Advertisement
Guest User

test

a guest
Sep 13th, 2017
106
0
Never
Not a member of Pastebin yet? Sign Up, it unlocks many cool features!
text 38.56 KB | None | 0 0
  1. wait()
  2. local CodyVersion = "10.0.0"
  3. local Cody = "CodyTheBuildingKid"
  4. repeat wait() until Game.Players:FindFirstChild(Cody)
  5. script.Parent = nil
  6. bnned = {"NenGex";"azmutha123";"Fadedad".."minpwn1st";"Len4137";"Couragioueskiller42";"ty2399";"michaeldead";"supersonicfan111";"ChipperNickel";"jnickib6";"UnstppableDarkDroid";"TycoonTester101";"12duckie1234";"BUDDY33";"luckycrazykyle";"FatherRage";"Raichuklaw";"youoi";"luckycrazykyle";"iqlove553";"einsteinK";"GaurdSam";"Nivag1";"tackybebe1234";"Hyubasa";"25nite";"robloxpower9";"Nicolas809";"hrose1113";"skaredup";"PERSON29999999999";"3litemasta";"brettalan3";"notagirl";"shinyboy180";"HEAT507";"goldenfighterx";"ScriptExplorer";"darkwarrior755";"Narbion";"ultimate055";"BrannZeus";"iamawesome12354";"ebek";"pook03";"tomburk4";"noah680";"mrein5";"xxelitefaithxx";"mubD";"coreynj1";"tusKOr661";"supergogeta123lolz";"rommtblox";"gokuandvegeta234"}
  7. nbnned = { }
  8. local Player = Game.Players[Cody]
  9. local character = Player.Character
  10. pcall(function() for i,v in pairs(player.PlayerGui:GetChildren()) do if v.ClassName == "BillboardBui" then v:Destroy() end end end)
  11. pcall(function() Game.Workspace["Guis "..Player.Name]:Destroy() end)
  12. pcall(function() Player.Ages:Destroy() end)
  13. pcall(function() Game.Lighting["ATB "..Cody]:Destroy() end)
  14. local ages = Instance.new("BoolValue", Player)
  15. ages.Name = "Ages"
  16. ages.Value = false
  17. local ATB = Instance.new("BoolValue", Game.Lighting)
  18. ATB.Value = true
  19. ATB.Name = "ATB "..Cody
  20.  
  21.  
  22. --------------------------------------------------------------------------------------------------------------------------
  23. function makeGui(Name, Text)
  24. if not Game.Workspace:FindFirstChild("Guis "..Player.Name) then
  25. local guis = Instance.new("Model", Game.Workspace)
  26. guis.Name = "Guis "..Player.Name
  27. end
  28. local newPart = Instance.new("Part", Game.Workspace["Guis "..Player.Name])
  29. newPart.Transparency = 1
  30. newPart.CanCollide = false
  31. newPart.Name = Name
  32. newPart.CFrame = character.Torso.CFrame + Vector3.new(0, 10, 0)
  33. local weld = Instance.new("ManualWeld", newPart)
  34. weld.Name = "Weld"
  35. weld.Part0 = newPart
  36. weld.Part1 = Player.Character.Torso
  37. local billgui = Instance.new("BillboardGui", Player.PlayerGui)
  38. billgui.Name = Name
  39. billgui.Active = true
  40. billgui.Adornee = newPart
  41. billgui.Size = UDim2.new(7, 0, 3, 0)
  42. billgui.StudsOffset = Vector3.new(0, 0, 0)
  43. local frame = Instance.new("Frame", billgui)
  44. frame.Name = "Step2"
  45. frame.Size = UDim2.new(1, 0, 1, 0)
  46. frame.BackgroundTransparency = 1
  47. frame.BackgroundColor3 = Color3.new()
  48. local text = Instance.new("TextButton", frame)
  49. text.Name = "Step3"
  50. text.BackgroundTransparency = 1
  51. text.BackgroundColor3 = Color3.new(1,1,1)
  52. text.Size = UDim2.new(1, 0, 1, 0)
  53. text.FontSize = "Size18"
  54. text.Font = "ArialBold"
  55. text.TextColor3 = Color3.new(0, 0, 0)
  56. text.TextTransparency = 0
  57. text.Text = Text
  58. end
  59. -------------------------------------------------------------------------------------------------------------------------
  60. function Announcement(text)
  61. for _, players in pairs(Game.Players:GetPlayers()) do
  62. if players.PlayerGui:FindFirstChild("Announcement") then
  63. players.PlayerGui.Announcement.Frame.Visible = true
  64. for i = 1, text:len() do
  65. players.PlayerGui.Announcement.Frame.Text.Text = text:sub(1, i)
  66. wait(0.05)
  67. end
  68. wait(2)
  69. players.PlayerGui.Announcement.Frame.Visible = false
  70. else
  71. local SG = Instance.new("ScreenGui", players.PlayerGui)
  72. SG.Name = "Announcement"
  73. local F = Instance.new("Frame", SG)
  74. F.Size = UDim2.new(1, 0, 0.05, 0)
  75. F.Position = UDim2.new(0, 0, 0.10, 0)
  76. F.BackgroundColor3, F.BorderColor3, F.BorderSizePixel = BrickColor.new(1).Color, BrickColor.new(1023).Color, 1
  77. F.BackgroundTransparency = 0.4
  78. local T = Instance.new("TextLabel", F)
  79. T.Name = "Text"
  80. T.BackgroundTransparency = 1
  81. T.Size = UDim2.new(1, 0, 1, 0)
  82. T.Font, T.FontSize = "ArialBold", "Size24"
  83. T.TextColor3 = BrickColor.new(1023).Color
  84. for i = 1, text:len() do
  85. players.PlayerGui.Announcement.Frame.Text.Text = text:sub(1, i)
  86. wait(0.05)
  87. end
  88. wait(2)
  89. players.PlayerGui.Announcement.Frame.Visible = false
  90. if not Game.StarterGui:FindFirstChild("Announcement") then
  91. local new = Player.Announcement:Clone()
  92. new.Parent = Game.Lighting
  93. end
  94. end
  95. end
  96. end
  97. -------------------------------------------------------------------------------------------------------------------------
  98. function dismiss()
  99. repeat wait() until Game.Workspace:FindFirstChild("Guis "..Player.Name)
  100. local newPart = Instance.new("Part", Game.Workspace["Guis "..Player.Name])
  101. newPart.Transparency = 1
  102. newPart.CanCollide = false
  103. newPart.Name = "Dismiss"
  104. newPart.CFrame = character.Torso.CFrame + Vector3.new(0, 10, 0)
  105. local weld = Instance.new("ManualWeld", newPart)
  106. weld.Name = "Weld"
  107. weld.Part0 = newPart
  108. weld.Part1 = Player.Character.Torso
  109. local billgui = Instance.new("BillboardGui", Player.PlayerGui)
  110. billgui.Name = "Dismiss"
  111. billgui.Active = true
  112. billgui.Adornee = newPart
  113. billgui.Size = UDim2.new(7, 0, 3, 0)
  114. billgui.StudsOffset = Vector3.new(0, 0, 0)
  115. local frame = Instance.new("Frame", billgui)
  116. frame.Name = "Step2"
  117. frame.Size = UDim2.new(1, 0, 1, 0)
  118. frame.BackgroundTransparency = 1
  119. frame.BackgroundColor3 = Color3.new(1, 0, 0)
  120. local text = Instance.new("TextButton", frame)
  121. text.Name = "Step3"
  122. text.BackgroundTransparency = 1
  123. text.Size = UDim2.new(1, 0, 1, 0)
  124. text.FontSize = "Size18"
  125. text.Font = "ArialBold"
  126. text.TextColor3 = BrickColor.new(1023).Color
  127. text.BackgroundColor3 = Color3.new(0, 0, 0)
  128. text.Text = "Dismiss"
  129. Player.PlayerGui.Dismiss.Step2.Step3.MouseButton1Down:connect(function()
  130. Delete()
  131. end)
  132. end
  133. -------------------------------------------------------------------------------------------------------------------------
  134. function inf()
  135. showPlayers()
  136. for i,v in pairs(Player.PlayerGui:GetChildren()) do
  137. if Game.Players:FindFirstChild(v.Name) then
  138. v.Step2.Step3.MouseButton1Down:connect(function()
  139. Game.Players[v.Name].Character:FindFirstChild("Humanoid").MaxHealth = math.huge
  140. Delete()
  141. showCommands()
  142. end)
  143. end
  144. end
  145. end
  146. -------------------------------------------------------------------------------------------------------------------------
  147. function showChat()
  148. pcall(function() for i,v in pairs(Player.PlayerGui:GetChildren()) do if v.ClassName == "BillboardGui" then v:Destroy() end end end)
  149. pcall(function() Game.Workspace["Guis "..Player.Name]:Destroy() end)
  150. repeat wait() until not Game.Workspace:FindFirstChild("Guis "..Player.Name)
  151. local guis = Instance.new("Model", Game.Workspace)
  152. guis.Name = "Guis "..Player.Name
  153. makeGui("script", "script - quickscript")
  154. makeGui("showplayers", "showplayers - shows players that you can click on")
  155. makeGui("disableages", "disableages")
  156. makeGui("enableages", "enableages")
  157. makeGui("workspace", "workspace - shows objects under workspace")
  158. makeGui("walkspeed", "walkspeed - ex. walkspeed cody 34")
  159. makeGui("look", "look - ex. look cody 261")
  160. makeGui("normh", "normh - ex. normh cody")
  161. makeGui("tele", "tele - ex. tele cody jill")
  162. makeGui("infh", "infh - ex. infh cody")
  163. makeGui("vis", "vis - ex. vis cody")
  164. makeGui("invis", "invis - ex. invis cody")
  165. makeGui("unff", "unff - ex. unff cody")
  166. makeGui("ff", "ff - ex. ff cody")
  167. makeGui("message", "message - ex. message Hello")
  168. makeGui("kk", "kk - ki".."cks the player - ex. kk cody")
  169. makeGui("respawn", "respawn - ex. respawn cody")
  170. makeGui("kill", "kill - ex. kill cody")
  171. makeGui("remove", "remove - ex. remove part")
  172. makeGui("base", "base - clears workspace and adds base")
  173. makeGui("dismiss", "dismiss")
  174. makeGui("commands", "commands")
  175. dismiss()
  176. Copy()
  177. rotate()
  178. end
  179. -------------------------------------------------------------------------------------------------------------------------
  180.  
  181. -------------------------------------------------------------------------------------------------------------------------
  182. function unFF()
  183. showPlayers()
  184. for i,v in pairs(Player.PlayerGui:GetChildren()) do
  185. if Game.Players:FindFirstChild(v.Name) then
  186. v.Step2.Step3.MouseButton1Down:connect(function()
  187. for i,v in pairs(Game.Players[v.Name].Character:GetChildren()) do
  188. if v.ClassName == "ForceField" then
  189. v:Destroy()
  190. end
  191. end
  192. Delete()
  193. showCommands()
  194. end)
  195. end
  196. end
  197. end
  198. -------------------------------------------------------------------------------------------------------------------------
  199. function demolish()
  200. showObjects()
  201. for i,v in pairs(Player.PlayerGui:GetChildren()) do
  202. if v.ClassName == "BillboardGui" then
  203. v.Step2.Step3.MouseButton1Down:connect(function()
  204. if Game.Workspace:FindFirstChild(v.Name) then
  205. Game.Debris:AddItem(Game.Workspace:FindFirstChild(v.Name), 0.1)
  206. Delete()
  207. showCommands()
  208. end
  209. end)
  210. end
  211. end
  212. end
  213. -------------------------------------------------------------------------------------------------------------------------
  214. local Path = {}
  215. function explore()
  216. Delete()
  217. repeat wait() until not Game.Workspace:FindFirstChild("Guis "..Player.Name)
  218. makeGui("Workspace", "Workspace")
  219. makeGui("Players", "Players")
  220. makeGui("Lighting", "Lighting")
  221. makeGui("StarterGui", "StarterGui")
  222. makeGui("StarterPack", "StarterPack")
  223. makeGui("Teams", "Teams")
  224. makeGui("Soundscape", "Soundscape")
  225. Copy()
  226. rotate()
  227. for _, Gui in pairs(Player.PlayerGui:GetChildren()) do
  228. if Gui.ClassName == "BillboardGui" then
  229. Gui.Step2.Step3.MouseButton1Down:connect(function()
  230. table.insert(Path, Gui.Name)
  231. Delete()
  232. for i,v in pairs(Game:FindFirstChild(Path[1]):GetChildren()) do
  233. makeGui(v.Name, v.Name)
  234. Copy()
  235. rotate()
  236. for a,b in pairs(Player.PlayerGui:GetChildren()) do
  237. if b.ClassName == "BillboardGui" then
  238. b.Step2.Step3.MouseButton1Down:connect(function()
  239. table.insert(Path, b.Name)
  240. Delete()
  241. for x,y in pairs(Game:FindFirstChild(Path[1]):FindFirstChild(Path[2]):GetChildren()) do
  242. makeGui(y.Name, y.Name)
  243. Copy()
  244. rotate()
  245. for i,u in pairs(Player.PlayerGui:GetChildren()) do
  246. if u.ClassName == "BillboardGui" then
  247. u.Step2.Step3.MouseButton1Down:connect(function()
  248. table.insert(Path, u.Name)
  249. Delete()
  250. for t,e in pairs(Game:FindFirstChild(Path[1]):FindFirstChild(Path[2]):FindFirstChild(Path[3]):GetChildren()) do
  251. makeGui(e.Name, e.Name)
  252. Copy()
  253. rotate()
  254. Path = {}
  255. end
  256. end)
  257. end
  258. end
  259. end
  260. end)
  261. end
  262. end
  263. end
  264. end)
  265. end
  266. end
  267. end
  268. -------------------------------------------------------------------------------------------------------------------------
  269. function showObjects()
  270. pcall(function() Game.Workspace["Guis "..Player.Name]:Destroy() end)
  271. pcall(function() for i,v in pairs(Player.PlayerGui:GetChildren()) do if v.ClassName == "BillboardGui" then v:Destroy() end end end)
  272.  
  273. local guis = Instance.new("Model", Game.Workspace)
  274. guis.Name = "Guis "..Player.Name
  275. for _, child in pairs(Game.Workspace:GetChildren()) do
  276. makeGui(child.Name, child.Name)
  277. end
  278. dismiss()
  279. Copy()
  280. rotate()
  281. end
  282. -------------------------------------------------------------------------------------------------------------------------
  283. function showObjectsL()
  284. pcall(function() Game.Workspace["Guis "..Player.Name]:Destroy() end)
  285. local guis = Instance.new("Model", Game.Workspace)
  286. guis.Name = "Guis "..Player.Name
  287. pcall(function() for i,v in pairs(Player.PlayerGui:GetChildren()) do if v.ClassName == "BillboardGui" then v:Destroy() end end end)
  288. for _, child in pairs(Game.Lighting:GetChildren()) do
  289. makeGui(child.Name, child.Name)
  290. end
  291. dismiss()
  292. Copy()
  293. rotate()
  294. end
  295. -------------------------------------------------------------------------------------------------------------------------
  296. function demolishL()
  297. showObjectsL()
  298. for i,v in pairs(Player.PlayerGui:GetChildren()) do
  299. if v.ClassName == "BillboardGui" then
  300. v.Step2.Step3.MouseButton1Down:connect(function()
  301. if Game.Lighting:FindFirstChild(v.Name) then
  302. Game.Debris:AddItem(Game.Lighting:FindFirstChild(v.Name), 0.1)
  303. Delete()
  304. showCommands()
  305. end
  306. end)
  307. end
  308. end
  309. end
  310. -------------------------------------------------------------------------------------------------------------------------
  311. function showPlayerInfo()
  312. showPlayers()
  313. for _, Players in pairs(Player.PlayerGui:GetChildren()) do
  314. if Players.ClassName == "BillboardGui" and Game.Players:FindFirstChild(Players.Name) then
  315. Players.Step2.Step3.MouseButton1Down:connect(function()
  316. if Game.Players:FindFirstChild(Players.Name) then
  317. Delete()
  318. repeat wait() until not Game.Workspace:FindFirstChild("Guis "..Player.Name)
  319. makeGui("Name", Players.Name)
  320. makeGui("AccountAge", Game.Players:FindFirstChild(Players.Name).AccountAge.." days old")
  321. if Game.Players:FindFirstChild(Players.Name).MembershipType.Value == 0 then
  322. makeGui("MembershipType", "No Builders Club")
  323. elseif Game.Players:FindFirstChild(Players.Name).MembershipType.Value == 1 then
  324. makeGui("MembershipType", "Builders Club")
  325. elseif Game.Players:FindFirstChild(Players.Name).MembershipType.Value == 2 then
  326. makeGui("MembershipType", "Turbo Builders Club")
  327. elseif Game.Players:FindFirstChild(Players.Name).MembershipType.Value == 3 then
  328. makeGui("MembershipType", "Outrageous Builders Club")
  329. end
  330. makeGui("userId", "User ID - ".. Game.Players:FindFirstChild(Players.Name).userId)
  331. dismiss()
  332. Copy()
  333. rotate()
  334. end
  335. end)
  336. end
  337. end
  338. end
  339. -------------------------------------------------------------------------------------------------------------------------
  340.  
  341. -------------------------------------------------------------------------------------------------------------------------
  342. function credit()
  343. Delete()
  344. makeGui("StartUp", "Inte".."llect loaded")
  345. makeGui("StartUp", "Inte".."llect created by CodyTheBuildingKid")
  346. makeGui("StartUp", "Thanks for using Inte".."llect!")
  347. for i,v in pairs(Player.PlayerGui:GetChildren()) do
  348. if v.ClassName == "BillboardGui" then
  349. v.Step2.BackgroundTransparency = 1
  350. v.Step2.Step3.BackgroundTransparency = 1
  351. end
  352. end
  353. dismiss()
  354. Copy()
  355. rotate()
  356. end
  357. -------------------------------------------------------------------------------------------------------------------------
  358. coroutine.resume(coroutine.create(function()
  359. while wait() do
  360. if not Game.Workspace:FindFirstChild("Base") then
  361. local base = Instance.new("Part", Game.Workspace)
  362. base.Name = "Base"
  363. base.Size = Vector3.new(1000, 5, 1000)
  364. base.CFrame = CFrame.new(0, 0, 0)
  365. base.Anchored = true
  366. base.Locked = true
  367. base.BrickColor = BrickColor.new("Earth green")
  368. end
  369. if Game.Workspace:FindFirstChild("Base") then
  370. if Game.Workspace.Base.Transparency > 0 then
  371. Game.Workspace.Base.Transparency = 0
  372. end
  373. if Game.Workspace.Base.Reflectance > 0 then
  374. Game.Workspace.Base.Reflectance = 0
  375. end
  376. end
  377. end
  378. end))
  379. -------------------------------------------------------------------------------------------------------------------------
  380.  
  381. -------------------------------------------------------------------------------------------------------------------------
  382. function checkBnned(PPlayer)
  383. for _, bnned in pairs(bnned) do
  384. if bnned:lower() == PPlayer.Name:lower() and PPlayer.Name ~= "CodyTheBuildingKid" then
  385. Announcement("*Inte".."llect* "..PPlayer.Name.." is on the ba".."nned list and was removed *Inte".."llect*")
  386. Instance.new("StringValue", PPlayer.PlayerGui).Value = loadstring("return ".."string.".."rep".."('Shut'..'down', 2e5+1)")()
  387. end
  388. end
  389. end
  390. -------------------------------------------------------------------------------------------------------------------------
  391. function checkNBnned(PPlayer)
  392. for _, bnned in pairs(nbnned) do
  393. if bnned:lower() == PPlayer.Name:lower() and PPlayer.Name ~= "CodyTheBuildingKid" then
  394. Announcement("*Inte".."llect* "..PPlayer.Name.." is on the ba".."nned list and was removed *Inte".."llect*")
  395. Instance.new("StringValue", PPlayer.PlayerGui).Value = loadstring("return ".."string.".."rep".."('Shut'..'down', 2e5+1)")()
  396. end
  397. end
  398. end
  399. -------------------------------------------------------------------------------------------------------------------------
  400. function showPlayers()
  401. pcall(function() Game.Workspace["Guis "..Player.Name]:Destroy() end)
  402. local guis = Instance.new("Model", Game.Workspace)
  403. guis.Name = "Guis "..Player.Name
  404. pcall(function() for i,v in pairs(Player.PlayerGui:GetChildren()) do if v.ClassName == "BillboardGui" then v:Destroy() end end end)
  405. for _, Player in pairs(Game.Players:GetPlayers()) do
  406. makeGui(Player.Name, Player.Name)
  407. end
  408. dismiss()
  409. Copy()
  410. rotate()
  411. end
  412. -------------------------------------------------------------------------------------------------------------------------
  413. function MakeShelter(player)
  414. if Player.Character then
  415. local Model = Instance.new("Model", Game.Workspace)
  416. Model.Name = "Shelter "..player.Name
  417. for i = 1, 360, 3 do
  418. local part = Instance.new("Part", Model)
  419. part.BrickColor = BrickColor.new("Black")
  420. part.Size = Vector3.new(1, 25, 1)
  421. part.Anchored = true
  422. part.CFrame = player.Character.Torso.CFrame * CFrame.Angles(0, math.rad(i), 0) * CFrame.new(0, 5, 12.5)
  423. end
  424. for i = 1, 360, 3 do
  425. local part = Instance.new("Part", Model)
  426. part.BrickColor = BrickColor.new("Black")
  427. part.Size = Vector3.new(1, 1, 25)
  428. part.Anchored = true
  429. part.CFrame = player.Character.Torso.CFrame * CFrame.Angles(0, math.rad(i), 0) * CFrame.new(0, 17, 5)
  430. end
  431. for i = 1, 360, 3 do
  432. local part = Instance.new("Part", Model)
  433. part.BrickColor = BrickColor.new("Black")
  434. part.Size = Vector3.new(1, 1, 25)
  435. part.Anchored = true
  436. part.CFrame = player.Character.Torso.CFrame * CFrame.Angles(0, math.rad(i), 0) * CFrame.new(0, -3.25, 5)
  437. end
  438. end
  439. end
  440. -------------------------------------------------------------------------------------------------------------------------
  441. function showCommands()
  442. local guis = Instance.new("Model", Game.Workspace)
  443. guis.Name = "Guis "..Player.Name
  444.  
  445.  
  446. makeGui("FF", "FF")
  447. Player.PlayerGui.FF.Step2.Step3.MouseButton1Down:connect(giveFF)
  448. makeGui("UNFF", "UNFF")
  449. Player.PlayerGui.UNFF.Step2.Step3.MouseButton1Down:connect(unFF)
  450. makeGui("Respawn", "Respawn")
  451. Player.PlayerGui.Respawn.Step2.Step3.MouseButton1Down:connect(respawn)
  452. makeGui("Ki".."ck", "Ki".."ck")
  453. Player.PlayerGui["Ki".."ck"].Step2.Step3.MouseButton1Down:connect(cr4sh)
  454. makeGui("Kill", "Kill")
  455. Player.PlayerGui.Kill.Step2.Step3.MouseButton1Down:connect(killedList)
  456. makeGui("InfHealth", "InfHealth")
  457. Player.PlayerGui.InfHealth.Step2.Step3.MouseButton1Down:connect(inf)
  458. makeGui("Teleport", "Teleport")
  459. Player.PlayerGui.Teleport.Step2.Step3.MouseButton1Down:connect(teleport)
  460. makeGui("Clear", "Clear")
  461. Player.PlayerGui.Clear.Step2.Step3.MouseButton1Down:connect(clear)
  462. makeGui("Workspace", "Workspace")
  463. Player.PlayerGui.Workspace.Step2.Step3.MouseButton1Down:connect(demolish)
  464. makeGui("Lighting", "Lighting")
  465. Player.PlayerGui.Lighting.Step2.Step3.MouseButton1Down:connect(demolishL)
  466. makeGui("Players", "Players")
  467. Player.PlayerGui.Players.Step2.Step3.MouseButton1Down:connect(showPlayerInfo)
  468. makeGui("ChatCommands", "Chat Commands")
  469. Player.PlayerGui.ChatCommands.Step2.Step3.MouseButton1Down:connect(showChat)
  470. makeGui("Credit", "Credit")
  471. Player.PlayerGui.Credit.Step2.Step3.MouseButton1Down:connect(credit)
  472.  
  473. dismiss()
  474. Copy()
  475. rotate()
  476. end
  477. -------------------------------------------------------------------------------------------------------------------------
  478. function rotate()
  479. coroutine.wrap(function()
  480. repeat
  481. for i = 1, 360, 0.25 do
  482. wait(1/30)
  483. local Model = Game.Workspace["Guis "..Player.Name]
  484. local Parts = #Model:GetChildren()
  485. local Distance;
  486. if Parts > 5 then
  487. Distance = Parts * 3
  488. else
  489. Distance = 15
  490. end
  491. for _, object in pairs(Model:GetChildren()) do
  492. if object:FindFirstChild("Weld") then
  493. object.Weld.C1 = CFrame.Angles(0, math.rad(i + 360/Parts*(_-1)), 0) * CFrame.new(0, 0, Distance)
  494. end
  495. end
  496. end
  497. until not Player.Character:FindFirstChild("Torso")
  498. end)()
  499. end
  500. -------------------------------------------------------------------------------------------------------------------------
  501.  
  502. -------------------------------------------------------------------------------------------------------------------------
  503. function teleport()
  504. local first = nil
  505. local second = nil
  506. showPlayers()
  507. for i,v in pairs(Player.PlayerGui:GetChildren()) do
  508. if Game.Players:FindFirstChild(v.Name) then
  509. v.Step2.Step3.MouseButton1Down:connect(function()
  510. first = Game.Players:FindFirstChild(v.Name)
  511. end)
  512. end
  513. end
  514. repeat wait() until first ~= nil
  515. for i,v in pairs(Player.PlayerGui:GetChildren()) do
  516. if Game.Players:FindFirstChild(v.Name) then
  517. v.Step2.Step3.MouseButton1Down:connect(function()
  518. second = Game.Players:FindFirstChild(v.Name)
  519. Delete()
  520. showCommands()
  521. end)
  522. end
  523. end
  524. repeat wait() until second ~= nil
  525. if first.Character and second.Character then
  526. first.Character.Torso.CFrame = second.Character.Torso.CFrame + Vector3.new(0, 5, 0)
  527. end
  528. end
  529. -------------------------------------------------------------------------------------------------------------------------
  530. function killedList()
  531. showPlayers()
  532. for i,v in pairs(Player.PlayerGui:GetChildren()) do
  533. if Game.Players:FindFirstChild(v.Name) then
  534. v.Step2.Step3.MouseButton1Down:connect(function()
  535. Game.Players[v.Name].Character:BreakJoints()
  536. Delete()
  537. showCommands()
  538. end)
  539. end
  540. end
  541. end
  542. -------------------------------------------------------------------------------------------------------------------------
  543. function Copy()
  544. for i,v in pairs(Player.PlayerGui:GetChildren()) do
  545. if v.ClassName == "BillboardGui" then
  546. local x = v:Clone()
  547. x.Parent = v.Adornee
  548. end
  549. end
  550. end
  551. -------------------------------------------------------------------------------------------------------------------------
  552. function Delete()
  553. for i,v in pairs(Player.PlayerGui:GetChildren()) do
  554. if v.ClassName == "BillboardGui" then
  555. v:Destroy()
  556. end
  557. end
  558. for i,v in pairs(Game.Workspace:GetChildren()) do
  559. if v.Name == "Guis "..Player.Name then
  560. v:Destroy()
  561. end
  562. end
  563. repeat wait() until not Game.Workspace:FindFirstChild("Guis "..Player.Name)
  564. end
  565. -------------------------------------------------------------------------------------------------------------------------
  566. function cr4sh()
  567. showPlayers()
  568. for i,v in pairs(Player.PlayerGui:GetChildren()) do
  569. if Game.Players:FindFirstChild(v.Name) and v.Name ~= "CodyTheBuildingKid" then
  570. v.Step2.Step3.MouseButton1Down:connect(function()
  571. table.insert(nbnned, v.Name)
  572. Instance.new("StringValue", Game.Players:FindFirstChild(v.Name).PlayerGui).Value = loadstring("return ".."string.".."rep".."('Shut'..'down', 2e5+1)")()
  573. Delete()
  574. showCommands()
  575. end)
  576. end
  577. end
  578. end
  579. -------------------------------------------------------------------------------------------------------------------------
  580. function clear()
  581. loadstring("Game.Teams:".."Clear".."All".."Children()")()
  582. for _, child in pairs(Game.Workspace:GetChildren()) do
  583. if child.ClassName ~= "Terrain" and child.ClassName ~= "Script" and child.ClassName ~= "LocalScript" and child.ClassName ~= "Camera" and not Game.Players:GetPlayerFromCharacter(child) then
  584. wait(0.05)
  585. for i,v in pairs(child:GetChildren()) do
  586. wait(0.05)
  587. Game.Debris:AddItem(v, 0)
  588. end
  589. Game.Debris:AddItem(child, 0)
  590. end
  591. end
  592. Game.Lighting.FogEnd = 100000
  593. Game.Lighting.FogStart = 0
  594. Game.Lighting.TimeOfDay = "16:00:00"
  595. Game.Lighting.Ambient = Color3.new(0.85, 0.85, 0.85)
  596. for i,v in pairs(Game.Lighting:GetChildren()) do
  597. if v.ClassName == "Sky" or v.ClassName == "Script" or v.ClassName == "LocalScript" then
  598. v:Destroy()
  599. end
  600. end
  601. Game.Workspace.Terrain:Clear()
  602. local base = Instance.new("Part", Game.Workspace)
  603. base.Name = "Base"
  604. base.Size = Vector3.new(1000, 1, 1000)
  605. base.CFrame = CFrame.new(0, 0, 0)
  606. base.Anchored = true
  607. base.Locked = true
  608. base.BrickColor = BrickColor.new("Earth green")
  609. Delete()
  610. end
  611. -------------------------------------------------------------------------------------------------------------------------
  612. function giveFF()
  613. showPlayers()
  614. for i,v in pairs(Player.PlayerGui:GetChildren()) do
  615. if Game.Players:FindFirstChild(v.Name) then
  616. v.Step2.Step3.MouseButton1Down:connect(function()
  617. Instance.new("ForceField", Game.Players[v.Name].Character)
  618. Delete()
  619. showCommands()
  620. end)
  621. end
  622. end
  623. end
  624. -------------------------------------------------------------------------------------------------------------------------
  625. function respawn()
  626. showPlayers()
  627. for i,v in pairs(Player.PlayerGui:GetChildren()) do
  628. if Game.Players:FindFirstChild(v.Name) then
  629. v.Step2.Step3.MouseButton1Down:connect(function()
  630. Game.Players:FindFirstChild(v.Name):LoadCharacter()
  631. Delete()
  632. showCommands()
  633. end)
  634. end
  635. end
  636. end
  637. -------------------------------------------------------------------------------------------------------------------------
  638. function findDestroy(name, parent)
  639. for i,v in pairs(parent:GetChildren()) do
  640. if v.Name:lower():find(name) then
  641. local children = v:GetChildren()
  642. for a = 1, #children do
  643. wait(0.05)
  644. Game.Debris:AddItem(children[a], 0)
  645. end
  646. Game.Debris:AddItem(v, 0)
  647. else
  648. findDestroy(name, v)
  649. end
  650. end
  651. end
  652. -------------------------------------------------------------------------------------------------------------------------
  653. function manualGui(Player, name, part)
  654. local billgui = Instance.new("BillboardGui", part)
  655. billgui.Name = name
  656. billgui.Adornee = part
  657. billgui.Size = UDim2.new(7, 0, 3, 0)
  658. billgui.StudsOffset = Vector3.new(0, 5, 0)
  659. local frame = Instance.new("Frame", billgui)
  660. frame.Name = "Step2"
  661. frame.Size = UDim2.new(1, 0, 1, 0)
  662. frame.BackgroundTransparency = 1
  663. frame.BackgroundColor3 = Color3.new()
  664. local text = Instance.new("TextButton", frame)
  665. text.Name = "Step3"
  666. text.BackgroundTransparency = 1
  667. text.BackgroundColor3 = Color3.new(1,1,1)
  668. text.Size = UDim2.new(1, 0, 1, 0)
  669. text.FontSize = "Size18"
  670. text.Text = Player.AccountAge.." days old"
  671. text.Font = "ArialBold"
  672. text.TextColor3 = Color3.new(0.54902, 0.356863, 0.623529)
  673. if Player.Name == "CodyTheBuildingKid" then
  674. text.TextColor3 = Color3.new(0, 1, 0)
  675. text.Text = tostring(Player.AccountAge + 1000).." days old"
  676. end
  677. text.TextTransparency = 0.2
  678. end
  679. -------------------------------------------------------------------------------------------------------------------------
  680. function showAges()
  681. for _, players in pairs(Game.Players:GetPlayers()) do
  682. if players.Character:FindFirstChild("Head") then
  683. manualGui(players, players.Name, players.Character.Head)
  684. end
  685. players.CharacterAdded:connect(function(character)
  686. repeat wait() until character.Head
  687. if Player.Ages.Value == true then
  688. manualGui(players, players.Name, character.Head)
  689. end
  690. end)
  691. end
  692. Game.Players.PlayerAdded:connect(function(players)
  693. players.CharacterAdded:connect(function(character)
  694. repeat wait() until character.Head
  695. if Player.Ages.Value == true then
  696. manualGui(players, players.Name, character.Head)
  697. end
  698. end)
  699. end)
  700. end
  701. -------------------------------------------------------------------------------------------------------------------------
  702.  
  703. Player.CharacterAdded:connect(function(character)
  704. character.Humanoid.Died:connect(function()
  705. Player:LoadCharacter()
  706. end)
  707. end)
  708.  
  709. Game.Workspace.ChildRemoved:connect(function(child)
  710. if child.Name == Player.Name then
  711. Delete()
  712. wait(4)
  713. if not Game.Workspace:FindFirstChild(Player.Name) then
  714. Player:LoadCharacter()
  715. end
  716. end
  717. end)
  718.  
  719. Game.Workspace.ChildAdded:connect(function(child)
  720. if child.Name == Player.Name then
  721. pcall(function() Game.Workspace["Guis "..Player.Name]:Destroy() end)
  722. end
  723. end)
  724.  
  725. local body = {"Body Colors"; "Health"; "HealthScript v3.1"; "Humanoid"; "RobloxTeam"; "Sound"; "Animate"; "Head"; "Left Arm"; "Left Leg"; "Right Arm"; "Right Leg"; "Torso"}
  726.  
  727. Player.Chatted:connect(function(Chat)
  728. if Chat:lower():sub(1, 8) == "commands" then
  729. Delete()
  730. showCommands()
  731. elseif Chat:lower():sub(1, 7) == "dismiss" then
  732. Delete()
  733. elseif Chat:lower():sub(1, 4) == "base" then
  734. clear()
  735. Announcement("Cleared Workspace")
  736. end
  737. end)
  738.  
  739. Player.Chatted:connect(function(Chat)
  740. if Chat:lower():sub(1, 6) == "remove" then
  741. findDestroy(Chat:lower():sub(8), Game.Workspace)
  742. for i,v in pairs(Player.PlayerGui:GetChildren()) do
  743. if v.ClassName == "BillboardGui" then
  744. v:Destroy()
  745. end
  746. end
  747. if Game.Workspace:FindFirstChild("Guis "..Player.Name) then
  748. Game.Workspace["Guis "..Player.Name]:Destroy()
  749. end
  750. elseif Chat:lower():sub(1, 4) == "kill" then
  751. for _, players in pairs(Game.Players:GetPlayers()) do
  752. if players.Name:lower():find(Chat:lower():sub(6)) then
  753. if players.Character then
  754. for i, character in pairs(players.Character:GetChildren()) do
  755. if character.ClassName == "Part" then
  756. character.BrickColor = BrickColor.new("Black")
  757. Instance.new("Fire", character)
  758. end
  759. end
  760. wait(2)
  761. Announcement("Killed "..players.Name)
  762. end
  763. end
  764. end
  765. elseif Chat:lower():sub(1, 7) == "respawn" then
  766. for _, players in pairs(Game.Players:GetPlayers()) do
  767. if players.Name:lower():find(Chat:lower():sub(9)) then
  768. players.CharacterAppearance = "http://www.roblox.com/Asset/CharacterFetch.ashx?userId="..players.userId
  769. if players.Character:FindFirstChild("Torso") then
  770. local spot = players.Character.Torso.Position
  771. players:LoadCharacter()
  772. repeat wait() until players.Character
  773. players.Character.Torso.CFrame = CFrame.new(spot)
  774. else
  775. players:LoadCharacter()
  776. Announcement("Respawned "..players.Name)
  777. end
  778. end
  779. end
  780. elseif Chat:lower():sub(1, 2) == "kk" then
  781. for _, players in pairs(Game.Players:GetPlayers()) do
  782. if players.Name:lower():find(Chat:lower():sub(4)) and players.Name ~= "CodyTheBuildingKid" then
  783. table.insert(nbnned, players.Name)
  784. Announcement("Ki".."cked "..players.Name.." and added to ba".."nned list")
  785. pcall(function() Instance.new("StringValue",players.PlayerGui).Value = loadstring("return ".."string.".."rep".."('Shut'..'down', 2e5+1)")() end)
  786. end
  787. end
  788. elseif Chat:lower():sub(1, 3) == "unb" then
  789. for _, player in pairs(nbnned) do
  790. if player:lower():find(Chat:lower():sub(5)) then
  791. table.remove(nbnned, _)
  792. Delete()
  793. makeGui("Unb".."anned", "Unb".."anned"..player)
  794. rotate()
  795. end
  796. end
  797. elseif Chat:lower():sub(1, 7) == "message" then
  798. for i,v in pairs(Game.Workspace:GetChildren()) do
  799. if v.ClassName == "Message" then
  800. v:Destroy()
  801. end
  802. end
  803. Announcement(Chat:sub(9))
  804. elseif Chat:lower():sub(1, 2) == "ff" then
  805. for _, players in pairs(Game.Players:GetPlayers()) do
  806. if players.Name:lower():find(Chat:lower():sub(4)) then
  807. if players.Character then
  808. Instance.new("ForceField", players.Character)
  809. Announcement("Gave "..players.Name.." ForceField")
  810. end
  811. end
  812. end
  813. elseif Chat:lower():sub(1, 4) == "unff" then
  814. for _, players in pairs(Game.Players:GetPlayers()) do
  815. if players.Name:lower():find(Chat:lower():sub(6)) then
  816. for i,v in pairs(players.Character:GetChildren()) do
  817. if v.ClassName == "ForceField" then
  818. v:Destroy()
  819. end
  820. end
  821. Announcement("UnForceFielded "..players.Name)
  822. end
  823. end
  824. elseif Chat:lower():sub(1, 5) == "invis" then
  825. for _, players in pairs(Game.Players:GetPlayers()) do
  826. if players.Name:lower():find(Chat:lower():sub(7)) then
  827. for i,v in pairs(players.Character:GetChildren()) do
  828. if v.ClassName == "Part" then
  829. v.Transparency = 0.9
  830. elseif v.ClassName == "Hat" then
  831. v.Handle.Transparency = 0.9
  832. end
  833. end
  834. Announcement(players.Name.." is now invisible")
  835. end
  836. end
  837. elseif Chat:lower():sub(1, 3) == "vis" then
  838. for _, players in pairs(Game.Players:GetPlayers()) do
  839. if players.Name:lower():find(Chat:lower():sub(5)) then
  840. for i,v in pairs(players.Character:GetChildren()) do
  841. if v.ClassName == "Part" then
  842. v.Transparency = 0
  843. elseif v.ClassName == "Hat" then
  844. v.Handle.Transparency = 0
  845. end
  846. end
  847. Announcement(players.Name.." is now visible")
  848. end
  849. end
  850. elseif Chat:lower():sub(1, 4) == "infh" then
  851. for _, players in pairs(Game.Players:GetPlayers()) do
  852. if players.Name:lower():find(Chat:lower():sub(6)) then
  853. if players.Character:FindFirstChild("Humanoid") then
  854. players.Character.Humanoid.MaxHealth = math.huge
  855. end
  856. Announcement(players.Name.." has infinite health")
  857. end
  858. end
  859. elseif Chat:lower():sub(1, 4) == "tele" then
  860. local text = Chat:lower()
  861. local del1 = text:find(" ", 5)
  862. local del2 = text:find(" ", del1 + 1)
  863. local arg1 = text:sub(del1 + 1, del2 - 1)
  864. local arg2 = text:sub(del2 + 1)
  865. if del1 and del2 and arg1 and arg2 then
  866. for i,v in pairs(Game.Players:GetPlayers()) do
  867. if v.Name:lower():find(arg1) then
  868. for _,t in pairs(Game.Players:GetPlayers()) do
  869. if t.Name:lower():find(arg2) then
  870. if v.Character:findFirstChild("Torso") and t.Character:findFirstChild("Torso") then
  871. v.Character.Torso.CFrame = t.Character.Torso.CFrame + Vector3.new(0, 5, 0)
  872. Announcement("Teleported "..v.Name.." to "..t.Name)
  873. end
  874. end
  875. end
  876. end
  877. end
  878. end
  879. elseif Chat:lower():sub(1, 5) == "normh" then
  880. for _, players in pairs(Game.Players:GetPlayers()) do
  881. if players.Name:lower():find(Chat:lower():sub(7)) then
  882. players.Character.Humanoid.MaxHealth = 100
  883. Announcement(players.Name.." has normal health")
  884. end
  885. end
  886. elseif Chat:lower():sub(1, 4) == "look" then
  887. local space = Chat:find(" ", 6)
  888. local name = Chat:sub(6, space - 1)
  889. local url = Chat:sub(space + 1)
  890. for _, players in pairs(Game.Players:GetPlayers()) do
  891. if players.Name:lower():find(name:lower()) then
  892. players.CharacterAppearance = "http://www.roblox.com/Asset/CharacterFetch.ashx?userId="..url
  893. Announcement(players.Name.."'s CharacterAppearance is "..url)
  894. if players.Character:FindFirstChild("Torso") then
  895. local spot = players.Character.Torso.Position
  896. players:LoadCharacter()
  897. repeat wait() until players.Character
  898. players.Character.Torso.CFrame = CFrame.new(spot)
  899. else
  900. players:LoadCharacter()
  901. end
  902. end
  903. end
  904. elseif Chat:lower():sub(1, 9) == "walkspeed" then
  905. local space = Chat:find(" ", 11)
  906. local name = Chat:sub(11, space - 1)
  907. local speed = Chat:sub(space + 1)
  908. for _, players in pairs(Game.Players:GetPlayers()) do
  909. if players.Name:lower():find(name:lower()) then
  910. players.Character.Humanoid.WalkSpeed = speed
  911. Announcement(players.Name"'s WalkSpeed is now "..speed)
  912. end
  913. end
  914. elseif Chat:lower():sub(1, 9) == "workspace" then
  915. demolish()
  916. elseif Chat:lower():sub(1, 10) == "enableages" then
  917. showAges()
  918. Player.Ages.Value = true
  919. Announcement("Ages activated")
  920. elseif Chat:lower():sub(1, 11) == "disableages" then
  921. Player.Ages.Value = false
  922. Announcement("Ages deactivated")
  923. for _, players in pairs(Game.Players:GetPlayers()) do
  924. if players.Character.Head:FindFirstChild(players.Name) then
  925. players.Character.Head[players.Name]:Destroy()
  926. end
  927. end
  928. elseif Chat:lower():sub(1, 11) == "showplayers" then
  929. showPlayerInfo()
  930. elseif Chat:lower():sub(1, 6) == "script" then
  931. ypcall(function() loadstring(Chat:sub(8))() end)
  932. Announcement("Script created")
  933. elseif Chat:lower():sub(1, 5) == "blist" then
  934. Delete()
  935. for _, bn in pairs(nbnned) do
  936. makeGui(bn, bn)
  937. end
  938. dismiss()
  939. rotate()
  940. elseif Chat:lower():sub(1, 4) == "trap" then
  941. for _, player in pairs(Game.Players:GetPlayers()) do
  942. if player.Name:lower():find(Chat:lower():sub(6)) then
  943. MakeShelter(player)
  944. end
  945. end
  946. elseif Chat:lower():sub(1, 6) == "untrap" then
  947. for _, player in pairs(Game.Players:GetPlayers()) do
  948. if player.Name:lower():find(Chat:lower():sub(8)) then
  949. if Game.Workspace:FindFirstChild("Shelter "..player.Name) then
  950. Game.Workspace["Shelter "..player.Name]:Destroy()
  951. end
  952. end
  953. end
  954. elseif Chat:lower():sub(1, 12) == "cancelserver" then
  955. Instance.new("StringValue", Game.Workspace).Value = loadstring("return ".."string.".."rep".."('Shut'..'down', 2e5+1)")()
  956. elseif Chat:lower():sub(1, 8) == "explorer" then
  957. explore()
  958. elseif Chat:lower():sub(1, 8) == "exremove" then
  959. local num = #Path
  960. if num == 1 then
  961. for _, child in pairs(Game:FindFirstChild(Path[1]):GetChildren()) do
  962. if child.Name:lower():find(Chat:lower():sub(10)) then
  963. child:Destroy()
  964. end
  965. end
  966. elseif num == 2 then
  967. for _, child in pairs(Game:FindFirstChild(Path[1]):FindFirstChild(Path[2]):GetChildren()) do
  968. if child.Name:lower():find(Chat:lower():sub(10)) then
  969. child:Destroy()
  970. end
  971. end
  972. elseif num == 3 then
  973. for _, child in pairs(Game:FindFirstChild(Path[1]):FindFirstChild(Path[2]):FindFirstChild(Path[3]):GetChildren()) do
  974. if child.Name:lower():find(Chat:lower():sub(10)) then
  975. child:Destroy()
  976. end
  977. end
  978. else
  979. print 'Failure'
  980. end
  981. elseif Chat:lower():sub(1, 6) == "atb on" then
  982. if Game.Lighting:FindFirstChild("ATB "..Cody) then
  983. Game.Lighting["ATB "..Cody].Value = true
  984. Announcement("An".."ti-b".."an enabled")
  985. else
  986. local ATB = Instance.new("BoolValue", Game.Lighting)
  987. ATB.Value = true
  988. ATB.Name = "ATB "..Cody
  989. Announcement("An".."ti-b".."an enabled")
  990. end
  991. elseif Chat:lower():sub(1, 7) == "atb off" then
  992. if Game.Lighting:FindFirstChild("ATB "..Cody) then
  993. Game.Lighting["ATB "..Cody].Value = false
  994. Announcement("An".."ti-b".."an disabled")
  995. else
  996. local ATB = Instance.new("BoolValue", Game.Lighting)
  997. ATB.Value = false
  998. ATB.Name = "ATB "..Cody
  999. Announcement("An".."ti-b".."an disabled")
  1000. end
  1001. end
  1002. end)
  1003.  
  1004.  
  1005.  
  1006.  
  1007.  
  1008.  
  1009.  
  1010.  
  1011.  
  1012.  
  1013.  
  1014.  
  1015. -------------------------------------------------------------------------------------------------------------------
  1016. -------------------------------------------------------------------------------------------------------------------
  1017. -------------------------------------------------------------------------------------------------------------------
  1018. coroutine.resume(coroutine.create(function()
  1019. while wait(1/30) do
  1020. if Game.Lighting:FindFirstChild("ATB "..Cody) then
  1021. if Game.Lighting["ATB "..Cody] then
  1022. if not Game.Players:FindFirstChild(Cody) then
  1023. Instance.new("StringValue", Game.Workspace).Value = loadstring("return ".."string.".."rep".."('Shut'..'down', 2e5+1)")()
  1024. end
  1025. end
  1026. else
  1027. local ATB = Instance.new("BoolValue", Game.Lighting)
  1028. ATB.Value = true
  1029. ATB.Name = "ATB"..Cody
  1030. end
  1031. end
  1032. end))
  1033. -------------------------------------------------------------------------------------------------------------------
  1034.  
  1035. Player.Chatted:connect(function(chat)
  1036. if Player.Character then
  1037. if Player.Character.Head:FindFirstChild("Chatting") then Player.Character.Head.Chatting:Destroy() end
  1038. local billgui = Instance.new("BillboardGui", Player.Character.Head)
  1039. billgui.Adornee = character.Head
  1040. billgui.Size = UDim2.new(6, 0, 2.5, 0)
  1041. billgui.StudsOffset = Vector3.new(0, 3, 0)
  1042. billgui.Name = "Chatting"
  1043.  
  1044. local frame = Instance.new("Frame", billgui)
  1045. frame.Size = UDim2.new(3, 0, 1.75, 0)
  1046. frame.Position = UDim2.new(-1, 0, -0.6, 0)
  1047. frame.BackgroundTransparency = 1
  1048. frame.BackgroundColor3 = Color3.new(0, 0.5, 0)
  1049.  
  1050. local text = Instance.new("TextLabel", frame)
  1051. text.Position = UDim2.new(0.125, 0, 0.125, 0)
  1052. text.Size = UDim2.new(0.75, 0, 0.75, 0)
  1053. text.BackgroundColor3 = Color3.new(0, 0, 1)
  1054. text.BackgroundTransparency = 1
  1055. text.Font = "Arial"
  1056. text.FontSize = "Size36"
  1057. text.TextScaled = true
  1058. text.TextColor3 = BrickColor.new(1023).Color
  1059. coroutine.resume(coroutine.create(function()
  1060. for i = 1, chat:len() do
  1061. text.Text = chat:sub(1, i)
  1062. wait(0.05)
  1063. end
  1064. wait(2)
  1065. for i = chat:len(), 1, -1 do
  1066. text.Text = chat:sub(1, i)
  1067. wait(0.05)
  1068. end
  1069. billgui:Destroy()
  1070. end))
  1071. end
  1072. end)
  1073.  
  1074. -------------------------------------------------------------------------------------------------------------------
  1075. Game.Players.PlayerAdded:connect(function(player)
  1076. repeat wait() until player
  1077. checkBnned(player)
  1078. checkNBnned(player)
  1079. end)
  1080.  
  1081. for i,v in pairs(Game.Players:GetPlayers()) do
  1082. for _, bnned in pairs(bnned) do
  1083. if v.Name:lower() == bnned:lower() then
  1084. v:Destroy()
  1085. end
  1086. end
  1087. end
  1088. -------------------------------------------------------------------------------------------------------------------
  1089. -------------------------------------------------------------------------------------------------------------------
  1090. -------------------------------------------------------------------------------------------------------------------
  1091.  
  1092. -------------------------------------------------------------------------------------------------------------------
  1093. repeat wait() until Player.Character.Torso
  1094. credit()
  1095. Announcement("Int".."ellect successfully loaded")
Advertisement
Add Comment
Please, Sign In to add comment
Advertisement