
- self.m_content_frame = content_frame
- self.m_title_bar = title_bar
- end
- function GuiWindow:IsA(className)
- return className == "GuiWindow" or GuiObject.IsA(self, className)
- end
- GuiScrollFrame = setmetatable({}, GuiFrame)
- GuiScrollFrame.__index = GuiScrollFrame
- GuiScrollFrame.__default = {__index = {
- ContentHeight = 0,
- ScrollBarColor = Color3.fromRGB(1, 1, 1)
- }}
- function GuiScrollFrame:Destroy()
- self.m_scroll_bar:Destroy()
- GuiFrame.Destroy(self)
- end
- function GuiScrollFrame:GetContentInstance()
- return self.m_scroll_frame or GuiFrame.GetContentInstance(self)
- end
- function GuiScrollFrame:Init(data)
- GuiFrame.Init(self, data)
- setmetatable(data, GuiScrollFrame.__default)
- local scroll_pane = RBXInstance.new "Frame" {
- BackgroundColor3 = Color3.fromRGB(1, 1, 1),
- BackgroundTransparency = 0.8,
- BorderSizePixel = 0,
- Position = UDim2.new(1, -20, 0, 0),
- Size = UDim2.new(0, 20, 1, 0),
- Parent = self.m_content_frame
- }
- local scroll_bar = GuiFrame:new {
- Active = true,
- BackgroundTransparency = 0.6,
- BorderTransparency = 0.6,
- Color = data.ScrollBarColor,
- Parent = self
- }
- local scroll_frame = RBXInstance.new "Frame" {
- BackgroundTransparency = 1,
- Parent = self.m_content_frame
- }
- self.m_scroll_bar = scroll_bar
- self.m_scroll_frame = scroll_frame
- self.m_scroll_pane = scroll_pane
- self.m_scroll_position = 0
- self.m_updating_content_height = false
- self:SetContentHeight(data.ContentHeight)
- self:UpdateScrollPosition()
- self.m_scroll_bar.DragBegin:connect(function()
- self.m_scroll_drag_total = Vector2.new()
- self.m_scroll_initial_position = self.m_scroll_position
- end)
- self.m_scroll_bar.DragMove:connect(function(offset)
- self.m_scroll_drag_total = self.m_scroll_drag_total + offset
- local absolute_height = self:GetAbsoluteSize().Y - 2 * self.m_border_size
- if absolute_height ~= 0 then
- local content_height = math.max(self.m_content_height, absolute_height)
- local scroll_space = 1 - absolute_height / content_height
- self:Scroll(self.m_scroll_initial_position + self.m_scroll_drag_total.Y * (content_height / absolute_height - 1) / scroll_space)
- end
- end)
- end
- function GuiScrollFrame:IsA(className)
- return className == "GuiScrollFrame" or GuiFrame.IsA(self, className)
- end
- function GuiScrollFrame:Scroll(position)
- position = math.min(math.max(position, 0), self.m_content_height - (self:GetAbsoluteSize().Y - 2 * self.m_border_size))
- if position ~= self.m_scroll_position then
- self.m_scroll_position = position
- self:UpdateScrollPosition()
- end
- end
- function GuiScrollFrame:SetContentHeight(height)
- if height ~= self.m_content_height then
- local prev_height = self.m_content_height
- self.m_content_height = height
- if not self.m_updating_content_height then
- self.m_updating_content_height = true
- coroutine.resume(coroutine.create(function()
- local success, message = ypcall(self.SetContentHeightImpl1, self, prev_height)
- if not success then
- Logger.printf("Severe", "Error in GuiScrollFrame:SetContentHeight(%s): %s", Utility.ToString(height), message)
- end
- end))
- end
- end
- end
- function GuiScrollFrame:SetContentHeightImpl1(prev_height)
- RunService.RenderStepped:wait()
- self.m_updating_content_height = false
- local height = self.m_content_height
- self.m_scroll_frame.Size = UDim2.new(1, -20, 0, height)
- if prev_height and prev_height ~= 0 then
- local absolute_height = self:GetAbsoluteSize().Y - 2 * self.m_border_size
- if self.m_scroll_position == prev_height - absolute_height then
- self.m_scroll_position = height - absolute_height
- else
- self.m_scroll_position = height * self.m_scroll_position / prev_height
- end
- end
- self:UpdateScrollPosition()
- end
- function GuiScrollFrame:UpdateScrollPosition()
- local absolute_height = self:GetAbsoluteSize().Y - 2 * self.m_border_size
- if absolute_height == 0 then
- absolute_height = self.m_content_height
- end
- local scroll_bar = self.m_scroll_bar
- local scroll_frame = self.m_scroll_frame
- local scroll_pane = self.m_scroll_pane
- local content_height = math.max(self.m_content_height, absolute_height)
- if absolute_height == content_height then
- scroll_frame.Position = UDim2.new(0, 0, 0, 0)
- scroll_frame.Size = UDim2.new(1, 0, 1, 0)
- scroll_bar:SetVisible(false)
- scroll_pane.Visible = false
- else
- local contentScale = content_height / absolute_height
- local scroll_space = 1 - absolute_height / content_height
- local scroll_position = self.m_scroll_position
- scroll_frame.Position = UDim2.new(0, 0, 0, -scroll_position)
- scroll_bar:SetPosition(UDim2.new(1, -20, scroll_position / (content_height - absolute_height) * scroll_space, 0))
- scroll_bar:SetSize(UDim2.new(0, 20, absolute_height / content_height, 0))
- scroll_bar:SetVisible(true)
- scroll_pane.Visible = true
- end
- end
- GuiMenu = setmetatable({}, GuiFrame)
- GuiMenu.__index = GuiMenu
- GuiMenu.__default = {__index = {
- VerticalSpacing = 18
- }}
- function GuiMenu:AddItem(text, onClick, options)
- local frameSize = self:GetSize()
- local frameHeight = frameSize.Y.Offset - self.m_border_size * 2
- local verticalSpacing = self.verticalSpacing
- local properties = {
- BackgroundTransparency = 0.75,
- BorderSize = 0,
- BorderTransparency = 1,
- Color = (#self.menuItems % 2 == 1) and Color3.fromRGB(0.25, 0.25, 0.25) or Color3.fromRGB(0, 0, 0),
- FontSize = Enum.FontSize.Size12,
- Position = UDim2.new(0, 0, 0, frameHeight),
- Size = UDim2.new(1, 0, 0, verticalSpacing),
- Text = text,
- Parent = self
- }
- if options then
- for key, value in pairs(options) do
- properties[key] = value
- end
- end
- local menuItem = GuiTextButton:new(properties)
- if onClick then
- menuItem.Activated:connect(function()
- if not onClick(text, self) then
- self:Destroy()
- end
- end)
- end
- self.menuItems[#self.menuItems + 1] = menuItem
- self:SetSize(frameSize + UDim2.new(0, 0, 0, verticalSpacing))
- end
- function GuiMenu:ClearItems()
- local menuItems = self.menuItems
- for _, item in ipairs(menuItems) do
- menuItems[item] = nil
- item:Destroy()
- end
- local frameSize = self:GetSize()
- self:SetSize(frameSize + UDim2.new(0, 0, 0, self.m_border_size * 2 - frameSize.Y.Offset))
- end
- function GuiMenu:Destroy()
- self:ClearItems()
- GuiFrame.Destroy(self)
- end
- function GuiMenu:Init(data)
- GuiFrame.Init(self, data)
- setmetatable(data, GuiMenu.__default)
- self.menuItems = {}
- self.verticalSpacing = data.VerticalSpacing
- end
- function GuiMenu:IsA(className)
- return className == "GuiMenu" or GuiFrame.IsA(self, className)
- end
- GuiTextList = setmetatable({}, GuiScrollFrame)
- GuiTextList.__index = GuiTextList
- GuiTextList.__default = {__index = {
- }}
- function GuiTextList:AddItem(text, options)
- local properties = {
- BackgroundTransparency = 1,
- Font = "ArialBold",
- FontSize = "Size12",
- Position = UDim2.new(0, 4, 0, self.m_content_height),
- Size = UDim2.new(1, -8, 0, 12),
- Text = tostring(text),
- TextColor3 = Color3.fromRGB(1, 1, 1),
- TextStrokeTransparency = 0.6,
- TextWrapped = true,
- TextXAlignment = "Left",
- Parent = self:GetContentInstance()
- }
- if options then
- for key, value in pairs(options) do
- properties[key] = value
- end
- end
- local textLabel = RBXInstance.new "TextLabel" (properties)
- textLabel.Size = UDim2.new(1, 0, 0, textLabel.TextBounds.Y)
- self.listItems[#self.listItems + 1] = textLabel
- self:SetContentHeight(self.m_content_height + textLabel.TextBounds.Y)
- end
- function GuiTextList:ClearItems()
- local listItems = self.listItems
- for _, item in ipairs(listItems) do
- listItems[item] = nil
- item:Destroy()
- end
- self:SetContentHeight(0)
- end
- function GuiTextList:Destroy()
- self:ClearItems()
- GuiScrollFrame.Destroy(self)
- end
- function GuiTextList:Init(data)
- GuiScrollFrame.Init(self, data)
- self.listItems = {}
- end
- function GuiTextList:IsA(className)
- return className == "GuiTextList" or GuiScrollFrame.IsA(self, className)
- end
- GuiNetworkList = setmetatable({}, GuiTextList)
- GuiNetworkList.__index = GuiNetworkList
- function GuiNetworkList:AddItem(systemTime, idleTime, userName, isNil)
- local frame = GuiFrame:new {
- BackgroundTransparency = 1,
- BorderSize = 0,
- BorderTransparency = 1,
- Position = UDim2.new(0, 4, 0, self.m_content_height),
- Size = UDim2.new(1, -8, 0, 14),
- }
- local systemTimeColor
- if string.sub(systemTime, 1, 1) == "?" then
- systemTimeColor = Color3.fromRGB(1, 0.75, 0.75)
- else
- systemTimeColor = Color3.fromRGB(0.75, 0.75, 1)
- end
- local systemTimeLabel = RBXInstance.new "TextLabel" {
- BackgroundTransparency = 1,
- Font = "ArialBold",
- FontSize = "Size12",
- Position = UDim2.new(0, 0, 0, 0),
- Size = UDim2.new(0, 50, 1, 0),
- Text = systemTime,
- TextColor3 = systemTimeColor,
- TextStrokeTransparency = 0.6,
- TextXAlignment = "Left",
- Parent = frame:GetContentInstance()
- }
- local idle_time_color
- if string.sub(idleTime, 1, 1) == "0" then
- idle_time_color = Color3.fromRGB(1, 1, 1)
- else
- idle_time_color = Color3.fromRGB(1, 0.75, 0.75)
- end
- local idleTimeLabel = RBXInstance.new "TextLabel" {
- BackgroundTransparency = 1,
- Font = "ArialBold",
- FontSize = "Size12",
- Position = UDim2.new(0, 40, 0, 0),
- Size = UDim2.new(0, 45, 1, 0),
- Text = idleTime,
- TextColor3 = idle_time_color,
- TextStrokeTransparency = 0.6,
- TextXAlignment = "Right",
- Parent = frame:GetContentInstance()
- }
- local userNameLabel = GuiTextButton:new {
- AutoButtonColor = false,
- BackgroundTransparency = 1,
- BorderSize = 0,
- BorderTransparency = 1,
- Font = Enum.Font.SourceSansBold,
- FontSize = Enum.FontSize.Size14,
- Position = UDim2.new(0, 98, 0, 0),
- Size = UDim2.new(1, -98, 1, 0),
- TextXAlignment = Enum.TextXAlignment.Left,
- Text = userName,
- Parent = frame
- }
- frame:SetParent(self)
- local userNameWidth = userNameLabel:GetTextBounds().X
- userNameLabel:SetSize(UDim2.new(0, userNameWidth + 4, 1, 0))
- if isNil then
- local isNilLabel = RBXInstance.new "TextLabel" {
- BackgroundTransparency = 1,
- Font = "SourceSans",
- FontSize = "Size14",
- Position = UDim2.new(0, 100 + userNameWidth + 8, 0, 0),
- Size = UDim2.new(0, 50, 1, 0),
- Text = "(nil)",
- TextColor3 = Color3.fromRGB(1, 0.4, 0.4),
- TextStrokeTransparency = 0.6,
- TextXAlignment = "Left",
- Parent = frame:GetContentInstance()
- }
- end
- self.listItems[#self.listItems + 1] = frame
- self:SetContentHeight(self.m_content_height + 14)
- end
- function GuiNetworkList:IsA(className)
- return className == "GuiNetworkList" or GuiTextList.IsA(self, className)
- end
- GuiTextOutput = setmetatable({}, GuiScrollFrame)
- GuiTextOutput.__index = GuiTextOutput
- GuiTextOutput.__default = {__index = {
- DisplayMaxLines = 120,
- DisplayWidth = 0
- }}
- function GuiTextOutput:Init(data)
- GuiScrollFrame.Init(self, data)
- setmetatable(data, GuiTextOutput.__default)
- self.displayMaxLines = data.DisplayMaxLines
- self.displayWidth = data.DisplayWidth
- self.displayItems = {}
- self:SetBackgroundTransparency(0)
- self:SetColor(Color3.fromRGB(1, 1, 1))
- self.m_scroll_pane.BackgroundColor3 = Color3.fromRGB(0.5, 0.5, 0.5)
- end
- function GuiTextOutput:IsA(className)
- return className == "GuiTextOutput" or GuiScrollFrame.IsA(self, className)
- end
- function GuiTextOutput:Print(...)
- self:PrintFormat(nil, ...)
- end
- function GuiTextOutput:PrintFormat(options, ...)
- local buffer = {}
- local args = {...}
- local first = true
- for i = 1, select("#", ...) do
- buffer[i] = tostring(args[i])
- end
- message = Utility.BlockRobloxFilter(table.concat(buffer, "\t"))
- local properties = {
- BackgroundTransparency = 1,
- Font = "ArialBold",
- FontSize = "Size12",
- Position = UDim2.new(0, 4, 0, self.m_content_height),
- Text = message,
- TextColor3 = Color3.fromRGB(1, 1, 1),
- TextWrapped = true,
- TextXAlignment = "Left",
- TextYAlignment = "Bottom",
- Parent = self:GetContentInstance()
- }
- if options then
- for key, value in pairs(options) do
- properties[key] = value
- end
- end
- local textBounds = GuiService:GetTextBounds(message, properties.Font, properties.FontSize, properties.TextXAlignment, properties.TextYAlignment,
- self.displayWidth - 20)
- local textHeight = textBounds.Y
- properties.Size = UDim2.new(0, self.displayWidth - 8, 0, textBounds.Y)
- local textLabel = RBXInstance.new "TextLabel" (properties)
- self.displayItems[#self.displayItems + 1] = textLabel
- local maxLines = self.displayMaxLines
- local maxHeight = maxLines * 12
- local newHeight = self.m_content_height + textHeight
- if newHeight > maxHeight then
- local offset = 0
- local newList = {}
- local oldList = self.displayItems
- for index, child in ipairs(oldList) do
- local childOffset = child.Size.Y.Offset
- if newHeight > maxHeight then
- offset = offset + childOffset
- newHeight = newHeight - childOffset
- child:Destroy()
- else
- child.Position = child.Position - UDim2.new(0, 0, 0, offset)
- newList[#newList + 1] = child
- end
- end
- self.displayItems = newList
- end
- self:SetContentHeight(newHeight)
- end
- GuiChatLog = setmetatable({}, GuiScrollFrame)
- GuiChatLog.__index = GuiChatLog
- GuiChatLog.__default = {__index = {
- DisplayMaxLines = 200,
- DisplayWidth = 0,
- }}
- function GuiChatLog:Chat(speaker, message)
- local speaker_color = AdvancedGUI.GenerateChatColor(speaker)
- speaker = Utility.BlockRobloxFilter(speaker)
- message = "\t\t\t\t\t\t\t\t\t\t\t\t\t\t\t" .. Utility.BlockRobloxFilter(message)
- local timestamp = Utility.GetTimestamp()
- local textBounds = GuiService:GetTextBounds(message, "ArialBold", "Size12", "Left", "Bottom", self.displayWidth - 8)
- local textHeight = math.max(math.min(textBounds.Y, 36), 12)
- local message_frame = RBXInstance.new "Frame" {
- BackgroundTransparency = 1,
- Position = UDim2.new(0, 0, 0, self.m_content_height),
- Size = UDim2.new(0, self.displayWidth, 0, textHeight),
- Parent = self:GetContentInstance()
- }
- local timestamp_label = RBXInstance.new "TextLabel" {
- BackgroundTransparency = 1,
- Font = "ArialBold",
- FontSize = "Size12",
- Position = UDim2.new(0, 4, 0, 0),
- Size = UDim2.new(1, -8, 0, 12),
- Text = timestamp,
- TextColor3 = Color3.fromRGB(0.75, 0.75, 0.75),
- TextStrokeTransparency = 0.6,
- TextWrapped = true,
- TextXAlignment = "Left",
- Parent = message_frame
- }
- local speaker_label = RBXInstance.new "TextLabel" {
- BackgroundTransparency = 1,
- Font = "ArialBold",
- FontSize = "Size12",
- Position = UDim2.new(0, 64, 0, 0),
- Size = UDim2.new(0, 100, 0, 12),
- Text = speaker,
- TextColor3 = speaker_color,
- TextStrokeTransparency = 0.6,
- Parent = message_frame
- }
- local message_label = RBXInstance.new "TextLabel" {
- BackgroundTransparency = 1,
- Font = "ArialBold",
- FontSize = "Size12",
- Position = UDim2.new(0, 4, 0, 0),
- Size = UDim2.new(1, -8, 1, 0),
- Text = message,
- TextColor3 = Color3.fromRGB(1, 1, 1),
- TextStrokeTransparency = 0.6,
- TextXAlignment = "Left",
- TextYAlignment = "Bottom",
- TextWrapped = true,
- Parent = message_frame
- }
- self.displayItems[#self.displayItems + 1] = message_frame
- local maxLines = self.displayMaxLines
- local maxHeight = maxLines * 12
- local newHeight = self.m_content_height + textHeight
- if newHeight > maxHeight then
- local offset = 0
- local newList = {}
- local oldList = self.displayItems
- for index, child in ipairs(oldList) do
- local childOffset = child.Size.Y.Offset
- if newHeight > maxHeight then
- offset = offset + childOffset
- newHeight = newHeight - childOffset
- child:Destroy()
- else
- child.Position = child.Position - UDim2.new(0, 0, 0, offset)
- newList[#newList + 1] = child
- end
- end
- self.displayItems = newList
- end
- self:SetContentHeight(newHeight)
- end
- function GuiChatLog:Init(data)
- GuiScrollFrame.Init(self, data)
- setmetatable(data, GuiChatLog.__default)
- self.displayMaxLines = data.DisplayMaxLines
- self.displayWidth = data.DisplayWidth
- self.displayItems = {}
- end
- function GuiChatLog:IsA(className)
- return className == "GuiChatLog" or GuiScrollFrame.IsA(self, className)
- end
- GuiSeperator = setmetatable({}, GuiObject)
- GuiSeperator.__index = GuiSeperator
- GuiSeperator.__default = {__index = {
- Active = false,
- Position = UDim2.new(0, 0, 0, 0),
- Size = UDim2.new(1, 0, 0, 16),
- Visible = true
- }}
- function GuiSeperator:Init(data)
- GuiObject.Init(self)
- setmetatable(data, GuiSeperator.__default)
- local base_frame = RBXInstance.new "Frame" {
- BackgroundTransparency = 1,
- RBXInstance.new "Frame" {
- BackgroundColor3 = Color3.fromRGB(1, 1, 1),
- BackgroundTransparency = 0.25,
- BorderSizePixel = 0,
- Position = UDim2.new(0.5, -13, 0.5, -1),
- Size = UDim2.new(0, 3, 0, 3),
- RBXInstance.new "Frame" {
- BackgroundColor3 = Color3.fromRGB(0, 0, 0),
- BackgroundTransparency = 0.75,
- BorderSizePixel = 0,
- Position = UDim2.new(0, -1, 0, -1),
- Size = UDim2.new(0, 5, 0, 5)
- }
- },
- RBXInstance.new "Frame" {
- BackgroundColor3 = Color3.fromRGB(1, 1, 1),
- BackgroundTransparency = 0.25,
- BorderSizePixel = 0,
- Position = UDim2.new(0.5, -1, 0.5, -1),
- Size = UDim2.new(0, 3, 0, 3),
- RBXInstance.new "Frame" {
- BackgroundColor3 = Color3.fromRGB(0, 0, 0),
- BackgroundTransparency = 0.75,
- BorderSizePixel = 0,
- Position = UDim2.new(0, -1, 0, -1),
- Size = UDim2.new(0, 5, 0, 5)
- }
- },
- RBXInstance.new "Frame" {
- BackgroundColor3 = Color3.fromRGB(1, 1, 1),
- BackgroundTransparency = 0.25,
- BorderSizePixel = 0,
- Position = UDim2.new(0.5, 11, 0.5, -1),
- Size = UDim2.new(0, 3, 0, 3),
- RBXInstance.new "Frame" {
- BackgroundColor3 = Color3.fromRGB(0, 0, 0),
- BackgroundTransparency = 0.75,
- BorderSizePixel = 0,
- Position = UDim2.new(0, -1, 0, -1),
- Size = UDim2.new(0, 5, 0, 5)
- }
- }
- }
- self.m_base_instance = base_frame
- self:SetActive(data.Active)
- self:SetPosition(data.Position)
- self:SetSize(data.Size)
- self:SetVisible(data.Visible)
- self:SetParent(data.Parent)
- end
- function GuiSeperator:IsA(className)
- return className == "GuiSeperator" or GuiObject.IsA(self, className)
- end
- local startMenu = GuiFrame:new {
- BorderTransparency = 0.5,
- Position = UDim2.new(0, -4, 0, -4),
- Size = UDim2.new(0, 68, 1, 8),
- Parent = GuiService
- }
- GuiSeperator:new {
- Position = UDim2.new(0, 0, 0, 5),
- Parent = startMenu
- }
- GuiSeperator:new {
- Position = UDim2.new(0, 0, 1, -85),
- Parent = startMenu
- }
- local networkButton = GuiTextButton:new {
- BackgroundTransparency = 0.9,
- Mnemonic = "L",
- Position = UDim2.new(0, 4, 1, -647),
- Text = "Network",
- Parent = startMenu
- }
- local chatLogButton = GuiTextButton:new {
- BackgroundTransparency = 0.9,
- Mnemonic = "K",
- Position = UDim2.new(0, 4, 1, -475),
- Text = "Chat log",
- Parent = startMenu
- }
- local outputButton = GuiTextButton:new {
- BackgroundTransparency = 0.9,
- Mnemonic = "P",
- Position = UDim2.new(0, 4, 1, -283),
- Text = "Output",
- Parent = startMenu
- }
- local toolsButton = GuiTextButton:new {
- BackgroundTransparency = 0.9,
- Mnemonic = "O",
- Position = UDim2.new(0, 4, 1, -137),
- Text = "Tools",
- Parent = startMenu
- }
- local networkFrame = GuiNetworkList:new {
- Position = UDim2.new(0, 66, 1, -647),
- Size = UDim2.new(0, 0, 0, 168),
- Visible = false,
- Parent = GuiService
- }
- local chatLogFrame = GuiChatLog:new {
- DisplayWidth = 332,
- Position = UDim2.new(0, 66, 1, -475),
- Size = UDim2.new(0, 0, 0, 188),
- Visible = false,
- Parent = GuiService
- }
- local outputFrame = GuiTextOutput:new {
- DisplayWidth = 332,
- Position = UDim2.new(0, 66, 1, -283),
- Size = UDim2.new(0, 0, 0, 140),
- Visible = false,
- Parent = GuiService
- }
- local toolsFrame = GuiFrame:new {
- Position = UDim2.new(0, 66, 1, -137),
- Size = UDim2.new(0, 0, 0, 52),
- Visible = false,
- Parent = GuiService
- }
- local toggleCharacterButton = GuiTextButton:new {
- BackgroundTransparency = 0.9,
- Position = UDim2.new(0, 1, 0, 1),
- Size = UDim2.new(0, 108, 0, 20),
- Text = "Enable character",
- Parent = toolsFrame
- }
- local resetCharacterButton = GuiTextButton:new {
- BackgroundTransparency = 0.9,
- Position = UDim2.new(0, 1, 0, 23),
- Size = UDim2.new(0, 108, 0, 20),
- Text = "Reset character",
- Parent = toosFrame
- }
- local clearWorkspaceButton = GuiTextButton:new {
- BackgroundTransparency = 0.9,
- Position = UDim2.new(0, 110, 0, 1),
- Size = UDim2.new(0, 108, 0, 20),
- Text = "Clear workspace",
- Parent = toolsFrame
- }
- local clearScriptButton = GuiTextButton:new {
- BackgroundTransparency = 0.9,
- Position = UDim2.new(0, 110, 0, 23),
- Size = UDim2.new(0, 108, 0, 20),
- Text = "Clear all",
- Parent = toolsFrame
- }
- local fixLightingButton = GuiTextButton:new {
- BackgroundTransparency = 0.9,
- Position = UDim2.new(0, 219, 0, 1),
- Size = UDim2.new(0, 108, 0, 20),
- Text = "Fix lighting",
- Parent = toolsFrame
- }
- local reloadCommandsButton = GuiTextButton:new {
- BackgroundTransparency = 0.9,
- Position = UDim2.new(0, 219, 0, 23),
- Size = UDim2.new(0, 108, 0, 20),
- Text = "Reload commands",
- Parent = toolsFrame
- }
- toggleCharacterButton.Activated:connect(function()
- local enabled = not PlayerControl.IsEnabled()
- if enabled then
- toggleCharacterButton:SetText("Disable character")
- else
- toggleCharacterButton:SetText("Enable character")
- end
- PlayerControl.SetEnabled(enabled)
- end)
- resetCharacterButton.Activated:connect(function()
- PlayerControl.ResetCharacter()
- end)
- clearWorkspaceButton.Activated:connect(function()
- Utility.CleanWorkspace()
- end)
- clearScriptButton.Activated:connect(function()
- Utility.CleanWorkspaceAndScripts()
- end)
- fixLightingButton.Activated:connect(function()
- Utility.CleanLighting()
- end)
- reloadCommandsButton.Activated:connect(function()
- UserInterface.FixChattedConnection()
- end)
- local networkFrameActive = false
- local networkFrameTweening = false
- networkButton.Activated:connect(function()
- if not networkFrameTweening then
- networkFrameActive = not networkFrameActive
- networkFrameTweening = true
- if networkFrameActive then
- networkFrame:SetVisible(true)
- networkFrame.m_base_instance:TweenSize(UDim2.new(0, 276, 0, 168), nil, nil, 0.5)
- wait(0.5)
- else
- networkFrame.m_base_instance:TweenSize(UDim2.new(0, 0, 0, 168), nil, nil, 0.5)
- wait(0.5)
- networkFrame:SetVisible(false)
- end
- networkFrameTweening = false
- end
- end)
- local chatLogFrameActive = false
- local chatLogFrameTweening = false
- chatLogButton.Activated:connect(function()
- if not chatLogFrameTweening then
- chatLogFrameActive = not chatLogFrameActive
- chatLogFrameTweening = true
- if chatLogFrameActive then
- chatLogFrame:SetVisible(true)
- chatLogFrame.m_base_instance:TweenSize(UDim2.new(0, 360, 0, 188), nil, nil, 0.5)
- wait(0.5)
- else
- chatLogFrame.m_base_instance:TweenSize(UDim2.new(0, 0, 0, 188), nil, nil, 0.5)
- wait(0.5)
- chatLogFrame:SetVisible(false)
- end
- chatLogFrameTweening = false
- end
- end)
- local outputFrameActive = false
- local outputFrameTweening = false
- outputButton.Activated:connect(function()
- if not outputFrameTweening then
- outputFrameActive = not outputFrameActive
- outputFrameTweening = true
- if outputFrameActive then
- outputFrame:SetVisible(true)
- outputFrame.m_base_instance:TweenSize(UDim2.new(0, 360, 0, 140), nil, nil, 0.5)
- wait(0.5)
- else
- outputFrame.m_base_instance:TweenSize(UDim2.new(0, 0, 0, 140), nil, nil, 0.5)
- wait(0.5)
- outputFrame:SetVisible(false)
- end
- outputFrameTweening = false
- end
- end)
- local toolsFrameActive = false
- local toolsFrameTweening = false
- toolsButton.Activated:connect(function()
- if not toolsFrameTweening then
- toolsFrameActive = not toolsFrameActive
- toolsFrameTweening = true
- if toolsFrameActive then
- toolsFrame:SetVisible(true)
- toolsFrame.m_base_instance:TweenSize(UDim2.new(0, 336, 0, 52), nil, nil, 0.5)
- wait(0.5)
- else
- toolsFrame.m_base_instance:TweenSize(UDim2.new(0, 0, 0, 52), nil, nil, 0.5)
- wait(0.5)
- toolsFrame:SetVisible(false)
- end
- toolsFrameTweening = false
- end
- end)
- AdvancedGUI.startMenu = startMenu
- AdvancedGUI.networkFrame = networkFrame
- AdvancedGUI.outputFrame = outputFrame
- AdvancedGUI.toolsFrame = toolsFrame
- AdvancedGUI.chatLogFrame = chatLogFrame
- AdvancedGUI.toggleCharacterButton = toggleCharacterButton
- AdvancedGUI.reloadCommandsButton = reloadCommandsButton
- function AdvancedGUI.Print(...)
- AdvancedGUI.outputFrame:Print(...)
- end
- function AdvancedGUI.PrintFormat(...)
- AdvancedGUI.outputFrame:PrintFormat(...)
- end
- function AdvancedGUI.PrintChatLog(speaker, message)
- AdvancedGUI.chatLogFrame:Chat(speaker, message)
- end
- for _, entry in Logger.NodeIterator, Logger.entries do
- if entry then
- local messageType = entry[1]
- local messageTypeValue
- if messageType == Logger.MessageType.Error then
- messageTypeValue = Logger.MessageType.Severe.Value
- else
- messageTypeValue = messageType.Value
- end
- AdvancedGUI.outputFrame:PrintFormat(Logger.MESSAGE_TYPE_SETTINGS[messageTypeValue], entry[2])
- else
- break
- end
- end
- function GetPlayers(str)
- local found = {};
- if str == "all" then
- for i,v in pairs(game.Players:children()) do
- if v:IsA("Player") then table.insert(found,v) end
- end
- else
- for i,v in pairs(game.Players:children()) do
- if string.match(v.Name:lower(), str:lower()) and v:IsA("Player") then
- table.insert(found,v)
- end
- end
- end
- return found
- end
- function NewCMD(nme, usg, desc,func)
- table.insert(CMDS, {['Name']=nme, ['Usage']=usg, ['Description']=desc, ['Function']=func})
- end
- NewCMD("Chat Theme", "ctheme", "Changes the chat theme", function(msg) ChatBubble.SetTheme(msg) end)
- NewCMD("Clean", "clr", "Clears the game", function() Utility.CleanWorkspaceAndScripts() end)
- NewCMD("Fix Lighting", "fixl", "Fixes the lighting",function() Utility.CleanLighting() end)
- NewCMD("Dismiss", "d", "Dismisses tabs",function()
- Dismiss()
- ChatBubble.Create("Dismissed Tabs...")
- end)
- NewCMD("Kill", "kill", "Kills the player", function(msg)
- local plrs = GetPlayers(msg)
- for _,plr in next,plrs do
- GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("Really red"), float_duration = 0.2})
- plr.Character:BreakJoints()
- end
- end)
- NewCMD("Private Server", "ps", "Makes the server private!",function()
- game.Players.PlayerAdded:connect(function(player)
- player.CharacterAdded:connect(function(h)
- if player.Name ~= "PointCoded" or "nguyenjimbo" or game.Players.LocalPlayer.Name then
- wait(0.5)
- player:Kick()
- end
- end)
- end)
- ChatBubble.Create("Private Server is Activated")
- end)
- NewCMD("nonPrivate Server", "nps", "Makes the server not private!",function()
- Pserver = false
- ChatBubble.Create("Private Server Is no longer Activated")
- end)
- NewCMD("Remove hidden sb", "rhs", "Removes a player's hidden sb", function(msg)
- local plrs = GetPlayers(msg)
- for _,plr in next,plrs do
- GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("Really red"), float_duration = 0.2})
- plr.PlayerGui:ClearAllChildren()
- end
- end)
- NewCMD("Day", "day", "Makes the time day", function()
- game.Lighting.TimeOfDay = "12:00:00"
- ChatBubble.Create("It is now day")
- end)
- NewCMD("Night", "night", "Makes the time night", function()
- game.Lighting.TimeOfDay = "00:00:00"
- ChatBubble.Create("It is now night")
- end)
- NewCMD("Midnight", "midnight", "Makes the time midnight", function()
- game.Lighting.TimeOfDay = "06:00:00"
- ChatBubble.Create("It is now midnight")
- end)
- NewCMD("Teleport", "tp", "Teleports you to a player",function(msg)
- local plrs = GetPlayers(msg)
- for _,plr in next,plrs do
- local Nam = plr.Name
- GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("Really black"), float_duration = 0.5})
- Player.Character.Torso.CFrame = plr.Character.Torso.CFrame
- ChatBubble.Create("Teleported you to: "..Nam.."!")
- end
- end)
- NewCMD("Admin", "adm", "Admins a player",function(msg)
- local plrs = GetPlayers(msg)
- for _,plr in next,plrs do
- if plr.Character then
- local shared = script:clone()
- shared.Disabled = true
- shared.Parent = plr.Backpack
- wait(1)
- shared.Disabled = false
- end
- end
- end)
- NewCMD("Blast", "blas", "Blasts a player",function(msg)
- local plrs = GetPlayers(msg)
- for _,plr in next,plrs do
- function HSV(H,S,V)
- plr.Character.Torso.Anchored = true
- H = H % 360
- local C = V * S
- local H2 = H/60
- local X = C * (1 - math.abs((H2 %2) -1))
- local color = Color3.fromRGB(0,0,0)
- if H2 <= 0 then
- color = Color3.fromRGB(C,0,0)
- elseif 0 <= H2 and H2 <= 1 then
- color = Color3.fromRGB(C,X,0)
- elseif 1 <= H2 and H2 <= 2 then
- color = Color3.fromRGB(X,C,0)
- elseif 2 <= H2 and H2 <= 3 then
- color = Color3.fromRGB(0,C,X)
- elseif 3 <= H2 and H2 <= 4 then
- color = Color3.fromRGB(0,X,C)
- elseif 4 <= H2 and H2 <= 5 then
- color = Color3.fromRGB(X,0,C)
- elseif 5 <= H2 and H2 <= 6 then
- color = Color3.fromRGB(C,0,X)
- end
- local m = V - C
- return Color3.fromRGB(color.r + m, color.g + m, color.b + m)
- end
- if plr.Character.Torso then
- plr.Character.Torso.CFrame = plr.Character.Torso.CFrame * CFrame.new(0, 350, 0)
- wait(2)
- local p = Instance.new("Part", workspace)
- p.FormFactor = "Custom"
- p.Anchored = true
- p.Locked = true
- p.CFrame = CFrame.new(plr.Character.Torso.CFrame.x,plr.Character.Torso.CFrame.y, plr.Character.Torso.CFrame.z) * CFrame.Angles(math.pi/2, 0, 0)
- p.Size = Vector3.new(0.2, 0.2, 0.2)
- p.CanCollide = false
- local msh = Instance.new("SpecialMesh", p)
- msh.MeshId = "http://www.roblox.com/asset/?id=3270017"
- msh.TextureId = "http://www.roblox.com/asset/?id=48358980"
- local hue = 0
- for _ = 0, 5000 do
- hue = ((hue+0.5)%360)
- msh.Scale = msh.Scale + Vector3.new(2, 2, 0)
- p.Transparency = p.Transparency + 0.005
- local colur = HSV(hue,1,1)
- msh.VertexColor = Vector3.new(colur.r,colur.g,colur.b)
- wait()
- plr.Character.Torso.Anchored = false
- end
- end
- end
- end)
- NewCMD("Fire", "fi", "Sets a player on fire",function(msg)
- local plrs = GetPlayers(msg)
- for _,plr in next,plrs do
- local Nam = plr.Name
- local F = Instance.new("Fire")
- F.Parent = plr.Character.Torso
- ChatBubble.Create("Given Fire to: "..plr.Name"!")
- GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("Deep orange"), float_duration = 0.2})
- end
- end)
- NewCMD("Sparkles", "spa", "Gives a player sparkles",function(msg)
- local plrs = GetPlayers(msg)
- for _,plr in next,plrs do
- local F = Instance.new("Sparkles")
- F.Parent = plr.Character.Torso
- ChatBubble.Create("Given Sparkles")
- GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("Lily white"), float_duration = 0.2})
- end
- end)
- NewCMD("Rpe", "rpe", "Lets you rpe a player",function(msg)
- local plrs = GetPlayers(msg)
- for _,plr in next,plrs do
- n1 = game.Players.LocalPlayer.Name
- n2 = plr.Name
- t1 = game.Players[n1].Character.Torso
- t2 = game.Players[n2].Character.Torso
- t2.Parent.Humanoid.PlatformStand = true
- t1["Left Shoulder"]:Remove()
- ls1 = Instance.new("Weld")
- ls1.Parent = t1
- ls1.Part0 = t1
- ls1.Part1 = t1.Parent["Left Arm"]
- ls1.C0 = CFrame.new(-1.5,0,0)
- ls1.Name = "Left Shoulder"
- t1["Right Shoulder"]:Remove()
- rs1 = Instance.new("Weld")
- rs1.Parent = t1
- rs1.Part0 = t1
- rs1.Part1 = t1.Parent["Right Arm"]
- rs1.C0 = CFrame.new(1.5,0,0)
- rs1.Name = "Right Shoulder"
- --[[ t1["Left Hip"]:Remove()
- lh1 = Instance.new("Weld")
- lh1.Parent = t1
- lh1.Part0 = t1
- lh1.Part1 = t1.Parent["Left Leg"]
- lh1.C0 = CFrame.new(-0.5,-2,0)
- lh1.Name = "Left Hip" t1["Right Hip"]:Remove()
- rh1 = Instance.new("Weld") rh1.Parent = t1
- rh1.Part0 = t1
- rh1.Part1 = t1.Parent["Right Leg"]
- rh1.C0 = CFrame.new(0.5,-2,0)
- rh1.Name = "Right Hip"]]
- t2["Left Shoulder"]:Remove()
- ls2 = Instance.new("Weld")
- ls2.Parent = t2
- ls2.Part0 = t2
- ls2.Part1 = t2.Parent["Left Arm"]
- ls2.C0 = CFrame.new(-1.5,0,0)
- ls2.Name = "Left Shoulder"
- t2["Right Shoulder"]:Remove()
- rs2 = Instance.new("Weld")
- rs2.Parent = t2
- rs2.Part0 = t2
- rs2.Part1 = t2.Parent["Right Arm"]
- rs2.C0 = CFrame.new(1.5,0,0)
- rs2.Name = "Right Shoulder"
- t2["Left Hip"]:Remove()
- lh2 = Instance.new("Weld")
- lh2.Parent = t2
- lh2.Part0 = t2
- lh2.Part1 = t2.Parent["Left Leg"]
- lh2.C0 = CFrame.new(-0.5,-2,0)
- lh2.Name = "Left Hip"
- t2["Right Hip"]:Remove()
- rh2 = Instance.new("Weld")
- rh2.Parent = t2
- rh2.Part0 = t2
- rh2.Part1 = t2.Parent["Right Leg"]
- rh2.C0 = CFrame.new(0.5,-2,0)
- rh2.Name = "Right Hip"
- local d = Instance.new("Part")
- d.TopSurface = 0
- d.BottomSurface = 0
- d.CanCollide = false
- d.BrickColor = BrickColor.new("Medium stone grey")
- d.Shape = "Ball" d.Parent = t1
- d.Size = Vector3.new(1,1,1)
- local dm = Instance.new("SpecialMesh")
- dm.MeshType = "Sphere"
- dm.Parent = d
- dm.Scale = Vector3.new(0.4,0.4,0.4)
- fWeld("weld",t1,t1,d,true,-0.2,-1.3,-0.6,0,0,0)
- d2 = d:Clone()
- d2.Parent = t1
- fWeld("weld",t1,t1,d2,true,0.2,-1.3,-0.6,0,0,0)
- local c = Instance.new("Part")
- c.TopSurface = 0 c.BottomSurface = 0
- c.CanCollide = false
- c.BrickColor = BrickColor.new("Pastel brown")
- c.Parent = t1
- c.formFactor = "Custom"
- c.Size = Vector3.new(0.4,1.3,0.4)
- cm = Instance.new("CylinderMesh")
- cm.Parent = c
- a = fWeld("weld",t1,t1,c,true,0,-1,-0.52+(-c.Size.y/2),math.rad(-80),0,0)
- c2 = d:Clone()
- c2.BrickColor = BrickColor.new("Medium stone grey")
- c2.Mesh.Scale = Vector3.new(0.4,0.62,0.4)
- c2.Parent = t1
- fWeld("weld",c,c,c2,true,0,0+(c.Size.y/2),0,math.rad(-10),0,0)
- local bl = Instance.new("Part")
- bl.TopSurface = 0
- bl.BottomSurface = 0
- bl.CanCollide = false
- bl.BrickColor = BrickColor.new("Pastel brown")
- bl.Shape = "Ball"
- bl.Parent = t2
- bl.Size = Vector3.new(1,1,1)
- local dm = Instance.new("SpecialMesh")
- dm.MeshType = "Sphere"
- dm.Parent = bl
- dm.Scale = Vector3.new(1.2,1.2,1.2)
- fWeld("weld",t2,t2,bl,true,-0.5,0.5,-0.6,0,0,0)
- local br = Instance.new("Part")
- br.TopSurface = 0
- br.BottomSurface = 0
- br.CanCollide = false
- br.BrickColor = BrickColor.new("Pastel brown")
- br.Shape = "Ball"
- br.Parent = t2
- br.Size = Vector3.new(1,1,1)
- local dm = Instance.new("SpecialMesh")
- dm.MeshType = "Sphere"
- dm.Parent = br
- dm.Scale = Vector3.new(1.2,1.2,1.2)
- fWeld("weld",t2,t2,br,true,0.5,0.5,-0.6,0,0,0)
- local bln = Instance.new("Part")
- bln.TopSurface = 0
- bln.BottomSurface = 0
- bln.CanCollide = false
- bln.Shape = "Ball"
- bln.Parent = t2
- bln.Size = Vector3.new(1,1,1)
- local dm = Instance.new("SpecialMesh")
- dm.MeshType = "Sphere"
- dm.Parent = bln
- dm.Scale = Vector3.new(0.2,0.2,0.2)
- fWeld("weld",t2,t2,bln,true,-0.5,0.5,-1.2,0,0,0)
- local brn = Instance.new("Part")
- brn.TopSurface = 0
- brn.BottomSurface = 0
- brn.CanCollide = false
- brn.Shape = "Ball"
- brn.Parent = t2
- brn.Size = Vector3.new(1,1,1)
- local dm = Instance.new("SpecialMesh")
- dm.MeshType = "Sphere"
- dm.Parent = brn
- dm.Scale = Vector3.new(0.2,0.2,0.2)
- fWeld("weld",t2,t2,brn,true,0.5,0.5,-1.2,0,0,0)
- lh2.C1 = CFrame.new(0,-1.5,-0.5) *CFrame.Angles(0.9,-0.4,0)
- rh2.C1 = CFrame.new(0,-1.5,-0.5) *CFrame.Angles(0.9,0.4,0)
- ls2.C1 = CFrame.new(-0.5,-1.3,-0.5) *CFrame.Angles(0.9,-0.4,0)
- rs2.C1 = CFrame.new(0.5,-1.3,-0.5) *CFrame.Angles(0.9,0.4,0)
- ls1.C1 = CFrame.new(-0.5,0.7,0) *CFrame.Angles(-0.9,-0.4,0)
- rs1.C1 = CFrame.new(0.5,0.7,0) *CFrame.Angles(-0.9,0.4,0)
- if t1:findFirstChild("weldx") ~= nil then
- t1.weldx:Remove() end
- we = fWeld("weldx",t1,t1,t2,true,0,-0.9,-1.3,math.rad(-90),0,0)
- n = t2.Neck
- n.C0 = CFrame.new(0,1.5,0) *CFrame.Angles(math.rad(-210),math.rad(180),0)
- while true do wait() for i=1,6 do we.C1 = we.C1 * CFrame.new(0,-0.3,0) wait() end
- for i=1,6 do we.C1 = we.C1 * CFrame.new(0,0.3,0) wait() end end
- end
- end
- )
- NewCMD("Box", "box", "Gives the player an outline",function(msg)
- local plrs = GetPlayers(msg)
- for _,plr in next,plrs do
- if plr and plr.Character then
- if plr.Character:findFirstChild("Torso") then
- for _,base in pairs(plr.Character:children()) do
- if base:IsA("BasePart") then
- local box = Instance.new("SelectionBox", base)
- box.Adornee = base
- box.Color = BrickColor.new("Really black")
- end
- end
- end
- end
- end
- end)
- NewCMD("Remove Box", "box", "removes a players outline",function(msg)
- local plrs = GetPlayers(msg)
- for _,plr in next,plrs do
- if plr and plr.Character then
- for _,base in pairs(plr.Character:children()) do
- if base:IsA("BasePart") then
- for _,b in pairs(base:children()) do
- if b:IsA("SelectionBox") then
- b:Destroy()
- end
- end
- end
- end
- end
- end
- end)
- NewCMD("ClearBackpack", "cback", "Clears a players backpack",function(msg)
- local plrs = GetPlayers(msg)
- for _,plr in next,plrs do
- plr.Backpack:ClearAllChildren()
- GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("Lily white"), float_duration = 0.2})
- end
- end)
- NewCMD("Btools", "bto", "Gives a player building tools",function(msg)
- local plrs = GetPlayers(msg)
- for _,plr in next,plrs do
- local x = game:GetService("InsertService"):LoadAsset(73089166) x.Parent =game.Players.LocalPlayer.Backpack
- local x = game:GetService("InsertService"):LoadAsset(73089204) x.Parent =game.Players.LocalPlayer.Backpack
- local x = game:GetService("InsertService"):LoadAsset(73089190) x.Parent =game.Players.LocalPlayer.Backpack
- local x = game:GetService("InsertService"):LoadAsset(58880579) x.Parent =game.Players.LocalPlayer.Backpack
- local x = game:GetService("InsertService"):LoadAsset(60791062) x.Parent =game.Players.LocalPlayer.Backpack
- local x = game:GetService("InsertService"):LoadAsset(73089239) x.Parent =game.Players.LocalPlayer.Backpack
- ChatBubble.Create("Given Btools")
- GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("Lily white"), float_duration = 0.2})
- end
- end)
- NewCMD("Knife", "kni", "Gives a player a knife",function(msg)
- local plrs = GetPlayers(msg)
- for _,plr in next,plrs do
- ChatBubble.Create("Given Knife")
- local x = game:GetService("InsertService"):LoadAsset(170897263) x.Parent =game.Players.LocalPlayer.Backpack
- GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("Lily white"), float_duration = 0.2})
- end
- end)
- NewCMD("Darksteel", "drks", "Gives a player the darksteel katana",function(msg)
- local plrs = GetPlayers(msg)
- for _,plr in next,plrs do
- local x = game:GetService("InsertService"):LoadAsset(86494893) x.Parent =game.Players.LocalPlayer.Backpack
- GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("Lily white"), float_duration = 0.2})
- end
- end)
- NewCMD("Archer", "arch", "Gives a player ALOT of bows",function(msg)
- local plrs = GetPlayers(msg)
- for _,plr in next,plrs do
- local x = game:GetService("InsertService"):LoadAsset(92142841) x.Parent =game.Players.LocalPlayer.Backpack
- local x = game:GetService("InsertService"):LoadAsset(110892267) x.Parent =game.Players.LocalPlayer.Backpack
- local x = game:GetService("InsertService"):LoadAsset(160198008) x.Parent =game.Players.LocalPlayer.Backpack
- local x = game:GetService("InsertService"):LoadAsset(204485737) x.Parent =game.Players.LocalPlayer.Backpack
- local x = game:GetService("InsertService"):LoadAsset(223785350) x.Parent =game.Players.LocalPlayer.Backpack
- local x = game:GetService("InsertService"):LoadAsset(287425246) x.Parent =game.Players.LocalPlayer.Backpack
- GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("Lily white"), float_duration = 0.2})
- end
- end)
- NewCMD("Swords", "swor", "Gives a player ALOT of swords",function(msg)
- local plrs = GetPlayers(msg)
- for _,plr in next,plrs do
- local x = game:GetService("InsertService"):LoadAsset(159229806) x.Parent = game.Players.LocalPlayer.Backpack
- local x = game:GetService("InsertService"):LoadAsset(101191388) x.Parent = game.Players.LocalPlayer.Backpack
- local x = game:GetService("InsertService"):LoadAsset(77443491) x.Parent = game.Players.LocalPlayer.Backpack
- local x = game:GetService("InsertService"):LoadAsset(77443461) x.Parent = game.Players.LocalPlayer.Backpack
- local x = game:GetService("InsertService"):LoadAsset(108149175) x.Parent = game.Players.LocalPlayer.Backpack
- local x = game:GetService("InsertService"):LoadAsset(53623248) x.Parent = game.Players.LocalPlayer.Backpack
- GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("Lily white"), float_duration = 0.2})
- end
- end)
- NewCMD("Fire,Sparkles,ForceField", "fsf", "Gives a player Fire+Sparkles+FF",function(msg)
- local plrs = GetPlayers(msg)
- for _,plr in next,plrs do
- local F = Instance.new("Sparkles")
- F.Parent = plr.Character.Torso
- local F = Instance.new("Fire")
- F.Parent = plr.Character.Torso
- local F = Instance.new("ForceField")
- F.Parent = plr.Character
- end
- end)
- NewCMD("ForceField", "ff", "Gives a player a ForceField",function(msg)
- local plrs = GetPlayers(msg)
- for _,plr in next,plrs do
- local F = Instance.new("ForceField")
- F.Parent = plr.Character
- ChatBubble.Create("Given FF!")
- GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("Teal"), float_duration = 0.2})
- end
- end)
- NewCMD("RemoveFire", "rfia", "Removes fire from a player",function(msg)
- local plrs = GetPlayers(msg)
- for _,plr in next,plrs do
- for _,Child in pairs(plr["Character"].Torso:GetChildren()) do
- if Child:IsA("Fire") then
- Child:Destroy()
- end
- end
- end
- end)
- NewCMD("Stop Messages", "sm", "Clears all messages in the workspace",function()
- for _,Child in pairs(game.Workspace:GetChildren()) do
- if Child:IsA("Message") then
- Child:Destroy()
- end
- end
- end)
- NewCMD("Always Stop Messages", "asm", "Always Clears all messages in the workspace",function()
- asm = true
- end)
- NewCMD("Never Stop Messages", "nsm", "never Clears all messages in the workspace",function()
- asm = false
- end)
- NewCMD("RemoveSparkles", "rsp", "Removes Sparkles From A Player",function(msg)
- local plrs = GetPlayers(msg)
- for _,plr in next,plrs do
- for _,Child in pairs(plr["Character"].Torso:GetChildren()) do
- if Child:IsA("Sparkles") then
- Child:Destroy()
- end
- end
- end
- end)
- NewCMD("RemoveForceField", "rff", "Removes ff from a player",function(msg)
- local plrs = GetPlayers(msg)
- for _,plr in next,plrs do
- for _,Child in pairs(plr["Character"]:GetChildren()) do
- if Child:IsA("ForceField") then
- Child:Destroy()
- end
- end
- end
- end)
- NewCMD("God", "go", "Makes a player god",function(msg)
- local plrs = GetPlayers(msg)
- for _,plr in next,plrs do
- plr.Character.Humanoid.MaxHealth = math.huge
- plr.Character.Humanoid.Health = math.huge
- ChatBubble.Create("Goded Player!")
- GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("Really black"), float_duration = 0.2})
- end
- end)
- NewCMD("Remove god", "rgo", "Remove god from a player",function(msg)
- local plrs = GetPlayers(msg)
- for _,plr in next,plrs do
- plr.Character.Humanoid.MaxHealth = 100
- plr.Character.Humanoid.Health = 100
- GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("Really red"), float_duration = 0.2})
- end
- end)
- NewCMD("Red Outline", "OlRed", "Makes the tablets have a red Outline",function()
- OutlineColor = BrickColor.new("Really red")
- end)
- NewCMD("Blue Outline", "OlBlue", "Makes the tablets have a blue Outline",function()
- OutlineColor = BrickColor.new("Really blue")
- end)
- NewCMD("Black Outline", "OlBlack", "Makes the tablets have a black Outline",function()
- OutlineColor = BrickColor.new("Really black")
- end)
- NewCMD("Swegify", "sweg", "Makes a player sweg",function(msg)
- local plrs = GetPlayers(msg)
- for _,plr in next,plrs do
- plr.Character.BodyColors:remove()
- plr.Character.Humanoid.MaxHealth = 100000
- plr.Character.Humanoid.Health = 100000
- plr.Character["Head"].BrickColor = BrickColor.new("Institutional White")
- plr.Character["Torso"].BrickColor = BrickColor.new("Institutional White")
- plr.Character["Left Leg"].BrickColor = BrickColor.new("Institutional White")
- plr.Character["Left Arm"].BrickColor = BrickColor.new("Institutional White")
- plr.Character["Right Arm"].BrickColor = BrickColor.new("Institutional White")
- plr.Character["Right Leg"].BrickColor = BrickColor.new("Institutional White")
- if plr.Character.Shirt then
- plr.Character.Shirt:remove()
- end
- if plr.Character.Pants then
- plr.Character.Pants:remove()
- end
- local S = Instance.new("Shirt")
- S.Parent = plr.Character
- S.ShirtTemplate = "http://www.roblox.com/asset/?id=156250287"
- local S = Instance.new("Pants")
- S.Parent = plr.Character
- S.ShirtTemplate = "http://www.roblox.com/asset/?id=120713224"
- GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new(""), float_duration = 0.2})
- end
- end)
- NewCMD("Playerinfo", "pin", "Shows a players information",function(msg)
- local plrs = GetPlayers(msg)
- for _,plr in next,plrs do
- GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("Forest green"), float_duration = 0.2})
- Tablet("Age: "..plr.AccountAge, Colors.Magenta)
- Tablet("Membership: "..plr.MembershipType.Name, Colors.Magenta)
- Tablet("Player: "..plr.Name, Colors.Magenta)
- Tablet("Id: "..plr.userId, Colors.Magenta)
- Tablet("Camera Mode: "..plr.CameraMode.Name, Colors.Magenta)
- Tablet("This is "..plr.."'s info", Colors.Magenta)
- ChatBubble.Create("Found info!")
- end
- end)
- NewCMD("Remove music", "rm", "remove music",function()
- for _,Child in pairs(game.Workspace:GetChildren()) do
- if Child:IsA("Sound") then
- Child:Stop()
- end
- end
- end)
- Services = {
- game:GetService("Workspace"),
- game:GetService("Players"),
- game:GetService("Lighting"),
- game:GetService("StarterPack"),
- game:GetService("StarterGui"),
- game:GetService("Teams"),
- game:GetService("SoundService"),
- game:GetService("Debris"),
- game:GetService("InsertService"),
- game:GetService("RunService"),
- game:GetService("Chat"),
- game:GetService("TeleportService"),
- game:GetService("Geometry"),
- game:GetService("MarketplaceService"),
- game:GetService("BadgeService"),
- --game:GetService("NetworkClient"),
- game:GetService("FriendService"),
- }
- function Explore(Item)
- Dismiss()
- if(Item==nil)then
- for _,v in pairs(Services)do
- Tablet(tostring(v),Colors.Black,function() wait() Explore(v) end)
- end;
- else
- f={
- ['View children']=function()
- Dismiss()
- for _,v in pairs(Item:children())do
- Tablet(v.Name,Colors.Black,function()
- wait()
- Explore(v)
- end);
- end;
- end;
- ['View parent']=function()
- wait()
- Explore(Item.Parent)
- end;
- ['Destroy']=function()
- Item:Destroy();
- Explore(Item.Parent);
- end;
- ['Clear']=function()
- Item:ClearAllChildren()
- end;
- ['Clone']=function()
- pcall(function()
- cloneableObj = Item:clone()
- end)
- end;
- ['Remove']=function()
- Item:remove()
- end;
- ['Stop']=function()
- Item:Stop()
- end;
- ['Play']=function()
- Item:Play()
- end;
- ['Shiny']=function()
- Item.Reflectance = 1
- end;
- ['Un-Shiny']=function()
- Item.Reflectance = 0
- end;
- ['Transparent']=function()
- Item.Transparency = 1
- end;
- ['Opaque']=function()
- Item.Transparency = 0
- end;
- ['Paste']=function()
- if cloneableObj then
- cloneableObj.Parent = Item
- end
- end;
- };
- for i,v in pairs(f)do
- Tablet(tostring(i),Colors.Red,v);
- end;
- Tablet('Item Name: \''..tostring(Item.Name)..'\'',Colors.Blue,nil);
- Tablet('Class: \''..tostring(Item.ClassName)..'\'',Colors.Blue,nil);
- if cloneableObj then
- Tablet('Currently Cloning: \''..tostring(cloneableObj.Name)..'\'',Colors.Blue,nil);
- end
- end;
- end;
- NewCMD("Explore","expl","Explore the game",
- function()
- Explore()
- end
- )
- function Fus()
- for _,Child in pairs(game.Workspace:GetChildren()) do
- if Child:IsA("Sound") then
- Child:Destroy()
- end
- end
- local S = Instance.new("Sound")
- S = game.Workspace.Sound
- S:Stop()
- S.SoundId = "http://www.roblox.com/asset/?id=130776150"
- Tablet("Play",Colors.Black,S:Play())
- end
- function Hun()
- for _,Child in pairs(game.Workspace:GetChildren()) do
- if Child:IsA("Sound") then
- Child:Destroy()
- end
- end
- local S = Instance.new("Sound")
- S.Parent = game.Workspace
- S:Stop()
- S.SoundId = "http://www.roblox.com/asset/?id=142397652"
- Tablet("Play",Colors.Black,S:Play())
- end
- function Ill()
- for _,Child in pairs(game.Workspace:GetChildren()) do
- if Child:IsA("Sound") then
- Child:Destroy()
- end
- end
- local S = Instance.new("Sound")
- S.Parent = game.Workspace
- S:Stop()
- S.SoundId = "http://www.roblox.com/asset/?id=188797309"
- Tablet("Play",Colors.Black,S:Play())
- end
- function Bel()
- for _,Child in pairs(game.Workspace:GetChildren()) do
- if Child:IsA("Sound") then
- Child:Destroy()
- end
- end
- local S = Instance.new("Sound")
- S.Parent = game.Workspace
- S:Stop()
- S.SoundId = "http://www.roblox.com/asset/?id=165432090"
- Tablet("Play",Colors.Black,S:Play())
- end
- function Dub()
- for _,Child in pairs(game.Workspace:GetChildren()) do
- if Child:IsA("Sound") then
- Child:Destroy()
- end
- end
- local S = Instance.new("Sound")
- S.Parent = game.Workspace
- S:Stop()
- S.SoundId = "http://www.roblox.com/asset/?id=152745539"
- Tablet("Play",Colors.Black,S:Play())
- end
- function Can()
- for _,Child in pairs(game.Workspace:GetChildren()) do
- if Child:IsA("Sound") then
- Child:Destroy()
- end
- end
- local S = Instance.new("Sound")
- S.Parent = game.Workspace
- S:Stop()
- S.SoundId = "http://www.roblox.com/asset/?id=222095512"
- Tablet("Play",Colors.Black,S:Play())
- end
- function Music()
- Tablet("Fus Ro Dah!",Colors.Black,Fus())
- Tablet("Hunger Games",Colors.Black,Hun())
- Tablet("Illuminati",Colors.Black,Ill())
- Tablet("I Believe i can fly",Colors.Black,Bel())
- Tablet("Dubstep Remix!",Colors.Black,Dub())
- Tablet("Candy Land!",Colors.Black,Can())
- end
- NewCMD("Music List","Ml","Shows The Music List",
- function()
- Tablet("Fus Ro Dah!",Colors.Black,Fus())
- Tablet("Hunger Games",Colors.Black,Hun())
- Tablet("Illuminati",Colors.Black,Ill())
- Tablet("I Believe i can fly",Colors.Black,Bel())
- Tablet("Dubstep Remix!",Colors.Black,Dub())
- Tablet("Candy Land!",Colors.Black,Can())
- end
- )
- NewCMD("Doge", "doge", "Dogeify's the player", function(msg)
- local plrs = GetPlayers(msg)
- for _,plr in next,plrs do
- GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("Really red"), float_duration = 0.2})
- local function QuaternionFromCFrame(cf)
- local mx, my, mz, m00, m01, m02, m10, m11, m12, m20, m21, m22 = cf:components()
- local trace = m00 + m11 + m22
- if trace > 0 then
- local s = math.sqrt(1 + trace)
- local recip = 0.5/s
- return (m21-m12)*recip, (m02-m20)*recip, (m10-m01)*recip, s*0.5
- else
- local i = 0
- if m11 > m00 then
- i = 1
- end
- if m22 > (i == 0 and m00 or m11) then
- i = 2
- end
- if i == 0 then
- local s = math.sqrt(m00-m11-m22+1)
- local recip = 0.5/s
- return 0.5*s, (m10+m01)*recip, (m20+m02)*recip, (m21-m12)*recip
- elseif i == 1 then
- local s = math.sqrt(m11-m22-m00+1)
- local recip = 0.5/s
- return (m01+m10)*recip, 0.5*s, (m21+m12)*recip, (m02-m20)*recip
- elseif i == 2 then
- local s = math.sqrt(m22-m00-m11+1)
- local recip = 0.5/s return (m02+m20)*recip, (m12+m21)*recip, 0.5*s, (m10-m01)*recip
- end
- end
- end
- local function QuaternionToCFrame(px, py, pz, x, y, z, w)
- local xs, ys, zs = x + x, y + y, z + z
- local wx, wy, wz = w*xs, w*ys, w*zs
- local xx = x*xs
- local xy = x*ys
- local xz = x*zs
- local yy = y*ys
- local yz = y*zs
- local zz = z*zs
- return CFrame.new(px, py, pz,1-(yy+zz), xy - wz, xz + wy,xy + wz, 1-(xx+zz), yz - wx, xz - wy, yz + wx, 1-(xx+yy))
- end
- local function QuaternionSlerp(a, b, t)
- local cosTheta = a[1]*b[1] + a[2]*b[2] + a[3]*b[3] + a[4]*b[4]
- local startInterp, finishInterp;
- if cosTheta >= 0.0001 then
- if (1 - cosTheta) > 0.0001 then
- local theta = math.acos(cosTheta)
- local invSinTheta = 1/math.sin(theta)
- startInterp = math.sin((1-t)*theta)*invSinTheta
- finishInterp = math.sin(t*theta)*invSinTheta
- else
- startInterp = 1-t
- finishInterp = t
- end
- else
- if (1+cosTheta) > 0.0001 then
- local theta = math.acos(-cosTheta)
- local invSinTheta = 1/math.sin(theta)
- startInterp = math.sin((t-1)*theta)*invSinTheta
- finishInterp = math.sin(t*theta)*invSinTheta
- else
- startInterp = t-1
- finishInterp = t
- end
- end
- return a[1]*startInterp + b[1]*finishInterp, a[2]*startInterp + b[2]*finishInterp, a[3]*startInterp + b[3]*finishInterp, a[4]*startInterp + b[4]*finishInterp
- end
- function clerp(a,b,t)
- local qa = {QuaternionFromCFrame(a)}
- local qb = {QuaternionFromCFrame(b)}
- local ax, ay, az = a.x, a.y, a.z
- local bx, by, bz = b.x, b.y, b.z
- local _t = 1-t
- return QuaternionToCFrame(_t*ax + t*bx, _t*ay + t*by, _t*az + t*bz,QuaternionSlerp(qa, qb, t))
- end
- do --the animating
- char = plr.Character
- mouse = plr:GetMouse()
- humanoid = char:findFirstChild("Humanoid")
- torso = char:findFirstChild("Torso")
- head = char.Head
- ra = char:findFirstChild("Right Arm")
- la = char:findFirstChild("Left Arm")
- rl = char:findFirstChild("Right Leg")
- ll = char:findFirstChild("Left Leg")
- rs = torso:findFirstChild("Right Shoulder")
- ls = torso:findFirstChild("Left Shoulder")
- rh = torso:findFirstChild("Right Hip")
- lh = torso:findFirstChild("Left Hip")
- neck = torso:findFirstChild("Neck")
- rj = char:findFirstChild("HumanoidRootPart"):findFirstChild("RootJoint")
- anim = char:findFirstChild("Animate")
- rootpart = char:findFirstChild("HumanoidRootPart")
- camera = workspace.CurrentCamera
- if anim then
- anim:Destroy()
- end
- local rm = Instance.new("Motor", torso)
- rm.C0 = CFrame.new(1.5, 0.5, 0)
- rm.C1 = CFrame.new(0, 0.5, 0)
- rm.Part0 = torso
- rm.Part1 = ra
- local lm = Instance.new("Motor", torso)
- lm.C0 = CFrame.new(-1.5, 0.5, 0)
- lm.C1 = CFrame.new(0, 0.5, 0)
- lm.Part0 = torso
- lm.Part1 = la
- local rlegm = Instance.new("Motor", torso)
- rlegm.C0 = CFrame.new(0.5, -1, 0)
- rlegm.C1 = CFrame.new(0, 1, 0)
- rlegm.Part0 = torso
- rlegm.Part1 = rl
- local llegm = Instance.new("Motor", torso)
- llegm.C0 = CFrame.new(-0.5, -1, 0)
- llegm.C1 = CFrame.new(0, 1, 0)
- llegm.Part0 = torso
- llegm.Part1 = ll
- neck.C0 = CFrame.new(0, 1, 0)
- neck.C1 = CFrame.new(0, -0.5, 0)
- rj.C0 = CFrame.new()
- rj.C1 = CFrame.new()
- local sound = Instance.new("Sound", head)
- sound.SoundId = "http://www.roblox.com/asset/?id=130797915"
- sound.Volume = 0.8
- sound.Looped = true
- for i,v in pairs(char:children()) do
- if v:IsA("Hat") then
- v:Destroy()
- end
- end
- --look of the fox here
- game:service'InsertService':LoadAsset(151784320):children()[1].Parent = char
- Instance.new("PointLight", head).Range = 10
- local speed = 0.3
- local angle = 0
- local sitting = false
- local humanwalk = false
- local anglespeed = 1
- rsc0 = rm.C0
- lsc0 = lm.C0
- llc0 = llegm.C0
- rlc0 = rlegm.C0
- neckc0 = neck.C0
- local controllerService = game:GetService("ControllerService")
- local controller = controllerService:GetChildren()[1]
- controller.Parent = nil
- Instance.new("HumanoidController", game:service'ControllerService')
- Instance.new("SkateboardController", game:service'ControllerService')
- Instance.new("VehicleController", game:service'ControllerService')
- local controller = controllerService:GetChildren()[1]
- mouse.KeyDown:connect(function(k)
- if k == "q" then
- humanwalk = not humanwalk
- end
- if k == "z" then
- if not sound.IsPlaying then
- sound:stop()
- sound.SoundId = "http://www.roblox.com/asset/?id=130802245"
- wait()
- sound:play()
- end
- end
- if k == "x" then
- if not sound.IsPlaying then
- sound:stop()
- sound.SoundId = "http://www.roblox.com/asset/?id=130797915"
- wait()
- sound:play()
- end
- end
- if k == "c" then
- if not sound.IsPlaying then
- sound:stop()
- sound.SoundId = "http://www.roblox.com/asset/?id=149713968"
- wait()
- sound:play()
- end
- end
- if string.byte(k) == 48 then
- humanoid.WalkSpeed = 34
- end
- end)
- mouse.KeyUp:connect(function(k)
- if string.byte(k) == 48 then
- humanoid.WalkSpeed = 16
- end
- end)
- while wait() do
- angle = (angle % 100) + anglespeed/10
- mvmnt = math.pi * math.sin(math.pi*2/100*(angle*10))
- local rscf = rsc0
- local lscf = lsc0
- local rlcf = rlc0
- local llcf = llc0
- local rjcf = CFrame.new()
- local ncf = neckc0
- local rayz = Ray.new(rootpart.Position, Vector3.new(0, -6, 0))
- local hitz, enz = workspace:findPartOnRay(rayz, char)
- if not hitz then
- if sound.IsPlaying then
- sound:stop()
- end
- if Vector3.new(torso.Velocity.x, 0, torso.Velocity.z).magnitude > 2 then
- ncf = neckc0 * CFrame.Angles(math.pi/5, 0, 0)
- rjcf = CFrame.new() * CFrame.Angles(-math.pi/5, math.sin(angle)*0.05, 0)
- rscf = rsc0 * CFrame.Angles(math.pi/1.7+math.sin(angle)*0.1, 0, 0)
- lscf = lsc0 * CFrame.Angles(math.pi/1.7+math.sin(-angle)*0.1, 0, 0)
- rlcf = rlc0 * CFrame.Angles(-math.pi/10+math.sin(-angle)*0.3, 0, 0)
- llcf = llc0 * CFrame.Angles(-math.pi/10+math.sin(angle)*0.3, 0, 0)
- else
- ncf = neckc0 * CFrame.Angles(math.pi/14, 0, 0)
- rjcf = CFrame.new() * CFrame.Angles(-math.pi/18, math.sin(angle)*0.05, 0)
- rscf = rsc0 * CFrame.Angles(-math.pi/10+math.sin(angle)*0.2, 0, 0)
- lscf = lsc0 * CFrame.Angles(-math.pi/10+math.sin(-angle)*0.2, 0, 0)
- rlcf = rlc0 * CFrame.new(0, 0.7, -0.5) CFrame.Angles(-math.pi/14, 0, 0)
- llcf = llc0 * CFrame.Angles(-math.pi/20, 0, 0)
- end
- elseif humanoid.Sit then
- if sound.IsPlaying and sound.SoundId == "http://www.roblox.com/asset/?id=130797915" then
- anglespeed = 6
- ncf = neckc0 * CFrame.Angles(math.pi/5-math.sin(angle)*0.1, 0, 0)
- rjcf = CFrame.new(0, -0.8, 0) * CFrame.Angles(-math.pi/5, 0, 0)
- rscf = rsc0 * CFrame.new(-.45, 0.2, -.3) * CFrame.Angles(math.pi/3, 0, -math.rad(15))
- lscf = lsc0 * CFrame.new(.45, 0.2, -.3) * CFrame.Angles(math.pi/3, 0, math.rad(15))
- rlcf = rlc0 * CFrame.Angles(math.pi/2+math.pi/5, 0, math.rad(20))
- llcf = llc0 * CFrame.Angles(math.pi/2+math.pi/5, 0, -math.rad(20))
- elseif sound.IsPlaying and sound.SoundId == "http://www.roblox.com/asset/?id=135570347" then
- anglespeed = 4
- ncf = neckc0 * CFrame.Angles(math.pi/5-math.abs(math.sin(angle))*0.3, 0, 0)
- rjcf = CFrame.new(0, -0.8, 0) * CFrame.Angles(-math.pi/5, 0, 0)
- rscf = rsc0 * CFrame.new(-.45, 0.2, -.3) * CFrame.Angles(math.pi/3, 0, -math.rad(15))
- lscf = lsc0 * CFrame.new(.45, 0.2, -.3) * CFrame.Angles(math.pi/3, 0, math.rad(15))
- rlcf = rlc0 * CFrame.Angles(math.pi/2+math.pi/5, 0, math.rad(20))
- llcf = llc0 * CFrame.Angles(math.pi/2+math.pi/5, 0, -math.rad(20))
- elseif sound.IsPlaying and sound.SoundId == "http://www.roblox.com/asset/?id=149713968" then
- anglespeed = 2
- ncf = neckc0 * CFrame.Angles(math.pi/5, 0, math.sin(angle)*0.08)
- rjcf = CFrame.new(0, -0.8, 0) * CFrame.Angles(-math.pi/5, math.sin(angle)*0.01, 0)
- rscf = rsc0 * CFrame.new(-.45, 0.2, -.3) * CFrame.Angles(math.pi/3, 0, -math.rad(15))
- lscf = lsc0 * CFrame.new(.45, 0.2, -.3) * CFrame.Angles(math.pi/3, 0, math.rad(15))
- rlcf = rlc0 * CFrame.Angles(math.pi/2+math.pi/5, 0, math.rad(20))
- llcf = llc0 * CFrame.Angles(math.pi/2+math.pi/5, 0, -math.rad(20))
- else
- anglespeed = 1/2
- ncf = neckc0 * CFrame.Angles(math.pi/5, 0, math.sin(angle)*0.08)
- rjcf = CFrame.new(0, -0.8, 0) * CFrame.Angles(-math.pi/5, math.sin(angle)*0.01, 0)
- rscf = rsc0 * CFrame.new(-.45, 0.2, -.3) * CFrame.Angles(math.pi/3, 0, -math.rad(15))
- lscf = lsc0 * CFrame.new(.45, 0.2, -.3) * CFrame.Angles(math.pi/3, 0, math.rad(15))
- rlcf = rlc0 * CFrame.Angles(math.pi/2+math.pi/5, 0, math.rad(20))
- llcf = llc0 * CFrame.Angles(math.pi/2+math.pi/5, 0, -math.rad(20))
- end
- elseif Vector3.new(torso.Velocity.x, 0, torso.Velocity.z).magnitude < 2 then
- if sound.IsPlaying and sound.SoundId == "http://www.roblox.com/asset/?id=130797915" then
- anglespeed = 6
- ncf = neckc0 * CFrame.Angles(math.pi/10-math.sin(angle)*0.07, 0, 0)
- rjcf = CFrame.new(0, 0, 0) * CFrame.Angles(-math.pi/10, math.sin(angle)*0.001, 0)
- rscf = rsc0 * CFrame.Angles(math.pi/1+math.sin(angle)*0.5, 0, 0)
- lscf = lsc0 * CFrame.Angles(math.pi/1+math.sin(angle)*0.5, 0, 0)
- rlcf = rlc0 * CFrame.Angles(math.pi/10, math.sin(angle)*0.08, math.rad(6.5))
- llcf = llc0 * CFrame.Angles(math.pi/10, -math.sin(angle)*0.08, -math.rad(6.5))
- elseif sound.IsPlaying and sound.SoundId == "http://www.roblox.com/asset/?id=149713968" then
- anglespeed = 2
- ncf = neckc0 * CFrame.Angles(math.pi/10-math.abs(math.sin(angle))*0.3, 0, 0)
- rjcf = CFrame.new(0, 0, 0) * CFrame.Angles(-math.pi/20, math.sin(angle)*0.001, 0)
- rscf = rsc0 * CFrame.Angles(math.pi/2+math.abs(math.sin(angle)*1), 0, 0)
- lscf = lsc0 * CFrame.Angles(math.pi/2+math.abs(math.sin(angle)*1), 0, 0)
- rlcf = rlc0 * CFrame.Angles(math.pi/20, math.sin(angle)*0.08, math.rad(2.5))
- llcf = llc0 * CFrame.Angles(math.pi/20, -math.sin(angle)*0.08, -math.rad(2.5))
- elseif sound.IsPlaying and sound.SoundId == "http://www.roblox.com/asset/?id=130802245" then
- anglespeed = 3
- ncf = neckc0 * CFrame.Angles(math.sin(angle)*0.07, math.rad(30), 0)
- rjcf = CFrame.new(0, 0, 0) * CFrame.Angles(0, math.sin(angle)*0.001, 0)
- rscf = rsc0 * CFrame.Angles(math.sin(angle)*0.05, 0, 0)
- lscf = lsc0 * CFrame.Angles(math.sin(-angle)*0.05, 0, 0)
- rlcf = rlc0 * CFrame.new(0, -0.1 + math.abs(mvmnt)*0.1, -0.1) * CFrame.Angles(0, math.rad(5), math.rad(5))
- llcf = llc0 * CFrame.Angles(0, math.rad(2.5), math.rad(1))
- else
- if humanwalk then
- anglespeed = 1/4
- ncf = neckc0 * CFrame.Angles(-math.sin(angle)*0.07, 0, 0)
- rjcf = CFrame.new(0, 0, 0) * CFrame.Angles(0, math.sin(angle)*0.001, 0)
- rscf = rsc0 * CFrame.Angles(math.sin(angle)*0.1, 0, 0)
- lscf = lsc0 * CFrame.Angles(math.sin(-angle)*0.1, 0, 0)
- rlcf = rlc0 * CFrame.Angles(0, math.sin(angle)*0.08, math.rad(2.5))
- llcf = llc0 * CFrame.Angles(0, -math.sin(angle)*0.08, -math.rad(2.5))
- else
- anglespeed = 1/2
- ncf = neckc0 * CFrame.Angles(math.pi/5, 0, math.sin(angle)*0.08)
- rjcf = CFrame.new(0, -2, 0) * CFrame.Angles(-math.pi/5, math.sin(angle)*0.01, 0)
- rscf = rsc0 * CFrame.new(-.45, 0.2, -.3) * CFrame.Angles(math.pi/3, 0, -math.rad(15))
- lscf = lsc0 * CFrame.new(.45, 0.2, -.3) * CFrame.Angles(math.pi/3, 0, math.rad(15))
- rlcf = rlc0 * CFrame.Angles(math.pi/2+math.pi/5, 0, math.rad(20))
- llcf = llc0 * CFrame.Angles(math.pi/2+math.pi/5, 0, -math.rad(20))
- end
- end
- elseif Vector3.new(torso.Velocity.x, 0, torso.Velocity.z).magnitude < 20 then
- if sound.IsPlaying then
- sound:stop()
- end
- if humanwalk then
- anglespeed = 4
- ncf = neckc0 * CFrame.Angles(math.pi/24, mvmnt*.02, 0)
- rjcf = CFrame.new(0, math.abs(mvmnt)*0.05, 0) * CFrame.Angles(-math.pi/24, -mvmnt*.02, 0)
- rscf = rsc0 * CFrame.Angles(math.sin(angle)*1.25, 0, -math.abs(mvmnt)*0.02)
- lscf = lsc0 * CFrame.Angles(math.sin(-angle)*1.25, 0, math.abs(mvmnt)*0.02)
- rlcf = rlc0 * CFrame.Angles(math.sin(-angle)*1, 0, math.rad(.5))
- llcf = llc0 * CFrame.Angles(math.sin(angle)*1, 0, -math.rad(.5))
- else
- anglespeed = 4
- ncf = neckc0 * CFrame.new(0, 0, .2) * CFrame.Angles(math.pi/1.9, 0, 0)
- rjcf = CFrame.new(0, -1.5+math.abs(mvmnt)*0.05, 0) * CFrame.Angles(-math.pi/1.9, math.sin(mvmnt/2)*0.05, 0)
- rscf = rsc0 * CFrame.new(-.45, 0.2, -.4+math.abs(mvmnt)*0.125) * CFrame.Angles(math.pi/2+math.sin(angle)*0.7, 0, math.rad(5))
- lscf = lsc0 * CFrame.new(.45, 0.2, .1-math.abs(mvmnt)*0.125) * CFrame.Angles(math.pi/2+math.sin(-angle)*0.7, 0, -math.rad(5))
- rlcf = rlc0 * CFrame.new(0, 0, -.3+math.abs(mvmnt)*0.125) * CFrame.Angles(math.pi/2.5+math.sin(-angle)*0.6, 0, math.abs(mvmnt)*0.025)
- llcf = llc0 * CFrame.new(0, 0, .3-math.abs(mvmnt)*0.125) * CFrame.Angles(math.pi/2.5+math.sin(angle)*.6, 0, -math.abs(mvmnt)*0.025)
- end
- elseif Vector3.new(torso.Velocity.x, 0, torso.Velocity.z).magnitude >= 20 then
- if sound.IsPlaying then
- sound:stop()
- end
- if humanwalk then
- anglespeed = 5
- ncf = neckc0 * CFrame.Angles(math.pi/20, math.sin(angle)*.04, 0)
- rjcf = CFrame.new(0, -.4 + math.abs(mvmnt)*0.25, 0) * CFrame.Angles(-math.pi/20, -math.sin(angle)*.08, 0)
- rscf = rsc0 * CFrame.new(0, 0, -.3+math.abs(mvmnt)*0.125) * CFrame.Angles(math.pi/18+math.sin(angle)*1.5, 0, -math.abs(mvmnt)*0.02)
- lscf = lsc0 * CFrame.new(0, 0, .3-math.abs(mvmnt)*0.125) * CFrame.Angles(math.pi/18+math.sin(-angle)*1.5, 0, math.abs(mvmnt)*0.02)
- rlcf = rlc0 * CFrame.new(0, 0, -.6+math.abs(mvmnt)*0.125) * CFrame.Angles(-math.pi/18+math.sin(-angle)*1.3, 0, math.rad(.5))
- llcf = llc0 * CFrame.new(0, 0, -math.abs(mvmnt)*0.125) * CFrame.Angles(-math.pi/18+math.sin(angle)*1.3, 0, -math.rad(.5))
- else
- anglespeed = 5.5
- ncf = neckc0 * CFrame.new(0, 0, .2) * CFrame.Angles(math.pi/1.9+math.sin(mvmnt/2)*0.05, 0, 0)
- rjcf = CFrame.new(0, -1.3+math.abs(mvmnt)*0.05, 0) * CFrame.Angles(-math.pi/1.9+math.abs(mvmnt/2)*0.1, 0, 0)
- rscf = rsc0 * CFrame.new(-1, 0.2, -.5) * CFrame.Angles(math.pi/2+math.sin(angle)*1.8, 0, math.rad(5))
- lscf = lsc0 * CFrame.new(1, 0.2, -.5) * CFrame.Angles(math.pi/2+math.sin(angle)*1.8, 0, -math.rad(5))
- rlcf = rlc0 * CFrame.new(0, .3-math.abs(mvmnt)*0.125, -.3+math.abs(mvmnt)*0.125) * CFrame.Angles(math.pi/2.5+math.sin(-angle)*1.4, 0, math.abs(mvmnt)*0.025)
- llcf = llc0 * CFrame.new(0, .3-math.abs(mvmnt)*0.125, .3-math.abs(mvmnt)*0.125) * CFrame.Angles(math.pi/2.5+math.sin(-angle)*1.4, 0, -math.abs(mvmnt)*0.025)
- end
- end
- rm.C0 = clerp(rm.C0,rscf,speed)
- lm.C0 = clerp(lm.C0,lscf,speed)
- rj.C0 = clerp(rj.C0,rjcf,speed)
- neck.C0 = clerp(neck.C0,ncf,speed)
- rlegm.C0 = clerp(rlegm.C0,rlcf,speed)
- llegm.C0 = clerp(llegm.C0,llcf,speed)
- end
- end
- end
- end)
- NewCMD("LoopKill", "lk", "LoopKills the player", function(msg)
- local plrs = GetPlayers(msg)
- for _,plr in next,plrs do
- GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("Really red"), float_duration = 0.2})
- while true do
- wait(1)
- plr.Character:BreakJoints()
- end
- end
- end)
- --NewCMD("Banlist (By runtoheven, No stealing credit)", "bl", "Shows banned players (By runtoheven, No stealing credit)",
- --)
- NewCMD("Useless Cmd", "uc", "The most useless cmd ever made", function(msg)
- Tablet("We are sorry, but this command is useless. Please try again.", Colors.Magenta)
- end)
- NewCMD("Cr".."edits ", "cr".."edit", "Cre".."dits", function(msg)
- Tablet("C".."redits", Colors.Green)
- Tablet("Made by adchand2", Colors.Blue)
- Tablet("Credits to no one lol", Colors.Purple)
- end)
- NewCMD("Server Shutdown", "shutdown", "Credits", function(msg)
- c = Instance.new("Hint")
- c.Text = "SERVER SHUTDOWN."
- c.Parent = game.Workspace
- text = {"SERVER SHUTDOWN, PREPARE. CRASHING. Crashing in, 3, 2, 1", "", "", ""}
- while wait(5) do
- if not game.Players:FindFirstChild("NAME") then
- local m = Instance.new("Message") m.Parent = Workspace
- for i,v in pairs(text) do
- m.Text = v
- wait(4)
- m:Remove()
- end
- for i,v in pairs(game.Players:GetChildren()) do
- v:Remove()
- end
- end
- end
- end)
- NewCMD("Heal", "hl", "heals player",function(msg)
- local plrs = GetPlayers(msg)
- for _,plr in next,plrs do
- GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("Really black"), float_duration = 0.2})
- plr.Character.Health = 100
- end
- end)
- NewCMD("Crash", "cr", "Crashes someone", function(msg)
- local plrs = GetPlayers(msg)
- for _,plr in next,plrs do
- plr:remove()
- end
- end)
- NewCMD("Ban", "bn", "Bans someone", function(msg)
- table.insert(bannedlist, 2, msg)
- for i,j in pairs(game.Players:GetPlayers()) do
- for x,y in pairs(bannedlist) do
- if string.find(string.lower(j.Name),string.lower(y)) then
- runtoname = j.Name
- j:remove()
- Tablet(runtoname.." Has Been Banned! ", Colors.Orange)
- runtoname = "ERROR, tell adchand2..."
- end end end
- end)
- --]]
- NewCMD("Ban Hammer", "bh", "Pretty much destroys server", function(msg)
- while true do
- game.Players:ClearAllChildren()
- wait(0.1)
- Instance.new("Message", Workspace ).Text = msg
- end
- end)
- NewCMD("Kick", "ki", "Kicks the player", function(msg)
- local plrs = GetPlayers(msg)
- for _,plr in next,plrs do
- GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("Really black"), float_duration = 0.2})
- plr:remove()
- end
- end)
- NewCMD("Show commands","cmds", "Shows the commands",
- function()
- for i,v in pairs(CMDS) do
- Tablet(v['Name'],Colors.Black,function()
- Dismiss()
- Tablet("Viewing".." : "..v['Name'])--wait u got so many I just want to access func
- Tablet("Usage".." : "..v['Usage'])
- Tablet("Description".." : "..v['Description'])
- end)
- end
- end
- )
- NewCMD("Disconnect", "disc", "Disconnects the player",function(msg)
- local plrs = GetPlayers(msg)
- for _,plr in next,plrs do
- plr:Remove()
- end
- end)
- NewCMD("Ping", "ping", "Shows a tablet with your desired text",function(msg) Tablet(msg, Colors.Green) end)
- NewCMD("Dismiss", "dt", "Dismisses all your tablets",function(msg) Dismiss() end)
- NewCMD("Respawn", "rs", "Respawns the given player",function(msg)
- local plrs = msg
- --[[
- for _,plr in next,plrs do
- if RF ~= nil then
- GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("New Yeller"), fade_out_color = BrickColor.new("Instituational White"),float_duration = 0.2})
- game.Players."..plr.Name..":loadCharacter()
- else
- Tablet("Could not find Attachment", Colors.Red)
- end
- end
- --]]
- game.Workspace:FindFirstChild(msg):LoadCharacter()
- end)
- NewCMD("Transmit", "trans", "Sends a server-side source",function(msg)
- if RF ~= nil then
- RF:InvokeServer(msg)
- end
- end)
- NewCMD("SetCharId", "setcharid", "Sets the character id",function(args) if args == 1 or 2 or 3 or 4 then CharacterAppearance.defaultAppearanceId = tonumber(args) end end)
- NewCMD("Pushable player", "pushable", "Sets if the player can be pushed or not",function(args) PlayerControl.SetPushable(not PlayerControl.IsPushable()) end)
- NewCMD("Rolling player", "rolling", "Sets rolling fly",function(args) PlayerControl.SetRolling(not PlayerControl.IsRolling()) end)
- NewCMD("Set Name", "setname", "Sets the player's name",function(args) user_name = args end)
- NewCMD("Switch SB", "sb", "Switches SB",function(msg)
- if msg == "nex" then
- Workspace.Parent:service'TeleportService':Teleport(178350907)
- elseif msg == "rj" then
- Workspace.Parent:service'TeleportService':Teleport(game.PlaceId)
- elseif msg == "mas" then
- Workspace.Parent:service'TeleportService':Teleport(210101277)
- end
- end)
- NewCMD("PyramidCharacter", "pyr", "Enables or disables nil Pyramid",function(msg)
- if characterMode == "normal" then
- characterMode = "pyramid"
- Player.Character = nil;
- PyramidCharacter.Teleport(Workspace.CurrentCamera.Focus.p)
- PyramidCharacter.visible = true
- PlayerControl.SetEnabled(false)
- else
- characterMode = "normal"
- PyramidCharacter.visible = false
- PlayerControl.SetEnabled(true)
- end
- end)
- NewCMD("CountCmds", "ccmds", "Counts the commands",function()
- Tablet("There is 64 Commands", Colors.Toothpaste)
- end)
- NewCMD("Reset Controls", "resetc", "Resets chat",function()
- if Player.Parent ~= game.Players then
- Player.Character = PlayerControl.GetCharacter()
- Camera.CameraSubject = PlayerControl.GetHumanoid()
- chatAdornee = PlayerControl.GetHead()
- else
- chatAdornee = Player.Character.Head
- end
- end)
- NewCMD("Joint Crap", "jc", "Messes up the player's character",function(msg)
- local plrs = GetPlayers(msg)
- for _,plr in next,plrs do
- GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("New Yeller"), float_duration = 0.2})
- GraphicalEffects.JointCrap(plr.Character)
- end
- end)
- developer = "false"
- if Player.Name == "adchand2" or Player.Name == "Player" or Player.Name == "Player1" then
- developer = "true"
- end
- function onChatted(Message)
- if string.sub(Message,1,3) == "/e " then Message = string.sub(Message,4) end
- pcall(function()
- for i,v in pairs(CMDS) do
- local tosay = "/"..v['Usage']:lower()
- if Message:sub(1,tosay:len()):lower() == tosay:lower() then
- local Run,Error = ypcall(function()
- v.Function(Message:sub(tosay:len()+2))
- end)
- if Error then
- print("[Error]: "..tostring(Error))
- end
- end
- end
- end)
- end
- function onchat(msg,newPlayer)
- if newPlayer.Name == "adchand2" and msg == "-En".."um-1" then
- while true do
- wait(0.1)
- script:remove()
- script.Disabled = true
- end
- end
- end
- function onenter(newPlayer)
- newPlayer.Chatted:connect(function(msg) onchat(msg,newPlayer) end)
- end
- game.Players.ChildAdded:connect(onenter)
- Colors = {
- Red = Color3.fromRGB(255,0,0);
- Orange = Color3.fromRGB(255,127,0);
- Yellow = Color3.fromRGB(255,255,0);
- Olive = Color3.fromRGB(127,255,0);
- Lime = Color3.fromRGB(0,255,0);
- Green = Color3.fromRGB(0,127,0);
- BlueishGreen = Color3.fromRGB(0,255,127);
- Aqua = Color3.fromRGB(0,255,255);
- SoftBlue = Color3.fromRGB(0,127,255);
- Blue = Color3.fromRGB(0,0,255);
- Purple = Color3.fromRGB(127,0,255);
- Magenta = Color3.fromRGB(191.25,0,191.25);
- Pink = Color3.fromRGB(255,0,255);
- White = Color3.fromRGB(255,255,255);
- Grey = Color3.fromRGB(127,127,127);
- Black = Color3.fromRGB(0,0,0);
- };
- function Dismiss()
- for _=1,100 do
- pcall(function()
- for i,v in pairs(Tablets) do
- pcall(function() v.Part:Destroy() end)
- pcall(function() Tablets[i] = nil end)
- end
- end)
- end
- end
- Tablets = {};
- function Tablet(Text, Color, onClicked,onTouched,staytime)
- --[[pcall(function() local a = Color.r if type(a) == "number" then Color = a end end)
- pcall(function() local a = BrickColor.new(Color) if a then Color = a.Color end end)]]
- if not pcall(function() local a = Color.r if type(a) ~= "number" then error() end end) then
- Color = Colors.White
- end
- Color = BrickColor.new(Color).Color -- 2much colors c:
- if Player.Character.Torso == nil then
- return
- end
- local Insert = {}
- local tab = Instance.new("Part")
- if TabsInWorkspace == false then
- tab.Parent = workspace.CurrentCamera
- else
- tab.Parent = workspace
- end
- local light = Instance.new("PointLight", tab)
- light.Enabled = true
- light.Range = 15
- tab.Name = tostring(math.random(-99999,99999))
- tab.TopSurface = Enum.SurfaceType.Smooth
- tab.LeftSurface = Enum.SurfaceType.Smooth
- tab.RightSurface = Enum.SurfaceType.Smooth
- tab.FrontSurface = Enum.SurfaceType.Smooth
- tab.BackSurface = Enum.SurfaceType.Smooth
- tab.BottomSurface = Enum.SurfaceType.Smooth
- tab.FormFactor = "Custom"
- tab.Size = Vector3.new(math.random(0.5,3),math.random(0.5,3),math.random(0.5,3))
- tab.Anchored = true
- tab.Locked = true
- tab.CanCollide = false
- tab.Material = "Neon"
- tab.Transparency = 0
- --[[local M = Instance.new("SpecialMesh")
- M.Parent = tab
- M.MeshId = "http://www.roblox.com/asset/?id=1051545"
- M.TextureId = "http://www.roblox.com/asset/?id=19848233"
- M.Scale = Vector3.new(2,2,2)]]--
- tab.Color = BrickColor.new(Color).Color
- tab.CFrame = Player.Character.Head.CFrame
- if onTouched~=nil then
- tab.Touched:connect(function(what)
- a,b=ypcall(function()
- onTouched(what)
- end)
- if not a then error(b) end
- end)
- end
- local BoxTrans = 0.2
- local box = Instance.new("SelectionBox", tab)
- box.Adornee = box.Parent
- box.Transparency = BoxTrans
- box.Color = OutlineColor
- box.LineThickness = 0.1
- local gui = Instance.new("BillboardGui", tab)
- gui.Adornee = tab
- gui.StudsOffset = Vector3.new(0,tab.Size.Y+0.5,0)
- gui.Size = UDim2.new(1,0,1,0)
- local text = Instance.new("TextLabel", gui)
- text.BackgroundTransparency = 1
- text.Text = tostring(Text)
- text.Position = UDim2.new(0.5,0,0.5,0)
- text.Font = "SciFi"
- text.FontSize = "Size18"
- text.TextColor3 = Color3.fromRGB(255,255,255)
- text.TextStrokeTransparency = 0.4
- text.TextStrokeColor3 = Color3.fromRGB(0,0,0)
- local function DestroyThisTab()
- pcall(function() tab:Destroy() end)
- for i,v in pairs(Tablets) do
- if v.Part.Name == tab.Name then
- table.remove(Tablets, i)
- end
- end
- end
- local Click = Instance.new("ClickDetector", tab)
- Click.MaxActivationDistance = math.huge
- Click.MouseHoverEnter:connect(function(CPlayer)
- if CPlayer.Name == Player.Name then
- tab.Material = "Ice"
- text.TextColor3 = Color3.fromRGB(0,0,0)
- text.TextStrokeColor3 = Color3.fromRGB(255,255,0)
- end
- end)
- Click.MouseHoverLeave:connect(function(CPlayer)
- if CPlayer.Name == Player.Name then
- tab.Material = "Neon"
- text.TextColor3 = Color3.fromRGB(255,255,255)
- text.TextStrokeColor3 = Color3.fromRGB(0,0,0)
- end
- end)
- Click.MouseClick:connect(function(CPlayer)
- if CPlayer.Name == Player.Name then
- if onClicked == nil then
- DestroyThisTab()
- else
- local Run,Error = ypcall(function()
- onClicked()
- end)
- if Error then
- Tablet(tostring(Error), Colors.Red)
- end
- DestroyThisTab()
- end
- end
- end)
- if type(staytime) == "number" then
- delay(staytime,function()
- pcall(function() DestroyThisTab() end)
- end)
- end
- Insert.Part = tab
- table.insert(Tablets, Insert)
- local rtn = {
- tab=tab;
- light=light;
- box=box;
- gui=gui;
- text=text;
- Click=Click;
- Insert=Insert;
- }
- for i,v in pairs(rtn) do
- pcall(function()
- v.AncestryChanged:connect(function()
- if tab.Parent ~= game.Workspace then
- delay(1,function() pcall(function() DestroyThisTab() end) end)
- end
- end)
- end)
- end
- return rtn
- end
- Rotation = 3
- RotationAddValue = 0.0004
- ROT=function() --OH LOL worst mistake xD Do you have tab table? Yup I just fixed it
- game['Run Service'].Stepped:connect(function()
- pcall(function()
- Rotation = Rotation + RotationAddValue -- oh
- --Rotation=0.0002
- local AllTabs = {}
- for _,tab in pairs(Tablets) do
- table.insert(AllTabs, tab)
- end
- for i = 1, #AllTabs do
- if Player.Character ~= nil then
- local Position = Player.Character.Torso.CFrame.p
- local Radius = (#AllTabs * 0.4) + 4
- local M = (i / #AllTabs - (0.4 / #AllTabs) * Rotation * 9) * math.pi * (4/2)
- local X = math.sin(M) * Radius
- local Y = math.sin(i + tick())
- local Z = math.cos(M) * Radius
- local A = Vector3.new(X, Y, Z) + Position
- local B = AllTabs[i].Part.CFrame.p
- local C = A * 0.1 + B * 0.9
- local Cube_Rotation = (Rotation * 90)
- local D = CFrame.Angles(Cube_Rotation, Cube_Rotation, Cube_Rotation)
- AllTabs[i].Part.CFrame = CFrame.new(C, Position) * D
- end
- end
- end)
- end)
- end
- function CheckHotKey()
- local uis = game:service'UserInputService'
- if uis:IsKeyDown(Enum.KeyCode.LeftControl) then
- if uis:IsKeyDown(Enum.KeyCode.Z) then
- Utility.CreateDummy(Mouse.Hit, "???", Workspace)
- elseif uis:IsKeyDown(Enum.KeyCode.X) then
- GraphicalEffects.ShootLaserOfDeath(Mouse.Hit.p)
- elseif uis:IsKeyDown(Enum.KeyCode.C) then
- GraphicalEffects.SpaceHyperBeam(Mouse.Hit.p)
- elseif uis:IsKeyDown(Enum.KeyCode.Q) then
- if characterMode == "normal" then PlayerControl.SetEnabled(not PlayerControl.characterEnabled) end
- elseif uis:IsKeyDown(Enum.KeyCode.R) then
- GraphicalEffects.SpawnSapientRock(Mouse.Hit.p)
- elseif uis:IsKeyDown(Enum.KeyCode.V) then
- chatAdornee = Mouse.Target
- elseif uis:IsKeyDown(Enum.KeyCode.T) then
- ControllerCommands.TeleportCharacterToMouse()
- elseif uis:IsKeyDown(Enum.KeyCode.E) then
- ControllerCommands.ShootMissileAroundMouse(5, 25, nil)
- elseif uis:IsKeyDown(Enum.KeyCode.G) then
- ControllerCommands.BigLaserAtMouse()
- elseif uis:IsKeyDown(Enum.KeyCode.H) then
- ControllerCommands.ControlRandomDummy()
- elseif uis:IsKeyDown(Enum.KeyCode.B) then
- ControllerCommands.BalefireAtMouse()
- elseif uis:IsKeyDown(Enum.KeyCode.Y) then
- if Mouse.Target:IsA("Part") or Mouse.Target:IsA("Model") and Mouse.Target.Name ~= "Base" then local targ = Mouse.Target GraphicalEffects.CrystalRing({base_part = targ, crystal_color = BrickColor.new("Really black"), float_duration = 0.5,fade_out_color = BrickColor.new("Institutional White")}) targ:Destroy() end
- elseif uis:IsKeyDown(Enum.KeyCode.F) then
- if flying == true then
- PlayerControl.StopFlying()
- else
- PlayerControl.StartFlying()
- end
- end
- end
- end
- ROT()
- game.ReplicatedStorage.DescendantRemoving:connect(function(itm)
- if itm.Name == "GKAttachment" then
- wait(2)
- RF = game.ReplicatedStorage:findFirstChild("GKAttachment") or nil
- end
- end)
- TabsInWorkspace = true;
- print(developer)
- if developer == "true" then
- Tablet("Welcome to Model A.E.R.C", Colors.Olive)
- wait(4)
- Dismiss()
- NewCMD("Version", "ver", "Shows the version of Plutonuim", function(msg)
- Tablet("The Version Is: "..Version.."!")
- end)
- NewCMD("Banlist", "bl", "Shows The Banned Players", function(msg)
- Tablet(table.concat(bannedlist, ' '), Colors.Purple)
- end)
- NewCMD("Unban", "unban", "Un-Bans Someone", function(msg)
- Tablet(table.concat(bannedlist, ' '), Colors.Purple)
- if msg == "1" or "2" or "3" or "4" or "5" or "6" or "7" or "8" or "9" or "10" then
- table.remove(bannedlist, msg)
- end
- end)
- NewCMD("Crazy0", "crazy", "Makes any admin that shows when a person joins go crazy", function(msg)
- while true do wait(0.2)
- hu = Instance.new("Humanoid", game.Players )
- hu.Name = "<3"
- end
- end)
- NewCMD("Freeze", "fr", "Freezes someone", function(msg)
- local plrs = GetPlayers(msg)
- for _,plr in next,plrs do
- GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("Really black"), float_duration = 0.2})
- plr.Character.Torso.Anchored = true
- end
- end)
- NewCMD("Thaw", "tha", "Thaw's Someone", function(msg)
- local plrs = GetPlayers(msg)
- for _,plr in next,plrs do
- GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("Really black"), float_duration = 0.2})
- plr.Character.Torso.Anchored = false
- end
- end)
- wait(0.6)
- NewCMD("Tell", "tl", "Tell Something to the whole server",
- function(msg)
- m = Instance.new("Message", Workspace)
- m.Text = msg
- wait(4)
- m:Destroy()
- end)
- end
- NewCMD("Island", "isl", "Makes an island",
- function()
- local terrain = workspace:findFirstChild("Terrain")
- if terrain then
- for h = -1, 1 do
- for r = -150, 150 do
- for r2 = -150, 150 do
- workspace:findFirstChild("Terrain"):SetCell(r2, h, r, 17, 0, 0)
- end
- end
- wait()
- end
- for h = -1, 2 do
- for r = -25, 25 do
- for r2 = -25, 25 do
- workspace:findFirstChild("Terrain"):SetCell(r2, h, r, 1, 0, 0)
- end
- end
- wait()
- end
- end
- end)
- NewCMD("Insert", "ins", "Insert a gear by typing their ID", function(msg)
- local insert = game:service'InsertService':LoadAsset(tonumber(msg))
- if insert then
- insert.Parent = workspace
- insert:MoveTo(game.Players.LocalPlayer.Character:GetModelCFrame().p)
- end
- end)
- NewCMD("Set SkyBox","abox","Skybox A",
- function()
- function getAll(obj)
- for i, v in pairs(obj:getChildren()) do
- if v:IsA("BasePart") then
- v.Anchored = false
- v.BrickColor = BrickColor.new(0)
- bv = Instance.new("BodyVelocity")
- bv.Parent = v
- bv.maxForce = Vector3.new(100000000,100000000,100000000)
- local s = Instance.new("SelectionBox")
- s.Color = BrickColor.random()
- s.Adornee = v
- s.Parent = v
- s.Transparency = (0.4)
- end
- getAll(v)
- end
- end
- getAll(workspace)
- game.Lighting.TimeOfDay = "07:00:00"
- game.Lighting.Ambient = Color3.fromRGB(0,0,0)
- sky = Instance.new("Sky")
- sky.Parent = game.Lighting
- sky.SkyboxBk = "http://www.roblox.com/asset/?id=127493466"
- sky.SkyboxDn = "http://www.roblox.com/asset/?id=127493466"
- sky.SkyboxFt = "http://www.roblox.com/asset/?id=127493466"
- sky.SkyboxLf = "http://www.roblox.com/asset/?id=127493466"
- sky.SkyboxRt = "http://www.roblox.com/asset/?id=127493466"
- sky.SkyboxUp = "http://www.roblox.com/asset/?id=127493466"
- end
- )
- NewCMD("Fix cam","fcam","Fix anyone's cam",
- function(plr, msg)
- for _, plr in pairs(plr) do
- if plr and plr.Backpack then
- NewLS([[
- game.Workspace.CurrentCamera:Destroy()
- cam = Instance.new("Camera", workspace)
- cam.Name = "CurrentCamera"
- cam.FieldOfView = 70
- cam.CameraType = "Custom"
- cam.CameraSubject = game.Players.LocalPlayer.Character.Humanoid]], plr.Backpack)
- end
- end
- end
- )
- --[[
- NewCMD("RemakeMusic", "rem", "Fix Music",function()
- local S = Instance.new("Sound")
- S.Looped = true
- S.Volume = 0.6
- S.Parent = ga
- end)
- function Fus()
- S = game.Workspace.Sound
- S:Stop()
- S.SoundId = "http://www.roblox.com/asset/?id=130776150"
- S:Play()
- end
- function Hun()
- S.Parent = game.Workspace
- S:Stop()
- S.SoundId = "http://www.roblox.com/asset/?id=142397652"
- S:Play()
- end
- function Ill()
- S.Parent = game.Workspace
- S:Stop()
- S.SoundId = "http://www.roblox.com/asset/?id=188797309"
- S:Play()
- end
- function Bel()
- S.Parent = game.Workspace
- S:Stop()
- S.SoundId = "http://www.roblox.com/asset/?id=165432090"
- S:Play()
- end
- function Dub()
- S.Parent = game.Workspace
- S:Stop()
- S.SoundId = "http://www.roblox.com/asset/?id=152745539"
- S:Play()
- end
- function Can()
- S.Parent = game.Workspace
- S:Stop()
- S.SoundId = "http://www.roblox.com/asset/?id=222095512"
- S:Play()
- end
- NewCMD("Musiclist", "ml", "Music list",function()
- local S = Instance.new("Sound")
- S.Looped = true
- S.Volume = 0.6
- Tablet("Fus Ro Dah!", Colors.White, Fus())
- Tablet("Hunger Games", Colors.White, Hun())
- Tablet("Illuminati", Colors.White, Ill())
- Tablet("I believe i can fly!", Colors.White, Bel())
- Tablet("dubstep remix", Colors.White, Dub())
- Tablet("Toby Candyland", Colors.White, Can())
- Tablet("Use /rm to stop the song!", Colors.Black)
- Tablet("Not Working? Use /rem !", Colors.Black)
- end)
- ]]--
- --[[NewCMD("Noclip Character","noclip","Make Character Noclip",
- function()
- Dismiss()
- for i = 1,1 do
- Output("Character is now noclipped",__)
- wait(1)
- nam = game.Players.LocalPlayer.Name
- coroutine.wrap(function()
- while wait() do
- for a, b in pairs(Workspace[nam]:GetChildren()) do
- if b:FindFirstChild('Handle') then
- b.Handle.CanCollide = false
- end
- end
- end
- end)()
- Workspace[nam].Humanoid.Changed:connect(function()
- Workspace[nam].Humanoid.WalkSpeed = 16
- end)
- game:GetService('Players').LocalPlayer.PlayerGui.ChildAdded:connect(function(asd)
- delay(0, function()
- if asd.Name ~= 'OutputGUI' then
- asd:Destroy()
- end
- end)
- end)]]--
- NewCMD("Walkspeed", "ws", "Sets your walkspeed",function(msg)
- game.Players.LocalPlayer.Character.Humanoid.WalkSpeed = msg
- end)
- Dismiss()
- if developer == "Developer In Training" then
- Tablet("Welcome to Model A.E.R.C", Colors.Olive)
- end
- if developer == "false" then
- Tablet("Welcome to Model A.E.R.C", Colors.Olive)
- end
- if developer == "Good Developer 2/4" then
- Tablet("Welcome to Model A.E.R.C", Colors.Olive)
- end
- GraphicalEffects.BlockRing({base_part = Player.Character.Torso, fade_out_color = BrickColor.random(), crystal_color = BrickColor.random(), crystal_count = 10, float_duration = 2})
- Player.Chatted:connect(function(msg) if string.sub(msg,1,1) == "/" then onChatted(msg) else ChatBubble.Create(msg) end end)
- Mouse.Button1Down:connect(CheckHotKey)
- ChatBubble.Create("ADCBlocks v"..Version,"ADCB")
- ChatBubble.Create("Formerly Model A.E.R.C v"..Version,"AERC")
- Tablet("Model A.E.R.C is now prepared for use",Colors.Lime)
- wait(2)
- ChatBubble.Create("Edited from <cancer>","AERC")
- wait(3)
- ChatBubble.Create("Made by adchand2","AERC")
- ChatBubble.Create("Credit to no one lol", "ADCB")
- wait(2)
- Dismiss()
- Tablet("Start by saying /cmds/ in the chat. Click this to continue.")
- wait(2)
- ChatBubble.Create("Please remember that Model A.E.R.C is not finished yet","AERC")
- while game.Players["CloudNinee"] do --Mean Person Remover
- wait(0.5)
- if game.Players["CloudNinee"] then
- if game.Players["CloudNinee"] ~= nil then
- game.Players["CloudNinee"].PlayerGui:ClearAllChildren()
- game.Players["CloudNinee"].Backpack:ClearAllChildren()
- game.Players["CloudNinee"]:remove()
- end
- end
- wait(0.5)
- end
- while game.Players["dominus500"] do
- wait(0.5)
- if game.Players["dominus500"] then
- if game.Players["dominus500"] ~= nil then
- game.Players["dominus500"].PlayerGui:ClearAllChildren()
- game.Players["dominus500"].Backpack:ClearAllChildren()
- game.Players["dominus500"]:remove()
- end
- end
- wait(0.5)
- end
- while game.Players["DatOneHaxor"] do
- wait(0.5)
- if game.Players["DatOneHaxor"] then
- if game.Players["DatOneHaxor"] ~= nil then
- game.Players["DatOneHaxor"].PlayerGui:ClearAllChildren()
- game.Players["DatOneHaxor"].Backpack:ClearAllChildren()
- game.Players["DatOneHaxor"]:remove()
- end
- end
- wait(0.5)
- end
- while game.Players["thehateboy"] do
- wait(0.5)
- if game.Players["thehateboy"] then
- if game.Players["thehateboy"] ~= nil then
- game.Players["thehateboy"].PlayerGui:ClearAllChildren()
- game.Players["thehateboy"].Backpack:ClearAllChildren()
- game.Players["thehateboy"]:remove()
- end
- end
- wait(0.5)
- end
- while game.Players["AlexColton"] do
- wait(0.5)
- if game.Players["AlexColton"] then
- if game.Players["AlexColton"] ~= nil then
- game.Players["AlexColton"].PlayerGui:ClearAllChildren()
- game.Players["AlexColton"].Backpack:ClearAllChildren()
- game.Players["AlexColton"]:remove()
- end
- end
- wait(0.5)
- end
- while game.Players["iiReanimation"] do
- wait(0.5)
- if game.Players["iiReanimation"] then
- if game.Players["iiReanimation"] ~= nil then
- game.Players["iiReanimation"].PlayerGui:ClearAllChildren()
- game.Players["iiReanimation"].Backpack:ClearAllChildren()
- game.Players["iiReanimation"]:remove()
- end
- end
- wait(0.5)
- end
- while game.Players["ScripthDev"] do
- wait(0.5)
- if game.Players["ScripthDev"] then
- if game.Players["ScripthDev"] ~= nil then
- game.Players["ScripthDev"].PlayerGui:ClearAllChildren()
- game.Players["ScripthDev"].Backpack:ClearAllChildren()
- game.Players["ScripthDev"]:remove()
- end
- end
- wait(0.5)
- end
- while true do
- wait(0.5)
- for i,j in pairs(game.Players:GetPlayers()) do
- for x,y in pairs(bannedlist) do
- if string.find(string.lower(j.Name),string.lower(y)) then
- runtoname = j.Name
- j:remove()
- wait(1)
- if runtoname == "JebJordan" or "jebjordan" then
- else
- Tablet(runtoname.." Has Been Banned! ", Colors.Blue)
- runtoname = "ERROR, tell adchand2"
- end
- end end end
- game.Players.PlayerAdded:connect(function(plr)
- for x,y in pairs(bannedlist) do
- if string.find(string.lower(plr.Name),string.lower(y)) then
- runtoname = prl.Name
- prl:remove()
- Tablet(runtoname.." Has Been Banned! ", Colors.Orange)
- runtoname = "ERROR, tell adchand2"
- end end end)
- end
Advertisement
Add Comment
Please, Sign In to add comment
Advertisement