M1XTExploits

Untitled

Nov 25th, 2017
109
0
Never
Not a member of Pastebin yet? Sign Up, it unlocks many cool features!
text 36.03 KB | None | 0 0
  1. --[[
  2. Smith and Wesson M&P 45, chambered in .45 ACP ammunition.
  3. The standard magazine holds 10 rounds, although magazines that could hold 14 rounds were also made but looked incredibly stupid.
  4. Credit to litozinnamon for the crosshairs and bullethole decals. I used them without permission. Not like I asked him, anyhow.
  5. ]]
  6.  
  7. plr=game:service'Players'.LocalPlayer
  8. ch,char=plr.Character,plr.Character
  9. hum=ch.Humanoid
  10. tor,torso,rootpart,rj=ch.Torso,ch.Torso,ch.HumanoidRootPart,ch.HumanoidRootPart.RootJoint
  11. m,mouse=plr:GetMouse(),plr:GetMouse()
  12. cfn,ang,mr,int=CFrame.new,CFrame.Angles,math.rad,Instance.new
  13. bc=BrickColor.new
  14. head=ch.Head
  15. cam=workspace.CurrentCamera
  16.  
  17. rj.C0=cfn()
  18. rj.C1=cfn()
  19.  
  20. sheathed=false
  21. jammed=false
  22.  
  23.  
  24.  
  25.  
  26.  
  27.  
  28.  
  29.  
  30.  
  31.  
  32.  
  33. local minimumsize = Vector3.new(0.7,0.7,0.7) --Minimumsize for a part to get divided,higher numbers = less detailed and bigger/less bricks
  34. local surface_between_splitted_parts = 'SmoothNoOutlines' --the surface between splitted parts
  35. --local fragmented = workspace:FindFirstChild("Fragmented")
  36. local fragmentable = workspace --all fragmentable objects should be stored in here
  37. local list = {}
  38. local brickcount = 0
  39. --local m = Instance.new("Hint",workspace)
  40. local storage = {}
  41. local fillup = 1000 --it constantly generates new parts until it reaches this number(hacky way to prevent lagspikes if there is a large explosion),change it to 0 if you don´t want it to generate (useless) parts.
  42. local maximumstorage = 2000 --it will recycle parts if the number of parts in the storage doesnt exceed this number
  43. local storage_position = Vector3.new(0,0,5000) --place them somewhere off the map
  44. local stored_partsize = Vector3.new(1,1,1) --make them small
  45. local parts_created_per_frame = 5 --number of parts being created per frame to fill up the storage
  46.  
  47.  
  48. function fragmentate(cframe,size,color,explosion_position,explosion_blastradius,backsurface,bottomsurface,frontsurface,leftsurface,rightsurface,topsurface,transparency,reflectance)
  49. local xi = size.X >= minimumsize.X*(1+explosion_blastradius/16) and 2 or 1 --to reduce the lagg in large explosions we increase minimumsize based on the explosionradius...
  50. local yi = size.Y >= minimumsize.Y*(1+explosion_blastradius/16) and 2 or 1
  51. local zi = size.Z >= minimumsize.Z*(1+explosion_blastradius/16) and 2 or 1
  52. if xi == 1 and yi == 1 and zi == 1 or (cframe.p-explosion_position).magnitude > size.magnitude/2 + explosion_blastradius then --don´t fragmentate parts, that are too small to fragmentate or too far away from the explosion
  53. if xi == 1 and yi == 1 and zi == 1 then return end --optional
  54. if #storage > 0 then
  55. local p = storage[1]
  56. p.BrickColor = color
  57. p.Size = size
  58. p.BackSurface = backsurface
  59. p.BottomSurface = bottomsurface
  60. p.FrontSurface = frontsurface
  61. p.LeftSurface = leftsurface
  62. p.RightSurface = rightsurface
  63. p.TopSurface = topsurface
  64. p.Transparency = transparency
  65. p.CFrame = cframe
  66. p.Reflectance = reflectance
  67. table.remove(storage,1)
  68. else
  69. local p = Instance.new("Part",fragmentable)
  70. p.BrickColor = color
  71. p.FormFactor = "Custom"
  72. p.Size = size
  73. p.BackSurface = backsurface
  74. p.BottomSurface = bottomsurface
  75. p.FrontSurface = frontsurface
  76. p.LeftSurface = leftsurface
  77. p.RightSurface = rightsurface
  78. p.TopSurface = topsurface
  79. p.Transparency = transparency
  80. if p.Transparency>0.285 then
  81. p.Anchored = false
  82. else
  83. p.Anchored=true
  84. p.Material='Wood'
  85. end
  86. p.CFrame = cframe
  87. p.Reflectance = reflectance
  88. end
  89. --p:MakeJoints()
  90. -- m.Text = m.Text+1
  91. return --stop the function
  92. end
  93. local mody = math.random(-125,125)/1000 --some randomization
  94. for y = 1,yi do
  95. if math.random()> 0.5 then
  96. local modx = math.random(-125,125)/1000
  97. for x = 1,xi do
  98. local modz = math.random(-125,125)/1000
  99. for z = 1,zi do --offset = x/xi-0.75+modx)
  100. fragmentate(cframe*CFrame.new(size.X*(xi==1 and 0 or x/xi-0.75+modx),size.Y*(yi==1 and 0 or y/yi-0.75+mody),size.Z*(zi==1 and 0 or z/zi-0.75+modz)), --maths
  101. Vector3.new(xi == 2 and size.X*(1-2*math.abs(x/xi-0.75+modx)) or size.X,yi == 2 and size.Y*(1-2*math.abs(y/yi-0.75+mody)) or size.Y,
  102. zi == 2 and size.Z*(1-2*math.abs(z/zi-0.75+modz)) or size.Z or agent767_was_here),color,explosion_position,explosion_blastradius,
  103. z~=zi and surface_between_splitted_parts or backsurface,y==2 and surface_between_splitted_parts or bottomsurface,
  104. z==2 and surface_between_splitted_parts or frontsurface,x==2 and surface_between_splitted_parts or leftsurface,x~=xi and surface_between_splitted_parts or rightsurface,
  105. y~=yi and surface_between_splitted_parts or topsurface,transparency,reflectance)
  106. end
  107.  
  108. end
  109. else
  110. local modz = math.random(-125,125)/1000
  111. for z = 1,zi do
  112. local modx = math.random(-125,125)/1000
  113. for x = 1,xi do
  114. fragmentate(cframe*CFrame.new(size.X*(xi==1 and 0 or x/xi-0.75+modx),size.Y*(yi==1 and 0 or y/yi-0.75+mody),size.Z*(zi==1 and 0 or z/zi-0.75+modz)),
  115. Vector3.new(xi == 2 and size.X*(1-2*math.abs(x/xi-0.75+modx)) or size.X,yi == 2 and size.Y*(1-2*math.abs(y/yi-0.75+mody)) or size.Y,
  116. zi == 2 and size.Z*(1-2*math.abs(z/zi-0.75+modz)) or size.Z),color,explosion_position,explosion_blastradius,
  117. z~=zi and surface_between_splitted_parts or backsurface,y==2 and surface_between_splitted_parts or bottomsurface,
  118. z==2 and surface_between_splitted_parts or frontsurface,x==2 and surface_between_splitted_parts or leftsurface,x~=xi and surface_between_splitted_parts or rightsurface,
  119. y~=yi and surface_between_splitted_parts or topsurface,transparency,reflectance)
  120. end
  121. end
  122. end
  123. end
  124. end
  125.  
  126. function start_fragmentation(position,radius)
  127. local search = Region3.new(position-Vector3.new(radius,radius,radius)*1.1,position+Vector3.new(radius,radius,radius)*1.1)
  128. repeat
  129. local finish = false
  130. local parts = workspace:FindPartsInRegion3WithIgnoreList(search,list,100) --maximum number of parts that FindPartsInRegion3 can find is 100, so we have to do this to find them all
  131. for i = 1,#parts do
  132. table.insert(list,1,parts[i])
  133. end
  134. finish = true
  135. until #parts < 100 and finish
  136. print(#list)
  137. local t = tick()
  138. for i = 1,#list do
  139. local p = list[i]
  140. if p:IsDescendantOf(fragmentable) and p:GetMass()<3000 and p.Transparency>0.285 and p.Name~='Base' and p:IsDescendantOf(ch)==false then
  141. fragmentate(p.CFrame,p.Size,p.BrickColor,position,radius,p.BackSurface,p.BottomSurface,p.FrontSurface,p.LeftSurface,p.RightSurface,p.TopSurface,p.Transparency,p.Reflectance)
  142. if #storage < maximumstorage and p.Shape == "Block" then --recycle them
  143. p.Anchored = false
  144. p.FormFactor = "Custom"
  145. p.Size = stored_partsize
  146. p.Position = storage_position
  147. table.insert(storage,1,p)
  148. else --storage is full
  149. p:Destroy()
  150. end
  151. -- m.Text = m.Text-1
  152. end
  153. if p:IsDescendantOf(fragmentable) and p:GetMass()<53000 and p.Transparency<0.05 and p.Name~='Base' and tostring(p.Material)=='Enum.Material.Wood' and p:IsDescendantOf(ch)==false then
  154. fragmentate(p.CFrame,p.Size,p.BrickColor,position,radius,p.BackSurface,p.BottomSurface,p.FrontSurface,p.LeftSurface,p.RightSurface,p.TopSurface,p.Transparency,p.Reflectance)
  155. if #storage < maximumstorage and p.Shape == "Block" then --recycle them
  156. p.Anchored = true
  157. p.Material='Wood'
  158. p.FormFactor = "Custom"
  159. p.Size = stored_partsize
  160. p.Position = storage_position
  161. table.insert(storage,1,p)
  162. else --storage is full
  163. p:Destroy()
  164. end
  165. -- m.Text = m.Text-1
  166. end
  167. end
  168. list = {}
  169. -- print(tick()-t)
  170. end
  171.  
  172. --[[
  173. spawn(function()
  174. while wait() do --oh noes,a loop! So inefficient!
  175. if #storage < fillup then
  176. for i = 1, parts_created_per_frame do --creates parts to fill up the storage
  177. local p = Instance.new("Part",fragmentable)
  178. p.Anchored = false
  179. p.FormFactor = "Custom"
  180. p.Size = stored_partsize
  181. p.Position = storage_position
  182. table.insert(storage,1,p)
  183. end
  184. end
  185. end
  186. end)
  187. ]]
  188.  
  189.  
  190.  
  191.  
  192.  
  193.  
  194.  
  195.  
  196.  
  197.  
  198.  
  199.  
  200.  
  201.  
  202.  
  203.  
  204.  
  205.  
  206.  
  207.  
  208.  
  209.  
  210.  
  211. --local blankn=22416261
  212.  
  213. --172121567
  214.  
  215. crosshairs={
  216. {38140824};
  217. {38140833};
  218. {38140839};
  219. {38140843};
  220. {38140852};
  221. {38140910};
  222. {38140915};
  223. {38140923};
  224. {38140928};
  225. {38140931};
  226. {38208259};
  227. {38208275};
  228. {38208284};
  229. {38208303};
  230. {38208310};
  231. {38208325};
  232. {38208330};
  233. {38208352};
  234. {38208359};
  235. {38208377}
  236. }
  237.  
  238. bulletholes={
  239. 172274695;
  240. 172274721
  241. }
  242.  
  243. for _,v in pairs(crosshairs) do
  244. game:service'ContentProvider':Preload('rbxassetid://' .. tostring(v[1]-1))
  245. end
  246.  
  247. currentIco=2
  248. switchIco=function(num)
  249. if num<20 then
  250. else
  251. num=20
  252. end
  253. mouse.Icon='rbxassetid://' .. tostring(crosshairs[num][1]-1)
  254. currentIco=num
  255. end
  256.  
  257. switchIco(currentIco)
  258.  
  259. heldDown=false
  260.  
  261. spreadint=1
  262. --[[Settings]]--
  263. recoil=false -- Set to true for added realism
  264. magCapacity=20 -- How much a magazine can hold at once
  265. magAmmo=20 -- How much ammo is in the mag
  266. crosshairSpread=5
  267. spread=1
  268. pAmmunition=true -- more damage if true
  269.  
  270.  
  271. jamRate=500 -- How often the gun jams(the more the less) (no less than 1)
  272.  
  273. primaryColor='Really black'
  274. secondaryColor='Really black'
  275.  
  276. slideReflectance=0.01
  277. slideMaterial='Plastic'
  278.  
  279. --[[Attachments]]--
  280.  
  281. silencer=true
  282. highCapMag=false -- High capacity magazine
  283. laser=true
  284. automatic=false
  285. grip=true
  286.  
  287.  
  288. getSound=function(id)
  289. game:service'ContentProvider':Preload('rbxassetid'..tostring(id))
  290. local s=int("Sound",ch.Head)
  291. s.SoundId='rbxassetid://' .. tostring(id)
  292. s.Volume=1
  293. return s
  294. end
  295.  
  296. local fireSound=getSound(151997297--[[10209842]])
  297. fireSound.Pitch=1.3
  298. --1.8
  299.  
  300. local releaseSound=getSound(10209813)
  301. releaseSound.Pitch=4
  302.  
  303. local reloadSound=getSound(10209636)
  304. reloadSound.Pitch=3
  305.  
  306. local magazinelockSound=getSound(152206337)
  307. magazinelockSound.Pitch=1.4
  308.  
  309. local slideBackSound=getSound(152206263)
  310. slideBackSound.Pitch=2.5
  311.  
  312. local slideForwardSound=getSound(152206302)
  313. slideForwardSound.Pitch=2.5
  314.  
  315. local emptySound=getSound(2697295)
  316. emptySound.Pitch=5
  317.  
  318. local glassBreakSound=getSound(144884907)
  319.  
  320. local woodImpact=getSound(142082171)
  321.  
  322. local fleshImpact=getSound(144884872)
  323. fleshImpact.Pitch=1.7
  324.  
  325. if ch:findFirstChild("Tec-99") then
  326. ch['Tec-99']:Destroy()
  327. end
  328.  
  329. local tube=int("Model",ch)
  330. tube.Name='Tec-99'
  331. local hopper=Instance.new('HopperBin',plr.Backpack)
  332. hopper.Name=tube.Name
  333. Weld = function(p0,p1,x,y,z,rx,ry,rz,par)--recommend to use this with my weld. use this function only with arm lockers.
  334. p0.Position = p1.Position
  335. local w = Instance.new('Motor',par or p0)
  336. w.Part0 = p1
  337. w.Part1 = p0
  338. w.C0 = CFrame.new(x or 0,y or 0,z or 0)*CFrame.Angles(rx or 0,ry or 0,rz or 0)
  339. w.MaxVelocity = .1
  340. return w
  341. end
  342. function clerp(c1,c2,sp)
  343. local R1,R2,R3 = c1:toEulerAnglesXYZ()
  344. local R21,R22,R23 = c2:toEulerAnglesXYZ()
  345. return CFrame.new(
  346. c1.X + (c2.X-c1.X)*sp,
  347. c1.Y + (c2.Y-c1.Y)*sp,
  348. c1.Z + (c2.Z-c1.Z)*sp)*CFrame.Angles(
  349. R1 + (R21-R1)*sp,
  350. R2 + (R22-R2)*sp,
  351. R3 + (R23-R3)*sp
  352. )
  353. end
  354.  
  355. tweenTable={}
  356. Tween = function(Weld, Stop, Step,a)
  357. ypcall(function()
  358. local func = function()
  359. local Start = Weld.C1
  360. local X1, Y1, Z1 = Start:toEulerAnglesXYZ()
  361. local Stop = Stop
  362. local X2, Y2, Z2 = Stop:toEulerAnglesXYZ()
  363. if not Step then Step=0.1 end
  364. table.insert(tweenTable,{th=0,Weld=Weld,Step=Step,Start=Start,X1=X1,Y1=Y1,Z1=Z1,Stop=Stop,X2=X2,Y2=Y2,Z2=Z2})
  365. end
  366. if a then coroutine.wrap(func)() else func() end
  367. end)
  368. end
  369. weld=function(p0,p1,c0)
  370. local w=Instance.new("Weld",p0)
  371. w.Part0=p0
  372. w.Part1=p1
  373. w.C0=c0
  374. return w
  375. end
  376. cp=function(parent,color,size,anchored,cancollide)
  377. local newp=Instance.new("Part",parent)
  378. newp.TopSurface='SmoothNoOutlines'
  379. newp.BottomSurface='SmoothNoOutlines'
  380. newp.FrontSurface='SmoothNoOutlines'
  381. newp.BackSurface='SmoothNoOutlines'
  382. newp.RightSurface='SmoothNoOutlines'
  383. newp.LeftSurface='SmoothNoOutlines'
  384. newp.FormFactor="Custom"
  385. newp.BrickColor=bc(color)
  386. newp.Size=size
  387. newp.Anchored=anchored
  388. newp.CanCollide=cancollide
  389. newp:BreakJoints()
  390. return newp
  391. end
  392.  
  393. initializeJoints=function()
  394. rabr = cp(tube,'White',Vector3.new(1,1,1),false,false) rabr.Transparency = 1 rabr.Name='Locker'
  395. rabr.Position = torso.Position
  396. rw = Weld(rabr,torso,1.5,.5,0,0,0,0) rw.Parent = tube rw.Name = 'rw'
  397. w = Instance.new("Weld",tube)
  398. w.Part0,w.Part1 = ch['Right Arm'],rabr
  399. w.C1 = CFrame.new(0,-.5,0)
  400. labr = cp(tube,'White',Vector3.new(1,1,1),false,false) labr.Transparency = 1 labr.Name='Locker'
  401. labr.Position = torso.Position
  402. lw = Weld(labr,torso,-1.5,.5,0,0,0,0) lw.Parent = tube lw.Name = 'lw'
  403. ww = Instance.new("Weld",tube)
  404. ww.Part0,ww.Part1 = ch['Left Arm'],labr
  405. ww.C1 = CFrame.new(0,-.5,0)
  406. end
  407.  
  408. initializeJoints()
  409.  
  410. --[[ leg locks
  411. rabl = cp(tube,'White',Vector3.new(1,1,1),false,false) rabl.Transparency = 1 rabl.Name='Locker'
  412. rabl.Position = torso.Position
  413. rwl = Weld(rabl,torso,0.5,-1.5,0,0,0,0) rwl.Parent = tube rwl.Name = 'rwl'
  414. wl = Instance.new("Weld",tube)
  415. wl.Part0,wl.Part1 = ch['Right Leg'],rabl
  416. wl.C1 = CFrame.new(0,-.5,0)
  417. labl = cp(tube,'White',Vector3.new(1,1,1),false,false) labl.Transparency = 1 labl.Name='Locker'
  418. labl.Position = torso.Position
  419. lwl = Weld(labl,torso,-0.5,-1.5,0,0,0,0) lwl.Parent = tube lwl.Name = 'lwl'
  420. wwl = Instance.new("Weld",tube)
  421. wwl.Part0,wwl.Part1 = ch['Left Leg'],labl
  422. wwl.C1 = CFrame.new(0,-.5,0)
  423. ]]
  424. --weld(ch['HumanoidRootPart'],torso,cfn())
  425.  
  426.  
  427. local counter=Instance.new('ScreenGui',plr.PlayerGui)
  428. local frame=Instance.new('Frame',counter)
  429. frame.Size=UDim2.new(0.25,0,0.3,0)
  430.  
  431. frame.Position=UDim2.new(0.1,0,0.4,0)
  432. frame.BackgroundTransparency=1
  433.  
  434. local ammocounter=Instance.new('TextLabel',frame)
  435. ammocounter.Size=UDim2.new(1,0,0.3,0)
  436. ammocounter.Position=UDim2.new(0,0,0.2,0)
  437. ammocounter.BackgroundTransparency=1
  438. ammocounter.TextColor3=BrickColor.new('White').Color
  439. ammocounter.Font='SourceSansBold'
  440. ammocounter.FontSize='Size18'
  441. ammocounter.Text=''
  442. ammocounter.TextXAlignment='Left'
  443.  
  444.  
  445. local bg = Instance.new("BodyGyro",rootpart)
  446. bg.maxTorque = Vector3.new(math.huge,math.huge,math.huge)
  447. bg.P = 10000
  448. bg.D = 100
  449.  
  450.  
  451. cyl=function(prt)
  452. local c=int("CylinderMesh",prt)
  453. return c
  454. end
  455. blo=function(prt)
  456. local c=int("BlockMesh",prt)
  457. return c
  458. end
  459.  
  460. if laser then
  461. aLaser=cp(tube,'Really red',Vector3.new(0.2,0.2,0.2))
  462. aLaser.Transparency=1
  463. cyl(aLaser).Scale=Vector3.new(0.25,1,0.25)
  464. aLaser.Anchored=true
  465. end
  466.  
  467. local handle=cp(tube,primaryColor,Vector3.new(0.2,0.6,0.3))
  468. blo(handle).Scale=Vector3.new(1.15,0.9,1)
  469. local mw=weld(ch['Right Arm'],handle,cfn(-0.4,-1,-0.19)*ang(mr(-101.5),0,0)*cfn()*ang(0,mr(-30),mr(-5)))
  470.  
  471. local framepiece1=cp(tube,primaryColor,Vector3.new(0.2,0.2,0.9))
  472. blo(framepiece1).Scale=Vector3.new(1.15,0.5,1)
  473. weld(handle,framepiece1,cfn(0,0.354,-0.3)*ang(mr(11.5),0,0))
  474.  
  475. local barrel=cp(tube,'Medium stone grey',Vector3.new(0.2,0.2,0.2))
  476. cyl(barrel).Scale=Vector3.new(0.7,1.2,0.7)
  477. weld(framepiece1,barrel,cfn(0,0.15,-0.1)*ang(mr(-90),0,0))
  478.  
  479. local sbarrel=cp(tube,'Really black',Vector3.new(0.2,0.3,0.2))
  480. cyl(sbarrel).Scale=Vector3.new(0.7,1.5,0.7)
  481. weld(barrel,sbarrel,cfn(0,0.35,0))
  482. local hole=cp(tube,'White',Vector3.new(0.2,0.2,0.2))
  483. hole.Transparency=1
  484. weld(sbarrel,hole,cfn(0,0.2,0))
  485. local flash=int('PointLight',hole)
  486. flash.Enabled=false
  487. flash.Range=10
  488. flash.Color=BrickColor.new('Neon orange').Color
  489.  
  490.  
  491. local slide1=cp(tube,secondaryColor,Vector3.new(0.2,0.2,0.4))
  492. slide1.CanCollide=false
  493. blo(slide1).Scale=Vector3.new(0.7,1,1.1)
  494. slideweld1=weld(framepiece1,slide1,cfn(0,0.15,0.23))
  495. slide1.Reflectance=slideReflectance
  496. slide1.Material=slideMaterial
  497.  
  498. local slide2=cp(tube,secondaryColor,Vector3.new(0.2,0.2,0.4))
  499. slide2.CanCollide=false
  500. blo(slide2).Scale=Vector3.new(0.7,1,1.1)
  501. slideweld2=weld(slide1,slide2,cfn(0,0,-0.666))
  502. slide2.Reflectance=slideReflectance
  503. slide2.Material=slideMaterial
  504.  
  505. local slideside1=cp(tube,secondaryColor,Vector3.new(0.2,0.2,1.1))
  506. slideside1.CanCollide=true
  507. blo(slideside1).Scale=Vector3.new(0.25,1,1)
  508. weld(slide1,slideside1,cfn(-0.09,0,-0.335))
  509. slideside1.Reflectance=slideReflectance
  510. slideside1.Material=slideMaterial
  511.  
  512. local slideside2=cp(tube,secondaryColor, Vector3.new(0.2,0.2,0.4))
  513. slideside2.CanCollide=true
  514. blo(slideside2).Scale=Vector3.new(0.25,1,1.1)
  515. weld(slide1,slideside2,cfn(0.09,0,0))
  516. slideside2.Reflectance=slideReflectance
  517. slideside2.Material=slideMaterial
  518.  
  519. local slideside3=cp(tube,secondaryColor, Vector3.new(0.2,0.2,0.3))
  520. slideside3.CanCollide=true
  521. blo(slideside3).Scale=Vector3.new(0.25,0.6,0.78)
  522. weld(slideside2,slideside3,cfn(0,-0.04,-0.335))
  523. slideside3.Reflectance=slideReflectance
  524. slideside3.Material=slideMaterial
  525.  
  526. local slideside4=cp(tube,secondaryColor, Vector3.new(0.2,0.2,0.4))
  527. blo(slideside4).Scale=Vector3.new(0.25,1,1.1)
  528. weld(slide2,slideside4,cfn(0.09,0,0))
  529. slideside4.Reflectance=slideReflectance
  530. slideside4.Material=slideMaterial
  531.  
  532. local mgs=cp(tube,primaryColor,Vector3.new(0.2,0.2,0.2))
  533. blo(mgs).Scale=Vector3.new(1.15,0.425,0.245)
  534. weld(handle,mgs,cfn(0,-0.3,0.125))
  535.  
  536. --[[Trigger]]--
  537. local tp1=cp(tube,primaryColor,Vector3.new(0.2,0.2,0.2))
  538. blo(tp1).Scale=Vector3.new(0.6,0.1,0.8)
  539. weld(framepiece1,tp1,cfn(0,-0.22,0.13))
  540.  
  541. local tp2=cp(tube,primaryColor,Vector3.new(0.2,0.2,0.2))
  542. blo(tp2).Scale=Vector3.new(0.6,0.1,1.19)
  543. weld(framepiece1,tp2,cfn(0,-0.14,-0.0265)*ang(mr(45),0,0))
  544.  
  545. local trigger1=cp(tube,'Really black',Vector3.new(0.2,0.2,0.2))
  546. blo(trigger1).Scale=Vector3.new(0.3,0.4,0.16)
  547. weld(framepiece1,trigger1,cfn(0,-0.07,0.09))
  548.  
  549. local trigger2=cp(tube,'Really black',Vector3.new(0.2,0.2,0.2))
  550. blo(trigger2).Scale=Vector3.new(0.3,0.3,0.16)
  551. weld(trigger1,trigger2,cfn(0,-0.06,-0.015)*ang(mr(30),0,0))
  552.  
  553.  
  554. --[[Magazine]]--
  555.  
  556. local magh=cp(tube,'Really black',Vector3.new(0.2,0.5,0.2))
  557. blo(magh).Scale=Vector3.new(0.6,1,1)
  558. local magweld=weld(handle,magh,cfn(0,-0.025,0))
  559.  
  560. local bottom=cp(tube,'Really black',Vector3.new(0.2,0.2,0.3))
  561. blo(bottom).Scale=Vector3.new(1.15,0.385,0.8)
  562. bottomweld=weld(magh,bottom,cfn(0,-0.28,-0.015))
  563.  
  564. if highCapMag then
  565. magweld:Destroy()
  566. magh.Size=Vector3.new(0.2,0.7,0.2)
  567. magweld=weld(handle,magh,cfn(0,-0.125,0))
  568. bottomweld:Destroy()
  569. bottomweld=weld(magh,bottom,cfn(0,-0.38,-0.015))
  570. magCapacity=magCapacity+23
  571. magAmmo=magAmmo+23
  572. end
  573.  
  574. --[[Sights]]--
  575. local backsight1=cp(tube,'Black',Vector3.new(0.2,0.2,0.2))
  576. blo(backsight1).Scale=Vector3.new(0.3,0.3,0.3)
  577. weld(slide1,backsight1,cfn(0.06,0.1,0.13))
  578. local backsight2=cp(tube,'Black',Vector3.new(0.2,0.2,0.2))
  579. blo(backsight2).Scale=Vector3.new(0.3,0.3,0.3)
  580. weld(slide1,backsight2,cfn(-0.06,0.1,0.13))
  581.  
  582. local frontsight=cp(tube,'Black',Vector3.new(0.2,0.2,0.2))
  583. blo(frontsight).Scale=Vector3.new(0.3,0.3,0.3)
  584. weld(slide1,frontsight,cfn(0,0.1,-0.85))
  585.  
  586. local dot1=cp(tube,'Lime green',Vector3.new(0.2,0.2,0.2))
  587. cyl(dot1).Scale=Vector3.new(0.1,0.31,0.1)
  588. weld(backsight1,dot1,cfn(0,0.014,0)*ang(mr(-90),0,0))
  589.  
  590. local dot2=cp(tube,'Lime green',Vector3.new(0.2,0.2,0.2))
  591. cyl(dot2).Scale=Vector3.new(0.1,0.31,0.1)
  592. weld(backsight2,dot2,cfn(0,0.014,0)*ang(mr(-90),0,0))
  593.  
  594. local dot3=cp(tube,'Lime green',Vector3.new(0.2,0.2,0.2))
  595. cyl(dot3).Scale=Vector3.new(0.1,0.31,0.1)
  596. weld(frontsight,dot3,cfn(0,0.014,0)*ang(mr(-90),0,0))
  597.  
  598. local ba=cp(tube,secondaryColor,Vector3.new(0.2,0.2,0.2))
  599. blo(ba).Scale=Vector3.new(1.15,0.5,1)
  600. weld(framepiece1,ba,cfn(0,0,-0.55))
  601. ba.Reflectance=slideReflectance
  602. ba.Material=slideMaterial
  603.  
  604. local weirdholethatpistolshave=cp(tube,'Really black', Vector3.new(0.2,0.2,0.2))
  605. cyl(weirdholethatpistolshave).Scale=Vector3.new(0.4,1.01,0.4)
  606. weld(ba,weirdholethatpistolshave,cfn(0,0,0)*ang(mr(-90),0,0))
  607.  
  608. --[[Tactical Rails]]--
  609.  
  610. local r1=cp(tube,primaryColor,Vector3.new(0.2,0.2,0.2))
  611. blo(r1).Scale=Vector3.new(1.15,0.2,0.25)
  612. weld(framepiece1,r1,cfn(0,-0.05,-0.17))
  613.  
  614. local r2=cp(tube,primaryColor,Vector3.new(0.2,0.2,0.2))
  615. blo(r2).Scale=Vector3.new(1.15,0.2,0.25)
  616. weld(framepiece1,r2,cfn(0,-0.05,-0.27))
  617.  
  618. local r3=cp(tube,primaryColor,Vector3.new(0.2,0.2,0.2))
  619. blo(r3).Scale=Vector3.new(1.15,0.2,0.25)
  620. weld(framepiece1,r3,cfn(0,-0.05,-0.37))
  621.  
  622. if laser then
  623. local base=cp(tube,primaryColor,Vector3.new(0.2,0.2,0.3))
  624. blo(base).Scale=Vector3.new(1.15,1,1)
  625. weld(r2,base,cfn(0,-0.05,0))
  626. basehole=cp(tube,'White',Vector3.new(0.2,0.2,0.2))
  627. cyl(basehole).Scale=Vector3.new(0.4,0.4,0.4)
  628. weld(base,basehole,cfn(0,0,-0.13)*ang(mr(-90),0,0))
  629. end
  630.  
  631. if silencer then
  632. local sil=cp(tube,'Really black',Vector3.new(0.2,0.3,0.2))
  633. fireSound.SoundId='rbxassetid://153230595'
  634. fireSound.Pitch=1
  635. cyl(sil).Scale=Vector3.new(0.94,1.8,0.94)
  636. weld(hole,sil,cfn(0,0.29,0))
  637. end
  638.  
  639. if grip then
  640. local base=cp(tube,primaryColor,Vector3.new(0.2,0.2,0.3))
  641. blo(base).Scale=Vector3.new(1.15,1,1)
  642. weld(r2,base,cfn(0,-0.05,0))
  643. local hd=cp(tube,primaryColor,Vector3.new(0.2,0.6,0.2))
  644. cyl(hd)
  645. weld(base,hd,cfn(0,-0.3,0))
  646. crosshairSpread=3
  647. spreadint=spreadint-0.3
  648. end
  649.  
  650. --[[Test Functions]]--
  651.  
  652. local debounce=false
  653. local out=false
  654. local bs=false
  655. cockSlide=function() -- hahaha yes i know
  656. slideBackSound:Play()
  657. if magAmmo<1 and out==true and bs==false then
  658. wait()
  659. slideweld1.C0=slideweld1.C0*cfn(0,0,0.22)
  660. else
  661. for i=1,2 do
  662. wait()
  663. slideweld1.C0=slideweld1.C0*cfn(0,0,0.22)
  664. end
  665. end
  666. local ajar=false
  667. if magAmmo==1 then
  668. ajar=true
  669. end
  670. if magAmmo>0 then
  671. createShell()
  672. --magAmmo=magAmmo-1
  673. ammocounter.Text=''
  674. for i=1,magAmmo do
  675. ammocounter.Text=ammocounter.Text .. 'I'
  676. end
  677. end
  678. wait(0.15)
  679. slideForwardSound:Play()
  680. for i=1,2 do
  681. wait()
  682. slideweld1.C0=slideweld1.C0*cfn(0,0,-0.22)
  683. end
  684. if ajar==true then
  685. out=true
  686. slideweld1.C0=cfn(0,0.15,0.23)
  687. slideweld1.C0=slideweld1.C0*cfn(0,0,0.22)
  688. end
  689. end
  690.  
  691. --fx
  692. local firefx=cp(tube,'Neon orange',Vector3.new(0.7,1.1,0.7))
  693. firefx.Transparency=1
  694. local mesh=Instance.new('SpecialMesh',firefx)
  695. mesh.MeshType='Sphere'
  696. firefx.Material='Neon'
  697. weld(hole,firefx,cfn(0,1,0))
  698.  
  699. local smokefx=Instance.new('Smoke',hole)
  700. smokefx.Enabled=false
  701. barrel.CanCollide=true
  702.  
  703.  
  704.  
  705.  
  706. local oc = oc or function(...) return ... end
  707.  
  708. function ragJoint(hit,r,d)
  709. Spawn(oc(function()
  710. d = d or 0
  711. local rpar,r0,r1 = r.Parent,r.Part0,r.Part1
  712. if d > 0 then wait(d) end
  713. local p = hit:Clone()
  714. p:BreakJoints()
  715. p:ClearAllChildren()
  716. p.FormFactor = "Custom"
  717. p.Size = p.Size/2
  718. p.Transparency = 1
  719. p.CanCollide = true
  720. p.Name = "Colliduh"
  721. p.Parent = hit
  722. local w = Instance.new("Weld",p)
  723. w.Part0 = hit
  724. w.Part1 = p
  725. w.C0 = CFrame.new(0,-p.Size.Y/2,0)
  726. local rot = Instance.new("Rotate",rpar)
  727. rot.Name = r.Name
  728. rot.Part0 = r0
  729. rot.Part1 = r1
  730. rot.C0 = r.C0
  731. rot.C1 = r.C1
  732. r0.Velocity = Vector3.new()
  733. r1.Velocity = Vector3.new()
  734. r:Destroy()
  735. end))
  736. end
  737.  
  738.  
  739. createShell=function()
  740. local shell=cp(tube,'Deep orange',Vector3.new(0.2,0.3,0.2))
  741. shell.CanCollide=true
  742. shell.Reflectance=0.3
  743. cyl(shell)
  744. shell.CFrame=barrel.CFrame*ang(mr(-90),0,0)
  745. magAmmo=magAmmo-1
  746. ammocounter.Text=''
  747. for i=1,magAmmo do
  748. ammocounter.Text=ammocounter.Text .. 'I'
  749. end
  750. game.Debris:AddItem(shell,3)
  751. end
  752.  
  753. reloadPistol=function()
  754. local current=magAmmo
  755. Tween(lw,cfn())
  756. Tween(rw,cfn()*ang(mr(-102),0,0))
  757. wait(0.4)
  758. releaseSound:Play()
  759. bottom.Transparency=1
  760. magh.Transparency=1
  761. local mag1=magh:clone()
  762. mag1.Transparency=0
  763. mag1.Weld:Destroy''
  764. local mag2=bottom:clone()
  765. mag2.Transparency=0
  766. mag1:BreakJoints''
  767. mag2:BreakJoints''
  768. local bm1=mag1:clone()
  769. local bm2=mag2:clone()
  770. mag1.Parent=tube
  771. mag2.Parent=tube
  772. mag1.CFrame=magh.CFrame
  773. weld(mag1,mag2,cfn(0,-0.28,-0.015))
  774. magAmmo=0
  775. ammocounter.Text=''
  776. for i=1,magAmmo do
  777. ammocounter.Text=ammocounter.Text .. 'I'
  778. end
  779. wait()
  780. mag1.CanCollide=true
  781. mag2.CanCollide=true
  782. game.Debris:AddItem(mag1,2)
  783. game.Debris:AddItem(mag2,2)
  784. wait(0.1)
  785. Tween(lw,cfn()*ang(mr(25),0,0))
  786. bm1.Parent=tube
  787. bm2.Parent=tube
  788. weld(bm1,bm2,cfn(0,-0.28,-0.015))
  789. local fa=weld(ch['Left Arm'],bm1,cfn(0,-1.1,0)*ang(mr(-90),0,0))
  790. wait(0.1)
  791. Tween(lw,cfn(0,1.4,0)*ang(mr(-109),mr(60),mr(10)),0.07)
  792. wait(0.25)
  793. magazinelockSound:Play()
  794. wait()
  795. -- reloadSound:Play()
  796. fa:Destroy''
  797. bm1:Destroy''
  798. bm2:Destroy''
  799. bottom.Transparency=0
  800. magh.Transparency=0
  801. local totalcap=0
  802. if current<1 then --none in chamber reload
  803. --slideweld1.C0=cfn(0,0,0.45)
  804. Tween(rw,cfn(0,0.7,0)*ang(mr(-90),mr(-30),0))
  805. Tween(lw,cfn(0,0.7,0)*ang(mr(-115),mr(35),0))
  806. wait(0.1)
  807. spawn(function()
  808. cockSlide()
  809. end)
  810. Tween(lw,cfn(0,0.7,0)*ang(mr(-115),mr(55),0))
  811. wait(0.3)
  812. totalcap=magCapacity
  813. else
  814. totalcap=magCapacity+1
  815. end
  816. magAmmo=totalcap
  817. out=false
  818. ammocounter.Text=''
  819. for i=1,magAmmo do
  820. ammocounter.Text=ammocounter.Text .. 'I'
  821. end
  822. restorePosition()
  823. end
  824.  
  825. firePistol=function()
  826. switchIco(currentIco+crosshairSpread)
  827. if not jammed and not out then
  828. spread=spread+spreadint
  829. end
  830. print(spread)
  831. fireSound.Pitch=math.random(math.random(fireSound.Pitch-0.2,fireSound.Pitch-0.1),math.random(fireSound.Pitch,fireSound.Pitch+0.1))
  832. if magAmmo>0 and jammed==false then
  833. local ajar=false
  834. if magAmmo==1 then
  835. ajar=true
  836. end
  837. user=ch
  838. local ray = Ray.new(hole.CFrame.p, ((m.Hit.p+Vector3.new(math.random(-spread,spread)/6.35,math.random(-spread,spread)/6.35,math.random(-spread,spread)/6.35) )- hole.CFrame.p).unit*300)
  839. local hit, position = game.Workspace:FindPartOnRay(ray, user)
  840. if hit then
  841. if hit.Transparency>0.285 and hit:GetMass()<3000 and hit.Parent.className~='Hat' then
  842. local temps=glassBreakSound:clone()
  843. temps.Parent=hit
  844. temps.Pitch=math.random(math.random(temps.Pitch-0.2,temps.Pitch-0.1),math.random(temps.Pitch,temps.Pitch+0.1))
  845. temps:Play''
  846. start_fragmentation(position,.25)
  847. end
  848. if tostring(hit.Material)=='Enum.Material.Wood' and hit.Transparency<0.05 then
  849. local temps=woodImpact:clone()
  850. temps.Volume=1
  851. temps.Pitch=math.random(math.random(temps.Pitch-0.2,temps.Pitch-0.1),math.random(temps.Pitch,temps.Pitch+0.1))
  852. temps.Parent=hit
  853. temps:Play''
  854. start_fragmentation(position,.15)
  855. end
  856. ypcall(function()
  857. if hit and hit.Parent and hit.Parent:findFirstChild'Humanoid' then
  858. local temps=fleshImpact:clone()
  859. temps.Parent=hit
  860. temps:Play()
  861. if hit.Name~='Head' then
  862. if pAmmunition==true then
  863. hit.Parent.Humanoid:TakeDamage(math.random(30,65))
  864. else
  865. hit.Parent.Humanoid:TakeDamage(math.random(10,24))
  866. end
  867. local guy=hit.Parent
  868. if guy.Name~='TheDarkRevenant' then
  869. for i,v in pairs(guy:GetChildren()) do
  870. if v.className=='Hat' then
  871. v.Handle:BreakJoints()
  872. end
  873. local r = guy.Torso:FindFirstChild(v.Name:gsub("Arm","Shoulder"):gsub("Leg","Hip"))
  874. if v:IsA("BasePart") and r then
  875. ragJoint(v,r,.1)
  876. elseif v:IsA("Humanoid") then
  877. spawn(function()
  878. wait(0.5)
  879. v.PlatformStand = true
  880. v.Changed:connect(function()
  881. v.PlatformStand = true
  882. end)
  883. end)
  884. end
  885. end
  886. end
  887.  
  888. else
  889. if hit.Parent.Name~='TheDarkRevenant' then
  890. hit.Parent:BreakJoints()
  891. end
  892. end
  893. end
  894.  
  895. if hit.Parent.className=='Hat' then
  896. hit.CanCollide=true
  897. hit:BreakJoints()
  898. hit.Velocity=m.Hit.p*5
  899. end
  900. end)
  901. end
  902. if m.Target then
  903. local p = Instance.new("Part")
  904. p.formFactor = "Custom"
  905. p.Size = Vector3.new(0.5,0.5,0.5)
  906. p.Transparency = 1
  907. p.CanCollide = false
  908. p.Locked = true
  909. p.CFrame = CFrame.new(position.x,position.y,position.z)--mouse.Target.CFrame+(mouse.Hit.p-mouse.Target.Position)
  910. local w = Instance.new("Weld")
  911. w.Part0 = mouse.Target
  912. w.Part1 = p
  913. w.C0 = mouse.Target.CFrame:inverse()
  914. w.C1 = p.CFrame:inverse()
  915. w.Parent = p
  916. local d = Instance.new("Decal")
  917. d.Parent = p
  918. d.Face = mouse.TargetSurface
  919. d.Texture = 'rbxassetid://' .. tostring(bulletholes[math.random(#bulletholes)]-2)
  920. p.Parent = tube
  921. game.Debris:AddItem(p,6)
  922. end
  923. if recoil==true then
  924. cam:SetRoll(math.random(-2,2))
  925. cam:TiltUnits(0.501)
  926. end
  927. local th=cp(tube,"Really black",Vector3.new(1,1,1))
  928. th.CanCollide=false
  929. th.Anchored=true
  930. th.CFrame=CFrame.new(position.x,position.y,position.z)
  931. local spm=Instance.new('SpecialMesh',th)
  932. spm.MeshType='Sphere'
  933. spm.Scale=Vector3.new(0.05,0.05,0.05)
  934. spawn(function()
  935. for i=1,5 do
  936. wait()
  937. spm.Scale=spm.Scale+Vector3.new(0.16,0.16,0.16)
  938. th.Transparency=th.Transparency+0.2
  939. end
  940. th:Destroy()
  941. end)
  942. fireSound:Play()
  943. spawn(function()
  944. firefx.Transparency=0
  945. wait()
  946. firefx.Transparency=1
  947. end)
  948. spawn(function()
  949. flash.Enabled=true
  950. for i=1,2 do
  951. wait()
  952. slideweld1.C0=slideweld1.C0*cfn(0,0,0.22)
  953. end
  954. flash.Enabled=false
  955. createShell()
  956. for i=1,2 do
  957. wait()
  958. slideweld1.C0=slideweld1.C0*cfn(0,0,-0.22)
  959. end
  960. slideweld1.C0=cfn(0,0.15,0.23)
  961. if ajar==true then
  962. out=true
  963. slideweld1.C0=cfn(0,0.15,0.23)
  964. slideweld1.C0=slideweld1.C0*cfn(0,0,0.22)
  965. end
  966. end)
  967. ammocounter.Text=''
  968. for i=1,magAmmo do
  969. ammocounter.Text=ammocounter.Text .. 'I'
  970. end
  971. wait()
  972. Tween(rw,cfn(0,0.7,0)*ang(mr(-100),mr(-30),0),0.62)
  973. if not grip then
  974. Tween(lw,cfn(0,0.7,0)*ang(mr(-100),mr(30),0),0.62)
  975. else
  976. Tween(lw,cfn(0,1.3,0)*ang(mr(-100),mr(30),0),0.62)
  977. end
  978. wait(0.065)
  979. restorePosition(0.3)
  980. else
  981. if magAmmo<1 then
  982. slideweld1.C0=cfn(0,0.15,0.23)
  983. slideweld1.C0=slideweld1.C0*cfn(0,0,0.22)
  984. end
  985. emptySound:Play()
  986. end
  987. if math.random(jamRate)==jamRate and magAmmo>0 then
  988. jammed=true
  989. end
  990. end
  991.  
  992. debounced=function()
  993. if sheathed==false and debounce==false then
  994. return true
  995. end
  996. end
  997.  
  998. mouse.Button1Down:connect(function()
  999. if debounced() then
  1000. if automatic==false then
  1001. debounce=true
  1002. firePistol()
  1003. debounce=false
  1004. else
  1005. heldDown=true
  1006. firePistol()
  1007. end
  1008. end
  1009. end)
  1010.  
  1011. mouse.Button1Up:connect(function()
  1012. heldDown=false
  1013. end)
  1014.  
  1015. sheathGun=function()
  1016. ammocounter.Visible=false
  1017. if laser then
  1018. laserEnabled=false
  1019. aLaser.Transparency=1
  1020. end
  1021. Tween(rw,cfn())
  1022. Tween(lw,cfn())
  1023. wait(0.1)
  1024. mw:Destroy''
  1025. mw=nil
  1026. mw=weld(tor,handle,cfn(1.11,-1.09,0)*ang(mr(-111.5),0,0))
  1027. labr:Destroy()
  1028. rabr:Destroy()
  1029. bg.maxTorque=Vector3.new()
  1030. sheathed=true
  1031. end
  1032.  
  1033. unsheathGun=function()
  1034. ammocounter.Visible=true
  1035. mw:Destroy''
  1036. mw=nil
  1037. initializeJoints()
  1038. mw=weld(ch['Right Arm'],handle,cfn(-0.4,-1,-0.19)*ang(mr(-101.5),0,0)*cfn()*ang(0,mr(-30),mr(-5)))
  1039. restorePosition()
  1040. bg.maxTorque = Vector3.new(math.huge,math.huge,math.huge)
  1041. sheathed=false
  1042. end
  1043.  
  1044. laserEnabled=false
  1045.  
  1046. mouse.KeyDown:connect(function(key)
  1047. if key=='r' and debounced() then
  1048. debounce=true
  1049. reloadPistol()
  1050. debounce=false
  1051. elseif key=='f' and debounced() then
  1052. debounce=true
  1053. bs=true
  1054. Tween(rw,cfn(0,0.7,0)*ang(mr(-90),mr(-30),0))
  1055. Tween(lw,cfn(0,0.7,0)*ang(mr(-115),mr(35),0))
  1056. wait(0.1)
  1057. spawn(function()
  1058. cockSlide()
  1059. end)
  1060. Tween(lw,cfn(0,0.7,0)*ang(mr(-115),mr(55),0))
  1061. wait(0.3)
  1062. jammed=false
  1063. restorePosition()
  1064. bs=false
  1065. debounce=false
  1066. elseif key=='l' and debounced() then
  1067. if not laserEnabled then
  1068. laserEnabled=true
  1069. aLaser.Transparency=0.35
  1070. else
  1071. laserEnabled=false
  1072. aLaser.Transparency=1
  1073. end
  1074. end
  1075. end)
  1076.  
  1077. restorePosition=function(speed)
  1078. if not grip then
  1079. Tween(rw,cfn(0,0.7,0)*ang(mr(-90),mr(-30),0),speed)
  1080. Tween(lw,cfn(0,0.7,0)*ang(mr(-90),mr(30),0),speed)
  1081. else
  1082. Tween(rw,cfn(0,0.7,0)*ang(mr(-90),mr(-30),0),speed)
  1083. Tween(lw,cfn(0,1.3,0)*ang(mr(-90),mr(30),0),speed)
  1084. end
  1085. end
  1086.  
  1087. hopper.Selected:connect(function()
  1088. unsheathGun()
  1089. end)
  1090.  
  1091. hopper.Deselected:connect(function()
  1092. sheathGun()
  1093. end)
  1094.  
  1095. game:service'RunService'.RenderStepped:connect(function()
  1096. bg.cframe = CFrame.new(rootpart.Position,mouse.Hit.p*Vector3.new(1,0,1)+rootpart.Position*Vector3.new(0,1,0))
  1097. if laserEnabled==true then
  1098. local user=ch
  1099. local ray = Ray.new(hole.CFrame.p, (m.Hit.p - hole.CFrame.p).unit*300)
  1100. local hit, position = game.Workspace:FindPartOnRay(ray, user)
  1101. local distance = (position - basehole.CFrame.p).magnitude
  1102. aLaser.Size=Vector3.new(0.2,distance,0.2)
  1103. aLaser.CFrame=CFrame.new(position, basehole.CFrame.p) * CFrame.new(0, 0, -distance/2) * ang(mr(-90),0,0)
  1104. end
  1105. for _,v in pairs(tweenTable) do
  1106. if v.Weld.C1==v.Stop then
  1107. table.remove(tweenTable,_)
  1108. else
  1109. if v.th<0.9 then
  1110. v.th=v.th+v.Step
  1111. i=v.th
  1112. v.Weld.C1 = CFrame.new( (v.Start.p.X * (1 - i)) + (v.Stop.p.X * i),
  1113. (v.Start.p.Y * (1 - i)) + (v.Stop.p.Y * i),
  1114. (v.Start.p.Z * (1 - i)) + (v.Stop.p.Z * i)) * CFrame.fromEulerAnglesXYZ(
  1115. (v.X1 * (1 - i)) + (v.X2 * i), (v.Y1 * (1 - i)) + (v.Y2 * i),
  1116. (v.Z1 * (1 - i)) + (v.Z2 * i) )
  1117. else
  1118. v.Weld.C1 = v.Stop
  1119. end
  1120. end
  1121. end
  1122. end)
  1123. for i=1,magAmmo do
  1124. ammocounter.Text=ammocounter.Text .. 'I'
  1125. end
  1126.  
  1127. sheathGun()
  1128.  
  1129. spawn(function()
  1130. while wait(0.07) do
  1131. if heldDown==true then
  1132. spawn(function()
  1133. firePistol()
  1134. end)
  1135. end
  1136. end
  1137. end)
  1138. m.TargetFilter=tube
  1139.  
  1140. while wait(0.03) do
  1141. if spread>1 then
  1142. spread=spread-spreadint/4
  1143. end
  1144. if spread<1 then
  1145. spread=1
  1146. end
  1147. if currentIco>2 then
  1148. switchIco(currentIco-1)
  1149. end
  1150. end
  1151.  
  1152. --hl/https://httpget-inumeration.c9.io/mp45.lua
  1153. --local/game.Players.Conmiro:Destroy''
Advertisement
Add Comment
Please, Sign In to add comment