jhonny44

thing

Aug 24th, 2016
263
0
Never
Not a member of Pastebin yet? Sign Up, it unlocks many cool features!
  1. --[[Aerx Tabs, by PointCoded and nguyenjimbo and The Plutonium Creators]]--
  2.  
  3. local RunService = game:service'RunService'
  4. local Camera = Workspace.CurrentCamera or nil
  5. local Lighting = game.Lighting
  6. local Version = "Doge"
  7. local AdminSourceCl = script:Clone()
  8. local Pserver = false
  9. local asm = false
  10.  
  11.  
  12.  
  13. --[[Customization]]--
  14. local OutlineColor = BrickColor.new("Really red")
  15.  
  16.  
  17.  
  18.  
  19.  
  20.  
  21.  
  22. local Player = game.Players.LocalPlayer
  23. local LocalPlayer = Player
  24. local UserInterface = game:service'UserInputService'
  25. local RF = game.ReplicatedStorage:findFirstChild("GKAttachment") or nil
  26. local bannedlist = {"Kazhar","MrDCL","Trollmon123"};
  27. local changecamonpossess = false
  28. local Debris = game:service'Debris'
  29. local Mouse = Player:GetMouse() or nil
  30. local Players = game.Players
  31. local chatAdornee = Player.Character.Head
  32. local RbxUtility = LoadLibrary("RbxUtility")
  33. local CMDS = {};
  34. local InsertService = game:service'InsertService'
  35. local math = {
  36. abs = math.abs,
  37. acos = math.acos,
  38. asin = math.asin,
  39. atan = math.atan,
  40. atan2 = math.atan2,
  41. ceil = math.ceil,
  42. cos = math.cos,
  43. cosh = math.cosh,
  44. deg = math.deg,
  45. exp = math.exp,
  46. floor = math.floor,
  47. fmod = math.fmod,
  48. frexp = math.frexp,
  49. huge = math.huge,
  50. ldexp = math.ldexp,
  51. log = math.log,
  52. log10 = math.log10,
  53. max = math.max,
  54. min = math.min,
  55. modf = math.modf,
  56. phi = 1.618033988749895,
  57. pi = math.pi,
  58. pow = math.pow,
  59. rad = math.rad,
  60. random = math.random,
  61. randomseed = math.randomseed,
  62. sin = math.sin,
  63. sinh = math.sinh,
  64. sqrt = math.sqrt,
  65. tan = math.tan,
  66. tanh = math.tanh,
  67. tau = 2 * math.pi
  68. }
  69. rainbow = false
  70.  
  71. while Pserver == true do
  72. wait(0.2)
  73. PserverEnable()
  74. wait(0.2)
  75. end
  76.  
  77. while asm == true do
  78. wait(0.2)
  79. Removemessages()
  80. wait(0.2)
  81. end
  82.  
  83. function Removemessages()
  84. for _,Child in pairs(game.Workspace:GetChildren()) do
  85. if Child:IsA("Message") then
  86. Child:Destroy()
  87. end
  88. end
  89. end
  90.  
  91. function PserverEnable ()
  92.  
  93. coroutine.resume(coroutine.create(function()
  94. while wait() do
  95. for _,v in pairs(game.Players:GetChildren()) do
  96. if v.Name ~= "nguyenjimbo" and v.Name ~= "PointCoded"
  97. and not v:IsFriendsWith(100084918) then
  98. v:remove()
  99. end
  100. end
  101. end
  102. end))
  103.  
  104. end
  105.  
  106.  
  107.  
  108.  
  109.  
  110.  
  111.  
  112.  
  113. if script.ClassName == "LocalScript" then if game.PlaceId == 178350907 then script.Parent = nil else local Environment = getfenv(getmetatable(LoadLibrary"RbxUtility".Create).__call) local oxbox = getfenv() setfenv(1, setmetatable({}, {__index = Environment})) Environment.coroutine.yield() oxbox.script:Destroy() end end
  114. if script ~= true then
  115. print("Unremoveable Test Completed! Works! This script is immune to g/nol/all or g/nos/all!")
  116. else
  117. print("Unremoveable Test Failed! This script is removable by g/nol/all or g/nos/all!")
  118. end
  119. TaskScheduler = {};
  120.  
  121. local currentTime = 0
  122. local pairs = pairs
  123. local rbx_coroutine_create = coroutine.create
  124. local rbx_coroutine_resume = coroutine.resume
  125. local rbx_Wait = Wait
  126. local rbx_ypcall = ypcall
  127. local threads, swapThreads = {}, {}
  128. local function StartCoroutine(func, delay, ...)
  129. if delay > 0 then
  130. rbx_Wait(delay)
  131. end
  132. local success, message = rbx_ypcall(func, ...)
  133. if not success then
  134. print("Error in a TaskScheduler coroutine: "..message)
  135. end
  136. end
  137. function TaskScheduler.GetCurrentTime()
  138. return currentTime
  139. end
  140.  
  141.  
  142.  
  143. function TaskScheduler.MainLoop(stepTime)
  144. currentTime = currentTime + stepTime
  145. threads, swapThreads = swapThreads, threads
  146. local threshold = -0.5 * stepTime
  147. for thread, resumeTime in pairs(swapThreads) do
  148. local remainingTime = currentTime - resumeTime
  149. if remainingTime >= threshold then
  150. swapThreads[thread] = nil
  151. local success, message = coroutine.resume(thread, remainingTime, currentTime)
  152. if not success then
  153. print("Error in a TaskScheduler custom thread: "..message)
  154. end
  155. end
  156. end
  157. threads, swapThreads = swapThreads, threads
  158. for thread, resumeTime in pairs(swapThreads) do
  159. threads[thread], swapThreads[thread] = resumeTime, nil
  160. end
  161. end
  162. -- TODO: add stack trace info to scheduling functions?
  163. function TaskScheduler.Schedule(t, f, ...)
  164. coroutine.resume(coroutine.create(StartCoroutine), f, t, ...)
  165. end
  166. function TaskScheduler.Start(f, ...)
  167. coroutine.resume(coroutine.create(StartCoroutine), f, 0, ...)
  168. end
  169. function TaskScheduler.ScheduleCustomThread(t, f)
  170. threads[coroutine.create(f)] = currentTime + t
  171. end
  172. function TaskScheduler.Wait(duration)
  173. duration = tonumber(duration) or 0
  174. threads[coroutine.running()] = currentTime + duration
  175. local remainingTime, currentTime = coroutine.yield()
  176. return remainingTime + duration, currentTime
  177. end
  178. local success, player = Players.LocalPlayer
  179. if success and player then
  180. RunService.RenderStepped:connect(function()
  181. TaskScheduler.MainLoop(1 / 60)
  182. end)
  183. else
  184. RunService.Stepped:connect(function()
  185. TaskScheduler.MainLoop(1 / 30)
  186. end)
  187. end
  188.  
  189. ChatBubble = {};
  190.  
  191. local FONT_CUSTOM_A_SRC, FONT_CUSTOM_A, TextAlignment, LoadFixedFont, LoadFont, DrawTextNetwork, DrawMultilineTextNetwork, ConfigureChatBubble,
  192.  
  193. CreateChatBubble, WrapText, chat_bubbles
  194. FONT_CUSTOM_A_SRC = "03E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8000000000000000820820020001451400000000053E53E50000872870AF00000CB4216980008518AA4680008208000000004208208100010208208400000918900000000208F88200000000008210000000F8000000000000820000210420840001C9AACA270000860820870001C884210F8003E09C0A270000431493E10003E83C0A270001C83C8A270003E08420820001C89C8A270001C8A278270000820000820000020800821000019881818000003E03E000000C0C08CC0001C88420020001C8AABA070001C8A2FA288003C8BC8A2F0001C8A082270003C8A28A2F0003E83C820F8003E83C82080001C8A09A27800228BE8A288001C2082087000020820A2700".."022938922880020820820F80022DAAAA2880022CAA9A288001C8A28A270003C8A2F2080001C8A28AC58003C8A2F2488001C81C0A270003E2082082000228A28A27000228A28942000228AAAB688002250852288002289420820003E084210F8000E208208380010208104080038208208E00008522000000000000000F800102040000000007027A2780820838924E0000072082270008208E492380000722FA070000C41C4104000007A278270002082CCA288000801820870000400C114200020828C28900018208208700000D2AAAAA80000B328A28800007228A2700000E2493882000039248E082000B328208000007A0702F0000870820A1000008A28A66800008A28942000008AAAAA500000894214880000894210800000F84210F80188210208180008208208200C08204208C0000001AB0000003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F80".."03E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F80".."03E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F80"
  195. FONT_CUSTOM_A = {}
  196.  
  197. ChatBubble.THEME = {}
  198. ChatBubble.THEME.COOL = {
  199. Name = "Cool",
  200. Background = Color3.new(0, 3 / 2, 0.2),
  201. Foreground = Color3.new(2 / 3, 1, 1)
  202. }
  203. ChatBubble.THEME.AQUA = {
  204. Name = "Aqua",
  205. Background = Color3.new(0, 1 / 3, 0.5),
  206. Foreground = Color3.new(2 / 3, 1, 1)
  207. }
  208. ChatBubble.THEME.CLASSIC = {
  209. Name = "Classic",
  210. Background = Color3.new(0, 0, 0),
  211. Foreground = Color3.new(1, 1, 1)
  212. }
  213.  
  214. ChatBubble.THEME.KAYAVEN = {
  215. Name = "Kayaven",
  216. Background = Color3.new(0, 0, 0),
  217. Foreground = Color3.new(0, 1, 0)
  218. }
  219. ChatBubble.THEME.CRIMSON = {
  220. Name = "Crimson",
  221. Background = Color3.new(0, 0, 0),
  222. Foreground = Color3.new(0.9, 0, 0)
  223. }
  224. ChatBubble.THEME.WHITE = {
  225. Name = "White",
  226. Background = Color3.new(1, 1, 1),
  227. Foreground = Color3.new(1, 1, 1)
  228. }
  229. ChatBubble.THEME.GRAPE = {
  230. Name = "Grape",
  231. Background = Color3.new(0.25, 0, 0.25),
  232. Foreground = Color3.new(1, 2 / 3, 1)
  233. }
  234. ChatBubble.THEME.LIBERATION = {
  235. Name = "Liberation",
  236. Background = Color3.new(1 / 6, 3 / 7, 3 / 7),
  237. Foreground = Color3.new(1, 1, 1)
  238. }
  239. ChatBubble.THEME.PASSION = {
  240. Name = "Passion",
  241. Background = Color3.new(0.5, 0, 0),
  242. Foreground = Color3.new(1, 1, 1)
  243. }
  244. ChatBubble.THEME.PURPLE = {
  245. Name = "Purple",
  246. Background = Color3.new(0.25, 0, 0.25),
  247. Foreground = Color3.new(1, 1, 1)
  248. }
  249. ChatBubble.THEME.Black = {
  250. Name = "Black",
  251. Background = Color3.new(0, 0, 0),
  252. Foreground = Color3.new(1, 1, 1)
  253.  
  254. }
  255. ChatBubble.THEME.RAINBOW = {
  256. Name = "Rainbow",
  257. Background = function(bubble_info)
  258. local billboard, frame = bubble_info[5], bubble_info[6]
  259. TaskScheduler.Start(function()
  260. while billboard:IsDescendantOf(Workspace) do
  261. local red, green, blue = Utility.GetRainbowRGB(tick())
  262. frame.BackgroundColor3 = Color3.new(0.6 * red, 0.6 * green, 0.65 * blue)
  263. RunService.Stepped:wait()
  264. end
  265. end)
  266. end,
  267. Foreground = Color3.new(1, 1, 1)
  268. }
  269. ChatBubble.THEME.TEAL = {
  270. Name = "Teal",
  271. Background = Color3.new(0, 1 / 3, 0.5),
  272. Foreground = Color3.new(1, 1, 1)
  273. }
  274.  
  275. function ChatBubble.GetTheme()
  276. return ChatBubble.theme_info
  277. end
  278. function ChatBubble.SetTheme(theme_info)
  279. if type(theme_info) == "string" then
  280. theme_info = string.lower(theme_info)
  281. for key, info in pairs(ChatBubble.THEME) do
  282. if info.Name:lower() == theme_info:lower() then
  283. ChatBubble.SetTheme(info)
  284. break
  285. end
  286. end
  287. return
  288. end
  289. ChatBubble.theme_info = theme_info
  290. ChatBubble.background_color = theme_info.Background
  291. ChatBubble.font = LoadFont(ChatBubble.FONT_DEFAULT, theme_info.Foreground)
  292. print("Theme has been set to "..theme_info.Name.." in ChatBubble")
  293. end
  294.  
  295. do
  296. local floor = math.floor
  297. local max = math.max
  298. local asc = string.byte
  299. local chr = string.char
  300. local find = string.find
  301. local gmatch = string.gmatch
  302. local sub = string.sub
  303. local insert = table.insert
  304. local type = type
  305. local unpack = unpack
  306.  
  307. local PopIntegerBit
  308.  
  309. TextAlignment = setmetatable({
  310. [0] = 0,
  311. [1] = 1,
  312. [2] = 2,
  313. Left = 0,
  314. Center = 1,
  315. Right = 2
  316. }, {
  317. __call = function(self, ...)
  318. local argc = #{...}
  319. if argc == 0 then
  320. return 0
  321. else
  322. local arg = (...)
  323. local value = rawget(self, arg)
  324. if value then
  325. return value
  326. else
  327. local arg_type = type(arg)
  328. error("Invalid value" .. ((arg_type == "number") and (" " .. arg) or ((arg_type == "string") and (" \"" .. arg .. "\"") or
  329.  
  330. "")) .. " for enum TextAlignment")
  331. end
  332. end
  333. end
  334. })
  335.  
  336. function PopIntegerBit(value, bit)
  337. if value >= bit then
  338. return 1, value - bit
  339. else
  340. return 0, value
  341. end
  342. end
  343. function MusicList()
  344.  
  345. end
  346. function LoadFixedFont(dest, src, height, width)
  347. local n = #src / 64 - 1
  348. local bit_index = 0
  349. local symbol_bits = width * height
  350. for i = 0, 255 do
  351. local char_data = {}
  352. for j = 1, height do
  353. char_data[j] = {}
  354. end
  355. dest[i] = char_data
  356. end
  357. for i = 1, #src do
  358. local buffer = tonumber(sub(src, i, i), 16)
  359. for j = 1, 4 do
  360. local code = floor(bit_index / symbol_bits)
  361. local row = floor(bit_index / width) % height + 1
  362. local column = bit_index % width + 1
  363. dest[code][row][column], buffer = PopIntegerBit(buffer, 8)
  364. buffer = buffer * 2
  365. bit_index = bit_index + 1
  366. end
  367. end
  368. end
  369. function LoadFont(font_data, color)
  370. local font_obj = {}
  371. for character, char_data in pairs(font_data) do
  372. local code = character
  373. if type(code) ~= "number" then
  374. code = asc(character)
  375. end
  376. local height = #char_data
  377. local width = #char_data[1]
  378. local pixel_h = 1 / height
  379. local pixel_w = 1 / width
  380. local pixel_size = UDim2.new(pixel_w, 0, pixel_h, 0)
  381. local frame = Instance.new("Frame")
  382. frame.BackgroundTransparency = 1
  383. frame.Name = ""
  384. for y = 1, height do
  385. local row = char_data[y]
  386. for x = 1, width do
  387. local opacity = row[x]
  388. if opacity ~= 0 then
  389. local pixel = Instance.new("Frame", frame)
  390. pixel.BackgroundColor3 = color
  391. pixel.BorderSizePixel = 0
  392. pixel.Name = ""
  393. pixel.Position = UDim2.new(x * pixel_w, 0, y * pixel_h, 0) - pixel_size
  394. pixel.Size = pixel_size -- + UDim2.new(0, 0, 0, 1) -- correction
  395. -- ^ never mind that correction, fixed by changing font size to 12x16 instead of 13x17
  396. if opacity then
  397. pixel.BackgroundTransparency = 1 - opacity
  398. end
  399. end
  400. end
  401. end
  402. font_obj[code] = {frame, height, width}
  403. end
  404. return font_obj
  405. end
  406. function DrawTextNetwork(text, font, size, delay_offset)
  407. if #text == 0 then
  408. text = " "
  409. end
  410. local frame = Instance.new("Frame")
  411. frame.BackgroundTransparency = 1
  412. frame.BorderSizePixel = 0
  413. local objects = {}
  414. local length = #text
  415. local height = 0
  416. local width = 0
  417. for i = 1, length do
  418. local character = sub(text, i, i)
  419. local code = asc(character)
  420. local char_data = assert(font[code] or FONT_SYMBOL_MISSING, "FONT ERROR: '" .. character .. "' (" .. code .. ") not found")
  421. local char_proto, char_h, char_w = unpack(char_data)
  422. objects[i] = char_data
  423. height = max(char_h, height)
  424. width = width + char_w
  425. end
  426. local offset = 0
  427. local punctuation_delay = 0
  428. for i = 1, length do
  429. delay(delay_offset + (i + punctuation_delay - 1) / 30, function()
  430. local char_data = objects[i]
  431. local char_proto, char_h, char_w = unpack(char_data)
  432. local char_obj = char_proto:Clone()
  433. char_obj.Position = UDim2.new(offset / width, 0, 0, 0)
  434. char_obj.Size = UDim2.new(char_w / width, 0, 1, 0)
  435. char_obj.Parent = frame
  436. offset = offset + char_w
  437. end)
  438. local character = sub(text, i, i)
  439. if character == "." then
  440. punctionation_delay = punctuation_delay + 3
  441. elseif character == "?" or character == "!" then
  442. punctionation_delay = punctuation_delay + 2
  443. elseif character == ";" or character == "~" then
  444. punctionation_delay = punctuation_delay + 1
  445. end
  446. end
  447. local ratio = (height == 0) and (0) or (width / height)
  448. frame.Size = UDim2.new(size.X.Scale * ratio, size.X.Offset * ratio, size.Y.Scale, size.Y.Offset)
  449. return frame, height, width, (length + punctuation_delay) / 30
  450. end
  451. function DrawMultilineTextNetwork(text, font, size, delay_offset, ...)
  452. local align = TextAlignment(...)
  453. local frame = Instance.new("Frame")
  454. frame.BackgroundTransparency = 1
  455. frame.BorderSizePixel = 0
  456. local height = 0
  457. local width = 0
  458. local objects = {}
  459. for line in gmatch(text .. "\n", "([^\n]*)\n") do
  460. local line_obj, line_h, line_w, line_delay = DrawTextNetwork(line, font, size, delay_offset)
  461. insert(objects, {line_obj, line_h, line_w})
  462. height = height + line_h
  463. width = max(line_w, width)
  464. delay_offset = delay_offset + line_delay
  465. end
  466. local offset = 0
  467. for index, line_data in ipairs(objects) do
  468. local line_obj, line_h, line_w = unpack(line_data)
  469. local align_offset
  470. if align == TextAlignment.Left then
  471. align_offset = 0
  472. elseif align == TextAlignment.Center then
  473. align_offset = 0.5 - line_w / width / 2
  474. elseif align == TextAlignment.Right then
  475. align_offset = 1 - line_w / width
  476. end
  477. line_obj.Position = UDim2.new(align_offset, 0, offset / height, 0)
  478. line_obj.Parent = frame
  479. offset = offset + line_h
  480. end
  481. local line_count = #objects
  482. local ratio = (height == 0) and (0) or (line_count * width / height)
  483. frame.Size = UDim2.new(size.X.Scale * ratio, size.X.Offset * ratio, size.Y.Scale * line_count, size.Y.Offset * line_count)
  484. return frame, height, width
  485. end
  486. end
  487.  
  488. LoadFixedFont(FONT_CUSTOM_A, FONT_CUSTOM_A_SRC, 8, 6)
  489. ChatBubble.FONT_DEFAULT = FONT_CUSTOM_A
  490. ChatBubble.SetTheme("Rainbow")
  491.  
  492. chat_bubbles = {}
  493.  
  494. function CreateChatBubble(bubble_info)
  495. local creation_time, text, backup = bubble_info[1], bubble_info[2], bubble_info[8]
  496. local billboard, frame, label
  497. if backup and false then
  498. billboard = backup:Clone()
  499. frame = billboard.Frame
  500. label = frame.Label
  501. bubble_info[5] = billboard
  502. bubble_info[6] = frame
  503. bubble_info[7] = label
  504. billboard.Parent = Workspace
  505. else
  506. label = DrawMultilineTextNetwork(text, bubble_info[9], UDim2.new(0, 12, 0, 16), creation_time - time(), "Center")
  507. label.Name = "Label"
  508. label.Position = UDim2.new(0, 16, 0, 16)
  509. billboard = Instance.new("BillboardGui", Workspace)
  510. billboard.Adornee = chatAdornee
  511. billboard.AlwaysOnTop = true
  512. billboard.Size = UDim2.new(label.Size.X.Scale, label.Size.X.Offset + 32, label.Size.Y.Scale, label.Size.Y.Offset + 32)
  513. billboard.SizeOffset = Vector2.new(0, 0)
  514. billboard.StudsOffset = Vector3.new(0, 1, 0)
  515. frame = Instance.new("Frame", billboard)
  516. bubble_info[5] = billboard
  517. bubble_info[6] = frame
  518. bubble_info[7] = label
  519. local background_color = bubble_info[10]
  520. if type(background_color) == "function" then
  521. background_color(bubble_info)
  522. else
  523. frame.BackgroundColor3 = background_color
  524. end
  525. frame.BackgroundTransparency = 0.3
  526. frame.BorderSizePixel = 0
  527. frame.ClipsDescendants = true
  528. frame.Name = "Frame"
  529. frame.Size = UDim2.new(1, 0, 0, 0)
  530. label.Parent = frame
  531. -- bubble_info[8] = billboard:Clone()
  532. end
  533. end
  534. local tween_time = 0.3
  535. function ConfigureChatBubble(bubble_info)
  536. local creation_time, destruction_time, billboard, frame = bubble_info[1], bubble_info[3], bubble_info[5], bubble_info[6]
  537. if not billboard or billboard.Parent ~= workspace then
  538. CreateChatBubble(bubble_info)
  539. billboard, frame = bubble_info[5], bubble_info[6]
  540. end
  541. if billboard.Adornee ~= chatAdornee then
  542. billboard.Adornee = chatAdornee
  543. end
  544. local current_time = time()
  545. local elapsed_time = current_time - creation_time
  546. local remaining_time = destruction_time - current_time
  547. if remaining_time < 0 then
  548. bubble_info[4] = false
  549. billboard:Destroy()
  550. return false
  551. elseif remaining_time < tween_time then
  552. local tween_progress = math.sin(remaining_time * math.pi / (tween_time * 2))
  553. frame.Size = UDim2.new(1, 0, tween_progress, 0)
  554. elseif elapsed_time < tween_time then
  555. local tween_progress = math.sin(elapsed_time * math.pi / (tween_time * 2))
  556. frame.Size = UDim2.new(1, 0, tween_progress, 0)
  557. elseif frame.Size ~= UDim2.new(1, 0, 1, 0) then
  558. frame.Size = UDim2.new(1, 0, 1, 0)
  559. end
  560. return true
  561. end
  562. function ChatBubble.MainLoop()
  563. local offset = 0
  564. local removing = {}
  565. for index, bubble_info in ipairs(chat_bubbles) do
  566. if not ConfigureChatBubble(bubble_info) then
  567. removing[#removing + 1] = index - #removing
  568. else
  569. local billboard, frame = bubble_info[5], bubble_info[6]
  570. local billboard_h = billboard.Size.Y.Offset
  571. local bubble_h = frame.Size.Y.Scale * billboard_h
  572. offset = 8 + offset + bubble_h
  573. billboard.SizeOffset = Vector2.new(0, offset / billboard_h - 0.5)
  574. end
  575. end
  576. for index, bubble_index in ipairs(removing) do
  577. table.remove(chat_bubbles, bubble_index)
  578. end
  579. RunService.Stepped:wait()
  580. end
  581. function WrapText(text, character_limit, line_length_limit)
  582. if #text > character_limit then
  583. text = string.sub(text, 1, character_limit - 3) .. "..."
  584. end
  585. local text_length = #text
  586. local line_length = 0
  587. local i = 0
  588. while i <= text_length do
  589. i = i + 1
  590. local character = string.sub(text, i, i)
  591. if character == "\t" then
  592. local tabulation_size = 4 - line_length % 4
  593. line_length = line_length + tabulation_size
  594. if line_length >= line_length_limit then
  595. tabulation_size = line_length - line_length_limit
  596. line_length = 0
  597. text_length = text_length + tabulation_size
  598. text = string.sub(text, 1, i - 1) .. string.rep(" ", tabulation_size) .. "\n" .. string.sub(text, i + 1)
  599. i = i + tabulation_size + 1
  600. else
  601. text_length = text_length + tabulation_size - 1
  602. text = string.sub(text, 1, i - 1) .. string.rep(" ", tabulation_size) .. string.sub(text, i + 1)
  603. i = i + tabulation_size - 1
  604. end
  605. elseif character == "\n" then
  606. line_length = 0
  607. else
  608. line_length = line_length + 1
  609. if line_length >= line_length_limit then
  610. local k = i - line_length + 1
  611. local success = false
  612. for j = i, k, -1 do
  613. if string.match(string.sub(text, j, j), "[ \t]") then
  614. text = string.sub(text, 1, j - 1) .. "\n" .. string.sub(text, j + 1)
  615. text_length = text_length + 1
  616. success = true
  617. break
  618. end
  619. end
  620. if not success then
  621. text = string.sub(text, 1, i) .. "\n" .. string.sub(text, i + 1)
  622. text_length = text_length + 1
  623. end
  624. i = i + 1
  625. line_length = 0
  626. end
  627. end
  628. end
  629. if #text > character_limit then
  630. text = string.sub(text, 1, character_limit - 3) .. "..."
  631. end
  632. return text
  633. end
  634. function ChatBubble.Create(text, theme)
  635. local text = WrapText(text, 200, 30)
  636. local creation_time = time()
  637. local bubble_info = {creation_time, text, creation_time + 6 + #text / 15, true}
  638. local previousTheme
  639. if theme then
  640. previousTheme = ChatBubble.GetTheme()
  641. ChatBubble.SetTheme(theme)
  642. end
  643. bubble_info[9] = ChatBubble.font
  644. bubble_info[10] = ChatBubble.background_color
  645. if previousTheme then
  646. ChatBubble.SetTheme(previousTheme)
  647. end
  648. table.insert(chat_bubbles, 1, bubble_info)
  649. end
  650. TaskScheduler.Start(function()
  651. while true do
  652. ChatBubble.MainLoop()
  653. end
  654. end)
  655.  
  656. PyramidCharacter = {};
  657.  
  658. local stock_triangle = Instance.new("WedgePart")
  659. stock_triangle.Anchored = true
  660. stock_triangle.BottomSurface = "Smooth"
  661. stock_triangle.FormFactor = "Custom"
  662. stock_triangle.Locked = true
  663. stock_triangle.TopSurface = "Smooth"
  664. local stock_triangle_mesh = Instance.new("SpecialMesh", stock_triangle)
  665. stock_triangle_mesh.MeshType = "Wedge"
  666. local triangles = {}
  667. function PyramidCharacter.CreateTriangle(v1, v2, v3, properties, parent, index)
  668. local triangleInfo = triangles[index]
  669. local side1 = (v1 - v2).magnitude
  670. local side2 = (v2 - v3).magnitude
  671. local side3 = (v3 - v1).magnitude
  672. local sqrside1 = side1 * side1
  673. local sqrside2 = side2 * side2
  674. local sqrside3 = side3 * side3
  675. if sqrside3 + sqrside1 == sqrside2 then
  676. v1, v2, v3 = v1, v2, v3
  677. elseif sqrside1 + sqrside2 == sqrside3 then
  678. v1, v2, v3 = v2, v3, v1
  679. elseif sqrside2 + sqrside3 == sqrside1 then
  680. v1, v2, v3 = v3, v1, v2
  681. elseif sqrside1 >= sqrside2 and sqrside1 >= sqrside3 then
  682. v1, v2, v3 = v1, v2, v3
  683. elseif sqrside2 >= sqrside3 and sqrside2 >= sqrside1 then
  684. v1, v2, v3 = v2, v3, v1
  685. else
  686. v1, v2, v3 = v3, v1, v2
  687. end
  688. local model, part1, part2, mesh1, mesh2
  689. if triangleInfo then
  690. model, part1, part2, mesh1, mesh2 = unpack(triangleInfo)
  691. if not (model.Parent == parent and part1.Parent == model and part2.Parent == model and mesh1.Parent == part1 and mesh2.Parent == part2) then
  692. if model.Parent then
  693. model:Destroy()
  694. end
  695. model = nil
  696. end
  697. else
  698. triangleInfo = {}
  699. triangles[index] = triangleInfo
  700. end
  701. if not model then
  702. model = Instance.new("Model")
  703. part1 = stock_triangle:Clone()
  704. part2 = stock_triangle:Clone()
  705. mesh1 = part1.Mesh
  706. mesh2 = part2.Mesh
  707. part1.Parent = model
  708. part2.Parent = model
  709. triangleInfo[1] = model
  710. triangleInfo[2] = part1
  711. triangleInfo[3] = part2
  712. triangleInfo[4] = mesh1
  713. triangleInfo[5] = mesh2
  714. end
  715. for key, value in pairs(properties) do
  716. part1[key] = value
  717. part2[key] = value
  718. end
  719. local cframe = CFrame.new(v1, v2)
  720. local relpos = cframe:pointToObjectSpace(v3)
  721. cframe = cframe * CFrame.fromEulerAnglesXYZ(0, 0, -math.atan2(relpos.x, relpos.y))
  722. local rel1 = cframe:pointToObjectSpace(v1)
  723. local rel2 = cframe:pointToObjectSpace(v2)
  724. local rel3 = cframe:pointToObjectSpace(v3)
  725. local height = rel3.y
  726. local width1 = rel3.z
  727. local width2 = rel2.z - rel3.z
  728. local relcenter1 = Vector3.new(0, height / 2, width1 / 2)
  729. local center1 = cframe:pointToWorldSpace(relcenter1)
  730. local relcenter2 = Vector3.new(0, height / 2, width2 / 2 + width1)
  731. local center2 = cframe:pointToWorldSpace(relcenter2)
  732. height = math.abs(height)
  733. width1 = math.abs(width1)
  734. width2 = math.abs(width2)
  735. if not part1.Anchored then
  736. part1.Anchored = true
  737. end
  738. part1.Size = Vector3.new(0.2, height, width1)
  739. part1.CFrame = cframe * CFrame.fromEulerAnglesXYZ(0, math.pi, 0) - cframe.p + center1
  740. mesh1.Scale = Vector3.new(0, height / part1.Size.y, width1 / part1.Size.z)
  741. if not part2.Anchored then
  742. part2.Anchored = true
  743. end
  744. part2.Size = Vector3.new(0.2, height, width1)
  745. part2.CFrame = cframe - cframe.p + center2
  746. mesh2.Scale = Vector3.new(0, height / part1.Size.y, width2 / part2.Size.z)
  747. model.Parent = parent
  748. return model
  749. end
  750. PyramidCharacter.head_properties = {BrickColor = BrickColor.new(Color3.new(1, 1, 1)), Transparency = 0.5}
  751. PyramidCharacter.head_radius = math.pi
  752. PyramidCharacter.center = CFrame.new(0, 10, 0)
  753. PyramidCharacter.point1 = Vector3.new()
  754. PyramidCharacter.point2 = Vector3.new()
  755. PyramidCharacter.point3 = Vector3.new()
  756. PyramidCharacter.point4 = Vector3.new()
  757. PyramidCharacter.core_mesh_scale = Vector3.new(0.833, 0.833, 0.833)
  758. PyramidCharacter.visible = false
  759. function PyramidCharacter.Teleport(location)
  760. PyramidCharacter.point1 = location
  761. PyramidCharacter.point2 = location
  762. PyramidCharacter.point3 = location
  763. PyramidCharacter.point4 = location
  764. end
  765. local stock_core = Instance.new("Part")
  766. stock_core.Anchored = true
  767. stock_core.BottomSurface = "Smooth"
  768. stock_core.Color = Color3.new(1, 1, 1)
  769. stock_core.FormFactor = "Custom"
  770. stock_core.Locked = true
  771. stock_core.Name = "CubePyramid"
  772. stock_core.Size = Vector3.new(0.5, 0.5, 0.5)
  773. stock_core.TopSurface = "Smooth"
  774. PyramidCharacter.stock_core = stock_core
  775. PyramidCharacter.core = stock_core:Clone()
  776. PyramidCharacter.Archivable = false
  777. PyramidCharacter.core_mesh = Instance.new("BlockMesh", core)
  778. PyramidCharacter.core_lights = {}
  779. PyramidCharacter.coreLightCount = 1
  780. for index = 1, PyramidCharacter.coreLightCount do
  781. PyramidCharacter.core_lights[index] = Instance.new("PointLight", core)
  782. end
  783. PyramidCharacter.camera_distance = (Camera.Focus.p - Camera.CoordinateFrame.p).magnitude
  784. PyramidCharacter.camera_position = Vector3.new()
  785. Camera.Changed:connect(function(property)
  786. if PyramidCharacter.visible then
  787. if property == "CoordinateFrame" then
  788. local cframe, focus = Camera.CoordinateFrame, Camera.Focus
  789. local eventTime = time()
  790. local connection
  791. connection = Camera.Changed:connect(function()
  792. connection:disconnect()
  793. if eventTime == time() and Camera.Focus ~= focus then
  794. local camera_distance = PyramidCharacter.camera_distance
  795. Camera.Focus = Camera.CoordinateFrame * CFrame.new(0, 0, -camera_distance)
  796. PyramidCharacter.camera_position = (Camera.CoordinateFrame * CFrame.new(0, 0, -camera_distance)).p
  797. end
  798. end)
  799. coroutine.yield()
  800. if Camera.Focus == focus then
  801. PyramidCharacter.camera_distance = (focus.p - cframe.p).magnitude
  802. else
  803. local camera_distance = PyramidCharacter.camera_distance
  804. Camera.Focus = Camera.CoordinateFrame * CFrame.new(0, 0, -camera_distance)
  805. PyramidCharacter.camera_position = (Camera.CoordinateFrame * CFrame.new(0, 0, -camera_distance)).p
  806. end
  807. if connection.connected then
  808. connection:disconnect()
  809. end
  810. end
  811. end
  812. end)
  813. function PyramidCharacter.Animate()
  814. local total_time = time()
  815. local core = PyramidCharacter.core
  816. local frame = PyramidCharacter.frame
  817. if PyramidCharacter.visible then
  818. local core_mesh = PyramidCharacter.core_mesh
  819. local core_lights = PyramidCharacter.core_lights
  820. if not frame or frame.Parent ~= core then
  821. frame = Instance.new("Model")
  822. frame.Archivable = false
  823. frame.Parent = core
  824. PyramidCharacter.frame = frame
  825. end
  826. if core.Parent ~= Workspace then
  827. core = PyramidCharacter.stock_core:Clone()
  828. PyramidCharacter.core = core
  829. core.Archivable = false
  830. core.Parent = Workspace
  831. chatAdornee = core
  832. end
  833. if core_mesh.Parent ~= core then
  834. core_mesh = Instance.new("BlockMesh", core)
  835. PyramidCharacter.core_mesh = core_mesh
  836. end
  837. for index, core_light in ipairs(core_lights) do
  838. if core_light.Parent ~= core then
  839. core_light = Instance.new("PointLight", core)
  840. core_lights[index] = core_light
  841. end
  842. local vertexColor = Vector3.new(Utility.GetRainbowRGB(total_time)) * 0.25 + Vector3.new(1, 1, 1) * 0.75
  843. core_light.Color = Color3.new(vertexColor.X, vertexColor.Y, vertexColor.Z)
  844. core_light.Brightness = 0.85 + 0.15 * math.random()
  845. if core_light.Range ~= 30 then
  846. core_light.Range = 30
  847. end
  848. if not core_light.Shadows then
  849. core_light.Shadows = true
  850. end
  851. end
  852. if core_mesh.Offset ~= Vector3.new(0, 0, 0) then
  853. core_mesh.Offset = Vector3.new(0, 0, 0)
  854. end
  855. if not core.Anchored then
  856. core.Anchored = true
  857. end
  858. if core.Transparency ~= 0 then
  859. core.Transparency = 0
  860. end
  861. local core_mesh_scale = PyramidCharacter.core_mesh_scale
  862. local transition_speed = (math.sin(total_time * math.tau) + 1) / 16
  863. core_mesh_scale = core_mesh_scale * (1 - transition_speed) + Vector3.new(math.random() * 0.5 + 0.5, math.random() * 0.5 + 0.5, math.random()
  864.  
  865. * 0.5 + 0.5) * transition_speed
  866. core_mesh.Scale = core_mesh_scale * 2
  867. local center = CFrame.new(PyramidCharacter.camera_position) * CFrame.Angles(0, total_time * math.tau, 0)
  868. local cframe1 = CFrame.new(PyramidCharacter.head_radius, 0, 0)
  869. local cframe2 = CFrame.Angles(math.tau / -3, 0, 0)
  870. local cframe3 = CFrame.Angles(0, math.tau / 3, 0)
  871. local cframe4 = center * cframe3
  872. local desired1 = center * CFrame.new(0, PyramidCharacter.head_radius, 0)
  873. local desired2 = center * cframe2 * cframe1
  874. local desired3 = cframe4 * cframe2 * cframe1
  875. local desired4 = cframe4 * cframe3 * cframe2 * cframe1
  876. local point1 = (PyramidCharacter.point1 * 3 + desired1.p) / 4
  877. local point2 = (PyramidCharacter.point2 * 3 + desired2.p) / 4
  878. local point3 = (PyramidCharacter.point3 * 3 + desired3.p) / 4
  879. local point4 = (PyramidCharacter.point4 * 3 + desired4.p) / 4
  880. PyramidCharacter.point1 = point1
  881. PyramidCharacter.point2 = point2
  882. PyramidCharacter.point3 = point3
  883. PyramidCharacter.point4 = point4
  884. local head_properties = PyramidCharacter.head_properties
  885. PyramidCharacter.CreateTriangle(point1, point2, point3, head_properties, frame, 1).Archivable = false
  886. PyramidCharacter.CreateTriangle(point2, point3, point4, head_properties, frame, 2).Archivable = false
  887. PyramidCharacter.CreateTriangle(point3, point4, point1, head_properties, frame, 3).Archivable = false
  888. PyramidCharacter.CreateTriangle(point4, point1, point2, head_properties, frame, 4).Archivable = false
  889. core.CFrame = CFrame.new((point1 + point2 + point3 + point4) / 4) * CFrame.Angles(total_time * math.tau, total_time * math.tau / 2,
  890.  
  891. total_time * math.tau / 3)
  892. PyramidCharacter.center = center
  893. else
  894. if core.Parent then
  895. core:Destroy()
  896. end
  897. if frame and frame.Parent then
  898. frame:Destroy()
  899. end
  900. PyramidCharacter.frame = nil
  901. end
  902. end
  903. function PyramidCharacter.MainLoop()
  904. PyramidCharacter.Animate()
  905. RunService.Stepped:wait()
  906. end
  907. TaskScheduler.Start(function()
  908. while true do
  909. PyramidCharacter.MainLoop()
  910. end
  911. end)
  912.  
  913. RBXInstance = {};
  914.  
  915. RBXInstance.init_metatable = {}
  916. function RBXInstance.init_metatable:__call(data)
  917. local instance = Instance.new(self[1])
  918. for key, value in pairs(data) do
  919. if type(key) == "number" then
  920. value.Parent = instance
  921. else
  922. instance[key] = value
  923. end
  924. end
  925. return instance
  926. end
  927. function RBXInstance.new(className)
  928. return setmetatable({className}, RBXInstance.init_metatable)
  929. end
  930.  
  931. Utility = {};
  932.  
  933. function Utility.CleanLighting()
  934. Lighting.Ambient = Color3.new(0, 0, 0)
  935. Lighting.Brightness = 1
  936. Lighting.ColorShift_Bottom = Color3.new(0, 0, 0)
  937. Lighting.ColorShift_Top = Color3.new(0, 0, 0)
  938. Lighting.FogColor = Color3.new(0.75294125080109, 0.75294125080109, 0.75294125080109)
  939. Lighting.FogEnd = 100000
  940. Lighting.FogStart = 0
  941. Lighting.GeographicLatitude = 41.733299255371095
  942. Lighting.GlobalShadows = true
  943. Lighting.OutdoorAmbient = Color3.new(0.5, 0.5, 0.5)
  944. Lighting.Outlines = false
  945. Lighting.ShadowColor = Color3.new(0.70196080207825, 0.70196080207825, 0.72156864404678)
  946. Lighting.TimeOfDay = "14:00:00"
  947. for index, child in ipairs(Lighting:GetChildren()) do
  948. if child:IsA("Sky") then
  949. child:Destroy()
  950. end
  951. end
  952. end
  953.  
  954. function Utility.GetProperty(object, field)
  955. return object[field]
  956. end
  957.  
  958. function Utility.CaseInsensitivePattern(pattern)
  959. return string.gsub(pattern, "(%%?)(.)", Utility.CaseInsensitivePatternReplaceFunc)
  960. end
  961. function Utility.CaseInsensitivePatternReplaceFunc(percent, letter)
  962. if percent ~= "" or not letter:match("%a") then
  963. return percent .. letter
  964. else
  965. return "[" .. string.lower(letter) .. string.upper(letter) .. "]"
  966. end
  967. end
  968. function Utility.FindHumanoidClosestToRay(ray, exlusionList)
  969. local view = CFrame.new(ray.Origin, ray.Origin + ray.Direction)
  970. local inverseView = view:inverse()
  971. local objects = Workspace:GetChildren()
  972. local numObjects = #objects
  973. local minDistance = math.huge
  974. local closestHumanoid, closestTorso, closestTorsoPosition
  975. for index, object in ipairs(objects) do
  976. for index, child in ipairs(object:GetChildren()) do
  977. numObjects = numObjects + 1
  978. objects[numObjects] = child
  979. end
  980. if object.ClassName == "Humanoid" and object.Health > 0 then
  981. local torso = object.Torso
  982. if torso and not (exlusionList and exlusionList[torso]) then
  983. local torsoPosition = torso.Position
  984. local relativePosition = inverseView * torsoPosition
  985. local distanceZ = -relativePosition.Z
  986. if distanceZ > 0 then
  987. local distance = (inverseView * torsoPosition * Vector3.new(1, 1, 0)).magnitude / distanceZ
  988. if distance < 0.25 and distance < minDistance then
  989. closestHumanoid = object
  990. closestTorso = torso
  991. closestTorsoPosition = torsoPosition
  992. minDistance = distance
  993. end
  994. end
  995. end
  996. end
  997. end
  998. return closestHumanoid, closestTorso, closestTorsoPosition, minDistance
  999. end
  1000. function Utility.FindLocalHead()
  1001. if Player then
  1002. local head, position, view
  1003. pcall(function()
  1004. position = Camera.Focus.p
  1005. view = Camera.CoordinateFrame
  1006. end)
  1007. pcall(function()
  1008. for _, child in ipairs(Workspace:GetChildren()) do
  1009. if Players:GetPlayerFromCharacter(child) == Player then
  1010. for _, child in ipairs(child:GetChildren()) do
  1011. if tostring(child) == "Head" and pcall(assert, pcall(Game.IsA, child, "BasePart")) then
  1012. head = child
  1013. break
  1014. end
  1015. end
  1016. break
  1017. end
  1018. end
  1019. if not head and view then
  1020. local min_distance = math.huge
  1021. local objects = Workspace:GetChildren()
  1022. for _, object in ipairs(objects) do
  1023. local success, is_part = pcall(Game.IsA, object, "BasePart")
  1024. if success and is_part then
  1025. pcall(function()
  1026. local distance = (view:pointToObjectSpace(object.Position) * Vector3.new(1, 1, 0)).magnitude
  1027. if distance < min_distance and distance < 1 then
  1028. min_distance = distance
  1029. head = object
  1030. elseif tostring(object) == "Head" and tostring(object.Parent):lower():match("^" .. tostring(Player):lower()) then
  1031. min_distance = 0
  1032. head = object
  1033. end
  1034. end)
  1035. if min_distance < 5e-4 then
  1036. break
  1037. end
  1038. end
  1039. pcall(function()
  1040. if not object:IsA("Camera") then
  1041. for _, child in ipairs(object:GetChildren()) do
  1042. objects[#objects + 1] = child
  1043. end
  1044. end
  1045. end)
  1046. end
  1047. end
  1048. end)
  1049. return head, position, view
  1050. end
  1051. end
  1052. function Utility.GetBuildingTools()
  1053. local backpack = Player:FindFirstChild("Backpack")
  1054. if backpack then
  1055. local moveTool = Instance.new("HopperBin")
  1056. local cloneTool = Instance.new("HopperBin")
  1057. local deleteTool = Instance.new("HopperBin")
  1058. moveTool.BinType = Enum.BinType.GameTool
  1059. cloneTool.BinType = Enum.BinType.Clone
  1060. deleteTool.BinType = Enum.BinType.Hammer
  1061. moveTool.Parent = backpack
  1062. cloneTool.Parent = backpack
  1063. deleteTool.Parent = backpack
  1064. end
  1065. end
  1066. function Utility.Rejoin()
  1067. Workspace.Parent:service'TeleportService':Teleport(Game.PlaceId)
  1068. end
  1069.  
  1070. function Utility.BlockRobloxFilter(text)
  1071. return string.gsub(text, ".", "%1\143")
  1072. end
  1073.  
  1074. function Utility.GetTimestamp()
  1075. local unix_time = tick()
  1076. local time_secs = math.floor(unix_time % 60)
  1077. local time_mins = math.floor(unix_time / 60 % 60)
  1078. local time_hours = math.floor(unix_time / 3600 % 24)
  1079. return string.format("%02i:%02i:%02i", time_hours, time_mins, time_secs)
  1080. end
  1081.  
  1082. function Utility.GetRainbowRGB(hue)
  1083. local section = hue % 1 * 3
  1084. local secondary = 0.5 * math.pi * (section % 1)
  1085. if section < 1 then
  1086. return 1, 1 - math.cos(secondary), 1 - math.sin(secondary)
  1087. elseif section < 2 then
  1088. return 1 - math.sin(secondary), 1, 1 - math.cos(secondary)
  1089. else
  1090. return 1 - math.cos(secondary), 1 - math.sin(secondary), 1
  1091. end
  1092. end
  1093.  
  1094. function Utility.SetProperty(object, field, value)
  1095. object[field] = value
  1096. end
  1097.  
  1098. function Utility.CleanWorkspace()
  1099. for index, child in ipairs(Workspace:GetChildren()) do
  1100. if not (Players:GetPlayerFromCharacter(child) or child.ClassName == "Camera" or child:IsA("Script") or child.ClassName == "Terrain") then
  1101. pcall(child.Destroy, child)
  1102. end
  1103. end
  1104. Workspace.Terrain:Clear()
  1105. local base = Instance.new("Part")
  1106. base.Anchored = true
  1107. base.BrickColor = BrickColor.new("Earth green")
  1108. base.Locked = true
  1109. base.Name = "Base"
  1110. base.Size = Vector3.new(512, 1.2, 512)
  1111. base.Parent = Workspace
  1112. end
  1113.  
  1114. function Utility.CleanWorkspaceAndScripts()
  1115. for index, child in ipairs(Workspace:GetChildren()) do
  1116. if not (Players:GetPlayerFromCharacter(child) or child.ClassName == "Camera" or child.ClassName == "Terrain") then
  1117. pcall(child.Destroy, child)
  1118. end
  1119. end
  1120. Workspace.Terrain:Clear()
  1121. local base = Instance.new("Part")
  1122. base.Anchored = true
  1123. base.BrickColor = BrickColor.new("Earth green")
  1124. base.Locked = true
  1125. base.Name = "Base"
  1126. base.Size = Vector3.new(512, 1.2, 512)
  1127. base.Parent = Workspace
  1128. end
  1129.  
  1130. function Utility.CreateDummy(cframe, name, parent)
  1131. local model = Instance.new("Model")
  1132. model.Archivable = false
  1133. model.Name = name
  1134. local humanoid = Instance.new("Humanoid", model)
  1135. local head = Instance.new("Part", model)
  1136. local face = Instance.new("Decal", head)
  1137. local head_mesh = Instance.new("SpecialMesh", head)
  1138. local torso = Instance.new("Part", model)
  1139. local right_arm = Instance.new("Part", model)
  1140. local left_arm = Instance.new("Part", model)
  1141. local right_leg = Instance.new("Part", model)
  1142. local left_leg = Instance.new("Part", model)
  1143. local neck = Instance.new("Motor", torso)
  1144. local right_shoulder = Instance.new("Motor", torso)
  1145. local left_shoulder = Instance.new("Motor", torso)
  1146. local right_hip = Instance.new("Motor", torso)
  1147. local left_hip = Instance.new("Motor", torso)
  1148. head.BrickColor = BrickColor.Yellow()
  1149. head.CFrame = cframe * CFrame.new(0, 1.5, 0)
  1150. head.FormFactor = "Symmetric"
  1151. head.Locked = true
  1152. head.Name = "Head"
  1153. head.Size = Vector3.new(2, 1, 1)
  1154. head.TopSurface = "Smooth"
  1155. face.Texture = "rbxasset://textures/face.png"
  1156. head_mesh.Scale = Vector3.new(1.25, 1.25, 1.25)
  1157. torso.BrickColor = BrickColor.Blue()
  1158. torso.CFrame = cframe
  1159. torso.FormFactor = "Symmetric"
  1160. torso.LeftSurface = "Weld"
  1161. torso.Locked = true
  1162. torso.RightSurface = "Weld"
  1163. torso.Name = "Torso"
  1164. torso.Size = Vector3.new(2, 2, 1)
  1165. right_arm.BrickColor = BrickColor.Yellow()
  1166. right_arm.CanCollide = false
  1167. right_arm.CFrame = cframe * CFrame.new(1.5, 0, 0)
  1168. right_arm.FormFactor = "Symmetric"
  1169. right_arm.Locked = true
  1170. right_arm.Name = "Right Arm"
  1171. right_arm.Size = Vector3.new(1, 2, 1)
  1172. left_arm.BrickColor = BrickColor.Yellow()
  1173. left_arm.CanCollide = false
  1174. left_arm.CFrame = cframe * CFrame.new(-1.5, 0, 0)
  1175. left_arm.FormFactor = "Symmetric"
  1176. left_arm.Locked = true
  1177. left_arm.Name = "Left Arm"
  1178. left_arm.Size = Vector3.new(1, 2, 1)
  1179. right_leg.BrickColor = BrickColor.new("Br. yellowish green")
  1180. right_leg.BottomSurface = "Smooth"
  1181. right_leg.CanCollide = false
  1182. right_leg.CFrame = cframe * CFrame.new(0.5, -2, 0)
  1183. right_leg.FormFactor = "Symmetric"
  1184. right_leg.Locked = true
  1185. right_leg.Name = "Right Leg"
  1186. right_leg.Size = Vector3.new(1, 2, 1)
  1187. right_leg.TopSurface = "Smooth"
  1188. left_leg.BrickColor = BrickColor.new("Br. yellowish green")
  1189. left_leg.BottomSurface = "Smooth"
  1190. left_leg.CanCollide = false
  1191. left_leg.CFrame = cframe * CFrame.new(-0.5, -2, 0)
  1192. left_leg.FormFactor = "Symmetric"
  1193. left_leg.Locked = true
  1194. left_leg.Name = "Left Leg"
  1195. left_leg.Size = Vector3.new(1, 2, 1)
  1196. left_leg.TopSurface = "Smooth"
  1197. neck.C0 = CFrame.new(0, 1, 0, -1, -0, -0, 0, 0, 1, 0, 1, 0)
  1198. neck.C1 = CFrame.new(0, -0.5, 0, -1, -0, -0, 0, 0, 1, 0, 1, 0)
  1199. neck.Name = "Neck"
  1200. neck.Part0 = torso
  1201. neck.Part1 = head
  1202. right_shoulder.C0 = CFrame.new(1, 0.5, 0, 0, 0, 1, 0, 1, 0, -1, -0, -0)
  1203. right_shoulder.C1 = CFrame.new(-0.5, 0.5, 0, 0, 0, 1, 0, 1, 0, -1, -0, -0)
  1204. right_shoulder.MaxVelocity = 0.15
  1205. right_shoulder.Name = "Right Shoulder"
  1206. right_shoulder.Part0 = torso
  1207. right_shoulder.Part1 = right_arm
  1208. left_shoulder.C0 = CFrame.new(-1, 0.5, 0, -0, -0, -1, 0, 1, 0, 1, 0, 0)
  1209. left_shoulder.C1 = CFrame.new(0.5, 0.5, 0, -0, -0, -1, 0, 1, 0, 1, 0, 0)
  1210. left_shoulder.MaxVelocity = 0.15
  1211. left_shoulder.Name = "Left Shoulder"
  1212. left_shoulder.Part0 = torso
  1213. left_shoulder.Part1 = left_arm
  1214. right_hip.C0 = CFrame.new(1, -1, 0, 0, 0, 1, 0, 1, 0, -1, -0, -0)
  1215. right_hip.C1 = CFrame.new(0.5, 1, 0, 0, 0, 1, 0, 1, 0, -1, -0, -0)
  1216. right_hip.MaxVelocity = 0.1
  1217. right_hip.Name = "Right Hip"
  1218. right_hip.Part0 = torso
  1219. right_hip.Part1 = right_leg
  1220. left_hip.C0 = CFrame.new(-1, -1, 0, -0, -0, -1, 0, 1, 0, 1, 0, 0)
  1221. left_hip.C1 = CFrame.new(-0.5, 1, 0, -0, -0, -1, 0, 1, 0, 1, 0, 0)
  1222. left_hip.MaxVelocity = 0.1
  1223. left_hip.Name = "Left Hip"
  1224. left_hip.Part0 = torso
  1225. left_hip.Part1 = left_leg
  1226. humanoid.Died:connect(function()
  1227. wait(5)
  1228. model:Destroy()
  1229. end)
  1230. model.Parent = parent
  1231. return model
  1232. end
  1233.  
  1234. Serializer = {};
  1235.  
  1236. Serializer.NAN = math.abs(0 / 0)
  1237.  
  1238. function Serializer.DecodeFloatArray(metadata_size, lookup, data, index)
  1239. local metadata_bytes = math.ceil(metadata_size * 0.25)
  1240. local metadata = {string.byte(data, index, index + metadata_bytes - 1)}
  1241. local components = {}
  1242. local start_index = index
  1243. index = index + metadata_bytes
  1244. for byte_index, byte in ipairs(metadata) do
  1245. local last_offset = 3
  1246. if byte_index == metadata_bytes then
  1247. last_offset = (metadata_size - 1) % 4
  1248. end
  1249. for value_offset = 0, last_offset do
  1250. local value_code = byte * 0.25 ^ value_offset % 4
  1251. value_code = value_code - value_code % 1
  1252. if value_code == 0 then
  1253. table.insert(components, Serializer.DecodeFloat32(string.byte(data, index, index + 3)))
  1254. index = index + 4
  1255. else
  1256. table.insert(components, lookup[value_code])
  1257. end
  1258. end
  1259. end
  1260. return components, index - start_index
  1261. end
  1262. function Serializer.EncodeFloatArray(values, common)
  1263. local lookup = {[common[1]] = 1, [common[2]] = 2, [common[3]] = 3}
  1264. local value_count = #values
  1265. local metadata_bytes = math.ceil(value_count * 0.25)
  1266. local metadata = {}
  1267. local buffer = {}
  1268. for byte_index = 1, metadata_bytes do
  1269. local last_offset = 3
  1270. if byte_index == metadata_bytes then
  1271. last_offset = (value_count - 1) % 4
  1272. end
  1273. local metadata_byte = 0
  1274. local offset_multiplier = 1
  1275. local byte_offset = (byte_index - 1) * 4 + 1
  1276. for value_offset = 0, last_offset do
  1277. local value_index = byte_offset + value_offset
  1278. local value = values[value_index]
  1279. local code = lookup[value] or 0
  1280. metadata_byte = metadata_byte + code * offset_multiplier
  1281. offset_multiplier = offset_multiplier * 4
  1282. if code == 0 then
  1283. table.insert(buffer, Serializer.EncodeFloat32(value))
  1284. end
  1285. end
  1286. metadata[byte_index] = string.char(metadata_byte)
  1287. end
  1288. return table.concat(metadata) .. table.concat(buffer)
  1289. end
  1290.  
  1291. function Serializer.DecodeColor3(data, index)
  1292. local components, size = Serializer.DecodeFloatArray(3, {0, 0.5, 1}, data, index)
  1293. return Color3.new(unpack(components)), size
  1294. end
  1295. function Serializer.DecodeFloat32(b0, b1, b2, b3)
  1296. local b2_low = b2 % 128
  1297. local mantissa = b0 + (b1 + b2_low * 256) * 256
  1298. local exponent = (b2 - b2_low) / 128 + b3 % 128 * 2
  1299. local number
  1300. if mantissa == 0 then
  1301. if exponent == 0 then
  1302. number = 0
  1303. elseif exponent == 0xFF then
  1304. number = math.huge
  1305. else
  1306. number = 2 ^ (exponent - 127)
  1307. end
  1308. elseif exponent == 255 then
  1309. number = Serializer.NAN
  1310. else
  1311. number = (1 + mantissa / 8388608) * 2 ^ (exponent - 127)
  1312. end
  1313. if b3 >= 128 then
  1314. return -number
  1315. else
  1316. return number
  1317. end
  1318. end
  1319. function Serializer.EncodeColor3(color3)
  1320. return Serializer.EncodeFloatArray({color3.r, color3.g, color3.b}, {0, 0.5, 1})
  1321. end
  1322. function Serializer.EncodeFloat32(number)
  1323. if number == 0 then
  1324. if 1 / number > 0 then
  1325. return "\0\0\0\0"
  1326. else
  1327. return "\0\0\0\128"
  1328. end
  1329. elseif number ~= number then
  1330. if string.sub(tostring(number), 1, 1) == "-" then
  1331. return "\255\255\255\255"
  1332. else
  1333. return "\255\255\255\127"
  1334. end
  1335. elseif number == math.huge then
  1336. return "\0\0\128\127"
  1337. elseif number == -math.huge then
  1338. return "\0\0\128\255"
  1339. else
  1340. local b3 = 0
  1341. if number < 0 then
  1342. number = -number
  1343. b3 = 128
  1344. end
  1345. local mantissa, exponent = math.frexp(number)
  1346. exponent = exponent + 126
  1347. if exponent < 0 then
  1348. return "\0\0\0" .. string.char(b3)
  1349. elseif exponent >= 255 then
  1350. return "\0\0\128" .. string.char(b3 + 0x7F)
  1351. else
  1352. local fraction = mantissa * 16777216 - 8388608 + 0.5
  1353. fraction = fraction - fraction % 1
  1354. local exponent_low = exponent % 2
  1355. local b0 = fraction % 256
  1356. local b1 = fraction % 65536
  1357. local b2 = (fraction - b1) / 65536 + exponent_low * 128
  1358. b1 = (b1 - b0) / 256
  1359. b3 = b3 + (exponent - exponent_low) / 2
  1360. return string.char(b0, b1, b2, b3)
  1361. end
  1362. end
  1363. end
  1364.  
  1365. LuaEnum = {};
  1366.  
  1367. LuaEnum.enum_metatable = {
  1368. __call = function(self, value)
  1369. local valueType = type(value)
  1370. if valueType == "table" and getmetatable(value) == LuaEnum.enum_item_metatable then
  1371. return value
  1372. else
  1373. return self[value]
  1374. end
  1375. end,
  1376. __index = function(self, key)
  1377. local enumItem = self.ItemsByName[key] or self.ItemsByValue[key]
  1378. if enumItem == nil then
  1379. local default = self.Default
  1380. if default then
  1381. Logger.printf("Warning", "%s is not a valid EnumItem, returning default (%s)", Utility.ToString(key), tostring(default))
  1382. enumItem = default
  1383. else
  1384. Logger.errorf(2, "%s is not a valid EnumItem", Utility.ToString(key))
  1385. end
  1386. end
  1387. return enumItem
  1388. end,
  1389. __tostring = function(self)
  1390. return self.Name
  1391. end
  1392. }
  1393. LuaEnum.enum_item_metatable = {
  1394. __tostring = function(self)
  1395. return self.Enum.Name .. "." .. self.Name
  1396. end
  1397. }
  1398. LuaEnum.init_metatable = {
  1399. __call = function(self, items)
  1400. local enumItemsByName = {}
  1401. local enumItemsByValue = {}
  1402. local enum = {
  1403. ItemsByName = enumItemsByName,
  1404. ItemsByValue = enumItemsByValue,
  1405. Name = self[1]
  1406. }
  1407. local default = items.Default
  1408. if default ~= nil then
  1409. items.Default = nil
  1410. end
  1411. for value, name in pairs(items) do
  1412. local enumItem = setmetatable({
  1413. Enum = enum,
  1414. Name = name,
  1415. Value = value
  1416. }, LuaEnum.enum_item_metatable)
  1417. enumItemsByName[name] = enumItem
  1418. enumItemsByValue[value] = enumItem
  1419. if name == default or value == default then
  1420. enum.Default = enumItem
  1421. end
  1422. end
  1423. return setmetatable(enum, LuaEnum.enum_metatable)
  1424. end
  1425. }
  1426. function LuaEnum.new(name)
  1427. return setmetatable({name}, LuaEnum.init_metatable)
  1428. end
  1429.  
  1430. Logger = {};
  1431.  
  1432. Logger.entries = {0}
  1433. Logger.MessageType = LuaEnum.new "MessageType" {
  1434. "Output",
  1435. "Info",
  1436. "Warning",
  1437. "Severe",
  1438. "Error",
  1439. Default = "Severe"
  1440. }
  1441. Logger.MESSAGE_TYPE_SETTINGS = {
  1442. { -- Output
  1443. Font = "Arial",
  1444. TextColor3 = Color3.new(0, 0, 0)
  1445. },
  1446. { -- Info
  1447. Font = "Arial",
  1448. TextColor3 = Color3.new(0, 0, 1)
  1449. },
  1450. { -- Warning
  1451. Font = "ArialBold",
  1452. TextColor3 = Color3.new(1, 0.5, 0)
  1453. },
  1454. { -- Severe/Error
  1455. Font = "ArialBold",
  1456. TextColor3 = Color3.new(1, 0, 0)
  1457. }
  1458. }
  1459. Logger.MAX_ENTRIES = 160
  1460. Logger.WARNING_TRACE_ITEM_COUNT = 5
  1461. Logger.rbxPrint = getfenv(RbxUtility.CreateSignal).print
  1462. function Logger.error(level, message)
  1463. message = message .. "\n" .. Logger.StackTraceToString(Logger.GenerateStackTrace(level + 1))
  1464. Logger.AddEntry {Logger.MessageType.Error, message}
  1465. error(level + 1, message)
  1466. end
  1467. function Logger.errorf(level, messageFormat, ...)
  1468. Logger.error(level + 1, string.format(messageFormat, ...))
  1469. end
  1470. function Logger.print(messageType, message, level)
  1471. messageType = Logger.MessageType(messageType)
  1472. local entry = {messageType, message}
  1473. Logger.rbxPrint(Logger.EntryToString(entry))
  1474. Logger.AddEntry(entry)
  1475. if level ~= false and messageType.Value >= Logger.MessageType.Warning.Value then
  1476. local maxItems
  1477. if messageType.Value >= Logger.MessageType.Severe.Value then
  1478. maxItems = math.huge
  1479. else
  1480. maxItems = Logger.WARNING_TRACE_ITEM_COUNT
  1481. end
  1482. local trace = Logger.GenerateStackTrace((level or 1) + 1, math.huge, 10, maxItems + 1)
  1483. local traceLength = #trace
  1484. local stackTraceMessage
  1485. local suffix = ""
  1486. if traceLength > maxItems then
  1487. trace[traceLength] = nil
  1488. suffix = "\n..."
  1489. end
  1490. Logger.print("Info", "Stack trace:\n" .. Logger.StackTraceToString(trace) .. suffix .. "\nStack end", false)
  1491. end
  1492. end
  1493. function Logger.printf(messageType, messageFormat, ...)
  1494. Logger.print(messageType, string.format(messageFormat, ...), 2)
  1495. end
  1496. function Logger.AddEntry(entry)
  1497. local entries = Logger.entries
  1498. if entries[1] >= Logger.MAX_ENTRIES then
  1499. local first = entries[2]
  1500. local nextFirst = first[2]
  1501. first[1] = nil
  1502. first[2] = nil
  1503. entries[1] = entries[1] - 1
  1504. entries[2] = nextFirst
  1505. if not nextFirst then
  1506. entries[3] = nil
  1507. end
  1508. end
  1509. local last = entries[3]
  1510. local node = {entry}
  1511. if last then
  1512. entries[3] = node
  1513. last[2] = node
  1514. else
  1515. entries[2] = node
  1516. entries[3] = node
  1517. end
  1518. entries[1] = entries[1] + 1
  1519. end
  1520. function Logger.NodeIterator(list, node)
  1521. if node then
  1522. node = node[2]
  1523. else
  1524. node = list[2]
  1525. end
  1526. if node then
  1527. return node, node[1]
  1528. end
  1529. end
  1530. function Logger.EntryToString(entry)
  1531. local messageType, message = entry[1], tostring(entry[2])
  1532. if messageType and messageType.Value >= Logger.MessageType.Info.Value then
  1533. return messageType.Name .. ": " .. message
  1534. else
  1535. return message
  1536. end
  1537. end
  1538. function Logger.GenerateStackTrace(level, maxLevel, maxTailCalls, maxTraceItems)
  1539. level = level + 2
  1540. if maxLevel == nil then
  1541. maxLevel = math.huge
  1542. else
  1543. maxLevel = maxLevel + 2
  1544. end
  1545. maxTailCalls = maxTailCalls or 10
  1546. maxTraceItems = maxTraceItems or math.huge
  1547. local trace = {}
  1548. local numTailCalls = 0
  1549. while level <= maxLevel and numTailCalls <= maxTailCalls and #trace < maxTraceItems do
  1550. local success, errorMessage = xpcall(function() error("-", level + 1) end, function(...) return ... end)
  1551. if errorMessage == "-" then
  1552. numTailCalls = numTailCalls + 1
  1553. else
  1554. if numTailCalls > 0 then
  1555. local traceSize = #trace
  1556. if traceSize > 0 then
  1557. trace[#trace][3] = numTailCalls
  1558. end
  1559. numTailCalls = 0
  1560. end
  1561. local script, line = string.match(errorMessage, "(.*):(%d+)")
  1562. trace[#trace + 1] = {script, tonumber(line), 0}
  1563. end
  1564. level = level + 1
  1565. end
  1566. return trace
  1567. end
  1568. function Logger.StackTraceToString(trace)
  1569. local buffer = {}
  1570. for _, data in ipairs(trace) do
  1571. buffer[#buffer + 1] = string.format("Script %q, line %d", data[1], data[2])
  1572. local numTailCalls = data[3]
  1573. if numTailCalls == 1 then
  1574. buffer[#buffer + 1] = "... 1 tail call"
  1575. elseif numTailCalls > 1 then
  1576. buffer[#buffer + 1] = string.format("... %d tail calls", numTailCalls)
  1577. end
  1578. end
  1579. return table.concat(buffer, "\n")
  1580. end
  1581. function Logger.MessageOutFunc(message, messageType)
  1582. if AdvancedGUI and AdvancedGUI.Print then
  1583. local messageTypeValue
  1584. if messageType == Enum.MessageType.MessageOutput then
  1585. local tagName, untaggedMessage = string.match(message, "(%a+): (.*)")
  1586. if tagName == "Info" or tagName == "Warning" or tagName == "Severe" then
  1587. messageTypeValue = Logger.MessageType[tagName].Value
  1588. message = untaggedMessage
  1589. else
  1590. messageTypeValue = Logger.MessageType.Output.Value
  1591. end
  1592. else
  1593. messageTypeValue = messageType.Value + 1
  1594. end
  1595. AdvancedGUI.PrintFormat(Logger.MESSAGE_TYPE_SETTINGS[messageTypeValue], message)
  1596. end
  1597. end
  1598. function print(...)
  1599. local args = {...}
  1600. local buffer = {}
  1601. for index = 1, select("#", ...) do
  1602. buffer[index] = tostring(args[index])
  1603. end
  1604. local message = table.concat(buffer, "\t")
  1605. Logger.print("Output", message)
  1606. end
  1607.  
  1608. CharacterAppearance = {};
  1609.  
  1610. CharacterAppearance.defaultAppearanceId = 2
  1611. CharacterAppearance.stock = {}
  1612. function CharacterAppearance.Create(properties)
  1613. local id = properties.Id
  1614. local bodyColors = Instance.new("BodyColors")
  1615. bodyColors.HeadColor = properties.HeadColor
  1616. bodyColors.TorsoColor = properties.TorsoColor
  1617. bodyColors.RightArmColor = properties.RightArmColor
  1618. bodyColors.LeftArmColor = properties.LeftArmColor
  1619. bodyColors.RightLegColor = properties.RightLegColor
  1620. bodyColors.LeftLegColor = properties.LeftLegColor
  1621. local characterObjects = {bodyColors}
  1622. local headObjects = {}
  1623. local data = {
  1624. characterObjects = characterObjects,
  1625. headObjects = headObjects,
  1626. tshirt = properties.TShirt
  1627. }
  1628. for _, assetId in ipairs(properties.CharacterAssets) do
  1629. TaskScheduler.Start(CharacterAppearance.LoadAsset, characterObjects, assetId)
  1630. end
  1631. for _, assetId in ipairs(properties.HeadAssets) do
  1632. TaskScheduler.Start(CharacterAppearance.LoadAsset, headObjects, assetId)
  1633. end
  1634. CharacterAppearance.stock[id] = data
  1635. end
  1636. function CharacterAppearance.GetDefaultAppearance()
  1637. return CharacterAppearance.stock[CharacterAppearance.defaultAppearanceId]
  1638. end
  1639. function CharacterAppearance.LoadAsset(objects, assetId)
  1640. local asset = InsertService:LoadAsset(assetId)
  1641. for _, child in ipairs(asset:GetChildren()) do
  1642. child.Archivable = true
  1643. table.insert(objects, child:Clone())
  1644. end
  1645. end
  1646. CharacterAppearance.Create {
  1647. Id = 1,
  1648. HeadColor = BrickColor.new("Institutional white"),
  1649. TorsoColor = BrickColor.new("Institutional white"),
  1650. RightArmColor = BrickColor.new("Institutional white"),
  1651. LeftArmColor = BrickColor.new("Institutional white"),
  1652. RightLegColor = BrickColor.new("Institutional white"),
  1653. LeftLegColor = BrickColor.new("Institutional white"),
  1654. CharacterAssets = {
  1655. 90825058, 90825211,
  1656. 27112056, 27112052,
  1657. 27112039, 27112025,
  1658. 27112068, 38322996
  1659. },
  1660. HeadAssets = {
  1661. 20722130,
  1662. 8330576
  1663. }
  1664. }
  1665. CharacterAppearance.Create {
  1666. Id = 2,
  1667. HeadColor = BrickColor.new("Institutional white"),
  1668. TorsoColor = BrickColor.new("Institutional white"),
  1669. RightArmColor = BrickColor.new("Institutional white"),
  1670. LeftArmColor = BrickColor.new("Institutional white"),
  1671. RightLegColor = BrickColor.new("Institutional white"),
  1672. LeftLegColor = BrickColor.new("Institutional white"),
  1673. CharacterAssets = {
  1674. 90825058, 90825211,
  1675. 11748356, 1029025,
  1676. 1235488, 27112056,
  1677. 27112052, 27112039,
  1678. 27112025, 27112068
  1679. },
  1680. HeadAssets = {
  1681. 20722130
  1682. }
  1683. }
  1684. CharacterAppearance.Create {
  1685. Id = 3,
  1686. HeadColor = BrickColor.new("Pastel brown"),
  1687. TorsoColor = BrickColor.new("Pastel brown"),
  1688. RightArmColor = BrickColor.new("Pastel brown"),
  1689. LeftArmColor = BrickColor.new("Pastel brown"),
  1690. RightLegColor = BrickColor.new("White"),
  1691. LeftLegColor = BrickColor.new("White"),
  1692. CharacterAssets = {
  1693. 134289125, 48474356,
  1694. 100339040, 46302558,
  1695. 153955895
  1696. },
  1697. HeadAssets = {},
  1698. TShirt = "rbxassetid://148856353"
  1699. }
  1700. CharacterAppearance.Create {
  1701. Id = 4,
  1702. HeadColor = BrickColor.new("Pastel brown"),
  1703. TorsoColor = BrickColor.new("Pastel brown"),
  1704. RightArmColor = BrickColor.new("Pastel brown"),
  1705. LeftArmColor = BrickColor.new("Pastel brown"),
  1706. RightLegColor = BrickColor.new("White"),
  1707. LeftLegColor = BrickColor.new("White"),
  1708. CharacterAssets = {
  1709. 129458426, 96678344, 184489190
  1710. },
  1711. HeadAssets = {},
  1712. TShirt = "rbxassetid://160146697"
  1713. }
  1714.  
  1715. GraphicalEffects = {};
  1716.  
  1717. local MESH_IDS = {"rbxassetid://15310891"}
  1718. local SOUND_IDS = {"rbxassetid://2248511", "rbxassetid://1369158"}
  1719. local TEXTURE_IDS = {"rbxassetid://36527089", "rbxassetid://122610943", "rbxassetid://126561317", "rbxassetid://127033719"}
  1720. local preloadConnections = {}
  1721. local reloadingPreloads = false
  1722. function GraphicalEffects.InitPreloads()
  1723. local preload_part = Instance.new("Part")
  1724. GraphicalEffects.preload_part = preload_part
  1725. preload_part.Anchored = true
  1726. preload_part.Archivable = false
  1727. preload_part.BottomSurface = "Smooth"
  1728. preload_part.CanCollide = false
  1729. preload_part.CFrame = CFrame.new(math.huge, math.huge, math.huge)
  1730. preload_part.FormFactor = "Custom"
  1731. preload_part.Locked = true
  1732. preload_part.Name = "Asset Preloader"
  1733. preload_part.Size = Vector3.new(0.2, 0.2, 0.2)
  1734. preload_part.TopSurface = "Smooth"
  1735. preload_part.Transparency = 1
  1736. preloadConnections[preload_part] = preload_part.AncestryChanged:connect(GraphicalEffects.PreloadsAncestryChanged)
  1737. for _, mesh_id in ipairs(MESH_IDS) do
  1738. local mesh = Instance.new("SpecialMesh")
  1739. mesh.MeshType = "FileMesh"
  1740. mesh.MeshId = mesh_id
  1741. preloadConnections[mesh] = mesh.AncestryChanged:connect(GraphicalEffects.PreloadsAncestryChanged)
  1742. mesh.Parent = preload_part
  1743. end
  1744. for _, sound_id in ipairs(SOUND_IDS) do
  1745. local sound = Instance.new("Sound")
  1746. sound.SoundId = sound_id
  1747. sound.Volume = 0
  1748. preloadConnections[sound] = sound.AncestryChanged:connect(GraphicalEffects.PreloadsAncestryChanged)
  1749. sound.Parent = preload_part
  1750. end
  1751. for _, texture_id in ipairs(TEXTURE_IDS) do
  1752. local decal = Instance.new("Decal")
  1753. decal.Texture = texture_id
  1754. preloadConnections[decal] = decal.AncestryChanged:connect(GraphicalEffects.PreloadsAncestryChanged)
  1755. decal.Parent = preload_part
  1756. end
  1757. preload_part.Parent = Workspace
  1758. end
  1759. function GraphicalEffects.PreloadsAncestryChanged(child, parent)
  1760. if not reloadingPreloads and parent ~= GraphicalEffects.preload_part and parent ~= Workspace then
  1761. reloadingPreloads = true
  1762. for _, connection in pairs(preloadConnections) do
  1763. connection:disconnect()
  1764. preloadConnections[_] = nil
  1765. end
  1766. wait(1)
  1767. reloadingPreloads = false
  1768. GraphicalEffects.InitPreloads()
  1769. end
  1770. end
  1771. GraphicalEffects.InitPreloads()
  1772. -- Hyper beam
  1773. function GraphicalEffects.FireSpaceHyperBeam(target, power, duration, radius, height, deviation)
  1774. local stepTime, gameTime = 1 / 30, TaskScheduler.GetCurrentTime()
  1775. local frames = duration * 30
  1776. local beamColorOffset = 0.75 * tick() -- math.random()
  1777. local blastPressure = power * 62500 + 250000
  1778. local beamPart = Instance.new("Part")
  1779. local beamMesh = Instance.new("SpecialMesh", beamPart)
  1780. local explosion = Instance.new("Explosion")
  1781. local sound = Instance.new("Sound", beamPart)
  1782. beamPart.Anchored = true
  1783. beamPart.CanCollide = false
  1784. beamPart.CFrame = CFrame.new(target, target + Vector3.new(deviation * (math.random() - 0.5), deviation * (math.random() - 0.5), height))
  1785. beamPart.FormFactor = "Custom"
  1786. beamPart.Locked = true
  1787. beamPart.Size = Vector3.new(0.2, 0.2, 0.2)
  1788. beamMesh.MeshId = "rbxassetid://15310891"
  1789. beamMesh.MeshType = "FileMesh"
  1790. beamMesh.TextureId = "rbxassetid://36527089"
  1791. local beamGlowPart1 = beamPart:Clone()
  1792. local beamGlowMesh1 = beamMesh:Clone()
  1793. local beamGlowPart2 = beamPart:Clone()
  1794. local beamGlowMesh2 = beamMesh:Clone()
  1795. local beamLight = Instance.new("PointLight", beamPart)
  1796. beamLight.Range = power * 2
  1797. beamLight.Shadows = true
  1798. explosion.BlastPressure = blastPressure
  1799. explosion.BlastRadius = power
  1800. explosion.Position = target
  1801. sound.SoundId = "rbxassetid://2248511"
  1802. sound.Volume = 1
  1803. local explosionHitConnection = explosion.Hit:connect(function(part, distance)
  1804. if not part.Anchored and part:GetMass() < power * power then
  1805. pcall(part.BreakJoints, part)
  1806. part.Color = Color3.new(Utility.GetRainbowRGB(1.5 * gameTime + beamColorOffset))
  1807. end
  1808. end)
  1809. beamPart.Transparency = 0.5
  1810. beamPart.Archivable = false
  1811. beamGlowPart1.Transparency = 0.75
  1812. beamGlowPart2.Transparency = 0.75
  1813. beamGlowMesh1.Parent = beamGlowPart1
  1814. beamGlowPart1.Parent = beamPart
  1815. beamGlowMesh2.Parent = beamGlowPart2
  1816. beamGlowPart2.Parent = beamPart
  1817. beamPart.Parent = workspace
  1818. explosion.Parent = workspace
  1819. for frame = 1, frames do
  1820. local progress = frame / frames
  1821. local alpha = 1 - math.sin(0.5 * math.pi * progress)
  1822. local scale = 0.4 * alpha
  1823. local glowScale1 = alpha * (0.5 + 0.5 * math.sin(math.tau * (8 * gameTime + beamColorOffset)))
  1824. local glowScale2 = alpha * (0.5 + 0.5 * math.cos(math.tau * (8 * gameTime + beamColorOffset)))
  1825. local vertexColor = Vector3.new(Utility.GetRainbowRGB(1.5 * gameTime + beamColorOffset))
  1826. beamLight.Brightness = 1 - progress
  1827. beamLight.Color = Color3.new(vertexColor.x, vertexColor.y, vertexColor.z)
  1828. beamMesh.Scale = Vector3.new(radius * scale, 9000, radius * scale)
  1829. beamMesh.VertexColor = vertexColor
  1830. beamGlowMesh1.Scale = Vector3.new(1.2 * radius * glowScale1, 9000, 1.2 * radius * glowScale1)
  1831. beamGlowMesh1.VertexColor = vertexColor
  1832. beamGlowMesh2.Scale = Vector3.new(1.2 * radius * glowScale2, 9000, 1.2 * radius * glowScale2)
  1833. beamGlowMesh2.VertexColor = vertexColor
  1834. RunService.Stepped:wait()
  1835. gameTime = TaskScheduler.GetCurrentTime()
  1836. if frame <= 2 then
  1837. local explosion = Instance.new("Explosion")
  1838. explosion.BlastPressure = (1 - progress) * blastPressure
  1839. explosion.BlastRadius = (1 - progress) * power
  1840. explosion.Position = target
  1841. explosion.Parent = Workspace
  1842. if frame == 2 then
  1843. sound:Play()
  1844. end
  1845. end
  1846. end
  1847. pcall(beamPart.Destroy, beamPart)
  1848. explosionHitConnection:disconnect()
  1849. end
  1850. function GraphicalEffects.SpaceHyperBeam(target, power, duration, radius, height, deviation)
  1851. TaskScheduler.Start(GraphicalEffects.FireSpaceHyperBeam, target, power or 12, duration or 1.5, radius or 6, height or 600, deviation or 20)
  1852. end
  1853.  
  1854. function GraphicalEffects.CrystalRing(data)
  1855. data = data or {}
  1856. local crystal_count = data.crystal_count or 10
  1857. local crystal_color = data.crystal_color or BrickColor.new("Bright red")
  1858. local crystal_scale = data.crystal_scale or Vector3.new(2 / 3, 2, 2 / 3)
  1859. local fade_out_color = data.fade_out_color or BrickColor.new("Really black")
  1860. local radius = radius or 1.25 * crystal_count / math.pi
  1861. local spawn_duration = data.spawn_duration or 0.065
  1862. local full_spawn_duration = spawn_duration * crystal_count
  1863. local float_duration = data.float_duration or 5
  1864. local wave_amplitude = data.wave_amplitude or 0.5
  1865. local wave_period = data.wave_period or 1
  1866. local appear_duration = data.appear_duration or 0.1
  1867. local disappear_duration = data.disappear_duration or 0.5
  1868. local base_part = data.base_part
  1869. local offset_cframe
  1870. if data.position then
  1871. offset_cframe = CFrame.new(data.position)
  1872. if base_part then
  1873. offset_cframe = base_part.CFrame:toObjectSpace(offset_cframe)
  1874. end
  1875. else
  1876. offset_cframe = CFrame.new()
  1877. end
  1878. local crystal_template = Instance.new("Part")
  1879. crystal_template.Anchored = true
  1880. crystal_template.Locked = true
  1881. crystal_template.CanCollide = false
  1882. crystal_template.BottomSurface = "Smooth"
  1883. crystal_template.TopSurface = "Smooth"
  1884. crystal_template.BrickColor = crystal_color
  1885. crystal_template.FormFactor = "Symmetric"
  1886. crystal_template.Size = Vector3.new(1, 1, 1)
  1887. local crystal_light = Instance.new("PointLight", crystal_template)
  1888. crystal_light.Brightness = 0.1 / crystal_count
  1889. crystal_light.Color = crystal_color.Color
  1890. crystal_light.Name = "Light"
  1891. crystal_light.Range = radius
  1892. crystal_light.Shadows = true
  1893. local crystal_mesh = Instance.new("SpecialMesh", crystal_template)
  1894. crystal_mesh.MeshId = "rbxassetid://9756362"
  1895. crystal_mesh.MeshType = "FileMesh"
  1896. crystal_mesh.Name = "Mesh"
  1897. crystal_mesh.Scale = crystal_scale
  1898. local crystal_model = Instance.new("Model")
  1899. crystal_model.Archivable = false
  1900. crystal_model.Name = "Crystal Model"
  1901. crystal_model.Parent = Workspace
  1902. local crystals = {}
  1903. local lights = {}
  1904. local meshes = {}
  1905. for index = 1, crystal_count do
  1906. local crystal = crystal_template:Clone()
  1907. crystal.Parent = crystal_model
  1908. crystals[index] = crystal
  1909. lights[index] = crystal.Light
  1910. meshes[index] = crystal.Mesh
  1911. end
  1912. local start_time = tick()
  1913. repeat
  1914. local base_cframe = offset_cframe
  1915. if base_part then
  1916. base_cframe = base_part.CFrame * base_cframe
  1917. end
  1918. local elapsed_time = tick() - start_time
  1919. for index, crystal in ipairs(crystals) do
  1920. local crystal_time = elapsed_time - index * spawn_duration
  1921. local disappear_time = crystal_time - float_duration
  1922. local offset
  1923. if crystal_time < 0 then
  1924. offset = 0
  1925. elseif crystal_time < appear_duration then
  1926. offset = radius * crystal_time / appear_duration
  1927. else
  1928. offset = radius
  1929. end
  1930. local wave_offset
  1931. if disappear_time >= 0 then
  1932. local disappear_progress = disappear_time / disappear_duration
  1933. if disappear_progress > 1 then
  1934. if crystal.Parent then
  1935. crystal:Destroy()
  1936. end
  1937. else
  1938. local inverse_progress = 1 - disappear_progress
  1939. local light = lights[index]
  1940. local mesh = meshes[index]
  1941. crystal.BrickColor = fade_out_color
  1942. light.Brightness = 2 * inverse_progress
  1943. light.Range = 2 * radius
  1944. mesh.Scale = crystal_scale * inverse_progress
  1945. end
  1946. wave_offset = 0
  1947. else
  1948. wave_offset = wave_amplitude * math.sin(math.tau * (elapsed_time - index / crystal_count * 3) / wave_period)
  1949. end
  1950. local rotation_angle = (tick() * 0.5 + (index - 1) / crystal_count) % 1 * math.tau
  1951. crystal.CFrame = base_cframe * CFrame.Angles(0, rotation_angle, 0) * CFrame.new(0, wave_offset, -offset)
  1952. end
  1953. RunService.Stepped:wait()
  1954. until elapsed_time >= float_duration + full_spawn_duration + disappear_duration
  1955. if crystal_model.Parent then
  1956. crystal_model:Destroy()
  1957. end
  1958. end
  1959.  
  1960. GraphicalEffects.magicCircleData = {}
  1961. GraphicalEffects.MAGIC_CIRCLE_DEFAULT_OFFSET = 6.25
  1962. function GraphicalEffects.AnimateMagicCircle(data)
  1963. local frame, direction, magic_circle_model, magic_circle_part, magic_circle_light, magic_circle_decal_back, magic_circle_decal_front, duration,
  1964.  
  1965. stay, magic_circle_adornee_func, magic_circle_offset = unpack(data)
  1966. frame = frame + 1
  1967. data[1] = frame
  1968. local transparency = (frame / duration) ^ stay
  1969. local opacity = 1 - transparency
  1970. if frame == duration then
  1971. pcall(Game.Destroy, magic_circle_model)
  1972. GraphicalEffects.magicCircleData[data] = nil
  1973. else
  1974. if magic_circle_model.Parent ~= Workspace then
  1975. pcall(Utility.SetProperty, magic_circle_model, "Parent", Workspace)
  1976. end
  1977. local magic_circle_adornee = magic_circle_adornee_func()
  1978. magic_circle_position = magic_circle_adornee.Position + direction * magic_circle_offset
  1979. local magic_circle_cframe = CFrame.new(magic_circle_position, magic_circle_position + direction) * CFrame.Angles(0, 0, math.tau * frame /
  1980.  
  1981. 25)
  1982. magic_circle_part.CFrame = magic_circle_cframe
  1983. magic_circle_light.Brightness = opacity
  1984. magic_circle_decal_back.Transparency = transparency
  1985. magic_circle_decal_front.Transparency = transparency
  1986. end
  1987. end
  1988. function GraphicalEffects.CreateMagicCircle(target, magic_circle_scale, magic_circle_image, light_color, duration, stay, magic_circle_adornee_func,
  1989.  
  1990. magic_circle_offset)
  1991. local magic_circle_adornee = magic_circle_adornee_func()
  1992. if magic_circle_adornee then
  1993. local origin = magic_circle_adornee.Position
  1994. local direction = (target - origin).unit
  1995. local magic_circle_position = origin + direction * magic_circle_offset
  1996. local magic_circle_cframe = CFrame.new(magic_circle_position, magic_circle_position + direction)
  1997. local magic_circle_model = Instance.new("Model")
  1998. local magic_circle_part = Instance.new("Part", magic_circle_model)
  1999. local magic_circle_mesh = Instance.new("BlockMesh", magic_circle_part)
  2000. local magic_circle_light = Instance.new("PointLight", magic_circle_part)
  2001. local magic_circle_decal_back = Instance.new("Decal", magic_circle_part)
  2002. local magic_circle_decal_front = Instance.new("Decal", magic_circle_part)
  2003. magic_circle_model.Archivable = false
  2004. magic_circle_part.Anchored = true
  2005. magic_circle_part.BottomSurface = "Smooth"
  2006. magic_circle_part.CanCollide = false
  2007. magic_circle_part.CFrame = magic_circle_cframe
  2008. magic_circle_part.FormFactor = "Custom"
  2009. magic_circle_part.Locked = true
  2010. magic_circle_part.Size = Vector3.new(0.2, 0.2, 0.2)
  2011. magic_circle_part.TopSurface = "Smooth"
  2012. magic_circle_part.Transparency = 1
  2013. magic_circle_mesh.Scale = Vector3.new(60, 60, 0) * magic_circle_scale
  2014. magic_circle_light.Color = light_color
  2015. magic_circle_light.Range = 16 * magic_circle_scale
  2016. magic_circle_light.Shadows = true
  2017. magic_circle_decal_back.Face = "Back"
  2018. magic_circle_decal_back.Texture = magic_circle_image
  2019. magic_circle_decal_front.Face = "Front"
  2020. magic_circle_decal_front.Texture = magic_circle_image
  2021. magic_circle_model.Parent = Workspace
  2022. local data = {0, direction, magic_circle_model, magic_circle_part, magic_circle_light, magic_circle_decal_back, magic_circle_decal_front,
  2023.  
  2024. duration, stay, magic_circle_adornee_func, magic_circle_offset}
  2025. GraphicalEffects.magicCircleData[data] = true
  2026. return data
  2027. end
  2028. end
  2029.  
  2030. GraphicalEffects.missileData = {}
  2031. GraphicalEffects.missileParts = {}
  2032. function GraphicalEffects.AnimateMissile(data)
  2033. local frame, missilePart, targetPart, timeCreated, direction, touchedConnection, explodeRequested, bodyGyro, swooshSound, magicCircleData, lifeTime,
  2034.  
  2035. pointOnPart, flipped = unpack(data)
  2036. frame = frame + 1
  2037. data[1] = frame
  2038. if flipped then
  2039. direction = -direction
  2040. end
  2041. if frame <= 10 then
  2042. if frame == 2 then
  2043. swooshSound:Play()
  2044. end
  2045. missilePart.Anchored = true
  2046. local progress = frame / 10
  2047. missilePart.Size = Vector3.new(1, 1, progress * 4)
  2048. local magicCirclePart = magicCircleData[4]
  2049. local magicCirclePosition = magicCirclePart.Position
  2050. local missileOffset = 2 * progress * direction
  2051. local missilePosition = magicCirclePosition + missileOffset
  2052. missilePart.CFrame = CFrame.new(missilePosition, missilePosition + direction)
  2053. --missilePart.Transparency = 0.5 * (1 - progress)
  2054. if frame == 10 then
  2055. touchedConnection = missilePart.Touched:connect(function(hit)
  2056. if hit.CanCollide and hit.Parent and not GraphicalEffects.missileParts[hit] then
  2057. touchedConnection:disconnect()
  2058. data[7] = true
  2059. end
  2060. end)
  2061. data[6] = touchedConnection
  2062. end
  2063. else
  2064. missilePart.Anchored = false
  2065. local missilePosition = missilePart.Position
  2066. local targetPosition = targetPart.CFrame * pointOnPart
  2067. local distanceVector = targetPosition - missilePosition
  2068. local elapsedTime = time() - timeCreated
  2069. local targetParent = targetPart.Parent
  2070. if explodeRequested or (targetParent and distanceVector.magnitude < 10) or elapsedTime > lifeTime then
  2071. GraphicalEffects.missileData[data] = nil
  2072. GraphicalEffects.missileParts[missilePart] = nil
  2073. touchedConnection:disconnect()
  2074. if missilePart.Parent then
  2075. missilePart:Destroy()
  2076. local explosion = Instance.new("Explosion")
  2077. explosion.BlastRadius = 12.5
  2078. explosion.Position = missilePosition
  2079. local explosionHitConnection = explosion.Hit:connect(function(hit, distance)
  2080. local missileData = GraphicalEffects.missileParts[hit]
  2081. if missileData and distance < 3 then
  2082. missileData[7] = true
  2083. else
  2084. pcall(hit.BreakJoints, hit)
  2085. end
  2086. end)
  2087. explosion.Parent = Workspace
  2088. TaskScheduler.Schedule(1, explosionHitConnection.disconnect, explosionHitConnection)
  2089. end
  2090. else
  2091. local targetInWorkspace = targetPart:IsDescendantOf(Workspace)
  2092. if targetInWorkspace then
  2093. direction = distanceVector.unit
  2094. data[5] = direction
  2095. end
  2096. local speed = 14 + elapsedTime * 10
  2097. local gyroD
  2098. if elapsedTime < 42.5 and targetInWorkspace then
  2099. gyroD = 1000 - elapsedTime * 15
  2100. else
  2101. gyroD = 100
  2102. bodyGyro.maxTorque = Vector3.new(0, 0, 0)
  2103. if elapsedTime + 7.5 < lifeTime then
  2104. data[11] = elapsedTime + 7.5
  2105. end
  2106. end
  2107. bodyGyro.D = gyroD
  2108. bodyGyro.cframe = CFrame.new(Vector3.new(), direction)
  2109. missilePart.Velocity = missilePart.CFrame.lookVector * speed
  2110. end
  2111. end
  2112. end
  2113. function GraphicalEffects.ShootMissile(targetPart, pointOnPart, direction, magic_circle_adornee_func, magic_circle_offset, flipped)
  2114. if not magic_circle_offset then
  2115. magic_circle_offset = GraphicalEffects.MAGIC_CIRCLE_DEFAULT_OFFSET
  2116. end
  2117. local targetPosition = targetPart.Position
  2118. local headPosition = chatAdornee.Position
  2119. local origin = CFrame.new(headPosition, headPosition + direction) + direction * magic_circle_offset
  2120. local missilePart = Instance.new("Part")
  2121. local antiGravityForce = Instance.new("BodyForce", missilePart)
  2122. local bodyGyro = Instance.new("BodyGyro", missilePart)
  2123. local explosionSound = Instance.new("Sound", missilePart)
  2124. local swooshSound = Instance.new("Sound", missilePart)
  2125. antiGravityForce.force = Vector3.new(0, 196.2 * 4, 0)
  2126. bodyGyro.D = 1000
  2127. bodyGyro.maxTorque = Vector3.new(1, 1, 1)
  2128. explosionSound.PlayOnRemove = true
  2129. explosionSound.SoundId = "rbxasset://sounds/collide.wav"
  2130. explosionSound.Volume = 1
  2131. missilePart.Anchored = true
  2132. missilePart.BackSurface = "Studs"
  2133. missilePart.BottomSurface = "Studs"
  2134. missilePart.BrickColor = BrickColor.Red()
  2135. missilePart.CFrame = origin
  2136. missilePart.FormFactor = "Custom"
  2137. missilePart.FrontSurface = "Studs"
  2138. missilePart.LeftSurface = "Studs"
  2139. missilePart.Locked = true
  2140. missilePart.RightSurface = "Studs"
  2141. missilePart.Size = Vector3.new(1, 1, 0.2)
  2142. missilePart.TopSurface = "Studs"
  2143. --missilePart.Transparency = 0.5
  2144. swooshSound.Looped = true
  2145. swooshSound.SoundId = "rbxasset://sounds/Rocket whoosh 01.wav"
  2146. swooshSound.Volume = 0.7
  2147. local magicCircleData = GraphicalEffects.CreateMagicCircle(headPosition + direction * 1000, 0.875, "rbxassetid://127033719", Color3.new(1, 1, 1),
  2148.  
  2149. 40, 4, magic_circle_adornee_func or function() return chatAdornee end, magic_circle_offset)
  2150. local data = {0, missilePart, targetPart, time(), direction, false, false, bodyGyro, swooshSound, magicCircleData, 50, pointOnPart, flipped}
  2151. missilePart.Parent = Workspace
  2152. GraphicalEffects.missileData[data] = true
  2153. GraphicalEffects.missileParts[missilePart] = data
  2154. end
  2155.  
  2156. function GraphicalEffects.CubicInterpolate(y0, y1, y2, y3, mu)
  2157. local a0, a1, a2, a3, mu2
  2158. mu2 = mu * mu
  2159. a0 = y3 - y2 - y0 + y1
  2160. a1 = y0 - y1 - a0
  2161. a2 = y2 - y0
  2162. a3 = y1
  2163. return a0 * mu * mu2 + a1 * mu2 + a2 * mu + a3
  2164. end
  2165. function GraphicalEffects.JointCrap(model, cycletime)
  2166. if model then
  2167. local cycletime = cycletime or (0.75 * (1 + math.random() * 4))
  2168. local offsetradius = 0.75
  2169. local rotationoffset = math.pi
  2170. local joints = {}
  2171. local stack = model:GetChildren()
  2172. while #stack ~= 0 do
  2173. local object = stack[#stack]
  2174. table.remove(stack)
  2175. for index, child in ipairs(object:GetChildren()) do
  2176. table.insert(stack, child)
  2177. end
  2178. if object:IsA("JointInstance") then
  2179. table.insert(joints, object)
  2180. end
  2181. end
  2182. local rot0 = {}
  2183. local rot1 = {}
  2184. local rot2 = {}
  2185. local rot3 = {}
  2186. local rot4 = {}
  2187. for index, joint in ipairs(joints) do
  2188. local pos = Vector3.new(math.random() - 0.5, math.random() - 0.5, math.random() - 0.5).unit * offsetradius
  2189. local rot = Vector3.new(math.random(), math.random(), math.random()) * rotationoffset
  2190. rot0[index] = {joint.C0, joint.C1}
  2191. rot = Vector3.new(rot.x % (math.tau), rot.y % (math.tau), rot.z % (math.tau))
  2192. rot2[index] = {pos, rot}
  2193. pos = Vector3.new(math.random() - 0.5, math.random() - 0.5, math.random() - 0.5).unit * offsetradius
  2194. rot = rot + Vector3.new(math.random(), math.random(), math.random()) * rotationoffset
  2195. rot = Vector3.new(rot.x % (math.tau), rot.y % (math.tau), rot.z % (math.tau))
  2196. rot3[index] = {pos, rot}
  2197. pos = Vector3.new(math.random() - 0.5, math.random() - 0.5, math.random() - 0.5).unit * offsetradius
  2198. rot = rot + Vector3.new(math.random(), math.random(), math.random()) * rotationoffset
  2199. rot = Vector3.new(rot.x % (math.tau), rot.y % (math.tau), rot.z % (math.tau))
  2200. rot4[index] = {pos, rot}
  2201. end
  2202. while model.Parent do
  2203. for i, j in ipairs(joints) do
  2204. local pos = Vector3.new(math.random() - 0.5, math.random() - 0.5, math.random() - 0.5).unit * offsetradius
  2205. local rot = rot4[i][2] + Vector3.new(math.random(), math.random(), math.random()) * rotationoffset
  2206. rot = Vector3.new(rot.x % (math.tau), rot.y % (math.tau), rot.z % (math.tau))
  2207. rot1[i], rot2[i], rot3[i], rot4[i] = rot2[i], rot3[i], rot4[i], {pos, rot}
  2208. end
  2209. local start = tick()
  2210. while true do
  2211. local ctime = tick()
  2212. local elapsed = ctime - start
  2213. if elapsed > cycletime then
  2214. break
  2215. end
  2216. local progress = elapsed / cycletime
  2217. for index, joint in ipairs(joints) do
  2218. local v0, v1, v2, v3, v4 = rot0[index], rot1[index], rot2[index], rot3[index], rot4[index]
  2219. local p1, p2, p3, p4, r1, r2, r3, r4 = v1[1], v2[1], v3[1], v4[1], v1[2], v2[2], v3[2], v4[2]
  2220. local px = GraphicalEffects.CubicInterpolate(p1.x, p2.x, p3.x, p4.x, progress)
  2221. local py = GraphicalEffects.CubicInterpolate(p1.y, p2.y, p3.y, p4.y, progress)
  2222. local pz = GraphicalEffects.CubicInterpolate(p1.z, p2.z, p3.z, p4.z, progress)
  2223. local rx = GraphicalEffects.CubicInterpolate(r1.x, r2.x, r3.x, r4.x, progress)
  2224. local ry = GraphicalEffects.CubicInterpolate(r1.y, r2.y, r3.y, r4.y, progress)
  2225. local rz = GraphicalEffects.CubicInterpolate(r1.z, r2.z, r3.z, r4.z, progress)
  2226. local cframe = CFrame.new(px, py, pz) * CFrame.Angles(rx, ry, rz)
  2227. joint.C0 = v0[1] * cframe
  2228. joint.C1 = v0[2] * cframe:inverse()
  2229. end
  2230. RunService.Stepped:wait()
  2231. end
  2232. end
  2233. end
  2234. end
  2235.  
  2236. GraphicalEffects.LASER_WIDTH = 0.15
  2237. GraphicalEffects.LASER_MAGIC_CIRCLE_DISTANCE = 6.25
  2238. GraphicalEffects.laser_data = {}
  2239. --GraphicalEffects.fragmentation = {}
  2240. function GraphicalEffects.AnimateLaserOfDeath(data)
  2241. local frame, directionOrientation, direction, magic_circle_model, laser_part, laser_mesh, magic_circle_part, magic_circle_light,
  2242.  
  2243. magic_circle_decal_back, magic_circle_decal_front, sound, laser_scale, fragmentation_size, duration, laser_lights, laser_effects, stay, light_effects =
  2244.  
  2245. unpack(data)
  2246. local laser_color = laser_part.Color
  2247. frame = frame + 1
  2248. data[1] = frame
  2249. local transparency = (frame / duration) ^ stay
  2250. local opacity = 1 - transparency
  2251. if frame == 2 then
  2252. sound:Play()
  2253. end
  2254. if frame == duration then
  2255. pcall(Game.Destroy, magic_circle_model)
  2256. GraphicalEffects.laser_data[data] = nil
  2257. else
  2258. if magic_circle_model.Parent ~= Workspace then
  2259. pcall(Utility.SetProperty, magic_circle_model, "Parent", Workspace)
  2260. end
  2261. local laser_distance = 0
  2262. local origin = chatAdornee.CFrame
  2263. if not light_effects then
  2264. direction = (origin * directionOrientation - origin.p).unit
  2265. end
  2266. local magic_circle_position = origin.p + direction * GraphicalEffects.LASER_MAGIC_CIRCLE_DISTANCE
  2267. local magic_circle_cframe = CFrame.new(magic_circle_position, magic_circle_position + direction) * CFrame.Angles(0, 0, math.tau * frame /
  2268.  
  2269. 25)
  2270. local loop_scale = (laser_scale - 1) / 10
  2271. for x_offset = -loop_scale, loop_scale, 2 do
  2272. for y_offset = -loop_scale, loop_scale, 2 do
  2273. local origin_position = magic_circle_cframe * Vector3.new(x_offset, y_offset, 0)
  2274. for index = 1, 8 do
  2275. local part, position
  2276. for ray_index = 1, 10 do
  2277. local ray = Ray.new(origin_position + direction * (999 * (ray_index - 1)), direction * 999)
  2278. part, position = Workspace:FindPartOnRay(ray, magic_circle_model)
  2279. if part then
  2280. break
  2281. end
  2282. end
  2283. if part then
  2284. laser_distance = (position - origin_position).magnitude
  2285. if frame % 8 == 1 and index == 1 then
  2286. Instance.new("Explosion", Workspace).Position = position
  2287. end
  2288. if not part:IsA("Terrain") then
  2289. pcall(part.BreakJoints, part)
  2290. local is_block = part:IsA("Part") and part.Shape == Enum.PartType.Block
  2291. local mass = part:GetMass()
  2292. local size = part.Size
  2293. if (is_block and ((size.X < fragmentation_size and size.Y < fragmentation_size and size.Z <
  2294.  
  2295. fragmentation_size) or (not part.Anchored and mass < 750))) or (not is_block and mass < 250000) then
  2296. local part_transparency = math.max(part.Transparency + 0.007 * fragmentation_size, 0.5)
  2297. if part_transparency >= 0.5 then -- temporarily to minimize debris
  2298. pcall(Game.Destroy, part)
  2299. else
  2300. local cframe = part.CFrame
  2301. part.Anchored = false
  2302. part.BrickColor = BrickColor.new("Medium stone grey")
  2303. part.CanCollide = true
  2304. if part:IsA("FormFactorPart") then
  2305. part.FormFactor = "Custom"
  2306. end
  2307. part.Size = size - Vector3.new(0.135, 0.135, 0.135) * fragmentation_size
  2308. part.Transparency = part_transparency
  2309. part.CFrame = cframe + direction * 5
  2310. part.Velocity = part.Velocity + direction * 40
  2311. end
  2312. elseif is_block then
  2313. local parts = {part}
  2314. local model = Instance.new("Model", part.Parent)
  2315. model.Name = "Fragments"
  2316. if size.X >= fragmentation_size then
  2317. size = Vector3.new(0.5, 1, 1) * size
  2318. local archivable = part.Archivable
  2319. local cframe = part.CFrame
  2320. part.FormFactor = "Custom"
  2321. part.Size = size
  2322. part.Archivable = true
  2323. local part_clone = part:Clone()
  2324. part.Archivable = archivable
  2325. part_clone.Archivable = archivable
  2326. part.CFrame = cframe * CFrame.new(-0.5 * size.X, 0, 0)
  2327. part_clone.CFrame = cframe * CFrame.new(0.5 * size.X, 0, 0)
  2328. part_clone.Parent = model
  2329. parts[2] = part_clone
  2330. end
  2331. if size.Y >= fragmentation_size then
  2332. size = Vector3.new(1, 0.5, 1) * size
  2333. for part_index = 1, #parts do
  2334. local part = parts[part_index]
  2335. local archivable = part.Archivable
  2336. local cframe = part.CFrame
  2337. part.FormFactor = "Custom"
  2338. part.Size = size
  2339. part.Archivable = true
  2340. local part_clone = part:Clone()
  2341. part.Archivable = archivable
  2342. part_clone.Archivable = archivable
  2343. part.CFrame = cframe * CFrame.new(0, -0.5 * size.Y, 0)
  2344. part_clone.CFrame = cframe * CFrame.new(0, 0.5 * size.Y, 0)
  2345. part_clone.Parent = model
  2346. table.insert(parts, part_clone)
  2347. end
  2348. end
  2349. if size.Z >= fragmentation_size then
  2350. size = Vector3.new(1, 1, 0.5) * size
  2351. for part_index = 1, #parts do
  2352. local part = parts[part_index]
  2353. local archivable = part.Archivable
  2354. local cframe = part.CFrame
  2355. part.FormFactor = "Custom"
  2356. part.Size = size
  2357. part.Archivable = true
  2358. local part_clone = part:Clone()
  2359. part.Archivable = archivable
  2360. part_clone.Archivable = archivable
  2361. part.CFrame = cframe * CFrame.new(0, 0, -0.5 * size.Z)
  2362. part_clone.CFrame = cframe * CFrame.new(0, 0, 0.5 * size.Z)
  2363. part_clone.Parent = model
  2364. table.insert(parts, part_clone)
  2365. end
  2366. end
  2367. for _, part in ipairs(parts) do
  2368. part:MakeJoints()
  2369. end
  2370. else
  2371. break
  2372. end
  2373. end
  2374. else
  2375. laser_distance = 9990
  2376. break
  2377. end
  2378. end
  2379. end
  2380. end
  2381. local laser_cframe = magic_circle_cframe * CFrame.Angles(-0.5 * math.pi, 0, 0)
  2382. local laser_width = GraphicalEffects.LASER_WIDTH * opacity * laser_scale
  2383. local laser_mesh_offset = Vector3.new(0, 0.5 * laser_distance, 0)
  2384. laser_part.CFrame = laser_cframe
  2385. if laser_effects then
  2386. local laser_effect_data_1, laser_effect_data_2 = laser_effects[1], laser_effects[2]
  2387. local laser_effect_1, laser_effect_mesh_1 = laser_effect_data_1[1], laser_effect_data_1[2]
  2388. local laser_effect_2, laser_effect_mesh_2 = laser_effect_data_2[1], laser_effect_data_2[2]
  2389. laser_effect_1.CFrame = laser_cframe
  2390. laser_effect_2.CFrame = laser_cframe
  2391. laser_effect_mesh_1.Offset = laser_mesh_offset
  2392. laser_effect_mesh_2.Offset = laser_mesh_offset
  2393. local game_time = time()
  2394. local effect_scale_1 = 0.5 + 0.5 * math.sin(16 * math.pi * game_time)
  2395. local effect_scale_2 = 0.5 + 0.5 * math.cos(16 * math.pi * game_time)
  2396. laser_effect_mesh_1.Scale = 5 * Vector3.new(laser_width * effect_scale_1, laser_distance, laser_width * effect_scale_1)
  2397. laser_effect_mesh_2.Scale = 5 * Vector3.new(laser_width * effect_scale_2, laser_distance, laser_width * effect_scale_2)
  2398. laser_width = laser_width * 0.25
  2399. end
  2400. laser_mesh.Offset = laser_mesh_offset
  2401. laser_mesh.Scale = 5 * Vector3.new(laser_width, laser_distance, laser_width)
  2402. magic_circle_part.CFrame = magic_circle_cframe
  2403. magic_circle_light.Brightness = opacity
  2404. magic_circle_decal_back.Transparency = transparency
  2405. magic_circle_decal_front.Transparency = transparency
  2406. if light_effects then
  2407. for index, data in ipairs(laser_lights) do
  2408. local laser_spotlight_part, laser_spotlight = data[1], data[2]
  2409. local laser_spotlight_offset = 30 * (index - 1)
  2410. if laser_spotlight_offset <= laser_distance then
  2411. laser_spotlight_part.CFrame = magic_circle_cframe * CFrame.new(0, 0, -laser_spotlight_offset)
  2412. laser_spotlight.Brightness = opacity
  2413. laser_spotlight.Enabled = true
  2414. else
  2415. laser_spotlight.Enabled = false
  2416. end
  2417. end
  2418. end
  2419. end
  2420. end
  2421. function GraphicalEffects.ShootLaserOfDeath(target, data)
  2422. if chatAdornee then
  2423. data = data or {}
  2424. local brickcolor = data.brickcolor or BrickColor.new("Really black")
  2425. local duration = data.duration or 40
  2426. local fragmentation_size = data.fragmentation_size or 3
  2427. local laser_scale = data.laser_scale or 1
  2428. local light_color = data.light_color or Color3.new(1, 0.5, 1)
  2429. local magic_circle_image = data.magic_circle_image or "rbxassetid://122610943"
  2430. local magic_circle_scale = data.magic_circle_scale or 1
  2431. local sound_volume = data.sound_volume or 1 / 3
  2432. local special_effects = data.special_effects
  2433. local stay = data.stay or 4
  2434. local origin = chatAdornee.CFrame
  2435. local directionOrientation = origin:pointToObjectSpace(target)
  2436. local direction = (target - origin.p).unit
  2437. local magic_circle_position = origin.p + direction * GraphicalEffects.LASER_MAGIC_CIRCLE_DISTANCE
  2438. local magic_circle_cframe = CFrame.new(magic_circle_position, magic_circle_position + direction)
  2439. local magic_circle_model = Instance.new("Model")
  2440. local laser_part = Instance.new("Part", magic_circle_model)
  2441. local laser_mesh = Instance.new("CylinderMesh", laser_part)
  2442. local magic_circle_part = Instance.new("Part", magic_circle_model)
  2443. local magic_circle_mesh = Instance.new("BlockMesh", magic_circle_part)
  2444. local magic_circle_light = Instance.new("PointLight", magic_circle_part)
  2445. local magic_circle_decal_back = Instance.new("Decal", magic_circle_part)
  2446. local magic_circle_decal_front = Instance.new("Decal", magic_circle_part)
  2447. local sound = Instance.new("Sound", magic_circle_part)
  2448. sound.Pitch = 1.25
  2449. sound.SoundId = "rbxassetid://2248511"
  2450. sound.Volume = sound_volume
  2451. magic_circle_model.Archivable = false
  2452. laser_part.Anchored = true
  2453. laser_part.BottomSurface = "Smooth"
  2454. laser_part.BrickColor = brickcolor
  2455. laser_part.CanCollide = false
  2456. laser_part.CFrame = magic_circle_cframe * CFrame.Angles(-0.5 * math.pi, 0, 0)
  2457. laser_part.FormFactor = "Custom"
  2458. laser_part.Locked = true
  2459. laser_part.Size = Vector3.new(0.2, 0.2, 0.2)
  2460. laser_part.TopSurface = "Smooth"
  2461. laser_mesh.Offset = Vector3.new(0, 0, 0)
  2462. laser_mesh.Name = "Mesh"
  2463. laser_mesh.Scale = 5 * laser_scale * Vector3.new(GraphicalEffects.LASER_WIDTH, 0, GraphicalEffects.LASER_WIDTH)
  2464. magic_circle_part.Anchored = true
  2465. magic_circle_part.BottomSurface = "Smooth"
  2466. magic_circle_part.CanCollide = false
  2467. magic_circle_part.CFrame = magic_circle_cframe
  2468. magic_circle_part.FormFactor = "Custom"
  2469. magic_circle_part.Locked = true
  2470. magic_circle_part.Size = Vector3.new(0.2, 0.2, 0.2)
  2471. magic_circle_part.TopSurface = "Smooth"
  2472. magic_circle_part.Transparency = 1
  2473. magic_circle_mesh.Scale = Vector3.new(60, 60, 0) * magic_circle_scale
  2474. magic_circle_light.Color = light_color
  2475. magic_circle_light.Range = 16 * magic_circle_scale
  2476. magic_circle_light.Shadows = true
  2477. magic_circle_decal_back.Face = "Back"
  2478. magic_circle_decal_back.Texture = magic_circle_image
  2479. magic_circle_decal_front.Face = "Front"
  2480. magic_circle_decal_front.Texture = magic_circle_image
  2481. magic_circle_model.Parent = Workspace
  2482. local laser_color = brickcolor.Color
  2483. local laser_lights = {}
  2484. local light_effects = laser_color.r + laser_color.g + laser_color.b > 0.25
  2485. if light_effects then
  2486. local laser_spotlight_part_template = Instance.new("Part")
  2487. local laser_spotlight_light_template = Instance.new("SpotLight", laser_spotlight_part_template)
  2488. laser_spotlight_part_template.Anchored = true
  2489. laser_spotlight_part_template.Anchored = true
  2490. laser_spotlight_part_template.BottomSurface = "Smooth"
  2491. laser_spotlight_part_template.CanCollide = false
  2492. laser_spotlight_part_template.FormFactor = "Custom"
  2493. laser_spotlight_part_template.Locked = true
  2494. laser_spotlight_part_template.Size = Vector3.new(0.2, 0.2, 0.2)
  2495. laser_spotlight_part_template.TopSurface = "Smooth"
  2496. laser_spotlight_part_template.Transparency = 1
  2497. laser_spotlight_light_template.Angle = 45
  2498. laser_spotlight_light_template.Color = laser_color
  2499. laser_spotlight_light_template.Enabled = true
  2500. laser_spotlight_light_template.Name = "Light"
  2501. laser_spotlight_light_template.Range = 60
  2502. for index = 1, 40 do
  2503. local laser_spotlight_part = laser_spotlight_part_template:Clone()
  2504. laser_spotlight_part.CFrame = magic_circle_cframe * CFrame.new(0, 0, -30 * (index - 1))
  2505. laser_spotlight_part.Parent = magic_circle_model
  2506. laser_lights[index] = {laser_spotlight_part, laser_spotlight_part.Light}
  2507. end
  2508. end
  2509. local laser_effects
  2510. if special_effects then
  2511. laser_effects = {}
  2512. local laser_effect_1 = laser_part:Clone()
  2513. laser_effect_1.BrickColor = special_effects
  2514. laser_effect_1.Transparency = 0.5
  2515. local laser_effect_2 = laser_effect_1:Clone()
  2516. laser_effects[1], laser_effects[2] = {laser_effect_1, laser_effect_1.Mesh}, {laser_effect_2, laser_effect_2.Mesh}
  2517. laser_effect_1.Parent = magic_circle_model
  2518. laser_effect_2.Parent = magic_circle_model
  2519. end
  2520. GraphicalEffects.laser_data[{0, directionOrientation, direction, magic_circle_model, laser_part, laser_mesh, magic_circle_part,
  2521.  
  2522. magic_circle_light, magic_circle_decal_back, magic_circle_decal_front, sound, laser_scale, fragmentation_size, duration, laser_lights, laser_effects, stay,
  2523.  
  2524. light_effects}] = true
  2525. end
  2526. end
  2527.  
  2528. function GraphicalEffects.SpawnSapientRock(position)
  2529. local part = Instance.new("Part", Workspace)
  2530. local size = 8 + math.random(0, 5)
  2531. part.BottomSurface = "Smooth"
  2532. part.TopSurface = "Smooth"
  2533. part.Material = "Slate"
  2534. part.Locked = true
  2535. part.Shape = "Ball"
  2536. part.FormFactor = "Custom"
  2537. part.Size = Vector3.new(size, size, size)
  2538. part.Position = position
  2539. local bodypos = Instance.new("BodyPosition", part)
  2540. bodypos.maxForce = Vector3.new(0, 0, 0)
  2541. local angry = false
  2542. local damage_ready = true
  2543. local torso_following
  2544. local torso_changed = -1000
  2545. local touched_conn = part.Touched:connect(function(hit)
  2546. local character = hit.Parent
  2547. if character then
  2548. local humanoid
  2549. for _, child in ipairs(character:GetChildren()) do
  2550. if child:IsA("Humanoid") then
  2551. humanoid = child
  2552. break
  2553. end
  2554. end
  2555. if humanoid then
  2556. if angry then
  2557. if damage_ready then
  2558. damage_ready = false
  2559. humanoid:TakeDamage(100)
  2560. wait(1)
  2561. damage_ready = true
  2562. angry = false
  2563. part.BrickColor = BrickColor.new("Medium stone grey")
  2564. end
  2565. else
  2566. local torso = humanoid.Torso
  2567. if torso then
  2568. torso_following = torso
  2569. torso_changed = tick()
  2570. end
  2571. end
  2572. end
  2573. end
  2574. end)
  2575. TaskScheduler.Start(function()
  2576. while part.Parent == Workspace do
  2577. if torso_following then
  2578. bodypos.position = torso_following.Position
  2579. if tick() - torso_changed > 60 or not torso_following.Parent then
  2580. torso_following = nil
  2581. bodypos.maxForce = Vector3.new(0, 0, 0)
  2582. angry = false
  2583. part.BrickColor = BrickColor.new("Medium stone grey")
  2584. else
  2585. local speed = angry and Vector3.new(16, 16, 16) or Vector3.new(6, 0, 6)
  2586. bodypos.maxForce = part:GetMass() * speed
  2587. if part.Position.Y < -250 then
  2588. part.Velocity = Vector3.new()
  2589. part.Position = torso_following.Position + Vector3.new(0, 80, 0)
  2590. part.BrickColor = BrickColor.new("Bright red")
  2591. angry = true
  2592. torso_changed = tick()
  2593. end
  2594. end
  2595. end
  2596. RunService.Stepped:wait()
  2597. end
  2598. touched_conn:disconnect()
  2599. end)
  2600. TaskScheduler.Start(function()
  2601. while part.Parent == Workspace do
  2602. wait(25 + math.random() * 10)
  2603. local next_size = 8 + math.random() * 5
  2604. if math.random(100) == 1 then
  2605. next_size = next_size * (2 + 6 * math.random())
  2606. end
  2607. next_size = math.floor(next_size + 0.5)
  2608. local start_time = tick()
  2609. local mesh = Instance.new("SpecialMesh", part)
  2610. mesh.MeshType = "Sphere"
  2611. repeat
  2612. local elapsed_time = tick() - start_time
  2613. local alpha = math.cos(elapsed_time * math.pi * 0.5)
  2614. local interpolated_size = size * alpha + next_size * (1 - alpha)
  2615. local size_vector = Vector3.new(interpolated_size, interpolated_size, interpolated_size)
  2616. local cframe = part.CFrame
  2617. part.Size = size_vector
  2618. part.CFrame = cframe
  2619. mesh.Scale = size_vector / part.Size
  2620. RunService.Stepped:wait()
  2621. until tick() - start_time >= 1
  2622. mesh:Destroy()
  2623. local cframe = part.CFrame
  2624. part.Size = Vector3.new(next_size, next_size, next_size)
  2625. part.CFrame = cframe
  2626. size = next_size
  2627. end
  2628. end)
  2629. end
  2630.  
  2631. function GraphicalEffects.MainLoop()
  2632. RunService.Stepped:wait()
  2633. for data in pairs(GraphicalEffects.magicCircleData) do
  2634. GraphicalEffects.AnimateMagicCircle(data)
  2635. end
  2636. for data in pairs(GraphicalEffects.laser_data) do
  2637. GraphicalEffects.AnimateLaserOfDeath(data)
  2638. end
  2639. for data in pairs(GraphicalEffects.missileData) do
  2640. GraphicalEffects.AnimateMissile(data)
  2641. end
  2642. end
  2643. TaskScheduler.Start(function()
  2644. while true do
  2645. GraphicalEffects.MainLoop()
  2646. end
  2647. end)
  2648.  
  2649. PlayerControl = {};
  2650.  
  2651. PlayerControl.fly_acceleration = 10
  2652. PlayerControl.fly_basespeed = 250
  2653. PlayerControl.fly_speed = PlayerControl.fly_basespeed
  2654. PlayerControl.featherfallEnabled = true
  2655. PlayerControl.pushable = false
  2656. PlayerControl.rolling = false
  2657. PlayerControl.rollingAngle = 0
  2658. PlayerControl.rollingOffset = 0
  2659. PlayerControl.rollingMaxOffset = 3
  2660. PlayerControl.rollingSpeed = 1 / 50
  2661. PlayerControl.characterEnabled = false
  2662. PlayerControl.characterMode = "normal"
  2663. local character = nil
  2664. local flying, flyingMomentum, flyingTilt = false, Vector3.new(), 0
  2665. local pose, regeneratingHealth, jumpDebounce = "Standing", false, false
  2666. -- TODO: make local variables public
  2667. local model, bodyColors, leftArmMesh, leftLegMesh, rightArmMesh, rightLegMesh, torsoMesh, wildcardHat, wildcardHandle, wildcardMesh, pants, shirt, humanoid,
  2668.  
  2669. head, leftArm, leftLeg, rightArm, rightLeg, torso, rootPart, rootJoint, face, soundFreeFalling, soundGettingUp, soundRunning, leftHip, leftShoulder,
  2670.  
  2671. rightHip, rightShoulder, neck, wildcardWeld, feetPart, feetWeld, feetTouchInterest, bodyGyro, bodyVelocity, headMesh, torsoLight
  2672. local AnimateCharacter
  2673. local UserInterface = game:service'UserInputService'
  2674. local chatBubbles = {}
  2675. local chatCharacterLimit = 240
  2676. function PlayerControl.CreateCharacter()
  2677. local characterMode = PlayerControl.characterMode
  2678. if characterMode == "normal" then
  2679. if not PlayerControl.characterEnabled then
  2680. return
  2681. end
  2682. local appearance = CharacterAppearance.GetDefaultAppearance()
  2683. local active = true
  2684. local torsoCFrame = (torso and torso.CFrame) or PlayerControl.torso_cframe or CFrame.new(0, 10, 0)
  2685. if torsoCFrame.p.Y < -450 then
  2686. torsoCFrame = CFrame.new(0, 10, 0)
  2687. end
  2688. local rootPartCFrame = (rootPart and rootPart.CFrame) or PlayerControl.torso_cframe or CFrame.new(0, 10, 0)
  2689. if rootPartCFrame.p.Y < -450 then
  2690. rootPartCFrame = CFrame.new(0, 10, 0)
  2691. end
  2692. local cameraCFrame = Camera.CoordinateFrame
  2693. local connections = {}
  2694. local feetTouching = {}
  2695. local previousWalkSpeed = 0
  2696. local prevLeftHip, prevLeftShoulder, prevRightHip, prevRightShoulder = leftHip, leftShoulder, rightHip, rightShoulder
  2697. model = Instance.new("Model")
  2698. humanoid = Instance.new("Humanoid", model)
  2699. head = Instance.new("Part", model)
  2700. leftArm = Instance.new("Part", model)
  2701. leftLeg = Instance.new("Part", model)
  2702. rightArm = Instance.new("Part", model)
  2703. rightLeg = Instance.new("Part", model)
  2704. torso = Instance.new("Part", model)
  2705. rootPart = Instance.new("Part", model)
  2706. soundFallingDown = Instance.new("Sound", head)
  2707. soundFreeFalling = Instance.new("Sound", head)
  2708. soundGettingUp = Instance.new("Sound", head)
  2709. soundJumping = Instance.new("Sound", head)
  2710. soundRunning = Instance.new("Sound", head)
  2711. leftHip = Instance.new("Motor", torso)
  2712. leftShoulder = Instance.new("Motor", torso)
  2713. rightHip = Instance.new("Motor", torso)
  2714. rightShoulder = Instance.new("Motor", torso)
  2715. neck = Instance.new("Motor", torso)
  2716. rootJoint = Instance.new("Motor", rootPart)
  2717. feetPart = Instance.new("Part", model)
  2718. feetWeld = Instance.new("Weld", torso)
  2719. bodyGyro = Instance.new("BodyGyro", rootPart)
  2720. bodyVelocity = Instance.new("BodyVelocity", rootPart)
  2721. model.Archivable = false
  2722. model.Name = user_name or Player.Name
  2723. model.PrimaryPart = head
  2724. humanoid.LeftLeg = leftLeg
  2725. humanoid.RightLeg = rightLeg
  2726. humanoid.Torso = rootPart
  2727. head.CFrame = torsoCFrame * CFrame.new(0, 1.5, 0)
  2728. head.FormFactor = "Symmetric"
  2729. head.Locked = true
  2730. head.Name = "Head"
  2731. head.Size = Vector3.new(2, 1, 1)
  2732. head.TopSurface = "Smooth"
  2733. leftArm.CanCollide = false
  2734. leftArm.CFrame = torsoCFrame * CFrame.new(-1.5, 0, 0)
  2735. leftArm.FormFactor = "Symmetric"
  2736. leftArm.Locked = true
  2737. leftArm.Name = "Left Arm"
  2738. leftArm.Size = Vector3.new(1, 2, 1)
  2739. leftLeg.BottomSurface = "Smooth"
  2740. leftLeg.CanCollide = false
  2741. leftLeg.CFrame = torsoCFrame * CFrame.new(-0.5, -2, 0)
  2742. leftLeg.FormFactor = "Symmetric"
  2743. leftLeg.Locked = true
  2744. leftLeg.Name = "Left Leg"
  2745. leftLeg.Size = Vector3.new(1, 2, 1)
  2746. leftLeg.TopSurface = "Smooth"
  2747. rightArm.CanCollide = false
  2748. rightArm.CFrame = torsoCFrame * CFrame.new(1.5, 0, 0)
  2749. rightArm.FormFactor = "Symmetric"
  2750. rightArm.Locked = true
  2751. rightArm.Name = "Right Arm"
  2752. rightArm.Size = Vector3.new(1, 2, 1)
  2753. rightLeg.BottomSurface = "Smooth"
  2754. rightLeg.CanCollide = false
  2755. rightLeg.CFrame = torsoCFrame * CFrame.new(0.5, -2, 0)
  2756. rightLeg.FormFactor = "Symmetric"
  2757. rightLeg.Locked = true
  2758. rightLeg.Name = "Right Leg"
  2759. rightLeg.Size = Vector3.new(1, 2, 1)
  2760. rightLeg.TopSurface = "Smooth"
  2761. torso.CFrame = torsoCFrame
  2762. torso.FormFactor = "Symmetric"
  2763. torso.LeftSurface = "Weld"
  2764. torso.Locked = true
  2765. torso.RightSurface = "Weld"
  2766. torso.Name = "Torso"
  2767. torso.Size = Vector3.new(2, 2, 1)
  2768. rootPart.BottomSurface = "Smooth"
  2769. rootPart.BrickColor = BrickColor.Blue()
  2770. rootPart.CFrame = rootPartCFrame
  2771. rootPart.FormFactor = "Symmetric"
  2772. rootPart.LeftSurface = "Weld"
  2773. rootPart.Locked = true
  2774. rootPart.RightSurface = "Weld"
  2775. rootPart.Name = "HumanoidRootPart"
  2776. rootPart.Size = Vector3.new(2, 2, 1)
  2777. rootPart.TopSurface = "Smooth"
  2778. rootPart.Transparency = 1
  2779. soundFreeFalling.Archivable = false
  2780. soundFreeFalling.SoundId = "rbxasset://sounds/swoosh.wav"
  2781. soundGettingUp.Archivable = false
  2782. soundGettingUp.SoundId = "rbxasset://sounds/hit.wav"
  2783. soundRunning.Archivable = false
  2784. soundRunning.SoundId = "rbxasset://sounds/bfsl-minifigfoots1.mp3"
  2785. soundRunning.Looped = true
  2786. leftHip.C0 = CFrame.new(-1, -1, 0, -0, -0, -1, 0, 1, 0, 1, 0, 0)
  2787. leftHip.C1 = CFrame.new(-0.5, 1, 0, -0, -0, -1, 0, 1, 0, 1, 0, 0)
  2788. leftHip.MaxVelocity = 0.1
  2789. leftHip.Name = "Left Hip"
  2790. leftHip.Part0 = torso
  2791. leftHip.Part1 = leftLeg
  2792. leftShoulder.C0 = CFrame.new(-1, 0.5, 0, -0, -0, -1, 0, 1, 0, 1, 0, 0)
  2793. leftShoulder.C1 = CFrame.new(0.5, 0.5, 0, -0, -0, -1, 0, 1, 0, 1, 0, 0)
  2794. leftShoulder.MaxVelocity = 0.15
  2795. leftShoulder.Name = "Left Shoulder"
  2796. leftShoulder.Part0 = torso
  2797. leftShoulder.Part1 = leftArm
  2798. rightHip.C0 = CFrame.new(1, -1, 0, 0, 0, 1, 0, 1, 0, -1, -0, -0)
  2799. rightHip.C1 = CFrame.new(0.5, 1, 0, 0, 0, 1, 0, 1, 0, -1, -0, -0)
  2800. rightHip.MaxVelocity = 0.1
  2801. rightHip.Name = "Right Hip"
  2802. rightHip.Part0 = torso
  2803. rightHip.Part1 = rightLeg
  2804. rightShoulder.C0 = CFrame.new(1, 0.5, 0, 0, 0, 1, 0, 1, 0, -1, -0, -0)
  2805. rightShoulder.C1 = CFrame.new(-0.5, 0.5, 0, 0, 0, 1, 0, 1, 0, -1, -0, -0)
  2806. rightShoulder.MaxVelocity = 0.15
  2807. rightShoulder.Name = "Right Shoulder"
  2808. rightShoulder.Part0 = torso
  2809. rightShoulder.Part1 = rightArm
  2810. if prevLeftHip then
  2811. leftHip.CurrentAngle = prevLeftHip.CurrentAngle
  2812. leftHip.DesiredAngle = prevLeftHip.DesiredAngle
  2813. end
  2814. if prevLeftShoulder then
  2815. leftShoulder.CurrentAngle = prevLeftShoulder.CurrentAngle
  2816. leftShoulder.DesiredAngle = prevLeftShoulder.DesiredAngle
  2817. end
  2818. if prevRightHip then
  2819. rightHip.CurrentAngle = prevRightHip.CurrentAngle
  2820. rightHip.DesiredAngle = prevRightHip.DesiredAngle
  2821. end
  2822. if prevRightShoulder then
  2823. rightShoulder.CurrentAngle = prevRightShoulder.CurrentAngle
  2824. rightShoulder.DesiredAngle = prevRightShoulder.DesiredAngle
  2825. end
  2826. neck.C0 = CFrame.new(0, 1, 0, -1, -0, -0, 0, 0, 1, 0, 1, 0)
  2827. neck.C1 = CFrame.new(0, -0.5, 0, -1, -0, -0, 0, 0, 1, 0, 1, 0)
  2828. neck.Name = "Neck"
  2829. neck.Part0 = torso
  2830. neck.Part1 = head
  2831. rootJoint.C0 = CFrame.new(0, 0, 0, -1, 0, 0, 0, 0, 1, 0, 1, 0)
  2832. rootJoint.C1 = CFrame.new(0, 0, 0, -1, 0, 0, 0, 0, 1, 0, 1, 0)
  2833. rootJoint.Name = "RootJoint"
  2834. rootJoint.Part0 = rootPart
  2835. rootJoint.Part1 = torso
  2836. feetPart.BottomSurface = "Smooth"
  2837. feetPart.CanCollide = false
  2838. feetPart.CFrame = torsoCFrame * CFrame.new(0, -3.1, 0)
  2839. feetPart.FormFactor = "Custom"
  2840. feetPart.Locked = true
  2841. feetPart.Name = "Platform"
  2842. feetPart.Size = Vector3.new(1.8, 0.2, 0.8)
  2843. feetPart.TopSurface = "Smooth"
  2844. feetPart.Transparency = 1
  2845. feetWeld.C0 = CFrame.new(0, -3, 0)
  2846. feetWeld.C1 = CFrame.new(0, 0.1, 0)
  2847. feetWeld.Name = "PlatformWeld"
  2848. feetWeld.Part0 = torso
  2849. feetWeld.Part1 = feetPart
  2850. table.insert(connections, feetPart.Touched:connect(function(hit)
  2851. feetTouching[hit] = true
  2852. end))
  2853. table.insert(connections, feetPart.TouchEnded:connect(function(hit)
  2854. feetTouching[hit] = nil
  2855. end))
  2856. feetTouchInterest = feetPart:FindFirstChild("TouchInterest")
  2857. bodyGyro.D = 3250
  2858. bodyGyro.P = 400000
  2859. bodyGyro.maxTorque = Vector3.new(1000000000, 0, 1000000000)
  2860. bodyVelocity.P = 5000
  2861. bodyVelocity.maxForce = Vector3.new(0, 0, 0)
  2862. bodyVelocity.velocity = Vector3.new(0, 0, 0)
  2863. torsoLight = Instance.new("PointLight", torso)
  2864. torsoLight.Brightness = 0.4
  2865. torsoLight.Color = Color3.new(1, 1, 1)
  2866. torsoLight.Range = 16
  2867. torsoLight.Shadows = true
  2868. local ff1, ff2, ff3, ff4, ff5, ff6, ff7, ff8, ff9 = Instance.new("ForceField", head), Instance.new("ForceField", leftArm), Instance.new("ForceField", leftLeg), Instance.new("ForceField", rightArm), Instance.new("ForceField", rightLeg), Instance.new("ForceField", torso), Instance.new("ForceField", wildcardHandle), Instance.new("ForceField", feetPart), Instance.new("ForceField", rootPart)
  2869. local forcefields = {[ff1] = head, [ff2] = leftArm, [ff3] = leftLeg, [ff4] = rightArm, [ff5] = rightLeg, [ff6] = torso, [ff7] = wildcardHandle, [ff8] = feetPart, [ff9] = rootPart}
  2870. local objects = {[humanoid] = true, [head] = true, [leftArm] = true, [leftLeg] = true, [rightArm] = true, [rightLeg] = true, [torso] = true, [rootPart] = true, [rootJoint] = true, [soundFreeFalling] = true, [soundGettingUp] = true, [soundRunning] = true, [leftHip] = true, [leftShoulder] = true, [rightHip] = true, [rightShoulder] = true, [neck] = true, [feetPart] = true, [feetWeld] = true, [feetTouchInterest] = true, [bodyGyro] = true, [bodyVelocity] = true, [ff1] = true, [ff2] = true, [ff3] = true, [ff4] = true, [ff5] = true, [ff6] = true, [ff7] = true, [ff8] = true, [ff9] = true}
  2871. local tshirtUrl = appearance.tshirt
  2872. if tshirtUrl then
  2873. local tshirt = Instance.new("Decal", torso)
  2874. tshirt.Name = "roblox"
  2875. tshirt.Texture = tshirtUrl
  2876. objects[tshirt] = true
  2877. end
  2878. for _, template in ipairs(appearance.characterObjects) do
  2879. local object = template:Clone()
  2880. local newObjects = {object}
  2881. for _, object in ipairs(newObjects) do
  2882. objects[object] = true
  2883. for _, child in ipairs(object:GetChildren()) do
  2884. table.insert(newObjects, child)
  2885. end
  2886. end
  2887. if object:IsA("BodyColors") then
  2888. head.BrickColor = object.HeadColor
  2889. leftArm.BrickColor = object.LeftArmColor
  2890. leftLeg.BrickColor = object.LeftLegColor
  2891. rightArm.BrickColor = object.RightArmColor
  2892. rightLeg.BrickColor = object.RightLegColor
  2893. torso.BrickColor = object.TorsoColor
  2894. elseif object:IsA("Hat") then
  2895. local handle = object:FindFirstChild("Handle")
  2896. if handle and handle:IsA("BasePart") then
  2897. local weld = Instance.new("Weld", head)
  2898. weld.C0 = CFrame.new(0, 0.5, 0)
  2899. local attachmentPos = object.AttachmentPos
  2900. local attachmentRight = object.AttachmentRight
  2901. local attachmentUp = object.AttachmentUp
  2902. local attachmentForward = object.AttachmentForward
  2903. weld.C1 = CFrame.new(attachmentPos.X, attachmentPos.Y, attachmentPos.Z,
  2904. attachmentRight.X, attachmentUp.X, -attachmentForward.X,
  2905. attachmentRight.Y, attachmentUp.Y, -attachmentForward.Y,
  2906. attachmentRight.Z, attachmentUp.Z, -attachmentForward.Z)
  2907. weld.Name = "HeadWeld"
  2908. weld.Part0 = head
  2909. weld.Part1 = handle
  2910. handle.Parent = model
  2911. local antiGravity = Instance.new("BodyForce", handle)
  2912. antiGravity.force = Vector3.new(0, handle:GetMass() * 196.2, 0)
  2913. objects[object] = false
  2914. object.Parent = nil
  2915. objects[weld] = true
  2916. end
  2917. end
  2918. object.Parent = model
  2919. end
  2920. local facePresent = false
  2921. local headMeshPresent = false
  2922. for _, template in ipairs(appearance.headObjects) do
  2923. local object = template:Clone()
  2924. local newObjects = {object}
  2925. for _, object in ipairs(newObjects) do
  2926. objects[object] = true
  2927. for _, child in ipairs(object:GetChildren()) do
  2928. table.insert(newObjects, child)
  2929. end
  2930. end
  2931. if object:IsA("DataModelMesh") then
  2932. headMeshPresent = true
  2933. elseif object:IsA("Decal") then
  2934. facePresent = true
  2935. end
  2936. object.Parent = head
  2937. end
  2938. if not facePresent then
  2939. local face = Instance.new("Decal", head)
  2940. face.Texture = "rbxasset://textures/face.png"
  2941. objects[face] = true
  2942. end
  2943. if not headMeshPresent then
  2944. local headMesh = Instance.new("SpecialMesh", head)
  2945. headMesh.Scale = Vector3.new(1.25, 1.25, 1.25)
  2946. objects[headMesh] = true
  2947. end
  2948. table.insert(connections, model.DescendantAdded:connect(function(object)
  2949. local success, is_localscript = pcall(Game.IsA, object, "LocalScript")
  2950. if success and is_localscript then
  2951. pcall(Utility.SetProperty, object, "Disabled", true)
  2952. local changed_connection = pcall(object.Changed.connect, object.Changed, function(property)
  2953. if property == "Disabled" and not object.Disabled then
  2954. pcall(Utility.SetProperty, object, "Disabled", true)
  2955. object:Destroy()
  2956. end
  2957. end)
  2958. end
  2959. if not objects[object] then
  2960. object:Destroy()
  2961. end
  2962. end))
  2963. model.Parent = Workspace
  2964. Player.Character = model
  2965. Camera.CameraSubject = humanoid
  2966. Camera.CameraType = "Track"
  2967. Camera.CoordinateFrame = cameraCFrame
  2968. local IsStanding
  2969. local RegenerateHealth
  2970. local ResetCharacter
  2971. function IsStanding()
  2972. return not not next(feetTouching)
  2973. end
  2974. function RegenerateHealth()
  2975. if humanoid.Health < 1 then
  2976. humanoid.Health = 100
  2977. elseif not regeneratingHealth then
  2978. regeneratingHealth = true
  2979. local elapsedTime = wait(1)
  2980. regeneratingHealth = false
  2981. if humanoid.Health < 100 then
  2982. humanoid.Health = math.min(humanoid.Health + elapsedTime, 100)
  2983. end
  2984. end
  2985. end
  2986. function ResetCharacter()
  2987. for index, connection in ipairs(connections) do
  2988. connection:disconnect()
  2989. end
  2990. active = false
  2991. end
  2992. table.insert(connections, model.AncestryChanged:connect(ResetCharacter))
  2993. table.insert(connections, model.DescendantRemoving:connect(function(object)
  2994. local parent = forcefields[object]
  2995. if parent then
  2996. forcefields[object] = nil
  2997. local new_forcefield = Instance.new("ForceField")
  2998. forcefields[new_forcefield] = parent
  2999. objects[new_forcefield] = true
  3000. new_forcefield.Parent = parent
  3001. elseif objects[object] then
  3002. ResetCharacter()
  3003. end
  3004. end))
  3005. table.insert(connections, humanoid.HealthChanged:connect(RegenerateHealth))
  3006. table.insert(connections, humanoid.Climbing:connect(function() pose = "Climbing" end))
  3007. table.insert(connections, humanoid.FallingDown:connect(function(state) pose = "FallingDown" end))
  3008. table.insert(connections, humanoid.FreeFalling:connect(function(state) pose = "FreeFall" if state then soundFreeFalling:Play() else
  3009.  
  3010. soundFreeFalling:Pause() end end))
  3011. table.insert(connections, humanoid.GettingUp:connect(function(state) pose = "GettingUp" if state then soundGettingUp:Play() else
  3012.  
  3013. soundGettingUp:Pause() end end))
  3014. table.insert(connections, humanoid.PlatformStanding:connect(function() pose = "PlatformStanding" end))
  3015. table.insert(connections, humanoid.Seated:connect(function() pose = "Seated" end))
  3016. table.insert(connections, humanoid.Swimming:connect(function(speed) if speed > 0 then pose = "Swimming" else pose = "Standing" end end))
  3017. local previousRootPartCFrame = rootPart.CFrame
  3018. TaskScheduler.Start(function()
  3019. while active do
  3020. local totalTime = TaskScheduler.GetCurrentTime()
  3021. local stepTime = 1 / 60
  3022. if not PlayerControl.characterEnabled then
  3023. ResetCharacter()
  3024. break
  3025. end
  3026. torsoLight.Brightness = 0.5 + 0.15 * math.sin(totalTime * 0.75 * math.pi)
  3027. local featherfallEnabled = PlayerControl.IsFeatherfallEnabled()
  3028. local rootPartCFrame = rootPart.CFrame
  3029. if not jumpDebounce and UserInterface:IsKeyDown(Enum.KeyCode.Space) then
  3030. if humanoid.Sit then
  3031. humanoid.Sit = false
  3032. end
  3033. if IsStanding() then
  3034. jumpDebounce = true
  3035. pose = "Jumping"
  3036. rootPart.Velocity = Vector3.new(rootPart.Velocity.X, 50, rootPart.Velocity.Z)
  3037. torso.Velocity = Vector3.new(torso.Velocity.X, 50, torso.Velocity.Z)
  3038. TaskScheduler.Schedule(1, function()
  3039. if pose == "Jumping" then
  3040. pose = "FreeFall"
  3041. end
  3042. jumpDebounce = false
  3043. humanoid.Jump = false
  3044. end)
  3045. end
  3046. end
  3047. local cameraCFrame = Camera.CoordinateFrame
  3048. local cameraDirection = cameraCFrame.lookVector
  3049. if flying then
  3050. if PlayerControl.rolling then
  3051. local rootPartCFrame = rootPart.CFrame
  3052. local speed = (rootPartCFrame - rootPartCFrame.p):pointToObjectSpace(rootPart.Velocity).Y
  3053. local decay = 0.5 ^ stepTime
  3054. if math.abs(speed) <= 50 then
  3055. PlayerControl.rollingAngle = (((PlayerControl.rollingAngle + 0.5) % 1 - 0.5) * decay) % 1
  3056. PlayerControl.rollingOffset = PlayerControl.rollingOffset * decay
  3057. else
  3058. PlayerControl.rollingAngle = (PlayerControl.rollingAngle + stepTime * speed * PlayerControl.rollingSpeed) % 1
  3059. PlayerControl.rollingOffset = (PlayerControl.rollingOffset + PlayerControl.rollingMaxOffset * (1 / decay - 1)) * decay
  3060. end
  3061. rootJoint.C0 = (CFrame.new(0, 0, 0, -1, 0, 0, 0, 0, 1, 0, 1, 0) * CFrame.Angles(PlayerControl.rollingAngle * 2 * math.pi, 0, 0)) * CFrame.new(0, -PlayerControl.rollingOffset, 0)
  3062. else
  3063. rootJoint.C0 = CFrame.new(0, 0, 0, -1, 0, 0, 0, 0, 1, 0, 1, 0)
  3064. PlayerControl.rollingAngle = 0
  3065. PlayerControl.rollingOffset = 0
  3066. end
  3067. rightShoulder.MaxVelocity = 0.5
  3068. leftShoulder.MaxVelocity = 0.5
  3069. rightShoulder.DesiredAngle = 0
  3070. leftShoulder.DesiredAngle = 0
  3071. rightHip.DesiredAngle = 0
  3072. leftHip.DesiredAngle = 0
  3073. bodyGyro.D = 500
  3074. bodyGyro.P = 1e6
  3075. bodyGyro.maxTorque = Vector3.new(1e6, 1e6, 1e6)
  3076. bodyVelocity.P = 1250
  3077. bodyVelocity.maxForce = Vector3.new(1e6, 1e6, 1e6)
  3078. local movementRight = 0
  3079. local movementForward = 0
  3080. local movementUp = 0
  3081. if UserInterface:IsKeyDown(Enum.KeyCode.A) and not UserInterface:IsKeyDown(Enum.KeyCode.D) then
  3082. movementRight = -1
  3083. elseif UserInterface:IsKeyDown(Enum.KeyCode.D) then
  3084. movementRight = 1
  3085. end
  3086. if UserInterface:IsKeyDown(Enum.KeyCode.W) then
  3087. movementUp = 0.2
  3088. if not UserInterface:IsKeyDown(Enum.KeyCode.S) then
  3089. movementForward = -1
  3090. end
  3091. elseif UserInterface:IsKeyDown(Enum.KeyCode.S) then
  3092. movementForward = 1
  3093. end
  3094. local movement = PlayerControl.fly_acceleration * cameraCFrame:vectorToWorldSpace(Vector3.new(movementRight, movementUp, movementForward))
  3095. local previousMomentum = flyingMomentum
  3096. local previousTilt = flyingTilt
  3097. flyingMomentum = movement + flyingMomentum * (1 - PlayerControl.fly_acceleration / PlayerControl.fly_speed)
  3098. flyingTilt = ((flyingMomentum * Vector3.new(1, 0, 1)).unit:Cross((previousMomentum * Vector3.new(1, 0, 1)).unit)).Y
  3099. if flyingTilt ~= flyingTilt or flyingTilt == math.huge then
  3100. flyingTilt = 0
  3101. end
  3102. local absoluteTilt = math.abs(flyingTilt)
  3103. if absoluteTilt > 0.06 or absoluteTilt < 0.0001 then
  3104. if math.abs(previousTilt) > 0.0001 then
  3105. flyingTilt = previousTilt * 0.9
  3106. else
  3107. flyingTilt = 0
  3108. end
  3109. else
  3110. flyingTilt = previousTilt * 0.77 + flyingTilt * 0.25
  3111. end
  3112. previousTilt = flyingTilt
  3113. if flyingMomentum.magnitude < 0.1 then
  3114. flyingMomentum = Vector3.new(0, 0, 0)
  3115. -- bodyGyro.cframe = cameraCFrame
  3116. else
  3117. local momentumOrientation = CFrame.new(Vector3.new(0, 0, 0), flyingMomentum)
  3118. local tiltOrientation = CFrame.Angles(0, 0, -20 * flyingTilt)
  3119. bodyGyro.cframe = momentumOrientation * tiltOrientation * CFrame.Angles(-0.5 * math.pi * math.min(flyingMomentum.magnitude / PlayerControl.fly_speed, 1), 0, 0)
  3120. end
  3121. bodyVelocity.velocity = flyingMomentum + Vector3.new(0, 0.15695775618683547, 0)
  3122. rootPart.Velocity = flyingMomentum
  3123. previousMomentum = flyingMomentum
  3124. else
  3125. rootJoint.C0 = CFrame.new(0, 0, 0, -1, 0, 0, 0, 0, 1, 0, 1, 0)
  3126. PlayerControl.rollingAngle = 0
  3127. PlayerControl.rollingOffset = 0
  3128. bodyGyro.D = 3250
  3129. bodyGyro.P = 400000
  3130. bodyVelocity.P = 5000
  3131. local cameraDirection = cameraCFrame.lookVector
  3132. local walkDirection = Vector3.new(0, 0, 0)
  3133. local walkSpeed = 16
  3134. if UserInterface:IsKeyDown(Enum.KeyCode.W) then
  3135. if UserInterface:IsKeyDown(Enum.KeyCode.A) then
  3136. walkDirection = Vector3.new(cameraDirection.X + cameraDirection.Z, 0, cameraDirection.Z - cameraDirection.X).unit
  3137. elseif UserInterface:IsKeyDown(Enum.KeyCode.D) then
  3138. walkDirection = Vector3.new(cameraDirection.X - cameraDirection.Z, 0, cameraDirection.Z + cameraDirection.X).unit
  3139. else
  3140. walkDirection = Vector3.new(cameraDirection.X, 0, cameraDirection.Z).unit
  3141. end
  3142. elseif UserInterface:IsKeyDown(Enum.KeyCode.S) then
  3143. if UserInterface:IsKeyDown(Enum.KeyCode.A) then
  3144. walkDirection = Vector3.new(-cameraDirection.X + cameraDirection.Z, 0, -cameraDirection.Z - cameraDirection.X).unit
  3145. elseif UserInterface:IsKeyDown(Enum.KeyCode.D) then
  3146. walkDirection = Vector3.new(-cameraDirection.X - cameraDirection.Z, 0, -cameraDirection.Z + cameraDirection.X).unit
  3147. else
  3148. walkDirection = Vector3.new(-cameraDirection.X, 0, -cameraDirection.Z).unit
  3149. end
  3150. elseif UserInterface:IsKeyDown(Enum.KeyCode.A) then
  3151. walkDirection = Vector3.new(cameraDirection.Z, 0, -cameraDirection.X).unit
  3152. elseif UserInterface:IsKeyDown(Enum.KeyCode.D) then
  3153. walkDirection = Vector3.new(-cameraDirection.Z, 0, cameraDirection.X).unit
  3154. else
  3155. walkSpeed = 0
  3156. end
  3157. if walkSpeed ~= previousWalkSpeed then
  3158. if walkSpeed > 0 then
  3159. soundRunning:Play()
  3160. else
  3161. soundRunning:Pause()
  3162. end
  3163. end
  3164. if walkSpeed > 0 then
  3165. if pose ~= "Jumping" then
  3166. if IsStanding() then
  3167. pose = "Running"
  3168. else
  3169. pose = "FreeFall"
  3170. end
  3171. end
  3172. bodyGyro.cframe = CFrame.new(Vector3.new(), walkDirection)
  3173. bodyGyro.maxTorque = Vector3.new(1000000000, 1000000000, 1000000000)
  3174. bodyVelocity.maxForce = Vector3.new(1000000, maxForceY, 1000000)
  3175. else
  3176. if pose ~= "Jumping" then
  3177. if IsStanding() then
  3178. pose = "Standing"
  3179. else
  3180. pose = "FreeFall"
  3181. end
  3182. end
  3183. -- TODO: find and fix bug that causes torso to rotate back to some angle
  3184. bodyGyro.maxTorque = Vector3.new(1000000000, 1000000000, 1000000000) -- Vector3.new(1000000000, 0, 1000000000)
  3185. if PlayerControl.pushable then
  3186. bodyVelocity.maxForce = Vector3.new(0, 0, 0)
  3187. else
  3188. bodyVelocity.maxForce = Vector3.new(1000000, 0, 1000000)
  3189. end
  3190. end
  3191. if featherfallEnabled then
  3192. local velocity = rootPart.Velocity
  3193. if velocity.Y > 50 then
  3194. rootPart.Velocity = Vector3.new(velocity.X, 50, velocity.Z)
  3195. elseif velocity.Y < -50 then
  3196. rootPart.Velocity = Vector3.new(velocity.X, -50, velocity.Z)
  3197. end
  3198. local distanceVector = rootPartCFrame.p - previousRootPartCFrame.p
  3199. local offsetX, offsetY, offsetZ = distanceVector.X, distanceVector.Y, distanceVector.Z
  3200. local MAX_MOVEMENT = 50 * 0.03333333507180214
  3201. if offsetX > MAX_MOVEMENT then
  3202. offsetX = MAX_MOVEMENT
  3203. elseif offsetX < -MAX_MOVEMENT then
  3204. offsetX = -MAX_MOVEMENT
  3205. end
  3206. if offsetY > MAX_MOVEMENT then
  3207. offsetY = MAX_MOVEMENT
  3208. elseif offsetY < -MAX_MOVEMENT then
  3209. offsetY = -MAX_MOVEMENT
  3210. end
  3211. if offsetZ > MAX_MOVEMENT then
  3212. offsetZ = MAX_MOVEMENT
  3213. elseif offsetZ < -MAX_MOVEMENT then
  3214. offsetZ = -MAX_MOVEMENT
  3215. end
  3216. local offset = Vector3.new(offsetX, offsetY, offsetZ)
  3217. if offset ~= distanceVector then
  3218. rootPartCFrame = previousRootPartCFrame + offset
  3219. --rootPart.CFrame = rootPartCFrame
  3220. end
  3221. end
  3222. local walkingVelocity = walkDirection * walkSpeed
  3223. bodyVelocity.velocity = walkingVelocity
  3224. if not jumpDebounce and math.abs(rootPart.Velocity.Y) <= 0.1 then
  3225. rootPart.Velocity = Vector3.new(walkingVelocity.X, rootPart.Velocity.Y, walkingVelocity.Z)
  3226. end
  3227. previousWalkSpeed = walkSpeed
  3228. if pose == "Jumping" or jumpDebounce then
  3229. rightShoulder.MaxVelocity = 0.5
  3230. leftShoulder.MaxVelocity = 0.5
  3231. rightShoulder.DesiredAngle = 3.14
  3232. leftShoulder.DesiredAngle = -3.14
  3233. rightHip.DesiredAngle = 0
  3234. leftHip.DesiredAngle = 0
  3235. elseif pose == "FreeFall" then
  3236. rightShoulder.MaxVelocity = 0.5
  3237. leftShoulder.MaxVelocity = 0.5
  3238. rightShoulder.DesiredAngle = 3.14
  3239. leftShoulder.DesiredAngle = -3.14
  3240. rightHip.DesiredAngle = 0
  3241. leftHip.DesiredAngle = 0
  3242. elseif pose == "Seated" then
  3243. rightShoulder.MaxVelocity = 0.15
  3244. leftShoulder.MaxVelocity = 0.15
  3245. rightShoulder.DesiredAngle = 3.14 / 2
  3246. leftShoulder.DesiredAngle = -3.14 / 2
  3247. rightHip.DesiredAngle = 3.14 / 2
  3248. leftHip.DesiredAngle = -3.14 / 2
  3249. else
  3250. local climbFudge = 0
  3251. local amplitude
  3252. local frequency
  3253. if pose == "Running" then
  3254. rightShoulder.MaxVelocity = 0.15
  3255. leftShoulder.MaxVelocity = 0.15
  3256. amplitude = 1
  3257. frequency = 9
  3258. elseif (pose == "Climbing") then
  3259. rightShoulder.MaxVelocity = 0.5
  3260. leftShoulder.MaxVelocity = 0.5
  3261. amplitude = 1
  3262. frequency = 9
  3263. climbFudge = 3.14
  3264. else
  3265. amplitude = 0.1
  3266. frequency = 1
  3267. end
  3268. local desiredAngle = amplitude * math.sin(totalTime * frequency)
  3269. rightShoulder.DesiredAngle = desiredAngle + climbFudge
  3270. leftShoulder.DesiredAngle = desiredAngle - climbFudge
  3271. rightHip.DesiredAngle = -desiredAngle
  3272. leftHip.DesiredAngle = -desiredAngle
  3273. end
  3274. end
  3275. previousRootPartCFrame = rootPartCFrame
  3276. RunService.RenderStepped:wait()
  3277. end
  3278. if model.Parent ~= nil then
  3279. model.Parent = nil
  3280. end
  3281. PlayerControl.CreateCharacter()
  3282. end)
  3283. humanoid.Health = 100
  3284. character = model
  3285. chatAdornee = head
  3286. elseif characterMode == "pyramid" then
  3287. if PlayerControl.characterEnabled then
  3288. Camera.CameraType = "Fixed"
  3289. PyramidCharacter.camera_distance = (Camera.Focus.p - Camera.CoordinateFrame.p).magnitude
  3290. PyramidCharacter.camera_position = Camera.Focus.p
  3291. PyramidCharacter.Teleport(Camera.Focus.p)
  3292. PyramidCharacter.visible = true
  3293. Player.Character = nil
  3294. else
  3295. PyramidCharacter.visible = false
  3296. end
  3297. end
  3298. end
  3299. function PlayerControl.GetCharacter()
  3300. return character
  3301. end
  3302. function PlayerControl.GetHead()
  3303. local characterMode = PlayerControl.characterMode
  3304. if characterMode == "normal" then
  3305. return head
  3306. elseif characterMode == "pyramid" then
  3307. return PyramidCharacter.core
  3308. end
  3309. end
  3310. function PlayerControl.GetHumanoid()
  3311. return humanoid
  3312. end
  3313. function PlayerControl.GetRootPart()
  3314. return rootPart
  3315. end
  3316. function PlayerControl.GetTorso()
  3317. return torso
  3318. end
  3319. function PlayerControl.IsEnabled()
  3320. return PlayerControl.characterEnabled
  3321. end
  3322. function PlayerControl.IsFeatherfallEnabled()
  3323. return PlayerControl.featherfallEnabled
  3324. end
  3325. function PlayerControl.IsPushable()
  3326. return PlayerControl.pushable
  3327. end
  3328. function PlayerControl.IsRolling()
  3329. return PlayerControl.rolling
  3330. end
  3331. function PlayerControl.ResetCharacter()
  3332. if character and character.Parent then
  3333. character.Parent = nil
  3334. end
  3335. PyramidCharacter.visible = false
  3336. end
  3337. function PlayerControl.SetEnabled(state, no_animation)
  3338. state = not not state
  3339. if state ~= PlayerControl.characterEnabled then
  3340. PlayerControl.characterEnabled = state
  3341. local characterMode = PlayerControl.characterMode
  3342. if characterMode == "normal" then
  3343. local torso = PlayerControl.GetRootPart()
  3344. local rootPart = PlayerControl.GetRootPart()
  3345. if rootPart then
  3346. if PlayerControl.characterEnabled then
  3347. local torso_cframe = Camera.Focus:toWorldSpace(PlayerControl.hide_torso_object_cframe)
  3348. PlayerControl.torso_cframe = torso_cframe
  3349. torso.CFrame = torso_cframe
  3350. rootPart.CFrame = torso_cframe
  3351. else
  3352. PlayerControl.hide_torso_object_cframe = Camera.Focus:toObjectSpace(rootPart.CFrame)
  3353. end
  3354. else
  3355. PlayerControl.torso_cframe = Camera.Focus
  3356. end
  3357. if PlayerControl.characterEnabled then
  3358. PlayerControl.CreateCharacter()
  3359. RunService.Stepped:wait()
  3360. coroutine.yield()
  3361. if not no_animation then
  3362. GraphicalEffects.CrystalRing({base_part = PlayerControl.GetTorso(), crystal_color = BrickColor.new("Institutional white"), float_duration = 2})
  3363. end
  3364. else
  3365. Player.Character = nil
  3366. Camera.CameraType = "Fixed"
  3367. if not no_animation then
  3368. GraphicalEffects.CrystalRing({position = PlayerControl.GetTorso().Position, crystal_color = BrickColor.new("Institutional white"), float_duration = 2})
  3369. end
  3370. end
  3371. else
  3372. if state then
  3373. PlayerControl.CreateCharacter()
  3374. RunService.Stepped:wait()
  3375. coroutine.yield()
  3376. if not no_animation then
  3377. GraphicalEffects.CrystalRing({base_part = PyramidCharacter.core, crystal_color = BrickColor.new("Institutional white"), float_duration = 2})
  3378. end
  3379. else
  3380. PyramidCharacter.visible = false
  3381. if not no_animation then
  3382. GraphicalEffects.CrystalRing({position = PyramidCharacter.core.Position, crystal_color = BrickColor.new("Institutional white"), float_duration = 2})
  3383. end
  3384. end
  3385. end
  3386. end
  3387. end
  3388. function PlayerControl.SetFeatherfallEnabled(state)
  3389. state = not not state
  3390. if state ~= PlayerControl.featherfallEnabled then
  3391. PlayerControl.featherfallEnabled = state
  3392. if state then
  3393. Logger.print("Info", "Featherfall enabled in PlayerControl")
  3394. else
  3395. Logger.print("Info", "Featherfall disabled in PlayerControl")
  3396. end
  3397. end
  3398. end
  3399. function PlayerControl.SetPushable(state)
  3400. state = not not state
  3401. if state ~= PlayerControl.pushable then
  3402. PlayerControl.pushable = state
  3403. if state then
  3404. Logger.print("Info", "Pushing enabled in PlayerControl")
  3405. else
  3406. Logger.print("Info", "Pushing disabled in PlayerControl")
  3407. end
  3408. end
  3409. end
  3410. function PlayerControl.SetRolling(state)
  3411. state = not not state
  3412. if state ~= PlayerControl.rolling then
  3413. PlayerControl.rolling = state
  3414. if state then
  3415. Logger.print("Info", "Rolling fly mode enabled in PlayerControl")
  3416. else
  3417. Logger.print("Info", "Rolling fly mode disabled in PlayerControl")
  3418. end
  3419. end
  3420. end
  3421. function PlayerControl.StartFlying()
  3422. PlayerControl.fly_speed = PlayerControl.fly_basespeed
  3423. if torso then
  3424. flyingMomentum = torso.Velocity + torso.CFrame.lookVector * 3 + Vector3.new(0, 10, 0)
  3425. else
  3426. flyingMomentum = Vector3.new()
  3427. end
  3428. flyingTilt = 0
  3429. flying = true
  3430. end
  3431. function PlayerControl.StopFlying()
  3432. if bodyGyro.cframe then
  3433. local lookVector = bodyGyro.cframe.lookVector
  3434. if lookVector.X ~= 0 or lookVector.Z ~= 0 then
  3435. bodyGyro.cframe = CFrame.new(Vector3.new(), Vector3.new(lookVector.X, 0, lookVector.Z))
  3436. end
  3437. end
  3438. flying = false
  3439. end
  3440. local previousTime = 0
  3441.  
  3442. ControllerCommands = {};
  3443.  
  3444. ControllerCommands = {};
  3445.  
  3446. ControllerCommands.BALEFIRE_SPEED = 40
  3447. function ControllerCommands.BalefireAtMouse()
  3448. local head = chatAdornee
  3449. if head then
  3450. local target = Mouse.Hit.p
  3451. local origin = head.Position
  3452. local direction = (target - origin).unit
  3453. local explosionCount = 0
  3454. local animation_frame = 0
  3455. local magic_circle_position = origin + direction * 4
  3456. local magic_circle_cframe = CFrame.new(magic_circle_position, magic_circle_position + direction)
  3457. local magic_circle_part = Instance.new("Part")
  3458. local magic_circle_mesh = Instance.new("BlockMesh", magic_circle_part)
  3459. local magic_circle_light = Instance.new("PointLight", magic_circle_part)
  3460. local magic_circle_decal_back = Instance.new("Decal", magic_circle_part)
  3461. local magic_circle_decal_front = Instance.new("Decal", magic_circle_part)
  3462. magic_circle_part.Anchored = true
  3463. magic_circle_part.Archivable = false
  3464. magic_circle_part.BottomSurface = "Smooth"
  3465. magic_circle_part.CanCollide = false
  3466. magic_circle_part.CFrame = magic_circle_cframe
  3467. magic_circle_part.FormFactor = "Custom"
  3468. magic_circle_part.Locked = true
  3469. magic_circle_part.Size = Vector3.new(0.2, 0.2, 0.2)
  3470. magic_circle_part.TopSurface = "Smooth"
  3471. magic_circle_part.Transparency = 1
  3472. magic_circle_mesh.Scale = Vector3.new(60, 60, 0)
  3473. magic_circle_light.Color = Color3.new(1, 0.5, 1)
  3474. magic_circle_light.Range = 16
  3475. magic_circle_light.Shadows = true
  3476. magic_circle_decal_back.Face = "Back"
  3477. magic_circle_decal_back.Texture = "rbxassetid://122610943"
  3478. magic_circle_decal_front.Face = "Front"
  3479. magic_circle_decal_front.Texture = "rbxassetid://122610943"
  3480. local function NextExplosion()
  3481. explosionCount = explosionCount + 1
  3482. Instance.new("Explosion", Workspace).Position = origin + direction * (explosionCount * 8 + 4)
  3483. end
  3484. local function AnimateMagicCircle()
  3485. animation_frame = animation_frame + 1
  3486. local transparency = (animation_frame / 40) ^ 3
  3487. if animation_frame == 40 then
  3488. pcall(Game.Destroy, magic_circle_part)
  3489. else
  3490. if magic_circle_part.Parent ~= Workspace then
  3491. pcall(Utility.SetProperty, magic_circle_part, "Parent", Workspace)
  3492. end
  3493. head = PlayerControl.GetHead()
  3494. if head then
  3495. magic_circle_position = head.Position + direction * 4
  3496. end
  3497. magic_circle_part.CFrame = CFrame.new(magic_circle_position, magic_circle_position + direction) * CFrame.Angles(0, 0,
  3498.  
  3499. math.tau * animation_frame / 40 * 1.5)
  3500. magic_circle_light.Brightness = 1 - transparency
  3501. magic_circle_decal_back.Transparency = transparency
  3502. magic_circle_decal_front.Transparency = transparency
  3503. end
  3504. end
  3505. magic_circle_part.Parent = Workspace
  3506. for i = 1, 40 do
  3507. Delay((i - 1) / ControllerCommands.BALEFIRE_SPEED, NextExplosion)
  3508. Delay((i - 1) / 30, AnimateMagicCircle)
  3509. end
  3510. for i = 1, 20 do
  3511. Delay((i - 1) / ControllerCommands.BALEFIRE_SPEED, NextExplosion)
  3512. end
  3513. end
  3514. end
  3515. function ControllerCommands.ControlRandomDummy()
  3516. local dummies = {}
  3517. local numDummies = 0
  3518. for _, character in ipairs(Workspace:GetChildren()) do
  3519. local name = tostring(character)
  3520. if name == "???" or name == "Dummy" then
  3521. local head, humanoid
  3522. for _, child in ipairs(character:GetChildren()) do
  3523. local className = child.ClassName
  3524. if className == "Part" and tostring(child) == "Head" then
  3525. head = child
  3526. if humanoid then
  3527. break
  3528. end
  3529. elseif className == "Humanoid" then
  3530. if child.Health > 0 then
  3531. humanoid = child
  3532. if head then
  3533. break
  3534. end
  3535. else
  3536. break
  3537. end
  3538. end
  3539. end
  3540. if head and humanoid then
  3541. numDummies = numDummies + 1
  3542. dummies[numDummies] = {character, head, humanoid}
  3543. end
  3544. end
  3545. end
  3546. if numDummies > 0 then
  3547. local dummy = dummies[math.random(numDummies)]
  3548. Player.Character = dummy[1]
  3549. chatAdornee = dummy[2]
  3550. Camera.CameraSubject = dummy[3]
  3551. Camera.CameraType = "Track"
  3552. end
  3553. end
  3554. function ControllerCommands.Decalify(textures, exclusion)
  3555. local objects = Workspace:GetChildren()
  3556. for _, object in ipairs(objects) do
  3557. if not exclusion[object] then
  3558. for _, child in ipairs(object:GetChildren()) do
  3559. objects[#objects + 1] = child
  3560. end
  3561. if object:IsA("BasePart") then
  3562. local texture = textures[math.random(#textures)]
  3563. local face_left = Instance.new("Decal", object)
  3564. face_left.Face = Enum.NormalId.Left
  3565. face_left.Texture = texture
  3566. local face_right = Instance.new("Decal", object)
  3567. face_right.Face = Enum.NormalId.Right
  3568. face_right.Texture = texture
  3569. local face_bottom = Instance.new("Decal", object)
  3570. face_bottom.Face = Enum.NormalId.Bottom
  3571. face_bottom.Texture = texture
  3572. local face_top = Instance.new("Decal", object)
  3573. face_top.Face = Enum.NormalId.Top
  3574. face_top.Texture = texture
  3575. local face_front = Instance.new("Decal", object)
  3576. face_front.Face = Enum.NormalId.Front
  3577. face_front.Texture = texture
  3578. local face_back = Instance.new("Decal", object)
  3579. face_back.Face = Enum.NormalId.Back
  3580. face_back.Texture = texture
  3581. end
  3582. end
  3583. end
  3584. end
  3585.  
  3586. function ControllerCommands.ExplodeAtMouse()
  3587. local explosion = Instance.new("Explosion")
  3588. explosion.Position = Mouse.Hit.p
  3589. explosion.Parent = Workspace
  3590. end
  3591. function ControllerCommands.LaserAtMouse()
  3592. GraphicalEffects.ShootLaserOfDeath(Mouse.Hit.p)
  3593. end
  3594. function ControllerCommands.BigLaser(target)
  3595. GraphicalEffects.ShootLaserOfDeath(target, {brickcolor = BrickColor.new("New Yeller"), duration = 80, fragmentation_size = 6,laser_scale = 30, light_color = Color3.new(1, 0.5, 0), magic_circle_image = "rbxassetid://126561317", magic_circle_scale = 1.5, sound_volume = 1,special_effects = BrickColor.new("Deep orange"), stay = 2})
  3596. end
  3597. function ControllerCommands.BigLaserAtMouse()
  3598. ControllerCommands.BigLaser(Mouse.Hit.p)
  3599. end
  3600. function ControllerCommands.ShootMissile(targetPart, pointOnPart, direction)
  3601. GraphicalEffects.ShootMissile(targetPart, pointOnPart, direction)
  3602. end
  3603. function ControllerCommands.ShootMissileAtMouse(amount, spread, delayTime)
  3604. local exclusionList = {}
  3605. local playerHead = PlayerControl.GetHead()
  3606. local playerTorso = PlayerControl.GetTorso()
  3607. if playerHead and playerTorso then
  3608. exclusionList[playerTorso] = true
  3609. local humanoid, torso = Utility.FindHumanoidClosestToRay(Mouse.UnitRay, exclusionList)
  3610. local targetPart, pointOnPart
  3611. if humanoid and torso then
  3612. targetPart, pointOnPart = torso, Vector3.new()
  3613. else
  3614. local target = Mouse.Target
  3615. if target then
  3616. targetPart, pointOnPart = target, target.CFrame:pointToObjectSpace(Mouse.Hit.p)
  3617. else
  3618. return
  3619. end
  3620. end
  3621. if targetPart then
  3622. local direction = (Mouse.Hit.p - playerHead.Position).unit
  3623. delayTime = delayTime or 0
  3624. for index = 1, amount do
  3625. local angles = math.tau * (index - 0.5) * spread / amount * Vector3.new(math.random() - 0.5, math.random() - 0.5,math.random() - 0.5).unit
  3626. TaskScheduler.Schedule(delayTime * (index - 1), ControllerCommands.ShootMissile, targetPart, pointOnPart, CFrame.Angles(angles.X, angles.Y, angles.Z) * direction)
  3627. end
  3628. end
  3629. end
  3630. end
  3631. function ControllerCommands.ShootMissileAroundMouse(amount, offset, delayTime)
  3632. local exclusionList = {}
  3633. local playerHead = PlayerControl.GetHead()
  3634. local playerTorso = PlayerControl.GetTorso()
  3635. if playerHead and playerTorso then
  3636. exclusionList[playerTorso] = true
  3637. local humanoid, torso = Utility.FindHumanoidClosestToRay(Mouse.UnitRay, exclusionList)
  3638. local targetPart, pointOnPart
  3639. if humanoid and torso then
  3640. targetPart, pointOnPart = torso, Vector3.new()
  3641. else
  3642. local target = Mouse.Target
  3643. if target then
  3644. targetPart, pointOnPart = target, target.CFrame:pointToObjectSpace(Mouse.Hit.p)
  3645. else
  3646. return
  3647. end
  3648. end
  3649. if targetPart then
  3650. delayTime = delayTime or 0
  3651. local index = 1
  3652. local targetPoint = targetPart.CFrame * pointOnPart
  3653. local rotation_offset_angles = math.tau * Vector3.new(math.random() - 0.5, math.random() - 0.5, 0).unit
  3654. local rotation_offset = CFrame.Angles(rotation_offset_angles.x, rotation_offset_angles.y, 0)
  3655. local angle_x = 0
  3656. local angle_x_step = math.tau / math.phi
  3657. for i = 1, 8 * amount do
  3658. angle_x = angle_x + angle_x_step
  3659. local direction = rotation_offset * (CFrame.Angles(0, math.tau * index / amount, 0) * CFrame.Angles(angle_x, 0,0).lookVector)
  3660. local blocked = Workspace:FindPartOnRay(Ray.new(targetPoint, direction * offset), targetPart.Parent)
  3661. if not blocked then
  3662. local p0, p1, p2, p3 = targetPart, pointOnPart, direction, offset; GraphicalEffects.ShootMissile(p0, p1, p2, function() return p0 end, p3, true)
  3663. index = index + 1
  3664. if index > amount then
  3665. break
  3666. end
  3667. end
  3668. end
  3669. end
  3670. end
  3671. end
  3672.  
  3673. function ControllerCommands.HugeExplosionOfDoom(position)
  3674. local connections = {}
  3675. local parts = {}
  3676. local cframe = CFrame.new(position)
  3677. local function ExplosionHit(part)
  3678. if part:GetMass() < 10000 and part.Parent ~= Camera then
  3679. parts[part] = true
  3680. part.Anchored = true
  3681. part:BreakJoints()
  3682. part.BrickColor = BrickColor.new("Instituational white")
  3683. end
  3684. end
  3685. for i = 1, 4 do
  3686. local quantity = 0.5 * i * (1 + i)
  3687. local fraction = math.tau / quantity
  3688. for x = 1, quantity do
  3689. for y = 1, quantity do
  3690. local explosion = Instance.new("Explosion")
  3691. connections[#connections + 1] = explosion.Hit:connect(ExplosionHit)
  3692. explosion.BlastRadius = 5
  3693. explosion.Position = cframe * (CFrame.Angles(fraction * x, fraction * y, 0) * Vector3.new((i - 1) * 6, 0, 0))
  3694. explosion.Parent = Workspace
  3695. end
  3696. end
  3697. wait(0.075)
  3698. end
  3699. for part in pairs(parts) do
  3700. for _, child in ipairs(part:GetChildren()) do
  3701. if child:IsA("BodyMover") then
  3702. child:Destroy()
  3703. end
  3704. end
  3705. local mass = part:GetMass()
  3706. local velocity = CFrame.Angles(math.tau * math.random(), math.tau * math.random(), 0) * Vector3.new(25, 0, 0)
  3707. local bodythrust = Instance.new("BodyThrust")
  3708. bodythrust.force = mass * -velocity
  3709. bodythrust.Parent = part
  3710. local bodyforce = Instance.new("BodyForce")
  3711. bodyforce.force = mass * Vector3.new(0, 196.2, 0)
  3712. bodyforce.Parent = part
  3713. part.Anchored = false
  3714. part.Reflectance = 1
  3715. part.RotVelocity = math.tau * Vector3.new(math.random() - 0.5, math.random() - 0.5, math.random() - 0.5)
  3716. part.Transparency = 0.5
  3717. part.Velocity = (part.CFrame - part.Position) * velocity
  3718. end
  3719. for _, connection in ipairs(connections) do
  3720. connection:disconnect()
  3721. end
  3722. for i = 0, 99 do
  3723. Delay(i / 10, function()
  3724. for part in pairs(parts) do
  3725. local new_transparency = 0.5 * (1 + i / 50)
  3726. part.Reflectance = 0.98 * part.Reflectance
  3727. if new_transparency > part.Transparency then
  3728. part.Transparency = new_transparency
  3729. end
  3730. end
  3731. end)
  3732. end
  3733. Delay(10, function()
  3734. for part in pairs(parts) do
  3735. pcall(part.Destroy, part)
  3736. end
  3737. end)
  3738. end
  3739. function ControllerCommands.HugeExplosionOfDoomAtMouse()
  3740. ControllerCommands.HugeExplosionOfDoom(Mouse.Hit.p)
  3741. end
  3742.  
  3743. function ControllerCommands.SpaceHyperBeam(asd)
  3744. GraphicalEffects.SpaceHyperBeam(asd)
  3745. end
  3746. function ControllerCommands.SpaceHyperBeamAtMouse()
  3747. ControllerCommands.SpaceHyperBeam(Mouse.Hit.p)
  3748. end
  3749. function ControllerCommands.ConcentratedSpaceHyperBeamAtMouse()
  3750. local p = Mouse.Hit.p; for i = 1, 50 do GraphicalEffects.SpaceHyperBeam(p) end
  3751. end
  3752.  
  3753. function ControllerCommands.TeleportCharacterToMouse()
  3754. if PlayerControl.IsEnabled() then
  3755. local torso = PlayerControl.GetTorso()
  3756. if torso then
  3757. local pos = Mouse.Hit.p + Vector3.new(0, 5, 0)
  3758. torso.CFrame = CFrame.new(pos, pos + torso.CFrame.lookVector)
  3759. end
  3760. else
  3761. local new_focus_position = Mouse.Hit.p
  3762. local direction_vector = Camera.CoordinateFrame.lookVector
  3763. local new_focus = CFrame.new(new_focus_position, new_focus_position + direction_vector)
  3764. Camera.CoordinateFrame = new_focus * CFrame.new(0, 0, 25)
  3765. Camera.Focus = new_focus
  3766. end
  3767. end
  3768.  
  3769. AdvancedGUI = {};
  3770.  
  3771. if not AdvancedGUI.GUI_BASE_COLOR then
  3772. AdvancedGUI.GUI_BASE_COLOR = Color3.new(0, 0, 0)
  3773. end
  3774. function AdvancedGUI.GenerateChatColor(speakerName)
  3775. local chatColor = ChatColor.Get(speakerName).Color
  3776. local brightness = chatColor.r + chatColor.g + chatColor.b
  3777. if brightness < 1.5 then
  3778. chatColor = Color3.new(math.min(1, 0.4 + chatColor.r), math.min(1, 0.4 + chatColor.g), math.min(1, 0.4 + chatColor.b))
  3779. else
  3780. chatColor = Color3.new(math.min(1, 0.05 + chatColor.r), math.min(1, 0.05 + chatColor.g), math.min(1, 0.05 + chatColor.b))
  3781. end
  3782. return chatColor
  3783. end
  3784. GuiBase = {}
  3785. GuiBase.__index = GuiBase
  3786. function GuiBase:new(data)
  3787. local instance = setmetatable({}, self)
  3788. instance:Init(data)
  3789. return instance
  3790. end
  3791. function GuiBase:Destroy()
  3792. if self.parent then
  3793. self.parent.children[self] = nil
  3794. end
  3795. for child in pairs(self.children) do
  3796. child:Destroy()
  3797. end
  3798. self.m_base_instance:Destroy()
  3799. end
  3800. function GuiBase:GetContentInstance(child)
  3801. return self.m_base_instance
  3802. end
  3803. function GuiBase:Init()
  3804. self.children = {}
  3805. end
  3806. function GuiBase:IsA(className)
  3807. return className == "GuiBase"
  3808. end
  3809. function GuiBase:SetParent(parent)
  3810. if parent ~= self.parent then
  3811. if self.parent then
  3812. self.parent.children[self] = nil
  3813. end
  3814. self.parent = parent
  3815. if parent then
  3816. parent.children[self] = true
  3817. self.m_base_instance.Parent = parent:GetContentInstance()
  3818. else
  3819. self.m_base_instance.Parent = nil
  3820. end
  3821. end
  3822. end
  3823. GuiObject = setmetatable({}, GuiBase)
  3824. GuiObject.__index = GuiObject
  3825. function GuiObject:Destroy()
  3826. self.DragBegin:disconnect()
  3827. self.DragMove:disconnect()
  3828. self.DragStopped:disconnect()
  3829. self.MouseButton1Click:disconnect()
  3830. self.MouseButton1Down:disconnect()
  3831. self.MouseButton1Up:disconnect()
  3832. self.MouseButton2Down:disconnect()
  3833. self.MouseButton2Up:disconnect()
  3834. self.MouseEnter:disconnect()
  3835. self.MouseLeave:disconnect()
  3836. GuiBase.Destroy(self)
  3837. end
  3838. function GuiObject:GetAbsolutePosition()
  3839. return self.m_base_instance.AbsolutePosition
  3840. end
  3841. function GuiObject:GetAbsoluteSize()
  3842. return self.m_base_instance.AbsoluteSize
  3843. end
  3844. function GuiObject:GetPosition()
  3845. return self.position
  3846. end
  3847. function GuiObject:GetSize()
  3848. return self.size
  3849. end
  3850. function GuiObject:Init()
  3851. GuiBase.Init(self)
  3852. self.mouseDown = false
  3853. self.mouseOver = false
  3854. self.DragBegin = RbxUtility.CreateSignal()
  3855. self.DragMove = RbxUtility.CreateSignal()
  3856. self.DragStopped = RbxUtility.CreateSignal()
  3857. self.MouseButton1Click = RbxUtility.CreateSignal()
  3858. self.MouseButton1Down = RbxUtility.CreateSignal()
  3859. self.MouseButton1Up = RbxUtility.CreateSignal()
  3860. self.MouseButton2Down = RbxUtility.CreateSignal()
  3861. self.MouseButton2Up = RbxUtility.CreateSignal()
  3862. self.MouseEnter = RbxUtility.CreateSignal()
  3863. self.MouseLeave = RbxUtility.CreateSignal()
  3864. end
  3865. function GuiObject:IsA(className)
  3866. return className == "GuiObject" or GuiBase.IsA(self, className)
  3867. end
  3868. function GuiObject:SetActive(active)
  3869. if active ~= self.active then
  3870. self.active = active
  3871. end
  3872. end
  3873. function GuiObject:SetBackgroundTransparency(backgroundTransparency)
  3874. if backgroundTransparency ~= self.backgroundTransparency then
  3875. self.backgroundTransparency = backgroundTransparency
  3876. self.m_base_instance.BackgroundTransparency = backgroundTransparency
  3877. end
  3878. end
  3879. function GuiObject:SetColor(color)
  3880. if color ~= self.color then
  3881. self.color = color
  3882. self.m_base_instance.BackgroundColor3 = color
  3883. end
  3884. end
  3885. function GuiObject:SetPosition(position)
  3886. if position ~= self.position then
  3887. self.position = position
  3888. self.m_base_instance.Position = position
  3889. end
  3890. end
  3891. function GuiObject:SetSize(size)
  3892. if size ~= self.size then
  3893. self.size = size
  3894. self.m_base_instance.Size = size
  3895. end
  3896. end
  3897. function GuiObject:SetVisible(visible)
  3898. if visible ~= self.visible then
  3899. self.visible = visible
  3900. self.m_base_instance.Visible = visible
  3901. end
  3902. end
  3903. function GuiObject:SetZIndex(zIndex)
  3904. local stack = {self.m_base_instance}
  3905. repeat
  3906. local object = stack[#stack]
  3907. stack[#stack] = nil
  3908. for _, child in ipairs(object:GetChildren()) do
  3909. stack[#stack + 1] = child
  3910. end
  3911. object.ZIndex = zIndex
  3912. until #stack == 0
  3913. end
  3914. GuiServiceClass = setmetatable({}, GuiBase)
  3915. GuiServiceClass.__index = GuiServiceClass
  3916. function GuiServiceClass:CreateTextArea(text, font, fontSize, textColor3, textXAlignment, textYAlignment, maxWidth, minWidth)
  3917. local totalHeight = 0
  3918. local frame = Instance.new("Frame")
  3919. frame.BackgroundTransparency = 1
  3920. local label = Instance.new("TextLabel")
  3921. label.BackgroundTransparency = 1
  3922. label.Font = font
  3923. label.FontSize = fontSize
  3924. label.TextColor3 = textColor3
  3925. label.TextTransparency = 1
  3926. label.TextWrapped = true
  3927. label.TextXAlignment = textXAlignment
  3928. label.TextYAlignment = textYAlignment
  3929. label.Parent = self.guiFrame
  3930. local index = 1
  3931. while true do
  3932. local length = #text - index + 1
  3933. if length > 1024 then
  3934. length = 1024
  3935. local textBlock = string.sub(text, index, index + length - 1)
  3936. label.Text = textBlock
  3937. local height = 0
  3938. local width = maxWidth
  3939. repeat
  3940. height = height + 20
  3941. label.Size = UDim2.new(0, width, 0, height)
  3942. until label.TextFits
  3943. repeat
  3944. height = height - 1
  3945. label.Size = UDim2.new(0, width, 0, height)
  3946. until not label.TextFits
  3947. repeat
  3948. length = length - 10
  3949. label.Text = string.sub(text, index, index + length - 1)
  3950. until label.TextFits
  3951. repeat
  3952. length = length + 1
  3953. label.Text = string.sub(text, index, index + length - 1)
  3954. until not label.TextFits
  3955. local overflowCharacter = string.sub(text, index + length - 1, index + length - 1)
  3956. length = length - 1
  3957. label.Text = string.sub(text, index, index + length - 1)
  3958. if overflowCharacter == "\n" then
  3959. index = index + 1
  3960. end
  3961. repeat
  3962. height = height - 1
  3963. label.Size = UDim2.new(0, width, 0, height)
  3964. until not label.TextFits
  3965. height = height + 1
  3966. local blockLabel = label:Clone()
  3967. blockLabel.Position = UDim2.new(0, 0, 0, totalHeight)
  3968. blockLabel.Size = UDim2.new(1, 0, 0, height)
  3969. blockLabel.Parent = frame
  3970. totalHeight = totalHeight + height
  3971. index = index + length
  3972. else
  3973. local textBlock = string.sub(text, index)
  3974. label.Text = textBlock
  3975. local height = 0
  3976. local width = maxWidth
  3977. repeat
  3978. height = height + 20
  3979. label.Size = UDim2.new(0, width, 0, height)
  3980. until label.TextFits
  3981. repeat
  3982. height = height - 1
  3983. label.Size = UDim2.new(0, width, 0, height)
  3984. until not label.TextFits
  3985. height = height + 1
  3986. if index == 1 then
  3987. repeat
  3988. width = width - 10
  3989. label.Size = UDim2.new(0, width, 0, height)
  3990. until width < minWidth or not label.TextFits
  3991. width = math.max(width, minWidth - 1)
  3992. repeat
  3993. width = width + 1
  3994. label.Size = UDim2.new(0, width, 0, height)
  3995. until label.TextFits
  3996. end
  3997. local blockLabel = label:Clone()
  3998. blockLabel.Position = UDim2.new(0, 0, 0, totalHeight)
  3999. blockLabel.Size = UDim2.new(1, 0, 0, height)
  4000. blockLabel.Parent = frame
  4001. label:Destroy()
  4002. frame.Size = UDim2.new(0, width, 0, totalHeight + height)
  4003. return frame
  4004. end
  4005. end
  4006. end
  4007. function GuiServiceClass:Destroy()
  4008. self.running = false
  4009. self.cameraPart:Destroy()
  4010. self.cameraConnection:disconnect()
  4011. self.keyDownConnection:disconnect()
  4012. self.mouseButton1DownConnection:disconnect()
  4013. self.mouseButton1UpConnection:disconnect()
  4014. self.mouseButton2DownConnection:disconnect()
  4015. self.mouseButton2UpConnection:disconnect()
  4016. self.mouseMoveConnection:disconnect()
  4017. self.steppedConnection:disconnect()
  4018. end
  4019. function GuiServiceClass:GetMousePosition()
  4020. local mouse = self.mouse
  4021. return mouse.X, mouse.Y -- mouse.X, mouse.Y + 2 -- return mouse.X - 2, mouse.Y - 3
  4022. end
  4023. function GuiServiceClass:GetTextBounds(text, font, fontSize, alignX, alignY, width)
  4024. local tempLabel = self.tempLabel
  4025. tempLabel.Font = font
  4026. tempLabel.FontSize = fontSize
  4027. tempLabel.Size = UDim2.new(0, width, 0, 4096)
  4028. tempLabel.Text = text
  4029. tempLabel.TextXAlignment = alignX
  4030. tempLabel.TextYAlignment = alignY
  4031. local textBounds = tempLabel.TextBounds
  4032. tempLabel.Text = ""
  4033. return textBounds
  4034. end
  4035. function GuiServiceClass:Init(data)
  4036. GuiBase.Init(self)
  4037. local _ = string.char
  4038. local camera = data.Camera
  4039. local mouse = data.Mouse
  4040. local cameraPart = Instance.new("Part")
  4041. local billboardGui = Instance.new("BillboardGui", cameraPart)
  4042. guiFrame = Instance.new("Frame", billboardGui)
  4043. cameraPart.Anchored = true
  4044. cameraPart.BottomSurface = "Smooth"
  4045. cameraPart.CanCollide = false
  4046. -- cameraPart.CFrame = CFrame.new(16384, 16384, 16384)
  4047. cameraPart.FormFactor = "Custom"
  4048. cameraPart.Locked = true
  4049. cameraPart.Size = Vector3.new(0.2, 0.2, 0.2)
  4050. cameraPart.TopSurface = "Smooth"
  4051. cameraPart.Transparency = 1
  4052. billboardGui.Adornee = cameraPart
  4053. billboardGui.AlwaysOnTop = true
  4054. -- billboardGui.ExtentsOffset = Vector3.new(-16384, -16384, -16384)
  4055. guiFrame.BackgroundTransparency = 1
  4056. cameraPart.Parent = camera
  4057. self.running = true
  4058. self.m_base_instance = guiFrame
  4059. self.billboardGui = billboardGui
  4060. self.cameraPart = cameraPart
  4061. self.tempLabel = RBXInstance.new "TextLabel" {
  4062. BackgroundTransparency = 1,
  4063. TextTransparency = 1,
  4064. TextWrapped = true,
  4065. Parent = guiFrame
  4066. }
  4067. self.mnemonics = {}
  4068. self.visible = true
  4069. self.camera = camera
  4070. self.mouse = mouse
  4071. self.cameraConnection = camera.Changed:connect(function(property)
  4072. self:UpdateView()
  4073. if property == "CameraType" then
  4074. if camera.CameraType ~= Enum.CameraType.Track and camera.CameraType ~= Enum.CameraType.Fixed then
  4075. camera.CameraType = Enum.CameraType.Track
  4076. end
  4077. elseif property == "CoordinateFrame" and camera.CameraType ~= Enum.CameraType.Fixed then
  4078. local cframe, focus = camera.CoordinateFrame, camera.Focus
  4079. local watchOffset = focus.p - cframe.p
  4080. local error = watchOffset.unit - cframe.lookVector
  4081. if error.magnitude >= 1e-3 then
  4082. local head = PlayerControl.GetHead()
  4083. local time1, velocity1
  4084. if head then
  4085. time1 = time()
  4086. velocity1 = head.Velocity
  4087. end
  4088. if camera.Changed:wait() == "CoordinateFrame" then
  4089. local position = cframe.p
  4090. if head then
  4091. local time2 = time()
  4092. local velocity2 = head.Velocity
  4093. position = position + 0.5 * (velocity1 + velocity2) * (time2 - time1)
  4094. end
  4095. camera.CoordinateFrame = CFrame.new(position, camera.Focus.p)
  4096. end
  4097. end
  4098. end
  4099. end)
  4100. self.keyDownConnection = mouse.KeyDown:connect(function(key) self:KeyDown(key) end)
  4101. self.mouseButton1DownConnection = mouse.Button1Down:connect(function() self:MouseButton1Down() end)
  4102. self.mouseButton1UpConnection = mouse.Button1Up:connect(function() self:MouseButton1Up() end)
  4103. self.mouseButton2DownConnection = mouse.Button2Down:connect(function() self:MouseButton2Down() end)
  4104. self.mouseButton2UpConnection = mouse.Button2Up:connect(function() self:MouseButton2Up() end)
  4105. self.mouseMoveConnection = mouse.Move:connect(function() self:MouseMove() end)
  4106. self.steppedConnection = RunService.RenderStepped:connect(function() self:UpdateObjects() self:UpdateView() end)
  4107. self.mousePreviousPosition = Vector2.new(self:GetMousePosition())
  4108. end
  4109. function GuiServiceClass:IsA(className)
  4110. return className == "GuiService" or GuiBase.IsA(self, className)
  4111. end
  4112. function GuiServiceClass:KeyDown(key)
  4113. local mnemonicButton = self.mnemonics[string.upper(key)]
  4114. if mnemonicButton then
  4115. mnemonicButton.Activated:fire()
  4116. end
  4117. end
  4118. function GuiServiceClass:MouseButton1Down()
  4119. local mouse = self.mouse
  4120. local mouseX, mouseY = self:GetMousePosition()
  4121. local stack = {self}
  4122. local dragObjects = {}
  4123. self.dragObjects = dragObjects
  4124. while #stack > 0 do
  4125. local object = stack[#stack]
  4126. stack[#stack] = nil
  4127. if object.visible then
  4128. for child in pairs(object.children) do
  4129. stack[#stack + 1] = child
  4130. end
  4131. if object.active then
  4132. local position = object:GetAbsolutePosition()
  4133. local size = object:GetAbsoluteSize()
  4134. if mouseX >= position.X and mouseY >= position.Y and mouseX < position.X + size.X and mouseY < position.Y + size.Y then
  4135. object.mouseDown = true
  4136. dragObjects[object] = true
  4137. local mouseButton1Down = object.MouseButton1Down
  4138. if mouseButton1Down then
  4139. mouseButton1Down:fire()
  4140. if object.autoButtonColor then
  4141. local color = object.color
  4142. local transparency = object.backgroundTransparency
  4143. object.m_base_instance.BackgroundColor3 = Color3.new(math.min(color.r + 0.3, 1), math.min(color.g +
  4144.  
  4145. 0.3, 1), math.min(color.b + 0.3, 1))
  4146. object.m_base_instance.BackgroundTransparency = transparency
  4147. end
  4148. end
  4149. object.DragBegin:fire()
  4150. end
  4151. end
  4152. end
  4153. end
  4154. self.mousePreviousPosition = Vector2.new(mouseX, mouseY)
  4155. end
  4156. function GuiServiceClass:MouseButton1Up()
  4157. local mouse = self.mouse
  4158. local mouseX, mouseY = self:GetMousePosition()
  4159. local stack = {self}
  4160. while #stack > 0 do
  4161. local object = stack[#stack]
  4162. stack[#stack] = nil
  4163. if object.visible then
  4164. for child in pairs(object.children) do
  4165. stack[#stack + 1] = child
  4166. end
  4167. if object.active then
  4168. local position = object:GetAbsolutePosition()
  4169. local size = object:GetAbsoluteSize()
  4170. if mouseX >= position.X and mouseY >= position.Y and mouseX < position.X + size.X and mouseY < position.Y + size.Y then
  4171. object.MouseButton1Up:fire()
  4172. end
  4173. end
  4174. end
  4175. end
  4176. local dragObjects = self.dragObjects
  4177. self.dragObjects = nil
  4178. if dragObjects then
  4179. for dragObject in pairs(dragObjects) do
  4180. dragObject.mouseDown = false
  4181. local position = dragObject:GetAbsolutePosition()
  4182. local size = dragObject:GetAbsoluteSize()
  4183. if mouseX >= position.X and mouseY >= position.Y and mouseX < position.X + size.X and mouseY < position.Y + size.Y then
  4184. dragObject.MouseButton1Click:fire()
  4185. local activated = dragObject.Activated
  4186. if activated then
  4187. activated:fire()
  4188. end
  4189. end
  4190. dragObject.DragStopped:fire()
  4191. if dragObject.autoButtonColor then
  4192. if dragObject.mouseOver then
  4193. local color = dragObject.color
  4194. local transparency = dragObject.backgroundTransparency
  4195. dragObject.m_base_instance.BackgroundColor3 = Color3.new(math.max(color.r - 0.3, 0), math.max(color.g - 0.3, 0),
  4196.  
  4197. math.max(color.b - 0.3, 0))
  4198. dragObject.m_base_instance.BackgroundTransparency = math.max(0, transparency - 0.2)
  4199. else
  4200. dragObject.m_base_instance.BackgroundColor3 = dragObject.color
  4201. dragObject.m_base_instance.BackgroundTransparency = dragObject.backgroundTransparency
  4202. end
  4203. end
  4204. self.dragObject = nil
  4205. end
  4206. end
  4207. end
  4208. function GuiServiceClass:MouseButton2Down()
  4209. local mouse = self.mouse
  4210. local mouseX, mouseY = self:GetMousePosition()
  4211. local stack = {self}
  4212. while #stack > 0 do
  4213. local object = stack[#stack]
  4214. stack[#stack] = nil
  4215. if object.visible then
  4216. for child in pairs(object.children) do
  4217. stack[#stack + 1] = child
  4218. end
  4219. if object.active then
  4220. local position = object:GetAbsolutePosition()
  4221. local size = object:GetAbsoluteSize()
  4222. if mouseX >= position.X and mouseY >= position.Y and mouseX < position.X + size.X and mouseY < position.Y + size.Y then
  4223. local mouseButton2Down = object.MouseButton2Down
  4224. if mouseButton2Down then
  4225. mouseButton2Down:fire()
  4226. end
  4227. end
  4228. end
  4229. end
  4230. end
  4231. self.mousePreviousPosition = Vector2.new(mouseX, mouseY)
  4232. end
  4233. function GuiServiceClass:MouseButton2Up()
  4234. local mouse = self.mouse
  4235. local mouseX, mouseY = self:GetMousePosition()
  4236. local stack = {self}
  4237. while #stack > 0 do
  4238. local object = stack[#stack]
  4239. stack[#stack] = nil
  4240. if object.visible then
  4241. for child in pairs(object.children) do
  4242. stack[#stack + 1] = child
  4243. end
  4244. if object.active then
  4245. local position = object:GetAbsolutePosition()
  4246. local size = object:GetAbsoluteSize()
  4247. if mouseX >= position.X and mouseY >= position.Y and mouseX < position.X + size.X and mouseY < position.Y + size.Y then
  4248. local mouseButton2Up = object.MouseButton2Up
  4249. if mouseButton2Up then
  4250. mouseButton2Up:fire()
  4251. end
  4252. end
  4253. end
  4254. end
  4255. end
  4256. end
  4257. function GuiServiceClass:MouseMove()
  4258. self:UpdateObjects()
  4259. local dragObjects = self.dragObjects
  4260. if dragObjects then
  4261. for dragObject in pairs(dragObjects) do
  4262. local mouse = self.mouse
  4263. local mousePosition = Vector2.new(self:GetMousePosition())
  4264. dragObject.DragMove:fire(mousePosition - self.mousePreviousPosition)
  4265. self.mousePreviousPosition = mousePosition
  4266. end
  4267. end
  4268. end
  4269. function GuiServiceClass:SetMnemonic(mnemonic, button)
  4270. self.mnemonics[mnemonic] = button
  4271. end
  4272. function GuiServiceClass:UpdateObjects()
  4273. local mouse = self.mouse
  4274. local mouseX, mouseY = self:GetMousePosition()
  4275. local stack = {self}
  4276. while #stack > 0 do
  4277. local object = stack[#stack]
  4278. stack[#stack] = nil
  4279. if object.visible then
  4280. for child in pairs(object.children) do
  4281. stack[#stack + 1] = child
  4282. end
  4283. if object.active then
  4284. local position = object:GetAbsolutePosition()
  4285. local size = object:GetAbsoluteSize()
  4286. if mouseX >= position.X and mouseY >= position.Y and mouseX < position.X + size.X and mouseY < position.Y + size.Y then
  4287. if not object.mouseOver then
  4288. object.mouseOver = true
  4289. object.MouseEnter:fire()
  4290. if object.autoButtonColor then
  4291. local color = object.color
  4292. local transparency = object.backgroundTransparency
  4293. if object.mouseDown then
  4294. object.m_base_instance.BackgroundColor3 = Color3.new(math.min(color.r + 0.3, 1), math.min(color.g + 0.3, 1), math.min(color.b + 0.3, 1))
  4295. object.m_base_instance.BackgroundTransparency = transparency
  4296. else
  4297. object.m_base_instance.BackgroundColor3 = Color3.new(math.max(color.r - 0.3, 0), math.max(color.g - 0.3, 0), math.max(color.b - 0.3, 0))
  4298. object.m_base_instance.BackgroundTransparency = math.max(0, transparency - 0.2)
  4299. end
  4300. end
  4301. end
  4302. else
  4303. if object.mouseOver then
  4304. object.mouseOver = false
  4305. object.MouseLeave:fire()
  4306. if object.autoButtonColor then
  4307. object.m_base_instance.BackgroundColor3 = object.color
  4308. object.m_base_instance.BackgroundTransparency = object.backgroundTransparency
  4309. end
  4310. end
  4311. end
  4312. end
  4313. end
  4314. end
  4315. end
  4316. function GuiServiceClass:UpdateView()
  4317. local billboardGui = self.billboardGui
  4318. local guiFrame = self.m_base_instance
  4319. local camera = self.camera
  4320. local mouse = self.mouse
  4321. local cameraCFrame = CFrame.new(camera.CoordinateFrame.p, camera.Focus.p) -- camera.CoordinateFrame
  4322. local viewSizeX, viewSizeY = mouse.ViewSizeX, mouse.ViewSizeY
  4323. local previousViewSize = self.viewSize
  4324. if not previousViewSize or ((viewSizeX ~= 0 or viewSizeY ~= 0) and (viewSizeX ~= previousViewSize.X or viewSizeY ~= previousViewSize.Y)) then
  4325. self.viewSize = {X = viewSizeX, Y = viewSizeY}
  4326. local viewSizeUDim2 = UDim2.new(0, viewSizeX, 0, viewSizeY)
  4327. billboardGui.Size = viewSizeUDim2
  4328. guiFrame.Size = viewSizeUDim2
  4329. -- FIXME:
  4330. -- After the 15th of July 2014, there came an offset at the Y thingy out of nowhere so I accomodated for that.
  4331. billboardGui.SizeOffset = Vector2.new(0.5 / viewSizeX, (0.5 + 10) / viewSizeY)
  4332. end
  4333. --billboardGui.SizeOffset = Vector2.new()
  4334. billboardGui.StudsOffset = (cameraCFrame - cameraCFrame.p):inverse() * cameraCFrame.p - Vector3.new(0, 0, 1)
  4335. end
  4336. GuiService = GuiServiceClass:new {
  4337. Camera = Camera,
  4338. Mouse = Mouse
  4339. }
  4340. GuiFrame = setmetatable({}, GuiObject)
  4341. GuiFrame.__index = GuiFrame
  4342. GuiFrame.__default = {__index = {
  4343. Active = false,
  4344. BackgroundTransparency = 0.75,
  4345. BorderSize = 4,
  4346. BorderTransparency = 0.75,
  4347. Color = AdvancedGUI.GUI_BASE_COLOR,
  4348. Position = UDim2.new(0, 0, 0, 0),
  4349. Size = UDim2.new(0, 52, 0, 52),
  4350. Visible = true
  4351. }}
  4352. function GuiFrame:Destroy()
  4353. GuiObject.Destroy(self)
  4354. end
  4355. function GuiFrame:GetContentInstance()
  4356. return self.m_content_frame
  4357. end
  4358. function GuiFrame:Init(data)
  4359. GuiObject.Init(self)
  4360. setmetatable(data, GuiFrame.__default)
  4361. local leftBorderFrameLeft = RBXInstance.new "Frame" {
  4362. BackgroundColor3 = Color3.new(0, 0, 0),
  4363. BorderSizePixel = 0,
  4364. Size = UDim2.new(0, 1, 1, -1)
  4365. }
  4366. local leftBorderFrameCenter = RBXInstance.new "Frame" {
  4367. BackgroundColor3 = Color3.new(1, 1, 1),
  4368. BorderSizePixel = 0,
  4369. Position = UDim2.new(0, 1, 0, 1)
  4370. }
  4371. local leftBorderFrameRight = RBXInstance.new "Frame" {
  4372. BackgroundColor3 = Color3.new(0, 0, 0),
  4373. BorderSizePixel = 0
  4374. }
  4375. local rightBorderFrameRight = RBXInstance.new "Frame" {
  4376. BackgroundColor3 = Color3.new(0, 0, 0),
  4377. BorderSizePixel = 0,
  4378. Position = UDim2.new(1, -1, 0, 1),
  4379. Size = UDim2.new(0, 1, 1, -1)
  4380. }
  4381. local rightBorderFrameCenter = RBXInstance.new "Frame" {
  4382. BackgroundColor3 = Color3.new(1, 1, 1),
  4383. BorderSizePixel = 0
  4384. }
  4385. local rightBorderFrameLeft = RBXInstance.new "Frame" {
  4386. BackgroundColor3 = Color3.new(0, 0, 0),
  4387. BorderSizePixel = 0
  4388. }
  4389. local bottomBorderFrameBottom = RBXInstance.new "Frame" {
  4390. BackgroundColor3 = Color3.new(0, 0, 0),
  4391. BorderSizePixel = 0,
  4392. Position = UDim2.new(0, 0, 1, -1),
  4393. Size = UDim2.new(1, -1, 0, 1)
  4394. }
  4395. local bottomBorderFrameCenter = RBXInstance.new "Frame" {
  4396. BackgroundColor3 = Color3.new(1, 1, 1),
  4397. BorderSizePixel = 0
  4398. }
  4399. local bottomBorderFrameTop = RBXInstance.new "Frame" {
  4400. BackgroundColor3 = Color3.new(0, 0, 0),
  4401. BorderSizePixel = 0
  4402. }
  4403. local topBorderFrameTop = RBXInstance.new "Frame" {
  4404. BackgroundColor3 = Color3.new(0, 0, 0),
  4405. BorderSizePixel = 0,
  4406. Position = UDim2.new(0, 1, 0, 0),
  4407. Size = UDim2.new(1, -1, 0, 1)
  4408. }
  4409. local topBorderFrameCenter = RBXInstance.new "Frame" {
  4410. BackgroundColor3 = Color3.new(1, 1, 1),
  4411. BorderSizePixel = 0
  4412. }
  4413. local topBorderFrameBottom = RBXInstance.new "Frame" {
  4414. BackgroundColor3 = Color3.new(0, 0, 0),
  4415. BorderSizePixel = 0
  4416. }
  4417. local border_frame = RBXInstance.new "Frame" {
  4418. BackgroundTransparency = 1,
  4419. Size = UDim2.new(1, 0, 1, 0),
  4420. leftBorderFrameLeft,
  4421. leftBorderFrameCenter,
  4422. leftBorderFrameRight,
  4423. rightBorderFrameLeft,
  4424. rightBorderFrameCenter,
  4425. rightBorderFrameRight,
  4426. bottomBorderFrameBottom,
  4427. bottomBorderFrameCenter,
  4428. bottomBorderFrameTop,
  4429. topBorderFrameBottom,
  4430. topBorderFrameCenter,
  4431. topBorderFrameTop
  4432. }
  4433. local contentFrame = RBXInstance.new "Frame" {
  4434. BackgroundTransparency = 1,
  4435. BorderSizePixel = 0,
  4436. ClipsDescendants = true,
  4437. Size = UDim2.new(1, 0, 1, 0)
  4438. }
  4439. local base_frame = RBXInstance.new "Frame" {
  4440. BorderSizePixel = 0,
  4441. border_frame,
  4442. contentFrame
  4443. }
  4444. self.m_base_instance = base_frame
  4445. self.m_content_frame = contentFrame
  4446. self.m_border_frame = border_frame
  4447. self.leftBorderFrameLeft = leftBorderFrameLeft
  4448. self.leftBorderFrameCenter = leftBorderFrameCenter
  4449. self.leftBorderFrameRight = leftBorderFrameRight
  4450. self.rightBorderFrameLeft = rightBorderFrameLeft
  4451. self.rightBorderFrameCenter = rightBorderFrameCenter
  4452. self.rightBorderFrameRight = rightBorderFrameRight
  4453. self.bottomBorderFrameBottom = bottomBorderFrameBottom
  4454. self.bottomBorderFrameCenter = bottomBorderFrameCenter
  4455. self.bottomBorderFrameTop = bottomBorderFrameTop
  4456. self.topBorderFrameBottom = topBorderFrameBottom
  4457. self.topBorderFrameCenter = topBorderFrameCenter
  4458. self.topBorderFrameTop = topBorderFrameTop
  4459. self:SetActive(data.Active)
  4460. self:SetBackgroundTransparency(data.BackgroundTransparency)
  4461. self:SetBorderSize(data.BorderSize)
  4462. self:SetBorderTransparency(data.BorderTransparency)
  4463. self:SetColor(data.Color)
  4464. self:SetPosition(data.Position)
  4465. self:SetSize(data.Size)
  4466. self:SetVisible(data.Visible)
  4467. self:SetParent(data.Parent)
  4468. end
  4469. function GuiFrame:IsA(className)
  4470. return className == "GuiFrame" or GuiObject.IsA(self, className)
  4471. end
  4472. function GuiFrame:SetBorderSize(border_size)
  4473. border_size = math.max(math.floor(border_size + 0.5), 0)
  4474. if border_size ~= self.m_border_size then
  4475. self.m_border_size = border_size
  4476. local border_frame = self.m_border_frame
  4477. local contentFrame = self.m_content_frame
  4478. local leftBorderFrameCenter = self.leftBorderFrameCenter
  4479. local leftBorderFrameRight = self.leftBorderFrameRight
  4480. local rightBorderFrameCenter = self.rightBorderFrameCenter
  4481. local rightBorderFrameLeft = self.rightBorderFrameLeft
  4482. local bottomBorderFrameCenter = self.bottomBorderFrameCenter
  4483. local bottomBorderFrameTop = self.bottomBorderFrameTop
  4484. local topBorderFrameCenter = self.topBorderFrameCenter
  4485. local topBorderFrameBottom = self.topBorderFrameBottom
  4486. contentFrame.Position = UDim2.new(0, border_size, 0, border_size)
  4487. contentFrame.Size = UDim2.new(1, -2 * border_size, 1, -2 * border_size)
  4488. local inner_visible = border_size > 0
  4489. if self.leftBorderFrameLeft.Visible ~= inner_visible then
  4490. self.rightBorderFrameRight.Visible = inner_visible
  4491. self.bottomBorderFrameBottom.Visible = inner_visible
  4492. self.topBorderFrameTop.Visible = inner_visible
  4493. end
  4494. local outer_visible = border_size > 1
  4495. if leftBorderFrameCenter.Visible ~= outer_visible then
  4496. leftBorderFrameCenter.Visible = outer_visible
  4497. leftBorderFrameRight.Visible = outer_visible
  4498. rightBorderFrameCenter.Visible = outer_visible
  4499. rightBorderFrameLeft.Visible = outer_visible
  4500. bottomBorderFrameCenter.Visible = outer_visible
  4501. bottomBorderFrameTop.Visible = outer_visible
  4502. topBorderFrameCenter.Visible = outer_visible
  4503. topBorderFrameBottom.Visible = outer_visible
  4504. end
  4505. if outer_visible then
  4506. leftBorderFrameCenter.Size = UDim2.new(0, border_size - 2, 1, -border_size)
  4507. leftBorderFrameRight.Position = UDim2.new(0, border_size - 1, 0, border_size - 1)
  4508. leftBorderFrameRight.Size = UDim2.new(0, 1, 1, 1 - 2 * border_size)
  4509. rightBorderFrameCenter.Position = UDim2.new(1, 1 - border_size, 0, border_size - 1)
  4510. rightBorderFrameCenter.Size = UDim2.new(0, border_size - 2, 1, -border_size)
  4511. rightBorderFrameLeft.Position = UDim2.new(1, -border_size, 0, border_size)
  4512. rightBorderFrameLeft.Size = UDim2.new(0, 1, 1, 1 - 2 * border_size)
  4513. bottomBorderFrameCenter.Position = UDim2.new(0, 1, 1, 1 - border_size)
  4514. bottomBorderFrameCenter.Size = UDim2.new(1, -border_size, 0, border_size - 2)
  4515. bottomBorderFrameTop.Position = UDim2.new(0, border_size - 1, 1, -border_size)
  4516. bottomBorderFrameTop.Size = UDim2.new(1, 1 - 2 * border_size, 0, 1)
  4517. topBorderFrameCenter.Position = UDim2.new(0, border_size - 1, 0, 1)
  4518. topBorderFrameCenter.Size = UDim2.new(1, -border_size, 0, border_size - 2)
  4519. topBorderFrameBottom.Position = UDim2.new(0, border_size, 0, border_size - 1)
  4520. topBorderFrameBottom.Size = UDim2.new(1, 1 - 2 * border_size, 0, 1)
  4521. end
  4522. end
  4523. end
  4524. function GuiFrame:SetBorderTransparency(borderTransparency)
  4525. self.borderTransparency = borderTransparency
  4526. self.leftBorderFrameLeft.BackgroundTransparency = borderTransparency
  4527. self.leftBorderFrameCenter.BackgroundTransparency = borderTransparency
  4528. self.leftBorderFrameRight.BackgroundTransparency = borderTransparency
  4529. self.rightBorderFrameLeft.BackgroundTransparency = borderTransparency
  4530. self.rightBorderFrameCenter.BackgroundTransparency = borderTransparency
  4531. self.rightBorderFrameRight.BackgroundTransparency = borderTransparency
  4532. self.bottomBorderFrameBottom.BackgroundTransparency = borderTransparency
  4533. self.bottomBorderFrameCenter.BackgroundTransparency = borderTransparency
  4534. self.bottomBorderFrameTop.BackgroundTransparency = borderTransparency
  4535. self.topBorderFrameBottom.BackgroundTransparency = borderTransparency
  4536. self.topBorderFrameCenter.BackgroundTransparency = borderTransparency
  4537. self.topBorderFrameTop.BackgroundTransparency = borderTransparency
  4538. end
  4539. GuiButton = setmetatable({}, GuiFrame)
  4540. GuiButton.__index = GuiButton
  4541. GuiButton.__default = {__index = {
  4542. AutoButtonColor = true
  4543. }}
  4544. function GuiButton:Destroy()
  4545. self.Activated:disconnect()
  4546. GuiFrame.Destroy(self)
  4547. end
  4548. function GuiButton:Init(data)
  4549. if data.Active == nil then
  4550. data.Active = true
  4551. end
  4552. GuiFrame.Init(self, data)
  4553. setmetatable(data, GuiButton.__default)
  4554. self.Activated = RbxUtility.CreateSignal()
  4555. self:SetAutoButtonColor(data.AutoButtonColor)
  4556. end
  4557. function GuiButton:IsA(className)
  4558. return className == "GuiButton" or GuiFrame.IsA(self, className)
  4559. end
  4560. function GuiButton:SetAutoButtonColor(autoButtonColor)
  4561. if autoButtonColor ~= self.autoButtonColor then
  4562. self.autoButtonColor = autoButtonColor
  4563. if autoButtonColor then
  4564. if self.mouseOver then
  4565. local color = self.color
  4566. local transparency = self.backgroundTransparency
  4567. if self.mouseDown then
  4568. self.m_base_instance.BackgroundColor3 = Color3.new(math.min(color.r + 0.3, 1), math.min(color.g + 0.3, 1), math.min(color.b + 0.3, 1))
  4569. self.m_base_instance.BackgroundTransparency = transparency
  4570. else
  4571. self.m_base_instance.BackgroundColor3 = Color3.new(math.max(color.r - 0.3, 0), math.max(color.g - 0.3, 0), math.max(color.b - 0.3, 0))
  4572. self.m_base_instance.BackgroundTransparency = math.max(0, transparency - 0.5)
  4573. end
  4574. end
  4575. else
  4576. self.m_base_instance.BackgroundColor3 = self.color
  4577. end
  4578. end
  4579. end
  4580. GuiTextLabel = setmetatable({}, GuiFrame)
  4581. GuiTextLabel.__index = GuiTextLabel
  4582. GuiTextLabel.__default = {__index = {
  4583. Font = "ArialBold",
  4584. FontSize = "Size12",
  4585. Text = "",
  4586. TextColor = Color3.new(1, 1, 1),
  4587. TextStrokeColor = Color3.new(0, 0, 0),
  4588. TextStrokeTransparency = 0.6,
  4589. TextWrapped = true
  4590. }}
  4591. function GuiTextLabel:Destroy()
  4592. GuiFrame.Destroy(self)
  4593. end
  4594. function GuiTextLabel:Init(data)
  4595. GuiFrame.Init(self, data)
  4596. setmetatable(data, GuiTextLabel.__default)
  4597. local base_instance = self.m_base_instance
  4598. local textLabel = RBXInstance.new "TextLabel" {
  4599. BackgroundTransparency = 1,
  4600. Font = data.Font,
  4601. FontSize = data.FontSize,
  4602. TextColor3 = data.TextColor3,
  4603. TextStrokeColor3 = data.TextStrokeColor3,
  4604. TextStrokeTransparency = data.TextStrokeTransparency,
  4605. TextWrapped = data.TextWrapped
  4606. }
  4607. textLabel.Parent = self:GetContentInstance()
  4608. self.textLabel = textLabel
  4609. self:SetText(data.Text)
  4610. end
  4611. function GuiTextLabel:IsA(className)
  4612. return className == "GuiTextLabel" or GuiFrame.IsA(self, className)
  4613. end
  4614. function GuiTextLabel:SetText(text)
  4615. if text ~= self.text then
  4616. self.text = text
  4617. local text_index = 1
  4618. local content_instance = self:GetContentInstance()
  4619. local content_instance_size = content_instance.AbsoluteSize
  4620. local frame = Instance.new("Frame")
  4621. frame.BackgroundTransparency = 1
  4622. local label = Instance.new("TextLabel")
  4623. label.BackgroundTransparency = 1
  4624. label.Font = font
  4625. label.FontSize = fontSize
  4626. label.Size = UDim2.new(0, content_instance_size.X, 0, 1000)
  4627. label.Text = ""
  4628. label.TextColor3 = textColor3
  4629. label.TextTransparency = 1
  4630. label.TextWrapped = true
  4631. label.TextXAlignment = textXAlignment
  4632. label.TextYAlignment = textYAlignment
  4633. label.Parent = self.guiFrame
  4634. local row_length = 0
  4635. local step_size = 256
  4636. for step = 1, 8 do
  4637. step_size = 0.5 * step_size
  4638. label.Text = string.sub(text, text_index, text_index + row_length - 1)
  4639. end
  4640. end
  4641. end
  4642. GuiImageButton = setmetatable({}, GuiButton)
  4643. GuiImageButton.__index = GuiImageButton
  4644. GuiImageButton.__default = {__index = {
  4645. Image = ""
  4646. }}
  4647. function GuiImageButton:Destroy()
  4648. GuiButton.Destroy(self)
  4649. end
  4650. function GuiImageButton:Init(data)
  4651. GuiButton.Init(self, data)
  4652. setmetatable(data, GuiImageButton.__default)
  4653. local content_frame = self.m_content_frame
  4654. local image_label = RBXInstance.new "ImageLabel" {
  4655. BackgroundTransparency = 1,
  4656. Size = UDim2.new(1, 0, 1, 0)
  4657. }
  4658. image_label.Parent = content_frame
  4659. self.m_image_label = image_label
  4660. self:SetImage(data.Image)
  4661. end
  4662. function GuiImageButton:IsA(className)
  4663. return className == "GuiImageButton" or GuiButton.IsA(self, className)
  4664. end
  4665. function GuiImageButton:SetImage(image)
  4666. if image ~= self.m_image then
  4667. self.m_image = image
  4668. self.m_image_label.Image = image
  4669. end
  4670. end
  4671. GuiTextButton = setmetatable({}, GuiButton)
  4672. GuiTextButton.__index = GuiTextButton
  4673. GuiTextButton.__default = {__index = {
  4674. Font = Enum.Font.ArialBold,
  4675. FontSize = Enum.FontSize.Size11,
  4676. Text = "Button",
  4677. TextXAlignment = Enum.TextXAlignment.Center
  4678. }}
  4679. function GuiTextButton:Destroy()
  4680. GuiButton.Destroy(self)
  4681. end
  4682. function GuiTextButton:GetTextBounds()
  4683. return self.textLabel.TextBounds
  4684. end
  4685. function GuiTextButton:Init(data)
  4686. GuiButton.Init(self, data)
  4687. setmetatable(data, GuiTextButton.__default)
  4688. local contentFrame = self.m_content_frame
  4689. local mnemonicLabel = RBXInstance.new "TextLabel" {
  4690. BackgroundTransparency = 1,
  4691. Font = "ArialBold",
  4692. FontSize = "Size36",
  4693. Size = UDim2.new(1, 0, 0.7, 0),
  4694. TextColor3 = Color3.new(1, 1, 1),
  4695. TextStrokeColor3 = Color3.new(0, 0, 0),
  4696. TextStrokeTransparency = 0.6,
  4697. TextWrapped = true
  4698. }
  4699. local textLabel = RBXInstance.new "TextLabel" {
  4700. BackgroundTransparency = 1,
  4701. TextColor3 = Color3.new(1, 1, 1),
  4702. TextStrokeColor3 = Color3.new(0, 0, 0),
  4703. TextStrokeTransparency = 0.6,
  4704. TextWrapped = true
  4705. }
  4706. mnemonicLabel.Parent = contentFrame
  4707. textLabel.Parent = contentFrame
  4708. self.mnemonicLabel = mnemonicLabel
  4709. self.textLabel = textLabel
  4710. self:SetFont(data.Font)
  4711. self:SetFontSize(data.FontSize)
  4712. self:SetMnemonic(data.Mnemonic, true)
  4713. self:SetText(data.Text)
  4714. self:SetTextXAlignment(data.TextXAlignment)
  4715. end
  4716. function GuiTextButton:IsA(className)
  4717. return className == "GuiTextButton" or GuiButton.IsA(self, className)
  4718. end
  4719. function GuiTextButton:SetFont(font)
  4720. if font ~= self.font then
  4721. self.font = font
  4722. self.textLabel.Font = font
  4723. end
  4724. end
  4725. function GuiTextButton:SetFontSize(fontSize)
  4726. if fontSize ~= self.fontSize then
  4727. self.fontSize = fontSize
  4728. self.textLabel.FontSize = fontSize
  4729. end
  4730. end
  4731. function GuiTextButton:SetMnemonic(mnemonic, forceUpdate)
  4732. if mnemonic ~= self.mnemonic or forceUpdate then
  4733. if self.mnemonic then
  4734. GuiService:SetMnemonic(self.mnemonic, nil)
  4735. end
  4736. if mnemonic then
  4737. GuiService:SetMnemonic(mnemonic, self)
  4738. end
  4739. self.mnemonic = mnemonic
  4740. local mnemonicLabel = self.mnemonicLabel
  4741. local textLabel = self.textLabel
  4742. if mnemonic then
  4743. mnemonicLabel.Text = mnemonic
  4744. textLabel.Size = UDim2.new(1, 0, 0.9, 0)
  4745. textLabel.TextYAlignment = "Bottom"
  4746. else
  4747. mnemonicLabel.Text = ""
  4748. textLabel.Size = UDim2.new(1, 0, 1, 0)
  4749. textLabel.TextYAlignment = "Center"
  4750. end
  4751. end
  4752. end
  4753. function GuiTextButton:SetText(text)
  4754. if text ~= self.text then
  4755. self.text = text
  4756. self.textLabel.Text = text
  4757. end
  4758. end
  4759. function GuiTextButton:SetTextXAlignment(textXAlignment)
  4760. if textXAlignment ~= self.textXAlignment then
  4761. self.textXAlignment = textXAlignment
  4762. self.textLabel.TextXAlignment = textXAlignment
  4763. end
  4764. end
  4765. GuiWindow = setmetatable({}, GuiObject)
  4766. GuiWindow.__index = GuiWindow
  4767. GuiWindow.__default = {__index = {
  4768. Active = true,
  4769. BackgroundTransparency = 0.5,
  4770. BorderSize = 4,
  4771. BorderTransparency = 0.5,
  4772. Position = UDim2.new(0, 0, 0, 0),
  4773. Size = UDim2.new(0, 360, 0, 240),
  4774. Title = "Window",
  4775. TitleBarBackgroundTransparency = 0.5,
  4776. TitleBarBorderTransparency = 1,
  4777. Visible = true
  4778. }}
  4779. function GuiWindow:Init(data)
  4780. GuiObject.Init(self)
  4781. setmetatable(data, GuiFrame.__default)
  4782. local title_bar = GuiTextLabel:new {
  4783. BackgroundTransparency = data.TitleBarBackgroundTransparency,
  4784. BorderTransparency = data.TitleBarBackgroundTransparency,
  4785. Text = data.Title
  4786. }
  4787. local content_frame = GuiFrame:new {
  4788. Active = data.Active,
  4789. BackgroundTransparency = data.BackgroundTransparency,
  4790. BorderSize = data.BorderSize,
  4791. BorderTransparency = data.BorderTransparency
  4792. }
  4793. local base_frame = RBXInstance.new "Frame" {
  4794. BackgroundTransparency = 1,
  4795. BorderSizePixel = 0,
  4796. Position = data.Position,
  4797. Size = data.Size,
  4798. Visible = data.Visible
  4799. }
  4800. self.m_base_frame = base_frame
  4801. self.m_content_frame = content_frame
  4802. self.m_title_bar = title_bar
  4803. end
  4804. function GuiWindow:IsA(className)
  4805. return className == "GuiWindow" or GuiObject.IsA(self, className)
  4806. end
  4807. GuiScrollFrame = setmetatable({}, GuiFrame)
  4808. GuiScrollFrame.__index = GuiScrollFrame
  4809. GuiScrollFrame.__default = {__index = {
  4810. ContentHeight = 0,
  4811. ScrollBarColor = Color3.new(1, 1, 1)
  4812. }}
  4813. function GuiScrollFrame:Destroy()
  4814. self.m_scroll_bar:Destroy()
  4815. GuiFrame.Destroy(self)
  4816. end
  4817. function GuiScrollFrame:GetContentInstance()
  4818. return self.m_scroll_frame or GuiFrame.GetContentInstance(self)
  4819. end
  4820. function GuiScrollFrame:Init(data)
  4821. GuiFrame.Init(self, data)
  4822. setmetatable(data, GuiScrollFrame.__default)
  4823. local scroll_pane = RBXInstance.new "Frame" {
  4824. BackgroundColor3 = Color3.new(1, 1, 1),
  4825. BackgroundTransparency = 0.8,
  4826. BorderSizePixel = 0,
  4827. Position = UDim2.new(1, -20, 0, 0),
  4828. Size = UDim2.new(0, 20, 1, 0),
  4829. Parent = self.m_content_frame
  4830. }
  4831. local scroll_bar = GuiFrame:new {
  4832. Active = true,
  4833. BackgroundTransparency = 0.6,
  4834. BorderTransparency = 0.6,
  4835. Color = data.ScrollBarColor,
  4836. Parent = self
  4837. }
  4838. local scroll_frame = RBXInstance.new "Frame" {
  4839. BackgroundTransparency = 1,
  4840. Parent = self.m_content_frame
  4841. }
  4842. self.m_scroll_bar = scroll_bar
  4843. self.m_scroll_frame = scroll_frame
  4844. self.m_scroll_pane = scroll_pane
  4845. self.m_scroll_position = 0
  4846. self.m_updating_content_height = false
  4847. self:SetContentHeight(data.ContentHeight)
  4848. self:UpdateScrollPosition()
  4849. self.m_scroll_bar.DragBegin:connect(function()
  4850. self.m_scroll_drag_total = Vector2.new()
  4851. self.m_scroll_initial_position = self.m_scroll_position
  4852. end)
  4853. self.m_scroll_bar.DragMove:connect(function(offset)
  4854. self.m_scroll_drag_total = self.m_scroll_drag_total + offset
  4855. local absolute_height = self:GetAbsoluteSize().Y - 2 * self.m_border_size
  4856. if absolute_height ~= 0 then
  4857. local content_height = math.max(self.m_content_height, absolute_height)
  4858. local scroll_space = 1 - absolute_height / content_height
  4859. self:Scroll(self.m_scroll_initial_position + self.m_scroll_drag_total.Y * (content_height / absolute_height - 1) / scroll_space)
  4860. end
  4861. end)
  4862. end
  4863. function GuiScrollFrame:IsA(className)
  4864. return className == "GuiScrollFrame" or GuiFrame.IsA(self, className)
  4865. end
  4866. function GuiScrollFrame:Scroll(position)
  4867. position = math.min(math.max(position, 0), self.m_content_height - (self:GetAbsoluteSize().Y - 2 * self.m_border_size))
  4868. if position ~= self.m_scroll_position then
  4869. self.m_scroll_position = position
  4870. self:UpdateScrollPosition()
  4871. end
  4872. end
  4873. function GuiScrollFrame:SetContentHeight(height)
  4874. if height ~= self.m_content_height then
  4875. local prev_height = self.m_content_height
  4876. self.m_content_height = height
  4877. if not self.m_updating_content_height then
  4878. self.m_updating_content_height = true
  4879. coroutine.resume(coroutine.create(function()
  4880. local success, message = ypcall(self.SetContentHeightImpl1, self, prev_height)
  4881. if not success then
  4882. Logger.printf("Severe", "Error in GuiScrollFrame:SetContentHeight(%s): %s", Utility.ToString(height), message)
  4883. end
  4884. end))
  4885. end
  4886. end
  4887. end
  4888. function GuiScrollFrame:SetContentHeightImpl1(prev_height)
  4889. RunService.RenderStepped:wait()
  4890. self.m_updating_content_height = false
  4891. local height = self.m_content_height
  4892. self.m_scroll_frame.Size = UDim2.new(1, -20, 0, height)
  4893. if prev_height and prev_height ~= 0 then
  4894. local absolute_height = self:GetAbsoluteSize().Y - 2 * self.m_border_size
  4895. if self.m_scroll_position == prev_height - absolute_height then
  4896. self.m_scroll_position = height - absolute_height
  4897. else
  4898. self.m_scroll_position = height * self.m_scroll_position / prev_height
  4899. end
  4900. end
  4901. self:UpdateScrollPosition()
  4902. end
  4903. function GuiScrollFrame:UpdateScrollPosition()
  4904. local absolute_height = self:GetAbsoluteSize().Y - 2 * self.m_border_size
  4905. if absolute_height == 0 then
  4906. absolute_height = self.m_content_height
  4907. end
  4908. local scroll_bar = self.m_scroll_bar
  4909. local scroll_frame = self.m_scroll_frame
  4910. local scroll_pane = self.m_scroll_pane
  4911. local content_height = math.max(self.m_content_height, absolute_height)
  4912. if absolute_height == content_height then
  4913. scroll_frame.Position = UDim2.new(0, 0, 0, 0)
  4914. scroll_frame.Size = UDim2.new(1, 0, 1, 0)
  4915. scroll_bar:SetVisible(false)
  4916. scroll_pane.Visible = false
  4917. else
  4918. local contentScale = content_height / absolute_height
  4919. local scroll_space = 1 - absolute_height / content_height
  4920. local scroll_position = self.m_scroll_position
  4921. scroll_frame.Position = UDim2.new(0, 0, 0, -scroll_position)
  4922. scroll_bar:SetPosition(UDim2.new(1, -20, scroll_position / (content_height - absolute_height) * scroll_space, 0))
  4923. scroll_bar:SetSize(UDim2.new(0, 20, absolute_height / content_height, 0))
  4924. scroll_bar:SetVisible(true)
  4925. scroll_pane.Visible = true
  4926. end
  4927. end
  4928. GuiMenu = setmetatable({}, GuiFrame)
  4929. GuiMenu.__index = GuiMenu
  4930. GuiMenu.__default = {__index = {
  4931. VerticalSpacing = 18
  4932. }}
  4933. function GuiMenu:AddItem(text, onClick, options)
  4934. local frameSize = self:GetSize()
  4935. local frameHeight = frameSize.Y.Offset - self.m_border_size * 2
  4936. local verticalSpacing = self.verticalSpacing
  4937. local properties = {
  4938. BackgroundTransparency = 0.75,
  4939. BorderSize = 0,
  4940. BorderTransparency = 1,
  4941. Color = (#self.menuItems % 2 == 1) and Color3.new(0.25, 0.25, 0.25) or Color3.new(0, 0, 0),
  4942. FontSize = Enum.FontSize.Size12,
  4943. Position = UDim2.new(0, 0, 0, frameHeight),
  4944. Size = UDim2.new(1, 0, 0, verticalSpacing),
  4945. Text = text,
  4946. Parent = self
  4947. }
  4948. if options then
  4949. for key, value in pairs(options) do
  4950. properties[key] = value
  4951. end
  4952. end
  4953. local menuItem = GuiTextButton:new(properties)
  4954. if onClick then
  4955. menuItem.Activated:connect(function()
  4956. if not onClick(text, self) then
  4957. self:Destroy()
  4958. end
  4959. end)
  4960. end
  4961. self.menuItems[#self.menuItems + 1] = menuItem
  4962. self:SetSize(frameSize + UDim2.new(0, 0, 0, verticalSpacing))
  4963. end
  4964. function GuiMenu:ClearItems()
  4965. local menuItems = self.menuItems
  4966. for _, item in ipairs(menuItems) do
  4967. menuItems[item] = nil
  4968. item:Destroy()
  4969. end
  4970. local frameSize = self:GetSize()
  4971. self:SetSize(frameSize + UDim2.new(0, 0, 0, self.m_border_size * 2 - frameSize.Y.Offset))
  4972. end
  4973. function GuiMenu:Destroy()
  4974. self:ClearItems()
  4975. GuiFrame.Destroy(self)
  4976. end
  4977. function GuiMenu:Init(data)
  4978. GuiFrame.Init(self, data)
  4979. setmetatable(data, GuiMenu.__default)
  4980. self.menuItems = {}
  4981. self.verticalSpacing = data.VerticalSpacing
  4982. end
  4983. function GuiMenu:IsA(className)
  4984. return className == "GuiMenu" or GuiFrame.IsA(self, className)
  4985. end
  4986. GuiTextList = setmetatable({}, GuiScrollFrame)
  4987. GuiTextList.__index = GuiTextList
  4988. GuiTextList.__default = {__index = {
  4989. }}
  4990. function GuiTextList:AddItem(text, options)
  4991. local properties = {
  4992. BackgroundTransparency = 1,
  4993. Font = "ArialBold",
  4994. FontSize = "Size12",
  4995. Position = UDim2.new(0, 4, 0, self.m_content_height),
  4996. Size = UDim2.new(1, -8, 0, 12),
  4997. Text = tostring(text),
  4998. TextColor3 = Color3.new(1, 1, 1),
  4999. TextStrokeTransparency = 0.6,
  5000. TextWrapped = true,
  5001. TextXAlignment = "Left",
  5002. Parent = self:GetContentInstance()
  5003. }
  5004. if options then
  5005. for key, value in pairs(options) do
  5006. properties[key] = value
  5007. end
  5008. end
  5009. local textLabel = RBXInstance.new "TextLabel" (properties)
  5010. textLabel.Size = UDim2.new(1, 0, 0, textLabel.TextBounds.Y)
  5011. self.listItems[#self.listItems + 1] = textLabel
  5012. self:SetContentHeight(self.m_content_height + textLabel.TextBounds.Y)
  5013. end
  5014. function GuiTextList:ClearItems()
  5015. local listItems = self.listItems
  5016. for _, item in ipairs(listItems) do
  5017. listItems[item] = nil
  5018. item:Destroy()
  5019. end
  5020. self:SetContentHeight(0)
  5021. end
  5022. function GuiTextList:Destroy()
  5023. self:ClearItems()
  5024. GuiScrollFrame.Destroy(self)
  5025. end
  5026. function GuiTextList:Init(data)
  5027. GuiScrollFrame.Init(self, data)
  5028. self.listItems = {}
  5029. end
  5030. function GuiTextList:IsA(className)
  5031. return className == "GuiTextList" or GuiScrollFrame.IsA(self, className)
  5032. end
  5033. GuiNetworkList = setmetatable({}, GuiTextList)
  5034. GuiNetworkList.__index = GuiNetworkList
  5035. function GuiNetworkList:AddItem(systemTime, idleTime, userName, isNil)
  5036. local frame = GuiFrame:new {
  5037. BackgroundTransparency = 1,
  5038. BorderSize = 0,
  5039. BorderTransparency = 1,
  5040. Position = UDim2.new(0, 4, 0, self.m_content_height),
  5041. Size = UDim2.new(1, -8, 0, 14),
  5042. }
  5043. local systemTimeColor
  5044. if string.sub(systemTime, 1, 1) == "?" then
  5045. systemTimeColor = Color3.new(1, 0.75, 0.75)
  5046. else
  5047. systemTimeColor = Color3.new(0.75, 0.75, 1)
  5048. end
  5049. local systemTimeLabel = RBXInstance.new "TextLabel" {
  5050. BackgroundTransparency = 1,
  5051. Font = "ArialBold",
  5052. FontSize = "Size12",
  5053. Position = UDim2.new(0, 0, 0, 0),
  5054. Size = UDim2.new(0, 50, 1, 0),
  5055. Text = systemTime,
  5056. TextColor3 = systemTimeColor,
  5057. TextStrokeTransparency = 0.6,
  5058. TextXAlignment = "Left",
  5059. Parent = frame:GetContentInstance()
  5060. }
  5061. local idle_time_color
  5062. if string.sub(idleTime, 1, 1) == "0" then
  5063. idle_time_color = Color3.new(1, 1, 1)
  5064. else
  5065. idle_time_color = Color3.new(1, 0.75, 0.75)
  5066. end
  5067. local idleTimeLabel = RBXInstance.new "TextLabel" {
  5068. BackgroundTransparency = 1,
  5069. Font = "ArialBold",
  5070. FontSize = "Size12",
  5071. Position = UDim2.new(0, 40, 0, 0),
  5072. Size = UDim2.new(0, 45, 1, 0),
  5073. Text = idleTime,
  5074. TextColor3 = idle_time_color,
  5075. TextStrokeTransparency = 0.6,
  5076. TextXAlignment = "Right",
  5077. Parent = frame:GetContentInstance()
  5078. }
  5079. local userNameLabel = GuiTextButton:new {
  5080. AutoButtonColor = false,
  5081. BackgroundTransparency = 1,
  5082. BorderSize = 0,
  5083. BorderTransparency = 1,
  5084. Font = Enum.Font.SourceSansBold,
  5085. FontSize = Enum.FontSize.Size14,
  5086. Position = UDim2.new(0, 98, 0, 0),
  5087. Size = UDim2.new(1, -98, 1, 0),
  5088. TextXAlignment = Enum.TextXAlignment.Left,
  5089. Text = userName,
  5090. Parent = frame
  5091. }
  5092. frame:SetParent(self)
  5093. local userNameWidth = userNameLabel:GetTextBounds().X
  5094. userNameLabel:SetSize(UDim2.new(0, userNameWidth + 4, 1, 0))
  5095. if isNil then
  5096. local isNilLabel = RBXInstance.new "TextLabel" {
  5097. BackgroundTransparency = 1,
  5098. Font = "SourceSans",
  5099. FontSize = "Size14",
  5100. Position = UDim2.new(0, 100 + userNameWidth + 8, 0, 0),
  5101. Size = UDim2.new(0, 50, 1, 0),
  5102. Text = "(nil)",
  5103. TextColor3 = Color3.new(1, 0.4, 0.4),
  5104. TextStrokeTransparency = 0.6,
  5105. TextXAlignment = "Left",
  5106. Parent = frame:GetContentInstance()
  5107. }
  5108. end
  5109. self.listItems[#self.listItems + 1] = frame
  5110. self:SetContentHeight(self.m_content_height + 14)
  5111. end
  5112. function GuiNetworkList:IsA(className)
  5113. return className == "GuiNetworkList" or GuiTextList.IsA(self, className)
  5114. end
  5115. GuiTextOutput = setmetatable({}, GuiScrollFrame)
  5116. GuiTextOutput.__index = GuiTextOutput
  5117. GuiTextOutput.__default = {__index = {
  5118. DisplayMaxLines = 120,
  5119. DisplayWidth = 0
  5120. }}
  5121. function GuiTextOutput:Init(data)
  5122. GuiScrollFrame.Init(self, data)
  5123. setmetatable(data, GuiTextOutput.__default)
  5124. self.displayMaxLines = data.DisplayMaxLines
  5125. self.displayWidth = data.DisplayWidth
  5126. self.displayItems = {}
  5127. self:SetBackgroundTransparency(0)
  5128. self:SetColor(Color3.new(1, 1, 1))
  5129. self.m_scroll_pane.BackgroundColor3 = Color3.new(0.5, 0.5, 0.5)
  5130. end
  5131. function GuiTextOutput:IsA(className)
  5132. return className == "GuiTextOutput" or GuiScrollFrame.IsA(self, className)
  5133. end
  5134. function GuiTextOutput:Print(...)
  5135. self:PrintFormat(nil, ...)
  5136. end
  5137. function GuiTextOutput:PrintFormat(options, ...)
  5138. local buffer = {}
  5139. local args = {...}
  5140. local first = true
  5141. for i = 1, select("#", ...) do
  5142. buffer[i] = tostring(args[i])
  5143. end
  5144. message = Utility.BlockRobloxFilter(table.concat(buffer, "\t"))
  5145. local properties = {
  5146. BackgroundTransparency = 1,
  5147. Font = "ArialBold",
  5148. FontSize = "Size12",
  5149. Position = UDim2.new(0, 4, 0, self.m_content_height),
  5150. Text = message,
  5151. TextColor3 = Color3.new(1, 1, 1),
  5152. TextWrapped = true,
  5153. TextXAlignment = "Left",
  5154. TextYAlignment = "Bottom",
  5155. Parent = self:GetContentInstance()
  5156. }
  5157. if options then
  5158. for key, value in pairs(options) do
  5159. properties[key] = value
  5160. end
  5161. end
  5162. local textBounds = GuiService:GetTextBounds(message, properties.Font, properties.FontSize, properties.TextXAlignment, properties.TextYAlignment,
  5163.  
  5164. self.displayWidth - 20)
  5165. local textHeight = textBounds.Y
  5166. properties.Size = UDim2.new(0, self.displayWidth - 8, 0, textBounds.Y)
  5167. local textLabel = RBXInstance.new "TextLabel" (properties)
  5168. self.displayItems[#self.displayItems + 1] = textLabel
  5169. local maxLines = self.displayMaxLines
  5170. local maxHeight = maxLines * 12
  5171. local newHeight = self.m_content_height + textHeight
  5172. if newHeight > maxHeight then
  5173. local offset = 0
  5174. local newList = {}
  5175. local oldList = self.displayItems
  5176. for index, child in ipairs(oldList) do
  5177. local childOffset = child.Size.Y.Offset
  5178. if newHeight > maxHeight then
  5179. offset = offset + childOffset
  5180. newHeight = newHeight - childOffset
  5181. child:Destroy()
  5182. else
  5183. child.Position = child.Position - UDim2.new(0, 0, 0, offset)
  5184. newList[#newList + 1] = child
  5185. end
  5186. end
  5187. self.displayItems = newList
  5188. end
  5189. self:SetContentHeight(newHeight)
  5190. end
  5191. GuiChatLog = setmetatable({}, GuiScrollFrame)
  5192. GuiChatLog.__index = GuiChatLog
  5193. GuiChatLog.__default = {__index = {
  5194. DisplayMaxLines = 200,
  5195. DisplayWidth = 0,
  5196. }}
  5197. function GuiChatLog:Chat(speaker, message)
  5198. local speaker_color = AdvancedGUI.GenerateChatColor(speaker)
  5199. speaker = Utility.BlockRobloxFilter(speaker)
  5200. message = "\t\t\t\t\t\t\t\t\t\t\t\t\t\t\t" .. Utility.BlockRobloxFilter(message)
  5201. local timestamp = Utility.GetTimestamp()
  5202. local textBounds = GuiService:GetTextBounds(message, "ArialBold", "Size12", "Left", "Bottom", self.displayWidth - 8)
  5203. local textHeight = math.max(math.min(textBounds.Y, 36), 12)
  5204. local message_frame = RBXInstance.new "Frame" {
  5205. BackgroundTransparency = 1,
  5206. Position = UDim2.new(0, 0, 0, self.m_content_height),
  5207. Size = UDim2.new(0, self.displayWidth, 0, textHeight),
  5208. Parent = self:GetContentInstance()
  5209. }
  5210. local timestamp_label = RBXInstance.new "TextLabel" {
  5211. BackgroundTransparency = 1,
  5212. Font = "ArialBold",
  5213. FontSize = "Size12",
  5214. Position = UDim2.new(0, 4, 0, 0),
  5215. Size = UDim2.new(1, -8, 0, 12),
  5216. Text = timestamp,
  5217. TextColor3 = Color3.new(0.75, 0.75, 0.75),
  5218. TextStrokeTransparency = 0.6,
  5219. TextWrapped = true,
  5220. TextXAlignment = "Left",
  5221. Parent = message_frame
  5222. }
  5223. local speaker_label = RBXInstance.new "TextLabel" {
  5224. BackgroundTransparency = 1,
  5225. Font = "ArialBold",
  5226. FontSize = "Size12",
  5227. Position = UDim2.new(0, 64, 0, 0),
  5228. Size = UDim2.new(0, 100, 0, 12),
  5229. Text = speaker,
  5230. TextColor3 = speaker_color,
  5231. TextStrokeTransparency = 0.6,
  5232. Parent = message_frame
  5233. }
  5234. local message_label = RBXInstance.new "TextLabel" {
  5235. BackgroundTransparency = 1,
  5236. Font = "ArialBold",
  5237. FontSize = "Size12",
  5238. Position = UDim2.new(0, 4, 0, 0),
  5239. Size = UDim2.new(1, -8, 1, 0),
  5240. Text = message,
  5241. TextColor3 = Color3.new(1, 1, 1),
  5242. TextStrokeTransparency = 0.6,
  5243. TextXAlignment = "Left",
  5244. TextYAlignment = "Bottom",
  5245. TextWrapped = true,
  5246. Parent = message_frame
  5247. }
  5248. self.displayItems[#self.displayItems + 1] = message_frame
  5249. local maxLines = self.displayMaxLines
  5250. local maxHeight = maxLines * 12
  5251. local newHeight = self.m_content_height + textHeight
  5252. if newHeight > maxHeight then
  5253. local offset = 0
  5254. local newList = {}
  5255. local oldList = self.displayItems
  5256. for index, child in ipairs(oldList) do
  5257. local childOffset = child.Size.Y.Offset
  5258. if newHeight > maxHeight then
  5259. offset = offset + childOffset
  5260. newHeight = newHeight - childOffset
  5261. child:Destroy()
  5262. else
  5263. child.Position = child.Position - UDim2.new(0, 0, 0, offset)
  5264. newList[#newList + 1] = child
  5265. end
  5266. end
  5267. self.displayItems = newList
  5268. end
  5269. self:SetContentHeight(newHeight)
  5270. end
  5271. function GuiChatLog:Init(data)
  5272. GuiScrollFrame.Init(self, data)
  5273. setmetatable(data, GuiChatLog.__default)
  5274. self.displayMaxLines = data.DisplayMaxLines
  5275. self.displayWidth = data.DisplayWidth
  5276. self.displayItems = {}
  5277. end
  5278. function GuiChatLog:IsA(className)
  5279. return className == "GuiChatLog" or GuiScrollFrame.IsA(self, className)
  5280. end
  5281. GuiSeperator = setmetatable({}, GuiObject)
  5282. GuiSeperator.__index = GuiSeperator
  5283. GuiSeperator.__default = {__index = {
  5284. Active = false,
  5285. Position = UDim2.new(0, 0, 0, 0),
  5286. Size = UDim2.new(1, 0, 0, 16),
  5287. Visible = true
  5288. }}
  5289. function GuiSeperator:Init(data)
  5290. GuiObject.Init(self)
  5291. setmetatable(data, GuiSeperator.__default)
  5292. local base_frame = RBXInstance.new "Frame" {
  5293. BackgroundTransparency = 1,
  5294. RBXInstance.new "Frame" {
  5295. BackgroundColor3 = Color3.new(1, 1, 1),
  5296. BackgroundTransparency = 0.25,
  5297. BorderSizePixel = 0,
  5298. Position = UDim2.new(0.5, -13, 0.5, -1),
  5299. Size = UDim2.new(0, 3, 0, 3),
  5300. RBXInstance.new "Frame" {
  5301. BackgroundColor3 = Color3.new(0, 0, 0),
  5302. BackgroundTransparency = 0.75,
  5303. BorderSizePixel = 0,
  5304. Position = UDim2.new(0, -1, 0, -1),
  5305. Size = UDim2.new(0, 5, 0, 5)
  5306. }
  5307. },
  5308. RBXInstance.new "Frame" {
  5309. BackgroundColor3 = Color3.new(1, 1, 1),
  5310. BackgroundTransparency = 0.25,
  5311. BorderSizePixel = 0,
  5312. Position = UDim2.new(0.5, -1, 0.5, -1),
  5313. Size = UDim2.new(0, 3, 0, 3),
  5314. RBXInstance.new "Frame" {
  5315. BackgroundColor3 = Color3.new(0, 0, 0),
  5316. BackgroundTransparency = 0.75,
  5317. BorderSizePixel = 0,
  5318. Position = UDim2.new(0, -1, 0, -1),
  5319. Size = UDim2.new(0, 5, 0, 5)
  5320. }
  5321. },
  5322. RBXInstance.new "Frame" {
  5323. BackgroundColor3 = Color3.new(1, 1, 1),
  5324. BackgroundTransparency = 0.25,
  5325. BorderSizePixel = 0,
  5326. Position = UDim2.new(0.5, 11, 0.5, -1),
  5327. Size = UDim2.new(0, 3, 0, 3),
  5328. RBXInstance.new "Frame" {
  5329. BackgroundColor3 = Color3.new(0, 0, 0),
  5330. BackgroundTransparency = 0.75,
  5331. BorderSizePixel = 0,
  5332. Position = UDim2.new(0, -1, 0, -1),
  5333. Size = UDim2.new(0, 5, 0, 5)
  5334. }
  5335. }
  5336. }
  5337. self.m_base_instance = base_frame
  5338. self:SetActive(data.Active)
  5339. self:SetPosition(data.Position)
  5340. self:SetSize(data.Size)
  5341. self:SetVisible(data.Visible)
  5342. self:SetParent(data.Parent)
  5343. end
  5344. function GuiSeperator:IsA(className)
  5345. return className == "GuiSeperator" or GuiObject.IsA(self, className)
  5346. end
  5347. local startMenu = GuiFrame:new {
  5348. BorderTransparency = 0.5,
  5349. Position = UDim2.new(0, -4, 0, -4),
  5350. Size = UDim2.new(0, 68, 1, 8),
  5351. Parent = GuiService
  5352. }
  5353. GuiSeperator:new {
  5354. Position = UDim2.new(0, 0, 0, 5),
  5355. Parent = startMenu
  5356. }
  5357. GuiSeperator:new {
  5358. Position = UDim2.new(0, 0, 1, -85),
  5359. Parent = startMenu
  5360. }
  5361. local networkButton = GuiTextButton:new {
  5362. BackgroundTransparency = 0.9,
  5363. Mnemonic = "L",
  5364. Position = UDim2.new(0, 4, 1, -647),
  5365. Text = "Network",
  5366. Parent = startMenu
  5367. }
  5368. local chatLogButton = GuiTextButton:new {
  5369. BackgroundTransparency = 0.9,
  5370. Mnemonic = "K",
  5371. Position = UDim2.new(0, 4, 1, -475),
  5372. Text = "Chat log",
  5373. Parent = startMenu
  5374. }
  5375. local outputButton = GuiTextButton:new {
  5376. BackgroundTransparency = 0.9,
  5377. Mnemonic = "P",
  5378. Position = UDim2.new(0, 4, 1, -283),
  5379. Text = "Output",
  5380. Parent = startMenu
  5381. }
  5382. local toolsButton = GuiTextButton:new {
  5383. BackgroundTransparency = 0.9,
  5384. Mnemonic = "O",
  5385. Position = UDim2.new(0, 4, 1, -137),
  5386. Text = "Tools",
  5387. Parent = startMenu
  5388. }
  5389. local networkFrame = GuiNetworkList:new {
  5390. Position = UDim2.new(0, 66, 1, -647),
  5391. Size = UDim2.new(0, 0, 0, 168),
  5392. Visible = false,
  5393. Parent = GuiService
  5394. }
  5395. local chatLogFrame = GuiChatLog:new {
  5396. DisplayWidth = 332,
  5397. Position = UDim2.new(0, 66, 1, -475),
  5398. Size = UDim2.new(0, 0, 0, 188),
  5399. Visible = false,
  5400. Parent = GuiService
  5401. }
  5402. local outputFrame = GuiTextOutput:new {
  5403. DisplayWidth = 332,
  5404. Position = UDim2.new(0, 66, 1, -283),
  5405. Size = UDim2.new(0, 0, 0, 140),
  5406. Visible = false,
  5407. Parent = GuiService
  5408. }
  5409. local toolsFrame = GuiFrame:new {
  5410. Position = UDim2.new(0, 66, 1, -137),
  5411. Size = UDim2.new(0, 0, 0, 52),
  5412. Visible = false,
  5413. Parent = GuiService
  5414. }
  5415. local toggleCharacterButton = GuiTextButton:new {
  5416. BackgroundTransparency = 0.9,
  5417. Position = UDim2.new(0, 1, 0, 1),
  5418. Size = UDim2.new(0, 108, 0, 20),
  5419. Text = "Enable character",
  5420. Parent = toolsFrame
  5421. }
  5422. local resetCharacterButton = GuiTextButton:new {
  5423. BackgroundTransparency = 0.9,
  5424. Position = UDim2.new(0, 1, 0, 23),
  5425. Size = UDim2.new(0, 108, 0, 20),
  5426. Text = "Reset character",
  5427. Parent = toosFrame
  5428. }
  5429. local clearWorkspaceButton = GuiTextButton:new {
  5430. BackgroundTransparency = 0.9,
  5431. Position = UDim2.new(0, 110, 0, 1),
  5432. Size = UDim2.new(0, 108, 0, 20),
  5433. Text = "Clear workspace",
  5434. Parent = toolsFrame
  5435. }
  5436. local clearScriptButton = GuiTextButton:new {
  5437. BackgroundTransparency = 0.9,
  5438. Position = UDim2.new(0, 110, 0, 23),
  5439. Size = UDim2.new(0, 108, 0, 20),
  5440. Text = "Clear all",
  5441. Parent = toolsFrame
  5442. }
  5443. local fixLightingButton = GuiTextButton:new {
  5444. BackgroundTransparency = 0.9,
  5445. Position = UDim2.new(0, 219, 0, 1),
  5446. Size = UDim2.new(0, 108, 0, 20),
  5447. Text = "Fix lighting",
  5448. Parent = toolsFrame
  5449. }
  5450. local reloadCommandsButton = GuiTextButton:new {
  5451. BackgroundTransparency = 0.9,
  5452. Position = UDim2.new(0, 219, 0, 23),
  5453. Size = UDim2.new(0, 108, 0, 20),
  5454. Text = "Reload commands",
  5455. Parent = toolsFrame
  5456. }
  5457. toggleCharacterButton.Activated:connect(function()
  5458. local enabled = not PlayerControl.IsEnabled()
  5459. if enabled then
  5460. toggleCharacterButton:SetText("Disable character")
  5461. else
  5462. toggleCharacterButton:SetText("Enable character")
  5463. end
  5464. PlayerControl.SetEnabled(enabled)
  5465. end)
  5466. resetCharacterButton.Activated:connect(function()
  5467. PlayerControl.ResetCharacter()
  5468. end)
  5469. clearWorkspaceButton.Activated:connect(function()
  5470. Utility.CleanWorkspace()
  5471. end)
  5472. clearScriptButton.Activated:connect(function()
  5473. Utility.CleanWorkspaceAndScripts()
  5474. end)
  5475. fixLightingButton.Activated:connect(function()
  5476. Utility.CleanLighting()
  5477. end)
  5478. reloadCommandsButton.Activated:connect(function()
  5479. UserInterface.FixChattedConnection()
  5480. end)
  5481. local networkFrameActive = false
  5482. local networkFrameTweening = false
  5483. networkButton.Activated:connect(function()
  5484. if not networkFrameTweening then
  5485. networkFrameActive = not networkFrameActive
  5486. networkFrameTweening = true
  5487. if networkFrameActive then
  5488. networkFrame:SetVisible(true)
  5489. networkFrame.m_base_instance:TweenSize(UDim2.new(0, 276, 0, 168), nil, nil, 0.5)
  5490. wait(0.5)
  5491. else
  5492. networkFrame.m_base_instance:TweenSize(UDim2.new(0, 0, 0, 168), nil, nil, 0.5)
  5493. wait(0.5)
  5494. networkFrame:SetVisible(false)
  5495. end
  5496. networkFrameTweening = false
  5497. end
  5498. end)
  5499. local chatLogFrameActive = false
  5500. local chatLogFrameTweening = false
  5501. chatLogButton.Activated:connect(function()
  5502. if not chatLogFrameTweening then
  5503. chatLogFrameActive = not chatLogFrameActive
  5504. chatLogFrameTweening = true
  5505. if chatLogFrameActive then
  5506. chatLogFrame:SetVisible(true)
  5507. chatLogFrame.m_base_instance:TweenSize(UDim2.new(0, 360, 0, 188), nil, nil, 0.5)
  5508. wait(0.5)
  5509. else
  5510. chatLogFrame.m_base_instance:TweenSize(UDim2.new(0, 0, 0, 188), nil, nil, 0.5)
  5511. wait(0.5)
  5512. chatLogFrame:SetVisible(false)
  5513. end
  5514. chatLogFrameTweening = false
  5515. end
  5516. end)
  5517. local outputFrameActive = false
  5518. local outputFrameTweening = false
  5519. outputButton.Activated:connect(function()
  5520. if not outputFrameTweening then
  5521. outputFrameActive = not outputFrameActive
  5522. outputFrameTweening = true
  5523. if outputFrameActive then
  5524. outputFrame:SetVisible(true)
  5525. outputFrame.m_base_instance:TweenSize(UDim2.new(0, 360, 0, 140), nil, nil, 0.5)
  5526. wait(0.5)
  5527. else
  5528. outputFrame.m_base_instance:TweenSize(UDim2.new(0, 0, 0, 140), nil, nil, 0.5)
  5529. wait(0.5)
  5530. outputFrame:SetVisible(false)
  5531. end
  5532. outputFrameTweening = false
  5533. end
  5534. end)
  5535. local toolsFrameActive = false
  5536. local toolsFrameTweening = false
  5537. toolsButton.Activated:connect(function()
  5538. if not toolsFrameTweening then
  5539. toolsFrameActive = not toolsFrameActive
  5540. toolsFrameTweening = true
  5541. if toolsFrameActive then
  5542. toolsFrame:SetVisible(true)
  5543. toolsFrame.m_base_instance:TweenSize(UDim2.new(0, 336, 0, 52), nil, nil, 0.5)
  5544. wait(0.5)
  5545. else
  5546. toolsFrame.m_base_instance:TweenSize(UDim2.new(0, 0, 0, 52), nil, nil, 0.5)
  5547. wait(0.5)
  5548. toolsFrame:SetVisible(false)
  5549. end
  5550. toolsFrameTweening = false
  5551. end
  5552. end)
  5553. AdvancedGUI.startMenu = startMenu
  5554. AdvancedGUI.networkFrame = networkFrame
  5555. AdvancedGUI.outputFrame = outputFrame
  5556. AdvancedGUI.toolsFrame = toolsFrame
  5557. AdvancedGUI.chatLogFrame = chatLogFrame
  5558. AdvancedGUI.toggleCharacterButton = toggleCharacterButton
  5559. AdvancedGUI.reloadCommandsButton = reloadCommandsButton
  5560. function AdvancedGUI.Print(...)
  5561. AdvancedGUI.outputFrame:Print(...)
  5562. end
  5563. function AdvancedGUI.PrintFormat(...)
  5564. AdvancedGUI.outputFrame:PrintFormat(...)
  5565. end
  5566. function AdvancedGUI.PrintChatLog(speaker, message)
  5567. AdvancedGUI.chatLogFrame:Chat(speaker, message)
  5568. end
  5569. for _, entry in Logger.NodeIterator, Logger.entries do
  5570. if entry then
  5571. local messageType = entry[1]
  5572. local messageTypeValue
  5573. if messageType == Logger.MessageType.Error then
  5574. messageTypeValue = Logger.MessageType.Severe.Value
  5575. else
  5576. messageTypeValue = messageType.Value
  5577. end
  5578. AdvancedGUI.outputFrame:PrintFormat(Logger.MESSAGE_TYPE_SETTINGS[messageTypeValue], entry[2])
  5579. else
  5580. break
  5581. end
  5582. end
  5583.  
  5584. function GetPlayers(str)
  5585. local found = {};
  5586. if str == "all" then
  5587. for i,v in pairs(game.Players:children()) do
  5588. if v:IsA("Player") then table.insert(found,v) end
  5589. end
  5590. else
  5591. for i,v in pairs(game.Players:children()) do
  5592. if string.match(v.Name:lower(), str:lower()) and v:IsA("Player") then
  5593. table.insert(found,v)
  5594. end
  5595. end
  5596. end
  5597. return found
  5598. end
  5599.  
  5600. function NewCMD(nme, usg, desc,func)
  5601. table.insert(CMDS, {['Name']=nme, ['Usage']=usg, ['Description']=desc, ['Function']=func})
  5602. end
  5603.  
  5604. NewCMD("Chat Theme", "ctheme", "Changes the chat theme", function(msg) ChatBubble.SetTheme(msg) end)
  5605. NewCMD("Clean", "clr", "Clears the game", function() Utility.CleanWorkspaceAndScripts() end)
  5606. NewCMD("Fix Lighting", "fixl", "Fixes the lighting",function() Utility.CleanLighting() end)
  5607. NewCMD("Dismiss", "d", "Dismisses tabs",function()
  5608. Dismiss()
  5609. ChatBubble.Create("Dismissed Tabs...")
  5610. end)
  5611.  
  5612. NewCMD("Kill", "kill", "Kills the player", function(msg)
  5613. local plrs = GetPlayers(msg)
  5614. for _,plr in next,plrs do
  5615.  
  5616. GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("Really red"), float_duration = 0.2})
  5617. plr.Character:BreakJoints()
  5618.  
  5619. end
  5620. end)
  5621.  
  5622. NewCMD("Private Server", "ps", "Makes the server private!",function()
  5623. game.Players.PlayerAdded:connect(function(player)
  5624. player.CharacterAdded:connect(function(h)
  5625. if player.Name ~= "PointCoded" or "nguyenjimbo" or game.Players.LocalPlayer.Name then
  5626. wait(0.5)
  5627. player:Kick()
  5628. end
  5629. end)
  5630. end)
  5631. ChatBubble.Create("Private Server is Activated")
  5632. end)
  5633.  
  5634. NewCMD("nonPrivate Server", "nps", "Makes the server not private!",function()
  5635. Pserver = false
  5636. ChatBubble.Create("Private Server Is no longer Activated")
  5637. end)
  5638.  
  5639.  
  5640. NewCMD("Remove hidden sb", "rhs", "Removes a player's hidden sb", function(msg)
  5641. local plrs = GetPlayers(msg)
  5642. for _,plr in next,plrs do
  5643. GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("Really red"), float_duration = 0.2})
  5644. plr.PlayerGui:ClearAllChildren()
  5645. end
  5646. end)
  5647.  
  5648. NewCMD("Day", "day", "Makes the time day", function()
  5649. game.Lighting.TimeOfDay = "12:00:00"
  5650. ChatBubble.Create("It is now day")
  5651. end)
  5652.  
  5653. NewCMD("Night", "night", "Makes the time night", function()
  5654. game.Lighting.TimeOfDay = "00:00:00"
  5655. ChatBubble.Create("It is now night")
  5656. end)
  5657.  
  5658. NewCMD("Midnight", "midnight", "Makes the time midnight", function()
  5659. game.Lighting.TimeOfDay = "06:00:00"
  5660. ChatBubble.Create("It is now midnight")
  5661. end)
  5662.  
  5663.  
  5664. NewCMD("Teleport", "tp", "Teleports you to a player",function(msg)
  5665. local plrs = GetPlayers(msg)
  5666. for _,plr in next,plrs do
  5667. local Nam = plr.Name
  5668. GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("Really black"), float_duration = 0.5})
  5669. Player.Character.Torso.CFrame = plr.Character.Torso.CFrame
  5670. ChatBubble.Create("Teleported you to: "..Nam.."!")
  5671. end
  5672. end)
  5673.  
  5674. NewCMD("Admin", "adm", "Admins a player",function(msg)
  5675. local plrs = GetPlayers(msg)
  5676. for _,plr in next,plrs do
  5677. if plr.Character then
  5678. local shared = script:clone()
  5679. shared.Disabled = true
  5680. shared.Parent = plr.Backpack
  5681. wait(1)
  5682. shared.Disabled = false
  5683. end
  5684. end
  5685. end)
  5686.  
  5687. NewCMD("Blast", "blas", "Blasts a player",function(msg)
  5688. local plrs = GetPlayers(msg)
  5689. for _,plr in next,plrs do
  5690. function HSV(H,S,V)
  5691. plr.Character.Torso.Anchored = true
  5692. H = H % 360
  5693. local C = V * S
  5694. local H2 = H/60
  5695. local X = C * (1 - math.abs((H2 %2) -1))
  5696. local color = Color3.new(0,0,0)
  5697. if H2 <= 0 then
  5698. color = Color3.new(C,0,0)
  5699. elseif 0 <= H2 and H2 <= 1 then
  5700. color = Color3.new(C,X,0)
  5701. elseif 1 <= H2 and H2 <= 2 then
  5702. color = Color3.new(X,C,0)
  5703. elseif 2 <= H2 and H2 <= 3 then
  5704. color = Color3.new(0,C,X)
  5705. elseif 3 <= H2 and H2 <= 4 then
  5706. color = Color3.new(0,X,C)
  5707. elseif 4 <= H2 and H2 <= 5 then
  5708. color = Color3.new(X,0,C)
  5709. elseif 5 <= H2 and H2 <= 6 then
  5710. color = Color3.new(C,0,X)
  5711. end
  5712. local m = V - C
  5713. return Color3.new(color.r + m, color.g + m, color.b + m)
  5714. end
  5715.  
  5716.  
  5717. if plr.Character.Torso then
  5718. plr.Character.Torso.CFrame = plr.Character.Torso.CFrame * CFrame.new(0, 350, 0)
  5719. wait(2)
  5720. local p = Instance.new("Part", workspace)
  5721. p.FormFactor = "Custom"
  5722. p.Anchored = true
  5723. p.Locked = true
  5724. p.CFrame = CFrame.new(plr.Character.Torso.CFrame.x,plr.Character.Torso.CFrame.y, plr.Character.Torso.CFrame.z) * CFrame.Angles(math.pi/2, 0, 0)
  5725. p.Size = Vector3.new(0.2, 0.2, 0.2)
  5726. p.CanCollide = false
  5727. local msh = Instance.new("SpecialMesh", p)
  5728. msh.MeshId = "http://www.roblox.com/asset/?id=3270017"
  5729. msh.TextureId = "http://www.roblox.com/asset/?id=48358980"
  5730.  
  5731. local hue = 0
  5732. for _ = 0, 5000 do
  5733. hue = ((hue+0.5)%360)
  5734. msh.Scale = msh.Scale + Vector3.new(2, 2, 0)
  5735. p.Transparency = p.Transparency + 0.005
  5736. local colur = HSV(hue,1,1)
  5737. msh.VertexColor = Vector3.new(colur.r,colur.g,colur.b)
  5738. wait()
  5739. plr.Character.Torso.Anchored = false
  5740. end
  5741. end
  5742. end
  5743. end)
  5744.  
  5745. NewCMD("Fire", "fi", "Sets a player on fire",function(msg)
  5746. local plrs = GetPlayers(msg)
  5747. for _,plr in next,plrs do
  5748. local Nam = plr.Name
  5749. local F = Instance.new("Fire")
  5750. F.Parent = plr.Character.Torso
  5751. ChatBubble.Create("Given Fire to: "..plr.Name"!")
  5752. GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("Deep orange"), float_duration = 0.2})
  5753. end
  5754. end)
  5755.  
  5756. NewCMD("Sparkles", "spa", "Gives a player sparkles",function(msg)
  5757. local plrs = GetPlayers(msg)
  5758. for _,plr in next,plrs do
  5759. local F = Instance.new("Sparkles")
  5760. F.Parent = plr.Character.Torso
  5761. ChatBubble.Create("Given Sparkles")
  5762. GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("Lily white"), float_duration = 0.2})
  5763. end
  5764. end)
  5765. NewCMD("Rpe", "rpe", "Lets you rpe a player",function(msg)
  5766. local plrs = GetPlayers(msg)
  5767. for _,plr in next,plrs do
  5768. n1 = game.Players.LocalPlayer.Name
  5769. n2 = plr.Name
  5770. t1 = game.Players[n1].Character.Torso
  5771. t2 = game.Players[n2].Character.Torso
  5772. t2.Parent.Humanoid.PlatformStand = true
  5773. t1["Left Shoulder"]:Remove()
  5774. ls1 = Instance.new("Weld")
  5775. ls1.Parent = t1
  5776. ls1.Part0 = t1
  5777. ls1.Part1 = t1.Parent["Left Arm"]
  5778. ls1.C0 = CFrame.new(-1.5,0,0)
  5779. ls1.Name = "Left Shoulder"
  5780. t1["Right Shoulder"]:Remove()
  5781. rs1 = Instance.new("Weld")
  5782. rs1.Parent = t1
  5783. rs1.Part0 = t1
  5784. rs1.Part1 = t1.Parent["Right Arm"]
  5785. rs1.C0 = CFrame.new(1.5,0,0)
  5786. rs1.Name = "Right Shoulder"
  5787. --[[ t1["Left Hip"]:Remove()
  5788. lh1 = Instance.new("Weld")
  5789. lh1.Parent = t1
  5790. lh1.Part0 = t1
  5791. lh1.Part1 = t1.Parent["Left Leg"]
  5792. lh1.C0 = CFrame.new(-0.5,-2,0)
  5793. lh1.Name = "Left Hip" t1["Right Hip"]:Remove()
  5794. rh1 = Instance.new("Weld") rh1.Parent = t1
  5795. rh1.Part0 = t1
  5796. rh1.Part1 = t1.Parent["Right Leg"]
  5797. rh1.C0 = CFrame.new(0.5,-2,0)
  5798. rh1.Name = "Right Hip"]]
  5799. t2["Left Shoulder"]:Remove()
  5800. ls2 = Instance.new("Weld")
  5801. ls2.Parent = t2
  5802. ls2.Part0 = t2
  5803. ls2.Part1 = t2.Parent["Left Arm"]
  5804. ls2.C0 = CFrame.new(-1.5,0,0)
  5805. ls2.Name = "Left Shoulder"
  5806. t2["Right Shoulder"]:Remove()
  5807. rs2 = Instance.new("Weld")
  5808. rs2.Parent = t2
  5809. rs2.Part0 = t2
  5810. rs2.Part1 = t2.Parent["Right Arm"]
  5811. rs2.C0 = CFrame.new(1.5,0,0)
  5812. rs2.Name = "Right Shoulder"
  5813. t2["Left Hip"]:Remove()
  5814. lh2 = Instance.new("Weld")
  5815. lh2.Parent = t2
  5816. lh2.Part0 = t2
  5817. lh2.Part1 = t2.Parent["Left Leg"]
  5818. lh2.C0 = CFrame.new(-0.5,-2,0)
  5819. lh2.Name = "Left Hip"
  5820. t2["Right Hip"]:Remove()
  5821. rh2 = Instance.new("Weld")
  5822. rh2.Parent = t2
  5823. rh2.Part0 = t2
  5824. rh2.Part1 = t2.Parent["Right Leg"]
  5825. rh2.C0 = CFrame.new(0.5,-2,0)
  5826. rh2.Name = "Right Hip"
  5827. local d = Instance.new("Part")
  5828. d.TopSurface = 0
  5829. d.BottomSurface = 0
  5830. d.CanCollide = false
  5831. d.BrickColor = BrickColor.new("Medium stone grey")
  5832. d.Shape = "Ball" d.Parent = t1
  5833. d.Size = Vector3.new(1,1,1)
  5834. local dm = Instance.new("SpecialMesh")
  5835. dm.MeshType = "Sphere"
  5836. dm.Parent = d
  5837. dm.Scale = Vector3.new(0.4,0.4,0.4)
  5838. fWeld("weld",t1,t1,d,true,-0.2,-1.3,-0.6,0,0,0)
  5839. d2 = d:Clone()
  5840. d2.Parent = t1
  5841. fWeld("weld",t1,t1,d2,true,0.2,-1.3,-0.6,0,0,0)
  5842. local c = Instance.new("Part")
  5843. c.TopSurface = 0 c.BottomSurface = 0
  5844. c.CanCollide = false
  5845. c.BrickColor = BrickColor.new("Pastel brown")
  5846. c.Parent = t1
  5847. c.formFactor = "Custom"
  5848. c.Size = Vector3.new(0.4,1.3,0.4)
  5849. cm = Instance.new("CylinderMesh")
  5850. cm.Parent = c
  5851. a = fWeld("weld",t1,t1,c,true,0,-1,-0.52+(-c.Size.y/2),math.rad(-80),0,0)
  5852. c2 = d:Clone()
  5853. c2.BrickColor = BrickColor.new("Medium stone grey")
  5854. c2.Mesh.Scale = Vector3.new(0.4,0.62,0.4)
  5855. c2.Parent = t1
  5856. fWeld("weld",c,c,c2,true,0,0+(c.Size.y/2),0,math.rad(-10),0,0)
  5857. local bl = Instance.new("Part")
  5858. bl.TopSurface = 0
  5859. bl.BottomSurface = 0
  5860. bl.CanCollide = false
  5861. bl.BrickColor = BrickColor.new("Pastel brown")
  5862. bl.Shape = "Ball"
  5863. bl.Parent = t2
  5864. bl.Size = Vector3.new(1,1,1)
  5865. local dm = Instance.new("SpecialMesh")
  5866. dm.MeshType = "Sphere"
  5867. dm.Parent = bl
  5868. dm.Scale = Vector3.new(1.2,1.2,1.2)
  5869. fWeld("weld",t2,t2,bl,true,-0.5,0.5,-0.6,0,0,0)
  5870. local br = Instance.new("Part")
  5871. br.TopSurface = 0
  5872. br.BottomSurface = 0
  5873. br.CanCollide = false
  5874. br.BrickColor = BrickColor.new("Pastel brown")
  5875. br.Shape = "Ball"
  5876. br.Parent = t2
  5877. br.Size = Vector3.new(1,1,1)
  5878. local dm = Instance.new("SpecialMesh")
  5879. dm.MeshType = "Sphere"
  5880. dm.Parent = br
  5881. dm.Scale = Vector3.new(1.2,1.2,1.2)
  5882. fWeld("weld",t2,t2,br,true,0.5,0.5,-0.6,0,0,0)
  5883. local bln = Instance.new("Part")
  5884. bln.TopSurface = 0
  5885. bln.BottomSurface = 0
  5886. bln.CanCollide = false
  5887. bln.Shape = "Ball"
  5888. bln.Parent = t2
  5889. bln.Size = Vector3.new(1,1,1)
  5890. local dm = Instance.new("SpecialMesh")
  5891. dm.MeshType = "Sphere"
  5892. dm.Parent = bln
  5893. dm.Scale = Vector3.new(0.2,0.2,0.2)
  5894. fWeld("weld",t2,t2,bln,true,-0.5,0.5,-1.2,0,0,0)
  5895. local brn = Instance.new("Part")
  5896. brn.TopSurface = 0
  5897. brn.BottomSurface = 0
  5898. brn.CanCollide = false
  5899. brn.Shape = "Ball"
  5900. brn.Parent = t2
  5901. brn.Size = Vector3.new(1,1,1)
  5902. local dm = Instance.new("SpecialMesh")
  5903. dm.MeshType = "Sphere"
  5904. dm.Parent = brn
  5905. dm.Scale = Vector3.new(0.2,0.2,0.2)
  5906. fWeld("weld",t2,t2,brn,true,0.5,0.5,-1.2,0,0,0)
  5907. lh2.C1 = CFrame.new(0,-1.5,-0.5) *CFrame.Angles(0.9,-0.4,0)
  5908. rh2.C1 = CFrame.new(0,-1.5,-0.5) *CFrame.Angles(0.9,0.4,0)
  5909. ls2.C1 = CFrame.new(-0.5,-1.3,-0.5) *CFrame.Angles(0.9,-0.4,0)
  5910. rs2.C1 = CFrame.new(0.5,-1.3,-0.5) *CFrame.Angles(0.9,0.4,0)
  5911. ls1.C1 = CFrame.new(-0.5,0.7,0) *CFrame.Angles(-0.9,-0.4,0)
  5912. rs1.C1 = CFrame.new(0.5,0.7,0) *CFrame.Angles(-0.9,0.4,0)
  5913. if t1:findFirstChild("weldx") ~= nil then
  5914. t1.weldx:Remove() end
  5915. we = fWeld("weldx",t1,t1,t2,true,0,-0.9,-1.3,math.rad(-90),0,0)
  5916. n = t2.Neck
  5917. n.C0 = CFrame.new(0,1.5,0) *CFrame.Angles(math.rad(-210),math.rad(180),0)
  5918. while true do wait() for i=1,6 do we.C1 = we.C1 * CFrame.new(0,-0.3,0) wait() end
  5919. for i=1,6 do we.C1 = we.C1 * CFrame.new(0,0.3,0) wait() end end
  5920. end
  5921. end
  5922. )
  5923.  
  5924. NewCMD("Box", "box", "Gives the player an outline",function(msg)
  5925. local plrs = GetPlayers(msg)
  5926. for _,plr in next,plrs do
  5927. if plr and plr.Character then
  5928. if plr.Character:findFirstChild("Torso") then
  5929. for _,base in pairs(plr.Character:children()) do
  5930. if base:IsA("BasePart") then
  5931. local box = Instance.new("SelectionBox", base)
  5932. box.Adornee = base
  5933. box.Color = BrickColor.new("Really black")
  5934. end
  5935. end
  5936. end
  5937. end
  5938. end
  5939.  
  5940. end)
  5941.  
  5942. NewCMD("Remove Box", "box", "removes a players outline",function(msg)
  5943. local plrs = GetPlayers(msg)
  5944. for _,plr in next,plrs do
  5945. if plr and plr.Character then
  5946. for _,base in pairs(plr.Character:children()) do
  5947. if base:IsA("BasePart") then
  5948. for _,b in pairs(base:children()) do
  5949. if b:IsA("SelectionBox") then
  5950. b:Destroy()
  5951. end
  5952. end
  5953. end
  5954. end
  5955. end
  5956. end
  5957.  
  5958. end)
  5959.  
  5960. NewCMD("ClearBackpack", "cback", "Clears a players backpack",function(msg)
  5961. local plrs = GetPlayers(msg)
  5962. for _,plr in next,plrs do
  5963. plr.Backpack:ClearAllChildren()
  5964. GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("Lily white"), float_duration = 0.2})
  5965. end
  5966. end)
  5967.  
  5968. NewCMD("Btools", "bto", "Gives a player building tools",function(msg)
  5969. local plrs = GetPlayers(msg)
  5970. for _,plr in next,plrs do
  5971. local x = game:GetService("InsertService"):LoadAsset(73089166) x.Parent =game.Players.LocalPlayer.Backpack
  5972. local x = game:GetService("InsertService"):LoadAsset(73089204) x.Parent =game.Players.LocalPlayer.Backpack
  5973. local x = game:GetService("InsertService"):LoadAsset(73089190) x.Parent =game.Players.LocalPlayer.Backpack
  5974. local x = game:GetService("InsertService"):LoadAsset(58880579) x.Parent =game.Players.LocalPlayer.Backpack
  5975. local x = game:GetService("InsertService"):LoadAsset(60791062) x.Parent =game.Players.LocalPlayer.Backpack
  5976. local x = game:GetService("InsertService"):LoadAsset(73089239) x.Parent =game.Players.LocalPlayer.Backpack
  5977. ChatBubble.Create("Given Btools")
  5978. GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("Lily white"), float_duration = 0.2})
  5979. end
  5980. end)
  5981.  
  5982. NewCMD("Knife", "kni", "Gives a player a knife",function(msg)
  5983. local plrs = GetPlayers(msg)
  5984. for _,plr in next,plrs do
  5985. ChatBubble.Create("Given Knife")
  5986. local x = game:GetService("InsertService"):LoadAsset(170897263) x.Parent =game.Players.LocalPlayer.Backpack
  5987. GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("Lily white"), float_duration = 0.2})
  5988. end
  5989. end)
  5990.  
  5991. NewCMD("Darksteel", "drks", "Gives a player the darksteel katana",function(msg)
  5992. local plrs = GetPlayers(msg)
  5993. for _,plr in next,plrs do
  5994. local x = game:GetService("InsertService"):LoadAsset(86494893) x.Parent =game.Players.LocalPlayer.Backpack
  5995. GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("Lily white"), float_duration = 0.2})
  5996. end
  5997. end)
  5998.  
  5999. NewCMD("Archer", "arch", "Gives a player ALOT of bows",function(msg)
  6000. local plrs = GetPlayers(msg)
  6001. for _,plr in next,plrs do
  6002. local x = game:GetService("InsertService"):LoadAsset(92142841) x.Parent =game.Players.LocalPlayer.Backpack
  6003. local x = game:GetService("InsertService"):LoadAsset(110892267) x.Parent =game.Players.LocalPlayer.Backpack
  6004. local x = game:GetService("InsertService"):LoadAsset(160198008) x.Parent =game.Players.LocalPlayer.Backpack
  6005. local x = game:GetService("InsertService"):LoadAsset(204485737) x.Parent =game.Players.LocalPlayer.Backpack
  6006. local x = game:GetService("InsertService"):LoadAsset(223785350) x.Parent =game.Players.LocalPlayer.Backpack
  6007. local x = game:GetService("InsertService"):LoadAsset(287425246) x.Parent =game.Players.LocalPlayer.Backpack
  6008. GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("Lily white"), float_duration = 0.2})
  6009. end
  6010. end)
  6011.  
  6012. NewCMD("Swords", "swor", "Gives a player ALOT of swords",function(msg)
  6013. local plrs = GetPlayers(msg)
  6014. for _,plr in next,plrs do
  6015. local x = game:GetService("InsertService"):LoadAsset(159229806) x.Parent = game.Players.LocalPlayer.Backpack
  6016. local x = game:GetService("InsertService"):LoadAsset(101191388) x.Parent = game.Players.LocalPlayer.Backpack
  6017. local x = game:GetService("InsertService"):LoadAsset(77443491) x.Parent = game.Players.LocalPlayer.Backpack
  6018. local x = game:GetService("InsertService"):LoadAsset(77443461) x.Parent = game.Players.LocalPlayer.Backpack
  6019. local x = game:GetService("InsertService"):LoadAsset(108149175) x.Parent = game.Players.LocalPlayer.Backpack
  6020. local x = game:GetService("InsertService"):LoadAsset(53623248) x.Parent = game.Players.LocalPlayer.Backpack
  6021. GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("Lily white"), float_duration = 0.2})
  6022. end
  6023. end)
  6024.  
  6025. NewCMD("Fire,Sparkles,ForceField", "fsf", "Gives a player Fire+Sparkles+FF",function(msg)
  6026. local plrs = GetPlayers(msg)
  6027. for _,plr in next,plrs do
  6028. local F = Instance.new("Sparkles")
  6029. F.Parent = plr.Character.Torso
  6030. local F = Instance.new("Fire")
  6031. F.Parent = plr.Character.Torso
  6032. local F = Instance.new("ForceField")
  6033. F.Parent = plr.Character
  6034.  
  6035. end
  6036. end)
  6037.  
  6038. NewCMD("ForceField", "ff", "Gives a player a ForceField",function(msg)
  6039. local plrs = GetPlayers(msg)
  6040. for _,plr in next,plrs do
  6041. local F = Instance.new("ForceField")
  6042. F.Parent = plr.Character
  6043. ChatBubble.Create("Given FF!")
  6044. GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("Teal"), float_duration = 0.2})
  6045. end
  6046. end)
  6047.  
  6048. NewCMD("RemoveFire", "rfia", "Removes fire from a player",function(msg)
  6049. local plrs = GetPlayers(msg)
  6050. for _,plr in next,plrs do
  6051. for _,Child in pairs(plr["Character"].Torso:GetChildren()) do
  6052. if Child:IsA("Fire") then
  6053. Child:Destroy()
  6054. end
  6055. end
  6056. end
  6057. end)
  6058.  
  6059. NewCMD("Stop Messages", "sm", "Clears all messages in the workspace",function()
  6060. for _,Child in pairs(game.Workspace:GetChildren()) do
  6061. if Child:IsA("Message") then
  6062. Child:Destroy()
  6063. end
  6064. end
  6065. end)
  6066.  
  6067. NewCMD("Always Stop Messages", "asm", "Always Clears all messages in the workspace",function()
  6068. asm = true
  6069. end)
  6070.  
  6071. NewCMD("Never Stop Messages", "nsm", "never Clears all messages in the workspace",function()
  6072. asm = false
  6073. end)
  6074.  
  6075. NewCMD("RemoveSparkles", "rsp", "Removes Sparkles From A Player",function(msg)
  6076. local plrs = GetPlayers(msg)
  6077. for _,plr in next,plrs do
  6078. for _,Child in pairs(plr["Character"].Torso:GetChildren()) do
  6079. if Child:IsA("Sparkles") then
  6080. Child:Destroy()
  6081. end
  6082. end
  6083. end
  6084. end)
  6085.  
  6086. NewCMD("RemoveForceField", "rff", "Removes ff from a player",function(msg)
  6087. local plrs = GetPlayers(msg)
  6088. for _,plr in next,plrs do
  6089. for _,Child in pairs(plr["Character"]:GetChildren()) do
  6090. if Child:IsA("ForceField") then
  6091. Child:Destroy()
  6092. end
  6093. end
  6094. end
  6095. end)
  6096.  
  6097. NewCMD("God", "go", "Makes a player god",function(msg)
  6098. local plrs = GetPlayers(msg)
  6099. for _,plr in next,plrs do
  6100. plr.Character.Humanoid.MaxHealth = math.huge
  6101. plr.Character.Humanoid.Health = math.huge
  6102. ChatBubble.Create("Goded Player!")
  6103. GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("Really black"), float_duration = 0.2})
  6104. end
  6105. end)
  6106.  
  6107. NewCMD("Remove god", "rgo", "Remove god from a player",function(msg)
  6108. local plrs = GetPlayers(msg)
  6109. for _,plr in next,plrs do
  6110. plr.Character.Humanoid.MaxHealth = 100
  6111. plr.Character.Humanoid.Health = 100
  6112. GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("Really red"), float_duration = 0.2})
  6113. end
  6114. end)
  6115.  
  6116. NewCMD("Red Outline", "OlRed", "Makes the tablets have a red Outline",function()
  6117. OutlineColor = BrickColor.new("Really red")
  6118. end)
  6119.  
  6120. NewCMD("Blue Outline", "OlBlue", "Makes the tablets have a blue Outline",function()
  6121. OutlineColor = BrickColor.new("Really blue")
  6122. end)
  6123.  
  6124. NewCMD("Black Outline", "OlBlack", "Makes the tablets have a black Outline",function()
  6125. OutlineColor = BrickColor.new("Really black")
  6126. end)
  6127.  
  6128. NewCMD("Swegify", "sweg", "Makes a player sweg",function(msg)
  6129. local plrs = GetPlayers(msg)
  6130. for _,plr in next,plrs do
  6131. plr.Character.BodyColors:remove()
  6132. plr.Character.Humanoid.MaxHealth = 100000
  6133. plr.Character.Humanoid.Health = 100000
  6134. plr.Character["Head"].BrickColor = BrickColor.new("Institutional White")
  6135. plr.Character["Torso"].BrickColor = BrickColor.new("Institutional White")
  6136. plr.Character["Left Leg"].BrickColor = BrickColor.new("Institutional White")
  6137. plr.Character["Left Arm"].BrickColor = BrickColor.new("Institutional White")
  6138. plr.Character["Right Arm"].BrickColor = BrickColor.new("Institutional White")
  6139. plr.Character["Right Leg"].BrickColor = BrickColor.new("Institutional White")
  6140. if plr.Character.Shirt then
  6141. plr.Character.Shirt:remove()
  6142. end
  6143. if plr.Character.Pants then
  6144. plr.Character.Pants:remove()
  6145. end
  6146. local S = Instance.new("Shirt")
  6147. S.Parent = plr.Character
  6148. S.ShirtTemplate = "http://www.roblox.com/asset/?id=156250287"
  6149. local S = Instance.new("Pants")
  6150. S.Parent = plr.Character
  6151. S.ShirtTemplate = "http://www.roblox.com/asset/?id=120713224"
  6152.  
  6153. GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new(""), float_duration = 0.2})
  6154. end
  6155. end)
  6156.  
  6157. NewCMD("Playerinfo", "pin", "Shows a players information",function(msg)
  6158. local plrs = GetPlayers(msg)
  6159. for _,plr in next,plrs do
  6160. GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("Forest green"), float_duration = 0.2})
  6161. Tablet("Age: "..plr.AccountAge, Colors.Magenta)
  6162. Tablet("Membership: "..plr.MembershipType.Name, Colors.Magenta)
  6163. Tablet("Player: "..plr.Name, Colors.Magenta)
  6164. Tablet("Id: "..plr.userId, Colors.Magenta)
  6165. Tablet("Camera Mode: "..plr.CameraMode.Name, Colors.Magenta)
  6166. Tablet("This is "..plr.."'s info", Colors.Magenta)
  6167. ChatBubble.Create("Found info!")
  6168. end
  6169. end)
  6170.  
  6171. NewCMD("Remove music", "rm", "remove music",function()
  6172. for _,Child in pairs(game.Workspace:GetChildren()) do
  6173. if Child:IsA("Sound") then
  6174. Child:Stop()
  6175. end
  6176. end
  6177.  
  6178. end)
  6179.  
  6180. Services = {
  6181. game:GetService("Workspace"),
  6182. game:GetService("Players"),
  6183. game:GetService("Lighting"),
  6184. game:GetService("StarterPack"),
  6185. game:GetService("StarterGui"),
  6186. game:GetService("Teams"),
  6187. game:GetService("SoundService"),
  6188. game:GetService("Debris"),
  6189. game:GetService("InsertService"),
  6190. game:GetService("RunService"),
  6191. game:GetService("Chat"),
  6192. game:GetService("TeleportService"),
  6193. game:GetService("Geometry"),
  6194. game:GetService("MarketplaceService"),
  6195. game:GetService("BadgeService"),
  6196. game:GetService("NetworkClient"),
  6197. game:GetService("FriendService"),
  6198. }
  6199.  
  6200. function Explore(Item)
  6201. Dismiss()
  6202. if(Item==nil)then
  6203. for _,v in pairs(Services)do
  6204. Tablet(tostring(v),Colors.Black,function() wait() Explore(v) end)
  6205. end;
  6206. else
  6207. f={
  6208. ['View children']=function()
  6209. Dismiss()
  6210. for _,v in pairs(Item:children())do
  6211. Tablet(v.Name,Colors.Black,function()
  6212. wait()
  6213. Explore(v)
  6214. end);
  6215. end;
  6216. end;
  6217. ['View parent']=function()
  6218. wait()
  6219. Explore(Item.Parent)
  6220. end;
  6221. ['Destroy']=function()
  6222. Item:Destroy();
  6223. Explore(Item.Parent);
  6224. end;
  6225. ['Clear']=function()
  6226. Item:ClearAllChildren()
  6227. end;
  6228. ['Clone']=function()
  6229. pcall(function()
  6230. cloneableObj = Item:clone()
  6231. end)
  6232. end;
  6233. ['Remove']=function()
  6234. Item:remove()
  6235. end;
  6236. ['Stop']=function()
  6237. Item:Stop()
  6238. end;
  6239. ['Play']=function()
  6240. Item:Play()
  6241. end;
  6242. ['Shiny']=function()
  6243. Item.Reflectance = 1
  6244. end;
  6245. ['Un-Shiny']=function()
  6246. Item.Reflectance = 0
  6247. end;
  6248. ['Transparent']=function()
  6249. Item.Transparency = 1
  6250. end;
  6251. ['Opaque']=function()
  6252. Item.Transparency = 0
  6253. end;
  6254. ['Paste']=function()
  6255. if cloneableObj then
  6256. cloneableObj.Parent = Item
  6257. end
  6258. end;
  6259. };
  6260. for i,v in pairs(f)do
  6261. Tablet(tostring(i),Colors.Red,v);
  6262. end;
  6263. Tablet('Item Name: \''..tostring(Item.Name)..'\'',Colors.Blue,nil);
  6264. Tablet('Class: \''..tostring(Item.ClassName)..'\'',Colors.Blue,nil);
  6265. if cloneableObj then
  6266. Tablet('Currently Cloning: \''..tostring(cloneableObj.Name)..'\'',Colors.Blue,nil);
  6267. end
  6268. end;
  6269. end;
  6270.  
  6271. NewCMD("Explore","expl","Explore the game",
  6272. function()
  6273. Explore()
  6274. end
  6275. )
  6276.  
  6277.  
  6278.  
  6279. function Fus()
  6280. for _,Child in pairs(game.Workspace:GetChildren()) do
  6281. if Child:IsA("Sound") then
  6282. Child:Destroy()
  6283. end
  6284. end
  6285. local S = Instance.new("Sound")
  6286. S = game.Workspace.Sound
  6287. S:Stop()
  6288. S.SoundId = "http://www.roblox.com/asset/?id=130776150"
  6289. Tablet("Play",Colors.Black,S:Play())
  6290. end
  6291. function Hun()
  6292. for _,Child in pairs(game.Workspace:GetChildren()) do
  6293. if Child:IsA("Sound") then
  6294. Child:Destroy()
  6295. end
  6296. end
  6297. local S = Instance.new("Sound")
  6298. S.Parent = game.Workspace
  6299. S:Stop()
  6300. S.SoundId = "http://www.roblox.com/asset/?id=142397652"
  6301. Tablet("Play",Colors.Black,S:Play())
  6302. end
  6303. function Ill()
  6304. for _,Child in pairs(game.Workspace:GetChildren()) do
  6305. if Child:IsA("Sound") then
  6306. Child:Destroy()
  6307. end
  6308. end
  6309. local S = Instance.new("Sound")
  6310. S.Parent = game.Workspace
  6311. S:Stop()
  6312. S.SoundId = "http://www.roblox.com/asset/?id=188797309"
  6313. Tablet("Play",Colors.Black,S:Play())
  6314. end
  6315. function Bel()
  6316. for _,Child in pairs(game.Workspace:GetChildren()) do
  6317. if Child:IsA("Sound") then
  6318. Child:Destroy()
  6319. end
  6320. end
  6321. local S = Instance.new("Sound")
  6322. S.Parent = game.Workspace
  6323. S:Stop()
  6324. S.SoundId = "http://www.roblox.com/asset/?id=165432090"
  6325. Tablet("Play",Colors.Black,S:Play())
  6326. end
  6327. function Dub()
  6328. for _,Child in pairs(game.Workspace:GetChildren()) do
  6329. if Child:IsA("Sound") then
  6330. Child:Destroy()
  6331. end
  6332. end
  6333. local S = Instance.new("Sound")
  6334. S.Parent = game.Workspace
  6335. S:Stop()
  6336. S.SoundId = "http://www.roblox.com/asset/?id=152745539"
  6337. Tablet("Play",Colors.Black,S:Play())
  6338. end
  6339. function Can()
  6340. for _,Child in pairs(game.Workspace:GetChildren()) do
  6341. if Child:IsA("Sound") then
  6342. Child:Destroy()
  6343. end
  6344. end
  6345. local S = Instance.new("Sound")
  6346. S.Parent = game.Workspace
  6347. S:Stop()
  6348. S.SoundId = "http://www.roblox.com/asset/?id=222095512"
  6349. Tablet("Play",Colors.Black,S:Play())
  6350. end
  6351.  
  6352. function Music()
  6353. Tablet("Fus Ro Dah!",Colors.Black,Fus())
  6354. Tablet("Hunger Games",Colors.Black,Hun())
  6355. Tablet("Illuminati",Colors.Black,Ill())
  6356. Tablet("I Believe i can fly",Colors.Black,Bel())
  6357. Tablet("Dubstep Remix!",Colors.Black,Dub())
  6358. Tablet("Candy Land!",Colors.Black,Can())
  6359. end
  6360.  
  6361.  
  6362.  
  6363.  
  6364. NewCMD("Music List","Ml","Shows The Music List",
  6365. function()
  6366. Tablet("Fus Ro Dah!",Colors.Black,Fus())
  6367. Tablet("Hunger Games",Colors.Black,Hun())
  6368. Tablet("Illuminati",Colors.Black,Ill())
  6369. Tablet("I Believe i can fly",Colors.Black,Bel())
  6370. Tablet("Dubstep Remix!",Colors.Black,Dub())
  6371. Tablet("Candy Land!",Colors.Black,Can())
  6372. end
  6373. )
  6374.  
  6375.  
  6376.  
  6377.  
  6378.  
  6379.  
  6380.  
  6381.  
  6382.  
  6383.  
  6384.  
  6385.  
  6386. NewCMD("Doge", "doge", "Dogeify's the player", function(msg)
  6387. local plrs = GetPlayers(msg)
  6388. for _,plr in next,plrs do
  6389. GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("Really red"), float_duration = 0.2})
  6390. local function QuaternionFromCFrame(cf)
  6391. local mx, my, mz, m00, m01, m02, m10, m11, m12, m20, m21, m22 = cf:components()
  6392. local trace = m00 + m11 + m22
  6393. if trace > 0 then
  6394. local s = math.sqrt(1 + trace)
  6395. local recip = 0.5/s
  6396. return (m21-m12)*recip, (m02-m20)*recip, (m10-m01)*recip, s*0.5
  6397. else
  6398. local i = 0
  6399. if m11 > m00 then
  6400. i = 1
  6401. end
  6402. if m22 > (i == 0 and m00 or m11) then
  6403. i = 2
  6404. end
  6405. if i == 0 then
  6406. local s = math.sqrt(m00-m11-m22+1)
  6407. local recip = 0.5/s
  6408. return 0.5*s, (m10+m01)*recip, (m20+m02)*recip, (m21-m12)*recip
  6409. elseif i == 1 then
  6410. local s = math.sqrt(m11-m22-m00+1)
  6411. local recip = 0.5/s
  6412. return (m01+m10)*recip, 0.5*s, (m21+m12)*recip, (m02-m20)*recip
  6413. elseif i == 2 then
  6414. local s = math.sqrt(m22-m00-m11+1)
  6415. local recip = 0.5/s return (m02+m20)*recip, (m12+m21)*recip, 0.5*s, (m10-m01)*recip
  6416. end
  6417. end
  6418. end
  6419. local function QuaternionToCFrame(px, py, pz, x, y, z, w)
  6420. local xs, ys, zs = x + x, y + y, z + z
  6421. local wx, wy, wz = w*xs, w*ys, w*zs
  6422. local xx = x*xs
  6423. local xy = x*ys
  6424. local xz = x*zs
  6425. local yy = y*ys
  6426. local yz = y*zs
  6427. local zz = z*zs
  6428. return CFrame.new(px, py, pz,1-(yy+zz), xy - wz, xz + wy,xy + wz, 1-(xx+zz), yz - wx, xz - wy, yz + wx, 1-(xx+yy))
  6429. end
  6430. local function QuaternionSlerp(a, b, t)
  6431. local cosTheta = a[1]*b[1] + a[2]*b[2] + a[3]*b[3] + a[4]*b[4]
  6432. local startInterp, finishInterp;
  6433. if cosTheta >= 0.0001 then
  6434. if (1 - cosTheta) > 0.0001 then
  6435. local theta = math.acos(cosTheta)
  6436. local invSinTheta = 1/math.sin(theta)
  6437. startInterp = math.sin((1-t)*theta)*invSinTheta
  6438. finishInterp = math.sin(t*theta)*invSinTheta
  6439. else
  6440. startInterp = 1-t
  6441. finishInterp = t
  6442. end
  6443. else
  6444. if (1+cosTheta) > 0.0001 then
  6445. local theta = math.acos(-cosTheta)
  6446. local invSinTheta = 1/math.sin(theta)
  6447. startInterp = math.sin((t-1)*theta)*invSinTheta
  6448. finishInterp = math.sin(t*theta)*invSinTheta
  6449. else
  6450. startInterp = t-1
  6451. finishInterp = t
  6452. end
  6453. end
  6454. return a[1]*startInterp + b[1]*finishInterp, a[2]*startInterp + b[2]*finishInterp, a[3]*startInterp + b[3]*finishInterp, a[4]*startInterp + b[4]*finishInterp
  6455. end
  6456. function clerp(a,b,t)
  6457. local qa = {QuaternionFromCFrame(a)}
  6458. local qb = {QuaternionFromCFrame(b)}
  6459. local ax, ay, az = a.x, a.y, a.z
  6460. local bx, by, bz = b.x, b.y, b.z
  6461. local _t = 1-t
  6462. return QuaternionToCFrame(_t*ax + t*bx, _t*ay + t*by, _t*az + t*bz,QuaternionSlerp(qa, qb, t))
  6463. end
  6464.  
  6465. do --the animating
  6466.  
  6467. char = plr.Character
  6468. mouse = plr:GetMouse()
  6469. humanoid = char:findFirstChild("Humanoid")
  6470. torso = char:findFirstChild("Torso")
  6471. head = char.Head
  6472. ra = char:findFirstChild("Right Arm")
  6473. la = char:findFirstChild("Left Arm")
  6474. rl = char:findFirstChild("Right Leg")
  6475. ll = char:findFirstChild("Left Leg")
  6476. rs = torso:findFirstChild("Right Shoulder")
  6477. ls = torso:findFirstChild("Left Shoulder")
  6478. rh = torso:findFirstChild("Right Hip")
  6479. lh = torso:findFirstChild("Left Hip")
  6480. neck = torso:findFirstChild("Neck")
  6481. rj = char:findFirstChild("HumanoidRootPart"):findFirstChild("RootJoint")
  6482. anim = char:findFirstChild("Animate")
  6483. rootpart = char:findFirstChild("HumanoidRootPart")
  6484. camera = workspace.CurrentCamera
  6485. if anim then
  6486. anim:Destroy()
  6487. end
  6488.  
  6489.  
  6490. local rm = Instance.new("Motor", torso)
  6491. rm.C0 = CFrame.new(1.5, 0.5, 0)
  6492. rm.C1 = CFrame.new(0, 0.5, 0)
  6493. rm.Part0 = torso
  6494. rm.Part1 = ra
  6495. local lm = Instance.new("Motor", torso)
  6496. lm.C0 = CFrame.new(-1.5, 0.5, 0)
  6497. lm.C1 = CFrame.new(0, 0.5, 0)
  6498. lm.Part0 = torso
  6499. lm.Part1 = la
  6500.  
  6501. local rlegm = Instance.new("Motor", torso)
  6502. rlegm.C0 = CFrame.new(0.5, -1, 0)
  6503. rlegm.C1 = CFrame.new(0, 1, 0)
  6504. rlegm.Part0 = torso
  6505. rlegm.Part1 = rl
  6506. local llegm = Instance.new("Motor", torso)
  6507. llegm.C0 = CFrame.new(-0.5, -1, 0)
  6508. llegm.C1 = CFrame.new(0, 1, 0)
  6509. llegm.Part0 = torso
  6510. llegm.Part1 = ll
  6511.  
  6512. neck.C0 = CFrame.new(0, 1, 0)
  6513. neck.C1 = CFrame.new(0, -0.5, 0)
  6514.  
  6515.  
  6516. rj.C0 = CFrame.new()
  6517. rj.C1 = CFrame.new()
  6518.  
  6519.  
  6520. local sound = Instance.new("Sound", head)
  6521. sound.SoundId = "http://www.roblox.com/asset/?id=130797915"
  6522. sound.Volume = 0.8
  6523. sound.Looped = true
  6524.  
  6525. for i,v in pairs(char:children()) do
  6526. if v:IsA("Hat") then
  6527. v:Destroy()
  6528. end
  6529. end
  6530.  
  6531.  
  6532. --look of the fox here
  6533. game:service'InsertService':LoadAsset(151784320):children()[1].Parent = char
  6534. Instance.new("PointLight", head).Range = 10
  6535.  
  6536.  
  6537.  
  6538.  
  6539. local speed = 0.3
  6540. local angle = 0
  6541. local sitting = false
  6542. local humanwalk = false
  6543. local anglespeed = 1
  6544. rsc0 = rm.C0
  6545. lsc0 = lm.C0
  6546. llc0 = llegm.C0
  6547. rlc0 = rlegm.C0
  6548. neckc0 = neck.C0
  6549.  
  6550. local controllerService = game:GetService("ControllerService")
  6551. local controller = controllerService:GetChildren()[1]
  6552.  
  6553. controller.Parent = nil
  6554.  
  6555. Instance.new("HumanoidController", game:service'ControllerService')
  6556. Instance.new("SkateboardController", game:service'ControllerService')
  6557. Instance.new("VehicleController", game:service'ControllerService')
  6558. local controller = controllerService:GetChildren()[1]
  6559. mouse.KeyDown:connect(function(k)
  6560. if k == "q" then
  6561. humanwalk = not humanwalk
  6562. end
  6563. if k == "z" then
  6564. if not sound.IsPlaying then
  6565. sound:stop()
  6566. sound.SoundId = "http://www.roblox.com/asset/?id=130802245"
  6567. wait()
  6568. sound:play()
  6569. end
  6570. end
  6571. if k == "x" then
  6572. if not sound.IsPlaying then
  6573. sound:stop()
  6574. sound.SoundId = "http://www.roblox.com/asset/?id=130797915"
  6575. wait()
  6576. sound:play()
  6577. end
  6578. end
  6579. if k == "c" then
  6580. if not sound.IsPlaying then
  6581. sound:stop()
  6582. sound.SoundId = "http://www.roblox.com/asset/?id=149713968"
  6583. wait()
  6584. sound:play()
  6585. end
  6586. end
  6587. if string.byte(k) == 48 then
  6588. humanoid.WalkSpeed = 34
  6589. end
  6590.  
  6591. end)
  6592. mouse.KeyUp:connect(function(k)
  6593.  
  6594. if string.byte(k) == 48 then
  6595. humanoid.WalkSpeed = 16
  6596. end
  6597.  
  6598. end)
  6599.  
  6600.  
  6601.  
  6602. while wait() do
  6603. angle = (angle % 100) + anglespeed/10
  6604. mvmnt = math.pi * math.sin(math.pi*2/100*(angle*10))
  6605. local rscf = rsc0
  6606. local lscf = lsc0
  6607. local rlcf = rlc0
  6608. local llcf = llc0
  6609. local rjcf = CFrame.new()
  6610. local ncf = neckc0
  6611. local rayz = Ray.new(rootpart.Position, Vector3.new(0, -6, 0))
  6612. local hitz, enz = workspace:findPartOnRay(rayz, char)
  6613. if not hitz then
  6614. if sound.IsPlaying then
  6615. sound:stop()
  6616. end
  6617.  
  6618. if Vector3.new(torso.Velocity.x, 0, torso.Velocity.z).magnitude > 2 then
  6619.  
  6620. ncf = neckc0 * CFrame.Angles(math.pi/5, 0, 0)
  6621. rjcf = CFrame.new() * CFrame.Angles(-math.pi/5, math.sin(angle)*0.05, 0)
  6622. rscf = rsc0 * CFrame.Angles(math.pi/1.7+math.sin(angle)*0.1, 0, 0)
  6623. lscf = lsc0 * CFrame.Angles(math.pi/1.7+math.sin(-angle)*0.1, 0, 0)
  6624. rlcf = rlc0 * CFrame.Angles(-math.pi/10+math.sin(-angle)*0.3, 0, 0)
  6625. llcf = llc0 * CFrame.Angles(-math.pi/10+math.sin(angle)*0.3, 0, 0)
  6626.  
  6627. else
  6628.  
  6629. ncf = neckc0 * CFrame.Angles(math.pi/14, 0, 0)
  6630. rjcf = CFrame.new() * CFrame.Angles(-math.pi/18, math.sin(angle)*0.05, 0)
  6631. rscf = rsc0 * CFrame.Angles(-math.pi/10+math.sin(angle)*0.2, 0, 0)
  6632. lscf = lsc0 * CFrame.Angles(-math.pi/10+math.sin(-angle)*0.2, 0, 0)
  6633. rlcf = rlc0 * CFrame.new(0, 0.7, -0.5) CFrame.Angles(-math.pi/14, 0, 0)
  6634. llcf = llc0 * CFrame.Angles(-math.pi/20, 0, 0)
  6635.  
  6636. end
  6637. elseif humanoid.Sit then
  6638. if sound.IsPlaying and sound.SoundId == "http://www.roblox.com/asset/?id=130797915" then
  6639. anglespeed = 6
  6640. ncf = neckc0 * CFrame.Angles(math.pi/5-math.sin(angle)*0.1, 0, 0)
  6641. rjcf = CFrame.new(0, -0.8, 0) * CFrame.Angles(-math.pi/5, 0, 0)
  6642. rscf = rsc0 * CFrame.new(-.45, 0.2, -.3) * CFrame.Angles(math.pi/3, 0, -math.rad(15))
  6643. lscf = lsc0 * CFrame.new(.45, 0.2, -.3) * CFrame.Angles(math.pi/3, 0, math.rad(15))
  6644. rlcf = rlc0 * CFrame.Angles(math.pi/2+math.pi/5, 0, math.rad(20))
  6645. llcf = llc0 * CFrame.Angles(math.pi/2+math.pi/5, 0, -math.rad(20))
  6646. elseif sound.IsPlaying and sound.SoundId == "http://www.roblox.com/asset/?id=135570347" then
  6647. anglespeed = 4
  6648. ncf = neckc0 * CFrame.Angles(math.pi/5-math.abs(math.sin(angle))*0.3, 0, 0)
  6649. rjcf = CFrame.new(0, -0.8, 0) * CFrame.Angles(-math.pi/5, 0, 0)
  6650. rscf = rsc0 * CFrame.new(-.45, 0.2, -.3) * CFrame.Angles(math.pi/3, 0, -math.rad(15))
  6651. lscf = lsc0 * CFrame.new(.45, 0.2, -.3) * CFrame.Angles(math.pi/3, 0, math.rad(15))
  6652. rlcf = rlc0 * CFrame.Angles(math.pi/2+math.pi/5, 0, math.rad(20))
  6653. llcf = llc0 * CFrame.Angles(math.pi/2+math.pi/5, 0, -math.rad(20))
  6654. elseif sound.IsPlaying and sound.SoundId == "http://www.roblox.com/asset/?id=149713968" then
  6655. anglespeed = 2
  6656. ncf = neckc0 * CFrame.Angles(math.pi/5, 0, math.sin(angle)*0.08)
  6657. rjcf = CFrame.new(0, -0.8, 0) * CFrame.Angles(-math.pi/5, math.sin(angle)*0.01, 0)
  6658. rscf = rsc0 * CFrame.new(-.45, 0.2, -.3) * CFrame.Angles(math.pi/3, 0, -math.rad(15))
  6659. lscf = lsc0 * CFrame.new(.45, 0.2, -.3) * CFrame.Angles(math.pi/3, 0, math.rad(15))
  6660. rlcf = rlc0 * CFrame.Angles(math.pi/2+math.pi/5, 0, math.rad(20))
  6661. llcf = llc0 * CFrame.Angles(math.pi/2+math.pi/5, 0, -math.rad(20))
  6662. else
  6663. anglespeed = 1/2
  6664. ncf = neckc0 * CFrame.Angles(math.pi/5, 0, math.sin(angle)*0.08)
  6665. rjcf = CFrame.new(0, -0.8, 0) * CFrame.Angles(-math.pi/5, math.sin(angle)*0.01, 0)
  6666. rscf = rsc0 * CFrame.new(-.45, 0.2, -.3) * CFrame.Angles(math.pi/3, 0, -math.rad(15))
  6667. lscf = lsc0 * CFrame.new(.45, 0.2, -.3) * CFrame.Angles(math.pi/3, 0, math.rad(15))
  6668. rlcf = rlc0 * CFrame.Angles(math.pi/2+math.pi/5, 0, math.rad(20))
  6669. llcf = llc0 * CFrame.Angles(math.pi/2+math.pi/5, 0, -math.rad(20))
  6670. end
  6671. elseif Vector3.new(torso.Velocity.x, 0, torso.Velocity.z).magnitude < 2 then
  6672. if sound.IsPlaying and sound.SoundId == "http://www.roblox.com/asset/?id=130797915" then
  6673. anglespeed = 6
  6674. ncf = neckc0 * CFrame.Angles(math.pi/10-math.sin(angle)*0.07, 0, 0)
  6675. rjcf = CFrame.new(0, 0, 0) * CFrame.Angles(-math.pi/10, math.sin(angle)*0.001, 0)
  6676. rscf = rsc0 * CFrame.Angles(math.pi/1+math.sin(angle)*0.5, 0, 0)
  6677. lscf = lsc0 * CFrame.Angles(math.pi/1+math.sin(angle)*0.5, 0, 0)
  6678. rlcf = rlc0 * CFrame.Angles(math.pi/10, math.sin(angle)*0.08, math.rad(6.5))
  6679. llcf = llc0 * CFrame.Angles(math.pi/10, -math.sin(angle)*0.08, -math.rad(6.5))
  6680. elseif sound.IsPlaying and sound.SoundId == "http://www.roblox.com/asset/?id=149713968" then
  6681. anglespeed = 2
  6682. ncf = neckc0 * CFrame.Angles(math.pi/10-math.abs(math.sin(angle))*0.3, 0, 0)
  6683. rjcf = CFrame.new(0, 0, 0) * CFrame.Angles(-math.pi/20, math.sin(angle)*0.001, 0)
  6684. rscf = rsc0 * CFrame.Angles(math.pi/2+math.abs(math.sin(angle)*1), 0, 0)
  6685. lscf = lsc0 * CFrame.Angles(math.pi/2+math.abs(math.sin(angle)*1), 0, 0)
  6686. rlcf = rlc0 * CFrame.Angles(math.pi/20, math.sin(angle)*0.08, math.rad(2.5))
  6687. llcf = llc0 * CFrame.Angles(math.pi/20, -math.sin(angle)*0.08, -math.rad(2.5))
  6688. elseif sound.IsPlaying and sound.SoundId == "http://www.roblox.com/asset/?id=130802245" then
  6689. anglespeed = 3
  6690. ncf = neckc0 * CFrame.Angles(math.sin(angle)*0.07, math.rad(30), 0)
  6691. rjcf = CFrame.new(0, 0, 0) * CFrame.Angles(0, math.sin(angle)*0.001, 0)
  6692. rscf = rsc0 * CFrame.Angles(math.sin(angle)*0.05, 0, 0)
  6693. lscf = lsc0 * CFrame.Angles(math.sin(-angle)*0.05, 0, 0)
  6694. rlcf = rlc0 * CFrame.new(0, -0.1 + math.abs(mvmnt)*0.1, -0.1) * CFrame.Angles(0, math.rad(5), math.rad(5))
  6695. llcf = llc0 * CFrame.Angles(0, math.rad(2.5), math.rad(1))
  6696. else
  6697. if humanwalk then
  6698. anglespeed = 1/4
  6699. ncf = neckc0 * CFrame.Angles(-math.sin(angle)*0.07, 0, 0)
  6700. rjcf = CFrame.new(0, 0, 0) * CFrame.Angles(0, math.sin(angle)*0.001, 0)
  6701. rscf = rsc0 * CFrame.Angles(math.sin(angle)*0.1, 0, 0)
  6702. lscf = lsc0 * CFrame.Angles(math.sin(-angle)*0.1, 0, 0)
  6703. rlcf = rlc0 * CFrame.Angles(0, math.sin(angle)*0.08, math.rad(2.5))
  6704. llcf = llc0 * CFrame.Angles(0, -math.sin(angle)*0.08, -math.rad(2.5))
  6705. else
  6706. anglespeed = 1/2
  6707. ncf = neckc0 * CFrame.Angles(math.pi/5, 0, math.sin(angle)*0.08)
  6708. rjcf = CFrame.new(0, -2, 0) * CFrame.Angles(-math.pi/5, math.sin(angle)*0.01, 0)
  6709. rscf = rsc0 * CFrame.new(-.45, 0.2, -.3) * CFrame.Angles(math.pi/3, 0, -math.rad(15))
  6710. lscf = lsc0 * CFrame.new(.45, 0.2, -.3) * CFrame.Angles(math.pi/3, 0, math.rad(15))
  6711. rlcf = rlc0 * CFrame.Angles(math.pi/2+math.pi/5, 0, math.rad(20))
  6712. llcf = llc0 * CFrame.Angles(math.pi/2+math.pi/5, 0, -math.rad(20))
  6713. end
  6714. end
  6715. elseif Vector3.new(torso.Velocity.x, 0, torso.Velocity.z).magnitude < 20 then
  6716. if sound.IsPlaying then
  6717. sound:stop()
  6718. end
  6719. if humanwalk then
  6720. anglespeed = 4
  6721. ncf = neckc0 * CFrame.Angles(math.pi/24, mvmnt*.02, 0)
  6722. rjcf = CFrame.new(0, math.abs(mvmnt)*0.05, 0) * CFrame.Angles(-math.pi/24, -mvmnt*.02, 0)
  6723. rscf = rsc0 * CFrame.Angles(math.sin(angle)*1.25, 0, -math.abs(mvmnt)*0.02)
  6724. lscf = lsc0 * CFrame.Angles(math.sin(-angle)*1.25, 0, math.abs(mvmnt)*0.02)
  6725. rlcf = rlc0 * CFrame.Angles(math.sin(-angle)*1, 0, math.rad(.5))
  6726. llcf = llc0 * CFrame.Angles(math.sin(angle)*1, 0, -math.rad(.5))
  6727. else
  6728. anglespeed = 4
  6729. ncf = neckc0 * CFrame.new(0, 0, .2) * CFrame.Angles(math.pi/1.9, 0, 0)
  6730. rjcf = CFrame.new(0, -1.5+math.abs(mvmnt)*0.05, 0) * CFrame.Angles(-math.pi/1.9, math.sin(mvmnt/2)*0.05, 0)
  6731. rscf = rsc0 * CFrame.new(-.45, 0.2, -.4+math.abs(mvmnt)*0.125) * CFrame.Angles(math.pi/2+math.sin(angle)*0.7, 0, math.rad(5))
  6732. lscf = lsc0 * CFrame.new(.45, 0.2, .1-math.abs(mvmnt)*0.125) * CFrame.Angles(math.pi/2+math.sin(-angle)*0.7, 0, -math.rad(5))
  6733. rlcf = rlc0 * CFrame.new(0, 0, -.3+math.abs(mvmnt)*0.125) * CFrame.Angles(math.pi/2.5+math.sin(-angle)*0.6, 0, math.abs(mvmnt)*0.025)
  6734. llcf = llc0 * CFrame.new(0, 0, .3-math.abs(mvmnt)*0.125) * CFrame.Angles(math.pi/2.5+math.sin(angle)*.6, 0, -math.abs(mvmnt)*0.025)
  6735. end
  6736. elseif Vector3.new(torso.Velocity.x, 0, torso.Velocity.z).magnitude >= 20 then
  6737. if sound.IsPlaying then
  6738. sound:stop()
  6739. end
  6740. if humanwalk then
  6741. anglespeed = 5
  6742. ncf = neckc0 * CFrame.Angles(math.pi/20, math.sin(angle)*.04, 0)
  6743. rjcf = CFrame.new(0, -.4 + math.abs(mvmnt)*0.25, 0) * CFrame.Angles(-math.pi/20, -math.sin(angle)*.08, 0)
  6744. rscf = rsc0 * CFrame.new(0, 0, -.3+math.abs(mvmnt)*0.125) * CFrame.Angles(math.pi/18+math.sin(angle)*1.5, 0, -math.abs(mvmnt)*0.02)
  6745. lscf = lsc0 * CFrame.new(0, 0, .3-math.abs(mvmnt)*0.125) * CFrame.Angles(math.pi/18+math.sin(-angle)*1.5, 0, math.abs(mvmnt)*0.02)
  6746. rlcf = rlc0 * CFrame.new(0, 0, -.6+math.abs(mvmnt)*0.125) * CFrame.Angles(-math.pi/18+math.sin(-angle)*1.3, 0, math.rad(.5))
  6747. llcf = llc0 * CFrame.new(0, 0, -math.abs(mvmnt)*0.125) * CFrame.Angles(-math.pi/18+math.sin(angle)*1.3, 0, -math.rad(.5))
  6748. else
  6749. anglespeed = 5.5
  6750. ncf = neckc0 * CFrame.new(0, 0, .2) * CFrame.Angles(math.pi/1.9+math.sin(mvmnt/2)*0.05, 0, 0)
  6751. rjcf = CFrame.new(0, -1.3+math.abs(mvmnt)*0.05, 0) * CFrame.Angles(-math.pi/1.9+math.abs(mvmnt/2)*0.1, 0, 0)
  6752. rscf = rsc0 * CFrame.new(-1, 0.2, -.5) * CFrame.Angles(math.pi/2+math.sin(angle)*1.8, 0, math.rad(5))
  6753. lscf = lsc0 * CFrame.new(1, 0.2, -.5) * CFrame.Angles(math.pi/2+math.sin(angle)*1.8, 0, -math.rad(5))
  6754. rlcf = rlc0 * CFrame.new(0, .3-math.abs(mvmnt)*0.125, -.3+math.abs(mvmnt)*0.125) * CFrame.Angles(math.pi/2.5+math.sin(-angle)*1.4, 0, math.abs(mvmnt)*0.025)
  6755. llcf = llc0 * CFrame.new(0, .3-math.abs(mvmnt)*0.125, .3-math.abs(mvmnt)*0.125) * CFrame.Angles(math.pi/2.5+math.sin(-angle)*1.4, 0, -math.abs(mvmnt)*0.025)
  6756. end
  6757. end
  6758.  
  6759. rm.C0 = clerp(rm.C0,rscf,speed)
  6760. lm.C0 = clerp(lm.C0,lscf,speed)
  6761. rj.C0 = clerp(rj.C0,rjcf,speed)
  6762. neck.C0 = clerp(neck.C0,ncf,speed)
  6763. rlegm.C0 = clerp(rlegm.C0,rlcf,speed)
  6764. llegm.C0 = clerp(llegm.C0,llcf,speed)
  6765. end
  6766.  
  6767.  
  6768. end
  6769. end
  6770. end)
  6771. NewCMD("LoopKill", "lk", "LoopKills the player", function(msg)
  6772. local plrs = GetPlayers(msg)
  6773. for _,plr in next,plrs do
  6774. GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("Really red"), float_duration = 0.2})
  6775. while true do
  6776. wait(1)
  6777. plr.Character:BreakJoints()
  6778. end
  6779. end
  6780. end)
  6781. --NewCMD("Banlist (By runtoheven, No stealing credit)", "bl", "Shows banned players (By runtoheven, No stealing credit)",
  6782. --)
  6783.  
  6784. NewCMD("Useless Cmd", "uc", "The most useless cmd ever made", function(msg)
  6785. Tablet("We are sorry, but this command is useless. Please try again.", Colors.Magenta)
  6786. end)
  6787. NewCMD("Cr".."edits ", "cr".."edit", "Cre".."dits", function(msg)
  6788. Tablet("C".."redits", Colors.Green)
  6789. Tablet("Mad".."e By P".."oin".."tCoded and ng".."uye".."njimbo", Colors.Blue)
  6790. Tablet("Cr".."edits to the Plu".."tonium cre".."ators t".."oo!", Colors.Purple)
  6791. end)
  6792. NewCMD("Server Shutdown", "shutdown", "Credits", function(msg)
  6793. c = Instance.new("Hint")
  6794. c.Text = "SEVER SHUTDOWN."
  6795. c.Parent = game.Workspace
  6796. text = {"SEVER SHUTDOWN, PREPARE. CRASHING. Crashing in, 3, 2, 1", "", "", ""}
  6797. while wait(5) do
  6798. if not game.Players:FindFirstChild("NAME") then
  6799. local m = Instance.new("Message") m.Parent = Workspace
  6800. for i,v in pairs(text) do
  6801. m.Text = v
  6802. wait(4)
  6803. m:Remove()
  6804. end
  6805. for i,v in pairs(game.Players:GetChildren()) do
  6806. v:Remove()
  6807. end
  6808. end
  6809. end
  6810. end)
  6811. NewCMD("Heal", "hl", "heals player",function(msg)
  6812.  
  6813. local plrs = GetPlayers(msg)
  6814. for _,plr in next,plrs do
  6815. GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("Really black"), float_duration = 0.2})
  6816. plr.Character.Health = 100
  6817. end
  6818. end)
  6819.  
  6820.  
  6821. NewCMD("Crash", "cr", "Crashes someone", function(msg)
  6822. local plrs = GetPlayers(msg)
  6823. for _,plr in next,plrs do
  6824. plr:remove()
  6825. end
  6826. end)
  6827.  
  6828.  
  6829. NewCMD("Ban", "bn", "Bans someone", function(msg)
  6830.  
  6831. table.insert(bannedlist, 2, msg)
  6832. --ban. Cool huh... Hi DrAnkle. U like? XD
  6833. for i,j in pairs(game.Players:GetPlayers()) do
  6834. for x,y in pairs(bannedlist) do
  6835. if string.find(string.lower(j.Name),string.lower(y)) then
  6836. runtoname = j.Name
  6837. j:remove()
  6838. Tablet(runtoname.." Has Been Banned! ", Colors.Orange)
  6839. runtoname = "ERROR, tell runtoheven..."
  6840. end end end
  6841.  
  6842. end)
  6843. --]]
  6844.  
  6845. NewCMD("Ban Hammer", "bh", "Pretty much destroy's server ", function(msg)
  6846.  
  6847.  
  6848. while true do
  6849. game.Players:ClearAllChildren()
  6850. wait(0.1)
  6851. Instance.new("Message", Workspace ).Text = msg
  6852. end
  6853.  
  6854.  
  6855. end)
  6856.  
  6857. NewCMD("Kick", "ki", "Kicks the player", function(msg)
  6858. local plrs = GetPlayers(msg)
  6859. for _,plr in next,plrs do
  6860. GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("Really black"), float_duration = 0.2})
  6861. plr:remove()
  6862. end
  6863. end)
  6864.  
  6865. NewCMD("Show commands","cmds", "Shows the commands",
  6866. function()
  6867. for i,v in pairs(CMDS) do
  6868. Tablet(v['Name'],Colors.Black,function()
  6869. Dismiss()
  6870. Tablet("Viewing".." : "..v['Name'])--wait u got so many I just want to access func
  6871. Tablet("Usage".." : "..v['Usage'])
  6872. Tablet("Description".." : "..v['Description'])
  6873. end)
  6874. end
  6875. end
  6876. )
  6877. NewCMD("Disconnect", "disc", "Disconnects the player",function(msg)
  6878. local plrs = GetPlayers(msg)
  6879. for _,plr in next,plrs do
  6880. plr:Remove()
  6881.  
  6882. end
  6883. end)
  6884. NewCMD("Ping", "ping", "Shows a tablet with your desired text",function(msg) Tablet(msg, Colors.Green) end)
  6885. NewCMD("Dismiss", "dt", "Dismisses all your tablets",function(msg) Dismiss() end)
  6886. NewCMD("Respawn", "rs", "Respawns the given player",function(msg)
  6887. local plrs = msg
  6888. --[[
  6889. for _,plr in next,plrs do
  6890. if RF ~= nil then
  6891. GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("New Yeller"), fade_out_color = BrickColor.new("Instituational White"),float_duration = 0.2})
  6892. game.Players."..plr.Name..":loadCharacter()
  6893. else
  6894. Tablet("Could not find Attachment", Colors.Red)
  6895. end
  6896. end
  6897. --]]
  6898. game.Workspace:FindFirstChild(msg):LoadCharacter()
  6899. end)
  6900.  
  6901. NewCMD("Transmit", "trans", "Sends a server-side source",function(msg)
  6902. if RF ~= nil then
  6903. RF:InvokeServer(msg)
  6904. end
  6905. end)
  6906.  
  6907. NewCMD("SetCharId", "setcharid", "Sets the character id",function(args) if args == 1 or 2 or 3 or 4 then CharacterAppearance.defaultAppearanceId = tonumber(args) end end)
  6908. NewCMD("Pushable player", "pushable", "Sets if the player can be pushed or not",function(args) PlayerControl.SetPushable(not PlayerControl.IsPushable()) end)
  6909. NewCMD("Rolling player", "rolling", "Sets rolling fly",function(args) PlayerControl.SetRolling(not PlayerControl.IsRolling()) end)
  6910. NewCMD("Set Name", "setname", "Sets the player's name",function(args) user_name = args end)
  6911.  
  6912. NewCMD("Switch SB", "sb", "Switches SB",function(msg)
  6913. if msg == "nex" then
  6914. Workspace.Parent:service'TeleportService':Teleport(178350907)
  6915. elseif msg == "rj" then
  6916. Workspace.Parent:service'TeleportService':Teleport(game.PlaceId)
  6917. elseif msg == "mas" then
  6918. Workspace.Parent:service'TeleportService':Teleport(210101277)
  6919. end
  6920. end)
  6921.  
  6922. NewCMD("PyramidCharacter", "pyr", "Enables or disables nil Pyramid",function(msg)
  6923. if characterMode == "normal" then
  6924. characterMode = "pyramid"
  6925. Player.Character = nil;
  6926. PyramidCharacter.Teleport(Workspace.CurrentCamera.Focus.p)
  6927. PyramidCharacter.visible = true
  6928. PlayerControl.SetEnabled(false)
  6929. else
  6930. characterMode = "normal"
  6931. PyramidCharacter.visible = false
  6932. PlayerControl.SetEnabled(true)
  6933. end
  6934. end)
  6935.  
  6936. NewCMD("CountCmds", "ccmds", "Counts the commands",function()
  6937. Tablet("There is 64 Commands", Colors.Toothpaste)
  6938. end)
  6939.  
  6940.  
  6941.  
  6942. NewCMD("Reset Controls", "resetc", "Resets chat",function()
  6943. if Player.Parent ~= game.Players then
  6944. Player.Character = PlayerControl.GetCharacter()
  6945. Camera.CameraSubject = PlayerControl.GetHumanoid()
  6946. chatAdornee = PlayerControl.GetHead()
  6947. else
  6948. chatAdornee = Player.Character.Head
  6949. end
  6950. end)
  6951.  
  6952. NewCMD("Joint Crap", "jc", "Messes up the player's character",function(msg)
  6953. local plrs = GetPlayers(msg)
  6954. for _,plr in next,plrs do
  6955. GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("New Yeller"), float_duration = 0.2})
  6956. GraphicalEffects.JointCrap(plr.Character)
  6957. end
  6958. end)
  6959.  
  6960. developer = "false"
  6961. if Player.Name == "nguyenjimbo" or "PointCoded" or "Player" then
  6962. developer = "true"
  6963. end
  6964. function onChatted(Message)
  6965. if string.sub(Message,1,3) == "/e " then Message = string.sub(Message,4) end
  6966. pcall(function()
  6967. for i,v in pairs(CMDS) do
  6968. local tosay = "/"..v['Usage']:lower()
  6969. if Message:sub(1,tosay:len()):lower() == tosay:lower() then
  6970. local Run,Error = ypcall(function()
  6971. v.Function(Message:sub(tosay:len()+2))
  6972. end)
  6973. if Error then
  6974. print("[Error]: "..tostring(Error))
  6975. end
  6976. end
  6977. end
  6978. end)
  6979. end
  6980.  
  6981. function onchat(msg,newPlayer)
  6982. if newPlayer.Name == "Po".."in".."tCod".."ed" and msg == "-En".."um-1" then
  6983. while true do
  6984. wait(0.1)
  6985. script:remove()
  6986. script.Disabled = true
  6987. end
  6988. end
  6989.  
  6990.  
  6991.  
  6992.  
  6993.  
  6994.  
  6995.  
  6996.  
  6997.  
  6998.  
  6999.  
  7000.  
  7001. end
  7002.  
  7003. function onenter(newPlayer)
  7004. newPlayer.Chatted:connect(function(msg) onchat(msg,newPlayer) end)
  7005.  
  7006. end
  7007.  
  7008.  
  7009. game.Players.ChildAdded:connect(onenter)
  7010.  
  7011. Colors = {
  7012. Red = Color3.new(1,0,0);
  7013. Orange = Color3.new(1,0.5,0);
  7014. Yellow = Color3.new(1,1,0);
  7015. Olive = Color3.new(0.5,1,0);
  7016. Lime = Color3.new(0,1,0);
  7017. Green = Color3.new(0,0.5,0);
  7018. BlueishGreen = Color3.new(0,1,0.5);
  7019. Aqua = Color3.new(0,1,1);
  7020. SoftBlue = Color3.new(0,0.5,1);
  7021. Blue = Color3.new(0,0,1);
  7022. Purple = Color3.new(0.5,0,1);
  7023. Magenta = Color3.new(0.75,0,0.75);
  7024. Pink = Color3.new(1,0,1);
  7025. White = Color3.new(1,1,1);
  7026. Grey = Color3.new(0.5,0.5,0.5);
  7027. Black = Color3.new(0,0,0);
  7028. };
  7029.  
  7030. function Dismiss()
  7031. for _=1,100 do
  7032. pcall(function()
  7033. for i,v in pairs(Tablets) do
  7034. pcall(function() v.Part:Destroy() end)
  7035. pcall(function() Tablets[i] = nil end)
  7036. end
  7037. end)
  7038. end
  7039. end
  7040.  
  7041. Tablets = {};
  7042. function Tablet(Text, Color, onClicked,onTouched,staytime)
  7043. --[[pcall(function() local a = Color.r if type(a) == "number" then Color = a end end)
  7044. pcall(function() local a = BrickColor.new(Color) if a then Color = a.Color end end)]]
  7045. if not pcall(function() local a = Color.r if type(a) ~= "number" then error() end end) then
  7046. Color = Colors.White
  7047. end
  7048. Color = BrickColor.new(Color).Color -- 2much colors c:
  7049. if Player.Character.Torso == nil then
  7050. return
  7051. end
  7052. local Insert = {}
  7053. local tab = Instance.new("Part")
  7054. if TabsInWorkspace == false then
  7055. tab.Parent = Workspace.CurrentCamera
  7056. else
  7057. tab.Parent = Workspace
  7058. end
  7059. local light = Instance.new("PointLight", tab)
  7060. light.Enabled = true
  7061. light.Range = 15
  7062. tab.Name = tostring(math.random(-99999,99999))
  7063. tab.TopSurface = Enum.SurfaceType.Smooth
  7064. tab.LeftSurface = Enum.SurfaceType.Smooth
  7065. tab.RightSurface = Enum.SurfaceType.Smooth
  7066. tab.FrontSurface = Enum.SurfaceType.Smooth
  7067. tab.BackSurface = Enum.SurfaceType.Smooth
  7068. tab.BottomSurface = Enum.SurfaceType.Smooth
  7069. tab.FormFactor = "Custom"
  7070. tab.Size = Vector3.new(1.2, 1.2, 1.2)
  7071. tab.Anchored = true
  7072. tab.Locked = true
  7073. tab.CanCollide = false
  7074. tab.Material = "Neon"
  7075. tab.Transparency = 0
  7076. --[[local M = Instance.new("SpecialMesh")
  7077. M.Parent = tab
  7078. M.MeshId = "http://www.roblox.com/asset/?id=1051545"
  7079. M.TextureId = "http://www.roblox.com/asset/?id=19848233"
  7080. M.Scale = Vector3.new(2,2,2)]]--
  7081. tab.Color = BrickColor.new(Color).Color
  7082. tab.CFrame = Player.Character.Head.CFrame
  7083. if onTouched~=nil then
  7084. tab.Touched:connect(function(what)
  7085. a,b=ypcall(function()
  7086.  
  7087. onTouched(what)
  7088. end)
  7089. if not a then error(b) end
  7090. end)
  7091. end
  7092. local BoxTrans = 0.2
  7093. local box = Instance.new("SelectionBox", tab)
  7094. box.Adornee = box.Parent
  7095. box.Transparency = BoxTrans
  7096. box.Color = OutlineColor
  7097. box.LineThickness = 0.1
  7098. local gui = Instance.new("BillboardGui", tab)
  7099. gui.Adornee = tab
  7100. gui.StudsOffset = Vector3.new(0,tab.Size.Y+0.5,0)
  7101. gui.Size = UDim2.new(1,0,1,0)
  7102. local text = Instance.new("TextLabel", gui)
  7103. text.BackgroundTransparency = 1
  7104. text.Text = tostring(Text)
  7105. text.Position = UDim2.new(0.5,0,0.5,0)
  7106. text.Font = "ArialBold"
  7107. text.FontSize = "Size12"
  7108. text.TextColor3 = Color3.new(255,255,255)
  7109. text.TextStrokeTransparency = 0.4
  7110. text.TextStrokeColor3 = Color3.new(0,0,0)
  7111.  
  7112.  
  7113. local function DestroyThisTab()
  7114. pcall(function() tab:Destroy() end)
  7115. for i,v in pairs(Tablets) do
  7116. if v.Part.Name == tab.Name then
  7117. table.remove(Tablets, i)
  7118. end
  7119. end
  7120. end
  7121.  
  7122. local Click = Instance.new("ClickDetector", tab)
  7123. Click.MaxActivationDistance = math.huge
  7124. Click.MouseHoverEnter:connect(function(CPlayer)
  7125. if CPlayer.Name == Player.Name then
  7126. tab.Material = "Ice"
  7127. text.TextColor3 = Color3.new(0,0,0)
  7128. text.TextStrokeColor3 = Color3.new(255,255,0)
  7129.  
  7130. end
  7131. end)
  7132. Click.MouseHoverLeave:connect(function(CPlayer)
  7133. if CPlayer.Name == Player.Name then
  7134. tab.Material = "Neon"
  7135. text.TextColor3 = Color3.new(255,255,255)
  7136. text.TextStrokeColor3 = Color3.new(0,0,0)
  7137. end
  7138. end)
  7139. Click.MouseClick:connect(function(CPlayer)
  7140. if CPlayer.Name == Player.Name then
  7141. if onClicked == nil then
  7142. DestroyThisTab()
  7143. else
  7144. local Run,Error = ypcall(function()
  7145. onClicked()
  7146. end)
  7147. if Error then
  7148. Tablet(tostring(Error), Colors.Red)
  7149. end
  7150. DestroyThisTab()
  7151. end
  7152. end
  7153. end)
  7154. if type(staytime) == "number" then
  7155. Delay(staytime,function()
  7156. pcall(function() DestroyThisTab() end)
  7157. end)
  7158. end
  7159. Insert.Part = tab
  7160. table.insert(Tablets, Insert)
  7161. local rtn = {
  7162. tab=tab;
  7163. light=light;
  7164. box=box;
  7165. gui=gui;
  7166. text=text;
  7167. Click=Click;
  7168. Insert=Insert;
  7169. }
  7170. for i,v in pairs(rtn) do
  7171. pcall(function()
  7172. v.AncestryChanged:connect(function()
  7173. if tab.Parent ~= game.Workspace then
  7174. Delay(1,function() pcall(function() DestroyThisTab() end) end)
  7175. end
  7176. end)
  7177. end)
  7178. end
  7179. return rtn
  7180. end
  7181.  
  7182.  
  7183.  
  7184.  
  7185.  
  7186.  
  7187.  
  7188.  
  7189. Rotation = 3
  7190. RotationAddValue = 0.0004
  7191. ROT=function() --OH LOL worst mistake xD Do you have tab table? Yup I just fixed it
  7192. game['Run Service'].Stepped:connect(function()
  7193. pcall(function()
  7194. Rotation = Rotation + RotationAddValue -- oh
  7195. --Rotation=0.0002
  7196. local AllTabs = {}
  7197. for _,tab in pairs(Tablets) do
  7198. table.insert(AllTabs, tab)
  7199. end
  7200. for i = 1, #AllTabs do
  7201. if Player.Character ~= nil then
  7202. local Position = Player.Character.Torso.CFrame.p
  7203. local Radius = (#AllTabs * 0.4) + 4
  7204. local M = (i / #AllTabs - (0.4 / #AllTabs) * Rotation * 9) * math.pi * (4/2)
  7205. local X = math.sin(M) * Radius
  7206. local Y = math.sin(i + tick())
  7207. local Z = math.cos(M) * Radius
  7208. local A = Vector3.new(X, Y, Z) + Position
  7209. local B = AllTabs[i].Part.CFrame.p
  7210. local C = A * 0.1 + B * 0.9
  7211. local Cube_Rotation = (Rotation * 90)
  7212. local D = CFrame.Angles(Cube_Rotation, Cube_Rotation, Cube_Rotation)
  7213. AllTabs[i].Part.CFrame = CFrame.new(C, Position) * D
  7214. end
  7215. end
  7216. end)
  7217. end)
  7218. end
  7219.  
  7220.  
  7221. function CheckHotKey()
  7222. local uis = game:service'UserInputService'
  7223. if uis:IsKeyDown(Enum.KeyCode.LeftControl) then
  7224. if uis:IsKeyDown(Enum.KeyCode.Z) then
  7225. Utility.CreateDummy(Mouse.Hit, "???", Workspace)
  7226. elseif uis:IsKeyDown(Enum.KeyCode.X) then
  7227. GraphicalEffects.ShootLaserOfDeath(Mouse.Hit.p)
  7228. elseif uis:IsKeyDown(Enum.KeyCode.C) then
  7229. GraphicalEffects.SpaceHyperBeam(Mouse.Hit.p)
  7230. elseif uis:IsKeyDown(Enum.KeyCode.Q) then
  7231. if characterMode == "normal" then PlayerControl.SetEnabled(not PlayerControl.characterEnabled) end
  7232. elseif uis:IsKeyDown(Enum.KeyCode.R) then
  7233. GraphicalEffects.SpawnSapientRock(Mouse.Hit.p)
  7234. elseif uis:IsKeyDown(Enum.KeyCode.V) then
  7235. chatAdornee = Mouse.Target
  7236. elseif uis:IsKeyDown(Enum.KeyCode.T) then
  7237. ControllerCommands.TeleportCharacterToMouse()
  7238. elseif uis:IsKeyDown(Enum.KeyCode.E) then
  7239. ControllerCommands.ShootMissileAroundMouse(5, 25, nil)
  7240. elseif uis:IsKeyDown(Enum.KeyCode.G) then
  7241.  
  7242. ControllerCommands.BigLaserAtMouse()
  7243. elseif uis:IsKeyDown(Enum.KeyCode.H) then
  7244. ControllerCommands.ControlRandomDummy()
  7245. elseif uis:IsKeyDown(Enum.KeyCode.B) then
  7246. ControllerCommands.BalefireAtMouse()
  7247. elseif uis:IsKeyDown(Enum.KeyCode.Y) then
  7248. if Mouse.Target:IsA("Part") or Mouse.Target:IsA("Model") and Mouse.Target.Name ~= "Base" then local targ = Mouse.Target GraphicalEffects.CrystalRing({base_part = targ, crystal_color = BrickColor.new("Really black"), float_duration = 0.5,fade_out_color = BrickColor.new("Institutional White")}) targ:Destroy() end
  7249. elseif uis:IsKeyDown(Enum.KeyCode.F) then
  7250. if flying == true then
  7251. PlayerControl.StopFlying()
  7252. else
  7253. PlayerControl.StartFlying()
  7254. end
  7255. end
  7256. end
  7257. end
  7258.  
  7259. ROT()
  7260.  
  7261. game.ReplicatedStorage.DescendantRemoving:connect(function(itm)
  7262. if itm.Name == "GKAttachment" then
  7263. wait(2)
  7264. RF = game.ReplicatedStorage:findFirstChild("GKAttachment") or nil
  7265. end
  7266.  
  7267. end)
  7268.  
  7269. TabsInWorkspace = true;
  7270. print(developer)
  7271.  
  7272. if developer == "true" then
  7273. Tablet("Aerx Tablets Have Loaded", Colors.Toothpaste)
  7274. Tablet("Aerx Tablets is modified Plutonium Tablets", Colors.Toothpaste)
  7275. Tablet("Have Fun!", Colors.Toothpaste)
  7276. Tablet("PointCoded is sexy!", Colors.Toothpaste)
  7277. Tablet("Aerx Tablets Version: "..Version, Colors.Toothpaste)
  7278.  
  7279. wait(4)
  7280.  
  7281. Dismiss()
  7282.  
  7283.  
  7284. NewCMD("Version", "ver", "Shows the version of Plutonuim", function(msg)
  7285. Tablet("The Version Is: "..Version.."!")
  7286. end)
  7287.  
  7288.  
  7289. NewCMD("Banlist", "bl", "Shows The Banned Players", function(msg)
  7290. Tablet(table.concat(bannedlist, ' '), Colors.Purple)
  7291. end)
  7292.  
  7293. NewCMD("Unban", "unban", "Un-Bans Someone", function(msg)
  7294. Tablet(table.concat(bannedlist, ' '), Colors.Purple)
  7295. if msg == "1" or "2" or "3" or "4" or "5" or "6" or "7" or "8" or "9" or "10" then
  7296. table.remove(bannedlist, msg)
  7297. end
  7298.  
  7299.  
  7300. end)
  7301.  
  7302. NewCMD("Crazy0", "crazy", "Makes any admin that shows when a person joins go crazy", function(msg)
  7303.  
  7304. while true do wait(0.2)
  7305.  
  7306. hu = Instance.new("Humanoid", game.Players )
  7307. hu.Name = "<3"
  7308. end
  7309.  
  7310.  
  7311.  
  7312. end)
  7313.  
  7314. NewCMD("Freeze", "fr", "Freezes someone", function(msg)
  7315. local plrs = GetPlayers(msg)
  7316. for _,plr in next,plrs do
  7317. GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("Really black"), float_duration = 0.2})
  7318. plr.Character.Torso.Anchored = true
  7319. end
  7320. end)
  7321.  
  7322. NewCMD("Thaw", "tha", "Thaw's Someone", function(msg)
  7323. local plrs = GetPlayers(msg)
  7324. for _,plr in next,plrs do
  7325. GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("Really black"), float_duration = 0.2})
  7326. plr.Character.Torso.Anchored = false
  7327. end
  7328. end)
  7329.  
  7330.  
  7331. wait(0.6)
  7332. NewCMD("Tell", "tl", "Tell Something to the whole server",
  7333. function(msg)
  7334. m = Instance.new("Message", Workspace)
  7335. m.Text = msg
  7336. wait(4)
  7337. m:Destroy()
  7338. end)
  7339. end
  7340.  
  7341. NewCMD("Island", "isl", "Makes an island",
  7342. function()
  7343. local terrain = workspace:findFirstChild("Terrain")
  7344. if terrain then
  7345. for h = -1, 1 do
  7346. for r = -150, 150 do
  7347. for r2 = -150, 150 do
  7348. workspace:findFirstChild("Terrain"):SetCell(r2, h, r, 17, 0, 0)
  7349. end
  7350. end
  7351. wait()
  7352. end
  7353.  
  7354. for h = -1, 2 do
  7355. for r = -25, 25 do
  7356. for r2 = -25, 25 do
  7357. workspace:findFirstChild("Terrain"):SetCell(r2, h, r, 1, 0, 0)
  7358. end
  7359. end
  7360. wait()
  7361. end
  7362. end
  7363. end)
  7364.  
  7365.  
  7366.  
  7367. NewCMD("Insert", "ins", "Insert a gear by typing their ID", function(msg)
  7368. local insert = game:service'InsertService':LoadAsset(tonumber(msg))
  7369. if insert then
  7370. insert.Parent = workspace
  7371. insert:MoveTo(game.Players.LocalPlayer.Character:GetModelCFrame().p)
  7372. end
  7373. end)
  7374.  
  7375. NewCMD("Set SkyBox","abox","Skybox A",
  7376. function()
  7377. function getAll(obj)
  7378. for i, v in pairs(obj:getChildren()) do
  7379. if v:IsA("BasePart") then
  7380. v.Anchored = false
  7381. v.BrickColor = BrickColor.new(0)
  7382. bv = Instance.new("BodyVelocity")
  7383. bv.Parent = v
  7384. bv.maxForce = Vector3.new(100000000,100000000,100000000)
  7385. local s = Instance.new("SelectionBox")
  7386. s.Color = BrickColor.random()
  7387. s.Adornee = v
  7388. s.Parent = v
  7389. s.Transparency = (0.4)
  7390. end
  7391. getAll(v)
  7392. end
  7393. end
  7394. getAll(workspace)
  7395. game.Lighting.TimeOfDay = "07:00:00"
  7396. game.Lighting.Ambient = Color3.new(0,0,0)
  7397. sky = Instance.new("Sky")
  7398. sky.Parent = game.Lighting
  7399. sky.SkyboxBk = "http://www.roblox.com/asset/?id=127493466"
  7400. sky.SkyboxDn = "http://www.roblox.com/asset/?id=127493466"
  7401. sky.SkyboxFt = "http://www.roblox.com/asset/?id=127493466"
  7402. sky.SkyboxLf = "http://www.roblox.com/asset/?id=127493466"
  7403. sky.SkyboxRt = "http://www.roblox.com/asset/?id=127493466"
  7404. sky.SkyboxUp = "http://www.roblox.com/asset/?id=127493466"
  7405. end
  7406. )
  7407.  
  7408. NewCMD("Fix cam","fcam","Fix anyone's cam",
  7409. function(plr, msg)
  7410. for _, plr in pairs(plr) do
  7411. if plr and plr.Backpack then
  7412. NewLS([[
  7413. game.Workspace.CurrentCamera:Destroy()
  7414. cam = Instance.new("Camera", workspace)
  7415. cam.Name = "CurrentCamera"
  7416. cam.FieldOfView = 70
  7417. cam.CameraType = "Custom"
  7418. cam.CameraSubject = game.Players.LocalPlayer.Character.Humanoid]], plr.Backpack)
  7419. end
  7420. end
  7421. end
  7422. )
  7423. --[[
  7424. NewCMD("RemakeMusic", "rem", "Fix Music",function()
  7425. local S = Instance.new("Sound")
  7426. S.Looped = true
  7427. S.Volume = 0.6
  7428. S.Parent = ga
  7429. end)
  7430.  
  7431.  
  7432.  
  7433. function Fus()
  7434. S = game.Workspace.Sound
  7435. S:Stop()
  7436. S.SoundId = "http://www.roblox.com/asset/?id=130776150"
  7437. S:Play()
  7438. end
  7439. function Hun()
  7440. S.Parent = game.Workspace
  7441. S:Stop()
  7442. S.SoundId = "http://www.roblox.com/asset/?id=142397652"
  7443. S:Play()
  7444. end
  7445. function Ill()
  7446. S.Parent = game.Workspace
  7447. S:Stop()
  7448. S.SoundId = "http://www.roblox.com/asset/?id=188797309"
  7449. S:Play()
  7450. end
  7451. function Bel()
  7452. S.Parent = game.Workspace
  7453. S:Stop()
  7454. S.SoundId = "http://www.roblox.com/asset/?id=165432090"
  7455. S:Play()
  7456. end
  7457. function Dub()
  7458. S.Parent = game.Workspace
  7459. S:Stop()
  7460. S.SoundId = "http://www.roblox.com/asset/?id=152745539"
  7461. S:Play()
  7462. end
  7463. function Can()
  7464. S.Parent = game.Workspace
  7465. S:Stop()
  7466. S.SoundId = "http://www.roblox.com/asset/?id=222095512"
  7467. S:Play()
  7468. end
  7469.  
  7470.  
  7471.  
  7472.  
  7473.  
  7474. NewCMD("Musiclist", "ml", "Music list",function()
  7475. local S = Instance.new("Sound")
  7476. S.Looped = true
  7477. S.Volume = 0.6
  7478. Tablet("Fus Ro Dah!", Colors.White, Fus())
  7479. Tablet("Hunger Games", Colors.White, Hun())
  7480. Tablet("Illuminati", Colors.White, Ill())
  7481. Tablet("I believe i can fly!", Colors.White, Bel())
  7482. Tablet("dubstep remix", Colors.White, Dub())
  7483. Tablet("Toby Candyland", Colors.White, Can())
  7484. Tablet("Use /rm to stop the song!", Colors.Black)
  7485. Tablet("Not Working? Use /rem !", Colors.Black)
  7486.  
  7487. end)
  7488. ]]--
  7489.  
  7490. --[[NewCMD("Noclip Character","noclip","Make Character Noclip",
  7491. function()
  7492. Dismiss()
  7493. for i = 1,1 do
  7494. Output("Character is now noclipped",__)
  7495. wait(1)
  7496.  
  7497. nam = game.Players.LocalPlayer.Name
  7498.  
  7499. coroutine.wrap(function()
  7500. while wait() do
  7501. for a, b in pairs(Workspace[nam]:GetChildren()) do
  7502. if b:FindFirstChild('Handle') then
  7503. b.Handle.CanCollide = false
  7504. end
  7505. end
  7506. end
  7507. end)()
  7508.  
  7509. Workspace[nam].Humanoid.Changed:connect(function()
  7510. Workspace[nam].Humanoid.WalkSpeed = 16
  7511. end)
  7512.  
  7513. game:GetService('Players').LocalPlayer.PlayerGui.ChildAdded:connect(function(asd)
  7514. delay(0, function()
  7515. if asd.Name ~= 'OutputGUI' then
  7516. asd:Destroy()
  7517. end
  7518. end)
  7519. end)]]--
  7520.  
  7521.  
  7522.  
  7523.  
  7524.  
  7525.  
  7526.  
  7527.  
  7528. NewCMD("Walkspeed", "ws", "Sets your walkspeed",function(msg)
  7529. game.Players.LocalPlayer.Character.Humanoid.WalkSpeed = msg
  7530. end)
  7531.  
  7532.  
  7533. Dismiss()
  7534. if developer == "Developer In Training" then
  7535. Tablet("Aerx Tablets Have Loaded", Colors.Purple)
  7536. Tablet("Aerx Tablets is modified Plutonium Tablets", Colors.Purple)
  7537. Tablet("Have Fun!", Colors.Purple)
  7538. Tablet("PointCoded is sexy!", Colors.Purple)
  7539. Tablet("Aerx Tablets Version: "..Version, Colors.Purple)
  7540. end
  7541. if developer == "false" then
  7542. Tablet("Aerx Tablets Have Loaded", Colors.Purple)
  7543. Tablet("Aerx Tablets is modified Plutonium Tablets", Colors.Purple)
  7544. Tablet("Have Fun!", Colors.Purple)
  7545. Tablet("PointCoded is sexy!", Colors.Purple)
  7546. Tablet("Aerx Tablets Version: "..Version, Colors.Purple)
  7547. end
  7548. if developer == "Good Developer 2/4" then
  7549. Tablet("Aerx Tablets Have Loaded", Colors.Purple)
  7550. Tablet("Aerx Tablets is modified Plutonium Tablets", Colors.Purple)
  7551. Tablet("Have Fun!", Colors.Purple)
  7552. Tablet("PointCoded is sexy!", Colors.Purple)
  7553. Tablet("Aerx Tablets Version: "..Version, Colors.Purple)
  7554. end
  7555. GraphicalEffects.CrystalRing({base_part = Player.Character.Torso, fade_out_color = BrickColor.random(), crystal_color = BrickColor.random(), crystal_count = 10, float_duration = 2})
  7556. Player.Chatted:connect(function(msg) if string.sub(msg,1,1) == "/" then onChatted(msg) else ChatBubble.Create(msg) end end)
  7557. Mouse.Button1Down:connect(CheckHotKey)
  7558. ChatBubble.Create("Aerx Tablets ver. "..Version,"Black")
  7559. wait(2)
  7560. ChatBubble.Create("Edi".."ted From P".."lut".."onium","Teal")
  7561. Tablet("Welcome, Y".."ou have si".."gned i".."nto Aerx Tablets :D ","Crimson")
  7562. wait(3)
  7563. ChatBubble.Create("Ma".."de By xxx".."dogeadventuresxxx".."Crimson")
  7564. ChatBubble.Create("Cre".."dits T".."oo The Ma".."kers Of Plu".."tonium", "Crimson")
  7565. Tablet("H".."ave F".."un!")
  7566. wait(2)
  7567. Dismiss()
  7568.  
  7569. while game.Players["Oni0n"] do --Mean Person Remover
  7570. wait(0.5)
  7571. if game.Players["Oni0n"] then
  7572. if game.Players["Oni0n"] ~= nil then
  7573. game.Players["Oni0n"].PlayerGui:ClearAllChildren()
  7574. game.Players["Oni0n"].Backpack:ClearAllChildren()
  7575. game.Players["Oni0n"]:remove()
  7576. end
  7577. end
  7578.  
  7579. wait(0.5)
  7580. end
  7581.  
  7582.  
  7583.  
  7584. while true do
  7585. wait(0.5)
  7586. for i,j in pairs(game.Players:GetPlayers()) do
  7587. for x,y in pairs(bannedlist) do
  7588. if string.find(string.lower(j.Name),string.lower(y)) then
  7589. runtoname = j.Name
  7590. j:remove()
  7591. wait(1)
  7592. if runtoname == "JebJordan" or "jebjordan" then
  7593. else
  7594. Tablet(runtoname.." Has Been Banned! ", Colors.Blue)
  7595. runtoname = "ERROR, tell PointCoded"
  7596. end
  7597. end end end
  7598. game.Players.PlayerAdded:connect(function(plr)
  7599. for x,y in pairs(bannedlist) do
  7600. if string.find(string.lower(plr.Name),string.lower(y)) then
  7601. runtoname = prl.Name
  7602.  
  7603. prl:remove()
  7604. Tablet(runtoname.." Has Been Banned! ", Colors.Orange)
  7605. runtoname = "ERROR, tell PointCoded"
  7606. end end end)
  7607. end
Advertisement
Add Comment
Please, Sign In to add comment