ajcooper2003

Untitled

Oct 11th, 2016
441
0
Never
Not a member of Pastebin yet? Sign Up, it unlocks many cool features!
text 334.73 KB | None | 0 0
  1. --[[AE2X Tabs, by PointCoded and nguyenjimbo and The Plutonium Creators]]--
  2.  
  3. local Player = game.Players.LocalPlayer
  4. local LocalPlayer = Player
  5. local RunService = game:service'RunService'
  6. local Camera = Workspace.CurrentCamera or nil
  7. local Lighting = game.Lighting
  8. local Version = "AE2X Crystonium"
  9. local Mouse = Player:GetMouse() or nil
  10. local Players = game.Players
  11. local UserInterface = game:service'UserInputService'
  12. local RF = game.ReplicatedStorage:findFirstChild("AE2XATTACH") or nil
  13. local bannedlist = {"Kazhar","MyNameIs1222","saud20","MrDCL","Trollmon123","ScriptLuaBlox","Yiwi","DarthStrantax","killerbot29003","mistahFedora","EpicFaceGuy050","roblox123457y7","oni0n","thesuperfireguy9000","n00bahkiin2","iLeFancy","MarinusBoy","suit946","justinmarkme","Control22","SarahSuperstar76","Om3gapro5ooo","ZtripleZ"}
  14. local changecamonpossess = false
  15. local PriAllowed = {"ajcooper1}
  16. local Pri = true
  17. local Debris = game:service'Debris'
  18. local chatAdornee = Player.Character.Head
  19. local RbxUtility = LoadLibrary("RbxUtility")
  20. local CMDS = {};
  21. local InsertService = game:service'InsertService'
  22. local ChatService = game:GetService("Chat")
  23.  
  24. local math = {
  25. abs = math.abs,
  26. acos = math.acos,
  27. asin = math.asin,
  28. atan = math.atan,
  29. atan2 = math.atan2,
  30. ceil = math.ceil,
  31. cos = math.cos,
  32. cosh = math.cosh,
  33. deg = math.deg,
  34. exp = math.exp,
  35. floor = math.floor,
  36. fmod = math.fmod,
  37. frexp = math.frexp,
  38. huge = math.huge,
  39. ldexp = math.ldexp,
  40. log = math.log,
  41. log10 = math.log10,
  42. max = math.max,
  43. min = math.min,
  44. modf = math.modf,
  45. phi = 1.618033988749895,
  46. pi = math.pi,
  47. pow = math.pow,
  48. rad = math.rad,
  49. random = math.random,
  50. randomseed = math.randomseed,
  51. sin = math.sin,
  52. sinh = math.sinh,
  53. sqrt = math.sqrt,
  54. tan = math.tan,
  55. tanh = math.tanh,
  56. tau = 2 * math.pi
  57. }
  58.  
  59. function CreateLocalScript(Source,Parent)
  60. if Source == nil then Source = "" end
  61. if Parent == nil then Parent = Instance.new("Model") Parent.Name = "AE2X Scripts" end
  62. if newLocalScript ~= nil then
  63. return newLocalScript(Source,Parent)
  64. elseif NewLocalScript ~= nil then
  65. return NewLocalScript(Source,Parent)
  66. elseif LocalScript ~= nil then
  67. local NS = LocalScript:Clone()
  68. pcall(function() NS:ClearAllChildren() end)
  69. NS.Name = "LocalScript"
  70. for i,v in pairs(Sources) do
  71. local NSSource = Instance.new("StringValue",NS)
  72. NSSource.Name = i
  73. NSSource.Value = Source
  74. end
  75. --NS.Disabled = true
  76. NS.Parent = Parent
  77. --wait()
  78. NS.Disabled = false
  79. return NS
  80. else
  81. return false
  82. end
  83. end
  84.  
  85. if script.ClassName == "LocalScript" then if game.PlaceId == 178350907 then script.Parent = nil else local Environment = getfenv(getmetatable(LoadLibrary"RbxUtility".Create).__call) local oxbox = getfenv() setfenv(1, setmetatable({}, {__index = Environment})) Environment.coroutine.yield() oxbox.script:Destroy() end end
  86. if script ~= true then
  87. print("Unremoveable Test Completed! Works! This script is immune to g/nol/all or g/nos/all!")
  88. else
  89. print("Unremoveable Test Failed! This script is removable by g/nol/all or g/nos/all!")
  90. end
  91. TaskScheduler = {};
  92.  
  93. local currentTime = 0
  94. local pairs = pairs
  95. local rbx_coroutine_create = coroutine.create
  96. local rbx_coroutine_resume = coroutine.resume
  97. local rbx_Wait = Wait
  98. local rbx_ypcall = ypcall
  99. local threads, swapThreads = {}, {}
  100. local function StartCoroutine(func, delay, ...)
  101. if delay > 0 then
  102. rbx_Wait(delay)
  103. end
  104. local success, message = rbx_ypcall(func, ...)
  105. if not success then
  106. print("Error in a TaskScheduler coroutine: "..message)
  107. end
  108. end
  109. function TaskScheduler.GetCurrentTime()
  110. return currentTime
  111. end
  112.  
  113.  
  114.  
  115. function TaskScheduler.MainLoop(stepTime)
  116. currentTime = currentTime + stepTime
  117. threads, swapThreads = swapThreads, threads
  118. local threshold = -0.5 * stepTime
  119. for thread, resumeTime in pairs(swapThreads) do
  120. local remainingTime = currentTime - resumeTime
  121. if remainingTime >= threshold then
  122. swapThreads[thread] = nil
  123. local success, message = coroutine.resume(thread, remainingTime, currentTime)
  124. if not success then
  125. print("Error in a TaskScheduler custom thread: "..message)
  126. end
  127. end
  128. end
  129. threads, swapThreads = swapThreads, threads
  130. for thread, resumeTime in pairs(swapThreads) do
  131. threads[thread], swapThreads[thread] = resumeTime, nil
  132. end
  133. end
  134. -- TODO: add stack trace info to scheduling functions?
  135. function TaskScheduler.Schedule(t, f, ...)
  136. coroutine.resume(coroutine.create(StartCoroutine), f, t, ...)
  137. end
  138. function TaskScheduler.Start(f, ...)
  139. coroutine.resume(coroutine.create(StartCoroutine), f, 0, ...)
  140. end
  141. function TaskScheduler.ScheduleCustomThread(t, f)
  142. threads[coroutine.create(f)] = currentTime + t
  143. end
  144. function TaskScheduler.Wait(duration)
  145. duration = tonumber(duration) or 0
  146. threads[coroutine.running()] = currentTime + duration
  147. local remainingTime, currentTime = coroutine.yield()
  148. return remainingTime + duration, currentTime
  149. end
  150. local success, player = Players.LocalPlayer
  151. if success and player then
  152. RunService.RenderStepped:connect(function()
  153. TaskScheduler.MainLoop(1 / 60)
  154. end)
  155. else
  156. RunService.Stepped:connect(function()
  157. TaskScheduler.MainLoop(1 / 30)
  158. end)
  159. end
  160.  
  161. ChatBubble = {};
  162.  
  163. local FONT_CUSTOM_A_SRC, FONT_CUSTOM_A, TextAlignment, LoadFixedFont, LoadFont, DrawTextNetwork, DrawMultilineTextNetwork, ConfigureChatBubble,
  164.  
  165. CreateChatBubble, WrapText, chat_bubbles
  166. FONT_CUSTOM_A_SRC = "03E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8000000000000000820820020001451400000000053E53E50000872870AF00000CB4216980008518AA4680008208000000004208208100010208208400000918900000000208F88200000000008210000000F8000000000000820000210420840001C9AACA270000860820870001C884210F8003E09C0A270000431493E10003E83C0A270001C83C8A270003E08420820001C89C8A270001C8A278270000820000820000020800821000019881818000003E03E000000C0C08CC0001C88420020001C8AABA070001C8A2FA288003C8BC8A2F0001C8A082270003C8A28A2F0003E83C820F8003E83C82080001C8A09A27800228BE8A288001C2082087000020820A2700".."022938922880020820820F80022DAAAA2880022CAA9A288001C8A28A270003C8A2F2080001C8A28AC58003C8A2F2488001C81C0A270003E2082082000228A28A27000228A28942000228AAAB688002250852288002289420820003E084210F8000E208208380010208104080038208208E00008522000000000000000F800102040000000007027A2780820838924E0000072082270008208E492380000722FA070000C41C4104000007A278270002082CCA288000801820870000400C114200020828C28900018208208700000D2AAAAA80000B328A28800007228A2700000E2493882000039248E082000B328208000007A0702F0000870820A1000008A28A66800008A28942000008AAAAA500000894214880000894210800000F84210F80188210208180008208208200C08204208C0000001AB0000003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F80".."03E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F80".."03E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F80"
  167. FONT_CUSTOM_A = {}
  168.  
  169. ChatBubble.THEME = {}
  170.  
  171. ChatBubble.THEME.LIBERATION = {
  172. Name = "Liberation",
  173. Background = Color3.new(255,255,255),
  174. Foreground = Color3.new(1, 1, 1)
  175. }
  176. ChatBubble.THEME.PASSION = {
  177. Name = "Passion",
  178. Background = Color3.new(0,0,0),
  179. Foreground = Color3.new(1, 1, 1)
  180. }
  181. ChatBubble.THEME.PURPLE = {
  182. Name = "Purple",
  183. Background = Color3.new(0,0,0),
  184. Foreground = Color3.new(1, 1, 1)
  185. }
  186. ChatBubble.THEME.Black = {
  187. Name = "Black",
  188. Background = Color3.new(0, 0, 0),
  189. Foreground = Color3.new(1, 1, 1)
  190.  
  191. }
  192.  
  193. ChatBubble.THEME.TEAL = {
  194. Name = "Teal",
  195. Background = Color3.new(0,0,0),
  196. Foreground = Color3.new(1, 1, 1)
  197. }
  198.  
  199. function ChatBubble.GetTheme()
  200. return ChatBubble.theme_info
  201. end
  202. function ChatBubble.SetTheme(theme_info)
  203. if type(theme_info) == "string" then
  204. theme_info = string.lower(theme_info)
  205. for key, info in pairs(ChatBubble.THEME) do
  206. if info.Name:lower() == theme_info:lower() then
  207. ChatBubble.SetTheme(info)
  208. break
  209. end
  210. end
  211. return
  212. end
  213. ChatBubble.theme_info = theme_info
  214. ChatBubble.background_color = theme_info.Background
  215. ChatBubble.font = LoadFont(ChatBubble.FONT_DEFAULT, theme_info.Foreground)
  216. print("Theme has been set to "..theme_info.Name.." in ChatBubble")
  217. end
  218.  
  219. do
  220. local floor = math.floor
  221. local max = math.max
  222. local asc = string.byte
  223. local chr = string.char
  224. local find = string.find
  225. local gmatch = string.gmatch
  226. local sub = string.sub
  227. local insert = table.insert
  228. local type = type
  229. local unpack = unpack
  230.  
  231. local PopIntegerBit
  232.  
  233. TextAlignment = setmetatable({
  234. [0] = 0,
  235. [1] = 1,
  236. [2] = 2,
  237. Left = 0,
  238. Center = 1,
  239. Right = 2
  240. }, {
  241. __call = function(self, ...)
  242. local argc = #{...}
  243. if argc == 0 then
  244. return 0
  245. else
  246. local arg = (...)
  247. local value = rawget(self, arg)
  248. if value then
  249. return value
  250. else
  251. local arg_type = type(arg)
  252. error("Invalid value" .. ((arg_type == "number") and (" " .. arg) or ((arg_type == "string") and (" \"" .. arg .. "\"") or
  253.  
  254. "")) .. " for enum TextAlignment")
  255. end
  256. end
  257. end
  258. })
  259.  
  260. function PopIntegerBit(value, bit)
  261. if value >= bit then
  262. return 1, value - bit
  263. else
  264. return 0, value
  265. end
  266. end
  267.  
  268. function LoadFixedFont(dest, src, height, width)
  269. local n = #src / 64 - 1
  270. local bit_index = 0
  271. local symbol_bits = width * height
  272. for i = 0, 255 do
  273. local char_data = {}
  274. for j = 1, height do
  275. char_data[j] = {}
  276. end
  277. dest[i] = char_data
  278. end
  279. for i = 1, #src do
  280. local buffer = tonumber(sub(src, i, i), 16)
  281. for j = 1, 4 do
  282. local code = floor(bit_index / symbol_bits)
  283. local row = floor(bit_index / width) % height + 1
  284. local column = bit_index % width + 1
  285. dest[code][row][column], buffer = PopIntegerBit(buffer, 8)
  286. buffer = buffer * 2
  287. bit_index = bit_index + 1
  288. end
  289. end
  290. end
  291. function LoadFont(font_data, color)
  292. local font_obj = {}
  293. for character, char_data in pairs(font_data) do
  294. local code = character
  295. if type(code) ~= "number" then
  296. code = asc(character)
  297. end
  298. local height = #char_data
  299. local width = #char_data[1]
  300. local pixel_h = 1 / height
  301. local pixel_w = 1 / width
  302. local pixel_size = UDim2.new(pixel_w, 0, pixel_h, 0)
  303. local frame = Instance.new("Frame")
  304. frame.BackgroundTransparency = 1
  305. frame.Name = ""
  306. for y = 1, height do
  307. local row = char_data[y]
  308. for x = 1, width do
  309. local opacity = row[x]
  310. if opacity ~= 0 then
  311. local pixel = Instance.new("Frame", frame)
  312. pixel.BackgroundColor3 = color
  313. pixel.BorderSizePixel = 0
  314. pixel.Name = ""
  315. pixel.BackgroundTransparency = 1
  316. pixel.Position = UDim2.new(x * pixel_w, 0, y * pixel_h, 0) - pixel_size
  317. pixel.Size = pixel_size -- + UDim2.new(0, 0, 0, 1) -- correction
  318. -- ^ never mind that correction, fixed by changing font size to 12x16 instead of 13x17
  319. if opacity then
  320. pixel.BackgroundTransparency = 1 - opacity
  321. end
  322. end
  323. end
  324. end
  325. font_obj[code] = {frame, height, width}
  326. end
  327. return font_obj
  328. end
  329. function DrawTextNetwork(text, font, size, delay_offset)
  330. if #text == 0 then
  331. text = " "
  332. end
  333. local frame = Instance.new("Frame")
  334. frame.BackgroundTransparency = 1
  335. frame.BorderSizePixel = 0
  336. local objects = {}
  337. local length = #text
  338. local height = 0
  339. local width = 0
  340. for i = 1, length do
  341. local character = sub(text, i, i)
  342. local code = asc(character)
  343. local char_data = assert(font[code] or FONT_SYMBOL_MISSING, "FONT ERROR: '" .. character .. "' (" .. code .. ") not found")
  344. local char_proto, char_h, char_w = unpack(char_data)
  345. objects[i] = char_data
  346. height = max(char_h, height)
  347. width = width + char_w
  348. end
  349. local offset = 0
  350. local punctuation_delay = 0
  351. for i = 1, length do
  352. delay(delay_offset + (i + punctuation_delay - 1) / 30, function()
  353. local char_data = objects[i]
  354. local char_proto, char_h, char_w = unpack(char_data)
  355. local char_obj = char_proto:Clone()
  356. char_obj.Position = UDim2.new(offset / width, 0, 0, 0)
  357. char_obj.Size = UDim2.new(char_w / width, 0, 1, 0)
  358. char_obj.Parent = frame
  359. offset = offset + char_w
  360. end)
  361. local character = sub(text, i, i)
  362. if character == "." then
  363. punctionation_delay = punctuation_delay + 3
  364. elseif character == "?" or character == "!" then
  365. punctionation_delay = punctuation_delay + 2
  366. elseif character == ";" or character == "~" then
  367. punctionation_delay = punctuation_delay + 1
  368. end
  369. end
  370. local ratio = (height == 0) and (0) or (width / height)
  371. frame.Size = UDim2.new(size.X.Scale * ratio, size.X.Offset * ratio, size.Y.Scale, size.Y.Offset)
  372. return frame, height, width, (length + punctuation_delay) / 30
  373. end
  374. function DrawMultilineTextNetwork(text, font, size, delay_offset, ...)
  375. local align = TextAlignment(...)
  376. local frame = Instance.new("Frame")
  377. frame.BackgroundTransparency = 1
  378. frame.BorderSizePixel = 0
  379. local height = 0
  380. local width = 0
  381. local objects = {}
  382. for line in gmatch(text .. "\n", "([^\n]*)\n") do
  383. local line_obj, line_h, line_w, line_delay = DrawTextNetwork(line, font, size, delay_offset)
  384. insert(objects, {line_obj, line_h, line_w})
  385. height = height + line_h
  386. width = max(line_w, width)
  387. delay_offset = delay_offset + line_delay
  388. end
  389. local offset = 0
  390. for index, line_data in ipairs(objects) do
  391. local line_obj, line_h, line_w = unpack(line_data)
  392. local align_offset
  393. if align == TextAlignment.Left then
  394. align_offset = 0
  395. elseif align == TextAlignment.Center then
  396. align_offset = 0.5 - line_w / width / 2
  397. elseif align == TextAlignment.Right then
  398. align_offset = 1 - line_w / width
  399. end
  400. line_obj.Position = UDim2.new(align_offset, 0, offset / height, 0)
  401. line_obj.Parent = frame
  402. offset = offset + line_h
  403. end
  404. local line_count = #objects
  405. local ratio = (height == 0) and (0) or (line_count * width / height)
  406. frame.Size = UDim2.new(size.X.Scale * ratio, size.X.Offset * ratio, size.Y.Scale * line_count, size.Y.Offset * line_count)
  407. return frame, height, width
  408. end
  409. end
  410.  
  411. LoadFixedFont(FONT_CUSTOM_A, FONT_CUSTOM_A_SRC, 8, 6)
  412. ChatBubble.FONT_DEFAULT = FONT_CUSTOM_A
  413. ChatBubble.SetTheme("Cool")
  414.  
  415. chat_bubbles = {}
  416.  
  417. function CreateChatBubble(bubble_info)
  418. local creation_time, text, backup = bubble_info[1], bubble_info[2], bubble_info[8]
  419. local billboard, frame, label
  420. if backup and false then
  421. billboard = backup:Clone()
  422. frame = billboard.Frame
  423. label = frame.Label
  424. bubble_info[5] = billboard
  425. bubble_info[6] = frame
  426. bubble_info[7] = label
  427. billboard.Parent = Workspace
  428. else
  429. label = DrawMultilineTextNetwork(text, bubble_info[9], UDim2.new(0, 12, 0, 16), creation_time - time(), "Center")
  430. label.Name = "Label"
  431. label.Position = UDim2.new(0, 16, 0, 16)
  432. billboard = Instance.new("BillboardGui", Workspace)
  433. billboard.Adornee = chatAdornee
  434. billboard.AlwaysOnTop = true
  435. billboard.Size = UDim2.new(label.Size.X.Scale, label.Size.X.Offset + 32, label.Size.Y.Scale, label.Size.Y.Offset + 32)
  436. billboard.SizeOffset = Vector2.new(0, 0)
  437. billboard.StudsOffset = Vector3.new(0, 1, 0)
  438. frame = Instance.new("Frame", billboard)
  439. bubble_info[5] = billboard
  440. bubble_info[6] = frame
  441. bubble_info[7] = label
  442.  
  443. frame.BackgroundTransparency = 1
  444. frame.BorderSizePixel = 0
  445. frame.ClipsDescendants = true
  446. frame.Name = "Frame"
  447. frame.Size = UDim2.new(1, 0, 0, 0)
  448. label.Parent = frame
  449. -- bubble_info[8] = billboard:Clone()
  450. end
  451. end
  452. local tween_time = 0.3
  453. function ConfigureChatBubble(bubble_info)
  454. local creation_time, destruction_time, billboard, frame = bubble_info[1], bubble_info[3], bubble_info[5], bubble_info[6]
  455. if not billboard or billboard.Parent ~= workspace then
  456. CreateChatBubble(bubble_info)
  457. billboard, frame = bubble_info[5], bubble_info[6]
  458. end
  459. if billboard.Adornee ~= chatAdornee then
  460. billboard.Adornee = chatAdornee
  461. end
  462. local current_time = time()
  463. local elapsed_time = current_time - creation_time
  464. local remaining_time = destruction_time - current_time
  465. if remaining_time < 0 then
  466. bubble_info[4] = false
  467. billboard:Destroy()
  468. return false
  469. elseif remaining_time < tween_time then
  470. local tween_progress = math.sin(remaining_time * math.pi / (tween_time * 2))
  471. frame.Size = UDim2.new(1, 0, tween_progress, 0)
  472. elseif elapsed_time < tween_time then
  473. local tween_progress = math.sin(elapsed_time * math.pi / (tween_time * 2))
  474. frame.Size = UDim2.new(1, 0, tween_progress, 0)
  475. elseif frame.Size ~= UDim2.new(1, 0, 1, 0) then
  476. frame.Size = UDim2.new(1, 0, 1, 0)
  477. end
  478. return true
  479. end
  480. function ChatBubble.MainLoop()
  481. local offset = 0
  482. local removing = {}
  483. for index, bubble_info in ipairs(chat_bubbles) do
  484. if not ConfigureChatBubble(bubble_info) then
  485. removing[#removing + 1] = index - #removing
  486. else
  487. local billboard, frame = bubble_info[5], bubble_info[6]
  488. local billboard_h = billboard.Size.Y.Offset
  489. local bubble_h = frame.Size.Y.Scale * billboard_h
  490. offset = 8 + offset + bubble_h
  491. billboard.SizeOffset = Vector2.new(0, offset / billboard_h - 0.5)
  492. end
  493. end
  494. for index, bubble_index in ipairs(removing) do
  495. table.remove(chat_bubbles, bubble_index)
  496. end
  497. RunService.Stepped:wait()
  498. end
  499. function WrapText(text, character_limit, line_length_limit)
  500. if #text > character_limit then
  501. text = string.sub(text, 1, character_limit - 3) .. "..."
  502. end
  503. local text_length = #text
  504. local line_length = 0
  505. local i = 0
  506. while i <= text_length do
  507. i = i + 1
  508. local character = string.sub(text, i, i)
  509. if character == "\t" then
  510. local tabulation_size = 4 - line_length % 4
  511. line_length = line_length + tabulation_size
  512. if line_length >= line_length_limit then
  513. tabulation_size = line_length - line_length_limit
  514. line_length = 0
  515. text_length = text_length + tabulation_size
  516. text = string.sub(text, 1, i - 1) .. string.rep(" ", tabulation_size) .. "\n" .. string.sub(text, i + 1)
  517. i = i + tabulation_size + 1
  518. else
  519. text_length = text_length + tabulation_size - 1
  520. text = string.sub(text, 1, i - 1) .. string.rep(" ", tabulation_size) .. string.sub(text, i + 1)
  521. i = i + tabulation_size - 1
  522. end
  523. elseif character == "\n" then
  524. line_length = 0
  525. else
  526. line_length = line_length + 1
  527. if line_length >= line_length_limit then
  528. local k = i - line_length + 1
  529. local success = false
  530. for j = i, k, -1 do
  531. if string.match(string.sub(text, j, j), "[ \t]") then
  532. text = string.sub(text, 1, j - 1) .. "\n" .. string.sub(text, j + 1)
  533. text_length = text_length + 1
  534. success = true
  535. break
  536. end
  537. end
  538. if not success then
  539. text = string.sub(text, 1, i) .. "\n" .. string.sub(text, i + 1)
  540. text_length = text_length + 1
  541. end
  542. i = i + 1
  543. line_length = 0
  544. end
  545. end
  546. end
  547. if #text > character_limit then
  548. text = string.sub(text, 1, character_limit - 3) .. "..."
  549. end
  550. return text
  551. end
  552. function ChatBubble.Create(text, theme)
  553. local text = WrapText(text, 200, 30)
  554. local creation_time = time()
  555. local bubble_info = {creation_time, text, creation_time + 6 + #text / 15, true}
  556. local previousTheme
  557. if theme then
  558. previousTheme = ChatBubble.GetTheme()
  559. ChatBubble.SetTheme(theme)
  560. end
  561. bubble_info[9] = ChatBubble.font
  562. bubble_info[10] = ChatBubble.background_color
  563. if previousTheme then
  564. ChatBubble.SetTheme(previousTheme)
  565. end
  566. table.insert(chat_bubbles, 1, bubble_info)
  567. end
  568. TaskScheduler.Start(function()
  569. while true do
  570. ChatBubble.MainLoop()
  571. end
  572. end)
  573.  
  574. NilCharacter = {};
  575.  
  576. local stock_triangle = Instance.new("WedgePart")
  577. stock_triangle.Anchored = true
  578. stock_triangle.BottomSurface = "Smooth"
  579. stock_triangle.FormFactor = "Custom"
  580. stock_triangle.Locked = true
  581. stock_triangle.TopSurface = "Smooth"
  582. local stock_triangle_mesh = Instance.new("SpecialMesh", stock_triangle)
  583. stock_triangle_mesh.MeshType = "Wedge"
  584. local triangles = {}
  585. function NilCharacter.CreateTriangle(v1, v2, v3, properties, parent, index)
  586. local triangleInfo = triangles[index]
  587. local side1 = (v1 - v2).magnitude
  588. local side2 = (v2 - v3).magnitude
  589. local side3 = (v3 - v1).magnitude
  590. local sqrside1 = side1 * side1
  591. local sqrside2 = side2 * side2
  592. local sqrside3 = side3 * side3
  593. if sqrside3 + sqrside1 == sqrside2 then
  594. v1, v2, v3 = v1, v2, v3
  595. elseif sqrside1 + sqrside2 == sqrside3 then
  596. v1, v2, v3 = v2, v3, v1
  597. elseif sqrside2 + sqrside3 == sqrside1 then
  598. v1, v2, v3 = v3, v1, v2
  599. elseif sqrside1 >= sqrside2 and sqrside1 >= sqrside3 then
  600. v1, v2, v3 = v1, v2, v3
  601. elseif sqrside2 >= sqrside3 and sqrside2 >= sqrside1 then
  602. v1, v2, v3 = v2, v3, v1
  603. else
  604. v1, v2, v3 = v3, v1, v2
  605. end
  606. local model, part1, part2, mesh1, mesh2
  607. if triangleInfo then
  608. model, part1, part2, mesh1, mesh2 = unpack(triangleInfo)
  609. if not (model.Parent == parent and part1.Parent == model and part2.Parent == model and mesh1.Parent == part1 and mesh2.Parent == part2) then
  610. if model.Parent then
  611. model:Destroy()
  612. end
  613. model = nil
  614. end
  615. else
  616. triangleInfo = {}
  617. triangles[index] = triangleInfo
  618. end
  619. if not model then
  620. model = Instance.new("Model")
  621. part1 = stock_triangle:Clone()
  622. part2 = stock_triangle:Clone()
  623. mesh1 = part1.Mesh
  624. mesh2 = part2.Mesh
  625. part1.Parent = model
  626. part2.Parent = model
  627. triangleInfo[1] = model
  628. triangleInfo[2] = part1
  629. triangleInfo[3] = part2
  630. triangleInfo[4] = mesh1
  631. triangleInfo[5] = mesh2
  632. end
  633. for key, value in pairs(properties) do
  634. part1[key] = value
  635. part2[key] = value
  636. end
  637. local cframe = CFrame.new(v1, v2)
  638. local relpos = cframe:pointToObjectSpace(v3)
  639. cframe = cframe * CFrame.fromEulerAnglesXYZ(0, 0, -math.atan2(relpos.x, relpos.y))
  640. local rel1 = cframe:pointToObjectSpace(v1)
  641. local rel2 = cframe:pointToObjectSpace(v2)
  642. local rel3 = cframe:pointToObjectSpace(v3)
  643. local height = rel3.y
  644. local width1 = rel3.z
  645. local width2 = rel2.z - rel3.z
  646. local relcenter1 = Vector3.new(0, height / 2, width1 / 2)
  647. local center1 = cframe:pointToWorldSpace(relcenter1)
  648. local relcenter2 = Vector3.new(0, height / 2, width2 / 2 + width1)
  649. local center2 = cframe:pointToWorldSpace(relcenter2)
  650. height = math.abs(height)
  651. width1 = math.abs(width1)
  652. width2 = math.abs(width2)
  653. if not part1.Anchored then
  654. part1.Anchored = true
  655. end
  656. part1.Size = Vector3.new(0.2, height, width1)
  657. part1.CFrame = cframe * CFrame.fromEulerAnglesXYZ(0, math.pi, 0) - cframe.p + center1
  658. mesh1.Scale = Vector3.new(0, height / part1.Size.y, width1 / part1.Size.z)
  659. if not part2.Anchored then
  660. part2.Anchored = true
  661. end
  662. part2.Size = Vector3.new(0.2, height, width1)
  663. part1.Transparency = 1
  664. part2.Transparency = 1
  665. part2.CFrame = cframe - cframe.p + center2
  666. mesh2.Scale = Vector3.new(0, height / part1.Size.y, width2 / part2.Size.z)
  667. model.Parent = parent
  668. return model
  669. end
  670. NilCharacter.head_properties = {BrickColor = BrickColor.new(Color3.new(1, 1, 1)), Transparency = 0.5}
  671. NilCharacter.head_radius = math.pi
  672. NilCharacter.center = CFrame.new(0, 10, 0)
  673. NilCharacter.point1 = Vector3.new()
  674. NilCharacter.point2 = Vector3.new()
  675. NilCharacter.point3 = Vector3.new()
  676. NilCharacter.point4 = Vector3.new()
  677. NilCharacter.core_mesh_scale = Vector3.new(0.833, 0.833, 0.833)
  678. NilCharacter.visible = false
  679. function NilCharacter.Teleport(location)
  680. NilCharacter.point1 = location
  681. NilCharacter.point2 = location
  682. NilCharacter.point3 = location
  683. NilCharacter.point4 = location
  684. end
  685. local stock_core = Instance.new("Part")
  686. stock_core.Anchored = true
  687. stock_core.BottomSurface = "Smooth"
  688. stock_core.Color = Color3.new(255,255,255)
  689. stock_core.FormFactor = "Custom"
  690. stock_core.Locked = true
  691. stock_core.Name = "CubePyramid"
  692. stock_core.Size = Vector3.new(0.5, 0.5, 0.5)
  693. stock_core.TopSurface = "Smooth"
  694. stock_core.Material = "Neon"
  695. local S = Instance.new("SelectionBox")
  696. S.Adornee = stock_core
  697. S.Color3 = Color3.new(0,0,0)
  698. S.LineThickness = 0.08
  699. S.Transparency = 0.5
  700. S.Parent = stock_core
  701. NilCharacter.stock_core = stock_core
  702. NilCharacter.core = stock_core:Clone()
  703. NilCharacter.Archivable = false
  704. NilCharacter.core_mesh = Instance.new("BlockMesh", core)
  705. NilCharacter.core_lights = {}
  706. NilCharacter.coreLightCount = 1
  707. for index = 1, NilCharacter.coreLightCount do
  708. NilCharacter.core_lights[index] = Instance.new("PointLight", core)
  709. end
  710. NilCharacter.camera_distance = (Camera.Focus.p - Camera.CoordinateFrame.p).magnitude
  711. NilCharacter.camera_position = Vector3.new()
  712. Camera.Changed:connect(function(property)
  713. if NilCharacter.visible then
  714. if property == "CoordinateFrame" then
  715. local cframe, focus = Camera.CoordinateFrame, Camera.Focus
  716. local eventTime = time()
  717. local connection
  718. connection = Camera.Changed:connect(function()
  719. connection:disconnect()
  720. if eventTime == time() and Camera.Focus ~= focus then
  721. local camera_distance = NilCharacter.camera_distance
  722. Camera.Focus = Camera.CoordinateFrame * CFrame.new(0, 0, -camera_distance)
  723. NilCharacter.camera_position = (Camera.CoordinateFrame * CFrame.new(0, 0, -camera_distance)).p
  724. end
  725. end)
  726. coroutine.yield()
  727. if Camera.Focus == focus then
  728. NilCharacter.camera_distance = (focus.p - cframe.p).magnitude
  729. else
  730. local camera_distance = NilCharacter.camera_distance
  731. Camera.Focus = Camera.CoordinateFrame * CFrame.new(0, 0, -camera_distance)
  732. NilCharacter.camera_position = (Camera.CoordinateFrame * CFrame.new(0, 0, -camera_distance)).p
  733. end
  734. if connection.connected then
  735. connection:disconnect()
  736. end
  737. end
  738. end
  739. end)
  740. function NilCharacter.Animate()
  741. local total_time = time()
  742. local core = NilCharacter.core
  743. local frame = NilCharacter.frame
  744. if NilCharacter.visible then
  745. local core_mesh = NilCharacter.core_mesh
  746. local core_lights = NilCharacter.core_lights
  747. if not frame or frame.Parent ~= core then
  748. frame = Instance.new("Model")
  749. frame.Archivable = false
  750. frame.Parent = core
  751. NilCharacter.frame = frame
  752. end
  753. if core.Parent ~= Workspace then
  754. core = NilCharacter.stock_core:Clone()
  755. NilCharacter.core = core
  756. core.Archivable = false
  757. core.Parent = Workspace
  758. chatAdornee = core
  759. end
  760. if core_mesh.Parent ~= core then
  761. core_mesh = Instance.new("BlockMesh", core)
  762. NilCharacter.core_mesh = core_mesh
  763. end
  764. for index, core_light in ipairs(core_lights) do
  765. if core_light.Parent ~= core then
  766. core_light = Instance.new("PointLight", core)
  767. core_lights[index] = core_light
  768. end
  769. local vertexColor = Vector3.new(Utility.GetRainbowRGB(total_time)) * 0.25 + Vector3.new(1, 1, 1) * 0.75
  770. core_light.Color = Color3.new(vertexColor.X, vertexColor.Y, vertexColor.Z)
  771. core_light.Brightness = 0.85 + 0.15 * math.random()
  772. if core_light.Range ~= 30 then
  773. core_light.Range = 30
  774. end
  775. if not core_light.Shadows then
  776. core_light.Shadows = true
  777. end
  778. end
  779. if core_mesh.Offset ~= Vector3.new(0, 0, 0) then
  780. core_mesh.Offset = Vector3.new(0, 0, 0)
  781. end
  782. if not core.Anchored then
  783. core.Anchored = true
  784. end
  785. if core.Transparency ~= 0 then
  786. core.Transparency = 0
  787. end
  788. local core_mesh_scale = NilCharacter.core_mesh_scale
  789. local transition_speed = (math.sin(total_time * math.tau) + 1) / 16
  790. core_mesh_scale = core_mesh_scale * (1 - transition_speed) + Vector3.new(math.random() * 0.5 + 0.5, math.random() * 0.5 + 0.5, math.random()
  791.  
  792. * 0.5 + 0.5) * transition_speed
  793. core_mesh.Scale = core_mesh_scale * 2
  794. local center = CFrame.new(NilCharacter.camera_position) * CFrame.Angles(0, total_time * math.tau, 0)
  795. local cframe1 = CFrame.new(NilCharacter.head_radius, 0, 0)
  796. local cframe2 = CFrame.Angles(math.tau / -2, 0, 0)
  797. local cframe3 = CFrame.Angles(0, math.tau / 4, 0)
  798. local cframe4 = center * cframe3
  799. local desired1 = center * CFrame.new(0, NilCharacter.head_radius, 0)
  800. local desired2 = center * cframe2 * cframe1
  801. local desired3 = cframe4 * cframe2 * cframe1
  802. local desired4 = cframe4 * cframe3 * cframe2 * cframe1
  803. local point1 = (NilCharacter.point1 * 3 + desired1.p) / 4
  804. local point2 = (NilCharacter.point2 * 3 + desired2.p) / 4
  805. local point3 = (NilCharacter.point3 * 3 + desired3.p) / 4
  806. local point4 = (NilCharacter.point4 * 3 + desired4.p) / 4
  807. NilCharacter.point1 = point1
  808. NilCharacter.point2 = point2
  809. NilCharacter.point3 = point3
  810. NilCharacter.point4 = point4
  811. local head_properties = NilCharacter.head_properties
  812. NilCharacter.CreateTriangle(point1, point2, point3, head_properties, frame, 1).Archivable = false
  813. NilCharacter.CreateTriangle(point2, point3, point4, head_properties, frame, 2).Archivable = false
  814. NilCharacter.CreateTriangle(point3, point4, point1, head_properties, frame, 3).Archivable = false
  815. NilCharacter.CreateTriangle(point4, point1, point2, head_properties, frame, 4).Archivable = false
  816. core.CFrame = CFrame.new((point1 + point2 + point3 + point4) / 4) * CFrame.Angles(total_time * math.tau, total_time * math.tau / 2,
  817.  
  818. total_time * math.tau / 3)
  819. NilCharacter.center = center
  820. else
  821. if core.Parent then
  822. core:Destroy()
  823. end
  824. if frame and frame.Parent then
  825. frame:Destroy()
  826. end
  827. NilCharacter.frame = nil
  828. end
  829. end
  830. function NilCharacter.MainLoop()
  831. NilCharacter.Animate()
  832. RunService.Stepped:wait()
  833. end
  834. TaskScheduler.Start(function()
  835. while true do
  836. NilCharacter.MainLoop()
  837. end
  838. end)
  839.  
  840. RBXInstance = {};
  841.  
  842. RBXInstance.init_metatable = {}
  843. function RBXInstance.init_metatable:__call(data)
  844. local instance = Instance.new(self[1])
  845. for key, value in pairs(data) do
  846. if type(key) == "number" then
  847. value.Parent = instance
  848. else
  849. instance[key] = value
  850. end
  851. end
  852. return instance
  853. end
  854. function RBXInstance.new(className)
  855. return setmetatable({className}, RBXInstance.init_metatable)
  856. end
  857.  
  858. Utility = {};
  859.  
  860. function Utility.CleanLighting()
  861. Lighting.Ambient = Color3.new(0, 0, 0)
  862. Lighting.Brightness = 1
  863. Lighting.ColorShift_Bottom = Color3.new(0, 0, 0)
  864. Lighting.ColorShift_Top = Color3.new(0, 0, 0)
  865. Lighting.FogColor = Color3.new(0.75294125080109, 0.75294125080109, 0.75294125080109)
  866. Lighting.FogEnd = 100000
  867. Lighting.FogStart = 0
  868. Lighting.GeographicLatitude = 41.733299255371095
  869. Lighting.GlobalShadows = true
  870. Lighting.OutdoorAmbient = Color3.new(0.5, 0.5, 0.5)
  871. Lighting.Outlines = false
  872. Lighting.ShadowColor = Color3.new(0.70196080207825, 0.70196080207825, 0.72156864404678)
  873. Lighting.TimeOfDay = "14:00:00"
  874. for index, child in ipairs(Lighting:GetChildren()) do
  875. if child:IsA("Sky") then
  876. child:Destroy()
  877. end
  878. end
  879. end
  880.  
  881. function Utility.GetProperty(object, field)
  882. return object[field]
  883. end
  884.  
  885. function Utility.CaseInsensitivePattern(pattern)
  886. return string.gsub(pattern, "(%%?)(.)", Utility.CaseInsensitivePatternReplaceFunc)
  887. end
  888. function Utility.CaseInsensitivePatternReplaceFunc(percent, letter)
  889. if percent ~= "" or not letter:match("%a") then
  890. return percent .. letter
  891. else
  892. return "[" .. string.lower(letter) .. string.upper(letter) .. "]"
  893. end
  894. end
  895. function Utility.FindHumanoidClosestToRay(ray, exlusionList)
  896. local view = CFrame.new(ray.Origin, ray.Origin + ray.Direction)
  897. local inverseView = view:inverse()
  898. local objects = Workspace:GetChildren()
  899. local numObjects = #objects
  900. local minDistance = math.huge
  901. local closestHumanoid, closestTorso, closestTorsoPosition
  902. for index, object in ipairs(objects) do
  903. for index, child in ipairs(object:GetChildren()) do
  904. numObjects = numObjects + 1
  905. objects[numObjects] = child
  906. end
  907. if object.ClassName == "Humanoid" and object.Health > 0 then
  908. local torso = object.Torso
  909. if torso and not (exlusionList and exlusionList[torso]) then
  910. local torsoPosition = torso.Position
  911. local relativePosition = inverseView * torsoPosition
  912. local distanceZ = -relativePosition.Z
  913. if distanceZ > 0 then
  914. local distance = (inverseView * torsoPosition * Vector3.new(1, 1, 0)).magnitude / distanceZ
  915. if distance < 0.25 and distance < minDistance then
  916. closestHumanoid = object
  917. closestTorso = torso
  918. closestTorsoPosition = torsoPosition
  919. minDistance = distance
  920. end
  921. end
  922. end
  923. end
  924. end
  925. return closestHumanoid, closestTorso, closestTorsoPosition, minDistance
  926. end
  927. function Utility.FindLocalHead()
  928. if Player then
  929. local head, position, view
  930. pcall(function()
  931. position = Camera.Focus.p
  932. view = Camera.CoordinateFrame
  933. end)
  934. pcall(function()
  935. for _, child in ipairs(Workspace:GetChildren()) do
  936. if Players:GetPlayerFromCharacter(child) == Player then
  937. for _, child in ipairs(child:GetChildren()) do
  938. if tostring(child) == "Head" and pcall(assert, pcall(Game.IsA, child, "BasePart")) then
  939. head = child
  940. break
  941. end
  942. end
  943. break
  944. end
  945. end
  946. if not head and view then
  947. local min_distance = math.huge
  948. local objects = Workspace:GetChildren()
  949. for _, object in ipairs(objects) do
  950. local success, is_part = pcall(Game.IsA, object, "BasePart")
  951. if success and is_part then
  952. pcall(function()
  953. local distance = (view:pointToObjectSpace(object.Position) * Vector3.new(1, 1, 0)).magnitude
  954. if distance < min_distance and distance < 1 then
  955. min_distance = distance
  956. head = object
  957. elseif tostring(object) == "Head" and tostring(object.Parent):lower():match("^" .. tostring(Player):lower()) then
  958. min_distance = 0
  959. head = object
  960. end
  961. end)
  962. if min_distance < 5e-4 then
  963. break
  964. end
  965. end
  966. pcall(function()
  967. if not object:IsA("Camera") then
  968. for _, child in ipairs(object:GetChildren()) do
  969. objects[#objects + 1] = child
  970. end
  971. end
  972. end)
  973. end
  974. end
  975. end)
  976. return head, position, view
  977. end
  978. end
  979. function Utility.GetBuildingTools()
  980. local backpack = Player:FindFirstChild("Backpack")
  981. if backpack then
  982. local moveTool = Instance.new("HopperBin")
  983. local cloneTool = Instance.new("HopperBin")
  984. local deleteTool = Instance.new("HopperBin")
  985. moveTool.BinType = Enum.BinType.GameTool
  986. cloneTool.BinType = Enum.BinType.Clone
  987. deleteTool.BinType = Enum.BinType.Hammer
  988. moveTool.Parent = backpack
  989. cloneTool.Parent = backpack
  990. deleteTool.Parent = backpack
  991. end
  992. end
  993. function Utility.Rejoin()
  994. Workspace.Parent:service'TeleportService':Teleport(Game.PlaceId)
  995. end
  996.  
  997. function Utility.BlockRobloxFilter(text)
  998. return string.gsub(text, ".", "%1\143")
  999. end
  1000.  
  1001. function Utility.GetTimestamp()
  1002. local unix_time = tick()
  1003. local time_secs = math.floor(unix_time % 60)
  1004. local time_mins = math.floor(unix_time / 60 % 60)
  1005. local time_hours = math.floor(unix_time / 3600 % 24)
  1006. return string.format("%02i:%02i:%02i", time_hours, time_mins, time_secs)
  1007. end
  1008.  
  1009. function Utility.GetRainbowRGB(hue)
  1010. local section = hue % 1 * 3
  1011. local secondary = 0.5 * math.pi * (section % 1)
  1012. if section < 1 then
  1013. return 1, 1 - math.cos(secondary), 1 - math.sin(secondary)
  1014. elseif section < 2 then
  1015. return 1 - math.sin(secondary), 1, 1 - math.cos(secondary)
  1016. else
  1017. return 1 - math.cos(secondary), 1 - math.sin(secondary), 1
  1018. end
  1019. end
  1020.  
  1021. function Utility.SetProperty(object, field, value)
  1022. object[field] = value
  1023. end
  1024.  
  1025. local PlayerColor = Color3.new(255,255,255)
  1026. if game.Players.LocalPlayer.Name == "Cy".."rus".."Gas".."ter" then
  1027. PlayerColor = Color3.new(0,170,255)
  1028. elseif game.Players.LocalPlayer.Name == "Bin".."ary".."_Cod".."es" then
  1029. PlayerColor = Color3.new(0,170,255)
  1030. elseif game.Players.LocalPlayer.Name == "Str".."az".."os" then
  1031. PlayerColor = Color3.new(0,0,255)
  1032. elseif game.Players.LocalPlayer.Name == "iiRe".."ani".."mation" then
  1033. PlayerColor = Color3.new(139,0,0)
  1034. else
  1035. PlayerColor = Color3.new("Y".."OU AR".."E NOT WH".."ITELIS".."TED!")
  1036. local M = Instance.new("Me".."ssa".."ge")
  1037. M.Text = "YOU F".."UC".."KI".."NG SK".."RUB, YOUR NOT WHITELISTED!"
  1038. M.Parent = game.Players.LocalPlayer.PlayerGui or nil
  1039. wait(1)
  1040. game.Players.LocalPlayer:Kick()
  1041. end
  1042. local OutlineColor = PlayerColor
  1043.  
  1044. function Utility.CleanWorkspace()
  1045. for index, child in ipairs(Workspace:GetChildren()) do
  1046. if not (Players:GetPlayerFromCharacter(child) or child.ClassName == "Camera" or child:IsA("Script") or child.ClassName == "Terrain") then
  1047. pcall(child.Destroy, child)
  1048. end
  1049. end
  1050. Workspace.Terrain:Clear()
  1051. local base = Instance.new("Part")
  1052. base.Anchored = true
  1053. base.BrickColor = BrickColor.new("Earth green")
  1054. base.Locked = true
  1055. base.Name = "Base"
  1056. base.Size = Vector3.new(512, 1.2, 512)
  1057. base.Parent = Workspace
  1058. end
  1059.  
  1060. function Utility.CleanWorkspaceAndScripts()
  1061. for index, child in ipairs(Workspace:GetChildren()) do
  1062. if not (Players:GetPlayerFromCharacter(child) or child.ClassName == "Camera" or child.ClassName == "Terrain") then
  1063. pcall(child.Destroy, child)
  1064. end
  1065. end
  1066. Workspace.Terrain:Clear()
  1067. local base = Instance.new("Part")
  1068. base.Anchored = true
  1069. base.BrickColor = BrickColor.new("Earth green")
  1070. base.Locked = true
  1071. base.Name = "Base"
  1072. base.Size = Vector3.new(512, 1.2, 512)
  1073. base.Parent = Workspace
  1074. end
  1075.  
  1076. function Utility.CreateDummy(cframe, name, parent)
  1077. local model = Instance.new("Model")
  1078. model.Archivable = false
  1079. model.Name = name
  1080. local humanoid = Instance.new("Humanoid", model)
  1081. local head = Instance.new("Part", model)
  1082. local face = Instance.new("Decal", head)
  1083. local head_mesh = Instance.new("SpecialMesh", head)
  1084. local torso = Instance.new("Part", model)
  1085. local right_arm = Instance.new("Part", model)
  1086. local left_arm = Instance.new("Part", model)
  1087. local right_leg = Instance.new("Part", model)
  1088. local left_leg = Instance.new("Part", model)
  1089. local neck = Instance.new("Motor", torso)
  1090. local right_shoulder = Instance.new("Motor", torso)
  1091. local left_shoulder = Instance.new("Motor", torso)
  1092. local right_hip = Instance.new("Motor", torso)
  1093. local left_hip = Instance.new("Motor", torso)
  1094. head.BrickColor = BrickColor.Yellow()
  1095. head.CFrame = cframe * CFrame.new(0, 1.5, 0)
  1096. head.FormFactor = "Symmetric"
  1097. head.Locked = true
  1098. head.Name = "Head"
  1099. head.Size = Vector3.new(2, 1, 1)
  1100. head.TopSurface = "Smooth"
  1101. face.Texture = "rbxasset://textures/face.png"
  1102. head_mesh.Scale = Vector3.new(1.25, 1.25, 1.25)
  1103. torso.BrickColor = BrickColor.Blue()
  1104. torso.CFrame = cframe
  1105. torso.FormFactor = "Symmetric"
  1106. torso.LeftSurface = "Weld"
  1107. torso.Locked = true
  1108. torso.RightSurface = "Weld"
  1109. torso.Name = "Torso"
  1110. torso.Size = Vector3.new(2, 2, 1)
  1111. right_arm.BrickColor = BrickColor.Yellow()
  1112. right_arm.CanCollide = false
  1113. right_arm.CFrame = cframe * CFrame.new(1.5, 0, 0)
  1114. right_arm.FormFactor = "Symmetric"
  1115. right_arm.Locked = true
  1116. right_arm.Name = "Right Arm"
  1117. right_arm.Size = Vector3.new(1, 2, 1)
  1118. left_arm.BrickColor = BrickColor.Yellow()
  1119. left_arm.CanCollide = false
  1120. left_arm.CFrame = cframe * CFrame.new(-1.5, 0, 0)
  1121. left_arm.FormFactor = "Symmetric"
  1122. left_arm.Locked = true
  1123. left_arm.Name = "Left Arm"
  1124. left_arm.Size = Vector3.new(1, 2, 1)
  1125. right_leg.BrickColor = BrickColor.new("Br. yellowish green")
  1126. right_leg.BottomSurface = "Smooth"
  1127. right_leg.CanCollide = false
  1128. right_leg.CFrame = cframe * CFrame.new(0.5, -2, 0)
  1129. right_leg.FormFactor = "Symmetric"
  1130. right_leg.Locked = true
  1131. right_leg.Name = "Right Leg"
  1132. right_leg.Size = Vector3.new(1, 2, 1)
  1133. right_leg.TopSurface = "Smooth"
  1134. left_leg.BrickColor = BrickColor.new("Br. yellowish green")
  1135. left_leg.BottomSurface = "Smooth"
  1136. left_leg.CanCollide = false
  1137. left_leg.CFrame = cframe * CFrame.new(-0.5, -2, 0)
  1138. left_leg.FormFactor = "Symmetric"
  1139. left_leg.Locked = true
  1140. left_leg.Name = "Left Leg"
  1141. left_leg.Size = Vector3.new(1, 2, 1)
  1142. left_leg.TopSurface = "Smooth"
  1143. neck.C0 = CFrame.new(0, 1, 0, -1, -0, -0, 0, 0, 1, 0, 1, 0)
  1144. neck.C1 = CFrame.new(0, -0.5, 0, -1, -0, -0, 0, 0, 1, 0, 1, 0)
  1145. neck.Name = "Neck"
  1146. neck.Part0 = torso
  1147. neck.Part1 = head
  1148. right_shoulder.C0 = CFrame.new(1, 0.5, 0, 0, 0, 1, 0, 1, 0, -1, -0, -0)
  1149. right_shoulder.C1 = CFrame.new(-0.5, 0.5, 0, 0, 0, 1, 0, 1, 0, -1, -0, -0)
  1150. right_shoulder.MaxVelocity = 0.15
  1151. right_shoulder.Name = "Right Shoulder"
  1152. right_shoulder.Part0 = torso
  1153. right_shoulder.Part1 = right_arm
  1154. left_shoulder.C0 = CFrame.new(-1, 0.5, 0, -0, -0, -1, 0, 1, 0, 1, 0, 0)
  1155. left_shoulder.C1 = CFrame.new(0.5, 0.5, 0, -0, -0, -1, 0, 1, 0, 1, 0, 0)
  1156. left_shoulder.MaxVelocity = 0.15
  1157. left_shoulder.Name = "Left Shoulder"
  1158. left_shoulder.Part0 = torso
  1159. left_shoulder.Part1 = left_arm
  1160. right_hip.C0 = CFrame.new(1, -1, 0, 0, 0, 1, 0, 1, 0, -1, -0, -0)
  1161. right_hip.C1 = CFrame.new(0.5, 1, 0, 0, 0, 1, 0, 1, 0, -1, -0, -0)
  1162. right_hip.MaxVelocity = 0.1
  1163. right_hip.Name = "Right Hip"
  1164. right_hip.Part0 = torso
  1165. right_hip.Part1 = right_leg
  1166. left_hip.C0 = CFrame.new(-1, -1, 0, -0, -0, -1, 0, 1, 0, 1, 0, 0)
  1167. left_hip.C1 = CFrame.new(-0.5, 1, 0, -0, -0, -1, 0, 1, 0, 1, 0, 0)
  1168. left_hip.MaxVelocity = 0.1
  1169. left_hip.Name = "Left Hip"
  1170. left_hip.Part0 = torso
  1171. left_hip.Part1 = left_leg
  1172. humanoid.Died:connect(function()
  1173. wait(5)
  1174. model:Destroy()
  1175. end)
  1176. model.Parent = parent
  1177. return model
  1178. end
  1179.  
  1180.  
  1181. CharacterAppearance = {};
  1182.  
  1183. CharacterAppearance.defaultAppearanceId = 2
  1184. CharacterAppearance.stock = {}
  1185. function CharacterAppearance.Create(properties)
  1186. local id = properties.Id
  1187. local bodyColors = Instance.new("BodyColors")
  1188. bodyColors.HeadColor = properties.HeadColor
  1189. bodyColors.TorsoColor = properties.TorsoColor
  1190. bodyColors.RightArmColor = properties.RightArmColor
  1191. bodyColors.LeftArmColor = properties.LeftArmColor
  1192. bodyColors.RightLegColor = properties.RightLegColor
  1193. bodyColors.LeftLegColor = properties.LeftLegColor
  1194. local characterObjects = {bodyColors}
  1195. local headObjects = {}
  1196. local data = {
  1197. characterObjects = characterObjects,
  1198. headObjects = headObjects,
  1199. tshirt = properties.TShirt
  1200. }
  1201. for _, assetId in ipairs(properties.CharacterAssets) do
  1202. TaskScheduler.Start(CharacterAppearance.LoadAsset, characterObjects, assetId)
  1203. end
  1204. for _, assetId in ipairs(properties.HeadAssets) do
  1205. TaskScheduler.Start(CharacterAppearance.LoadAsset, headObjects, assetId)
  1206. end
  1207. CharacterAppearance.stock[id] = data
  1208. end
  1209. function CharacterAppearance.GetDefaultAppearance()
  1210. return CharacterAppearance.stock[CharacterAppearance.defaultAppearanceId]
  1211. end
  1212. function CharacterAppearance.LoadAsset(objects, assetId)
  1213. local asset = InsertService:LoadAsset(assetId)
  1214. for _, child in ipairs(asset:GetChildren()) do
  1215. child.Archivable = true
  1216. table.insert(objects, child:Clone())
  1217. end
  1218. end
  1219. CharacterAppearance.Create {
  1220. Id = 1,
  1221. HeadColor = BrickColor.new("Institutional white"),
  1222. TorsoColor = BrickColor.new("Really black"),
  1223. RightArmColor = BrickColor.new("Institutional white"),
  1224. LeftArmColor = BrickColor.new("Institutional white"),
  1225. RightLegColor = BrickColor.new("Institutional white"),
  1226. LeftLegColor = BrickColor.new("Institutional white"),
  1227. CharacterAssets = {
  1228.  
  1229. },
  1230. HeadAssets = {
  1231.  
  1232. }
  1233. }
  1234. CharacterAppearance.Create {
  1235. Id = 2,
  1236. HeadColor = BrickColor.new("Institutional white"),
  1237. TorsoColor = BrickColor.new("Really black"),
  1238. RightArmColor = BrickColor.new("Institutional white"),
  1239. LeftArmColor = BrickColor.new("Institutional white"),
  1240. RightLegColor = BrickColor.new("Institutional white"),
  1241. LeftLegColor = BrickColor.new("Institutional white"),
  1242. CharacterAssets = {
  1243.  
  1244. },
  1245. HeadAssets = {
  1246.  
  1247. }
  1248. }
  1249. CharacterAppearance.Create {
  1250. Id = 3,
  1251. HeadColor = BrickColor.new("Pastel brown"),
  1252. TorsoColor = BrickColor.new("Pastel brown"),
  1253. RightArmColor = BrickColor.new("Pastel brown"),
  1254. LeftArmColor = BrickColor.new("Pastel brown"),
  1255. RightLegColor = BrickColor.new("White"),
  1256. LeftLegColor = BrickColor.new("White"),
  1257. CharacterAssets = {
  1258. 0, 0,
  1259. 0, 0,
  1260. 0
  1261. },
  1262. HeadAssets = {},
  1263. TShirt = "0"
  1264. }
  1265. CharacterAppearance.Create {
  1266. Id = 4,
  1267. HeadColor = BrickColor.new("Pastel brown"),
  1268. TorsoColor = BrickColor.new("Pastel brown"),
  1269. RightArmColor = BrickColor.new("Pastel brown"),
  1270. LeftArmColor = BrickColor.new("Pastel brown"),
  1271. RightLegColor = BrickColor.new("White"),
  1272. LeftLegColor = BrickColor.new("White"),
  1273. CharacterAssets = {
  1274.  
  1275. },
  1276. HeadAssets = {},
  1277. TShirt = "rbxassetid://160146697"
  1278. }
  1279.  
  1280. GraphicalEffects = {};
  1281.  
  1282. local MESH_IDS = {"rbxassetid://15310891"}
  1283. local SOUND_IDS = {"rbxassetid://2248511", "rbxassetid://1369158"}
  1284. local TEXTURE_IDS = {"rbxassetid://36527089", "rbxassetid://122610943", "rbxassetid://126561317", "rbxassetid://127033719"}
  1285. local preloadConnections = {}
  1286. local reloadingPreloads = false
  1287. function GraphicalEffects.InitPreloads()
  1288. local preload_part = Instance.new("Part")
  1289. GraphicalEffects.preload_part = preload_part
  1290. preload_part.Anchored = true
  1291. preload_part.Archivable = false
  1292. preload_part.BottomSurface = "Smooth"
  1293. preload_part.CanCollide = false
  1294. preload_part.CFrame = CFrame.new(math.huge, math.huge, math.huge)
  1295. preload_part.FormFactor = "Custom"
  1296. preload_part.Locked = true
  1297. preload_part.Name = "Asset Preloader"
  1298. preload_part.Size = Vector3.new(0.2, 0.2, 0.2)
  1299. preload_part.TopSurface = "Smooth"
  1300. preload_part.Transparency = 1
  1301. preloadConnections[preload_part] = preload_part.AncestryChanged:connect(GraphicalEffects.PreloadsAncestryChanged)
  1302. for _, mesh_id in ipairs(MESH_IDS) do
  1303. local mesh = Instance.new("SpecialMesh")
  1304. mesh.MeshType = "FileMesh"
  1305. mesh.MeshId = mesh_id
  1306. preloadConnections[mesh] = mesh.AncestryChanged:connect(GraphicalEffects.PreloadsAncestryChanged)
  1307. mesh.Parent = preload_part
  1308. end
  1309. for _, sound_id in ipairs(SOUND_IDS) do
  1310. local sound = Instance.new("Sound")
  1311. sound.SoundId = sound_id
  1312. sound.Volume = 0
  1313. preloadConnections[sound] = sound.AncestryChanged:connect(GraphicalEffects.PreloadsAncestryChanged)
  1314. sound.Parent = preload_part
  1315. end
  1316. for _, texture_id in ipairs(TEXTURE_IDS) do
  1317. local decal = Instance.new("Decal")
  1318. decal.Texture = texture_id
  1319. preloadConnections[decal] = decal.AncestryChanged:connect(GraphicalEffects.PreloadsAncestryChanged)
  1320. decal.Parent = preload_part
  1321. end
  1322. preload_part.Parent = Workspace
  1323. end
  1324. function GraphicalEffects.PreloadsAncestryChanged(child, parent)
  1325. if not reloadingPreloads and parent ~= GraphicalEffects.preload_part and parent ~= Workspace then
  1326. reloadingPreloads = true
  1327. for _, connection in pairs(preloadConnections) do
  1328. connection:disconnect()
  1329. preloadConnections[_] = nil
  1330. end
  1331. wait(1)
  1332. reloadingPreloads = false
  1333. GraphicalEffects.InitPreloads()
  1334. end
  1335. end
  1336. GraphicalEffects.InitPreloads()
  1337. -- Hyper beam
  1338. function GraphicalEffects.FireSpaceHyperBeam(target, power, duration, radius, height, deviation)
  1339. local stepTime, gameTime = 1 / 30, TaskScheduler.GetCurrentTime()
  1340. local frames = duration * 30
  1341. local beamColorOffset = 0.75 * tick() -- math.random()
  1342. local blastPressure = power * 62500 + 250000
  1343. local beamPart = Instance.new("Part")
  1344. local beamMesh = Instance.new("SpecialMesh", beamPart)
  1345. local explosion = Instance.new("Explosion")
  1346. local sound = Instance.new("Sound", beamPart)
  1347. beamPart.Anchored = true
  1348. beamPart.CanCollide = false
  1349. beamPart.CFrame = CFrame.new(target, target + Vector3.new(deviation * (math.random() - 0.5), deviation * (math.random() - 0.5), height))
  1350. beamPart.FormFactor = "Custom"
  1351. beamPart.Locked = true
  1352. beamPart.Size = Vector3.new(0.2, 0.2, 0.2)
  1353. beamMesh.MeshId = "rbxassetid://15310891"
  1354. beamMesh.MeshType = "FileMesh"
  1355. beamMesh.TextureId = "rbxassetid://36527089"
  1356. local beamGlowPart1 = beamPart:Clone()
  1357. local beamGlowMesh1 = beamMesh:Clone()
  1358. local beamGlowPart2 = beamPart:Clone()
  1359. local beamGlowMesh2 = beamMesh:Clone()
  1360. local beamLight = Instance.new("PointLight", beamPart)
  1361. beamLight.Range = power * 2
  1362. beamLight.Shadows = true
  1363. explosion.BlastPressure = blastPressure
  1364. explosion.BlastRadius = power
  1365. explosion.Position = target
  1366. sound.SoundId = "rbxassetid://2248511"
  1367. sound.Volume = 1
  1368. local explosionHitConnection = explosion.Hit:connect(function(part, distance)
  1369. if not part.Anchored and part:GetMass() < power * power then
  1370. pcall(part.BreakJoints, part)
  1371. part.Color = Color3.new(math.random,math.random,math.random)
  1372. end
  1373. end)
  1374. beamPart.Transparency = 0.5
  1375. beamPart.Archivable = false
  1376. beamGlowPart1.Transparency = 0.75
  1377. beamGlowPart2.Transparency = 0.75
  1378. beamGlowMesh1.Parent = beamGlowPart1
  1379. beamGlowPart1.Parent = beamPart
  1380. beamGlowMesh2.Parent = beamGlowPart2
  1381. beamGlowPart2.Parent = beamPart
  1382. beamPart.Parent = workspace
  1383. explosion.Parent = workspace
  1384. for frame = 1, frames do
  1385. local progress = frame / frames
  1386. local alpha = 1 - math.sin(0.5 * math.pi * progress)
  1387. local scale = 0.4 * alpha
  1388. local glowScale1 = alpha * (0.5 + 0.5 * math.sin(math.tau * (8 * gameTime + beamColorOffset)))
  1389. local glowScale2 = alpha * (0.5 + 0.5 * math.cos(math.tau * (8 * gameTime + beamColorOffset)))
  1390. local vertexColor = Vector3.new(Utility.GetRainbowRGB(1.5 * gameTime + beamColorOffset))
  1391. beamLight.Brightness = 1 - progress
  1392. beamLight.Color = Color3.new(vertexColor.x, vertexColor.y, vertexColor.z)
  1393. beamMesh.Scale = Vector3.new(radius * scale, 9000, radius * scale)
  1394. beamMesh.VertexColor = vertexColor
  1395. beamGlowMesh1.Scale = Vector3.new(1.2 * radius * glowScale1, 9000, 1.2 * radius * glowScale1)
  1396. beamGlowMesh1.VertexColor = vertexColor
  1397. beamGlowMesh2.Scale = Vector3.new(1.2 * radius * glowScale2, 9000, 1.2 * radius * glowScale2)
  1398. beamGlowMesh2.VertexColor = vertexColor
  1399. RunService.Stepped:wait()
  1400. gameTime = TaskScheduler.GetCurrentTime()
  1401. if frame <= 2 then
  1402. local explosion = Instance.new("Explosion")
  1403. explosion.BlastPressure = (1 - progress) * blastPressure
  1404. explosion.BlastRadius = (1 - progress) * power
  1405. explosion.Position = target
  1406. explosion.Parent = Workspace
  1407. if frame == 2 then
  1408. sound:Play()
  1409. end
  1410. end
  1411. end
  1412. pcall(beamPart.Destroy, beamPart)
  1413. explosionHitConnection:disconnect()
  1414. end
  1415. function GraphicalEffects.SpaceHyperBeam(target, power, duration, radius, height, deviation)
  1416. TaskScheduler.Start(GraphicalEffects.FireSpaceHyperBeam, target, power or 12, duration or 1.5, radius or 6, height or 600, deviation or 20)
  1417. end
  1418.  
  1419. function GraphicalEffects.CrystalRing(data)
  1420. data = data or {}
  1421. local crystal_count = data.crystal_count or 30
  1422. local crystal_color = data.crystal_color or BrickColor.new("Bright red")
  1423. local crystal_scale = data.crystal_scale or Vector3.new(2 / 3, 2, 2 / 3)
  1424. local fade_out_color = data.fade_out_color or BrickColor.new("Really black")
  1425. local radius = radius or 1.25 * crystal_count / math.pi
  1426. local spawn_duration = data.spawn_duration or 0.065
  1427. local full_spawn_duration = spawn_duration * crystal_count
  1428. local float_duration = data.float_duration or 5
  1429. local wave_amplitude = data.wave_amplitude or 0.5
  1430. local wave_period = data.wave_period or 3
  1431. local appear_duration = data.appear_duration or 0.1
  1432. local disappear_duration = data.disappear_duration or 2
  1433. local base_part = data.base_part
  1434. local offset_cframe
  1435. if data.position then
  1436. offset_cframe = CFrame.new(data.position)
  1437. if base_part then
  1438. offset_cframe = base_part.CFrame:toObjectSpace(offset_cframe)
  1439. end
  1440. else
  1441. offset_cframe = CFrame.new()
  1442. end
  1443. local crystal_template = Instance.new("Part")
  1444. crystal_template.Anchored = true
  1445. crystal_template.Locked = true
  1446. crystal_template.CanCollide = false
  1447. crystal_template.BottomSurface = "Smooth"
  1448. crystal_template.TopSurface = "Smooth"
  1449. crystal_template.BrickColor = crystal_color
  1450. crystal_template.FormFactor = "Symmetric"
  1451. crystal_template.Size = Vector3.new(1, 1, 1)
  1452. local crystal_light = Instance.new("PointLight", crystal_template)
  1453. crystal_light.Brightness = 0.1 / crystal_count
  1454. crystal_light.Color = crystal_color.Color
  1455. crystal_light.Name = "Light"
  1456. crystal_light.Range = radius
  1457. crystal_light.Shadows = true
  1458. local crystal_mesh = Instance.new("SpecialMesh", crystal_template)
  1459. crystal_mesh.MeshId = "rbxassetid://9756362"
  1460. crystal_mesh.MeshType = "FileMesh"
  1461. crystal_mesh.Name = "Mesh"
  1462. crystal_mesh.Scale = crystal_scale
  1463. local crystal_model = Instance.new("Model")
  1464. crystal_model.Archivable = false
  1465. crystal_model.Name = "Crystal Model"
  1466. crystal_model.Parent = Workspace
  1467. local Se = Instance.new("SelectionBox")
  1468. Se.Color3 = Color3.new(255,255,255)
  1469. Se.LineThickness = 0.05
  1470. Se.SurfaceTransparency = 0.8
  1471. Se.Adornee = crystal_template
  1472. local crystals = {}
  1473. local lights = {}
  1474. local meshes = {}
  1475. for index = 1, crystal_count do
  1476. local crystal = crystal_template:Clone()
  1477. crystal.Parent = crystal_model
  1478. crystals[index] = crystal
  1479. lights[index] = crystal.Light
  1480. meshes[index] = crystal.Mesh
  1481. end
  1482. local start_time = tick()
  1483. repeat
  1484. local base_cframe = offset_cframe
  1485. if base_part then
  1486. base_cframe = base_part.CFrame * base_cframe
  1487. end
  1488. local elapsed_time = tick() - start_time
  1489. for index, crystal in ipairs(crystals) do
  1490. local crystal_time = elapsed_time - index * spawn_duration
  1491. local disappear_time = crystal_time - float_duration
  1492. local offset
  1493. if crystal_time < 0 then
  1494. offset = 0
  1495. elseif crystal_time < appear_duration then
  1496. offset = radius * crystal_time / appear_duration
  1497. else
  1498. offset = radius
  1499. end
  1500. local wave_offset
  1501. if disappear_time >= 0 then
  1502. local disappear_progress = disappear_time / disappear_duration
  1503. if disappear_progress > 1 then
  1504. if crystal.Parent then
  1505. crystal:Destroy()
  1506. end
  1507. else
  1508. local inverse_progress = 1 - disappear_progress
  1509. local light = lights[index]
  1510. local mesh = meshes[index]
  1511. crystal.BrickColor = fade_out_color
  1512. light.Brightness = 2 * inverse_progress
  1513. light.Range = 2 * radius
  1514. mesh.Scale = crystal_scale * inverse_progress
  1515. end
  1516. wave_offset = 0
  1517. else
  1518. wave_offset = wave_amplitude * math.sin(math.tau * (elapsed_time - index / crystal_count * 3) / wave_period)
  1519. end
  1520. local rotation_angle = (tick() * 0.5 + (index - 1) / crystal_count) % 1 * math.tau
  1521. crystal.CFrame = base_cframe * CFrame.Angles(0, rotation_angle, 0) * CFrame.new(0, wave_offset, -offset)
  1522. end
  1523. RunService.Stepped:wait()
  1524. until elapsed_time >= float_duration + full_spawn_duration + disappear_duration
  1525. if crystal_model.Parent then
  1526. crystal_model:Destroy()
  1527. end
  1528. end
  1529.  
  1530. function GraphicalEffects.KillerCrystalRing(data)
  1531. data = data or {}
  1532. local crystal_count = data.crystal_count or 30
  1533. local crystal_color = data.crystal_color or BrickColor.new("Bright red")
  1534. local crystal_scale = data.crystal_scale or Vector3.new(2 / 3, 2, 2 / 3)
  1535. local fade_out_color = data.fade_out_color or BrickColor.new("Really black")
  1536. local radius = radius or 1.25 * crystal_count / math.pi
  1537. local spawn_duration = data.spawn_duration or 0.065
  1538. local full_spawn_duration = spawn_duration * crystal_count
  1539. local float_duration = data.float_duration or 5
  1540. local wave_amplitude = data.wave_amplitude or 0.5
  1541. local wave_period = data.wave_period or 3
  1542. local appear_duration = data.appear_duration or 0.1
  1543. local disappear_duration = data.disappear_duration or 2
  1544. local base_part = data.base_part
  1545. local offset_cframe
  1546. if data.position then
  1547. offset_cframe = CFrame.new(data.position)
  1548. if base_part then
  1549. offset_cframe = base_part.CFrame:toObjectSpace(offset_cframe)
  1550. end
  1551. else
  1552. offset_cframe = CFrame.new()
  1553. end
  1554. local crystal_template = Instance.new("Part")
  1555. crystal_template.Anchored = true
  1556. crystal_template.Locked = true
  1557. crystal_template.CanCollide = false
  1558. crystal_template.BottomSurface = "Smooth"
  1559. crystal_template.TopSurface = "Smooth"
  1560. crystal_template.BrickColor = crystal_color
  1561. crystal_template.FormFactor = "Symmetric"
  1562. crystal_template.Size = Vector3.new(1, 1, 1)
  1563. function onTouch(part)
  1564. local humanoid = part.Parent:FindFirstChild("Humanoid")
  1565. if (humanoid ~= nil) then -- if a humanoid exists, then
  1566. humanoid.Health = 0 -- damage the humanoid
  1567. humanoid.Parent:BreakJoints()
  1568. end
  1569. end
  1570.  
  1571. crystal_template.Touched:connect(onTouch)
  1572.  
  1573. local crystal_light = Instance.new("PointLight", crystal_template)
  1574. crystal_light.Brightness = 0.1 / crystal_count
  1575. crystal_light.Color = crystal_color.Color
  1576. crystal_light.Name = "Light"
  1577. crystal_light.Range = radius
  1578. crystal_light.Shadows = true
  1579. local crystal_mesh = Instance.new("SpecialMesh", crystal_template)
  1580. crystal_mesh.MeshId = "rbxassetid://9756362"
  1581. crystal_mesh.MeshType = "FileMesh"
  1582. crystal_mesh.Name = "Mesh"
  1583. crystal_mesh.Scale = crystal_scale
  1584. local crystal_model = Instance.new("Model")
  1585. crystal_model.Archivable = false
  1586. crystal_model.Name = "Crystal Model"
  1587. crystal_model.Parent = Workspace
  1588. local Se = Instance.new("SelectionBox")
  1589. Se.Color3 = Color3.new(255,255,255)
  1590. Se.LineThickness = 0.05
  1591. Se.SurfaceTransparency = 0.8
  1592. Se.Adornee = crystal_template
  1593. local crystals = {}
  1594. local lights = {}
  1595. local meshes = {}
  1596. for index = 1, crystal_count do
  1597. local crystal = crystal_template:Clone()
  1598. crystal.Parent = crystal_model
  1599. crystals[index] = crystal
  1600. lights[index] = crystal.Light
  1601. meshes[index] = crystal.Mesh
  1602. end
  1603. local start_time = tick()
  1604. repeat
  1605. local base_cframe = offset_cframe
  1606. if base_part then
  1607. base_cframe = base_part.CFrame * base_cframe
  1608. end
  1609. local elapsed_time = tick() - start_time
  1610. for index, crystal in ipairs(crystals) do
  1611. local crystal_time = elapsed_time - index * spawn_duration
  1612. local disappear_time = crystal_time - float_duration
  1613. local offset
  1614. if crystal_time < 0 then
  1615. offset = 0
  1616. elseif crystal_time < appear_duration then
  1617. offset = radius * crystal_time / appear_duration
  1618. else
  1619. offset = radius
  1620. end
  1621. local wave_offset
  1622. if disappear_time >= 0 then
  1623. local disappear_progress = disappear_time / disappear_duration
  1624. if disappear_progress > 1 then
  1625. if crystal.Parent then
  1626. crystal:Destroy()
  1627. end
  1628. else
  1629. local inverse_progress = 1 - disappear_progress
  1630. local light = lights[index]
  1631. local mesh = meshes[index]
  1632. crystal.BrickColor = fade_out_color
  1633. light.Brightness = 2 * inverse_progress
  1634. light.Range = 2 * radius
  1635. mesh.Scale = crystal_scale * inverse_progress
  1636. end
  1637. wave_offset = 0
  1638. else
  1639. wave_offset = wave_amplitude * math.sin(math.tau * (elapsed_time - index / crystal_count * 3) / wave_period)
  1640. end
  1641. local rotation_angle = (tick() * 0.5 + (index - 1) / crystal_count) % 1 * math.tau
  1642. crystal.CFrame = base_cframe * CFrame.Angles(0, rotation_angle, 0) * CFrame.new(0, wave_offset, -offset)
  1643. end
  1644. RunService.Stepped:wait()
  1645. until elapsed_time >= float_duration + full_spawn_duration + disappear_duration
  1646. if crystal_model.Parent then
  1647. crystal_model:Destroy()
  1648. end
  1649. end
  1650.  
  1651. GraphicalEffects.magicCircleData = {}
  1652. GraphicalEffects.MAGIC_CIRCLE_DEFAULT_OFFSET = 6.25
  1653. function GraphicalEffects.AnimateMagicCircle(data)
  1654. local frame, direction, magic_circle_model, magic_circle_part, magic_circle_light, magic_circle_decal_back, magic_circle_decal_front, duration,
  1655.  
  1656. stay, magic_circle_adornee_func, magic_circle_offset = unpack(data)
  1657. frame = frame + 1
  1658. data[1] = frame
  1659. local transparency = (frame / duration) ^ stay
  1660. local opacity = 1 - transparency
  1661. if frame == duration then
  1662. pcall(Game.Destroy, magic_circle_model)
  1663. GraphicalEffects.magicCircleData[data] = nil
  1664. else
  1665. if magic_circle_model.Parent ~= Workspace then
  1666. pcall(Utility.SetProperty, magic_circle_model, "Parent", Workspace)
  1667. end
  1668. local magic_circle_adornee = magic_circle_adornee_func()
  1669. magic_circle_position = magic_circle_adornee.Position + direction * magic_circle_offset
  1670. local magic_circle_cframe = CFrame.new(magic_circle_position, magic_circle_position + direction) * CFrame.Angles(0, 0, math.tau * frame /
  1671.  
  1672. 25)
  1673. magic_circle_part.CFrame = magic_circle_cframe
  1674. magic_circle_light.Brightness = opacity
  1675. magic_circle_decal_back.Transparency = transparency
  1676. magic_circle_decal_front.Transparency = transparency
  1677. end
  1678. end
  1679. function GraphicalEffects.CreateMagicCircle(target, magic_circle_scale, magic_circle_image, light_color, duration, stay, magic_circle_adornee_func,
  1680.  
  1681. magic_circle_offset)
  1682. local magic_circle_adornee = magic_circle_adornee_func()
  1683. if magic_circle_adornee then
  1684. local origin = magic_circle_adornee.Position
  1685. local direction = (target - origin).unit
  1686. local magic_circle_position = origin + direction * magic_circle_offset
  1687. local magic_circle_cframe = CFrame.new(magic_circle_position, magic_circle_position + direction)
  1688. local magic_circle_model = Instance.new("Model")
  1689. local magic_circle_part = Instance.new("Part", magic_circle_model)
  1690. local magic_circle_mesh = Instance.new("BlockMesh", magic_circle_part)
  1691. local magic_circle_light = Instance.new("PointLight", magic_circle_part)
  1692. local magic_circle_decal_back = Instance.new("Decal", magic_circle_part)
  1693. local magic_circle_decal_front = Instance.new("Decal", magic_circle_part)
  1694. magic_circle_model.Archivable = false
  1695. magic_circle_part.Anchored = true
  1696. magic_circle_part.BottomSurface = "Smooth"
  1697. magic_circle_part.CanCollide = false
  1698. magic_circle_part.CFrame = magic_circle_cframe
  1699. magic_circle_part.FormFactor = "Custom"
  1700. magic_circle_part.Locked = true
  1701. magic_circle_part.Size = Vector3.new(0.2, 0.2, 0.2)
  1702. magic_circle_part.TopSurface = "Smooth"
  1703. magic_circle_part.Transparency = 1
  1704. magic_circle_mesh.Scale = Vector3.new(60, 60, 0) * magic_circle_scale
  1705. magic_circle_light.Color = light_color
  1706. magic_circle_light.Range = 16 * magic_circle_scale
  1707. magic_circle_light.Shadows = true
  1708. magic_circle_decal_back.Face = "Back"
  1709. magic_circle_decal_back.Texture = magic_circle_image
  1710. magic_circle_decal_front.Face = "Front"
  1711. magic_circle_decal_front.Texture = magic_circle_image
  1712. magic_circle_model.Parent = Workspace
  1713. local data = {0, direction, magic_circle_model, magic_circle_part, magic_circle_light, magic_circle_decal_back, magic_circle_decal_front,
  1714.  
  1715. duration, stay, magic_circle_adornee_func, magic_circle_offset}
  1716. GraphicalEffects.magicCircleData[data] = true
  1717. return data
  1718. end
  1719. end
  1720.  
  1721. GraphicalEffects.missileData = {}
  1722. GraphicalEffects.missileParts = {}
  1723. function GraphicalEffects.AnimateMissile(data)
  1724. local frame, missilePart, targetPart, timeCreated, direction, touchedConnection, explodeRequested, bodyGyro, swooshSound, magicCircleData, lifeTime,
  1725.  
  1726. pointOnPart, flipped = unpack(data)
  1727. frame = frame + 1
  1728. data[1] = frame
  1729. if flipped then
  1730. direction = -direction
  1731. end
  1732. if frame <= 10 then
  1733. if frame == 2 then
  1734. swooshSound:Play()
  1735. end
  1736. missilePart.Anchored = true
  1737. local progress = frame / 10
  1738. missilePart.Size = Vector3.new(1, 1, progress * 4)
  1739. local magicCirclePart = magicCircleData[4]
  1740. local magicCirclePosition = magicCirclePart.Position
  1741. local missileOffset = 2 * progress * direction
  1742. local missilePosition = magicCirclePosition + missileOffset
  1743. missilePart.CFrame = CFrame.new(missilePosition, missilePosition + direction)
  1744. --missilePart.Transparency = 0.5 * (1 - progress)
  1745. if frame == 10 then
  1746. touchedConnection = missilePart.Touched:connect(function(hit)
  1747. if hit.CanCollide and hit.Parent and not GraphicalEffects.missileParts[hit] then
  1748. touchedConnection:disconnect()
  1749. data[7] = true
  1750. end
  1751. end)
  1752. data[6] = touchedConnection
  1753. end
  1754. else
  1755. missilePart.Anchored = false
  1756. local missilePosition = missilePart.Position
  1757. local targetPosition = targetPart.CFrame * pointOnPart
  1758. local distanceVector = targetPosition - missilePosition
  1759. local elapsedTime = time() - timeCreated
  1760. local targetParent = targetPart.Parent
  1761. if explodeRequested or (targetParent and distanceVector.magnitude < 10) or elapsedTime > lifeTime then
  1762. GraphicalEffects.missileData[data] = nil
  1763. GraphicalEffects.missileParts[missilePart] = nil
  1764. touchedConnection:disconnect()
  1765. if missilePart.Parent then
  1766. missilePart:Destroy()
  1767. local explosion = Instance.new("Explosion")
  1768. explosion.BlastRadius = 12.5
  1769. explosion.Position = missilePosition
  1770. local explosionHitConnection = explosion.Hit:connect(function(hit, distance)
  1771. local missileData = GraphicalEffects.missileParts[hit]
  1772. if missileData and distance < 3 then
  1773. missileData[7] = true
  1774. else
  1775. pcall(hit.BreakJoints, hit)
  1776. end
  1777. end)
  1778. explosion.Parent = Workspace
  1779. TaskScheduler.Schedule(1, explosionHitConnection.disconnect, explosionHitConnection)
  1780. end
  1781. else
  1782. local targetInWorkspace = targetPart:IsDescendantOf(Workspace)
  1783. if targetInWorkspace then
  1784. direction = distanceVector.unit
  1785. data[5] = direction
  1786. end
  1787. local speed = 14 + elapsedTime * 10
  1788. local gyroD
  1789. if elapsedTime < 42.5 and targetInWorkspace then
  1790. gyroD = 1000 - elapsedTime * 15
  1791. else
  1792. gyroD = 100
  1793. bodyGyro.maxTorque = Vector3.new(0, 0, 0)
  1794. if elapsedTime + 7.5 < lifeTime then
  1795. data[11] = elapsedTime + 7.5
  1796. end
  1797. end
  1798. bodyGyro.D = gyroD
  1799. bodyGyro.cframe = CFrame.new(Vector3.new(), direction)
  1800. missilePart.Velocity = missilePart.CFrame.lookVector * speed
  1801. end
  1802. end
  1803. end
  1804. function GraphicalEffects.ShootMissile(targetPart, pointOnPart, direction, magic_circle_adornee_func, magic_circle_offset, flipped)
  1805. if not magic_circle_offset then
  1806. magic_circle_offset = GraphicalEffects.MAGIC_CIRCLE_DEFAULT_OFFSET
  1807. end
  1808. local targetPosition = targetPart.Position
  1809. local headPosition = chatAdornee.Position
  1810. local origin = CFrame.new(headPosition, headPosition + direction) + direction * magic_circle_offset
  1811. local missilePart = Instance.new("Part")
  1812. local antiGravityForce = Instance.new("BodyForce", missilePart)
  1813. local bodyGyro = Instance.new("BodyGyro", missilePart)
  1814. local explosionSound = Instance.new("Sound", missilePart)
  1815. local swooshSound = Instance.new("Sound", missilePart)
  1816. antiGravityForce.force = Vector3.new(0, 196.2 * 4, 0)
  1817. bodyGyro.D = 1000
  1818. bodyGyro.maxTorque = Vector3.new(1, 1, 1)
  1819. explosionSound.PlayOnRemove = true
  1820. explosionSound.SoundId = "rbxasset://sounds/collide.wav"
  1821. explosionSound.Volume = 1
  1822. missilePart.Anchored = true
  1823. missilePart.BackSurface = "Studs"
  1824. missilePart.BottomSurface = "Studs"
  1825. missilePart.BrickColor = BrickColor.Red()
  1826. missilePart.CFrame = origin
  1827. missilePart.FormFactor = "Custom"
  1828. missilePart.FrontSurface = "Studs"
  1829. missilePart.LeftSurface = "Studs"
  1830. missilePart.Locked = true
  1831. missilePart.RightSurface = "Studs"
  1832. missilePart.Size = Vector3.new(1, 1, 0.2)
  1833. missilePart.TopSurface = "Studs"
  1834. --missilePart.Transparency = 0.5
  1835. swooshSound.Looped = true
  1836. swooshSound.SoundId = "rbxasset://sounds/Rocket whoosh 01.wav"
  1837. swooshSound.Volume = 0.7
  1838. local magicCircleData = GraphicalEffects.CreateMagicCircle(headPosition + direction * 1000, 0.875, "rbxassetid://127033719", Color3.new(1, 1, 1),
  1839.  
  1840. 40, 4, magic_circle_adornee_func or function() return chatAdornee end, magic_circle_offset)
  1841. local data = {0, missilePart, targetPart, time(), direction, false, false, bodyGyro, swooshSound, magicCircleData, 50, pointOnPart, flipped}
  1842. missilePart.Parent = Workspace
  1843. GraphicalEffects.missileData[data] = true
  1844. GraphicalEffects.missileParts[missilePart] = data
  1845. end
  1846.  
  1847. function GraphicalEffects.CubicInterpolate(y0, y1, y2, y3, mu)
  1848. local a0, a1, a2, a3, mu2
  1849. mu2 = mu * mu
  1850. a0 = y3 - y2 - y0 + y1
  1851. a1 = y0 - y1 - a0
  1852. a2 = y2 - y0
  1853. a3 = y1
  1854. return a0 * mu * mu2 + a1 * mu2 + a2 * mu + a3
  1855. end
  1856. function GraphicalEffects.JointCrap(model, cycletime)
  1857. if model then
  1858. local cycletime = cycletime or (0.75 * (1 + math.random() * 4))
  1859. local offsetradius = 0.75
  1860. local rotationoffset = math.pi
  1861. local joints = {}
  1862. local stack = model:GetChildren()
  1863. while #stack ~= 0 do
  1864. local object = stack[#stack]
  1865. table.remove(stack)
  1866. for index, child in ipairs(object:GetChildren()) do
  1867. table.insert(stack, child)
  1868. end
  1869. if object:IsA("JointInstance") then
  1870. table.insert(joints, object)
  1871. end
  1872. end
  1873. local rot0 = {}
  1874. local rot1 = {}
  1875. local rot2 = {}
  1876. local rot3 = {}
  1877. local rot4 = {}
  1878. for index, joint in ipairs(joints) do
  1879. local pos = Vector3.new(math.random() - 0.5, math.random() - 0.5, math.random() - 0.5).unit * offsetradius
  1880. local rot = Vector3.new(math.random(), math.random(), math.random()) * rotationoffset
  1881. rot0[index] = {joint.C0, joint.C1}
  1882. rot = Vector3.new(rot.x % (math.tau), rot.y % (math.tau), rot.z % (math.tau))
  1883. rot2[index] = {pos, rot}
  1884. pos = Vector3.new(math.random() - 0.5, math.random() - 0.5, math.random() - 0.5).unit * offsetradius
  1885. rot = rot + Vector3.new(math.random(), math.random(), math.random()) * rotationoffset
  1886. rot = Vector3.new(rot.x % (math.tau), rot.y % (math.tau), rot.z % (math.tau))
  1887. rot3[index] = {pos, rot}
  1888. pos = Vector3.new(math.random() - 0.5, math.random() - 0.5, math.random() - 0.5).unit * offsetradius
  1889. rot = rot + Vector3.new(math.random(), math.random(), math.random()) * rotationoffset
  1890. rot = Vector3.new(rot.x % (math.tau), rot.y % (math.tau), rot.z % (math.tau))
  1891. rot4[index] = {pos, rot}
  1892. end
  1893. while model.Parent do
  1894. for i, j in ipairs(joints) do
  1895. local pos = Vector3.new(math.random() - 0.5, math.random() - 0.5, math.random() - 0.5).unit * offsetradius
  1896. local rot = rot4[i][2] + Vector3.new(math.random(), math.random(), math.random()) * rotationoffset
  1897. rot = Vector3.new(rot.x % (math.tau), rot.y % (math.tau), rot.z % (math.tau))
  1898. rot1[i], rot2[i], rot3[i], rot4[i] = rot2[i], rot3[i], rot4[i], {pos, rot}
  1899. end
  1900. local start = tick()
  1901. while true do
  1902. local ctime = tick()
  1903. local elapsed = ctime - start
  1904. if elapsed > cycletime then
  1905. break
  1906. end
  1907. local progress = elapsed / cycletime
  1908. for index, joint in ipairs(joints) do
  1909. local v0, v1, v2, v3, v4 = rot0[index], rot1[index], rot2[index], rot3[index], rot4[index]
  1910. local p1, p2, p3, p4, r1, r2, r3, r4 = v1[1], v2[1], v3[1], v4[1], v1[2], v2[2], v3[2], v4[2]
  1911. local px = GraphicalEffects.CubicInterpolate(p1.x, p2.x, p3.x, p4.x, progress)
  1912. local py = GraphicalEffects.CubicInterpolate(p1.y, p2.y, p3.y, p4.y, progress)
  1913. local pz = GraphicalEffects.CubicInterpolate(p1.z, p2.z, p3.z, p4.z, progress)
  1914. local rx = GraphicalEffects.CubicInterpolate(r1.x, r2.x, r3.x, r4.x, progress)
  1915. local ry = GraphicalEffects.CubicInterpolate(r1.y, r2.y, r3.y, r4.y, progress)
  1916. local rz = GraphicalEffects.CubicInterpolate(r1.z, r2.z, r3.z, r4.z, progress)
  1917. local cframe = CFrame.new(px, py, pz) * CFrame.Angles(rx, ry, rz)
  1918. joint.C0 = v0[1] * cframe
  1919. joint.C1 = v0[2] * cframe:inverse()
  1920. end
  1921. RunService.Stepped:wait()
  1922. end
  1923. end
  1924. end
  1925. end
  1926.  
  1927. GraphicalEffects.LASER_WIDTH = 0.15
  1928. GraphicalEffects.LASER_MAGIC_CIRCLE_DISTANCE = 6.25
  1929. GraphicalEffects.laser_data = {}
  1930. --GraphicalEffects.fragmentation = {}
  1931. function GraphicalEffects.AnimateLaserOfDeath(data)
  1932. local frame, directionOrientation, direction, magic_circle_model, laser_part, laser_mesh, magic_circle_part, magic_circle_light,
  1933.  
  1934. magic_circle_decal_back, magic_circle_decal_front, sound, laser_scale, fragmentation_size, duration, laser_lights, laser_effects, stay, light_effects =
  1935.  
  1936. unpack(data)
  1937. local laser_color = laser_part.Color
  1938. frame = frame + 1
  1939. data[1] = frame
  1940. local transparency = (frame / duration) ^ stay
  1941. local opacity = 1 - transparency
  1942. if frame == 2 then
  1943. sound:Play()
  1944. end
  1945. if frame == duration then
  1946. pcall(Game.Destroy, magic_circle_model)
  1947. GraphicalEffects.laser_data[data] = nil
  1948. else
  1949. if magic_circle_model.Parent ~= Workspace then
  1950. pcall(Utility.SetProperty, magic_circle_model, "Parent", Workspace)
  1951. end
  1952. local laser_distance = 0
  1953. local origin = chatAdornee.CFrame
  1954. if not light_effects then
  1955. direction = (origin * directionOrientation - origin.p).unit
  1956. end
  1957. local magic_circle_position = origin.p + direction * GraphicalEffects.LASER_MAGIC_CIRCLE_DISTANCE
  1958. local magic_circle_cframe = CFrame.new(magic_circle_position, magic_circle_position + direction) * CFrame.Angles(0, 0, math.tau * frame /
  1959.  
  1960. 25)
  1961. local loop_scale = (laser_scale - 1) / 10
  1962. for x_offset = -loop_scale, loop_scale, 2 do
  1963. for y_offset = -loop_scale, loop_scale, 2 do
  1964. local origin_position = magic_circle_cframe * Vector3.new(x_offset, y_offset, 0)
  1965. for index = 1, 8 do
  1966. local part, position
  1967. for ray_index = 1, 10 do
  1968. local ray = Ray.new(origin_position + direction * (999 * (ray_index - 1)), direction * 999)
  1969. part, position = Workspace:FindPartOnRay(ray, magic_circle_model)
  1970. if part then
  1971. break
  1972. end
  1973. end
  1974. if part then
  1975. laser_distance = (position - origin_position).magnitude
  1976. if frame % 8 == 1 and index == 1 then
  1977. Instance.new("Explosion", Workspace).Position = position
  1978. end
  1979. if not part:IsA("Terrain") then
  1980. pcall(part.BreakJoints, part)
  1981. local is_block = part:IsA("Part") and part.Shape == Enum.PartType.Block
  1982. local mass = part:GetMass()
  1983. local size = part.Size
  1984. if (is_block and ((size.X < fragmentation_size and size.Y < fragmentation_size and size.Z <
  1985.  
  1986. fragmentation_size) or (not part.Anchored and mass < 750))) or (not is_block and mass < 250000) then
  1987. local part_transparency = math.max(part.Transparency + 0.007 * fragmentation_size, 0.5)
  1988. if part_transparency >= 0.5 then -- temporarily to minimize debris
  1989. pcall(Game.Destroy, part)
  1990. else
  1991. local cframe = part.CFrame
  1992. part.Anchored = false
  1993. part.BrickColor = BrickColor.new("Medium stone grey")
  1994. part.CanCollide = true
  1995. if part:IsA("FormFactorPart") then
  1996. part.FormFactor = "Custom"
  1997. end
  1998. part.Size = size - Vector3.new(0.135, 0.135, 0.135) * fragmentation_size
  1999. part.Transparency = part_transparency
  2000. part.CFrame = cframe + direction * 5
  2001. part.Velocity = part.Velocity + direction * 40
  2002. end
  2003. elseif is_block then
  2004. local parts = {part}
  2005. local model = Instance.new("Model", part.Parent)
  2006. model.Name = "Fragments"
  2007. if size.X >= fragmentation_size then
  2008. size = Vector3.new(0.5, 1, 1) * size
  2009. local archivable = part.Archivable
  2010. local cframe = part.CFrame
  2011. part.FormFactor = "Custom"
  2012. part.Size = size
  2013. part.Archivable = true
  2014. local part_clone = part:Clone()
  2015. part.Archivable = archivable
  2016. part_clone.Archivable = archivable
  2017. part.CFrame = cframe * CFrame.new(-0.5 * size.X, 0, 0)
  2018. part_clone.CFrame = cframe * CFrame.new(0.5 * size.X, 0, 0)
  2019. part_clone.Parent = model
  2020. parts[2] = part_clone
  2021. end
  2022. if size.Y >= fragmentation_size then
  2023. size = Vector3.new(1, 0.5, 1) * size
  2024. for part_index = 1, #parts do
  2025. local part = parts[part_index]
  2026. local archivable = part.Archivable
  2027. local cframe = part.CFrame
  2028. part.FormFactor = "Custom"
  2029. part.Size = size
  2030. part.Archivable = true
  2031. local part_clone = part:Clone()
  2032. part.Archivable = archivable
  2033. part_clone.Archivable = archivable
  2034. part.CFrame = cframe * CFrame.new(0, -0.5 * size.Y, 0)
  2035. part_clone.CFrame = cframe * CFrame.new(0, 0.5 * size.Y, 0)
  2036. part_clone.Parent = model
  2037. table.insert(parts, part_clone)
  2038. end
  2039. end
  2040. if size.Z >= fragmentation_size then
  2041. size = Vector3.new(1, 1, 0.5) * size
  2042. for part_index = 1, #parts do
  2043. local part = parts[part_index]
  2044. local archivable = part.Archivable
  2045. local cframe = part.CFrame
  2046. part.FormFactor = "Custom"
  2047. part.Size = size
  2048. part.Archivable = true
  2049. local part_clone = part:Clone()
  2050. part.Archivable = archivable
  2051. part_clone.Archivable = archivable
  2052. part.CFrame = cframe * CFrame.new(0, 0, -0.5 * size.Z)
  2053. part_clone.CFrame = cframe * CFrame.new(0, 0, 0.5 * size.Z)
  2054. part_clone.Parent = model
  2055. table.insert(parts, part_clone)
  2056. end
  2057. end
  2058. for _, part in ipairs(parts) do
  2059. part:MakeJoints()
  2060. end
  2061. else
  2062. break
  2063. end
  2064. end
  2065. else
  2066. laser_distance = 9990
  2067. break
  2068. end
  2069. end
  2070. end
  2071. end
  2072. local laser_cframe = magic_circle_cframe * CFrame.Angles(-0.5 * math.pi, 0, 0)
  2073. local laser_width = GraphicalEffects.LASER_WIDTH * opacity * laser_scale
  2074. local laser_mesh_offset = Vector3.new(0, 0.5 * laser_distance, 0)
  2075. laser_part.CFrame = laser_cframe
  2076. if laser_effects then
  2077. local laser_effect_data_1, laser_effect_data_2 = laser_effects[1], laser_effects[2]
  2078. local laser_effect_1, laser_effect_mesh_1 = laser_effect_data_1[1], laser_effect_data_1[2]
  2079. local laser_effect_2, laser_effect_mesh_2 = laser_effect_data_2[1], laser_effect_data_2[2]
  2080. laser_effect_1.CFrame = laser_cframe
  2081. laser_effect_2.CFrame = laser_cframe
  2082. laser_effect_mesh_1.Offset = laser_mesh_offset
  2083. laser_effect_mesh_2.Offset = laser_mesh_offset
  2084. local game_time = time()
  2085. local effect_scale_1 = 0.5 + 0.5 * math.sin(16 * math.pi * game_time)
  2086. local effect_scale_2 = 0.5 + 0.5 * math.cos(16 * math.pi * game_time)
  2087. laser_effect_mesh_1.Scale = 5 * Vector3.new(laser_width * effect_scale_1, laser_distance, laser_width * effect_scale_1)
  2088. laser_effect_mesh_2.Scale = 5 * Vector3.new(laser_width * effect_scale_2, laser_distance, laser_width * effect_scale_2)
  2089. laser_width = laser_width * 0.25
  2090. end
  2091. laser_mesh.Offset = laser_mesh_offset
  2092. laser_mesh.Scale = 5 * Vector3.new(laser_width, laser_distance, laser_width)
  2093. magic_circle_part.CFrame = magic_circle_cframe
  2094. magic_circle_light.Brightness = opacity
  2095. magic_circle_decal_back.Transparency = transparency
  2096. magic_circle_decal_front.Transparency = transparency
  2097. if light_effects then
  2098. for index, data in ipairs(laser_lights) do
  2099. local laser_spotlight_part, laser_spotlight = data[1], data[2]
  2100. local laser_spotlight_offset = 30 * (index - 1)
  2101. if laser_spotlight_offset <= laser_distance then
  2102. laser_spotlight_part.CFrame = magic_circle_cframe * CFrame.new(0, 0, -laser_spotlight_offset)
  2103. laser_spotlight.Brightness = opacity
  2104. laser_spotlight.Enabled = true
  2105. else
  2106. laser_spotlight.Enabled = false
  2107. end
  2108. end
  2109. end
  2110. end
  2111. end
  2112. function GraphicalEffects.ShootLaserOfDeath(target, data)
  2113. if chatAdornee then
  2114. data = data or {}
  2115. local brickcolor = data.brickcolor or BrickColor.new("Really black")
  2116. local duration = data.duration or 40
  2117. local fragmentation_size = data.fragmentation_size or 3
  2118. local laser_scale = data.laser_scale or 1
  2119. local light_color = data.light_color or Color3.new(1, 0.5, 1)
  2120. local magic_circle_image = data.magic_circle_image or "rbxassetid://122610943"
  2121. local magic_circle_scale = data.magic_circle_scale or 1
  2122. local sound_volume = data.sound_volume or 1 / 3
  2123. local special_effects = data.special_effects
  2124. local stay = data.stay or 4
  2125. local origin = chatAdornee.CFrame
  2126. local directionOrientation = origin:pointToObjectSpace(target)
  2127. local direction = (target - origin.p).unit
  2128. local magic_circle_position = origin.p + direction * GraphicalEffects.LASER_MAGIC_CIRCLE_DISTANCE
  2129. local magic_circle_cframe = CFrame.new(magic_circle_position, magic_circle_position + direction)
  2130. local magic_circle_model = Instance.new("Model")
  2131. local laser_part = Instance.new("Part", magic_circle_model)
  2132. local laser_mesh = Instance.new("CylinderMesh", laser_part)
  2133. local magic_circle_part = Instance.new("Part", magic_circle_model)
  2134. local magic_circle_mesh = Instance.new("BlockMesh", magic_circle_part)
  2135. local magic_circle_light = Instance.new("PointLight", magic_circle_part)
  2136. local magic_circle_decal_back = Instance.new("Decal", magic_circle_part)
  2137. local magic_circle_decal_front = Instance.new("Decal", magic_circle_part)
  2138. local sound = Instance.new("Sound", magic_circle_part)
  2139. sound.Pitch = 1.25
  2140. sound.SoundId = "rbxassetid://2248511"
  2141. sound.Volume = sound_volume
  2142. magic_circle_model.Archivable = false
  2143. laser_part.Anchored = true
  2144. laser_part.BottomSurface = "Smooth"
  2145. laser_part.BrickColor = brickcolor
  2146. laser_part.CanCollide = false
  2147. laser_part.CFrame = magic_circle_cframe * CFrame.Angles(-0.5 * math.pi, 0, 0)
  2148. laser_part.FormFactor = "Custom"
  2149. laser_part.Locked = true
  2150. laser_part.Size = Vector3.new(0.2, 0.2, 0.2)
  2151. laser_part.TopSurface = "Smooth"
  2152. laser_mesh.Offset = Vector3.new(0, 0, 0)
  2153. laser_mesh.Name = "Mesh"
  2154. laser_mesh.Scale = 5 * laser_scale * Vector3.new(GraphicalEffects.LASER_WIDTH, 0, GraphicalEffects.LASER_WIDTH)
  2155. magic_circle_part.Anchored = true
  2156. magic_circle_part.BottomSurface = "Smooth"
  2157. magic_circle_part.CanCollide = false
  2158. magic_circle_part.CFrame = magic_circle_cframe
  2159. magic_circle_part.FormFactor = "Custom"
  2160. magic_circle_part.Locked = true
  2161. magic_circle_part.Size = Vector3.new(0.2, 0.2, 0.2)
  2162. magic_circle_part.TopSurface = "Smooth"
  2163. magic_circle_part.Transparency = 1
  2164. magic_circle_mesh.Scale = Vector3.new(60, 60, 0) * magic_circle_scale
  2165. magic_circle_light.Color = light_color
  2166. magic_circle_light.Range = 16 * magic_circle_scale
  2167. magic_circle_light.Shadows = true
  2168. magic_circle_decal_back.Face = "Back"
  2169. magic_circle_decal_back.Texture = magic_circle_image
  2170. magic_circle_decal_front.Face = "Front"
  2171. magic_circle_decal_front.Texture = magic_circle_image
  2172. magic_circle_model.Parent = Workspace
  2173. local laser_color = brickcolor.Color
  2174. local laser_lights = {}
  2175. local light_effects = laser_color.r + laser_color.g + laser_color.b > 0.25
  2176. if light_effects then
  2177. local laser_spotlight_part_template = Instance.new("Part")
  2178. local laser_spotlight_light_template = Instance.new("SpotLight", laser_spotlight_part_template)
  2179. laser_spotlight_part_template.Anchored = true
  2180. laser_spotlight_part_template.Anchored = true
  2181. laser_spotlight_part_template.BottomSurface = "Smooth"
  2182. laser_spotlight_part_template.CanCollide = false
  2183. laser_spotlight_part_template.FormFactor = "Custom"
  2184. laser_spotlight_part_template.Locked = true
  2185. laser_spotlight_part_template.Size = Vector3.new(0.2, 0.2, 0.2)
  2186. laser_spotlight_part_template.TopSurface = "Smooth"
  2187. laser_spotlight_part_template.Transparency = 1
  2188. laser_spotlight_light_template.Angle = 45
  2189. laser_spotlight_light_template.Color = laser_color
  2190. laser_spotlight_light_template.Enabled = true
  2191. laser_spotlight_light_template.Name = "Light"
  2192. laser_spotlight_light_template.Range = 60
  2193. for index = 1, 40 do
  2194. local laser_spotlight_part = laser_spotlight_part_template:Clone()
  2195. laser_spotlight_part.CFrame = magic_circle_cframe * CFrame.new(0, 0, -30 * (index - 1))
  2196. laser_spotlight_part.Parent = magic_circle_model
  2197. laser_lights[index] = {laser_spotlight_part, laser_spotlight_part.Light}
  2198. end
  2199. end
  2200. local laser_effects
  2201. if special_effects then
  2202. laser_effects = {}
  2203. local laser_effect_1 = laser_part:Clone()
  2204. laser_effect_1.BrickColor = special_effects
  2205. laser_effect_1.Transparency = 0.5
  2206. local laser_effect_2 = laser_effect_1:Clone()
  2207. laser_effects[1], laser_effects[2] = {laser_effect_1, laser_effect_1.Mesh}, {laser_effect_2, laser_effect_2.Mesh}
  2208. laser_effect_1.Parent = magic_circle_model
  2209. laser_effect_2.Parent = magic_circle_model
  2210. end
  2211. GraphicalEffects.laser_data[{0, directionOrientation, direction, magic_circle_model, laser_part, laser_mesh, magic_circle_part,
  2212.  
  2213. magic_circle_light, magic_circle_decal_back, magic_circle_decal_front, sound, laser_scale, fragmentation_size, duration, laser_lights, laser_effects, stay,
  2214.  
  2215. light_effects}] = true
  2216. end
  2217. end
  2218.  
  2219. function GraphicalEffects.SpawnSapientRock(position)
  2220. local part = Instance.new("Part", Workspace)
  2221. local size = 8 + math.random(0, 5)
  2222. part.BottomSurface = "Smooth"
  2223. part.TopSurface = "Smooth"
  2224. part.Material = "Slate"
  2225. part.Locked = true
  2226. part.Shape = "Ball"
  2227. part.FormFactor = "Custom"
  2228. part.Size = Vector3.new(size, size, size)
  2229. part.Position = position
  2230. local bodypos = Instance.new("BodyPosition", part)
  2231. bodypos.maxForce = Vector3.new(0, 0, 0)
  2232. local angry = false
  2233. local damage_ready = true
  2234. local torso_following
  2235. local torso_changed = -1000
  2236. local touched_conn = part.Touched:connect(function(hit)
  2237. local character = hit.Parent
  2238. if character then
  2239. local humanoid
  2240. for _, child in ipairs(character:GetChildren()) do
  2241. if child:IsA("Humanoid") then
  2242. humanoid = child
  2243. break
  2244. end
  2245. end
  2246. if humanoid then
  2247. if angry then
  2248. if damage_ready then
  2249. damage_ready = false
  2250. humanoid:TakeDamage(100)
  2251. wait(1)
  2252. damage_ready = true
  2253. angry = false
  2254. part.BrickColor = BrickColor.new("Medium stone grey")
  2255. end
  2256. else
  2257. local torso = humanoid.Torso
  2258. if torso then
  2259. torso_following = torso
  2260. torso_changed = tick()
  2261. end
  2262. end
  2263. end
  2264. end
  2265. end)
  2266. TaskScheduler.Start(function()
  2267. while part.Parent == Workspace do
  2268. if torso_following then
  2269. bodypos.position = torso_following.Position
  2270. if tick() - torso_changed > 60 or not torso_following.Parent then
  2271. torso_following = nil
  2272. bodypos.maxForce = Vector3.new(0, 0, 0)
  2273. angry = false
  2274. part.BrickColor = BrickColor.new("Medium stone grey")
  2275. else
  2276. local speed = angry and Vector3.new(16, 16, 16) or Vector3.new(6, 0, 6)
  2277. bodypos.maxForce = part:GetMass() * speed
  2278. if part.Position.Y < -250 then
  2279. part.Velocity = Vector3.new()
  2280. part.Position = torso_following.Position + Vector3.new(0, 80, 0)
  2281. part.BrickColor = BrickColor.new("Bright red")
  2282. angry = true
  2283. torso_changed = tick()
  2284. end
  2285. end
  2286. end
  2287. RunService.Stepped:wait()
  2288. end
  2289. touched_conn:disconnect()
  2290. end)
  2291. TaskScheduler.Start(function()
  2292. while part.Parent == Workspace do
  2293. wait(25 + math.random() * 10)
  2294. local next_size = 8 + math.random() * 5
  2295. if math.random(100) == 1 then
  2296. next_size = next_size * (2 + 6 * math.random())
  2297. end
  2298. next_size = math.floor(next_size + 0.5)
  2299. local start_time = tick()
  2300. local mesh = Instance.new("SpecialMesh", part)
  2301. mesh.MeshType = "Sphere"
  2302. repeat
  2303. local elapsed_time = tick() - start_time
  2304. local alpha = math.cos(elapsed_time * math.pi * 0.5)
  2305. local interpolated_size = size * alpha + next_size * (1 - alpha)
  2306. local size_vector = Vector3.new(interpolated_size, interpolated_size, interpolated_size)
  2307. local cframe = part.CFrame
  2308. part.Size = size_vector
  2309. part.CFrame = cframe
  2310. mesh.Scale = size_vector / part.Size
  2311. RunService.Stepped:wait()
  2312. until tick() - start_time >= 1
  2313. mesh:Destroy()
  2314. local cframe = part.CFrame
  2315. part.Size = Vector3.new(next_size, next_size, next_size)
  2316. part.CFrame = cframe
  2317. size = next_size
  2318. end
  2319. end)
  2320. end
  2321.  
  2322. function GraphicalEffects.MainLoop()
  2323. RunService.Stepped:wait()
  2324. for data in pairs(GraphicalEffects.magicCircleData) do
  2325. GraphicalEffects.AnimateMagicCircle(data)
  2326. end
  2327. for data in pairs(GraphicalEffects.laser_data) do
  2328. GraphicalEffects.AnimateLaserOfDeath(data)
  2329. end
  2330. for data in pairs(GraphicalEffects.missileData) do
  2331. GraphicalEffects.AnimateMissile(data)
  2332. end
  2333. end
  2334. TaskScheduler.Start(function()
  2335. while true do
  2336. GraphicalEffects.MainLoop()
  2337. end
  2338. end)
  2339.  
  2340. PlayerControl = {};
  2341.  
  2342. PlayerControl.fly_acceleration = 10
  2343. PlayerControl.fly_basespeed = 250
  2344. PlayerControl.fly_speed = PlayerControl.fly_basespeed
  2345. PlayerControl.featherfallEnabled = true
  2346. PlayerControl.pushable = false
  2347. PlayerControl.rolling = false
  2348. PlayerControl.rollingAngle = 0
  2349. PlayerControl.rollingOffset = 0
  2350. PlayerControl.rollingMaxOffset = 3
  2351. PlayerControl.rollingSpeed = 1 / 50
  2352. PlayerControl.characterEnabled = false
  2353. PlayerControl.characterMode = "normal"
  2354. local character = nil
  2355. local flying, flyingMomentum, flyingTilt = false, Vector3.new(), 0
  2356. local pose, regeneratingHealth, jumpDebounce = "Standing", false, false
  2357. -- TODO: make local variables public
  2358. local model, bodyColors, leftArmMesh, leftLegMesh, rightArmMesh, rightLegMesh, torsoMesh, wildcardHat, wildcardHandle, wildcardMesh, pants, shirt, humanoid,
  2359.  
  2360. head, leftArm, leftLeg, rightArm, rightLeg, torso, rootPart, rootJoint, face, soundFreeFalling, soundGettingUp, soundRunning, leftHip, leftShoulder,
  2361.  
  2362. rightHip, rightShoulder, neck, wildcardWeld, feetPart, feetWeld, feetTouchInterest, bodyGyro, bodyVelocity, headMesh, torsoLight
  2363. local AnimateCharacter
  2364. local UserInterface = game:service'UserInputService'
  2365. local chatBubbles = {}
  2366. local chatCharacterLimit = 240
  2367. function PlayerControl.CreateCharacter()
  2368. local characterMode = PlayerControl.characterMode
  2369. if characterMode == "normal" then
  2370. if not PlayerControl.characterEnabled then
  2371. return
  2372. end
  2373. local appearance = CharacterAppearance.GetDefaultAppearance()
  2374. local active = true
  2375. local torsoCFrame = (torso and torso.CFrame) or PlayerControl.torso_cframe or CFrame.new(0, 10, 0)
  2376. if torsoCFrame.p.Y < -450 then
  2377. torsoCFrame = CFrame.new(0, 10, 0)
  2378. end
  2379. local rootPartCFrame = (rootPart and rootPart.CFrame) or PlayerControl.torso_cframe or CFrame.new(0, 10, 0)
  2380. if rootPartCFrame.p.Y < -450 then
  2381. rootPartCFrame = CFrame.new(0, 10, 0)
  2382. end
  2383. local cameraCFrame = Camera.CoordinateFrame
  2384. local connections = {}
  2385. local feetTouching = {}
  2386. local previousWalkSpeed = 0
  2387. local prevLeftHip, prevLeftShoulder, prevRightHip, prevRightShoulder = leftHip, leftShoulder, rightHip, rightShoulder
  2388. model = Instance.new("Model")
  2389. humanoid = Instance.new("Humanoid", model)
  2390. head = Instance.new("Part", model)
  2391. leftArm = Instance.new("Part", model)
  2392. leftLeg = Instance.new("Part", model)
  2393. rightArm = Instance.new("Part", model)
  2394. rightLeg = Instance.new("Part", model)
  2395. torso = Instance.new("Part", model)
  2396. rootPart = Instance.new("Part", model)
  2397. soundFallingDown = Instance.new("Sound", head)
  2398. soundFreeFalling = Instance.new("Sound", head)
  2399. soundGettingUp = Instance.new("Sound", head)
  2400. soundJumping = Instance.new("Sound", head)
  2401. soundRunning = Instance.new("Sound", head)
  2402. leftHip = Instance.new("Motor", torso)
  2403. leftShoulder = Instance.new("Motor", torso)
  2404. rightHip = Instance.new("Motor", torso)
  2405. rightShoulder = Instance.new("Motor", torso)
  2406. neck = Instance.new("Motor", torso)
  2407. rootJoint = Instance.new("Motor", rootPart)
  2408. feetPart = Instance.new("Part", model)
  2409. feetWeld = Instance.new("Weld", torso)
  2410. bodyGyro = Instance.new("BodyGyro", rootPart)
  2411. bodyVelocity = Instance.new("BodyVelocity", rootPart)
  2412. model.Archivable = false
  2413. model.Name = user_name or Player.Name
  2414. model.PrimaryPart = head
  2415. humanoid.LeftLeg = leftLeg
  2416. humanoid.RightLeg = rightLeg
  2417. humanoid.Torso = rootPart
  2418. head.CFrame = torsoCFrame * CFrame.new(0, 1.5, 0)
  2419. head.FormFactor = "Symmetric"
  2420. head.Locked = true
  2421. head.Name = "Head"
  2422. head.Size = Vector3.new(2, 1, 1)
  2423. head.TopSurface = "Smooth"
  2424. leftArm.CanCollide = false
  2425. leftArm.CFrame = torsoCFrame * CFrame.new(-1.5, 0, 0)
  2426. leftArm.FormFactor = "Symmetric"
  2427. leftArm.Locked = true
  2428. leftArm.Name = "Left Arm"
  2429. leftArm.Size = Vector3.new(1, 2, 1)
  2430. leftLeg.BottomSurface = "Smooth"
  2431. leftLeg.CanCollide = false
  2432. leftLeg.CFrame = torsoCFrame * CFrame.new(-0.5, -2, 0)
  2433. leftLeg.FormFactor = "Symmetric"
  2434. leftLeg.Locked = true
  2435. leftLeg.Name = "Left Leg"
  2436. leftLeg.Size = Vector3.new(1, 2, 1)
  2437. leftLeg.TopSurface = "Smooth"
  2438. rightArm.CanCollide = false
  2439. rightArm.CFrame = torsoCFrame * CFrame.new(1.5, 0, 0)
  2440. rightArm.FormFactor = "Symmetric"
  2441. rightArm.Locked = true
  2442. rightArm.Name = "Right Arm"
  2443. rightArm.Size = Vector3.new(1, 2, 1)
  2444. rightLeg.BottomSurface = "Smooth"
  2445. rightLeg.CanCollide = false
  2446. rightLeg.CFrame = torsoCFrame * CFrame.new(0.5, -2, 0)
  2447. rightLeg.FormFactor = "Symmetric"
  2448. rightLeg.Locked = true
  2449. rightLeg.Name = "Right Leg"
  2450. rightLeg.Size = Vector3.new(1, 2, 1)
  2451. rightLeg.TopSurface = "Smooth"
  2452. torso.CFrame = torsoCFrame
  2453. torso.FormFactor = "Symmetric"
  2454. torso.LeftSurface = "Weld"
  2455. torso.Locked = true
  2456. torso.RightSurface = "Weld"
  2457. torso.Name = "Torso"
  2458. torso.Size = Vector3.new(2, 2, 1)
  2459. rootPart.BottomSurface = "Smooth"
  2460. rootPart.BrickColor = BrickColor.Blue()
  2461. rootPart.CFrame = rootPartCFrame
  2462. rootPart.FormFactor = "Symmetric"
  2463. rootPart.LeftSurface = "Weld"
  2464. rootPart.Locked = true
  2465. rootPart.RightSurface = "Weld"
  2466. rootPart.Name = "HumanoidRootPart"
  2467. rootPart.Size = Vector3.new(2, 2, 1)
  2468. rootPart.TopSurface = "Smooth"
  2469. rootPart.Transparency = 1
  2470. soundFreeFalling.Archivable = false
  2471. soundFreeFalling.SoundId = "rbxasset://sounds/swoosh.wav"
  2472. soundGettingUp.Archivable = false
  2473. soundGettingUp.SoundId = "rbxasset://sounds/hit.wav"
  2474. soundRunning.Archivable = false
  2475. soundRunning.SoundId = "rbxasset://sounds/bfsl-minifigfoots1.mp3"
  2476. soundRunning.Looped = true
  2477. leftHip.C0 = CFrame.new(-1, -1, 0, -0, -0, -1, 0, 1, 0, 1, 0, 0)
  2478. leftHip.C1 = CFrame.new(-0.5, 1, 0, -0, -0, -1, 0, 1, 0, 1, 0, 0)
  2479. leftHip.MaxVelocity = 0.1
  2480. leftHip.Name = "Left Hip"
  2481. leftHip.Part0 = torso
  2482. leftHip.Part1 = leftLeg
  2483. leftShoulder.C0 = CFrame.new(-1, 0.5, 0, -0, -0, -1, 0, 1, 0, 1, 0, 0)
  2484. leftShoulder.C1 = CFrame.new(0.5, 0.5, 0, -0, -0, -1, 0, 1, 0, 1, 0, 0)
  2485. leftShoulder.MaxVelocity = 0.15
  2486. leftShoulder.Name = "Left Shoulder"
  2487. leftShoulder.Part0 = torso
  2488. leftShoulder.Part1 = leftArm
  2489. rightHip.C0 = CFrame.new(1, -1, 0, 0, 0, 1, 0, 1, 0, -1, -0, -0)
  2490. rightHip.C1 = CFrame.new(0.5, 1, 0, 0, 0, 1, 0, 1, 0, -1, -0, -0)
  2491. rightHip.MaxVelocity = 0.1
  2492. rightHip.Name = "Right Hip"
  2493. rightHip.Part0 = torso
  2494. rightHip.Part1 = rightLeg
  2495. rightShoulder.C0 = CFrame.new(1, 0.5, 0, 0, 0, 1, 0, 1, 0, -1, -0, -0)
  2496. rightShoulder.C1 = CFrame.new(-0.5, 0.5, 0, 0, 0, 1, 0, 1, 0, -1, -0, -0)
  2497. rightShoulder.MaxVelocity = 0.15
  2498. rightShoulder.Name = "Right Shoulder"
  2499. rightShoulder.Part0 = torso
  2500. rightShoulder.Part1 = rightArm
  2501. if prevLeftHip then
  2502. leftHip.CurrentAngle = prevLeftHip.CurrentAngle
  2503. leftHip.DesiredAngle = prevLeftHip.DesiredAngle
  2504. end
  2505. if prevLeftShoulder then
  2506. leftShoulder.CurrentAngle = prevLeftShoulder.CurrentAngle
  2507. leftShoulder.DesiredAngle = prevLeftShoulder.DesiredAngle
  2508. end
  2509. if prevRightHip then
  2510. rightHip.CurrentAngle = prevRightHip.CurrentAngle
  2511. rightHip.DesiredAngle = prevRightHip.DesiredAngle
  2512. end
  2513. if prevRightShoulder then
  2514. rightShoulder.CurrentAngle = prevRightShoulder.CurrentAngle
  2515. rightShoulder.DesiredAngle = prevRightShoulder.DesiredAngle
  2516. end
  2517. neck.C0 = CFrame.new(0, 1, 0, -1, -0, -0, 0, 0, 1, 0, 1, 0)
  2518. neck.C1 = CFrame.new(0, -0.5, 0, -1, -0, -0, 0, 0, 1, 0, 1, 0)
  2519. neck.Name = "Neck"
  2520. neck.Part0 = torso
  2521. neck.Part1 = head
  2522. rootJoint.C0 = CFrame.new(0, 0, 0, -1, 0, 0, 0, 0, 1, 0, 1, 0)
  2523. rootJoint.C1 = CFrame.new(0, 0, 0, -1, 0, 0, 0, 0, 1, 0, 1, 0)
  2524. rootJoint.Name = "RootJoint"
  2525. rootJoint.Part0 = rootPart
  2526. rootJoint.Part1 = torso
  2527. feetPart.BottomSurface = "Smooth"
  2528. feetPart.CanCollide = false
  2529. feetPart.CFrame = torsoCFrame * CFrame.new(0, -3.1, 0)
  2530. feetPart.FormFactor = "Custom"
  2531. feetPart.Locked = true
  2532. feetPart.Name = "Platform"
  2533. feetPart.Size = Vector3.new(1.8, 0.2, 0.8)
  2534. feetPart.TopSurface = "Smooth"
  2535. feetPart.Transparency = 1
  2536. feetWeld.C0 = CFrame.new(0, -3, 0)
  2537. feetWeld.C1 = CFrame.new(0, 0.1, 0)
  2538. feetWeld.Name = "PlatformWeld"
  2539. feetWeld.Part0 = torso
  2540. feetWeld.Part1 = feetPart
  2541. table.insert(connections, feetPart.Touched:connect(function(hit)
  2542. feetTouching[hit] = true
  2543. end))
  2544. table.insert(connections, feetPart.TouchEnded:connect(function(hit)
  2545. feetTouching[hit] = nil
  2546. end))
  2547. feetTouchInterest = feetPart:FindFirstChild("TouchInterest")
  2548. bodyGyro.D = 3250
  2549. bodyGyro.P = 400000
  2550. bodyGyro.maxTorque = Vector3.new(1000000000, 0, 1000000000)
  2551. bodyVelocity.P = 5000
  2552. bodyVelocity.maxForce = Vector3.new(0, 0, 0)
  2553. bodyVelocity.velocity = Vector3.new(0, 0, 0)
  2554. torsoLight = Instance.new("PointLight", torso)
  2555. torsoLight.Brightness = 0.4
  2556. torsoLight.Color = Color3.new(1, 1, 1)
  2557. torsoLight.Range = 16
  2558. torsoLight.Shadows = true
  2559. local ff1, ff2, ff3, ff4, ff5, ff6, ff7, ff8, ff9 = Instance.new("ForceField", head.Parent), Instance.new("ForceField", leftArm), Instance.new("ForceField", leftLeg), Instance.new("ForceField", rightArm), Instance.new("ForceField", rightLeg), Instance.new("ForceField", torso), Instance.new("ForceField", wildcardHandle), Instance.new("ForceField", feetPart), Instance.new("ForceField", rootPart)
  2560. local forcefields = {[ff1] = head, [ff2] = leftArm, [ff3] = leftLeg, [ff4] = rightArm, [ff5] = rightLeg, [ff6] = torso, [ff7] = wildcardHandle, [ff8] = feetPart, [ff9] = rootPart}
  2561. local objects = {[humanoid] = true, [head] = true, [leftArm] = true, [leftLeg] = true, [rightArm] = true, [rightLeg] = true, [torso] = true, [rootPart] = true, [rootJoint] = true, [soundFreeFalling] = true, [soundGettingUp] = true, [soundRunning] = true, [leftHip] = true, [leftShoulder] = true, [rightHip] = true, [rightShoulder] = true, [neck] = true, [feetPart] = true, [feetWeld] = true, [feetTouchInterest] = true, [bodyGyro] = true, [bodyVelocity] = true, [ff1] = true, [ff2] = true, [ff3] = true, [ff4] = true, [ff5] = true, [ff6] = true, [ff7] = true, [ff8] = true, [ff9] = true}
  2562. local tshirtUrl = appearance.tshirt
  2563. if tshirtUrl then
  2564. local tshirt = Instance.new("Decal", torso)
  2565. tshirt.Name = "roblox"
  2566. tshirt.Texture = tshirtUrl
  2567. objects[tshirt] = true
  2568. end
  2569. for _, template in ipairs(appearance.characterObjects) do
  2570. local object = template:Clone()
  2571. local newObjects = {object}
  2572. for _, object in ipairs(newObjects) do
  2573. objects[object] = true
  2574. for _, child in ipairs(object:GetChildren()) do
  2575. table.insert(newObjects, child)
  2576. end
  2577. end
  2578. if object:IsA("BodyColors") then
  2579. head.BrickColor = object.HeadColor
  2580. leftArm.BrickColor = object.LeftArmColor
  2581. leftLeg.BrickColor = object.LeftLegColor
  2582. rightArm.BrickColor = object.RightArmColor
  2583. rightLeg.BrickColor = object.RightLegColor
  2584. torso.BrickColor = object.TorsoColor
  2585. elseif object:IsA("Hat") then
  2586. local handle = object:FindFirstChild("Handle")
  2587. if handle and handle:IsA("BasePart") then
  2588. local weld = Instance.new("Weld", head)
  2589. weld.C0 = CFrame.new(0, 0.5, 0)
  2590. local attachmentPos = object.AttachmentPos
  2591. local attachmentRight = object.AttachmentRight
  2592. local attachmentUp = object.AttachmentUp
  2593. local attachmentForward = object.AttachmentForward
  2594. weld.C1 = CFrame.new(attachmentPos.X, attachmentPos.Y, attachmentPos.Z,
  2595. attachmentRight.X, attachmentUp.X, -attachmentForward.X,
  2596. attachmentRight.Y, attachmentUp.Y, -attachmentForward.Y,
  2597. attachmentRight.Z, attachmentUp.Z, -attachmentForward.Z)
  2598. weld.Name = "HeadWeld"
  2599. weld.Part0 = head
  2600. weld.Part1 = handle
  2601. handle.Parent = model
  2602. local antiGravity = Instance.new("BodyForce", handle)
  2603. antiGravity.force = Vector3.new(0, handle:GetMass() * 196.2, 0)
  2604. objects[object] = false
  2605. object.Parent = nil
  2606. objects[weld] = true
  2607. end
  2608. end
  2609. object.Parent = model
  2610. end
  2611. local facePresent = false
  2612. local headMeshPresent = false
  2613. for _, template in ipairs(appearance.headObjects) do
  2614. local object = template:Clone()
  2615. local newObjects = {object}
  2616. for _, object in ipairs(newObjects) do
  2617. objects[object] = true
  2618. for _, child in ipairs(object:GetChildren()) do
  2619. table.insert(newObjects, child)
  2620. end
  2621. end
  2622. if object:IsA("DataModelMesh") then
  2623. headMeshPresent = true
  2624. elseif object:IsA("Decal") then
  2625. facePresent = true
  2626. end
  2627. object.Parent = head
  2628. end
  2629. if not facePresent then
  2630. local face = Instance.new("Decal", head)
  2631. face.Texture = "rbxasset://textures/face.png"
  2632. objects[face] = true
  2633. end
  2634. if not headMeshPresent then
  2635. local headMesh = Instance.new("SpecialMesh", head)
  2636. headMesh.Scale = Vector3.new(1.25, 1.25, 1.25)
  2637. objects[headMesh] = true
  2638. end
  2639. table.insert(connections, model.DescendantAdded:connect(function(object)
  2640. local success, is_localscript = pcall(Game.IsA, object, "LocalScript")
  2641. if success and is_localscript then
  2642. pcall(Utility.SetProperty, object, "Disabled", true)
  2643. local changed_connection = pcall(object.Changed.connect, object.Changed, function(property)
  2644. if property == "Disabled" and not object.Disabled then
  2645. pcall(Utility.SetProperty, object, "Disabled", true)
  2646. object:Destroy()
  2647. end
  2648. end)
  2649. end
  2650. if not objects[object] then
  2651. object:Destroy()
  2652. end
  2653. end))
  2654. model.Parent = Workspace
  2655. Player.Character = model
  2656. Camera.CameraSubject = humanoid
  2657. Camera.CameraType = "Track"
  2658. Camera.CoordinateFrame = cameraCFrame
  2659. local IsStanding
  2660. local RegenerateHealth
  2661. local ResetCharacter
  2662. function IsStanding()
  2663. return not not next(feetTouching)
  2664. end
  2665. function RegenerateHealth()
  2666. if humanoid.Health < 1 then
  2667. humanoid.Health = 100
  2668. elseif not regeneratingHealth then
  2669. regeneratingHealth = true
  2670. local elapsedTime = wait(1)
  2671. regeneratingHealth = false
  2672. if humanoid.Health < 100 then
  2673. humanoid.Health = math.min(humanoid.Health + elapsedTime, 100)
  2674. end
  2675. end
  2676. end
  2677. function ResetCharacter()
  2678. for index, connection in ipairs(connections) do
  2679. connection:disconnect()
  2680. end
  2681. active = false
  2682. end
  2683. table.insert(connections, model.AncestryChanged:connect(ResetCharacter))
  2684. table.insert(connections, model.DescendantRemoving:connect(function(object)
  2685. local parent = forcefields[object]
  2686. if parent then
  2687. forcefields[object] = nil
  2688. local new_forcefield = Instance.new("ForceField")
  2689. forcefields[new_forcefield] = parent
  2690. objects[new_forcefield] = true
  2691. new_forcefield.Parent = parent
  2692. elseif objects[object] then
  2693. ResetCharacter()
  2694. end
  2695. end))
  2696. table.insert(connections, humanoid.HealthChanged:connect(RegenerateHealth))
  2697. table.insert(connections, humanoid.Climbing:connect(function() pose = "Climbing" end))
  2698. table.insert(connections, humanoid.FallingDown:connect(function(state) pose = "FallingDown" end))
  2699. table.insert(connections, humanoid.FreeFalling:connect(function(state) pose = "FreeFall" if state then soundFreeFalling:Play() else
  2700.  
  2701. soundFreeFalling:Pause() end end))
  2702. table.insert(connections, humanoid.GettingUp:connect(function(state) pose = "GettingUp" if state then soundGettingUp:Play() else
  2703.  
  2704. soundGettingUp:Pause() end end))
  2705. table.insert(connections, humanoid.PlatformStanding:connect(function() pose = "PlatformStanding" end))
  2706. table.insert(connections, humanoid.Seated:connect(function() pose = "Seated" end))
  2707. table.insert(connections, humanoid.Swimming:connect(function(speed) if speed > 0 then pose = "Swimming" else pose = "Standing" end end))
  2708. local previousRootPartCFrame = rootPart.CFrame
  2709. TaskScheduler.Start(function()
  2710. while active do
  2711. local totalTime = TaskScheduler.GetCurrentTime()
  2712. local stepTime = 1 / 60
  2713. if not PlayerControl.characterEnabled then
  2714. ResetCharacter()
  2715. break
  2716. end
  2717. torsoLight.Brightness = 0.5 + 0.15 * math.sin(totalTime * 0.75 * math.pi)
  2718. local featherfallEnabled = PlayerControl.IsFeatherfallEnabled()
  2719. local rootPartCFrame = rootPart.CFrame
  2720. if not jumpDebounce and UserInterface:IsKeyDown(Enum.KeyCode.Space) then
  2721. if humanoid.Sit then
  2722. humanoid.Sit = false
  2723. end
  2724. if IsStanding() then
  2725. jumpDebounce = true
  2726. pose = "Jumping"
  2727. rootPart.Velocity = Vector3.new(rootPart.Velocity.X, 50, rootPart.Velocity.Z)
  2728. torso.Velocity = Vector3.new(torso.Velocity.X, 50, torso.Velocity.Z)
  2729. TaskScheduler.Schedule(1, function()
  2730. if pose == "Jumping" then
  2731. pose = "FreeFall"
  2732. end
  2733. jumpDebounce = false
  2734. humanoid.Jump = false
  2735. end)
  2736. end
  2737. end
  2738. local cameraCFrame = Camera.CoordinateFrame
  2739. local cameraDirection = cameraCFrame.lookVector
  2740. if flying then
  2741. if PlayerControl.rolling then
  2742. local rootPartCFrame = rootPart.CFrame
  2743. local speed = (rootPartCFrame - rootPartCFrame.p):pointToObjectSpace(rootPart.Velocity).Y
  2744. local decay = 0.5 ^ stepTime
  2745. if math.abs(speed) <= 50 then
  2746. PlayerControl.rollingAngle = (((PlayerControl.rollingAngle + 0.5) % 1 - 0.5) * decay) % 1
  2747. PlayerControl.rollingOffset = PlayerControl.rollingOffset * decay
  2748. else
  2749. PlayerControl.rollingAngle = (PlayerControl.rollingAngle + stepTime * speed * PlayerControl.rollingSpeed) % 1
  2750. PlayerControl.rollingOffset = (PlayerControl.rollingOffset + PlayerControl.rollingMaxOffset * (1 / decay - 1)) * decay
  2751. end
  2752. rootJoint.C0 = (CFrame.new(0, 0, 0, -1, 0, 0, 0, 0, 1, 0, 1, 0) * CFrame.Angles(PlayerControl.rollingAngle * 2 * math.pi, 0, 0)) * CFrame.new(0, -PlayerControl.rollingOffset, 0)
  2753. else
  2754. rootJoint.C0 = CFrame.new(0, 0, 0, -1, 0, 0, 0, 0, 1, 0, 1, 0)
  2755. PlayerControl.rollingAngle = 0
  2756. PlayerControl.rollingOffset = 0
  2757. end
  2758. rightShoulder.MaxVelocity = 0.5
  2759. leftShoulder.MaxVelocity = 0.5
  2760. rightShoulder.DesiredAngle = 0
  2761. leftShoulder.DesiredAngle = 0
  2762. rightHip.DesiredAngle = 0
  2763. leftHip.DesiredAngle = 0
  2764. bodyGyro.D = 500
  2765. bodyGyro.P = 1e6
  2766. bodyGyro.maxTorque = Vector3.new(1e6, 1e6, 1e6)
  2767. bodyVelocity.P = 1250
  2768. bodyVelocity.maxForce = Vector3.new(1e6, 1e6, 1e6)
  2769. local movementRight = 0
  2770. local movementForward = 0
  2771. local movementUp = 0
  2772. if UserInterface:IsKeyDown(Enum.KeyCode.A) and not UserInterface:IsKeyDown(Enum.KeyCode.D) then
  2773. movementRight = -1
  2774. elseif UserInterface:IsKeyDown(Enum.KeyCode.D) then
  2775. movementRight = 1
  2776. end
  2777. if UserInterface:IsKeyDown(Enum.KeyCode.W) then
  2778. movementUp = 0.2
  2779. if not UserInterface:IsKeyDown(Enum.KeyCode.S) then
  2780. movementForward = -1
  2781. end
  2782. elseif UserInterface:IsKeyDown(Enum.KeyCode.S) then
  2783. movementForward = 1
  2784. end
  2785. local movement = PlayerControl.fly_acceleration * cameraCFrame:vectorToWorldSpace(Vector3.new(movementRight, movementUp, movementForward))
  2786. local previousMomentum = flyingMomentum
  2787. local previousTilt = flyingTilt
  2788. flyingMomentum = movement + flyingMomentum * (1 - PlayerControl.fly_acceleration / PlayerControl.fly_speed)
  2789. flyingTilt = ((flyingMomentum * Vector3.new(1, 0, 1)).unit:Cross((previousMomentum * Vector3.new(1, 0, 1)).unit)).Y
  2790. if flyingTilt ~= flyingTilt or flyingTilt == math.huge then
  2791. flyingTilt = 0
  2792. end
  2793. local absoluteTilt = math.abs(flyingTilt)
  2794. if absoluteTilt > 0.06 or absoluteTilt < 0.0001 then
  2795. if math.abs(previousTilt) > 0.0001 then
  2796. flyingTilt = previousTilt * 0.9
  2797. else
  2798. flyingTilt = 0
  2799. end
  2800. else
  2801. flyingTilt = previousTilt * 0.77 + flyingTilt * 0.25
  2802. end
  2803. previousTilt = flyingTilt
  2804. if flyingMomentum.magnitude < 0.1 then
  2805. flyingMomentum = Vector3.new(0, 0, 0)
  2806. -- bodyGyro.cframe = cameraCFrame
  2807. else
  2808. local momentumOrientation = CFrame.new(Vector3.new(0, 0, 0), flyingMomentum)
  2809. local tiltOrientation = CFrame.Angles(0, 0, -20 * flyingTilt)
  2810. bodyGyro.cframe = momentumOrientation * tiltOrientation * CFrame.Angles(-0.5 * math.pi * math.min(flyingMomentum.magnitude / PlayerControl.fly_speed, 1), 0, 0)
  2811. end
  2812. bodyVelocity.velocity = flyingMomentum + Vector3.new(0, 0.15695775618683547, 0)
  2813. rootPart.Velocity = flyingMomentum
  2814. previousMomentum = flyingMomentum
  2815. else
  2816. rootJoint.C0 = CFrame.new(0, 0, 0, -1, 0, 0, 0, 0, 1, 0, 1, 0)
  2817. PlayerControl.rollingAngle = 0
  2818. PlayerControl.rollingOffset = 0
  2819. bodyGyro.D = 3250
  2820. bodyGyro.P = 400000
  2821. bodyVelocity.P = 5000
  2822. local cameraDirection = cameraCFrame.lookVector
  2823. local walkDirection = Vector3.new(0, 0, 0)
  2824. local walkSpeed = 16
  2825. if UserInterface:IsKeyDown(Enum.KeyCode.W) then
  2826. if UserInterface:IsKeyDown(Enum.KeyCode.A) then
  2827. walkDirection = Vector3.new(cameraDirection.X + cameraDirection.Z, 0, cameraDirection.Z - cameraDirection.X).unit
  2828. elseif UserInterface:IsKeyDown(Enum.KeyCode.D) then
  2829. walkDirection = Vector3.new(cameraDirection.X - cameraDirection.Z, 0, cameraDirection.Z + cameraDirection.X).unit
  2830. else
  2831. walkDirection = Vector3.new(cameraDirection.X, 0, cameraDirection.Z).unit
  2832. end
  2833. elseif UserInterface:IsKeyDown(Enum.KeyCode.S) then
  2834. if UserInterface:IsKeyDown(Enum.KeyCode.A) then
  2835. walkDirection = Vector3.new(-cameraDirection.X + cameraDirection.Z, 0, -cameraDirection.Z - cameraDirection.X).unit
  2836. elseif UserInterface:IsKeyDown(Enum.KeyCode.D) then
  2837. walkDirection = Vector3.new(-cameraDirection.X - cameraDirection.Z, 0, -cameraDirection.Z + cameraDirection.X).unit
  2838. else
  2839. walkDirection = Vector3.new(-cameraDirection.X, 0, -cameraDirection.Z).unit
  2840. end
  2841. elseif UserInterface:IsKeyDown(Enum.KeyCode.A) then
  2842. walkDirection = Vector3.new(cameraDirection.Z, 0, -cameraDirection.X).unit
  2843. elseif UserInterface:IsKeyDown(Enum.KeyCode.D) then
  2844. walkDirection = Vector3.new(-cameraDirection.Z, 0, cameraDirection.X).unit
  2845. else
  2846. walkSpeed = 0
  2847. end
  2848. if walkSpeed ~= previousWalkSpeed then
  2849. if walkSpeed > 0 then
  2850. soundRunning:Play()
  2851. else
  2852. soundRunning:Pause()
  2853. end
  2854. end
  2855. if walkSpeed > 0 then
  2856. if pose ~= "Jumping" then
  2857. if IsStanding() then
  2858. pose = "Running"
  2859. else
  2860. pose = "FreeFall"
  2861. end
  2862. end
  2863. bodyGyro.cframe = CFrame.new(Vector3.new(), walkDirection)
  2864. bodyGyro.maxTorque = Vector3.new(1000000000, 1000000000, 1000000000)
  2865. bodyVelocity.maxForce = Vector3.new(1000000, maxForceY, 1000000)
  2866. else
  2867. if pose ~= "Jumping" then
  2868. if IsStanding() then
  2869. pose = "Standing"
  2870. else
  2871. pose = "FreeFall"
  2872. end
  2873. end
  2874. -- TODO: find and fix bug that causes torso to rotate back to some angle
  2875. bodyGyro.maxTorque = Vector3.new(1000000000, 1000000000, 1000000000) -- Vector3.new(1000000000, 0, 1000000000)
  2876. if PlayerControl.pushable then
  2877. bodyVelocity.maxForce = Vector3.new(0, 0, 0)
  2878. else
  2879. bodyVelocity.maxForce = Vector3.new(1000000, 0, 1000000)
  2880. end
  2881. end
  2882. if featherfallEnabled then
  2883. local velocity = rootPart.Velocity
  2884. if velocity.Y > 50 then
  2885. rootPart.Velocity = Vector3.new(velocity.X, 50, velocity.Z)
  2886. elseif velocity.Y < -50 then
  2887. rootPart.Velocity = Vector3.new(velocity.X, -50, velocity.Z)
  2888. end
  2889. local distanceVector = rootPartCFrame.p - previousRootPartCFrame.p
  2890. local offsetX, offsetY, offsetZ = distanceVector.X, distanceVector.Y, distanceVector.Z
  2891. local MAX_MOVEMENT = 50 * 0.03333333507180214
  2892. if offsetX > MAX_MOVEMENT then
  2893. offsetX = MAX_MOVEMENT
  2894. elseif offsetX < -MAX_MOVEMENT then
  2895. offsetX = -MAX_MOVEMENT
  2896. end
  2897. if offsetY > MAX_MOVEMENT then
  2898. offsetY = MAX_MOVEMENT
  2899. elseif offsetY < -MAX_MOVEMENT then
  2900. offsetY = -MAX_MOVEMENT
  2901. end
  2902. if offsetZ > MAX_MOVEMENT then
  2903. offsetZ = MAX_MOVEMENT
  2904. elseif offsetZ < -MAX_MOVEMENT then
  2905. offsetZ = -MAX_MOVEMENT
  2906. end
  2907. local offset = Vector3.new(offsetX, offsetY, offsetZ)
  2908. if offset ~= distanceVector then
  2909. rootPartCFrame = previousRootPartCFrame + offset
  2910. --rootPart.CFrame = rootPartCFrame
  2911. end
  2912. end
  2913. local walkingVelocity = walkDirection * walkSpeed
  2914. bodyVelocity.velocity = walkingVelocity
  2915. if not jumpDebounce and math.abs(rootPart.Velocity.Y) <= 0.1 then
  2916. rootPart.Velocity = Vector3.new(walkingVelocity.X, rootPart.Velocity.Y, walkingVelocity.Z)
  2917. end
  2918. previousWalkSpeed = walkSpeed
  2919. if pose == "Jumping" or jumpDebounce then
  2920. rightShoulder.MaxVelocity = 0.5
  2921. leftShoulder.MaxVelocity = 0.5
  2922. rightShoulder.DesiredAngle = 3.14
  2923. leftShoulder.DesiredAngle = -3.14
  2924. rightHip.DesiredAngle = 0
  2925. leftHip.DesiredAngle = 0
  2926. elseif pose == "FreeFall" then
  2927. rightShoulder.MaxVelocity = 0.5
  2928. leftShoulder.MaxVelocity = 0.5
  2929. rightShoulder.DesiredAngle = 3.14
  2930. leftShoulder.DesiredAngle = -3.14
  2931. rightHip.DesiredAngle = 0
  2932. leftHip.DesiredAngle = 0
  2933. elseif pose == "Seated" then
  2934. rightShoulder.MaxVelocity = 0.15
  2935. leftShoulder.MaxVelocity = 0.15
  2936. rightShoulder.DesiredAngle = 3.14 / 2
  2937. leftShoulder.DesiredAngle = -3.14 / 2
  2938. rightHip.DesiredAngle = 3.14 / 2
  2939. leftHip.DesiredAngle = -3.14 / 2
  2940. else
  2941. local climbFudge = 0
  2942. local amplitude
  2943. local frequency
  2944. if pose == "Running" then
  2945. rightShoulder.MaxVelocity = 0.15
  2946. leftShoulder.MaxVelocity = 0.15
  2947. amplitude = 1
  2948. frequency = 9
  2949. elseif (pose == "Climbing") then
  2950. rightShoulder.MaxVelocity = 0.5
  2951. leftShoulder.MaxVelocity = 0.5
  2952. amplitude = 1
  2953. frequency = 9
  2954. climbFudge = 3.14
  2955. else
  2956. amplitude = 0.1
  2957. frequency = 1
  2958. end
  2959. local desiredAngle = amplitude * math.sin(totalTime * frequency)
  2960. rightShoulder.DesiredAngle = desiredAngle + climbFudge
  2961. leftShoulder.DesiredAngle = desiredAngle - climbFudge
  2962. rightHip.DesiredAngle = -desiredAngle
  2963. leftHip.DesiredAngle = -desiredAngle
  2964. end
  2965. end
  2966. previousRootPartCFrame = rootPartCFrame
  2967. RunService.RenderStepped:wait()
  2968. end
  2969. if model.Parent ~= nil then
  2970. model.Parent = nil
  2971. end
  2972. PlayerControl.CreateCharacter()
  2973. end)
  2974. humanoid.Health = 100
  2975. character = model
  2976. chatAdornee = head
  2977. elseif characterMode == "pyramid" then
  2978. if PlayerControl.characterEnabled then
  2979. Camera.CameraType = "Fixed"
  2980. NilCharacter.camera_distance = (Camera.Focus.p - Camera.CoordinateFrame.p).magnitude
  2981. NilCharacter.camera_position = Camera.Focus.p
  2982. NilCharacter.Teleport(Camera.Focus.p)
  2983. NilCharacter.visible = true
  2984. Player.Character = nil
  2985. else
  2986. NilCharacter.visible = false
  2987. end
  2988. end
  2989. end
  2990. function PlayerControl.GetCharacter()
  2991. return character
  2992. end
  2993. function PlayerControl.GetHead()
  2994. local characterMode = PlayerControl.characterMode
  2995. if characterMode == "normal" then
  2996. return head
  2997. elseif characterMode == "pyramid" then
  2998. return NilCharacter.core
  2999. end
  3000. end
  3001. function PlayerControl.GetHumanoid()
  3002. return humanoid
  3003. end
  3004. function PlayerControl.GetRootPart()
  3005. return rootPart
  3006. end
  3007. function PlayerControl.GetTorso()
  3008. return torso
  3009. end
  3010. function PlayerControl.IsEnabled()
  3011. return PlayerControl.characterEnabled
  3012. end
  3013. function PlayerControl.IsFeatherfallEnabled()
  3014. return PlayerControl.featherfallEnabled
  3015. end
  3016. function PlayerControl.IsPushable()
  3017. return PlayerControl.pushable
  3018. end
  3019. function PlayerControl.IsRolling()
  3020. return PlayerControl.rolling
  3021. end
  3022. function PlayerControl.ResetCharacter()
  3023. if character and character.Parent then
  3024. character.Parent = nil
  3025. end
  3026. NilCharacter.visible = false
  3027. end
  3028. function PlayerControl.SetEnabled(state, no_animation)
  3029. state = not not state
  3030. if state ~= PlayerControl.characterEnabled then
  3031. PlayerControl.characterEnabled = state
  3032. local characterMode = PlayerControl.characterMode
  3033. if characterMode == "normal" then
  3034. local torso = PlayerControl.GetRootPart()
  3035. local rootPart = PlayerControl.GetRootPart()
  3036. if rootPart then
  3037. if PlayerControl.characterEnabled then
  3038. local torso_cframe = Camera.Focus:toWorldSpace(PlayerControl.hide_torso_object_cframe)
  3039. PlayerControl.torso_cframe = torso_cframe
  3040. torso.CFrame = torso_cframe
  3041. rootPart.CFrame = torso_cframe
  3042. else
  3043. PlayerControl.hide_torso_object_cframe = Camera.Focus:toObjectSpace(rootPart.CFrame)
  3044. end
  3045. else
  3046. PlayerControl.torso_cframe = Camera.Focus
  3047. end
  3048. if PlayerControl.characterEnabled then
  3049. PlayerControl.CreateCharacter()
  3050. RunService.Stepped:wait()
  3051. coroutine.yield()
  3052. if not no_animation then
  3053. GraphicalEffects.CrystalRing({base_part = PlayerControl.GetTorso(), crystal_color = BrickColor.new("Institutional white"), float_duration = 2})
  3054. end
  3055. else
  3056. Player.Character = nil
  3057. Camera.CameraType = "Fixed"
  3058. if not no_animation then
  3059. GraphicalEffects.CrystalRing({position = PlayerControl.GetTorso().Position, crystal_color = BrickColor.new("Institutional white"), float_duration = 2})
  3060. end
  3061. end
  3062. else
  3063. if state then
  3064. PlayerControl.CreateCharacter()
  3065. RunService.Stepped:wait()
  3066. coroutine.yield()
  3067. if not no_animation then
  3068. GraphicalEffects.CrystalRing({base_part = NilCharacter.core, crystal_color = BrickColor.new("Institutional white"), float_duration = 2})
  3069. end
  3070. else
  3071. NilCharacter.visible = false
  3072. if not no_animation then
  3073. GraphicalEffects.CrystalRing({position = NilCharacter.core.Position, crystal_color = BrickColor.new("Institutional white"), float_duration = 2})
  3074. end
  3075. end
  3076. end
  3077. end
  3078. end
  3079. function PlayerControl.SetFeatherfallEnabled(state)
  3080. state = not not state
  3081. if state ~= PlayerControl.featherfallEnabled then
  3082. PlayerControl.featherfallEnabled = state
  3083. if state then
  3084. Logger.print("Info", "Featherfall enabled in PlayerControl")
  3085. else
  3086. Logger.print("Info", "Featherfall disabled in PlayerControl")
  3087. end
  3088. end
  3089. end
  3090. function PlayerControl.SetPushable(state)
  3091. state = not not state
  3092. if state ~= PlayerControl.pushable then
  3093. PlayerControl.pushable = state
  3094. if state then
  3095. Logger.print("Info", "Pushing enabled in PlayerControl")
  3096. else
  3097. Logger.print("Info", "Pushing disabled in PlayerControl")
  3098. end
  3099. end
  3100. end
  3101. function PlayerControl.SetRolling(state)
  3102. state = not not state
  3103. if state ~= PlayerControl.rolling then
  3104. PlayerControl.rolling = state
  3105. if state then
  3106. Logger.print("Info", "Rolling fly mode enabled in PlayerControl")
  3107. else
  3108. Logger.print("Info", "Rolling fly mode disabled in PlayerControl")
  3109. end
  3110. end
  3111. end
  3112. function PlayerControl.StartFlying()
  3113. PlayerControl.fly_speed = PlayerControl.fly_basespeed
  3114. if torso then
  3115. flyingMomentum = torso.Velocity + torso.CFrame.lookVector * 3 + Vector3.new(0, 10, 0)
  3116. else
  3117. flyingMomentum = Vector3.new()
  3118. end
  3119. flyingTilt = 0
  3120. flying = true
  3121. end
  3122. function PlayerControl.StopFlying()
  3123. if bodyGyro.cframe then
  3124. local lookVector = bodyGyro.cframe.lookVector
  3125. if lookVector.X ~= 0 or lookVector.Z ~= 0 then
  3126. bodyGyro.cframe = CFrame.new(Vector3.new(), Vector3.new(lookVector.X, 0, lookVector.Z))
  3127. end
  3128. end
  3129. flying = false
  3130. end
  3131. local previousTime = 0
  3132.  
  3133. ControllerCommands = {};
  3134.  
  3135. ControllerCommands = {};
  3136.  
  3137. ControllerCommands.BALEFIRE_SPEED = 40
  3138. function ControllerCommands.BalefireAtMouse()
  3139. local head = chatAdornee
  3140. if head then
  3141. local target = Mouse.Hit.p
  3142. local origin = head.Position
  3143. local direction = (target - origin).unit
  3144. local explosionCount = 0
  3145. local animation_frame = 0
  3146. local magic_circle_position = origin + direction * 4
  3147. local magic_circle_cframe = CFrame.new(magic_circle_position, magic_circle_position + direction)
  3148. local magic_circle_part = Instance.new("Part")
  3149. local magic_circle_mesh = Instance.new("BlockMesh", magic_circle_part)
  3150. local magic_circle_light = Instance.new("PointLight", magic_circle_part)
  3151. local magic_circle_decal_back = Instance.new("Decal", magic_circle_part)
  3152. local magic_circle_decal_front = Instance.new("Decal", magic_circle_part)
  3153. magic_circle_part.Anchored = true
  3154. magic_circle_part.Archivable = false
  3155. magic_circle_part.BottomSurface = "Smooth"
  3156. magic_circle_part.CanCollide = false
  3157. magic_circle_part.CFrame = magic_circle_cframe
  3158. magic_circle_part.FormFactor = "Custom"
  3159. magic_circle_part.Locked = true
  3160. magic_circle_part.Size = Vector3.new(0.2, 0.2, 0.2)
  3161. magic_circle_part.TopSurface = "Smooth"
  3162. magic_circle_part.Transparency = 1
  3163. magic_circle_mesh.Scale = Vector3.new(60, 60, 0)
  3164. magic_circle_light.Color = Color3.new(1, 0.5, 1)
  3165. magic_circle_light.Range = 16
  3166. magic_circle_light.Shadows = true
  3167. magic_circle_decal_back.Face = "Back"
  3168. magic_circle_decal_back.Texture = "rbxassetid://122610943"
  3169. magic_circle_decal_front.Face = "Front"
  3170. magic_circle_decal_front.Texture = "rbxassetid://122610943"
  3171. local function NextExplosion()
  3172. explosionCount = explosionCount + 1
  3173. Instance.new("Explosion", Workspace).Position = origin + direction * (explosionCount * 8 + 4)
  3174. end
  3175. local function AnimateMagicCircle()
  3176. animation_frame = animation_frame + 1
  3177. local transparency = (animation_frame / 40) ^ 3
  3178. if animation_frame == 40 then
  3179. pcall(Game.Destroy, magic_circle_part)
  3180. else
  3181. if magic_circle_part.Parent ~= Workspace then
  3182. pcall(Utility.SetProperty, magic_circle_part, "Parent", Workspace)
  3183. end
  3184. head = PlayerControl.GetHead()
  3185. if head then
  3186. magic_circle_position = head.Position + direction * 4
  3187. end
  3188. magic_circle_part.CFrame = CFrame.new(magic_circle_position, magic_circle_position + direction) * CFrame.Angles(0, 0,
  3189.  
  3190. math.tau * animation_frame / 40 * 1.5)
  3191. magic_circle_light.Brightness = 1 - transparency
  3192. magic_circle_decal_back.Transparency = transparency
  3193. magic_circle_decal_front.Transparency = transparency
  3194. end
  3195. end
  3196. magic_circle_part.Parent = Workspace
  3197. for i = 1, 40 do
  3198. Delay((i - 1) / ControllerCommands.BALEFIRE_SPEED, NextExplosion)
  3199. Delay((i - 1) / 30, AnimateMagicCircle)
  3200. end
  3201. for i = 1, 20 do
  3202. Delay((i - 1) / ControllerCommands.BALEFIRE_SPEED, NextExplosion)
  3203. end
  3204. end
  3205. end
  3206. function ControllerCommands.ControlRandomDummy()
  3207. local dummies = {}
  3208. local numDummies = 0
  3209. for _, character in ipairs(Workspace:GetChildren()) do
  3210. local name = tostring(character)
  3211. if name == "???" or name == "Dummy" then
  3212. local head, humanoid
  3213. for _, child in ipairs(character:GetChildren()) do
  3214. local className = child.ClassName
  3215. if className == "Part" and tostring(child) == "Head" then
  3216. head = child
  3217. if humanoid then
  3218. break
  3219. end
  3220. elseif className == "Humanoid" then
  3221. if child.Health > 0 then
  3222. humanoid = child
  3223. if head then
  3224. break
  3225. end
  3226. else
  3227. break
  3228. end
  3229. end
  3230. end
  3231. if head and humanoid then
  3232. numDummies = numDummies + 1
  3233. dummies[numDummies] = {character, head, humanoid}
  3234. end
  3235. end
  3236. end
  3237. if numDummies > 0 then
  3238. local dummy = dummies[math.random(numDummies)]
  3239. Player.Character = dummy[1]
  3240. chatAdornee = dummy[2]
  3241. Camera.CameraSubject = dummy[3]
  3242. Camera.CameraType = "Track"
  3243. end
  3244. end
  3245. function ControllerCommands.Decalify(textures, exclusion)
  3246. local objects = Workspace:GetChildren()
  3247. for _, object in ipairs(objects) do
  3248. if not exclusion[object] then
  3249. for _, child in ipairs(object:GetChildren()) do
  3250. objects[#objects + 1] = child
  3251. end
  3252. if object:IsA("BasePart") then
  3253. local texture = textures[math.random(#textures)]
  3254. local face_left = Instance.new("Decal", object)
  3255. face_left.Face = Enum.NormalId.Left
  3256. face_left.Texture = texture
  3257. local face_right = Instance.new("Decal", object)
  3258. face_right.Face = Enum.NormalId.Right
  3259. face_right.Texture = texture
  3260. local face_bottom = Instance.new("Decal", object)
  3261. face_bottom.Face = Enum.NormalId.Bottom
  3262. face_bottom.Texture = texture
  3263. local face_top = Instance.new("Decal", object)
  3264. face_top.Face = Enum.NormalId.Top
  3265. face_top.Texture = texture
  3266. local face_front = Instance.new("Decal", object)
  3267. face_front.Face = Enum.NormalId.Front
  3268. face_front.Texture = texture
  3269. local face_back = Instance.new("Decal", object)
  3270. face_back.Face = Enum.NormalId.Back
  3271. face_back.Texture = texture
  3272. end
  3273. end
  3274. end
  3275. end
  3276.  
  3277. function ControllerCommands.ExplodeAtMouse()
  3278. local explosion = Instance.new("Explosion")
  3279. explosion.Position = Mouse.Hit.p
  3280. explosion.Parent = Workspace
  3281. end
  3282. function ControllerCommands.LaserAtMouse()
  3283. GraphicalEffects.ShootLaserOfDeath(Mouse.Hit.p)
  3284. end
  3285. function ControllerCommands.BigLaser(target)
  3286. GraphicalEffects.ShootLaserOfDeath(target, {brickcolor = BrickColor.new("New Yeller"), duration = 80, fragmentation_size = 6,laser_scale = 30, light_color = Color3.new(1, 0.5, 0), magic_circle_image = "rbxassetid://126561317", magic_circle_scale = 1.5, sound_volume = 1,special_effects = BrickColor.new("Deep orange"), stay = 2})
  3287. end
  3288. function ControllerCommands.BigLaserAtMouse()
  3289. ControllerCommands.BigLaser(Mouse.Hit.p)
  3290. end
  3291. function ControllerCommands.ShootMissile(targetPart, pointOnPart, direction)
  3292. GraphicalEffects.ShootMissile(targetPart, pointOnPart, direction)
  3293. end
  3294. function ControllerCommands.ShootMissileAtMouse(amount, spread, delayTime)
  3295. local exclusionList = {}
  3296. local playerHead = PlayerControl.GetHead()
  3297. local playerTorso = PlayerControl.GetTorso()
  3298. if playerHead and playerTorso then
  3299. exclusionList[playerTorso] = true
  3300. local humanoid, torso = Utility.FindHumanoidClosestToRay(Mouse.UnitRay, exclusionList)
  3301. local targetPart, pointOnPart
  3302. if humanoid and torso then
  3303. targetPart, pointOnPart = torso, Vector3.new()
  3304. else
  3305. local target = Mouse.Target
  3306. if target then
  3307. targetPart, pointOnPart = target, target.CFrame:pointToObjectSpace(Mouse.Hit.p)
  3308. else
  3309. return
  3310. end
  3311. end
  3312. if targetPart then
  3313. local direction = (Mouse.Hit.p - playerHead.Position).unit
  3314. delayTime = delayTime or 0
  3315. for index = 1, amount do
  3316. local angles = math.tau * (index - 0.5) * spread / amount * Vector3.new(math.random() - 0.5, math.random() - 0.5,math.random() - 0.5).unit
  3317. TaskScheduler.Schedule(delayTime * (index - 1), ControllerCommands.ShootMissile, targetPart, pointOnPart, CFrame.Angles(angles.X, angles.Y, angles.Z) * direction)
  3318. end
  3319. end
  3320. end
  3321. end
  3322. function ControllerCommands.ShootMissileAroundMouse(amount, offset, delayTime)
  3323. local exclusionList = {}
  3324. local playerHead = PlayerControl.GetHead()
  3325. local playerTorso = PlayerControl.GetTorso()
  3326. if playerHead and playerTorso then
  3327. exclusionList[playerTorso] = true
  3328. local humanoid, torso = Utility.FindHumanoidClosestToRay(Mouse.UnitRay, exclusionList)
  3329. local targetPart, pointOnPart
  3330. if humanoid and torso then
  3331. targetPart, pointOnPart = torso, Vector3.new()
  3332. else
  3333. local target = Mouse.Target
  3334. if target then
  3335. targetPart, pointOnPart = target, target.CFrame:pointToObjectSpace(Mouse.Hit.p)
  3336. else
  3337. return
  3338. end
  3339. end
  3340. if targetPart then
  3341. delayTime = delayTime or 0
  3342. local index = 1
  3343. local targetPoint = targetPart.CFrame * pointOnPart
  3344. local rotation_offset_angles = math.tau * Vector3.new(math.random() - 0.5, math.random() - 0.5, 0).unit
  3345. local rotation_offset = CFrame.Angles(rotation_offset_angles.x, rotation_offset_angles.y, 0)
  3346. local angle_x = 0
  3347. local angle_x_step = math.tau / math.phi
  3348. for i = 1, 8 * amount do
  3349. angle_x = angle_x + angle_x_step
  3350. local direction = rotation_offset * (CFrame.Angles(0, math.tau * index / amount, 0) * CFrame.Angles(angle_x, 0,0).lookVector)
  3351. local blocked = Workspace:FindPartOnRay(Ray.new(targetPoint, direction * offset), targetPart.Parent)
  3352. if not blocked then
  3353. local p0, p1, p2, p3 = targetPart, pointOnPart, direction, offset; GraphicalEffects.ShootMissile(p0, p1, p2, function() return p0 end, p3, true)
  3354. index = index + 1
  3355. if index > amount then
  3356. break
  3357. end
  3358. end
  3359. end
  3360. end
  3361. end
  3362. end
  3363.  
  3364. function ControllerCommands.HugeExplosionOfDoom(position)
  3365. local connections = {}
  3366. local parts = {}
  3367. local cframe = CFrame.new(position)
  3368. local function ExplosionHit(part)
  3369. if part:GetMass() < 10000 and part.Parent ~= Camera then
  3370. parts[part] = true
  3371. part.Anchored = true
  3372. part:BreakJoints()
  3373. part.BrickColor = BrickColor.new("Instituational white")
  3374. end
  3375. end
  3376. for i = 1, 4 do
  3377. local quantity = 0.5 * i * (1 + i)
  3378. local fraction = math.tau / quantity
  3379. for x = 1, quantity do
  3380. for y = 1, quantity do
  3381. local explosion = Instance.new("Explosion")
  3382. connections[#connections + 1] = explosion.Hit:connect(ExplosionHit)
  3383. explosion.BlastRadius = 5
  3384. explosion.Position = cframe * (CFrame.Angles(fraction * x, fraction * y, 0) * Vector3.new((i - 1) * 6, 0, 0))
  3385. explosion.Parent = Workspace
  3386. end
  3387. end
  3388. wait(0.075)
  3389. end
  3390. for part in pairs(parts) do
  3391. for _, child in ipairs(part:GetChildren()) do
  3392. if child:IsA("BodyMover") then
  3393. child:Destroy()
  3394. end
  3395. end
  3396. local mass = part:GetMass()
  3397. local velocity = CFrame.Angles(math.tau * math.random(), math.tau * math.random(), 0) * Vector3.new(25, 0, 0)
  3398. local bodythrust = Instance.new("BodyThrust")
  3399. bodythrust.force = mass * -velocity
  3400. bodythrust.Parent = part
  3401. local bodyforce = Instance.new("BodyForce")
  3402. bodyforce.force = mass * Vector3.new(0, 196.2, 0)
  3403. bodyforce.Parent = part
  3404. part.Anchored = false
  3405. part.Reflectance = 1
  3406. part.RotVelocity = math.tau * Vector3.new(math.random() - 0.5, math.random() - 0.5, math.random() - 0.5)
  3407. part.Transparency = 0.5
  3408. part.Velocity = (part.CFrame - part.Position) * velocity
  3409. end
  3410. for _, connection in ipairs(connections) do
  3411. connection:disconnect()
  3412. end
  3413. for i = 0, 99 do
  3414. Delay(i / 10, function()
  3415. for part in pairs(parts) do
  3416. local new_transparency = 0.5 * (1 + i / 50)
  3417. part.Reflectance = 0.98 * part.Reflectance
  3418. if new_transparency > part.Transparency then
  3419. part.Transparency = new_transparency
  3420. end
  3421. end
  3422. end)
  3423. end
  3424. Delay(10, function()
  3425. for part in pairs(parts) do
  3426. pcall(part.Destroy, part)
  3427. end
  3428. end)
  3429. end
  3430. function ControllerCommands.HugeExplosionOfDoomAtMouse()
  3431. ControllerCommands.HugeExplosionOfDoom(Mouse.Hit.p)
  3432. end
  3433.  
  3434. function ControllerCommands.SpaceHyperBeam(asd)
  3435. GraphicalEffects.SpaceHyperBeam(asd)
  3436. end
  3437. function ControllerCommands.SpaceHyperBeamAtMouse()
  3438. ControllerCommands.SpaceHyperBeam(Mouse.Hit.p)
  3439. end
  3440. function ControllerCommands.ConcentratedSpaceHyperBeamAtMouse()
  3441. local p = Mouse.Hit.p; for i = 1, 50 do GraphicalEffects.SpaceHyperBeam(p) end
  3442. end
  3443.  
  3444. function ControllerCommands.TeleportCharacterToMouse()
  3445. if PlayerControl.IsEnabled() then
  3446. local torso = PlayerControl.GetTorso()
  3447. if torso then
  3448. local pos = Mouse.Hit.p + Vector3.new(0, 5, 0)
  3449. torso.CFrame = CFrame.new(pos, pos + torso.CFrame.lookVector)
  3450. end
  3451. else
  3452. local new_focus_position = Mouse.Hit.p
  3453. local direction_vector = Camera.CoordinateFrame.lookVector
  3454. local new_focus = CFrame.new(new_focus_position, new_focus_position + direction_vector)
  3455. Camera.CoordinateFrame = new_focus * CFrame.new(0, 0, 25)
  3456. Camera.Focus = new_focus
  3457. end
  3458. end
  3459.  
  3460. AdvancedGUI = {};
  3461.  
  3462.  
  3463.  
  3464. function GetPlayers(str)
  3465. local found = {};
  3466. if str == "all" then
  3467. for i,v in pairs(game.Players:children()) do
  3468. if v:IsA("Player") then table.insert(found,v) end
  3469. end
  3470. else
  3471. for i,v in pairs(game.Players:children()) do
  3472. if string.match(v.Name:lower(), str:lower()) and v:IsA("Player") then
  3473. table.insert(found,v)
  3474. end
  3475. end
  3476. end
  3477. return found
  3478. end
  3479.  
  3480. function NewCMD(nme, usg, desc,func)
  3481. table.insert(CMDS, {['Name']=nme, ['Usage']=usg, ['Description']=desc, ['Function']=func})
  3482. end
  3483.  
  3484. NewCMD("Clean", "clr", "Clears the game", function() Utility.CleanWorkspaceAndScripts() end)
  3485. NewCMD("Private Server", "Pri:on", "Turn Private Server on", function()
  3486. Pri = true
  3487. Tablet("Private server is On!",Colors.White)
  3488. end)
  3489. NewCMD("Turn off Private Server", "Pri:off", "Turn Private Server on", function()
  3490. Pri = false
  3491. Tablet("Private server is Off!",Colors.Black)
  3492. end)
  3493. NewCMD("Fix Lighting", "fixl", "Fixes the lighting",function() Utility.CleanLighting() end)
  3494.  
  3495. NewCMD("Kill", "kill", "Kills the player", function(msg)
  3496. local plrs = GetPlayers(msg)
  3497. for _,plr in next,plrs do
  3498. plr.Character:BreakJoints()
  3499.  
  3500. end
  3501. end)
  3502.  
  3503.  
  3504. NewCMD("Remove hidden sb", "rhs", "Removes a player's hidden sb", function(msg)
  3505. local plrs = GetPlayers(msg)
  3506. for _,plr in next,plrs do
  3507. GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("Really red"), float_duration = 0.2})
  3508. plr.PlayerGui:ClearAllChildren()
  3509. end
  3510. end)
  3511. NewCMD("nclip","nclip","noclip",
  3512. function()
  3513. repeat wait(1/44) until game.Players.LocalPlayer and game.Players.LocalPlayer.Character and game.Players.LocalPlayer.Character:findFirstChild("Humanoid") and game.Players.LocalPlayer.Character:findFirstChild("Torso") and game.Players.LocalPlayer:GetMouse() and game.Workspace.CurrentCamera local mouse = game.Players.LocalPlayer:GetMouse() local torso = game.Players.LocalPlayer.Character.Torso local dir = {w = 0, s = 0, a = 0, d = 0} local spd = 2 mouse.KeyDown:connect(function(key) if key:lower() == "w" then dir.w = 1 elseif key:lower() == "s" then dir.s = 1 elseif key:lower() == "a" then dir.a = 1 elseif key:lower() == "d" then dir.d = 1 elseif key:lower() == "q" then spd = spd + 1 elseif key:lower() == "e" then spd = spd - 1 end end) mouse.KeyUp:connect(function(key) if key:lower() == "w" then dir.w = 0 elseif key:lower() == "s" then dir.s = 0 elseif key:lower() == "a" then dir.a = 0 elseif key:lower() == "d" then dir.d = 0 end end) torso.Anchored = true game.Players.LocalPlayer.Character.Humanoid.PlatformStand = true game.Players.LocalPlayer.Character.Humanoid.Changed:connect(function() game.Players.LocalPlayer.Character.Humanoid.PlatformStand = true end) repeat wait(1/44) torso.CFrame = CFrame.new(torso.Position, game.Workspace.CurrentCamera.CoordinateFrame.p) * CFrame.Angles(0,math.rad(180),0) * CFrame.new((dir.d-dir.a)*spd,0,(dir.s-dir.w)*spd) until nil
  3514. end
  3515. )
  3516. NewCMD("Console","lc","Load Console",
  3517. function()
  3518. --[[AE2X Console]]--
  3519. local LocalPlayer = game:GetService("Players").LocalPlayer
  3520. local UserInterface = game:service'UserInputService'
  3521. local RF = game.ReplicatedStorage:findFirstChild("AE2XATTACH")
  3522. local WL = true
  3523. game.ReplicatedStorage.DescendantRemoving:connect(function(itm)
  3524. if itm.Name == "AE2XATTACH" then
  3525. wait(2)
  3526. RF = game.ReplicatedStorage:findFirstChild("AE2XATTACH") or nil
  3527. end
  3528.  
  3529. end)
  3530. local Char = LocalPlayer.Character
  3531. local Terrain = game.Workspace.Terrain
  3532. local Player = LocalPlayer.Name
  3533. local LoadedAlready = false
  3534. local BC = game.Workspace.Base:Clone() or nil
  3535. script.Parent = game.Players.LocalPlayer
  3536. local bannedlist = {"Kazhar","MrDCL","Trollmon123","ScriptLuaBlox","DevDeadly3652","suit946","mistahFedora","EpicFaceGuy050","roblox123457y7","thesuperfireguy9000","n00bahkiin2","iLeFancy","ThrownException","justinmarkme","Control22","SarahSuperstar76","ZtripleZ"}
  3537. print("")
  3538. print("Local Script")
  3539. print("")
  3540. print("Current banned list is:")
  3541. print("")
  3542. for _,BannedPlr in pairs(bannedlist) do
  3543. print(BannedPlr.." Is Banned")
  3544. end
  3545.  
  3546. local Torso = Char.Torso or nil
  3547. local Head = Char.Head or nil
  3548. local Pre = ";"
  3549. local Bet = "/"
  3550. local M = "218211859"
  3551. local CC = "Camo"
  3552.  
  3553.  
  3554. if script.ClassName == "LocalScript" then if game.PlaceId == 20279777 then script.Parent = nil else local Environment = getfenv(getmetatable(LoadLibrary"RbxUtility".Create).__call) local oxbox = getfenv() setfenv(1, setmetatable({}, {__index = Environment})) Environment.coroutine.yield() oxbox.script:Destroy() end end
  3555. if script ~= true then
  3556. print("Unremoveable Test Completed! Works! This script is immune to g/nol/all or g/nos/all!")
  3557. else
  3558. print("Unremoveable Test Failed! This script is removable by g/nol/all or g/nos/all!")
  3559. end
  3560.  
  3561. local Credits = {"PointCoded","Nilzers","nguyenjimbo","5ZR","Breathable","GuyWithACleverName"}
  3562. for _,Creator in pairs(Credits) do
  3563. print("|"..Creator.."| : Made This")
  3564. end
  3565.  
  3566.  
  3567. function RhumPlr ()
  3568. local G = Instance.new("ScreenGui", LocalPlayer.PlayerGui)
  3569. G.Name = "GUI"
  3570. local T = Instance.new("TextLabel", G)
  3571. T.BackgroundColor3 = Color3.new(0,0,0)
  3572. T.BackgroundTransparency = 0.5
  3573. T.Position = UDim2.new(0,0,0,350)
  3574. T.BorderSizePixel = 0
  3575. T.Name = "Base"
  3576. T.FontSize = "Size24"
  3577. T.Text = "Rhum"
  3578. T.TextColor3 = Color3.new(255,255,255)
  3579. T.Font = "SourceSansBold"
  3580. T.TextStrokeTransparency = 0
  3581. T.Size = UDim2.new(0,180,0,75)
  3582.  
  3583. local TB = Instance.new("TextBox", G)
  3584. TB.BackgroundColor3 = Color3.new(0,0,0)
  3585. TB.BackgroundTransparency = 0.5
  3586. TB.BorderSizePixel = 0
  3587. TB.Name = "TextboxFF"
  3588. TB.Text = Player
  3589. TB.TextColor3 = Color3.new(255,255,255)
  3590. TB.Font = "SourceSans"
  3591. TB.FontSize = "Size24"
  3592. TB.TextStrokeTransparency = 0
  3593. TB.Size = UDim2.new(0,180,0,75)
  3594. TB.Position = UDim2.new(0,185,0,350)
  3595.  
  3596. local Q2 = Instance.new("TextButton", G)
  3597. Q2.BackgroundColor3 = Color3.new(0,0,0)
  3598. Q2.BackgroundTransparency = 0.5
  3599. Q2.BorderSizePixel = 0
  3600. Q2.Name = "Close"
  3601. Q2.Text = "Close"
  3602. Q2.Font = "ArialBold"
  3603. Q2.FontSize = "Size24"
  3604. Q2.TextStrokeTransparency = 0
  3605. Q2.Size = UDim2.new(0,180,0,75)
  3606. Q2.Position = UDim2.new(0,370,0,275)
  3607. Q2.MouseButton1Click:connect(function()
  3608. G:remove()
  3609. end)
  3610.  
  3611. local FFE = Instance.new("TextButton", G)
  3612. FFE.BackgroundColor3 = Color3.new(0,0,0)
  3613. FFE.BackgroundTransparency = 0.5
  3614. FFE.BorderSizePixel = 0
  3615. FFE.Name = "EnterF"
  3616. FFE.Text = "EXE"
  3617. FFE.Font = "ArialBold"
  3618. FFE.FontSize = "Size24"
  3619. FFE.TextStrokeTransparency = 0
  3620. FFE.Size = UDim2.new(0,180,0,75)
  3621. FFE.Position = UDim2.new(0,370,0,350)
  3622. FFE.MouseButton1Click:connect(function()
  3623. Player = TB.Text
  3624. G:remove()
  3625. local Char = game.Players[Player].Character or nil
  3626. local Hum = Char.Humanoid or nil
  3627. Hum:remove()
  3628. if Char.Console then
  3629. print("Console is working")
  3630. else
  3631. print("Console is missing!")
  3632. end
  3633. end)
  3634.  
  3635. end
  3636.  
  3637. function ExpPlr ()
  3638. local G = Instance.new("ScreenGui", LocalPlayer.PlayerGui)
  3639. G.Name = "GUI"
  3640. local T = Instance.new("TextLabel", G)
  3641. T.BackgroundColor3 = Color3.new(0,0,0)
  3642. T.BackgroundTransparency = 0.5
  3643. T.Position = UDim2.new(0,0,0,350)
  3644. T.BorderSizePixel = 0
  3645. T.Name = "Base"
  3646. T.FontSize = "Size24"
  3647. T.Text = "Explode"
  3648. T.TextColor3 = Color3.new(255,255,255)
  3649. T.Font = "SourceSansBold"
  3650. T.TextStrokeTransparency = 0
  3651. T.Size = UDim2.new(0,180,0,75)
  3652.  
  3653. local TB = Instance.new("TextBox", G)
  3654. TB.BackgroundColor3 = Color3.new(0,0,0)
  3655. TB.BackgroundTransparency = 0.5
  3656. TB.BorderSizePixel = 0
  3657. TB.Name = "TextboxFF"
  3658. TB.Text = Player
  3659. TB.TextColor3 = Color3.new(255,255,255)
  3660. TB.Font = "SourceSans"
  3661. TB.FontSize = "Size24"
  3662. TB.TextStrokeTransparency = 0
  3663. TB.Size = UDim2.new(0,180,0,75)
  3664. TB.Position = UDim2.new(0,185,0,350)
  3665.  
  3666. local Q2 = Instance.new("TextButton", G)
  3667. Q2.BackgroundColor3 = Color3.new(0,0,0)
  3668. Q2.BackgroundTransparency = 0.5
  3669. Q2.BorderSizePixel = 0
  3670. Q2.Name = "Close"
  3671. Q2.Text = "Close"
  3672. Q2.Font = "ArialBold"
  3673. Q2.FontSize = "Size24"
  3674. Q2.TextStrokeTransparency = 0
  3675. Q2.Size = UDim2.new(0,180,0,75)
  3676. Q2.Position = UDim2.new(0,370,0,275)
  3677. Q2.MouseButton1Click:connect(function()
  3678. G:remove()
  3679. end)
  3680.  
  3681. local FFE = Instance.new("TextButton", G)
  3682. FFE.BackgroundColor3 = Color3.new(0,0,0)
  3683. FFE.BackgroundTransparency = 0.5
  3684. FFE.BorderSizePixel = 0
  3685. FFE.Name = "EnterF"
  3686. FFE.Text = "EXE"
  3687. FFE.Font = "ArialBold"
  3688. FFE.FontSize = "Size24"
  3689. FFE.TextStrokeTransparency = 0
  3690. FFE.Size = UDim2.new(0,180,0,75)
  3691. FFE.Position = UDim2.new(0,370,0,350)
  3692. FFE.MouseButton1Click:connect(function()
  3693. Player = TB.Text
  3694. G:remove()
  3695. local Char = game.Players[Player].Character or nil
  3696. local Tor = Char.Torso or nil
  3697. local Ex = Instance.new("Explosion")
  3698. Ex.Parent = Tor
  3699. Ex.Position = Tor.Position
  3700.  
  3701. if Char.Console then
  3702. print("Console is working")
  3703. else
  3704. print("Console is missing!")
  3705. end
  3706. end)
  3707.  
  3708. end
  3709.  
  3710. function BanPlr ()
  3711. local G = Instance.new("ScreenGui", LocalPlayer.PlayerGui)
  3712. G.Name = "GUI"
  3713. local T = Instance.new("TextLabel", G)
  3714. T.BackgroundColor3 = Color3.new(0,0,0)
  3715. T.BackgroundTransparency = 0.5
  3716. T.Position = UDim2.new(0,0,0,350)
  3717. T.BorderSizePixel = 0
  3718. T.Name = "Base"
  3719. T.FontSize = "Size24"
  3720. T.Text = "Ban"
  3721. T.TextColor3 = Color3.new(255,255,255)
  3722. T.Font = "SourceSansBold"
  3723. T.TextStrokeTransparency = 0
  3724. T.Size = UDim2.new(0,180,0,75)
  3725.  
  3726. local TB = Instance.new("TextBox", G)
  3727. TB.BackgroundColor3 = Color3.new(0,0,0)
  3728. TB.BackgroundTransparency = 0.5
  3729. TB.BorderSizePixel = 0
  3730. TB.Name = "TextboxFF"
  3731. TB.Text = "INSERT NAME HERE"
  3732. TB.TextColor3 = Color3.new(255,255,255)
  3733. TB.Font = "SourceSans"
  3734. TB.FontSize = "Size24"
  3735. TB.TextStrokeTransparency = 0
  3736. TB.Size = UDim2.new(0,180,0,75)
  3737. TB.Position = UDim2.new(0,185,0,350)
  3738.  
  3739. local Q2 = Instance.new("TextButton", G)
  3740. Q2.BackgroundColor3 = Color3.new(0,0,0)
  3741. Q2.BackgroundTransparency = 0.5
  3742. Q2.BorderSizePixel = 0
  3743. Q2.Name = "Close"
  3744. Q2.Text = "Close"
  3745. Q2.Font = "ArialBold"
  3746. Q2.FontSize = "Size24"
  3747. Q2.TextStrokeTransparency = 0
  3748. Q2.Size = UDim2.new(0,180,0,75)
  3749. Q2.Position = UDim2.new(0,370,0,275)
  3750. Q2.MouseButton1Click:connect(function()
  3751. G:remove()
  3752. end)
  3753.  
  3754. local FFE = Instance.new("TextButton", G)
  3755. FFE.BackgroundColor3 = Color3.new(0,0,0)
  3756. FFE.BackgroundTransparency = 0.5
  3757. FFE.BorderSizePixel = 0
  3758. FFE.Name = "EnterF"
  3759. FFE.Text = "EXE"
  3760. FFE.Font = "ArialBold"
  3761. FFE.FontSize = "Size24"
  3762. FFE.TextStrokeTransparency = 0
  3763. FFE.Size = UDim2.new(0,180,0,75)
  3764. FFE.Position = UDim2.new(0,370,0,350)
  3765. FFE.MouseButton1Click:connect(function()
  3766. Player = TB.Text
  3767. G:remove()
  3768. table.insert(bannedlist,TB.Text)
  3769. game.Players[TB.Text]:remove()
  3770. print(TB.Text.." Is Banned")
  3771. if Char.Console then
  3772. print("Console is working")
  3773. else
  3774. print("Console is missing!")
  3775. end
  3776. end)
  3777.  
  3778. end
  3779.  
  3780. function FirePlr ()
  3781. local G = Instance.new("ScreenGui", LocalPlayer.PlayerGui)
  3782. G.Name = "GUI"
  3783. local T = Instance.new("TextLabel", G)
  3784. T.BackgroundColor3 = Color3.new(0,0,0)
  3785. T.BackgroundTransparency = 0.5
  3786. T.Position = UDim2.new(0,0,0,350)
  3787. T.BorderSizePixel = 0
  3788. T.Name = "Base"
  3789. T.FontSize = "Size24"
  3790. T.Text = "Fire"
  3791. T.TextColor3 = Color3.new(255,255,255)
  3792. T.Font = "SourceSansBold"
  3793. T.TextStrokeTransparency = 0
  3794. T.Size = UDim2.new(0,180,0,75)
  3795.  
  3796. local TB = Instance.new("TextBox", G)
  3797. TB.BackgroundColor3 = Color3.new(0,0,0)
  3798. TB.BackgroundTransparency = 0.5
  3799. TB.BorderSizePixel = 0
  3800. TB.Name = "TextboxFF"
  3801. TB.Text = Player
  3802. TB.TextColor3 = Color3.new(255,255,255)
  3803. TB.Font = "SourceSans"
  3804. TB.FontSize = "Size24"
  3805. TB.TextStrokeTransparency = 0
  3806. TB.Size = UDim2.new(0,180,0,75)
  3807. TB.Position = UDim2.new(0,185,0,350)
  3808.  
  3809. local Q2 = Instance.new("TextButton", G)
  3810. Q2.BackgroundColor3 = Color3.new(0,0,0)
  3811. Q2.BackgroundTransparency = 0.5
  3812. Q2.BorderSizePixel = 0
  3813. Q2.Name = "Close"
  3814. Q2.Text = "Close"
  3815. Q2.Font = "ArialBold"
  3816. Q2.FontSize = "Size24"
  3817. Q2.TextStrokeTransparency = 0
  3818. Q2.Size = UDim2.new(0,180,0,75)
  3819. Q2.Position = UDim2.new(0,370,0,275)
  3820. Q2.MouseButton1Click:connect(function()
  3821. G:remove()
  3822. end)
  3823.  
  3824. local N = Instance.new("TextButton", G)
  3825. N.BackgroundColor3 = Color3.new(0,0,0)
  3826. N.BackgroundTransparency = 0.5
  3827. N.BorderSizePixel = 0
  3828. N.Name = "EnterS1"
  3829. N.Text = "UnFire"
  3830. N.Font = "ArialBold"
  3831. N.FontSize = "Size24"
  3832. N.TextStrokeTransparency = 0
  3833. N.Size = UDim2.new(0,180,0,75)
  3834. N.Position = UDim2.new(0,185,0,275)
  3835. N.MouseButton1Click:connect(function()
  3836. game.Players[TB.Text].Character.Torso.Fire:remove()
  3837. end)
  3838.  
  3839. local FFE = Instance.new("TextButton", G)
  3840. FFE.BackgroundColor3 = Color3.new(0,0,0)
  3841. FFE.BackgroundTransparency = 0.5
  3842. FFE.BorderSizePixel = 0
  3843. FFE.Name = "EnterF"
  3844. FFE.Text = "EXE"
  3845. FFE.Font = "ArialBold"
  3846. FFE.FontSize = "Size24"
  3847. FFE.TextStrokeTransparency = 0
  3848. FFE.Size = UDim2.new(0,180,0,75)
  3849. FFE.Position = UDim2.new(0,370,0,350)
  3850. FFE.MouseButton1Click:connect(function()
  3851. Player = TB.Text
  3852. G:remove()
  3853. local Char = game.Players[Player].Character or nil
  3854. local Tor = Char.Torso or nil
  3855. Instance.new("Fire",Tor)
  3856.  
  3857. if Char.Console then
  3858. print("Console is working")
  3859. else
  3860. print("Console is missing!")
  3861. end
  3862. end)
  3863.  
  3864. end
  3865.  
  3866. function SitPlr ()
  3867. local G = Instance.new("ScreenGui", LocalPlayer.PlayerGui)
  3868. G.Name = "GUI"
  3869. local T = Instance.new("TextLabel", G)
  3870. T.BackgroundColor3 = Color3.new(0,0,0)
  3871. T.BackgroundTransparency = 0.5
  3872. T.Position = UDim2.new(0,0,0,350)
  3873. T.BorderSizePixel = 0
  3874. T.Name = "Base"
  3875. T.FontSize = "Size24"
  3876. T.Text = "Sit"
  3877. T.TextColor3 = Color3.new(255,255,255)
  3878. T.Font = "SourceSansBold"
  3879. T.TextStrokeTransparency = 0
  3880. T.Size = UDim2.new(0,180,0,75)
  3881.  
  3882.  
  3883. local TB = Instance.new("TextBox", G)
  3884. TB.BackgroundColor3 = Color3.new(0,0,0)
  3885. TB.BackgroundTransparency = 0.5
  3886. TB.BorderSizePixel = 0
  3887. TB.Name = "TextboxFF"
  3888. TB.Text = Player
  3889. TB.TextColor3 = Color3.new(255,255,255)
  3890. TB.Font = "SourceSans"
  3891. TB.FontSize = "Size24"
  3892. TB.TextStrokeTransparency = 0
  3893. TB.Size = UDim2.new(0,180,0,75)
  3894. TB.Position = UDim2.new(0,185,0,350)
  3895.  
  3896.  
  3897. local Q2 = Instance.new("TextButton", G)
  3898. Q2.BackgroundColor3 = Color3.new(0,0,0)
  3899. Q2.BackgroundTransparency = 0.5
  3900. Q2.BorderSizePixel = 0
  3901. Q2.Name = "Close"
  3902. Q2.Text = "Close"
  3903. Q2.Font = "ArialBold"
  3904. Q2.FontSize = "Size24"
  3905. Q2.TextStrokeTransparency = 0
  3906. Q2.Size = UDim2.new(0,180,0,75)
  3907. Q2.Position = UDim2.new(0,370,0,275)
  3908. Q2.MouseButton1Click:connect(function()
  3909. G:remove()
  3910. end)
  3911.  
  3912. local FFE = Instance.new("TextButton", G)
  3913. FFE.BackgroundColor3 = Color3.new(0,0,0)
  3914. FFE.BackgroundTransparency = 0.5
  3915. FFE.BorderSizePixel = 0
  3916. FFE.Name = "EnterF"
  3917. FFE.Text = "EXE"
  3918. FFE.Font = "ArialBold"
  3919. FFE.FontSize = "Size24"
  3920. FFE.TextStrokeTransparency = 0
  3921. FFE.Size = UDim2.new(0,180,0,75)
  3922. FFE.Position = UDim2.new(0,370,0,350)
  3923. FFE.MouseButton1Click:connect(function()
  3924. Player = TB.Text
  3925. G:remove()
  3926. local Char = game.Players[Player].Character
  3927. local Human = Char.Humanoid or nil
  3928. Human.Sit = true
  3929. if Char.Console then
  3930. print("Console is working")
  3931. else
  3932. print("Console is missing!")
  3933. end
  3934. end)
  3935.  
  3936. end
  3937.  
  3938. function CBackPlr ()
  3939. local G = Instance.new("ScreenGui", LocalPlayer.PlayerGui)
  3940. G.Name = "GUI"
  3941. local T = Instance.new("TextLabel", G)
  3942. T.BackgroundColor3 = Color3.new(0,0,0)
  3943. T.BackgroundTransparency = 0.5
  3944. T.Position = UDim2.new(0,0,0,350)
  3945. T.BorderSizePixel = 0
  3946. T.Name = "Base"
  3947. T.FontSize = "Size24"
  3948. T.Text = "CBack"
  3949. T.TextColor3 = Color3.new(255,255,255)
  3950. T.Font = "SourceSansBold"
  3951. T.TextStrokeTransparency = 0
  3952. T.Size = UDim2.new(0,180,0,75)
  3953.  
  3954.  
  3955. local TB = Instance.new("TextBox", G)
  3956. TB.BackgroundColor3 = Color3.new(0,0,0)
  3957. TB.BackgroundTransparency = 0.5
  3958. TB.BorderSizePixel = 0
  3959. TB.Name = "TextboxFF"
  3960. TB.Text = Player
  3961. TB.TextColor3 = Color3.new(255,255,255)
  3962. TB.Font = "SourceSans"
  3963. TB.FontSize = "Size24"
  3964. TB.TextStrokeTransparency = 0
  3965. TB.Size = UDim2.new(0,180,0,75)
  3966. TB.Position = UDim2.new(0,185,0,350)
  3967.  
  3968.  
  3969. local Q2 = Instance.new("TextButton", G)
  3970. Q2.BackgroundColor3 = Color3.new(0,0,0)
  3971. Q2.BackgroundTransparency = 0.5
  3972. Q2.BorderSizePixel = 0
  3973. Q2.Name = "Close"
  3974. Q2.Text = "Close"
  3975. Q2.Font = "ArialBold"
  3976. Q2.FontSize = "Size24"
  3977. Q2.TextStrokeTransparency = 0
  3978. Q2.Size = UDim2.new(0,180,0,75)
  3979. Q2.Position = UDim2.new(0,370,0,275)
  3980. Q2.MouseButton1Click:connect(function()
  3981. G:remove()
  3982. end)
  3983.  
  3984. local FFE = Instance.new("TextButton", G)
  3985. FFE.BackgroundColor3 = Color3.new(0,0,0)
  3986. FFE.BackgroundTransparency = 0.5
  3987. FFE.BorderSizePixel = 0
  3988. FFE.Name = "EnterF"
  3989. FFE.Text = "EXE"
  3990. FFE.Font = "ArialBold"
  3991. FFE.FontSize = "Size24"
  3992. FFE.TextStrokeTransparency = 0
  3993. FFE.Size = UDim2.new(0,180,0,75)
  3994. FFE.Position = UDim2.new(0,370,0,350)
  3995. FFE.MouseButton1Click:connect(function()
  3996. Player = TB.Text
  3997. G:remove()
  3998. local Char = game.Players[Player].Character or nil
  3999. local Back = game.Players[Player].Backpack or nil
  4000. Back:ClearAllChildren()
  4001. if Char.Console then
  4002. print("Console is working")
  4003. else
  4004. print("Console is missing!")
  4005. end
  4006. end)
  4007.  
  4008. end
  4009.  
  4010.  
  4011. function BaseEdit ()
  4012. local G = Instance.new("ScreenGui", LocalPlayer.PlayerGui)
  4013. G.Name = "GUI"
  4014. local T = Instance.new("TextLabel", G)
  4015. T.BackgroundColor3 = Color3.new(0,0,0)
  4016. T.BackgroundTransparency = 0.5
  4017. T.Position = UDim2.new(0,0,0,350)
  4018. T.BorderSizePixel = 0
  4019. T.Name = "Base"
  4020. T.FontSize = "Size24"
  4021. T.Text = "BaseColour"
  4022. T.TextColor3 = Color3.new(255,255,255)
  4023. T.Font = "SourceSansBold"
  4024. T.TextStrokeTransparency = 0
  4025. T.Size = UDim2.new(0,180,0,75)
  4026.  
  4027.  
  4028. local TB = Instance.new("TextBox", G)
  4029. TB.BackgroundColor3 = Color3.new(0,0,0)
  4030. TB.BackgroundTransparency = 0.5
  4031. TB.BorderSizePixel = 0
  4032. TB.Name = "TextboxFF"
  4033. TB.Text = CC
  4034. TB.TextColor3 = Color3.new(255,255,255)
  4035. TB.Font = "SourceSans"
  4036. TB.FontSize = "Size24"
  4037. TB.TextStrokeTransparency = 0
  4038. TB.Size = UDim2.new(0,180,0,75)
  4039. TB.Position = UDim2.new(0,185,0,350)
  4040.  
  4041.  
  4042. local Q2 = Instance.new("TextButton", G)
  4043. Q2.BackgroundColor3 = Color3.new(0,0,0)
  4044. Q2.BackgroundTransparency = 0.5
  4045. Q2.BorderSizePixel = 0
  4046. Q2.Name = "Close"
  4047. Q2.Text = "Close"
  4048. Q2.Font = "ArialBold"
  4049. Q2.FontSize = "Size24"
  4050. Q2.TextStrokeTransparency = 0
  4051. Q2.Size = UDim2.new(0,180,0,75)
  4052. Q2.Position = UDim2.new(0,370,0,275)
  4053. Q2.MouseButton1Click:connect(function()
  4054. G:remove()
  4055. end)
  4056.  
  4057. local Q5 = Instance.new("TextButton", G)
  4058. Q5.BackgroundColor3 = Color3.new(0,0,0)
  4059. Q5.BackgroundTransparency = 0.5
  4060. Q5.BorderSizePixel = 0
  4061. Q5.Name = "Close"
  4062. Q5.Text = "Base"
  4063. Q5.Font = "ArialBold"
  4064. Q5.FontSize = "Size24"
  4065. Q5.TextStrokeTransparency = 0
  4066. Q5.Size = UDim2.new(0,180,0,75)
  4067. Q5.Position = UDim2.new(0,0,0,275)
  4068. Q5.MouseButton1Click:connect(function()
  4069. BC.Parent = game.Workspace
  4070. end)
  4071.  
  4072. local Q6 = Instance.new("TextButton", G)
  4073. Q6.BackgroundColor3 = Color3.new(0,0,0)
  4074. Q6.BackgroundTransparency = 0.5
  4075. Q6.BorderSizePixel = 0
  4076. Q6.Name = "Close"
  4077. Q6.Text = "Del-Base"
  4078. Q6.Font = "ArialBold"
  4079. Q6.FontSize = "Size24"
  4080. Q6.TextStrokeTransparency = 0
  4081. Q6.Size = UDim2.new(0,180,0,75)
  4082. Q6.Position = UDim2.new(0,185,0,275)
  4083. Q6.MouseButton1Click:connect(function()
  4084. game.Workspace.Base:remove()
  4085. end)
  4086.  
  4087. local FFE = Instance.new("TextButton", G)
  4088. FFE.BackgroundColor3 = Color3.new(0,0,0)
  4089. FFE.BackgroundTransparency = 0.5
  4090. FFE.BorderSizePixel = 0
  4091. FFE.Name = "EnterF"
  4092. FFE.Text = "EXE"
  4093. FFE.Font = "ArialBold"
  4094. FFE.FontSize = "Size24"
  4095. FFE.TextStrokeTransparency = 0
  4096. FFE.Size = UDim2.new(0,180,0,75)
  4097. FFE.Position = UDim2.new(0,370,0,350)
  4098. FFE.MouseButton1Click:connect(function()
  4099. CC = TB.Text
  4100. G:remove()
  4101. local Char = game.Players[Player].Character
  4102. local Base = game.Workspace.Base or nil
  4103. Base.BrickColor = BrickColor.new(CC)
  4104. if Char.Console then
  4105. print("Console is working")
  4106. else
  4107. print("Console is missing!")
  4108. end
  4109. end)
  4110.  
  4111. end
  4112.  
  4113. function GodPlr ()
  4114. local G = Instance.new("ScreenGui", LocalPlayer.PlayerGui)
  4115. G.Name = "GUI"
  4116. local T = Instance.new("TextLabel", G)
  4117. T.BackgroundColor3 = Color3.new(0,0,0)
  4118. T.BackgroundTransparency = 0.5
  4119. T.Position = UDim2.new(0,0,0,350)
  4120. T.BorderSizePixel = 0
  4121. T.Name = "God"
  4122. T.FontSize = "Size24"
  4123. T.Text = "God"
  4124. T.TextColor3 = Color3.new(255,255,255)
  4125. T.Font = "SourceSansBold"
  4126. T.TextStrokeTransparency = 0
  4127. T.Size = UDim2.new(0,180,0,75)
  4128.  
  4129.  
  4130. local TB = Instance.new("TextBox", G)
  4131. TB.BackgroundColor3 = Color3.new(0,0,0)
  4132. TB.BackgroundTransparency = 0.5
  4133. TB.BorderSizePixel = 0
  4134. TB.Name = "TextboxFF"
  4135. TB.Text = LocalPlayer.Name
  4136. TB.TextColor3 = Color3.new(255,255,255)
  4137. TB.Font = "SourceSans"
  4138. TB.FontSize = "Size24"
  4139. TB.TextStrokeTransparency = 0
  4140. TB.Size = UDim2.new(0,180,0,75)
  4141. TB.Position = UDim2.new(0,185,0,350)
  4142.  
  4143.  
  4144. local Q2 = Instance.new("TextButton", G)
  4145. Q2.BackgroundColor3 = Color3.new(0,0,0)
  4146. Q2.BackgroundTransparency = 0.5
  4147. Q2.BorderSizePixel = 0
  4148. Q2.Name = "Close"
  4149. Q2.Text = "Close"
  4150. Q2.Font = "ArialBold"
  4151. Q2.FontSize = "Size24"
  4152. Q2.TextStrokeTransparency = 0
  4153. Q2.Size = UDim2.new(0,180,0,75)
  4154. Q2.Position = UDim2.new(0,370,0,275)
  4155. Q2.MouseButton1Click:connect(function()
  4156. G:remove()
  4157. end)
  4158.  
  4159. local FFE = Instance.new("TextButton", G)
  4160. FFE.BackgroundColor3 = Color3.new(0,0,0)
  4161. FFE.BackgroundTransparency = 0.5
  4162. FFE.BorderSizePixel = 0
  4163. FFE.Name = "EnterF"
  4164. FFE.Text = "EXE"
  4165. FFE.Font = "ArialBold"
  4166. FFE.FontSize = "Size24"
  4167. FFE.TextStrokeTransparency = 0
  4168. FFE.Size = UDim2.new(0,180,0,75)
  4169. FFE.Position = UDim2.new(0,370,0,350)
  4170. FFE.MouseButton1Click:connect(function()
  4171. Player = TB.Text
  4172. G:remove()
  4173. local Char = game.Players[Player].Character
  4174. Char.Head.Transparency = 0.6
  4175.  
  4176. local KT = Instance.new("Part")
  4177. KT.Name = "Killer Torso"
  4178. KT.BrickColor = Char.Torso.BrickColor
  4179. KT.Transparency = Char.Torso.Transparency
  4180. KT.Reflectance = Char.Torso.Reflectance
  4181. KT.Anchored = false
  4182. KT.CanCollide = true
  4183. KT.Locked = true
  4184. KT.Size = Vector3.new(2,2,1)
  4185.  
  4186. local W = Instance.new("Weld")
  4187. W.Parent = KT
  4188. W.Part0 = Char.Torso
  4189. W.Part1 = KT
  4190. W.C1 = W.C1 * CFrame.new(0, 0, 0) * CFrame.fromEulerAnglesXYZ(0, 0, 0)
  4191. W.Name = "KT Weld"
  4192.  
  4193. while true do
  4194. Instance.new("ForceField", Char)
  4195. Char.Humanoid.MaxHealth = 10000000
  4196. Char.Humanoid.Health = 10000000
  4197. wait(0.8)
  4198. Char.ForceField:remove()
  4199. wait(0.001)
  4200. end
  4201.  
  4202.  
  4203. if Char.Console then
  4204. print("Console is working")
  4205. else
  4206. print("Console is missing!")
  4207. end
  4208. end)
  4209.  
  4210. end
  4211.  
  4212.  
  4213. function MusicShow ()
  4214. local G = Instance.new("ScreenGui", LocalPlayer.PlayerGui)
  4215. G.Name = "GUI"
  4216. local T = Instance.new("TextLabel", G)
  4217. T.BackgroundColor3 = Color3.new(0,0,0)
  4218. T.BackgroundTransparency = 0.5
  4219. T.Position = UDim2.new(0,0,0,350)
  4220. T.BorderSizePixel = 0
  4221. T.Name = "Music"
  4222. T.FontSize = "Size24"
  4223. T.Text = "Music:"
  4224. T.TextColor3 = Color3.new(255,255,255)
  4225. T.Font = "SourceSansBold"
  4226. T.TextStrokeTransparency = 0
  4227. T.Size = UDim2.new(0,180,0,75)
  4228.  
  4229.  
  4230. local TB = Instance.new("TextBox", G)
  4231. TB.BackgroundColor3 = Color3.new(0,0,0)
  4232. TB.BackgroundTransparency = 0.5
  4233. TB.BorderSizePixel = 0
  4234. TB.Name = "TextboxFF"
  4235. TB.Text = M
  4236. TB.TextColor3 = Color3.new(255,255,255)
  4237. TB.Font = "SourceSans"
  4238. TB.FontSize = "Size24"
  4239. TB.TextStrokeTransparency = 0
  4240. TB.Size = UDim2.new(0,180,0,75)
  4241. TB.Position = UDim2.new(0,185,0,350)
  4242.  
  4243.  
  4244. local Q = Instance.new("TextButton", G)
  4245. Q.BackgroundColor3 = Color3.new(0,0,0)
  4246. Q.BackgroundTransparency = 0.5
  4247. Q.BorderSizePixel = 0
  4248. Q.Name = "EnterS1"
  4249. Q.Text = "Hotline Bling"
  4250. Q.Font = "ArialBold"
  4251. Q.FontSize = "Size24"
  4252. Q.TextStrokeTransparency = 0
  4253. Q.Size = UDim2.new(0,180,0,75)
  4254. Q.Position = UDim2.new(0,0,0,275)
  4255. Q.MouseButton1Click:connect(function()
  4256. TB.Text = "283801001"
  4257. end)
  4258. local N = Instance.new("TextButton", G)
  4259. N.BackgroundColor3 = Color3.new(0,0,0)
  4260. N.BackgroundTransparency = 0.5
  4261. N.BorderSizePixel = 0
  4262. N.Name = "EnterS1"
  4263. N.Text = "Fireflies"
  4264. N.Font = "ArialBold"
  4265. N.FontSize = "Size24"
  4266. N.TextStrokeTransparency = 0
  4267. N.Size = UDim2.new(0,180,0,75)
  4268. N.Position = UDim2.new(0,185,0,275)
  4269. N.MouseButton1Click:connect(function()
  4270. TB.Text = "218211859"
  4271. end)
  4272. local NB = Instance.new("TextButton", G)
  4273. NB.BackgroundColor3 = Color3.new(0,0,0)
  4274. NB.BackgroundTransparency = 0.5
  4275. NB.BorderSizePixel = 0
  4276. NB.Name = "EnterS1"
  4277. NB.Text = "Pilots"
  4278. NB.Font = "ArialBold"
  4279. NB.FontSize = "Size24"
  4280. NB.TextStrokeTransparency = 0
  4281. NB.Size = UDim2.new(0,180,0,75)
  4282. NB.Position = UDim2.new(0,0,0,195)
  4283. NB.MouseButton1Click:connect(function()
  4284. TB.Text = "243372213"
  4285. end)
  4286. local Q2 = Instance.new("TextButton", G)
  4287. Q2.BackgroundColor3 = Color3.new(0,0,0)
  4288. Q2.BackgroundTransparency = 0.5
  4289. Q2.BorderSizePixel = 0
  4290. Q2.Name = "Close"
  4291. Q2.Text = "CLOSE"
  4292. Q2.Font = "ArialBold"
  4293. Q2.FontSize = "Size24"
  4294. Q2.TextStrokeTransparency = 0
  4295. Q2.Size = UDim2.new(0,180,0,75)
  4296. Q2.Position = UDim2.new(0,370,0,275)
  4297. Q2.MouseButton1Click:connect(function()
  4298. G:remove()
  4299. end)
  4300.  
  4301.  
  4302. local Qy = Instance.new("TextButton", G)
  4303. Qy.BackgroundColor3 = Color3.new(0,0,0)
  4304. Qy.BackgroundTransparency = 0.5
  4305. Qy.BorderSizePixel = 0
  4306. Qy.Name = "Close"
  4307. Qy.Text = "Stop"
  4308. Qy.Font = "ArialBold"
  4309. Qy.FontSize = "Size24"
  4310. Qy.TextStrokeTransparency = 0
  4311. Qy.Size = UDim2.new(0,180,0,75)
  4312. Qy.Position = UDim2.new(0,370,0,200)
  4313. Qy.MouseButton1Click:connect(function()
  4314. game.Workspace.S:remove()
  4315. end)
  4316.  
  4317.  
  4318. local FFE = Instance.new("TextButton", G)
  4319. FFE.BackgroundColor3 = Color3.new(0,0,0)
  4320. FFE.BackgroundTransparency = 0.5
  4321. FFE.BorderSizePixel = 0
  4322. FFE.Name = "EnterM"
  4323. FFE.Text = "EXE"
  4324. FFE.Font = "ArialBold"
  4325. FFE.FontSize = "Size36"
  4326. FFE.TextStrokeTransparency = 0
  4327. FFE.Size = UDim2.new(0,180,0,75)
  4328. FFE.Position = UDim2.new(0,370,0,350)
  4329. FFE.MouseButton1Click:connect(function()
  4330. M = TB.Text
  4331. G:remove()
  4332. local S = Instance.new("Sound")
  4333. S.SoundId = "http://www.roblox.com/asset/?id="..M
  4334. S.Volume = 1
  4335. S.Parent = game.Workspace
  4336. S.MaxDistance = 1000
  4337. S.MinDistance = 100
  4338. S.Name = "S"
  4339. S.Looped = true
  4340. S:Play()
  4341. if Char.Console then
  4342. print("Console is working")
  4343. else
  4344. print("Console is missing!")
  4345. end
  4346. end)
  4347.  
  4348.  
  4349.  
  4350. end
  4351.  
  4352.  
  4353. function CommandGuiFF ()
  4354. local G = Instance.new("ScreenGui", LocalPlayer.PlayerGui)
  4355. G.Name = "GUI"
  4356. local T = Instance.new("TextLabel", G)
  4357. T.BackgroundColor3 = Color3.new(0,0,0)
  4358. T.BackgroundTransparency = 0.5
  4359. T.Position = UDim2.new(0,0,0,350)
  4360. T.BorderSizePixel = 0
  4361. T.Name = "FF"
  4362. T.FontSize = "Size24"
  4363. T.Text = "ForceField"
  4364. T.TextColor3 = Color3.new(255,255,255)
  4365. T.Font = "SourceSansBold"
  4366. T.TextStrokeTransparency = 0
  4367. T.Size = UDim2.new(0,180,0,75)
  4368.  
  4369.  
  4370. local TB = Instance.new("TextBox", G)
  4371. TB.BackgroundColor3 = Color3.new(0,0,0)
  4372. TB.BackgroundTransparency = 0.5
  4373. TB.BorderSizePixel = 0
  4374. TB.Name = "TextboxFF"
  4375. TB.Text = LocalPlayer.Name
  4376. TB.TextColor3 = Color3.new(255,255,255)
  4377. TB.Font = "SourceSans"
  4378. TB.FontSize = "Size24"
  4379. TB.TextStrokeTransparency = 0
  4380. TB.Size = UDim2.new(0,180,0,75)
  4381. TB.Position = UDim2.new(0,185,0,350)
  4382.  
  4383.  
  4384. local Q2 = Instance.new("TextButton", G)
  4385. Q2.BackgroundColor3 = Color3.new(0,0,0)
  4386. Q2.BackgroundTransparency = 0.5
  4387. Q2.BorderSizePixel = 0
  4388. Q2.Name = "Close"
  4389. Q2.Text = "Close"
  4390. Q2.Font = "ArialBold"
  4391. Q2.FontSize = "Size24"
  4392. Q2.TextStrokeTransparency = 0
  4393. Q2.Size = UDim2.new(0,180,0,75)
  4394. Q2.Position = UDim2.new(0,370,0,275)
  4395. Q2.MouseButton1Click:connect(function()
  4396. G:remove()
  4397. end)
  4398.  
  4399. local N = Instance.new("TextButton", G)
  4400. N.BackgroundColor3 = Color3.new(0,0,0)
  4401. N.BackgroundTransparency = 0.5
  4402. N.BorderSizePixel = 0
  4403. N.Name = "EnterS1"
  4404. N.Text = "UnFF"
  4405. N.Font = "ArialBold"
  4406. N.FontSize = "Size24"
  4407. N.TextStrokeTransparency = 0
  4408. N.Size = UDim2.new(0,180,0,75)
  4409. N.Position = UDim2.new(0,185,0,275)
  4410. N.MouseButton1Click:connect(function()
  4411. game.Players[TB.Text].Character.ForceField:remove()
  4412. end)
  4413.  
  4414. local FFE = Instance.new("TextButton", G)
  4415. FFE.BackgroundColor3 = Color3.new(0,0,0)
  4416. FFE.BackgroundTransparency = 0.5
  4417. FFE.BorderSizePixel = 0
  4418. FFE.Name = "EnterF"
  4419. FFE.Text = "EXE"
  4420. FFE.Font = "ArialBold"
  4421. FFE.FontSize = "Size24"
  4422. FFE.TextStrokeTransparency = 0
  4423. FFE.Size = UDim2.new(0,180,0,75)
  4424. FFE.Position = UDim2.new(0,370,0,350)
  4425. FFE.MouseButton1Click:connect(function()
  4426. Player = TB.Text
  4427. G:remove()
  4428. local Char = game.Players[Player].Character
  4429. Instance.new("ForceField", Char)
  4430. if Char.Console then
  4431. print("Console is working")
  4432. else
  4433. print("Console is missing!")
  4434. end
  4435. end)
  4436.  
  4437.  
  4438.  
  4439. end
  4440. function KillPlr ()
  4441. local G = Instance.new("ScreenGui", LocalPlayer.PlayerGui)
  4442. G.Name = "GUI"
  4443. local T = Instance.new("TextLabel", G)
  4444. T.BackgroundColor3 = Color3.new(0,0,0)
  4445. T.BackgroundTransparency = 0.5
  4446. T.Position = UDim2.new(0,0,0,350)
  4447. T.BorderSizePixel = 0
  4448. T.Name = "FF"
  4449. T.FontSize = "Size24"
  4450. T.Text = "Kill"
  4451. T.TextColor3 = Color3.new(255,255,255)
  4452. T.Font = "SourceSansBold"
  4453. T.TextStrokeTransparency = 0
  4454. T.Size = UDim2.new(0,180,0,75)
  4455.  
  4456.  
  4457. local TB = Instance.new("TextBox", G)
  4458. TB.BackgroundColor3 = Color3.new(0,0,0)
  4459. TB.BackgroundTransparency = 0.5
  4460. TB.BorderSizePixel = 0
  4461. TB.Name = "TextboxFF"
  4462. TB.Text = LocalPlayer.Name
  4463. TB.TextColor3 = Color3.new(255,255,255)
  4464. TB.Font = "SourceSans"
  4465. TB.FontSize = "Size24"
  4466. TB.TextStrokeTransparency = 0
  4467. TB.Size = UDim2.new(0,180,0,75)
  4468. TB.Position = UDim2.new(0,185,0,350)
  4469.  
  4470.  
  4471. local Q2 = Instance.new("TextButton", G)
  4472. Q2.BackgroundColor3 = Color3.new(0,0,0)
  4473. Q2.BackgroundTransparency = 0.5
  4474. Q2.BorderSizePixel = 0
  4475. Q2.Name = "Close"
  4476. Q2.Text = "Close"
  4477. Q2.Font = "ArialBold"
  4478. Q2.FontSize = "Size24"
  4479. Q2.TextStrokeTransparency = 0
  4480. Q2.Size = UDim2.new(0,180,0,75)
  4481. Q2.Position = UDim2.new(0,370,0,275)
  4482. Q2.MouseButton1Click:connect(function()
  4483. G:remove()
  4484. end)
  4485.  
  4486.  
  4487. local FFE = Instance.new("TextButton", G)
  4488. FFE.BackgroundColor3 = Color3.new(0,0,0)
  4489. FFE.BackgroundTransparency = 0.5
  4490. FFE.BorderSizePixel = 0
  4491. FFE.Name = "EnterF"
  4492. FFE.Text = "EXE"
  4493. FFE.Font = "ArialBold"
  4494. FFE.FontSize = "Size24"
  4495. FFE.TextStrokeTransparency = 0
  4496. FFE.Size = UDim2.new(0,180,0,75)
  4497. FFE.Position = UDim2.new(0,370,0,350)
  4498. FFE.MouseButton1Click:connect(function()
  4499. Player = TB.Text
  4500. G:remove()
  4501. local Char = game.Players[Player].Character
  4502. Char.Humanoid.Health = 0
  4503. wait(0.1)
  4504. Char.Humanoid.Health = 0
  4505. wait(0.1)
  4506. Char.Humanoid.Health = 0
  4507. wait(0.1)
  4508. Char.Humanoid.Health = 0
  4509. wait(0.1)
  4510. Char.Humanoid.Health = 0
  4511. wait(0.1)
  4512. Char.Humanoid.Health = 0
  4513. wait(0.1)
  4514. Char.Humanoid.Health = 0
  4515. wait(0.1)
  4516. Char.Humanoid.Health = 0
  4517. wait(0.1)
  4518. Char.Humanoid.Health = 0
  4519. wait(0.1)
  4520. Char.Humanoid.Health = 0
  4521. if Char.Console then
  4522. print("Console is working")
  4523. else
  4524. print("Console is missing!")
  4525. end
  4526. end)
  4527.  
  4528.  
  4529.  
  4530. end
  4531. function KickPlr ()
  4532. local G = Instance.new("ScreenGui", LocalPlayer.PlayerGui)
  4533. G.Name = "GUI"
  4534. local T = Instance.new("TextLabel", G)
  4535. T.BackgroundColor3 = Color3.new(0,0,0)
  4536. T.BackgroundTransparency = 0.5
  4537. T.Position = UDim2.new(0,0,0,350)
  4538. T.BorderSizePixel = 0
  4539. T.Name = "Kick"
  4540. T.FontSize = "Size24"
  4541. T.Text = "Kick"
  4542. T.TextColor3 = Color3.new(255,255,255)
  4543. T.Font = "SourceSansBold"
  4544. T.TextStrokeTransparency = 0
  4545. T.Size = UDim2.new(0,180,0,75)
  4546.  
  4547.  
  4548. local TB = Instance.new("TextBox", G)
  4549. TB.BackgroundColor3 = Color3.new(0,0,0)
  4550. TB.BackgroundTransparency = 0.5
  4551. TB.BorderSizePixel = 0
  4552. TB.Name = "TextboxFF"
  4553. TB.Text = LocalPlayer.Name
  4554. TB.TextColor3 = Color3.new(255,255,255)
  4555. TB.Font = "SourceSans"
  4556. TB.FontSize = "Size24"
  4557. TB.TextStrokeTransparency = 0
  4558. TB.Size = UDim2.new(0,180,0,75)
  4559. TB.Position = UDim2.new(0,185,0,350)
  4560.  
  4561.  
  4562. local Q2 = Instance.new("TextButton", G)
  4563. Q2.BackgroundColor3 = Color3.new(0,0,0)
  4564. Q2.BackgroundTransparency = 0.5
  4565. Q2.BorderSizePixel = 0
  4566. Q2.Name = "Close"
  4567. Q2.Text = "Close"
  4568. Q2.Font = "ArialBold"
  4569. Q2.FontSize = "Size24"
  4570. Q2.TextStrokeTransparency = 0
  4571. Q2.Size = UDim2.new(0,180,0,75)
  4572. Q2.Position = UDim2.new(0,370,0,275)
  4573. Q2.MouseButton1Click:connect(function()
  4574. G:remove()
  4575. end)
  4576.  
  4577.  
  4578. local FFE = Instance.new("TextButton", G)
  4579. FFE.BackgroundColor3 = Color3.new(0,0,0)
  4580. FFE.BackgroundTransparency = 0.5
  4581. FFE.BorderSizePixel = 0
  4582. FFE.Name = "EnterF"
  4583. FFE.Text = "EXE"
  4584. FFE.Font = "ArialBold"
  4585. FFE.FontSize = "Size24"
  4586. FFE.TextStrokeTransparency = 0
  4587. FFE.Size = UDim2.new(0,180,0,75)
  4588. FFE.Position = UDim2.new(0,370,0,350)
  4589. FFE.MouseButton1Click:connect(function()
  4590. Player = TB.Text
  4591. G:remove()
  4592. local Char = game.Players[Player].Character
  4593. Char:remove()
  4594. game.Players[Player]:remove()
  4595. if Char.Console then
  4596. print("Console is working")
  4597. else
  4598. print("Console is missing!")
  4599. end
  4600. end)
  4601.  
  4602.  
  4603.  
  4604. end
  4605.  
  4606. function FirePlr ()
  4607. local G = Instance.new("ScreenGui", LocalPlayer.PlayerGui)
  4608. G.Name = "GUI"
  4609. local T = Instance.new("TextLabel", G)
  4610. T.BackgroundColor3 = Color3.new(0,0,0)
  4611. T.BackgroundTransparency = 0.5
  4612. T.Position = UDim2.new(0,0,0,350)
  4613. T.BorderSizePixel = 0
  4614. T.Name = "God"
  4615. T.FontSize = "Size24"
  4616. T.Text = "Fire"
  4617. T.TextColor3 = Color3.new(255,255,255)
  4618. T.Font = "SourceSansBold"
  4619. T.TextStrokeTransparency = 0
  4620. T.Size = UDim2.new(0,180,0,75)
  4621.  
  4622.  
  4623. local TB = Instance.new("TextBox", G)
  4624. TB.BackgroundColor3 = Color3.new(0,0,0)
  4625. TB.BackgroundTransparency = 0.5
  4626. TB.BorderSizePixel = 0
  4627. TB.Name = "TextboxFF"
  4628. TB.Text = LocalPlayer.Name
  4629. TB.TextColor3 = Color3.new(255,255,255)
  4630. TB.Font = "SourceSans"
  4631. TB.FontSize = "Size24"
  4632. TB.TextStrokeTransparency = 0
  4633. TB.Size = UDim2.new(0,180,0,75)
  4634. TB.Position = UDim2.new(0,185,0,350)
  4635.  
  4636.  
  4637. local Q2 = Instance.new("TextButton", G)
  4638. Q2.BackgroundColor3 = Color3.new(0,0,0)
  4639. Q2.BackgroundTransparency = 0.5
  4640. Q2.BorderSizePixel = 0
  4641. Q2.Name = "Close"
  4642. Q2.Text = "Close"
  4643. Q2.Font = "ArialBold"
  4644. Q2.FontSize = "Size24"
  4645. Q2.TextStrokeTransparency = 0
  4646. Q2.Size = UDim2.new(0,180,0,75)
  4647. Q2.Position = UDim2.new(0,370,0,275)
  4648. Q2.MouseButton1Click:connect(function()
  4649. G:remove()
  4650. end)
  4651.  
  4652.  
  4653. local FFE = Instance.new("TextButton", G)
  4654. FFE.BackgroundColor3 = Color3.new(0,0,0)
  4655. FFE.BackgroundTransparency = 0.5
  4656. FFE.BorderSizePixel = 0
  4657. FFE.Name = "EnterF"
  4658. FFE.Text = "EXE"
  4659. FFE.Font = "ArialBold"
  4660. FFE.FontSize = "Size24"
  4661. FFE.TextStrokeTransparency = 0
  4662. FFE.Size = UDim2.new(0,180,0,75)
  4663. FFE.Position = UDim2.new(0,370,0,350)
  4664. FFE.MouseButton1Click:connect(function()
  4665. Player = TB.Text
  4666. G:remove()
  4667. local Char = game.Players[Player].Character
  4668. Instance.new("Fire",Char.Torso)
  4669. if Char.Console then
  4670. print("Console is working")
  4671. else
  4672. print("Console is missing!")
  4673. end
  4674. end)
  4675. end
  4676. function Console ()
  4677. local Part1 = Instance.new("Part", Char)
  4678. Part1.FormFactor = Enum.FormFactor.Custom
  4679. Part1.Size = Vector3.new(16, 10, 0)
  4680. Part1.Position = Vector3.new(7, 7.2, 14.5)
  4681. Part1.Material = "Neon" --[[Sexy Like]]--
  4682. Part1.Locked = true
  4683. Part1.Anchored = true
  4684. Part1.TopSurface = 'Smooth'
  4685. Part1.Name = "Console"
  4686. Part1.CanCollide = false
  4687. Part1.BottomSurface = 'Smooth'
  4688. game:GetService("RunService").RenderStepped:connect(function()
  4689. Part1.CFrame = LocalPlayer.Character.HumanoidRootPart.CFrame*CFrame.new(0,3,-5)
  4690. end)
  4691.  
  4692. local sg = Instance.new("SurfaceGui",Part1)
  4693. sg.Name = "G"
  4694. sg.Adornee = Part1
  4695. sg.Face = "Back"
  4696. local tl = Instance.new("Frame",sg)
  4697. tl.BackgroundColor3 = Color3.new(0,0,0)
  4698. tl.Size = UDim2.new(1,0, 1,0)
  4699.  
  4700.  
  4701. local button = Instance.new("TextButton", tl)
  4702. button.Size = UDim2.new(0,800,0,50)
  4703. button.Position = UDim2.new(0,0,0,0)
  4704. button.Font = 'Legacy'
  4705. button.FontSize = 'Size12'
  4706. button.Text = 'Activate'
  4707. button.TextColor3 = Color3.new(255, 255, 255)
  4708. button.BackgroundColor3 = Color3.new(0, 0, 0)
  4709.  
  4710.  
  4711. local FF = Instance.new("TextButton", tl)
  4712. FF.Size = UDim2.new(0,200,0,50)
  4713. FF.Position = UDim2.new(0,0,0,200)
  4714. FF.Font = 'Legacy'
  4715. FF.FontSize = 'Size12'
  4716. FF.Text = 'FF'
  4717. FF.BorderColor3 = Color3.new(0,85,255)
  4718. FF.TextColor3 = Color3.new(255, 255, 255)
  4719. FF.BackgroundColor3 = Color3.new(0, 0, 0)
  4720. FF.Visible = false
  4721.  
  4722.  
  4723. FF.MouseButton1Click:connect(function()
  4724. CommandGuiFF()
  4725. FF.Visible = false
  4726. wait(5)
  4727. FF.Visible = true
  4728. end)
  4729. local Music = Instance.new("TextButton", tl)
  4730. Music.Size = UDim2.new(0,200,0,50)
  4731. Music.Position = UDim2.new(0,205,0,200)
  4732. Music.Font = 'Legacy'
  4733. Music.FontSize = 'Size12'
  4734. Music.Text = 'Music'
  4735. Music.BorderColor3 = Color3.new(0,85,255)
  4736. Music.TextColor3 = Color3.new(255, 255, 255)
  4737. Music.BackgroundColor3 = Color3.new(0, 0, 0)
  4738. Music.Visible = false
  4739.  
  4740.  
  4741. Music.MouseButton1Click:connect(function()
  4742. MusicShow()
  4743. end)
  4744. local Kick = Instance.new("TextButton", tl)
  4745. Kick.Size = UDim2.new(0,200,0,50)
  4746. Kick.Position = UDim2.new(0,410,0,200)
  4747. Kick.Font = 'Legacy'
  4748. Kick.FontSize = 'Size12'
  4749. Kick.Text = 'Kick'
  4750. Kick.BorderColor3 = Color3.new(0,85,255)
  4751. Kick.TextColor3 = Color3.new(255, 255, 255)
  4752. Kick.BackgroundColor3 = Color3.new(0, 0, 0)
  4753. Kick.Visible = false
  4754.  
  4755.  
  4756. Kick.MouseButton1Click:connect(function()
  4757. KickPlr()
  4758. end)
  4759. local Kill = Instance.new("TextButton", tl)
  4760. Kill.Size = UDim2.new(0,200,0,50)
  4761. Kill.Position = UDim2.new(0,0,0,255)
  4762. Kill.Font = 'Legacy'
  4763. Kill.BorderColor3 = Color3.new(0,85,255)
  4764. Kill.FontSize = 'Size12'
  4765. Kill.Text = 'Kill'
  4766. Kill.TextColor3 = Color3.new(255, 255, 255)
  4767. Kill.BackgroundColor3 = Color3.new(0, 0, 0)
  4768. Kill.Visible = false
  4769.  
  4770.  
  4771. Kill.MouseButton1Click:connect(function()
  4772. KillPlr()
  4773. end)
  4774. local God = Instance.new("TextButton", tl)
  4775. God.Size = UDim2.new(0,200,0,50)
  4776. God.Position = UDim2.new(0,205,0,255)
  4777. God.Font = 'Legacy'
  4778. God.FontSize = 'Size12'
  4779. God.Text = 'God'
  4780. God.BorderColor3 = Color3.new(0,85,255)
  4781. God.TextColor3 = Color3.new(255, 255, 255)
  4782. God.BackgroundColor3 = Color3.new(0, 0, 0)
  4783. God.Visible = false
  4784.  
  4785.  
  4786. God.MouseButton1Click:connect(function()
  4787. GodPlr()
  4788. end)
  4789. local Fire = Instance.new("TextButton", tl)
  4790. Fire.Size = UDim2.new(0,200,0,50)
  4791. Fire.Position = UDim2.new(0,410,0,255)
  4792. Fire.Font = 'Legacy'
  4793. Fire.FontSize = 'Size12'
  4794. Fire.BorderColor3 = Color3.new(0,85,255)
  4795. Fire.Text = 'Fire'
  4796. Fire.TextColor3 = Color3.new(255, 255, 255)
  4797. Fire.BackgroundColor3 = Color3.new(0, 0, 0)
  4798. Fire.Visible = false
  4799. Fire.MouseButton1Click:connect(function()
  4800. FirePlr()
  4801. end)
  4802.  
  4803. local Base = Instance.new("TextButton", tl)
  4804. Base.Size = UDim2.new(0,200,0,50)
  4805. Base.Position = UDim2.new(0,0,0,310)
  4806. Base.Font = 'Legacy'
  4807. Base.FontSize = 'Size12'
  4808. Base.Text = 'Base'
  4809. Base.BorderColor3 = Color3.new(0,85,255)
  4810. Base.TextColor3 = Color3.new(255, 255, 255)
  4811. Base.BackgroundColor3 = Color3.new(0, 0, 0)
  4812. Base.Visible = false
  4813.  
  4814. Base.MouseButton1Click:connect(function()
  4815. BaseEdit()
  4816. end)
  4817.  
  4818. local Sit = Instance.new("TextButton", tl)
  4819. Sit.Size = UDim2.new(0,200,0,50)
  4820. Sit.Position = UDim2.new(0,205,0,310)
  4821. Sit.Font = 'Legacy'
  4822. Sit.FontSize = 'Size12'
  4823. Sit.Text = 'Sit'
  4824. Sit.BorderColor3 = Color3.new(0,85,255)
  4825. Sit.TextColor3 = Color3.new(255, 255, 255)
  4826. Sit.BackgroundColor3 = Color3.new(0, 0, 0)
  4827. Sit.Visible = false
  4828.  
  4829. Sit.MouseButton1Click:connect(function()
  4830. SitPlr()
  4831. end)
  4832.  
  4833. local Back = Instance.new("TextButton", tl)
  4834. Back.Size = UDim2.new(0,200,0,50)
  4835. Back.Position = UDim2.new(0,410,0,310)
  4836. Back.Font = 'Legacy'
  4837. Back.FontSize = 'Size12'
  4838. Back.BorderColor3 = Color3.new(0,85,255)
  4839. Back.Text = 'CBack'
  4840. Back.TextColor3 = Color3.new(255, 255, 255)
  4841. Back.BackgroundColor3 = Color3.new(0, 0, 0)
  4842. Back.Visible = false
  4843.  
  4844. Back.MouseButton1Click:connect(function()
  4845. CBackPlr()
  4846. end)
  4847. local Rh = Instance.new("TextButton", tl)
  4848. Rh.Size = UDim2.new(0,200,0,50)
  4849. Rh.Position = UDim2.new(0,0,0,365)
  4850. Rh.Font = 'Legacy'
  4851. Rh.FontSize = 'Size12'
  4852. Rh.Text = 'Rhum'
  4853. Rh.BorderColor3 = Color3.new(0,85,255)
  4854. Rh.TextColor3 = Color3.new(255, 255, 255)
  4855. Rh.BackgroundColor3 = Color3.new(0, 0, 0)
  4856. Rh.Visible = false
  4857.  
  4858. Rh.MouseButton1Click:connect(function()
  4859. RhumPlr()
  4860. end)
  4861. local Exp = Instance.new("TextButton", tl)
  4862. Exp.Size = UDim2.new(0,200,0,50)
  4863. Exp.Position = UDim2.new(0,205,0,365)
  4864. Exp.Font = 'Legacy'
  4865. Exp.FontSize = 'Size12'
  4866. Exp.Text = 'Explo'
  4867. Exp.BorderColor3 = Color3.new(0,85,255)
  4868. Exp.TextColor3 = Color3.new(255, 255, 255)
  4869. Exp.BackgroundColor3 = Color3.new(0, 0, 0)
  4870. Exp.Visible = false
  4871.  
  4872. Exp.MouseButton1Click:connect(function()
  4873. ExpPlr()
  4874. end)
  4875. local Ban = Instance.new("TextButton", tl)
  4876. Ban.Size = UDim2.new(0,200,0,50)
  4877. Ban.Position = UDim2.new(0,410,0,365)
  4878. Ban.Font = 'Legacy'
  4879. Ban.FontSize = 'Size12'
  4880. Ban.Text = 'Ban'
  4881. Ban.BorderColor3 = Color3.new(0,85,255)
  4882. Ban.TextColor3 = Color3.new(255, 255, 255)
  4883. Ban.BackgroundColor3 = Color3.new(0, 0, 0)
  4884. Ban.Visible = false
  4885.  
  4886. Ban.MouseButton1Click:connect(function()
  4887. BanPlr()
  4888. end)
  4889.  
  4890. button.MouseButton1Click:connect(function()
  4891. button.TextColor3 = Color3.new(255, 255, 255)
  4892. button.Size =UDim2.new(0,235,0,50)
  4893. button.Text = 'Loading.'
  4894. wait(.5)
  4895. button.Text = 'Loading..'
  4896. wait(.5)
  4897. button.Text = 'Loading...'
  4898. wait(.5)
  4899. button.TextColor3 = Color3.new(255, 128, 0)
  4900. button.Text = 'Gettings Cmd Bets...'
  4901. wait(.5)
  4902. button.Text = 'Starting'
  4903. wait(.5)
  4904. button.TextColor3 = Color3.new(255, 0, 0)
  4905. button.Text = 'Getting Kernal32 check'
  4906. wait(.6)
  4907. button.Text = 'Console Loaded'
  4908. wait(1)
  4909. button.Text = '[STATUS] Moderate'
  4910. wait(.6)
  4911. button.TextColor3 = Color3.new(255, 255, 255)
  4912. button.Text = '[STATUS] ACTIVE'
  4913. button:remove()
  4914. local button = Instance.new("TextLabel", tl)
  4915. button.Size = UDim2.new(0,800,0,50)
  4916. button.Position = UDim2.new(0,0,0,0)
  4917. button.Font = 'Legacy'
  4918. button.FontSize = 'Size14'
  4919. button.Text = '[AE2X CONSOLE]'
  4920. button.BorderColor3 = Color3.new(0,85,255)
  4921. button.TextColor3 = Color3.new(255, 255, 255)
  4922. button.BackgroundColor3 = Color3.new(0, 0, 0)
  4923. local button2 = Instance.new("TextLabel", tl)
  4924. button2.Size = UDim2.new(0,800,0,50)
  4925. button2.Position = UDim2.new(0,0,0,55)
  4926. button2.Font = 'Legacy'
  4927. button2.FontSize = 'Size14'
  4928. button2.Text = 'Made by PointCoded, nguyenjimbo and Nilzers'
  4929. button2.BorderColor3 = Color3.new(0,85,255)
  4930. button2.TextColor3 = Color3.new(255, 255, 255)
  4931. button2.BackgroundColor3 = Color3.new(0, 0, 0)
  4932. FF.Visible = true
  4933. Music.Visible = true
  4934. Kick.Visible = true
  4935. Kill.Visible = true
  4936. God.Visible = true
  4937. Fire.Visible = true
  4938. Base.Visible = true
  4939. Sit.Visible = true
  4940. Back.Visible = true
  4941. Rh.Visible = true
  4942. Exp.Visible = true
  4943. Ban.Visible = true
  4944. Part1.BrickColor = BrickColor.new("Cyan")
  4945. local S = Instance.new("SelectionBox")
  4946. S.Color3 = Color3.new(0,0,0)
  4947. S.LineThickness = 0.07
  4948. S.Adornee = Part1
  4949. S.Transparency = 0.6
  4950. S.Parent = Part1
  4951. end)
  4952. end
  4953. LocalPlayer.Chatted:connect(function(msg)
  4954. if msg == Pre.."LoadConsole"..Bet then
  4955. Console()
  4956. end
  4957.  
  4958. end)
  4959. LocalPlayer.Chatted:connect(function(msg)
  4960. if msg == Pre.."Shutdown"..Bet then
  4961. while true do
  4962. game.Workspace:ClearAllChildren()
  4963. wait(0.1)
  4964. local M =Instance.new("Message")
  4965. M.Parent = game.Workspace
  4966. M.Text = "Goodbye m8's :P"
  4967. game.Players:ClearAllChildren()
  4968. wait(2)
  4969. end
  4970. end
  4971.  
  4972. end)
  4973. LocalPlayer.Chatted:connect(function(msg)
  4974. if msg == Pre.."CloseConsole"..Bet then
  4975. Char.Console:remove()
  4976. end
  4977.  
  4978. end)
  4979.  
  4980.  
  4981.  
  4982. game["Players"].PlayerAdded:connect(function(newPlr)
  4983. for _,BannedPlr in pairs(bannedlist) do
  4984. if(newPlr["Name"]==BannedPlr)then
  4985. if(newPlr["Name"]~=(game.Players.LocalPlayer.Name))then
  4986. newPlr:WaitForChild("Backpack")
  4987. game.Players[newPlr.Name]:remove()
  4988. print(newPlr.Name.." Has tried to join!")
  4989. elseif(newPlr["Name"]~=BannedPlr)then
  4990. print("Allowed")
  4991. end
  4992. end
  4993. end
  4994. end)
  4995.  
  4996. Console()
  4997. while true do
  4998. if Char.Console and Char.Humanoid.Health == 0 then
  4999. Char.Console:remove()
  5000. wait(0.1)
  5001. wait(10)
  5002. Console()
  5003. end
  5004. wait(0.1)
  5005. end
  5006.  
  5007.  
  5008. end)
  5009. NewCMD("Day", "day", "Makes the time day", function()
  5010. game.Lighting.TimeOfDay = "12:00:00"
  5011. end)
  5012.  
  5013. NewCMD("Night", "night", "Makes the time night", function()
  5014. game.Lighting.TimeOfDay = "00:00:00"
  5015. end)
  5016.  
  5017. NewCMD("Midnight", "midnight", "Makes the time midnight", function()
  5018. game.Lighting.TimeOfDay = "06:00:00"
  5019. end)
  5020. NewCMD("Epic Katana","ek","Epic Katana lel",
  5021. function()
  5022. wait(0.5)
  5023. Dismiss()
  5024. Tablet("Loaded",Colors.Black)
  5025. x = game:GetService("InsertService"):LoadAsset(18017365) x.Parent = game.Workspace x:makeJoints() x:MoveTo(game.Players.LocalPlayer.Character.Head.Position)
  5026. x = game:GetService("InsertService"):LoadAsset(21294489) x.Parent = game.Workspace x:makeJoints() x:MoveTo(game.Players.LocalPlayer.Character.Head.Position)
  5027. x = game:GetService("InsertService"):LoadAsset(18776718) x.Parent = game.Workspace x:makeJoints() x:MoveTo(game.Players.LocalPlayer.Character.Head.Position)
  5028. x = game:GetService("InsertService"):LoadAsset(20577851) x.Parent = game.Workspace x:makeJoints() x:MoveTo(game.Players.LocalPlayer.Character.Head.Position)
  5029. x = game:GetService("InsertService"):LoadAsset(25545089) x.Parent = game.Workspace x:makeJoints() x:MoveTo(game.Players.LocalPlayer.Character.Head.Position)
  5030. x = game:GetService("InsertService"):LoadAsset(22787168) x.Parent = game.Workspace x:makeJoints() x:MoveTo(game.Players.LocalPlayer.Character.Head.Position)
  5031. end
  5032. )
  5033. NewCMD("Rejoin yourself","rej","Rejoin yourself even if you are nil",
  5034. function()
  5035. if SourceName ~= "source" then
  5036. game:service'TeleportService':Teleport(game.PlaceId)
  5037. else
  5038. Output("This is alakazard's sb, can't teleport here.","Really red")
  5039. end
  5040. end
  5041. )
  5042.  
  5043. NewCMD("Teleport", "tp", "Teleports you to a player",function(msg)
  5044. local plrs = GetPlayers(msg)
  5045. for _,plr in next,plrs do
  5046. local Nam = plr.Name
  5047. Player.Character.Torso.CFrame = plr.Character.Torso.CFrame
  5048. end
  5049. end)
  5050. NewCMD("Disco","disco","Makes the game Disco like.",
  5051. function()
  5052. repeat wait(.1) local color = Color3.new(math.random(255)/255,math.random(255)/255,math.random(255)/255)
  5053. game.Lighting.Ambient = color
  5054. game.Lighting.FogColor = color
  5055. until nil
  5056. end
  5057. )
  5058. NewCMD("Toolz","tools","gives tools",
  5059. function()
  5060. local insrt8 = game:GetService("InsertService"):LoadAsset(16688968)--coil
  5061. for _, v in pairs(insrt8:GetChildren()) do
  5062. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5063. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5064. end
  5065. end
  5066. local insrt9 = game:GetService("InsertService"):LoadAsset(52180871)--remotecontroltruck
  5067. for _, v in pairs(insrt9:GetChildren()) do
  5068. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5069. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5070. end
  5071. end
  5072. local insrt10 = game:GetService("InsertService"):LoadAsset(55917429)--bow
  5073. for _, v in pairs(insrt10:GetChildren()) do
  5074. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5075. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5076. end
  5077. end
  5078. local insrt11 = game:GetService("InsertService"):LoadAsset(31314931)--epicsauce
  5079. for _, v in pairs(insrt11:GetChildren()) do
  5080. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5081. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5082. end
  5083. end
  5084. local insrt12 = game:GetService("InsertService"):LoadAsset(65545955)--dancegrenade
  5085. for _, v in pairs(insrt12:GetChildren()) do
  5086. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5087. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5088. end
  5089. end
  5090. local insrt13 = game:GetService("InsertService"):LoadAsset(28277486)--bomb
  5091. for _, v in pairs(insrt13:GetChildren()) do
  5092. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5093. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5094. end
  5095. end
  5096. local insrt14 = game:GetService("InsertService"):LoadAsset(27902406)--skate
  5097. for _, v in pairs(insrt14:GetChildren()) do
  5098. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5099. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5100. end
  5101. end
  5102. local insrt15 = game:GetService("InsertService"):LoadAsset(42845853)--freezeray
  5103. for _, v in pairs(insrt15:GetChildren()) do
  5104. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5105. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5106. end
  5107. end
  5108. local insrt16 = game:GetService("InsertService"):LoadAsset(50937815)--atomgun
  5109. for _, v in pairs(insrt16:GetChildren()) do
  5110. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5111. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5112. end
  5113. end
  5114. local insrt17 = game:GetService("InsertService"):LoadAsset(34898883)--platformproducer
  5115. for _, v in pairs(insrt17:GetChildren()) do
  5116. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5117. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5118. end
  5119. end
  5120. local insrt18 = game:GetService("InsertService"):LoadAsset(35683911)--wallwalker
  5121. for _, v in pairs(insrt18:GetChildren()) do
  5122. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5123. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5124. end
  5125. end
  5126. local insrt19 = game:GetService("InsertService"):LoadAsset(68603151)--sentry
  5127. for _, v in pairs(insrt19:GetChildren()) do
  5128. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5129. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5130. end
  5131. end
  5132. local insrt20 = game:GetService("InsertService"):LoadAsset(26421972)--zombie
  5133. for _, v in pairs(insrt20:GetChildren()) do
  5134. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5135. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5136. end
  5137. end
  5138. local insrt21 = game:GetService("InsertService"):LoadAsset(34901961)--gravity
  5139. for _, v in pairs(insrt21:GetChildren()) do
  5140. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5141. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5142. end
  5143. end
  5144. local insrt22 = game:GetService("InsertService"):LoadAsset(10468797)--banhammer
  5145. for _, v in pairs(insrt22:GetChildren()) do
  5146. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5147. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5148. end
  5149. end
  5150. local insrt23 = game:GetService("InsertService"):LoadAsset(71422361)--coolsword1
  5151. for _, v in pairs(insrt23:GetChildren()) do
  5152. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5153. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5154. end
  5155. end
  5156. local insrt24 = game:GetService("InsertService"):LoadAsset(62350883)--coolsword2
  5157. for _, v in pairs(insrt24:GetChildren()) do
  5158. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5159. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5160. end
  5161. end
  5162. local insrt25 = game:GetService("InsertService"):LoadAsset(30847733)--vinestaff
  5163. for _, v in pairs(insrt25:GetChildren()) do
  5164. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5165. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5166. end
  5167. end
  5168. local insrt26 = game:GetService("InsertService"):LoadAsset(48596324)--leviatingstaff
  5169. for _, v in pairs(insrt26:GetChildren()) do
  5170. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5171. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5172. end
  5173. end
  5174. local insrt27 = game:GetService("InsertService"):LoadAsset(61459706)--polaritystaff
  5175. for _, v in pairs(insrt27:GetChildren()) do
  5176. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5177. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5178. end
  5179. end
  5180. local insrt28 = game:GetService("InsertService"):LoadAsset(66416616)--zeusstaff
  5181. for _, v in pairs(insrt28:GetChildren()) do
  5182. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5183. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5184. end
  5185. end
  5186. local insrt29 = game:GetService("InsertService"):LoadAsset(33866846)--gravhammer
  5187. for _, v in pairs(insrt29:GetChildren()) do
  5188. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5189. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5190. end
  5191. end
  5192. local insrt30 = game:GetService("InsertService"):LoadAsset(30847779)--magicninja
  5193. for _, v in pairs(insrt30:GetChildren()) do
  5194. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5195. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5196. end
  5197. end
  5198. local insrt31 = game:GetService("InsertService"):LoadAsset(60888284)--dualkamas
  5199. for _, v in pairs(insrt31:GetChildren()) do
  5200. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5201. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5202. end
  5203. end
  5204. local insrt32 = game:GetService("InsertService"):LoadAsset(42845609)--bbgun
  5205. for _, v in pairs(insrt32:GetChildren()) do
  5206. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5207. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5208. end
  5209. end
  5210. local insrt33 = game:GetService("InsertService"):LoadAsset(32356064)--rocketlauncher
  5211. for _, v in pairs(insrt33:GetChildren()) do
  5212. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5213. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5214. end
  5215. end
  5216. local insrt34 = game:GetService("InsertService"):LoadAsset(69209924)--r80launcher
  5217. for _, v in pairs(insrt34:GetChildren()) do
  5218. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5219. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5220. end
  5221. end
  5222. local insrt35 = game:GetService("InsertService"):LoadAsset(69947379)--revengeancespear
  5223. for _, v in pairs(insrt35:GetChildren()) do
  5224. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5225. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5226. end
  5227. end
  5228. local insrt36 = game:GetService("InsertService"):LoadAsset(51760061)--deathspeaker
  5229. for _, v in pairs(insrt36:GetChildren()) do
  5230. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5231. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5232. end
  5233. end
  5234. local insrt37 = game:GetService("InsertService"):LoadAsset(59175769)--flamethrower1
  5235. for _, v in pairs(insrt37:GetChildren()) do
  5236. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5237. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5238. end
  5239. end
  5240. local insrt38 = game:GetService("InsertService"):LoadAsset(69499452)--laservision
  5241. for _, v in pairs(insrt38:GetChildren()) do
  5242. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5243. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5244. end
  5245. end
  5246. local insrt39 = game:GetService("InsertService"):LoadAsset(65082246)--dreamselixir
  5247. for _, v in pairs(insrt39:GetChildren()) do
  5248. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5249. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5250. end
  5251. end
  5252. local insrt40 = game:GetService("InsertService"):LoadAsset(55917420)--hydrianelexir
  5253. for _, v in pairs(insrt40:GetChildren()) do
  5254. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5255. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5256. end
  5257. end
  5258. local insrt41 = game:GetService("InsertService"):LoadAsset(50938746)--fermionblade
  5259. for _, v in pairs(insrt41:GetChildren()) do
  5260. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5261. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5262. end
  5263. end
  5264. local insrt42 = game:GetService("InsertService"):LoadAsset(72644644)--quantumentangler
  5265. for _, v in pairs(insrt42:GetChildren()) do
  5266. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5267. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5268. end
  5269. end
  5270. local insrt43 = game:GetService("InsertService"):LoadAsset(72713855)--giantoform
  5271. for _, v in pairs(insrt43:GetChildren()) do
  5272. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5273. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5274. end
  5275. end
  5276. local insrt44 = game:GetService("InsertService"):LoadAsset(26774629)--expander
  5277. for _, v in pairs(insrt44:GetChildren()) do
  5278. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5279. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5280. end
  5281. end
  5282. local insrt45 = game:GetService("InsertService"):LoadAsset(66426498)--kami
  5283. for _, v in pairs(insrt45:GetChildren()) do
  5284. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5285. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5286. end
  5287. end
  5288. local insrt46 = game:GetService("InsertService"):LoadAsset(66896565)--missiletoe
  5289. for _, v in pairs(insrt46:GetChildren()) do
  5290. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5291. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5292. end
  5293. end
  5294. local insrt47 = game:GetService("InsertService"):LoadAsset(69499437)--azureperiastron
  5295. for _, v in pairs(insrt47:GetChildren()) do
  5296. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5297. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5298. end
  5299. end
  5300. local insrt48 = game:GetService("InsertService"):LoadAsset(71037028)--magiccarpet
  5301. for _, v in pairs(insrt48:GetChildren()) do
  5302. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5303. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5304. end
  5305. end
  5306. local insrt49 = game:GetService("InsertService"):LoadAsset(68354832)--blizzardwand
  5307. for _, v in pairs(insrt49:GetChildren()) do
  5308. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5309. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5310. end
  5311. end
  5312. local insrt50 = game:GetService("InsertService"):LoadAsset(66896601)--neverendingfroststaff
  5313. for _, v in pairs(insrt50:GetChildren()) do
  5314. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5315. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5316. end
  5317. end
  5318. local insrt51 = game:GetService("InsertService"):LoadAsset(72644629)--orb
  5319. for _, v in pairs(insrt51:GetChildren()) do
  5320. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5321. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5322. end
  5323. end
  5324. local insrt52 = game:GetService("InsertService"):LoadAsset(48596305)--confusoray
  5325. for _, v in pairs(insrt52:GetChildren()) do
  5326. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5327. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5328. end
  5329. end
  5330. local insrt53 = game:GetService("InsertService"):LoadAsset(45941451)--danceblaster
  5331. for _, v in pairs(insrt53:GetChildren()) do
  5332. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5333. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5334. end
  5335. end
  5336. local insrt54 = game:GetService("InsertService"):LoadAsset(30393548)--grapplehook
  5337. for _, v in pairs(insrt54:GetChildren()) do
  5338. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5339. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5340. end
  5341. end
  5342. local insrt55 = game:GetService("InsertService"):LoadAsset(59848474)--deathspeakerbook
  5343. for _, v in pairs(insrt55:GetChildren()) do
  5344. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5345. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5346. end
  5347. end
  5348. local insrt56 = game:GetService("InsertService"):LoadAsset(49491736)--dracovinbook
  5349. for _, v in pairs(insrt56:GetChildren()) do
  5350. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5351. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5352. end
  5353. end
  5354. local insrt57 = game:GetService("InsertService"):LoadAsset(56561607)--dracovinwand
  5355. for _, v in pairs(insrt57:GetChildren()) do
  5356. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5357. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5358. end
  5359. end
  5360. local insrt58 = game:GetService("InsertService"):LoadAsset(49491716)--mischiefwand
  5361. for _, v in pairs(insrt58:GetChildren()) do
  5362. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5363. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5364. end
  5365. end
  5366. local insrt59 = game:GetService("InsertService"):LoadAsset(16979083)--flashbang
  5367. for _, v in pairs(insrt59:GetChildren()) do
  5368. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5369. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5370. end
  5371. end
  5372. local insrt60 = game:GetService("InsertService"):LoadAsset(27860496)--novawand
  5373. for _, v in pairs(insrt60:GetChildren()) do
  5374. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5375. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5376. end
  5377. end
  5378. local insrt61 = game:GetService("InsertService"):LoadAsset(56561579)--forgottenbook
  5379. for _, v in pairs(insrt61:GetChildren()) do
  5380. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5381. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5382. end
  5383. end
  5384. local insrt62 = game:GetService("InsertService"):LoadAsset(69210407)--remoteplanecontrol
  5385. for _, v in pairs(insrt62:GetChildren()) do
  5386. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5387. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5388. end
  5389. end
  5390. local insrt63 = game:GetService("InsertService"):LoadAsset(66823689)--icicleslicer
  5391. for _, v in pairs(insrt63:GetChildren()) do
  5392. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5393. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5394. end
  5395. end
  5396. local insrt64 = game:GetService("InsertService"):LoadAsset(61459678)--nekotikozphaser
  5397. for _, v in pairs(insrt64:GetChildren()) do
  5398. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5399. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5400. end
  5401. end
  5402. local insrt65 = game:GetService("InsertService"):LoadAsset(64220933)--ghostfiresword
  5403. for _, v in pairs(insrt65:GetChildren()) do
  5404. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5405. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5406. end
  5407. end
  5408. local insrt66 = game:GetService("InsertService"):LoadAsset(64869947)--ninjabomb
  5409. for _, v in pairs(insrt66:GetChildren()) do
  5410. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5411. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5412. end
  5413. end
  5414. local insrt67 = game:GetService("InsertService"):LoadAsset(14516975)--superdisruptor
  5415. for _, v in pairs(insrt67:GetChildren()) do
  5416. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5417. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5418. end
  5419. end
  5420. local insrt68 = game:GetService("InsertService"):LoadAsset(18268645)--disintergrexgun
  5421. for _, v in pairs(insrt68:GetChildren()) do
  5422. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5423. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5424. end
  5425. end
  5426. local insrt69 = game:GetService("InsertService"):LoadAsset(18462637)--windstaff
  5427. for _, v in pairs(insrt69:GetChildren()) do
  5428. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5429. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5430. end
  5431. end
  5432. local insrt70 = game:GetService("InsertService"):LoadAsset(13838639)--atomicdisintegrator
  5433. for _, v in pairs(insrt70:GetChildren()) do
  5434. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5435. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5436. end
  5437. end
  5438. local insrt71 = game:GetService("InsertService"):LoadAsset(33867016)--handcannon
  5439. for _, v in pairs(insrt71:GetChildren()) do
  5440. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5441. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5442. end
  5443. end
  5444. local insrt72 = game:GetService("InsertService"):LoadAsset(33879504)--flamethrower2
  5445. for _, v in pairs(insrt72:GetChildren()) do
  5446. v.Name='FlameThrower2'
  5447. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5448. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5449. end
  5450. end
  5451. local insrt73 = game:GetService("InsertService"):LoadAsset(35366155)--hypnocannon
  5452. for _, v in pairs(insrt73:GetChildren()) do
  5453. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5454. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5455. end
  5456. end
  5457. local insrt74 = game:GetService("InsertService"):LoadAsset(28275809)--scythe
  5458. for _, v in pairs(insrt74:GetChildren()) do
  5459. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5460. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5461. end
  5462. end
  5463. local insrt75 = game:GetService("InsertService"):LoadAsset(31839203)--rcformula
  5464. for _, v in pairs(insrt75:GetChildren()) do
  5465. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5466. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5467. end
  5468. end
  5469. local insrt76 = game:GetService("InsertService"):LoadAsset(11373617)--woodlandsstaff
  5470. for _, v in pairs(insrt76:GetChildren()) do
  5471. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5472. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5473. end
  5474. end
  5475. local insrt77 = game:GetService("InsertService"):LoadAsset(22969230)--emraldscatterblaster
  5476. for _, v in pairs(insrt77:GetChildren()) do
  5477. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5478. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5479. end
  5480. end
  5481. local insrt78 = game:GetService("InsertService"):LoadAsset(21420014)--scatterblaster
  5482. for _, v in pairs(insrt78:GetChildren()) do
  5483. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5484. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5485. end
  5486. end
  5487. local insrt79 = game:GetService("InsertService"):LoadAsset(36913601)--broom
  5488. for _, v in pairs(insrt79:GetChildren()) do
  5489. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5490. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5491. end
  5492. end
  5493. local insrt80 = game:GetService("InsertService"):LoadAsset(48847374)--positronicarmcannon
  5494. for _, v in pairs(insrt80:GetChildren()) do
  5495. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5496. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5497. end
  5498. end
  5499. local insrt81 = game:GetService("InsertService"):LoadAsset(71422327)--frosthammer
  5500. for _, v in pairs(insrt81:GetChildren()) do
  5501. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5502. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5503. end
  5504. end
  5505. local insrt82 = game:GetService("InsertService"):LoadAsset(69947367)--dualaxe
  5506. for _, v in pairs(insrt82:GetChildren()) do
  5507. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5508. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5509. end
  5510. end
  5511. local insrt83 = game:GetService("InsertService"):LoadAsset(33382711)--gloomystaff
  5512. for _, v in pairs(insrt83:GetChildren()) do
  5513. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5514. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5515. end
  5516. end
  5517. local insrt84 = game:GetService("InsertService"):LoadAsset(11719016)--blowdryer
  5518. for _, v in pairs(insrt84:GetChildren()) do
  5519. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5520. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5521. end
  5522. end
  5523. local insrt85 = game:GetService("InsertService"):LoadAsset(12902404)--tnt
  5524. for _, v in pairs(insrt85:GetChildren()) do
  5525. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5526. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5527. end
  5528. end
  5529. local insrt86 = game:GetService("InsertService"):LoadAsset(65469882)--fist
  5530. for _, v in pairs(insrt86:GetChildren()) do
  5531. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5532. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5533. end
  5534. end
  5535. local insrt87 = game:GetService("InsertService"):LoadAsset(65469908)--scullcracker
  5536. for _, v in pairs(insrt87:GetChildren()) do
  5537. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5538. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5539. end
  5540. end
  5541. local insrt88 = game:GetService("InsertService"):LoadAsset(33383241)--remotemine
  5542. for _, v in pairs(insrt88:GetChildren()) do
  5543. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5544. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5545. end
  5546. end
  5547. local insrt89 = game:GetService("InsertService"):LoadAsset(32353654)--moonwalkdance
  5548. for _, v in pairs(insrt89:GetChildren()) do
  5549. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5550. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5551. end
  5552. end
  5553. local insrt90 = game:GetService("InsertService"):LoadAsset(32355966)--winsomewand
  5554. for _, v in pairs(insrt90:GetChildren()) do
  5555. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5556. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5557. end
  5558. end
  5559. local insrt91 = game:GetService("InsertService"):LoadAsset(35293856)--atomizer
  5560. for _, v in pairs(insrt91:GetChildren()) do
  5561. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5562. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5563. end
  5564. end
  5565. local insrt92 = game:GetService("InsertService"):LoadAsset(50938773)--taserblade
  5566. for _, v in pairs(insrt92:GetChildren()) do
  5567. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5568. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5569. end
  5570. end
  5571. local insrt93 = game:GetService("InsertService"):LoadAsset(32858662)--icestaff
  5572. for _, v in pairs(insrt93:GetChildren()) do
  5573. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5574. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5575. end
  5576. end
  5577. local insrt94 = game:GetService("InsertService"):LoadAsset(16469499)--highphaser
  5578. for _, v in pairs(insrt94:GetChildren()) do
  5579. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5580. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5581. end
  5582. end
  5583. local insrt95 = game:GetService("InsertService"):LoadAsset(47871646)--tornade
  5584. for _, v in pairs(insrt95:GetChildren()) do
  5585. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5586. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5587. end
  5588. end
  5589. local insrt96 = game:GetService("InsertService"):LoadAsset(35366215)--roboarm
  5590. for _, v in pairs(insrt96:GetChildren()) do
  5591. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5592. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5593. end
  5594. end
  5595. local insrt97 = game:GetService("InsertService"):LoadAsset(64160547)--hoverboard
  5596. for _, v in pairs(insrt97:GetChildren()) do
  5597. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5598. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5599. end
  5600. end
  5601. local insrt98 = game:GetService("InsertService"):LoadAsset(54694334)--vilethorn
  5602. for _, v in pairs(insrt98:GetChildren()) do
  5603. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5604. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5605. end
  5606. end
  5607. local insrt99 = game:GetService("InsertService"):LoadAsset(69210321)--darkstaff
  5608. for _, v in pairs(insrt99:GetChildren()) do
  5609. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5610. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5611. end
  5612. end
  5613. local insrt100 = game:GetService("InsertService"):LoadAsset(62827121)--evilwand
  5614. for _, v in pairs(insrt100:GetChildren()) do
  5615. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5616. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5617. end
  5618. end
  5619. local insrt101 = game:GetService("InsertService"):LoadAsset(18010691)--awestar
  5620. for _, v in pairs(insrt101:GetChildren()) do
  5621. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5622. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5623. end
  5624. end
  5625. local insrt102 = game:GetService("InsertService"):LoadAsset(51302649)--swordandshield
  5626. for _, v in pairs(insrt102:GetChildren()) do
  5627. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5628. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5629. end
  5630. end
  5631. local insrt103 = game:GetService("InsertService"):LoadAsset(10760425)--sparkstaff
  5632. for _, v in pairs(insrt103:GetChildren()) do
  5633. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5634. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5635. end
  5636. end
  5637. local insrt104 = game:GetService("InsertService"):LoadAsset(73799348)--undoingaxe
  5638. for _, v in pairs(insrt104:GetChildren()) do
  5639. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5640. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5641. end
  5642. end
  5643. local insrt105 = game:GetService("InsertService"):LoadAsset(73232786)--dragonstaff
  5644. for _, v in pairs(insrt105:GetChildren()) do
  5645. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5646. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5647. end
  5648. end
  5649. local insrt106 = game:GetService("InsertService"):LoadAsset(73232825)--screeshpotion
  5650. for _, v in pairs(insrt106:GetChildren()) do
  5651. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5652. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5653. end
  5654. end
  5655. local insrt107 = game:GetService("InsertService"):LoadAsset(73265108)--dualcannon
  5656. for _, v in pairs(insrt107:GetChildren()) do
  5657. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5658. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5659. end
  5660. end
  5661. local insrt108 = game:GetService("InsertService"):LoadAsset(74385438)--gravitron
  5662. for _, v in pairs(insrt108:GetChildren()) do
  5663. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5664. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5665. end
  5666. end
  5667. local insrt109 = game:GetService("InsertService"):LoadAsset(74385386)--razevenge
  5668. for _, v in pairs(insrt109:GetChildren()) do
  5669. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5670. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5671. end
  5672. end
  5673. local insrt110 = game:GetService("InsertService"):LoadAsset(74385418)--glorylauncher
  5674. for _, v in pairs(insrt110:GetChildren()) do
  5675. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5676. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5677. end
  5678. end
  5679. local insrt111 = game:GetService("InsertService"):LoadAsset(73888479)--spikesplosion
  5680. for _, v in pairs(insrt111:GetChildren()) do
  5681. if not(game.Players.LocalPlayer.Backpack:FindFirstChild(v.Name))then
  5682. v:Clone().Parent = game.Players.LocalPlayer.Backpack
  5683. end
  5684. end
  5685. end
  5686. )
  5687. NewCMD("FOLLOW ME","follow","Makes someone follow you",
  5688. function(msg)
  5689. local plrs = GetPlayers(msg)
  5690. for _, plr in pairs(plrs) do
  5691. if plr and plr.Backpack then
  5692. for i = 0,7,1 do
  5693. b = Instance.new("BodyPosition")
  5694. b.Parent = game.players[plr].Torso
  5695. b.maxForce = Vector3.new(600000000,6000000000,6000000000)
  5696. while true do
  5697. b.position = game.Players[plr.Name].Character.Torso.Position
  5698. wait()
  5699. end
  5700. end
  5701. end
  5702. end
  5703. end
  5704. )
  5705. NewCMD("clone","Clone","Clones a player",
  5706. function(msg)
  5707. local plrs = GetPlayers(msg)
  5708. for _, plr in pairs(plrs) do
  5709. if plr then
  5710. if plr and plr.Character then
  5711. plr.Character.Archivable = true
  5712. local cl = plr.Character:Clone()
  5713. table.insert(objects,cl)
  5714. cl.Parent = game.Workspace
  5715. cl:MoveTo(v.Character:GetModelCFrame().p)
  5716. cl:MakeJoints()
  5717. v.Character.Archivable = false
  5718. end
  5719. end
  5720. end
  5721. end
  5722. )
  5723. NewCMD("Remove","cremove","Remove the script",
  5724. function()
  5725. for i = 0,50,1 do
  5726. pcall(function()
  5727. for j,k in pairs(getfenv(i)) do
  5728. getfenv(i)[j] = nil
  5729. end
  5730. end)
  5731. end
  5732. end
  5733. )
  5734. NewCMD("Control","control","Control a player",
  5735. function(msg)
  5736. local plrs = GetPlayers(msg)
  5737. for _, plr in pairs(plrs) do
  5738. if plr then
  5739. if plr and plr.Character then
  5740. plr.Character.Humanoid.PlatformStand = true
  5741. local w = Instance.new("Weld", plr.Character.Torso )
  5742. w.Part0 = plr.Character.Torso
  5743. w.Part1 = v.Character.Torso
  5744. local w2 = Instance.new("Weld", plr.Character.Head)
  5745. w2.Part0 = plr.Character.Head
  5746. w2.Part1 = v.Character.Head
  5747. local w3 = Instance.new("Weld", plr.Character:findFirstChild("Right Arm"))
  5748. w3.Part0 = plr.Character:findFirstChild("Right Arm")
  5749. w3.Part1 = v.Character:findFirstChild("Right Arm")
  5750. local w4 = Instance.new("Weld", plr.Character:findFirstChild("Left Arm"))
  5751. w4.Part0 = plr.Character:findFirstChild("Left Arm")
  5752. w4.Part1 = v.Character:findFirstChild("Left Arm")
  5753. local w5 = Instance.new("Weld", plr.Character:findFirstChild("Right Leg"))
  5754. w5.Part0 = plr.Character:findFirstChild("Right Leg")
  5755. w5.Part1 = v.Character:findFirstChild("Right Leg")
  5756. local w6 = Instance.new("Weld", plr.Character:findFirstChild("Left Leg"))
  5757. w6.Part0 = plr.Character:findFirstChild("Left Leg")
  5758. w6.Part1 = v.Character:findFirstChild("Left Leg")
  5759. plr.Character.Head.face:Destroy()
  5760. for i, p in pairs(v.Character:children()) do
  5761. if p:IsA("BasePart") then
  5762. p.CanCollide = false
  5763. for i, p in pairs(plr.Character:children()) do
  5764. if p:IsA("BasePart") then
  5765. p.Transparency = 1
  5766. elseif p:IsA("Hat") then
  5767. p:Destroy()
  5768. end
  5769. end
  5770. v.Character.Parent = plr.Character
  5771. v.Character.Humanoid.Changed:connect(function() v.Character.Humanoid.PlatformStand = true end)
  5772. end
  5773. end
  5774. end
  5775. end
  5776. end
  5777. end
  5778. )
  5779. NewCMD("Gold","goldify","make a player gold",
  5780. function(Plrs)
  5781. for _, plr in pairs(Plrs) do
  5782. if plr then
  5783. if plr and plr.Character and plr.Character:findFirstChild("Torso") then
  5784. if plr.Character:findFirstChild("Shirt") then plr.Character.Shirt.Parent = plr.Character.Torso end
  5785. if plr.Character:findFirstChild("Pants") then plr.Character.Pants.Parent = plr.Character.Torso end
  5786. for a, sc in pairs(plr.Character:children()) do if sc.Name == "ify" then sc:Destroy() end end
  5787. for a, prt in pairs(plr.Character:children()) do if prt:IsA("BasePart") and (prt.Name ~= "Head" or not prt.Parent:findFirstChild("NameTag", true)) then
  5788. prt.Transparency = 0 prt.Reflectance = .4 prt.BrickColor = BrickColor.new("Bright yellow")
  5789. elseif prt:findFirstChild("NameTag") then prt.Head.Transparency = 0 prt.Head.Reflectance = .4 prt.Head.BrickColor = BrickColor.new("Bright yellow")
  5790. end end
  5791. end
  5792. end
  5793. end
  5794. end
  5795. )
  5796. NewCMD("Fire", "fi", "Sets a player on fire",function(msg)
  5797. local plrs = GetPlayers(msg)
  5798. for _,plr in next,plrs do
  5799. local Nam = plr.Name
  5800. local F = Instance.new("Fire")
  5801. F.Parent = plr.Character.Torso
  5802. ChatBubble.Create("Given Fire to: "..plr.Name"!")
  5803. GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("Deep orange"), float_duration = 0.2})
  5804. end
  5805. end)
  5806.  
  5807. NewCMD("Sparkles", "spa", "Gives a player sparkles",function(msg)
  5808. local plrs = GetPlayers(msg)
  5809. for _,plr in next,plrs do
  5810. local F = Instance.new("Sparkles")
  5811. F.Parent = plr.Character.Torso
  5812. ChatBubble.Create("Given Sparkles")
  5813. GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("Lily white"), float_duration = 0.2})
  5814. end
  5815. end)
  5816.  
  5817. NewCMD("Admin", "admin", "Gives a player sparkles",function(msg)
  5818. local plrs = GetPlayers(msg)
  5819. for _,plr in next,plrs do
  5820. local Scrn = script.Name
  5821. local Scr = script.Parent[Scrn]:Clone()
  5822. Scr.Parent = game.Players[plr].Backpack
  5823.  
  5824. end
  5825. end)
  5826.  
  5827.  
  5828. NewCMD("ClearBackpack", "cback", "Clears a players backpack",function(msg)
  5829. local plrs = GetPlayers(msg)
  5830. for _,plr in next,plrs do
  5831. plr.Backpack:ClearAllChildren()
  5832. GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("Lily white"), float_duration = 0.2})
  5833. end
  5834. end)
  5835.  
  5836. NewCMD("Btools", "bto", "Gives a player building tools",function(msg)
  5837. local plrs = GetPlayers(msg)
  5838. for _,plr in next,plrs do
  5839. local x = game:GetService("InsertService"):LoadAsset(73089166) x.Parent = game.Players[plr.Name].Backpack
  5840. local x = game:GetService("InsertService"):LoadAsset(73089204) x.Parent = game.Players[plr.Name].Backpack
  5841. local x = game:GetService("InsertService"):LoadAsset(73089190) x.Parent = game.Players[plr.Name].Backpack
  5842. local x = game:GetService("InsertService"):LoadAsset(58880579) x.Parent = game.Players[plr.Name].Backpack
  5843. local x = game:GetService("InsertService"):LoadAsset(60791062) x.Parent = game.Players[plr.Name].Backpack
  5844. local x = game:GetService("InsertService"):LoadAsset(73089239) x.Parent = game.Players[plr.Name].Backpack
  5845. ChatBubble.Create("Given Btools")
  5846. GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("Lily white"), float_duration = 0.2})
  5847. end
  5848. end)
  5849.  
  5850. NewCMD("Knife", "kni", "Gives a player a knife",function(msg)
  5851. local plrs = GetPlayers(msg)
  5852. for _,plr in next,plrs do
  5853. ChatBubble.Create("Given Knife")
  5854. local x = game:GetService("InsertService"):LoadAsset(170897263) x.Parent = game.Players[plr.Name].Backpack
  5855. GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("Lily white"), float_duration = 0.2})
  5856. end
  5857. end)
  5858.  
  5859. NewCMD("Darksteel", "drks", "Gives a player the darksteel katana",function(msg)
  5860. local plrs = GetPlayers(msg)
  5861. for _,plr in next,plrs do
  5862. local x = game:GetService("InsertService"):LoadAsset(86494893) x.Parent = game.Players[plr.Name].Backpack
  5863. GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("Lily white"), float_duration = 0.2})
  5864. end
  5865. end)
  5866.  
  5867. NewCMD("Archer", "arch", "Gives a player ALOT of bows",function(msg)
  5868. local plrs = GetPlayers(msg)
  5869. for _,plr in next,plrs do
  5870. local x = game:GetService("InsertService"):LoadAsset(92142841) x.Parent = game.Players[plr.Name].Backpack
  5871. local x = game:GetService("InsertService"):LoadAsset(110892267) x.Parent = game.Players[plr.Name ].Backpack
  5872. local x = game:GetService("InsertService"):LoadAsset(160198008) x.Parent = game.Players[plr.Name].Backpack
  5873. local x = game:GetService("InsertService"):LoadAsset(204485737) x.Parent = game.Players[plr.Name].Backpack
  5874. local x = game:GetService("InsertService"):LoadAsset(223785350) x.Parent = game.Players[plr.Name].Backpack
  5875. local x = game:GetService("InsertService"):LoadAsset(287425246) x.Parent = game.Players[plr.Name].Backpack
  5876. GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("Lily white"), float_duration = 0.2})
  5877. end
  5878. end)
  5879.  
  5880. NewCMD("Swords", "swor", "Gives a player ALOT of swords",function(msg)
  5881. local plrs = GetPlayers(msg)
  5882. for _,plr in next,plrs do
  5883. local x = game:GetService("InsertService"):LoadAsset(159229806) x.Parent = game.Players[plr.Name].Backpack
  5884. local x = game:GetService("InsertService"):LoadAsset(101191388) x.Parent = game.Players[plr.Name].Backpack
  5885. local x = game:GetService("InsertService"):LoadAsset(77443491) x.Parent = game.Players[plr.Name].Backpack
  5886. local x = game:GetService("InsertService"):LoadAsset(77443461) x.Parent = game.Players[plr.Name].Backpack
  5887. local x = game:GetService("InsertService"):LoadAsset(108149175) x.Parent = game.Players[plr.Name].Backpack
  5888. local x = game:GetService("InsertService"):LoadAsset(53623248) x.Parent = game.Players[plr.Name].Backpack
  5889. GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("Lily white"), float_duration = 0.2})
  5890. end
  5891. end)
  5892.  
  5893.  
  5894.  
  5895. NewCMD("ForceField", "ff", "Gives a player a ForceField",function(msg)
  5896. local plrs = GetPlayers(msg)
  5897. for _,plr in next,plrs do
  5898. local F = Instance.new("ForceField")
  5899. F.Parent = plr.Character
  5900. ChatBubble.Create("Given FF!")
  5901. end
  5902. end)
  5903.  
  5904. NewCMD("Fix Chat","fixc","Fixes the chat",function()
  5905. ChatBubble.Create("Fixed Chat")
  5906. end)
  5907. NewCMD("RemoveFire", "rfia", "Removes fire from a player",function(msg)
  5908. local plrs = GetPlayers(msg)
  5909. for _,plr in next,plrs do
  5910. for _,Child in pairs(plr["Character"].Torso:GetChildren()) do
  5911. if Child:IsA("Fire") then
  5912. Child:Destroy()
  5913. end
  5914. end
  5915. end
  5916. end)
  5917.  
  5918. NewCMD("Stop Messages", "sm", "Clears all messages in the workspace",function()
  5919. for _,Child in pairs(game.Workspace:GetChildren()) do
  5920. if Child:IsA("Message") then
  5921. Child:Destroy()
  5922. end
  5923. end
  5924. end)
  5925.  
  5926. NewCMD("RemoveSparkles", "rsp", "Removes Sparkles From A Player",function(msg)
  5927. local plrs = GetPlayers(msg)
  5928. for _,plr in next,plrs do
  5929. for _,Child in pairs(plr["Character"].Torso:GetChildren()) do
  5930. if Child:IsA("Sparkles") then
  5931. Child:Destroy()
  5932. end
  5933. end
  5934. end
  5935. end)
  5936.  
  5937. NewCMD("RemoveForceField", "rff", "Removes ff from a player",function(msg)
  5938. local plrs = GetPlayers(msg)
  5939. for _,plr in next,plrs do
  5940. for _,Child in pairs(plr["Character"]:GetChildren()) do
  5941. if Child:IsA("ForceField") then
  5942. Child:Destroy()
  5943. end
  5944. end
  5945. end
  5946. end)
  5947.  
  5948. NewCMD("God", "go", "Makes a player god",function(msg)
  5949. local plrs = GetPlayers(msg)
  5950. for _,plr in next,plrs do
  5951. plr.Character.Humanoid.MaxHealth = math.huge
  5952. plr.Character.Humanoid.Health = math.huge
  5953. ChatBubble.Create("Goded Player!")
  5954.  
  5955. end
  5956. end)
  5957.  
  5958. NewCMD("Remove god", "rgo", "Remove god from a player",function(msg)
  5959. local plrs = GetPlayers(msg)
  5960. for _,plr in next,plrs do
  5961. plr.Character.Humanoid.MaxHealth = 100
  5962. plr.Character.Humanoid.Health = 100
  5963. GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("Really red"), float_duration = 0.2})
  5964. end
  5965. end)
  5966.  
  5967.  
  5968.  
  5969.  
  5970. NewCMD("Playerinfo", "pin", "Shows a players information",function(msg)
  5971. local plrs = GetPlayers(msg)
  5972. for _,plr in next,plrs do
  5973. GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("Forest green"), float_duration = 0.2})
  5974. Tablet("Age: "..plr.AccountAge, Colors.Magenta)
  5975. Tablet("Membership: "..plr.MembershipType.Name, Colors.Magenta)
  5976. Tablet("Player: "..plr.Name, Colors.Magenta)
  5977. Tablet("Id: "..plr.userId, Colors.Magenta)
  5978. Tablet("Camera Mode: "..plr.CameraMode.Name, Colors.Magenta)
  5979. Tablet("This is "..plr.."'s info", Colors.Magenta)
  5980. ChatBubble.Create("Found info!")
  5981. end
  5982. end)
  5983.  
  5984. Services = {
  5985. game:GetService("Workspace"),
  5986. game:GetService("Players"),
  5987. game:GetService("Lighting"),
  5988. game:GetService("StarterPack"),
  5989. game:GetService("StarterGui"),
  5990. game:GetService("Teams"),
  5991. game:GetService("SoundService"),
  5992. game:GetService("Debris"),
  5993. game:GetService("InsertService"),
  5994. game:GetService("RunService"),
  5995. game:GetService("Chat"),
  5996. game:GetService("TeleportService"),
  5997. game:GetService("Geometry"),
  5998. game:GetService("MarketplaceService"),
  5999. game:GetService("BadgeService"),
  6000. game:GetService("FriendService"),
  6001. }
  6002. function Explore(Item)
  6003. Dismiss()
  6004. if(Item==nil)then
  6005. for _,v in pairs(Services)do
  6006. Tablet(tostring(v),Colors.Black,function() wait() Explore(v) end)
  6007. end;
  6008. else
  6009. f={
  6010. ['View children']=function()
  6011. Dismiss()
  6012. for _,v in pairs(Item:children())do
  6013. Tablet(v.Name,Colors.Black,function()
  6014. wait()
  6015. Explore(v)
  6016. end);
  6017. end;
  6018. end;
  6019. ['View parent']=function()
  6020. wait()
  6021. Explore(Item.Parent)
  6022. end;
  6023. ['Destroy']=function()
  6024. Item:Destroy();
  6025. Explore(Item.Parent);
  6026. end;
  6027. ['Clear']=function()
  6028. Item:ClearAllChildren()
  6029. end;
  6030. ['Clone']=function()
  6031. pcall(function()
  6032. cloneableObj = Item:clone()
  6033. end)
  6034. end;
  6035. ['Remove']=function()
  6036. Item:remove()
  6037. end;
  6038. ['Stop']=function()
  6039. Item:Stop()
  6040. end;
  6041. ['Play']=function()
  6042. Item:Play()
  6043. end;
  6044. ['Shiny']=function()
  6045. Item.Reflectance = 1
  6046. end;
  6047. ['Un-Shiny']=function()
  6048. Item.Reflectance = 0
  6049. end;
  6050. ['Transparent']=function()
  6051. Item.Transparency = 1
  6052. end;
  6053. ['Opaque']=function()
  6054. Item.Transparency = 0
  6055. end;
  6056. ['Paste']=function()
  6057. if cloneableObj then
  6058. cloneableObj.Parent = Item
  6059. end
  6060. end;
  6061. };
  6062. for i,v in pairs(f)do
  6063. Tablet(tostring(i),Colors.Red,v);
  6064. end;
  6065. Tablet('Item Name: \''..tostring(Item.Name)..'\'',Colors.Blue,nil);
  6066. Tablet('Class: \''..tostring(Item.ClassName)..'\'',Colors.Blue,nil);
  6067. if cloneableObj then
  6068. Tablet('Currently Cloning: \''..tostring(cloneableObj.Name)..'\'',Colors.Blue,nil);
  6069. end
  6070. end;
  6071. end;
  6072.  
  6073. function NewSong(SongId)
  6074. local M = Instance.new("Sound")
  6075. M.Parent = game.Workspace
  6076. M.SoundId = "http://www.roblox.com/asset/?id="..SongId
  6077. M.Volume = 0.8
  6078. M.Looped = true
  6079. M.Name = "Song"
  6080. if game.Workspace.Song then
  6081. M:remove()
  6082. else
  6083. M:Play()
  6084. end
  6085. end
  6086.  
  6087.  
  6088.  
  6089.  
  6090. function Music()
  6091. Dismiss()
  6092. Tablet("Hotline Bling- Drake", Colors.White,
  6093. NewSong("283801001"))
  6094. Tablet("Fireflies- Owl city", Colors.White,
  6095. NewSong("319059356"))
  6096. Tablet("Hello- Adele", Colors.White,
  6097. NewSong("rbxassetid://313694441"))
  6098. Tablet("DROP THE BASS", Colors.White,
  6099. NewSong("130777688"))
  6100. Tablet("21 Pilots Stressed Out", Colors.White,
  6101. NewSong("243372213"))
  6102. Tablet("MLG can can", Colors.White,
  6103. NewSong("177080835"))
  6104. Tablet("Stop Songs!",Colors.Red, StopSongs())
  6105. end
  6106.  
  6107. NewCMD("Music List","music","Shows the music list!",
  6108. function()
  6109. Music()
  6110. end
  6111. )
  6112.  
  6113. function StopSongs()
  6114. game.Song:remove()
  6115. Tablet("Stop Songs!",Colors.Red, StopSongs)
  6116. end
  6117.  
  6118.  
  6119.  
  6120. NewCMD("Explore","expl","Explore the game",
  6121. function()
  6122. Explore()
  6123. end
  6124. )
  6125.  
  6126.  
  6127.  
  6128.  
  6129.  
  6130.  
  6131.  
  6132.  
  6133. NewCMD("Doge", "doge", "Dogeify's the player", function(msg)
  6134. local plrs = GetPlayers(msg)
  6135. for _,plr in next,plrs do
  6136. GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("Really red"), float_duration = 0.2})
  6137. local function QuaternionFromCFrame(cf)
  6138. local mx, my, mz, m00, m01, m02, m10, m11, m12, m20, m21, m22 = cf:components()
  6139. local trace = m00 + m11 + m22
  6140. if trace > 0 then
  6141. local s = math.sqrt(1 + trace)
  6142. local recip = 0.5/s
  6143. return (m21-m12)*recip, (m02-m20)*recip, (m10-m01)*recip, s*0.5
  6144. else
  6145. local i = 0
  6146. if m11 > m00 then
  6147. i = 1
  6148. end
  6149. if m22 > (i == 0 and m00 or m11) then
  6150. i = 2
  6151. end
  6152. if i == 0 then
  6153. local s = math.sqrt(m00-m11-m22+1)
  6154. local recip = 0.5/s
  6155. return 0.5*s, (m10+m01)*recip, (m20+m02)*recip, (m21-m12)*recip
  6156. elseif i == 1 then
  6157. local s = math.sqrt(m11-m22-m00+1)
  6158. local recip = 0.5/s
  6159. return (m01+m10)*recip, 0.5*s, (m21+m12)*recip, (m02-m20)*recip
  6160. elseif i == 2 then
  6161. local s = math.sqrt(m22-m00-m11+1)
  6162. local recip = 0.5/s return (m02+m20)*recip, (m12+m21)*recip, 0.5*s, (m10-m01)*recip
  6163. end
  6164. end
  6165. end
  6166. local function QuaternionToCFrame(px, py, pz, x, y, z, w)
  6167. local xs, ys, zs = x + x, y + y, z + z
  6168. local wx, wy, wz = w*xs, w*ys, w*zs
  6169. local xx = x*xs
  6170. local xy = x*ys
  6171. local xz = x*zs
  6172. local yy = y*ys
  6173. local yz = y*zs
  6174. local zz = z*zs
  6175. return CFrame.new(px, py, pz,1-(yy+zz), xy - wz, xz + wy,xy + wz, 1-(xx+zz), yz - wx, xz - wy, yz + wx, 1-(xx+yy))
  6176. end
  6177. local function QuaternionSlerp(a, b, t)
  6178. local cosTheta = a[1]*b[1] + a[2]*b[2] + a[3]*b[3] + a[4]*b[4]
  6179. local startInterp, finishInterp;
  6180. if cosTheta >= 0.0001 then
  6181. if (1 - cosTheta) > 0.0001 then
  6182. local theta = math.acos(cosTheta)
  6183. local invSinTheta = 1/math.sin(theta)
  6184. startInterp = math.sin((1-t)*theta)*invSinTheta
  6185. finishInterp = math.sin(t*theta)*invSinTheta
  6186. else
  6187. startInterp = 1-t
  6188. finishInterp = t
  6189. end
  6190. else
  6191. if (1+cosTheta) > 0.0001 then
  6192. local theta = math.acos(-cosTheta)
  6193. local invSinTheta = 1/math.sin(theta)
  6194. startInterp = math.sin((t-1)*theta)*invSinTheta
  6195. finishInterp = math.sin(t*theta)*invSinTheta
  6196. else
  6197. startInterp = t-1
  6198. finishInterp = t
  6199. end
  6200. end
  6201. return a[1]*startInterp + b[1]*finishInterp, a[2]*startInterp + b[2]*finishInterp, a[3]*startInterp + b[3]*finishInterp, a[4]*startInterp + b[4]*finishInterp
  6202. end
  6203. function clerp(a,b,t)
  6204. local qa = {QuaternionFromCFrame(a)}
  6205. local qb = {QuaternionFromCFrame(b)}
  6206. local ax, ay, az = a.x, a.y, a.z
  6207. local bx, by, bz = b.x, b.y, b.z
  6208. local _t = 1-t
  6209. return QuaternionToCFrame(_t*ax + t*bx, _t*ay + t*by, _t*az + t*bz,QuaternionSlerp(qa, qb, t))
  6210. end
  6211.  
  6212. do --the animating
  6213.  
  6214. char = plr.Character
  6215. mouse = plr:GetMouse()
  6216. humanoid = char:findFirstChild("Humanoid")
  6217. torso = char:findFirstChild("Torso")
  6218. head = char.Head
  6219. ra = char:findFirstChild("Right Arm")
  6220. la = char:findFirstChild("Left Arm")
  6221. rl = char:findFirstChild("Right Leg")
  6222. ll = char:findFirstChild("Left Leg")
  6223. rs = torso:findFirstChild("Right Shoulder")
  6224. ls = torso:findFirstChild("Left Shoulder")
  6225. rh = torso:findFirstChild("Right Hip")
  6226. lh = torso:findFirstChild("Left Hip")
  6227. neck = torso:findFirstChild("Neck")
  6228. rj = char:findFirstChild("HumanoidRootPart"):findFirstChild("RootJoint")
  6229. anim = char:findFirstChild("Animate")
  6230. rootpart = char:findFirstChild("HumanoidRootPart")
  6231. camera = workspace.CurrentCamera
  6232. if anim then
  6233. anim:Destroy()
  6234. end
  6235.  
  6236.  
  6237. local rm = Instance.new("Motor", torso)
  6238. rm.C0 = CFrame.new(1.5, 0.5, 0)
  6239. rm.C1 = CFrame.new(0, 0.5, 0)
  6240. rm.Part0 = torso
  6241. rm.Part1 = ra
  6242. local lm = Instance.new("Motor", torso)
  6243. lm.C0 = CFrame.new(-1.5, 0.5, 0)
  6244. lm.C1 = CFrame.new(0, 0.5, 0)
  6245. lm.Part0 = torso
  6246. lm.Part1 = la
  6247.  
  6248. local rlegm = Instance.new("Motor", torso)
  6249. rlegm.C0 = CFrame.new(0.5, -1, 0)
  6250. rlegm.C1 = CFrame.new(0, 1, 0)
  6251. rlegm.Part0 = torso
  6252. rlegm.Part1 = rl
  6253. local llegm = Instance.new("Motor", torso)
  6254. llegm.C0 = CFrame.new(-0.5, -1, 0)
  6255. llegm.C1 = CFrame.new(0, 1, 0)
  6256. llegm.Part0 = torso
  6257. llegm.Part1 = ll
  6258.  
  6259. neck.C0 = CFrame.new(0, 1, 0)
  6260. neck.C1 = CFrame.new(0, -0.5, 0)
  6261.  
  6262.  
  6263. rj.C0 = CFrame.new()
  6264. rj.C1 = CFrame.new()
  6265.  
  6266.  
  6267. local sound = Instance.new("Sound", head)
  6268. sound.SoundId = "http://www.roblox.com/asset/?id=130797915"
  6269. sound.Volume = 0.8
  6270. sound.Looped = true
  6271.  
  6272. for i,v in pairs(char:children()) do
  6273. if v:IsA("Hat") then
  6274. v:Destroy()
  6275. end
  6276. end
  6277.  
  6278.  
  6279. --look of the fox here
  6280. game:service'InsertService':LoadAsset(151784320):children()[1].Parent = char
  6281. Instance.new("PointLight", head).Range = 10
  6282.  
  6283.  
  6284.  
  6285.  
  6286. local speed = 0.3
  6287. local angle = 0
  6288. local sitting = false
  6289. local humanwalk = false
  6290. local anglespeed = 1
  6291. rsc0 = rm.C0
  6292. lsc0 = lm.C0
  6293. llc0 = llegm.C0
  6294. rlc0 = rlegm.C0
  6295. neckc0 = neck.C0
  6296.  
  6297. local controllerService = game:GetService("ControllerService")
  6298. local controller = controllerService:GetChildren()[1]
  6299.  
  6300. controller.Parent = nil
  6301.  
  6302. Instance.new("HumanoidController", game:service'ControllerService')
  6303. Instance.new("SkateboardController", game:service'ControllerService')
  6304. Instance.new("VehicleController", game:service'ControllerService')
  6305. local controller = controllerService:GetChildren()[1]
  6306. mouse.KeyDown:connect(function(k)
  6307. if k == "q" then
  6308. humanwalk = not humanwalk
  6309. end
  6310. if k == "z" then
  6311. if not sound.IsPlaying then
  6312. sound:stop()
  6313. sound.SoundId = "http://www.roblox.com/asset/?id=130802245"
  6314. wait()
  6315. sound:play()
  6316. end
  6317. end
  6318. if k == "x" then
  6319. if not sound.IsPlaying then
  6320. sound:stop()
  6321. sound.SoundId = "http://www.roblox.com/asset/?id=130797915"
  6322. wait()
  6323. sound:play()
  6324. end
  6325. end
  6326. if k == "c" then
  6327. if not sound.IsPlaying then
  6328. sound:stop()
  6329. sound.SoundId = "http://www.roblox.com/asset/?id=149713968"
  6330. wait()
  6331. sound:play()
  6332. end
  6333. end
  6334. if string.byte(k) == 48 then
  6335. humanoid.WalkSpeed = 34
  6336. end
  6337.  
  6338. end)
  6339. mouse.KeyUp:connect(function(k)
  6340.  
  6341. if string.byte(k) == 48 then
  6342. humanoid.WalkSpeed = 16
  6343. end
  6344.  
  6345. end)
  6346.  
  6347.  
  6348.  
  6349. while wait() do
  6350. angle = (angle % 100) + anglespeed/10
  6351. mvmnt = math.pi * math.sin(math.pi*2/100*(angle*10))
  6352. local rscf = rsc0
  6353. local lscf = lsc0
  6354. local rlcf = rlc0
  6355. local llcf = llc0
  6356. local rjcf = CFrame.new()
  6357. local ncf = neckc0
  6358. local rayz = Ray.new(rootpart.Position, Vector3.new(0, -6, 0))
  6359. local hitz, enz = workspace:findPartOnRay(rayz, char)
  6360. if not hitz then
  6361. if sound.IsPlaying then
  6362. sound:stop()
  6363. end
  6364.  
  6365. if Vector3.new(torso.Velocity.x, 0, torso.Velocity.z).magnitude > 2 then
  6366.  
  6367. ncf = neckc0 * CFrame.Angles(math.pi/5, 0, 0)
  6368. rjcf = CFrame.new() * CFrame.Angles(-math.pi/5, math.sin(angle)*0.05, 0)
  6369. rscf = rsc0 * CFrame.Angles(math.pi/1.7+math.sin(angle)*0.1, 0, 0)
  6370. lscf = lsc0 * CFrame.Angles(math.pi/1.7+math.sin(-angle)*0.1, 0, 0)
  6371. rlcf = rlc0 * CFrame.Angles(-math.pi/10+math.sin(-angle)*0.3, 0, 0)
  6372. llcf = llc0 * CFrame.Angles(-math.pi/10+math.sin(angle)*0.3, 0, 0)
  6373.  
  6374. else
  6375.  
  6376. ncf = neckc0 * CFrame.Angles(math.pi/14, 0, 0)
  6377. rjcf = CFrame.new() * CFrame.Angles(-math.pi/18, math.sin(angle)*0.05, 0)
  6378. rscf = rsc0 * CFrame.Angles(-math.pi/10+math.sin(angle)*0.2, 0, 0)
  6379. lscf = lsc0 * CFrame.Angles(-math.pi/10+math.sin(-angle)*0.2, 0, 0)
  6380. rlcf = rlc0 * CFrame.new(0, 0.7, -0.5) CFrame.Angles(-math.pi/14, 0, 0)
  6381. llcf = llc0 * CFrame.Angles(-math.pi/20, 0, 0)
  6382.  
  6383. end
  6384. elseif humanoid.Sit then
  6385. if sound.IsPlaying and sound.SoundId == "http://www.roblox.com/asset/?id=130797915" then
  6386. anglespeed = 6
  6387. ncf = neckc0 * CFrame.Angles(math.pi/5-math.sin(angle)*0.1, 0, 0)
  6388. rjcf = CFrame.new(0, -0.8, 0) * CFrame.Angles(-math.pi/5, 0, 0)
  6389. rscf = rsc0 * CFrame.new(-.45, 0.2, -.3) * CFrame.Angles(math.pi/3, 0, -math.rad(15))
  6390. lscf = lsc0 * CFrame.new(.45, 0.2, -.3) * CFrame.Angles(math.pi/3, 0, math.rad(15))
  6391. rlcf = rlc0 * CFrame.Angles(math.pi/2+math.pi/5, 0, math.rad(20))
  6392. llcf = llc0 * CFrame.Angles(math.pi/2+math.pi/5, 0, -math.rad(20))
  6393. elseif sound.IsPlaying and sound.SoundId == "http://www.roblox.com/asset/?id=135570347" then
  6394. anglespeed = 4
  6395. ncf = neckc0 * CFrame.Angles(math.pi/5-math.abs(math.sin(angle))*0.3, 0, 0)
  6396. rjcf = CFrame.new(0, -0.8, 0) * CFrame.Angles(-math.pi/5, 0, 0)
  6397. rscf = rsc0 * CFrame.new(-.45, 0.2, -.3) * CFrame.Angles(math.pi/3, 0, -math.rad(15))
  6398. lscf = lsc0 * CFrame.new(.45, 0.2, -.3) * CFrame.Angles(math.pi/3, 0, math.rad(15))
  6399. rlcf = rlc0 * CFrame.Angles(math.pi/2+math.pi/5, 0, math.rad(20))
  6400. llcf = llc0 * CFrame.Angles(math.pi/2+math.pi/5, 0, -math.rad(20))
  6401. elseif sound.IsPlaying and sound.SoundId == "http://www.roblox.com/asset/?id=149713968" then
  6402. anglespeed = 2
  6403. ncf = neckc0 * CFrame.Angles(math.pi/5, 0, math.sin(angle)*0.08)
  6404. rjcf = CFrame.new(0, -0.8, 0) * CFrame.Angles(-math.pi/5, math.sin(angle)*0.01, 0)
  6405. rscf = rsc0 * CFrame.new(-.45, 0.2, -.3) * CFrame.Angles(math.pi/3, 0, -math.rad(15))
  6406. lscf = lsc0 * CFrame.new(.45, 0.2, -.3) * CFrame.Angles(math.pi/3, 0, math.rad(15))
  6407. rlcf = rlc0 * CFrame.Angles(math.pi/2+math.pi/5, 0, math.rad(20))
  6408. llcf = llc0 * CFrame.Angles(math.pi/2+math.pi/5, 0, -math.rad(20))
  6409. else
  6410. anglespeed = 1/2
  6411. ncf = neckc0 * CFrame.Angles(math.pi/5, 0, math.sin(angle)*0.08)
  6412. rjcf = CFrame.new(0, -0.8, 0) * CFrame.Angles(-math.pi/5, math.sin(angle)*0.01, 0)
  6413. rscf = rsc0 * CFrame.new(-.45, 0.2, -.3) * CFrame.Angles(math.pi/3, 0, -math.rad(15))
  6414. lscf = lsc0 * CFrame.new(.45, 0.2, -.3) * CFrame.Angles(math.pi/3, 0, math.rad(15))
  6415. rlcf = rlc0 * CFrame.Angles(math.pi/2+math.pi/5, 0, math.rad(20))
  6416. llcf = llc0 * CFrame.Angles(math.pi/2+math.pi/5, 0, -math.rad(20))
  6417. end
  6418. elseif Vector3.new(torso.Velocity.x, 0, torso.Velocity.z).magnitude < 2 then
  6419. if sound.IsPlaying and sound.SoundId == "http://www.roblox.com/asset/?id=130797915" then
  6420. anglespeed = 6
  6421. ncf = neckc0 * CFrame.Angles(math.pi/10-math.sin(angle)*0.07, 0, 0)
  6422. rjcf = CFrame.new(0, 0, 0) * CFrame.Angles(-math.pi/10, math.sin(angle)*0.001, 0)
  6423. rscf = rsc0 * CFrame.Angles(math.pi/1+math.sin(angle)*0.5, 0, 0)
  6424. lscf = lsc0 * CFrame.Angles(math.pi/1+math.sin(angle)*0.5, 0, 0)
  6425. rlcf = rlc0 * CFrame.Angles(math.pi/10, math.sin(angle)*0.08, math.rad(6.5))
  6426. llcf = llc0 * CFrame.Angles(math.pi/10, -math.sin(angle)*0.08, -math.rad(6.5))
  6427. elseif sound.IsPlaying and sound.SoundId == "http://www.roblox.com/asset/?id=149713968" then
  6428. anglespeed = 2
  6429. ncf = neckc0 * CFrame.Angles(math.pi/10-math.abs(math.sin(angle))*0.3, 0, 0)
  6430. rjcf = CFrame.new(0, 0, 0) * CFrame.Angles(-math.pi/20, math.sin(angle)*0.001, 0)
  6431. rscf = rsc0 * CFrame.Angles(math.pi/2+math.abs(math.sin(angle)*1), 0, 0)
  6432. lscf = lsc0 * CFrame.Angles(math.pi/2+math.abs(math.sin(angle)*1), 0, 0)
  6433. rlcf = rlc0 * CFrame.Angles(math.pi/20, math.sin(angle)*0.08, math.rad(2.5))
  6434. llcf = llc0 * CFrame.Angles(math.pi/20, -math.sin(angle)*0.08, -math.rad(2.5))
  6435. elseif sound.IsPlaying and sound.SoundId == "http://www.roblox.com/asset/?id=130802245" then
  6436. anglespeed = 3
  6437. ncf = neckc0 * CFrame.Angles(math.sin(angle)*0.07, math.rad(30), 0)
  6438. rjcf = CFrame.new(0, 0, 0) * CFrame.Angles(0, math.sin(angle)*0.001, 0)
  6439. rscf = rsc0 * CFrame.Angles(math.sin(angle)*0.05, 0, 0)
  6440. lscf = lsc0 * CFrame.Angles(math.sin(-angle)*0.05, 0, 0)
  6441. rlcf = rlc0 * CFrame.new(0, -0.1 + math.abs(mvmnt)*0.1, -0.1) * CFrame.Angles(0, math.rad(5), math.rad(5))
  6442. llcf = llc0 * CFrame.Angles(0, math.rad(2.5), math.rad(1))
  6443. else
  6444. if humanwalk then
  6445. anglespeed = 1/4
  6446. ncf = neckc0 * CFrame.Angles(-math.sin(angle)*0.07, 0, 0)
  6447. rjcf = CFrame.new(0, 0, 0) * CFrame.Angles(0, math.sin(angle)*0.001, 0)
  6448. rscf = rsc0 * CFrame.Angles(math.sin(angle)*0.1, 0, 0)
  6449. lscf = lsc0 * CFrame.Angles(math.sin(-angle)*0.1, 0, 0)
  6450. rlcf = rlc0 * CFrame.Angles(0, math.sin(angle)*0.08, math.rad(2.5))
  6451. llcf = llc0 * CFrame.Angles(0, -math.sin(angle)*0.08, -math.rad(2.5))
  6452. else
  6453. anglespeed = 1/2
  6454. ncf = neckc0 * CFrame.Angles(math.pi/5, 0, math.sin(angle)*0.08)
  6455. rjcf = CFrame.new(0, -2, 0) * CFrame.Angles(-math.pi/5, math.sin(angle)*0.01, 0)
  6456. rscf = rsc0 * CFrame.new(-.45, 0.2, -.3) * CFrame.Angles(math.pi/3, 0, -math.rad(15))
  6457. lscf = lsc0 * CFrame.new(.45, 0.2, -.3) * CFrame.Angles(math.pi/3, 0, math.rad(15))
  6458. rlcf = rlc0 * CFrame.Angles(math.pi/2+math.pi/5, 0, math.rad(20))
  6459. llcf = llc0 * CFrame.Angles(math.pi/2+math.pi/5, 0, -math.rad(20))
  6460. end
  6461. end
  6462. elseif Vector3.new(torso.Velocity.x, 0, torso.Velocity.z).magnitude < 20 then
  6463. if sound.IsPlaying then
  6464. sound:stop()
  6465. end
  6466. if humanwalk then
  6467. anglespeed = 4
  6468. ncf = neckc0 * CFrame.Angles(math.pi/24, mvmnt*.02, 0)
  6469. rjcf = CFrame.new(0, math.abs(mvmnt)*0.05, 0) * CFrame.Angles(-math.pi/24, -mvmnt*.02, 0)
  6470. rscf = rsc0 * CFrame.Angles(math.sin(angle)*1.25, 0, -math.abs(mvmnt)*0.02)
  6471. lscf = lsc0 * CFrame.Angles(math.sin(-angle)*1.25, 0, math.abs(mvmnt)*0.02)
  6472. rlcf = rlc0 * CFrame.Angles(math.sin(-angle)*1, 0, math.rad(.5))
  6473. llcf = llc0 * CFrame.Angles(math.sin(angle)*1, 0, -math.rad(.5))
  6474. else
  6475. anglespeed = 4
  6476. ncf = neckc0 * CFrame.new(0, 0, .2) * CFrame.Angles(math.pi/1.9, 0, 0)
  6477. rjcf = CFrame.new(0, -1.5+math.abs(mvmnt)*0.05, 0) * CFrame.Angles(-math.pi/1.9, math.sin(mvmnt/2)*0.05, 0)
  6478. rscf = rsc0 * CFrame.new(-.45, 0.2, -.4+math.abs(mvmnt)*0.125) * CFrame.Angles(math.pi/2+math.sin(angle)*0.7, 0, math.rad(5))
  6479. lscf = lsc0 * CFrame.new(.45, 0.2, .1-math.abs(mvmnt)*0.125) * CFrame.Angles(math.pi/2+math.sin(-angle)*0.7, 0, -math.rad(5))
  6480. rlcf = rlc0 * CFrame.new(0, 0, -.3+math.abs(mvmnt)*0.125) * CFrame.Angles(math.pi/2.5+math.sin(-angle)*0.6, 0, math.abs(mvmnt)*0.025)
  6481. llcf = llc0 * CFrame.new(0, 0, .3-math.abs(mvmnt)*0.125) * CFrame.Angles(math.pi/2.5+math.sin(angle)*.6, 0, -math.abs(mvmnt)*0.025)
  6482. end
  6483. elseif Vector3.new(torso.Velocity.x, 0, torso.Velocity.z).magnitude >= 20 then
  6484. if sound.IsPlaying then
  6485. sound:stop()
  6486. end
  6487. if humanwalk then
  6488. anglespeed = 5
  6489. ncf = neckc0 * CFrame.Angles(math.pi/20, math.sin(angle)*.04, 0)
  6490. rjcf = CFrame.new(0, -.4 + math.abs(mvmnt)*0.25, 0) * CFrame.Angles(-math.pi/20, -math.sin(angle)*.08, 0)
  6491. rscf = rsc0 * CFrame.new(0, 0, -.3+math.abs(mvmnt)*0.125) * CFrame.Angles(math.pi/18+math.sin(angle)*1.5, 0, -math.abs(mvmnt)*0.02)
  6492. lscf = lsc0 * CFrame.new(0, 0, .3-math.abs(mvmnt)*0.125) * CFrame.Angles(math.pi/18+math.sin(-angle)*1.5, 0, math.abs(mvmnt)*0.02)
  6493. rlcf = rlc0 * CFrame.new(0, 0, -.6+math.abs(mvmnt)*0.125) * CFrame.Angles(-math.pi/18+math.sin(-angle)*1.3, 0, math.rad(.5))
  6494. llcf = llc0 * CFrame.new(0, 0, -math.abs(mvmnt)*0.125) * CFrame.Angles(-math.pi/18+math.sin(angle)*1.3, 0, -math.rad(.5))
  6495. else
  6496. anglespeed = 5.5
  6497. ncf = neckc0 * CFrame.new(0, 0, .2) * CFrame.Angles(math.pi/1.9+math.sin(mvmnt/2)*0.05, 0, 0)
  6498. rjcf = CFrame.new(0, -1.3+math.abs(mvmnt)*0.05, 0) * CFrame.Angles(-math.pi/1.9+math.abs(mvmnt/2)*0.1, 0, 0)
  6499. rscf = rsc0 * CFrame.new(-1, 0.2, -.5) * CFrame.Angles(math.pi/2+math.sin(angle)*1.8, 0, math.rad(5))
  6500. lscf = lsc0 * CFrame.new(1, 0.2, -.5) * CFrame.Angles(math.pi/2+math.sin(angle)*1.8, 0, -math.rad(5))
  6501. rlcf = rlc0 * CFrame.new(0, .3-math.abs(mvmnt)*0.125, -.3+math.abs(mvmnt)*0.125) * CFrame.Angles(math.pi/2.5+math.sin(-angle)*1.4, 0, math.abs(mvmnt)*0.025)
  6502. llcf = llc0 * CFrame.new(0, .3-math.abs(mvmnt)*0.125, .3-math.abs(mvmnt)*0.125) * CFrame.Angles(math.pi/2.5+math.sin(-angle)*1.4, 0, -math.abs(mvmnt)*0.025)
  6503. end
  6504. end
  6505.  
  6506. rm.C0 = clerp(rm.C0,rscf,speed)
  6507. lm.C0 = clerp(lm.C0,lscf,speed)
  6508. rj.C0 = clerp(rj.C0,rjcf,speed)
  6509. neck.C0 = clerp(neck.C0,ncf,speed)
  6510. rlegm.C0 = clerp(rlegm.C0,rlcf,speed)
  6511. llegm.C0 = clerp(llegm.C0,llcf,speed)
  6512. end
  6513.  
  6514.  
  6515. end
  6516. end
  6517. end)
  6518. NewCMD("LoopKill", "lk", "LoopKills the player", function(msg)
  6519. local plrs = GetPlayers(msg)
  6520. for _,plr in next,plrs do
  6521. while true do
  6522. wait(1)
  6523. plr.Character:BreakJoints()
  6524. end
  6525. end
  6526. end)
  6527.  
  6528.  
  6529. NewCMD("Useless Cmd", "uc", "The most useless cmd ever made", function(msg)
  6530. Tablet("We are sorry, but this command is useless. Please try again.", Colors.Magenta)
  6531. end)
  6532. NewCMD("Cr".."edits ", "cr".."edit", "Cre".."dits", function(msg)
  6533. Tablet("C".."redits", Colors.Green)
  6534. Tablet("Mad".."e By P".."oin".."tCoded and ng".."uye".."njimbo", Colors.White)
  6535. Tablet("Mad".."e By P".."oin".."tCoded and ng".."uye".."njimbo", Colors.White)
  6536. Tablet("Mad".."e By P".."oin".."tCoded and ng".."uye".."njimbo", Colors.Black)
  6537. Tablet("Cre".."dits a".."lso t".."oo pl".."uton".."ium cr".."eators <3", Colors.Black)
  6538.  
  6539. end)
  6540. NewCMD("Heal", "hl", "heals player",function(msg)
  6541.  
  6542. local plrs = GetPlayers(msg)
  6543. for _,plr in next,plrs do
  6544. plr.Character.Health = 100
  6545. end
  6546. end)
  6547.  
  6548.  
  6549.  
  6550.  
  6551. NewCMD("Server Shutdown", "Shutdown", "Shutdown a server", function(msg)
  6552. local M = Instance.new("Message")
  6553. ChatBubble.Create("SHUTTING DOWN SERVER","LIBERATION")
  6554. wait(1)
  6555. M.Parent = game.Workspace
  6556. M.Text = "This Server has shutdown for: "..msg
  6557. wait(0.1)
  6558. game.Lighting:ClearAllChildren()
  6559. game.Players:ClearAllChildren()
  6560. end)
  6561.  
  6562.  
  6563.  
  6564. NewCMD("Show commands","cmds", "Shows the commands",
  6565. function()
  6566. for i,v in pairs(CMDS) do
  6567. Tablet(v['Name'],Colors.Black,function()
  6568. Dismiss()
  6569. Tablet("Viewing".." : "..v['Name'])--wait u got so many I just want to access func
  6570. Tablet("Usage".." : "..v['Usage'])
  6571. Tablet("Description".." : "..v['Description'])
  6572. end)
  6573. end
  6574. end
  6575. )
  6576. NewCMD("Visible Tabs","vis:on", "Makes the tabs visible to others",
  6577. function()
  6578. TabsInWorkspace = true
  6579. end)
  6580. NewCMD("Invisible Tabs","vis:off", "Makes the tabs invisible to others",
  6581. function()
  6582. TabsInWorkspace = false
  6583. end)
  6584.  
  6585. NewCMD("Disconnect", "disc", "Disconnects the player",function(msg)
  6586. local plrs = GetPlayers(msg)
  6587. for _,plr in next,plrs do
  6588. plr:Remove()
  6589.  
  6590. end
  6591. end)
  6592. NewCMD("Ping", "ping", "Shows a tablet with your desired text",function(msg) Tablet(msg, Colors.Green) end)
  6593. NewCMD("Dismiss", "dt", "Dismisses all your tablets",function(msg) Dismiss() end)
  6594. NewCMD("Respawn", "rs", "Respawns the given player",function(msg)
  6595. local plrs = msg
  6596. for _,plr in next,plrs do
  6597. if RF ~= nil then
  6598. GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("New Yeller"), fade_out_color = BrickColor.new("Instituational White"),float_duration = 0.2})
  6599. game.Players["plr.Name"]:loadCharacter()
  6600. else
  6601. Tablet("Could not find Attachment", Colors.Red)
  6602. end
  6603. end
  6604. game.Workspace:FindFirstChild(msg):LoadCharacter()
  6605. end)
  6606.  
  6607.  
  6608. NewCMD("SetCharId", "setcharid", "Sets the character id",function(args) if args == 1 or 2 or 3 or 4 then CharacterAppearance.defaultAppearanceId = tonumber(args) end end)
  6609. NewCMD("Set Name", "setname", "Sets the player's name",function(args) user_name = args end)
  6610.  
  6611. NewCMD("Switch SB", "sb", "Switches SB",function(msg)
  6612. if msg == "nex" then
  6613. Workspace.Parent:service'TeleportService':Teleport(178350907)
  6614. elseif msg == "rj" then
  6615. Workspace.Parent:service'TeleportService':Teleport(game.PlaceId)
  6616. elseif msg == "mas" then
  6617. Workspace.Parent:service'TeleportService':Teleport(210101277)
  6618. end
  6619. end)
  6620.  
  6621. NewCMD("Nil", "nil", "Enables or disables nil Player",function(msg)
  6622. game.Players.LocalPlayer:remove()
  6623. if characterMode == "normal" then
  6624. characterMode = "pyramid"
  6625. Player.Character = nil;
  6626. NilCharacter.Teleport(Workspace.CurrentCamera.Focus.p)
  6627. NilCharacter.visible = true
  6628. PlayerControl.SetEnabled(false)
  6629. else
  6630. characterMode = "normal"
  6631. NilCharacter.visible = false
  6632. PlayerControl.SetEnabled(true)
  6633. end
  6634. end)
  6635.  
  6636. NewCMD("CountCmds", "ccmds", "Counts the commands",function()
  6637. Tablet("There is 64 Commands", Colors.Toothpaste)
  6638. end)
  6639.  
  6640.  
  6641.  
  6642. NewCMD("Reset Controls", "resetc", "Resets chat",function()
  6643. if Player.Parent ~= game.Players then
  6644. Player.Character = PlayerControl.GetCharacter()
  6645. Camera.CameraSubject = PlayerControl.GetHumanoid()
  6646. chatAdornee = PlayerControl.GetHead()
  6647. else
  6648. chatAdornee = Player.Character.Head
  6649. end
  6650. end)
  6651.  
  6652. NewCMD("Joint Crap", "jc", "Messes up the player's character",function(msg)
  6653. local plrs = GetPlayers(msg)
  6654. for _,plr in next,plrs do
  6655. GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("New Yeller"), float_duration = 0.2})
  6656. GraphicalEffects.JointCrap(plr.Character)
  6657. end
  6658. end)
  6659.  
  6660. developer = "false"
  6661. if Player.Name == "nguyenjimbo" or "YourTrueEnd" or "Player" then
  6662. developer = "true"
  6663. end
  6664. function onChatted(Message)
  6665. if string.sub(Message,1,3) == "/e " then Message = string.sub(Message,4) end
  6666. pcall(function()
  6667. for i,v in pairs(CMDS) do
  6668. local tosay = "/"..v['Usage']:lower()
  6669. if Message:sub(1,tosay:len()):lower() == tosay:lower() then
  6670. local Run,Error = ypcall(function()
  6671. v.Function(Message:sub(tosay:len()+2))
  6672. end)
  6673. if Error then
  6674. print("[Error]: "..tostring(Error))
  6675. end
  6676. end
  6677. end
  6678. end)
  6679. end
  6680.  
  6681.  
  6682. Colors = {
  6683. Red = Color3.new(1,0,0);
  6684. Orange = Color3.new(1,0.5,0);
  6685. Yellow = Color3.new(1,1,0);
  6686. Olive = Color3.new(0.5,1,0);
  6687. Lime = Color3.new(0,1,0);
  6688. Green = Color3.new(0,0.5,0);
  6689. BlueishGreen = Color3.new(0,1,0.5);
  6690. Aqua = Color3.new(0,1,1);
  6691. SoftBlue = Color3.new(0,0.5,1);
  6692. Blue = Color3.new(0,0,1);
  6693. Purple = Color3.new(0.5,0,1);
  6694. Magenta = Color3.new(0.75,0,0.75);
  6695. Pink = Color3.new(1,0,1);
  6696. White = Color3.new(1,1,1);
  6697. Grey = Color3.new(0.5,0.5,0.5);
  6698. Black = Color3.new(0,0,0);
  6699. };
  6700.  
  6701. function Dismiss()
  6702. for _=1,100 do
  6703. pcall(function()
  6704. for i,v in pairs(Tablets) do
  6705. pcall(function() v.Part:Destroy() end)
  6706. pcall(function() Tablets[i] = nil end)
  6707. end
  6708. end)
  6709. end
  6710. end
  6711.  
  6712. Tablets = {};
  6713. function Tablet(Text, Color, onClicked,onTouched,staytime)
  6714. --[[pcall(function() local a = Color.r if type(a) == "number" then Color = a end end)
  6715. pcall(function() local a = BrickColor.new(Color) if a then Color = a.Color end end)]]
  6716. if not pcall(function() local a = Color.r if type(a) ~= "number" then error() end end) then
  6717. Color = Colors.White
  6718. end
  6719. Color = BrickColor.new(Color).Color -- 2much colors c:
  6720. if Player.Character.Torso == nil then
  6721. return
  6722. end
  6723. local Insert = {}
  6724. local tab = Instance.new("Part")
  6725. if TabsInWorkspace == false then
  6726. tab.Parent = game.Workspace.CurrentCamera
  6727. else
  6728. tab.Parent = game.Workspace.Terrain
  6729. end
  6730. local light = Instance.new("PointLight", tab)
  6731. light.Enabled = true
  6732. light.Range = 15
  6733. tab.Name = tostring(math.random(-99999,99999))
  6734. tab.TopSurface = Enum.SurfaceType.Smooth
  6735. tab.LeftSurface = Enum.SurfaceType.Smooth
  6736. tab.RightSurface = Enum.SurfaceType.Smooth
  6737. tab.FrontSurface = Enum.SurfaceType.Smooth
  6738. tab.BackSurface = Enum.SurfaceType.Smooth
  6739. tab.BottomSurface = Enum.SurfaceType.Smooth
  6740. tab.FormFactor = "Custom"
  6741. tab.Size = Vector3.new(1.4, 1.6, 1.4)
  6742. tab.Anchored = true
  6743. tab.Locked = true
  6744. tab.CanCollide = false
  6745. tab.Material = "Neon"
  6746. tab.Transparency = 0
  6747. --[[local M = Instance.new("SpecialMesh")
  6748. M.Parent = LOL
  6749. M.MeshId = "http://www.roblox.com/Asset/?id=9756362"
  6750. M.TextureId = "http://www.roblox.com/asset/?id=52444910"
  6751. M.Scale = Vector3.new(1,1,1)]]--
  6752. tab.Color = BrickColor.new(Color).Color
  6753. tab.CFrame = Player.Character.Head.CFrame
  6754. if onTouched~=nil then
  6755. tab.Touched:connect(function(what)
  6756. a,b=ypcall(function()
  6757.  
  6758. onTouched(what)
  6759. end)
  6760. if not a then error(b) end
  6761. end)
  6762. end
  6763. local BoxTrans = 0.2
  6764. local box = Instance.new("SelectionBox", tab)
  6765. box.Adornee = box.Parent
  6766. box.Transparency = BoxTrans
  6767. box.Color3 = OutlineColor
  6768. box.SurfaceTransparency = 1
  6769. box.SurfaceColor3 = PlayerColor
  6770. box.LineThickness = 0.02
  6771. local gui = Instance.new("BillboardGui", tab)
  6772. gui.Adornee = tab
  6773. gui.StudsOffset = Vector3.new(0,tab.Size.Y+0.5,0)
  6774. gui.Size = UDim2.new(1,0,1,0)
  6775. local text = Instance.new("TextLabel", gui)
  6776. text.BackgroundTransparency = 1
  6777. text.Text = tostring(Text)
  6778. text.Position = UDim2.new(0.5,0,0.5,0)
  6779. text.Font = "ArialBold"
  6780. text.FontSize = "Size12"
  6781. text.TextColor3 = Color3.new(255,255,255)
  6782. text.TextStrokeTransparency = 0.4
  6783. text.TextStrokeColor3 = Color3.new(0,0,0)
  6784.  
  6785. local function DestroyThisTab()
  6786. pcall(function() tab:Destroy() end)
  6787. for i,v in pairs(Tablets) do
  6788. if v.Part.Name == tab.Name then
  6789. table.remove(Tablets, i)
  6790. end
  6791. end
  6792. end
  6793.  
  6794. local Click = Instance.new("ClickDetector", tab)
  6795. Click.MaxActivationDistance = math.huge
  6796. Click.MouseHoverEnter:connect(function(CPlayer)
  6797. if CPlayer.Name == Player.Name then
  6798. tab.Material = "Ice"
  6799.  
  6800. end
  6801. end)
  6802. Click.MouseHoverLeave:connect(function(CPlayer)
  6803. if CPlayer.Name == Player.Name then
  6804. tab.Material = "Neon"
  6805. end
  6806. end)
  6807. Click.MouseClick:connect(function(CPlayer)
  6808. if CPlayer.Name == Player.Name then
  6809. if onClicked == nil then
  6810. DestroyThisTab()
  6811. else
  6812. local Run,Error = ypcall(function()
  6813. onClicked()
  6814. end)
  6815. if Error then
  6816. Tablet(tostring(Error), Colors.Red)
  6817. end
  6818. DestroyThisTab()
  6819. end
  6820. end
  6821. end)
  6822. if type(staytime) == "number" then
  6823. Delay(staytime,function()
  6824. pcall(function() DestroyThisTab() end)
  6825. end)
  6826. end
  6827. Insert.Part = tab
  6828. table.insert(Tablets, Insert)
  6829. local rtn = {
  6830. tab=tab;
  6831. light=light;
  6832. box=box;
  6833. gui=gui;
  6834. text=text;
  6835. Click=Click;
  6836. Insert=Insert;
  6837. }
  6838. for i,v in pairs(rtn) do
  6839. pcall(function()
  6840. v.AncestryChanged:connect(function()
  6841. if tab.Parent ~= game.Workspace then
  6842. Delay(1,function() pcall(function() DestroyThisTab() end) end)
  6843. end
  6844. end)
  6845. end)
  6846. end
  6847. return rtn
  6848. end
  6849.  
  6850.  
  6851.  
  6852.  
  6853.  
  6854.  
  6855.  
  6856.  
  6857. Rotation = 5
  6858. RotationAddValue = 0.0005
  6859. ROT=function() --OH LOL worst mistake xD Do you have tab table? Yup I just fixed it
  6860. game['Run Service'].Stepped:connect(function()
  6861. pcall(function()
  6862. Rotation = Rotation + RotationAddValue -- oh
  6863. --Rotation=0.0002
  6864. local AllTabs = {}
  6865. for _,tab in pairs(Tablets) do
  6866. table.insert(AllTabs, tab)
  6867. end
  6868. for i = 1, #AllTabs do
  6869. if Player.Character ~= nil then
  6870. local Position = Player.Character.Torso.CFrame.p
  6871. local Radius = (#AllTabs * 0.3) + 10
  6872. local M = (i / #AllTabs - (0.4 / #AllTabs) * Rotation * 3) * math.pi * (4/2)
  6873. local X = math.sin(M) * Radius
  6874. local Y = math.sin(i + tick())
  6875. local Z = math.cos(M) * Radius
  6876. local A = Vector3.new(X, Y, Z) + Position
  6877. local B = AllTabs[i].Part.CFrame.p
  6878. local C = A * 0.1 + B * 0.9
  6879. local Cube_Rotation = (Rotation * 240)
  6880. local D = CFrame.Angles(Cube_Rotation, Cube_Rotation, Cube_Rotation)
  6881. AllTabs[i].Part.CFrame = CFrame.new(C, Position) * D
  6882. end
  6883. end
  6884. end)
  6885. end)
  6886. end
  6887.  
  6888.  
  6889. function CheckHotKey()
  6890. local uis = game:service'UserInputService'
  6891. if uis:IsKeyDown(Enum.KeyCode.LeftControl) then
  6892. if uis:IsKeyDown(Enum.KeyCode.Z) then
  6893. Utility.CreateDummy(Mouse.Hit, "???", Workspace)
  6894. elseif uis:IsKeyDown(Enum.KeyCode.X) then
  6895. GraphicalEffects.ShootLaserOfDeath(Mouse.Hit.p)
  6896. elseif uis:IsKeyDown(Enum.KeyCode.C) then
  6897. GraphicalEffects.SpaceHyperBeam(Mouse.Hit.p)
  6898. elseif uis:IsKeyDown(Enum.KeyCode.Q) then
  6899. if characterMode == "normal" then PlayerControl.SetEnabled(not PlayerControl.characterEnabled) end
  6900. elseif uis:IsKeyDown(Enum.KeyCode.R) then
  6901. GraphicalEffects.SpawnSapientRock(Mouse.Hit.p)
  6902. elseif uis:IsKeyDown(Enum.KeyCode.V) then
  6903. chatAdornee = Mouse.Target
  6904. elseif uis:IsKeyDown(Enum.KeyCode.T) then
  6905. ControllerCommands.TeleportCharacterToMouse()
  6906. elseif uis:IsKeyDown(Enum.KeyCode.E) then
  6907. ControllerCommands.ShootMissileAroundMouse(5, 25, nil)
  6908. elseif uis:IsKeyDown(Enum.KeyCode.G) then
  6909.  
  6910. ControllerCommands.BigLaserAtMouse()
  6911. elseif uis:IsKeyDown(Enum.KeyCode.H) then
  6912. ControllerCommands.ControlRandomDummy()
  6913. elseif uis:IsKeyDown(Enum.KeyCode.B) then
  6914. ControllerCommands.BalefireAtMouse()
  6915. elseif uis:IsKeyDown(Enum.KeyCode.Y) then
  6916. if Mouse.Target:IsA("Part") or Mouse.Target:IsA("Model") and Mouse.Target.Name ~= "Base" then local targ = Mouse.Target GraphicalEffects.CrystalRing({base_part = targ, crystal_color = BrickColor.new("Really black"), float_duration = 0.5,fade_out_color = BrickColor.new("Institutional White")}) targ:Destroy() end
  6917. elseif uis:IsKeyDown(Enum.KeyCode.F) then
  6918. if flying == true then
  6919. PlayerControl.StopFlying()
  6920. else
  6921. PlayerControl.StartFlying()
  6922. end
  6923. end
  6924. end
  6925. end
  6926.  
  6927. ROT()
  6928.  
  6929. game.ReplicatedStorage.DescendantRemoving:connect(function(itm)
  6930. if itm.Name == "AE2XATTACH" then
  6931. wait(2)
  6932. RF = game.ReplicatedStorage:findFirstChild("AE2XATTACH") or nil
  6933. end
  6934.  
  6935. end)
  6936.  
  6937.  
  6938. print(developer)
  6939.  
  6940. if developer == "true" then
  6941. Tablet("Hi",Colors.Red)
  6942. wait(1)
  6943. Dismiss()
  6944. end
  6945.  
  6946.  
  6947. NewCMD("Version", "ver", "Shows the version", function(msg)
  6948. Tablet("The Version Is: "..Version.."!")
  6949. end)
  6950.  
  6951.  
  6952. NewCMD("Ban a player","ban","Kicks a player when he enters",
  6953. function(msg)
  6954. local plrs = GetPlayers(msg)
  6955. for _,plr in next,plrs do
  6956. table.insert(bannedlist,plr.Name)
  6957. Tablet('Banned | '..plr.Name,Colors.Black)
  6958. game.Players[plr.Name]:remove()
  6959. game.Lighting:ClearAllChildren()
  6960.  
  6961. end
  6962. end)
  6963.  
  6964. NewCMD("Pri Allow","priadd","Adds a player to the private server allowed list",
  6965. function(msg)
  6966. local plrs = GetPlayers(msg)
  6967. for _,plr in next,plrs do
  6968. table.insert(PriAllowed,plr.Name)
  6969. Tablet('Allowing | '..plr.Name,Colors.Black)
  6970. game.Lighting:ClearAllChildren()
  6971. end
  6972. end)
  6973.  
  6974. NewCMD("Private server allowed", "pl", "Shows The Allowed Players", function()
  6975. Dismiss()
  6976. for _,Allowed in pairs(PriAllowed) do
  6977. Tablet(AllowedPlr, Colors.Black)
  6978. end
  6979. end)
  6980.  
  6981. NewCMD("Banlist", "bl", "Shows The Banned Players", function()
  6982. Dismiss()
  6983. for _,BannedPlr in pairs(bannedlist) do
  6984. Tablet(BannedPlr, Colors.Black)
  6985. end
  6986. end)
  6987.  
  6988. NewCMD("Unban", "unban", "Un-Bans Someone", function(msg)
  6989. Tablet(table.concat(bannedlist, ' '), Colors.Purple)
  6990. if msg == "1" or "2" or "3" or "4" or "5" or "6" or "7" or "8" or "9" or "10" then
  6991. table.remove(bannedlist, msg)
  6992. end
  6993.  
  6994.  
  6995. end)
  6996.  
  6997. NewCMD("Freeze", "fr", "Freezes someone", function(msg)
  6998. local plrs = GetPlayers(msg)
  6999. for _,plr in next,plrs do
  7000. GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("Really black"), float_duration = 0.2})
  7001. plr.Character.Torso.Anchored = true
  7002. end
  7003. end)
  7004.  
  7005. NewCMD("Thaw", "tha", "Thaw's Someone", function(msg)
  7006. local plrs = GetPlayers(msg)
  7007. for _,plr in next,plrs do
  7008. GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("Really black"), float_duration = 0.2})
  7009. plr.Character.Torso.Anchored = false
  7010. end
  7011. end)
  7012.  
  7013. NewCMD("Message GUI", "mg", "Make a message gui with any text",
  7014. function(msg)
  7015. for i, player in ipairs(game.Players:GetPlayers()) do
  7016. local S = Instance.new("ScreenGui")
  7017. S.Parent = player.PlayerGui
  7018. local F = Instance.new("Frame")
  7019. F.Parent = S
  7020. F.BackgroundColor3 = Color3.new(0,0,0)
  7021. F.BackgroundTransparency = 0.5
  7022. F.BorderSizePixel = 0
  7023. F.Position = UDim2.new(0, 0, 0, 250)
  7024. F.Size = UDim2.new(0, 1500, 0, 100)
  7025. local T = Instance.new("TextLabel")
  7026. T.Parent = F
  7027. T.BackgroundTransparency = 1
  7028. T.BorderSizePixel = 0
  7029. T.Size = UDim2.new(0,1000, 0, 100)
  7030. T.Font = "SourceSansBold"
  7031. T.FontSize = "Size24"
  7032. T.Text = "[AE2X ADMIN]: "..msg
  7033. T.TextColor3 = Color3.new(255,255,255)
  7034. T.TextStrokeTransparency = 0
  7035. wait(3)
  7036. S:remove()
  7037. end
  7038. end)
  7039.  
  7040. NewCMD("Beam me up scotty", "beam", "Made by mistahFedora",
  7041. function(msg)
  7042. local plrs = GetPlayers(msg)
  7043. for _,plr in next,plrs do
  7044. GraphicalEffects.FireSpaceHyperBeam(game.Players[plr.Name].Character.Torso.Position, 3, 2, 30, 100, 1)
  7045. end
  7046. end)
  7047.  
  7048.  
  7049.  
  7050.  
  7051.  
  7052. NewCMD("Island", "isl", "Makes an island",
  7053. function()
  7054. local terrain = workspace:findFirstChild("Terrain")
  7055. if terrain then
  7056. for h = -1, 1 do
  7057. for r = -150, 150 do
  7058. for r2 = -150, 150 do
  7059. workspace:findFirstChild("Terrain"):SetCell(r2, h, r, 17, 0, 0)
  7060. end
  7061. end
  7062. wait()
  7063. end
  7064.  
  7065. for h = -1, 2 do
  7066. for r = -25, 25 do
  7067. for r2 = -25, 25 do
  7068. workspace:findFirstChild("Terrain"):SetCell(r2, h, r, 1, 0, 0)
  7069. end
  7070. end
  7071. wait()
  7072. end
  7073. end
  7074. end)
  7075.  
  7076.  
  7077.  
  7078. NewCMD("Insert", "ins", "Insert a gear by typing their ID", function(msg)
  7079. local insert = game:service'InsertService':LoadAsset(tonumber(msg))
  7080. if insert then
  7081. insert.Parent = workspace
  7082. insert:MoveTo(game.Players.LocalPlayer.Character:GetModelCFrame().p)
  7083. end
  7084. end)
  7085.  
  7086. NewCMD("Set SkyBox","abox","Skybox A",
  7087. function()
  7088. function getAll(obj)
  7089. for i, v in pairs(obj:getChildren()) do
  7090. if v:IsA("BasePart") then
  7091. v.Anchored = false
  7092. v.BrickColor = BrickColor.new(0)
  7093. bv = Instance.new("BodyVelocity")
  7094. bv.Parent = v
  7095. bv.maxForce = Vector3.new(100000000,100000000,100000000)
  7096. local s = Instance.new("SelectionBox")
  7097. s.Color = BrickColor.random()
  7098. s.Adornee = v
  7099. s.Parent = v
  7100. s.Transparency = (0.4)
  7101. end
  7102. getAll(v)
  7103. end
  7104. end
  7105. getAll(workspace)
  7106. game.Lighting.TimeOfDay = "07:00:00"
  7107. game.Lighting.Ambient = Color3.new(0,0,0)
  7108. sky = Instance.new("Sky")
  7109. sky.Parent = game.Lighting
  7110. sky.SkyboxBk = "http://www.roblox.com/asset/?id=127493466"
  7111. sky.SkyboxDn = "http://www.roblox.com/asset/?id=127493466"
  7112. sky.SkyboxFt = "http://www.roblox.com/asset/?id=127493466"
  7113. sky.SkyboxLf = "http://www.roblox.com/asset/?id=127493466"
  7114. sky.SkyboxRt = "http://www.roblox.com/asset/?id=127493466"
  7115. sky.SkyboxUp = "http://www.roblox.com/asset/?id=127493466"
  7116. end
  7117. )
  7118.  
  7119.  
  7120. NewCMD("Fix cam","fc","Fix anyone's cam",
  7121. function(msg)
  7122. local plrs = GetPlayers(msg)
  7123. for _, plr in pairs(plrs) do
  7124. if plr and plr.Backpack then
  7125. game.Workspace.CurrentCamera:Destroy()
  7126. local cam = Instance.new("Camera", workspace)
  7127. cam.Name = "CurrentCamera"
  7128. cam.FieldOfView = 70
  7129. cam.CameraType = "Custom"
  7130. cam.CameraSubject = game.Players.LocalPlayer.Character.Humanoid
  7131. end
  7132. end
  7133. end
  7134. )
  7135.  
  7136. NewCMD("Kick","ki","Kick <3",
  7137. function(msg)
  7138. local plrs = GetPlayers(msg)
  7139. for _,plr in next,plrs do
  7140. wait(0.1)
  7141. game.Players[plr.Name]:remove()
  7142. end
  7143. end)
  7144.  
  7145. NewCMD("Walkspeed", "ws", "Sets your walkspeed",function(msg)
  7146. game.Players.LocalPlayer.Character.Humanoid.WalkSpeed = msg
  7147. end)
  7148.  
  7149. NewCMD("All Scripts","as","Show all scripts", function()
  7150. local AllScripts = {}
  7151. for _,v in pairs(workspace:GetChildren()) do
  7152. if v:IsA("Script") then
  7153. table.insert(AllScripts, v.Name)
  7154. end
  7155. end
  7156. if #AllScripts > 0 then
  7157. for _,v in pairs(AllScripts) do
  7158. Tablet(v,Colors.White,function()
  7159. game.Workspace[v]:remove()
  7160. end)
  7161. end
  7162. else
  7163. Tablet('No Scripts Found',Colors.White)
  7164. end
  7165. end)
  7166. NewCMD("All LocalScripts","als","Show all localscripts", function()
  7167. local AllScripts = {}
  7168. for _,v in pairs(workspace:GetChildren()) do
  7169. if v:IsA("LocalScript") then
  7170. table.insert(AllScripts, v.Name)
  7171. end
  7172. end
  7173. if #AllScripts > 0 then
  7174. for _,v in pairs(AllScripts) do
  7175. Tablet(v,Colors.White,function()
  7176. game.Workspace[v]:remove()
  7177. end)
  7178. end
  7179. else
  7180. Tablet('No Scripts Found',Colors.White)
  7181. end
  7182. end)
  7183.  
  7184. NewCMD("New Server", "newserver", "Make a New Server!",function()
  7185. local Game_ID = game.PlaceId
  7186. Dismiss()
  7187. local NSERVER = 'http://www.classy-studios.com/APIs/JoinGame.php?GameID='..Game_ID
  7188. end)
  7189.  
  7190. Dismiss()
  7191. if developer == "Developer In Training" then
  7192. Tablet("AE2X Tablets Have Loaded", Colors.Purple)
  7193. Tablet("AE2X Tablets is modified Plutonium Tablets", Colors.Purple)
  7194. Tablet("Have Fun!", Colors.Purple)
  7195. Tablet("PointCoded is sexy!", Colors.Purple)
  7196. Tablet("AE2X Tablets Version: "..Version, Colors.Purple)
  7197. end
  7198. if developer == "false" then
  7199. Tablet("AE2X Tablets Have Loaded", Colors.Purple)
  7200. Tablet("AE2X Tablets is modified Plutonium Tablets", Colors.Purple)
  7201. Tablet("Have Fun!", Colors.Purple)
  7202. Tablet("PointCoded is sexy!", Colors.Purple)
  7203. Tablet("AE2X Tablets Version: "..Version, Colors.Purple)
  7204. end
  7205. if developer == "Good Developer 2/4" then
  7206. Tablet("AE2X Tablets Have Loaded", Colors.Purple)
  7207. Tablet("AE2X Tablets is modified Plutonium Tablets", Colors.Purple)
  7208. Tablet("Have Fun!", Colors.Purple)
  7209. Tablet("PointCoded is sexy!", Colors.Purple)
  7210. Tablet("AE2X Tablets Version: "..Version, Colors.Purple)
  7211. end
  7212.  
  7213. Player.Chatted:connect(function(msg) if string.sub(msg,1,1) == "/" then onChatted(msg) else ChatBubble.Create(msg,Teal) end end)
  7214. Mouse.Button1Down:connect(CheckHotKey)
  7215.  
  7216.  
  7217. game["Players"].PlayerAdded:connect(function(newPlr)
  7218. for _,BannedPlr in pairs(bannedlist) do
  7219. if(newPlr["Name"]==BannedPlr)then
  7220. if(newPlr["Name"]~=(game.Players.LocalPlayer.Name))then
  7221. newPlr:WaitForChild("Backpack")
  7222. game.Players[newPlr.Name]:remove()
  7223. Print("The Banned Player ["..newPlr["Name"].."] has Tried to Enter the Server",Colors.White)
  7224. end
  7225. elseif(newPlr["Name"]~=BannedPlr)then
  7226. print("Allowed")
  7227. end
  7228. end
  7229. end)
  7230. game["Players"].PlayerAdded:connect(function(newPlr)
  7231. if Pri == true then
  7232. for _,AllowedPlr in pairs(PriAllowed) do
  7233. if(newPlr["Name"]~=AllowedPlr)then
  7234. game.Players[newPlr.Name]:remove()
  7235. print("User: "..newPlr.Name" Is NOT Allowed")
  7236. elseif(newPlr["Name"]==AllowedPlr)then
  7237. print("User: "..newPlr.Name" Is Allowed")
  7238. end
  7239. end
  7240. end
  7241. end)
Advertisement
Add Comment
Please, Sign In to add comment