SHARE
TWEET

Vehicle Succ

HHLExploits Jun 23rd, 2019 190 Never
Not a member of Pastebin yet? Sign Up, it unlocks many cool features!
  1. local someone2_IIlllllIlllIlI='2d2d8197dfb642736c6ec5d9a192c427e2d25c928fcc1312d512e7139a8ae32c74f1c10862aa59ad2ae4515aebcd12f7f75da5d2e9a1169ba3e83401599e57763addcf97c8781488153e85cebd6f727e25749d3a2f'local someone2_IIllIIlIIlIIlIlIlIIl='2f6841356b10bf4d32af4bb33c682ced62295d58876a156921f3e42e8085d1ce184b50a8a6341ea28ad3aec51a9a486c1c8fbc3f53ca7a785d'local someone2_IIllIIlllIlIII=233;local someone2_IIlllI=63;local someone2_llIlIIIIIIllIIllIII=1983443;local someone2_lllllIllllll=2778;local someone2_IlIIlllIIIllIlllllIll=function()local someone2_IlIlIIIIlIIIIIIIIIll='546bff353429243e72f765f18fc875a30ee4cca0ff9887096bed09c988275ca1f9befc751c39616101e3012e3ad5adc20720ce0a2145ce0468e77c259de1b7d95979d6fe69'local someone2_llllllIllIlIIIIll='4677666c2e37ab6b26b29e5d2ef5021e19d7025afb4eeb295be360893992beaef7a1661011d6cac4657f'local someone2_lIlllIIIII='674dcd6ebe599aa207c94ab95fec0d0021b3d8844f6c40470fe6c8592c558ce8b8d23d45416855ed'local someone2_lllIlIllll='7878276072c83a18357e8691b26e26c7976cfa8e4b540c244e43cbe01ecbfb37a97a92b6a7e880e45dae61f929f861f4cdfa83356ff1f35c743d7805b745deaf2636356ffae7b5185550ed311b0bd362'local someone2_IllIllIlllIIllllllll='49571d5f9eadf022b2b2d01f2a3190bff74b35a8de8c669258965929fe45e191fdb91ceb553ee72fae'local someone2_IIlllIIIlIIlllIlI='54532a4c804980e50f7cdbc3985d24e0066e012a0e36edaad37daf1f6c69784663c93fa581dbca84114f7faa26bc8f'local someone2_IlllIIIIII='5047bc08a99a9e18e69df7d53608e0cfd2bc82f4a6cc389be5ef6b983ac87dadff7acac129b629'local someone2_llllIIlIlll='6e4e5f7b5c161ad70a90456582a153b485876cb8849d5ae287fb8d143210b66801b114c1'local someone2_IlIllI='7941c62bb48bd224b7bad4825e9e7c572d92d0c6044f398eccad19ebd8fa99f2dedf'local someone2_IlIIIIIIlIlllIlIl={mmRmnHRbKiKzWbLqHgHI,HDixA,OvpfXATtOqrPbSXRdydIWLjc,kFwWQqD,WkWKcaKc,MqczYUaxOIGuJ,kvALujZqMLPpidARE,jkRXA,oGwHiCC}end;local someone2_IlllllIIlIlIll='41421d3ce6b59db7674828205e74ff99b9ab03a905d0eeac684c2f27af55b378dac5a1839ef73ee64664bfd6c0f8e496cd240d470a85282086dbd982b7acaca4'local someone2_lIIl=function()local someone2_lIIIlIIlIllI='624a736a1df2d0fc07340fdc7677f5fa3949b9299973f91dc1d03a1b44a93dc6d0cda02f72a18a7389fdd4d6774b6f2b71a0d7c26e6b32f60633'local someone2_IlIllllIIIl='6e50f86e56489b9659158cfd186c641c8ea5769a18582d8b0c07910962909faf17a40c'local someone2_IIIlllIIlllIIIlIIl='4c415fde4bb3e15af88f379040ac9159424f6a17afff29400d9eec55185bd4b0bc1456c4d6f96afc1e872179412dffcbb8002cceef995c0328ac4c7f202a89264c72dfbd9daba26ba0b8abc097f447662a0c8c3cac8d6fd4'local someone2_IllIlIIllIll='76727ae55bb3b7ce0f3fed708d4185887a82c2ac31a42d8cd97fb04f4dbfc5043e5ef9a3398124e713cb84a323a3189ca9de6e0b68d8af58f24bb5a4eeb07aa18acfbb41a4e12d4c2c280f0eca3b78bafa866e5abe2d2daafca2b55986879844f3dd71'local someone2_IlllIlIIlll={PuKMk,zEuQxxJrJmROlWrDSf,veJoRYmDZ,IOsHoyOWVceKlCIcqZqUfRn}end;local someone2_IllIlIlIIlIlIlllII=function()local someone2_llIIIlll='785041f36b0859c2e463ef856af638217756b93c8e7bca91a9ba009d38e318da23b62eae2c916f8d90489212571cbb9dda6e8ee3e6eb529f949ed103bf11e32f56bf417659c31263b3213fab9097317de3'local someone2_llIIIIIII='4675da665ac420fa480cc49a35c948b01de52c1455a575f111a9ae92d2acd5da4feb1e52ba5b7710f4fff9fe977406c2f62e2b'local someone2_IIIIlIlllIIllIllIIll='5878484f020cabc1bfdcdf25b43dbb830693f4fe355d55d4f10ce8be92e74d5107a47a'local someone2_IlIIIlI='79577de99be0852d9877de72c4d1a4d4779f4652f5196dbbe5e59bcecc0ec2e949973d3af06c05a8347f547d76d2a4d15e6779947bd55df8bf5dc5679f24a133e2ee9a549ad2d8ffc18f7506bf5d04e2aba0d44a4f9abee0ab7dad23'local someone2_lIlIlI='6969b2c4913808af036bfb7d0c372f5cbe4bfcd42f2675b6f15296c718900ae093b9534adec656e7b262b20a30c157499b7b5999'local someone2_lIIlllIlIIIII='426c5cd7c0232d59334969e9130f9ff15348d77e39de5f52933260aea6e9550347c6d0d77da6a2985cf56c61b507e3f49673025c5a00eea134033a5a7700f90b0833380366f862bffb83b1711fc485af24feb394401abc5dfd72511166'local someone2_IlIllIlllIIIl='6e4f020a6901f3ed0d69161b9497624487ec13cc08a587b957bf8a0dd3bffc967319b40f53ad01f3c2555503b14477209e1be2832a14c2cd87878ed7'local someone2_lIIIIlIIlll='5661e159bd22f479c631df1ec94f33be503c55bf48d766ee188fb54002e0e46b2c1753cf1bf706097efda33fba8f593ba951c1ea7c147b9070349517267da2a7d50eb31cadd0681cbdd53fcad42b65206f93cc60f2af'local someone2_lllllIIlIlIlllIlI='556d8ae14b7c25d639cf7712994fe3b2501afc035ea0ac8d6864479648c7788e59f32c026d7a7c29e79ccbc77c7757a7a5ddc8592f08b311dddbbeb9d58a3c30eb4df3d995bfcb19740fecee'local someone2_IlIlllIIII={SuDgRpGNqCkhJ,ApkzgHTTM,dNqxkYDxIpmGUGaOO,HTpXcMJqSeQffYqCo,pfZwCquLxGgXOAdJbM,TqINvCrAfuVkP,JtKXBhLBqgSmUqgFtZszRrQk,oTmWJcChByRk,ICKFvQFlYtAKzkrtw}end;local someone2_lIIIIlIII=function()local someone2_llllllIIlIllIII='534ca879ddf98603efbb74d27fee47b5883eba68d4d2709704a024ff7d03d375c8f6fdc6c492ecfbb7ee4eb1833f4c5fc3807270edf030c2e70d7a5f0ae90748e545'local someone2_lIllllIIIllIll='62545c3f210b49cb177f45b1da7781c2320b61da4c4b41aa2637d0412fa94a1ff8db1d2414b8379ca3f3ecc2e11f8635062041fe3d72712f32bb27d7'local someone2_IllIlIIlIIIIll='43657a90017ffd1b99c6c226b3fe55123268d1303aa59876e8f87db6a778d1dbd2e705e12d19a556d4dd04cea0b2e932ff356559858d8f7f08cb0bb9b4e0ef3e261aaf10035405d9bc4a8fb390'local someone2_lIlIIIlIIII='6368f8b79cdf317ed485cb0d9d0e476b3226fc1a7f456a2e6015c6f49c1c2d5784432bbb5b7d184defd9895818615604eca3d5d252aa6422ce4363'local someone2_IIlIllII='5065709d3369fe87e75851f38b65963a5a02cd2de143f9e2655936ae83d4a4dd1e2547e1f9dccd244a8e4c8d0e01c493618b06a0a3089eab6d2d30ad7ad2797862bf89859020ecb612bd8319eb8833c23825434587a650928966e99fc358bb08acfb36'local someone2_IlllIIll={XkKDa,GTAYuMhQbByobm,sUlhfSuCLmrPuHkAXpIY,ROpNfFGRkmwKWiBDiyKcImEhi,AyOZXehWl}end;local someone2_lIlIIlIllIl='6e754bce1efe'local someone2_IIlIIIIIIlI=function()local someone2_lIIllIllllIlIlI='6f53b93cd2b3064e7695c1fc869805a66e475658ccbb260afce5d85d6649ed88be534164745cd8b130c560fa030e82b4b30d812a6d67870671fc58ed3789d3e86a1bc11bf3b9b4db'local someone2_IlllllIllIIII='447648422a2e9969831a6df9f23d04618091650995b48baef9eac8f657b8'local someone2_lIIIllII='766a73ba0166e982bae08cac1112b1838bde1b95a1826bc85b1fee8b725ce7eaaf9a6ee2672fd7c64669f1ab86988120aa74215e4fe4df727b201cb918a4a9dc220119f515de'local someone2_lIIIIlllIlIIlIIlll='6d68663c40cde006ca806eff12275020c9659e1d1b6b67873d5925a6b915eab85df259b8e5700cafefa4841d2c2bf7138233dcf42c39cd18878cc331f50c081544ab4e4c90ae82c383cf92829e24c59f51bad5aae0e32c92ff8e182bdbdcb26e'local someone2_lllllllllIIl={RkfOhDKlC,SgOsFPkJmFgLaTwmPaM,bYjBRwD,AGyCeNGiRpIExFuTrCusOqwpG}end;local someone2_IIIllllIlIll='756c7374f42881'local someone2_IIlIlllIIlllllII=function()local someone2_IIIIIIIlIIllIlI='654555c42e02f22431b536948414c388e278415902dab4fb2aa69237a206a593f9160c068771fc28665824c027d846888d4612f7142f4c9acd85b4d928fe3cf64703ded6377514bd83c0b9167ff8f376ebe9abe787a06343'local someone2_lIIIIIlIllIIIlI={jIokYDEjQadVaXhgWU}end;local someone2_IlllllIIIIllI='6c65a8744a9a'local someone2_lIIlIIIllIIl=function()local someone2_lIIlIlIlIlIIIllIl='70442d35c50b9f2283f357dbc90ab234138bdecd37e4649aad709e5f44dfa76b9d4a50fa418a63eec9c4e50afb7b3df041697d3e90697a69656d21ee49b42b64b4b4280e2e9a2fa6a1e48173dbb92ff71ac9e81f8deb10'local someone2_lIlllIlllIIIIl={tWwLzBmPVlrKsExNyC}end;local someone2_llIllIIl='4572b2d77f3b19'local someone2_llII=function()local someone2_IIlIIllIllIII='6e717af6dacc7c6458b2454317f36e93757fe01ffa8abbe10d60ddadc594cce0e1c34f5e31c3888b5510d2fd18e682894184db01b99ca9e4c3'local someone2_lIIIlII='614c5c7eecfe6b3e936fd379cd575c30f24d820ea2dcc090241a3dd2198209751b792fd72b10ce45cb88234aa1582c87d8fcc223aabe206e3c9680136e'local someone2_IllIIIllIIIIlllIlIl={geVMmFxzLlULRwpD,pjRYgHnQuZPlFnKaZ}end;local someone2_IIIIlllIIIlIIlllll='556e2dbdbf9d333638f1ea72b77e7d32c7210aef07494e015bd4338dc95058fe2cb354ea'local someone2_llIlIllI='4f6ed001113935eaaa9a0a28d1e0542abdbb8b54ed5bf1e2d2e2'local someone2_lllllIIIlIlIIlIIllIl='4c7587d809b4bccc2bfbb23f679a4650884933dc047c'local someone2_IlIIlIIIIlIllllIIllI='54685f1b0ff06019fd541e5f634cd9abadb32d8e533090a76f79cd28'local someone2_llIIlllIIIIIIIlIIIlII=function()local someone2_IIlIlIIlIIlIIlII='76439400e9563a79f812469ed3796860a90da3e223633f545ed8a97b706473acd972949295803e2e3d15c08e253ea3162596b35d233e82bf3535a8'local someone2_llIIlllIIIIllIIIlIIIl='6d4cd053c31b8bbee6b7d89f0ad45d5dc8e043c6257eb169fd07cb12530240b79b91a9322e1c1cd3baaeb79a256eb4a135c9b292d7e17b64eb411a971633dafcb03b7fbbb0b5bf582d92812750a54f72b32bdb57cd8e29d869'local someone2_lIIII='756734497bc6a0109efe6cf27cc4ce9a3f6cdaee9c83a9af1b50af422c2d92c4d9bf8c73982e433e76452cd6cfb1bdf3cc1bccc2212cf03525222f40b8cb9580fb11ffb309b832181058b9785553a806d3818090decef3f1523571b6641bd594f475'local someone2_IlIllIlIlllI='4c45da150592b871770c6cddc2d8e6564d60e3f3a8262c6f53df3e2960055f02cfecf2145402dc7a4ce0b2ecb2'local someone2_lllIlIlI='5a4887669623681fcc08287a6c859d13ff73e1322574fb7e1a8c6e88409217610e712a541759357c0bd74910a473d1ca7beed2dd99734b5a7361b3795685e1d0ba6bb79448955a9584b657953436'local someone2_IllIIll='6f4ef53c3f493d56c43b416b0b6714e83cd27a5c6bb71579f7f26958a88dddd2156d5ce7eb175f7afc3eb36f'local someone2_IIIllllI='64418e7e10a2278c5fcda6724c98521fbd26865c116f5768fb7777ca8241bf208da32f8a6a44d445204321ba'local someone2_lIIlIIlIIllIIIIllIlIlllIl='434555a060a028c0de597c39e3dae63aed6878ae466ca626f8d5db7858ea7a8d'local someone2_lIIIlIIlIII='70518eceb7202d1e33ac2a1d213b6d49e337788b0945abb327e21fc922c0da0bf8b24534183419e5661e797fbb0a235cbaa702d53d62e97f670a2968a4f232b3ee0a41a29dcfe3a645d2bb5d522466'local someone2_IIIllIIIlIIIIII='4764ebd7bb21366816d6f6fbd98dbdd6727f7345aabe7df1a4bd4330f413e1e7b8615948185f2de44be48c28cffecc2bbd7c4c89b447059ecb6030a106e18a40064deb7097acb8425d40f2b29c'local someone2_lllIlllIIIlIlIlIlI={yaEqXsYuAHuM,oGvTxcWItEdINaTlWiI,GEaEhJsb,afxWIsNM,FjNrNLwCcVHlfBadMlN,nLjtHZURWUgiJwogjDaMM,nEqXqJ,hFWdfIENfeLDhGpeDhFo,wlTaFwseUVIWtTqAIj,vwKBnNhHE}end;local someone2_IIlIIlI;local someone2_IIllIllll;local someone2_llIIIIIlIlIlIIlIllIIl;local someone2_IlIlIllIlllll;local someone2_IIllIlll;local someone2_IlIIll;local someone2_lIlIIl;local someone2_llllllllllllIlIlIlI;local someone2_lIIIlIllIllI;local someone2_llIIlIlIIl;local someone2_ll=setmetatable;local someone2_IIllllII=coroutine;local someone2_IIIlIIlll=someone2_IIllllII.create;local someone2_llIl=someone2_IIllllII.resume;local someone2_llIIlIlIIIIIIIlllI=string;local someone2_IIIIlIIIlll=someone2_llIIlIlIIIIIIIlllI.char;local someone2_IIlIIlllIllllI=someone2_llIIlIlIIIIIIIlllI.sub;local someone2_IIIllIlIIlIIl=someone2_llIIlIlIIIIIIIlllI.len;local someone2_IIlIlllIIIIIIlIlI=getfenv;local someone2_lIlllIllIIlIIlIIlll=tostring;local someone2_lIIllIIIlIIIll=tonumber;local someone2_lIlIIlIlIIlIIlIIIIlIl;local someone2_IIlIl;local someone2_lIlllIIIlIIIllllll;local someone2_IlllII;local someone2_llIlIllIIlIllllIllllI;local someone2_IIIlIllllllllllIIl=select;local someone2_IlIIIIIlIllll;local someone2_IIllIlIlIIlIllIlII;local someone2_IIlllIIII;local someone2_lllIIIIIIIIlllIllIlI;local someone2_IIl;local someone2_lIIlIIIIIIlll;local someone2_lIlIlIIIlIlllIllllI;local someone2_IlIlIlIlIllIII=function()local someone2_IIIlIll='7852c31eef1420fb97c9b58dce518ec879129faa2d244dc40df8c47f449cf6356e024238d2208f49f23996edf3336a6dfb2c2a22b679f0f68f78a481e41f8eaa40b3d598d550361423a4803b9c4fd4ffe1b41a6d3bfe60ff10f865924da2ff57b28515'local someone2_lllIllIlIllIIlIIIII='547709d7d2eae1a7db3e309e3ed4793e806bd95a1e612d2acc45bf25cfbc85231746e682cfb542e0a6b4a5c4517a4ef62d3ac59fbcc39a'local someone2_lIlIlIIIllllllIIIIIII='554beede4708e14edad9c1eafb3a2ebbc8c9b7355453528a993fd6a2d94bfb301514b5ddbb3f0c08049cfb3db0fd41'local someone2_IIIlllllIllII='4d79ffc41d54391404f38b0530a5d65015d1a6880ba79020b44871afc51e646e3068cfb6bcd5acbf81a14a0c897175e033414cab82658d716525154944b2409f4667c85e11'local someone2_lIlIIIIlIIIIIl='7559551efa4a5e6e27c10509af58c56d27b7d205f09d9dc9591519260d5a79d4'local someone2_IIIlIlIIlIllII='6e6998dbc75e002c2427c614b023bf1d44f0cf1daf0cdd64b73126f098869bc77f9af324836991cbb289ea827981e25797c297ded9da43f89d2d7d3fb315a094'local someone2_llIlIIIIIIllIIlll={OglMBlPEhi,FnGiHwJecubNkAUURgA,MbAqygSALgQmJUudYKbtlIBWr,jShyRxEoXiNTbPfN,PAfedWkHaRWHlDz,tgNrXYqHPkHglQCjR}end;someone2_llIIlIlIIl=function(someone2_llIIIlIIIlIIIIIl)local someone2_llllIlIIlIllIIIllIIlIII,someone2_llllIllIIlIIII=someone2_llIlIIIIIIllIIllIII,16384 +someone2_lllllIllllll;return(someone2_llIIIlIIIlIIIIIl:gsub('%x%x',function(someone2_IIlIlIlIIlllIIIIl)local someone2_IIlIlIlIIIIIllII=someone2_llllIlIIlIllIIIllIIlIII%274877906944;local someone2_IlllIIllll=(someone2_llllIlIIlIllIIIllIIlIII-someone2_IIlIlIlIIIIIllII)/274877906944;local someone2_lIlll=someone2_IlllIIllll%128;someone2_IIlIlIlIIlllIIIIl=someone2_lIIllIIIlIIIll(someone2_IIlIlIlIIlllIIIIl,16)local someone2_IlIllllIlllIlIlllIII=(someone2_IIlIlIlIIlllIIIIl+ (someone2_IlllIIllll-someone2_lIlll)/128)* (2 *someone2_lIlll+1)%256;someone2_llllIlIIlIllIIIllIIlIII=someone2_IIlIlIlIIIIIllII*someone2_llllIllIIlIIII+someone2_IlllIIllll+someone2_IIlIlIlIIlllIIIIl+someone2_IlIllllIlllIlIlllIII;return string.char(someone2_IlIllllIlllIlIlllIII)end))end;local someone2_lIlIIIlI={}local someone2_IIIIIIIl={}local someone2_lllIllllIlIl={}local someone2_IIIIlllllIIlI={}for i=65,90 do someone2_lIlIIIlI[someone2_llIIlIlIIl(someone2_lIlIIlIllIl)..i]=i end;for i=97,122 do someone2_IIIIIIIl[someone2_llIIlIlIIl(someone2_lIlIIlIllIl)..i]=i end;local someone2_IlIIIlIIl=function()local someone2_lllIIlIllllIIIIl='747173efe505695e6a5cc2d0d58f6336417aee793121771725b39d010da2e26f00d2db28de5836bf9333d8d04ebe570fd7148f214f0b290655ce98e452f7ed1d'local someone2_IlIllIl='66492321f5d68ef807418dd8ce05e19687cbbaeb0a510bea3a93a390590e16f2ab4778a3aff7368e707486b34c575e76be97d949b0277dbe320865d0d44e3eb536118418ac85'local someone2_IlIlIllIIlIIIlll='69459eb797820a1a95761e80dbca2d4ec9b825b0714cb5efaa8b5b4aaa78d64ed6b6cce4a297c63fa45f391175e14225aed68cec969b0e090af74b454864a75d7f632145b35829c738b2ba1b3582ed6861dc6e33'local someone2_IllIll='4e4c41eb2225ed0b5d798f5501e847f699078f21c0643da3cca7396e92ce88cd3e6005'local someone2_IllIlI={dWuJOtXtASmKnoWj,JKjOScDPvqyEyh,aKmSousZVfMpKfOPaI,DwDApbAmVcctHPkQyJJJzHbhG}end;local someone2_IIllIlIlIIIlI=function(someone2_IIllIIllIll,someone2_llIllIlIIlII)someone2_lllIllllIlIl[someone2_llIIlIlIIl(someone2_IIIllllIlIll)..someone2_IIIIlIIIlll(someone2_llIllIlIIlII)]=someone2_IIIIlIIIlll(someone2_llIllIlIIlII)end;local someone2_IlIlllIllIlllI=function(someone2_lIIIIIllIlIlIlI,someone2_IlllIlIlIllllIlI)someone2_IIIIlllllIIlI[someone2_llIIlIlIIl(someone2_IlllllIIIIllI)..someone2_IIIIlIIIlll(someone2_IlllIlIlIllllIlI)]=someone2_IIIIlIIIlll(someone2_IlllIlIlIllllIlI)end;table.foreach(someone2_lIlIIIlI,someone2_IIllIlIlIIIlI)table.foreach(someone2_IIIIIIIl,someone2_IlIlllIllIlllI)local someone2_IIlIIIlIlIIllIIlll=function()local someone2_IllIlIlIIIIIIllIIIl='45753eb01dd1d19bae4d195cc23d14b091a4822adf3da11a67aefb9d0c9f4d5b9f1b'local someone2_lIlIIlIIIllIIIIl='54793e93da7c5b68486b086ef60964474774e077bf343502116522794591f61832b6d36d50d807d9572037e2611aa36d40026a2a8c54bf12230b7977af21cc30ea5cf3'local someone2_IIlIIllIlIIllIlIIIIlI='495469d75390107ae410bed4ca16c7db141c08424850602b962f81b493e45718e2d828c42f64c46a8cb90d5cd1d75494c4d81eac16dc0e786e2c144dc4ffbd3f'local someone2_llIIIlI={aNkFmCrUyKqOUilK,FajhIDuGfXjDsYsAglUTPJhg,CyYYlALgzoX}end;local someone2_IllIIlllI=someone2_lllIllllIlIl.uletterA..someone2_lllIllllIlIl.uletterB..someone2_lllIllllIlIl.uletterC;local someone2_lIllll=someone2_lllIllllIlIl.uletterA..someone2_lllIllllIlIl.uletterB..someone2_IIIIlllllIIlI.letterx;local someone2_llllIl=someone2_lllIllllIlIl.uletterA..someone2_IIIIlllllIIlI.letters..someone2_lllIllllIlIl.uletterB..someone2_IIIIlllllIIlI.letterx;local someone2_lIIllllIIlllIlllIl=someone2_lllIllllIlIl.uletterM..someone2_lllIllllIlIl.uletterO..someone2_lllIllllIlIl.uletterV..someone2_lllIllllIlIl.uletterE;local someone2_llllIIIlIllIIlII=someone2_lllIllllIlIl.uletterL..someone2_lllIllllIlIl.uletterO..someone2_lllIllllIlIl.uletterA..someone2_lllIllllIlIl.uletterD..someone2_lllIllllIlIl.uletterK;local someone2_llIIllIIIlllllIIllIII=someone2_lllIllllIlIl.uletterL..someone2_lllIllllIlIl.uletterO..someone2_lllIllllIlIl.uletterA..someone2_lllIllllIlIl.uletterD..someone2_lllIllllIlIl.uletterB..someone2_lllIllllIlIl.uletterO..someone2_lllIllllIlIl.uletterO..someone2_lllIllllIlIl.uletterL;local someone2_IlII=someone2_lllIllllIlIl.uletterL..someone2_lllIllllIlIl.uletterO..someone2_lllIllllIlIl.uletterA..someone2_lllIllllIlIl.uletterD..someone2_lllIllllIlIl.uletterN..someone2_lllIllllIlIl.uletterI..someone2_lllIllllIlIl.uletterL;local someone2_IIIlIlll=someone2_lllIllllIlIl.uletterG..someone2_lllIllllIlIl.uletterE..someone2_lllIllllIlIl.uletterT..someone2_lllIllllIlIl.uletterU..someone2_lllIllllIlIl.uletterP..someone2_lllIllllIlIl.uletterV..someone2_lllIllllIlIl.uletterA..someone2_lllIllllIlIl.uletterL;local someone2_lIllIIllllllIllllllIl=someone2_lllIllllIlIl.uletterG..someone2_lllIllllIlIl.uletterE..someone2_lllIllllIlIl.uletterT..someone2_lllIllllIlIl.uletterG..someone2_lllIllllIlIl.uletterL..someone2_lllIllllIlIl.uletterO..someone2_lllIllllIlIl.uletterB..someone2_lllIllllIlIl.uletterA..someone2_lllIllllIlIl.uletterL;local someone2_lIllIllIIl=someone2_lllIllllIlIl.uletterG..someone2_lllIllllIlIl.uletterE..someone2_lllIllllIlIl.uletterT..someone2_lllIllllIlIl.uletterT..someone2_lllIllllIlIl.uletterA..someone2_lllIllllIlIl.uletterB..someone2_lllIllllIlIl.uletterL..someone2_lllIllllIlIl.uletterE;local someone2_IIIlIIIl=someone2_lllIllllIlIl.uletterS..someone2_lllIllllIlIl.uletterE..someone2_lllIllllIlIl.uletterT..someone2_lllIllllIlIl.uletterG..someone2_lllIllllIlIl.uletterL..someone2_lllIllllIlIl.uletterO..someone2_lllIllllIlIl.uletterB..someone2_lllIllllIlIl.uletterA..someone2_lllIllllIlIl.uletterL;local someone2_lIllIlIlIIlIIlllIlIIIll=someone2_lllIllllIlIl.uletterS..someone2_lllIllllIlIl.uletterE..someone2_lllIllllIlIl.uletterT..someone2_lllIllllIlIl.uletterU..someone2_lllIllllIlIl.uletterP..someone2_lllIllllIlIl.uletterV..someone2_lllIllllIlIl.uletterA..someone2_lllIllllIlIl.uletterL;local someone2_llllllIlIII=someone2_lllIllllIlIl.uletterS..someone2_lllIllllIlIl.uletterE..someone2_lllIllllIlIl.uletterT..someone2_lllIllllIlIl.uletterT..someone2_lllIllllIlIl.uletterA..someone2_lllIllllIlIl.uletterB..someone2_lllIllllIlIl.uletterL..someone2_lllIllllIlIl.uletterE;local someone2_llIIlIllIIllIIlI=someone2_lllIllllIlIl.uletterN..someone2_lllIllllIlIl.uletterE..someone2_lllIllllIlIl.uletterW..someone2_lllIllllIlIl.uletterT..someone2_lllIllllIlIl.uletterA..someone2_lllIllllIlIl.uletterB..someone2_lllIllllIlIl.uletterL..someone2_lllIllllIlIl.uletterE;local someone2_llIIlIlI=someone2_lllIllllIlIl.uletterS..someone2_lllIllllIlIl.uletterE..someone2_lllIllllIlIl.uletterL..someone2_lllIllllIlIl.uletterF;local someone2_IlIIl=someone2_lllIllllIlIl.uletterA..someone2_lllIllllIlIl.uletterD..someone2_lllIllllIlIl.uletterD;local someone2_IlIIllIllIlll=someone2_lllIllllIlIl.uletterS..someone2_lllIllllIlIl.uletterU..someone2_lllIllllIlIl.uletterB;local someone2_llllIIlllllIIIIIIlI=someone2_lllIllllIlIl.uletterM..someone2_lllIllllIlIl.uletterU..someone2_lllIllllIlIl.uletterL;local someone2_IIIlIIIIlIllll=someone2_lllIllllIlIl.uletterD..someone2_lllIllllIlIl.uletterI..someone2_lllIllllIlIl.uletterV;local someone2_lIIIlllIlIIIllIIIlIIl=someone2_lllIllllIlIl.uletterM..someone2_lllIllllIlIl.uletterO..someone2_lllIllllIlIl.uletterD;local someone2_lllIIllllIl=someone2_lllIllllIlIl.uletterP..someone2_lllIllllIlIl.uletterO..someone2_lllIllllIlIl.uletterW;local someone2_lllllllIllIlIIlI=someone2_lllIllllIlIl.uletterU..someone2_lllIllllIlIl.uletterN..someone2_lllIllllIlIl.uletterM;local someone2_lIIIIlIlIIll=someone2_lllIllllIlIl.uletterN..someone2_lllIllllIlIl.uletterO..someone2_lllIllllIlIl.uletterT;local someone2_lIIllIIlIlIIlIlll=someone2_lllIllllIlIl.uletterL..someone2_lllIllllIlIl.uletterE..someone2_lllIllllIlIl.uletterN;local someone2_IlllIll=someone2_lllIllllIlIl.uletterC..someone2_lllIllllIlIl.uletterO..someone2_lllIllllIlIl.uletterN..someone2_lllIllllIlIl.uletterC..someone2_lllIllllIlIl.uletterA..someone2_lllIllllIlIl.uletterT;local someone2_llIIIlllIIIII=someone2_lllIllllIlIl.uletterJ..someone2_lllIllllIlIl.uletterM..someone2_lllIllllIlIl.uletterP;local someone2_IlllIIIl=someone2_lllIllllIlIl.uletterE..someone2_lllIllllIlIl.uletterQ;local someone2_IlllIlllllIllIlI=someone2_lllIllllIlIl.uletterL..someone2_lllIllllIlIl.uletterT;local someone2_IIIIIIIllIlIII=someone2_lllIllllIlIl.uletterL..someone2_lllIllllIlIl.uletterE;local someone2_lIlIlll=someone2_lllIllllIlIl.uletterT..someone2_lllIllllIlIl.uletterE..someone2_lllIllllIlIl.uletterS..someone2_lllIllllIlIl.uletterT;local someone2_llIIlIIllllIllIIIllI=someone2_lllIllllIlIl.uletterT..someone2_lllIllllIlIl.uletterE..someone2_lllIllllIlIl.uletterS..someone2_lllIllllIlIl.uletterT..someone2_lllIllllIlIl.uletterS..someone2_lllIllllIlIl.uletterE..someone2_lllIllllIlIl.uletterT;local someone2_lIII=someone2_lllIllllIlIl.uletterC..someone2_lllIllllIlIl.uletterA..someone2_lllIllllIlIl.uletterL..someone2_lllIllllIlIl.uletterL;local someone2_IIllIll=someone2_lllIllllIlIl.uletterT..someone2_lllIllllIlIl.uletterA..someone2_lllIllllIlIl.uletterI..someone2_lllIllllIlIl.uletterL..someone2_lllIllllIlIl.uletterC..someone2_lllIllllIlIl.uletterA..someone2_lllIllllIlIl.uletterL..someone2_lllIllllIlIl.uletterL;local someone2_lIllllIllIlIlIll=someone2_lllIllllIlIl.uletterR..someone2_lllIllllIlIl.uletterE..someone2_lllIllllIlIl.uletterT..someone2_lllIllllIlIl.uletterU..someone2_lllIllllIlIl.uletterR..someone2_lllIllllIlIl.uletterN;local someone2_lllllllIll=someone2_lllIllllIlIl.uletterF..someone2_lllIllllIlIl.uletterO..someone2_lllIllllIlIl.uletterR..someone2_lllIllllIlIl.uletterL..someone2_lllIllllIlIl.uletterO..someone2_lllIllllIlIl.uletterO..someone2_lllIllllIlIl.uletterP;local someone2_IIlllllIIIIllI=someone2_lllIllllIlIl.uletterF..someone2_lllIllllIlIl.uletterO..someone2_lllIllllIlIl.uletterR..someone2_lllIllllIlIl.uletterP..someone2_lllIllllIlIl.uletterR..someone2_lllIllllIlIl.uletterE..someone2_lllIllllIlIl.uletterP;local someone2_IllIIIllIlllIlll=someone2_lllIllllIlIl.uletterT..someone2_lllIllllIlIl.uletterF..someone2_lllIllllIlIl.uletterO..someone2_lllIllllIlIl.uletterR..someone2_lllIllllIlIl.uletterL..someone2_lllIllllIlIl.uletterO..someone2_lllIllllIlIl.uletterO..someone2_lllIllllIlIl.uletterP;local someone2_IllIIIllIIIlI=someone2_lllIllllIlIl.uletterS..someone2_lllIllllIlIl.uletterE..someone2_lllIllllIlIl.uletterT..someone2_lllIllllIlIl.uletterL..someone2_lllIllllIlIl.uletterI..someone2_lllIllllIlIl.uletterS..someone2_lllIllllIlIl.uletterT;local someone2_IIIllllll=someone2_lllIllllIlIl.uletterC..someone2_lllIllllIlIl.uletterL..someone2_lllIllllIlIl.uletterO..someone2_lllIllllIlIl.uletterS..someone2_lllIllllIlIl.uletterE;local someone2_IIlIIIIllIIIIII=someone2_lllIllllIlIl.uletterC..someone2_lllIllllIlIl.uletterL..someone2_lllIllllIlIl.uletterO..someone2_lllIllllIlIl.uletterS..someone2_lllIllllIlIl.uletterU..someone2_lllIllllIlIl.uletterR..someone2_lllIllllIlIl.uletterE;local someone2_IIlllIIl=someone2_lllIllllIlIl.uletterV..someone2_lllIllllIlIl.uletterA..someone2_lllIllllIlIl.uletterR..someone2_lllIllllIlIl.uletterA..someone2_lllIllllIlIl.uletterR..someone2_lllIllllIlIl.uletterG;local someone2_lllIIIllllII={someone2_IllIIlllI,someone2_lIllll,someone2_IllIIlllI,someone2_IllIIlllI,someone2_IllIIlllI,someone2_lIllll,someone2_IllIIlllI,someone2_lIllll,someone2_IllIIlllI,someone2_IllIIlllI,someone2_IllIIlllI,someone2_IllIIlllI,someone2_IllIIlllI,someone2_IllIIlllI,someone2_IllIIlllI,someone2_IllIIlllI,someone2_IllIIlllI,someone2_IllIIlllI,someone2_IllIIlllI,someone2_IllIIlllI,someone2_IllIIlllI,someone2_IllIIlllI,someone2_llllIl,someone2_IllIIlllI,someone2_IllIIlllI,someone2_IllIIlllI,someone2_IllIIlllI,someone2_IllIIlllI,someone2_IllIIlllI,someone2_IllIIlllI,someone2_IllIIlllI,someone2_llllIl,someone2_llllIl,someone2_IllIIlllI,someone2_IllIIlllI,someone2_IllIIlllI,someone2_lIllll,someone2_IllIIlllI}local someone2_lIIIlIIlIllIlIIlIIIl={someone2_lIIllllIIlllIlllIl,someone2_llllIIIlIllIIlII,someone2_llIIllIIIlllllIIllIII,someone2_IlII,someone2_IIIlIlll,someone2_lIllIIllllllIllllllIl,someone2_lIllIllIIl,someone2_IIIlIIIl,someone2_lIllIlIlIIlIIlllIlIIIll,someone2_llllllIlIII,someone2_llIIlIllIIllIIlI,someone2_llIIlIlI,someone2_IlIIl,someone2_IlIIllIllIlll,someone2_llllIIlllllIIIIIIlI,someone2_IIIlIIIIlIllll,someone2_lIIIlllIlIIIllIIIlIIl,someone2_lllIIllllIl,someone2_lllllllIllIlIIlI,someone2_lIIIIlIlIIll,someone2_lIIllIIlIlIIlIlll,someone2_IlllIll,someone2_llIIIlllIIIII,someone2_IlllIIIl,someone2_IlllIlllllIllIlI,someone2_IIIIIIIllIlIII,someone2_lIlIlll,someone2_llIIlIIllllIllIIIllI,someone2_lIII,someone2_IIllIll,someone2_lIllllIllIlIlIll,someone2_lllllllIll,someone2_IIlllllIIIIllI,someone2_IllIIIllIlllIlll,someone2_IllIIIllIIIlI,someone2_IIIllllll,someone2_IIlIIIIllIIIIII,someone2_IIlllIIl}local someone2_llIIIIIllIIII=function()local someone2_lIIlllllIllIIl='6d622dc1dc5fcfc19612e3c452ebf75c692ba3c483dc15a35991621c3e32a73852e50cb14d0ae794523d8efcd44f4b1d1384dd3714681531bdcab31dff'local someone2_lIlllIIlI='7143c6ba5e3f458badd8f9a65e1df91f2bdfd9f4ec22c17ccb1dfbff838edfd68e0c7d488e0ccec0bca7ee8c58a79da984840ec461d79760e475936e3036dde351b9c55f049690fb9b9db1f220b2050c8f3f7aadcc0102c6d999'local someone2_II='62573446f2688189a04d00561b909bebd493dceb96c67dd8aa7a1100256a805f78862dfcb0d948ed7b82d9303d81fc7289d60618e8b62fba6cd2f211e3ba56ba801a61a0374aa230ea4c4ec2309f238699efc0fe48462b743d302e58'local someone2_IIIIIIIlIlIlIIll='774a2ddb7b1efb797c925f2144206777707b22286e10a8a4f3ccd512e4fd4f1d1f68cca99378757e04a630815d63813f1e147b6b'local someone2_IIIlllIIlIIlIllllll='44612a283243b57deaf85c3b36cebc508d8fa93bb93ff6e332553fadea58187a90718f4893fdb5fbf17c7234bbbf236e330c6a5f69c9466aecbbbfe112b6622d7a3c'local someone2_llIlIIIlIIlIllIllIIlI='4f6d2ab71aaf662a90d2f899682b7cac20690d3492cf8ee526e5a96f9613b0b4ca'local someone2_IIlIlll={GvYzWtWdYsGoELgJasK,BsFwFmBgCkIv,XNNDoUCiarejZqIxJu,ONBjJcvQiUlDnaIDsBMAolz,yiFbKWVgfJPzyAGzuM,LneFRPnYlUiEWvgmFyiTSd}end;someone2_IIllIlIlIIlIllIlII=function(someone2_llllIIlIlIlIlllIIIIIl)local someone2_lllIllIlIIlI=tonumber(someone2_llllIIlIlIlIlllIIIIIl)local someone2_IllIIIIllIlIIllIlll=''for i=7,0,-1 do local someone2_IIllllIIlI=math.pow(2,i)if someone2_lllIllIlIIlI>=someone2_IIllllIIlI then someone2_IllIIIIllIlIIllIlll=someone2_IllIIIIllIlIIllIlll..'1'someone2_lllIllIlIIlI=someone2_lllIllIlIIlI-someone2_IIllllIIlI else someone2_IllIIIIllIlIIllIlll=someone2_IllIIIIllIlIIllIlll..'0'end end;return someone2_IllIIIIllIlIIllIlll end;someone2_IIlllIIII=function(someone2_lIIIII)return tonumber(someone2_lIIIII,2)end;someone2_lllIIIIIIIIlllIllIlI=function(someone2_lIlllIll)local someone2_IllIIIIIlIIIlIllI=someone2_lIlllIll:gsub("%s","")local someone2_IlIlIlI=someone2_IllIIIIIlIIIlIllI:gsub("=","")local someone2_lIIIlllIIlIllllIIllII=''local someone2_lIlIlIllI=''for i=1,someone2_IIIllIlIIlIIl(someone2_IlIlIlI)do local someone2_IIIlIlIllIlI=someone2_IIlIIlllIllllI(someone2_lIlllIll,i,i)local someone2_llIlII,someone2_IlllIlIlIIllIlIllI=string.find(someone2_llIIlIlIIl(someone2_IlllllIIlIlIll),someone2_IIIlIlIllIlI)if someone2_llIlII==nil then error("Invalid character '"..someone2_IIIlIlIllIlI.."' found.")end;someone2_lIIIlllIIlIllllIIllII=someone2_lIIIlllIIlIllllIIllII..someone2_IIlIIlllIllllI(someone2_IIllIlIlIIlIllIlII(someone2_llIlII-1),3)end;for i=1,someone2_IIIllIlIIlIIl(someone2_lIIIlllIIlIllllIIllII),8 do local someone2_IlIIIIIlIl=someone2_IIlIIlllIllllI(someone2_lIIIlllIIlIllllIIllII,i,i+7)someone2_lIlIlIllI=someone2_lIlIlIllI..someone2_IIIIlIIIlll(someone2_IIlllIIII(someone2_IlIIIIIlIl))end;local someone2_lllIllllllIIII=someone2_IllIIIIIlIIIlIllI:len()-someone2_IlIlIlI:len()if(someone2_lllIllllllIIII==1 or someone2_lllIllllllIIII==2)then someone2_lIlIlIllI=someone2_lIlIlIllI:sub(1,-2)end;return someone2_lIlIlIllI end;someone2_IlIIIIIlIllll=function(someone2_IlIllI)print(someone2_IlIllI)end;someone2_lIlllIIIlIIIllllll=function(someone2_IlIIIlll)local someone2_IIllllIIIIlI={}local someone2_llIlIIlI=setmetatable({},someone2_IIllllIIIIlI)function someone2_IIllllIIIIlI:__index(someone2_IlIIIIII)local someone2_lIlIIllIIIII=someone2_IlIIIlll(someone2_IlIIIIII)someone2_llIlIIlI[someone2_IlIIIIII]=someone2_lIlIIllIIIII;return someone2_lIlIIllIIIII end;return someone2_llIlIIlI end;someone2_IlllII=function(someone2_lIIIIIIIIIlllllIIIlll,someone2_IlllIlIIIIIlI)local function someone2_lllIIllllIlllIIllll(someone2_IllllIlIllllIll,someone2_IIIllIl)local someone2_lIIIIlIlIIII,someone2_IlIlIIIllIIlIlIlIlll=0,1;while someone2_IllllIlIllllIll~=0 and someone2_IIIllIl~=0 do local someone2_lIlllIIlIllIIllIII,someone2_lIIIIII=someone2_IllllIlIllllIll%someone2_IlllIlIIIIIlI,someone2_IIIllIl%someone2_IlllIlIIIIIlI;someone2_lIIIIlIlIIII=someone2_lIIIIlIlIIII+someone2_lIIIIIIIIIlllllIIIlll[someone2_lIlllIIlIllIIllIII][someone2_lIIIIII]*someone2_IlIlIIIllIIlIlIlIlll;someone2_IllllIlIllllIll=(someone2_IllllIlIllllIll-someone2_lIlllIIlIllIIllIII)/someone2_IlllIlIIIIIlI;someone2_IIIllIl=(someone2_IIIllIl-someone2_lIIIIII)/someone2_IlllIlIIIIIlI;someone2_IlIlIIIllIIlIlIlIlll=someone2_IlIlIIIllIIlIlIlIlll*someone2_IlllIlIIIIIlI end;someone2_lIIIIlIlIIII=someone2_lIIIIlIlIIII+ (someone2_IllllIlIllllIll+someone2_IIIllIl)*someone2_IlIlIIIllIIlIlIlIlll;return someone2_lIIIIlIlIIII end;return someone2_lllIIllllIlllIIllll end;someone2_llIlIllIIlIllllIllllI=function(someone2_lIlIIlIIllII)local someone2_Illl=someone2_IlllII(someone2_lIlIIlIIllII,2 ^1)local someone2_IIlIII=someone2_lIlllIIIlIIIllllll(function(someone2_IIlIIlIlllIlll)return someone2_lIlllIIIlIIIllllll(function(someone2_lllllIlll)return someone2_Illl(someone2_IIlIIlIlllIlll,someone2_lllllIlll)end)end)return someone2_IlllII(someone2_IIlIII,2 ^ (someone2_lIlIIlIIllII.n or 1))end;someone2_IIlIl=someone2_llIlIllIIlIllllIllllI{[0]={[0]=0,[1]=1},[1]={[0]=1,[1]=0},n=4}someone2_lIlIIlIlIIlIIlIIIIlIl=function(someone2_lIIIIIIllIIlIIIIIllll,someone2_IIIlllIllIlllI,someone2_IIlIIllIllllIlIlIll,...)local someone2_lllIIIIIIIIlII;if someone2_IIIlllIllIlllI then someone2_lIIIIIIllIIlIIIIIllll=someone2_lIIIIIIllIIlIIIIIllll%2 ^32;someone2_IIIlllIllIlllI=someone2_IIIlllIllIlllI%2 ^32;someone2_lllIIIIIIIIlII=someone2_IIlIl(someone2_lIIIIIIllIIlIIIIIllll,someone2_IIIlllIllIlllI)if someone2_IIlIIllIllllIlIlIll then someone2_lllIIIIIIIIlII=someone2_lIlIIlIlIIlIIlIIIIlIl(someone2_lllIIIIIIIIlII,someone2_IIlIIllIllllIlIlIll,...)end;return someone2_lllIIIIIIIIlII elseif someone2_lIIIIIIllIIlIIIIIllll then return someone2_lIIIIIIllIIlIIIIIllll%MOD else return 0 end end;someone2_IIl=function(someone2_IlllIIIIllIII,someone2_IllIlIllIl,someone2_IllIlIlIllllllll)if someone2_IllIlIlIllllllll then local someone2_Illl=0;local someone2_IlIlIIlIIl=0;for i=someone2_IllIlIllIl,someone2_IllIlIlIllllllll do someone2_Illl=someone2_Illl+2 ^someone2_IlIlIIlIIl*someone2_IIl(someone2_IlllIIIIllIII,i)someone2_IlIlIIlIIl=someone2_IlIlIIlIIl+1 end;return someone2_Illl else local someone2_llIlllIIlIIl=2 ^ (someone2_IllIlIllIl-1)return(someone2_IlllIIIIllIII% (someone2_llIlllIIlIIl+someone2_llIlllIIlIIl)>=someone2_llIlllIIlIIl)and 1 or 0 end end;someone2_lIIlIIIIIIlll=function(someone2_lllIIIlIIIlI)local someone2_IIlIIlIIIlIIIIll=1;local someone2_lIIIIlIlIlll=''local someone2_IIlllIlIll;local someone2_lIlll=''if(someone2_lllIIIlIIIlI==nil)then error("Nil inputs.")else local someone2_lIIlIIIIIllIIlII=1;while someone2_lIIlIIIIIllIIlII<#someone2_lllIIIlIIIlI+1 do local someone2_lllIlIII=someone2_IIlIIlllIllllI(someone2_lllIIIlIIIlI,someone2_lIIlIIIIIllIIlII,someone2_lIIlIIIIIllIIlII+3)local someone2_llIlIlIlllIlll=someone2_lllIIIIIIIIlllIllIlI(someone2_lllIlIII)local someone2_llIllI=someone2_lIlIIl(someone2_llIlIlIlllIlll,someone2_IIlllI)local someone2_lIlllllI=someone2_llllllllllllIlIlIlI(someone2_llIllI,someone2_IIllIIlllIlIII)someone2_lIlll=someone2_lIlll..someone2_IIIIlIIIlll(someone2_lIlllllI)someone2_lIIlIIIIIllIIlII=someone2_lIIlIIIIIllIIlII+4 end end;local someone2_llIlIlIlI=1;local someone2_llIlIIlIIIIIllIIIl=false;local someone2_lIIllIllIIlIIII;local someone2_IllllIlIllI;local someone2_IIIIlIlIIIlllIl,someone2_IIlIlIlllIll;local someone2_IllIlIIII,someone2_lIIlIIllIIlll,someone2_lIIIlIIlIlI,someone2_IlIIIIIIlllIllllllII,someone2_IlIIIIIIlIlIIlIlIlIIIII;do function someone2_IllIlIIII()local someone2_lllIIlllIIlI=someone2_lIlll:byte(someone2_llIlIlIlI,someone2_llIlIlIlI)someone2_llIlIlIlI=someone2_llIlIlIlI+1;return someone2_lllIIlllIIlI end;function someone2_lIIlIIllIIlll()local someone2_lIIlIIl,someone2_lIlIllIlIlIlllIIlll,someone2_llllIllIllllIl,someone2_IllllIlIIllllIIIIIIIl=someone2_lIlll:byte(someone2_llIlIlIlI,someone2_llIlIlIlI+3)someone2_llIlIlIlI=someone2_llIlIlIlI+4;return someone2_IllllIlIIllllIIIIIIIl*16777216 +someone2_llllIllIllllIl*65536 +someone2_lIlIllIlIlIlllIIlll*256 +someone2_lIIlIIl end;function someone2_lIIIlIIlIlI()local someone2_IlIllIIlIIlII=someone2_lIIlIIllIIlll()local someone2_IllllIIIllll=someone2_lIIlIIllIIlll()return someone2_IllllIIIllll*4294967296 +someone2_IlIllIIlIIlII end;function someone2_IlIIIIIIlllIllllllII()local someone2_lIlIlIIIlIlllIllIlII=someone2_lIIlIIllIIlll()local someone2_IllIIIlI=someone2_lIIlIIllIIlll()return(-2 *someone2_IIl(someone2_IllIIIlI,32)+1)* (2 ^ (someone2_IIl(someone2_IllIIIlI,21,31)-1023))* ( (someone2_IIl(someone2_IllIIIlI,1,20)* (2 ^32)+someone2_lIlIlIIIlIlllIllIlII)/ (2 ^52)+1)end;function someone2_IlIIIIIIlIlIIlIlIlIIIII(someone2_lIIllllIlIIIlIllI)local someone2_lIIIIlIIlIIIIIllIIlllI;if someone2_lIIllllIlIIIlIllI then someone2_lIIIIlIIlIIIIIllIIlllI=someone2_lIlll:sub(someone2_llIlIlIlI,someone2_llIlIlIlI+someone2_lIIllllIlIIIlIllI-1)someone2_llIlIlIlI=someone2_llIlIlIlI+someone2_lIIllllIlIIIlIllI else someone2_lIIllllIlIIIlIllI=someone2_IIlIlIlllIll()if someone2_lIIllllIlIIIlIllI==0 then return end;someone2_lIIIIlIIlIIIIIllIIlllI=someone2_lIlll:sub(someone2_llIlIlIlI,someone2_llIlIlIlI+someone2_lIIllllIlIIIlIllI-1)someone2_llIlIlIlI=someone2_llIlIlIlI+someone2_lIIllllIlIIIlIllI end;return someone2_lIIIIlIIlIIIIIllIIlllI end end;local function someone2_IIllIIlIIIlI()local someone2_lllIIllIIIIllllI;local someone2_IlIlIIlllIllIlIlIIIIlIIII={}local someone2_lII={}local someone2_IIIIlIIIIl={}local someone2_IIlllIlIllIIIIllIlI={lines={}}someone2_lllIIllIIIIllllI={instructions=someone2_IlIlIIlllIllIlIlIIIIlIIII,constants=someone2_lII,prototypes=someone2_IIIIlIIIIl,debug=someone2_IIlllIlIllIIIIllIlI}local someone2_lIlIlII;someone2_lllIIllIIIIllllI.name=someone2_IlIIIIIIlIlIIlIlIlIIIII()someone2_lllIIllIIIIllllI.first_line=someone2_IIIIlIlIIIlllIl()someone2_lllIIllIIIIllllI.last_line=someone2_IIIIlIlIIIlllIl()if someone2_lllIIllIIIIllllI.name then someone2_lllIIllIIIIllllI.name=someone2_lllIIllIIIIllllI.name:sub(1,-2)end;someone2_lllIIllIIIIllllI.upvalues=someone2_IllIlIIII()someone2_lllIIllIIIIllllI.arguments=someone2_IllIlIIII()someone2_lllIIllIIIIllllI.varg=someone2_IllIlIIII()someone2_lllIIllIIIIllllI.stack=someone2_IllIlIIII()do someone2_lIlIlII=someone2_IIIIlIlIIIlllIl()for i=1,someone2_lIlIlII do local someone2_lIIIlIlIlIIIIIIIIIl={}local someone2_llIlIlIlII=someone2_lIIlIIllIIlll()local someone2_lIlIllIIII=someone2_IIl(someone2_llIlIlIlII,1,6)local someone2_IIllllIlllI=someone2_lllIIIllllII[someone2_lIlIllIIII+1]someone2_lIIIlIlIlIIIIIIIIIl.opcode=someone2_lIlIllIIII;someone2_lIIIlIlIlIIIIIIIIIl.type=someone2_IIllllIlllI;someone2_lIIIlIlIlIIIIIIIIIl.A=someone2_IIl(someone2_llIlIlIlII,7,14)if someone2_IIllllIlllI=="ABC"then someone2_lIIIlIlIlIIIIIIIIIl.B=someone2_IIl(someone2_llIlIlIlII,24,32)someone2_lIIIlIlIlIIIIIIIIIl.C=someone2_IIl(someone2_llIlIlIlII,15,23)elseif someone2_IIllllIlllI=="ABx"then someone2_lIIIlIlIlIIIIIIIIIl.Bx=someone2_IIl(someone2_llIlIlIlII,15,32)elseif someone2_IIllllIlllI=="AsBx"then someone2_lIIIlIlIlIIIIIIIIIl.sBx=someone2_IIl(someone2_llIlIlIlII,15,32)-131071 end;someone2_IlIlIIlllIllIlIlIIIIlIIII[i]=someone2_lIIIlIlIlIIIIIIIIIl end end;do someone2_lIlIlII=someone2_IIIIlIlIIIlllIl()for i=1,someone2_lIlIlII do local someone2_llIlIIIIl={}local someone2_lIIlIllIIlI=someone2_IllIlIIII()someone2_llIlIIIIl.type=someone2_lIIlIllIIlI;if someone2_lIIlIllIIlI==1 then someone2_llIlIIIIl.data=(someone2_IllIlIIII()~=0)elseif someone2_lIIlIllIIlI==3 then someone2_llIlIIIIl.data=someone2_IlIIIIIIlllIllllllII()elseif someone2_lIIlIllIIlI==4 then someone2_llIlIIIIl.data=someone2_IlIIIIIIlIlIIlIlIlIIIII():sub(1,-2)end;someone2_lII[i-1]=someone2_llIlIIIIl end end;do someone2_lIlIlII=someone2_IIIIlIlIIIlllIl()for i=1,someone2_lIlIlII do someone2_IIIIlIIIIl[i-1]=someone2_IIllIIlIIIlI()end end;do local someone2_IllllIII=someone2_IIlllIlIllIIIIllIlI.lines;someone2_lIlIlII=someone2_IIIIlIlIIIlllIl()for i=1,someone2_lIlIlII do someone2_IllllIII[i]=someone2_lIIlIIllIIlll()end;someone2_lIlIlII=someone2_IIIIlIlIIIlllIl()for i=1,someone2_lIlIlII do someone2_IlIIIIIIlIlIIlIlIlIIIII():sub(1,-2)someone2_lIIlIIllIIlll()someone2_lIIlIIllIIlll()end;someone2_lIlIlII=someone2_IIIIlIlIIIlllIl()for i=1,someone2_lIlIlII do someone2_IlIIIIIIlIlIIlIlIlIIIII()end end;return someone2_lllIIllIIIIllllI end;do assert(someone2_IlIIIIIIlIlIIlIlIlIIIII(4)=="\27Lua",someone2_llIIlIlIIl(someone2_lllllIIIlIlIIlIIllIl))assert(someone2_IllIlIIII()==0x51,someone2_llIIlIlIIl(someone2_llIlIllI))someone2_IllIlIIII()someone2_llIlIIlIIIIIllIIIl=(someone2_IllIlIIII()==0)someone2_lIIllIllIIlIIII=someone2_IllIlIIII()someone2_IllllIlIllI=someone2_IllIlIIII()if someone2_lIIllIllIIlIIII==4 then someone2_IIIIlIlIIIlllIl=someone2_lIIlIIllIIlll elseif someone2_lIIllIllIIlIIII==8 then someone2_IIIIlIlIIIlllIl=someone2_lIIIlIIlIlI else error(someone2_IIIIlllIIIlIIlllll)end;if someone2_IllllIlIllI==4 then someone2_IIlIlIlllIll=someone2_lIIlIIllIIlll elseif someone2_IllllIlIllI==8 then someone2_IIlIlIlllIll=someone2_lIIIlIIlIlI else error(someone2_llIIlIlIIl(someone2_IIIIlllIIIlIIlllll))end;assert(someone2_IlIIIIIIlIlIIlIlIlIIIII(3)=="\4\8\0",someone2_IIIIlllIIIlIIlllll)end;return someone2_IIllIIlIIIlI()end;local function someone2_lIIIllIlIIlIIl(...)local someone2_llllIlIIIIIIlll=select("#",...)local someone2_llIlIllII={...}return someone2_llllIlIIIIIIlll,someone2_llIlIllII end;someone2_lIlIlIIIlIlllIllllI=function(someone2_IlIllllIlllIIlIlIl,someone2_lllIIlI)local someone2_IllIlllIIlllllIllIlIl=someone2_IlIllllIlllIIlIlIl.instructions;local someone2_llIlllIl=someone2_IlIllllIlllIIlIlIl.constants;local someone2_lIllllIIllIIlllIlIl=someone2_IlIllllIlllIIlIlIl.prototypes;local someone2_IIlIlIlI,someone2_IIllI;local someone2_lllIllIllIlll;local someone2_IIIlIlI=1;local someone2_lllIl,someone2_llIlllII;local someone2_lIIIllIIllIlI={[0]=function(someone2_lIllllIIIlIII)someone2_IIlIlIlI[someone2_lIllllIIIlIII.A]=someone2_IIlIlIlI[someone2_lIllllIIIlIII.B]end,[1]=function(someone2_lIIIllIIIlIlI)someone2_IIlIlIlI[someone2_lIIIllIIIlIlI.A]=someone2_llIlllIl[someone2_lIIIllIIIlIlI.Bx].data end,[2]=function(someone2_llIlllllIIllIlIlIll)someone2_IIlIlIlI[someone2_llIlllllIIllIlIlIll.A]=someone2_llIlllllIIllIlIlIll.B~=0;if someone2_llIlllllIIllIlIlIll.C~=0 then someone2_IIIlIlI=someone2_IIIlIlI+1 end end,[3]=function(someone2_IIIll)local someone2_IlIIlIIIl=someone2_IIlIlIlI;for i=someone2_IIIll.A,someone2_IIIll.B do someone2_IlIIlIIIl[i]=nil end end,[4]=function(someone2_IlIIIIlIIIIlIlIlllIIl)someone2_IIlIlIlI[someone2_IlIIIIlIIIIlIlIlllIIl.A]=someone2_lllIIlI[someone2_IlIIIIlIIIIlIlIlllIIl.B]end,[5]=function(someone2_IIllIIlIIlIII)local someone2_IlllIIlllIllIll=someone2_llIlllIl[someone2_IIllIIlIIlIII.Bx].data;someone2_IIlIlIlI[someone2_IIllIIlIIlIII.A]=someone2_lllIllIllIlll[someone2_IlllIIlllIllIll]end,[6]=function(someone2_lllIIlIllIl)local someone2_IIIll=someone2_lllIIlIllIl.C;local someone2_IllIllIlIlIIllIlIIIIl=someone2_IIlIlIlI;someone2_IIIll=someone2_IIIll>255 and someone2_llIlllIl[someone2_IIIll-256].data or someone2_IllIllIlIlIIllIlIIIIl[someone2_IIIll]someone2_IllIllIlIlIIllIlIIIIl[someone2_lllIIlIllIl.A]=someone2_IllIllIlIlIIllIlIIIIl[someone2_lllIIlIllIl.B][someone2_IIIll]end,[7]=function(someone2_IlIlllllIlll)local someone2_llIIlIlIIlIll=someone2_llIlllIl[someone2_IlIlllllIlll.Bx].data;someone2_lllIllIllIlll[someone2_llIIlIlIIlIll]=someone2_IIlIlIlI[someone2_IlIlllllIlll.A]end,[8]=function(someone2_IIIllIIl)someone2_lllIIlI[someone2_IIIllIIl.B]=someone2_IIlIlIlI[someone2_IIIllIIl.A]end,[9]=function(someone2_lIllIllIIIIllIIIIlIlIIII)local someone2_IIII=someone2_lIllIllIIIIllIIIIlIlIIII.B;local someone2_IlIIlIIl=someone2_lIllIllIIIIllIIIIlIlIIII.C;local someone2_llIIIlllIllll,someone2_IllIIlIlIlIIlIlIIIIIl=someone2_IIlIlIlI,someone2_llIlllIl;someone2_IIII=someone2_IIII>255 and someone2_IllIIlIlIlIIlIlIIIIIl[someone2_IIII-256].data or someone2_llIIIlllIllll[someone2_IIII]someone2_IlIIlIIl=someone2_IlIIlIIl>255 and someone2_IllIIlIlIlIIlIlIIIIIl[someone2_IlIIlIIl-256].data or someone2_llIIIlllIllll[someone2_IlIIlIIl]someone2_llIIIlllIllll[someone2_lIllIllIIIIllIIIIlIlIIII.A][someone2_IIII]=someone2_IlIIlIIl end,[10]=function(someone2_lIIlIllllllI)someone2_IIlIlIlI[someone2_lIIlIllllllI.A]={}end,[11]=function(someone2_lIlIllll)local someone2_lIlIlIlllIllllIllIIlI=someone2_lIlIllll.A;local someone2_IllIlIIllllIIllIIll=someone2_lIlIllll.B;local someone2_lIlIIlIIIIIlI=someone2_lIlIllll.C;local someone2_IllllIlIlIIllII=someone2_IIlIlIlI;someone2_IllIlIIllllIIllIIll=someone2_IllllIlIlIIllII[someone2_IllIlIIllllIIllIIll]someone2_lIlIIlIIIIIlI=someone2_lIlIIlIIIIIlI>255 and someone2_llIlllIl[someone2_lIlIIlIIIIIlI-256].data or someone2_IllllIlIlIIllII[someone2_lIlIIlIIIIIlI]someone2_IllllIlIlIIllII[someone2_lIlIlIlllIllllIllIIlI+1]=someone2_IllIlIIllllIIllIIll;someone2_IllllIlIlIIllII[someone2_lIlIlIlllIllllIllIIlI]=someone2_IllIlIIllllIIllIIll[someone2_lIlIIlIIIIIlI]end,[12]=function(someone2_IIIlIlIllllIIIIlII)local someone2_IIlIIlllIII=someone2_IIIlIlIllllIIIIlII.B;local someone2_IIIlIlIl=someone2_IIIlIlIllllIIIIlII.C;local someone2_IllIlIllllIIIIl,someone2_IIIlllIIll=someone2_IIlIlIlI,someone2_llIlllIl;someone2_IIlIIlllIII=someone2_IIlIIlllIII>255 and someone2_IIIlllIIll[someone2_IIlIIlllIII-256].data or someone2_IllIlIllllIIIIl[someone2_IIlIIlllIII]someone2_IIIlIlIl=someone2_IIIlIlIl>255 and someone2_IIIlllIIll[someone2_IIIlIlIl-256].data or someone2_IllIlIllllIIIIl[someone2_IIIlIlIl]someone2_IllIlIllllIIIIl[someone2_IIIlIlIllllIIIIlII.A]=someone2_IIlIIlllIII+someone2_IIIlIlIl end,[13]=function(someone2_llllllIIlIIlIIlll)local someone2_IlllIIlIIllI=someone2_llllllIIlIIlIIlll.B;local someone2_lIIIlIlIIlllIllI=someone2_llllllIIlIIlIIlll.C;local someone2_lllIIlllIIllIIlIl,someone2_IIlI=someone2_IIlIlIlI,someone2_llIlllIl;someone2_IlllIIlIIllI=someone2_IlllIIlIIllI>255 and someone2_IIlI[someone2_IlllIIlIIllI-256].data or someone2_lllIIlllIIllIIlIl[someone2_IlllIIlIIllI]someone2_lIIIlIlIIlllIllI=someone2_lIIIlIlIIlllIllI>255 and someone2_IIlI[someone2_lIIIlIlIIlllIllI-256].data or someone2_lllIIlllIIllIIlIl[someone2_lIIIlIlIIlllIllI]someone2_lllIIlllIIllIIlIl[someone2_llllllIIlIIlIIlll.A]=someone2_IlllIIlIIllI-someone2_lIIIlIlIIlllIllI end,[14]=function(someone2_llIIlIIIllIIIIlI)local someone2_IlIlllIIIlllIl=someone2_llIIlIIIllIIIIlI.B;local someone2_IlIlllIllllll=someone2_llIIlIIIllIIIIlI.C;local someone2_IlIlIllIllIllllIIIl,someone2_llIIIIIIl=someone2_IIlIlIlI,someone2_llIlllIl;someone2_IlIlllIIIlllIl=someone2_IlIlllIIIlllIl>255 and someone2_llIIIIIIl[someone2_IlIlllIIIlllIl-256].data or someone2_IlIlIllIllIllllIIIl[someone2_IlIlllIIIlllIl]someone2_IlIlllIllllll=someone2_IlIlllIllllll>255 and someone2_llIIIIIIl[someone2_IlIlllIllllll-256].data or someone2_IlIlIllIllIllllIIIl[someone2_IlIlllIllllll]someone2_IlIlIllIllIllllIIIl[someone2_llIIlIIIllIIIIlI.A]=someone2_IlIlllIIIlllIl*someone2_IlIlllIllllll end,[15]=function(someone2_IIlllIllIIIllIIllll)local someone2_IIIIllIIlIllIIIIIl=someone2_IIlllIllIIIllIIllll.B;local someone2_lIIIIIlIl=someone2_IIlllIllIIIllIIllll.C;local someone2_IllIlI,someone2_llIIllIlIIIIIllIllII=someone2_IIlIlIlI,someone2_llIlllIl;someone2_IIIIllIIlIllIIIIIl=someone2_IIIIllIIlIllIIIIIl>255 and someone2_llIIllIlIIIIIllIllII[someone2_IIIIllIIlIllIIIIIl-256].data or someone2_IllIlI[someone2_IIIIllIIlIllIIIIIl]someone2_lIIIIIlIl=someone2_lIIIIIlIl>255 and someone2_llIIllIlIIIIIllIllII[someone2_lIIIIIlIl-256].data or someone2_IllIlI[someone2_lIIIIIlIl]someone2_IllIlI[someone2_IIlllIllIIIllIIllll.A]=someone2_IIIIllIIlIllIIIIIl/someone2_lIIIIIlIl end,[16]=function(someone2_IlIllIIIlIlIIIIlIlII)local someone2_IIllllIl=someone2_IlIllIIIlIlIIIIlIlII.B;local someone2_lIlIIIllI=someone2_IlIllIIIlIlIIIIlIlII.C;local someone2_llllllIlll,someone2_llIlIlIIIlIIllIIIIIllIl=someone2_IIlIlIlI,someone2_llIlllIl;someone2_IIllllIl=someone2_IIllllIl>255 and someone2_llIlIlIIIlIIllIIIIIllIl[someone2_IIllllIl-256].data or someone2_llllllIlll[someone2_IIllllIl]someone2_lIlIIIllI=someone2_lIlIIIllI>255 and someone2_llIlIlIIIlIIllIIIIIllIl[someone2_lIlIIIllI-256].data or someone2_llllllIlll[someone2_lIlIIIllI]someone2_llllllIlll[someone2_IlIllIIIlIlIIIIlIlII.A]=someone2_IIllllIl%someone2_lIlIIIllI end,[17]=function(someone2_llllIIlllllIIIlll)local someone2_IllIlIIIlIIIIll=someone2_llllIIlllllIIIlll.B;local someone2_lIIIllllIIlI=someone2_llllIIlllllIIIlll.C;local someone2_lIIIIIIIlII,someone2_IllIIllI=someone2_IIlIlIlI,someone2_llIlllIl;someone2_IllIlIIIlIIIIll=someone2_IllIlIIIlIIIIll>255 and someone2_IllIIllI[someone2_IllIlIIIlIIIIll-256].data or someone2_lIIIIIIIlII[someone2_IllIlIIIlIIIIll]someone2_lIIIllllIIlI=someone2_lIIIllllIIlI>255 and someone2_IllIIllI[someone2_lIIIllllIIlI-256].data or someone2_lIIIIIIIlII[someone2_lIIIllllIIlI]someone2_lIIIIIIIlII[someone2_llllIIlllllIIIlll.A]=someone2_IllIlIIIlIIIIll^someone2_lIIIllllIIlI end,[18]=function(someone2_lII)someone2_IIlIlIlI[someone2_lII.A]=-someone2_IIlIlIlI[someone2_lII.B]end,[19]=function(someone2_llIIlllIIIIlIlII)someone2_IIlIlIlI[someone2_llIIlllIIIIlIlII.A]=not someone2_IIlIlIlI[someone2_llIIlllIIIIlIlII.B]end,[20]=function(someone2_llIIIlllIlIIllIIl)someone2_IIlIlIlI[someone2_llIIIlllIlIIllIIl.A]=#someone2_IIlIlIlI[someone2_llIIIlllIlIIllIIl.B]end,[21]=function(someone2_lllIlIIlIlIIllIllIlll)local someone2_llIlIlllIIIIIIl=someone2_lllIlIIlIlIIllIllIlll.B;local someone2_IlIllllIlIIllIIlI=someone2_IIlIlIlI[someone2_llIlIlllIIIIIIl]for i=someone2_llIlIlllIIIIIIl+1,someone2_lllIlIIlIlIIllIllIlll.C do someone2_IlIllllIlIIllIIlI=someone2_IlIllllIlIIllIIlI..someone2_IIlIlIlI[i]end;someone2_IIlIlIlI[someone2_lllIlIIlIlIIllIllIlll.A]=someone2_IlIllllIlIIllIIlI end,[22]=function(someone2_lIllllI)someone2_IIIlIlI=someone2_IIIlIlI+someone2_lIllllI.sBx end,[23]=function(someone2_IIIIlIIllllIlIlI)local someone2_IlIIllllIllIllll=someone2_IIIIlIIllllIlIlI.A;local someone2_IlIIlIIIlIIl=someone2_IIIIlIIllllIlIlI.B;local someone2_lIIlIIIllllIllIllIlll=someone2_IIIIlIIllllIlIlI.C;local someone2_lIIllIIlIIlllllIlllI,someone2_IlIllllI=someone2_IIlIlIlI,someone2_llIlllIl;someone2_IlIIllllIllIllll=someone2_IlIIllllIllIllll~=0;someone2_IlIIlIIIlIIl=someone2_IlIIlIIIlIIl>255 and someone2_IlIllllI[someone2_IlIIlIIIlIIl-256].data or someone2_lIIllIIlIIlllllIlllI[someone2_IlIIlIIIlIIl]someone2_lIIlIIIllllIllIllIlll=someone2_lIIlIIIllllIllIllIlll>255 and someone2_IlIllllI[someone2_lIIlIIIllllIllIllIlll-256].data or someone2_lIIllIIlIIlllllIlllI[someone2_lIIlIIIllllIllIllIlll]if(someone2_IlIIlIIIlIIl==someone2_lIIlIIIllllIllIllIlll)~=someone2_IlIIllllIllIllll then someone2_IIIlIlI=someone2_IIIlIlI+1 end end,[24]=function(someone2_IIIII)local someone2_IllIIllIllIIIIII=someone2_IIIII.A;local someone2_IlIlIlI=someone2_IIIII.B;local someone2_llIllIllIlIIllIIlIIIlI=someone2_IIIII.C;local someone2_lllIIllIlllllIIlI,someone2_IllllIIIIlllllIIl=someone2_IIlIlIlI,someone2_llIlllIl;someone2_IllIIllIllIIIIII=someone2_IllIIllIllIIIIII~=0;someone2_IlIlIlI=someone2_IlIlIlI>255 and someone2_IllllIIIIlllllIIl[someone2_IlIlIlI-256].data or someone2_lllIIllIlllllIIlI[someone2_IlIlIlI]someone2_llIllIllIlIIllIIlIIIlI=someone2_llIllIllIlIIllIIlIIIlI>255 and someone2_IllllIIIIlllllIIl[someone2_llIllIllIlIIllIIlIIIlI-256].data or someone2_lllIIllIlllllIIlI[someone2_llIllIllIlIIllIIlIIIlI]if(someone2_IlIlIlI<someone2_llIllIllIlIIllIIlIIIlI)~=someone2_IllIIllIllIIIIII then someone2_IIIlIlI=someone2_IIIlIlI+1 end end,[25]=function(someone2_llll)local someone2_IIIIl=someone2_llll.A;local someone2_IlllIlllllll=someone2_llll.B;local someone2_IIIIlI=someone2_llll.C;local someone2_llIIlIl,someone2_lIllllIIllIII=someone2_IIlIlIlI,someone2_llIlllIl;someone2_IIIIl=someone2_IIIIl~=0;someone2_IlllIlllllll=someone2_IlllIlllllll>255 and someone2_lIllllIIllIII[someone2_IlllIlllllll-256].data or someone2_llIIlIl[someone2_IlllIlllllll]someone2_IIIIlI=someone2_IIIIlI>255 and someone2_lIllllIIllIII[someone2_IIIIlI-256].data or someone2_llIIlIl[someone2_IIIIlI]if(someone2_IlllIlllllll<=someone2_IIIIlI)~=someone2_IIIIl then someone2_IIIlIlI=someone2_IIIlIlI+1 end end,[26]=function(someone2_IlllllIlll)if(not not someone2_IIlIlIlI[someone2_IlllllIlll.A])== (someone2_IlllllIlll.C==0)then someone2_IIIlIlI=someone2_IIIlIlI+1 end end,[27]=function(someone2_IIlIlllIIIlIIIIIII)local someone2_llIllIlll=someone2_IIlIlIlI;local someone2_IlIllIllllIlII=someone2_llIllIlll[someone2_IIlIlllIIIlIIIIIII.B]if(not not someone2_IlIllIllllIlII)== (someone2_IIlIlllIIIlIIIIIII.C==0)then someone2_IIIlIlI=someone2_IIIlIlI+1 else someone2_llIllIlll[someone2_IIlIlllIIIlIIIIIII.A]=someone2_IlIllIllllIlII end end,[28]=function(someone2_IlllIIIllIlllI)local someone2_IllllII=someone2_IlllIIIllIlllI.A;local someone2_IlIIlIIIlIIIIl=someone2_IlllIIIllIlllI.B;local someone2_IlllllllIIIIlll=someone2_IlllIIIllIlllI.C;local someone2_llIIIIIIllllll=someone2_IIlIlIlI;local someone2_IIIIIIIlII,someone2_IIlIlIllllllIll;local someone2_lIIIlIIIIIIIIlIllII,someone2_lIIIIIIIIllIl;someone2_IIIIIIIlII={}if someone2_IlIIlIIIlIIIIl~=1 then if someone2_IlIIlIIIlIIIIl~=0 then someone2_lIIIlIIIIIIIIlIllII=someone2_IllllII+someone2_IlIIlIIIlIIIIl-1 else someone2_lIIIlIIIIIIIIlIllII=someone2_IIllI end;someone2_lIIIIIIIIllIl=0;for i=someone2_IllllII+1,someone2_lIIIlIIIIIIIIlIllII do someone2_lIIIIIIIIllIl=someone2_lIIIIIIIIllIl+1;someone2_IIIIIIIlII[someone2_lIIIIIIIIllIl]=someone2_llIIIIIIllllll[i]end;someone2_lIIIlIIIIIIIIlIllII,someone2_IIlIlIllllllIll=someone2_lIIIllIlIIlIIl(someone2_llIIIIIIllllll[someone2_IllllII](unpack(someone2_IIIIIIIlII,1,someone2_lIIIlIIIIIIIIlIllII-someone2_IllllII)))else someone2_lIIIlIIIIIIIIlIllII,someone2_IIlIlIllllllIll=someone2_lIIIllIlIIlIIl(someone2_llIIIIIIllllll[someone2_IllllII]())end;someone2_IIllI=someone2_IllllII-1;if someone2_IlllllllIIIIlll~=1 then if someone2_IlllllllIIIIlll~=0 then someone2_lIIIlIIIIIIIIlIllII=someone2_IllllII+someone2_IlllllllIIIIlll-2 else someone2_lIIIlIIIIIIIIlIllII=someone2_lIIIlIIIIIIIIlIllII+someone2_IllllII end;someone2_lIIIIIIIIllIl=0;for i=someone2_IllllII,someone2_lIIIlIIIIIIIIlIllII do someone2_lIIIIIIIIllIl=someone2_lIIIIIIIIllIl+1;someone2_llIIIIIIllllll[i]=someone2_IIlIlIllllllIll[someone2_lIIIIIIIIllIl]end end end,[29]=function(someone2_IlIlIIIIIllIll)local someone2_lllll=someone2_IlIlIIIIIllIll.A;local someone2_lllIllIllIIlIIlIIll=someone2_IlIlIIIIIllIll.B;local someone2_lIllllIIIllI=someone2_IlIlIIIIIllIll.C;local someone2_lIIlIlIIlIIIllII=someone2_IIlIlIlI;local someone2_Illl,someone2_lllIIIII;local someone2_lIIlIlIIllIll,someone2_IlllIIIllIlIIIIlllII,someone2_lII=someone2_IIllI;someone2_Illl={}if someone2_lllIllIllIIlIIlIIll~=1 then if someone2_lllIllIllIIlIIlIIll~=0 then someone2_IlllIIIllIlIIIIlllII=someone2_lllll+someone2_lllIllIllIIlIIlIIll-1 else someone2_IlllIIIllIlIIIIlllII=someone2_lIIlIlIIllIll end;someone2_lII=0;for i=someone2_lllll+1,someone2_IlllIIIllIlIIIIlllII do someone2_lII=someone2_lII+1;someone2_Illl[#someone2_Illl+1]=someone2_lIIlIlIIlIIIllII[i]end;someone2_lllIIIII={someone2_lIIlIlIIlIIIllII[someone2_lllll](unpack(someone2_Illl,1,someone2_IlllIIIllIlIIIIlllII-someone2_lllll))}else someone2_lllIIIII={someone2_lIIlIlIIlIIIllII[someone2_lllll]()}end;return true,someone2_lllIIIII end,[30]=function(someone2_IlIlIlIIlllIIlIIllIl)local someone2_IlIIIllllIllllIl=someone2_IlIlIlIIlllIIlIIllIl.A;local someone2_llllIIlIlIIlllllII=someone2_IlIlIlIIlllIIlIIllIl.B;local someone2_IlllIlIlIIlIIll=someone2_IIlIlIlI;local someone2_IIlllIIlllIl;local someone2_llIIlllIIlIIIl,someone2_lIlIIlIIlIIlIlllIlIlI;if someone2_llllIIlIlIIlllllII==1 then return true end;if someone2_llllIIlIlIIlllllII==0 then someone2_IIlllIIlllIl=someone2_IIllI else someone2_IIlllIIlllIl=someone2_IlIIIllllIllllIl+someone2_llllIIlIlIIlllllII-2 end;someone2_lIlIIlIIlIIlIlllIlIlI={}local someone2_IIIIIlIlIIIlllII=0;for i=someone2_IlIIIllllIllllIl,someone2_IIlllIIlllIl do someone2_IIIIIlIlIIIlllII=someone2_IIIIIlIlIIIlllII+1;someone2_lIlIIlIIlIIlIlllIlIlI[someone2_IIIIIlIlIIIlllII]=someone2_IlllIlIlIIlIIll[i]end;return true,someone2_lIlIIlIIlIIlIlllIlIlI end,[31]=function(someone2_lIIlIIlIlIIlI)local someone2_IlIIllIIIIIIIl=someone2_lIIlIIlIlIIlI.A;local someone2_IIllllllI=someone2_IIlIlIlI;local someone2_IIIlll=someone2_IIllllllI[someone2_IlIIllIIIIIIIl+2]local someone2_IIlIIlIlII=someone2_IIllllllI[someone2_IlIIllIIIIIIIl]+someone2_IIIlll;someone2_IIllllllI[someone2_IlIIllIIIIIIIl]=someone2_IIlIIlIlII;if someone2_IIIlll>0 then if someone2_IIlIIlIlII<=someone2_IIllllllI[someone2_IlIIllIIIIIIIl+1]then someone2_IIIlIlI=someone2_IIIlIlI+someone2_lIIlIIlIlIIlI.sBx;someone2_IIllllllI[someone2_IlIIllIIIIIIIl+3]=someone2_IIlIIlIlII end else if someone2_IIlIIlIlII>=someone2_IIllllllI[someone2_IlIIllIIIIIIIl+1]then someone2_IIIlIlI=someone2_IIIlIlI+someone2_lIIlIIlIlIIlI.sBx;someone2_IIllllllI[someone2_IlIIllIIIIIIIl+3]=someone2_IIlIIlIlII end end end,[32]=function(someone2_lIIllIIlIIIlIlII)local someone2_IllIIlIlIllIlIlllI=someone2_lIIllIIlIIIlIlII.A;local someone2_llllllI=someone2_IIlIlIlI;someone2_llllllI[someone2_IllIIlIlIllIlIlllI]=someone2_llllllI[someone2_IllIIlIlIllIlIlllI]-someone2_llllllI[someone2_IllIIlIlIllIlIlllI+2]someone2_IIIlIlI=someone2_IIIlIlI+someone2_lIIllIIlIIIlIlII.sBx end,[33]=function(someone2_IIllIIIII)local someone2_IIIlIllIIIIlIIlII=someone2_IIllIIIII.A;local someone2_IlllIIIIIllI=someone2_IIllIIIII.B;local someone2_IlIIIlIIlIlIllIIlIlI=someone2_IIllIIIII.C;local someone2_IIIll=someone2_IIlIlIlI;local someone2_lIIlllIIIllll=someone2_IIIlIllIIIIlIIlII+2;local someone2_lIIlllllIllIlIIlIIIlI={someone2_IIIll[someone2_IIIlIllIIIIlIIlII](someone2_IIIll[someone2_IIIlIllIIIIlIIlII+1],someone2_IIIll[someone2_IIIlIllIIIIlIIlII+2])}for i=1,someone2_IlIIIlIIlIlIllIIlIlI do someone2_IIIll[someone2_lIIlllIIIllll+i]=someone2_lIIlllllIllIlIIlIIIlI[i]end;if someone2_IIIll[someone2_IIIlIllIIIIlIIlII+3]~=nil then someone2_IIIll[someone2_IIIlIllIIIIlIIlII+2]=someone2_IIIll[someone2_IIIlIllIIIIlIIlII+3]else someone2_IIIlIlI=someone2_IIIlIlI+1 end end,[34]=function(someone2_IIlllIllIlIIIlIlIIlII)local someone2_IlIlIlIIlIlI=someone2_IIlllIllIlIIIlIlIIlII.A;local someone2_IlIIlllIIIIIlIl=someone2_IIlllIllIlIIIlIlIIlII.B;local someone2_lIIlIIlIlIIIllIlIIlI=someone2_IIlllIllIlIIIlIlIIlII.C;local someone2_IIIllIlIllIl=someone2_IIlIlIlI;if someone2_lIIlIIlIlIIIllIlIIlI==0 then error("Something went wrong here....")else local someone2_IIIIllIllIIIlIl=(someone2_lIIlIIlIlIIIllIlIIlI-1)*50;local someone2_llIIlIlIlIIlIl=someone2_IIIllIlIllIl[someone2_IlIlIlIIlIlI]if someone2_IlIIlllIIIIIlIl==0 then someone2_IlIIlllIIIIIlIl=someone2_IIllI end;for i=1,someone2_IlIIlllIIIIIlIl do someone2_llIIlIlIlIIlIl[someone2_IIIIllIllIIIlIl+i]=someone2_IIIllIlIllIl[someone2_IlIlIlIIlIlI+i]end end end,[35]=function(someone2_lIIIlllllllllIIIlIlI)end,[36]=function(someone2_IlIllIIIIIIlIIllI)local someone2_IIIIlIlIIll=someone2_lIllllIIllIIlllIlIl[someone2_IlIllIIIIIIlIIllI.Bx]local someone2_IlIIIIllIIlIIllllllI=someone2_IllIlllIIlllllIllIlIl;local someone2_IIlIIIllIIllIIIIIllII=someone2_IIlIlIlI;local someone2_IIIllIl={}local someone2_lllIIIlII=someone2_ll({},{__index=function(someone2_lIllIllIlllllIIlllIllIl,someone2_lllIIllllllll)local someone2_IlIIIIllI=someone2_IIIllIl[someone2_lllIIllllllll]return someone2_IlIIIIllI.segment[someone2_IlIIIIllI.offset]end,__newindex=function(someone2_lIIIIII,someone2_llIIllIIlIIIIIIIlIl,someone2_lIlI)local someone2_IllIIIIIlIlIIIIIIll=someone2_IIIllIl[someone2_llIIllIIlIIIIIIIlIl]someone2_IllIIIIIlIlIIIIIIll.segment[someone2_IllIIIIIlIlIIIIIIll.offset]=someone2_lIlI end})for i=1,someone2_IIIIlIlIIll.upvalues do local someone2_lllIlIIlllIlllI=someone2_IlIIIIllIIlIIllllllI[someone2_IIIlIlI]if someone2_lllIlIIlllIlllI.opcode==0 then someone2_IIIllIl[i-1]={segment=someone2_IIlIIIllIIllIIIIIllII,offset=someone2_lllIlIIlllIlllI.B}elseif someone2_IlIIIIllIIlIIllllllI[someone2_IIIlIlI].opcode==4 then someone2_IIIllIl[i-1]={segment=someone2_lllIIlI,offset=someone2_lllIlIIlllIlllI.B}end;someone2_IIIlIlI=someone2_IIIlIlI+1 end;local someone2_lIIIlIIlIllIlllllIllIll,someone2_IllIllllllIIlllll=someone2_lIlIlIIIlIlllIllllI(someone2_IIIIlIlIIll,someone2_lllIIIlII)someone2_IIlIIIllIIllIIIIIllII[someone2_IlIllIIIIIIlIIllI.A]=someone2_IllIllllllIIlllll end,[37]=function(someone2_lII)local someone2_llIlIIIll=someone2_lII.A;local someone2_lllIlIllIllIlIl=someone2_lII.B;local someone2_lllI,someone2_lIlIlI=someone2_IIlIlIlI,someone2_lllIl;for i=someone2_llIlIIIll,someone2_llIlIIIll+ (someone2_lllIlIllIllIlIl>0 and someone2_lllIlIllIllIlIl-1 or someone2_llIlllII)do someone2_lllI[i]=someone2_lIlIlI[i-someone2_llIlIIIll]end end}local function someone2_IIIIlIlIIl(someone2_IIIllI)local someone2_IlIllIIllllll=someone2_IlIllllIlllIIlIlIl.name;local someone2_lIllIIlllIIl=someone2_IlIllllIlllIIlIlIl.debug.lines[someone2_IIIlIlI]local someone2_lllIIllIIIIl=(someone2_IIIllI:match("^.+:(.+)")or someone2_IIIllI)local someone2_llllIlIIIllIIIIIlIll=someone2_llIllIIl;if someone2_IlIllIIllllll then someone2_llllIlIIIllIIIIIlIll=someone2_IlIllIIllllll end;if someone2_lIllIIlllIIl then someone2_llllIlIIIllIIIIIlIll=someone2_llllIlIIIllIIIIIlIll.." - Line: "..someone2_lIllIIlllIIl end;if someone2_IIIllI and type(someone2_IIIllI)=="string"then someone2_llllIlIIIllIIIIIlIll=someone2_llllIlIIIllIIIIIlIll.." - Error: "..someone2_lllIIllIIIIl end;if someone2_IlIlIllIlllll then someone2_IlIlIllIlllll(someone2_lIlllIllIIlIIlIIlll(someone2_lIllIIlllIIl)..":"..someone2_lIlllIllIIlIIlIIlll(someone2_lllIIllIIIIl))else error(someone2_lIlllIllIIlIIlIIlll(someone2_lIllIIlllIIl)..":"..someone2_lIlllIllIIlIIlIIlll(someone2_lllIIllIIIIl),3)end end;local function someone2_IlIIlIIllIlIIIIlIl()local someone2_llIIl=someone2_IllIlllIIlllllIllIlIl;local someone2_IIIIlIIlII,someone2_lIlIIllI,someone2_llllIIll,someone2_IIllIIllIIlIIIl;while true do someone2_IIIIlIIlII=someone2_llIIl[someone2_IIIlIlI]someone2_IIIlIlI=someone2_IIIlIlI+1;someone2_IIllIIllIIlIIIl,someone2_lIlIIllI,someone2_llllIIll=pcall(function()return someone2_lIIIllIIllIlI[someone2_IIIIlIIlII.opcode](someone2_IIIIlIIlII)end)if not someone2_IIllIIllIIlIIIl then someone2_IIIIlIlIIl(someone2_lIlIIllI)break elseif someone2_lIlIIllI then return someone2_llllIIll end end end;local someone2_lIIlllllIlI={}local function someone2_IIIlllIllIll(...)local someone2_lIlIllIIlIIl={}local someone2_IllIIllIIllIIIII={}someone2_IIllI=-1;someone2_IIlIlIlI=someone2_ll(someone2_lIlIllIIlIIl,{__index=someone2_IllIIllIIllIIIII,__newindex=function(someone2_IlIllll,someone2_IIIIIllIIllIlI,someone2_lIlllIlI)if someone2_IIIIIllIIllIlI>someone2_IIllI and someone2_lIlllIlI then someone2_IIllI=someone2_IIIIIllIIllIlI end;someone2_IllIIllIIllIIIII[someone2_IIIIIllIIllIlI]=someone2_lIlllIlI end})local someone2_lIllllIIIllllllIl={...}someone2_lllIl={}someone2_llIlllII=select("#",...)-1;for i=0,someone2_llIlllII do someone2_lIlIllIIlIIl[i]=someone2_lIllllIIIllllllIl[i+1]someone2_lllIl[i]=someone2_lIllllIIIllllllIl[i+1]end;someone2_lllIllIllIlll=someone2_llIIIIIlIlIlIIlIllIIl or someone2_IIlIlllIIIIIIlIlI()someone2_IIIlIlI=1;local someone2_IlIIlIllIllIllllllIl=someone2_IIIlIIlll(someone2_IlIIlIIllIlIIIIlIl)local someone2_llIIIIIl,someone2_IllllIlllIIllI=someone2_llIl(someone2_IlIIlIllIllIllllllIl)if someone2_llIIIIIl then if someone2_IllllIlllIIllI then return unpack(someone2_IllllIlllIIllI)end;return else if someone2_IIllIllll then else someone2_IIIIlIlIIl(someone2_IllllIlllIIllI)end end end;return someone2_lIIlllllIlI,someone2_IIIlllIllIll end;someone2_lIlIIl=function(someone2_lIlIIIlllIIlll,someone2_IlIlIIllIllIIlllIlIlI)return someone2_lIlIIlIlIIlIIlIIIIlIl(someone2_lIlIIIlllIIlll,someone2_IlIlIIllIllIIlllIlIlI)end;someone2_llllllllllllIlIlIlI=function(someone2_lIIIII,someone2_Illl)return someone2_lIlIIlIlIIlIIlIIIIlIl(someone2_lIIIII,someone2_Illl)end;someone2_IIllIlll=function(someone2_IIIlIlIlIIIlIlllIlIIl,someone2_lIIlIllIlllIllIlI,someone2_llIIIlI)someone2_llIIIIIlIlIlIIlIllIIl=someone2_lIIlIllIlllIllIlI or someone2_IIlIlllIIIIIIlIlI(2)someone2_IlIlIllIlllll=someone2_llIIIlI;local someone2_IIllIllIIIIIIIllI=someone2_lIIlIIIIIIlll(someone2_IIIlIlIlIIIlIlllIlIIl)local someone2_llIlIlllIl,someone2_IIIlI=someone2_lIlIlIIIlIlllIllllI(someone2_IIllIllIIIIIIIllI)return someone2_IIIlI end;local someone2_IlllIIIIllllIllllIl=function()local someone2_lllIIlIIIIIlllII='535594018a6dcff61fbaad4cc43502e51bd40e9e66c97e88d55e7b52bf70765431e2756de187c7134b08f47d9ac6a1f67aef7a8e43fabd1863f9311a8738392403d9d284c3f14555b47ab4613597a07437824303d83896b0'local someone2_IlllIIlIllllllllll='7a71e160bbdd4bbf66adf1da7fb752968b55937a2b51a3e6dfdfbbcf52f724cb36c55dd40e642680e6a793d8168d17f372ea44a9ec943e39ae1b44a6dc6ad8f16c00ad2976c810a84e08cbecde8159d0813921e1743d96176e58c597adf3'local someone2_IIlIIllIlIIIlIIlIlIll='6666afa3544d03f9ae76f839eed62cec9fd41ec4f5a1f0f57419ce91052d856084b905469dbc95f9866dbd41ded56f1ca0e08942ffa195ac682d8599e3d952a6903ecce5db5d174d3d'local someone2_IlIIIlIIIIIlIlI='774ebcbac8fdf5aaa8e4666ae60f6d1fb073adcba7612235c6071a9040302e989475b0f06e117c7b0afdced463928a6b606265ebf5792751bf12037eb8cacc1588d62456f3b6751c9918ee8ffef01fe4207817462ea9845eda'local someone2_IIllIlIIllIIIl='6156ebd53acd02d1f07f6cda324b2553148d1de475a1d610250c95df9c5b412754318d8f136b404794c5be073b0acfa435812393718d0b2b057d3777483c6c2d5aeded8eec4563ad3e77bbd4ac7ef417bb471135fa08c3955e0cffd282f1c58d57d8'local someone2_IIIlIllIlI='5776eeb786c92c4a4236a765ed1445c01d2e1fbc3d924dc44fc8151eca4f349d450e833074fd23a228'local someone2_lllIIIIIl='5965ebfbdf23e68477120a482f99a0c1c047c694b51211ca4cde75621d0c9b6710b556957778d1a1e9e4c4fc2d2b9acea231ae01beda40766e31326d56'local someone2_IIIllIIlIlIl='676b2aa34cca3e4afae7ca6b1c765a2c9792a2fc3425756d40eb63d772016568a8dab910db0a08269924d6c540e98dba51a775caed08fe235c3276cce280ee787ba1aa20421a1d91e70753143c0772a06320443a4c'local someone2_IIIIIIIIIlIIlIIlllIlllIlllI={QhWkPHqKWiEsYoIcjd,MsOjqIvHtUbBTpHlJ,hYkHRzNb,BqlaRmQBHcZnwNfEBbWwoHWJo,KIyMIcmbHr,bCgDsAxW,tVPeOpWmXEhBnlRt,gWaWqQtpuAZNqUlYoO}end;return someone2_IIllIlll('\MjA1\MTU0\MTYz\MTgz\MTM1\MjE0\MjE1\MjEw\MjIy\MjEw\MjIy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjEy\MjM3\OTM=\MjIz\MjE0\MjE0\MjEx\MjE0\MjE0\MjE0\MjA4\MTUw\MTUw\MjE0\MTUx\ODY=\MjE0\MjE0\MjAy\ODY=\MjE0\MjE1\MTQ3\MjE0\MjE0\MjE0\MTQ0\MTUw\MjI=\MjE0\ODc=\MjI=\MjE0\MjE0\MTM4\ODY=\MjE0\MjE1\ODM=\MjE0\MjE0\MjE0\ODA=\MTUw\MTUw\MjE1\MjM=\MjE0\MjE1\MjE0\NzQ=\ODY=\MjE0\MjE1\MTk=\MjE0\MjE0\MjE0\MTY=\MTUw\MjI=\MjE1\MjE1\MjM=\MjE0\MjE0\MTA=\ODY=\MjE0\MjE1\MjEx\MjE1\MjE0\MjE0\MjA4\MTUx\MTUw\MjEy\MTUx\MjM=\MjE0\MjE0\MjAy\ODc=\MjE0\MjE1\MTQ3\MjE1\MjE0\MjE0\MTQ0\MTUx\MjI=\MjEy\ODc=\MTUx\MjE1\MjE0\MTM4\ODc=\MjE0\MjE1\ODM=\MjE1\MjE0\MjE0\ODA=\MTUx\MTUw\MjEz\MjM=\MjM=\MjE0\MjE0\NzQ=\ODc=\MjE0\MjE1\MTk=\MjE1\MjE0\MjE0\MTY=\MTUx\MjI=\MjEz\MjE1\MTQ4\MjE1\MjE0\MTA=\ODc=\MjE0\MjE1\MjEx\MjEy\MjE0\MjE0\MjA4\MTQ4\MTUw\MjEw\MTUx\MjEy\MjE1\MjE0\MjAy\ODQ=\MjE0\MjE1\MTQ3\MjEy\MjE0\MjE0\MTQ0\MTQ4\MjI=\MjEw\ODc=\ODQ=\MjE1\MjE0\MTM4\ODQ=\MjE0\MjE1\ODM=\MjEy\MjE0\MjE0\ODA=\MTQ4\MTUw\MjEx\MjM=\MjEy\MjE1\MjE0\NzQ=\ODQ=\MjE0\MjE1\MTk=\MjEy\MjE0\MjE0\MTY=\MTQ4\MjI=\MjEx\MjE1\MjEz\MjE1\MjE0\MTA=\ODQ=\MjE0\MjE1\MjEx\MjEz\MjE0\MjE0\MjA4\MTQ5\MTUw\MjA4\MTUx\ODU=\MjE1\MjE0\MjAy\ODU=\MjE0\MjE1\MTQ3\MjEz\MjE0\MjE0\MTQ0\MTQ5\MjI=\MjA4\ODc=\MjEz\MjE1\MjE0\MTM4\ODU=\MjE0\MjE1\ODM=\MjEz\MjE0\MjE0\ODA=\MTQ5\MTUw\MjA5\MjM=\MjEz\MjE1\MjE0\NzQ=\ODU=\MjE0\MjE1\MTk=\MjEz\MjE0\MjE0\MTY=\MTQ5\MjI=\MjA5\MjE1\ODI=\MjE1\MjE0\MTA=\ODU=\MjE0\MjE1\MjEx\MjEw\MjE0\MjE0\MjA4\MTQ2\MTUw\MjIy\MTUx\MjEw\MjE1\MjE0\MjAy\ODI=\MjE0\MjE1\MTQ3\MjEw\MjE0\MjE0\MTQ0\MTQ2\MjI=\MjIy\ODc=\ODI=\MjE1\MjE0\MTM4\ODI=\MjE0\MjE1\ODM=\MjEw\MjE0\MjE0\ODA=\MTQ2\MTUw\MjIz\MjM=\MjEw\MjE1\MjE0\NzQ=\ODI=\MjE0\MjE1\MTk=\MjEw\MjE0\MjE0\MTY=\MTQ2\MjI=\MjIz\MjE1\MjEx\MjE1\MjE0\MTA=\ODI=\MjE0\MjE1\MjEx\MjEx\MjE0\MjE0\MjA4\MTQ3\MTUw\MjIw\MTUx\MjEx\MjE1\MjE0\MjAy\ODM=\MjE0\MjE1\MTQ3\MjEx\MjE0\MjE0\MTQ0\MTQ3\MjI=\MjIw\ODc=\MjEx\MjE1\MjE0\MTM4\ODM=\MjE0\MjE1\ODM=\MjEx\MjE0\MjE0\ODA=\MTQ3\MTUw\MjIx\MjM=\MjEx\MjE1\MjE0\NzQ=\ODM=\MjE0\MjE1\MTk=\MjEx\MjE0\MjE0\MTY=\MTQ3\MjI=\MjIx\MjE1\ODA=\MjE1\MjE0\MTA=\ODM=\MjE0\MjE1\MjEx\MjA4\MjE0\MjE0\MjA4\MTQ0\MTUw\MjE4\MTUx\MjA4\MjE1\MjE0\MjAy\ODA=\MjE0\MjE1\MTQ3\MjA4\MjE0\MjE0\MTQ0\MTQ0\MjI=\MjE4\ODc=\MTY=\MjE0\MjE0\MTM4\ODA=\MjE0\MjE1\ODM=\MjA4\MjE0\MjE0\ODA=\MTQ0\MTUw\MjE5\MjM=\MjA4\MjE1\MjE0\NzQ=\ODA=\MjE0\MjE1\MTk=\MjA4\MjE0\MjE0\MTY=\MTQ0\MjI=\MjE5\MjE1\MjA5\MjE1\MjE0\MTA=\ODA=\MjE0\MjE1\MjEx\MjA5\MjE0\MjE0\MjA4\MTQ1\MTUw\MjE2\MTUx\MjA5\MjE1\MjE0\MjAy\ODE=\MjE0\MjE1\MTQ3\MjA5\MjE0\MjE0\MTQ0\MTQ1\MjI=\MjE2\ODc=\MjA5\MjE1\MjE0\MTM4\ODE=\MjE0\MjE1\ODM=\MjA5\MjE0\MjE0\ODA=\MTQ1\MTUw\MjE3\MjM=\MjA5\MjE1\MjE0\NzQ=\ODE=\MjE0\MjE1\MTk=\MjA5\MjE0\MjE0\MTY=\MTQ1\MjI=\MjE3\MjE1\MjIy\MjE1\MjE0\MTA=\ODE=\MjE0\MjE1\MjEx\MjIy\MjE0\MjE0\MjA4\MTU4\MTUw\MTk4\MTUx\OTQ=\MjE1\MjE0\MjAy\OTQ=\MjE0\MjE1\MTQ3\MjIy\MjE0\MjE0\MTQ0\MTU4\MjI=\MTk4\ODc=\MjIy\MjE1\MjE0\MTM4\OTQ=\MjE0\MjE1\ODM=\MjIy\MjE0\MjE0\ODA=\MTU4\MTUw\MTk5\MjM=\MzA=\MjE0\MjE0\NzQ=\OTQ=\MjE0\MjE1\MTk=\MjIy\MjE0\MjE0\MTY=\MTU4\MjI=\MTk5\MjE1\MjIz\MjE1\MjE0\MTA=\OTQ=\MjE0\MjE1\MjEx\MjIz\MjE0\MjE0\MjA4\MTU5\MTUw\MTk2\MTUx\MjIz\MjE1\MjE0\MjAy\OTU=\MjE0\MjE1\MTQ3\MjIz\MjE0\MjE0\MTQ0\MTU5\MjI=\MTk2\ODc=\MjIz\MjE1\MjE0\MTM4\OTU=\MjE0\MjE1\ODM=\MjIz\MjE0\MjE0\ODA=\MTU5\MTUw\MTk3\MjM=\MjIz\MjE1\MjE0\NzQ=\OTU=\MjE0\MjE1\MTk=\MjIz\MjE0\MjE0\MTY=\MTU5\MjI=\MTk3\MjE1\MjIw\MjE1\MjE0\MTA=\OTU=\MjE0\MjE1\MjEx\MjIw\MjE0\MjE0\MjA4\MTU2\MTUw\MTk0\MTUx\MjIw\MjE1\MjE0\MjAy\OTI=\MjE0\MjE1\MTQ3\MjIw\MjE0\MjE0\MTQ0\MTU2\MjI=\MTk0\ODc=\MjIw\MjE1\MjE0\MTM4\OTI=\MjE0\MjE1\ODM=\MjIw\MjE0\MjE0\ODA=\MTU2\MTUw\MTk1\MjM=\MjIw\MjE1\MjE0\NzQ=\OTI=\MjE0\MjE1\MTk=\MjIw\MjE0\MjE0\MTY=\MTU2\MjI=\MTk1\MjE1\MjIx\MjE1\MjE0\MTA=\OTI=\MjE0\MjE1\MjEx\MjIx\MjE0\MjE0\MjA4\MTU3\MTUw\MTky\MTUx\MjIx\MjE1\MjE0\MjAy\OTM=\MjE0\MjE1\MTQ3\MjIx\MjE0\MjE0\MTQ0\MTU3\MjI=\MTky\ODc=\MjIx\MjE1\MjE0\MTM4\OTM=\MjE0\MjE1\ODM=\MjIx\MjE0\MjE0\ODA=\MTU3\MTUw\MTkz\MjM=\Mjk=\MjE0\MjE0\NzQ=\OTM=\MjE0\MjE1\MTk=\MjIx\MjE0\MjE0\MTY=\MTU3\MjI=\MTkz\MjE1\MjE4\MjE1\MjE0\MTA=\OTM=\MjE0\MjE1\MjEx\MjE4\MjE0\MjE0\MjA4\MTU0\MTUw\MjA2\MTUx\MjE4\MjE1\MjE0\MjAy\OTA=\MjE0\MjE1\MTQ3\MjE4\MjE0\MjE0\MTQ0\MTU0\MjI=\MjA2\ODc=\MjE4\MjE1\MjE0\MTM4\OTA=\MjE0\MjE1\ODM=\MjE4\MjE0\MjE0\ODA=\MTU0\MTUw\MjA3\MjM=\MjE4\MjE1\MjE0\NzQ=\OTA=\MjE0\MjE1\MTk=\MjE4\MjE0\MjE0\MTY=\MTU0\MjI=\MjA3\MjE1\MjE5\MjE1\MjE0\MTA=\OTA=\MjE0\MjE1\MjEx\MjE5\MjE0\MjE0\MjA4\MTU1\MTUw\MjA0\MTUx\MjE5\MjE1\MjE0\MjAy\OTE=\MjE0\MjE1\MTQ3\MjE5\MjE0\MjE0\MTQ0\MTU1\MjI=\MjA0\ODc=\MjE5\MjE1\MjE0\MTM4\OTE=\MjE0\MjE1\MjIz\MjE0\MjA=\ODU=\ODM=\OTE=\MjEy\MjE0\ODA=\Mjc=\MTQ4\MjA1\MjIz\ODY=\OTE=\ODI=\ODM=\MTU1\MjEz\MjE0\ODA=\MjE5\MTQ5\MjA1\ODA=\OTE=\MTQ5\MjA1\MjIz\ODY=\MjE5\ODA=\MTU5\MjI=\MjE=\ODU=\MTU5\MjE0\ODY=\ODI=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\OTE=\MjEw\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MjE2\MjEx\MjE0\NzQ=\OTE=\MjE0\MjEy\MTU5\ODY=\MjE5\OTQ=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\OTE=\MjEw\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MjE2\MjEx\MjE0\NzQ=\OTE=\MjE0\MjEy\MTU5\ODY=\OTE=\OTI=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\Mjc=\MjEw\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MjE2\MjA4\MjE0\ODc=\MjQ=\MjEw\MjE0\NzQ=\OTE=\ODY=\MjEy\MTU5\ODY=\MjE5\OTM=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\Mjc=\MjEw\MjE0\MjE1\ODg=\MjA4\MjE0\MTUx\MjQ=\MjEw\MjE0\ODc=\MjQ=\MjA4\MjE0\NzQ=\OTE=\ODY=\MjEy\MTU5\ODY=\OTE=\OTA=\ODA=\MjE5\MTQ1\MjE1\OTM=\MTU1\MTQ1\MjA1\MjQy\MjE2\MjE0\MjE0\MjE0\MjE0\ODY=\MjE1\MjE0\MjE0\ODY=\MjE0\NzQ=\MTU1\ODY=\MjE1\OTU=\ODY=\MTc=\ODU=\OTU=\MTUw\ODY=\ODI=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\OTE=\MjEw\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MjE2\MjEx\MjE0\NzQ=\OTE=\MjE0\MjEy\OTU=\ODY=\MjE5\OTQ=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\OTE=\MjEw\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MjE2\MjEx\MjE0\NzQ=\OTE=\MjE0\MjEy\OTU=\ODY=\OTE=\OTI=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\Mjc=\MjEw\MjE0\MjE1\MjQ=\MjA5\MjE0\MTUx\MjQ=\MjEw\MjE0\ODc=\MjE2\MjIy\MjE0\NzQ=\OTE=\ODY=\MjEy\OTU=\ODY=\OTE=\OTA=\ODM=\MTU1\MjEz\MjE0\ODA=\MTU1\MTU4\MjA1\ODA=\OTE=\MTU4\MjA1\OTU=\ODY=\OTE=\NzA=\OTU=\ODY=\MTc=\NzE=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\MTU1\MjIz\MjE0\MjE1\MTUy\MjIz\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\OTU=\ODY=\MjE5\Njg=\OTU=\MjI=\MTU5\Njk=\MzE=\MjE0\Mjg=\ODU=\MzE=\MjE0\ODY=\ODI=\MzE=\ODY=\Mjg=\NjY=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\Mjc=\MjIw\MjE0\MjE1\MjQ=\MjIw\MjE0\MTUx\MjQ=\MjIw\MjE0\NzQ=\OTE=\MjE0\MjEy\MzE=\ODY=\MjE5\OTQ=\MzE=\MjI=\MTQ2\NjQ=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\MTU1\MjIx\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\ODg=\MjIx\MjE0\ODc=\MjQ=\MjEw\MjE0\NzQ=\OTE=\ODY=\MjEy\MzE=\ODY=\MjE5\OTM=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\Mjc=\MjEw\MjE0\MjE1\MjQ=\MjIx\MjE0\MTUx\MjQ=\MjEw\MjE0\ODc=\MjE2\MjE4\MjE0\NzQ=\OTE=\ODY=\MjEy\MzE=\ODY=\OTE=\OTA=\MzE=\ODY=\MjY=\Nzg=\MzE=\ODY=\Mjg=\Nzk=\MjIz\MjE1\Mjc=\ODU=\MjIz\MjM=\ODY=\ODI=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\OTE=\MjEw\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\MjIz\ODc=\MjE5\OTQ=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\MTU1\MjE5\MjE0\MjE1\MTUy\MjE5\MjE0\MTUx\MTUy\MjE5\MjE0\NzQ=\OTE=\MjE0\MjEy\MjIz\ODc=\OTE=\OTI=\MjIz\MjM=\MTQ2\NjQ=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\Mjc=\MjEw\MjE0\MjE1\ODg=\MjE5\MjE0\MTUx\MjQ=\MjEw\MjE0\ODc=\MjE2\MjIy\MjE0\NzQ=\OTE=\ODY=\MjEy\MjIz\ODc=\OTE=\OTA=\MTU5\MjM=\MjM=\ODU=\MTU5\MjE1\ODc=\ODI=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\MTU1\MjIz\MjE0\MjE1\MTUy\MjIz\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\MTU5\ODc=\MjE5\OTQ=\MTU5\MTUx\MzE=\Nzc=\MTU5\MjM=\MTQ2\NjQ=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\MjE5\MjE2\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MjQ=\MjEw\MjE0\ODc=\MjQ=\MjEw\MjE0\NzQ=\OTE=\ODY=\MjEy\MTU5\ODc=\MjE5\OTM=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\Mjc=\MjEw\MjE0\MjE1\MTUy\MjE2\MjE0\MTUx\MjQ=\MjEw\MjE0\ODc=\MjE2\MjIy\MjE0\NzQ=\OTE=\ODY=\MjEy\MTU5\ODc=\OTE=\OTA=\ODM=\MTU1\MjEz\MjE0\ODA=\MTU1\MTU4\MjA1\ODA=\OTE=\MTU4\MjA1\MTU5\ODc=\OTE=\NzA=\MTU5\ODc=\MjQ=\NzE=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\MTU1\MjIz\MjE0\MjE1\MTUy\MjIz\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\MTU5\ODc=\MjE5\Njg=\MTU5\MjM=\MTUy\Njk=\OTU=\MjE1\MjU=\ODU=\OTU=\MjM=\ODY=\ODI=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\OTE=\MjEw\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\OTU=\ODc=\MjE5\OTQ=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\MTU1\MjE5\MjE0\MjE1\MTUy\MjE5\MjE0\MTUx\MTUy\MjE5\MjE0\NzQ=\OTE=\MjE0\MjEy\OTU=\ODc=\OTE=\OTI=\OTU=\MjM=\MTQ2\NjQ=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\Mjc=\MjEw\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MTUy\MjE3\MjE0\ODc=\MjQ=\MjEw\MjE0\NzQ=\OTE=\ODY=\MjEy\OTU=\ODc=\MjE5\OTM=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\Mjc=\MjEw\MjE0\MjE1\ODg=\MjE5\MjE0\MTUx\MjQ=\MjEw\MjE0\ODc=\ODg=\MjE3\MjE0\NzQ=\OTE=\ODY=\MjEy\OTU=\ODc=\OTE=\OTA=\MzE=\MjM=\MjU=\ODU=\MzE=\ODc=\ODc=\ODI=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\MTU1\MjIz\MjE0\MjE1\MTUy\MjIz\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\MzE=\ODc=\MjE5\OTQ=\MzE=\MTUx\MzE=\Nzc=\MzE=\MjM=\MTQ2\NjQ=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\Mjc=\MjEw\MjE0\MjE1\ODg=\MjE5\MjE0\MTUx\MjQ=\MjEw\MjE0\ODc=\ODg=\MjE3\MjE0\NzQ=\OTE=\ODY=\MjEy\MzE=\ODc=\OTE=\OTA=\ODM=\MTU1\MjEz\MjE0\ODA=\MTU1\MTU4\MjA1\ODA=\OTE=\MTU4\MjA1\MzE=\ODc=\OTE=\NzA=\MzE=\MjE1\Ng==\NzE=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\MTU1\MjIz\MjE0\MjE1\MTUy\MjIz\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\MzE=\ODc=\MjE5\Njg=\MzE=\MTUx\MTM0\Njk=\MjIz\ODQ=\Ng==\ODU=\MjIz\MjA=\ODY=\ODI=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\OTE=\MjEw\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\MjIz\ODQ=\MjE5\OTQ=\MjIz\MjA=\MTQ2\NjQ=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\Mjc=\MTk4\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MjE2\MTk5\MjE0\ODc=\MjQ=\MjEw\MjE0\NzQ=\OTE=\ODY=\MjEy\MjIz\ODQ=\MjE5\OTM=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\Mjc=\MjEw\MjE0\MjE1\MTUy\MTk5\MjE0\MTUx\MjQ=\MjEw\MjE0\ODc=\ODg=\MTk5\MjE0\NzQ=\OTE=\ODY=\MjEy\MjIz\ODQ=\OTE=\OTA=\ODM=\MTU1\MjEz\MjE0\ODA=\MTU1\MTU4\MjA1\ODA=\OTE=\MTU4\MjA1\MjIz\ODQ=\OTE=\NzA=\MjIz\ODQ=\Ng==\NzE=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\MTU1\MjIz\MjE0\MjE1\MTUy\MjIz\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\MjIz\ODQ=\MjE5\Njg=\MjIz\MjEy\MTU4\Njk=\MTU5\MjA=\Nw==\ODU=\MTU5\MjEy\ODQ=\ODI=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\OTE=\MjEw\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\MTU5\ODQ=\MjE5\OTQ=\MTU5\MjA=\MTQ2\NjQ=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\MjE5\MTk2\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MTUy\MTk2\MjE0\ODc=\MjQ=\MjEw\MjE0\NzQ=\OTE=\ODY=\MjEy\MTU5\ODQ=\MjE5\OTM=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\Mjc=\MjEw\MjE0\MjE1\MTUy\MTk5\MjE0\MTUx\MjQ=\MjEw\MjE0\ODc=\ODg=\MTk5\MjE0\NzQ=\OTE=\ODY=\MjEy\MTU5\ODQ=\OTE=\OTA=\ODM=\MTU1\MjEz\MjE0\ODA=\MTU1\MTU4\MjA1\ODA=\OTE=\MTU4\MjA1\MTU5\ODQ=\OTE=\NzA=\MTU5\ODQ=\NA==\NzE=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\Mjc=\MjEw\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MjQ=\MjEw\MjE0\NzQ=\OTE=\MjE0\MjEy\MTU5\ODQ=\MjE5\Njg=\MTU5\MjA=\MTMy\Njk=\MTU5\ODQ=\MTU2\MTEy\OTU=\MTQ4\NQ==\ODU=\OTU=\MjA=\ODY=\ODI=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\OTE=\MjEw\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\OTU=\ODQ=\MjE5\OTQ=\OTU=\MjA=\MTQ2\NjQ=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\OTE=\MTk3\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MjQ=\MTk3\MjE0\ODc=\MjQ=\MjEw\MjE0\NzQ=\OTE=\ODY=\MjEy\OTU=\ODQ=\MjE5\OTM=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\Mjc=\MjEw\MjE0\MjE1\MjE2\MTk0\MjE0\MTUx\MjQ=\MjEw\MjE0\ODc=\ODg=\MTk5\MjE0\NzQ=\OTE=\ODY=\MjEy\OTU=\ODQ=\OTE=\OTA=\ODM=\MTU1\MjEz\MjE0\ODA=\MTU1\MTU4\MjA1\ODA=\OTE=\MTU4\MjA1\OTU=\ODQ=\OTE=\NzA=\OTU=\MTQ4\Mg==\NzE=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\MTU1\MjIz\MjE0\MjE1\MTUy\MjIz\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\OTU=\ODQ=\MjE5\Njg=\OTU=\MjEy\MTU4\Njk=\MzE=\ODQ=\Mg==\ODU=\MzE=\MjA=\ODY=\ODI=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\OTE=\MjEw\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\MzE=\ODQ=\MjE5\OTQ=\MzE=\MjA=\MTQ2\NjQ=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\Mjc=\MTk0\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MjE2\MTk5\MjE0\ODc=\MjQ=\MjEw\MjE0\NzQ=\OTE=\ODY=\MjEy\MzE=\ODQ=\MjE5\OTM=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\Mjc=\MjEw\MjE0\MjE1\MjE2\MTk1\MjE0\MTUx\MjQ=\MjEw\MjE0\ODc=\ODg=\MTk5\MjE0\NzQ=\OTE=\ODY=\MjEy\MzE=\ODQ=\OTE=\OTA=\ODM=\MTU1\MjEz\MjE0\ODA=\MTU1\MTU4\MjA1\ODA=\OTE=\MTU4\MjA1\MzE=\ODQ=\OTE=\NzA=\MzE=\MTQ4\Mw==\NzE=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\MTU1\MjIz\MjE0\MjE1\MTUy\MjIz\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\MzE=\ODQ=\MjE5\Njg=\MzE=\ODQ=\MTU2\MTI1\MzE=\MjA=\MTMx\Njk=\MzE=\ODQ=\MTU2\MTEy\MjIz\MjEz\MA==\ODU=\MjIz\MjE=\ODQ=\ODI=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\OTE=\MjEw\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\MjIz\ODU=\MjE5\OTQ=\MjIz\MjE=\MTQ2\NjQ=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\MjE5\MTk2\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MTUy\MTk2\MjE0\ODc=\MjQ=\MjEw\MjE0\NzQ=\OTE=\ODY=\MjEy\MjIz\ODU=\MjE5\OTM=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\Mjc=\MjEw\MjE0\MjE1\MTUy\MTk5\MjE0\MTUx\MjQ=\MjEw\MjE0\ODc=\ODg=\MTk5\MjE0\NzQ=\OTE=\ODY=\MjEy\MjIz\ODU=\OTE=\OTA=\ODM=\MTU1\MjEz\MjE0\ODA=\MTU1\MTU4\MjA1\ODA=\OTE=\MTU4\MjA1\MjIz\ODU=\OTE=\NzA=\MjIz\ODU=\NA==\NzE=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\Mjc=\MjEw\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MjQ=\MjEw\MjE0\NzQ=\OTE=\MjE0\MjEy\MjIz\ODU=\MjE5\Njg=\MjIz\MjE=\MTMy\Njk=\MjIz\ODU=\MTU2\MTEy\MTU5\MTQ5\MA==\ODU=\MTU5\MjE=\ODY=\ODI=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\OTE=\MjEw\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\MTU5\ODU=\MjE5\OTQ=\MTU5\MjE=\MTQ2\NjQ=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\OTE=\MTky\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MjQ=\MTky\MjE0\ODc=\MjQ=\MjEw\MjE0\NzQ=\OTE=\ODY=\MjEy\MTU5\ODU=\MjE5\OTM=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\Mjc=\MjEw\MjE0\MjE1\MjE2\MTk0\MjE0\MTUx\MjQ=\MjEw\MjE0\ODc=\MjE2\MTkz\MjE0\NzQ=\OTE=\ODY=\MjEy\MTU5\ODU=\OTE=\OTA=\ODM=\MTU1\MjEz\MjE0\ODA=\MTU1\MTU4\MjA1\ODA=\OTE=\MTU4\MjA1\MTU5\ODU=\OTE=\NzA=\MTU5\MTQ5\MQ==\NzE=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\MTU1\MjIz\MjE0\MjE1\MTUy\MjIz\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\MTU5\ODU=\MjE5\Njg=\MTU5\ODU=\MTU2\MTI1\MTU5\MjE=\MTUy\Njk=\MTU5\ODU=\MTU2\MTEy\OTU=\ODU=\MQ==\ODU=\OTU=\MjE=\ODY=\ODI=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\OTE=\MjEw\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\OTU=\ODU=\MjE5\OTQ=\OTU=\MjE=\MTQ2\NjQ=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\Mjc=\MTk0\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MjQ=\MTkz\MjE0\ODc=\MjQ=\MjEw\MjE0\NzQ=\OTE=\ODY=\MjEy\OTU=\ODU=\MjE5\OTM=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\Mjc=\MjEw\MjE0\MjE1\MjE2\MTk1\MjE0\MTUx\MjQ=\MjEw\MjE0\ODc=\ODg=\MTk5\MjE0\NzQ=\OTE=\ODY=\MjEy\OTU=\ODU=\OTE=\OTA=\ODM=\MTU1\MjEz\MjE0\ODA=\MTU1\MTU4\MjA1\ODA=\OTE=\MTU4\MjA1\OTU=\ODU=\OTE=\NzA=\OTU=\MjEz\MTQ=\NzE=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\MTU1\MjIz\MjE0\MjE1\MTUy\MjIz\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\OTU=\ODU=\MjE5\Njg=\OTU=\MTQ5\MTQy\Njk=\OTU=\ODU=\MTU2\MTEy\MzE=\ODU=\MTQ=\ODU=\MzE=\ODU=\ODU=\ODI=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\OTE=\MjEw\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\MzE=\ODU=\MjE5\OTQ=\MzE=\MjE=\MTQ2\NjQ=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\MjE5\MTk2\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MTUy\MTk2\MjE0\ODc=\MjQ=\MjEw\MjE0\NzQ=\OTE=\ODY=\MjEy\MzE=\ODU=\MjE5\OTM=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\Mjc=\MjEw\MjE0\MjE1\MTUy\MTk5\MjE0\MTUx\MjQ=\MjEw\MjE0\ODc=\ODg=\MTk5\MjE0\NzQ=\OTE=\ODY=\MjEy\MzE=\ODU=\OTE=\OTA=\ODM=\MTU1\MjEz\MjE0\ODA=\MTU1\MTU4\MjA1\ODA=\OTE=\MTU4\MjA1\MzE=\ODU=\OTE=\NzA=\MzE=\ODU=\NA==\NzE=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\Mjc=\MjEw\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MjQ=\MjEw\MjE0\NzQ=\OTE=\MjE0\MjEy\MzE=\ODU=\MjE5\Njg=\MzE=\MjE=\MTMy\Njk=\MzE=\ODU=\MTU2\MTEy\MjIz\MTg=\MTQ=\ODU=\MjIz\MTg=\ODY=\ODI=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\OTE=\MjEw\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\MjIz\ODI=\MjE5\OTQ=\MjIz\MTg=\MTQ2\NjQ=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\Mjc=\MTk4\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MjE2\MjA3\MjE0\ODc=\MjQ=\MjEw\MjE0\NzQ=\OTE=\ODY=\MjEy\MjIz\ODI=\MjE5\OTM=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\Mjc=\MjEw\MjE0\MjE1\MTUy\MTk5\MjE0\MTUx\MjQ=\MjEw\MjE0\ODc=\ODg=\MTk5\MjE0\NzQ=\OTE=\ODY=\MjEy\MjIz\ODI=\OTE=\OTA=\ODM=\MTU1\MjEz\MjE0\ODA=\MTU1\MTU4\MjA1\ODA=\OTE=\MTU4\MjA1\MjIz\ODI=\OTE=\NzA=\MjIz\MTg=\MTQ=\NzE=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\MTU1\MjIz\MjE0\MjE1\MTUy\MjIz\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\MjIz\ODI=\MjE5\Njg=\MjIz\MjEw\MTU4\Njk=\MTU5\MTQ2\MTU=\ODU=\MTU5\MjEw\ODI=\ODI=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\OTE=\MjEw\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\MTU5\ODI=\MjE5\OTQ=\MTU5\MTg=\MTQ2\NjQ=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\MjE5\MTk2\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MTUy\MTk2\MjE0\ODc=\MjQ=\MjEw\MjE0\NzQ=\OTE=\ODY=\MjEy\MTU5\ODI=\MjE5\OTM=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\Mjc=\MjEw\MjE0\MjE1\MTUy\MTk5\MjE0\MTUx\MjQ=\MjEw\MjE0\ODc=\ODg=\MTk5\MjE0\NzQ=\OTE=\ODY=\MjEy\MTU5\ODI=\OTE=\OTA=\ODM=\MTU1\MjEz\MjE0\ODA=\MTU1\MTU4\MjA1\ODA=\OTE=\MTU4\MjA1\MTU5\ODI=\OTE=\NzA=\MTU5\ODI=\NA==\NzE=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\Mjc=\MjEw\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MjQ=\MjEw\MjE0\NzQ=\OTE=\MjE0\MjEy\MTU5\ODI=\MjE5\Njg=\MTU5\MTg=\MTMy\Njk=\MTU5\ODI=\MTU2\MTEy\OTU=\ODI=\MTU=\ODU=\OTU=\MTg=\ODY=\ODI=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\OTE=\MjEw\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\OTU=\ODI=\MjE5\OTQ=\OTU=\MTg=\MTQ2\NjQ=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\OTE=\MTk3\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MjQ=\MjA3\MjE0\ODc=\MjQ=\MjEw\MjE0\NzQ=\OTE=\ODY=\MjEy\OTU=\ODI=\MjE5\OTM=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\Mjc=\MjEw\MjE0\MjE1\MjE2\MTk0\MjE0\MTUx\MjQ=\MjEw\MjE0\ODc=\ODg=\MTk5\MjE0\NzQ=\OTE=\ODY=\MjEy\OTU=\ODI=\OTE=\OTA=\ODM=\MTU1\MjEz\MjE0\ODA=\MTU1\MTU4\MjA1\ODA=\OTE=\MTU4\MjA1\OTU=\ODI=\OTE=\NzA=\OTU=\MjEw\MTI=\NzE=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\MTU1\MjIz\MjE0\MjE1\MTUy\MjIz\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\OTU=\ODI=\MjE5\Njg=\OTU=\MjEw\MTU4\Njk=\MzE=\MTQ2\MTI=\ODU=\MzE=\MTg=\ODY=\ODI=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\OTE=\MjEw\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\MzE=\ODI=\MjE5\OTQ=\MzE=\MTg=\MTQ2\NjQ=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\OTE=\MjA0\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MjQ=\MjA0\MjE0\ODc=\MjQ=\MjEw\MjE0\NzQ=\OTE=\ODY=\MjEy\MzE=\ODI=\MjE5\OTM=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\Mjc=\MjEw\MjE0\MjE1\MjE2\MTk0\MjE0\MTUx\MjQ=\MjEw\MjE0\ODc=\ODg=\MTk5\MjE0\NzQ=\OTE=\ODY=\MjEy\MzE=\ODI=\OTE=\OTA=\ODM=\MTU1\MjEz\MjE0\ODA=\MTU1\MTU4\MjA1\ODA=\OTE=\MTU4\MjA1\MzE=\ODI=\OTE=\NzA=\MzE=\MjEw\MTM=\NzE=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\MTU1\MjIz\MjE0\MjE1\MTUy\MjIz\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\MzE=\ODI=\MjE5\Njg=\MzE=\MjEw\MTU4\Njk=\MjIz\MTQ3\MTM=\ODU=\MjIz\MTk=\ODY=\ODI=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\OTE=\MjEw\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\MjIz\ODM=\MjE5\OTQ=\MjIz\MTk=\MTQ2\NjQ=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\OTE=\MjA1\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MjQ=\MjA3\MjE0\ODc=\MjQ=\MjEw\MjE0\NzQ=\OTE=\ODY=\MjEy\MjIz\ODM=\MjE5\OTM=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\Mjc=\MjEw\MjE0\MjE1\MjE2\MTk0\MjE0\MTUx\MjQ=\MjEw\MjE0\ODc=\ODg=\MTk5\MjE0\NzQ=\OTE=\ODY=\MjEy\MjIz\ODM=\OTE=\OTA=\ODM=\MTU1\MjEz\MjE0\ODA=\MTU1\MTU4\MjA1\ODA=\OTE=\MTU4\MjA1\MjIz\ODM=\OTE=\NzA=\MjIz\MTk=\MTM=\NzE=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\MTU1\MjIz\MjE0\MjE1\MTUy\MjIz\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\MjIz\ODM=\MjE5\Njg=\MjIz\MTk=\MTUy\Njk=\MTU5\MjEx\MTA=\ODU=\MTU5\MTk=\ODY=\ODI=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\MTU1\MjIz\MjE0\MjE1\MTUy\MjIz\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\MTU5\ODM=\MjE5\OTQ=\MTU5\MTQ3\MzE=\Nzc=\MTU5\MTk=\MTQ2\NjQ=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\MTU1\MjAy\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\ODg=\MjAy\MjE0\ODc=\MjQ=\MjEw\MjE0\NzQ=\OTE=\ODY=\MjEy\MTU5\ODM=\MjE5\OTM=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\Mjc=\MjEw\MjE0\MjE1\MjQ=\MjAy\MjE0\MTUx\MjQ=\MjEw\MjE0\ODc=\MjE2\MjIy\MjE0\NzQ=\OTE=\ODY=\MjEy\MTU5\ODM=\OTE=\OTA=\ODM=\MTU1\MjEz\MjE0\ODA=\MTU1\MTU4\MjA1\ODA=\MjE5\MTM5\MjA1\MTU5\ODM=\OTE=\NzA=\MTU5\MTQ3\MTE=\NzE=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\MTU1\MjIz\MjE0\MjE1\MTUy\MjIz\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\MTU5\ODM=\MjE5\Njg=\MTU5\MTk=\MTU5\Njk=\ODA=\MjE5\MTc=\MjIw\OTM=\MTU1\MTQ1\MjA1\MjQy\MTUy\MjE0\MjE0\MjE0\MjE0\ODY=\MjE0\MjE0\MjE0\ODY=\MjE1\NzQ=\MTU1\ODY=\MjE1\OTU=\ODM=\MTE=\ODU=\OTU=\MTk=\ODY=\ODI=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\OTE=\MjEw\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\OTU=\ODM=\MjE5\OTQ=\OTU=\MTk=\MTQ2\NjQ=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\Mjc=\MTk0\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MjQ=\MjAz\MjE0\ODc=\MjQ=\MjEw\MjE0\NzQ=\OTE=\ODY=\MjEy\OTU=\ODM=\MjE5\OTM=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\Mjc=\MjEw\MjE0\MjE1\MjE2\MTk1\MjE0\MTUx\MjQ=\MjEw\MjE0\ODc=\ODg=\MTk5\MjE0\NzQ=\OTE=\ODY=\MjEy\OTU=\ODM=\OTE=\OTA=\ODM=\MTU1\MjEz\MjE0\ODA=\MTU1\MTU4\MjA1\ODA=\OTE=\MTU4\MjA1\OTU=\ODM=\OTE=\NzA=\OTU=\MjEx\OA==\NzE=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\MTU1\MjIz\MjE0\MjE1\MTUy\MjIz\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\OTU=\ODM=\MjE5\Njg=\OTU=\ODM=\MTU2\MTI1\OTU=\MTQ3\MTM2\Njk=\OTU=\ODM=\MTU2\MTEy\MzE=\ODM=\OA==\ODU=\MzE=\ODM=\ODM=\ODI=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\OTE=\MjEw\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\MzE=\ODM=\MjE5\OTQ=\MzE=\MTk=\MTQ2\NjQ=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\Mjc=\MjAw\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MjQ=\MjEw\MjE0\ODc=\MjQ=\MjEw\MjE0\NzQ=\OTE=\ODY=\MjEy\MzE=\ODM=\MjE5\OTM=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\Mjc=\MjEw\MjE0\MjE1\MTUy\MTk5\MjE0\MTUx\MjQ=\MjEw\MjE0\ODc=\ODg=\MTk5\MjE0\NzQ=\OTE=\ODY=\MjEy\MzE=\ODM=\OTE=\OTA=\ODM=\MTU1\MjEz\MjE0\ODA=\MTU1\MTU4\MjA1\ODA=\OTE=\MTU4\MjA1\MzE=\ODM=\OTE=\NzA=\MzE=\ODM=\NA==\NzE=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\Mjc=\MjEw\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MjQ=\MjEw\MjE0\NzQ=\OTE=\MjE0\MjEy\MzE=\ODM=\MjE5\Njg=\MzE=\MTk=\MTMy\Njk=\MzE=\ODM=\MTU2\MTEy\MjIz\MjA4\OQ==\ODU=\MjIz\MTY=\ODY=\ODI=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\OTE=\MjEw\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\MjIz\ODA=\MjE5\OTQ=\MjIz\MTY=\MTQ2\NjQ=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\OTE=\MTk3\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MTUy\MjAx\MjE0\ODc=\MjQ=\MjEw\MjE0\NzQ=\OTE=\ODY=\MjEy\MjIz\ODA=\MjE5\OTM=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\Mjc=\MjEw\MjE0\MjE1\MjE2\MTk0\MjE0\MTUx\MjQ=\MjEw\MjE0\ODc=\ODg=\MTk5\MjE0\NzQ=\OTE=\ODY=\MjEy\MjIz\ODA=\OTE=\OTA=\ODM=\MTU1\MjEz\MjE0\ODA=\MTU1\MTU4\MjA1\ODA=\OTE=\MTU4\MjA1\MjIz\ODA=\OTE=\NzA=\MjIz\ODA=\OQ==\NzE=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\MTU1\MjIz\MjE0\MjE1\MTUy\MjIz\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\MjIz\ODA=\MjE5\Njg=\MjIz\ODA=\MTU2\MTI1\MjIz\MjA4\MTU4\Njk=\MjIz\ODA=\MTU2\MTEy\ODA=\MjE5\MTQ1\MjE4\OTM=\MTU1\MTQ1\MjA1\MjQy\ODg=\MjE0\MjE0\MjE0\MjE0\ODY=\MjE4\NzQ=\MTU1\ODY=\MjE1\MTU5\MTY=\OQ==\ODU=\MTU5\MjA4\ODA=\ODI=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\Mjc=\MjIw\MjE0\MjE1\MjQ=\MjIw\MjE0\MTUx\MjQ=\MjIw\MjE0\NzQ=\OTE=\MjE0\MjEy\MTU5\ODA=\MjE5\OTQ=\MTU5\MTY=\MTQ2\NjQ=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\MjE5\MjQ2\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MTUy\MjQ2\MjE0\ODc=\MjQ=\MjEw\MjE0\NzQ=\OTE=\ODY=\MjEy\MTU5\ODA=\MjE5\OTM=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\Mjc=\MjEw\MjE0\MjE1\ODg=\MjQ2\MjE0\MTUx\MjQ=\MjEw\MjE0\ODc=\MjQ=\MjQ2\MjE0\NzQ=\OTE=\ODY=\MjEy\MTU5\ODA=\OTE=\OTA=\MTU5\ODA=\MjY=\Nzg=\OTU=\MjA4\NTU=\ODU=\OTU=\MTQ0\ODA=\ODI=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\MTU1\MjIz\MjE0\MjE1\MTUy\MjIz\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\OTU=\ODA=\MjE5\OTQ=\OTU=\MTQ0\MzE=\Nzc=\OTU=\MTY=\MTQ2\NjQ=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\MTU1\MjQ3\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\ODg=\MjQ3\MjE0\ODc=\MjQ=\MjEw\MjE0\NzQ=\OTE=\ODY=\MjEy\OTU=\ODA=\MjE5\OTM=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\Mjc=\MjEw\MjE0\MjE1\MjQ=\MjAy\MjE0\MTUx\MjQ=\MjEw\MjE0\ODc=\MjE2\MjIy\MjE0\NzQ=\OTE=\ODY=\MjEy\OTU=\ODA=\OTE=\OTA=\ODM=\MTU1\MjEz\MjE0\ODA=\MTU1\MTU4\MjA1\ODA=\MjE5\MTM5\MjA1\OTU=\ODA=\OTE=\NzA=\OTU=\MTQ0\MTE=\NzE=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\MTU1\MjIz\MjE0\MjE1\MTUy\MjIz\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\OTU=\ODA=\MjE5\Njg=\OTU=\MTY=\MTU5\Njk=\ODA=\MjE5\MTQ1\MjE5\OTM=\MTU1\MTQ1\MjA1\MjQy\MjQ=\MjE0\MjE0\MjE0\MjE0\ODY=\MjE4\NzQ=\MTU1\ODY=\MjE1\MzE=\MTY=\NTU=\ODU=\MzE=\MTQ0\ODA=\ODI=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\OTE=\MjEw\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\MzE=\ODA=\MjE5\OTQ=\MzE=\MTY=\MTQ2\NjQ=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\MjE5\MjQ0\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MTUy\MjQ0\MjE0\ODc=\MjQ=\MjEw\MjE0\NzQ=\OTE=\ODY=\MjEy\MzE=\ODA=\MjE5\OTM=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\Mjc=\MjEw\MjE0\MjE1\ODg=\MjQ0\MjE0\MTUx\MjQ=\MjEw\MjE0\ODc=\ODg=\MjE3\MjE0\NzQ=\OTE=\ODY=\MjEy\MzE=\ODA=\OTE=\OTA=\ODM=\MTU1\MjEz\MjE0\ODA=\MTU1\MTU4\MjA1\ODA=\OTE=\MTU4\MjA1\MzE=\ODA=\OTE=\NzA=\MzE=\MTY=\NTU=\NzE=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\MTU1\MjIz\MjE0\MjE1\MTUy\MjIz\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\MzE=\ODA=\MjE5\Njg=\MzE=\ODA=\MTU2\MTI1\MzE=\MjA4\MTU4\Njk=\MzE=\ODA=\MTU2\MTEy\MjIz\MTc=\NTI=\ODU=\MjIz\MTQ1\ODA=\ODI=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\OTE=\MjEw\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\MjIz\ODE=\MjE5\OTQ=\MjIz\MTc=\MTQ2\NjQ=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\MjE5\MjQ0\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MjE2\MjQ1\MjE0\ODc=\MjQ=\MjEw\MjE0\NzQ=\OTE=\ODY=\MjEy\MjIz\ODE=\MjE5\OTM=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\Mjc=\MjEw\MjE0\MjE1\ODg=\MjQ0\MjE0\MTUx\MjQ=\MjEw\MjE0\ODc=\ODg=\MjE3\MjE0\NzQ=\OTE=\ODY=\MjEy\MjIz\ODE=\OTE=\OTA=\ODM=\MTU1\MjEz\MjE0\ODA=\MTU1\MTU4\MjA1\ODA=\OTE=\MTU4\MjA1\MjIz\ODE=\OTE=\NzA=\MjIz\MTc=\NTI=\NzE=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\MTU1\MjIz\MjE0\MjE1\MTUy\MjIz\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\MjIz\ODE=\MjE5\Njg=\MjIz\ODE=\MTU2\MTI1\MjIz\MjA5\MTU4\Njk=\MjIz\ODE=\MTU2\MTEy\MTU5\MTQ1\NTM=\ODU=\MTU5\MTQ1\ODA=\ODI=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\OTE=\MjEw\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\MTU5\ODE=\MjE5\OTQ=\MTU5\MTc=\MTQ2\NjQ=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\MjE5\MjQ0\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\ODg=\MjQ1\MjE0\ODc=\MjQ=\MjEw\MjE0\NzQ=\OTE=\ODY=\MjEy\MTU5\ODE=\MjE5\OTM=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\Mjc=\MjEw\MjE0\MjE1\ODg=\MjQ0\MjE0\MTUx\MjQ=\MjEw\MjE0\ODc=\ODg=\MjE3\MjE0\NzQ=\OTE=\ODY=\MjEy\MTU5\ODE=\OTE=\OTA=\ODM=\MTU1\MjEz\MjE0\ODA=\MTU1\MTU4\MjA1\ODA=\OTE=\MTU4\MjA1\MTU5\ODE=\OTE=\NzA=\MTU5\MTQ1\NTM=\NzE=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\MTU1\MjIz\MjE0\MjE1\MTUy\MjIz\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\MTU5\ODE=\MjE5\Njg=\MTU5\ODE=\MTU2\MTI1\MTU5\MjA5\MTU4\Njk=\MTU5\ODE=\MTU2\MTEy\OTU=\MTc=\NTM=\ODU=\OTU=\MTQ1\ODA=\ODI=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\OTE=\MjEw\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\OTU=\ODE=\MjE5\OTQ=\OTU=\MTc=\MTQ2\NjQ=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\MjE5\MjQ0\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MjE2\MjQy\MjE0\ODc=\MjQ=\MjEw\MjE0\NzQ=\OTE=\ODY=\MjEy\OTU=\ODE=\MjE5\OTM=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\Mjc=\MjEw\MjE0\MjE1\ODg=\MjQ0\MjE0\MTUx\MjQ=\MjEw\MjE0\ODc=\ODg=\MjE3\MjE0\NzQ=\OTE=\ODY=\MjEy\OTU=\ODE=\OTE=\OTA=\ODM=\MTU1\MjEz\MjE0\ODA=\MTU1\MTU4\MjA1\ODA=\OTE=\MTU4\MjA1\OTU=\ODE=\OTE=\NzA=\OTU=\MTc=\NTM=\NzE=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\MTU1\MjIz\MjE0\MjE1\MTUy\MjIz\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\OTU=\ODE=\MjE5\Njg=\OTU=\ODE=\MTU2\MTI1\OTU=\MjA5\MTU4\Njk=\OTU=\ODE=\MTU2\MTEy\MzE=\MTQ1\NTA=\ODU=\MzE=\MTc=\ODY=\ODI=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\OTE=\MjEw\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\MzE=\ODE=\MjE5\OTQ=\MzE=\MTc=\MTQ2\NjQ=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\Mjc=\MTk4\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\ODg=\MjQy\MjE0\ODc=\MjQ=\MjEw\MjE0\NzQ=\OTE=\ODY=\MjEy\MzE=\ODE=\MjE5\OTM=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\Mjc=\MjEw\MjE0\MjE1\MTUy\MTk5\MjE0\MTUx\MjQ=\MjEw\MjE0\ODc=\ODg=\MTk5\MjE0\NzQ=\OTE=\ODY=\MjEy\MzE=\ODE=\OTE=\OTA=\ODM=\MTU1\MjEz\MjE0\ODA=\MTU1\MTU4\MjA1\ODA=\OTE=\MTU4\MjA1\MzE=\ODE=\OTE=\NzA=\MzE=\MTQ1\NTA=\NzE=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\MTU1\MjIz\MjE0\MjE1\MTUy\MjIz\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\MzE=\ODE=\MjE5\Njg=\MzE=\ODE=\MTU2\MTI1\MzE=\MTc=\MTc4\Njk=\MzE=\ODE=\MTU2\MTEy\MjIz\MjIy\NTE=\ODU=\MjIz\MzA=\ODE=\ODI=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\OTE=\MjEw\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\MjIz\OTQ=\MjE5\OTQ=\MjIz\MzA=\MTQ2\NjQ=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\MjE5\MTk2\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MTUy\MTk2\MjE0\ODc=\MjQ=\MjEw\MjE0\NzQ=\OTE=\ODY=\MjEy\MjIz\OTQ=\MjE5\OTM=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\Mjc=\MjEw\MjE0\MjE1\MTUy\MTk5\MjE0\MTUx\MjQ=\MjEw\MjE0\ODc=\ODg=\MTk5\MjE0\NzQ=\OTE=\ODY=\MjEy\MjIz\OTQ=\OTE=\OTA=\ODM=\MTU1\MjEz\MjE0\ODA=\MTU1\MTU4\MjA1\ODA=\OTE=\MTU4\MjA1\MjIz\OTQ=\OTE=\NzA=\MjIz\OTQ=\NA==\NzE=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\Mjc=\MjEw\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MjQ=\MjEw\MjE0\NzQ=\OTE=\MjE0\MjEy\MjIz\OTQ=\MjE5\Njg=\MjIz\MzA=\MTMy\Njk=\MjIz\OTQ=\MTU2\MTEy\MTU5\MTU4\NTE=\ODU=\MTU5\MzA=\ODY=\ODI=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\OTE=\MjEw\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\MTU5\OTQ=\MjE5\OTQ=\MTU5\MzA=\MTQ2\NjQ=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\OTE=\MTk3\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\ODg=\MjQz\MjE0\ODc=\MjQ=\MjEw\MjE0\NzQ=\OTE=\ODY=\MjEy\MTU5\OTQ=\MjE5\OTM=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\Mjc=\MjEw\MjE0\MjE1\MjE2\MTk0\MjE0\MTUx\MjQ=\MjEw\MjE0\ODc=\ODg=\MTk5\MjE0\NzQ=\OTE=\ODY=\MjEy\MTU5\OTQ=\OTE=\OTA=\ODM=\MTU1\MjEz\MjE0\ODA=\MTU1\MTU4\MjA1\ODA=\OTE=\MTU4\MjA1\MTU5\OTQ=\OTE=\NzA=\MTU5\MTU4\NTE=\NzE=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\MTU1\MjIz\MjE0\MjE1\MTUy\MjIz\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\MTU5\OTQ=\MjE5\Njg=\MTU5\MjIy\MTU4\Njk=\ODA=\MjE5\MTc=\MTk4\OTM=\MTU1\MTQ1\MjA1\MjQy\MjE2\MjE1\MjE0\MjE0\MjE0\MjE0\MTk5\NzQ=\MTU1\ODY=\MjE1\OTU=\MzA=\NTE=\ODU=\OTU=\MTU4\OTQ=\ODI=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\Mjc=\MjIw\MjE0\MjE1\MjQ=\MjIw\MjE0\MTUx\MjQ=\MjIw\MjE0\NzQ=\OTE=\MjE0\MjEy\OTU=\OTQ=\MjE5\OTQ=\OTU=\MzA=\MTQ2\NjQ=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\MjE5\MjQw\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MTUy\MjQw\MjE0\ODc=\MjQ=\MjEw\MjE0\NzQ=\OTE=\ODY=\MjEy\OTU=\OTQ=\MjE5\OTM=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\Mjc=\MjEw\MjE0\MjE1\ODg=\MjQw\MjE0\MTUx\MjQ=\MjEw\MjE0\ODc=\MjQ=\MjQw\MjE0\NzQ=\OTE=\ODY=\MjEy\OTU=\OTQ=\OTE=\OTA=\OTU=\OTQ=\MjY=\Nzg=\MzE=\MjIy\NDk=\ODU=\MzE=\OTQ=\OTQ=\ODI=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\MTU1\MjIz\MjE0\MjE1\MTUy\MjIz\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\MzE=\OTQ=\MjE5\OTQ=\MzE=\MTU4\MzE=\Nzc=\MzE=\MzA=\MTQ2\NjQ=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\MTU1\MjQx\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\ODg=\MjAy\MjE0\ODc=\MjQ=\MjEw\MjE0\NzQ=\OTE=\ODY=\MjEy\MzE=\OTQ=\MjE5\OTM=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\Mjc=\MjEw\MjE0\MjE1\MjQ=\MjAy\MjE0\MTUx\MjQ=\MjEw\MjE0\ODc=\MjE2\MjIy\MjE0\NzQ=\OTE=\ODY=\MjEy\MzE=\OTQ=\OTE=\OTA=\ODM=\MTU1\MjEz\MjE0\ODA=\MTU1\MTU4\MjA1\ODA=\MjE5\MTM5\MjA1\MzE=\OTQ=\OTE=\NzA=\MzE=\MTU4\MTE=\NzE=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\MTU1\MjIz\MjE0\MjE1\MTUy\MjIz\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\MzE=\OTQ=\MjE5\Njg=\MzE=\MzA=\MTU5\Njk=\ODA=\MjE5\MTc=\MTk5\OTM=\MTU1\MTQ1\MjA1\MjQy\MTUy\MjE1\MjE0\MjE0\MjE0\MjE0\MTk5\NzQ=\MTU1\ODY=\MjE1\MjIz\OTU=\NDk=\ODU=\MjIz\OTU=\OTQ=\ODI=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\OTE=\MjEw\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\MjIz\OTU=\MjE5\OTQ=\MjIz\MzE=\MTQ2\NjQ=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\Mjc=\MjQx\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MjE2\MjU0\MjE0\ODc=\MjQ=\MjEw\MjE0\NzQ=\OTE=\ODY=\MjEy\MjIz\OTU=\MjE5\OTM=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\Mjc=\MjEw\MjE0\MjE1\MTUy\MjU0\MjE0\MTUx\MjQ=\MjEw\MjE0\ODc=\ODg=\MjU0\MjE0\NzQ=\OTE=\ODY=\MjEy\MjIz\OTU=\OTE=\OTA=\ODM=\MTU1\MjEz\MjE0\ODA=\MTU1\MTU4\MjA1\ODA=\OTE=\MTU4\MjA1\MjIz\OTU=\OTE=\NzA=\MjIz\OTU=\NDk=\NzE=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\MTU1\MjIz\MjE0\MjE1\MTUy\MjIz\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\MjIz\OTU=\MjE5\Njg=\MjIz\MjIz\MTU4\Njk=\MTU5\MTU5\MTI=\ODU=\MTU5\OTU=\OTQ=\ODI=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\OTE=\MjEw\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\MTU5\OTU=\MjE5\OTQ=\MTU5\MzE=\MTQ2\NjQ=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\Mjc=\MjU0\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MjE2\MjU1\MjE0\ODc=\MjQ=\MjEw\MjE0\NzQ=\OTE=\ODY=\MjEy\MTU5\OTU=\MjE5\OTM=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\Mjc=\MjEw\MjE0\MjE1\MTUy\MjU0\MjE0\MTUx\MjQ=\MjEw\MjE0\ODc=\ODg=\MjU0\MjE0\NzQ=\OTE=\ODY=\MjEy\MTU5\OTU=\OTE=\OTA=\ODM=\MTU1\MjEz\MjE0\ODA=\MTU1\MTU4\MjA1\ODA=\OTE=\MTU4\MjA1\MTU5\OTU=\OTE=\NzA=\MTU5\MTU5\MTI=\NzE=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\MTU1\MjIz\MjE0\MjE1\MTUy\MjIz\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\MTU5\OTU=\MjE5\Njg=\MTU5\OTU=\MTU2\MTI1\MTU5\MjIz\MTU4\Njk=\MTU5\OTU=\MTU2\MTEy\OTU=\MTU5\NjM=\ODU=\OTU=\OTU=\OTQ=\ODI=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\OTE=\MjEw\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\OTU=\OTU=\MjE5\OTQ=\OTU=\MzE=\MTQ2\NjQ=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\OTE=\MjU1\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MjQ=\MjU1\MjE0\ODc=\MjQ=\MjEw\MjE0\NzQ=\OTE=\ODY=\MjEy\OTU=\OTU=\MjE5\OTM=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\Mjc=\MjEw\MjE0\MjE1\MTUy\MjU0\MjE0\MTUx\MjQ=\MjEw\MjE0\ODc=\ODg=\MjU0\MjE0\NzQ=\OTE=\ODY=\MjEy\OTU=\OTU=\OTE=\OTA=\ODM=\MTU1\MjEz\MjE0\ODA=\MTU1\MTU4\MjA1\ODA=\OTE=\MTU4\MjA1\OTU=\OTU=\OTE=\NzA=\OTU=\MTU5\NjM=\NzE=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\MTU1\MjIz\MjE0\MjE1\MTUy\MjIz\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\OTU=\OTU=\MjE5\Njg=\OTU=\OTU=\MTU2\MTI1\OTU=\MjIz\MTU4\Njk=\OTU=\OTU=\MTU2\MTEy\MzE=\MjIz\NjA=\ODU=\MzE=\OTU=\OTQ=\ODI=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\OTE=\MjEw\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\MzE=\OTU=\MjE5\OTQ=\MzE=\MzE=\MTQ2\NjQ=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\MTU1\MjUy\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\ODg=\MjUy\MjE0\ODc=\MjQ=\MjEw\MjE0\NzQ=\OTE=\ODY=\MjEy\MzE=\OTU=\MjE5\OTM=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\Mjc=\MjEw\MjE0\MjE1\MTUy\MjU0\MjE0\MTUx\MjQ=\MjEw\MjE0\ODc=\MjE2\MjIy\MjE0\NzQ=\OTE=\ODY=\MjEy\MzE=\OTU=\OTE=\OTA=\ODM=\MTU1\MjEz\MjE0\ODA=\MTU1\MTU4\MjA1\ODA=\OTE=\MTU4\MjA1\MzE=\OTU=\OTE=\NzA=\MzE=\MjIz\NjA=\NzE=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\MTU1\MjIz\MjE0\MjE1\MTUy\MjIz\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\MzE=\OTU=\MjE5\Njg=\MzE=\OTU=\MTU2\MTI1\MzE=\MjIz\MTU4\Njk=\MzE=\OTU=\MTU2\MTEy\MjIz\Mjg=\NjA=\ODU=\MjIz\OTI=\OTQ=\ODI=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\OTE=\MjEw\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\MjIz\OTI=\MjE5\OTQ=\MjIz\Mjg=\MTQ2\NjQ=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\MjE5\MjUz\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MTUy\MjUz\MjE0\ODc=\MjQ=\MjEw\MjE0\NzQ=\OTE=\ODY=\MjEy\MjIz\OTI=\MjE5\OTM=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\Mjc=\MjEw\MjE0\MjE1\MTUy\MjU0\MjE0\MTUx\MjQ=\MjEw\MjE0\ODc=\ODg=\MjU0\MjE0\NzQ=\OTE=\ODY=\MjEy\MjIz\OTI=\OTE=\OTA=\ODM=\MTU1\MjEz\MjE0\ODA=\MTU1\MTU4\MjA1\ODA=\OTE=\MTU4\MjA1\MjIz\OTI=\OTE=\NzA=\MjIz\Mjg=\NjA=\NzE=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\MTU1\MjIz\MjE0\MjE1\MTUy\MjIz\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\MjIz\OTI=\MjE5\Njg=\MjIz\OTI=\MTU2\MTI1\MjIz\MjIw\MTU4\Njk=\MjIz\OTI=\MTU2\MTEy\MTU5\OTI=\NjE=\ODU=\MTU5\OTI=\OTQ=\ODI=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\OTE=\MjEw\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\MTU5\OTI=\MjE5\OTQ=\MTU5\Mjg=\MTQ2\NjQ=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\MTU1\MjUy\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MjQ=\MjUz\MjE0\ODc=\MjQ=\MjEw\MjE0\NzQ=\OTE=\ODY=\MjEy\MTU5\OTI=\MjE5\OTM=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\Mjc=\MjEw\MjE0\MjE1\MTUy\MjU0\MjE0\MTUx\MjQ=\MjEw\MjE0\ODc=\ODg=\MjU0\MjE0\NzQ=\OTE=\ODY=\MjEy\MTU5\OTI=\OTE=\OTA=\ODM=\MTU1\MjEz\MjE0\ODA=\MTU1\MTU4\MjA1\ODA=\OTE=\MTU4\MjA1\MTU5\OTI=\OTE=\NzA=\MTU5\OTI=\NjE=\NzE=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\MTU1\MjIz\MjE0\MjE1\MTUy\MjIz\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\MTU5\OTI=\MjE5\Njg=\MTU5\OTI=\MTU2\MTI1\MTU5\MjIw\MTU4\Njk=\MTU5\OTI=\MTU2\MTEy\OTU=\MjIw\NTg=\ODU=\OTU=\OTI=\OTQ=\ODI=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\OTE=\MjEw\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\OTU=\OTI=\MjE5\OTQ=\OTU=\Mjg=\MTQ2\NjQ=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\MjE5\MjUz\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MTUy\MjUw\MjE0\ODc=\MjQ=\MjEw\MjE0\NzQ=\OTE=\ODY=\MjEy\OTU=\OTI=\MjE5\OTM=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\Mjc=\MjEw\MjE0\MjE1\MTUy\MjU0\MjE0\MTUx\MjQ=\MjEw\MjE0\ODc=\ODg=\MjU0\MjE0\NzQ=\OTE=\ODY=\MjEy\OTU=\OTI=\OTE=\OTA=\ODM=\MTU1\MjEz\MjE0\ODA=\MTU1\MTU4\MjA1\ODA=\OTE=\MTU4\MjA1\OTU=\OTI=\OTE=\NzA=\OTU=\MjIw\NTg=\NzE=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\MTU1\MjIz\MjE0\MjE1\MTUy\MjIz\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\OTU=\OTI=\MjE5\Njg=\OTU=\OTI=\MTU2\MTI1\OTU=\MjIw\MTU4\Njk=\OTU=\OTI=\MTU2\MTEy\MzE=\OTI=\NTg=\ODU=\MzE=\OTI=\OTQ=\ODI=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\OTE=\MjEw\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\MzE=\OTI=\MjE5\OTQ=\MzE=\Mjg=\MTQ2\NjQ=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\MjE5\MjUz\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MjQ=\MjUw\MjE0\ODc=\MjQ=\MjEw\MjE0\NzQ=\OTE=\ODY=\MjEy\MzE=\OTI=\MjE5\OTM=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\Mjc=\MjEw\MjE0\MjE1\MTUy\MjU0\MjE0\MTUx\MjQ=\MjEw\MjE0\ODc=\ODg=\MjU0\MjE0\NzQ=\OTE=\ODY=\MjEy\MzE=\OTI=\OTE=\OTA=\ODM=\MTU1\MjEz\MjE0\ODA=\MTU1\MTU4\MjA1\ODA=\OTE=\MTU4\MjA1\MzE=\OTI=\OTE=\NzA=\MzE=\OTI=\NTg=\NzE=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\MTU1\MjIz\MjE0\MjE1\MTUy\MjIz\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\MzE=\OTI=\MjE5\Njg=\MzE=\OTI=\MTU2\MTI1\MzE=\MjIw\MTU4\Njk=\MzE=\OTI=\MTU2\MTEy\MjIz\MjIx\NTk=\ODU=\MjIz\OTM=\OTQ=\ODI=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\OTE=\MjEw\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\MjIz\OTM=\MjE5\OTQ=\MjIz\Mjk=\MTQ2\NjQ=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\Mjc=\MjU0\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MTUy\MjUx\MjE0\ODc=\MjQ=\MjEw\MjE0\NzQ=\OTE=\ODY=\MjEy\MjIz\OTM=\MjE5\OTM=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\Mjc=\MjEw\MjE0\MjE1\MTUy\MjU0\MjE0\MTUx\MjQ=\MjEw\MjE0\ODc=\ODg=\MjU0\MjE0\NzQ=\OTE=\ODY=\MjEy\MjIz\OTM=\OTE=\OTA=\ODM=\MTU1\MjEz\MjE0\ODA=\MTU1\MTU4\MjA1\ODA=\OTE=\MTU4\MjA1\MjIz\OTM=\OTE=\NzA=\MjIz\MjIx\NTk=\NzE=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\MTU1\MjIz\MjE0\MjE1\MTUy\MjIz\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\MjIz\OTM=\MjE5\Njg=\MjIz\OTM=\MTU2\MTI1\MjIz\MjIx\MTU4\Njk=\MjIz\OTM=\MTU2\MTEy\MTU5\OTM=\NTk=\ODU=\MTU5\Mjk=\ODY=\ODI=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\OTE=\MjEw\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\MTU5\OTM=\MjE5\OTQ=\MTU5\Mjk=\MTQ2\NjQ=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\Mjc=\MjUx\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\ODg=\MjQz\MjE0\ODc=\MjQ=\MjEw\MjE0\NzQ=\OTE=\ODY=\MjEy\MTU5\OTM=\MjE5\OTM=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\Mjc=\MjEw\MjE0\MjE1\MjE2\MTk0\MjE0\MTUx\MjQ=\MjEw\MjE0\ODc=\ODg=\MTk5\MjE0\NzQ=\OTE=\ODY=\MjEy\MTU5\OTM=\OTE=\OTA=\ODM=\MTU1\MjEz\MjE0\ODA=\MTU1\MTU4\MjA1\ODA=\OTE=\MTU4\MjA1\MTU5\OTM=\OTE=\NzA=\MTU5\OTM=\NTk=\NzE=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\MTU1\MjIz\MjE0\MjE1\MTUy\MjIz\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\MTU5\OTM=\MjE5\Njg=\MTU5\MjIx\MTU4\Njk=\ODA=\MjE5\MTc=\MTky\OTM=\MTU1\MTQ1\MjA1\MjQy\ODg=\MjE1\MjE0\MjE0\MjE0\MjE0\MTkz\NzQ=\MTU1\ODY=\MjE1\OTU=\MjIx\NTY=\ODU=\OTU=\MTU3\OTM=\ODI=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\Mjc=\MjIw\MjE0\MjE1\MjQ=\MjIw\MjE0\MTUx\MjQ=\MjIw\MjE0\NzQ=\OTE=\MjE0\MjEy\OTU=\OTM=\MjE5\OTQ=\OTU=\Mjk=\MTQ2\NjQ=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\MTU1\MjQ4\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\ODg=\MjQ4\MjE0\ODc=\MjQ=\MjEw\MjE0\NzQ=\OTE=\ODY=\MjEy\OTU=\OTM=\MjE5\OTM=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\Mjc=\MjEw\MjE0\MjE1\MjQ=\MjQ4\MjE0\MTUx\MjQ=\MjEw\MjE0\ODc=\MjE2\MjQ5\MjE0\NzQ=\OTE=\ODY=\MjEy\OTU=\OTM=\OTE=\OTA=\OTU=\OTM=\MjY=\Nzg=\MzE=\MTU3\NTc=\ODU=\MzE=\OTM=\OTM=\ODI=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\OTE=\MjEw\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\MzE=\OTM=\MjE5\OTQ=\MzE=\Mjk=\MTQ2\NjQ=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\OTE=\MjQ5\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MjQ=\MjQ5\MjE0\ODc=\MjQ=\MjEw\MjE0\NzQ=\OTE=\ODY=\MjEy\MzE=\OTM=\MjE5\OTM=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\Mjc=\MjEw\MjE0\MjE1\MjE2\MTk0\MjE0\MTUx\MjQ=\MjEw\MjE0\ODc=\MjQ=\MjA4\MjE0\NzQ=\OTE=\ODY=\MjEy\MzE=\OTM=\OTE=\OTA=\ODM=\MTU1\MjEz\MjE0\ODA=\MTU1\MTU4\MjA1\ODA=\OTE=\MTU4\MjA1\MzE=\OTM=\OTE=\NzA=\MzE=\MjIx\Mzg=\NzE=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\MTU1\MjIz\MjE0\MjE1\MTUy\MjIz\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\MzE=\OTM=\MjE5\Njg=\MzE=\MjIx\MTU4\Njk=\MjIz\MTU0\Mzg=\ODU=\MjIz\OTA=\OTM=\ODI=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\OTE=\MjEw\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\MjIz\OTA=\MjE5\OTQ=\MjIz\MjY=\MTQ2\NjQ=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\OTE=\MjMw\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MjQ=\MjMw\MjE0\ODc=\MjQ=\MjEw\MjE0\NzQ=\OTE=\ODY=\MjEy\MjIz\OTA=\MjE5\OTM=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\Mjc=\MjEw\MjE0\MjE1\MjE2\MTk0\MjE0\MTUx\MjQ=\MjEw\MjE0\ODc=\MjQ=\MjQy\MjE0\NzQ=\OTE=\ODY=\MjEy\MjIz\OTA=\OTE=\OTA=\ODM=\MTU1\MjEz\MjE0\ODA=\MTU1\MTU4\MjA1\ODA=\OTE=\MTU4\MjA1\MjIz\OTA=\OTE=\NzA=\MjIz\MjE4\Mzk=\NzE=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\MTU1\MjIz\MjE0\MjE1\MTUy\MjIz\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\MjIz\OTA=\MjE5\Njg=\MjIz\OTA=\MTU2\MTI1\MjIz\MjY=\MTUy\Njk=\MjIz\OTA=\MTU2\MTEy\MTU5\MTU0\Mzk=\ODU=\MTU5\OTA=\OTM=\ODI=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\OTE=\MjEw\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\MTU5\OTA=\MjE5\OTQ=\MTU5\MjY=\MTQ2\NjQ=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\OTE=\MjMw\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\ODg=\MjMx\MjE0\ODc=\MjQ=\MjEw\MjE0\NzQ=\OTE=\ODY=\MjEy\MTU5\OTA=\MjE5\OTM=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\Mjc=\MjEw\MjE0\MjE1\MjE2\MTk0\MjE0\MTUx\MjQ=\MjEw\MjE0\ODc=\MjQ=\MjMx\MjE0\NzQ=\OTE=\ODY=\MjEy\MTU5\OTA=\OTE=\OTA=\ODM=\MTU1\MjEz\MjE0\ODA=\MTU1\MTU4\MjA1\ODA=\OTE=\MTU4\MjA1\MTU5\OTA=\OTE=\NzA=\MTU5\MjE4\MzY=\NzE=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\MTU1\MjIz\MjE0\MjE1\MTUy\MjIz\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\MTU5\OTA=\MjE5\Njg=\MTU5\OTA=\MTU2\MTI1\MTU5\MjE4\MTU4\Njk=\MTU5\OTA=\MTU2\MTEy\OTU=\MTU0\MzY=\ODU=\OTU=\OTA=\OTM=\ODI=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\OTE=\MjEw\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\OTU=\OTA=\MjE5\OTQ=\OTU=\MjY=\MTQ2\NjQ=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\OTE=\MjMw\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\ODg=\MjI4\MjE0\ODc=\MjQ=\MjEw\MjE0\NzQ=\OTE=\ODY=\MjEy\OTU=\OTA=\MjE5\OTM=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\Mjc=\MjEw\MjE0\MjE1\MjE2\MTk0\MjE0\MTUx\MjQ=\MjEw\MjE0\ODc=\MjQ=\MjMx\MjE0\NzQ=\OTE=\ODY=\MjEy\OTU=\OTA=\OTE=\OTA=\ODM=\MTU1\MjEz\MjE0\ODA=\MTU1\MTU4\MjA1\ODA=\OTE=\MTU4\MjA1\OTU=\OTA=\OTE=\NzA=\OTU=\MjY=\MzY=\NzE=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\MTU1\MjIz\MjE0\MjE1\MTUy\MjIz\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\OTU=\OTA=\MjE5\Njg=\OTU=\OTA=\MTU2\MTI1\OTU=\MjE4\MTU4\Njk=\OTU=\OTA=\MTU2\MTEy\MzE=\MjE4\Mzc=\ODU=\MzE=\OTA=\OTM=\ODI=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\OTE=\MjEw\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\MzE=\OTA=\MjE5\OTQ=\MzE=\MjY=\MTQ2\NjQ=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\OTE=\MjMw\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MTUy\MjI5\MjE0\ODc=\MjQ=\MjEw\MjE0\NzQ=\OTE=\ODY=\MjEy\MzE=\OTA=\MjE5\OTM=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\Mjc=\MjEw\MjE0\MjE1\MjE2\MTk0\MjE0\MTUx\MjQ=\MjEw\MjE0\ODc=\MjQ=\MjMx\MjE0\NzQ=\OTE=\ODY=\MjEy\MzE=\OTA=\OTE=\OTA=\ODM=\MTU1\MjEz\MjE0\ODA=\MTU1\MTU4\MjA1\ODA=\OTE=\MTU4\MjA1\MzE=\OTA=\OTE=\NzA=\MzE=\OTA=\Mzc=\NzE=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\MTU1\MjIz\MjE0\MjE1\MTUy\MjIz\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\MzE=\OTA=\MjE5\Njg=\MzE=\OTA=\MTU2\MTI1\MzE=\MjE4\MTU4\Njk=\MzE=\OTA=\MTU2\MTEy\MjIz\Mjc=\Mzc=\ODU=\MjIz\OTE=\OTM=\ODI=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\OTE=\MjEw\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\MjIz\OTE=\MjE5\OTQ=\MjIz\Mjc=\MTQ2\NjQ=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\OTE=\MjMw\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\MjE2\MjI2\MjE0\ODc=\MjQ=\MjEw\MjE0\NzQ=\OTE=\ODY=\MjEy\MjIz\OTE=\MjE5\OTM=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\Mjc=\MjEw\MjE0\MjE1\MjE2\MTk0\MjE0\MTUx\MjQ=\MjEw\MjE0\ODc=\MjQ=\MjMx\MjE0\NzQ=\OTE=\ODY=\MjEy\MjIz\OTE=\OTE=\OTA=\ODM=\MTU1\MjEz\MjE0\ODA=\MTU1\MTU4\MjA1\ODA=\OTE=\MTU4\MjA1\MjIz\OTE=\OTE=\NzA=\MjIz\Mjc=\Mzc=\NzE=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\MTU1\MjIz\MjE0\MjE1\MTUy\MjIz\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\MjIz\OTE=\MjE5\Njg=\MjIz\OTE=\MTU2\MTI1\MjIz\MjE5\MTU4\Njk=\MjIz\OTE=\MTU2\MTEy\MTU5\MTU1\MTE=\ODU=\MTU5\OTE=\OTM=\ODI=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\MTU1\MjIz\MjE0\MjE1\MTUy\MjIz\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\MTU5\OTE=\MjE5\OTQ=\MTU5\MTU1\MzE=\Nzc=\MTU5\Mjc=\MTQ2\NjQ=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\MTU1\MjI2\MjE0\MjE1\MjQ=\MjEw\MjE0\MTUx\ODg=\MjI2\MjE0\ODc=\MjQ=\MjEw\MjE0\NzQ=\OTE=\ODY=\MjEy\MTU5\OTE=\MjE5\OTM=\ODM=\Mjc=\MjEx\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\Mjc=\MjEw\MjE0\MjE1\MjQ=\MjA4\MjE0\MTUx\MjQ=\MjEw\MjE0\ODc=\MjQ=\MjQy\MjE0\NzQ=\OTE=\ODY=\MjEy\MTU5\OTE=\OTE=\OTA=\ODM=\MTU1\MjEz\MjE0\ODA=\MTU1\MTU4\MjA1\ODA=\MjE5\MTM5\MjA1\MTU5\OTE=\OTE=\NzA=\MTU5\MTU1\MTE=\NzE=\ODM=\MTU1\MjEw\MjE0\ODA=\MTU1\MTUw\MjA1\MjM=\MTU1\MjIz\MjE0\MjE1\MTUy\MjIz\MjE0\MTUx\MTUy\MjIz\MjE0\NzQ=\OTE=\MjE0\MjEy\MTU5\OTE=\MjE5\Njg=\MTU5\Mjc=\MTU5\Njk=\ODA=\MjE5\MTc=\MjA0\OTM=\MTU1\MTQ1\MjA1\MjQy\MjQ=\MjE1\MjE0\MjE0\MjE0\MjE0\MTkz\NzQ=\MTU1\ODY=\MjE1\MTE0\MjE5\MjEy\MjE0\ODE=\Mjc=\MjI2\MjE0\ODA=\MjE5\MTc=\MjE5\OTM=\MTU1\MTQ1\MjA1\MjQy\MTUy\MjEy\MjE0\NzQ=\MTU1\ODY=\MjE1\MTE0\OTE=\MjEy\MjE0\ODE=\Mjc=\MjI2\MjE0\ODA=\MjE5\MTQ1\MjE2\OTM=\MTU1\MTQ1\MjA1\MjQy\MjQ=\MjEy\MjE0\NzQ=\MTU1\ODY=\MjE1\MTE0\MjE5\MjEz\MjE0\ODE=\Mjc=\MjI2\MjE0\ODA=\MjE5\MTc=\MjE2\OTM=\MTU1\MTQ1\MjA1\MjQy\MTUy\MjEz\MjE0\NzQ=\MTU1\ODY=\MjE1\MTE0\OTE=\MjEz\MjE0\ODE=\Mjc=\MjI2\MjE0\ODA=\MjE5\MTQ1\MjE3\OTM=\MTU1\MTQ1\MjA1\MjQy\MjQ=\MjEz\MjE0\NzQ=\MTU1\ODY=\MjE1\ODA=\MjE5\MTc=\MjIz\OTM=\MTU1\MTQ1\MjA1\MjQy\MjE2\MjEw\MjE0\NzQ=\MTU1\ODY=\MjE1\ODA=\MjE5\MTQ1\MjIy\OTM=\MTU1\MTQ1\MjA1\MjQy\MTUy\MjEw\MjE0\MjE0\MjE0\ODY=\MjIy\NzQ=\MTU1\ODY=\MjE1\ODA=\MjE5\MTQ1\MjEw\OTM=\MTU1\MTQ1\MjA1\MjQy\ODg=\MjEw\MjE0\MjE0\MjE0\ODY=\MjEw\NzQ=\MTU1\ODY=\MjE1\ODA=\MjE5\MTc=\MjEx\OTM=\MTU1\MTQ1\MjA1\MjQy\MjQ=\MjEw\MjE0\MjE0\MjE0\MjE0\MjA4\NzQ=\MTU1\ODY=\MjE1\ODA=\MjE5\MTQ1\MjA5\OTM=\MTU1\MTQ1\MjA1\MjQy\MjE2\MjEx\MjE0\MjE0\MjE0\ODY=\MjA5\NzQ=\MTU1\ODY=\MjE1\ODA=\MjE5\MTQ1\MjIx\OTM=\MTU1\MTQ1\MjA1\MjQy\MTUy\MjEx\MjE0\MjE0\MjE0\ODY=\MjIx\NzQ=\MTU1\ODY=\MjE1\ODA=\MjE5\MTc=\MjE3\OTM=\MTU1\MTQ1\MjA1\MjQy\ODg=\MjEx\MjE0\MjE0\MjE0\MjE0\MTk4\NzQ=\MTU1\ODY=\MjE1\ODA=\MjE5\MTQ1\MjIw\OTM=\MTU1\MTQ1\MjA1\MjQy\MjQ=\MjEx\MjE0\NzQ=\MTU1\ODY=\MjE1\ODA=\MjE5\MTQ1\MjIz\OTM=\MTU1\MTQ1\MjA1\MjQy\MjE2\MjA4\MjE0\NzQ=\MTU1\ODY=\MjE1\ODA=\MjE5\MTQ1\MjEx\OTM=\MTU1\MTQ1\MjA1\MjQy\MTUy\MjA4\MjE0\NzQ=\MTU1\ODY=\MjE1\ODA=\MjE5\MTc=\MjA4\OTM=\MTU1\MTQ1\MjA1\MjQy\ODg=\MjA4\MjE0\NzQ=\MTU1\ODY=\MjE1\ODA=\MjE5\MTc=\MTkz\OTM=\MTU1\MTQ1\MjA1\MjQy\MjQ=\MjA4\MjE0\NzQ=\MTU1\ODY=\MjE1\ODA=\MjE5\MTQ1\MjA2\OTM=\MTU1\MTQ1\MjA1\MjQy\MjE2\MjA5\MjE0\NzQ=\MTU1\ODY=\MjE1\ODA=\MjE5\MTc=\MjA2\OTM=\MTU1\MTQ1\MjA1\MjQy\MTUy\MjA5\MjE0\NzQ=\MTU1\ODY=\MjE1\ODA=\MjE5\MTQ1\MjA0\OTM=\MTU1\MTQ1\MjA1\MjQy\ODg=\MjA5\MjE0\NzQ=\MTU1\ODY=\MjE1\ODA=\MjE5\MTc=\MjA3\OTM=\MTU1\MTQ1\MjA1\MjQy\MjQ=\MjA5\MjE0\NzQ=\MTU1\ODY=\MjE1\ODA=\MjE5\MTQ1\MjA3\OTM=\MTU1\MTQ1\MjA1\MjQy\MjE2\MjIy\MjE0\NzQ=\MTU1\ODY=\MjE1\ODA=\MjE5\MTc=\MjIz\OTM=\MTU1\MTQ1\MjA1\MjQy\MTUy\MjIy\MjE0\NzQ=\MTU1\ODY=\MjE1\ODA=\MjE5\MTQ1\MTk3\OTM=\MTU1\MTQ1\MjA1\MjQy\ODg=\MjIy\MjE0\NzQ=\MTU1\ODY=\MjE1\ODA=\MjE5\MTc=\MTk3\OTM=\MTU1\MTQ1\MjA1\MjQy\MjQ=\MjIy\MjE0\NzQ=\MTU1\ODY=\MjE1\ODA=\MjE5\MTQ1\MTk0\OTM=\MTU1\MTQ1\MjA1\MjQy\MjE2\MjIz\MjE0\NzQ=\MTU1\ODY=\MjE1\ODA=\MjE5\MTc=\MTk0\OTM=\MTU1\MTQ1\MjA1\MjQy\MTUy\MjIz\MjE0\NzQ=\MTU1\ODY=\MjE1\ODA=\MjE5\MTQ1\MTk1\OTM=\MTU1\MTQ1\MjA1\MjQy\ODg=\MjIz\MjE0\NzQ=\MTU1\ODY=\MjE1\ODA=\MjE5\MTc=\MTk1\OTM=\MTU1\MTQ1\MjA1\MjQy\MjQ=\MjIz\MjE0\NzQ=\MTU1\ODY=\MjE1\ODA=\MjE5\MTQ1\MTky\OTM=\MTU1\MTQ1\MjA1\MjQy\MjE2\MjIw\MjE0\NzQ=\MTU1\ODY=\MjE1\ODM=\MjE5\MjI3\MjE0\ODA=\MjE5\MTQ1\MjA1\OTM=\MTU1\MTQ1\MjA1\MjQy\MTUy\MjIw\MjE0\NzQ=\MTU1\ODY=\MjE1\MjAw\MjE0\ODY=\MjE0\Mw==\MjE0\MjE0\MjE0\MjEw\MjIz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTU5\MTg0\MTY1\MTYy\MTgz\MTg0\MTgx\MTc5\MjE0\MjEw\MjEw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTg0\MTc5\MTYx\MjE0\MjEw\MjIw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMz\MTgx\MTY0\MTc5\MTc5\MTg0\MTQ1\MTYz\MTkx\MjE0\MjEw\MjA4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ0\MTY0\MTgz\MTg3\MTc5\MjE0\MjEw\MjIx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMw\MTc5\MTc0\MTYy\MTQ4\MTYz\MTYy\MTYy\MTg1\MTg0\MjE0\MjEw\MjIw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMw\MTc5\MTc0\MTYy\MTU0\MTgz\MTgw\MTc5\MTg2\MjE0\MjEw\MjIy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMw\MTc5\MTc0\MTYy\MTQ4\MTg1\MTc0\MjE0\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTUy\MTgz\MTg3\MTc5\MjE0\MjEw\MjA0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTI4\MTc5\MTkw\MTkx\MTgx\MTg2\MTc5\MjQ2\MTMz\MTkx\MTg3\MTYz\MTg2\MTgz\MTYy\MTg1\MTY0\MjQ2\MTQ0\MTYz\MTkw\MTgz\MTc0\MTg1\MTY0\MjE0\MjEw\MjA5\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTM0\MTgz\MTY0\MTc5\MTg0\MTYy\MjE0\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTc3\MTgz\MTg3\MTc5\MjE0\MjEw\MjIy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTg1\MTY0\MTc5\MTQ1\MTYz\MTkx\MjE0\MjEw\MjE3\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQw\MTU5\MTg0\MTc4\MTc5\MTc0\MTQ4\MTc5\MTkw\MTgz\MTYw\MTkx\MTg1\MTY0\MjE0\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ3\MTg0\MTYz\MTg3\MjE0\MjEw\MjIy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMz\MTkx\MTgw\MTg2\MTkx\MTg0\MTc3\MjE0\MjEw\MjIw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTUz\MTY2\MTc5\MTg0\MTQ0\MTY0\MTgz\MTg3\MTc5\MjE0\MjEw\MTk5\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ4\MTgz\MTgx\MTg5\MTc3\MTY0\MTg1\MTYz\MTg0\MTc4\MTQ5\MTg1\MTg2\MTg1\MTY0\MjI5\MjE0\MjEw\MjA5\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTg1\MTg2\MTg1\MTY0\MjI5\MjE0\MjEz\MTM5\MTM1\MTU2\MjIy\MTI4\MTMx\NTE=\MjMz\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjEz\NzY=\MTcz\MTU4\NDY=\OA==\OQ==\OQ==\MjMz\MjEw\MjE5\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ4\MTg1\MTY0\MTc4\MTc5\MTY0\MTQ5\MTg1\MTg2\MTg1\MTY0\MjI5\MjE0\MjEw\MjIz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTM0\MTg1\MTY1\MTkx\MTYy\MTkx\MTg1\MTg0\MjE0\MjEw\MjA4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMx\MTQ2\MTkx\MTg3\MjI4\MjE0\MjEz\MTI0\MjAw\MjM4\ODY=\NTU=\OTU=\OA==\MjMz\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMz\MTkx\MTcy\MTc5\MjE0\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MTUw\MTM1\MTUw\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjM3\MTUw\MjEw\MTk5\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTU1\MTg1\MTYz\MTY1\MTc5\MTQ4\MTYz\MTYy\MTYy\MTg1\MTg0\MjMx\MTQ2\MTg1\MTYx\MTg0\MjE0\MjEw\MjIy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTgx\MTg1\MTg0\MTg0\MTc5\MTgx\MTYy\MjE0\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTUz\MTY2\MTc5\MTg0\MjE0\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MTUw\MTM0\MTUw\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjM5\MTUw\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ0\MTg1\MTg0\MTYy\MjE0\MjEw\MjIy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTgz\MTY0\MTYy\MTg1\MTg1\MTg0\MjE0\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMw\MTc5\MTc0\MTYy\MjE0\MjEw\MjIx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMw\MTc5\MTc0\MTYy\MTQ5\MTg1\MTg2\MTg1\MTY0\MjI5\MjE0\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\Mzg=\MjMz\MjEw\MjIz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMw\MTc5\MTc0\MTYy\MTMz\MTkx\MTcy\MTc5\MjE0\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjMy\MTUw\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTU1\MTgz\MTkx\MTg0\MjE0\MjEw\MjA5\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTUx\MTgx\MTYy\MTkx\MTYw\MTc5\MjE0\MjE1\MjE1\MjEz\Mzc=\MjQ2\MjM1\MTQ3\MjE2\MTk5\MjM=\MjMz\MjEw\MTk4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ4\MTg1\MTY0\MTc4\MTc5\MTY0\MTMz\MTkx\MTcy\MTc5\MTM0\MTkx\MTc0\MTc5\MTg2\MjE0\MjEz\MTI=\NTg=\MTI5\MjQ2\Mjk=\MjA3\MTQ=\MjMz\MjEz\MTA2\MjE3\MTM2\MjI=\MTg3\MTM=\MTY=\MjMz\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MTgy\MTcz\MTUw\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MTgy\MTY3\MTUw\MjEw\MjIy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTI4\MTkx\MTY1\MTkx\MTgw\MTg2\MTc5\MjE0\MjE1\MjE0\MjEw\MjIw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ2\MTY0\MTgz\MTc3\MTc3\MTgz\MTgw\MTg2\MTc5\MjE0\MjEw\MjIy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ4\MTc5\MTgz\MTYz\MTYy\MTc1\MTUx\MjE0\MjEz\MzA=\MzM=\MTcz\MjA2\MTk4\MTk4\MTAy\MjMz\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MTY2\MTcz\MTUw\MjEw\MTkz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ4\MTgz\MTgx\MTg5\MTc3\MTY0\MTg1\MTYz\MTg0\MTc4\MTMw\MTY0\MTgz\MTg0\MTY1\MTY2\MTgz\MTY0\MTc5\MTg0\MTgx\MTc1\MjE0\MjEz\NzY=\MjEy\ODY=\MjE0\MTE1\MTQ5\Mg==\MjMz\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MTUw\MTgx\MTUw\MjEw\MjA1\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTI4\MTc5\MTkw\MTkx\MTgx\MTg2\MTc5\MjQ2\MTMz\MTkx\MTg3\MTYz\MTg2\MTgz\MTYy\MTg1\MTY0\MjQ2\MTMz\MTYz\MTgx\MTgx\MjQ2\MTYw\MjI4\MjQ2\MjE0\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjI2\MTUw\MjEw\MjIy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ4\MTc5\MTgz\MTYz\MTYy\MTc1\MTQ4\MjE0\MjEz\MTEy\MjM=\MjQ1\NTQ=\MTY=\MjM0\NTk=\MjMz\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjM4\MTUw\MjEw\MjA5\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTY0\MTc5\MTc4\MTkx\MTYy\MjE0\MjEw\MjM5\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ1\MTYz\MTkx\MjQ2\MTU1\MTgz\MTc4\MTc5\MjQ2\MTQ4\MTc1\MjQ2\MTQ2\MTYz\MTg5\MTc1\MTQ4\MTQ1\MjQ2\MjUw\MjQ2\MTMz\MTgx\MTY0\MTkx\MTY2\MTYy\MTY1\MjQ2\MTU1\MTgz\MTc4\MTc5\MjQ2\MTQ4\MTc1\MjQ2\MTY1\MTg1\MTg3\MTc5\MTg1\MTg0\MTc5\MjI4\MjQ2\MTgz\MTg0\MTc4\MjQ2\MTQ2\MTYz\MTg5\MTc1\MTQ4\MTQ1\MjE0\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjMw\MTUw\MjEw\MjA5\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMw\MTg1\MTY0\MTY3\MTYz\MTc5\MjE0\MjEz\NzQ=\MTgz\MjEx\MjQ2\MjI1\MTgz\NTE=\MjMz\MjEz\NjI=\MTQ0\MjM2\NDA=\MTkx\MTYz\MTA0\MjMz\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MjI=\MTM0\MTUw\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTUw\MjEw\MjIy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMw\MTg1\MTY0\MTY3\MTYz\MTc5\MTYy\MjE0\MjEz\MTE2\MjAz\MjAw\MTM3\MjQ=\MTg0\Mzk=\MjMz\MjEz\MjAy\ODk=\MjUy\MjE0\MjE0\MjE0\MTkw\MjMy\MjEw\MjA5\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTUx\MTg3\MTg1\MTYz\MTg0\MTYy\MjE0\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjUw\MTUw\MjEw\MjE4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMw\MTc5\MTc0\MTYy\MTI5\MTY0\MTgz\MTY2\MTY2\MTc5\MTc4\MjE0\MjEw\MjIw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMw\MTY2\MTYy\MTg1\MTQ5\MTY0\MTgz\MTYy\MTc5\MjE0\MjEz\MTM=\MTE=\NzI=\NDE=\MTQz\Mw==\NzY=\MjMz\MjEz\MjI3\MTE4\MTk3\MTY5\MTg4\MTYz\MTA0\MjMz\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\ODY=\MTM3\MTUw\MjEw\MjE4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMw\MTY2\MjQ2\MTYy\MTg1\MjQ2\MTQ5\MTY0\MTgz\MTYy\MTc5\MjE0\MjEw\MjIx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTUy\MTkx\MTYy\MTY0\MTg1\MTMz\MTY2\MTc5\MTc5\MTc4\MjE0\MjEz\MjE2\MTk2\MTgy\MTgy\MTg1\MjQz\MA==\MjMz\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTM0\MTUw\MjEw\MjE4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTUy\MTkx\MTYy\MTY0\MTg1\MjQ2\MTMz\MTY2\MTc5\MTc5\MTc4\MjE0\MjEw\MjIx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMw\MTc5\MTc0\MTYy\MTMz\MTgx\MTgz\MTg2\MTc5\MTc4\MjE0\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjUy\MTUw\MjEw\MjEw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTUy\MTMz\MTMw\MjE0\MjEw\MjE2\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMw\MTc5\MTg2\MTc5\MTY2\MTg1\MTY0\MTYy\MTMw\MTg1\MTQ5\MTgz\MTY0\MjE0\MjEz\MTk=\MjA1\MTY1\ODY=\MTQx\Mw==\NzY=\MjMz\MjEz\MTQ0\MjQ5\MTU2\MTE4\MjQw\NA==\Nw==\MjMz\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\ODY=\MTUw\MTUw\MjEw\MTk4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMw\MTc5\MTg2\MTc5\MTY2\MTg1\MTY0\MTYy\MjQ2\MTMw\MTg1\MjQ2\MTQ5\MTgz\MTY0\MjE0\MjEw\MjIx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTUy\MTkx\MTYy\MTY0\MTg1\MTQ0\MTg1\MTY0\MTgx\MTc5\MjE0\MjEz\Nzk=\ODM=\ODY=\MjI=\MjQw\NA==\Nw==\MjMz\MjEw\MjE4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTUy\MTkx\MTYy\MTY0\MTg1\MjQ2\MTQ0\MTg1\MTY0\MTgx\MTc5\MjE0\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjMx\MTUw\MjEw\MjEw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTUy\MTQ0\MTMw\MjE0\MjEw\MjA4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMz\MTY2\MTc5\MTc5\MTc4\MjE0\MjEz\Mzg=\Mjk=\NDc=\MTM3\MjI1\NjU=\Nw==\MjMz\MjEw\MjIw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMz\MTY2\MTc5\MTc5\MTc4\MTQ4\MTkx\MTg0\MTc4\MjE0\MjEw\MjIz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTY0\MTgz\MTYy\MTc5\MTQ3\MTMz\MTM0\MjE0\MjEz\MTcy\MTky\MjQy\ODY=\MTk2\MzQ=\NDk=\MjMz\MjEw\MjIw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTY0\MTgz\MTYy\MTc5\MjQ2\MTQ3\MTMz\MTM0\MjE0\MjEw\MjIz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMz\MTYz\MTY2\MTc5\MTY0\MTQ5\MTgz\MTY0\MjE0\MjEz\NTc=\MTc4\MTI4\MTUw\MTEw\MTA4\MA==\MjMz\MjEz\MTg0\NDI=\Ng==\NzM=\MTk2\MzQ=\NDk=\MjMz\MjEw\MjIw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMz\MTYz\MTY2\MTc5\MTY0\MjQ2\MTQ5\MTgz\MTY0\MjE0\MjEw\MjE5\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ1\MTkx\MTYw\MTc5\MTUx\MTg2\MTg2\MTM0\MTc5\MTY0\MTg5\MTY1\MjE0\MjEz\MjI1\Mjk=\MjU0\MTUw\MTQx\MTUx\NDg=\MjMz\MjEw\MjE3\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ1\MTkx\MTYw\MTc5\MjQ2\MTUx\MTg2\MTg2\MjQ2\MTM0\MTc5\MTY0\MTg5\MTY1\MjE0\MjEw\MjA4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTg2\MTg1\MTY1\MTc5\MjE0\MjEz\NzY=\MjU1\MjQ4\MTUw\MjM3\NTk=\NTk=\MjMz\MjEz\NjA=\MTY5\MjIw\NDE=\MTY5\MjE4\MTMx\MTA1\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjM0\MTUw\MjEw\MjIx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMz\MTg1\MTYz\MTY0\MTgx\MTc5\MTMz\MTgz\MTg0\MTY1\MjE0\MjEw\MjEy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQy\MjE0\MjEw\MjIx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTU2\MTYz\MTg3\MTY2\MTU4\MTc5\MTkx\MTc3\MTkw\MTYy\MjE0\MjEz\OTY=\MTUy\MjM3\ODY=\MTg0\MTcx\MTM=\MjMz\MjEw\MjE4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTU2\MTYz\MTg3\MTY2\MjQ2\MTU4\MTc5\MTkx\MTc3\MTkw\MTYy\MjE0\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjQ4\MTUw\MjEw\MjEw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTU2\MTU4\MTMw\MjE0\MjEz\ODM=\MTU0\MjUy\MjE1\MjQ=\MTg0\Mzk=\MjMz\MjEw\MTk3\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTUx\MTYz\MTYy\MTg1\MTQ0\MTgz\MTY0\MTg3\MjQ2\MTU0\MTg1\MTgx\MTgz\MTYy\MTkx\MTg1\MTg0\MTY1\MjE0\MjEz\MTY3\MzA=\MTMy\MTgy\MjIx\MTY4\MTI=\MjMz\MjEw\MTk0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTUx\MTYz\MTYy\MTg1\MjQ2\MTQ0\MTgz\MTY0\MTg3\MjQ2\MTU0\MTg1\MTgx\MTgz\MTYy\MTkx\MTg1\MTg0\MTY1\MjE0\MjEw\MjA5\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTUx\MTQ0\MjQ2\MTU0\MTg1\MTgx\MjE0\MjEz\ODI=\MjM5\MjE3\MTgz\MTM=\OTY=\MzU=\MTA1\MjEz\NDA=\Mg==\MTk1\MTA1\MTg5\MjU0\NDE=\MTA1\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MjQ2\MTgx\MTUw\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MjI=\MTgx\MTUw\MjEw\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQy\MjI5\MjE0\MjEz\NDI=\NTI=\MjI0\MTUw\ODE=\MjAw\NjM=\MjMz\MjEz\NTI=\MTU=\Nzk=\MjE0\MTg2\OTc=\MTc4\MTA1\MjEw\MjE4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ4\MTY0\MTkx\MTc4\MTc3\MTc5\MjQ2\MTU0\MTc5\MTc2\MTYy\MjE0\MjEz\OTM=\MjE1\MTQ1\MjMz\MTY2\MjQ=\MTA1\MjMz\MjEz\MTc5\MzE=\NTA=\MjQ2\MTM5\OTY=\MTc=\MjMz\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\ODY=\MTM4\MTUw\MjEw\MjE5\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ4\MTY0\MTkx\MTc4\MTc3\MTc5\MjQ2\MTMy\MTkx\MTc3\MTkw\MTYy\MjE0\MjEz\NTM=\MzE=\MzQ=\NzM=\MjE=\MTkx\MTQ=\MjMz\MjEw\MjE2\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ4\MTY0\MTkx\MTc4\MTc3\MTc5\MjQ2\MjMx\MjQ2\MTU0\MTc5\MTc2\MTYy\MjE0\MjEz\NDM=\MTM3\MjI0\ODY=\MjEx\MTAy\NTI=\MjMz\MjEw\MjE3\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ4\MTY0\MTkx\MTc4\MTc3\MTc5\MjQ2\MjMx\MjQ2\MTMy\MTkx\MTc3\MTkw\MTYy\MjE0\MjEz\OTI=\MTM2\NjI=\MjMz\MTM=\Njg=\NjM=\MjMz\MjEw\MjIy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ4\MTY0\MTgz\MTg5\MTkx\MTg0\MTc3\MjE0\MjEz\MjIz\MTE1\MTY3\MTE4\MTg0\MTcx\MTM=\MjMz\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjI1\MTUw\MjEw\MjIz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ4\MTY0\MTgz\MTg5\MTkx\MTg0\MTc3\MTMw\MjE0\MjEw\MjIw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTU0\MTg1\MTgx\MTgz\MTYy\MTkx\MTg1\MTg0\MTY1\MjE0\MjEz\MTc1\MTg2\MzE=\MTY5\OTQ=\OTI=\NTI=\MjMz\MjEw\MjE2\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTU0\MTg1\MTgx\MTgz\MTYy\MTkx\MTg1\MTg0\MTQ0\MTY0\MTgz\MTg3\MTc5\MjE0\MjEz\MjUx\MTIw\NjQ=\NTQ=\MTc1\NzI=\MjIx\MTUw\MjEz\MTIz\MTI3\MzE=\OQ==\NDE=\NDE=\NTc=\MjMz\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTkw\MTUw\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\ODY=\MTYz\MTUw\MjEw\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQy\MjI4\MjE0\MjEz\MTgy\MTg4\MjA5\MjE0\NDk=\MjI3\NjA=\MjMz\MjEw\MjE4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ2\MTc5\MTgz\MTg2\MTc5\MTY0\MTMz\MTkw\MTkx\MTY2\MTY1\MjE0\MjEz\NTc=\MTI3\NDk=\MTM3\OTk=\NjE=\MTI1\MjMz\MjEz\MzQ=\MTcw\MjQ5\MjM=\ODg=\OQ==\ODk=\MjMz\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MTgy\MTgy\MTUw\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTUw\MTUw\MjEz\MTI3\MjI5\NDQ=\NDE=\MTM3\NjQ=\MTEy\MjMz\MjEz\MTMx\ODk=\MjMx\MjE0\MjAx\MTIx\NjI=\MjMz\MjEw\MjA4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMw\MTc5\MTY1\MTg2\MTgz\MjE0\MjEz\MTc1\MTAz\MjM0\MjE0\MjE4\MTUx\MTI3\MjMz\MjEz\ODE=\NDk=\NjM=\MTY5\MTgy\MjE2\NTE=\MjMz\MjEw\MjIz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTUx\MTYz\MTYy\MTg1\MTMz\MTkw\MTg1\MTY2\MjE0\MjEz\MTkw\MTY2\MTc3\MTgy\MTMx\NjQ=\MTIw\MjMz\MjEz\OTk=\MTcy\MjAy\MTUw\NzI=\MjE1\NTI=\MjMz\MjEw\MjIw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTUx\MTkx\MTY0\MTY2\MTg1\MTY0\MTYy\MTMw\MTY2\MjE0\MjEz\MTI3\MjI5\NDQ=\NDE=\MTM3\NjQ=\MTIw\MjMz\MjEz\MTA4\MjMz\NDY=\NDE=\MTQw\NDg=\MTA=\MjMz\MjEw\MjE4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMy\MTgz\MTgx\MTc5\MTMw\MTY0\MTgz\MTgx\MTg5\MTMw\MTY2\MjE0\MjEz\MjI2\MjQy\ODg=\MjMz\MzA=\MTQ1\MA==\MjMz\MjEw\MjIz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ2\MTYz\MTg0\MTc5\MTMy\MTgz\MTgx\MTc5\MjE0\MjEz\MTk4\MjQx\NTY=\ODY=\MjEw\MTI2\Mjc=\MjMz\MjEw\MjIw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTM1\MTYz\MTgz\MTY0\MTYy\MTc5\MTY0\MTMw\MTM0\MjE0\MjEz\OTE=\MTcx\MTE3\NDE=\NTQ=\MTgz\MjI=\MjMz\MjEw\MjIx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTUx\MTY2\MTgz\MTY0\MTYy\MTg3\MTc5\MTg0\MTYy\MTY1\MjE0\MjEz\MTg=\MTY=\NTc=\MTY5\MTE=\MTUz\NTg=\MjMz\MjEw\MjIw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTI5\MTkx\MTg0\MjQ2\MTMy\MTgz\MTgx\MTc5\MTY1\MjE0\MjEz\NjQ=\MTgw\MjIw\ODY=\MjM4\MjI4\NDg=\MjMz\MjEw\MjIz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTI5\MTkx\MTg0\MTQ0\MTY0\MTgz\MTg3\MTc5\MjE0\MjEz\MjM0\NjI=\MzA=\ODY=\MTE2\MjU0\MzY=\MjMz\MjEz\MTI0\Mzk=\MTAz\MjMz\MTc1\MjE5\MTk5\MjI=\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\NTQ=\MTc4\MTUw\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MTE4\MTkw\MTUw\MjEw\MjE4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTUx\MTkx\MTY0\MTY2\MTg1\MTY0\MTYy\MjQ2\MTYx\MTkx\MTg0\MjE0\MjEz\MTYy\MTY4\MzM=\MTY5\NTc=\MTc5\OTg=\MjMz\MjEz\NDM=\NjA=\MTkx\MjE0\MTgz\MTAw\MTIy\MjMz\MjEw\MjE4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTUx\MTkx\MTY0\MTY2\MTg1\MTY0\MTYy\MjQ2\MTI5\MTkx\MTg0\MjE0\MjEw\MTk5\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTM1\MTYz\MTgz\MTY0\MTYy\MTc5\MTY0\MjQ2\MTU1\MTkx\MTg2\MTc5\MjQ2\MTYx\MTkx\MTg0\MjE0\MjEz\MTQz\NA==\MTk4\MTgy\MTQ=\NjE=\MTAx\MjMz\MjEz\OA==\MTM=\MzM=\MjAx\MjQ=\MjI=\MjQ=\MjMz\MjEw\MTk5\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTM1\MTYz\MTgz\MTY0\MTYy\MTc5\MTY0\MjQ2\MTU1\MTkx\MTg2\MTc5\MjQ2\MTI5\MTkx\MTg0\MjE0\MjEw\MjE3\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ2\MTYz\MTg0\MTc5\MjQ2\MTY0\MTgz\MTg2\MTg2\MTc1\MjQ2\MTYx\MTkx\MTg0\MjE0\MjEz\ODM=\NjE=\MTE2\NDE=\MjAz\MjQz\MTU=\MjMz\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjI0\MTUw\MjEw\MjE3\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ2\MTYz\MTg0\MTc5\MjQ2\MTY0\MTgz\MTg2\MTg2\MTc1\MjQ2\MTI5\MTkx\MTg0\MjE0\MjEw\MjE3\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMy\MTgz\MTgx\MTc5\MjQ2\MTMw\MTY0\MTgz\MTgx\MTg5\MjQ2\MTYx\MTkx\MTg0\MjE0\MjEz\MjA=\MTE3\MjQz\MTUw\MTgz\MjQ3\NTI=\MjMz\MjEw\MjE3\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMy\MTgz\MTgx\MTc5\MjQ2\MTMw\MTY0\MTgz\MTgx\MTg5\MjQ2\MTI5\MTkx\MTg0\MjE0\MjEw\MTk5\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTU4\MTkx\MTc3\MTkw\MTYx\MTgz\MTc1\MjQ2\MTY0\MTgz\MTgx\MTc5\MjQ2\MTYx\MTkx\MTg0\MjE0\MjEz\MjQ0\MTEw\MjA4\MjI=\MTA2\MjEz\NDk=\MjMz\MjEw\MTk5\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTU4\MTkx\MTc3\MTkw\MTYx\MTgz\MTc1\MjQ2\MTY0\MTgz\MTgx\MTc5\MjQ2\MTI5\MTkx\MTg0\MjE0\MjEw\MTk1\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTUx\MTY0\MTg1\MTYz\MTg0\MTc4\MjQ2\MTYy\MTkw\MTc5\MjQ2\MTYx\MTg1\MTY0\MTg2\MTc4\MjQ2\MTYx\MTkx\MTg0\MjE0\MjEz\MjUw\MjA0\MTQ4\MjE0\MjI0\MTk5\NTg=\MjMz\MjEz\MTY1\MjM=\MjEy\MTgy\OTQ=\MTAz\NjA=\MjMz\MjEz\NjA=\MA==\MjIx\MTgy\MTQy\MjE4\MTMx\MTA1\MjEw\MjIy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTc2\MTkx\MTg0\MTc4\MTQ5\MTgz\MTY0\MjE0\MjEw\MjIy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTUx\MTY3\MTYz\MTgz\MTYy\MTkx\MTgx\MjE0\MjUy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MjE0\MjE0\MjE0\MTQ0\MjE0\MjE0\MjE0\MjEy\MjE0\MjE0\MjEy\MjEx\MjE0\MjE0\MjE0\MjEw\MjE0\MjE0\MjE0\MjIz\MTUw\MTUw\ODY=\MjEw\MjE0\ODY=\MjE0\MjIz\ODY=\MTUw\ODY=\MjAw\MjE0\ODY=\MjE0\MjEz\MjE0\MjE0\MjE0\MjEw\MjIy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTI4\MTkx\MTY1\MTkx\MTgw\MTg2\MTc5\MjE0\MjE1\MjE1\MjE1\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjQz\MjE1\MjE0\MjE0\MjU0\MjE1\MjE0\MjE0\MjEy\MjE0\MjE0\MjEy\MjEx\MjE0\MjE0\MjE0\MjEw\MjE0\MjE0\MjE0\MjIz\MTUw\MTUw\ODY=\MjEw\MjE0\ODY=\MjE0\MjIz\ODY=\MTUw\ODY=\MjAw\MjE0\ODY=\MjE0\MjEz\MjE0\MjE0\MjE0\MjEw\MjIy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTI4\MTkx\MTY1\MTkx\MTgw\MTg2\MTc5\MjE0\MjE1\MjE1\MjE1\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTUz\MjE1\MjE0\MjE0\MTM1\MjE1\MjE0\MjE0\MjE1\MjE0\MjE0\MjEy\MjEz\MjE0\MjE0\MjE0\MjEw\MjE0\MjE0\MjE0\MjIz\MTUw\MTUw\ODY=\MjAw\MjE0\ODY=\MjE0\MjEy\MjE0\MjE0\MjE0\MjEw\MjIy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTI4\MTkx\MTY1\MTkx\MTgw\MTg2\MTc5\MjE0\MjE1\MjE1\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTc2\MjE1\MjE0\MjE0\MTkw\MjE1\MjE0\MjE0\MjE1\MjE0\MjE0\MjEy\MjEz\MjE0\MjE0\MjE0\MjEw\MjE0\MjE0\MjE0\MjIz\MTUw\MTUw\ODY=\MjAw\MjE0\ODY=\MjE0\MjEy\MjE0\MjE0\MjE0\MjEw\MjIy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTI4\MTkx\MTY1\MTkx\MTgw\MTg2\MTc5\MjE0\MjE1\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjM=\MjE1\MjE0\MjE0\MjE=\MjE1\MjE0\MjE0\MjE1\MjE0\MjE0\MjEy\MjEz\MjE0\MjE0\MjE0\MjEw\MjE0\MjE0\MjE0\MjIz\MTUw\MTUw\ODY=\MjAw\MjE0\ODY=\MjE0\MjEy\MjE0\MjE0\MjE0\MjEw\MjIy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTI4\MTkx\MTY1\MTkx\MTgw\MTg2\MTc5\MjE0\MjE1\MjE1\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ=\MjE1\MjE0\MjE0\MTI=\MjE1\MjE0\MjE0\MjE1\MjE0\MjE0\MjEy\MjEz\MjE0\MjE0\MjE0\MjEw\MjE0\MjE0\MjE0\MjIz\MTUw\MTUw\ODY=\MjAw\MjE0\ODY=\MjE0\MjEy\MjE0\MjE0\MjE0\MjEw\MjIy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTI4\MTkx\MTY1\MTkx\MTgw\MTg2\MTc5\MjE0\MjE1\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQz\MjEy\MjE0\MjE0\MTQx\MjEy\MjE0\MjE0\MjE1\MjE0\MjE0\MjEy\MjEz\MjE0\MjE0\MjE0\MjEw\MjE0\MjE0\MjE0\MjIz\MTUw\MTUw\ODY=\MjAw\MjE0\ODY=\MjE0\MjEy\MjE0\MjE0\MjE0\MjEw\MjIy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTI4\MTkx\MTY1\MTkx\MTgw\MTg2\MTc5\MjE0\MjE1\MjE1\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTA2\MjEy\MjE0\MjE0\MTA0\MjEy\MjE0\MjE0\MjE1\MjE0\MjE0\MjEy\MjEz\MjE0\MjE0\MjE0\MjEw\MjE0\MjE0\MjE0\MjIz\MTUw\MTUw\ODY=\MjAw\MjE0\ODY=\MjE0\MjEy\MjE0\MjE0\MjE0\MjEw\MjIy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTI4\MTkx\MTY1\MTkx\MTgw\MTg2\MTc5\MjE0\MjE1\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjM=\MjEy\MjE0\MjE0\Mjg=\MjEy\MjE0\MjE0\MjE0\MjE0\MjE0\MjIy\MjA1\MjE0\MjE0\MjE0\MjEx\MjE0\MjE0\MjE0\MjA4\MTUw\MTUw\MjE0\MjIx\ODY=\MTUw\MjE0\MjAy\ODY=\MjE0\MjE1\MTUx\MjI=\MjE0\MjE0\NjY=\MjE0\MjE0\MjE0\MjM=\MjI=\MjE0\MjE0\MTgy\MjE0\MjEw\ODY=\MTQ0\MjE1\MjE1\MjE0\MTU3\MjE1\MjM=\MjEy\MjM=\MTUx\MjE1\MjE0\MTM4\ODc=\ODY=\MjE1\MTQw\MjE1\MjE0\MjE0\MTky\ODY=\MjEy\ODY=\MTQ0\MjE1\MjE1\MjE0\MTQ0\MTUx\MjM=\MjEy\MTQ0\ODc=\MjM=\MjEy\ODM=\MjM=\MjE1\MjE0\ODA=\MjE1\MTQ4\MjEz\ODA=\MTUx\MTQ4\MjEz\ODA=\ODc=\MTQ4\MjEz\MTkz\ODY=\ODc=\MjEy\MTky\MTUw\MjE0\ODY=\MTQ0\MjE1\MjE1\MjE0\MTQ1\MjM=\MjEy\MjE0\MTM3\MTUw\NDU=\MTY5\MjAw\MjE0\ODY=\MjE0\MjE4\MjE0\MjE0\MjE0\MjEw\MjIw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTYx\MTg1\MTY0\MTg5\MTY1\MTY2\MTgz\MTgx\MTc5\MjE0\MjEw\MjIz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTI4\MTc5\MTkw\MTkx\MTgx\MTg2\MTc5\MTY1\MjE0\MjEw\MjE4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTc3\MTc5\MTYy\MTQ5\MTkw\MTkx\MTg2\MTc4\MTY0\MTc5\MTg0\MjE0\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\Mzg=\MjMz\MjEw\MjE3\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTc2\MTkx\MTg0\MTc4\MTQ0\MTkx\MTY0\MTY1\MTYy\MTQ5\MTkw\MTkx\MTg2\MTc4\MjE0\MjEw\MjA4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTg1\MTYx\MTg0\MTc5\MTY0\MjE0\MjEw\MjA4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTI4\MTgz\MTg2\MTYz\MTc5\MjE0\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTc3\MTgz\MTg3\MTc5\MjE0\MjEw\MjIy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTM0\MTg2\MTgz\MTc1\MTc5\MTY0\MTY1\MjE0\MjEw\MjE4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTU0\MTg1\MTgx\MTgz\MTg2\MTM0\MTg2\MTgz\MTc1\MTc5\MTY0\MjE0\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTUy\MTgz\MTg3\MTc5\MjE0\MjEw\MjA4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTg3\MTc1\MTQ5\MTgz\MTY0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjY=\MjEy\MjE0\MjE0\NDQ=\MjEy\MjE0\MjE0\MjE0\MjE0\MjE0\MjA4\MjQ2\MjE0\MjE0\MjE0\MjE1\MjE0\MjE0\MjE0\MTQ3\MTUw\MjE0\MjE0\MTQ0\ODY=\MjI=\MjE0\ODc=\MjI=\MjE0\MjE0\MTk=\MjE0\MjE1\MjE0\MTM4\ODY=\ODY=\MjE1\MTU5\ODY=\MjM=\ODQ=\ODQ=\MjE0\MjE0\MjE0\MjA=\MjE0\ODY=\MjE0\MjQy\MjE1\MjE0\MjE0\MjE0\MjE0\MjE0\MjE1\MjE0\MjE0\ODY=\MjE0\MjA5\MjM=\MjE1\MjE0\MjQy\MTUx\MjE0\MjE0\MjE0\MjE0\ODY=\MjE0\MjE0\MjE0\MjE0\MjE0\MjA5\MjE1\MjEy\MjE0\MjEx\MjM=\MjE1\MjE0\MjAy\MTUx\ODY=\MjE0\MTI=\MjE0\MjE0\MjE0\MTky\MTUw\MjEy\ODY=\MjEx\MTUx\MjEy\MjE0\MTQ3\MjE1\MjEy\MjE0\MTM4\MjE1\ODY=\MjE0\MjAy\ODc=\MjE0\MjE0\MjA0\MTUx\MjE0\MjE0\MTky\MjI=\NDM=\MTY5\ODQ=\MjE0\MjE0\MjE0\MjEx\MjM=\MjE1\MjE0\MjAy\MTUx\ODY=\MjE0\MTky\MjI=\NDI=\MTY5\MjAw\MjE0\ODY=\MjE0\MjIw\MjE0\MjE0\MjE0\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjIy\MTUw\MjEw\MjIz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTU5\MTg0\MTY1\MTYy\MTgz\MTg0\MTgx\MTc5\MjE0\MjEw\MjEw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTg0\MTc5\MTYx\MjE0\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTU4\MTkx\MTg0\MTYy\MjE0\MjEw\MjIw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTI5\MTg1\MTY0\MTg5\MTY1\MTY2\MTgz\MTgx\MTc5\MjE0\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMw\MTc5\MTc0\MTYy\MjE0\MjEw\MjQw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTI4\MTc5\MTkw\MTkx\MTgx\MTg2\MTc5\MjQ2\MTMz\MTkx\MTg3\MTYz\MTg2\MTgz\MTYy\MTg1\MTY0\MjQ2\MTUx\MTYz\MTYy\MTg1\MTc2\MTgz\MTY0\MTg3\MjQ2\MTg2\MTg1\MTgz\MTc4\MTkx\MTg0\MTc3\MjQ4\MjQ4\MjQ4\MjE0\MjEw\MjE4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTc2\MTkx\MTg0\MTc4\MTI4\MTc5\MTkw\MTkx\MTgx\MTg2\MTc5\MjE0\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTc2\MTgz\MTY0\MTg3\MjE0\MjEw\MjA4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTY2\MTgx\MTgz\MTg2\MTg2\MjE0\MjEy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\NQ==\MjEy\MjE0\MjE0\NjM=\MjEy\MjE0\MjE0\MjEy\MjE0\MjE0\MjIz\MTQ2\MjE0\MjE0\MjE0\MjEw\MjE0\MjE0\MjE0\MjA0\MTUw\MjE0\MjE0\MTky\MjI=\MjE5\ODY=\MjEx\MjE0\MjE0\MjE0\MjA4\MTUw\MTUw\MjE0\MjIx\ODY=\MTUw\MjE0\MjAy\ODY=\MjE0\MjE1\MTUx\MjI=\MjE0\MjE0\NjY=\MjE0\MjE0\MjE0\MjM=\MjI=\MjE0\MjE0\MTgy\ODY=\MjIw\ODY=\MTQ0\MjE1\MjE1\MjE0\MTU3\MjE1\MjM=\MjEy\MjM=\MTUx\MjE1\MjE0\MTM4\ODc=\ODY=\MjE1\MTQw\MjE1\MjE0\MjE0\MTky\MjE0\MjIz\ODY=\MTQ0\MjE1\MjE1\MjE0\MTQ0\MTUx\MjM=\MjEy\MTQ0\ODc=\MjM=\MjEy\ODM=\MjM=\MjE1\MjE0\OTM=\MjE1\MTQ4\MjEz\MjE1\MTQ4\MjEy\MjE0\NzQ=\ODc=\ODY=\MjE1\ODA=\ODc=\MTQ4\MjEz\ODA=\MjM=\MTQ4\MjEz\MTkz\ODY=\ODc=\MjEy\MTky\MjE0\MjEw\ODY=\MTQ4\MjE1\ODY=\MjE0\MTU4\MjE1\MjE0\MjE0\MTQ0\MjE1\MjE1\MjE0\MTQ1\MjE1\MjEz\MjE0\MTQ3\MjE1\MjEz\MjE0\MTQ0\ODc=\MjE=\MjEy\MTQ1\MTUx\MjEz\MjE0\MTQ3\MTUx\MjEz\MjE0\MTQ0\MjM=\MjE=\MjEy\MTU5\MjE1\MTQ2\ODU=\MTQ3\MTUx\MjEz\MjE0\MTQ0\MTUx\MTg=\MjEy\MTU5\ODc=\MTQ2\ODU=\MTQ3\MTUx\MjEz\MjE0\MTQ0\MjM=\MTg=\MjEy\MTU5\MjE1\MTQ3\ODU=\MTky\MjE0\MjEy\ODY=\MTU0\MjM=\MTUw\MjEy\MTQ0\MTUx\MjE1\MjE0\MTkz\MTUw\MTk=\MjEy\MTky\MjE0\MjE1\ODY=\MTQ2\MjE1\MjE0\MjE0\MTQw\MTUx\MjE0\MjE0\MTky\MTUw\MjE0\ODY=\MTQ2\MjE1\ODY=\MjE0\MTU5\MjM=\MTQ3\OTM=\MTM3\MjI=\MzQ=\MTY5\MTQ3\MjE0\MjA4\MjE0\ODc=\MjI=\MjE0\MjE0\MTM4\MTUw\MjE0\MjE1\MTky\MjE0\Mzk=\MTY5\MjEx\MjE0\MjA4\MjE0\MTUx\MTUw\MjA4\MjE0\MjAy\MTUw\MjE0\MjE1\MjEx\MjE0\MjEz\MjE0\MTQ3\MjE0\MjEz\MjE0\MTQ0\MjI=\MTY=\MjE0\MTQ0\MjE0\MTc=\MjE0\MjIz\MTUw\MjE0\OTE=\MjAw\MjE0\ODY=\MjE0\MjAz\MjE0\MjE0\MjE0\MjEw\MjIw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTI5\MTg1\MTY0\MTg5\MTY1\MTY2\MTgz\MTgx\MTc5\MjE0\MjEw\MjIz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTI4\MTc5\MTkw\MTkx\MTgx\MTg2\MTc5\MTY1\MjE0\MjEw\MjE4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTc3\MTc5\MTYy\MTQ5\MTkw\MTkx\MTg2\MTc4\MTY0\MTc5\MTg0\MjE0\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\Mzg=\MjMz\MjEw\MjE3\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTc2\MTkx\MTg0\MTc4\MTQ0\MTkx\MTY0\MTY1\MTYy\MTQ5\MTkw\MTkx\MTg2\MTc4\MjE0\MjEw\MjA4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTg1\MTYx\MTg0\MTc5\MTY0\MjE0\MjEw\MjA4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTI4\MTgz\MTg2\MTYz\MTc5\MjE0\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTc3\MTgz\MTg3\MTc5\MjE0\MjEw\MjIx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ1\MTc5\MTYy\MTMz\MTc5\MTY0\MTYw\MTkx\MTgx\MTc5\MjE0\MjEw\MjIy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTM0\MTg2\MTgz\MTc1\MTc5\MTY0\MTY1\MjE0\MjEw\MjE4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTU0\MTg1\MTgx\MTgz\MTg2\MTM0\MTg2\MTgz\MTc1\MTc5\MTY0\MjE0\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTUy\MTgz\MTg3\MTc5\MjE0\MjEw\MjIy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTYw\MTc5\MTkw\MTkx\MTgx\MTg2\MTc5\MjE0\MjEw\MjIz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTYw\MTc5\MTkw\MTMz\MTYy\MTgz\MTYy\MTY1\MjE0\MjEw\MjIz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTU4\MTgz\MTg0\MTc4\MTg2\MTkx\MTg0\MTc3\MjE0\MjEw\MjIz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTU1\MTgz\MTc0\MTMz\MTY2\MTc5\MTc5\MTc4\MjE0\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\OTU=\MTUw\MjEw\MjA5\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMw\MTg1\MTY0\MTY3\MTYz\MTc5\MjE0\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MTg4\NDY=\MTUw\MjEw\MTkz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMz\MTYy\MTc5\MTc5\MTY0\MTkx\MTg0\MTc3\MTMy\MTgz\MTc4\MTkx\MTYz\MTY1\MTQ5\MTg1\MTg0\MTY1\MTYy\MTgz\MTg0\MTYy\MjE0\MjEz\MjE0\MjE0\MjE0\MjE0\MjM4\NzQ=\NzQ=\MTUx\MjE0\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMw\MTc5\MTc0\MTYy\MjE0\MjEw\MjQz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTM0\MTg2\MTc5\MTgz\MTY1\MTc5\MjQ2\MTY1\MTY2\MTgz\MTYx\MTg0\MjQ2\MTgz\MTg0\MTc4\MjQ2\MTc5\MTg0\MTYy\MTc5\MTY0\MjQ2\MTc1\MTg1\MTYz\MTY0\MjQ2\MTYw\MTc5\MTkw\MTkx\MTgx\MTg2\MTc5\MjQ3\MjE0\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTYx\MTgz\MTkx\MTYy\MjE0\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTUw\MjEw\MjE4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTM0\MTY0\MTkx\MTg3\MTgz\MTY0\MTc1\MTM0\MTgz\MTY0\MTYy\MjE0\MjEw\MjIy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTkw\MTgz\MTY1\MTY1\MTkx\MTY1\MjE0\MjEw\MjE4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTI4\MTc5\MTkw\MTkx\MTgx\MTg2\MTc5\MTMz\MTc5\MTgz\MTYy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\NjE=\MjEy\MjE0\MjE0\MzY=\MjEy\MjE0\MjE0\MjEy\MjE0\MjE0\MjA4\MjQ2\MjE0\MjE0\MjE0\MjEw\MjE0\MjE0\MjE0\MjIz\MTUw\MTUw\ODY=\MjEx\ODY=\MjE0\MjE0\MTQ2\MjE0\ODY=\MjE0\MjAy\ODY=\MjE0\MjE1\MjA0\MjE0\MjE0\MjE0\MTky\MjI=\MjEx\ODY=\MjEx\MjI=\MjE0\MjE0\MjIx\MjE0\MTUx\MjE0\ODM=\MTUw\MjE1\MjE0\ODA=\ODY=\MTUx\MjE1\MjM=\MjI=\MjE1\MjE0\MjE1\MjE1\MjEy\MjE0\MTUx\MTUx\MjEy\MjE0\NzQ=\MjE0\MjE0\MjEy\MjAy\MTUw\MjE0\MjE0\MjEx\ODY=\MjEy\MjE0\MjIx\MjI=\MTQ4\MjE0\ODc=\MjE0\MjEz\MjE0\MjAy\ODY=\ODY=\MjE1\MjIx\MTUw\MTQ5\MjE0\ODc=\ODY=\MjEz\MjE0\MjAy\MTUw\ODY=\MjE1\MjEx\ODY=\MjEy\MjE0\MjIx\MjI=\MTQ4\MjE0\ODc=\MjE0\MjEz\MjE0\MjAy\ODY=\ODY=\MjE1\MjIx\MjI=\MTQ5\MjE0\ODc=\ODY=\MjEz\MjE0\MjAy\MTUw\ODY=\MjE1\MTky\ODY=\NDY=\MTY5\MjAw\MjE0\ODY=\MjE0\MTk4\MjE0\MjE0\MjE0\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMw\MTc5\MTc0\MTYy\MjE0\MjEw\MjU0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ0\MTkx\MTg0\MTkx\MTY1\MTkw\MTc5\MTc4\MjQ2\MTg2\MTg1\MTgz\MTc4\MTkx\MTg0\MTc3\MjQ3\MjQ2\MTUx\MTYz\MTYy\MTg1\MTc2\MTgz\MTY0\MTg3\MjQ2\MTkx\MTg0\MTkx\MTYy\MTkx\MTgz\MTg2\MTkx\MTcy\MTc5\MTc4\MjQ4\MjE0\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTYx\MTgz\MTkx\MTYy\MjE0\MjEw\MjIy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTYw\MTc5\MTkw\MTkx\MTgx\MTg2\MTc5\MjE0\MjEw\MTk1\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMz\MTc5\MTYy\MTM0\MTY0\MTkx\MTg3\MTgz\MTY0\MTc1\MTM0\MTgz\MTY0\MTYy\MTQ5\MTQ0\MTY0\MTgz\MTg3\MTc5\MjE0\MjEw\MjA5\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTQ0\MTY0\MTgz\MTg3\MTc5\MjE0\MjEw\MjEw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTg0\MTc5\MTYx\MjE0\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\NTQ=\MTE3\MjI=\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\ODY=\MTUy\MTUw\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MTc0\OTQ=\MTUw\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTc3\MTgz\MTg3\MTc5\MjE0\MjEw\MjIx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ1\MTc5\MTYy\MTMz\MTc5\MTY0\MTYw\MTkx\MTgx\MTc5\MjE0\MjEw\MjE4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTI4\MTkx\MTY0\MTYy\MTYz\MTgz\MTg2\MTMx\MTY1\MTc5\MTY0\MjE0\MjEw\MjIz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMz\MTc5\MTYy\MTU3\MTc5\MTc1\MTMx\MTY2\MjE0\MjEw\MjEy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTYx\MjE0\MjEw\MjIx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMz\MTc5\MTYy\MTU3\MTc5\MTc1\MTQ2\MTg1\MTYx\MTg0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\NDI=\MjEy\MjE0\MjE0\MjEx\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MjIy\MjA1\MjE0\MjE0\MjE0\MjEx\MjE0\MjE0\MjE0\MjA4\MTUw\MTUw\MjE0\MjIx\ODY=\MTUw\MjE0\MjAy\ODY=\MjE0\MjE1\MTUx\MjI=\MjE0\MjE0\NjY=\MjE0\MjE0\MjE0\MjM=\MjI=\MjE0\MjE0\MTgy\MjE0\MjEw\ODY=\MTQ0\MjE1\MjE1\MjE0\MTU3\MjE1\MjM=\MjEy\MjM=\MTUx\MjE1\MjE0\MTM4\ODc=\ODY=\MjE1\MTQw\MjE1\MjE0\MjE0\MTky\ODY=\MjEy\ODY=\MTQ0\MjE1\MjE1\MjE0\MTQ0\MTUx\MjM=\MjEy\MTQ0\ODc=\MjM=\MjEy\ODM=\MjM=\MjE1\MjE0\ODA=\MjE1\MTQ4\MjEz\ODA=\MTUx\MTQ4\MjEz\ODA=\ODc=\MTQ4\MjEz\MTkz\ODY=\ODc=\MjEy\MTky\MTUw\MjE0\ODY=\MTQ0\MjE1\MjE1\MjE0\MTQ1\MjM=\MjEy\MjE0\MTM3\MTUw\NDU=\MTY5\MjAw\MjE0\ODY=\MjE0\MjE4\MjE0\MjE0\MjE0\MjEw\MjIw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTYx\MTg1\MTY0\MTg5\MTY1\MTY2\MTgz\MTgx\MTc5\MjE0\MjEw\MjIz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTI4\MTc5\MTkw\MTkx\MTgx\MTg2\MTc5\MTY1\MjE0\MjEw\MjE4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTc3\MTc5\MTYy\MTQ5\MTkw\MTkx\MTg2\MTc4\MTY0\MTc5\MTg0\MjE0\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\Mzg=\MjMz\MjEw\MjE3\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTc2\MTkx\MTg0\MTc4\MTQ0\MTkx\MTY0\MTY1\MTYy\MTQ5\MTkw\MTkx\MTg2\MTc4\MjE0\MjEw\MjA4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTg1\MTYx\MTg0\MTc5\MTY0\MjE0\MjEw\MjA4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTI4\MTgz\MTg2\MTYz\MTc5\MjE0\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTc3\MTgz\MTg3\MTc5\MjE0\MjEw\MjIy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTM0\MTg2\MTgz\MTc1\MTc5\MTY0\MTY1\MjE0\MjEw\MjE4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTU0\MTg1\MTgx\MTgz\MTg2\MTM0\MTg2\MTgz\MTc1\MTc5\MTY0\MjE0\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTUy\MTgz\MTg3\MTc5\MjE0\MjEw\MjA4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTg3\MTc1\MTQ5\MTgz\MTY0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjA5\MjEz\MjE0\MjE0\MjI3\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MjA4\MjQ2\MjE0\MjE0\MjE0\MjE1\MjE0\MjE0\MjE0\MTQ3\MTUw\MjE0\MjE0\MTQ0\ODY=\MjI=\MjE0\ODc=\MjI=\MjE0\MjE0\MTk=\MjE0\MjE1\MjE0\MTM4\ODY=\ODY=\MjE1\MTU5\ODY=\MjM=\ODQ=\ODQ=\MjE0\MjE0\MjE0\MjA=\MjE0\ODY=\MjE0\MjQy\MjE1\MjE0\MjE0\MjE0\MjE0\MjE0\MjE1\MjE0\MjE0\ODY=\MjE0\MjA5\MjM=\MjE1\MjE0\MjQy\MTUx\MjE0\MjE0\MjE0\MjE0\ODY=\MjE0\MjE0\MjE0\MjE0\MjE0\MjA5\MjE1\MjEy\MjE0\MjEx\MjM=\MjE1\MjE0\MjAy\MTUx\ODY=\MjE0\MTI=\MjE0\MjE0\MjE0\MTky\MTUw\MjEy\ODY=\MjEx\MTUx\MjEy\MjE0\MTQ3\MjE1\MjEy\MjE0\MTM4\MjE1\ODY=\MjE0\MjAy\ODc=\MjE0\MjE0\MjA0\MTUx\MjE0\MjE0\MTky\MjI=\NDM=\MTY5\ODQ=\MjE0\MjE0\MjE0\MjEx\MjM=\MjE1\MjE0\MjAy\MTUx\ODY=\MjE0\MTky\MjI=\NDI=\MTY5\MjAw\MjE0\ODY=\MjE0\MjIw\MjE0\MjE0\MjE0\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjIy\MTUw\MjEw\MjIz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTU5\MTg0\MTY1\MTYy\MTgz\MTg0\MTgx\MTc5\MjE0\MjEw\MjEw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTg0\MTc5\MTYx\MjE0\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTU4\MTkx\MTg0\MTYy\MjE0\MjEw\MjIw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTI5\MTg1\MTY0\MTg5\MTY1\MTY2\MTgz\MTgx\MTc5\MjE0\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMw\MTc5\MTc0\MTYy\MjE0\MjEw\MjQw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTI4\MTc5\MTkw\MTkx\MTgx\MTg2\MTc5\MjQ2\MTMz\MTkx\MTg3\MTYz\MTg2\MTgz\MTYy\MTg1\MTY0\MjQ2\MTUx\MTYz\MTYy\MTg1\MTc2\MTgz\MTY0\MTg3\MjQ2\MTg2\MTg1\MTgz\MTc4\MTkx\MTg0\MTc3\MjQ4\MjQ4\MjQ4\MjE0\MjEw\MjE4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTc2\MTkx\MTg0\MTc4\MTI4\MTc5\MTkw\MTkx\MTgx\MTg2\MTc5\MjE0\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTc2\MTgz\MTY0\MTg3\MjE0\MjEw\MjA4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTY2\MTgx\MTgz\MTg2\MTg2\MjE0\MjEy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE2\MjEz\MjE0\MjE0\MjQy\MjEz\MjE0\MjE0\MjEy\MjE0\MjE0\MjIz\MTQ2\MjE0\MjE0\MjE0\MjEw\MjE0\MjE0\MjE0\MjA0\MTUw\MjE0\MjE0\MTky\MjI=\MjE5\ODY=\MjEx\MjE0\MjE0\MjE0\MjA4\MTUw\MTUw\MjE0\MjIx\ODY=\MTUw\MjE0\MjAy\ODY=\MjE0\MjE1\MTUx\MjI=\MjE0\MjE0\NjY=\MjE0\MjE0\MjE0\MjM=\MjI=\MjE0\MjE0\MTgy\ODY=\MjIw\ODY=\MTQ0\MjE1\MjE1\MjE0\MTU3\MjE1\MjM=\MjEy\MjM=\MTUx\MjE1\MjE0\MTM4\ODc=\ODY=\MjE1\MTQw\MjE1\MjE0\MjE0\MTky\MjE0\MjIz\ODY=\MTQ0\MjE1\MjE1\MjE0\MTQ0\MTUx\MjM=\MjEy\MTQ0\ODc=\MjM=\MjEy\ODM=\MjM=\MjE1\MjE0\OTM=\MjE1\MTQ4\MjEz\MjE1\MTQ4\MjEy\MjE0\NzQ=\ODc=\ODY=\MjE1\ODA=\ODc=\MTQ4\MjEz\ODA=\MjM=\MTQ4\MjEz\MTkz\ODY=\ODc=\MjEy\MTky\MjE0\MjEw\ODY=\MTQ4\MjE1\ODY=\MjE0\MTU4\MjE1\MjE0\MjE0\MTQ0\MjE1\MjE1\MjE0\MTQ1\MjE1\MjEz\MjE0\MTQ3\MjE1\MjEz\MjE0\MTQ0\ODc=\MjE=\MjEy\MTQ1\MTUx\MjEz\MjE0\MTQ3\MTUx\MjEz\MjE0\MTQ0\MjM=\MjE=\MjEy\MTU5\MjE1\MTQ2\ODU=\MTQ3\MTUx\MjEz\MjE0\MTQ0\MTUx\MTg=\MjEy\MTU5\ODc=\MTQ2\ODU=\MTQ3\MTUx\MjEz\MjE0\MTQ0\MjM=\MTg=\MjEy\MTU5\MjE1\MTQ3\ODU=\MTky\MjE0\MjEy\ODY=\MTU0\MjM=\MTUw\MjEy\MTQ0\MTUx\MjE1\MjE0\MTkz\MTUw\MTk=\MjEy\MTky\MjE0\MjE1\ODY=\MTQ2\MjE1\MjE0\MjE0\MTQw\MTUx\MjE0\MjE0\MTky\MTUw\MjE0\ODY=\MTQ2\MjE1\ODY=\MjE0\MTU5\MjM=\MTQ3\OTM=\MTM3\MjI=\MzQ=\MTY5\MTQ3\MjE0\MjA4\MjE0\ODc=\MjI=\MjE0\MjE0\MTM4\MTUw\MjE0\MjE1\MTky\MjE0\Mzk=\MTY5\MjEx\MjE0\MjA4\MjE0\MTUx\MTUw\MjA4\MjE0\MjAy\MTUw\MjE0\MjE1\MjEx\MjE0\MjEz\MjE0\MTQ3\MjE0\MjEz\MjE0\MTQ0\MjI=\MTY=\MjE0\MTQ0\MjE0\MTc=\MjE0\MjIz\MTUw\MjE0\OTE=\MjAw\MjE0\ODY=\MjE0\MjAz\MjE0\MjE0\MjE0\MjEw\MjIw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTI5\MTg1\MTY0\MTg5\MTY1\MTY2\MTgz\MTgx\MTc5\MjE0\MjEw\MjIz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTI4\MTc5\MTkw\MTkx\MTgx\MTg2\MTc5\MTY1\MjE0\MjEw\MjE4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTc3\MTc5\MTYy\MTQ5\MTkw\MTkx\MTg2\MTc4\MTY0\MTc5\MTg0\MjE0\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\Mzg=\MjMz\MjEw\MjE3\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTc2\MTkx\MTg0\MTc4\MTQ0\MTkx\MTY0\MTY1\MTYy\MTQ5\MTkw\MTkx\MTg2\MTc4\MjE0\MjEw\MjA4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTg1\MTYx\MTg0\MTc5\MTY0\MjE0\MjEw\MjA4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTI4\MTgz\MTg2\MTYz\MTc5\MjE0\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTc3\MTgz\MTg3\MTc5\MjE0\MjEw\MjIx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ1\MTc5\MTYy\MTMz\MTc5\MTY0\MTYw\MTkx\MTgx\MTc5\MjE0\MjEw\MjIy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTM0\MTg2\MTgz\MTc1\MTc5\MTY0\MTY1\MjE0\MjEw\MjE4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTU0\MTg1\MTgx\MTgz\MTg2\MTM0\MTg2\MTgz\MTc1\MTc5\MTY0\MjE0\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTUy\MTgz\MTg3\MTc5\MjE0\MjEw\MjIy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTYw\MTc5\MTkw\MTkx\MTgx\MTg2\MTc5\MjE0\MjEw\MjIz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTYw\MTc5\MTkw\MTMz\MTYy\MTgz\MTYy\MTY1\MjE0\MjEw\MjIz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTU4\MTgz\MTg0\MTc4\MTg2\MTkx\MTg0\MTc3\MjE0\MjEw\MjIz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTU1\MTgz\MTc0\MTMz\MTY2\MTc5\MTc5\MTc4\MjE0\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\OTU=\MTUw\MjEw\MjA5\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMw\MTg1\MTY0\MTY3\MTYz\MTc5\MjE0\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MTg4\NDY=\MTUw\MjEw\MTkz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMz\MTYy\MTc5\MTc5\MTY0\MTkx\MTg0\MTc3\MTMy\MTgz\MTc4\MTkx\MTYz\MTY1\MTQ5\MTg1\MTg0\MTY1\MTYy\MTgz\MTg0\MTYy\MjE0\MjEz\MjE0\MjE0\MjE0\MjE0\MjM4\NzQ=\NzQ=\MTUx\MjE0\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMw\MTc5\MTc0\MTYy\MjE0\MjEw\MjQz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTM0\MTg2\MTc5\MTgz\MTY1\MTc5\MjQ2\MTY1\MTY2\MTgz\MTYx\MTg0\MjQ2\MTgz\MTg0\MTc4\MjQ2\MTc5\MTg0\MTYy\MTc5\MTY0\MjQ2\MTc1\MTg1\MTYz\MTY0\MjQ2\MTYw\MTc5\MTkw\MTkx\MTgx\MTg2\MTc5\MjQ3\MjE0\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTYx\MTgz\MTkx\MTYy\MjE0\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTUw\MjEw\MjE4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTM0\MTY0\MTkx\MTg3\MTgz\MTY0\MTc1\MTM0\MTgz\MTY0\MTYy\MjE0\MjEw\MjIy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTkw\MTgz\MTY1\MTY1\MTkx\MTY1\MjE0\MjEw\MjE4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTI4\MTc5\MTkw\MTkx\MTgx\MTg2\MTc5\MTMz\MTc5\MTgz\MTYy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjQw\MjEz\MjE0\MjE0\MjUx\MjEz\MjE0\MjE0\MjEy\MjE0\MjE0\MjA4\MjQ2\MjE0\MjE0\MjE0\MjEw\MjE0\MjE0\MjE0\MjIz\MTUw\MTUw\ODY=\MjEx\ODY=\MjE0\MjE0\MTQ2\MjE0\ODY=\MjE0\MjAy\ODY=\MjE0\MjE1\MjA0\MjE0\MjE0\MjE0\MTky\MjI=\MjEx\ODY=\MjEx\MjI=\MjE0\MjE0\MjIx\MjE0\MTUx\MjE0\ODM=\MTUw\MjE1\MjE0\ODA=\ODY=\MTUx\MjE1\MjM=\MjI=\MjE1\MjE0\MjE1\MjE1\MjEy\MjE0\MTUx\MTUx\MjEy\MjE0\NzQ=\MjE0\MjE0\MjEy\MjAy\MTUw\MjE0\MjE0\MjEx\ODY=\MjEy\MjE0\MjIx\MjI=\MTQ4\MjE0\ODc=\MjE0\MjEz\MjE0\MjAy\ODY=\ODY=\MjE1\MjIx\MTUw\MTQ5\MjE0\ODc=\ODY=\MjEz\MjE0\MjAy\MTUw\ODY=\MjE1\MjEx\ODY=\MjEy\MjE0\MjIx\MjI=\MTQ4\MjE0\ODc=\MjE0\MjEz\MjE0\MjAy\ODY=\ODY=\MjE1\MjIx\MjI=\MTQ5\MjE0\ODc=\ODY=\MjEz\MjE0\MjAy\MTUw\ODY=\MjE1\MTky\ODY=\NDY=\MTY5\MjAw\MjE0\ODY=\MjE0\MTk4\MjE0\MjE0\MjE0\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMw\MTc5\MTc0\MTYy\MjE0\MjEw\MjU0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ0\MTkx\MTg0\MTkx\MTY1\MTkw\MTc5\MTc4\MjQ2\MTg2\MTg1\MTgz\MTc4\MTkx\MTg0\MTc3\MjQ3\MjQ2\MTUx\MTYz\MTYy\MTg1\MTc2\MTgz\MTY0\MTg3\MjQ2\MTkx\MTg0\MTkx\MTYy\MTkx\MTgz\MTg2\MTkx\MTcy\MTc5\MTc4\MjQ4\MjE0\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTYx\MTgz\MTkx\MTYy\MjE0\MjEw\MjIy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTYw\MTc5\MTkw\MTkx\MTgx\MTg2\MTc5\MjE0\MjEw\MTk1\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMz\MTc5\MTYy\MTM0\MTY0\MTkx\MTg3\MTgz\MTY0\MTc1\MTM0\MTgz\MTY0\MTYy\MTQ5\MTQ0\MTY0\MTgz\MTg3\MTc5\MjE0\MjEw\MjA5\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTQ0\MTY0\MTgz\MTg3\MTc5\MjE0\MjEw\MjEw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTg0\MTc5\MTYx\MjE0\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MTU0\MTE3\MjI=\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTUy\MTUw\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MTU4\OTQ=\MTUw\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTc3\MTgz\MTg3\MTc5\MjE0\MjEw\MjIx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ1\MTc5\MTYy\MTMz\MTc5\MTY0\MTYw\MTkx\MTgx\MTc5\MjE0\MjEw\MjE4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTI4\MTkx\MTY0\MTYy\MTYz\MTgz\MTg2\MTMx\MTY1\MTc5\MTY0\MjE0\MjEw\MjIz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMz\MTc5\MTYy\MTU3\MTc5\MTc1\MTMx\MTY2\MjE0\MjEw\MjEy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTYx\MjE0\MjEw\MjIx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMz\MTc5\MTYy\MTU3\MTc5\MTc1\MTQ2\MTg1\MTYx\MTg0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjI1\MjEz\MjE0\MjE0\MTUw\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MjIy\MjA1\MjE0\MjE0\MjE0\MjEx\MjE0\MjE0\MjE0\MjA4\MTUw\MTUw\MjE0\MjIx\ODY=\MTUw\MjE0\MjAy\ODY=\MjE0\MjE1\MTUx\MjI=\MjE0\MjE0\NjY=\MjE0\MjE0\MjE0\MjM=\MjI=\MjE0\MjE0\MTgy\MjE0\MjEw\ODY=\MTQ0\MjE1\MjE1\MjE0\MTU3\MjE1\MjM=\MjEy\MjM=\MTUx\MjE1\MjE0\MTM4\ODc=\ODY=\MjE1\MTQw\MjE1\MjE0\MjE0\MTky\ODY=\MjEy\ODY=\MTQ0\MjE1\MjE1\MjE0\MTQ0\MTUx\MjM=\MjEy\MTQ0\ODc=\MjM=\MjEy\ODM=\MjM=\MjE1\MjE0\ODA=\MjE1\MTQ4\MjEz\ODA=\MTUx\MTQ4\MjEz\ODA=\ODc=\MTQ4\MjEz\MTkz\ODY=\ODc=\MjEy\MTky\MTUw\MjE0\ODY=\MTQ0\MjE1\MjE1\MjE0\MTQ1\MjM=\MjEy\MjE0\MTM3\MTUw\NDU=\MTY5\MjAw\MjE0\ODY=\MjE0\MjE4\MjE0\MjE0\MjE0\MjEw\MjIw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTYx\MTg1\MTY0\MTg5\MTY1\MTY2\MTgz\MTgx\MTc5\MjE0\MjEw\MjIz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTI4\MTc5\MTkw\MTkx\MTgx\MTg2\MTc5\MTY1\MjE0\MjEw\MjE4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTc3\MTc5\MTYy\MTQ5\MTkw\MTkx\MTg2\MTc4\MTY0\MTc5\MTg0\MjE0\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\Mzg=\MjMz\MjEw\MjE3\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTc2\MTkx\MTg0\MTc4\MTQ0\MTkx\MTY0\MTY1\MTYy\MTQ5\MTkw\MTkx\MTg2\MTc4\MjE0\MjEw\MjA4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTg1\MTYx\MTg0\MTc5\MTY0\MjE0\MjEw\MjA4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTI4\MTgz\MTg2\MTYz\MTc5\MjE0\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTc3\MTgz\MTg3\MTc5\MjE0\MjEw\MjIy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTM0\MTg2\MTgz\MTc1\MTc5\MTY0\MTY1\MjE0\MjEw\MjE4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTU0\MTg1\MTgx\MTgz\MTg2\MTM0\MTg2\MTgz\MTc1\MTc5\MTY0\MjE0\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTUy\MTgz\MTg3\MTc5\MjE0\MjEw\MjA4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTg3\MTc1\MTQ5\MTgz\MTY0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ4\MjEz\MjE0\MjE0\MTY2\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MjA4\MjQ2\MjE0\MjE0\MjE0\MjE1\MjE0\MjE0\MjE0\MTQ3\MTUw\MjE0\MjE0\MTQ0\ODY=\MjI=\MjE0\ODc=\MjI=\MjE0\MjE0\MTk=\MjE0\MjE1\MjE0\MTM4\ODY=\ODY=\MjE1\MTU5\ODY=\MjM=\ODQ=\ODQ=\MjE0\MjE0\MjE0\MjA=\MjE0\ODY=\MjE0\MjQy\MjE1\MjE0\MjE0\MjE0\MjE0\MjE0\MjE1\MjE0\MjE0\ODY=\MjE0\MjA5\MjM=\MjE1\MjE0\MjQy\MTUx\MjE0\MjE0\MjE0\MjE0\ODY=\MjE0\MjE0\MjE0\MjE0\MjE0\MjA5\MjE1\MjEy\MjE0\MjEx\MjM=\MjE1\MjE0\MjAy\MTUx\ODY=\MjE0\MTI=\MjE0\MjE0\MjE0\MTky\MTUw\MjEy\ODY=\MjEx\MTUx\MjEy\MjE0\MTQ3\MjE1\MjEy\MjE0\MTM4\MjE1\ODY=\MjE0\MjAy\ODc=\MjE0\MjE0\MjA0\MTUx\MjE0\MjE0\MTky\MjI=\NDM=\MTY5\ODQ=\MjE0\MjE0\MjE0\MjEx\MjM=\MjE1\MjE0\MjAy\MTUx\ODY=\MjE0\MTky\MjI=\NDI=\MTY5\MjAw\MjE0\ODY=\MjE0\MjIw\MjE0\MjE0\MjE0\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjIy\MTUw\MjEw\MjIz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTU5\MTg0\MTY1\MTYy\MTgz\MTg0\MTgx\MTc5\MjE0\MjEw\MjEw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTg0\MTc5\MTYx\MjE0\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTU4\MTkx\MTg0\MTYy\MjE0\MjEw\MjIw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTI5\MTg1\MTY0\MTg5\MTY1\MTY2\MTgz\MTgx\MTc5\MjE0\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMw\MTc5\MTc0\MTYy\MjE0\MjEw\MjQw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTI4\MTc5\MTkw\MTkx\MTgx\MTg2\MTc5\MjQ2\MTMz\MTkx\MTg3\MTYz\MTg2\MTgz\MTYy\MTg1\MTY0\MjQ2\MTUx\MTYz\MTYy\MTg1\MTc2\MTgz\MTY0\MTg3\MjQ2\MTg2\MTg1\MTgz\MTc4\MTkx\MTg0\MTc3\MjQ4\MjQ4\MjQ4\MjE0\MjEw\MjE4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTc2\MTkx\MTg0\MTc4\MTI4\MTc5\MTkw\MTkx\MTgx\MTg2\MTc5\MjE0\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTc2\MTgz\MTY0\MTg3\MjE0\MjEw\MjA4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTY2\MTgx\MTgz\MTg2\MTg2\MjE0\MjEy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTU5\MjEz\MjE0\MjE0\MTM3\MjEz\MjE0\MjE0\MjEy\MjE0\MjE0\MjIz\MTQ2\MjE0\MjE0\MjE0\MjEw\MjE0\MjE0\MjE0\MjA0\MTUw\MjE0\MjE0\MTky\MjI=\MjE5\ODY=\MjEx\MjE0\MjE0\MjE0\MjA4\MTUw\MTUw\MjE0\MjIx\ODY=\MTUw\MjE0\MjAy\ODY=\MjE0\MjE1\MTUx\MjI=\MjE0\MjE0\NjY=\MjE0\MjE0\MjE0\MjM=\MjI=\MjE0\MjE0\MTgy\ODY=\MjIw\ODY=\MTQ0\MjE1\MjE1\MjE0\MTU3\MjE1\MjM=\MjEy\MjM=\MTUx\MjE1\MjE0\MTM4\ODc=\ODY=\MjE1\MTQw\MjE1\MjE0\MjE0\MTky\MjE0\MjIz\ODY=\MTQ0\MjE1\MjE1\MjE0\MTQ0\MTUx\MjM=\MjEy\MTQ0\ODc=\MjM=\MjEy\ODM=\MjM=\MjE1\MjE0\OTM=\MjE1\MTQ4\MjEz\MjE1\MTQ4\MjEy\MjE0\NzQ=\ODc=\ODY=\MjE1\ODA=\ODc=\MTQ4\MjEz\ODA=\MjM=\MTQ4\MjEz\MTkz\ODY=\ODc=\MjEy\MTky\MjE0\MjEw\ODY=\MTQ4\MjE1\ODY=\MjE0\MTU4\MjE1\MjE0\MjE0\MTQ0\MjE1\MjE1\MjE0\MTQ1\MjE1\MjEz\MjE0\MTQ3\MjE1\MjEz\MjE0\MTQ0\ODc=\MjE=\MjEy\MTQ1\MTUx\MjEz\MjE0\MTQ3\MTUx\MjEz\MjE0\MTQ0\MjM=\MjE=\MjEy\MTU5\MjE1\MTQ2\ODU=\MTQ3\MTUx\MjEz\MjE0\MTQ0\MTUx\MTg=\MjEy\MTU5\ODc=\MTQ2\ODU=\MTQ3\MTUx\MjEz\MjE0\MTQ0\MjM=\MTg=\MjEy\MTU5\MjE1\MTQ3\ODU=\MTky\MjE0\MjEy\ODY=\MTU0\MjM=\MTUw\MjEy\MTQ0\MTUx\MjE1\MjE0\MTkz\MTUw\MTk=\MjEy\MTky\MjE0\MjE1\ODY=\MTQ2\MjE1\MjE0\MjE0\MTQw\MTUx\MjE0\MjE0\MTky\MTUw\MjE0\ODY=\MTQ2\MjE1\ODY=\MjE0\MTU5\MjM=\MTQ3\OTM=\MTM3\MjI=\MzQ=\MTY5\MTQ3\MjE0\MjA4\MjE0\ODc=\MjI=\MjE0\MjE0\MTM4\MTUw\MjE0\MjE1\MTky\MjE0\Mzk=\MTY5\MjEx\MjE0\MjA4\MjE0\MTUx\MTUw\MjA4\MjE0\MjAy\MTUw\MjE0\MjE1\MjEx\MjE0\MjEz\MjE0\MTQ3\MjE0\MjEz\MjE0\MTQ0\MjI=\MTY=\MjE0\MTQ0\MjE0\MTc=\MjE0\MjIz\MTUw\MjE0\OTE=\MjAw\MjE0\ODY=\MjE0\MjAz\MjE0\MjE0\MjE0\MjEw\MjIw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTI5\MTg1\MTY0\MTg5\MTY1\MTY2\MTgz\MTgx\MTc5\MjE0\MjEw\MjIz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTI4\MTc5\MTkw\MTkx\MTgx\MTg2\MTc5\MTY1\MjE0\MjEw\MjE4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTc3\MTc5\MTYy\MTQ5\MTkw\MTkx\MTg2\MTc4\MTY0\MTc5\MTg0\MjE0\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\Mzg=\MjMz\MjEw\MjE3\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTc2\MTkx\MTg0\MTc4\MTQ0\MTkx\MTY0\MTY1\MTYy\MTQ5\MTkw\MTkx\MTg2\MTc4\MjE0\MjEw\MjA4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTg1\MTYx\MTg0\MTc5\MTY0\MjE0\MjEw\MjA4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTI4\MTgz\MTg2\MTYz\MTc5\MjE0\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTc3\MTgz\MTg3\MTc5\MjE0\MjEw\MjIx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ1\MTc5\MTYy\MTMz\MTc5\MTY0\MTYw\MTkx\MTgx\MTc5\MjE0\MjEw\MjIy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTM0\MTg2\MTgz\MTc1\MTc5\MTY0\MTY1\MjE0\MjEw\MjE4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTU0\MTg1\MTgx\MTgz\MTg2\MTM0\MTg2\MTgz\MTc1\MTc5\MTY0\MjE0\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTUy\MTgz\MTg3\MTc5\MjE0\MjEw\MjIy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTYw\MTc5\MTkw\MTkx\MTgx\MTg2\MTc5\MjE0\MjEw\MjIz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTYw\MTc5\MTkw\MTMz\MTYy\MTgz\MTYy\MTY1\MjE0\MjEw\MjIz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTU4\MTgz\MTg0\MTc4\MTg2\MTkx\MTg0\MTc3\MjE0\MjEw\MjIz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTU1\MTgz\MTc0\MTMz\MTY2\MTc5\MTc5\MTc4\MjE0\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\OTU=\MTUw\MjEw\MjA5\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMw\MTg1\MTY0\MTY3\MTYz\MTc5\MjE0\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MTg4\NDY=\MTUw\MjEw\MTkz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMz\MTYy\MTc5\MTc5\MTY0\MTkx\MTg0\MTc3\MTMy\MTgz\MTc4\MTkx\MTYz\MTY1\MTQ5\MTg1\MTg0\MTY1\MTYy\MTgz\MTg0\MTYy\MjE0\MjEz\MjE0\MjE0\MjE0\MjE0\MjM4\NzQ=\NzQ=\MTUx\MjE0\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMw\MTc5\MTc0\MTYy\MjE0\MjEw\MjQz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTM0\MTg2\MTc5\MTgz\MTY1\MTc5\MjQ2\MTY1\MTY2\MTgz\MTYx\MTg0\MjQ2\MTgz\MTg0\MTc4\MjQ2\MTc5\MTg0\MTYy\MTc5\MTY0\MjQ2\MTc1\MTg1\MTYz\MTY0\MjQ2\MTYw\MTc5\MTkw\MTkx\MTgx\MTg2\MTc5\MjQ3\MjE0\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTYx\MTgz\MTkx\MTYy\MjE0\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTUw\MjEw\MjE4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTM0\MTY0\MTkx\MTg3\MTgz\MTY0\MTc1\MTM0\MTgz\MTY0\MTYy\MjE0\MjEw\MjIy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTkw\MTgz\MTY1\MTY1\MTkx\MTY1\MjE0\MjEw\MjE4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTI4\MTc5\MTkw\MTkx\MTgx\MTg2\MTc5\MTMz\MTc5\MTgz\MTYy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTgz\MjEz\MjE0\MjE0\MTkw\MjEz\MjE0\MjE0\MjEy\MjE0\MjE0\MjA4\MjQ2\MjE0\MjE0\MjE0\MjEw\MjE0\MjE0\MjE0\MjIz\MTUw\MTUw\ODY=\MjEx\ODY=\MjE0\MjE0\MTQ2\MjE0\ODY=\MjE0\MjAy\ODY=\MjE0\MjE1\MjA0\MjE0\MjE0\MjE0\MTky\MjI=\MjEx\ODY=\MjEx\MjI=\MjE0\MjE0\MjIx\MjE0\MTUx\MjE0\ODM=\MTUw\MjE1\MjE0\ODA=\ODY=\MTUx\MjE1\MjM=\MjI=\MjE1\MjE0\MjE1\MjE1\MjEy\MjE0\MTUx\MTUx\MjEy\MjE0\NzQ=\MjE0\MjE0\MjEy\MjAy\MTUw\MjE0\MjE0\MjEx\ODY=\MjEy\MjE0\MjIx\MjI=\MTQ4\MjE0\ODc=\MjE0\MjEz\MjE0\MjAy\ODY=\ODY=\MjE1\MjIx\MTUw\MTQ5\MjE0\ODc=\ODY=\MjEz\MjE0\MjAy\MTUw\ODY=\MjE1\MjEx\ODY=\MjEy\MjE0\MjIx\MjI=\MTQ4\MjE0\ODc=\MjE0\MjEz\MjE0\MjAy\ODY=\ODY=\MjE1\MjIx\MjI=\MTQ5\MjE0\ODc=\ODY=\MjEz\MjE0\MjAy\MTUw\ODY=\MjE1\MTky\ODY=\NDY=\MTY5\MjAw\MjE0\ODY=\MjE0\MTk4\MjE0\MjE0\MjE0\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMw\MTc5\MTc0\MTYy\MjE0\MjEw\MjU0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ0\MTkx\MTg0\MTkx\MTY1\MTkw\MTc5\MTc4\MjQ2\MTg2\MTg1\MTgz\MTc4\MTkx\MTg0\MTc3\MjQ3\MjQ2\MTUx\MTYz\MTYy\MTg1\MTc2\MTgz\MTY0\MTg3\MjQ2\MTkx\MTg0\MTkx\MTYy\MTkx\MTgz\MTg2\MTkx\MTcy\MTc5\MTc4\MjQ4\MjE0\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTYx\MTgz\MTkx\MTYy\MjE0\MjEw\MjIy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTYw\MTc5\MTkw\MTkx\MTgx\MTg2\MTc5\MjE0\MjEw\MTk1\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMz\MTc5\MTYy\MTM0\MTY0\MTkx\MTg3\MTgz\MTY0\MTc1\MTM0\MTgz\MTY0\MTYy\MTQ5\MTQ0\MTY0\MTgz\MTg3\MTc5\MjE0\MjEw\MjA5\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTQ0\MTY0\MTgz\MTg3\MTc5\MjE0\MjEw\MjEw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTg0\MTc5\MTYx\MjE0\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\ODY=\MTQz\MTUw\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTU1\MTUw\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MTgy\OTA=\MTUw\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTc3\MTgz\MTg3\MTc5\MjE0\MjEw\MjIx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ1\MTc5\MTYy\MTMz\MTc5\MTY0\MTYw\MTkx\MTgx\MTc5\MjE0\MjEw\MjE4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTI4\MTkx\MTY0\MTYy\MTYz\MTgz\MTg2\MTMx\MTY1\MTc5\MTY0\MjE0\MjEw\MjIz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMz\MTc5\MTYy\MTU3\MTc5\MTc1\MTMx\MTY2\MjE0\MjEw\MjEy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTYx\MjE0\MjEw\MjIx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMz\MTc5\MTYy\MTU3\MTc5\MTc1\MTQ2\MTg1\MTYx\MTg0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTY0\MjEz\MjE0\MjE0\MTcz\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MjIy\MjA1\MjE0\MjE0\MjE0\MjEx\MjE0\MjE0\MjE0\MjA4\MTUw\MTUw\MjE0\MjIx\ODY=\MTUw\MjE0\MjAy\ODY=\MjE0\MjE1\MTUx\MjI=\MjE0\MjE0\NjY=\MjE0\MjE0\MjE0\MjM=\MjI=\MjE0\MjE0\MTgy\MjE0\MjEw\ODY=\MTQ0\MjE1\MjE1\MjE0\MTU3\MjE1\MjM=\MjEy\MjM=\MTUx\MjE1\MjE0\MTM4\ODc=\ODY=\MjE1\MTQw\MjE1\MjE0\MjE0\MTky\ODY=\MjEy\ODY=\MTQ0\MjE1\MjE1\MjE0\MTQ0\MTUx\MjM=\MjEy\MTQ0\ODc=\MjM=\MjEy\ODM=\MjM=\MjE1\MjE0\ODA=\MjE1\MTQ4\MjEz\ODA=\MTUx\MTQ4\MjEz\ODA=\ODc=\MTQ4\MjEz\MTkz\ODY=\ODc=\MjEy\MTky\MTUw\MjE0\ODY=\MTQ0\MjE1\MjE1\MjE0\MTQ1\MjM=\MjEy\MjE0\MTM3\MTUw\NDU=\MTY5\MjAw\MjE0\ODY=\MjE0\MjE4\MjE0\MjE0\MjE0\MjEw\MjIw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTYx\MTg1\MTY0\MTg5\MTY1\MTY2\MTgz\MTgx\MTc5\MjE0\MjEw\MjIz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTI4\MTc5\MTkw\MTkx\MTgx\MTg2\MTc5\MTY1\MjE0\MjEw\MjE4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTc3\MTc5\MTYy\MTQ5\MTkw\MTkx\MTg2\MTc4\MTY0\MTc5\MTg0\MjE0\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\Mzg=\MjMz\MjEw\MjE3\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTc2\MTkx\MTg0\MTc4\MTQ0\MTkx\MTY0\MTY1\MTYy\MTQ5\MTkw\MTkx\MTg2\MTc4\MjE0\MjEw\MjA4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTg1\MTYx\MTg0\MTc5\MTY0\MjE0\MjEw\MjA4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTI4\MTgz\MTg2\MTYz\MTc5\MjE0\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTc3\MTgz\MTg3\MTc5\MjE0\MjEw\MjIy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTM0\MTg2\MTgz\MTc1\MTc5\MTY0\MTY1\MjE0\MjEw\MjE4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTU0\MTg1\MTgx\MTgz\MTg2\MTM0\MTg2\MTgz\MTc1\MTc5\MTY0\MjE0\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTUy\MTgz\MTg3\MTc5\MjE0\MjEw\MjA4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTg3\MTc1\MTQ5\MTgz\MTY0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTcx\MjEz\MjE0\MjE0\MTI1\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MjA4\MjQ2\MjE0\MjE0\MjE0\MjE1\MjE0\MjE0\MjE0\MTQ3\MTUw\MjE0\MjE0\MTQ0\ODY=\MjI=\MjE0\ODc=\MjI=\MjE0\MjE0\MTk=\MjE0\MjE1\MjE0\MTM4\ODY=\ODY=\MjE1\MTU5\ODY=\MjM=\ODQ=\ODQ=\MjE0\MjE0\MjE0\MjA=\MjE0\ODY=\MjE0\MjQy\MjE1\MjE0\MjE0\MjE0\MjE0\MjE0\MjE1\MjE0\MjE0\ODY=\MjE0\MjA5\MjM=\MjE1\MjE0\MjQy\MTUx\MjE0\MjE0\MjE0\MjE0\ODY=\MjE0\MjE0\MjE0\MjE0\MjE0\MjA5\MjE1\MjEy\MjE0\MjEx\MjM=\MjE1\MjE0\MjAy\MTUx\ODY=\MjE0\MTI=\MjE0\MjE0\MjE0\MTky\MTUw\MjEy\ODY=\MjEx\MTUx\MjEy\MjE0\MTQ3\MjE1\MjEy\MjE0\MTM4\MjE1\ODY=\MjE0\MjAy\ODc=\MjE0\MjE0\MjA0\MTUx\MjE0\MjE0\MTky\MjI=\NDM=\MTY5\ODQ=\MjE0\MjE0\MjE0\MjEx\MjM=\MjE1\MjE0\MjAy\MTUx\ODY=\MjE0\MTky\MjI=\NDI=\MTY5\MjAw\MjE0\ODY=\MjE0\MjIw\MjE0\MjE0\MjE0\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjIy\MTUw\MjEw\MjIz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTU5\MTg0\MTY1\MTYy\MTgz\MTg0\MTgx\MTc5\MjE0\MjEw\MjEw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTg0\MTc5\MTYx\MjE0\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTU4\MTkx\MTg0\MTYy\MjE0\MjEw\MjIw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTI5\MTg1\MTY0\MTg5\MTY1\MTY2\MTgz\MTgx\MTc5\MjE0\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMw\MTc5\MTc0\MTYy\MjE0\MjEw\MjQw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTI4\MTc5\MTkw\MTkx\MTgx\MTg2\MTc5\MjQ2\MTMz\MTkx\MTg3\MTYz\MTg2\MTgz\MTYy\MTg1\MTY0\MjQ2\MTUx\MTYz\MTYy\MTg1\MTc2\MTgz\MTY0\MTg3\MjQ2\MTg2\MTg1\MTgz\MTc4\MTkx\MTg0\MTc3\MjQ4\MjQ4\MjQ4\MjE0\MjEw\MjE4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTc2\MTkx\MTg0\MTc4\MTI4\MTc5\MTkw\MTkx\MTgx\MTg2\MTc5\MjE0\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTc2\MTgz\MTY0\MTg3\MjE0\MjEw\MjA4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTY2\MTgx\MTgz\MTg2\MTg2\MjE0\MjEy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\ODI=\MjEz\MjE0\MjE0\NzY=\MjEz\MjE0\MjE0\MjEy\MjE0\MjE0\MjIz\MTQ2\MjE0\MjE0\MjE0\MjEw\MjE0\MjE0\MjE0\MjA0\MTUw\MjE0\MjE0\MTky\MjI=\MjE5\ODY=\MjEx\MjE0\MjE0\MjE0\MjA4\MTUw\MTUw\MjE0\MjIx\ODY=\MTUw\MjE0\MjAy\ODY=\MjE0\MjE1\MTUx\MjI=\MjE0\MjE0\NjY=\MjE0\MjE0\MjE0\MjM=\MjI=\MjE0\MjE0\MTgy\ODY=\MjIw\ODY=\MTQ0\MjE1\MjE1\MjE0\MTU3\MjE1\MjM=\MjEy\MjM=\MTUx\MjE1\MjE0\MTM4\ODc=\ODY=\MjE1\MTQw\MjE1\MjE0\MjE0\MTky\MjE0\MjIz\ODY=\MTQ0\MjE1\MjE1\MjE0\MTQ0\MTUx\MjM=\MjEy\MTQ0\ODc=\MjM=\MjEy\ODM=\MjM=\MjE1\MjE0\OTM=\MjE1\MTQ4\MjEz\MjE1\MTQ4\MjEy\MjE0\NzQ=\ODc=\ODY=\MjE1\ODA=\ODc=\MTQ4\MjEz\ODA=\MjM=\MTQ4\MjEz\MTkz\ODY=\ODc=\MjEy\MTky\MjE0\MjEw\ODY=\MTQ4\MjE1\ODY=\MjE0\MTU4\MjE1\MjE0\MjE0\MTQ0\MjE1\MjE1\MjE0\MTQ1\MjE1\MjEz\MjE0\MTQ3\MjE1\MjEz\MjE0\MTQ0\ODc=\MjE=\MjEy\MTQ1\MTUx\MjEz\MjE0\MTQ3\MTUx\MjEz\MjE0\MTQ0\MjM=\MjE=\MjEy\MTU5\MjE1\MTQ2\ODU=\MTQ3\MTUx\MjEz\MjE0\MTQ0\MTUx\MTg=\MjEy\MTU5\ODc=\MTQ2\ODU=\MTQ3\MTUx\MjEz\MjE0\MTQ0\MjM=\MTg=\MjEy\MTU5\MjE1\MTQ3\ODU=\MTky\MjE0\MjEy\ODY=\MTU0\MjM=\MTUw\MjEy\MTQ0\MTUx\MjE1\MjE0\MTkz\MTUw\MTk=\MjEy\MTky\MjE0\MjE1\ODY=\MTQ2\MjE1\MjE0\MjE0\MTQw\MTUx\MjE0\MjE0\MTky\MTUw\MjE0\ODY=\MTQ2\MjE1\ODY=\MjE0\MTU5\MjM=\MTQ3\OTM=\MTM3\MjI=\MzQ=\MTY5\MTQ3\MjE0\MjA4\MjE0\ODc=\MjI=\MjE0\MjE0\MTM4\MTUw\MjE0\MjE1\MTky\MjE0\Mzk=\MTY5\MjEx\MjE0\MjA4\MjE0\MTUx\MTUw\MjA4\MjE0\MjAy\MTUw\MjE0\MjE1\MjEx\MjE0\MjEz\MjE0\MTQ3\MjE0\MjEz\MjE0\MTQ0\MjI=\MTY=\MjE0\MTQ0\MjE0\MTc=\MjE0\MjIz\MTUw\MjE0\OTE=\MjAw\MjE0\ODY=\MjE0\MjAz\MjE0\MjE0\MjE0\MjEw\MjIw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTI5\MTg1\MTY0\MTg5\MTY1\MTY2\MTgz\MTgx\MTc5\MjE0\MjEw\MjIz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTI4\MTc5\MTkw\MTkx\MTgx\MTg2\MTc5\MTY1\MjE0\MjEw\MjE4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTc3\MTc5\MTYy\MTQ5\MTkw\MTkx\MTg2\MTc4\MTY0\MTc5\MTg0\MjE0\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\Mzg=\MjMz\MjEw\MjE3\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTc2\MTkx\MTg0\MTc4\MTQ0\MTkx\MTY0\MTY1\MTYy\MTQ5\MTkw\MTkx\MTg2\MTc4\MjE0\MjEw\MjA4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTg1\MTYx\MTg0\MTc5\MTY0\MjE0\MjEw\MjA4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTI4\MTgz\MTg2\MTYz\MTc5\MjE0\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTc3\MTgz\MTg3\MTc5\MjE0\MjEw\MjIx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ1\MTc5\MTYy\MTMz\MTc5\MTY0\MTYw\MTkx\MTgx\MTc5\MjE0\MjEw\MjIy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTM0\MTg2\MTgz\MTc1\MTc5\MTY0\MTY1\MjE0\MjEw\MjE4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTU0\MTg1\MTgx\MTgz\MTg2\MTM0\MTg2\MTgz\MTc1\MTc5\MTY0\MjE0\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTUy\MTgz\MTg3\MTc5\MjE0\MjEw\MjIy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTYw\MTc5\MTkw\MTkx\MTgx\MTg2\MTc5\MjE0\MjEw\MjIz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTYw\MTc5\MTkw\MTMz\MTYy\MTgz\MTYy\MTY1\MjE0\MjEw\MjIz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTU4\MTgz\MTg0\MTc4\MTg2\MTkx\MTg0\MTc3\MjE0\MjEw\MjIz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTU1\MTgz\MTc0\MTMz\MTY2\MTc5\MTc5\MTc4\MjE0\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\OTU=\MTUw\MjEw\MjA5\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMw\MTg1\MTY0\MTY3\MTYz\MTc5\MjE0\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MTg4\NDY=\MTUw\MjEw\MTkz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMz\MTYy\MTc5\MTc5\MTY0\MTkx\MTg0\MTc3\MTMy\MTgz\MTc4\MTkx\MTYz\MTY1\MTQ5\MTg1\MTg0\MTY1\MTYy\MTgz\MTg0\MTYy\MjE0\MjEz\MjE0\MjE0\MjE0\MjE0\MjM4\NzQ=\NzQ=\MTUx\MjE0\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMw\MTc5\MTc0\MTYy\MjE0\MjEw\MjQz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTM0\MTg2\MTc5\MTgz\MTY1\MTc5\MjQ2\MTY1\MTY2\MTgz\MTYx\MTg0\MjQ2\MTgz\MTg0\MTc4\MjQ2\MTc5\MTg0\MTYy\MTc5\MTY0\MjQ2\MTc1\MTg1\MTYz\MTY0\MjQ2\MTYw\MTc5\MTkw\MTkx\MTgx\MTg2\MTc5\MjQ3\MjE0\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTYx\MTgz\MTkx\MTYy\MjE0\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTUw\MjEw\MjE4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTM0\MTY0\MTkx\MTg3\MTgz\MTY0\MTc1\MTM0\MTgz\MTY0\MTYy\MjE0\MjEw\MjIy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTkw\MTgz\MTY1\MTY1\MTkx\MTY1\MjE0\MjEw\MjE4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTI4\MTc5\MTkw\MTkx\MTgx\MTg2\MTc5\MTMz\MTc5\MTgz\MTYy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\NzQ=\MjEz\MjE0\MjE0\MTE3\MjEz\MjE0\MjE0\MjEy\MjE0\MjE0\MjA4\MjQ2\MjE0\MjE0\MjE0\MjEw\MjE0\MjE0\MjE0\MjIz\MTUw\MTUw\ODY=\MjEx\ODY=\MjE0\MjE0\MTQ2\MjE0\ODY=\MjE0\MjAy\ODY=\MjE0\MjE1\MjA0\MjE0\MjE0\MjE0\MTky\MjI=\MjEx\ODY=\MjEx\MjI=\MjE0\MjE0\MjIx\MjE0\MTUx\MjE0\ODM=\MTUw\MjE1\MjE0\ODA=\ODY=\MTUx\MjE1\MjM=\MjI=\MjE1\MjE0\MjE1\MjE1\MjEy\MjE0\MTUx\MTUx\MjEy\MjE0\NzQ=\MjE0\MjE0\MjEy\MjAy\MTUw\MjE0\MjE0\MjEx\ODY=\MjEy\MjE0\MjIx\MjI=\MTQ4\MjE0\ODc=\MjE0\MjEz\MjE0\MjAy\ODY=\ODY=\MjE1\MjIx\MTUw\MTQ5\MjE0\ODc=\ODY=\MjEz\MjE0\MjAy\MTUw\ODY=\MjE1\MjEx\ODY=\MjEy\MjE0\MjIx\MjI=\MTQ4\MjE0\ODc=\MjE0\MjEz\MjE0\MjAy\ODY=\ODY=\MjE1\MjIx\MjI=\MTQ5\MjE0\ODc=\ODY=\MjEz\MjE0\MjAy\MTUw\ODY=\MjE1\MTky\ODY=\NDY=\MTY5\MjAw\MjE0\ODY=\MjE0\MTk4\MjE0\MjE0\MjE0\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMw\MTc5\MTc0\MTYy\MjE0\MjEw\MjU0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ0\MTkx\MTg0\MTkx\MTY1\MTkw\MTc5\MTc4\MjQ2\MTg2\MTg1\MTgz\MTc4\MTkx\MTg0\MTc3\MjQ3\MjQ2\MTUx\MTYz\MTYy\MTg1\MTc2\MTgz\MTY0\MTg3\MjQ2\MTkx\MTg0\MTkx\MTYy\MTkx\MTgz\MTg2\MTkx\MTcy\MTc5\MTc4\MjQ4\MjE0\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTYx\MTgz\MTkx\MTYy\MjE0\MjEw\MjIy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTYw\MTc5\MTkw\MTkx\MTgx\MTg2\MTc5\MjE0\MjEw\MTk1\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMz\MTc5\MTYy\MTM0\MTY0\MTkx\MTg3\MTgz\MTY0\MTc1\MTM0\MTgz\MTY0\MTYy\MTQ5\MTQ0\MTY0\MTgz\MTg3\MTc5\MjE0\MjEw\MjA5\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTQ0\MTY0\MTgz\MTg3\MTc5\MjE0\MjEw\MjEw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTg0\MTc5\MTYx\MjE0\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTc3\MTUw\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTUy\MTUw\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MTkw\OTA=\MTUw\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTc3\MTgz\MTg3\MTc5\MjE0\MjEw\MjIx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ1\MTc5\MTYy\MTMz\MTc5\MTY0\MTYw\MTkx\MTgx\MTc5\MjE0\MjEw\MjE4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTI4\MTkx\MTY0\MTYy\MTYz\MTgz\MTg2\MTMx\MTY1\MTc5\MTY0\MjE0\MjEw\MjIz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMz\MTc5\MTYy\MTU3\MTc5\MTc1\MTMx\MTY2\MjE0\MjEw\MjEy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTYx\MjE0\MjEw\MjIx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMz\MTc5\MTYy\MTU3\MTc5\MTc1\MTQ2\MTg1\MTYx\MTg0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTIz\MjEz\MjE0\MjE0\OTc=\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MjEy\MjQw\MjE0\MjE0\MjE0\MjEx\MjE0\MjE0\MjE0\MjAy\MTUw\ODY=\MjE0\MjEx\MTUw\MjE0\MjE0\MjA4\ODY=\MTUw\MjE0\MjA4\MjI=\MTUw\MjE0\MjIz\MTUw\MTUx\ODQ=\MjEx\MTUw\MjE0\MjE0\MjA4\ODY=\MTUw\MjE0\MjA4\ODY=\MTUx\MjE0\MjIz\MjI=\MTUx\ODQ=\MjEx\MTUw\MjE0\MjE0\MjA4\ODY=\MTUw\MjE0\MjA4\MjE0\MTQ4\MjE0\MjIz\MTUw\MTQ4\ODQ=\MjEx\MTUw\MjE0\MjE0\MjA4\ODY=\MTUw\MjE0\MjA4\ODY=\MTQ4\MjE0\MjIz\MjI=\MTQ4\ODQ=\MjEx\MTUw\MjE0\MjE0\MjA4\ODY=\MTUw\MjE0\MjA4\MjE0\MTQ5\MjE0\MjA4\MTUw\MTQ5\MjE0\MjIz\ODY=\MTQ5\ODQ=\MjEx\MTUw\MjE0\MjE0\MjA4\ODY=\MTUw\MjE0\MjA4\MjE0\MTQ5\MjE0\MjA4\MjI=\MTQ5\MjE0\MjIz\ODY=\MTQ5\ODQ=\MjEx\MTUw\MjE0\MjE0\MjA4\ODY=\MTUw\MjE0\MjA4\MjE0\MTQ2\MjE0\MjIz\ODY=\MTQ5\ODQ=\MjEx\MTUw\MjE0\MjE0\MjA4\ODY=\MTUw\MjE0\MjA4\MTUw\MTQ2\MjE0\MjA4\ODY=\MTQ2\MjE0\MjIz\MjI=\MTQ2\ODQ=\MjAw\MjE0\ODY=\MjE0\MTk0\MjE0\MjE0\MjE0\MjEw\MjIy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTc2\MTkx\MTg0\MTc4\MTQ5\MTgz\MTY0\MjE0\MjEw\MjA4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTg3\MTc1\MTQ5\MTgz\MTY0\MjE0\MjEw\MjIz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTU4\MTgz\MTg0\MTc4\MTg2\MTkx\MTg0\MTc3\MjE0\MjEw\MjIz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTU1\MTgz\MTc0\MTMz\MTY2\MTc5\MTc5\MTc4\MjE0\MjEw\MjA4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTI4\MTgz\MTg2\MTYz\MTc5\MjE0\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\OTQ=\MjE=\MTUw\MjEw\MjA5\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMw\MTg1\MTY0\MTY3\MTYz\MTc5\MjE0\MjEz\MjE0\MjE0\MjE0\MjE0\MTgy\MjQ2\NjE=\MTUw\MjEw\MTkz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMz\MTYy\MTc5\MTc5\MTY0\MTkx\MTg0\MTc3\MTMy\MTgz\MTc4\MTkx\MTYz\MTY1\MTQ5\MTg1\MTg0\MTY1\MTYy\MTgz\MTg0\MTYy\MjE0\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MTU0\Mjc=\MTUw\MjEw\MjE5\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ0\MTY0\MTkx\MTgx\MTYy\MTkx\MTg1\MTg0\MTMy\MTg1\MTgz\MTc4\MjE0\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MTUw\MTg1\MTUw\MjEw\MjA4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTUy\MTkx\MTYy\MTY0\MTg1\MjE0\MjEw\MjIx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTUy\MTkx\MTYy\MTY0\MTg1\MTMz\MTY2\MTc5\MTc5\MTc4\MjE0\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MTg4\NDY=\MTUw\MjEw\MjIx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTUy\MTkx\MTYy\MTY0\MTg1\MTQ0\MTg1\MTY0\MTgx\MTc5\MjE0\MjEw\MjIy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ4\MTY0\MTgz\MTg5\MTkx\MTg0\MTc3\MjE0\MjEw\MjIw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMw\MTYz\MTY0\MTgw\MTg1\MTU2\MTYz\MTg3\MTY2\MjE0\MjEw\MTk4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMw\MTYz\MTY0\MTgw\MTg1\MTU2\MTYz\MTg3\MTY2\MTU4\MTc5\MTkx\MTc3\MTkw\MTYy\MjE0\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjM5\MTUw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTEx\MjEz\MjE0\MjE0\MTA3\MjEz\MjE0\MjE0\MjE1\MjE0\MjE0\MjEy\MjE5\MjE0\MjE0\MjE0\MjEx\MjE0\MjE0\MjE0\MjAy\MTUw\ODY=\MjE0\MjEx\MTUw\MjE0\MjE0\MjA4\ODY=\MTUw\MjE0\MjA4\MjI=\MTUw\MjE0\MTQ2\MjE0\MjE0\MjE0\MTQ0\MTUw\MjM=\MjE0\MjIz\MTUw\MjE0\ODQ=\MjEx\MTUw\MjE0\MjE0\MjA4\ODY=\MTUw\MjE0\MjA4\ODY=\MTUx\MjE0\MjIz\MjI=\MTUx\ODQ=\MjAw\MjE0\ODY=\MjE0\MjIy\MjE0\MjE0\MjE0\MjEw\MjIy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTc2\MTkx\MTg0\MTc4\MTQ5\MTgz\MTY0\MjE0\MjEw\MjA4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTg3\MTc1\MTQ5\MTgz\MTY0\MjE0\MjEw\MjIz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTU4\MTgz\MTg0\MTc4\MTg2\MTkx\MTg0\MTc3\MjE0\MjEw\MjIz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTU1\MTgz\MTc0\MTMz\MTY2\MTc5\MTc5\MTc4\MjE0\MjEw\MjA4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTI4\MTgz\MTg2\MTYz\MTc5\MjE0\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMw\MTc5\MTc0\MTYy\MjE0\MjEw\MTkz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMz\MTYy\MTc5\MTc5\MTY0\MTkx\MTg0\MTc3\MTMy\MTgz\MTc4\MTkx\MTYz\MTY1\MTQ5\MTg1\MTg0\MTY1\MTYy\MTgz\MTg0\MTYy\MjE0\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MTU0\Mjc=\MTUw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTA1\MjEz\MjE0\MjE0\MjA=\MjEz\MjE0\MjE0\MjE1\MjE0\MjE0\MjEy\MjIz\MjE0\MjE0\MjE0\MjEx\MjE0\MjE0\MjE0\MjAy\MTUw\ODY=\MjE0\MjEx\MTUw\MjE0\MjE0\MjA4\ODY=\MTUw\MjE0\MjA4\MjI=\MTUw\MjE0\MTQ2\MjE0\MjE0\MjE0\MTQ0\MTUw\MjM=\MjE0\MjIz\MTUw\MjE0\ODQ=\MjAw\MjE0\ODY=\MjE0\MjA4\MjE0\MjE0\MjE0\MjEw\MjIy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTc2\MTkx\MTg0\MTc4\MTQ5\MTgz\MTY0\MjE0\MjEw\MjA4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTg3\MTc1\MTQ5\MTgz\MTY0\MjE0\MjEw\MjIz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTU4\MTgz\MTg0\MTc4\MTg2\MTkx\MTg0\MTc3\MjE0\MjEw\MjA5\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMw\MTg1\MTY0\MTY3\MTYz\MTc5\MjE0\MjEw\MjA4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTI4\MTgz\MTg2\MTYz\MTc5\MjE0\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMw\MTc5\MTc0\MTYy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTg=\MjEz\MjE0\MjE0\MTc=\MjEz\MjE0\MjE0\MjE1\MjE0\MjE0\MjEy\MjIw\MjE0\MjE0\MjE0\MjEx\MjE0\MjE0\MjE0\MjAy\MTUw\ODY=\MjE0\MjEx\MTUw\MjE0\MjE0\MjA4\ODY=\MTUw\MjE0\MjA4\MjI=\MTUw\MjE0\MjA4\MjE0\MTUx\MjE0\MTQ2\MjE0\MjE0\MjE0\MTQ0\ODY=\MjM=\MjE0\MjIz\MTUw\ODY=\ODQ=\MjAw\MjE0\ODY=\MjE0\MjA5\MjE0\MjE0\MjE0\MjEw\MjIy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTc2\MTkx\MTg0\MTc4\MTQ5\MTgz\MTY0\MjE0\MjEw\MjA4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTg3\MTc1\MTQ5\MTgz\MTY0\MjE0\MjEw\MjIz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTU4\MTgz\MTg0\MTc4\MTg2\MTkx\MTg0\MTc3\MjE0\MjEw\MjA4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTUy\MTkx\MTYy\MTY0\MTg1\MjE0\MjEw\MjIx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTUy\MTkx\MTYy\MTY0\MTg1\MTMz\MTY2\MTc5\MTc5\MTc4\MjE0\MjEw\MjA4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTI4\MTgz\MTg2\MTYz\MTc5\MjE0\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMw\MTc5\MTc0\MTYy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MzE=\MjEz\MjE0\MjE0\MjY=\MjEz\MjE0\MjE0\MjE1\MjE0\MjE0\MjEy\MjIw\MjE0\MjE0\MjE0\MjEx\MjE0\MjE0\MjE0\MjAy\MTUw\ODY=\MjE0\MjEx\MTUw\MjE0\MjE0\MjA4\ODY=\MTUw\MjE0\MjA4\MjI=\MTUw\MjE0\MjA4\MjE0\MTUx\MjE0\MTQ2\MjE0\MjE0\MjE0\MTQ0\ODY=\MjM=\MjE0\MjIz\MTUw\ODY=\ODQ=\MjAw\MjE0\ODY=\MjE0\MjA5\MjE0\MjE0\MjE0\MjEw\MjIy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTc2\MTkx\MTg0\MTc4\MTQ5\MTgz\MTY0\MjE0\MjEw\MjA4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTg3\MTc1\MTQ5\MTgz\MTY0\MjE0\MjEw\MjIz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTU4\MTgz\MTg0\MTc4\MTg2\MTkx\MTg0\MTc3\MjE0\MjEw\MjA4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTUy\MTkx\MTYy\MTY0\MTg1\MjE0\MjEw\MjIx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTUy\MTkx\MTYy\MTY0\MTg1\MTQ0\MTg1\MTY0\MTgx\MTc5\MjE0\MjEw\MjA4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTI4\MTgz\MTg2\MTYz\MTc5\MjE0\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMw\MTc5\MTc0\MTYy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjQ=\MjEz\MjE0\MjE0\Nw==\MjEz\MjE0\MjE0\MjE1\MjE0\MjE0\MjEy\MjIw\MjE0\MjE0\MjE0\MjEx\MjE0\MjE0\MjE0\MjAy\MTUw\ODY=\MjE0\MjEx\MTUw\MjE0\MjE0\MjA4\ODY=\MTUw\MjE0\MjA4\MjI=\MTUw\MjE0\MjA4\MjE0\MTUx\MjE0\MTQ2\MjE0\MjE0\MjE0\MTQ0\ODY=\MjM=\MjE0\MjIz\MTUw\ODY=\ODQ=\MjAw\MjE0\ODY=\MjE0\MjA5\MjE0\MjE0\MjE0\MjEw\MjIy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTc2\MTkx\MTg0\MTc4\MTQ5\MTgz\MTY0\MjE0\MjEw\MjA4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTg3\MTc1\MTQ5\MTgz\MTY0\MjE0\MjEw\MjIz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTU4\MTgz\MTg0\MTc4\MTg2\MTkx\MTg0\MTc3\MjE0\MjEw\MjIw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMw\MTYz\MTY0\MTgw\MTg1\MTU2\MTYz\MTg3\MTY2\MjE0\MjEw\MTk4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMw\MTYz\MTY0\MTgw\MTg1\MTU2\MTYz\MTg3\MTY2\MTU4\MTc5\MTkx\MTc3\MTkw\MTYy\MjE0\MjEw\MjA4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTI4\MTgz\MTg2\MTYz\MTc5\MjE0\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMw\MTc5\MTc0\MTYy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\NQ==\MjEz\MjE0\MjE0\MA==\MjEz\MjE0\MjE0\MjE1\MjE0\MjE0\MjEy\MjIz\MjE0\MjE0\MjE0\MjEx\MjE0\MjE0\MjE0\MjAy\MTUw\ODY=\MjE0\MjEx\MTUw\MjE0\MjE0\MjA4\ODY=\MTUw\MjE0\MjA4\MjI=\MTUw\MjE0\MTQ2\MjE0\MjE0\MjE0\MTQ0\MTUw\MjM=\MjE0\MjIz\MTUw\MjE0\ODQ=\MjAw\MjE0\ODY=\MjE0\MjA4\MjE0\MjE0\MjE0\MjEw\MjIy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTc2\MTkx\MTg0\MTc4\MTQ5\MTgz\MTY0\MjE0\MjEw\MjA4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTg3\MTc1\MTQ5\MTgz\MTY0\MjE0\MjEw\MjIz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTU4\MTgz\MTg0\MTc4\MTg2\MTkx\MTg0\MTc3\MjE0\MjEw\MjIy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ4\MTY0\MTgz\MTg5\MTkx\MTg0\MTc3\MjE0\MjEw\MjA4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTI4\MTgz\MTg2\MTYz\MTc5\MjE0\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMw\MTc5\MTc0\MTYy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ=\MjEz\MjE0\MjE0\MTI=\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MjEz\MjA5\MjE0\MjE0\MjE0\MjEx\MjE0\MjE0\MjE0\MjIx\MTUw\MTUw\MjE0\ODc=\ODY=\MjE0\MjE0\MjAy\ODY=\ODY=\MjE1\MjA4\MjI=\MTUw\MjE0\MjIz\MTUw\MTUx\ODQ=\MjAw\MjE0\ODY=\MjE0\MjA4\MjE0\MjE0\MjE0\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTc3\MTgz\MTg3\MTc5\MjE0\MjEw\MjIx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ1\MTc5\MTYy\MTMz\MTc5\MTY0\MTYw\MTkx\MTgx\MTc5\MjE0\MjEw\MjIy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTM0\MTg2\MTgz\MTc1\MTc5\MTY0\MTY1\MjE0\MjEw\MjE4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTU0\MTg1\MTgx\MTgz\MTg2\MTM0\MTg2\MTgz\MTc1\MTc5\MTY0\MjE0\MjEw\MjA5\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMx\MTY1\MTc5\MTY0\MTU5\MTc4\MjE0\MjEz\MjE0\MjE0\MjE0\MjE0\MjM0\MTc=\MjMw\MTUx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTA=\MjEz\MjE0\MjE0\MjE1\MjEw\MjE0\MjE0\MjE0\MjE0\MjE0\MTk1\MTg1\MjE0\MjE0\MjE0\MjEx\MjE0\MjE0\MjE0\MjIx\MTUw\MTUw\MjE0\MjAy\ODY=\MjE0\MjE1\MTUx\ODY=\MjE0\MjE0\NjY=\MjE0\MjE0\MjE0\MjM=\ODY=\MjE0\MjE0\MTgy\MTUw\MjA3\ODY=\MTQ0\MjE1\MjE1\MjE0\MTQ0\MjM=\MjI=\MjEy\MTkz\MjE0\MjM=\MjEy\MTky\MTUw\MjA2\ODY=\MTQ0\MjE1\MjE1\MjE0\MTU3\MTUx\MjI=\MjEy\MTM4\ODc=\MjE0\MjE1\ODc=\ODc=\MjE0\MjE0\Mg==\MjE1\ODY=\MjEy\MjE1\ODQ=\MjE0\MjE0\MTE4\MTUx\MTky\ODY=\ODA=\MTQ4\ODQ=\MjEy\ODA=\MjA=\MTUw\MjEx\MTkz\MjE0\MTUx\MjEx\MTky\MTUw\MTk1\ODY=\ODA=\MTQ4\ODQ=\MjEy\OTM=\MTQ4\MTUw\MjEx\NzQ=\ODQ=\MjE0\MjE1\MjM=\ODQ=\MjE0\MjE0\MTk0\MjEz\MjE0\MjEx\MTUx\ODU=\MjE0\MjE0\NTQ=\MTQ4\MTk3\ODY=\MTY=\ODU=\MjEz\MjEx\MTY=\MjE=\MjI=\MjA5\MTkz\MTUw\MjM=\MjA5\MTky\MTUw\MTk2\ODY=\MTY=\ODU=\MjEz\MjEx\Mjk=\ODU=\MjM=\MjA5\MTUx\MTg=\MjE1\MjE0\MTA=\ODU=\ODY=\MjE1\MTI=\MjEz\MjE0\MjE0\MTky\MjI=\MTk4\ODY=\MTY=\ODU=\MjEz\MjEx\Mjk=\ODU=\MjM=\MjA5\MTUx\MjEw\MjEy\MjE0\MTA=\ODU=\ODY=\MjE1\MTI=\MjEz\MjE0\MjE0\MTky\ODY=\MjE1\ODY=\MTY=\ODU=\MjEz\MjEx\Mjk=\ODU=\MjM=\MjA5\MTUx\MjEw\MjEy\MjE0\MTA=\ODU=\ODY=\MjE1\Mjk=\MTQ5\MjA=\MjA5\MTA=\MTQ5\MjE0\MjE1\MTky\ODY=\MjE5\ODY=\MTk=\ODU=\MjEy\MjE0\MTY=\MjE=\MjA=\MjA5\MjE1\MjEw\MjEy\MjE0\MTQ0\ODI=\MjEz\MjEx\MTA=\ODU=\ODY=\MjE1\MjEx\MTQ2\MjEz\MjE0\MjA4\MTg=\MTQ4\MjIy\MTUx\ODI=\MjEz\MjE0\ODc=\MTg=\MjEz\MjE0\MjM=\MjEw\MjEw\MjE0\MjAy\ODI=\MjE0\MjEy\MzE=\MjEz\MjEw\ODA=\MjEx\MTQ2\MjEz\MjE0\MjA4\MTg=\MTQ4\MjIy\MTUx\ODI=\MjEw\MjE0\ODc=\MTg=\MjEw\MjE0\MjM=\ODI=\MjEw\MjE0\MjAy\ODI=\MjE0\MjEy\MzE=\MjEz\ODI=\OTQ=\MjEx\MjEw\MjEx\MjE0\MjA4\MTQ2\MTQ3\MjIy\MTUx\ODI=\MjEw\MjE0\ODc=\ODI=\MjEx\MjE0\MjM=\ODI=\MjEw\MjE0\MjAy\ODI=\MjE0\MjEy\MzE=\MjEz\MjEw\OTI=\MzE=\MjEz\MTY=\OTM=\MzE=\ODU=\MTY=\OTA=\MjA4\ODI=\MjEz\MjEx\MzE=\MjEz\ODI=\OTE=\MzE=\ODU=\MTUw\ODg=\MjEx\ODI=\MjEy\MjE0\MjA4\MTg=\MTQ4\MjIy\MTUx\MjEw\MjEy\MjE0\ODA=\ODI=\MjEz\MjEx\MjAy\ODI=\ODY=\MjE1\MTQ3\MTQ2\MjEz\MjE0\MTQ0\MTg=\MjA=\MjIy\ODc=\ODI=\MjEz\MjE0\MjM=\MTQ2\MjA5\MjE0\MjE1\MjEx\MjEw\MjE0\MTM4\ODI=\MjE0\MjEy\MjIz\MTQ2\MjEw\ODA=\MTQ3\MjEw\MjEx\MjE0\MTQ0\MTQ2\MTk=\MjIy\ODc=\ODI=\MjEw\MjE0\MjM=\ODI=\MjEw\MjE0\MjE1\ODM=\MjEx\MjE0\MTM4\ODI=\MjE0\MjEy\MjIz\MTQ2\MjEw\OTI=\MjIz\ODI=\MTc=\OTM=\MjIz\ODI=\MTY=\OTA=\MTQ0\ODI=\MjEz\MjEx\MjIz\MTQ2\ODI=\OTE=\MjIz\ODI=\MTUw\ODg=\OQ==\MjEy\NTg=\MTY5\NzM=\MjE1\NjM=\MTY5\MTM3\MjE0\NDg=\MTY5\MjAw\MjE0\ODY=\MjE0\MjAx\MjE0\MjE0\MjE0\MjEw\MjIw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTYx\MTg1\MTY0\MTg5\MTY1\MTY2\MTgz\MTgx\MTc5\MjE0\MjEw\MjE4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTc3\MTc5\MTYy\MTQ5\MTkw\MTkx\MTg2\MTc4\MTY0\MTc5\MTg0\MjE0\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\Mzg=\MjMz\MjEw\MjIw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTg2\MTgz\MTY1\MTY1\MTUy\MTgz\MTg3\MTc5\MjE0\MjEw\MjA4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTU1\MTg1\MTc4\MTc5\MTg2\MjE0\MjEw\MjIz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTU1\MTc5\MTY1\MTkw\MTM0\MTgz\MTY0\MTYy\MjE0\MjEw\MjE3\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTc2\MTkx\MTg0\MTc4\MTQ0\MTkx\MTY0\MTY1\MTYy\MTQ5\MTkw\MTkx\MTg2\MTc4\MjE0\MjEw\MjA4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMz\MTg3\MTg1\MTg5\MTc5\MjE0\MjEw\MTk3\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ4\MTg1\MTc0\MTU4\MTgz\MTg0\MTc4\MTg2\MTc5\MTUx\MTc4\MTg1\MTY0\MTg0\MTg3\MTc5\MTg0\MTYy\MjE0\MjEw\MjA5\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMy\MTc5\MTg3\MTg1\MTYw\MTc5\MjE0\MjEw\MjIz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTU5\MTg0\MTY1\MTYy\MTgz\MTg0\MTgx\MTc5\MjE0\MjEw\MjEw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTg0\MTc5\MTYx\MjE0\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMz\MTkx\MTcy\MTc5\MjE0\MjEw\MjIy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTI4\MTc5\MTgx\MTYy\MTg1\MTY0\MjI5\MjE0\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjQy\MTUw\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MTUw\MTY5\MTUw\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjA2\MTUw\MjEw\MTk3\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMz\MTkx\MTcy\MTc5\MTMy\MTc5\MTg2\MTgz\MTYy\MTkx\MTYw\MTc5\MTUz\MTc2\MTc2\MTY1\MTc5\MTYy\MjE0\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\NTQ=\MTgy\MTUw\MjEw\MjA5\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTg1\MTg2\MTg1\MTY0\MjI5\MjE0\MjEw\MjIy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTc2\MTY0\MTg1\MTg3\MTMy\MTQ1\MTQ4\MjE0\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\NTQ=\MTg1\MTUw\MjEw\MjE5\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMw\MTY0\MTgz\MTg0\MTY1\MTY2\MTgz\MTY0\MTc5\MTg0\MTgx\MTc1\MjE0\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\NTQ=\MjMz\MjEw\MjE4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTUx\MTg2\MTYx\MTgz\MTc1\MTY1\MTUz\MTg0\MTMw\MTg1\MTY2\MjE0\MjE1\MjE1\MjEw\MjIy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTUx\MTc4\MTg1\MTY0\MTg0\MTc5\MTc5\MjE0\MjEw\MjA5\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQw\MTU5\MTg0\MTc4\MTc5\MTc0\MjE0\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTk4\MTUw\MjEz\MjI5\MjI5\MjI5\MjI5\MjI5\MjI5\NQ==\MjMz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjEz\MjEw\MjE0\MjE0\MjA3\MjEw\MjE0\MjE0\MjE0\MjE0\MjE0\MTk1\MTI5\MjE0\MjE0\MjE0\MjEx\MjE0\MjE0\MjE0\MjIx\MTUw\MTUw\MjE0\MjAy\ODY=\MjE0\MjE1\MTUx\ODY=\MjE0\MjE0\NjY=\MjE0\MjE0\MjE0\MjM=\ODY=\MjE0\MjE0\MTgy\MTUw\MTk3\ODY=\MTQ0\MjE1\MjE1\MjE0\MTQ0\MjM=\MjI=\MjEy\MTkz\MjE0\MjM=\MjEy\MTky\MTUw\MTk2\ODY=\MTQ0\MjE1\MjE1\MjE0\MTU3\MTUx\MjI=\MjEy\MTM4\ODc=\MjE0\MjE1\ODc=\ODc=\MjE0\MjE0\Mg==\MjE1\ODY=\MjEy\MjE1\ODQ=\MjE0\MjE0\MTE4\MTUx\MTk4\ODY=\ODA=\MTQ4\ODQ=\MjEy\ODA=\MjA=\MTUw\MjEx\MTkz\MjE0\MTUx\MjEx\MTky\MTUw\MjE3\ODY=\ODA=\MTQ4\ODQ=\MjEy\OTM=\MTQ4\MTUw\MjEx\NzQ=\ODQ=\MjE0\MjE1\MjM=\ODQ=\MjE0\MjE0\MTk0\MjEz\MjE0\MjEx\MTUx\ODU=\MjE0\MjE0\NTQ=\MTQ4\MjE5\ODY=\MTY=\ODU=\MjEz\MjEx\MTY=\MjE=\MjI=\MjA5\MTkz\MTUw\MjM=\MjA5\MTky\MTUw\MjE4\ODY=\MTY=\ODU=\MjEz\MjEx\Mjk=\ODU=\MjM=\MjA5\MTUx\MTg=\MjE1\MjE0\MTA=\ODU=\ODY=\MjE1\MTI=\MjEz\MjE0\MjE0\MTky\MjI=\MjIw\ODY=\MTk=\MjEz\MjEy\MjE0\MTY=\MTQ5\MjA=\MjA5\MTY=\ODU=\MjA=\MjA5\MTY=\MjE=\MjA=\MjA5\Mjk=\MjEz\MjE=\MjA5\MTQ3\MTQ2\MjEz\MjE0\MTQ0\ODI=\MjE=\MjIy\ODA=\ODI=\MjEz\MjEx\ODA=\MTg=\MTQ5\MjIz\ODA=\MjEw\MTQ2\MjIz\OTA=\MTQ2\MTQ2\MjIz\MTY=\ODI=\MjEz\MjEx\MTY=\MTg=\MjE=\MjIz\MTY=\ODI=\MTg=\MjIz\MjY=\MTg=\MTg=\MjIz\MjA4\ODM=\MjEz\MjEx\MjA4\MTk=\MTQ5\MjIw\MjA4\MjEx\MTQ3\MjIw\MTM4\MjEw\MjE0\MjEy\MTA=\MTQ5\MjE0\MjE0\MTk=\MTQ5\MjEx\MjE0\MTA=\MTQ5\ODY=\MjE0\MTk=\MjEz\MjEy\MjE0\MTY=\MTQ5\MjA=\MjA5\MTY=\ODU=\MjA=\MjA5\MTY=\MjE=\MjA=\MjA5\MTY=\ODU=\MTk=\MjA5\Mjk=\MjEz\MjE=\MjA5\MTQ3\MTQ2\MjEz\MjE0\MTQ0\ODI=\MjE=\MjIy\ODA=\ODI=\MjEz\MjEx\ODA=\MTg=\MTQ5\MjIz\ODA=\MjEw\MTQ2\MjIz\MTY=\ODI=\MjEz\MjEx\MTY=\MTg=\MjE=\MjIz\MTY=\ODI=\MTg=\MjIz\MjA4\ODM=\MjEz\MjEx\MjA4\MTk=\MTQ5\MjIw\MjA4\MjEx\MTQ3\MjIw\MTM4\MjEw\MjE0\MjEy\MTA=\MTQ5\MjE0\MjE0\MTk=\MTQ5\MjEx\MjE0\MjE1\MTg=\MjEx\MjE0\MTA=\MTQ5\MjE0\MjE1\OQ==\MjEy\MzY=\MTY5\NzM=\MjE1\NTc=\MTY5\MTM3\MjE0\NTg=\MTY5\MjAw\MjE0\ODY=\MjE0\MjA2\MjE0\MjE0\MjE0\MjEw\MjIw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTYx\MTg1\MTY0\MTg5\MTY1\MTY2\MTgz\MTgx\MTc5\MjE0\MjEw\MjE4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTc3\MTc5\MTYy\MTQ5\MTkw\MTkx\MTg2\MTc4\MTY0\MTc5\MTg0\MjE0\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\Mzg=\MjMz\MjEw\MjIw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTg2\MTgz\MTY1\MTY1\MTUy\MTgz\MTg3\MTc5\MjE0\MjEw\MjA4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTU1\MTg1\MTc4\MTc5\MTg2\MjE0\MjEw\MjIz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTU1\MTc5\MTY1\MTkw\MTM0\MTgz\MTY0\MTYy\MjE0\MjEw\MjE3\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTc2\MTkx\MTg0\MTc4\MTQ0\MTkx\MTY0\MTY1\MTYy\MTQ5\MTkw\MTkx\MTg2\MTc4\MjE0\MjEw\MjA4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMz\MTg3\MTg1\MTg5\MTc5\MjE0\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTc3\MTgz\MTg3\MTc5\MjE0\MjEw\MjIy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTM0\MTg2\MTgz\MTc1\MTc5\MTY0\MTY1\MjE0\MjEw\MjE4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTU0\MTg1\MTgx\MTgz\MTg2\MTM0\MTg2\MTgz\MTc1\MTc5\MTY0\MjE0\MjEw\MjIw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTkw\MTgz\MTY0\MTgz\MTgx\MTYy\MTc5\MTY0\MjE0\MjEw\MjA5\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTU1\MTg1\MTYw\MTc5\MTMw\MTg1\MjE0\MjEw\MjIy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTI4\MTc5\MTgx\MTYy\MTg1\MTY0\MjI5\MjE0\MjEw\MjEw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTg0\MTc5\MTYx\MjE0\MjEw\MjIz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTM0\MTg1\MTY1\MTkx\MTYy\MTkx\MTg1\MTg0\MjE0\MjEw\MjEy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQy\MjE0\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjMy\MTUw\MjEw\MjEy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQz\MjE0\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTk0\MTUw\MjEw\MjEy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQw\MjE0\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTYx\MTgz\MTkx\MTYy\MjE0\MjEw\MjIz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTU4\MTYz\MTg3\MTgz\MTg0\MTg1\MTkx\MTc4\MjE0\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTk4\MTUw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjA1\MjEw\MjE0\MjE0\MjAw\MjEw\MjE0\MjE0\MjE0\MjE0\MjE0\MjEw\MTky\MjE0\MjE0\MjE0\MjEx\MjE0\MjE0\MjE0\MjAy\MTUw\ODY=\MjE0\MjEx\MTUw\MjE0\MjE0\MjA4\ODY=\MTUw\MjE0\MjA4\MjI=\MTUw\MjE0\MjA4\MjE0\MTUx\MjE0\MjA4\MTUw\MTUx\MjE0\MTQ3\ODY=\MjE1\MjE0\MTQ0\MjI=\MjM=\MjE0\ODM=\MjE0\MjEy\MjE0\ODA=\MTUw\MTQ4\MjE1\ODA=\ODY=\MTQ4\MjE1\ODA=\MjI=\MTQ4\MjE1\MTk=\MjE0\MjEy\MjE0\MTY=\MTUw\MjA=\MjE1\MTY=\ODY=\MjA=\MjE1\MTY=\MjE0\MjE=\MjE1\MTY=\MTUw\MjE=\MjE1\OTA=\MjI=\MjE0\MjE1\MTM4\ODY=\MjE0\MjE1\MjIz\MTUw\MjE0\ODU=\MjAw\MjE0\ODY=\MjE0\MjE2\MjE0\MjE0\MjE0\MjEw\MjIy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTc2\MTkx\MTg0\MTc4\MTQ5\MTgz\MTY0\MjE0\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTc3\MTgz\MTg3\MTc5\MjE0\MjEw\MjIy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTM0\MTg2\MTgz\MTc1\MTc5\MTY0\MTY1\MjE0\MjEw\MjE4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTU0\MTg1\MTgx\MTgz\MTg2\MTM0\MTg2\MTgz\MTc1\MTc5\MTY0\MjE0\MjEw\MjIw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTkw\MTgz\MTY0\MTgz\MTgx\MTYy\MTc5\MTY0\MjE0\MjEw\MTk5\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTU4\MTYz\MTg3\MTgz\MTg0\MTg1\MTkx\MTc4\MTMy\MTg1\MTg1\MTYy\MTM0\MTgz\MTY0\MTYy\MjE0\MjEw\MjA5\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTQ0\MTY0\MTgz\MTg3\MTc5\MjE0\MjEw\MjEw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTg0\MTc5\MTYx\MjE0\MjEw\MjA4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTg3\MTc1\MTQ5\MTgz\MTY0\MjE0\MjEw\MjIy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTkw\MTgz\MTY1\MTY1\MTkx\MTY1\MjE0\MjEw\MjE4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTI4\MTc5\MTkw\MTkx\MTgx\MTg2\MTc5\MTMz\MTc5\MTgz\MTYy\MjE0\MjEw\MjIz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTM0\MTg1\MTY1\MTkx\MTYy\MTkx\MTg1\MTg0\MjE0\MjEw\MjIx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMz\MTc5\MTgz\MTYy\MTUz\MTc2\MTc2\MTY1\MTc5\MTYy\MjE0\MjEw\MjA4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTI4\MTgz\MTg2\MTYz\MTc5\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjQ2\MjEw\MjE0\MjE0\MjQy\MjEw\MjE0\MjE0\MjE0\MjE0\MjE0\MjEw\MTk5\MjE0\MjE0\MjE0\MjEx\MjE0\MjE0\MjE0\MjA4\MTUw\MTUw\MjE0\MjA4\ODY=\MTUw\MjE0\MjA4\MjI=\MTUw\MjE0\MjA4\MjE0\MTUx\MjE0\MjA4\MTUw\MTUx\MjE0\MTQ3\ODY=\MjE1\MjE0\ODc=\MjI=\MjE1\MjE0\MTM4\MTUw\MjE0\MjE1\MTU3\MjE0\MTQ4\MjE0\MTk=\MTUw\MjEy\MjE0\MTY=\ODY=\MjA=\MjE1\MTY=\MjI=\MjA=\MjE1\MTY=\MjE0\MjE=\MjE1\MTY=\MTUw\MjE=\MjE1\MTM4\MTUw\ODY=\MjE1\MjAw\MjE0\ODY=\MjE0\MjE2\MjE0\MjE0\MjE0\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTc3\MTgz\MTg3\MTc5\MjE0\MjEw\MjIy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTM0\MTg2\MTgz\MTc1\MTc5\MTY0\MTY1\MjE0\MjEw\MjE4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTU0\MTg1\MTgx\MTgz\MTg2\MTM0\MTg2\MTgz\MTc1\MTc5\MTY0\MjE0\MjEw\MjE4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTg2\MTc5\MTgz\MTc4\MTc5\MTY0\MTY1\MTYy\MTgz\MTYy\MTY1\MjE0\MjEw\MjE3\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTYz\MTY0\MTY0\MTc5\MTg0\MTYy\MTI4\MTc5\MTkw\MTkx\MTgx\MTg2\MTc5\MjE0\MjEw\MjA4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTI4\MTgz\MTg2\MTYz\MTc5\MjE0\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTYx\MTgz\MTkx\MTYy\MjE0\MjEz\MjI5\MjI5\MjI5\MjI5\MjI5\MjI5\NQ==\MjMz\MjEw\MTk1\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMz\MTc5\MTYy\MTM0\MTY0\MTkx\MTg3\MTgz\MTY0\MTc1\MTM0\MTgz\MTY0\MTYy\MTQ5\MTQ0\MTY0\MTgz\MTg3\MTc5\MjE0\MjEw\MjIw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTYx\MTg1\MTY0\MTg5\MTY1\MTY2\MTgz\MTgx\MTc5\MjE0\MjEw\MTk5\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTY0\MTgz\MTgx\MTc5\MTM3\MTgx\MTkw\MTc5\MTgx\MTg5\MTY2\MTg1\MTkx\MTg0\MTYy\MTY1\MjE0\MjEw\MTk0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTgz\MTkx\MTY0\MTY2\MTg1\MTY0\MTYy\MTM3\MTgx\MTkw\MTc5\MTgx\MTg5\MTY2\MTg1\MTkx\MTg0\MTYy\MTY1\MjE0\MjEw\MjQ0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTkw\MTc5\MTgx\MTg5\MTY2\MTg1\MTkx\MTg0\MTYy\MTM3\MjMx\MTM3\MTUx\MTkx\MTY0\MTY2\MTg1\MTY0\MTYy\MjQ2\MTM1\MTYz\MTgz\MTY0\MTYy\MTc5\MTY0\MjQ2\MTU1\MTkx\MTg2\MTc5\MjE0\MjEw\MjA5\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTQ0\MTY0\MTgz\MTg3\MTc5\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjQz\MjEw\MjE0\MjE0\MjU1\MjEw\MjE0\MjE0\MjE0\MjE0\MjE0\MjEw\MTk5\MjE0\MjE0\MjE0\MjEx\MjE0\MjE0\MjE0\MjA4\MTUw\MTUw\MjE0\MjA4\ODY=\MTUw\MjE0\MjA4\MjI=\MTUw\MjE0\MjA4\MjE0\MTUx\MjE0\MjA4\MTUw\MTUx\MjE0\MTQ3\ODY=\MjE1\MjE0\ODc=\MjI=\MjE1\MjE0\MTM4\MTUw\MjE0\MjE1\MTU3\MjE0\MTQ4\MjE0\MTk=\MTUw\MjEy\MjE0\MTY=\ODY=\MjA=\MjE1\MTY=\MjI=\MjA=\MjE1\MTY=\MjE0\MjE=\MjE1\MTY=\MTUw\MjE=\MjE1\MTM4\MTUw\ODY=\MjE1\MjAw\MjE0\ODY=\MjE0\MjE2\MjE0\MjE0\MjE0\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTc3\MTgz\MTg3\MTc5\MjE0\MjEw\MjIy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTM0\MTg2\MTgz\MTc1\MTc5\MTY0\MTY1\MjE0\MjEw\MjE4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTU0\MTg1\MTgx\MTgz\MTg2\MTM0\MTg2\MTgz\MTc1\MTc5\MTY0\MjE0\MjEw\MjE4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTg2\MTc5\MTgz\MTc4\MTc5\MTY0\MTY1\MTYy\MTgz\MTYy\MTY1\MjE0\MjEw\MjE3\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTYz\MTY0\MTY0\MTc5\MTg0\MTYy\MTI4\MTc5\MTkw\MTkx\MTgx\MTg2\MTc5\MjE0\MjEw\MjA4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTI4\MTgz\MTg2\MTYz\MTc5\MjE0\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTYx\MTgz\MTkx\MTYy\MjE0\MjEz\MjI5\MjI5\MjI5\MjI5\MjI5\MjI5\NQ==\MjMz\MjEw\MTk1\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMz\MTc5\MTYy\MTM0\MTY0\MTkx\MTg3\MTgz\MTY0\MTc1\MTM0\MTgz\MTY0\MTYy\MTQ5\MTQ0\MTY0\MTgz\MTg3\MTc5\MjE0\MjEw\MjIw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTYx\MTg1\MTY0\MTg5\MTY1\MTY2\MTgz\MTgx\MTc5\MjE0\MjEw\MTk5\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTY0\MTgz\MTgx\MTc5\MTM3\MTgx\MTkw\MTc5\MTgx\MTg5\MTY2\MTg1\MTkx\MTg0\MTYy\MTY1\MjE0\MjEw\MjA2\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTY3\MTYz\MTgz\MTY0\MTYy\MTc5\MTY0\MTg3\MTkx\MTg2\MTc5\MTM3\MTgx\MTkw\MTc5\MTgx\MTg5\MTY2\MTg1\MTkx\MTg0\MTYy\MTY1\MjE0\MjEw\MjA0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTkw\MTc5\MTgx\MTg5\MTY2\MTg1\MTkx\MTg0\MTYy\MTM3\MjMx\MTM3\MTM1\MTYz\MTgz\MTY0\MTYy\MTc5\MTY0\MjQ2\MTU1\MTkx\MTg2\MTc5\MjE0\MjEw\MjA5\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTQ0\MTY0\MTgz\MTg3\MTc5\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjUy\MjEw\MjE0\MjE0\MTU2\MjEw\MjE0\MjE0\MjE0\MjE0\MjE0\MjEw\NzU=\MjE0\MjE0\MjE0\MjEx\MjE0\MjE0\MjE0\MjA4\MTUw\MTUw\MjE0\MjA4\ODY=\MTUw\MjE0\MjA4\MjI=\MTUw\MjE0\MjA4\MjE0\MTUx\MjE0\MjA4\MTUw\MTUx\MjE0\MTQ3\ODY=\MjE1\MjE0\ODc=\MjI=\MjE1\MjE0\MTM4\MTUw\MjE0\MjE1\MTU3\MjE0\MTQ4\MjE0\MTk=\MTUw\MjEy\MjE0\MTY=\ODY=\MjA=\MjE1\MTY=\MjI=\MjA=\MjE1\MTY=\MjE0\MjE=\MjE1\MTY=\MTUw\MjE=\MjE1\MTM4\MTUw\ODY=\MjE1\MTQ3\ODY=\MjE1\MjE0\ODc=\ODY=\MjEz\MjE0\MTM4\MTUw\MjE0\MjE1\MTU3\MjE0\MTQ4\MjE0\MTk=\MTUw\MjEy\MjE0\MTY=\ODY=\MjA=\MjE1\MTY=\MjI=\MjA=\MjE1\MTY=\MjI=\MjE=\MjE1\MTY=\MTUw\MjE=\MjE1\MTM4\MTUw\ODY=\MjE1\MTQ3\ODY=\MjE1\MjE0\ODc=\ODY=\MjEz\MjE0\MTM4\MTUw\MjE0\MjE1\MTU3\MjE0\MTQ4\MjE0\MTk=\MTUw\MjEy\MjE0\MTY=\ODY=\MjA=\MjE1\MTY=\MjI=\MjA=\MjE1\MTY=\MjE0\MTg=\MjE1\MTY=\MTUw\MjE=\MjE1\MTM4\MTUw\ODY=\MjE1\MTQ3\ODY=\MjE1\MjE0\ODc=\ODY=\MjEz\MjE0\MTM4\MTUw\MjE0\MjE1\MTU3\MjE0\MTQ4\MjE0\MTk=\MTUw\MjEy\MjE0\MTY=\ODY=\MjA=\MjE1\MTY=\MjI=\MjA=\MjE1\MTY=\MTUw\MTg=\MjE1\MTY=\MTUw\MjE=\MjE1\MTM4\MTUw\ODY=\MjE1\MTQ3\ODY=\MjE1\MjE0\ODc=\ODY=\MjEz\MjE0\MTM4\MTUw\MjE0\MjE1\MTU3\MjE0\MTQ4\MjE0\MTk=\MTUw\MjEy\MjE0\MTY=\ODY=\MjA=\MjE1\MTY=\MjI=\MjA=\MjE1\MTY=\ODY=\MTg=\MjE1\MTY=\MTUw\MjE=\MjE1\MTM4\MTUw\ODY=\MjE1\MTQ3\ODY=\MjE1\MjE0\ODc=\ODY=\MjEz\MjE0\MTM4\MTUw\MjE0\MjE1\MTU3\MjE0\MTQ4\MjE0\MTk=\MTUw\MjEy\MjE0\MTY=\ODY=\MjA=\MjE1\MTY=\MjI=\MjA=\MjE1\MTY=\MjI=\MTg=\MjE1\MTY=\MTUw\MjE=\MjE1\MTM4\MTUw\ODY=\MjE1\MTQ3\ODY=\MjE1\MjE0\ODc=\ODY=\MjEz\MjE0\MTM4\MTUw\MjE0\MjE1\MTU3\MjE0\MTQ4\MjE0\MTk=\MTUw\MjEy\MjE0\MTY=\ODY=\MjA=\MjE1\MTY=\MjI=\MjA=\MjE1\MTY=\MjE0\MTk=\MjE1\MTY=\MTUw\MjE=\MjE1\MTM4\MTUw\ODY=\MjE1\MTQ3\ODY=\MjE1\MjE0\ODc=\ODY=\MjEz\MjE0\MTM4\MTUw\MjE0\MjE1\MTU3\MjE0\MTQ4\MjE0\MTk=\MTUw\MjEy\MjE0\MTY=\ODY=\MjA=\MjE1\MTY=\MjI=\MjA=\MjE1\MTY=\MjE0\MjE=\MjE1\MTY=\MTUw\MjE=\MjE1\MTM4\MTUw\ODY=\MjE1\MTQ3\ODY=\MjE1\MjE0\ODc=\ODY=\MjEz\MjE0\MTM4\MTUw\MjE0\MjE1\MTU3\MjE0\MTQ4\MjE0\MTk=\MTUw\MjEy\MjE0\MTY=\ODY=\MjA=\MjE1\MTY=\MjI=\MjA=\MjE1\MTY=\MjI=\MjE=\MjE1\MTY=\MTUw\MjE=\MjE1\MTM4\MTUw\ODY=\MjE1\MTQ3\ODY=\MjE1\MjE0\ODc=\ODY=\MjEz\MjE0\MTM4\MTUw\MjE0\MjE1\MTU3\MjE0\MTQ4\MjE0\MTk=\MTUw\MjEy\MjE0\MTY=\ODY=\MjA=\MjE1\MTY=\MjI=\MjA=\MjE1\MTY=\MjE0\MTg=\MjE1\MTY=\MTUw\MjE=\MjE1\MTM4\MTUw\ODY=\MjE1\MTQ3\ODY=\MjE1\MjE0\ODc=\ODY=\MjEz\MjE0\MTM4\MTUw\MjE0\MjE1\MTU3\MjE0\MTQ4\MjE0\MTk=\MTUw\MjEy\MjE0\MTY=\ODY=\MjA=\MjE1\MTY=\MjI=\MjA=\MjE1\MTY=\MTUw\MTg=\MjE1\MTY=\MTUw\MjE=\MjE1\MTM4\MTUw\ODY=\MjE1\MTQ3\ODY=\MjE1\MjE0\ODc=\ODY=\MjEz\MjE0\MTM4\MTUw\MjE0\MjE1\MTU3\MjE0\MTQ4\MjE0\MTk=\MTUw\MjEy\MjE0\MTY=\ODY=\MjA=\MjE1\MTY=\MjI=\MjA=\MjE1\MTY=\ODY=\MTg=\MjE1\MTY=\MTUw\MjE=\MjE1\MTM4\MTUw\ODY=\MjE1\MTQ3\ODY=\MjE1\MjE0\ODc=\ODY=\MjEz\MjE0\MTM4\MTUw\MjE0\MjE1\MTU3\MjE0\MTQ4\MjE0\MTk=\MTUw\MjEy\MjE0\MTY=\ODY=\MjA=\MjE1\MTY=\MjI=\MjA=\MjE1\MTY=\MjI=\MTg=\MjE1\MTY=\MTUw\MjE=\MjE1\MTM4\MTUw\ODY=\MjE1\MTQ3\ODY=\MjE1\MjE0\ODc=\ODY=\MjEz\MjE0\MTM4\MTUw\MjE0\MjE1\MTU3\MjE0\MTQ4\MjE0\MTk=\MTUw\MjEy\MjE0\MTY=\ODY=\MjA=\MjE1\MTY=\MjI=\MjA=\MjE1\MTY=\MjE0\MTk=\MjE1\MTY=\MTUw\MjE=\MjE1\MTM4\MTUw\ODY=\MjE1\MTQ3\ODY=\MjE1\MjE0\ODc=\ODY=\MjEz\MjE0\MTM4\MTUw\MjE0\MjE1\MTU3\MjE0\MTQ4\MjE0\MTk=\MTUw\MjEy\MjE0\MTY=\ODY=\MjA=\MjE1\MTY=\MjI=\MjA=\MjE1\MTY=\MjE0\MjE=\MjE1\MTY=\MTUw\MjE=\MjE1\MTM4\MTUw\ODY=\MjE1\MjAw\MjE0\ODY=\MjE0\MTk1\MjE0\MjE0\MjE0\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTc3\MTgz\MTg3\MTc5\MjE0\MjEw\MjIy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTM0\MTg2\MTgz\MTc1\MTc5\MTY0\MTY1\MjE0\MjEw\MjE4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTU0\MTg1\MTgx\MTgz\MTg2\MTM0\MTg2\MTgz\MTc1\MTc5\MTY0\MjE0\MjEw\MjE4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTg2\MTc5\MTgz\MTc4\MTc5\MTY0\MTY1\MTYy\MTgz\MTYy\MTY1\MjE0\MjEw\MjE3\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTYz\MTY0\MTY0\MTc5\MTg0\MTYy\MTI4\MTc5\MTkw\MTkx\MTgx\MTg2\MTc5\MjE0\MjEw\MjA4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTI4\MTgz\MTg2\MTYz\MTc5\MjE0\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTYx\MTgz\MTkx\MTYy\MjE0\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\Mzg=\MjMz\MjEw\MTk1\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMz\MTc5\MTYy\MTM0\MTY0\MTkx\MTg3\MTgz\MTY0\MTc1\MTM0\MTgz\MTY0\MTYy\MTQ5\MTQ0\MTY0\MTgz\MTg3\MTc5\MjE0\MjEw\MjIw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTYx\MTg1\MTY0\MTg5\MTY1\MTY2\MTgz\MTgx\MTc5\MjE0\MjEw\MTk5\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTY0\MTgz\MTgx\MTc5\MTM3\MTgx\MTkw\MTc5\MTgx\MTg5\MTY2\MTg1\MTkx\MTg0\MTYy\MTY1\MjE0\MjEw\MTky\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTc4\MTYz\MTg0\MTc5\MTY0\MTgz\MTg2\MTg2\MTc1\MTM3\MTgx\MTkw\MTc5\MTgx\MTg5\MTY2\MTg1\MTkx\MTg0\MTYy\MTY1\MjE0\MjEw\MjA2\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTkw\MTc5\MTgx\MTg5\MTY2\MTg1\MTkx\MTg0\MTYy\MTM3\MjMx\MTM3\MTQ2\MTYz\MTg0\MTc5\MjQ2\MTMy\MTgz\MTg2\MTg2\MTc1\MjE0\MjEw\MjA5\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTQ0\MTY0\MTgz\MTg3\MTc5\MjE0\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\NDY=\MjMz\MjEw\MjA2\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTkw\MTc5\MTgx\MTg5\MTY2\MTg1\MTkx\MTg0\MTYy\MTM3\MjI4\MTM3\MTQ2\MTYz\MTg0\MTc5\MjQ2\MTMy\MTgz\MTg2\MTg2\MTc1\MjE0\MjEw\MjA2\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTkw\MTc5\MTgx\MTg5\MTY2\MTg1\MTkx\MTg0\MTYy\MTM3\MjI5\MTM3\MTQ2\MTYz\MTg0\MTc5\MjQ2\MTMy\MTgz\MTg2\MTg2\MTc1\MjE0\MjEw\MjA2\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTkw\MTc5\MTgx\MTg5\MTY2\MTg1\MTkx\MTg0\MTYy\MTM3\MjI2\MTM3\MTQ2\MTYz\MTg0\MTc5\MjQ2\MTMy\MTgz\MTg2\MTg2\MTc1\MjE0\MjEw\MjA2\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTkw\MTc5\MTgx\MTg5\MTY2\MTg1\MTkx\MTg0\MTYy\MTM3\MjI3\MTM3\MTQ2\MTYz\MTg0\MTc5\MjQ2\MTMy\MTgz\MTg2\MTg2\MTc1\MjE0\MjEw\MjA2\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTkw\MTc5\MTgx\MTg5\MTY2\MTg1\MTkx\MTg0\MTYy\MTM3\MjI0\MTM3\MTQ2\MTYz\MTg0\MTc5\MjQ2\MTMy\MTgz\MTg2\MTg2\MTc1\MjE0\MjEw\MjA2\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTkw\MTc5\MTgx\MTg5\MTY2\MTg1\MTkx\MTg0\MTYy\MTM3\MjI1\MTM3\MTQ2\MTYz\MTg0\MTc5\MjQ2\MTMy\MTgz\MTg2\MTg2\MTc1\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTU3\MjEw\MjE0\MjE0\MTg3\MjEw\MjE0\MjE0\MjE0\MjE0\MjE0\MjEw\MTEz\MjE0\MjE0\MjE0\MjEx\MjE0\MjE0\MjE0\MjA4\MTUw\MTUw\MjE0\MjA4\ODY=\MTUw\MjE0\MjA4\MjI=\MTUw\MjE0\MjA4\MjE0\MTUx\MjE0\MjA4\MTUw\MTUx\MjE0\MTQ3\ODY=\MjE1\MjE0\ODc=\MjI=\MjE1\MjE0\MTM4\MTUw\MjE0\MjE1\MTU3\MjE0\MTQ4\MjE0\MTk=\MTUw\MjEy\MjE0\MTY=\ODY=\MjA=\MjE1\MTY=\MjI=\MjA=\MjE1\MTY=\MjE0\MjE=\MjE1\MTY=\MTUw\MjE=\MjE1\MTM4\MTUw\ODY=\MjE1\MTQ3\ODY=\MjE1\MjE0\ODc=\MjI=\MjE1\MjE0\MTM4\MTUw\MjE0\MjE1\MTU3\MjE0\MTQ4\MjE0\MTk=\MTUw\MjEy\MjE0\MTY=\ODY=\MjA=\MjE1\MTY=\MjI=\MjA=\MjE1\MTY=\ODY=\MjE=\MjE1\MTY=\MTUw\MjE=\MjE1\MTM4\MTUw\ODY=\MjE1\MTQ3\ODY=\MjE1\MjE0\ODc=\MjI=\MjE1\MjE0\MTM4\MTUw\MjE0\MjE1\MTU3\MjE0\MTQ4\MjE0\MTk=\MTUw\MjEy\MjE0\MTY=\ODY=\MjA=\MjE1\MTY=\MjI=\MjA=\MjE1\MTY=\MjI=\MjE=\MjE1\MTY=\MTUw\MjE=\MjE1\MTM4\MTUw\ODY=\MjE1\MTQ3\ODY=\MjE1\MjE0\ODc=\MjI=\MjE1\MjE0\MTM4\MTUw\MjE0\MjE1\MTU3\MjE0\MTQ4\MjE0\MTk=\MTUw\MjEy\MjE0\MTY=\ODY=\MjA=\MjE1\MTY=\MjI=\MjA=\MjE1\MTY=\MjE0\MTg=\MjE1\MTY=\MTUw\MjE=\MjE1\MTM4\MTUw\ODY=\MjE1\MTQ3\ODY=\MjE1\MjE0\ODc=\MjI=\MjE1\MjE0\MTM4\MTUw\MjE0\MjE1\MTU3\MjE0\MTQ4\MjE0\MTk=\MTUw\MjEy\MjE0\MTY=\ODY=\MjA=\MjE1\MTY=\MjI=\MjA=\MjE1\MTY=\MTUw\MTg=\MjE1\MTY=\MTUw\MjE=\MjE1\MTM4\MTUw\ODY=\MjE1\MTQ3\ODY=\MjE1\MjE0\ODc=\MjI=\MjE1\MjE0\MTM4\MTUw\MjE0\MjE1\MTU3\MjE0\MTQ4\MjE0\MTk=\MTUw\MjEy\MjE0\MTY=\ODY=\MjA=\MjE1\MTY=\MjI=\MjA=\MjE1\MTY=\ODY=\MTg=\MjE1\MTY=\MTUw\MjE=\MjE1\MTM4\MTUw\ODY=\MjE1\MTQ3\ODY=\MjE1\MjE0\ODc=\MjI=\MjE1\MjE0\MTM4\MTUw\MjE0\MjE1\MTU3\MjE0\MTQ4\MjE0\MTk=\MTUw\MjEy\MjE0\MTY=\ODY=\MjA=\MjE1\MTY=\MjI=\MjA=\MjE1\MTY=\MjI=\MTg=\MjE1\MTY=\MTUw\MjE=\MjE1\MTM4\MTUw\ODY=\MjE1\MTQ3\ODY=\MjE1\MjE0\ODc=\MjI=\MjE1\MjE0\MTM4\MTUw\MjE0\MjE1\MTU3\MjE0\MTQ4\MjE0\MTk=\MTUw\MjEy\MjE0\MTY=\ODY=\MjA=\MjE1\MTY=\MjI=\MjA=\MjE1\MTY=\MjE0\MTk=\MjE1\MTY=\MTUw\MjE=\MjE1\MTM4\MTUw\ODY=\MjE1\MTQ3\ODY=\MjE1\MjE0\ODc=\MjI=\MjE1\MjE0\MTM4\MTUw\MjE0\MjE1\MTU3\MjE0\MTQ4\MjE0\MTk=\MTUw\MjEy\MjE0\MTY=\ODY=\MjA=\MjE1\MTY=\MjI=\MjA=\MjE1\MTY=\MTUw\MTk=\MjE1\MTY=\MTUw\MjE=\MjE1\MTM4\MTUw\ODY=\MjE1\MTQ3\ODY=\MjE1\MjE0\ODc=\MjI=\MjE1\MjE0\MTM4\MTUw\MjE0\MjE1\MTU3\MjE0\MTQ4\MjE0\MTk=\MTUw\MjEy\MjE0\MTY=\ODY=\MjA=\MjE1\MTY=\MjI=\MjA=\MjE1\MTY=\ODY=\MTk=\MjE1\MTY=\MTUw\MjE=\MjE1\MTM4\MTUw\ODY=\MjE1\MTQ3\ODY=\MjE1\MjE0\ODc=\MjI=\MjE1\MjE0\MTM4\MTUw\MjE0\MjE1\MTU3\MjE0\MTQ4\MjE0\MTk=\MTUw\MjEy\MjE0\MTY=\ODY=\MjA=\MjE1\MTY=\MjI=\MjA=\MjE1\MTY=\MjI=\MTk=\MjE1\MTY=\MTUw\MjE=\MjE1\MTM4\MTUw\ODY=\MjE1\MTQ3\ODY=\MjE1\MjE0\ODc=\MjI=\MjE1\MjE0\MTM4\MTUw\MjE0\MjE1\MTU3\MjE0\MTQ4\MjE0\MTk=\MTUw\MjEy\MjE0\MTY=\ODY=\MjA=\MjE1\MTY=\MjI=\MjA=\MjE1\MTY=\MjE0\MTY=\MjE1\MTY=\MTUw\MjE=\MjE1\MTM4\MTUw\ODY=\MjE1\MTQ3\ODY=\MjE1\MjE0\ODc=\MjI=\MjE1\MjE0\MTM4\MTUw\MjE0\MjE1\MTU3\MjE0\MTQ4\MjE0\MTk=\MTUw\MjEy\MjE0\MTY=\ODY=\MjA=\MjE1\MTY=\MjI=\MjA=\MjE1\MTY=\MTUw\MTY=\MjE1\MTY=\MTUw\MjE=\MjE1\MTM4\MTUw\ODY=\MjE1\MTQ3\ODY=\MjE1\MjE0\ODc=\MjI=\MjE1\MjE0\MTM4\MTUw\MjE0\MjE1\MTU3\MjE0\MTQ4\MjE0\MTk=\MTUw\MjEy\MjE0\MTY=\ODY=\MjA=\MjE1\MTY=\MjI=\MjA=\MjE1\MTY=\ODY=\MTY=\MjE1\MTY=\MTUw\MjE=\MjE1\MTM4\MTUw\ODY=\MjE1\MTQ3\ODY=\MjE1\MjE0\ODc=\MjI=\MjE1\MjE0\MTM4\MTUw\MjE0\MjE1\MTU3\MjE0\MTQ4\MjE0\MTk=\MTUw\MjEy\MjE0\MTY=\ODY=\MjA=\MjE1\MTY=\MjI=\MjA=\MjE1\MTY=\MjI=\MTY=\MjE1\MTY=\MTUw\MjE=\MjE1\MTM4\MTUw\ODY=\MjE1\MTQ3\ODY=\MjE1\MjE0\ODc=\MjI=\MjE1\MjE0\MTM4\MTUw\MjE0\MjE1\MTU3\MjE0\MTQ4\MjE0\MTk=\MTUw\MjEy\MjE0\MTY=\ODY=\MjA=\MjE1\MTY=\MjI=\MjA=\MjE1\MTY=\MjE0\MjE=\MjE1\MTY=\MTUw\MjE=\MjE1\MTM4\MTUw\ODY=\MjE1\MjAw\MjE0\ODY=\MjE0\MjAy\MjE0\MjE0\MjE0\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTc3\MTgz\MTg3\MTc5\MjE0\MjEw\MjIy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTM0\MTg2\MTgz\MTc1\MTc5\MTY0\MTY1\MjE0\MjEw\MjE4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTU0\MTg1\MTgx\MTgz\MTg2\MTM0\MTg2\MTgz\MTc1\MTc5\MTY0\MjE0\MjEw\MjE4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTg2\MTc5\MTgz\MTc4\MTc5\MTY0\MTY1\MTYy\MTgz\MTYy\MTY1\MjE0\MjEw\MjE3\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTYz\MTY0\MTY0\MTc5\MTg0\MTYy\MTI4\MTc5\MTkw\MTkx\MTgx\MTg2\MTc5\MjE0\MjEw\MjA4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTI4\MTgz\MTg2\MTYz\MTc5\MjE0\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTYx\MTgz\MTkx\MTYy\MjE0\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\NDY=\MjMz\MjEw\MTk1\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMz\MTc5\MTYy\MTM0\MTY0\MTkx\MTg3\MTgz\MTY0\MTc1\MTM0\MTgz\MTY0\MTYy\MTQ5\MTQ0\MTY0\MTgz\MTg3\MTc5\MjE0\MjEw\MjIw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTYx\MTg1\MTY0\MTg5\MTY1\MTY2\MTgz\MTgx\MTc5\MjE0\MjEw\MTk5\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTY0\MTgz\MTgx\MTc5\MTM3\MTgx\MTkw\MTc5\MTgx\MTg5\MTY2\MTg1\MTkx\MTg0\MTYy\MTY1\MjE0\MjEw\MjA1\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTgz\MTY0\MTg1\MTYz\MTg0\MTc4\MTYy\MTkw\MTc5\MTYx\MTg1\MTY0\MTg2\MTc4\MTM3\MTgx\MTkw\MTc5\MTgx\MTg5\MTY2\MTg1\MTkx\MTg0\MTYy\MTY1\MjE0\MjEw\MjAw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTkw\MTc5\MTgx\MTg5\MTY2\MTg1\MTkx\MTg0\MTYy\MTM3\MjMx\MTM3\MTUx\MTY0\MTg1\MTYz\MTg0\MTc4\MjQ2\MTYy\MTkw\MTc5\MjQ2\MTI5\MTg1\MTY0\MTg2\MTc4\MjE0\MjEw\MjA5\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTQ0\MTY0\MTgz\MTg3\MTc5\MjE0\MjEw\MjAw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTkw\MTc5\MTgx\MTg5\MTY2\MTg1\MTkx\MTg0\MTYy\MTM3\MjI4\MTM3\MTUx\MTY0\MTg1\MTYz\MTg0\MTc4\MjQ2\MTYy\MTkw\MTc5\MjQ2\MTI5\MTg1\MTY0\MTg2\MTc4\MjE0\MjEw\MjAw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTkw\MTc5\MTgx\MTg5\MTY2\MTg1\MTkx\MTg0\MTYy\MTM3\MjI5\MTM3\MTUx\MTY0\MTg1\MTYz\MTg0\MTc4\MjQ2\MTYy\MTkw\MTc5\MjQ2\MTI5\MTg1\MTY0\MTg2\MTc4\MjE0\MjEw\MjAw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTkw\MTc5\MTgx\MTg5\MTY2\MTg1\MTkx\MTg0\MTYy\MTM3\MjI2\MTM3\MTUx\MTY0\MTg1\MTYz\MTg0\MTc4\MjQ2\MTYy\MTkw\MTc5\MjQ2\MTI5\MTg1\MTY0\MTg2\MTc4\MjE0\MjEw\MjAw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTkw\MTc5\MTgx\MTg5\MTY2\MTg1\MTkx\MTg0\MTYy\MTM3\MjI3\MTM3\MTUx\MTY0\MTg1\MTYz\MTg0\MTc4\MjQ2\MTYy\MTkw\MTc5\MjQ2\MTI5\MTg1\MTY0\MTg2\MTc4\MjE0\MjEw\MjAw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTkw\MTc5\MTgx\MTg5\MTY2\MTg1\MTkx\MTg0\MTYy\MTM3\MjI0\MTM3\MTUx\MTY0\MTg1\MTYz\MTg0\MTc4\MjQ2\MTYy\MTkw\MTc5\MjQ2\MTI5\MTg1\MTY0\MTg2\MTc4\MjE0\MjEw\MjAw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTkw\MTc5\MTgx\MTg5\MTY2\MTg1\MTkx\MTg0\MTYy\MTM3\MjI1\MTM3\MTUx\MTY0\MTg1\MTYz\MTg0\MTc4\MjQ2\MTYy\MTkw\MTc5\MjQ2\MTI5\MTg1\MTY0\MTg2\MTc4\MjE0\MjEw\MjAw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTkw\MTc5\MTgx\MTg5\MTY2\MTg1\MTkx\MTg0\MTYy\MTM3\MjM4\MTM3\MTUx\MTY0\MTg1\MTYz\MTg0\MTc4\MjQ2\MTYy\MTkw\MTc5\MjQ2\MTI5\MTg1\MTY0\MTg2\MTc4\MjE0\MjEw\MjAw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTkw\MTc5\MTgx\MTg5\MTY2\MTg1\MTkx\MTg0\MTYy\MTM3\MjM5\MTM3\MTUx\MTY0\MTg1\MTYz\MTg0\MTc4\MjQ2\MTYy\MTkw\MTc5\MjQ2\MTI5\MTg1\MTY0\MTg2\MTc4\MjE0\MjEw\MjAx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTkw\MTc5\MTgx\MTg5\MTY2\MTg1\MTkx\MTg0\MTYy\MTM3\MjMx\MjMw\MTM3\MTUx\MTY0\MTg1\MTYz\MTg0\MTc4\MjQ2\MTYy\MTkw\MTc5\MjQ2\MTI5\MTg1\MTY0\MTg2\MTc4\MjE0\MjEw\MjAx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTkw\MTc5\MTgx\MTg5\MTY2\MTg1\MTkx\MTg0\MTYy\MTM3\MjMx\MjMx\MTM3\MTUx\MTY0\MTg1\MTYz\MTg0\MTc4\MjQ2\MTYy\MTkw\MTc5\MjQ2\MTI5\MTg1\MTY0\MTg2\MTc4\MjE0\MjEw\MjAx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTkw\MTc5\MTgx\MTg5\MTY2\MTg1\MTkx\MTg0\MTYy\MTM3\MjMx\MjI4\MTM3\MTUx\MTY0\MTg1\MTYz\MTg0\MTc4\MjQ2\MTYy\MTkw\MTc5\MjQ2\MTI5\MTg1\MTY0\MTg2\MTc4\MjE0\MjEw\MjAx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTkw\MTc5\MTgx\MTg5\MTY2\MTg1\MTkx\MTg0\MTYy\MTM3\MjMx\MjI5\MTM3\MTUx\MTY0\MTg1\MTYz\MTg0\MTc4\MjQ2\MTYy\MTkw\MTc5\MjQ2\MTI5\MTg1\MTY0\MTg2\MTc4\MjE0\MjEw\MjAx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTkw\MTc5\MTgx\MTg5\MTY2\MTg1\MTkx\MTg0\MTYy\MTM3\MjMx\MjI2\MTM3\MTUx\MTY0\MTg1\MTYz\MTg0\MTc4\MjQ2\MTYy\MTkw\MTc5\MjQ2\MTI5\MTg1\MTY0\MTg2\MTc4\MjE0\MjEw\MjAx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTkw\MTc5\MTgx\MTg5\MTY2\MTg1\MTkx\MTg0\MTYy\MTM3\MjMx\MjI3\MTM3\MTUx\MTY0\MTg1\MTYz\MTg0\MTc4\MjQ2\MTYy\MTkw\MTc5\MjQ2\MTI5\MTg1\MTY0\MTg2\MTc4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTg0\MjEw\MjE0\MjE0\NzY=\MjEw\MjE0\MjE0\MjE0\MjE0\MjE0\MjEw\MTU=\MjE0\MjE0\MjE0\MjEx\MjE0\MjE0\MjE0\MjA4\MTUw\MTUw\MjE0\MjA4\ODY=\MTUw\MjE0\MjA4\MjI=\MTUw\MjE0\MjA4\MjE0\MTUx\MjE0\MjA4\MTUw\MTUx\MjE0\MTQ3\ODY=\MjE1\MjE0\ODc=\MjI=\MjE1\MjE0\MTM4\MTUw\MjE0\MjE1\MTU3\MjE0\MTQ4\MjE0\MTk=\MTUw\MjEy\MjE0\MTY=\ODY=\MjA=\MjE1\MTY=\MjI=\MjA=\MjE1\MTY=\MjE0\MjE=\MjE1\MTY=\MTUw\MjE=\MjE1\MTM4\MTUw\ODY=\MjE1\MTQ3\ODY=\MjE1\MjE0\ODc=\ODY=\MjEz\MjE0\MTM4\MTUw\MjE0\MjE1\MTU3\MjE0\MTQ4\MjE0\MTk=\MTUw\MjEy\MjE0\MTY=\ODY=\MjA=\MjE1\MTY=\MjI=\MjA=\MjE1\MTY=\MjI=\MjE=\MjE1\MTY=\MTUw\MjE=\MjE1\MTM4\MTUw\ODY=\MjE1\MTQ3\ODY=\MjE1\MjE0\ODc=\ODY=\MjEz\MjE0\MTM4\MTUw\MjE0\MjE1\MTU3\MjE0\MTQ4\MjE0\MTk=\MTUw\MjEy\MjE0\MTY=\ODY=\MjA=\MjE1\MTY=\MjI=\MjA=\MjE1\MTY=\MjE0\MTg=\MjE1\MTY=\MTUw\MjE=\MjE1\MTM4\MTUw\ODY=\MjE1\MTQ3\ODY=\MjE1\MjE0\ODc=\ODY=\MjEz\MjE0\MTM4\MTUw\MjE0\MjE1\MTU3\MjE0\MTQ4\MjE0\MTk=\MTUw\MjEy\MjE0\MTY=\ODY=\MjA=\MjE1\MTY=\MjI=\MjA=\MjE1\MTY=\MTUw\MTg=\MjE1\MTY=\MTUw\MjE=\MjE1\MTM4\MTUw\ODY=\MjE1\MTQ3\ODY=\MjE1\MjE0\ODc=\ODY=\MjEz\MjE0\MTM4\MTUw\MjE0\MjE1\MTU3\MjE0\MTQ4\MjE0\MTk=\MTUw\MjEy\MjE0\MTY=\ODY=\MjA=\MjE1\MTY=\MjI=\MjA=\MjE1\MTY=\ODY=\MTg=\MjE1\MTY=\MTUw\MjE=\MjE1\MTM4\MTUw\ODY=\MjE1\MTQ3\ODY=\MjE1\MjE0\ODc=\ODY=\MjEz\MjE0\MTM4\MTUw\MjE0\MjE1\MTU3\MjE0\MTQ4\MjE0\MTk=\MTUw\MjEy\MjE0\MTY=\ODY=\MjA=\MjE1\MTY=\MjI=\MjA=\MjE1\MTY=\MjI=\MTg=\MjE1\MTY=\MTUw\MjE=\MjE1\MTM4\MTUw\ODY=\MjE1\MTQ3\ODY=\MjE1\MjE0\ODc=\ODY=\MjEz\MjE0\MTM4\MTUw\MjE0\MjE1\MTU3\MjE0\MTQ4\MjE0\MTk=\MTUw\MjEy\MjE0\MTY=\ODY=\MjA=\MjE1\MTY=\MjI=\MjA=\MjE1\MTY=\MjE0\MTk=\MjE1\MTY=\MTUw\MjE=\MjE1\MTM4\MTUw\ODY=\MjE1\MTQ3\ODY=\MjE1\MjE0\ODc=\ODY=\MjEz\MjE0\MTM4\MTUw\MjE0\MjE1\MTU3\MjE0\MTQ4\MjE0\MTk=\MTUw\MjEy\MjE0\MTY=\ODY=\MjA=\MjE1\MTY=\MjI=\MjA=\MjE1\MTY=\MTUw\MTk=\MjE1\MTY=\MTUw\MjE=\MjE1\MTM4\MTUw\ODY=\MjE1\MTQ3\ODY=\MjE1\MjE0\ODc=\ODY=\MjEz\MjE0\MTM4\MTUw\MjE0\MjE1\MTU3\MjE0\MTQ4\MjE0\MTk=\MTUw\MjEy\MjE0\MTY=\ODY=\MjA=\MjE1\MTY=\MjI=\MjA=\MjE1\MTY=\ODY=\MTk=\MjE1\MTY=\MTUw\MjE=\MjE1\MTM4\MTUw\ODY=\MjE1\MTQ3\ODY=\MjE1\MjE0\ODc=\ODY=\MjEz\MjE0\MTM4\MTUw\MjE0\MjE1\MTU3\MjE0\MTQ4\MjE0\MTk=\MTUw\MjEy\MjE0\MTY=\ODY=\MjA=\MjE1\MTY=\MjI=\MjA=\MjE1\MTY=\MjI=\MTk=\MjE1\MTY=\MTUw\MjE=\MjE1\MTM4\MTUw\ODY=\MjE1\MTQ3\ODY=\MjE1\MjE0\ODc=\ODY=\MjEz\MjE0\MTM4\MTUw\MjE0\MjE1\MTU3\MjE0\MTQ4\MjE0\MTk=\MTUw\MjEy\MjE0\MTY=\ODY=\MjA=\MjE1\MTY=\MjI=\MjA=\MjE1\MTY=\MjE0\MjE=\MjE1\MTY=\MTUw\MjE=\MjE1\MTM4\MTUw\ODY=\MjE1\MTQ3\ODY=\MjE1\MjE0\ODc=\ODY=\MjEz\MjE0\MTM4\MTUw\MjE0\MjE1\MTU3\MjE0\MTQ4\MjE0\MTk=\MTUw\MjEy\MjE0\MTY=\ODY=\MjA=\MjE1\MTY=\MjI=\MjA=\MjE1\MTY=\MjI=\MjE=\MjE1\MTY=\MTUw\MjE=\MjE1\MTM4\MTUw\ODY=\MjE1\MTQ3\ODY=\MjE1\MjE0\ODc=\ODY=\MjEz\MjE0\MTM4\MTUw\MjE0\MjE1\MTU3\MjE0\MTQ4\MjE0\MTk=\MTUw\MjEy\MjE0\MTY=\ODY=\MjA=\MjE1\MTY=\MjI=\MjA=\MjE1\MTY=\MjE0\MTg=\MjE1\MTY=\MTUw\MjE=\MjE1\MTM4\MTUw\ODY=\MjE1\MTQ3\ODY=\MjE1\MjE0\ODc=\ODY=\MjEz\MjE0\MTM4\MTUw\MjE0\MjE1\MTU3\MjE0\MTQ4\MjE0\MTk=\MTUw\MjEy\MjE0\MTY=\ODY=\MjA=\MjE1\MTY=\MjI=\MjA=\MjE1\MTY=\MTUw\MTg=\MjE1\MTY=\MTUw\MjE=\MjE1\MTM4\MTUw\ODY=\MjE1\MTQ3\ODY=\MjE1\MjE0\ODc=\ODY=\MjEz\MjE0\MTM4\MTUw\MjE0\MjE1\MTU3\MjE0\MTQ4\MjE0\MTk=\MTUw\MjEy\MjE0\MTY=\ODY=\MjA=\MjE1\MTY=\MjI=\MjA=\MjE1\MTY=\ODY=\MTg=\MjE1\MTY=\MTUw\MjE=\MjE1\MTM4\MTUw\ODY=\MjE1\MTQ3\ODY=\MjE1\MjE0\ODc=\ODY=\MjEz\MjE0\MTM4\MTUw\MjE0\MjE1\MTU3\MjE0\MTQ4\MjE0\MTk=\MTUw\MjEy\MjE0\MTY=\ODY=\MjA=\MjE1\MTY=\MjI=\MjA=\MjE1\MTY=\MjI=\MTg=\MjE1\MTY=\MTUw\MjE=\MjE1\MTM4\MTUw\ODY=\MjE1\MTQ3\ODY=\MjE1\MjE0\ODc=\ODY=\MjEz\MjE0\MTM4\MTUw\MjE0\MjE1\MTU3\MjE0\MTQ4\MjE0\MTk=\MTUw\MjEy\MjE0\MTY=\ODY=\MjA=\MjE1\MTY=\MjI=\MjA=\MjE1\MTY=\MjE0\MTk=\MjE1\MTY=\MTUw\MjE=\MjE1\MTM4\MTUw\ODY=\MjE1\MTQ3\ODY=\MjE1\MjE0\ODc=\ODY=\MjEz\MjE0\MTM4\MTUw\MjE0\MjE1\MTU3\MjE0\MTQ4\MjE0\MTk=\MTUw\MjEy\MjE0\MTY=\ODY=\MjA=\MjE1\MTY=\MjI=\MjA=\MjE1\MTY=\MTUw\MTk=\MjE1\MTY=\MTUw\MjE=\MjE1\MTM4\MTUw\ODY=\MjE1\MTQ3\ODY=\MjE1\MjE0\ODc=\ODY=\MjEz\MjE0\MTM4\MTUw\MjE0\MjE1\MTU3\MjE0\MTQ4\MjE0\MTk=\MTUw\MjEy\MjE0\MTY=\ODY=\MjA=\MjE1\MTY=\MjI=\MjA=\MjE1\MTY=\ODY=\MTk=\MjE1\MTY=\MTUw\MjE=\MjE1\MTM4\MTUw\ODY=\MjE1\MTQ3\ODY=\MjE1\MjE0\ODc=\ODY=\MjEz\MjE0\MTM4\MTUw\MjE0\MjE1\MTU3\MjE0\MTQ4\MjE0\MTk=\MTUw\MjEy\MjE0\MTY=\ODY=\MjA=\MjE1\MTY=\MjI=\MjA=\MjE1\MTY=\MjI=\MTk=\MjE1\MTY=\MTUw\MjE=\MjE1\MTM4\MTUw\ODY=\MjE1\MTQ3\ODY=\MjE1\MjE0\ODc=\ODY=\MjEz\MjE0\MTM4\MTUw\MjE0\MjE1\MTU3\MjE0\MTQ4\MjE0\MTk=\MTUw\MjEy\MjE0\MTY=\ODY=\MjA=\MjE1\MTY=\MjI=\MjA=\MjE1\MTY=\MjE0\MjE=\MjE1\MTY=\MTUw\MjE=\MjE1\MTM4\MTUw\ODY=\MjE1\MjAw\MjE0\ODY=\MjE0\MjA2\MjE0\MjE0\MjE0\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTc3\MTgz\MTg3\MTc5\MjE0\MjEw\MjIy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTM0\MTg2\MTgz\MTc1\MTc5\MTY0\MTY1\MjE0\MjEw\MjE4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTU0\MTg1\MTgx\MTgz\MTg2\MTM0\MTg2\MTgz\MTc1\MTc5\MTY0\MjE0\MjEw\MjE4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTg2\MTc5\MTgz\MTc4\MTc5\MTY0\MTY1\MTYy\MTgz\MTYy\MTY1\MjE0\MjEw\MjE3\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTYz\MTY0\MTY0\MTc5\MTg0\MTYy\MTI4\MTc5\MTkw\MTkx\MTgx\MTg2\MTc5\MjE0\MjEw\MjA4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTI4\MTgz\MTg2\MTYz\MTc5\MjE0\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTYx\MTgz\MTkx\MTYy\MjE0\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\Mzg=\MjMz\MjEw\MTk1\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMz\MTc5\MTYy\MTM0\MTY0\MTkx\MTg3\MTgz\MTY0\MTc1\MTM0\MTgz\MTY0\MTYy\MTQ5\MTQ0\MTY0\MTgz\MTg3\MTc5\MjE0\MjEw\MjIw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTYx\MTg1\MTY0\MTg5\MTY1\MTY2\MTgz\MTgx\MTc5\MjE0\MjEw\MTk5\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTY0\MTgz\MTgx\MTc5\MTM3\MTgx\MTkw\MTc5\MTgx\MTg5\MTY2\MTg1\MTkx\MTg0\MTYy\MTY1\MjE0\MjEw\MTk0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTkw\MTkx\MTc3\MTkw\MTYx\MTgz\MTc1\MTM3\MTgx\MTkw\MTc5\MTgx\MTg5\MTY2\MTg1\MTkx\MTg0\MTYy\MTY1\MjE0\MjEw\MjA0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTkw\MTc5\MTgx\MTg5\MTY2\MTg1\MTkx\MTg0\MTYy\MTM3\MjMx\MTM3\MTU4\MTkx\MTc3\MTkw\MTYx\MTgz\MTc1\MjQ2\MTMy\MTgz\MTgx\MTc5\MjE0\MjEw\MjA5\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTQ0\MTY0\MTgz\MTg3\MTc5\MjE0\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\NDY=\MjMz\MjEw\MjA0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTkw\MTc5\MTgx\MTg5\MTY2\MTg1\MTkx\MTg0\MTYy\MTM3\MjI4\MTM3\MTU4\MTkx\MTc3\MTkw\MTYx\MTgz\MTc1\MjQ2\MTMy\MTgz\MTgx\MTc5\MjE0\MjEw\MjA0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTkw\MTc5\MTgx\MTg5\MTY2\MTg1\MTkx\MTg0\MTYy\MTM3\MjI5\MTM3\MTU4\MTkx\MTc3\MTkw\MTYx\MTgz\MTc1\MjQ2\MTMy\MTgz\MTgx\MTc5\MjE0\MjEw\MjA0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTkw\MTc5\MTgx\MTg5\MTY2\MTg1\MTkx\MTg0\MTYy\MTM3\MjI2\MTM3\MTU4\MTkx\MTc3\MTkw\MTYx\MTgz\MTc1\MjQ2\MTMy\MTgz\MTgx\MTc5\MjE0\MjEw\MjA0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTkw\MTc5\MTgx\MTg5\MTY2\MTg1\MTkx\MTg0\MTYy\MTM3\MjI3\MTM3\MTU4\MTkx\MTc3\MTkw\MTYx\MTgz\MTc1\MjQ2\MTMy\MTgz\MTgx\MTc5\MjE0\MjEw\MjA0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTkw\MTc5\MTgx\MTg5\MTY2\MTg1\MTkx\MTg0\MTYy\MTM3\MjI0\MTM3\MTU4\MTkx\MTc3\MTkw\MTYx\MTgz\MTc1\MjQ2\MTMy\MTgz\MTgx\MTc5\MjE0\MjEw\MjA0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTkw\MTc5\MTgx\MTg5\MTY2\MTg1\MTkx\MTg0\MTYy\MTM3\MjI1\MTM3\MTU4\MTkx\MTc3\MTkw\MTYx\MTgz\MTc1\MjQ2\MTMy\MTgz\MTgx\MTc5\MjE0\MjEw\MjA0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTkw\MTc5\MTgx\MTg5\MTY2\MTg1\MTkx\MTg0\MTYy\MTM3\MjM4\MTM3\MTU4\MTkx\MTc3\MTkw\MTYx\MTgz\MTc1\MjQ2\MTMy\MTgz\MTgx\MTc5\MjE0\MjEw\MjA0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTkw\MTc5\MTgx\MTg5\MTY2\MTg1\MTkx\MTg0\MTYy\MTM3\MjM5\MTM3\MTU4\MTkx\MTc3\MTkw\MTYx\MTgz\MTc1\MjQ2\MTMy\MTgz\MTgx\MTc5\MjE0\MjEw\MjA1\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTkw\MTc5\MTgx\MTg5\MTY2\MTg1\MTkx\MTg0\MTYy\MTM3\MjMx\MjMw\MTM3\MTU4\MTkx\MTc3\MTkw\MTYx\MTgz\MTc1\MjQ2\MTMy\MTgz\MTgx\MTc5\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\Nzc=\MjEw\MjE0\MjE0\MjU=\MjEw\MjE0\MjE0\MjE0\MjE0\MjE0\MjEw\MjE1\MjE1\MjE0\MjE0\MjEx\MjE0\MjE0\MjE0\MjA4\MTUw\MTUw\MjE0\MjA4\ODY=\MTUw\MjE0\MjA4\MjI=\MTUw\MjE0\MjA4\MjE0\MTUx\MjE0\MjA4\MTUw\MTUx\MjE0\MTQ3\ODY=\MjE1\MjE0\ODc=\MjI=\MjE1\MjE0\MTM4\MTUw\MjE0\MjE1\MTU3\MjE0\MTQ4\MjE0\MTk=\MTUw\MjEy\MjE0\MTY=\ODY=\MjA=\MjE1\MTY=\MjI=\MjA=\MjE1\MTY=\MjE0\MjE=\MjE1\MTY=\MTUw\MjE=\MjE1\MTM4\MTUw\ODY=\MjE1\MTQ3\ODY=\MjE1\MjE0\ODc=\MjI=\MjE1\MjE0\MTM4\MTUw\MjE0\MjE1\MTU3\MjE0\MTQ4\MjE0\MTk=\MTUw\MjEy\MjE0\MTY=\ODY=\MjA=\MjE1\MTY=\MjI=\MjA=\MjE1\MTY=\ODY=\MjE=\MjE1\MTY=\MTUw\MjE=\MjE1\MTM4\MTUw\ODY=\MjE1\MTQ3\ODY=\MjE1\MjE0\ODc=\MjI=\MjE1\MjE0\MTM4\MTUw\MjE0\MjE1\MTU3\MjE0\MTQ4\MjE0\MTk=\MTUw\MjEy\MjE0\MTY=\ODY=\MjA=\MjE1\MTY=\MjI=\MjA=\MjE1\MTY=\MjI=\MjE=\MjE1\MTY=\MTUw\MjE=\MjE1\MTM4\MTUw\ODY=\MjE1\MTQ3\ODY=\MjE1\MjE0\ODc=\MjI=\MjE1\MjE0\MTM4\MTUw\MjE0\MjE1\MTU3\MjE0\MTQ4\MjE0\MTk=\MTUw\MjEy\MjE0\MTY=\ODY=\MjA=\MjE1\MTY=\MjI=\MjA=\MjE1\MTY=\MjE0\MTg=\MjE1\MTY=\MTUw\MjE=\MjE1\MTM4\MTUw\ODY=\MjE1\MTQ3\ODY=\MjE1\MjE0\ODc=\MjI=\MjE1\MjE0\MTM4\MTUw\MjE0\MjE1\MTU3\MjE0\MTQ4\MjE0\MTk=\MTUw\MjEy\MjE0\MTY=\ODY=\MjA=\MjE1\MTY=\MjI=\MjA=\MjE1\MTY=\MTUw\MTg=\MjE1\MTY=\MTUw\MjE=\MjE1\MTM4\MTUw\ODY=\MjE1\MTQ3\ODY=\MjE1\MjE0\ODc=\MjI=\MjE1\MjE0\MTM4\MTUw\MjE0\MjE1\MTU3\MjE0\MTQ4\MjE0\MTk=\MTUw\MjEy\MjE0\MTY=\ODY=\MjA=\MjE1\MTY=\MjI=\MjA=\MjE1\MTY=\ODY=\MTg=\MjE1\MTY=\MTUw\MjE=\MjE1\MTM4\MTUw\ODY=\MjE1\MTQ3\ODY=\MjE1\MjE0\ODc=\MjI=\MjE1\MjE0\MTM4\MTUw\MjE0\MjE1\MTU3\MjE0\MTQ4\MjE0\MTk=\MTUw\MjEy\MjE0\MTY=\ODY=\MjA=\MjE1\MTY=\MjI=\MjA=\MjE1\MTY=\MjI=\MTg=\MjE1\MTY=\MTUw\MjE=\MjE1\MTM4\MTUw\ODY=\MjE1\MTQ3\ODY=\MjE1\MjE0\ODc=\MjI=\MjE1\MjE0\MTM4\MTUw\MjE0\MjE1\MTU3\MjE0\MTQ4\MjE0\MTk=\MTUw\MjEy\MjE0\MTY=\ODY=\MjA=\MjE1\MTY=\MjI=\MjA=\MjE1\MTY=\MjE0\MTk=\MjE1\MTY=\MTUw\MjE=\MjE1\MTM4\MTUw\ODY=\MjE1\MTQ3\ODY=\MjE1\MjE0\ODc=\MjI=\MjE1\MjE0\MTM4\MTUw\MjE0\MjE1\MTU3\MjE0\MTQ4\MjE0\MTk=\MTUw\MjEy\MjE0\MTY=\ODY=\MjA=\MjE1\MTY=\MjI=\MjA=\MjE1\MTY=\MTUw\MTk=\MjE1\MTY=\MTUw\MjE=\MjE1\MTM4\MTUw\ODY=\MjE1\MTQ3\ODY=\MjE1\MjE0\ODc=\MjI=\MjE1\MjE0\MTM4\MTUw\MjE0\MjE1\MTU3\MjE0\MTQ4\MjE0\MTk=\MTUw\MjEy\MjE0\MTY=\ODY=\MjA=\MjE1\MTY=\MjI=\MjA=\MjE1\MTY=\ODY=\MTk=\MjE1\MTY=\MTUw\MjE=\MjE1\MTM4\MTUw\ODY=\MjE1\MTQ3\ODY=\MjE1\MjE0\ODc=\MjI=\MjE1\MjE0\MTM4\MTUw\MjE0\MjE1\MTU3\MjE0\MTQ4\MjE0\MTk=\MTUw\MjEy\MjE0\MTY=\ODY=\MjA=\MjE1\MTY=\MjI=\MjA=\MjE1\MTY=\MjI=\MTk=\MjE1\MTY=\MTUw\MjE=\MjE1\MTM4\MTUw\ODY=\MjE1\MTQ3\ODY=\MjE1\MjE0\ODc=\MjI=\MjE1\MjE0\MTM4\MTUw\MjE0\MjE1\MTU3\MjE0\MTQ4\MjE0\MTk=\MTUw\MjEy\MjE0\MTY=\ODY=\MjA=\MjE1\MTY=\MjI=\MjA=\MjE1\MTY=\MjE0\MTY=\MjE1\MTY=\MTUw\MjE=\MjE1\MTM4\MTUw\ODY=\MjE1\MTQ3\ODY=\MjE1\MjE0\ODc=\MjI=\MjE1\MjE0\MTM4\MTUw\MjE0\MjE1\MTU3\MjE0\MTQ4\MjE0\MTk=\MTUw\MjEy\MjE0\MTY=\ODY=\MjA=\MjE1\MTY=\MjI=\MjA=\MjE1\MTY=\MjE0\MjE=\MjE1\MTY=\MTUw\MjE=\MjE1\MTM4\MTUw\ODY=\MjE1\MTQ3\ODY=\MjE1\MjE0\ODc=\MjI=\MjE1\MjE0\MTM4\MTUw\MjE0\MjE1\MTU3\MjE0\MTQ4\MjE0\MTk=\MTUw\MjEy\MjE0\MTY=\ODY=\MjA=\MjE1\MTY=\MjI=\MjA=\MjE1\MTY=\ODY=\MjE=\MjE1\MTY=\MTUw\MjE=\MjE1\MTM4\MTUw\ODY=\MjE1\MTQ3\ODY=\MjE1\MjE0\ODc=\MjI=\MjE1\MjE0\MTM4\MTUw\MjE0\MjE1\MTU3\MjE0\MTQ4\MjE0\MTk=\MTUw\MjEy\MjE0\MTY=\ODY=\MjA=\MjE1\MTY=\MjI=\MjA=\MjE1\MTY=\MjI=\MjE=\MjE1\MTY=\MTUw\MjE=\MjE1\MTM4\MTUw\ODY=\MjE1\MTQ3\ODY=\MjE1\MjE0\ODc=\MjI=\MjE1\MjE0\MTM4\MTUw\MjE0\MjE1\MTU3\MjE0\MTQ4\MjE0\MTk=\MTUw\MjEy\MjE0\MTY=\ODY=\MjA=\MjE1\MTY=\MjI=\MjA=\MjE1\MTY=\MjE0\MTg=\MjE1\MTY=\MTUw\MjE=\MjE1\MTM4\MTUw\ODY=\MjE1\MTQ3\ODY=\MjE1\MjE0\ODc=\MjI=\MjE1\MjE0\MTM4\MTUw\MjE0\MjE1\MTU3\MjE0\MTQ4\MjE0\MTk=\MTUw\MjEy\MjE0\MTY=\ODY=\MjA=\MjE1\MTY=\MjI=\MjA=\MjE1\MTY=\MTUw\MTg=\MjE1\MTY=\MTUw\MjE=\MjE1\MTM4\MTUw\ODY=\MjE1\MTQ3\ODY=\MjE1\MjE0\ODc=\MjI=\MjE1\MjE0\MTM4\MTUw\MjE0\MjE1\MTU3\MjE0\MTQ4\MjE0\MTk=\MTUw\MjEy\MjE0\MTY=\ODY=\MjA=\MjE1\MTY=\MjI=\MjA=\MjE1\MTY=\ODY=\MTg=\MjE1\MTY=\MTUw\MjE=\MjE1\MTM4\MTUw\ODY=\MjE1\MTQ3\ODY=\MjE1\MjE0\ODc=\MjI=\MjE1\MjE0\MTM4\MTUw\MjE0\MjE1\MTU3\MjE0\MTQ4\MjE0\MTk=\MTUw\MjEy\MjE0\MTY=\ODY=\MjA=\MjE1\MTY=\MjI=\MjA=\MjE1\MTY=\MjI=\MTg=\MjE1\MTY=\MTUw\MjE=\MjE1\MTM4\MTUw\ODY=\MjE1\MTQ3\ODY=\MjE1\MjE0\ODc=\MjI=\MjE1\MjE0\MTM4\MTUw\MjE0\MjE1\MTU3\MjE0\MTQ4\MjE0\MTk=\MTUw\MjEy\MjE0\MTY=\ODY=\MjA=\MjE1\MTY=\MjI=\MjA=\MjE1\MTY=\MjE0\MTk=\MjE1\MTY=\MTUw\MjE=\MjE1\MTM4\MTUw\ODY=\MjE1\MTQ3\ODY=\MjE1\MjE0\ODc=\MjI=\MjE1\MjE0\MTM4\MTUw\MjE0\MjE1\MTU3\MjE0\MTQ4\MjE0\MTk=\MTUw\MjEy\MjE0\MTY=\ODY=\MjA=\MjE1\MTY=\MjI=\MjA=\MjE1\MTY=\MTUw\MTk=\MjE1\MTY=\MTUw\MjE=\MjE1\MTM4\MTUw\ODY=\MjE1\MTQ3\ODY=\MjE1\MjE0\ODc=\MjI=\MjE1\MjE0\MTM4\MTUw\MjE0\MjE1\MTU3\MjE0\MTQ4\MjE0\MTk=\MTUw\MjEy\MjE0\MTY=\ODY=\MjA=\MjE1\MTY=\MjI=\MjA=\MjE1\MTY=\ODY=\MTk=\MjE1\MTY=\MTUw\MjE=\MjE1\MTM4\MTUw\ODY=\MjE1\MTQ3\ODY=\MjE1\MjE0\ODc=\MjI=\MjE1\MjE0\MTM4\MTUw\MjE0\MjE1\MTU3\MjE0\MTQ4\MjE0\MTk=\MTUw\MjEy\MjE0\MTY=\ODY=\MjA=\MjE1\MTY=\MjI=\MjA=\MjE1\MTY=\MjI=\MTk=\MjE1\MTY=\MTUw\MjE=\MjE1\MTM4\MTUw\ODY=\MjE1\MTQ3\ODY=\MjE1\MjE0\ODc=\MjI=\MjE1\MjE0\MTM4\MTUw\MjE0\MjE1\MTU3\MjE0\MTQ4\MjE0\MTk=\MTUw\MjEy\MjE0\MTY=\ODY=\MjA=\MjE1\MTY=\MjI=\MjA=\MjE1\MTY=\MjE0\MTY=\MjE1\MTY=\MTUw\MjE=\MjE1\MTM4\MTUw\ODY=\MjE1\MTQ3\ODY=\MjE1\MjE0\ODc=\MjI=\MjE1\MjE0\MTM4\MTUw\MjE0\MjE1\MTU3\MjE0\MTQ4\MjE0\MTk=\MTUw\MjEy\MjE0\MTY=\ODY=\MjA=\MjE1\MTY=\MjI=\MjA=\MjE1\MTY=\MjE0\MjE=\MjE1\MTY=\MTUw\MjE=\MjE1\MTM4\MTUw\ODY=\MjE1\MjAw\MjE0\ODY=\MjE0\MjA3\MjE0\MjE0\MjE0\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTc3\MTgz\MTg3\MTc5\MjE0\MjEw\MjIy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTM0\MTg2\MTgz\MTc1\MTc5\MTY0\MTY1\MjE0\MjEw\MjE4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTU0\MTg1\MTgx\MTgz\MTg2\MTM0\MTg2\MTgz\MTc1\MTc5\MTY0\MjE0\MjEw\MjE4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTg2\MTc5\MTgz\MTc4\MTc5\MTY0\MTY1\MTYy\MTgz\MTYy\MTY1\MjE0\MjEw\MjE3\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTYz\MTY0\MTY0\MTc5\MTg0\MTYy\MTI4\MTc5\MTkw\MTkx\MTgx\MTg2\MTc5\MjE0\MjEw\MjA4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTI4\MTgz\MTg2\MTYz\MTc5\MjE0\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTYx\MTgz\MTkx\MTYy\MjE0\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\Mzg=\MjMz\MjEw\MTk1\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTMz\MTc5\MTYy\MTM0\MTY0\MTkx\MTg3\MTgz\MTY0\MTc1\MTM0\MTgz\MTY0\MTYy\MTQ5\MTQ0\MTY0\MTgz\MTg3\MTc5\MjE0\MjEw\MjIw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTYx\MTg1\MTY0\MTg5\MTY1\MTY2\MTgz\MTgx\MTc5\MjE0\MjEw\MTk5\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTY0\MTgz\MTgx\MTc5\MTM3\MTgx\MTkw\MTc5\MTgx\MTg5\MTY2\MTg1\MTkx\MTg0\MTYy\MTY1\MjE0\MjEw\MTky\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTY0\MTgz\MTgx\MTc5\MTYy\MTY0\MTgz\MTgx\MTg5\MTM3\MTgx\MTkw\MTc5\MTgx\MTg5\MTY2\MTg1\MTkx\MTg0\MTYy\MTY1\MjE0\MjEw\MjA2\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTkw\MTc5\MTgx\MTg5\MTY2\MTg1\MTkx\MTg0\MTYy\MTM3\MjMx\MTM3\MTMy\MTgz\MTgx\MTc5\MjQ2\MTMw\MTY0\MTgz\MTgx\MTg5\MjE0\MjEw\MjA5\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTQ0\MTY0\MTgz\MTg3\MTc5\MjE0\MjEw\MjA2\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTkw\MTc5\MTgx\MTg5\MTY2\MTg1\MTkx\MTg0\MTYy\MTM3\MjI4\MTM3\MTMy\MTgz\MTgx\MTc5\MjQ2\MTMw\MTY0\MTgz\MTgx\MTg5\MjE0\MjEw\MjA2\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTkw\MTc5\MTgx\MTg5\MTY2\MTg1\MTkx\MTg0\MTYy\MTM3\MjI5\MTM3\MTMy\MTgz\MTgx\MTc5\MjQ2\MTMw\MTY0\MTgz\MTgx\MTg5\MjE0\MjEw\MjA2\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTkw\MTc5\MTgx\MTg5\MTY2\MTg1\MTkx\MTg0\MTYy\MTM3\MjI2\MTM3\MTMy\MTgz\MTgx\MTc5\MjQ2\MTMw\MTY0\MTgz\MTgx\MTg5\MjE0\MjEw\MjA2\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTkw\MTc5\MTgx\MTg5\MTY2\MTg1\MTkx\MTg0\MTYy\MTM3\MjI3\MTM3\MTMy\MTgz\MTgx\MTc5\MjQ2\MTMw\MTY0\MTgz\MTgx\MTg5\MjE0\MjEw\MjA2\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTkw\MTc5\MTgx\MTg5\MTY2\MTg1\MTkx\MTg0\MTYy\MTM3\MjI0\MTM3\MTMy\MTgz\MTgx\MTc5\MjQ2\MTMw\MTY0\MTgz\MTgx\MTg5\MjE0\MjEw\MjA2\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTkw\MTc5\MTgx\MTg5\MTY2\MTg1\MTkx\MTg0\MTYy\MTM3\MjI1\MTM3\MTMy\MTgz\MTgx\MTc5\MjQ2\MTMw\MTY0\MTgz\MTgx\MTg5\MjE0\MjEw\MjA2\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTkw\MTc5\MTgx\MTg5\MTY2\MTg1\MTkx\MTg0\MTYy\MTM3\MjM4\MTM3\MTMy\MTgz\MTgx\MTc5\MjQ2\MTMw\MTY0\MTgz\MTgx\MTg5\MjE0\MjEw\MjA2\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTkw\MTc5\MTgx\MTg5\MTY2\MTg1\MTkx\MTg0\MTYy\MTM3\MjM5\MTM3\MTMy\MTgz\MTgx\MTc5\MjQ2\MTMw\MTY0\MTgz\MTgx\MTg5\MjE0\MjEw\MjA3\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTkw\MTc5\MTgx\MTg5\MTY2\MTg1\MTkx\MTg0\MTYy\MTM3\MjMx\MjMw\MTM3\MTMy\MTgz\MTgx\MTc5\MjQ2\MTMw\MTY0\MTgz\MTgx\MTg5\MjE0\MjEw\MjA3\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTkw\MTc5\MTgx\MTg5\MTY2\MTg1\MTkx\MTg0\MTYy\MTM3\MjMx\MjMx\MTM3\MTMy\MTgz\MTgx\MTc5\MjQ2\MTMw\MTY0\MTgz\MTgx\MTg5\MjE0\MjEw\MjA3\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTkw\MTc5\MTgx\MTg5\MTY2\MTg1\MTkx\MTg0\MTYy\MTM3\MjMx\MjI4\MTM3\MTMy\MTgz\MTgx\MTc5\MjQ2\MTMw\MTY0\MTgz\MTgx\MTg5\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\Nw==\MjEw\MjE0\MjE0\NQ==\MjEw\MjE0\MjE0\MjE0\MjE0\MjE0\MjA4\MTk4\MjE0\MjE0\MjE0\MjEx\MjE0\MjE0\MjE0\MjA4\MTUw\MTUw\MjE0\MjA4\ODY=\MTUw\MjE0\MjA4\MjI=\MTUw\MjE0\MjA4\MjE0\MTUx\MjE0\MTQ3\MTUw\MjE1\MjE0\MTQ0\ODY=\MjM=\MjE0\ODM=\MjI=\MjE1\MjE0\ODA=\ODY=\MTUx\MjE1\MjM=\MjE0\MjEy\MjE0\MjE1\MTUx\MjEy\MjE0\MTUx\ODc=\MjEy\MjE0\NzQ=\MjE0\MjE0\MjEy\MTM4\ODY=\MjE0\MjE0\MjIz\MTUw\ODY=\ODQ=\MjAw\MjE0\ODY=\MjE0\MjIx\MjE0\MjE0\MjE0\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTc3\MTgz\MTg3\MTc5\MjE0\MjEw\MjIy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTM0\MTg2\MTgz\MTc1\MTc5\MTY0\MTY1\MjE0\MjEw\MjE4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTU0\MTg1\MTgx\MTgz\MTg2\MTM0\MTg2\MTgz\MTc1\MTc5\MTY0\MjE0\MjEw\MjIw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTkw\MTgz\MTY0\MTgz\MTgx\MTYy\MTc5\MTY0\MjE0\MjEw\MTk5\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTU4\MTYz\MTg3\MTgz\MTg0\MTg1\MTkx\MTc4\MTMy\MTg1\MTg1\MTYy\MTM0\MTgz\MTY0\MTYy\MjE0\MjEw\MjA5\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTQ0\MTY0\MTgz\MTg3\MTc5\MjE0\MjEw\MjEw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTg0\MTc5\MTYx\MjE0\MjEw\MjIy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTI4\MTc5\MTgx\MTYy\MTg1\MTY0\MjI5\MjE0\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\NTQ=\MTc1\MjI=\MjEz\Mjc=\MjY=\MjY=\MjY=\MjY=\MjE4\MTUy\MTUw\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\NzQ=\Njg=\MjI=\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\Mw==\MjEw\MjE0\MjE0\MQ==\MjEw\MjE0\MjE0\MjE0\MjE0\MjE0\MjA4\MTk4\MjE0\MjE0\MjE0\MjEx\MjE0\MjE0\MjE0\MjA4\MTUw\MTUw\MjE0\MjA4\ODY=\MTUw\MjE0\MjA4\MjI=\MTUw\MjE0\MjA4\MjE0\MTUx\MjE0\MTQ3\MTUw\MjE1\MjE0\MTQ0\ODY=\MjM=\MjE0\ODM=\MjI=\MjE1\MjE0\ODA=\ODY=\MTUx\MjE1\MjM=\MjE0\MjEy\MjE0\MjE1\MTUx\MjEy\MjE0\MTUx\ODc=\MjEy\MjE0\NzQ=\MjE0\MjE0\MjEy\MTM4\ODY=\MjE0\MjE0\MjIz\MTUw\ODY=\ODQ=\MjAw\MjE0\ODY=\MjE0\MjIx\MjE0\MjE0\MjE0\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTc3\MTgz\MTg3\MTc5\MjE0\MjEw\MjIy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTM0\MTg2\MTgz\MTc1\MTc5\MTY0\MTY1\MjE0\MjEw\MjE4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTU0\MTg1\MTgx\MTgz\MTg2\MTM0\MTg2\MTgz\MTc1\MTc5\MTY0\MjE0\MjEw\MjIw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTkw\MTgz\MTY0\MTgz\MTgx\MTYy\MTc5\MTY0\MjE0\MjEw\MTk5\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTU4\MTYz\MTg3\MTgz\MTg0\MTg1\MTkx\MTc4\MTMy\MTg1\MTg1\MTYy\MTM0\MTgz\MTY0\MTYy\MjE0\MjEw\MjA5\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTQ0\MTY0\MTgz\MTg3\MTc5\MjE0\MjEw\MjEw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTg0\MTc5\MTYx\MjE0\MjEw\MjIy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTI4\MTc5\MTgx\MTYy\MTg1\MTY0\MjI5\MjE0\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\NDQ=\MTE1\MjI=\MjEz\MjMx\MjIy\MTIy\MjAy\MTQw\MzQ=\MTU0\MTUw\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\NzA=\MTcz\MjI=\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTU=\MjEw\MjE0\MjE0\MTM=\MjEw\MjE0\MjE0\MjE0\MjE0\MjE0\MjA4\MTk4\MjE0\MjE0\MjE0\MjEx\MjE0\MjE0\MjE0\MjA4\MTUw\MTUw\MjE0\MjA4\ODY=\MTUw\MjE0\MjA4\MjI=\MTUw\MjE0\MjA4\MjE0\MTUx\MjE0\MTQ3\MTUw\MjE1\MjE0\MTQ0\ODY=\MjM=\MjE0\ODM=\MjI=\MjE1\MjE0\ODA=\ODY=\MTUx\MjE1\MjM=\MjE0\MjEy\MjE0\MjE1\MTUx\MjEy\MjE0\MTUx\ODc=\MjEy\MjE0\NzQ=\MjE0\MjE0\MjEy\MTM4\ODY=\MjE0\MjE0\MjIz\MTUw\ODY=\ODQ=\MjAw\MjE0\ODY=\MjE0\MjIx\MjE0\MjE0\MjE0\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTc3\MTgz\MTg3\MTc5\MjE0\MjEw\MjIy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTM0\MTg2\MTgz\MTc1\MTc5\MTY0\MTY1\MjE0\MjEw\MjE4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTU0\MTg1\MTgx\MTgz\MTg2\MTM0\MTg2\MTgz\MTc1\MTc5\MTY0\MjE0\MjEw\MjIw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTkw\MTgz\MTY0\MTgz\MTgx\MTYy\MTc5\MTY0\MjE0\MjEw\MTk5\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTU4\MTYz\MTg3\MTgz\MTg0\MTg1\MTkx\MTc4\MTMy\MTg1\MTg1\MTYy\MTM0\MTgz\MTY0\MTYy\MjE0\MjEw\MjA5\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTQ0\MTY0\MTgz\MTg3\MTc5\MjE0\MjEw\MjEw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTg0\MTc5\MTYx\MjE0\MjEw\MjIy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTI4\MTc5\MTgx\MTYy\MTg1\MTY0\MjI5\MjE0\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MTA2\NzU=\MjI=\MjEz\MTA2\MTYy\Njk=\MjA2\MjEw\MTEy\MTU2\MTUw\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\Njk=\MjI=\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTE=\MjEw\MjE0\MjE0\OQ==\MjEw\MjE0\MjE0\MjE0\MjE0\MjE0\MjA4\MTk4\MjE0\MjE0\MjE0\MjEx\MjE0\MjE0\MjE0\MjA4\MTUw\MTUw\MjE0\MjA4\ODY=\MTUw\MjE0\MjA4\MjI=\MTUw\MjE0\MjA4\MjE0\MTUx\MjE0\MTQ3\MTUw\MjE1\MjE0\MTQ0\ODY=\MjM=\MjE0\ODM=\MjI=\MjE1\MjE0\ODA=\ODY=\MTUx\MjE1\MjM=\MjE0\MjEy\MjE0\MjE1\MTUx\MjEy\MjE0\MTUx\ODc=\MjEy\MjE0\NzQ=\MjE0\MjE0\MjEy\MTM4\ODY=\MjE0\MjE0\MjIz\MTUw\ODY=\ODQ=\MjAw\MjE0\ODY=\MjE0\MjIx\MjE0\MjE0\MjE0\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTc3\MTgz\MTg3\MTc5\MjE0\MjEw\MjIy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTM0\MTg2\MTgz\MTc1\MTc5\MTY0\MTY1\MjE0\MjEw\MjE4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTU0\MTg1\MTgx\MTgz\MTg2\MTM0\MTg2\MTgz\MTc1\MTc5\MTY0\MjE0\MjEw\MjIw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTkw\MTgz\MTY0\MTgz\MTgx\MTYy\MTc5\MTY0\MjE0\MjEw\MTk5\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTU4\MTYz\MTg3\MTgz\MTg0\MTg1\MTkx\MTc4\MTMy\MTg1\MTg1\MTYy\MTM0\MTgz\MTY0\MTYy\MjE0\MjEw\MjA5\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTQ0\MTY0\MTgz\MTg3\MTc5\MjE0\MjEw\MjEw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTg0\MTc5\MTYx\MjE0\MjEw\MjIy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTI4\MTc5\MTgx\MTYy\MTg1\MTY0\MjI5\MjE0\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MjY=\NzM=\MjI=\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ2\MTUw\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MTEw\NjU=\MTUw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\NTU=\MjEw\MjE0\MjE0\NTM=\MjEw\MjE0\MjE0\MjE0\MjE0\MjE0\MjA4\MTk4\MjE0\MjE0\MjE0\MjEx\MjE0\MjE0\MjE0\MjA4\MTUw\MTUw\MjE0\MjA4\ODY=\MTUw\MjE0\MjA4\MjI=\MTUw\MjE0\MjA4\MjE0\MTUx\MjE0\MTQ3\MTUw\MjE1\MjE0\MTQ0\ODY=\MjM=\MjE0\ODM=\MjI=\MjE1\MjE0\ODA=\ODY=\MTUx\MjE1\MjM=\MjE0\MjEy\MjE0\MjE1\MTUx\MjEy\MjE0\MTUx\ODc=\MjEy\MjE0\NzQ=\MjE0\MjE0\MjEy\MTM4\ODY=\MjE0\MjE0\MjIz\MTUw\ODY=\ODQ=\MjAw\MjE0\ODY=\MjE0\MjIx\MjE0\MjE0\MjE0\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTc3\MTgz\MTg3\MTc5\MjE0\MjEw\MjIy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTM0\MTg2\MTgz\MTc1\MTc5\MTY0\MTY1\MjE0\MjEw\MjE4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTU0\MTg1\MTgx\MTgz\MTg2\MTM0\MTg2\MTgz\MTc1\MTc5\MTY0\MjE0\MjEw\MjIw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTkw\MTgz\MTY0\MTgz\MTgx\MTYy\MTc5\MTY0\MjE0\MjEw\MTk5\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTU4\MTYz\MTg3\MTgz\MTg0\MTg1\MTkx\MTc4\MTMy\MTg1\MTg1\MTYy\MTM0\MTgz\MTY0\MTYy\MjE0\MjEw\MjA5\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTQ0\MTY0\MTgz\MTg3\MTc5\MjE0\MjEw\MjEw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTg0\MTc5\MTYx\MjE0\MjEw\MjIy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTI4\MTc5\MTgx\MTYy\MTg1\MTY0\MjI5\MjE0\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\NDI=\NjY=\MTUw\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ3\MTUw\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\ODY=\ODQ=\MTUw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\NTE=\MjEw\MjE0\MjE0\NDk=\MjEw\MjE0\MjE0\MjE0\MjE0\MjE0\MjA4\MTk4\MjE0\MjE0\MjE0\MjEx\MjE0\MjE0\MjE0\MjA4\MTUw\MTUw\MjE0\MjA4\ODY=\MTUw\MjE0\MjA4\MjI=\MTUw\MjE0\MjA4\MjE0\MTUx\MjE0\MTQ3\MTUw\MjE1\MjE0\MTQ0\ODY=\MjM=\MjE0\ODM=\MjI=\MjE1\MjE0\ODA=\ODY=\MTUx\MjE1\MjM=\MjE0\MjEy\MjE0\MjE1\MTUx\MjEy\MjE0\MTUx\ODc=\MjEy\MjE0\NzQ=\MjE0\MjE0\MjEy\MTM4\ODY=\MjE0\MjE0\MjIz\MTUw\ODY=\ODQ=\MjAw\MjE0\ODY=\MjE0\MjIx\MjE0\MjE0\MjE0\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTc3\MTgz\MTg3\MTc5\MjE0\MjEw\MjIy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTM0\MTg2\MTgz\MTc1\MTc5\MTY0\MTY1\MjE0\MjEw\MjE4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTU0\MTg1\MTgx\MTgz\MTg2\MTM0\MTg2\MTgz\MTc1\MTc5\MTY0\MjE0\MjEw\MjIw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTkw\MTgz\MTY0\MTgz\MTgx\MTYy\MTc5\MTY0\MjE0\MjEw\MTk5\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTU4\MTYz\MTg3\MTgz\MTg0\MTg1\MTkx\MTc4\MTMy\MTg1\MTg1\MTYy\MTM0\MTgz\MTY0\MTYy\MjE0\MjEw\MjA5\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTQ0\MTY0\MTgz\MTg3\MTc5\MjE0\MjEw\MjEw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTg0\MTc5\MTYx\MjE0\MjEw\MjIy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTI4\MTc5\MTgx\MTYy\MTg1\MTY0\MjI5\MjE0\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MTk2\MTE1\MTUw\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\ODY=\MTQ3\MTUw\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MzY=\MTE1\MjI=\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\NjM=\MjEw\MjE0\MjE0\NjE=\MjEw\MjE0\MjE0\MjE0\MjE0\MjE0\MjA4\MTk4\MjE0\MjE0\MjE0\MjEx\MjE0\MjE0\MjE0\MjA4\MTUw\MTUw\MjE0\MjA4\ODY=\MTUw\MjE0\MjA4\MjI=\MTUw\MjE0\MjA4\MjE0\MTUx\MjE0\MTQ3\MTUw\MjE1\MjE0\MTQ0\ODY=\MjM=\MjE0\ODM=\MjI=\MjE1\MjE0\ODA=\ODY=\MTUx\MjE1\MjM=\MjE0\MjEy\MjE0\MjE1\MTUx\MjEy\MjE0\MTUx\ODc=\MjEy\MjE0\NzQ=\MjE0\MjE0\MjEy\MTM4\ODY=\MjE0\MjE0\MjIz\MTUw\ODY=\ODQ=\MjAw\MjE0\ODY=\MjE0\MjIx\MjE0\MjE0\MjE0\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTc3\MTgz\MTg3\MTc5\MjE0\MjEw\MjIy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTM0\MTg2\MTgz\MTc1\MTc5\MTY0\MTY1\MjE0\MjEw\MjE4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTU0\MTg1\MTgx\MTgz\MTg2\MTM0\MTg2\MTgz\MTc1\MTc5\MTY0\MjE0\MjEw\MjIw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTkw\MTgz\MTY0\MTgz\MTgx\MTYy\MTc5\MTY0\MjE0\MjEw\MTk5\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTU4\MTYz\MTg3\MTgz\MTg0\MTg1\MTkx\MTc4\MTMy\MTg1\MTg1\MTYy\MTM0\MTgz\MTY0\MTYy\MjE0\MjEw\MjA5\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTQ0\MTY0\MTgz\MTg3\MTc5\MjE0\MjEw\MjEw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTg0\MTc5\MTYx\MjE0\MjEw\MjIy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTI4\MTc5\MTgx\MTYy\MTg1\MTY0\MjI5\MjE0\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MTUw\MTcz\MjI=\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ3\MTUw\MjEz\MjE0\MjE0\MjE0\MjE0\MjE0\NzA=\MTI1\MjI=\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\NTk=\MjEw\MjE0\MjE0\NTc=\MjEw\MjE0\MjE0\MjE0\MjE0\MjE0\MjA4\MTk4\MjE0\MjE0\MjE0\MjEx\MjE0\MjE0\MjE0\MjA4\MTUw\MTUw\MjE0\MjA4\ODY=\MTUw\MjE0\MjA4\MjI=\MTUw\MjE0\MjA4\MjE0\MTUx\MjE0\MTQ3\MTUw\MjE1\MjE0\MTQ0\ODY=\MjM=\MjE0\ODM=\MjI=\MjE1\MjE0\ODA=\ODY=\MTUx\MjE1\MjM=\MjE0\MjEy\MjE0\MjE1\MTUx\MjEy\MjE0\MTUx\ODc=\MjEy\MjE0\NzQ=\MjE0\MjE0\MjEy\MTM4\ODY=\MjE0\MjE0\MjIz\MTUw\ODY=\ODQ=\MjAw\MjE0\ODY=\MjE0\MjIx\MjE0\MjE0\MjE0\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTc3\MTgz\MTg3\MTc5\MjE0\MjEw\MjIy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTM0\MTg2\MTgz\MTc1\MTc5\MTY0\MTY1\MjE0\MjEw\MjE4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTU0\MTg1\MTgx\MTgz\MTg2\MTM0\MTg2\MTgz\MTc1\MTc5\MTY0\MjE0\MjEw\MjIw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTkw\MTgz\MTY0\MTgz\MTgx\MTYy\MTc5\MTY0\MjE0\MjEw\MTk5\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTU4\MTYz\MTg3\MTgz\MTg0\MTg1\MTkx\MTc4\MTMy\MTg1\MTg1\MTYy\MTM0\MTgz\MTY0\MTYy\MjE0\MjEw\MjA5\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTQ0\MTY0\MTgz\MTg3\MTc5\MjE0\MjEw\MjEw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTg0\MTc5\MTYx\MjE0\MjEw\MjIy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTI4\MTc5\MTgx\MTYy\MTg1\MTY0\MjI5\MjE0\MjEz\MTc=\MTU3\MjI1\OTU=\MTUx\MjA0\MTY5\MjI=\MjEz\ODM=\NjE=\MTM1\MTEw\MjAw\MTYz\MTQ5\MTUw\MjEz\MTY3\MjM1\MjIw\MQ==\MTE3\MTc2\MTY2\MjI=\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\Mzk=\MjEw\MjE0\MjE0\Mzc=\MjEw\MjE0\MjE0\MjE0\MjE0\MjE0\MjA4\MTk4\MjE0\MjE0\MjE0\MjEx\MjE0\MjE0\MjE0\MjA4\MTUw\MTUw\MjE0\MjA4\ODY=\MTUw\MjE0\MjA4\MjI=\MTUw\MjE0\MjA4\MjE0\MTUx\MjE0\MTQ3\MTUw\MjE1\MjE0\MTQ0\ODY=\MjM=\MjE0\ODM=\MjI=\MjE1\MjE0\ODA=\ODY=\MTUx\MjE1\MjM=\MjE0\MjEy\MjE0\MjE1\MTUx\MjEy\MjE0\MTUx\ODc=\MjEy\MjE0\NzQ=\MjE0\MjE0\MjEy\MTM4\ODY=\MjE0\MjE0\MjIz\MTUw\ODY=\ODQ=\MjAw\MjE0\ODY=\MjE0\MjIx\MjE0\MjE0\MjE0\MjEw\MjEx\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTc3\MTgz\MTg3\MTc5\MjE0\MjEw\MjIy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTM0\MTg2\MTgz\MTc1\MTc5\MTY0\MTY1\MjE0\MjEw\MjE4\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTU0\MTg1\MTgx\MTgz\MTg2\MTM0\MTg2\MTgz\MTc1\MTc5\MTY0\MjE0\MjEw\MjIw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTkw\MTgz\MTY0\MTgz\MTgx\MTYy\MTc5\MTY0\MjE0\MjEw\MTk5\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTU4\MTYz\MTg3\MTgz\MTg0\MTg1\MTkx\MTc4\MTMy\MTg1\MTg1\MTYy\MTM0\MTgz\MTY0\MTYy\MjE0\MjEw\MjA5\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTQ5\MTQ0\MTY0\MTgz\MTg3\MTc5\MjE0\MjEw\MjEw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTg0\MTc5\MTYx\MjE0\MjEw\MjIy\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MTI4\MTc5\MTgx\MTYy\MTg1\MTY0\MjI5\MjE0\MjEz\MzI=\MjU0\MTM4\ODk=\MjA=\MjE3\MTEz\MjI=\MjEz\MjE=\MzU=\MjU0\MTM4\ODk=\MTMy\MTUx\MTUw\MjEz\MTcz\MTk0\MTIw\MTQ1\NTU=\MTk2\MTgw\MTUw\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0\MjE0',someone2_IIlIlllIIIIIIlIlI())()
RAW Paste Data
We use cookies for various purposes including analytics. By continuing to use Pastebin, you agree to our use of cookies as described in the Cookies Policy. OK, I Understand
Top