Upscalefanatic3

(Roblox) [FE] Woah Script {No Idea}

Jun 15th, 2020
754
Never
Not a member of Pastebin yet? Sign Up, it unlocks many cool features!
  1. --[[
  2. fixed cuz roblox gay and tried to patch cframes sloppily LOL
  3. ]]
  4. return(function(the_IIIIIIIlIIllllIIl,the_IlIIllIIIlIIlIIlIllIIIllI,the_lIIlIIllIlllII)local the_IIIllIlIIIlIllIlIIIIIl=string.char;local the_IlIlllIIIlllIlIIlIl=string.sub;local the_lllIllIlllllI=table.concat;local the_lllIIIIlIIIIIlIllll=math.ldexp;local the_lIIllIlllIllIIIIIIl=getfenv or function()return _ENV end;local the_lIlIIIllI=select;local the_IlIlIlIlIllIIlllIIlIl=unpack or table.unpack;local the_IIlIIlIIIlllllllllIIlIII=tonumber;local function the_llIlIIIllllllllIIIlllll(the_IIIIllIlIlIIIlIIlIlIIlI)local the_lIIlIIlllIl,the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl="","",{}local the_IllIIIIIlIlIllIIIIlIl=256;local the_IlIlIlIlIllIIlllIIlIl={}for the_IlIIIIIlIlIIlIl=0,the_IllIIIIIlIlIllIIIIlIl-1 do the_IlIlIlIlIllIIlllIIlIl[the_IlIIIIIlIlIIlIl]=the_IIIllIlIIIlIllIlIIIIIl(the_IlIIIIIlIlIIlIl)end;local the_IlIIIIIlIlIIlIl=1;local function the_IIIIIIIlIIllllIIl()local the_lIIlIIlllIl=the_IIlIIlIIIlllllllllIIlIII(the_IlIlllIIIlllIlIIlIl(the_IIIIllIlIlIIIlIIlIlIIlI,the_IlIIIIIlIlIIlIl,the_IlIIIIIlIlIIlIl),36)the_IlIIIIIlIlIIlIl=the_IlIIIIIlIlIIlIl+1;local the_IlIlIIIllIlIIIIlIIlIIIlll=the_IIlIIlIIIlllllllllIIlIII(the_IlIlllIIIlllIlIIlIl(the_IIIIllIlIlIIIlIIlIlIIlI,the_IlIIIIIlIlIIlIl,the_IlIIIIIlIlIIlIl+the_lIIlIIlllIl-1),36)the_IlIIIIIlIlIIlIl=the_IlIIIIIlIlIIlIl+the_lIIlIIlllIl;return the_IlIlIIIllIlIIIIlIIlIIIlll end;the_lIIlIIlllIl=the_IIIllIlIIIlIllIlIIIIIl(the_IIIIIIIlIIllllIIl())the_IlIllIIIIl[1]=the_lIIlIIlllIl;while the_IlIIIIIlIlIIlIl<#the_IIIIllIlIlIIIlIIlIlIIlI do local the_IlIIIIIlIlIIlIl=the_IIIIIIIlIIllllIIl()if the_IlIlIlIlIllIIlllIIlIl[the_IlIIIIIlIlIIlIl]then the_IlIlIIIllIlIIIIlIIlIIIlll=the_IlIlIlIlIllIIlllIIlIl[the_IlIIIIIlIlIIlIl]else the_IlIlIIIllIlIIIIlIIlIIIlll=the_lIIlIIlllIl..the_IlIlllIIIlllIlIIlIl(the_lIIlIIlllIl,1,1)end;the_IlIlIlIlIllIIlllIIlIl[the_IllIIIIIlIlIllIIIIlIl]=the_lIIlIIlllIl..the_IlIlllIIIlllIlIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,1,1)the_IlIllIIIIl[#the_IlIllIIIIl+1],the_lIIlIIlllIl,the_IllIIIIIlIlIllIIIIlIl=the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIlIIIllIlIIIIlIIlIIIlll,the_IllIIIIIlIlIllIIIIlIl+1 end;return table.concat(the_IlIllIIIIl)end;local the_IIIIllIlIlIIIlIIlIlIIlI=the_llIlIIIllllllllIIIlllll('26D1H2751I1L2751H23A23423G2381I1R27922E23822T21U23822R22V23C23627E1327922K23422R23E27J22P23H23427Q27L27N27P27E1K27922P23623423H23H1I1V27H27J21T22R23I23922S23622T22G23J23B23I1I1M27921T28027Q22G2391I1I27923G22Q23A28T27923623I23J22T23829B1I1A27923523523D22T22T22P22Q21721Q21Q28J23723H23I22X21R29923G21Q27B27D22Q21Q1I1G2792A427827522N27C27E1J29H2351I1N27923823G23723823922Q1I28727529929U22R2791H21D23H21G23F2281I1Q27923923822Q23622R23C22P22T23C29A1I1P28V28022W27M21721D29727528W2342BK22R2AP2B427522L23I28A23H2BQ2BS1I21L27921D22S22Q2AN21D22E22S23J21D29A21D1R21D29K29M29O29Q29S29U29W29Y2A02AC2A32AH27923422S22T23D23I22R27727923J2AC1I1027922B22S23C23H2B622R23G2342CD2BX23A23A27M29127922Q22W23J2BO1H22R23822O22S2B722T2DM27521W22R28D22Y2792CJ29N29P21Q23923C2B82D023923422P22P29X23I29Z2EF23C21Q22U2382372CZ23I23E2A32121W2122111Z2101W1Y2F02151Z2132122131X2132142A022L21W22E21022J23E21S21523A21X1X21Y21O1Z21S22H23I22823D22G1W1W23J22321523721W23421V22L22Z21523822322Q22B21S22A22U21S23A22322K23D22S29U22L23422K22G21S2DW22J22Q1Z23J2EG21121T1Z22Q21323G21Z2CU27522K27J2CZ2902A91H21T22M21U21X2DR22H2382342DD2AP1T27922A29A29C29B21O21X22W22P27E112CV2EG23H27P2342BD29A21Q23F22Q2BF2HB22B28K22W2B327922H29L22P28327O27Q27F27922J21U22M22N22C23J2992B62AQ2882BA29E21E27923A2CC2AY23I2HK23C23J23A21P21D2DF2B621D23722W2JE2DA2DC27M2DF2CD29U28D1O2J12CC23G2EJ29D2DY2J02752HU2HW21O21121421D2282372EJ2J72EE2I42CD22B28123E2K323627Q22Q2I822R2ID1S29323427X2D023C2JU2812361I2HN2752DF27X28B23C23A2D42KF2IW2752EO2DC23G1I2JP27522A23D27V28129C2D12AI2BP2BJ2DL2AR1H22D22S23G23G2ID2922752GK2L82BH27522H2LP2DG23I23C29028U2BW23823B22T2282DE2BG27922L2M722T2K32MB2M51H2ME2M82ME2962LX2MK2MF21D2MN2MC27521V2L029K2MA2L82LA1H2MW23A29K2MH2LW2792N329K2MT2N12N92MG2MT2HB21V23I23I2DY2HY2LY2M023J2M22392NH2NJ21T27V2DY2HB2HI2HK2L41H21X2D02I82D22AA23823623E2NZ2JS2C727E2MP27I22T22K23I2OB2DR22U28B23E2J72962MJ23F2LP22P2ON2L92CV29L2KC2OT2N123B23C2BT29L23C27D1I2KL27522T2CW29B2B62K52CC2IL2MP22P23I22Q23C2K92MU1H22K2C82CB2M327E2MJ22R2CC23J2OT2MJ2C82P327D2AW2Q22O41H2PJ23J27E2A62P81I2AE2L522Q2Q22751Z2292H51H2362LD2J82382QF1H26921A2QJ29Y2K51W2NZ2DU2DA22P2DZ1H23923A2QE2Q225T21V2QI2LI2QK2EJ2K51Z2DR22Q22U2PK2QL2QW2PY2RH22T2QL2RE27G2752P02P22BD27D2RE2RA2QU23I1Y2KU2JQ2D428C23I2OK2IT2OC2DN2ER2BD2J82QJ21V2CC21U27N2IM2MV2SF27M2IK27E2P72N229D2DD21U29C2EG2AN2P62792DT2JS22V2382OB23H2B72AP2RA22D2EP2BA2AP2N12B82DT29D2PQ2PM28P22Q2P92S72R12Q722U2OU27521U2B92382TE2DA2QJ2NT2DT29E2RA2TC2BB2DY2RQ2PN2DG22S28B21Y2382DC2NZ2TW22T1X2UB2NU2QW2QC1H22A2UE2RA22A22F22R2AC2QP26H24U2QJ2282J82T32AP2HB2DF2CY2R12UP2392UR21A2QP26P24U2QP1H2292V72QS2N122K22822I22C21X21V22822G22L2NZ22Q23D2P12DY2LM21U2VR22R2VT2882DG22T2AP2LM2NT29B2AP2SO2VV2VS21X2AK27Z2I327E21N2E52IH2E822U2WJ21R2CN29V2EI2EK2KH27J21Q21A2M32182FX1Z1Y1Z2K12141W2112SW2BP2W022Q2WA23G2WC29C1I2WF2LU2WH29Q2WJ22U2WL23I29T2WN2CQ2342WQ22T2WS2WU1W2151Y2141Y1W1X2WX2S02MP22T2EJ2LR2J22DQ2HB2UC2Q421U23C22Z2PS27921Z2O62Y322R2S02U322A2DG2HP28C2PR2QC23V23S2YT2YT2602V92YS2YU23S24O2V62Q224122V2VC2Z321Z25T2QF24122F25T2S12P82Y422W2Y62L62HA2792U82UA2MJ2J72T02BT2QO2YY2YU26W2V92QF26D2Z22AW2412212QI2N123G2Y32LQ2ZH2CC2IE2TP2HW23623C28B2H72VQ2NZ2TQ28B2S82752VQ2NI22T2K522X1H2ZT2YV2QS2KV2O02UP23J22Q22P27V29D2362ID310W310N2NJ310Q2ZJ310S2YZ23S2542V926F21L22524E25V26C1L2QI2LM2I12N42U228V2M229B22L2MX2VY2LB23I2AU2SI1H22B2BA2O72YO2D02X431222BA311Q21D2BK2S42TN2LM21V2DG2DK2QP152QI2U33123311W2Q72KH2QP21J2QI2MJ2IS23429T2SV28F27531112VX27P2T323G2PK27M2QW1U28V2NU313423822C313629L2DL2MJ2WA22X22T22S2DT1I172SX23722X2XO2PZ2M32E82112131W2WZ2F52EW2PM311V23B27J2P427E2BV1H22N2LP2AM22R312H2QN28E279314C2AL27M27L2DV311327E2NG2WD2QP2112QI2MP2NH27K2HW2SV2VU314Z290310W31062Y52CC27C2JS1I2NL1H315531082D42LQ2S52U92V4310T23S25K2ZZ2AW25D2QS2SO31052ZG2Y6315828S2MP310G23D2JY310L1H22F2DB238315Y2QJ315Y28Z2TO2O0238313L313N238316921K2WG29M2WI2WK2WM2CP2EJ21Q313U2WR2WT2392WV1W2F62111X1W2102101I316H2XE316J2XG316L2XK2CO2WO316P2XP2XR316T2FX2132F6214317I31712N129928J2CX2J7314Q27922U2UP2R02MJ23A28K2JS2IV2UI23B23B312122F2D027Q3163315I2DR21Z2EB23C312Y31212EE2DF2DK28B28C2ZE1H2MA2BD2P0310D28B22H22B312822B2K7312X2T322C2T029E2N12NX2VX2AM2I3318K21Y2342PK318422R2LC2DB2902LM23B2UP2Q110319J319K23K2QS2UI22T318231301H318I2S5319G2AC29U2KH31282Y32KH2SY319823J2DD316A2802TI319V2P52HB2BD2O72Q43163313O2MJ29923J2Q728N2VP2OK2PK316A2392NI310523D2AK28627921U2OH31A42QJ21Z311Z2LP27E2RA2BX23I2HW2391J1G2DR31AX2CC2393169313Q27522R313S316Q2BD2392E82XX21521531402XV31712Y82BJ318K319C2DC21V2AK23I2T0319E2VZ2P12BU28G22T31BY2392TX2R122G22Q2B22N12282KF2T42D02ID2RA31C02SZ31AV2752T72BZ310I22M21W22N22D2DR22I23822W22D2S52DQ31AH31AT2O722Q2QW2LT2DS2BR2Q42UP22W2RW27922M22R2L12UK2PM2P42JS2VX28B314I2752OE2T72B82SQ2X62PM2KB2C82Y92RA23H318G27P2QJ2DE23423A31E6192HO2C7310621T23D22W2PJ2BZ28I31B727M2BD2B71I27S2BP31EH31EJ28B31EL2HW313331EP2LM2P9318D2RA2J72C82VX2PM27U2LG310E28D2SO22J311T28O310Z2TJ27Q2Q92Q21P2Z62Q211314V2792T327O2P92XB2N122A31A722Q2AB31AA2AJ22W23I2QW2HB31D123I2RE313A2752UV2KG22T2KJ2LC312I2SV314A31DO2D02P92I122T2ID2HB2OK22R2DQ21B2N82EB29D21D319G2EJ2CI2U923H2JA2DT2HK2JG2Y321D22P28J2T02CI2EB21D2DT22P2CX2I32BE23J21R21D27U2JD2JF21D21U22S31H92X21C279319R310A318L311P23J31DJ2KQ29E2MP2TH31FH27E31DB2TM315A27922831I031I22KR2PL31G92N22L02M32PK22W312W312Y31B91H316A27U22X2O122R314O1H24B22G23H21624322S24H2HG31ER2U422X2UV2J228022R2YG29U310D31GN1I31II28I2P427V22W22822X2EB22M23J23H2ID142N82HJ28N31HJ31IV314O31IO2T331B931BB319R31C0311029A2PJ318Z2T42QP23C31FM1H15279132332792UI21D2QF29231ER2A62HB2Q22AE2AE31J71H31FJ31KW31FJ1X2AW2872AI31KZ27931L127928U2BH31L527531L72752JP31LA2AW31L02AW27G31L431LH31L62AW2B42HN31LB1H31LD1H2KL28F31LR31KT2VA31FJ1H31HX2MP31ID2L023J21T2PI2TG31FG2DG2IL31I92382TN2SO31M42L131M72PJ31IH31GU31EA2EA31GN31K22AN2AE1I1231IC2I031JN31C92JU27M22M23B27U2KH31BA31F723422X319A27Q315O24925U312231HY31IT31JE2BY31IM31IY31J031J231J42HG31KH2MV31JX2K931N9313E2D431IP31DS2SP31K8310Z23C31KB312R27931NP1H31KJ31KL2C531KO31O627531KR2VA31KU31OB27931KY31LM31LC31L21H31LL31OH31LN31L81H31LG31OO31OK2792JP27G31LR31LT31LP31OG31OC31OP2752KL31ON31P231OU27528F31LQ31OJ2QF2UI2Q231M031JV2762RA22H2DG2392T331N62KH2UX22Q31BA31MS31PH31622K731AF2TI31CA31N131FW313U31HY21U310C31FA31662MJ31DV31GD23I2ID314A31232HJ23E31FD2J72W12NZ2802KS31M92TI31MB31I82D331ME31212282OW2QL27D2TY31FQ2341Y31QM2UM2UO2D531E32341Z31QM2LM2GN31M4318K2KX2HJ31I031QM314A31QU2P931QW2JU2UE31RI31QV23D31QX22T2QW2RA2TW2JU312831RE2KP2KR2KF2AW31FM2C61H2LM2A61X27G28731MS1H21J24B31IR1H27G31OD1L21127931SH2AX22S31S531OO21D2VC28731ST31OG28U2RA27928728U2AE31KN31SP31SZ31OL2AE2A631S431S62AX21J31T331OR31T531KX31OG2872U331T231SU2B431ER2AI310W31T22MJ31M031T431KV2752872N131ER31TH31O931TC31TL27531TN31TZ31TQ31OL31T031TG31LU2792LI2AE31HV31FJ31SJ27931UD31O625131SP2SO112AI28728F31KV31UJ31TY27521D25M31U031OG31U32Q228U31M031TU1H31U731TX1H31II31UB1H21I31TF27531UF27531VA2A61331UR31V627931UM31SP28F27831VH31SP2D727927331SP2A631TT31SP315B31V531VY31U21H2N12NL28727S31ON28731W031OM31VJ27531W41H31MU31W71H315B31T22RA2A631WD31KH31WG31PU31SY31TF31VW31W831KI31V231W92AI31UL31V231W631U831WW31WB31WH31V231WF31X131TZ31WK31X431SP31WN2QF31FJ1K2MP31QN31I72TL31QS2U327U23J2U623H2ZM31C42X52VX2UE2W32UG2QB2HO2UL2HO31R42P52ZO23J2ZQ2C82AW31II132401H31T631TZ31OF31VW29231DB27931KS2AW2AE2782AE2NL31YL31VK2752AE28731T727631OQ31T231YG31TD27929231OF31T22782A62MJ31SF29227831YO31WA31YH31OF2QP31FJ1J31BH31IR31FJ2B231I531MA2TK31MD2TN2U331RJ28131RQ31RW2MP31MJ2PK31HJ2Q431FZ2Q82D82R131GD2QW2LM21X2UP2DB31HY31ZR31RL29B31RN31IC31RP31RR2RK27931MQ31K4314423C31462RU3149279313K313M2DT2OG2IV2RA2SS31HI2KT319R311V311Q28P23B23H2DW2S72VA31IR2LM31262D1310W32072DG311031122IT2ID319R314K314E314N321731NA2QF2QR2AW1Z31KI26331SP31KM31V228731KP31W131YJ31V32VA31TS31U831OI31VU31YQ31TC31VG31V231LI31SP2AI322C321X31TZ31SU322131WA322331Z631U631YB31U82MJ31V52MJ31WD31SA322R31OP31L3322431V5321Y31TC322L2AI2N131OQ2QP322631V52MP323A31WU31WA31FJ31WD31LK31U8323B31W1322U31V22B431WG2MP31L72872HN2KL323C31WC31V228F322L287323P31V2313A2HY323U31LS31V22D727S324431WD31MU31VO31V2323J31WA31PU31WJ31ZB31SV31P131ER2BH31ZH31UA31TD31YN31V231XC31PF31SY2U32Q431AN2DY31DB2LV316A319723H23E31Q42TS2902UI22U2AP2MJ2ML2M92MB312N312423E321C31XJ2TN310W31C0318I2JG29T2KC2PM2ND2MZ2Q42NX2V427929G27531VP31P727523F31OO2AE1N2UI1B31VB1H31VD1H326831VG31UJ31YR31KI22031TF2HB315B31SF322H31V2325Z31P22RA31T22A631Z531OG2AE2MP3264322Q326L322G31P131W2323D2A6326R31P2326U31ER326W31XD322Q324Q324O326N31SG327431WA31UT32773230326G326X31P231OF3270326J327B1H2C4326131YZ321A31C52BT316A31GF2UP28N2DL314A2OE31CA31CC31DB31CE31ZK2D82XO2382Y92NG310O2PM31GB2CZ2DT31IQ2AW31MU325Z3173326931KQ322Q327J31TF2A631YH31VV3219322Q31KS2HY31T722331SP27831VO28U28U2LM1H22P31SP31U7326631VX3269326B329231UI322F31UA26V326A31VJ2A6287326B313A31KR31SK323V31S727G27831L931OM23W327E3290329V323E275327U3269327I327X31313198327Z31FV2LD32822LG31HY32862VR2DC31CC2HB32002DR2UV31JL2XB31CN31C12T031Y731KI328Q3228328Y328U326T31SF326Y321931YP2792HN31T731SO329R329O31SD31SP31SM329R32A531SM326B32B92AX329432BC2LI26T322I327532A231W1328Y326B3271327T31OT31P431Z02LM311131C6316A22U2D02ET31112IL328527J328729D328032AG2LF2DL31PU316331A431PX31C932AL23931Q031FX2PM2LZ2JL2NP31NX32CK23932CM31CA2NZ31IV2O32U321W2SU22R32D2315W311S31MK31ZY310431E92PW313M2IV31F0318W31B427931F431EN31S22AW21O328T323D292322831YM31TZ329632B431VC31SP2Q331WQ31KS21931TF31VP2BH2HB1N2V428U31JV2A632E732A532EC32BM31TD329931O628U323H28831TD27G3265327A32EG31VC32EF31TF21D32942BH329832EK327G326X329C2BH32EP31OM32ER329H32EU329U279326D32EH32EY323032EL327332EN32F4322Q329F2BH32E431UE32A532FN32FD322428U1332FG32F232EO32FK327A21P32F827932G032BA32EI31TD31S42BH32FJ1H25I31TD2BH32G432G81H323N24R31TD31TB32FO27932GK326A32FP32E531UJ2JP31TO1E32732JP2SO327G31PE2752B4322O32732B431OD27932FQ32EW32G532FT32FG323632F332GY32F631TD32FQ32ET32H632EV31SO32FE2JP32G732FX32GA32GC32HK32HR323N25O32HG32G127532FQ31VP32GS2C531SO2JP32GW27529G32F5325X32GG322427923P32H331TF1N32A229231V032A431OQ2Q9230327C2AW32A831ZF2SO31XX2P83182319F319H27E319R319T22U31A92U92PI2T52DN2B92U1316A3192310P2HJ2NV27931AF27E2N131A7319P32IX2Q431AC23E2QP2QR2Q42V023D2NZ32152NI2D12SO31A022Q31A22K727M328Z27921231KI22K322Q31V132IO326P32K8323D31YC32KB31Z1324O31SF32GD32IK27532KJ326B21332GQ322Q31DB329F2AE31MU32GL27532KU329K32B72AX21T32IO28731T231OF31SX31OF322H327A31LY328Y327932IB329O27921H32E531U731TW2QE29231TI31YV29231U1329O3228322W2Q232DX329A32KG31VW2782N12A92AE21C32KP2AI2HB31S42AI31UN32EH32M7327I32BQ2AI31YC1L32KG1D32KP32L9326232KC31KV25W322Q322S31UJ2AE310W1N24Q322Q2C432B3326B32MW32GO27921M32LH322Q2SO1332MN32KE32N027532KO326E32KC325Z32K532KG32KB27832LM329O27832LP31YT323D32MD2QF31SU31SX32DV31PE31YY31KS31OF322L32N832BY32611J327N31ZE2Q42A12YE310M2SL28531212SE23J2IJ32OA2MJ2SS2382SU2ZK2L5319822T32JO315N32MH27532BE322D326J32A532NN32OS322931YL32OV32OU31HW32KP328W2C532N232MX31OG292329A31P232KG326S32IF2AX327K32FT31YV32K932P432FA32I632N332B332I932GZ32FU32KI31YI26F31TF29G32NC322032P531TC324C322432PA329D322Q31TJ329L32Q631T431ER32IJ2Q231T431KR32DT31OB2Q932IQ31OH32IS32AO2D52N131AQ2EJ2CY31AU31XH31QP325J310I31AY31XR2O02O228S2RA31B132162Q1321R2QS31B52NI31B831N532OG32QW31BG313R313T2XP313W29Q31BP31BR2WX21431BU2BI2BR2AW324G31SO31FJ2A621J24531TF31KH32BV32A532RY329K32P431UT25K328V329O32LC2LM31ER29231SX32PB322Q328S2UI32SF31OP326U31OS32B1324532S631VW32SL31L72A631OW31OG32SP31P231P032SH32B231TF32GX328Y32QH32BZ1G310W32IT2Q532D927531I632QT31ZO32QV31BE2TV321I2DY32RB31BE31692SO31BJ32RF313V31BN29Q31B031B22P532R731EM32OK2HC31BW32TL32AV2T12C831PQ32AQ23931BF29C23G2AW1831KI222322I328U322K31UX32LE31TE31WS328R32OT323V31TC32KB32NN32KB2AI32H232QB2AW32MA28U31WD32MA31V5323F324D32SE32UL31XA31TV31SF32UZ322J32BF31TE322H287314A32Q81H31PB322432K932E732NQ31TD32PJ31SY1W32C131FQ315H2D131FJ2DY32JX2PA22T2PC31AY2PF27932TA31ZN31QR325K2D82DB23H2K527V2392TF2NW2HJ32TW2YB2YD2NZ21W22D2P4321U32K32AW31FO311B2YZ26G2QS314A2SS22S2AO31N123B2PZ31892YH2D02S032QL31G02752803181320A23H2OK31EI31JR2O122P31BA2VA312U31IC31AQ31GR2TS31282SY31C232U12U92T432U432U62AK2QP31FL316A320S2GN2AM28D31ZH2KB2O723A317N31A4321F310Z3132311322W32OO2Q4320S2D62IF2382HI32YL32YK32YN2HI21R32YQ31AE2HQ2PM22E2LE2JS31AZ2MP320S32WG2QO2QF21B31FP32X7234318129C313L313P320R316C27K31QA27X32YA321H2TX31143121320S321C2YK2D8325G325I2HB22E2DT2ID321B311Z3127315B32Z032ZF23832ZN2QJ32ZN2VD32TD31AZ32TI31A431691632RE31BL32RH21Q1Z31402132102XZ2102XV32TR32R332Z22Q2312L2Q42C1324W32OM2SD32U02AW23B2C5329432RT2KW31WR328T325Y326932RV2AJ3315326B2QO32NC32S331OM32MU32SR32S6326B2JP32PL327G32T2327V25C32S6325Z24C31TF31DB328S32M5327K31W5326G2RA32SA32LD31OO32KG32LC2N132L4322Q331Z31SF2U331ER32NL323D31US32UG310W31O832NP2NL32ED32V2322Q319R332831YS32P8327G32NH332T31U82U331O8322W332L31U92AE32SQ31VJ2HY33333247326V31M131YD3329332S332C32DZ328O332W31PD322I33302KL31VW2AE323L32RX332N2AE324G326G2AE324N31Z4332F1H330C31LY32NN32LC331X32L2332S31EC32LT32A9326G32DV31L72AE32UA3268334A1H29G32MH334E31HV1F32SM2AE32GU31KN334E313A32M2334E21F327G332232LG328U31YY332A27821G31OA31Z232LN31SC31XA2AE2J0322L29232A831YX31SF334Z332V31V5333D31WA332X31YV332K326G31VA335932FH32PF31Z731SP332D326C333W335H2AI328Q32QA332V31Z03224327D327A335O3342334Y31OG2782XD322X32E1322W332231W9292315B31L729232N232G0336E31OP29232DQ21R332S31WI329431YY21Q27523A31SF31YC332231LD335T336Q32E1336Z31YV31WI335432VO336132NZ31YH332S31YH32QI31OC22F32VP32X732VR2A52AJ2PM32VY2PE31CQ1H2QY2BB32T623A31RT31JW31CP31QK311W2DR320K31MS32C22BZ28D32C232AD2AP2Y2315T3109319R31DU2B727Q31A431DY32X5337Q32U72LR31NX313231AC3135313722R31DA2E52LP31BX2AC2UP32WY32X02MJ2YG28N32X3325J3219316A2I331RK2OM2SC2MP31172SB296310W315U312E32QT32582R52Q22QH32QS2TK2MP2IB23922W22E22W28J2Q42NR2DY31FJ22D2QF26P2382QI31FJ32L12Q224925E310327T31N731K02DW2QF23P25S2R931Y032JK31ZV2PI31ZX2BF2LM2OA2C82R122H31AO31FJ2R0317L2D02OH2SB317Q2L5317T31CU31CW31CY314W311W2MZ27924125P22P25X2632282QP1931KF32DO32R52QP32Z4318K315D2ZI31882UI31DM2HB2T322R329C25U26C311H311J26S2ZW2Q22ZY2UU2UW31EP2UZ2I332JS31DB2V32ZA21Z33BK32A72Z92QF315P32JO2YX311C2Z132WQ2YU315M33CF33CJ2Q222N2Z9315K26C2QS2LM2RG330W31QD2CX2Y323J1W31D322U31D529829A31AK2DY2N12D929L29A1W32D52MJ2UI2NZ338L31CM337X32XQ2AW2HB3260326932H831YK27532BQ326G331O32A931HV2762LM337S2R02UI337V330431Y133B21H33BW2R032TC328G2NJ2PM31ZW2PL33AQ2OH33AS31DB33AU339Z32EN315K2Z132T632592QP21H311N2DN324X2PM31NH31JG2ID31FJ32YE32R52PM2PH32DB33AP2IN2OR1Y33CM2PM22F318I2ON2S02VF32DE2PK32WW330Q2Q232XJ31BI2PV2ON31MS2N133982OX2J831N52LM325223E2S02LM28Z2T332A51H22E31KI326F326932MT31YI331J32A5333V326B337H32NC326G325Z32G332DR32PD32P433GS32S73354334X335D336832AA31Z3329O32PH31SP2MP32VE32HN321Z336032P9332N332E324T32DV326L32QF31KW32N52AW310W31KW319R324T327F32762Q2313A31T232WO33391H2D732GU32KV1H33HX32F032KW31KI32MN32KB32N931OO33DV326R31SO32AX31S433HT21J25P27931VF31KG33I633IH32PR27531PU32N6323D33I631P233I832I233HQ31SN2Q2313Q1V336Q330C32K533HY33J1329K275334531SC31SE31OK2A632UA326B31L1331M33J333DV326832OR33J81H31SK2A629G326B33JL33I633JF2MJ32OQ31O633I431P1326B33IR33GE33I933IU33IC279313Q33IE324T330C33JX32KP33J532GM32RW31LM33JB33GA33K9335U33JI2HO32PV33I622A32P131LM33IL1H33E433JU33IP33K833E231M0210337I337R2DV337T33D133F22PY27J320P33CQ2YT2542QS2HB2Q632DK2AS2QM2DK33FA33AN33EM33FE2X933FM2OV33992PX2SX33FV2J81H26426533LV33LV26T319N31XY2Q433EF33EB32JK31ZO2V733C433FS33962RA31JA2UX32JQ33CB2V22HK33EY2VC315K33CS33A2315N279321S33LU33LW26527133MM275314U33FI33FK2J833FG2QF31SR2QP32WP2QF21P33CH31WH2ZD33G32OL1Y31PS31IR31DB2Q62QP22G33CX311C2602QS31DB2992QE318133NP23B25J2V633NQ31811N2VC24P1F24426Y21S24P26N2V61Y33O633O71Q2VC33NU23B1J33N621433MI33CO33D032W131PM23831SK33EU33CN2YZ2YW32T622A32VO33O733O725E33M732LF2Z933OU33O625E315N2732Q933DV31FJ33GG32DZ32MX33GJ33KN1H2701G33GN32DR1H23131OO327F33DU2AW331V31OL32KB3275328Z327F32S92AW2MJ31TB31YQ332M329I33PC21X33KG2N1329F2JX32HX2O033KG2U333Q5333X33Q7330C331M33Q231VG2MJ314A31KW32SC33PS2Q233GU2HN33GU323T31YV332P3354313A335T31W928731VR32UG31KW335K33HB33HU335Q32DX31MU31V531O532VE31JV31TM1H324N31V231OF33RC33R931W12AI33RB27533H332UU32IO335Z33RI32FS1H33RL31TD33R1322432O32HB32NU31SF32Q1278333Y31LM33HE33HJ334733S832PO335Q32B333QP327K33QR31SF33QT335R33QV32DZ33J631V532UA32UQ33KH33PN31WA32LX33R433H127833R7324R32V828733RU2AI331731WQ33RG31W133RR32MA33RU33RN324O33T4322433RR32EZ33RU31OS33PV327W33GH33GO335433S233QC33HD326Z33S732H533KO33GE33PW33KC1H23U31TF32MH326B33TX33PG33Q42UI33U131YI32A533U533DV33QA2UI22733Q733UC331M33U833QI33IP32AA32WN31V133QO33SB32SZ332S33SH31YY33SJ329O33QX33HV32NO327233R233SS33SH33R631U833RR31SU33T033KQ32VK33TB2AI33T6324F324J334K2Q232NP31VW28U33TD322433TF33UX33RX2QF33RZ33SQ31Z833GZ33S431OO33S632B833S9327B31FJ33UM33QQ33UP31TZ33UR33GZ33SL31V233SN32UG33JH33SQ32NP335T33V0329O33SW31XB33SY33RT32UG32GU32QC33RP33T531X833VB335Z33HS33TA332N33VH31U433VJ31OG33TG31OQ33RY31O8336133VQ335T33VS31P233VU27532BL322333PG33TU27922I33PF1H32M2326B33XE33U233KB33XD33XF334T33XI33XF33U933XL27533XJ1H2J033XP33QH27933QJ23X32KH333H324T323233SC33UN2A633SF29233UQ31SF33US32Q133V233WH32LG33RC2LM324H2AI33VD33RF33TP3295335S31W133RW32SB33R333WD33SV33YF32UE31SP33V533RW322W31VW33V933WO33RK324J335133VE33WM33TC33WV32EB33WX33VL32A0334633TK335R33TM33PX33S533YO33X833S831ZE33QN327K33SD32S633Y933ST33QU33GZ33UU33V331SP31VA33YI33Z533V633T333YO2872C432L333H8316H31WD2WF332A33Z4328U32MA33YH33RM32E0335Q32EZ33KR33SR32Q533RJ1H32N22NL2AI31TB31SX33YT33UZ32DW33WE33YX335Q33V432UG33RE322I33Z333II340H31WA340J32Q233ZC340531W131ZD340R341A2AI32G031WQ322Z33RH340433T833VL33VF324J33VI28U340232KL340L31T232GF33SN32U831U72QC336V32UV341T341E33VK33RW342333ZE33RR32GF341W327333RR32I431V931OG31S931TZ27G27G340O2JP327P31LE1H32DQ32362BH323632DZ33ZI32NV33GZ337333ZM327D33ZO32VM33HN31TZ33Y633W0332233YB29233YD1H33W533WG33YY287342F32M8341J341F341732V432BY340A31TC340C31V2340E32UG33VA2AI341C32EJ328U340N33RO335331WA2AI340T31W1340W33WA33YU341033YW33R833WH33V5341633Z2343W3404343Z341Y340K28U340O341S324O33HP32MA341L33H831ON340G335Q33T7324J33RW341S33RQ341E342F2BH33YJ341X2BH33W7336233PH34263453344133WW324L33ZF33ZA2BH342D31TD342F2JP342H3273342F342L328U342N343N342Q33YO2JP342U2AW342W33VN33X121W33ZJ3431327B33X732VF327R324T33DV33PW33JJ22M33XF336V326B346F331M33JY31OV32GM33JJ21U33XN33I6346P346K33Q933XS31OO33XW33KF33XY32H031KI32E431W12QP32GZ331532SY2A633ZT32B333ZV343C31VJ335T31J7344E343I1H341C343L344Y31WA32DQ3406327D28731L131WT31SP32VO340F33VL340Y33GZ33YV31WE341233RA33R033V7332N344X33YK33WI335Z33Z8344333WT3419340M345G341X342A33TI342Y33PH34303372346733ZN346932K933ZQ2AW33GU321U343A33QS33W233YC33GZ347F31WZ33UW33YS340P33WC344C3480347G341333YZ348333WL33V8324K340K33RW329Z348K33S1346633TO34341H321U348Q327S343831TF347933UO343B348X343D33GZ33MZ348133H8347J344M3445342T32UI343P336Q347S33QY33YQ31WA349333WB32DZ347Z33WF287340033SZ349B3314344I1322O31WA343X3488349F2QF3452340K341U34AS31TD33KF33VM33ZH349I33X332DZ343233VT348O32BL324T34373477349N33Y731U9349V33GX349X347E333W349034AC31OA34AE329O34AG31U834BL31P6335Z349G345B33X233GV329O34B633X6348O349O349Q33PK349R347834BE347B349W347D32DZ33KX32UO348D32VE34A2345734A4347N33YN347P1H34A8343P2D7347V34AD344B328U33V13498348233RC33Z133ZA3486340R341Q345133ZA33WU345F33ZD345H341633ZG33DT33X133TL349K343331XA343532UH31OT337F27533QZ318K339H29U2S62IL319R338O313D313G3138338131NV31K333G227933DP339O31MC32W43307290338A31072Y631BC32RC29033S432TM330E32TP330G1Z1X21131BP1X2152X332R132TS33FR27933BJ31ZZ31R52MD32R82SV31BV31DD339C2SA2ON32U933GD32BZ33QB31EC33HY34FA33J432DR1X31XG34BY3473335Q33TH328S324E2AE342X31O831VW326O32722LM31LT27G32LP34FR31LT323S34FS31P33339332A34FX32AX33YE34A333HT32LA349Q31KW33QZ32O032A931J734DO3157339I32W32LU338V310W2YM27D338Y318133902YF32X22YJ33952VA337Z311Q34DY32DJ31IQ338N313C236338Q2LG320528833852NZ32C3327Z34E931562DQ338D27J31DV338G2EE2W534EW2P531F02AK338M32AU337Y34F3310O2ON31ZF33KY34E334HR33DS33TJ34FD33VY329433DY1H33E032ND34DL347I34F7326133P832LQ33PC33GK32A52J033PG32SG23Z346A34BE332A326532DS32AA335T33QL31OD349M33HG33TH31P831TD2JP31KW2U331LT346131KW314A1J21833S824931O8327F33HK31P22SO33GU33HM32SL347434DJ33I031T8329O313A32BE28731UH2HY326B31UH326B34JL32BN329O31VR32BQ322W32BS27932UA32RZ34K331VB331Q2QF33IO33I534GD31M0324V2U32RS2TI320P2RE33L232OM32XX32Z52Q534F42SC2RL2RI23D320I310M2RM2RO34GX29K34GZ31IP33NC2AW2JW34I231UA32MU33P934IF33PC32UP34I934K8328R33JV31KY33GE32SG32IJ31YH34I7336Z33GE32E834L7333933PA32P2331M32IJ33DV2LM34F933Q734FC1H34LD2AW1324831WQ348R3272332134IX32SM341X2JP31KS34LU33JZ31UA2UI32UT326B32QB34LD31KY34M434FR321933QK33UI2MJ34J3327G34MD31VB34I933S4316A34KG2Q03161339D2OT33BT2UE33BV27M2R031R333M432W432OO33LT33MQ26526L2V633MJ32R631IC33C82UY2KM2V133CD33MG2Z72ZD33NE2J72Q433LC33MH32WN315O33MT2QQ33OO2YU33NK2VD2QP33CW31AM34KL2793464325Z33GE33P72UI333V32HI34L834KC2AW34ML33I332BZ33DV2UI33QB22N33Q734OS2Q933GC2QP34II33ZR32S629233GU32Q133HA34BH34BM33H2333W324E323534BN33R334CI32DX31OX323M33WH32VG31WX3484341832VD340R32VG28U34PM33RS31LW341X31II31OQ342R32242HY32UW340K2D731Z634AV322434PQ32EZ32VG2BH34GC340K33X0342Z349J34BJ349L34DH326M34C4327K34BC34P1327K34P334A331YY31ON33YW34CE34PQ31SU34PS31WA34PU34CL343P2JP34A933II347V31WP33UY33GZ34PD329O34PF31SP34QT31SP34PI31U9349C348532IA343M34PO33RD34AU34D534RH348E28U34Q733UV31UZ348I32UH33S034B434FH34B734IV34IM1H21S33KG34OQ34LP34S234LR27534S634FD33VS26234C532BW34MW32BZ1H26U331132692Q932U8328Y2QC331731FJ3319275329N34K534SS32P332DY329F331I33HY331L32A734OO31UJ33TR34SY1H21533Q734T8331E341Y334T32B331SX32T132ST32LD333334J431P22U334J733PH27534JA34TG328S33QJ326G31TO333S34RE326G337C326933VQ27934JL31SO32M828F33192AI33I0313A34JV32EV329432M832BP340P34K22A632FC32OZ32FB34SW34MS23K31TF34TK31TF336H31P234UQ2A633QZ32LC333F332Q33II332233IN32DZ34V2349A333Z33YO322C31PE31V1328S341634VA34C134BA327H33X53347328S343G34UI327H33W731KS34ST32S2334F2C522V32S631KH32LC33JT3322340O32SD32SO340L328S34FT31P2334K32GU34W332SI32PF32M234W832KB32KT333A2AE34VV31YV34V427834L431V534R4333B327D2A6334T34W133PU322Q334W335Q31OF34WH31SF33KR335C2923351335T33ZL33SU342J34X632A8329034V734IA34V932UK31TF34VC34XE331F34C533PQ32UH328S328Q33GU2WF34TN32NZ34SM32KA34SC32B334TB34XN32RS31TF2WF1N313A32L732B424H2VA34Y5327V34Y733PH259331534XD32B3328S32N234WD1H344U332234CK348M33WL34M231W1336V324T3271328S3371326G3379332S31LD2A92A626532KP28732WM31O626A31WA34Z4348733FG348731SK345H34WV341Z31TD34WY2JP34V427G34CD31OG2B432KO31FK32IA31VW2JP34ZE342S2JP32K531ER27G34T8345T327G21434ZM1H2172QF32F531VW2B434ZZ335Q2B42B4350231ER2HN34WN2B433TB2HN350A31T22HN2HN350E32C02162QF34FZ2Q22N131PE32GF34J0342S347233RO345W31WD33FG31SX32PY33Z931DB34Z9347L2AI34ZC341X34ZT32HR34ZH1H34J832KB27G31GT32KB2B433MT2BH350I31OG34ZS31TZ342I34ZW27534ZY342M3501350333CH35073503350L3470350D31OG2HN33BH2Q2351Q31VW350K31TZ350N1H350P31U934WN350T2AW350V346034IZ351R1H3510324O351231V2351431OL322332M4340434ZA340R351C31TD351E32GF351G34YU327G22B323D351N2QF351P332N351S328U351U342K34T7351Y27G352H2B4352133ZA350931TZ350C352G352733WI352A33ZA352D328U352F352H2KL31WP26C346932GX22C335P350W352O31ER2JP352R31W1352T31SP352V31V533KM33WL32MX32QF2AV2Q9331Q33SA33IO2A633SL34T4335531UT34XY2A633A132H832B3354734TN31YY32IC331U34SW34X5354X316232EH355131YB34J834U127532ID32PK34VQ34XX32S634XP34J8332R29334YC27534XU32S631VP2A6355K32B334Y034Y232A62QC34Y931KS34Y931YH34XS31ZD355S32PO354P2Q2354R32DY34OK31OC324V311O337K31FJ22Z34HA2IY2DY333F22K2C727P21D2RG34KS2C931H72UH32DL325W2AX23K26G23726P31CG2B531AR32QQ31Y231AW34ED32XO31BK32RG34EI330T2BJ328N34SJ33131H3566331632BZ34SR32QG32KK357Q355U32DY1325V34XA33Y432E5326Q327H34WT326U34YH31TW31YV32Q332NX31XA332M34W12MJ33GU332X34TG356E31KX356G32VQ2EO32VS27922V356L31QI31MT27T356Q236356S34KW31AT23921D31H72X32UI2M327925T2DU22X25Q357527532QO31AS32QR330931BF29032TL357D32TO2E8357G32RP31O4357J31OT357M34SO357O33JJ327134UK32BU33I632KX357T331V357W32KZ326Y322H33PR34XK358232LD332634IQ358732KQ3589324P34TH358C327K358E34I832T3358I337J358K337L27522X358O29E356O358S358U356U358X31H72RE3591356Z1H26Y34Y524I35982R2357731AT35792TP357B359G32TN3147357F34F133F833I231UT3312359O355Q34VR3261357P27S34SU357S354U359Z357X31LM337532PE35A5327H322S326G358533GY31LY31SB33302BH358B34C63360358F34DL1G35AK33EE356I29835AQ356N358R31EJ35AU2RN358W358Y23I21D2S035AZ2AW25F22W23225035B5359A357832O71H31BD330A359F330D357E359J35BG2AW33R935BK31P7359P32PM35BO359S331B32A53271326B359X35BT31KI35A034DJ327O357Z35BY34TH35A635C1322Q35C334P433DY35C634UT332N358334BE35AH32KE35CD35CF34DQ2DL31FJ23735CJ358Q2H635AT356T35CO356V35CR317135CU2791423X22125U35D035B7359C357A32TJ35D731BI359H35BE35DA32RO35BH34CF35DE31VB35DG35BN331835DJ35BR35DM32A535DO3556325Z35DR33XA32KC328S34M831TF35DX32KD335P332235AA35E334UP35E532LD358D35BW34SF32611G31II339X328H2MP33F431IM35AN1H35F633MN2QS2PG33LI31ZY2HB22J2OR33FH2MJ33FJ2YP2SC33FN2L133FP2B632XI2Q433G834ET33MU33FT1H33G433LP2SJ31AJ2OT31GP34OA27534YQ34L5354W31LY33K233QS336Q27832KJ34OI32VL33I134IR33JV2LM326B32P635HA33IV33DY35HD31SF21J26934LS3224326B28F331M2D7346Z327W34KA340L35HO33KG33VY33IA31O835HT2JP33K527534K434MU32A535IG33KP33QJ35HM33U632N135I833IT35HS35IA342S35HV34U2349S33I633I0326B34TD35HK32N535IM35HI35HP33P635IQ35IB35IS32731V31L12HN32MZ35HI32MZ35I735I3319R35I535HN32A535J533GE34PU34SC34QM346Y34T2327V2LM32C532C7321H2IL2SO32CX2UC31JR312H2LS2N831DD33EH2792CC2PK33S7325Z34T834OH33R5329O34183518340R34MV348S341X329Q352N35C833RO35KQ31OQ34TZ349H34B234M61L2HB33M32D532TC2U329U2ES33922YI33MF35F635JJ22U34IE34CU35KH33PP34RL32K927832NP34X6323Y35DS33UJ33TH322335KS352L356D31V234FO32Q331PC1L31VA31PI2N82SF2SH2SO31C031A4314M2ST31B8330V31AO2RA32072I822L2H4320632QZ35L02P535L32NI23E35L631272HB32WK2TI2Q432WK32X9315X2PP2DA32DH2IX358P333F33FJ316435AW35CR2DT29935GR32WH2N121Y35JX32C92SN32JE2K735K223J35K42R135NJ35K82LY32WE35GA2R033EN2OI33EQ31AO32DD35GR32DG32012752202DR325C325T2LM35MQ22T34KJ27935MT23B35AY31XY34NZ2792US33C723A33MC33CA34NP2SX2NY32AO2O62O834N733BX2QJ31DJ31DL2UE31DB2TJ32YF2HB21W32DF2NZ22A28J312R33EU315N24434IB33DW35J931T134I43361357L34FP32HF27532RW33HY35PJ34FD33YJ26633Z933WR34AT34I134MP352N32K331KW35C3351W33Y233WI34S735Q034FD33QJ32IJ332I34LL33PC346L32C031UT33X534QV2AE31II34UZ324331YV33QZ34X131WA35QK3248333E349631KH34X631Z631YP31YF34TX35PS31OL349P3340326G35QJ34TW2AI34UZ31KW34Y334UZ33RU32MJ32LC35R132IO35R334TW313Q335C2A6324N358835A834YH34JF34TW34QV27835QF32DZ31Z931U833S432VE35RD31TC35QN31WA34UY340R35QQ340R31Z635LI332N28732GX34FI34RS32K9333M32V632DZ35RU35RR35QL35SG31KW32DX31YU32NK34AY278343G33S3349635RW32DX35RF32OT333U329O335E345A348J34CE33HP31SU35QH31WA3317335Z34VX341X33T232V13418344S31WA31HV335Z33YM31TP322434W735T92QF342B345H35TH345833HZ352P35TA35AD34ZR1H35TP32GV35TR34ZX35FB346M335J32AA31PE32NR31XA2783268335E33HS31V533HS32VE326832H831SU34WB33KM28U334T32KB2BH33HP32GF35TF342S35TX342I2J035U035C32B432O3345U314A32733444342I341C27G35T6347035RB353S35RW353S34J532IA35SL353S335131T2353S31TB31ER2KL34CI2KL31P5335Q35VN33232B4333K350B32IA35SU32IA2B434WV31TD351Q31OQ32A0345H35LY31OL35KQ2NL35U833YP34BA34I931FJ32TF2TX32ON35PS34OW2QF33GC33SA31VL34QJ35WC31Z031RU32TG34DC27H2VA35WK326935WM331R34I934162AW32JP2MP31GJ31DQ23H349P33N631FL33N233N6330S31FV31FX32AP2Y82NU35G533EJ315X2WD2BA31DR32ZW3120321E310Y32ZI32YD35WE31RW324Z338V34HZ2T034E431QQ27531IA2MP32CT2M12M332CF2LE32832D1338J31IB35Y229A23823I23B313N237356Q312Q339L340S31KI25034OO35DT34BB333831UE2AW2WF32NC32DV32W135SM29232BE278316H32P4326B35Z5329K35YZ27525X35Z13499333V324H32DX35TI278343R32VJ35RW34MC322431T2342L2BH33PX27G32S134MC32S033PC32FC31VP345U31U2329N28732FC329Y32A532FC31VL32VC34PX32M82HN2BH360831U932HN31SO342L28F32E9327G35Z832M432A535Z835ZZ31X331HQ327G27G326L32F531WL323W34P627G35RB345U35RY2B4333F350F348D31SL346931VW27G31Y835PY31II31L727G31JV313Q32MF31WQ33KV32AX27635XW2L831PJ31RF2CY33L72Z02VE2B532WE2I832TE31ZL31QO34GJ1H31IA2VU32QW32D135MH34ER330P33BI35GZ35D5359E1I34EF35F231BM2E82X22FX2F21Z2122WX359K31QC32DL315G35X535G935H635KB34EU35P935I931LY35IU32OT31Z832P0331M32S134LV2C524Z33Z9328S35DY32MJ35C5327233PM34I131LT32SS35SJ34G132SW35WS34FJ27935S835FM2AW33HM31LM33PG35JP34SD35JS358G27A31Z033L434N1361T33L934NW317P2QT33LF316133FB33AO2Y733LK33AX33LN33G023A347527532JP3154338B23J2ZJ33OR34N631FQ34N835MI35Y1362331ME328Z315K2ZV2QP33C633MA34NM33MD35OK31BI34NR310031022QP315P33OR32VO35P6361T33CS33OB26F34NI33NJ33OX35GY32XX33CU32WO365Q2792V832XI34NY33ML34NE33MQ33MS2NZ35GJ2X92RE34NU23J2QP21F33N621134NT33DC35YN2C52QI33EI2DY314A314X35G831JH31FJ326I32Z32VC33P01Y33P22UR2V9366Q26Q34O122933N621L35XB33N622D33N626H34O115365S31CR33NI33OP33O533P026A367C33OU33OW1H22H26O22Z1525B22E26O2V9367J367L367N26O2V622Y367M367O22Z23P34O133OF2DR35GN2I133LS2QF33N32Q233N5361T32WS33MW35GO23A2RE2MJ35H134KQ33LQ35H4368J32OL325334F533MP33LW26D365N24123B33CH22921W33OA33NU33NS2ZA2283678347I36941D368Z33NQ33NW1H33NY33O033O233O41H366Q33O91H33OB33OD35GV33OK361T24O2V922O2181R25I24Y22P32WS2VA369434EV33G733OK34Z42AW26X34O135X9365033MT24122833OG32WR2UT2MP368I368F33EW366D32T935GZ32OC2PW33LS369U22P369S25I26A368T23433CH24121S369833NP26V34O133NH2QP21R33F034KV35H71H24V2LA33KP32SG2ZZ322831YV34XK322333KO33SQ34KB2LM33ZL331N322M32BI33PC25R33KG346D35HX32EE35HX326B36BS35I331TW35WG34XL31LJ327H32NJ32B32B433UM332235RM335R35RO31X331VZ33UW34Q931SF34BO27836CB32DX35RY28735S031TC34WY33Z634RF341836CP32MA34WY28U34QX340P33VG31X333GH31U734BX33TM34XG346832H434NZ33UL327K330C36C931YV36CB31YY36CD361C31SP36DJ2AI36CZ347X335T36CL33GV31V536DL36CE340K36CZ349H34RV34BY35SO348N349M33QE34QI331R34BE36DD33ZS332S36DG33SG33GZ36DJ28736DT36DN349432DZ36DQ324C31V536CP31SU36CR36D234QY33RC36DJ36CY346236D434DE335T33J634RY34QG36E331LY357Y34BC36E732S632VG29236EA33YA36EC333W36EF34PB31UQ329O34JF33UC36CM31U836FD32KB36ET334636EV3465335T35SZ327R36E233S834TZ331F33GU36C836E836CA34CA36DI36FC33UW36EG36CJ34TX34X636CN3480347H36EO36CZ34AN31W136CV34AQ324J36CZ34Q328U36CP32EZ34WY2BH36CZ34DB34I136DY33TM36FS34IU34QG36D936F235G034BC36FZ36F636E936G233GZ33W931V5343G33T136FE33GZ36EJ31OB36EL33WH36EO33JT347O32UG36GH33Z4335Z34VZ36D0324J36GN33ZB35TO35TM34RT33VO36D533GZ36GW35LE326L36GZ31PC34XJ34BE36H333Y636G134P536CD33WK31U835UB31W136G633R336HE36GA34UY32BB33WG1322J31WA32M236CT36HL340436CX36EP36HQ335Z36HS33WU345H36GR36HW34DD36FQ32DZ36I036D833ZP34QI36FY34BE36F736G8335436CD35UL31U835C32AI34L4336136G736II31U836EM36IM31W136HJ36EQ36GG36IT36GJ34RL33TB36GM341E36GP36IV36GS348J36GU36HZ36E136GY34S024R1O33PG36BM33JJ26R31TF32LG326B36KF331M1G32XH346C346V36KL33PZ32A536KP35HK31TW319R36BI35LS35FI36I636JB36H536IA36FB34CE36FL344A33SS36JN36HG36GC36IS343M34X3340K35KJ33RS36BN341S340U32732AI36LJ31VA351534D036GB351A34V0340K36IY32BY345H36LF32GF328Q345B327D36ET34PZ3224313A34Q234RM36LU36K136J133TB2BH336A34ZF2BH32N236ME34YI335Q32GF34CK33RS31OS2BH36CP32GF2C4354B36LQ31T2342I36MR35PY36LF345U36IQ342S34PW2JP32M2342V335P36GT33VP36DZ34CN36K736I236J834VF36F436L036I9335Q36DH36L336FK36G536HC36DP349636GA36L5335Z36DW34BW36EW34B536NB2AW36F136I434QJ36E636NG31UJ36F82C525H36CC36NK36DS36NM32E136JM36NP36JO36HH32UG36GE36LP36ES36IV36DX36N833TM34C036FT36F033S835FL334236C736NG36DF36H6335T35H931V5353734U836NN36EI36OE36L9349934AI32UG34YW36HK33RC36HM36LS322436LU36LD31TD36LX31TD36A3342B2NL28U31EC36M328U33FG36M636JY36MT344N36PF36MO31TZ32GF36PI2JP36LF342I36A335KQ327D2BH334T360D341X31SK326X36K334RU36ON34DF36EZ36NC35SB327B33Y531TF36I735IW36NH35QK36CD34ZL36P133UW36IC36JL36IH36P631X536OG33RC36ML36JT35RZ36JV36IX341E36PI2BH3518332M2BH32WM24M36M031XA36PP34PX340K32KO36PU348C36M833ZE36MP31TD36Q232DY36MU327336Q632IO2NL36Q931TD36RZ1H32K536QE36J234QC34RW27836OP36GX36QK33Y336H136O236DE31SF36F93339335T350A31V5350233SO350536OC33R336SA36I136NY33VW35YT36JA36SG36O536L2335T350R34CE36JP28736PI2AI36LF32MA36BN344I31WD31EC34R135U932UG36FS36DO36P535LD36EK36R136LA36PD340436MW322436LF32EZ36LH36RY31W131KN36LL344833UJ36GF36R6343M36IU36GK36M736K033ZE36J134QB34B336N936SS36J7349P36NE36KZ36SY36JD36O8335T351031VP36CO2C523L31TC36T636RU340R36TA36TV31SP34J834R131KN347V36PE36PI28U36TS322436TU34PW2AI31EC36TY31WA34T8340X36EH36FG36R031SP36T436PF2AI36V2324J36V528U36V733YO2AI352V36LJ31GT36LO349D36PE36IU36JS36IW36LT36U736J036HV36UA36K534YM34DG36SC31KS36KA36KC346V24R32XH2V6326B36WF33XB36WE32XH36BW27536WJ36KT31KI36C2363H35PY34XK36C636QO36OW36SH36OY32DZ36ED34DH33RC36CH36TI36VG36TK36HF36TM36P836VK353V34A636TO36U336JW33Z936PV36NT36FP348L32DZ36D7348O36I333QM35KM32S636F536I836OX36T036X136G433SO36IG36L736VH36EE36OB36XH34DC36XL34QD33SK36NX27936NZ34SG36O133GU36XU36QQ36XW36NI36EB335T36X236L536QY36Y236X836IJ36R236IF34PK36OH323D36FN36Y736UB33TM36EY34C136FU36QL36F336SF36G036YJ36QS36O9324136Y536YP35Z936G836FI36DR36ZC36Y036YX36OL36NU36J4329O36J6348O36YD327V36YF327K36QP34C736QR36JE33GZ36IC35UC36ZD34R536NO36YR36OF36TN31W136LZ36R536VL36R7340K33CH36GL36PW33RS36M936W5346236S736N9350A36QJ31LO36ND36O036SX36Z836WZ36XX329O36JG31V536JI33XV36P436X735KG36TL36VI36YT31WA352936XE36JU36XG35TG36JX36RO36W334PT370K34B236W732DZ370O36Z336K836Z536SE370T36H436ZY36UK32DZ353934CE370Y36YU36SQ36YQ371436X9371635HB36EN31O624N34QW36YV36XF36LR36U4371E36D136RP345H36W036QF36HX36NV329O371M36OQ36WA2AW36WC35PM346N27924V32XH33KM326B372V331M25O337L36KN32OR33TV373136KQ279373636WQ325Z36KV34GW327B36LF36OV36UI36SI36G336L4370336CI36QZ370636P732VE36EO36VM335Z36VO354V341G36VR36LK31XA2AI36LN371A36U2372C36HR341E36TQ36RB36Q031TD36LZ36PN36DV36RK36M43323370G372G371H34RS36MB1H36MD35TQ36MG35TQ32G036MH36ML32EZ36MN370H36MQ352P36CP36MV353I36MY327G36N035V1345X33XG36N63461371J36QH36W8370P33XZ370R36YE36YG36WY36SZ36YK36FA36YM36XZ36YW372036HD36Y336DU372936FM36ZM36Y836S836NA34QF326L36ZS33VW33VY36DC36O3370V2AX36O736NJ375M373K36ZK375P3705372236YS3708375T374236DM36ZL36XK36Z036QI371N376036OS348N36H2375I36UJ376932DZ36P031V236P235TR376D36TJ376F370736XB36EO36PB370B370H36CW374534D71H36RA36UT32HR36PM36UW36RJ36PR369G374G36U6377D36K136RR2BH36RT36Q436RW352N34PW36S036QB34AZ33TI372J36J336XM34BZ36YB3470371P32B536UH370U375J36ZA335T36QU376Z36QW371236CK375R36VJ36EO36R4343O372B348736IU36PH33ZE36RC377H27536RG374C322436PQ36RI1H36RM348B372F371G31TD377R377E352P377U2JP36RX377X1H36QA31XA2BH36S433TH36W6375B36NW375Z370Q378835YS36Z7371S36Z936ZZ36SK333W36SN32UG36SP36L6376O372O36SU3436363V35CA36ZW3469371T376W329O36T2377532VE36US36T831WA36UV34PW28736TD343P36TF33RC36TH36VF378J373O36XA373Q36LB36LR36TQ36V4341E36VQ327D35RD36VB340V36U036LP36VY36Y633WS3795377P36U8371I363O371K3785379O375E36UF370S36ZV376U373I33GZ36UM31VI34UY36UQ31SU37AG340437AJ3407351H329G31SP36V037AW348736V3377G36TT3794373Z343F31WA36LJ36VD37A1376E36G937AE33H8373R340437C5373U37B137C936VT31W136VV376J377A36GI35T7372E377C34RO36PY36K236S6376N375C376P379P34DJ372R3638373431IC1K354Y33I622837DB34FD33XC31GA37DF36WN318L37DF33DV354737D937DI373737DQ35HK379Y1322H35QW35YR32JE33UI335H2A636WW2A637A836JC37BO376A31X733SO36X537AR36UJ36FJ373P37CI32UG34WN36U1370C371C374D36XI348C376M37BG27836XO349M36XQ35T034VE378A379T3766378D32DZ35WI370Z373L36X637AS377437EF36CQ32UG37DW36IR378P35S1324J34FO374H37962BH375434QA370L37D236YA37BI378736DA34OZ32B336YH36ZX379U371U34JN375N36ER378I37ED36ZI36DK36Y536NS36EU37FN329O36Z237A336YC36SV37A635HB37FT2AX32BL37FV37EZ379V36XY376B375O37CE377337CG37F8372637G037FC371Z37B932DZ375W36N937GA36SB37A436SD3789371R36XV37GK37FX33693496374P35SM374R35SG22G35U71H33KX32Q128736IO33SO373S36LE341E36LZ36LI31W1334T36VE36OD37AT3724377637C3340R37CL37HQ37C836LJ22I37B636VX370D36PG36R9378T37492BH374B377J31VJ36RN37BB37CY36K1374N32HR37HC32GF37HE32HR32M236S232M231OS2JP374Z327336PI27G36CP345U36PI2B436LF353S31KF35222NL27G32MH332X32SS34RS2QP372K36ZO36S936NB2RA36GZ26W35PE31LM373F36WX373H36X037FY36T333WH37BV343M31KF36TB33YN347V36Y1375Q37HX36UO376H2AI22L372A371B374436R8377D3747377G32GF32K734PV33YO36PS377N36PV374I31TD36MA332N36MC37ID35YO36MH37IQ36MK33TH35W3341X379836TQ37IW351T327336TQ27G375227G3754345W327D2JP31GT36N534FO37JG378436E037FP35VD36E433SA37H636YI37H837AB278370137AU33H836TQ36T7340436LZ37JZ31SP36IO343R31SU34OS31WD22M34AB37EK36LR37I2377D37HR32IO348732L137CC33UJ37F537G2371537K537HZ32PR2AI3754246378O37KA37C436VN37I337BA33RO35TD2AI34S2341M34P637M8378Q37GX36W137IA37KD37IC328U350X33TH341H34A433H336JZ37BC36W4374K37KQ374W31TD37L1370H375035U037L71H36LZ37LA31XA37LC375836N636K4379M37BH36W937D533UK37FS37JQ378B376V36YL32DZ371Y37HY32VE37LV377G32MA37LY36UW37HL37C133H837M431V237M636V137CK37MU37MB37C837ME37C937CD36ZE37CF35SI37CH37F933RC37FK37MR374337MT373T37MV373W31PE32MA343M37N0344V37I034A4372D37EN37IJ35TI28U36MR31UJ374831UT24132HR3236342B344R327L37N737IK37BD37NJ31VW36PZ37NA37NM374Y37L32JP37L5377G345U37NT36UW37NW37LE37FM37EQ375Y37O237BJ37D636KB372S37DP1H2201N2A621V33I637QO36WK37QM37QT31TD326B37QW37DN346V37QW37DK37QZ2MJ370Y37I6348J34J136C537A737BN37JS35RP333W31X237EB37HW37F737LT37P131W137EI37B737I936YY37MW37G636FO37G837ER378637LK32E1324T37JP37E437RC370W37RE37JU347H37JW36LR36A337LZ28721U37C028729G37K137G136L837RK37GT37GW36PC37MS37FE335Z351L37C837KC37PX37NI379K37QE37O037LI37QH37FQ35KW37EW37LN37GJ378C37GL341136X836PI351636XB36A332NT37HH31EC35RS329O33GC37HK370H37BU32UG37AH2AI37S936RY24J31SP37AM1126431SP34R037GO37OX37GQ37OZ37GS36JQ31WA37FB37CS37B8335Z37FG377O37ST37KZ37KS377T37Q534BD27936Q7379H377M377Z37IE378137D137QF37H136ST37QI36H037H537BM37JR37S3370H32DX37T9377G31SU37TC36UW32DV37TG27833Q237TJ36VJ37S7348737TP37AK37CA34R137AM37GU37GP371337GR37SJ37U32AI34OC37U637RP363P37P937CX37PK37CZ379837UE353G377V37UH36UW2BH21Z36S1341X316H36S5379L36HY379W37LJ37EU376235CA37FU37A936Z931SO376924L37JT36NL376C37VJ37F637VL37OC37EG37VI37SM376I37RS36YZ37UP37RW376132VM376332S637E536L1375K36SJ32DZ37A037U236T537TM340437VD37BY37TT31V237C237WU370437U035SM376G37MM37SL377937U737EM37SR36W237NH341X37K834RS37W9372L37SY375D37T032K336DB36XT37S237X7373J37WN37TY37XL37VK37U136ZJ37GO37WX36D337RU37CA37LJ376134M6376T37UW37Y934DF373P36IL37XC1334Y037OF34Z734A636TC37SD32PF37SG377237YE37XN37P037SK376I37WV37N337SO37XT37RR37XV37UB31TD37P33782370M36Z137RW36D936WB37QK37D833J727922437QP35H033I637ZU331M23D1M37QU31SC33TV380037DR1H380534FD37DO37ZS359937ZV37DK23937ZV326B380833KP22131KI35HN373D37RZ37RB37YQ37F037WM36OA37WO37TZ37Z637EE37VM36P937FD34A437MA37CY37CN36LJ326I37B431VJ36VW34RG36OK37EP37SX37YL37SZ37RX36O036E5375H380Q37T637S437YB37XK373M372137WR37ML37AV381O37EJ375S37RQ37GY37YK37UQ346837YN36J93764381K37H935FB31V536SL37XQ381P37K337RJ37G437WO37YI381Y37WZ37YM33S832SG34JE35CA35QD375S349X332U36CZ36GX31VP2AE34JF337H33T4332236DJ381M380T33DY32LS327K36Z437H4379R37T337WH37LP37O9329O371W37Z831SP37VB36UU37Z031V237XH31SP34JX381O37MI37SI37WS37RL37ZA37XR37VR378S36LW37KS36BN378Y28U326I377L36M537XU37PW37VV377Q37UD379A37UF36BN37UI36S233FG37UL1H32UC37W837SW37WA36J537ZN376R33TO37YP37O737E732DZ225333W37VA37XD343M37BX34CM383L287383N382A383P378K3717376K37GV37P537ZD384636PX34X337PN36RU24E32HR383Z37IG38423791384437ZF385C370I36RQ384936MS379B373V35TU37UJ384F37UJ37I6384J375A384L36ZP384N37A536I5383937E637RD1H37AD37XB379933RC37TN385V37SA37VF37AN37M71H37AQ37RI381R37TK37VN37CT2AI37AY37C636V637I436TW37CB36TZ381936CU37VR36U537KM37FI37D037Y037JH386M386537FR36XS373G384R386A37OB343R37YC382B37OY37Z7386D36GD37K9385A37PG37B932U8345236BS37NG37ZH37Q136MJ36RS384A37VZ35ID377W33YO2BH31KN384G37K8386137BF381D36ZQ37ET36K937ZQ33GE36KD31FQ38011H22433I623H388K326B23L1P380232OX22P388K37DK388V331M388R33PG380A32OX22T388W33I63894388Z388S35HK22631KI319R33UC2QP36FW377G387E37EY37T5382636YN37F437EC383Q381S37WT37SN381137OR3813386X31WA2JP3817374137ZB386S36PF387W37VV37KE36PK37UM37KI36M137IH385M37KL371F37XW37KO36HV374L37IM32GF37IO31TD37KV31TD374T33VM345H37L037Q4388236LV36MX353K3757346M36N2375737QD386237Y137QG37Y3381G36XR37WF37Y8380R383137YG383O389O375R36NR37ZE382H381D36UD36ZR37GD3867382436G036O436G83768383C38BC382E387J385537K4386Q380Z382A381V381B37G737QF38BL383637T134IM386837X638BB1H376Y31SP377036QX37YD37WQ37YF383R37Z92AI377837P437ZC387R37SS37VV377F38A737UG340K34PW377K379136PT384538A436PX384837Q2377S3881335Q36Q5388436Q8379F37W53780388A36N7386337JI37WC382K36QM380P387F37UX378F38CG378H37Z538CK387M380Y36XC378N381V37XS385P32EZ38CV2C536RD37UG378X37IG379036PO379238AD37PJ38D5385R38D7386E342S385U379D388538DE384G379J33WZ384K38B438C7371O38373476379S37H7389K37LQ353J34CE37DU31W137A0380V38DK381F37X133VX38DO389J37O8375L32DZ386C38DX383H34A4384Z343P3851335U347V386N373N382D389Q383S38CR32MA386U37CM389W37B337C9344938A138E1381X37N638D4385Q37SU38EQ38B3387938ET36SC37O4387D37O638FC384S329O37BQ37OC37BT383G384X36LR38FK31WD36UY343P37XJ389S32MA381237VV381431W136VA37OV37MH38BF38BZ378L37PF38GW389U38GY38FY377M381737CR38G237VR36W037FH38AF36GQ37BE38DI38ES387B37ZP36WD33KI355G389923533I623P389936WI388G3237380B1H23T389937DK38I3331M37D72MJ31TW383E36KW36OT38FB38EY38FD37X8380S31V237OB385837WP37MJ372338FS38CN36IV38E0387337CW38CT38EF38G837FL38GA37LH38B537D437US34I5371Q38BP38GH386A36CP37UZ31U836LF31SU31KF37TD35W8324527834X6326838JG23434BY28736UM38GV31WA38GX36PX31KF37HS31WA34UD37C9313A37HV38FQ386P38H6381038H837P7377D38JU36UW2AI23735SH34A4350236LJ37W4387138H737CU38BI38G5370H36GO38EG387Z38D8385T37UF31KF384D341X23638DF2BH32MH38DH31KH36HX32VO38J038GC37H337UT383837UV38DP37YR37E831V538IK36IV38BY38FR38C036XC36OI37I837EL374F37PI37VU38IW374J37SV38IZ36Y937O138B637WD389G37S032IA382538F036X235V6383T387K37XM380X38CM386R37HO36TR341E38K836V8381837C938A0383U38LM38G638E337N938KP2VB37NC37KJ1H37W4384338ED38LP38G738LR38A933ZE38AJ31TD38AL2BH38AN2BH38AP37KY3797385S342S37IX2JP37IZ37Q8327G2Z632U837NU1131MU36N337NX37LF378338LU38F738LW38BN36ZU37Y738M138BU375S36Y437HN37OQ38K637CY38ME345C32AA36LJ37HU37C929G38K033SS38L537GC386638NU389I38IF38GI37LR384V37JV38GO348737JY37OI386J31WD353937OP36LC38H938JT37C837PU32UM2AI2V438OB382C38K2385738A238JS33RS38O437B2337R386Z31WA331038KH37VI382G34P738C6387B38GE38B938NW38FE38II38BW38K438JR38OW38P9331436LI26Q31WA38O836LJ38OA38IM38OD275382236UG38CB37AA38NX387H38LI38FI32MA38OP37VE38FM38OT38KI2AI38P832EZ38PA37C938P238IM389P38LI37CJ38OV38O237VV38QN36LJ389B381738PF37CS38C437RT38PK38DL33PG336X27935JQ33GI35WB34SG2192A913388M326135PQ333P36KX34TW331W333A34MO337C335T37X332DX34TF35LE1H36KF31DB31KV271329O35C332UP36XB344W332V35TI2AE32LP2BH332I35SG377Z29232VJ33GH32K935JV31LS360I347D37M62AI34UW340K37X332EZ27S37VV31MU37VV38S9348D36MS37X3342I31SX32MA2JP31WD2HY2LI36KF31X931S831WA313Q330C360E31JV2LI25Z35SX34UR37LW2KL31VO313Q32II34IQ33J635QK345A2HB27831L735W929G38TU1H32MH340O31T9323Q35TR31KN38JG334K332A38S335UG322I1325E322436JG31WQ31U732VE35UU36PX33WL31U738JG32M232LV33ZA27834WV31V5348A33GH336Z28U27835W533IO27833ZL34TN31YJ38UZ34GD38V234LE329O328Q38V632SG24D329O336A38RR36OE34X638SU35SG32N231V536BN35SG335E33ZL38VF370638VH33GZ34YJ32DZ344U34X637HC32DX32DQ335T34YG33GZ38W234X6336V36W838W1349632VO335T353727838W435SG33FG335T34Z438W836X833KX335T32A538WJ3722351V329O34ZO38W33496352H2783829329O38WE35SM3505335T37XA32DZ38WZ32DX350R36T1323D27837AD34X632E436UL38X936MI36X837SQ35LE33SS351I363O332U33MT38V332DZ33CH38XP329O371935QW335T383E38XV32DZ354J34DC363H27833A1334632DU1H380A38XY329O337H332U37U5335T37F232DZ38YD32DZ37HG38YC38XF37HM33GZ37XY33GZ37R733GZ34OS332U37KH34DC38Y637M637T1335T33A733GZ37QR332U37PD38XV32MN27837SC27923S35LC33GZ33Q238YY32DZ37VP38Y927837W438ZE329O21Y37FM332U380K38ZK278366N33GZ38RS35LE33RC32UC334636G735PD38VQ3722341838ZX34DC35LJ35SG384U335T384U332U38ZU32DV33RC389E390533R338RH33GZ38HU36X838JM31V538KB334633TB278389B332U390S31U8356Z32VE38KW38JG38KW335E390K3722390M31V235GX37TD31V537A0390Z34AB287391932DZ331038U73504322A278336X391G23C33WH391437U436ZL326335UM367I32VK35KQ33RC391M343M32JN335Z23H341E32U8345H37U538MZ345H392138EH3923342S3925341X33TB2JP392838DA3273392A327G392C327335U32RA35U5329L38JG23D391B1H391232VE391O2AI35GX381V350A31WD38KW38S537AD31WD38R1391W3404390M32EZ38YD310R2BH38YH3273392L34PA36D1391X37CY391Z341X392G36MH392J2JP392L37UI36MS393O34ZU35PF35U0392L37NU35U0393V360T393X3470392L34FV36HV33ZI342631WD392S38S5392V340R391O28U35GX370G393131W138KW37NF38F137C93310394N393531W1336X394N393K37VV391O393E323D393R323D27G392L32FG37Q01H394W35TQ393M32733942342I392J39532QF394035PY3942345U392J2B43946353P33EE353R32IA392J2HN392L31P034ZP33ZI374U37C9392S394N394E33RS394Y38PC37PZ33ZE32A538EB38KW374V3968340K3310374V394S3224336X374V395832HR391O2JP391R353I393F395M353C34ZQ352P396K342I395A27G395J327G395L391T2Q2352231ER2B43942353S395S3972370Q350J395P35HB352F392325Y31U9392L352K346M33ZI37NB38EB392S374V396232GF396M396538DC352P31LD36S238KW350Y3273397X341X331039802JP396G2BH336X3985395737UF391O27G3666351M397A3616393Z3619353I396K345U395A3976395Q2B43979395U353X397D335Q397F31OG2KL397J33ZA2KL394235VQ392J28F392L31LV350636J3342I360U341X392S398A3962342I398D397U38AZ332N27G38WS2NL2JP38KW34R9399M322A2JP3310399R386B399T3641399W398M327G391O2B423I323D2HN329C32KB398Z399935VT3975398B328U353S395A2HN3942398X35VK397A33VV33TB399231TZ399431OG39962QF35VT31VW28F394228F28F392J313A392L28F36CZ34J636C43947399O3807334U35PY3962345U39A3399J35PY33TB2B434Z437J92QK32IA39AD39BK35PY331032LP2B4393531JV27G336X39BS39AE35VU2B4391O2HN34AP39A9329B323D39AT353W31UP353U396K352F395A39AP35HB39AR1338HU39C82AW39AV39AS398V31T239AZ394431VJ39B333ZA313A3942313A313A392J2HY392L324235DC346933GO23Q35VX346931VL27G392S350I34J837J431KL34J82HN33DU33A12HN2AV32KB2HN3962352F391O2KL36C231ER28F38W233VV39CA3616339L39DY31OP2HN2B432ON361639DO346939DQ1H34VT32KB39DU350S3339352C1H35IA361635IA31L739E239E9353U38WZ352F32ON39EK1H35LB310R361639EO346934VT39ER32YE22Z353U39E62HN39E833PJ39EB35YO2Q22HN39DX33ZO2E439DM1H39FD398Y1H31KK328U35VQ391O39CK31ER39B2323D39D039AU31X4327D2HN32IN33SF2HN39FG39AL32A531T235VQ391M2NL2HN391M39FX39FF39E11H2321H37PQ361638VE32C038VP31P939G932KB313A396K39CX319S31OG39FR32KB2D731YA32KB27S2432QF33SJ31PE326L31OG2D7396K2D72D7395A27S394235QN392J31MU24234K933ZA31MU394231MU31MU392J31KH33TV27931MU33TB31KH394231KH31KH392J31JV35P8330R36XD27936CH33ZO33IR33ZO39F339GP39AL37MQ39F739FG39DW332N2HN24739A61H39ID39C539FG39G5369J34BF33ZO39IG39FH396831U3336X323T25Q346939IN39AL39FG39G231U9391M39IY2KL34JA363Q33ZA28F39G139GJ28F393K31U9399839DT39BZ39CP3339391O39FP32KB2HY34MN39H231IY2QF28F2D731PE35VQ34QV39J931TZ39CQ395A39CV31TZ39GO39CZ1H24A39GY33ZA2HY39422HY2HY392J2D7392L2HY33TB39KB39JO33UV39JR31U928F39IJ392S39G839I439E8331T39I839ED39FB346938VC39FE39KV39FH39FJ35VP31U939FM314B323D313A38YS39GQ39L32Q22KL39KD31XA2HN24F39IL346939KO39FH39F639CN39DV33ZO39KT2HN385H39FE39LP39KY39AQ39L139CN36UQ39GL1H39LW39L739LZ39J439LB39IJ39FW353U39LR39ER39GC39GE33ZO39M733ZO34UO34OS361639LR39IW39LT2KL39G433ZO39G733S734TT31U939MH39GJ39I939LM39IB1H23N39IE39MX39C5396K39FL39CN393F313A23M39FQ1H32ID39L939FT39LC39BA39KN352E39E732F02KL23R31KI24V333939LR39IA39EF23O39IE39NQ39C523T39MJ39I539GJ38ZA39NA344435VQ39D639IJ39D639G839NS32SM2HN23V33TW353U39O639ER33Y132A2361639OC33ZO34IL39MA39LG39NF39F439FH24X39C71H39NN39MU39EF23Y39IE39OV31OU2HN39OJ353U39OX39O71H24W1H363A361639P239AL33GE39J139NW333939GX39NZ33YO2HN24Y39LF2HN39P932C035YQ39FK39LU39JD39L639FO39AM32C0355Z39M439PK1H39P239ER2531H25239P1323D2KL39PB32C02KL39L2399736UW2HN25539PY39PM31U939Q839JB39PD39CK39J434PW2HN25439PY39LH39AL39LJ39JD39LL346939LN1H25739IE39R039C539KZ39PC39L239A831OG313A39R731ER2HY39R739M239PH1H39M5361639R239FH39IX39Q9398B39IJ39MN39RI39GA39M939F239OM39PD2KL39I739CN39RJ39NO353U25639IE39S2325Z2QO2KL39RJ39IJ331039G839S439RK322A2HN39IR39S139Q639GK39L039MK39SK1H39J332C033RG31UJ28F39IX38KB39CQ39JA39JS39CN396K39CQ39JH398H323V34YB39GS1H25839KG39JQ39CL39KJ39SY33IT39JW31O638KW39JY328U39K039L739D139K539CO323V39K939JM39KC33ZA39KF2Q239JP328T39O439TB11270346939KM39RT353Z39NG39AL39KQ39RY39KS39MV25B39IE39UB39OY1H25A1H34Y5361639UD329K2KL39R4326839N239PR39L439L839L739L639RE39FU1H39LE39G839UK39AL39V039GJ24I31OP2KL37TR37WL31VL2HN24G36SJ31UJ39FY31L627G2HN34UO37DW31VP2HN24K33IT352F372834TN35VL2AW32U82HN3567348P32KP39VL39VN346939VP34J835VO27933KX39VU39MV36RG39FE39W833TQ35DU39DN39RU39E824O39OQ39QW39FA39MV24P34F72HN39WL31LC39VG1H32GI39GE39VD1H39VM397E39W0355D31U931Z639VT34XT39VW31VV39DG35I439NU2HN34LP39E539WE39FH24S39OQ35B039OT353U24T39IE39XJ39UE2B439NL3616390W3294352F2V9132V928F39NL39F934LQ353U25S39IE33CU398I39IE357W39XY34YO346931ND39Y739IE35ZC34OD346938TG27939NQ32BL39EF33JV39XP39RU39NL350M3469397H39AN39WC33DW33ZO39W639JD390439S031S4352F39YO39XR346926139WZ28F323632ID39WJ39X53469332C32MN2HN26039WM392U2C532S539DP39FH38RA39JD37AD39S03616321W39FE39ZS39P334Z139MF33ZO39ZU39ER2B4321W39ZR39GA37TV267353U39ZZ33ZO35PO25D3A0739RU34M139W632NC2HN38XB31SO352F25F32EH352F39Z534TN28F35V039Z939XZ13316H2HN38UC39C538WZ35VQ36O739J4363U39D4333931KS21P337L32H82D72HY25G32F031MU25J2AW329C2D739HO32HF2D73A1733HY3A1M32EH3A1A32HQ34I639KH32IF32A22HN21G337L359U377E373239WU3A0X31O62HY2KL3A0Z31U93A1132C03A13310W31VN2AW2193A1832943A1Q3A1C32PR31MU25L3A1G33UV3A1J33GG2D7217337L331M3A2S331M3A2F329333UV2HY32GB3A1S39T934K22HN2X335BR3A3639WZ352F325Z39ZE1H32S539YE2HN38XL39Z0346925N3A0M39Z439Z635QV3A0S35I0329K3A3G39VZ2HN3A3K32H83A0N31OM313A39CQ35KO1H39Y1342S2793A4333603A4631SX3A4631Z63A46326X3A3P39VX37BZ39WX3A3U3A3L2HN3A0O34J839B42AW3A4E3A0G3A4G33IV352F3A3V39Z33A4K3A3N326L3A4P3A3R3A4R3A3I3A4I3A3W3A3M3A0P34RR355G39QX3A4F3A3H3A0J3A3J3A4J1H3A4L38IH3A5839ZA3A503A5B34693A533A4V3A5F3A3N333F39N83A593A4Q39WW3A4S39WY39VQ361739X233RG3A3C31UV3A3F1H3A63355R39X43A3936XD33IO2HN33IF31YR39X631ZH1339VB2HN32HV39FE351039YP2HN392S361636BS39FE3A5V3A6N1H372834Y131U936E32Q93A4631KS38ZM39W639KI38SB31U933SA35QV39FH39IT328P31U93A2339QV39JV333926P363T36IV2SO34UA2AW25G3A2G31OB2D73A2J33WU26O3A2N27S31KH32EQ31OB25Y35GA326B3A8032G427S2D72B432BE27S3A8338RW33I63A8A31S43A8532IA331927S23K337L38PY326B3A8J331M3A8A31VP27S350A1N329N2D723O373233I63A8W331M24Q3A2131OB37AD3A8T33UV23S3A8X326B3A973A903A9227S37A03A952D723W3A9832A53A9H3A9B32NC27S35DL2V42D73A91322C326B3A9R329K27S31LD3A9F1H2513A9I2793AA03A9L3A9V38EC31U23A9P1H3A9U27S3A9T3A1831SO3A8F3A8731SE27S3A9U36KF3AAC3A8433UV3A8732RW27S25B3A8K33I63AAR3AA43A8Q38CX3A9Y24J3AA12753AAZ3AAV31UJ27S26S2C539GX35QN391O31MU393F31KH393F31JV393F313Q393F330C392L27S330C327D2D732BQ32483AB41H329N31UT2AV35QN34SI31ER31MU3A7B39D332Q331JV35RB313Q2D738KW31T2330C2D726X335Q31EC2D739D631T232UA2D734UO359M35IG3A5S3A7W33PC3A7O3A2Y3A8F3A7S33II37JM32EN3ACN3A7Y27S3ACP35IN2753ACZ3AAW3ABT2AX32KO3ABW31OG3ABZ2QF31KH3AC23A5731T23AC539BM37GC36FS31KH3ACL32ID3ACN34K22KL2443A1Y33I63ADP33XY2KL39PS39SR1H3AC01H3A0B39CQ325Z36ET39L61L32PU2KL21J1L32NC2D73ADY37HG39H531X432BE2D721G3AE91H26Z33I63AEI3AEA3ADX2AW33Q23AEE2HY31T23A8F34OS31T231MU2D7329C31T231KH2D726Y335Q3AC31H38S03ADE33UV33TX31ER330C39U03473330C1S3AEJ35HI3AFH32G4330C27S31VT32BE330C273337L33PJ326B3AFR331M1N3AEJ31VP330C3A8S329N27S26B337L33K732A53AG43AFW3AEJ31S43AFM39BN31UJ31EC27231UA2V4330C3AFX354S33I63AGK33IV3AGC31TL3AGE2QQ329M33QC26I337L37TF32A53AGV3AG93AFL31OB3AAO33QC26M337L3AAK32A53AH53AH03AGO3AH2380333QC2772A63A8L32A53AHF3AGM3AEJ31VL27S3ACB31KH3AHM1H39D631JV3AHQ34UO35RF31SO3AGC26832EH330C330C39Z53A6X32UA34FC2QC3A4631KW3A463A5R32ID330C35IG326B21H3AGA3AHX31OB3AFO32RW330C1F3AEJ3AFT32A53AIN32NC3AG03AGH31OB3AIR33QC326B3AIW3AGB3AHC33193AI13AEJ3AH736YC3AEJ3AIY3AIH33QC27S3AH3330C1A3AEJ3AHH325X3AJ73AIQ3AHL31LL3AHO31WH31LL3AHS3AJN31OB3AHV3AHB27S3AHZ32H83AI13A5P3AI4387A32B13AI82AW3AIA3A4O33QC3ACL34OS34Q9361J2KL25P3A1Y39W233SP33IO2KL26B34F72KL3A6T31SO35VQ39W1333933T232U839CM1H34SC2KL34YE31UJ3AKK33IT3AKN3A3Y333932MH3A413A46332X3A4632363A4C3AK335PZ3A4A2AW39MX3AKS39GJ363R3A3Q322H28F34Z639LX27439TU32ND36I4');local the_IlIIIIIlIlIIlIl=(bit or bit32);local the_IllIIIIIlIlIllIIIIlIl=the_IlIIIIIlIlIIlIl and the_IlIIIIIlIlIIlIl.bxor or function(the_IlIIIIIlIlIIlIl,the_lIIlIIlllIl)local the_IlIlIIIllIlIIIIlIIlIIIlll,the_IllIIIIIlIlIllIIIIlIl,the_IlIlllIIIlllIlIIlIl=1,0,10 while the_IlIIIIIlIlIIlIl>0 and the_lIIlIIlllIl>0 do local the_IlIlllIIIlllIlIIlIl,the_IlIlIlIlIllIIlllIIlIl=the_IlIIIIIlIlIIlIl%2,the_lIIlIIlllIl%2 if the_IlIlllIIIlllIlIIlIl~=the_IlIlIlIlIllIIlllIIlIl then the_IllIIIIIlIlIllIIIIlIl=the_IllIIIIIlIlIllIIIIlIl+the_IlIlIIIllIlIIIIlIIlIIIlll end the_IlIIIIIlIlIIlIl,the_lIIlIIlllIl,the_IlIlIIIllIlIIIIlIIlIIIlll=(the_IlIIIIIlIlIIlIl-the_IlIlllIIIlllIlIIlIl)/2,(the_lIIlIIlllIl-the_IlIlIlIlIllIIlllIIlIl)/2,the_IlIlIIIllIlIIIIlIIlIIIlll*2 end if the_IlIIIIIlIlIIlIl<the_lIIlIIlllIl then the_IlIIIIIlIlIIlIl=the_lIIlIIlllIl end while the_IlIIIIIlIlIIlIl>0 do local the_lIIlIIlllIl=the_IlIIIIIlIlIIlIl%2 if the_lIIlIIlllIl>0 then the_IllIIIIIlIlIllIIIIlIl=the_IllIIIIIlIlIllIIIIlIl+the_IlIlIIIllIlIIIIlIIlIIIlll end the_IlIIIIIlIlIIlIl,the_IlIlIIIllIlIIIIlIIlIIIlll=(the_IlIIIIIlIlIIlIl-the_lIIlIIlllIl)/2,the_IlIlIIIllIlIIIIlIIlIIIlll*2 end return the_IllIIIIIlIlIllIIIIlIl end local function the_IlIlIIIllIlIIIIlIIlIIIlll(the_lIIlIIlllIl,the_IlIIIIIlIlIIlIl,the_IlIlIIIllIlIIIIlIIlIIIlll)if the_IlIlIIIllIlIIIIlIIlIIIlll then local the_IlIIIIIlIlIIlIl=(the_lIIlIIlllIl/2^(the_IlIIIIIlIlIIlIl-1))%2^((the_IlIlIIIllIlIIIIlIIlIIIlll-1)-(the_IlIIIIIlIlIIlIl-1)+1);return the_IlIIIIIlIlIIlIl-the_IlIIIIIlIlIIlIl%1;else local the_IlIIIIIlIlIIlIl=2^(the_IlIIIIIlIlIIlIl-1);return(the_lIIlIIlllIl%(the_IlIIIIIlIlIIlIl+the_IlIIIIIlIlIIlIl)>=the_IlIIIIIlIlIIlIl)and 1 or 0;end;end;local the_IlIIIIIlIlIIlIl=1;local function the_lIIlIIlllIl()local the_IlIlIlIlIllIIlllIIlIl,the_IlIlllIIIlllIlIIlIl,the_IlIlIIIllIlIIIIlIIlIIIlll,the_lIIlIIlllIl=the_IIIIIIIlIIllllIIl(the_IIIIllIlIlIIIlIIlIlIIlI,the_IlIIIIIlIlIIlIl,the_IlIIIIIlIlIIlIl+3);the_IlIlIlIlIllIIlllIIlIl=the_IllIIIIIlIlIllIIIIlIl(the_IlIlIlIlIllIIlllIIlIl,17)the_IlIlllIIIlllIlIIlIl=the_IllIIIIIlIlIllIIIIlIl(the_IlIlllIIIlllIlIIlIl,17)the_IlIlIIIllIlIIIIlIIlIIIlll=the_IllIIIIIlIlIllIIIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,17)the_lIIlIIlllIl=the_IllIIIIIlIlIllIIIIlIl(the_lIIlIIlllIl,17)the_IlIIIIIlIlIIlIl=the_IlIIIIIlIlIIlIl+4;return(the_lIIlIIlllIl*16777216)+(the_IlIlIIIllIlIIIIlIIlIIIlll*65536)+(the_IlIlllIIIlllIlIIlIl*256)+the_IlIlIlIlIllIIlllIIlIl;end;local function the_IIlIIlIIIlllllllllIIlIII()local the_lIIlIIlllIl=the_IllIIIIIlIlIllIIIIlIl(the_IIIIIIIlIIllllIIl(the_IIIIllIlIlIIIlIIlIlIIlI,the_IlIIIIIlIlIIlIl,the_IlIIIIIlIlIIlIl),17);the_IlIIIIIlIlIIlIl=the_IlIIIIIlIlIIlIl+1;return the_lIIlIIlllIl;end;local function the_IlIllIIIIl()local the_lIIlIIlllIl,the_IlIlIIIllIlIIIIlIIlIIIlll=the_IIIIIIIlIIllllIIl(the_IIIIllIlIlIIIlIIlIlIIlI,the_IlIIIIIlIlIIlIl,the_IlIIIIIlIlIIlIl+2);the_lIIlIIlllIl=the_IllIIIIIlIlIllIIIIlIl(the_lIIlIIlllIl,17)the_IlIlIIIllIlIIIIlIIlIIIlll=the_IllIIIIIlIlIllIIIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,17)the_IlIIIIIlIlIIlIl=the_IlIIIIIlIlIIlIl+2;return(the_IlIlIIIllIlIIIIlIIlIIIlll*256)+the_lIIlIIlllIl;end;local function the_lIlllIlIIllllIIllI()local the_IlIIIIIlIlIIlIl=the_lIIlIIlllIl();local the_lIIlIIlllIl=the_lIIlIIlllIl();local the_IlIlllIIIlllIlIIlIl=1;local the_IllIIIIIlIlIllIIIIlIl=(the_IlIlIIIllIlIIIIlIIlIIIlll(the_lIIlIIlllIl,1,20)*(2^32))+the_IlIIIIIlIlIIlIl;local the_IlIIIIIlIlIIlIl=the_IlIlIIIllIlIIIIlIIlIIIlll(the_lIIlIIlllIl,21,31);local the_lIIlIIlllIl=((-1)^the_IlIlIIIllIlIIIIlIIlIIIlll(the_lIIlIIlllIl,32));if(the_IlIIIIIlIlIIlIl==0)then if(the_IllIIIIIlIlIllIIIIlIl==0)then return the_lIIlIIlllIl*0;else the_IlIIIIIlIlIIlIl=1;the_IlIlllIIIlllIlIIlIl=0;end;elseif(the_IlIIIIIlIlIIlIl==2047)then return(the_IllIIIIIlIlIllIIIIlIl==0)and(the_lIIlIIlllIl*(1/0))or(the_lIIlIIlllIl*(0/0));end;return the_lllIIIIlIIIIIlIllll(the_lIIlIIlllIl,the_IlIIIIIlIlIIlIl-1023)*(the_IlIlllIIIlllIlIIlIl+(the_IllIIIIIlIlIllIIIIlIl/(2^52)));end;local the_llIlIIIllllllllIIIlllll=the_lIIlIIlllIl;local function the_lllIIIIlIIIIIlIllll(the_lIIlIIlllIl)local the_IlIlIIIllIlIIIIlIIlIIIlll;if(not the_lIIlIIlllIl)then the_lIIlIIlllIl=the_llIlIIIllllllllIIIlllll();if(the_lIIlIIlllIl==0)then return'';end;end;the_IlIlIIIllIlIIIIlIIlIIIlll=the_IlIlllIIIlllIlIIlIl(the_IIIIllIlIlIIIlIIlIlIIlI,the_IlIIIIIlIlIIlIl,the_IlIIIIIlIlIIlIl+the_lIIlIIlllIl-1);the_IlIIIIIlIlIIlIl=the_IlIIIIIlIlIIlIl+the_lIIlIIlllIl;local the_lIIlIIlllIl={}for the_IlIIIIIlIlIIlIl=1,#the_IlIlIIIllIlIIIIlIIlIIIlll do the_lIIlIIlllIl[the_IlIIIIIlIlIIlIl]=the_IIIllIlIIIlIllIlIIIIIl(the_IllIIIIIlIlIllIIIIlIl(the_IIIIIIIlIIllllIIl(the_IlIlllIIIlllIlIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIIIIIlIlIIlIl,the_IlIIIIIlIlIIlIl)),17))end return the_lllIllIlllllI(the_lIIlIIlllIl);end;local the_IlIIIIIlIlIIlIl=the_lIIlIIlllIl;local function the_llIlIIIllllllllIIIlllll(...)return{...},the_lIlIIIllI('#',...)end local function the_IIIllIlIIIlIllIlIIIIIl()local the_IIIIllIlIlIIIlIIlIlIIlI={};local the_IllIIIIIlIlIllIIIIlIl={};local the_IlIIIIIlIlIIlIl={};local the_IIIIIIIlIIllllIIl={[#{"1 + 1 = 111";{206;820;367;884};}]=the_IllIIIIIlIlIllIIIIlIl,[#{"1 + 1 = 111";{809;227;951;787};"1 + 1 = 111";}]=nil,[#{"1 + 1 = 111";{601;132;105;835};{320;701;379;427};"1 + 1 = 111";}]=the_IlIIIIIlIlIIlIl,[#{"1 + 1 = 111";}]=the_IIIIllIlIlIIIlIIlIlIIlI,};local the_IlIIIIIlIlIIlIl=the_lIIlIIlllIl()local the_IlIlllIIIlllIlIIlIl={}for the_IlIlIIIllIlIIIIlIIlIIIlll=1,the_IlIIIIIlIlIIlIl do local the_lIIlIIlllIl=the_IIlIIlIIIlllllllllIIlIII();local the_IlIIIIIlIlIIlIl;if(the_lIIlIIlllIl==2)then the_IlIIIIIlIlIIlIl=(the_IIlIIlIIIlllllllllIIlIII()~=0);elseif(the_lIIlIIlllIl==0)then the_IlIIIIIlIlIIlIl=the_lIlllIlIIllllIIllI();elseif(the_lIIlIIlllIl==3)then the_IlIIIIIlIlIIlIl=the_lllIIIIlIIIIIlIllll();end;the_IlIlllIIIlllIlIIlIl[the_IlIlIIIllIlIIIIlIIlIIIlll]=the_IlIIIIIlIlIIlIl;end;for the_IlIIIIIlIlIIlIl=1,the_lIIlIIlllIl()do the_IllIIIIIlIlIllIIIIlIl[the_IlIIIIIlIlIIlIl-1]=the_IIIllIlIIIlIllIlIIIIIl();end;for the_IIIIIIIlIIllllIIl=1,the_lIIlIIlllIl()do local the_IlIIIIIlIlIIlIl=the_IIlIIlIIIlllllllllIIlIII();if(the_IlIlIIIllIlIIIIlIIlIIIlll(the_IlIIIIIlIlIIlIl,1,1)==0)then local the_IllIIIIIlIlIllIIIIlIl=the_IlIlIIIllIlIIIIlIIlIIIlll(the_IlIIIIIlIlIIlIl,2,3);local the_IlIlIlIlIllIIlllIIlIl=the_IlIlIIIllIlIIIIlIIlIIIlll(the_IlIIIIIlIlIIlIl,4,6);local the_IlIIIIIlIlIIlIl={the_IlIllIIIIl(),the_IlIllIIIIl(),nil,nil};if(the_IllIIIIIlIlIllIIIIlIl==0)then the_IlIIIIIlIlIIlIl[#("ymC")]=the_IlIllIIIIl();the_IlIIIIIlIlIIlIl[#("iSLa")]=the_IlIllIIIIl();elseif(the_IllIIIIIlIlIllIIIIlIl==1)then the_IlIIIIIlIlIIlIl[#("6qm")]=the_lIIlIIlllIl();elseif(the_IllIIIIIlIlIllIIIIlIl==2)then the_IlIIIIIlIlIIlIl[#("bSI")]=the_lIIlIIlllIl()-(2^16)elseif(the_IllIIIIIlIlIllIIIIlIl==3)then the_IlIIIIIlIlIIlIl[#("sHa")]=the_lIIlIIlllIl()-(2^16)the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]=the_IlIllIIIIl();end;if(the_IlIlIIIllIlIIIIlIIlIIIlll(the_IlIlIlIlIllIIlllIIlIl,1,1)==1)then the_IlIIIIIlIlIIlIl[#("k1")]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("Zi")]]end if(the_IlIlIIIllIlIIIIlIIlIIIlll(the_IlIlIlIlIllIIlllIIlIl,2,2)==1)then the_IlIIIIIlIlIIlIl[#("lSH")]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("j8N")]]end if(the_IlIlIIIllIlIIIIlIIlIIIlll(the_IlIlIlIlIllIIlllIIlIl,3,3)==1)then the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";{469;466;532;867};"1 + 1 = 111";}]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("G4K2")]]end the_IIIIllIlIlIIIlIIlIlIIlI[the_IIIIIIIlIIllllIIl]=the_IlIIIIIlIlIIlIl;end end;the_IIIIIIIlIIllllIIl[3]=the_IIlIIlIIIlllllllllIIlIII();return the_IIIIIIIlIIllllIIl;end;local function the_lIlllIlIIllllIIllI(the_IlIIIIIlIlIIlIl,the_IIIIIIIlIIllllIIl,the_IlIlllIIIlllIlIIlIl)the_IlIIIIIlIlIIlIl=(the_IlIIIIIlIlIIlIl==true and the_IIIllIlIIIlIllIlIIIIIl())or the_IlIIIIIlIlIIlIl;return(function(...)local the_IllIIIIIlIlIllIIIIlIl=the_IlIIIIIlIlIIlIl[1];local the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[3];local the_lllIIIIlIIIIIlIllll=the_IlIIIIIlIlIIlIl[2];local the_IIlIIlIIIlllllllllIIlIII=the_llIlIIIllllllllIIIlllll local the_lIIlIIlllIl=1;local the_IIIIllIlIlIIIlIIlIlIIlI=-1;local the_lIIllIlllIllIIIIIIl={};local the_llIlIIIllllllllIIIlllll={...};local the_IIIllIlIIIlIllIlIIIIIl=the_lIlIIIllI('#',...)-1;local the_lIlIIIllI={};local the_IlIlIIIllIlIIIIlIIlIIIlll={};for the_IlIIIIIlIlIIlIl=0,the_IIIllIlIIIlIllIlIIIIIl do if(the_IlIIIIIlIlIIlIl>=the_IlIllIIIIl)then the_lIIllIlllIllIIIIIIl[the_IlIIIIIlIlIIlIl-the_IlIllIIIIl]=the_llIlIIIllllllllIIIlllll[the_IlIIIIIlIlIIlIl+1];else the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl]=the_llIlIIIllllllllIIIlllll[the_IlIIIIIlIlIIlIl+#{{984;124;366;389};}];end;end;local the_IlIIIIIlIlIIlIl=the_IIIllIlIIIlIllIlIIIIIl-the_IlIllIIIIl+1 local the_IlIIIIIlIlIIlIl;local the_IlIllIIIIl;while true do the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("g")];if the_IlIllIIIIl<=#("TLFUNGSoaK8j0jKfD8d39Sv3XcRLyiBOk72jk10OhfEdK94hCRX5sfXbpL6LZg11jt93rA5LhzV4nrtYhKjQvGuej14J5oZboN4p9aZcWlX4t3Y7riDo7lFN94")then if the_IlIllIIIIl<=#("BFvQ2KUPKxdYhUg3kTBVqc6qWWKechqqfrzHBF4tKnnLotvF0ru4IiCyJe3g")then if the_IlIllIIIIl<=#("QMDfXS0uKDQYgldZvcDBfnVXxS6Zb")then if the_IlIllIIIIl<=#("vLXu3LUGBLGjpY")then if the_IlIllIIIIl<=#("fC7zIm")then if the_IlIllIIIIl<=#{"1 + 1 = 111";{524;357;11;399};}then if the_IlIllIIIIl<=#("")then local the_IIIllIlIIIlIllIlIIIIIl;local the_llIlIIIllllllllIIIlllll,the_lIlllIlIIllllIIllI;local the_lIlIIIllI;local the_IlIllIIIIl;the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("N0F")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("5D")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("3v")]]=the_IIIIIIIlIIllllIIl[the_IlIIIIIlIlIIlIl[#("Fl5")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("5j")]]=the_IIIIIIIlIIllllIIl[the_IlIIIIIlIlIIlIl[#("K75")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("61")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("9WP")]][the_IlIIIIIlIlIIlIl[#("nmjT")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("OJ")];the_lIlIIIllI=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("PL4")]];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1]=the_lIlIIIllI;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_lIlIIIllI[the_IlIIIIIlIlIIlIl[#("vQAm")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("WG")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("JAW")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Xo")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("2jM")]][the_IlIIIIIlIlIIlIl[#("FVXa")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{{429;652;78;652};"1 + 1 = 111";}]]=the_IlIIIIIlIlIIlIl[#("83k")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("nv")]]=the_IlIIIIIlIlIIlIl[#("KpG")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("j4")]]=the_IlIIIIIlIlIIlIl[#{{755;614;146;308};{842;863;145;692};"1 + 1 = 111";}];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("ju")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("WdZ")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("ro")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("LI1")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Hn")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("cPC")]][the_IlIIIIIlIlIIlIl[#("3dqx")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("dn")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("duN")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Fk")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("dtK")]][the_IlIIIIIlIlIIlIl[#("s9JA")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("DZ")]]=the_IlIIIIIlIlIIlIl[#("JVG")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("Jz")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Wc")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("WH2")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("C6")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("qKf")]][the_IlIIIIIlIlIIlIl[#("HuGT")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("oP")]]=the_IlIIIIIlIlIIlIl[#("DeF")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("0V")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("NW")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("KBK")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("1v")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("snh")]][the_IlIIIIIlIlIIlIl[#("yLCc")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("mo")]]=the_IlIIIIIlIlIIlIl[#("BMu")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("rT")]the_llIlIIIllllllllIIIlllll,the_lIlllIlIIllllIIllI=the_IIlIIlIIIlllllllllIIlIII(the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1]))the_IIIIllIlIlIIIlIIlIlIIlI=the_lIlllIlIIllllIIllI+the_IlIllIIIIl-1 the_IIIllIlIIIlIllIlIIIIIl=0;for the_IlIIIIIlIlIIlIl=the_IlIllIIIIl,the_IIIIllIlIlIIIlIIlIlIIlI do the_IIIllIlIIIlIllIlIIIIIl=the_IIIllIlIIIlIllIlIIIIIl+1;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl]=the_llIlIIIllllllllIIIlllll[the_IIIllIlIIIlIllIlIIIIIl];end;the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#{{784;652;470;808};"1 + 1 = 111";}]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IIIIllIlIlIIIlIIlIlIIlI))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("iU")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Nrb")]]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{{727;529;595;361};"1 + 1 = 111";{111;788;386;842};"1 + 1 = 111";}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("MK")]]=the_IlIIIIIlIlIIlIl[#("kXq")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("mx")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("E0")]][the_IlIIIIIlIlIIlIl[#{{32;830;295;242};"1 + 1 = 111";"1 + 1 = 111";}]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("4Whk")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("yr")]]=the_IIIIIIIlIIllllIIl[the_IlIIIIIlIlIIlIl[#("JIf")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("En")]]=the_IIIIIIIlIIllllIIl[the_IlIIIIIlIlIIlIl[#("ZhO")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("f1")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Upc")]][the_IlIIIIIlIlIIlIl[#("zRft")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("NL")];the_lIlIIIllI=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Omp")]];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1]=the_lIlIIIllI;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_lIlIIIllI[the_IlIIIIIlIlIIlIl[#("DNni")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("xx")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("lNf")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("cF")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("IPU")]][the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";{591;588;719;463};{311;507;815;200};}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("3R")]]=the_IlIIIIIlIlIIlIl[#("XE6")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Mf")]]=the_IlIIIIIlIlIIlIl[#("2GO")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Dn")]]=the_IlIIIIIlIlIIlIl[#("eOT")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("TA")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("Hvz")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("ny")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("NzQ")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("dY")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("U5x")]][the_IlIIIIIlIlIIlIl[#("ajRZ")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("UY")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("3y2")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("JP")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{{131;819;398;247};"1 + 1 = 111";{349;37;703;632};}]][the_IlIIIIIlIlIIlIl[#("4tU9")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("7G")]]=the_IlIIIIIlIlIIlIl[#("Xzl")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("dp")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("vk")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("knV")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("aL")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("L2q")]][the_IlIIIIIlIlIIlIl[#("ulQR")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("ZV")]]=the_IlIIIIIlIlIIlIl[#("DxO")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("Nb")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("qx")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("oKu")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("7A")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("8Y5")]][the_IlIIIIIlIlIIlIl[#("H2z3")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("7t")]]=the_IlIIIIIlIlIIlIl[#("gMI")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("mr")]the_llIlIIIllllllllIIIlllll,the_lIlllIlIIllllIIllI=the_IIlIIlIIIlllllllllIIlIII(the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1]))the_IIIIllIlIlIIIlIIlIlIIlI=the_lIlllIlIIllllIIllI+the_IlIllIIIIl-1 the_IIIllIlIIIlIllIlIIIIIl=0;for the_IlIIIIIlIlIIlIl=the_IlIllIIIIl,the_IIIIllIlIlIIIlIIlIlIIlI do the_IIIllIlIIIlIllIlIIIIIl=the_IIIllIlIIIlIllIlIIIIIl+1;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl]=the_llIlIIIllllllllIIIlllll[the_IIIllIlIIIlIllIlIIIIIl];end;the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("Xt")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IIIIllIlIlIIIlIIlIlIIlI))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{{210;386;553;568};{458;278;279;18};}]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("OMg")]]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("0pmm")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Vz")]]=the_IlIIIIIlIlIIlIl[#("TZf")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("8y")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("jdu")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Im")]][the_IlIIIIIlIlIIlIl[#("OCt")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Uys8")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_lIIlIIlllIl=the_IlIIIIIlIlIIlIl[#("Py2")];elseif the_IlIllIIIIl>#("1")then if the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("xn")]]then the_lIIlIIlllIl=the_lIIlIIlllIl+1;else the_lIIlIIlllIl=the_IlIIIIIlIlIIlIl[#("UbX")];end;else the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{{629;194;491;269};{495;834;378;461};}]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("ZW6")]]/the_IlIIIIIlIlIIlIl[#("sYbS")];end;elseif the_IlIllIIIIl<=#("TeWa")then if the_IlIllIIIIl>#("Mhe")then local the_IlIllIIIIl;local the_IIIIIIIlIIllllIIl;local the_IIIllIlIIIlIllIlIIIIIl,the_llIlIIIllllllllIIIlllll;local the_lIlIIIllI;local the_IlIllIIIIl;the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("Gr")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("k9")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("Dto")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{{358;74;888;933};{310;130;952;981};}]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("QqL")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("Oi")];the_lIlIIIllI=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Vvq")]];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1]=the_lIlIIIllI;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_lIlIIIllI[the_IlIIIIIlIlIIlIl[#("Vfsr")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("kn")]the_IIIllIlIIIlIllIlIIIIIl,the_llIlIIIllllllllIIIlllll=the_IIlIIlIIIlllllllllIIlIII(the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1]))the_IIIIllIlIlIIIlIIlIlIIlI=the_llIlIIIllllllllIIIlllll+the_IlIllIIIIl-1 the_IIIIIIIlIIllllIIl=0;for the_IlIIIIIlIlIIlIl=the_IlIllIIIIl,the_IIIIllIlIlIIIlIIlIlIIlI do the_IIIIIIIlIIllllIIl=the_IIIIIIIlIIllllIIl+1;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl]=the_IIIllIlIIIlIllIlIIIIIl[the_IIIIIIIlIIllllIIl];end;the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("g9")]the_IIIllIlIIIlIllIlIIIIIl={the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IIIIllIlIlIIIlIIlIlIIlI))};the_IIIIIIIlIIllllIIl=0;for the_IlIIIIIlIlIIlIl=the_IlIllIIIIl,the_IlIIIIIlIlIIlIl[#("e6fC")]do the_IIIIIIIlIIllllIIl=the_IIIIIIIlIIllllIIl+1;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl]=the_IIIllIlIIIlIllIlIIIIIl[the_IIIIIIIlIIllllIIl];end the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_lIIlIIlllIl=the_IlIIIIIlIlIIlIl[#("qHR")];else local the_IllIIIIIlIlIllIIIIlIl=the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{584;792;892;720};}];local the_IlIlIlIlIllIIlllIIlIl=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IllIIIIIlIlIllIIIIlIl+2];local the_IlIlllIIIlllIlIIlIl=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IllIIIIIlIlIllIIIIlIl]+the_IlIlIlIlIllIIlllIIlIl;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IllIIIIIlIlIllIIIIlIl]=the_IlIlllIIIlllIlIIlIl;if(the_IlIlIlIlIllIIlllIIlIl>0)then if(the_IlIlllIIIlllIlIIlIl<=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IllIIIIIlIlIllIIIIlIl+1])then the_lIIlIIlllIl=the_IlIIIIIlIlIIlIl[#("p5G")];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IllIIIIIlIlIllIIIIlIl+3]=the_IlIlllIIIlllIlIIlIl;end elseif(the_IlIlllIIIlllIlIIlIl>=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IllIIIIIlIlIllIIIIlIl+1])then the_lIIlIIlllIl=the_IlIIIIIlIlIIlIl[#("Fdn")];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IllIIIIIlIlIllIIIIlIl+3]=the_IlIlllIIIlllIlIIlIl;end end;elseif the_IlIllIIIIl>#{{506;143;651;952};"1 + 1 = 111";"1 + 1 = 111";{92;202;654;401};{710;789;156;895};}then the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("cs")]][the_IlIIIIIlIlIIlIl[#("TaU")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("r7Gt")]];else local the_IIIIllIlIlIIIlIIlIlIIlI;local the_IlIllIIIIl;the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("YOf")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("lz")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("AK")]]=the_IIIIIIIlIIllllIIl[the_IlIIIIIlIlIIlIl[#("2gO")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=the_IIIIIIIlIIllllIIl[the_IlIIIIIlIlIIlIl[#("ZVT")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("4q")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("1ug")]][the_IlIIIIIlIlIIlIl[#("vo0v")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#{{155;900;475;212};"1 + 1 = 111";}];the_IIIIllIlIlIIIlIIlIlIIlI=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("gnp")]];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1]=the_IIIIllIlIlIIIlIIlIlIIlI;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IIIIllIlIlIIIlIIlIlIIlI[the_IlIIIIIlIlIIlIl[#{{363;85;855;308};{498;246;21;444};"1 + 1 = 111";{388;771;535;617};}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("D0")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("uNm")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("bt")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("pzE")]][the_IlIIIIIlIlIIlIl[#("HaWm")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("yy")]]=the_IlIIIIIlIlIIlIl[#("gFZ")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Gp")]]=the_IlIIIIIlIlIIlIl[#("H8k")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("7g")]]=the_IlIIIIIlIlIIlIl[#("qtV")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("kE")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("20v")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("s9")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("ljQ")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("3F")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("64N")]][the_IlIIIIIlIlIIlIl[#("Gj7b")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("1i")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("VHr")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Qq")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("ClR")]][the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";{878;526;654;584};"1 + 1 = 111";}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("ox")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("MoT")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Ak")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("6eZ")]][the_IlIIIIIlIlIIlIl[#("4jVb")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{772;436;176;842};}]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("j9b")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("TX")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Cgu")]]/the_IlIIIIIlIlIIlIl[#("X18B")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{62;734;236;413};}]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("0I")]]=the_IlIIIIIlIlIIlIl[#("rTS")]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("d7QR")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("6T")]]=the_IlIIIIIlIlIIlIl[#("TuD")]-the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("YLzk")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("dB")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("gK")]]=the_IlIIIIIlIlIIlIl[#("2s4")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Wk")]]=the_IlIIIIIlIlIIlIl[#{{645;453;285;2};{377;704;882;925};"1 + 1 = 111";}];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("KS")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("cr")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("haI")]]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{{889;938;264;38};"1 + 1 = 111";{273;252;53;538};{36;920;367;629};}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("5I")]]=the_IlIIIIIlIlIIlIl[#("tX9")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("m1")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("30e")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("9K")]][the_IlIIIIIlIlIIlIl[#("lY4")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("haEq")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("IP")]]=the_IIIIIIIlIIllllIIl[the_IlIIIIIlIlIIlIl[#("DKU")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("ma")]]=the_IIIIIIIlIIllllIIl[the_IlIIIIIlIlIIlIl[#("WIC")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("sU")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("kZm")]][the_IlIIIIIlIlIIlIl[#{{933;235;263;601};"1 + 1 = 111";"1 + 1 = 111";{116;995;504;212};}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("jl")];the_IIIIllIlIlIIIlIIlIlIIlI=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("u5j")]];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1]=the_IIIIllIlIlIIIlIIlIlIIlI;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IIIIllIlIlIIIlIIlIlIIlI[the_IlIIIIIlIlIIlIl[#("MlDp")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Os")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("ISx")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("RG")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("lLX")]][the_IlIIIIIlIlIIlIl[#("PbvW")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Zj")]]=the_IlIIIIIlIlIIlIl[#("uGs")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{{398;508;722;152};"1 + 1 = 111";}]]=the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";{425;326;611;480};}];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("A5")]]=the_IlIIIIIlIlIIlIl[#("f6N")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{187;674;634;292};}]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";{936;250;652;961};}]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("te")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("I46")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("EI")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("KZM")]][the_IlIIIIIlIlIIlIl[#("IEqi")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("TK")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("Q4g")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Kr")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("CNH")]][the_IlIIIIIlIlIIlIl[#("0k6m")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("K3")]]=the_IlIIIIIlIlIIlIl[#("WX6")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#{{910;940;632;905};"1 + 1 = 111";}]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("uF")]]=the_IlIIIIIlIlIIlIl[#("oAy")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Nk")]]=the_IlIIIIIlIlIIlIl[#("auf")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("gN")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("sgL")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("9W")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("1XS")]]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Up1v")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{292;859;793;889};}]]=the_IlIIIIIlIlIIlIl[#("Osv")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("P0")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("3vx")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("ej")]][the_IlIIIIIlIlIIlIl[#("iuA")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("WxSu")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Q8")]]=the_IIIIIIIlIIllllIIl[the_IlIIIIIlIlIIlIl[#("zVp")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Qp")]]=the_IIIIIIIlIIllllIIl[the_IlIIIIIlIlIIlIl[#("tKt")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("ht")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("HbE")]][the_IlIIIIIlIlIIlIl[#("5zUJ")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("GC")];the_IIIIllIlIlIIIlIIlIlIIlI=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("UnO")]];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1]=the_IIIIllIlIlIIIlIIlIlIIlI;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IIIIllIlIlIIIlIIlIlIIlI[the_IlIIIIIlIlIIlIl[#("NiiZ")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Vf")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("sYN")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("GR")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("5qn")]][the_IlIIIIIlIlIIlIl[#("cYhy")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("By")]]=the_IlIIIIIlIlIIlIl[#("BBx")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("AU")]]=the_IlIIIIIlIlIIlIl[#("ddW")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("f9")]]=the_IlIIIIIlIlIIlIl[#("5N9")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("84")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("009")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{{250;427;602;734};{167;116;219;2};}]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("DKT")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("FO")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("ZgW")]][the_IlIIIIIlIlIIlIl[#("OUvb")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("z6")]]=the_IlIIIIIlIlIIlIl[#("RXb")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("J8")]]=the_IlIIIIIlIlIIlIl[#("RUH")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("mD")]]=the_IlIIIIIlIlIIlIl[#("HWt")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("AZ")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("mBe")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Vi")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("pXt")]]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("MlxK")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("nO")]]=the_IlIIIIIlIlIIlIl[#("ofS")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("Zq")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("Zvl")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("iK")]][the_IlIIIIIlIlIIlIl[#("IMO")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("vtgU")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Cj")]]=the_IIIIIIIlIIllllIIl[the_IlIIIIIlIlIIlIl[#("PRl")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("oH")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("bB8")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Iq")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("f1b")]][the_IlIIIIIlIlIIlIl[#("rtah")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Rh")]]=the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{643;650;974;186};{167;676;325;503};}];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("91")]]=the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Lm")]]=the_IlIIIIIlIlIIlIl[#{{768;213;443;842};"1 + 1 = 111";"1 + 1 = 111";}];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("EQ")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("fJG")]))end;elseif the_IlIllIIIIl<=#("14587hqq8B")then if the_IlIllIIIIl<=#("VtkgACTe")then if the_IlIllIIIIl>#("xZF0OQL")then local the_IIIIllIlIlIIIlIIlIlIIlI;local the_IlIllIIIIl;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Nm")]][the_IlIIIIIlIlIIlIl[#("JlK")]]=the_IlIIIIIlIlIIlIl[#("jTR1")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("4V")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("h9m")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("uP")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("pZC")]][the_IlIIIIIlIlIIlIl[#("SbgW")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("sq")]]=the_IlIIIIIlIlIIlIl[#("Yjb")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Pg")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("eO5")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("47")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("qk0")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("pMI")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("W2")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("ue")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";}]][the_IlIIIIIlIlIIlIl[#("4NM")]]=the_IlIIIIIlIlIIlIl[#("5iEo")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("yn")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("qf6")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{{559;944;970;275};"1 + 1 = 111";}]][the_IlIIIIIlIlIIlIl[#("3JW")]]=the_IlIIIIIlIlIIlIl[#("cbRg")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("fZ")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("YHn")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Nu")]][the_IlIIIIIlIlIIlIl[#("OdH")]]=the_IlIIIIIlIlIIlIl[#{{124;712;104;851};{783;380;390;573};"1 + 1 = 111";"1 + 1 = 111";}];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("rn")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("NYe")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("dy")]][the_IlIIIIIlIlIIlIl[#("vsQ")]]=the_IlIIIIIlIlIIlIl[#("sbyr")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("yt")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("Bmo")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("KR")];the_IIIIllIlIlIIIlIIlIlIIlI=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("O94")]];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1]=the_IIIIllIlIlIIIlIIlIlIIlI;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IIIIllIlIlIIIlIIlIlIIlI[the_IlIIIIIlIlIIlIl[#("SY9Y")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("vS")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Ls")]]=(the_IlIIIIIlIlIIlIl[#("Hhg")]~=0);the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("RzY")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("UF")]];else the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("E6")]]=the_IlIIIIIlIlIIlIl[#("ykE")];end;elseif the_IlIllIIIIl==#{{728;504;60;503};{291;927;634;219};{448;562;408;543};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{814;979;167;705};{711;914;290;286};}then if(the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("tv")]]~=the_IlIIIIIlIlIIlIl[#("4cEz")])then the_lIIlIIlllIl=the_lIIlIIlllIl+1;else the_lIIlIIlllIl=the_IlIIIIIlIlIIlIl[#("y5x")];end;else the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("CJ")]][the_IlIIIIIlIlIIlIl[#("dTZ")]]=the_IlIIIIIlIlIIlIl[#("KeKq")];end;elseif the_IlIllIIIIl<=#("3ICYXK00Y34v")then if the_IlIllIIIIl==#("TadobAftqHl")then do return end;else local the_IIIllIlIIIlIllIlIIIIIl;local the_llIlIIIllllllllIIIlllll,the_lIlllIlIIllllIIllI;local the_lIlIIIllI;local the_IlIllIIIIl;the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("1q")];the_lIlIIIllI=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("InI")]];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1]=the_lIlIIIllI;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_lIlIIIllI[the_IlIIIIIlIlIIlIl[#("n022")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("jE")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("ABg")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("7q")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("tgb")]][the_IlIIIIIlIlIIlIl[#("qM3f")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("la")]]=the_IlIIIIIlIlIIlIl[#("Ncf")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("aY")]]=the_IlIIIIIlIlIIlIl[#("7IU")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("YM")]]=the_IlIIIIIlIlIIlIl[#("9xa")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("gF")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("Z7h")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Z3")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("0bM")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("oY")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("kYN")]][the_IlIIIIIlIlIIlIl[#("hIH6")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("kU")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("JhI")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{637;623;710;823};}]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("rhy")]][the_IlIIIIIlIlIIlIl[#("ROZO")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("ES")]]=the_IlIIIIIlIlIIlIl[#("iPf")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("Nl")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("jO")]]=the_IlIIIIIlIlIIlIl[#("Z0p")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=the_IlIIIIIlIlIIlIl[#("9Kg")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("NE")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("mxj")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("4F")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("tL0")]]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("gjPr")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Qu")]]=the_IlIIIIIlIlIIlIl[#("EhO")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#{{197;598;973;802};{409;769;833;860};}]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("AW6")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("W5")]][the_IlIIIIIlIlIIlIl[#("9D6")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("9IsK")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("yW")]]=the_IIIIIIIlIIllllIIl[the_IlIIIIIlIlIIlIl[#("8Tb")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("O7")]]=the_IIIIIIIlIIllllIIl[the_IlIIIIIlIlIIlIl[#("2VQ")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Wh5")]][the_IlIIIIIlIlIIlIl[#("QC3S")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#{{610;517;399;750};"1 + 1 = 111";}];the_lIlIIIllI=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("RBg")]];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1]=the_lIlIIIllI;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_lIlIIIllI[the_IlIIIIIlIlIIlIl[#("DjGW")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("S7")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("8f7")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Ey")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("qfX")]][the_IlIIIIIlIlIIlIl[#("g449")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("vM")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#{{224;912;63;730};"1 + 1 = 111";{866;707;872;110};}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("iq")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{{862;683;313;569};"1 + 1 = 111";"1 + 1 = 111";}]][the_IlIIIIIlIlIIlIl[#("xGHf")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("rH")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Non")]][the_IlIIIIIlIlIIlIl[#("6o5Q")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("RT")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("v9L")]]/the_IlIIIIIlIlIIlIl[#("ekL5")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("e0")]]=the_IlIIIIIlIlIIlIl[#("51G")]+the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("TtsN")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("IV")]]=the_IlIIIIIlIlIIlIl[#("ldh")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("GX")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("QU1")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("zE")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("GoL")]][the_IlIIIIIlIlIIlIl[#("POYp")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("cZ")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("69i")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("t8")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("ZMf")]]/the_IlIIIIIlIlIIlIl[#("IhdX")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("nr")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("bA")]]=the_IlIIIIIlIlIIlIl[#("Mz7")]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("moPB")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("vp")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("nM0")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("qx")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("FzW")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("EC")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("JAZ")]][the_IlIIIIIlIlIIlIl[#("EamV")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Ab")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("j7y")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("jj")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("JL9")]][the_IlIIIIIlIlIIlIl[#("CHnv")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("87")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("NtH")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("V6")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("19S")]][the_IlIIIIIlIlIIlIl[#("rJLp")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("xf")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("VkV")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("68")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("fOV")]]/the_IlIIIIIlIlIIlIl[#("XLr1")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("nE")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("cd")]]=the_IlIIIIIlIlIIlIl[#{{505;445;425;318};{145;482;273;100};"1 + 1 = 111";}]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("SRro")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("7m")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("vp")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("Dlt")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("k5")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("jkC")]][the_IlIIIIIlIlIIlIl[#("Ykil")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("o6X")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("7j")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";{225;973;615;540};}]][the_IlIIIIIlIlIIlIl[#("ZGju")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("ko")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("fEg")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("cq")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("REO")]]/the_IlIIIIIlIlIIlIl[#{{493;571;18;747};"1 + 1 = 111";"1 + 1 = 111";{738;170;936;285};}];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("l8")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("et")]]=the_IlIIIIIlIlIIlIl[#("Oc2")]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("hBCM")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("1p")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("xy")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("mtp")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("5m")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("l25")]][the_IlIIIIIlIlIIlIl[#("9HXO")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("QN")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("aam")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("kL")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("IZd")]][the_IlIIIIIlIlIIlIl[#("L7Yp")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{{53;746;349;314};"1 + 1 = 111";}]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("xVy")]][the_IlIIIIIlIlIIlIl[#("WS7F")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("O8")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Z18")]]/the_IlIIIIIlIlIIlIl[#("qzcm")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Vc")]]=the_IlIIIIIlIlIIlIl[#("X4B")]+the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Wzqo")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("h9")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("I52")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("6V")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("s6Q")]][the_IlIIIIIlIlIIlIl[#("Qdkj")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("vq")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("RhY")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("bs")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Oy3")]][the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";{602;939;250;708};{598;621;333;382};}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("eX")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";{751;163;508;735};}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Zc")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("AYb")]]/the_IlIIIIIlIlIIlIl[#("ryFE")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("0F")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("M1")]]=the_IlIIIIIlIlIIlIl[#("OvQ")]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("1R4C")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("Cg")]the_llIlIIIllllllllIIIlllll,the_lIlllIlIIllllIIllI=the_IIlIIlIIIlllllllllIIlIII(the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1]))the_IIIIllIlIlIIIlIIlIlIIlI=the_lIlllIlIIllllIIllI+the_IlIllIIIIl-1 the_IIIllIlIIIlIllIlIIIIIl=0;for the_IlIIIIIlIlIIlIl=the_IlIllIIIIl,the_IIIIllIlIlIIIlIIlIlIIlI do the_IIIllIlIIIlIllIlIIIIIl=the_IIIllIlIIIlIllIlIIIIIl+1;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl]=the_llIlIIIllllllllIIIlllll[the_IIIllIlIIIlIllIlIIIIIl];end;the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("RB")]the_llIlIIIllllllllIIIlllll,the_lIlllIlIIllllIIllI=the_IIlIIlIIIlllllllllIIlIII(the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IIIIllIlIlIIIlIIlIlIIlI)))the_IIIIllIlIlIIIlIIlIlIIlI=the_lIlllIlIIllllIIllI+the_IlIllIIIIl-1 the_IIIllIlIIIlIllIlIIIIIl=0;for the_IlIIIIIlIlIIlIl=the_IlIllIIIIl,the_IIIIllIlIlIIIlIIlIlIIlI do the_IIIllIlIIIlIllIlIIIIIl=the_IIIllIlIIIlIllIlIIIIIl+1;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl]=the_llIlIIIllllllllIIIlllll[the_IIIllIlIIIlIllIlIIIIIl];end;the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("Kf")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IIIIllIlIlIIIlIIlIlIIlI))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Sp")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("uZ2")]]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("9jcz")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("l8")]]=the_IlIIIIIlIlIIlIl[#("C63")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("Tt")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{302;866;900;173};"1 + 1 = 111";}]))end;elseif the_IlIllIIIIl>#("tF9y2KvB80GuJ")then local the_lIlIIIllI;local the_llIlIIIllllllllIIIlllll,the_lIlllIlIIllllIIllI;local the_IIIllIlIIIlIllIlIIIIIl;local the_IlIllIIIIl;the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("jii")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Xi")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("ua")]]=the_IIIIIIIlIIllllIIl[the_IlIIIIIlIlIIlIl[#("612")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("mY")]]=the_IIIIIIIlIIllllIIl[the_IlIIIIIlIlIIlIl[#("73h")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("04")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("7JJ")]][the_IlIIIIIlIlIIlIl[#("TyoY")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("OG")];the_IIIllIlIIIlIllIlIIIIIl=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("38D")]];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1]=the_IIIllIlIIIlIllIlIIIIIl;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IIIllIlIIIlIllIlIIIIIl[the_IlIIIIIlIlIIlIl[#("KpJn")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("gF")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("quK")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("EP")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("pHe")]][the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{881;309;609;292};"1 + 1 = 111";"1 + 1 = 111";}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("KC")]]=the_IlIIIIIlIlIIlIl[#("FY6")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Dx")]]=the_IlIIIIIlIlIIlIl[#("bvS")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("1O")]]=the_IlIIIIIlIlIIlIl[#("PW7")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";}]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("Eox")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("oY")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("RGt")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("yg")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("xjk")]][the_IlIIIIIlIlIIlIl[#("Hcqn")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("LCu")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("zT")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Jra")]][the_IlIIIIIlIlIIlIl[#("34IP")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Pd")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("Xk6")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("qe")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("75u")]][the_IlIIIIIlIlIIlIl[#("eFZ8")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Wo")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("1re")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Gm")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("bRD")]]/the_IlIIIIIlIlIIlIl[#("GbVT")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("e2")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("2v")]]=the_IlIIIIIlIlIIlIl[#{{905;806;888;734};"1 + 1 = 111";"1 + 1 = 111";}]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("2a13")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("1u")]]=the_IlIIIIIlIlIIlIl[#("nmu")]-the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("bYqD")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("xA")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("zS")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("NXL")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Jj")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("b3S")]][the_IlIIIIIlIlIIlIl[#{{361;684;218;538};{766;364;896;293};{147;456;957;318};{468;613;502;866};}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("nk")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("WI9")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("cX")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("snF")]][the_IlIIIIIlIlIIlIl[#("62Z9")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("YL")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("kRa")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("KU")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{{722;828;995;583};{729;154;907;890};"1 + 1 = 111";}]]/the_IlIIIIIlIlIIlIl[#("Z0K1")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("GT")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("bt")]]=the_IlIIIIIlIlIIlIl[#("8sZ")]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("eBKW")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("CB")]]=the_IlIIIIIlIlIIlIl[#("hql")]+the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Hb51")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("DH")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("ys")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("0LG")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("c1")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("tUL")]][the_IlIIIIIlIlIIlIl[#("GlyF")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("gm")]]=the_IlIIIIIlIlIIlIl[#("KQv")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";}]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{{931;294;574;989};{199;926;691;141};}]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("RjT")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{476;139;697;781};}]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("NxJ")]][the_IlIIIIIlIlIIlIl[#("eNeP")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Kq")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("lpp")]][the_IlIIIIIlIlIIlIl[#("bX9p")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("40")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("QRL")]]/the_IlIIIIIlIlIIlIl[#("OlVl")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("ex")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("drq")]]+the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("cAal")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("ig")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("vzD")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("dU")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("SvD")]][the_IlIIIIIlIlIIlIl[#("LnF7")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("sO")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("fcF")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("PV")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("RNm")]][the_IlIIIIIlIlIIlIl[#("dh0g")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("nE")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("JfX")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Yc")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("RPz")]]/the_IlIIIIIlIlIIlIl[#("VFtM")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("Kc")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("jh")]]=the_IlIIIIIlIlIIlIl[#("v5D")]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("mV59")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("x3")]the_llIlIIIllllllllIIIlllll,the_lIlllIlIIllllIIllI=the_IIlIIlIIIlllllllllIIlIII(the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1]))the_IIIIllIlIlIIIlIIlIlIIlI=the_lIlllIlIIllllIIllI+the_IlIllIIIIl-1 the_lIlIIIllI=0;for the_IlIIIIIlIlIIlIl=the_IlIllIIIIl,the_IIIIllIlIlIIIlIIlIlIIlI do the_lIlIIIllI=the_lIlIIIllI+1;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl]=the_llIlIIIllllllllIIIlllll[the_lIlIIIllI];end;the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("YE")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IIIIllIlIlIIIlIIlIlIIlI))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("78")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("i24")]]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("qCus")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("77")]]=the_IlIIIIIlIlIIlIl[#("A0i")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";}]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("Rac")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("yQ")]][the_IlIIIIIlIlIIlIl[#("4iB")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("upUx")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("JP")]]=the_IIIIIIIlIIllllIIl[the_IlIIIIIlIlIIlIl[#("V03")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("cv")]]=the_IIIIIIIlIIllllIIl[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{182;204;885;994};"1 + 1 = 111";}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("cf")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("EGX")]][the_IlIIIIIlIlIIlIl[#("fkm2")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("qF")];the_IIIllIlIIIlIllIlIIIIIl=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("93x")]];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1]=the_IIIllIlIIIlIllIlIIIIIl;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IIIllIlIIIlIllIlIIIIIl[the_IlIIIIIlIlIIlIl[#("1hgk")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("g8")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("20r")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("vQ")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("im9")]][the_IlIIIIIlIlIIlIl[#("472d")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("yF")]]=the_IlIIIIIlIlIIlIl[#("F4h")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("cS")]]=the_IlIIIIIlIlIIlIl[#("cF0")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("op")]]=the_IlIIIIIlIlIIlIl[#("oqZ")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("CC")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("bzi")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("1m")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("T5Y")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("4L")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("cCt")]][the_IlIIIIIlIlIIlIl[#("j2jS")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("cu")]]=the_IlIIIIIlIlIIlIl[#("OpA")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("DV")]]=the_IlIIIIIlIlIIlIl[#{{71;521;875;476};"1 + 1 = 111";{611;343;390;928};}];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("PR")]]=the_IlIIIIIlIlIIlIl[#("0dI")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("j1")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("PL6")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("g9")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("PoB")]]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("qFaF")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("S9")]]=the_IlIIIIIlIlIIlIl[#("d1V")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("oG")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("S5E")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("HX")]][the_IlIIIIIlIlIIlIl[#("yfX")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("i3lg")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("pK")]]=the_IIIIIIIlIIllllIIl[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";{474;827;948;53};}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("kA")]]=the_IIIIIIIlIIllllIIl[the_IlIIIIIlIlIIlIl[#("fWT")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("8l")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";{788;187;834;322};}]][the_IlIIIIIlIlIIlIl[#("XxDA")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("Gs")];the_IIIllIlIIIlIllIlIIIIIl=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("0JR")]];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1]=the_IIIllIlIIIlIllIlIIIIIl;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IIIllIlIIIlIllIlIIIIIl[the_IlIIIIIlIlIIlIl[#("LsCZ")]];else local the_lIIlIIlllIl=the_IlIIIIIlIlIIlIl[#("t4")];do return the_IlIlIIIllIlIIIIlIIlIIIlll[the_lIIlIIlllIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_lIIlIIlllIl+1,the_IlIIIIIlIlIIlIl[#("9Yo")]))end;end;elseif the_IlIllIIIIl<=#{{52;386;770;114};{688;196;719;835};{618;12;92;50};{101;372;988;564};{828;778;241;100};"1 + 1 = 111";"1 + 1 = 111";{795;871;316;476};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{684;619;671;143};"1 + 1 = 111";"1 + 1 = 111";{918;843;66;852};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}then if the_IlIllIIIIl<=#{{703;818;29;507};"1 + 1 = 111";{73;579;676;474};"1 + 1 = 111";"1 + 1 = 111";{484;248;636;241};{978;557;519;556};{652;578;745;58};"1 + 1 = 111";{956;428;471;245};{546;323;210;375};{118;953;975;550};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{120;806;536;264};}then if the_IlIllIIIIl<=#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{317;107;537;579};{561;642;797;732};{735;536;538;812};{660;696;827;903};"1 + 1 = 111";{855;863;505;188};"1 + 1 = 111";"1 + 1 = 111";{497;407;857;128};"1 + 1 = 111";"1 + 1 = 111";}then local the_IIIIllIlIlIIIlIIlIlIIlI=the_lllIIIIlIIIIIlIllll[the_IlIIIIIlIlIIlIl[#("aLU")]];local the_IlIllIIIIl;local the_IlIlIlIlIllIIlllIIlIl={};the_IlIllIIIIl=the_lIIlIIllIlllII({},{__index=function(the_lIIlIIlllIl,the_IlIIIIIlIlIIlIl)local the_IlIIIIIlIlIIlIl=the_IlIlIlIlIllIIlllIIlIl[the_IlIIIIIlIlIIlIl];return the_IlIIIIIlIlIIlIl[1][the_IlIIIIIlIlIIlIl[2]];end,__newindex=function(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIIIIIlIlIIlIl,the_lIIlIIlllIl)local the_IlIIIIIlIlIIlIl=the_IlIlIlIlIllIIlllIIlIl[the_IlIIIIIlIlIIlIl]the_IlIIIIIlIlIIlIl[1][the_IlIIIIIlIlIIlIl[2]]=the_lIIlIIlllIl;end;});for the_IlIlllIIIlllIlIIlIl=1,the_IlIIIIIlIlIIlIl[#("eOUl")]do the_lIIlIIlllIl=the_lIIlIIlllIl+1;local the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];if the_IlIIIIIlIlIIlIl[#{{129;32;696;584};}]==193 then the_IlIlIlIlIllIIlllIIlIl[the_IlIlllIIIlllIlIIlIl-1]={the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIIIIIlIlIIlIl[#("E6v")]};else the_IlIlIlIlIllIIlllIIlIl[the_IlIlllIIIlllIlIIlIl-1]={the_IIIIIIIlIIllllIIl,the_IlIIIIIlIlIIlIl[#("UWk")]};end;the_lIlIIIllI[#the_lIlIIIllI+1]=the_IlIlIlIlIllIIlllIIlIl;end;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Vy")]]=the_lIlllIlIIllllIIllI(the_IIIIllIlIlIIIlIIlIlIIlI,the_IlIllIIIIl,the_IlIlllIIIlllIlIIlIl);elseif the_IlIllIIIIl>#("hu7yMz8r9LHJ0VNo")then the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{92;12;846;558};}]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("qF9")]]+the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("tJrK")]];else local the_IlIllIIIIl;local the_IIIIIIIlIIllllIIl;local the_IIIllIlIIIlIllIlIIIIIl,the_llIlIIIllllllllIIIlllll;local the_lIlIIIllI;local the_IlIllIIIIl;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Iv")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("Rj4")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("3i")];the_lIlIIIllI=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("GAB")]];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1]=the_lIlIIIllI;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_lIlIIIllI[the_IlIIIIIlIlIIlIl[#("Dgce")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("kQ")]the_IIIllIlIIIlIllIlIIIIIl,the_llIlIIIllllllllIIIlllll=the_IIlIIlIIIlllllllllIIlIII(the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1]))the_IIIIllIlIlIIIlIIlIlIIlI=the_llIlIIIllllllllIIIlllll+the_IlIllIIIIl-1 the_IIIIIIIlIIllllIIl=0;for the_IlIIIIIlIlIIlIl=the_IlIllIIIIl,the_IIIIllIlIlIIIlIIlIlIIlI do the_IIIIIIIlIIllllIIl=the_IIIIIIIlIIllllIIl+1;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl]=the_IIIllIlIIIlIllIlIIIIIl[the_IIIIIIIlIIllllIIl];end;the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";}]the_IIIllIlIIIlIllIlIIIIIl={the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IIIIllIlIlIIIlIIlIlIIlI))};the_IIIIIIIlIIllllIIl=0;for the_IlIIIIIlIlIIlIl=the_IlIllIIIIl,the_IlIIIIIlIlIIlIl[#("LkSG")]do the_IIIIIIIlIIllllIIl=the_IIIIIIIlIIllllIIl+1;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl]=the_IIIllIlIIIlIllIlIIIIIl[the_IIIIIIIlIIllllIIl];end the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_lIIlIIlllIl=the_IlIIIIIlIlIIlIl[#("lXM")];end;elseif the_IlIllIIIIl<=#("o5aVvzoqJvbR9OsBP9l")then if the_IlIllIIIIl>#("CA3FbGDjDiXm8t0BIe")then local the_IIIllIlIIIlIllIlIIIIIl;local the_lIlIIIllI;local the_llIlIIIllllllllIIIlllll,the_lIlllIlIIllllIIllI;local the_IlIllIIIIl;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Bm")]]=the_IlIIIIIlIlIIlIl[#("nun")]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("86ac")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("UF")]the_llIlIIIllllllllIIIlllll,the_lIlllIlIIllllIIllI=the_IIlIIlIIIlllllllllIIlIII(the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1]))the_IIIIllIlIlIIIlIIlIlIIlI=the_lIlllIlIIllllIIllI+the_IlIllIIIIl-1 the_lIlIIIllI=0;for the_IlIIIIIlIlIIlIl=the_IlIllIIIIl,the_IIIIllIlIlIIIlIIlIlIIlI do the_lIlIIIllI=the_lIlIIIllI+1;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl]=the_llIlIIIllllllllIIIlllll[the_lIlIIIllI];end;the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("kk")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IIIIllIlIlIIIlIIlIlIIlI))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("LK")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("18c")]]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{877;18;84;42};}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("zz")]]=the_IlIIIIIlIlIIlIl[#("Jgr")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";}]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("BXr")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("6m")]][the_IlIIIIIlIlIIlIl[#("g5R")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("1Aug")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("SS")]]=the_IIIIIIIlIIllllIIl[the_IlIIIIIlIlIIlIl[#("JvC")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("lq")]]=the_IIIIIIIlIIllllIIl[the_IlIIIIIlIlIIlIl[#("4vs")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("fY")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("k6M")]][the_IlIIIIIlIlIIlIl[#("MVYT")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("sa")];the_IIIllIlIIIlIllIlIIIIIl=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("tmR")]];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1]=the_IIIllIlIIIlIllIlIIIIIl;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IIIllIlIIIlIllIlIIIIIl[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Y2")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("JK2")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Ia")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("DbW")]][the_IlIIIIIlIlIIlIl[#("Quza")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Ui")]]=the_IlIIIIIlIlIIlIl[#("1UC")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("S7")]]=the_IlIIIIIlIlIIlIl[#("h6R")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("VF")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("fqK")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("hS")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("2yP")]][the_IlIIIIIlIlIIlIl[#("AK5k")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("6J")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("PCY")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("ZT")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("EL0")]]/the_IlIIIIIlIlIIlIl[#("iOSj")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("6I")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("ae")]]=-the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("f35")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("jr")]]=the_IlIIIIIlIlIIlIl[#("cA3")]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("0guD")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("4K")]]=the_IlIIIIIlIlIIlIl[#("J18")]+the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("cW50")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("x4")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("3LD")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("pm")]]=the_IlIIIIIlIlIIlIl[#("pvL")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#{{308;240;750;489};{376;968;650;106};}]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{900;357;339;119};"1 + 1 = 111";}]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("DB")]][the_IlIIIIIlIlIIlIl[#("5xM")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("0v8E")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("G8")]]=the_IIIIIIIlIIllllIIl[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";{198;457;631;934};}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=the_IIIIIIIlIIllllIIl[the_IlIIIIIlIlIIlIl[#("4oM")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("D8")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("aln")]][the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("mL")];the_IIIllIlIIIlIllIlIIIIIl=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("ycs")]];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1]=the_IIIllIlIIIlIllIlIIIIIl;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IIIllIlIIIlIllIlIIIIIl[the_IlIIIIIlIlIIlIl[#("meDC")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("PT")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{{941;163;83;399};"1 + 1 = 111";"1 + 1 = 111";}]][the_IlIIIIIlIlIIlIl[#("qFjD")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("l1")]]=the_IlIIIIIlIlIIlIl[#("aXL")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("oU")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("xUK")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("VR")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("X1t")]][the_IlIIIIIlIlIIlIl[#{{861;25;484;104};{666;264;812;720};"1 + 1 = 111";"1 + 1 = 111";}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("pb")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("WTp")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("UE")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("8on")]]/the_IlIIIIIlIlIIlIl[#("DriH")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("BE")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{468;93;205;881};}]]=the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{956;821;805;177};"1 + 1 = 111";}]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("4zJl")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("jB")]]=the_IlIIIIIlIlIIlIl[#("FFW")]+the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("dMCg")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("vk")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("UIc")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("9K")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("X6p")]][the_IlIIIIIlIlIIlIl[#("XcvZ")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("ap")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("Nu2")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("er")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("LJ2")]]/the_IlIIIIIlIlIIlIl[#{{725;980;824;623};"1 + 1 = 111";{63;601;297;291};{522;56;19;327};}];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("2r")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("rI")]]=-the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("S4p")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("dn")]]=the_IlIIIIIlIlIIlIl[#("o7f")]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("IMDU")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("AC")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("vsb")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("uo")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{111;981;724;176};{527;821;515;436};}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("7r")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("7j5")]][the_IlIIIIIlIlIIlIl[#("XREq")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Uc")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("ZRM")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("s2")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Djb")]][the_IlIIIIIlIlIIlIl[#("emeT")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("EV")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("x7D")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("4o")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("ch1")]][the_IlIIIIIlIlIIlIl[#("YFqW")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("sQ")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("phl")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("II")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Csr")]]/the_IlIIIIIlIlIIlIl[#("Oddk")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("18")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("pf")]]=the_IlIIIIIlIlIIlIl[#("5k7")]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("5RZE")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("O6")]]=the_IlIIIIIlIlIIlIl[#("Jar")]+the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Zzx6")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("lO")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("oc")]]=the_IlIIIIIlIlIIlIl[#("ONR")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Tt")]]=the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("iK")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#{{415;299;491;857};"1 + 1 = 111";"1 + 1 = 111";}]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("PY")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("0Dd")]]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{426;740;379;136};{461;52;280;416};"1 + 1 = 111";}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Ij")]]=the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("lh")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("7iX")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("4W")]][the_IlIIIIIlIlIIlIl[#("zi3")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("vhkF")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("cg")]]=the_IIIIIIIlIIllllIIl[the_IlIIIIIlIlIIlIl[#("lAf")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("yF")]]=the_IIIIIIIlIIllllIIl[the_IlIIIIIlIlIIlIl[#("Pb4")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("mO")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("BZt")]][the_IlIIIIIlIlIIlIl[#("L8My")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("2r")];the_IIIllIlIIIlIllIlIIIIIl=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("4g1")]];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1]=the_IIIllIlIIIlIllIlIIIIIl;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IIIllIlIIIlIllIlIIIIIl[the_IlIIIIIlIlIIlIl[#("pxgg")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("WP")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#{{184;647;983;665};{591;876;220;980};"1 + 1 = 111";}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("YJ")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("h5C")]][the_IlIIIIIlIlIIlIl[#("EIsC")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("7z")]]=the_IlIIIIIlIlIIlIl[#("yCE")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Wm")]]=the_IlIIIIIlIlIIlIl[#("ZkM")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("GR")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("H33")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("oC")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("xaS")]][the_IlIIIIIlIlIIlIl[#("f290")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("5r")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("JOL")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Pm")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("0W5")]]/the_IlIIIIIlIlIIlIl[#("QZhN")];else local the_IlIlllIIIlllIlIIlIl=the_IlIIIIIlIlIIlIl[#("Ou")];local the_IlIlIlIlIllIIlllIIlIl=the_IlIIIIIlIlIIlIl[#("1Q44")];local the_IllIIIIIlIlIllIIIIlIl=the_IlIlllIIIlllIlIIlIl+2 local the_IlIlllIIIlllIlIIlIl={the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIlllIIIlllIlIIlIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIlllIIIlllIlIIlIl+1],the_IlIlIIIllIlIIIIlIIlIIIlll[the_IllIIIIIlIlIllIIIIlIl])};for the_IlIIIIIlIlIIlIl=1,the_IlIlIlIlIllIIlllIIlIl do the_IlIlIIIllIlIIIIlIIlIIIlll[the_IllIIIIIlIlIllIIIIlIl+the_IlIIIIIlIlIIlIl]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl];end;local the_IlIlllIIIlllIlIIlIl=the_IlIlllIIIlllIlIIlIl[1]if the_IlIlllIIIlllIlIIlIl then the_IlIlIIIllIlIIIIlIIlIIIlll[the_IllIIIIIlIlIllIIIIlIl]=the_IlIlllIIIlllIlIIlIl the_lIIlIIlllIl=the_IlIIIIIlIlIIlIl[#("qXK")];else the_lIIlIIlllIl=the_lIIlIIlllIl+1;end;end;elseif the_IlIllIIIIl>#("6Sgcc6L96nhlWBXTZbFT")then local the_IlIllIIIIl;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("s6")]][the_IlIIIIIlIlIIlIl[#("FCl")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("H2I7")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("EX")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("8R7")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("PW")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("IzK")]][the_IlIIIIIlIlIIlIl[#("7eCq")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Wy")]]=the_IlIIIIIlIlIIlIl[#("mks")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("B7")]]=the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Rp")]]=the_IlIIIIIlIlIIlIl[#("kY3")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("j2")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("uhI")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("a8")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("GMo")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("h6")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{224;888;592;930};"1 + 1 = 111";}]][the_IlIIIIIlIlIIlIl[#("Crpa")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{518;531;70;829};}]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#{{243;391;86;21};"1 + 1 = 111";"1 + 1 = 111";}]];else local the_IlIIIIIlIlIIlIl=the_IlIIIIIlIlIIlIl[#("pj")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIIIIIlIlIIlIl+1,the_IIIIllIlIlIIIlIIlIlIIlI))end;elseif the_IlIllIIIIl<=#("5fYAIZSQY23LnpTux0IAGG5u7")then if the_IlIllIIIIl<=#{{631;862;288;617};"1 + 1 = 111";"1 + 1 = 111";{74;861;765;955};"1 + 1 = 111";{800;715;683;643};"1 + 1 = 111";{528;663;40;49};{518;563;89;566};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{454;738;909;648};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{184;614;748;609};}then if the_IlIllIIIIl==#("Ck6ttAjDCHdIfXD0pspfbT")then the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("dFr")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("HP")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("ds")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("dug")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("P0")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("E4P")]][the_IlIIIIIlIlIIlIl[#("TOyB")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("CC")]]={};the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";}]][the_IlIIIIIlIlIIlIl[#("jPu")]]=the_IlIIIIIlIlIIlIl[#("EhuT")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("E7")]][the_IlIIIIIlIlIIlIl[#("JS5")]]=the_IlIIIIIlIlIIlIl[#("V09p")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("dF")]]={};the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("ar")]][the_IlIIIIIlIlIIlIl[#("ivS")]]=the_IlIIIIIlIlIIlIl[#("KDmY")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Sv")]][the_IlIIIIIlIlIIlIl[#("kIP")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("L9uU")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("FA")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("Hot")]];else local the_IlIllIIIIl,the_lIlllIlIIllllIIllI;local the_IIIllIlIIIlIllIlIIIIIl;local the_lIlIIIllI;local the_llIlIIIllllllllIIIlllll;local the_IlIllIIIIl;the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("bH")];the_llIlIIIllllllllIIIlllll=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Y71")]];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1]=the_llIlIIIllllllllIIIlllll;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_llIlIIIllllllllIIIlllll[the_IlIIIIIlIlIIlIl[#("bATP")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("t3")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("HTA")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("4O")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("a2h")]][the_IlIIIIIlIlIIlIl[#("yKgc")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("EE")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("6s2")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{{741;981;509;488};"1 + 1 = 111";}]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("W7G")]][the_IlIIIIIlIlIIlIl[#("nrDi")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("i0")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("RRH")]][the_IlIIIIIlIlIIlIl[#("zIZB")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("RV")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("Wv9")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Gm")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Qai")]][the_IlIIIIIlIlIIlIl[#("gfm5")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("VH")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Lfh")]][the_IlIIIIIlIlIIlIl[#("9fCL")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("Fu")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("XOj")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Jj")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("r5Z")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("oA")]]=(the_IlIIIIIlIlIIlIl[#("ng8")]~=0);the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Z7")]]=(the_IlIIIIIlIlIIlIl[#("QTt")]~=0);the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("bK")]the_lIlIIIllI={the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("St2")]))};the_IIIllIlIIIlIllIlIIIIIl=0;for the_IlIIIIIlIlIIlIl=the_IlIllIIIIl,the_IlIIIIIlIlIIlIl[#("UsOE")]do the_IIIllIlIIIlIllIlIIIIIl=the_IIIllIlIIIlIllIlIIIIIl+1;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl]=the_lIlIIIllI[the_IIIllIlIIIlIllIlIIIIIl];end the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("aJ")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("Bk3")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{173;62;401;267};}]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("T4t")]][the_IlIIIIIlIlIIlIl[#("dzQA")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("CK")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{{95;983;815;905};{280;333;869;653};{15;361;760;531};}]][the_IlIIIIIlIlIIlIl[#("lT60")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("zY")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("kQh")]]-the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("r9e9")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("HG")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("YQS")]][the_IlIIIIIlIlIIlIl[#{{179;708;644;555};"1 + 1 = 111";{314;201;343;1};{212;978;212;608};}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("2qD")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("KI")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("5z")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("xhZ")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("94")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("QJH")]][the_IlIIIIIlIlIIlIl[#("5nXd")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("LP")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("nbV")]][the_IlIIIIIlIlIIlIl[#("shGc")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Ls")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("U8f")]][the_IlIIIIIlIlIIlIl[#("4O9y")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("0P")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("MYG")]]-the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("92zr")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("fhQ")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("YF")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Os")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("LmU")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("Pd")];the_llIlIIIllllllllIIIlllll=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{620;913;389;19};"1 + 1 = 111";}]];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1]=the_llIlIIIllllllllIIIlllll;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_llIlIIIllllllllIIIlllll[the_IlIIIIIlIlIIlIl[#("xivY")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Ck")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("RnY")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("VS")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("fxt")]][the_IlIIIIIlIlIIlIl[#("9bCK")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Kp")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("vTN")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("ng")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("5Fy")]][the_IlIIIIIlIlIIlIl[#("JA0N")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("bb")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Kuk")]][the_IlIIIIIlIlIIlIl[#("ZMMf")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Q1")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#{{309;40;212;114};"1 + 1 = 111";"1 + 1 = 111";}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("J0")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("BZv")]][the_IlIIIIIlIlIIlIl[#("dn4l")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("MI")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("YEQ")]][the_IlIIIIIlIlIIlIl[#("O9Ro")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("FS")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("XL5")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{{857;800;754;954};{76;968;576;990};}]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("jEr")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("6q")]]=(the_IlIIIIIlIlIIlIl[#("Fv9")]~=0);the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("II")]]=(the_IlIIIIIlIlIIlIl[#("EHe")]~=0);the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("8Z")]the_lIlIIIllI={the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#{{95;514;417;784};{360;576;632;155};"1 + 1 = 111";}]))};the_IIIllIlIIIlIllIlIIIIIl=0;for the_IlIIIIIlIlIIlIl=the_IlIllIIIIl,the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{929;236;428;420};"1 + 1 = 111";{901;342;631;760};}]do the_IIIllIlIIIlIllIlIIIIIl=the_IIIllIlIIIlIllIlIIIIIl+1;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl]=the_lIlIIIllI[the_IIIllIlIIIlIllIlIIIIIl];end the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("ob")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("5jA")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("NJk")]][the_IlIIIIIlIlIIlIl[#("W28U")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("9X")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("a0v")]][the_IlIIIIIlIlIIlIl[#("rQ6g")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("88")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("cGv")]]-the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("FXxI")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("af")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("J0Q")]][the_IlIIIIIlIlIIlIl[#("xptC")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#{{398;301;337;701};{834;42;993;188};"1 + 1 = 111";}]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("D0")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("mq")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("inV")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("32")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("VqP")]][the_IlIIIIIlIlIIlIl[#("jokM")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("jr")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("bAm")]][the_IlIIIIIlIlIIlIl[#("9tnI")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("0E")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("lx3")]][the_IlIIIIIlIlIIlIl[#("XYXi")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("3R")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("tbo")]]-the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{{362;416;370;400};"1 + 1 = 111";{743;886;530;30};{644;126;960;998};}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("ait")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("og")]]=the_IIIIIIIlIIllllIIl[the_IlIIIIIlIlIIlIl[#("lUH")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("KF")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("oxm")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("HT")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("LbB")]][the_IlIIIIIlIlIIlIl[#("yqXe")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Y6")]]=the_IlIIIIIlIlIIlIl[#("YpF")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("ie")]]=the_IlIIIIIlIlIIlIl[#("lCZ")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("hV")]]=the_IlIIIIIlIlIIlIl[#("sSi")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("8v")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("6eW")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Sv")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#{{550;37;771;188};{831;129;537;710};"1 + 1 = 111";}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Sj")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{{684;736;81;742};{30;339;890;375};{177;148;68;46};}]][the_IlIIIIIlIlIIlIl[#("0Nis")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("9f")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#{{451;241;133;906};{968;485;291;962};"1 + 1 = 111";}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("AH")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("nnc")]][the_IlIIIIIlIlIIlIl[#("4Djx")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("yo")]]=the_IlIIIIIlIlIIlIl[#("5FX")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("RM")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("ev")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("xv")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("sRQ")]][the_IlIIIIIlIlIIlIl[#("IRvf")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("PR")]]=the_IlIIIIIlIlIIlIl[#("Mtb")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("WW")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("DF")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("Lks")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("QH")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("NBF")]][the_IlIIIIIlIlIIlIl[#("7Cyu")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("K2")]]=the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";{720;749;886;30};}];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("MI")]the_lIlIIIllI,the_lIlllIlIIllllIIllI=the_IIlIIlIIIlllllllllIIlIII(the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1]))the_IIIIllIlIlIIIlIIlIlIIlI=the_lIlllIlIIllllIIllI+the_IlIllIIIIl-1 the_IIIllIlIIIlIllIlIIIIIl=0;for the_IlIIIIIlIlIIlIl=the_IlIllIIIIl,the_IIIIllIlIlIIIlIIlIlIIlI do the_IIIllIlIIIlIllIlIIIIIl=the_IIIllIlIIIlIllIlIIIIIl+1;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl]=the_lIlIIIllI[the_IIIllIlIIIlIllIlIIIIIl];end;the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("Ry")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IIIIllIlIlIIIlIIlIlIIlI))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("zV")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("WkA")]]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("RanG")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("8B")]][the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{354;893;863;420};"1 + 1 = 111";}]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("TzI3")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Y3")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("rSG")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("9u")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("CZR")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{{616;329;192;616};{832;555;568;137};}]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("gpz")]][the_IlIIIIIlIlIIlIl[#("2Bf5")]];end;elseif the_IlIllIIIIl==#("BHlxKgyDKflJogbLKD0l6duo")then local the_IlIllIIIIl;local the_IIIIIIIlIIllllIIl;local the_IIIllIlIIIlIllIlIIIIIl,the_llIlIIIllllllllIIIlllll;local the_lIlIIIllI;local the_IlIllIIIIl;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("4n")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("PFe")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("u6")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#{{283;861;527;843};"1 + 1 = 111";"1 + 1 = 111";}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#{{664;535;641;71};{533;1;726;96};}];the_lIlIIIllI=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("9WH")]];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1]=the_lIlIIIllI;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_lIlIIIllI[the_IlIIIIIlIlIIlIl[#("xl43")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("8g")]the_IIIllIlIIIlIllIlIIIIIl,the_llIlIIIllllllllIIIlllll=the_IIlIIlIIIlllllllllIIlIII(the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1]))the_IIIIllIlIlIIIlIIlIlIIlI=the_llIlIIIllllllllIIIlllll+the_IlIllIIIIl-1 the_IIIIIIIlIIllllIIl=0;for the_IlIIIIIlIlIIlIl=the_IlIllIIIIl,the_IIIIllIlIlIIIlIIlIlIIlI do the_IIIIIIIlIIllllIIl=the_IIIIIIIlIIllllIIl+1;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl]=the_IIIllIlIIIlIllIlIIIIIl[the_IIIIIIIlIIllllIIl];end;the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("zC")]the_IIIllIlIIIlIllIlIIIIIl={the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IIIIllIlIlIIIlIIlIlIIlI))};the_IIIIIIIlIIllllIIl=0;for the_IlIIIIIlIlIIlIl=the_IlIllIIIIl,the_IlIIIIIlIlIIlIl[#("tOBY")]do the_IIIIIIIlIIllllIIl=the_IIIIIIIlIIllllIIl+1;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl]=the_IIIllIlIIIlIllIlIIIIIl[the_IIIIIIIlIIllllIIl];end the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_lIIlIIlllIl=the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{353;944;479;702};{632;515;774;787};}];else if(the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("GQ")]]<the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("prWB")]])then the_lIIlIIlllIl=the_lIIlIIlllIl+1;else the_lIIlIIlllIl=the_IlIIIIIlIlIIlIl[#("rLY")];end;end;elseif the_IlIllIIIIl<=#("3zup58xTYGWhcKveeEC3noToRPN")then if the_IlIllIIIIl==#("IAxm7bRSdmOgZ0ALpEH3Eg2K2v")then local the_IlIllIIIIl;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("7p")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("cJ2")]][the_IlIIIIIlIlIIlIl[#("63DV")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("JX")]]=the_IlIIIIIlIlIIlIl[#("Oin")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("WP")]]=the_IlIIIIIlIlIIlIl[#("Ts4")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("8Q")]]=the_IlIIIIIlIlIIlIl[#("gK0")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("UL")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("fxk")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("4S")]][the_IlIIIIIlIlIIlIl[#("BWD")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("ZANv")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("uv")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("lEP")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("xM")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("cJ5")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{467;25;306;413};}]]=the_IlIIIIIlIlIIlIl[#("CUx")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("zz")]][the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]]=the_IlIIIIIlIlIIlIl[#("G4pd")];else the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("lE")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("iTV")]];end;elseif the_IlIllIIIIl==#("PPfJpvkkziJkb3Ob2ZudyYi9niTR")then local the_IIIIIIIlIIllllIIl;local the_IIIllIlIIIlIllIlIIIIIl,the_lIlIIIllI;local the_IlIllIIIIl;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("db")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("1p5")]][the_IlIIIIIlIlIIlIl[#("gMAq")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Fu")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("iFc")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("7I")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("AGm")]]/the_IlIIIIIlIlIIlIl[#("VHED")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("BY")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=the_IlIIIIIlIlIIlIl[#("gxR")]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("dKzb")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("5F")]]=the_IlIIIIIlIlIIlIl[#("DVV")]+the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("BMhr")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("El")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("yzZ")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("GL")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("mVP")]][the_IlIIIIIlIlIIlIl[#("98t6")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("3B")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("8zj")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("by")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("aXO")]]/the_IlIIIIIlIlIIlIl[#("6JJ8")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("jX")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("IR")]]=the_IlIIIIIlIlIIlIl[#("JUu")]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Ayxv")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("bz")]]=the_IlIIIIIlIlIIlIl[#("H9f")]+the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("O1FD")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("4x")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("Ig8")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("j5")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("Fns")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("bM")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("7Ls")]][the_IlIIIIIlIlIIlIl[#("zz9W")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("YD")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("AKS")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("SR")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("0i6")]][the_IlIIIIIlIlIIlIl[#("paLO")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("tI")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("jM")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("SUL")]][the_IlIIIIIlIlIIlIl[#("3X8R")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("N6")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("AnN")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("br")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("s4X")]]/the_IlIIIIIlIlIIlIl[#("irEr")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#{{782;254;703;883};{621;455;952;198};}]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("64")]]=the_IlIIIIIlIlIIlIl[#("WAz")]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{154;156;353;906};"1 + 1 = 111";"1 + 1 = 111";}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=the_IlIIIIIlIlIIlIl[#("gVV")]+the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("PncN")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("Hv")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("01")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("FmH")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("9n")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("b7R")]][the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("vB")]]=the_IlIIIIIlIlIIlIl[#("ceJ")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#{{28;750;234;469};"1 + 1 = 111";}]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("h1")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#{{222;976;602;771};{386;197;487;758};"1 + 1 = 111";}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Eq")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("NK8")]][the_IlIIIIIlIlIIlIl[#("K8Ia")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Nh")]]=the_IlIIIIIlIlIIlIl[#("84i")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("Wm")]the_IIIllIlIIIlIllIlIIIIIl,the_lIlIIIllI=the_IIlIIlIIIlllllllllIIlIII(the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1]))the_IIIIllIlIlIIIlIIlIlIIlI=the_lIlIIIllI+the_IlIllIIIIl-1 the_IIIIIIIlIIllllIIl=0;for the_IlIIIIIlIlIIlIl=the_IlIllIIIIl,the_IIIIllIlIlIIIlIIlIlIIlI do the_IIIIIIIlIIllllIIl=the_IIIIIIIlIIllllIIl+1;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl]=the_IIIllIlIIIlIllIlIIIIIl[the_IIIIIIIlIIllllIIl];end;the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("q1")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IIIIllIlIlIIIlIIlIlIIlI))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Yv")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("WMM")]]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("674E")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("EW")]]=the_IlIIIIIlIlIIlIl[#("Tm4")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("Ws")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("T0Y")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("eN")]][the_IlIIIIIlIlIIlIl[#("nMR")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("NAP3")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_lIIlIIlllIl=the_IlIIIIIlIlIIlIl[#("Gou")];else do return the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("qP")]]end end;elseif the_IlIllIIIIl<=#("IXuL3bd7NzVOPbCQsGa0f9VHsT0GgvhNET1voKh1LdoB")then if the_IlIllIIIIl<=#("zTXRs4MT0vIcXsjlH0qqhk5jgCTyipbVt63a")then if the_IlIllIIIIl<=#{{523;844;583;540};{417;689;783;839};"1 + 1 = 111";"1 + 1 = 111";{807;426;758;940};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{909;880;632;249};{716;404;809;914};{683;273;677;847};"1 + 1 = 111";{851;1;532;1};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{26;589;183;599};"1 + 1 = 111";"1 + 1 = 111";{771;250;62;453};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{312;117;739;177};{702;569;36;103};{596;346;971;647};"1 + 1 = 111";}then if the_IlIllIIIIl<=#("iSdZVnHI0XaCAElYXjEPmzo5pptbdH")then local the_IIIIIIIlIIllllIIl;local the_IIIllIlIIIlIllIlIIIIIl,the_lIlIIIllI;local the_IlIllIIIIl;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("56")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("vTp")]][the_IlIIIIIlIlIIlIl[#("vymC")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("vY")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#{{287;710;120;945};"1 + 1 = 111";"1 + 1 = 111";}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{388;305;29;380};}]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("XbB")]]/the_IlIIIIIlIlIIlIl[#("B32m")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("y4")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("be")]]=the_IlIIIIIlIlIIlIl[#("dbm")]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("c77L")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("lT")]]=the_IlIIIIIlIlIIlIl[#("vqP")]+the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("XiGT")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("vI")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("k7u")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{{195;967;618;476};"1 + 1 = 111";}]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{{174;456;467;926};{551;447;829;291};"1 + 1 = 111";}]][the_IlIIIIIlIlIIlIl[#("kUEJ")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("8v")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#{{713;469;67;676};"1 + 1 = 111";"1 + 1 = 111";}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("dA")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("J4j")]]/the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{226;683;134;810};{936;674;201;795};{556;871;356;110};}];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("Sx")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("X0")]]=the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("pIjy")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("35")]]=the_IlIIIIIlIlIIlIl[#{{878;948;221;920};"1 + 1 = 111";{351;454;40;905};}]+the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("l3mY")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";}]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("znD")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Xg")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("Arg")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("7U")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("JFd")]][the_IlIIIIIlIlIIlIl[#("RfuT")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("e2")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("zno")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("x4")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("ggN")]][the_IlIIIIIlIlIIlIl[#("89tJ")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("V5")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("YRb")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("sy")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("1jd")]][the_IlIIIIIlIlIIlIl[#("E36b")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Fo")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("SKU")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("QQ")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("iNN")]]/the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{889;360;626;264};"1 + 1 = 111";"1 + 1 = 111";}];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("Wo")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Ar")]]=the_IlIIIIIlIlIIlIl[#("JuL")]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("x1lq")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("s1")]]=the_IlIIIIIlIlIIlIl[#("z8k")]+the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{249;186;319;643};"1 + 1 = 111";{789;509;885;545};}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";}]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Jb")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#{{953;482;982;811};{101;283;370;530};"1 + 1 = 111";}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("t8")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("qR8")]][the_IlIIIIIlIlIIlIl[#("35Sl")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Tv")]]=the_IlIIIIIlIlIIlIl[#("VH3")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("ub")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("RK")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("mtu")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("La")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("nqH")]][the_IlIIIIIlIlIIlIl[#("eAU1")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("ah")]]=the_IlIIIIIlIlIIlIl[#("Urp")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("uk")]the_IIIllIlIIIlIllIlIIIIIl,the_lIlIIIllI=the_IIlIIlIIIlllllllllIIlIII(the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1]))the_IIIIllIlIlIIIlIIlIlIIlI=the_lIlIIIllI+the_IlIllIIIIl-1 the_IIIIIIIlIIllllIIl=0;for the_IlIIIIIlIlIIlIl=the_IlIllIIIIl,the_IIIIllIlIlIIIlIIlIlIIlI do the_IIIIIIIlIIllllIIl=the_IIIIIIIlIIllllIIl+1;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl]=the_IIIllIlIIIlIllIlIIIIIl[the_IIIIIIIlIIllllIIl];end;the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("bP")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IIIIllIlIlIIIlIIlIlIIlI))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("gd")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("LLs")]]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{6;549;950;846};"1 + 1 = 111";{778;570;331;354};}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{{212;638;229;36};"1 + 1 = 111";}]]=the_IlIIIIIlIlIIlIl[#("Fb2")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("qU")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("H6r")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("0l")]][the_IlIIIIIlIlIIlIl[#("F4J")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("vMhs")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_lIIlIIlllIl=the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{255;409;969;287};{563;989;698;742};}];elseif the_IlIllIIIIl==#("K1YGujizoRpXW1TZgAF9JxU6UEhJF4F")then local the_IlIlllIIIlllIlIIlIl;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("66")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("T5B")]][the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";{205;260;482;54};"1 + 1 = 111";}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("fC")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("aty")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("sT")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Bku")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlllIIIlllIlIIlIl=the_IlIIIIIlIlIIlIl[#("qR")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIlllIIIlllIlIIlIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIlllIIIlllIlIIlIl+1,the_IlIIIIIlIlIIlIl[#("F3H")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_lIIlIIlllIl=the_IlIIIIIlIlIIlIl[#("zmE")];else local the_IIIIllIlIlIIIlIIlIlIIlI;local the_IlIllIIIIl;local the_IlIlIlIlIllIIlllIIlIl;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("VM")]]=the_IlIIIIIlIlIIlIl[#("Odj")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIlIlIllIIlllIIlIl=the_IlIIIIIlIlIIlIl[#{{832;81;969;260};"1 + 1 = 111";}]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIlIlIlIllIIlllIIlIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIlIlIlIllIIlllIIlIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("gs")]]=the_IlIIIIIlIlIIlIl[#("cnW")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("SFz")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("6N")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("zo")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("rOc")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("kB")]]=the_IlIIIIIlIlIIlIl[#("kdW")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("lU")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("OUz")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("MTL")];the_IIIIllIlIlIIIlIIlIlIIlI=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]for the_IlIIIIIlIlIIlIl=the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("04dR")]do the_IIIIllIlIlIIIlIIlIlIIlI=the_IIIIllIlIlIIIlIIlIlIIlI..the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl];end;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("ad")]]=the_IIIIllIlIlIIIlIIlIlIIlI;the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("ep")]][the_IlIIIIIlIlIIlIl[#("y3M")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("kAA0")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("rS")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("rq7")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIlIlIllIIlllIIlIl=the_IlIIIIIlIlIIlIl[#("30")];the_IlIllIIIIl=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Wjm")]];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIlIlIlIllIIlllIIlIl+1]=the_IlIllIIIIl;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIlIlIlIllIIlllIIlIl]=the_IlIllIIIIl[the_IlIIIIIlIlIIlIl[#("IkU0")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIlIlIllIIlllIIlIl=the_IlIIIIIlIlIIlIl[#("mt")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIlIlIlIllIIlllIIlIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIlIlIlIllIIlllIIlIl+1])end;elseif the_IlIllIIIIl<=#("tnBKL70PPVp87MCeHBnMJHbmh2W1bJ3tlV")then if the_IlIllIIIIl>#("JAioiJ0uXhW8iccceR35WlnDSk9Nf15Wl")then local the_IlIllIIIIl;local the_IlIlIlIlIllIIlllIIlIl;the_IlIlIlIlIllIIlllIIlIl=the_IlIIIIIlIlIIlIl[#("Py")];the_IlIllIIIIl=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("IeA")]];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIlIlIlIllIIlllIIlIl+1]=the_IlIllIIIIl;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIlIlIlIllIIlllIIlIl]=the_IlIllIIIIl[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";{367;632;952;881};"1 + 1 = 111";}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIlIlIllIIlllIIlIl=the_IlIIIIIlIlIIlIl[#("FU")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIlIlIlIllIIlllIIlIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIlIlIlIllIIlllIIlIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("6a")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("Wvq")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("dQ")]][the_IlIIIIIlIlIIlIl[#("01F")]]=the_IlIIIIIlIlIIlIl[#("NAjZ")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("th")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("Asf")]];else if(the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("1e")]]<=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("2QqX")]])then the_lIIlIIlllIl=the_IlIIIIIlIlIIlIl[#("OXP")];else the_lIIlIIlllIl=the_lIIlIIlllIl+1;end;end;elseif the_IlIllIIIIl>#("2PymedSmnfv3OZ9GZNs0SymQG7Jno6m9Waj")then if(the_IlIIIIIlIlIIlIl[#("bV")]<the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Ngsb")]])then the_lIIlIIlllIl=the_IlIIIIIlIlIIlIl[#("Nk5")];else the_lIIlIIlllIl=the_lIIlIIlllIl+1;end;else local the_IIIllIlIIIlIllIlIIIIIl;local the_lIlllIlIIllllIIllI,the_llIlIIIllllllllIIIlllll;local the_lIlIIIllI;local the_IlIllIIIIl;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("4X")]]=the_IIIIIIIlIIllllIIl[the_IlIIIIIlIlIIlIl[#("2aR")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("hY")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{{449;598;865;920};"1 + 1 = 111";{873;518;693;225};}]][the_IlIIIIIlIlIIlIl[#("jxdP")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("yc")];the_lIlIIIllI=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{{917;188;750;202};{878;834;416;366};"1 + 1 = 111";}]];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1]=the_lIlIIIllI;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_lIlIIIllI[the_IlIIIIIlIlIIlIl[#("YtLp")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("5m")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("tDK")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("xG")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("DTV")]][the_IlIIIIIlIlIIlIl[#("k1qs")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{328;567;89;844};}]]=the_IlIIIIIlIlIIlIl[#("yr8")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("6d")]]=the_IlIIIIIlIlIIlIl[#("kdb")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{{877;133;831;255};{137;499;816;114};}]]=the_IlIIIIIlIlIIlIl[#("F3i")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("G8")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("iLd")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Oc")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("Pok")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("zk")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("7ED")]][the_IlIIIIIlIlIIlIl[#("iDJp")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("7U")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("QGK")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Iy")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("nz0")]][the_IlIIIIIlIlIIlIl[#("AUob")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("sJ")]]=the_IlIIIIIlIlIIlIl[#("zzB")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("Hi")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("r6")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("bS1")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("pH")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("u5G")]][the_IlIIIIIlIlIIlIl[#("EjMz")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("7f")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("1oB")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Fd")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("AXL")]][the_IlIIIIIlIlIIlIl[#("C1TG")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("zM")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("IqI")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("9T")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{{146;839;959;500};"1 + 1 = 111";}]]=the_IlIIIIIlIlIIlIl[#("YIs")]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Yfhu")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=the_IlIIIIIlIlIIlIl[#("EZU")]-the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("sY35")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("CW")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("dN")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#{{17;112;385;764};"1 + 1 = 111";{212;24;977;605};}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("gu")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("kCU")]][the_IlIIIIIlIlIIlIl[#("bA72")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("fo")]]=the_IlIIIIIlIlIIlIl[#("yIj")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#{{793;487;262;632};"1 + 1 = 111";}]the_lIlllIlIIllllIIllI,the_llIlIIIllllllllIIIlllll=the_IIlIIlIIIlllllllllIIlIII(the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1]))the_IIIIllIlIlIIIlIIlIlIIlI=the_llIlIIIllllllllIIIlllll+the_IlIllIIIIl-1 the_IIIllIlIIIlIllIlIIIIIl=0;for the_IlIIIIIlIlIIlIl=the_IlIllIIIIl,the_IIIIllIlIlIIIlIIlIlIIlI do the_IIIllIlIIIlIllIlIIIIIl=the_IIIllIlIIIlIllIlIIIIIl+1;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl]=the_lIlllIlIIllllIIllI[the_IIIllIlIIIlIllIlIIIIIl];end;the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("vC")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IIIIllIlIlIIIlIIlIlIIlI))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{{392;601;830;601};"1 + 1 = 111";}]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{{670;828;326;878};"1 + 1 = 111";"1 + 1 = 111";}]]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("kHdD")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Yi")]]=the_IlIIIIIlIlIIlIl[#("f1W")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("gt")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("YNv")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("7F")]][the_IlIIIIIlIlIIlIl[#("0HW")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Ahcu")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("C5")]]=the_IIIIIIIlIIllllIIl[the_IlIIIIIlIlIIlIl[#("Ani")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("ZX")]]=the_IIIIIIIlIIllllIIl[the_IlIIIIIlIlIIlIl[#("kA5")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("g3")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("qRI")]][the_IlIIIIIlIlIIlIl[#("PSmi")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("my")];the_lIlIIIllI=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("dOZ")]];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1]=the_lIlIIIllI;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_lIlIIIllI[the_IlIIIIIlIlIIlIl[#("shUC")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("3t")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("hG4")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Y9")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("92I")]][the_IlIIIIIlIlIIlIl[#("cun4")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("FP")]]=the_IlIIIIIlIlIIlIl[#("dtr")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{{655;142;876;721};"1 + 1 = 111";}]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("3Z3")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("eO")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("QqH")]][the_IlIIIIIlIlIIlIl[#("M0tH")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("G7")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("AO1")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("Pj")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("qN")]]=the_IlIIIIIlIlIIlIl[#("J6k")]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("elTf")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Ej")]]=the_IlIIIIIlIlIIlIl[#("sZy")]+the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("4YpM")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Up")]]=the_IlIIIIIlIlIIlIl[#("Xvb")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("NP")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("MDF")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{{667;623;381;944};{562;777;993;758};}]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("PGC")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("zr")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("iGT")]][the_IlIIIIIlIlIIlIl[#("RdX3")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("FC")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("X4r")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("IG")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("hPK")]][the_IlIIIIIlIlIIlIl[#("LLVE")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("KV")]]=the_IlIIIIIlIlIIlIl[#("OvU")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("hK")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("iH")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#{{53;535;652;375};"1 + 1 = 111";"1 + 1 = 111";}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("3M")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("6hM")]][the_IlIIIIIlIlIIlIl[#("4PFW")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("du")]]=the_IlIIIIIlIlIIlIl[#("YJa")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("TV")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Fs")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("W9F")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("2f")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("laA")]][the_IlIIIIIlIlIIlIl[#("0tjo")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Yh")]]=the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{881;492;520;410};"1 + 1 = 111";}];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("ak")]the_lIlllIlIIllllIIllI,the_llIlIIIllllllllIIIlllll=the_IIlIIlIIIlllllllllIIlIII(the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1]))the_IIIIllIlIlIIIlIIlIlIIlI=the_llIlIIIllllllllIIIlllll+the_IlIllIIIIl-1 the_IIIllIlIIIlIllIlIIIIIl=0;for the_IlIIIIIlIlIIlIl=the_IlIllIIIIl,the_IIIIllIlIlIIIlIIlIlIIlI do the_IIIllIlIIIlIllIlIIIIIl=the_IIIllIlIIIlIllIlIIIIIl+1;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl]=the_lIlllIlIIllllIIllI[the_IIIllIlIIIlIllIlIIIIIl];end;the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("aT")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IIIIllIlIlIIIlIIlIlIIlI))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("23")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("ILc")]]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("JYFc")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("DM")]]=the_IlIIIIIlIlIIlIl[#("VHQ")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("ME")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("TCZ")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("0f")]][the_IlIIIIIlIlIIlIl[#("mn5")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("D8hk")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_lIIlIIlllIl=the_IlIIIIIlIlIIlIl[#{{427;828;951;143};"1 + 1 = 111";"1 + 1 = 111";}];end;elseif the_IlIllIIIIl<=#("P2NZmJ7ihZHkOKcrEvAFCSQgEF7r2vgNPL17aDNi")then if the_IlIllIIIIl<=#("eJRBzJP45FBLP66lGvSMQpVS4FcSeqbTrfyj9Q")then if the_IlIllIIIIl>#{{323;114;577;176};"1 + 1 = 111";"1 + 1 = 111";{373;506;155;551};{173;94;514;738};{246;401;117;442};{351;62;586;719};{203;616;439;963};"1 + 1 = 111";{668;633;179;396};{840;964;756;572};"1 + 1 = 111";{753;518;652;305};{182;36;515;346};"1 + 1 = 111";{923;401;614;81};{770;389;926;309};{459;233;124;781};{200;33;521;655};"1 + 1 = 111";{281;612;695;153};"1 + 1 = 111";{766;742;146;884};{414;10;822;336};"1 + 1 = 111";"1 + 1 = 111";{38;475;555;102};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{757;684;443;164};"1 + 1 = 111";{735;905;181;447};"1 + 1 = 111";{9;332;618;898};"1 + 1 = 111";"1 + 1 = 111";}then local the_IIIIllIlIlIIIlIIlIlIIlI;local the_IlIllIIIIl;the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("ju")];the_IIIIllIlIlIIIlIIlIlIIlI=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("4ea")]];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1]=the_IIIIllIlIlIIIlIIlIlIIlI;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IIIIllIlIlIIIlIIlIlIIlI[the_IlIIIIIlIlIIlIl[#("F1ib")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("EV")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("zc")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("jQr")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("MS")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("5QZ")]][the_IlIIIIIlIlIIlIl[#("8Htn")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Bt")]]=the_IlIIIIIlIlIIlIl[#("I5Q")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("qi")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("eDW")]][the_IlIIIIIlIlIIlIl[#("beZu")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("H2")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("2UE")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("k9R")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Il")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Bq")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("fzj")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("V3")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{{43;423;453;147};"1 + 1 = 111";"1 + 1 = 111";}]][the_IlIIIIIlIlIIlIl[#("zQ7Y")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Rc")]]=the_IlIIIIIlIlIIlIl[#("K59")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{288;213;255;130};"1 + 1 = 111";}]][the_IlIIIIIlIlIIlIl[#("LObt")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("SG")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{439;560;128;641};{481;647;181;270};}]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("HK6")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("bL")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];if the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("4p")]]then the_lIIlIIlllIl=the_lIIlIIlllIl+1;else the_lIIlIIlllIl=the_IlIIIIIlIlIIlIl[#("yvv")];end;else the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Ub")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("LQ7")]]/the_IlIIIIIlIlIIlIl[#("3IVG")];end;elseif the_IlIllIIIIl==#("3b2FxYtX4YVvJvajkzxHtx7TAggINZinAH37Nyj")then local the_lIIlIIlllIl=the_IlIIIIIlIlIIlIl[#("mv")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_lIIlIIlllIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_lIIlIIlllIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_lIIlIIlllIl+1,the_IlIIIIIlIlIIlIl[#("8tJ")]))else do return end;end;elseif the_IlIllIIIIl<=#("G1J4Hn9CmQfy6W8HeifqRVjfPI6cCdGXpobDYdmmhP")then if the_IlIllIIIIl==#("6TUrNIx3Fs3AURDo9q7ajksiRUGSa62iczmv4qsEe")then local the_IlIllIIIIl;local the_IIIIIIIlIIllllIIl;local the_IIIllIlIIIlIllIlIIIIIl,the_llIlIIIllllllllIIIlllll;local the_lIlIIIllI;local the_IlIllIIIIl;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Vs")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("GX1")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("AL")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("CnU")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("Hc")];the_lIlIIIllI=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("DSb")]];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1]=the_lIlIIIllI;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_lIlIIIllI[the_IlIIIIIlIlIIlIl[#("MDK8")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("IO")]the_IIIllIlIIIlIllIlIIIIIl,the_llIlIIIllllllllIIIlllll=the_IIlIIlIIIlllllllllIIlIII(the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1]))the_IIIIllIlIlIIIlIIlIlIIlI=the_llIlIIIllllllllIIIlllll+the_IlIllIIIIl-1 the_IIIIIIIlIIllllIIl=0;for the_IlIIIIIlIlIIlIl=the_IlIllIIIIl,the_IIIIllIlIlIIIlIIlIlIIlI do the_IIIIIIIlIIllllIIl=the_IIIIIIIlIIllllIIl+1;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl]=the_IIIllIlIIIlIllIlIIIIIl[the_IIIIIIIlIIllllIIl];end;the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("y5")]the_IIIllIlIIIlIllIlIIIIIl={the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IIIIllIlIlIIIlIIlIlIIlI))};the_IIIIIIIlIIllllIIl=0;for the_IlIIIIIlIlIIlIl=the_IlIllIIIIl,the_IlIIIIIlIlIIlIl[#("cGEx")]do the_IIIIIIIlIIllllIIl=the_IIIIIIIlIIllllIIl+1;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl]=the_IIIllIlIIIlIllIlIIIIIl[the_IIIIIIIlIIllllIIl];end the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_lIIlIIlllIl=the_IlIIIIIlIlIIlIl[#("zBS")];else local the_IIIIIIIlIIllllIIl;local the_IIIllIlIIIlIllIlIIIIIl,the_lIlIIIllI;local the_IlIllIIIIl;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Pb")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("bBB")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("QI")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("CTO")]]/the_IlIIIIIlIlIIlIl[#("s95K")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("7G")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("mO")]]=the_IlIIIIIlIlIIlIl[#("bt2")]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("E9kO")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("pR")]]=the_IlIIIIIlIlIIlIl[#("70f")]-the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Wate")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("ZJ")]]=the_IlIIIIIlIlIIlIl[#("EYH")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("D5")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("8YZ")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("X8")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("0X7")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("tGV")]][the_IlIIIIIlIlIIlIl[#("0ZYj")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("4D")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("8Oi")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("HH")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("3de")]][the_IlIIIIIlIlIIlIl[#("BWYb")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Fe")]]=the_IlIIIIIlIlIIlIl[#("jgi")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";}]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("TY")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("u0l")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("5n")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Mgv")]][the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";{321;59;311;200};"1 + 1 = 111";}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("nr")]]=the_IlIIIIIlIlIIlIl[#("33u")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("pS")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{455;874;885;431};}]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("LhP")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{{349;833;962;269};{315;569;861;237};}]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("V7C")]][the_IlIIIIIlIlIIlIl[#("3mLG")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{252;373;600;69};}]]=the_IlIIIIIlIlIIlIl[#("IS6")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("ic")]the_IIIllIlIIIlIllIlIIIIIl,the_lIlIIIllI=the_IIlIIlIIIlllllllllIIlIII(the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1]))the_IIIIllIlIlIIIlIIlIlIIlI=the_lIlIIIllI+the_IlIllIIIIl-1 the_IIIIIIIlIIllllIIl=0;for the_IlIIIIIlIlIIlIl=the_IlIllIIIIl,the_IIIIllIlIlIIIlIIlIlIIlI do the_IIIIIIIlIIllllIIl=the_IIIIIIIlIIllllIIl+1;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl]=the_IIIllIlIIIlIllIlIIIIIl[the_IIIIIIIlIIllllIIl];end;the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{944;970;774;477};}]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IIIIllIlIlIIIlIIlIlIIlI))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("LU")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("RHb")]]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("LTBd")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("ol")]]=the_IlIIIIIlIlIIlIl[#("UUP")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#{{180;691;558;266};{12;64;282;95};}]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("PR8")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("71")]][the_IlIIIIIlIlIIlIl[#("Lue")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("3yhH")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_lIIlIIlllIl=the_IlIIIIIlIlIIlIl[#("klq")];end;elseif the_IlIllIIIIl==#("bEvYqVuYm6kPmWAMK3cP2JBUyvFhtT7D59iZW2DUxlT")then local the_IlIllIIIIl;local the_IlIlllIIIlllIlIIlIl;the_IlIlllIIIlllIlIIlIl=the_IlIIIIIlIlIIlIl[#("gA")];the_IlIllIIIIl=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{420;278;610;516};{638;184;599;608};}]];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIlllIIIlllIlIIlIl+1]=the_IlIllIIIIl;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIlllIIIlllIlIIlIl]=the_IlIllIIIIl[the_IlIIIIIlIlIIlIl[#("MjGc")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("hO")]]=the_IlIIIIIlIlIIlIl[#("zAb")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlllIIIlllIlIIlIl=the_IlIIIIIlIlIIlIl[#("14")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIlllIIIlllIlIIlIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIlllIIIlllIlIIlIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIlllIIIlllIlIIlIl+1,the_IlIIIIIlIlIIlIl[#("PNK")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("uI")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("325")]][the_IlIIIIIlIlIIlIl[#("mRu0")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlllIIIlllIlIIlIl=the_IlIIIIIlIlIIlIl[#("7b")];the_IlIllIIIIl=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{{981;953;402;178};{632;424;857;831};{384;807;106;77};}]];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIlllIIIlllIlIIlIl+1]=the_IlIllIIIIl;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIlllIIIlllIlIIlIl]=the_IlIllIIIIl[the_IlIIIIIlIlIIlIl[#("Hl4J")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("AK")]]=the_IlIIIIIlIlIIlIl[#("oCI")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlllIIIlllIlIIlIl=the_IlIIIIIlIlIIlIl[#("TL")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIlllIIIlllIlIIlIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIlllIIIlllIlIIlIl+1,the_IlIIIIIlIlIIlIl[#("iPd")]))else local the_IIIIllIlIlIIIlIIlIlIIlI;local the_IlIllIIIIl;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("0M")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("3nu")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Ub")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("C1a")]][the_IlIIIIIlIlIIlIl[#("9iGr")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("c2")];the_IIIIllIlIlIIIlIIlIlIIlI=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Lpb")]];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1]=the_IIIIllIlIlIIIlIIlIlIIlI;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IIIIllIlIlIIIlIIlIlIIlI[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";{674;500;2;637};"1 + 1 = 111";}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("3a")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("TEn")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";{646;48;425;742};}]][the_IlIIIIIlIlIIlIl[#("hzVV")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Eb")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("z9i")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("sD")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("uh0")]][the_IlIIIIIlIlIIlIl[#("cPqK")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Fq")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("ycO")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Aq")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("vKr")]][the_IlIIIIIlIlIIlIl[#("y8YY")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Jt")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("smk")]][the_IlIIIIIlIlIIlIl[#("l1VO")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("vn")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#{{677;556;350;17};"1 + 1 = 111";"1 + 1 = 111";}]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("oq")]]=the_IlIIIIIlIlIIlIl[#("3Gz")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("xx")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("oGW")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("oZ")]][the_IlIIIIIlIlIIlIl[#("Jvc")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("zZ2t")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=the_IlIIIIIlIlIIlIl[#("eec")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("bix")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("lQ")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("16")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("Mr8")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("xB")]]();the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Vv")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("lXT")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("ut")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("ld0")]][the_IlIIIIIlIlIIlIl[#("V1ZD")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("vD")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Gux")]][the_IlIIIIIlIlIIlIl[#("lvpR")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];if(the_IlIIIIIlIlIIlIl[#("aI")]<the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Y6Jn")]])then the_lIIlIIlllIl=the_lIIlIIlllIl+1;else the_lIIlIIlllIl=the_IlIIIIIlIlIIlIl[#("SfN")];end;end;elseif the_IlIllIIIIl<=#("8ymA5sQACzrDdMB5qnEE8RTnNL0RAsrQZEV9jelbcHbGRQVjCIDi")then if the_IlIllIIIIl<=#("o7qO8WuD9aigLNJ1BWmcDCBQnG7ZQp2Zi9KHEvkr1JdH2zfd")then if the_IlIllIIIIl<=#("saWqgoXGLBCZFWTit7MccxfL5l4y4YYB3NyofJcUWa34SC")then if the_IlIllIIIIl>#("WtzJBEak55kv5tAMWNb52zFcU51pbEk2DZieGpx63CCs5")then if(the_IlIIIIIlIlIIlIl[#("Tc")]<the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("24ti")]])then the_lIIlIIlllIl=the_lIIlIIlllIl+1;else the_lIIlIIlllIl=the_IlIIIIIlIlIIlIl[#("q2k")];end;else local the_IlIllIIIIl;local the_IIIIIIIlIIllllIIl;local the_IIIllIlIIIlIllIlIIIIIl,the_llIlIIIllllllllIIIlllll;local the_lIlIIIllI;local the_IlIllIIIIl;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Zh")]]={};the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Ve")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("Iyv")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Uc")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("k1a")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("On")];the_lIlIIIllI=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("X6m")]];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1]=the_lIlIIIllI;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_lIlIIIllI[the_IlIIIIIlIlIIlIl[#("btSj")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("OS")]the_IIIllIlIIIlIllIlIIIIIl,the_llIlIIIllllllllIIIlllll=the_IIlIIlIIIlllllllllIIlIII(the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1]))the_IIIIllIlIlIIIlIIlIlIIlI=the_llIlIIIllllllllIIIlllll+the_IlIllIIIIl-1 the_IIIIIIIlIIllllIIl=0;for the_IlIIIIIlIlIIlIl=the_IlIllIIIIl,the_IIIIllIlIlIIIlIIlIlIIlI do the_IIIIIIIlIIllllIIl=the_IIIIIIIlIIllllIIl+1;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl]=the_IIIllIlIIIlIllIlIIIIIl[the_IIIIIIIlIIllllIIl];end;the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("L8")]the_IIIllIlIIIlIllIlIIIIIl={the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IIIIllIlIlIIIlIIlIlIIlI))};the_IIIIIIIlIIllllIIl=0;for the_IlIIIIIlIlIIlIl=the_IlIllIIIIl,the_IlIIIIIlIlIIlIl[#("SPj9")]do the_IIIIIIIlIIllllIIl=the_IIIIIIIlIIllllIIl+1;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl]=the_IIIllIlIIIlIllIlIIIIIl[the_IIIIIIIlIIllllIIl];end the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_lIIlIIlllIl=the_IlIIIIIlIlIIlIl[#("HpJ")];end;elseif the_IlIllIIIIl>#("gAxzgrRGExYvYGMUjCVr2flvfHpecA6lgHYB3Mx2l6vVpjC")then if(the_IlIIIIIlIlIIlIl[#("jD")]<the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("rGCx")]])then the_lIIlIIlllIl=the_IlIIIIIlIlIIlIl[#("W2K")];else the_lIIlIIlllIl=the_lIIlIIlllIl+1;end;else local the_lIlllIlIIllllIIllI;local the_IIIllIlIIIlIllIlIIIIIl;local the_lIlIIIllI,the_llIlIIIllllllllIIIlllll;local the_IlIllIIIIl;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Bb")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("GYz")]]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("lZYU")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{{457;774;887;560};{835;341;412;3};}]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("SnL")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("DB")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("GEq")]][the_IlIIIIIlIlIIlIl[#("bSgf")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("VD")]]=the_IlIIIIIlIlIIlIl[#("h9L")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("rb")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("4L")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("CFT")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Db")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("dgB")]][the_IlIIIIIlIlIIlIl[#("prHZ")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("HQ")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("hVr")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("kS")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Glg")]][the_IlIIIIIlIlIIlIl[#("EFU8")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("kA")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("sPE")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("9K")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("9LG")]]/the_IlIIIIIlIlIIlIl[#("CjQJ")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("ty")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{750;251;842;876};}]]=the_IlIIIIIlIlIIlIl[#("pen")]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("HmpW")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("sq")]the_lIlIIIllI,the_llIlIIIllllllllIIIlllll=the_IIlIIlIIIlllllllllIIlIII(the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1]))the_IIIIllIlIlIIIlIIlIlIIlI=the_llIlIIIllllllllIIIlllll+the_IlIllIIIIl-1 the_IIIllIlIIIlIllIlIIIIIl=0;for the_IlIIIIIlIlIIlIl=the_IlIllIIIIl,the_IIIIllIlIlIIIlIIlIlIIlI do the_IIIllIlIIIlIllIlIIIIIl=the_IIIllIlIIIlIllIlIIIIIl+1;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl]=the_lIlIIIllI[the_IIIllIlIIIlIllIlIIIIIl];end;the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("63")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IIIIllIlIlIIIlIIlIlIIlI))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("6v")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("PDD")]]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("sEmx")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("IQ")]]=the_IlIIIIIlIlIIlIl[#("OW9")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("BQ")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("ioC")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("M4")]][the_IlIIIIIlIlIIlIl[#("xZN")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("cgK4")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("6R")]]=the_IIIIIIIlIIllllIIl[the_IlIIIIIlIlIIlIl[#("5iA")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Ls")]]=the_IIIIIIIlIIllllIIl[the_IlIIIIIlIlIIlIl[#("y2B")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{865;139;502;887};}]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("F1X")]][the_IlIIIIIlIlIIlIl[#("smNZ")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("e8")];the_lIlllIlIIllllIIllI=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("9Vf")]];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1]=the_lIlllIlIIllllIIllI;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_lIlllIlIIllllIIllI[the_IlIIIIIlIlIIlIl[#("AhtL")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Ts")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("2h4")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("kk")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("rTY")]][the_IlIIIIIlIlIIlIl[#("XVDa")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("SK")]]=the_IlIIIIIlIlIIlIl[#("mZp")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("vo")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{213;338;289;966};"1 + 1 = 111";}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("eN")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("8Jc")]][the_IlIIIIIlIlIIlIl[#("bjoL")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("mJ")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("P34")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("gS")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("cad")]]/the_IlIIIIIlIlIIlIl[#("ZCuO")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("UP")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("bS")]]=the_IlIIIIIlIlIIlIl[#("9ir")]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{{352;838;68;352};{859;623;102;854};"1 + 1 = 111";"1 + 1 = 111";}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("KO")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("jDH")]]/the_IlIIIIIlIlIIlIl[#("y5ZP")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("21")]]=the_IlIIIIIlIlIIlIl[#("58O")]+the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";{624;388;691;364};{724;459;367;143};}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("cY")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("tQh")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Pp")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Nxp")]][the_IlIIIIIlIlIIlIl[#("A3Pu")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("S4")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("EN2")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("IL")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("T7t")]]/the_IlIIIIIlIlIIlIl[#("Hbm7")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("YH")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("rg")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("mhM")]]/the_IlIIIIIlIlIIlIl[#("318n")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("98")]]=the_IlIIIIIlIlIIlIl[#("QbU")]+the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("128Y")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("l9")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{371;150;877;465};{452;912;31;381};}]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Gj")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("Iho")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Wh")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("50X")]][the_IlIIIIIlIlIIlIl[#("u6ho")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("QE")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("Wvj")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("8b")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("VNs")]][the_IlIIIIIlIlIIlIl[#{{307;639;578;124};{702;503;595;890};{90;422;218;153};{289;174;361;530};}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("vH")]]=the_IlIIIIIlIlIIlIl[#("p1O")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("yz")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("hl")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("jIb")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{{269;588;908;513};"1 + 1 = 111";}]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("vxF")]][the_IlIIIIIlIlIIlIl[#("Ftt3")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("sr")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("6ca")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("32")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("DG2")]]/the_IlIIIIIlIlIIlIl[#("6Waa")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("h0")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Sj")]]=-the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("y2F")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{{75;66;51;739};{110;733;167;534};}]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("kul")]]/the_IlIIIIIlIlIIlIl[#("T3nK")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("z2")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("77H")]]-the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("H6Mk")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("f0")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#{{931;585;282;611};"1 + 1 = 111";{685;528;57;461};}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("15")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("nTK")]][the_IlIIIIIlIlIIlIl[#("xIcd")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("4L")]]=the_IlIIIIIlIlIIlIl[#("fBO")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("Dd")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("LW")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("uFc")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("rD")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("vAm")]][the_IlIIIIIlIlIIlIl[#("EVBr")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("zX")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("V69")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("E0")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("vVa")]]/the_IlIIIIIlIlIIlIl[#("LopW")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("9N")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("nu")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("vk1")]]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";{786;414;108;311};{972;775;961;371};}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("bT")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("0CK")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("7N")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("ouG")]][the_IlIIIIIlIlIIlIl[#("e28t")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("QB")]]=the_IlIIIIIlIlIIlIl[#("62q")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("89")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("tP")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("o7I")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("ah")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("sCF")]][the_IlIIIIIlIlIIlIl[#("BSHV")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("jV")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("Vrr")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("59")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("zBt")]][the_IlIIIIIlIlIIlIl[#("5tMU")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("SVN")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("t2")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("KoS")]]/the_IlIIIIIlIlIIlIl[#("7qpG")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("kR")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("gB")]]=the_IlIIIIIlIlIIlIl[#("4EF")]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("kvSo")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("FN")]the_lIlIIIllI,the_llIlIIIllllllllIIIlllll=the_IIlIIlIIIlllllllllIIlIII(the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1]))the_IIIIllIlIlIIIlIIlIlIIlI=the_llIlIIIllllllllIIIlllll+the_IlIllIIIIl-1 the_IIIllIlIIIlIllIlIIIIIl=0;for the_IlIIIIIlIlIIlIl=the_IlIllIIIIl,the_IIIIllIlIlIIIlIIlIlIIlI do the_IIIllIlIIIlIllIlIIIIIl=the_IIIllIlIIIlIllIlIIIIIl+1;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl]=the_lIlIIIllI[the_IIIllIlIIIlIllIlIIIIIl];end;the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("KL")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IIIIllIlIlIIIlIIlIlIIlI))end;elseif the_IlIllIIIIl<=#("uisaIOubobsKbMEeANpqRk1He2f6UBf6ezT4g6ODmXm2sW0JCr")then if the_IlIllIIIIl>#("M3ljkqW5QIyrX5xFN2K7E9Xd479osbHECfEc3oJNua84YFz66")then local the_IllIIIIIlIlIllIIIIlIl=the_IlIIIIIlIlIIlIl[#{{170;371;370;118};"1 + 1 = 111";"1 + 1 = 111";}];local the_lIIlIIlllIl=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IllIIIIIlIlIllIIIIlIl]for the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl+1,the_IlIIIIIlIlIIlIl[#("FNBF")]do the_lIIlIIlllIl=the_lIIlIIlllIl..the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl];end;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=the_lIIlIIlllIl;else local the_lIlIIIllI;local the_lIlllIlIIllllIIllI,the_llIlIIIllllllllIIIlllll;local the_IIIllIlIIIlIllIlIIIIIl;local the_IlIllIIIIl;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("tj")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Qci")]]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("91QM")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("y8")]]=the_IlIIIIIlIlIIlIl[#("nuG")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("ad")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("PtO")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("af")]][the_IlIIIIIlIlIIlIl[#("kXj")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("FJS5")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("nC")]]=the_IIIIIIIlIIllllIIl[the_IlIIIIIlIlIIlIl[#("adb")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=the_IIIIIIIlIIllllIIl[the_IlIIIIIlIlIIlIl[#("pvx")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("dX")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";{54;334;968;370};}]][the_IlIIIIIlIlIIlIl[#("VnPV")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("an")];the_IIIllIlIIIlIllIlIIIIIl=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("7FO")]];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1]=the_IIIllIlIIIlIllIlIIIIIl;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IIIllIlIIIlIllIlIIIIIl[the_IlIIIIIlIlIIlIl[#("rMG8")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("EG")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("9Ag")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("oJ")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("r5o")]][the_IlIIIIIlIlIIlIl[#("srJi")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("AB")]]=the_IlIIIIIlIlIIlIl[#("pTp")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("rl")]]=the_IlIIIIIlIlIIlIl[#("KkS")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("X5")]]=the_IlIIIIIlIlIIlIl[#("tRa")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("Xk")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("BhN")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Sg")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("Qik")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Kq")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("JR6")]][the_IlIIIIIlIlIIlIl[#("SjUB")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("hm")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("QvI")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("EB")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("QXG")]][the_IlIIIIIlIlIIlIl[#("Yrc2")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Ft")]]=the_IlIIIIIlIlIIlIl[#{{279;820;152;506};"1 + 1 = 111";{908;190;562;702};}];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("74")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("aV")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("ggA")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("zK")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{{821;543;544;743};"1 + 1 = 111";"1 + 1 = 111";}]][the_IlIIIIIlIlIIlIl[#("eN9M")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("k6")]]=the_IlIIIIIlIlIIlIl[#("EX1")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("JK")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Op")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("WWQ")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Pr")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("UPY")]][the_IlIIIIIlIlIIlIl[#("yJuK")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("34")]]=the_IlIIIIIlIlIIlIl[#("XeK")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("sh")]the_lIlllIlIIllllIIllI,the_llIlIIIllllllllIIIlllll=the_IIlIIlIIIlllllllllIIlIII(the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1]))the_IIIIllIlIlIIIlIIlIlIIlI=the_llIlIIIllllllllIIIlllll+the_IlIllIIIIl-1 the_lIlIIIllI=0;for the_IlIIIIIlIlIIlIl=the_IlIllIIIIl,the_IIIIllIlIlIIIlIIlIlIIlI do the_lIlIIIllI=the_lIlIIIllI+1;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl]=the_lIlllIlIIllllIIllI[the_lIlIIIllI];end;the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("55")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IIIIllIlIlIIIlIIlIlIIlI))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{{224;917;25;797};{338;190;185;902};}]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("M7B")]]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{{166;612;189;975};{490;47;800;796};{413;565;898;518};"1 + 1 = 111";}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("G0")]]=the_IlIIIIIlIlIIlIl[#("k5b")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{528;152;456;811};}]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("nhn")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("hs")]][the_IlIIIIIlIlIIlIl[#("TfN")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("3hCx")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Qz")]]=the_IIIIIIIlIIllllIIl[the_IlIIIIIlIlIIlIl[#("mPR")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("5I")]]=the_IIIIIIIlIIllllIIl[the_IlIIIIIlIlIIlIl[#("FQ8")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("X0")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("hxu")]][the_IlIIIIIlIlIIlIl[#("RrIo")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("aZ")];the_IIIllIlIIIlIllIlIIIIIl=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("ZuS")]];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1]=the_IIIllIlIIIlIllIlIIIIIl;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IIIllIlIIIlIllIlIIIIIl[the_IlIIIIIlIlIIlIl[#("uZqr")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{{669;32;727;61};{15;751;954;867};}]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{848;178;207;988};}]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("n7f")]][the_IlIIIIIlIlIIlIl[#("ElXo")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("hD")]]=the_IlIIIIIlIlIIlIl[#("WeO")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Oo")]]=the_IlIIIIIlIlIIlIl[#("IgB")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("zd")]]=the_IlIIIIIlIlIIlIl[#("c4v")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("zm")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("xRT")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("nI")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("8Gz")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Kn")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("L27")]][the_IlIIIIIlIlIIlIl[#("OM4P")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("3x")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("Amc")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Ui")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("NOR")]][the_IlIIIIIlIlIIlIl[#("U79f")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{{393;765;420;338};{156;22;893;699};}]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("Jig")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("ZQ")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("btv")]][the_IlIIIIIlIlIIlIl[#("blvZ")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("bm")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#{{412;959;116;842};{706;242;835;104};{37;350;538;580};}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{{609;233;351;576};{969;578;317;99};}]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("9KP")]]/the_IlIIIIIlIlIIlIl[#("QZQr")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("2b")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("lH")]]=the_IlIIIIIlIlIIlIl[#("CGa")]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("WfUl")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("3y")]]=the_IlIIIIIlIlIIlIl[#("Jr7")]-the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("IrcB")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("RW")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("do")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("gWo")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Fu")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("e3b")]][the_IlIIIIIlIlIIlIl[#("V3SM")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("ey")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("mgI")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("JZ")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Ls4")]][the_IlIIIIIlIlIIlIl[#("qmWM")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("lK")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("kz2")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("6y")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Vc3")]]/the_IlIIIIIlIlIIlIl[#("UrCY")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("AD")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("iS")]]=the_IlIIIIIlIlIIlIl[#("Hnf")]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("jEBI")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("vS")]]=the_IlIIIIIlIlIIlIl[#("N9Q")]+the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("PFGz")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("f0")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Bh")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("klu")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("PV")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("ea6")]][the_IlIIIIIlIlIIlIl[#("J1SR")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("6G")]]=the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{148;261;658;228};{179;392;549;13};}];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("SQ")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Gs")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("bBn")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("19")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("LvH")]][the_IlIIIIIlIlIIlIl[#("C4IH")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("g7")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Adi")]][the_IlIIIIIlIlIIlIl[#("iDT3")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{{46;673;685;102};"1 + 1 = 111";{955;714;250;231};}]]/the_IlIIIIIlIlIIlIl[#("DcdA")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("U4")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("X4V")]]+the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";{124;256;738;218};{29;804;353;210};}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Oj")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("Bqd")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("G8")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("8PJ")]][the_IlIIIIIlIlIIlIl[#("e0F9")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Ki")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("CZp")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("iG")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{178;464;711;974};{432;730;263;577};}]][the_IlIIIIIlIlIIlIl[#("pysN")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("59")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("a6G")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("gR")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("DG1")]]/the_IlIIIIIlIlIIlIl[#("AFfB")];end;elseif the_IlIllIIIIl>#("nQ2t1NghpmrINOb4ZSCtMzt7NDb2ozIcrbY0Mhn05W8xuXxt34P")then the_lIIlIIlllIl=the_IlIIIIIlIlIIlIl[#("cqv")];else local the_IIIIllIlIlIIIlIIlIlIIlI;local the_IlIllIIIIl;local the_IlIlIlIlIllIIlllIIlIl;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("5N")]]=the_IlIIIIIlIlIIlIl[#("lgo")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIlIlIllIIlllIIlIl=the_IlIIIIIlIlIIlIl[#("aE")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIlIlIlIllIIlllIIlIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIlIlIlIllIIlllIIlIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("39")]]=the_IlIIIIIlIlIIlIl[#("6FC")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("xYk")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("UW")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("05")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("WxS")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("5s")]]=the_IlIIIIIlIlIIlIl[#("XfU")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("pm")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("MRZ")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("yEV")];the_IIIIllIlIlIIIlIIlIlIIlI=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]for the_IlIIIIIlIlIIlIl=the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("0U4i")]do the_IIIIllIlIlIIIlIIlIlIIlI=the_IIIIllIlIlIIIlIIlIlIIlI..the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl];end;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("e5")]]=the_IIIIllIlIlIIIlIIlIlIIlI;the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("ET")]][the_IlIIIIIlIlIIlIl[#("A6v")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("QVIf")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("ik")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("s48")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIlIlIllIIlllIIlIl=the_IlIIIIIlIlIIlIl[#("iI")];the_IlIllIIIIl=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("KGg")]];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIlIlIlIllIIlllIIlIl+1]=the_IlIllIIIIl;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIlIlIlIllIIlllIIlIl]=the_IlIllIIIIl[the_IlIIIIIlIlIIlIl[#("MCft")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIlIlIllIIlllIIlIl=the_IlIIIIIlIlIIlIl[#("HY")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIlIlIlIllIIlllIIlIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIlIlIlIllIIlllIIlIl+1])end;elseif the_IlIllIIIIl<=#("FMPYx5RyMo21OopLZkrSFLyZA6MZgR9uT1IPxaERAZnR3gTgHVFTM7l3")then if the_IlIllIIIIl<=#("ZyBs2r5pIiWRKoZRLrQyQ6tmGrumqSVQOBHMdyIHsCv86z7HPbaQFG")then if the_IlIllIIIIl==#("3enXK7S80xfdiSmNnUienKuqhuYHoRfki3NHZL8JKDGM1vYYCzX5v")then local the_IlIllIIIIl;the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("gO")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("JdU")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("4M")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("O0")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("WKG")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("1r")]]();the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("7a")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#{{806;292;153;488};"1 + 1 = 111";"1 + 1 = 111";}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("F0")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("GEd")]][the_IlIIIIIlIlIIlIl[#("5432")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("d1")]]=the_IlIIIIIlIlIIlIl[#("qyx")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("oG")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("UHu")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("pU")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("CDN")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("yva")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("5L")]];else local the_IlIllIIIIl;local the_IlIlIlIlIllIIlllIIlIl;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("qt")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("85s")]][the_IlIIIIIlIlIIlIl[#("MzJO")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("JY")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("7Mf")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Rv")]]={};the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("TA")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("7Pf")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{{679;747;675;646};"1 + 1 = 111";}]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Mzl")]][the_IlIIIIIlIlIIlIl[#("VjfG")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];for the_IlIIIIIlIlIIlIl=the_IlIIIIIlIlIIlIl[#("2k")],the_IlIIIIIlIlIIlIl[#("1Ff")]do the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl]=nil;end;the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIlIlIllIIlllIIlIl=the_IlIIIIIlIlIIlIl[#("rO")];the_IlIllIIIIl=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIlIlIlIllIIlllIIlIl];for the_IlIIIIIlIlIIlIl=the_IlIlIlIlIllIIlllIIlIl+1,the_IlIIIIIlIlIIlIl[#("iOe")]do the_IlIIllIIIlIIlIIlIllIIIllI(the_IlIllIIIIl,the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl])end;end;elseif the_IlIllIIIIl>#("tsU7QojlUiq45peQYNVJFUeTzVH9e04jYRJtX24TAySxu6BITWKjkW6")then local the_IIIIIIIlIIllllIIl;local the_IlIllIIIIl;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("fD")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#{{237;960;779;119};"1 + 1 = 111";{920;693;544;569};}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("L1")];the_IIIIIIIlIIllllIIl=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("7OS")]];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1]=the_IIIIIIIlIIllllIIl;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IIIIIIIlIIllllIIl[the_IlIIIIIlIlIIlIl[#{{584;341;476;662};{180;216;886;83};"1 + 1 = 111";{55;416;887;774};}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("4P")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("pd8")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("lT")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("lFH")]][the_IlIIIIIlIlIIlIl[#("UTYJ")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("hK")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("sJF")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Ez")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";{407;27;511;248};}]][the_IlIIIIIlIlIIlIl[#("srAb")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("bX")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{658;274;493;63};{511;437;924;251};}]]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Yr9i")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("3u")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("qYi")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("NB")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("0q0")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("tx")];do return the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("1WZ")]))end;the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("NN")];do return the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl,the_IIIIllIlIlIIIlIIlIlIIlI)end;the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];do return end;else local the_IlIlIlIlIllIIlllIIlIl;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Hk")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("7N2")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("j8")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("ALO")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("HW")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("8B3")]][the_IlIIIIIlIlIIlIl[#("FLmt")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("TH")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("i9L")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("ZQ")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("FRc")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("NYm")]]/the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("BlqT")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIlIlIllIIlllIIlIl=the_IlIIIIIlIlIIlIl[#("8q")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIlIlIlIllIIlllIIlIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIlIlIlIllIIlllIIlIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIlIlIlIllIIlllIIlIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("mm")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("5OU")]]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("GPcb")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("F7")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("O2W")]]-the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{{363;142;479;616};{381;483;647;188};{342;418;9;568};{757;519;462;371};}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("Tkh")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("oK")]];end;elseif the_IlIllIIIIl<=#("naI4Sjh4ohfnRV25ScjgcSzDu8qrpU9bUafWuabpqYim0m184PCiN0HGMf")then if the_IlIllIIIIl==#("T3ZPEhdDRPfKRa3ZnJlMihrxKr1z4DKjpCsvBiOfWTksYeUhTbs7BDALM")then local the_IIIllIlIIIlIllIlIIIIIl;local the_lIlIIIllI;local the_lIlllIlIIllllIIllI,the_llIlIIIllllllllIIIlllll;local the_IlIllIIIIl;the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("rI")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=the_IlIIIIIlIlIIlIl[#("tqN")]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("mguT")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("hu")]]=the_IlIIIIIlIlIIlIl[#("jO5")]+the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("u9Iv")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("oE")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{{510;868;724;385};"1 + 1 = 111";}]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("4Il")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("VX")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Quj")]][the_IlIIIIIlIlIIlIl[#("Dk7e")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("01")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("TPR")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("XO")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("BBN")]][the_IlIIIIIlIlIIlIl[#("xUsp")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("gu")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("0TS")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("SO")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";{559;217;455;616};}]]/the_IlIIIIIlIlIIlIl[#("JCef")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";}]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("AB")]]=the_IlIIIIIlIlIIlIl[#("1Wm")]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Npya")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("LH")]]=the_IlIIIIIlIlIIlIl[#("exa")]+the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("9n4y")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";}]the_lIlllIlIIllllIIllI,the_llIlIIIllllllllIIIlllll=the_IIlIIlIIIlllllllllIIlIII(the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1]))the_IIIIllIlIlIIIlIIlIlIIlI=the_llIlIIIllllllllIIIlllll+the_IlIllIIIIl-1 the_lIlIIIllI=0;for the_IlIIIIIlIlIIlIl=the_IlIllIIIIl,the_IIIIllIlIlIIIlIIlIlIIlI do the_lIlIIIllI=the_lIlIIIllI+1;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl]=the_lIlllIlIIllllIIllI[the_lIlIIIllI];end;the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{111;267;271;142};}]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IIIIllIlIlIIIlIIlIlIIlI))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Zz")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("3xI")]]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("yqEF")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{66;333;489;179};}]]=the_IlIIIIIlIlIIlIl[#("C3o")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("Qz")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("TMX")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("rF")]][the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{587;135;135;715};"1 + 1 = 111";}]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("BN4i")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Tl")]]=the_IIIIIIIlIIllllIIl[the_IlIIIIIlIlIIlIl[#("N0Z")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("CA")]]=the_IIIIIIIlIIllllIIl[the_IlIIIIIlIlIIlIl[#("50l")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("AT")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("So9")]][the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{562;905;358;46};{196;991;871;823};"1 + 1 = 111";}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("Yy")];the_IIIllIlIIIlIllIlIIIIIl=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("i4f")]];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1]=the_IIIllIlIIIlIllIlIIIIIl;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IIIllIlIIIlIllIlIIIIIl[the_IlIIIIIlIlIIlIl[#("5GYp")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Yj")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("PTp")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Om")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{{668;373;901;101};"1 + 1 = 111";"1 + 1 = 111";}]][the_IlIIIIIlIlIIlIl[#("Ucof")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("6B")]]=the_IlIIIIIlIlIIlIl[#("EAv")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Kr")]]=the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{937;781;438;349};"1 + 1 = 111";}];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("5y")]]=the_IlIIIIIlIlIIlIl[#("ytL")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("0Z")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("HJc")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Eh")]]=the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{987;847;48;553};"1 + 1 = 111";}];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("f2")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("3vk")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Zk")]][the_IlIIIIIlIlIIlIl[#("HBz")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("fLHU")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("x6")]]=the_IIIIIIIlIIllllIIl[the_IlIIIIIlIlIIlIl[#("Uua")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{756;8;933;167};}]]=the_IIIIIIIlIIllllIIl[the_IlIIIIIlIlIIlIl[#("G27")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Ei8")]][the_IlIIIIIlIlIIlIl[#("oqJZ")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("3c")];the_IIIllIlIIIlIllIlIIIIIl=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("UhF")]];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1]=the_IIIllIlIIIlIllIlIIIIIl;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IIIllIlIIIlIllIlIIIIIl[the_IlIIIIIlIlIIlIl[#("gpYX")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("ku")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("t1Z")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{{362;564;586;637};"1 + 1 = 111";}]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Rm2")]][the_IlIIIIIlIlIIlIl[#("5I6e")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("tG")]]=the_IlIIIIIlIlIIlIl[#("Mgd")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{{871;57;393;42};"1 + 1 = 111";}]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("oHF")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("st")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("yUi")]][the_IlIIIIIlIlIIlIl[#("4q5y")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("YT")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";{348;724;448;140};}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("5Y")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("LGI")]]/the_IlIIIIIlIlIIlIl[#("EAOm")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";}]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("49")]]=the_IlIIIIIlIlIIlIl[#{{711;641;31;532};{789;188;685;935};"1 + 1 = 111";}]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("ubyt")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("6O")]]=the_IlIIIIIlIlIIlIl[#("0vF")]+the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("ZgjI")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("s7")]]=the_IlIIIIIlIlIIlIl[#("Msd")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("Rt")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("DhU")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("1g")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("YZr")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("CG")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("O0I")]][the_IlIIIIIlIlIIlIl[#("eiir")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("3L")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#{{987;397;881;82};"1 + 1 = 111";"1 + 1 = 111";}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("gr")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]][the_IlIIIIIlIlIIlIl[#("PRb2")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("TE")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("OZ1")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("s7")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Nqq")]][the_IlIIIIIlIlIIlIl[#("mgkW")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("jI")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("c0G")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Je")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{{238;228;820;624};"1 + 1 = 111";"1 + 1 = 111";}]]/the_IlIIIIIlIlIIlIl[#("YQid")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("Ox")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("iD")]]=the_IlIIIIIlIlIIlIl[#("Fs0")]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("ZMvv")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("gM")]]=the_IlIIIIIlIlIIlIl[#("oMz")]+the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("e1EB")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{28;884;4;887};}]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("IE")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("lDX")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("zT")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("1BF")]][the_IlIIIIIlIlIIlIl[#("Yyyr")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("hY")]]=the_IlIIIIIlIlIIlIl[#("X22")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("Jm")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("f9")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("q1V")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("KH")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Jz4")]][the_IlIIIIIlIlIIlIl[#("VhN1")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("as")]]=the_IlIIIIIlIlIIlIl[#("uCt")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{550;213;509;112};}]the_lIlllIlIIllllIIllI,the_llIlIIIllllllllIIIlllll=the_IIlIIlIIIlllllllllIIlIII(the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1]))the_IIIIllIlIlIIIlIIlIlIIlI=the_llIlIIIllllllllIIIlllll+the_IlIllIIIIl-1 the_lIlIIIllI=0;for the_IlIIIIIlIlIIlIl=the_IlIllIIIIl,the_IIIIllIlIlIIIlIIlIlIIlI do the_lIlIIIllI=the_lIlIIIllI+1;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl]=the_lIlllIlIIllllIIllI[the_lIlIIIllI];end;the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("WU")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IIIIllIlIlIIIlIIlIlIIlI))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Va")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("ZtJ")]]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{{561;971;849;633};"1 + 1 = 111";{599;236;202;341};{968;684;689;904};}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Ro")]]=the_IlIIIIIlIlIIlIl[#("tT5")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("jV")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{946;512;854;175};{844;446;826;945};}]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("5V")]][the_IlIIIIIlIlIIlIl[#("E1b")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("o1Md")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("YB")]]=the_IIIIIIIlIIllllIIl[the_IlIIIIIlIlIIlIl[#("ver")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Be")]]=the_IIIIIIIlIIllllIIl[the_IlIIIIIlIlIIlIl[#("T85")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Sd")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Hsm")]][the_IlIIIIIlIlIIlIl[#("i8gC")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("MH")];the_IIIllIlIIIlIllIlIIIIIl=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("RM0")]];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1]=the_IIIllIlIIIlIllIlIIIIIl;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IIIllIlIIIlIllIlIIIIIl[the_IlIIIIIlIlIIlIl[#("DXXC")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("jzK")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("L6")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("2Nh")]][the_IlIIIIIlIlIIlIl[#("XnLt")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("jN")]]=the_IlIIIIIlIlIIlIl[#{{523;779;543;643};{717;931;334;729};"1 + 1 = 111";}];else the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("kLd")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("0x")]];end;elseif the_IlIllIIIIl==#("fmqPJnf5upSIyf4gZz78IFIUP3jNTWbRU8cCYhk6n3UFzlNmctOaON4LOH9")then the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("b2")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("xsC")]]+the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("ZS3I")]];else local the_lIlIIIllI;local the_lIlllIlIIllllIIllI,the_llIlIIIllllllllIIIlllll;local the_IIIllIlIIIlIllIlIIIIIl;local the_IlIllIIIIl;the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("jGP")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("M6")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("GP")]]=the_IIIIIIIlIIllllIIl[the_IlIIIIIlIlIIlIl[#("y5t")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("5l")]]=the_IIIIIIIlIIllllIIl[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{123;860;206;789};"1 + 1 = 111";}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Vk")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("07a")]][the_IlIIIIIlIlIIlIl[#("Qdrb")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("9d")];the_IIIllIlIIIlIllIlIIIIIl=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";{710;321;500;151};}]];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1]=the_IIIllIlIIIlIllIlIIIIIl;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IIIllIlIIIlIllIlIIIIIl[the_IlIIIIIlIlIIlIl[#("BZze")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Oi")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("6n0")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("LB")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("VvD")]][the_IlIIIIIlIlIIlIl[#("npA2")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("3J")]]=the_IlIIIIIlIlIIlIl[#("oGE")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("XV")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("kKK")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("18")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("UTj")]][the_IlIIIIIlIlIIlIl[#("0q6u")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("shJ")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("lf")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("FyT")]]/the_IlIIIIIlIlIIlIl[#("8ukz")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("og")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("ru")]]=the_IlIIIIIlIlIIlIl[#("L9B")]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("JXCH")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("WZ")]]=the_IlIIIIIlIlIIlIl[#("KTs")]+the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("H7eJ")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("7k")]]=the_IlIIIIIlIlIIlIl[#("QVf")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("rl")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";{904;71;618;143};}]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("uB")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("M6O")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("nT")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("xxt")]][the_IlIIIIIlIlIIlIl[#("fQeh")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("AS")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("uVz")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Oe")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("O9z")]][the_IlIIIIIlIlIIlIl[#("NzT1")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Ws")]]=the_IlIIIIIlIlIIlIl[#("Mou")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("GX")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("KA")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("fLY")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("qN7")]][the_IlIIIIIlIlIIlIl[#("HXT5")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Dh")]]=the_IlIIIIIlIlIIlIl[#("OhF")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("c0")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("JK")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("vJp")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("1i")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("TD0")]][the_IlIIIIIlIlIIlIl[#("IVIV")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("V8")]]=the_IlIIIIIlIlIIlIl[#("P3I")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("UZ")]the_lIlllIlIIllllIIllI,the_llIlIIIllllllllIIIlllll=the_IIlIIlIIIlllllllllIIlIII(the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1]))the_IIIIllIlIlIIIlIIlIlIIlI=the_llIlIIIllllllllIIIlllll+the_IlIllIIIIl-1 the_lIlIIIllI=0;for the_IlIIIIIlIlIIlIl=the_IlIllIIIIl,the_IIIIllIlIlIIIlIIlIlIIlI do the_lIlIIIllI=the_lIlIIIllI+1;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl]=the_lIlllIlIIllllIIllI[the_lIlIIIllI];end;the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("8O")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IIIIllIlIlIIIlIIlIlIIlI))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("e9")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("uEs")]]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("v23X")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("9B")]]=the_IlIIIIIlIlIIlIl[#("xRA")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("MR")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("dG4")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("kT")]][the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";{684;335;928;614};}]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Nx1M")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("uU")]]=the_IIIIIIIlIIllllIIl[the_IlIIIIIlIlIIlIl[#("zu3")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Nx")]]=the_IIIIIIIlIIllllIIl[the_IlIIIIIlIlIIlIl[#("qEE")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("rf")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{{795;797;293;533};{833;338;371;664};"1 + 1 = 111";}]][the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";{716;891;88;608};{395;920;759;59};}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("B5")];the_IIIllIlIIIlIllIlIIIIIl=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("ygK")]];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1]=the_IIIllIlIIIlIllIlIIIIIl;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IIIllIlIIIlIllIlIIIIIl[the_IlIIIIIlIlIIlIl[#("jmYY")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("YV")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("d8f")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("LZ")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("uqN")]][the_IlIIIIIlIlIIlIl[#("KLsj")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("PN")]]=the_IlIIIIIlIlIIlIl[#("Sq0")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("0y")]]=the_IlIIIIIlIlIIlIl[#("Ooz")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("nc")]]=the_IlIIIIIlIlIIlIl[#("EgY")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("n7")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("9uI")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("bQ")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("9n6")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("0B")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("cp0")]][the_IlIIIIIlIlIIlIl[#("VeH7")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Vh")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("5T6")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("FQ")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("hlA")]][the_IlIIIIIlIlIIlIl[#("Vzsd")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("WN")]]=the_IlIIIIIlIlIIlIl[#("S7F")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";}]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Jb")]]=the_IlIIIIIlIlIIlIl[#("NOB")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("lG")]]=the_IlIIIIIlIlIIlIl[#("CjP")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";}]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("som")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("EA")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("BpX")]]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("mXqy")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Dd")]]=the_IlIIIIIlIlIIlIl[#("tg3")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("MA")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("B34")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("U7")]][the_IlIIIIIlIlIIlIl[#("roy")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("pHgX")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("KZ")]]=the_IIIIIIIlIIllllIIl[the_IlIIIIIlIlIIlIl[#("QQN")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("hj")]]=the_IIIIIIIlIIllllIIl[the_IlIIIIIlIlIIlIl[#{{254;589;967;184};"1 + 1 = 111";"1 + 1 = 111";}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("gd")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("WCd")]][the_IlIIIIIlIlIIlIl[#("v6TM")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("c1")];the_IIIllIlIIIlIllIlIIIIIl=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("LIP")]];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1]=the_IIIllIlIIIlIllIlIIIIIl;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IIIllIlIIIlIllIlIIIIIl[the_IlIIIIIlIlIIlIl[#("v6UM")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("TP")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("GnT")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("aZ")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("ysY")]][the_IlIIIIIlIlIIlIl[#("UKUg")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("tz")]]=the_IlIIIIIlIlIIlIl[#("dcJ")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("1r")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("TFm")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("ic")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("WvM")]][the_IlIIIIIlIlIIlIl[#("J04T")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Bj")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("Mk3")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("ZM")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("cCu")]]/the_IlIIIIIlIlIIlIl[#("03YD")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("v8")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("ke")]]=the_IlIIIIIlIlIIlIl[#("da0")]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("x5B5")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("iu")]]=the_IlIIIIIlIlIIlIl[#("onA")]-the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("dEFj")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("MB")]]=the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";{373;327;348;507};}];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("DU")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("2c8")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("lM")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("9DM")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("fB")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("p0h")]][the_IlIIIIIlIlIIlIl[#("Zv5I")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("yT")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("6ce")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("98")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("u00")]][the_IlIIIIIlIlIIlIl[#("YPQh")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("tQ")]]=the_IlIIIIIlIlIIlIl[#("76I")];end;elseif the_IlIllIIIIl<=#("dDlJnbXzcDrRoaVPVduEp6KzhbcheCXrhF2VRkqyznjJc6VN2o0LlGAg2XCm8QuLP9KUh98KW6fcWbxkpzo0MmfMeW3")then if the_IlIllIIIIl<=#("TdzS3J4dxbF2ppYpBxt0Bq7JBE9D37Pvge1SHxingsYo3xKvy0lSCcDDgZrzKCjzvjWlzgSengU")then if the_IlIllIIIIl<=#("CSQe3NecW74dLyLSeUOPjz2UKz7rigEusvazjnF6xgNyoTKaFa9ECe7dZ5EFQX4PEJV")then if the_IlIllIIIIl<=#("ymI0oRrcWFG1Z7Wih93ny7JoUaqKm84Q7uMrCjpUW5ruANQSaWIEQH1AOtgnBSZ")then if the_IlIllIIIIl<=#("L03EuFQ7UiCDQnZguIJBAA9BEmNidbtdfEUKTlyGfKUIfzUBE932jzyk0Dai1")then the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Hn")]]=the_lIlllIlIIllllIIllI(the_lllIIIIlIIIIIlIllll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{470;802;101;92};"1 + 1 = 111";}]],nil,the_IlIlllIIIlllIlIIlIl);elseif the_IlIllIIIIl>#("4SYyxmDpxikcuZPCueCmOdiB4RfKTqlpOJQcTSbI7oMUSgeIGyh5QP20JyEQg3")then the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("fhS")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Mx")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("U0")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("BnT")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Yk")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("lg3")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("ZeM")]]+the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Ndky")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("2L6")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("jQ")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("no")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("jeU")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];if(the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("OT")]]~=the_IlIIIIIlIlIIlIl[#("ANyF")])then the_lIIlIIlllIl=the_lIIlIIlllIl+1;else the_lIIlIIlllIl=the_IlIIIIIlIlIIlIl[#("O9A")];end;else local the_lIlIIIllI;local the_llIlIIIllllllllIIIlllll,the_lIlllIlIIllllIIllI;local the_IIIllIlIIIlIllIlIIIIIl;local the_IlIllIIIIl;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Q7")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("F5L")]][the_IlIIIIIlIlIIlIl[#("CiqF")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Ok")]]=the_IlIIIIIlIlIIlIl[#("8gk")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{297;219;551;819};}]]=the_IlIIIIIlIlIIlIl[#("h0Y")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Hf")]]=the_IlIIIIIlIlIIlIl[#("sFj")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("t1")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("7rg")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("SC")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("tuk")]]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";{927;940;905;48};{504;617;516;681};}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Yr")]]=the_IlIIIIIlIlIIlIl[#("Tsx")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("F3")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{125;153;675;490};"1 + 1 = 111";}]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("R0")]][the_IlIIIIIlIlIIlIl[#("YXe")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("peKV")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Yg")]]=the_IIIIIIIlIIllllIIl[the_IlIIIIIlIlIIlIl[#("GKK")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("v2")]]=the_IIIIIIIlIIllllIIl[the_IlIIIIIlIlIIlIl[#("3Df")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("d6")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{{207;947;885;323};"1 + 1 = 111";{87;953;309;772};}]][the_IlIIIIIlIlIIlIl[#("n4vl")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("Bf")];the_IIIllIlIIIlIllIlIIIIIl=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("4GR")]];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1]=the_IIIllIlIIIlIllIlIIIIIl;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IIIllIlIIIlIllIlIIIIIl[the_IlIIIIIlIlIIlIl[#("kmQQ")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("QI")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("3GM")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("z8")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("VaK")]][the_IlIIIIIlIlIIlIl[#("sVcL")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("N0")]]=the_IlIIIIIlIlIIlIl[#("UiV")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("6F")]]=the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";{446;169;178;728};}];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("WZ")]]=the_IlIIIIIlIlIIlIl[#("A3S")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("6l")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("Rya")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{{142;823;559;104};{79;480;134;104};}]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("piY")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("WB")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("BSg")]][the_IlIIIIIlIlIIlIl[#("Agaa")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("nk")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("xqI")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Sp")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("k4F")]][the_IlIIIIIlIlIIlIl[#("ReAF")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("7q")]]=the_IlIIIIIlIlIIlIl[#("a58")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("gi")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("3f")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("SaY")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("sd")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("uxn")]][the_IlIIIIIlIlIIlIl[#("s07p")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{435;601;794;115};}]]=the_IlIIIIIlIlIIlIl[#{{20;151;353;360};"1 + 1 = 111";"1 + 1 = 111";}];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("NK")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{{304;898;285;490};"1 + 1 = 111";}]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("GV5")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("uP")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("leo")]][the_IlIIIIIlIlIIlIl[#("JEAo")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("v3")]]=the_IlIIIIIlIlIIlIl[#{{130;945;247;739};{938;769;607;843};{954;442;461;885};}];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("Ok")]the_llIlIIIllllllllIIIlllll,the_lIlllIlIIllllIIllI=the_IIlIIlIIIlllllllllIIlIII(the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1]))the_IIIIllIlIlIIIlIIlIlIIlI=the_lIlllIlIIllllIIllI+the_IlIllIIIIl-1 the_lIlIIIllI=0;for the_IlIIIIIlIlIIlIl=the_IlIllIIIIl,the_IIIIllIlIlIIIlIIlIlIIlI do the_lIlIIIllI=the_lIlIIIllI+1;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl]=the_llIlIIIllllllllIIIlllll[the_lIlIIIllI];end;the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("85")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IIIIllIlIlIIIlIIlIlIIlI))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("48")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("ZLu")]]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Fqma")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("CP")]]=the_IlIIIIIlIlIIlIl[#("ymv")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("Tc")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("zpi")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";}]][the_IlIIIIIlIlIIlIl[#("tzj")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("pCLb")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("tr")]]=the_IIIIIIIlIIllllIIl[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{779;996;925;920};{54;162;339;600};}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("gL")]]=the_IIIIIIIlIIllllIIl[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{262;754;715;296};{447;611;576;995};}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("jQ")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("92t")]][the_IlIIIIIlIlIIlIl[#("PDmo")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("kN")];the_IIIllIlIIIlIllIlIIIIIl=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("R6S")]];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1]=the_IIIllIlIIIlIllIlIIIIIl;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IIIllIlIIIlIllIlIIIIIl[the_IlIIIIIlIlIIlIl[#("jdJ1")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("mU")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("s1J")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Lo")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("bSN")]][the_IlIIIIIlIlIIlIl[#("iE1d")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("hu")]]=the_IlIIIIIlIlIIlIl[#("82g")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("AK")]]=the_IlIIIIIlIlIIlIl[#("NQr")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("yk")]]=the_IlIIIIIlIlIIlIl[#("5kI")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("xt")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("ZPu")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("Y5H")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("pc")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("3Ae")]][the_IlIIIIIlIlIIlIl[#("uoAi")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("JI")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("Ht5")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("lZ")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("ZAc")]][the_IlIIIIIlIlIIlIl[#("ZvYF")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("CT")]]=the_IlIIIIIlIlIIlIl[#("CDe")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("Mp")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Ch")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("6GX")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("kc")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("LGa")]][the_IlIIIIIlIlIIlIl[#("i39c")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("U3")]]=the_IlIIIIIlIlIIlIl[#("zW9")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("PT")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("RW")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("HW5")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("cG")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("kiR")]][the_IlIIIIIlIlIIlIl[#("oEzV")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("A6")]]=the_IlIIIIIlIlIIlIl[#("XOT")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("Oc")]the_llIlIIIllllllllIIIlllll,the_lIlllIlIIllllIIllI=the_IIlIIlIIIlllllllllIIlIII(the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1]))the_IIIIllIlIlIIIlIIlIlIIlI=the_lIlllIlIIllllIIllI+the_IlIllIIIIl-1 the_lIlIIIllI=0;for the_IlIIIIIlIlIIlIl=the_IlIllIIIIl,the_IIIIllIlIlIIIlIIlIlIIlI do the_lIlIIIllI=the_lIlIIIllI+1;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl]=the_llIlIIIllllllllIIIlllll[the_lIlIIIllI];end;the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("u5")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IIIIllIlIlIIIlIIlIlIIlI))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("37")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("UZ7")]]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("ZOTY")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("HV")]]=the_IlIIIIIlIlIIlIl[#("hWE")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("95")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("LL0")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("rD")]][the_IlIIIIIlIlIIlIl[#("hn4")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("F4IV")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("dG")]]=the_IIIIIIIlIIllllIIl[the_IlIIIIIlIlIIlIl[#("zIc")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("33")]]=the_IIIIIIIlIIllllIIl[the_IlIIIIIlIlIIlIl[#("ts5")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("jF")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{651;601;150;24};"1 + 1 = 111";}]][the_IlIIIIIlIlIIlIl[#("aziZ")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#{{87;357;851;28};"1 + 1 = 111";}];the_IIIllIlIIIlIllIlIIIIIl=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("WG6")]];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1]=the_IIIllIlIIIlIllIlIIIIIl;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IIIllIlIIIlIllIlIIIIIl[the_IlIIIIIlIlIIlIl[#("acCg")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("4m")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("XEI")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("mX")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("JFz")]][the_IlIIIIIlIlIIlIl[#("tOSp")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{{487;536;152;842};{43;162;986;850};}]]=the_IlIIIIIlIlIIlIl[#("rOb")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("M0")]]=the_IlIIIIIlIlIIlIl[#("6N8")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("1i")]]=the_IlIIIIIlIlIIlIl[#("nui")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("ER")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("L79")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("kV")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("34b")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("kkK")]][the_IlIIIIIlIlIIlIl[#("peHn")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("JU")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];end;elseif the_IlIllIIIIl<=#("g74yWjNTNc4oACyTXNIevipK9QZEunvBeTGXXSry3OF2VADzkPRcJZk7RuzftiyzR")then if the_IlIllIIIIl==#("jR5L5eujkROyYJmBsQHt2oJJgDtleUqflrqWDKTMSzODstGZ330R1xM4hxEDUifB")then local the_IlIllIIIIl;local the_IlIlllIIIlllIlIIlIl;the_IlIlllIIIlllIlIIlIl=the_IlIIIIIlIlIIlIl[#("2l")];the_IlIllIIIIl=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("PjY")]];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIlllIIIlllIlIIlIl+1]=the_IlIllIIIIl;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIlllIIIlllIlIIlIl]=the_IlIllIIIIl[the_IlIIIIIlIlIIlIl[#("PfgM")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Eb")]]=the_IlIIIIIlIlIIlIl[#("jAD")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlllIIIlllIlIIlIl=the_IlIIIIIlIlIIlIl[#("ON")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIlllIIIlllIlIIlIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIlllIIIlllIlIIlIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIlllIIIlllIlIIlIl+1,the_IlIIIIIlIlIIlIl[#("q9g")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlllIIIlllIlIIlIl=the_IlIIIIIlIlIIlIl[#("NW")];the_IlIllIIIIl=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("7Of")]];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIlllIIIlllIlIIlIl+1]=the_IlIllIIIIl;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIlllIIIlllIlIIlIl]=the_IlIllIIIIl[the_IlIIIIIlIlIIlIl[#("QFMV")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlllIIIlllIlIIlIl=the_IlIIIIIlIlIIlIl[#("gl")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIlllIIIlllIlIIlIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIlllIIIlllIlIIlIl+1])else local the_lIlIIIllI;local the_lIlllIlIIllllIIllI,the_llIlIIIllllllllIIIlllll;local the_IIIllIlIIIlIllIlIIIIIl;local the_IlIllIIIIl;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("bC")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("yQR")]][the_IlIIIIIlIlIIlIl[#("5XdH")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("mc")]]=the_IlIIIIIlIlIIlIl[#("Eg1")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("1P")]]=the_IlIIIIIlIlIIlIl[#("EnC")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("kS")]]=the_IlIIIIIlIlIIlIl[#("d6r")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("kK")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("iur")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("2N")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";{275;328;958;853};}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{{923;38;684;673};"1 + 1 = 111";}]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Ftk")]][the_IlIIIIIlIlIIlIl[#("UVkz")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Qi")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("Ykn")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("yn")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("eiR")]][the_IlIIIIIlIlIIlIl[#("mcs1")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("z1")]]=the_IlIIIIIlIlIIlIl[#("1Oj")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("Ud")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("zr")]]=the_IlIIIIIlIlIIlIl[#("rjA")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Ux")]]=the_IlIIIIIlIlIIlIl[#("8uM")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("yb")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("SSS")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Ms")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("vb5")]]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("l5EF")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("4D")]]=the_IlIIIIIlIlIIlIl[#("KFu")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#{{822;768;851;564};{663;375;885;688};}]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("560")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("el")]][the_IlIIIIIlIlIIlIl[#("94d")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("AxtH")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("9u")]]=the_IIIIIIIlIIllllIIl[the_IlIIIIIlIlIIlIl[#("psH")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("1Z")]]=the_IIIIIIIlIIllllIIl[the_IlIIIIIlIlIIlIl[#("lSW")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("qD")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Ykm")]][the_IlIIIIIlIlIIlIl[#("5sGD")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("2B")];the_IIIllIlIIIlIllIlIIIIIl=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("S1m")]];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1]=the_IIIllIlIIIlIllIlIIIIIl;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IIIllIlIIIlIllIlIIIIIl[the_IlIIIIIlIlIIlIl[#("FAQQ")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("dV")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("6i")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]][the_IlIIIIIlIlIIlIl[#("GLlq")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("uH")]]=the_IlIIIIIlIlIIlIl[#("s9N")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("id")]]=the_IlIIIIIlIlIIlIl[#("tg5")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("GD")]]=the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{32;913;71;576};{362;368;385;811};}];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("CQ")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("lmC")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("VQ")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("pJu")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("MA")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("slC")]][the_IlIIIIIlIlIIlIl[#("E3iL")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("L2")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#{{381;114;66;727};{415;419;308;485};{30;383;207;861};}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("3h")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("TaS")]][the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{964;623;907;806};"1 + 1 = 111";"1 + 1 = 111";}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("ST")]]=the_IlIIIIIlIlIIlIl[#("4kl")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("O0")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("VW")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("fBb")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("2U")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("oi1")]][the_IlIIIIIlIlIIlIl[#("VbgN")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("W0")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#{{98;629;947;264};{526;693;502;757};{63;504;589;289};}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Eu")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("jHX")]][the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("eY")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("n8d")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Qh")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("IJL")]]/the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";{215;833;146;707};"1 + 1 = 111";}];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("WC")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("uv")]]=the_IlIIIIIlIlIIlIl[#("pHu")]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("WvN2")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("TB")]]=the_IlIIIIIlIlIIlIl[#("9xF")]-the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("KUn6")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("OB")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("62")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#{{501;456;533;77};"1 + 1 = 111";"1 + 1 = 111";}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("cQ")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("HMk")]][the_IlIIIIIlIlIIlIl[#("HoSE")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("H3")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("tBr")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("nZ")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("0Lo")]][the_IlIIIIIlIlIIlIl[#("iccr")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Ph")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("mdE")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("kZ")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("hdO")]]/the_IlIIIIIlIlIIlIl[#("EtcQ")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("Vb")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("h2")]]=the_IlIIIIIlIlIIlIl[#("0CD")]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("ce7m")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("vA")]]=the_IlIIIIIlIlIIlIl[#("YJb")]-the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("plRE")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("uj")]the_lIlllIlIIllllIIllI,the_llIlIIIllllllllIIIlllll=the_IIlIIlIIIlllllllllIIlIII(the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1]))the_IIIIllIlIlIIIlIIlIlIIlI=the_llIlIIIllllllllIIIlllll+the_IlIllIIIIl-1 the_lIlIIIllI=0;for the_IlIIIIIlIlIIlIl=the_IlIllIIIIl,the_IIIIllIlIlIIIlIIlIlIIlI do the_lIlIIIllI=the_lIlIIIllI+1;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl]=the_lIlllIlIIllllIIllI[the_lIlIIIllI];end;the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("oh")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IIIIllIlIlIIIlIIlIlIIlI))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("7H")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("s3n")]]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("qjy2")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Ub")]]=the_IlIIIIIlIlIIlIl[#("88g")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("2j")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("Y4X")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("ZI")]][the_IlIIIIIlIlIIlIl[#("qOT")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("aYj9")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("WQ")]]=the_IIIIIIIlIIllllIIl[the_IlIIIIIlIlIIlIl[#("rie")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("SJ")]]=the_IIIIIIIlIIllllIIl[the_IlIIIIIlIlIIlIl[#("3J3")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("f2")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Mb8")]][the_IlIIIIIlIlIIlIl[#("sVcH")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("RZ")];the_IIIllIlIIIlIllIlIIIIIl=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1]=the_IIIllIlIIIlIllIlIIIIIl;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IIIllIlIIIlIllIlIIIIIl[the_IlIIIIIlIlIIlIl[#("zmzo")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{614;128;962;404};}]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("z3O")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("El")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("yvm")]][the_IlIIIIIlIlIIlIl[#("Cs7C")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("M9")]]=the_IlIIIIIlIlIIlIl[#("62h")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("iS")]]=the_IlIIIIIlIlIIlIl[#("qHq")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("eB")]]=the_IlIIIIIlIlIIlIl[#("SZA")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("k3")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("FgG")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("ys")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("aqr")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("WJ")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("9bC")]][the_IlIIIIIlIlIIlIl[#("FXaZ")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("lN")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("JcS")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Si")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("9Xp")]][the_IlIIIIIlIlIIlIl[#("uInn")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("bp")]]=the_IlIIIIIlIlIIlIl[#("509")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("DG")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("1z")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{891;937;724;232};{181;68;249;720};}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Fm")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{{910;974;440;538};{898;405;700;298};"1 + 1 = 111";}]][the_IlIIIIIlIlIIlIl[#("8PkR")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("5O")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("dPp")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("ON")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("x46")]][the_IlIIIIIlIlIIlIl[#("Pjdm")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("X4")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("dpo")]];end;elseif the_IlIllIIIIl>#("IlHsB7S75LDLfpX6Fsl3JoYQvOffq1JtmcVh9GC5hU6WitchRHp03I1ty17W2NQdcj")then local the_IIIIllIlIlIIIlIIlIlIIlI;local the_IlIllIIIIl;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Ht")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("BXO")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("QC")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("Z3m")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Gr")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("JDU")]][the_IlIIIIIlIlIIlIl[#("qcAr")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("i4")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("gFs")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Ch")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Kml")]][the_IlIIIIIlIlIIlIl[#("dWC1")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("2M")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("Phr")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Ct")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("WA9")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("43")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{{300;658;491;232};"1 + 1 = 111";{336;279;298;886};}]]/the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("7m5r")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("U0")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("WI")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("LeK")]]*the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{809;259;391;969};"1 + 1 = 111";"1 + 1 = 111";}];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("D4")]]=the_IlIIIIIlIlIIlIl[#("bDp")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("qF")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("KCV")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("lW")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("4Ll")]][the_IlIIIIIlIlIIlIl[#("VHYh")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("LMH")]][the_IlIIIIIlIlIIlIl[#("UbSc")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("zv")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("dbp")]]-the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("rpUu")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("TD")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("FVC")]][the_IlIIIIIlIlIIlIl[#("DxTg")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("GW")];the_IIIIllIlIlIIIlIIlIlIIlI=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("3he")]];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1]=the_IIIIllIlIlIIIlIIlIlIIlI;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IIIIllIlIlIIIlIIlIlIIlI[the_IlIIIIIlIlIIlIl[#("Igxz")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("Jfd")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("FM")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{{943;834;109;600};"1 + 1 = 111";"1 + 1 = 111";}]][the_IlIIIIIlIlIIlIl[#("WU2M")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("A5")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("7tN")]][the_IlIIIIIlIlIIlIl[#("1ZCd")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("kU")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("vQ9")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("JQ")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("nhE")]][the_IlIIIIIlIlIIlIl[#("Toru")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Ml")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("LcL")]]*the_IlIIIIIlIlIIlIl[#("bez3")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("GQ")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("Zqi")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Zn")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("b09")]]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("RCK9")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("yF")]]=the_IlIIIIIlIlIIlIl[#("yub")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("Yb")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("Ii8")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Ap")]][the_IlIIIIIlIlIIlIl[#("rA3")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Zeop")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_lIIlIIlllIl=the_IlIIIIIlIlIIlIl[#("yb7")];else local the_IIIllIlIIIlIllIlIIIIIl;local the_llIlIIIllllllllIIIlllll,the_lIlllIlIIllllIIllI;local the_lIlIIIllI;local the_IlIllIIIIl;the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("Vpl")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("9o")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("NV")]]=the_IIIIIIIlIIllllIIl[the_IlIIIIIlIlIIlIl[#("NYY")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("HW")]]=the_IIIIIIIlIIllllIIl[the_IlIIIIIlIlIIlIl[#("EDn")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Dd")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Hdf")]][the_IlIIIIIlIlIIlIl[#("OkzQ")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("x0")];the_lIlIIIllI=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("tk0")]];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1]=the_lIlIIIllI;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_lIlIIIllI[the_IlIIIIIlIlIIlIl[#("ajfd")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("sg")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("3a")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";{790;905;882;996};}]][the_IlIIIIIlIlIIlIl[#("DYQ9")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("kz")]]=the_IlIIIIIlIlIIlIl[#("j1m")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Ng")]]=the_IlIIIIIlIlIIlIl[#("stF")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("2M")]]=the_IlIIIIIlIlIIlIl[#("PnZ")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("nV")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("GFv")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("8J")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#{{352;192;484;786};"1 + 1 = 111";"1 + 1 = 111";}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("B9")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("tWB")]][the_IlIIIIIlIlIIlIl[#("ofzh")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("U9")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("l6j")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("9v")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("MgN")]][the_IlIIIIIlIlIIlIl[#("DRE2")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("ya")]]=the_IlIIIIIlIlIIlIl[#{{354;531;677;435};"1 + 1 = 111";"1 + 1 = 111";}];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("1F")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("fH")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("pBu")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("PY")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("JuD")]][the_IlIIIIIlIlIIlIl[#("tj39")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("A9")]]=the_IlIIIIIlIlIIlIl[#("vrF")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("VO")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("6p")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("YJj")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("gz")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("jS1")]][the_IlIIIIIlIlIIlIl[#("XLlD")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("n1")]]=the_IlIIIIIlIlIIlIl[#("AaL")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("2i")]the_llIlIIIllllllllIIIlllll,the_lIlllIlIIllllIIllI=the_IIlIIlIIIlllllllllIIlIII(the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1]))the_IIIIllIlIlIIIlIIlIlIIlI=the_lIlllIlIIllllIIllI+the_IlIllIIIIl-1 the_IIIllIlIIIlIllIlIIIIIl=0;for the_IlIIIIIlIlIIlIl=the_IlIllIIIIl,the_IIIIllIlIlIIIlIIlIlIIlI do the_IIIllIlIIIlIllIlIIIIIl=the_IIIllIlIIIlIllIlIIIIIl+1;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl]=the_llIlIIIllllllllIIIlllll[the_IIIllIlIIIlIllIlIIIIIl];end;the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";}]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IIIIllIlIlIIIlIIlIlIIlI))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{{377;712;514;396};"1 + 1 = 111";}]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("j2j")]]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("JZLj")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Da")]]=the_IlIIIIIlIlIIlIl[#("LVR")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#{{159;12;851;889};"1 + 1 = 111";}]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("hTZ")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("os")]][the_IlIIIIIlIlIIlIl[#("8lQ")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("19vW")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Ma")]]=the_IIIIIIIlIIllllIIl[the_IlIIIIIlIlIIlIl[#("tt0")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("V9")]]=the_IIIIIIIlIIllllIIl[the_IlIIIIIlIlIIlIl[#("C8X")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Sd")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{{932;900;434;993};{122;965;197;479};{586;279;903;827};}]][the_IlIIIIIlIlIIlIl[#{{472;597;20;332};{677;237;905;872};"1 + 1 = 111";"1 + 1 = 111";}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("1q")];the_lIlIIIllI=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("W9m")]];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1]=the_lIlIIIllI;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_lIlIIIllI[the_IlIIIIIlIlIIlIl[#("UQg6")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("xN")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("Z8c")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Xn")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("k4G")]][the_IlIIIIIlIlIIlIl[#("6QG6")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("oC")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("KMd")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("XC")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{{512;493;258;345};"1 + 1 = 111";{561;701;489;70};}]][the_IlIIIIIlIlIIlIl[#("0qg4")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Is")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("b1e")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("e7")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("kQ4")]]/the_IlIIIIIlIlIIlIl[#("2Mmr")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("d2")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=the_IlIIIIIlIlIIlIl[#("egM")]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("hg")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("0Hf")]]/the_IlIIIIIlIlIIlIl[#("EvSZ")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("QF")]]=the_IlIIIIIlIlIIlIl[#("HKP")]+the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("JJEL")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("5g")]]=the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{529;756;649;951};{573;630;178;160};}];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Ff")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("Ypt")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Cl")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("5Ss")]][the_IlIIIIIlIlIIlIl[#("gEpv")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("0a")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("76h")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("iY")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("5fe")]]/the_IlIIIIIlIlIIlIl[#("3sPt")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("pm")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("SO")]]=the_IlIIIIIlIlIIlIl[#("d1L")]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("L3BD")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{{572;921;341;100};{208;449;933;480};}]]=the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{324;427;18;418};{447;368;521;390};}]-the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("rItz")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("F0")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{52;150;857;80};"1 + 1 = 111";}]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{{779;225;727;363};{414;497;162;884};}]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("9ZY")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("oI")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{{510;192;518;831};"1 + 1 = 111";"1 + 1 = 111";}]][the_IlIIIIIlIlIIlIl[#("pB7E")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("F2")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("vfp")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Vd")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("YtZ")]][the_IlIIIIIlIlIIlIl[#("K8Rf")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("pM")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("zkm")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("nn")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("GH6")]][the_IlIIIIIlIlIIlIl[#("rXFF")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("py")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("zUg")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("q1")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]]/the_IlIIIIIlIlIIlIl[#("yv1G")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("D8")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("c6")]]=the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("gY5a")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("J9")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("ig2")]]/the_IlIIIIIlIlIIlIl[#("L4oN")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("vO")]]=the_IlIIIIIlIlIIlIl[#("XkW")]+the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("aoeM")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("WL")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("3N")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("Mop")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("nE")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("40O")]][the_IlIIIIIlIlIIlIl[#("PHWS")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("EC")]]=the_IlIIIIIlIlIIlIl[#("ShO")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{95;995;297;592};}]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Hp")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("3HM")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("oH")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Iny")]][the_IlIIIIIlIlIIlIl[#("4MKb")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("nW")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#{{561;181;608;400};"1 + 1 = 111";"1 + 1 = 111";}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("hD")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("aQV")]][the_IlIIIIIlIlIIlIl[#("Xy6p")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("cm")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("r6N")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{{698;403;829;209};{862;807;856;258};}]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("U7P")]]/the_IlIIIIIlIlIIlIl[#("5RXq")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("nB")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Av")]]=the_IlIIIIIlIlIIlIl[#("Fik")]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("BG6M")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("0d")]]=the_IlIIIIIlIlIIlIl[#("N6r")]+the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{{797;597;929;16};{251;151;184;967};{982;908;827;871};"1 + 1 = 111";}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("U8")]the_llIlIIIllllllllIIIlllll,the_lIlllIlIIllllIIllI=the_IIlIIlIIIlllllllllIIlIII(the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1]))the_IIIIllIlIlIIIlIIlIlIIlI=the_lIlllIlIIllllIIllI+the_IlIllIIIIl-1 the_IIIllIlIIIlIllIlIIIIIl=0;for the_IlIIIIIlIlIIlIl=the_IlIllIIIIl,the_IIIIllIlIlIIIlIIlIlIIlI do the_IIIllIlIIIlIllIlIIIIIl=the_IIIllIlIIIlIllIlIIIIIl+1;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl]=the_llIlIIIllllllllIIIlllll[the_IIIllIlIIIlIllIlIIIIIl];end;end;elseif the_IlIllIIIIl<=#("cFP680qVYrcHbL8yUMTAPlBUhJPcFe3T95aNcKr9NWdbuu5l3o6BtTT1d5ZzlnqUzsIfLvv")then if the_IlIllIIIIl<=#("tUX3hzzXNEjqhCAqmjJgV2YAFtNbW0KI2WhK60TOGbVRdaM73q2BWpzB6xyYWxaX3Myuu")then if the_IlIllIIIIl>#("uxB4KTggvFRQiF7jVNyQOJD42ib8XCMrNc6Ga1PQuZb2hfoF0U0V7OmV4GcBSit43Adf")then local the_IlIllIIIIl;the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("ZR")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IIIIllIlIlIIIlIIlIlIIlI))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Sb")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{946;664;730;546};"1 + 1 = 111";}]]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("cS3u")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Wh")]]=the_IlIIIIIlIlIIlIl[#("ELS")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("TJ")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("XRl")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("2W")]][the_IlIIIIIlIlIIlIl[#("cK7")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("0Kiv")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("bk")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("eue")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("fH")]]();else local the_IIIIIIIlIIllllIIl;local the_lIlIIIllI,the_IIIllIlIIIlIllIlIIIIIl;local the_IlIllIIIIl;the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("FsS")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("cg")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("7h")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("1CX")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Sy")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("dRD")]][the_IlIIIIIlIlIIlIl[#("Eo3j")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("AD")]]=the_IlIIIIIlIlIIlIl[#("7kj")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("cs")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("CjZ")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("Ut")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("ocI")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#{{602;883;512;48};"1 + 1 = 111";"1 + 1 = 111";}]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("uk")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("1F")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("l6L")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("XH")]][the_IlIIIIIlIlIIlIl[#("2GH")]]=the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{402;226;634;641};{493;519;702;215};{874;625;992;937};}];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("JZ")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("isU")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("fP")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{{797;592;783;690};"1 + 1 = 111";"1 + 1 = 111";}]][the_IlIIIIIlIlIIlIl[#("sCYT")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("8W")]]=the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("1V")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("BXV")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("Yd")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("GyH")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("VPj")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Os")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{{569;236;355;293};{70;367;731;217};}]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("t2n")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Aq")]][the_IlIIIIIlIlIIlIl[#("gk7")]]=the_IlIIIIIlIlIIlIl[#("jKjP")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("gU")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("N7b")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Vk")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("AW3")]][the_IlIIIIIlIlIIlIl[#("lIeT")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Cj")]][the_IlIIIIIlIlIIlIl[#("GCY")]]=the_IlIIIIIlIlIIlIl[#("fELT")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("uj")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("2pE")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Ku")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("kQW")]][the_IlIIIIIlIlIIlIl[#("uIBe")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("ve")]][the_IlIIIIIlIlIIlIl[#("9eB")]]=the_IlIIIIIlIlIIlIl[#("mMXJ")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("l3")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("jkS")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("qG")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("fB9")]][the_IlIIIIIlIlIIlIl[#("SUn2")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("cn")]]=the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{376;948;236;203};"1 + 1 = 111";}];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("WV")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("VNF")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("fj")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("EL6")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("0SR")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("c8")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("fn")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{200;251;242;73};{116;472;100;734};}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("8z")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("zDC")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("tE")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("GI9")]][the_IlIIIIIlIlIIlIl[#("K4kN")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("ld")]]=the_IlIIIIIlIlIIlIl[#("e80")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("qQ")]]=the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{607;566;661;150};{876;234;662;175};}];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("7n")]]=the_IlIIIIIlIlIIlIl[#("bbN")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("rZ")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("kca")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("oS")]][the_IlIIIIIlIlIIlIl[#("iiN")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("qBE1")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("zP")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("DOH")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("2o")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("FJP")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("8I")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("HQ6")]][the_IlIIIIIlIlIIlIl[#{{2;468;225;308};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("3q")]][the_IlIIIIIlIlIIlIl[#("OpP")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Svp2")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("5m")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("V0Z")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("77")]][the_IlIIIIIlIlIIlIl[#{{591;746;852;296};{136;684;76;902};{920;943;509;676};}]]=the_IlIIIIIlIlIIlIl[#("UbUu")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{232;114;948;477};}]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("mxo")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("oG")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("DeA")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{{892;338;681;717};"1 + 1 = 111";}]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("5IW")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("lV")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("BKK")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("R0")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("fix")]][the_IlIIIIIlIlIIlIl[#("HXLZ")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("OJ")]]=the_IlIIIIIlIlIIlIl[#("eA4")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("mB")]]=the_IlIIIIIlIlIIlIl[#("xEM")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("4n")]]=the_IlIIIIIlIlIIlIl[#("tHV")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("Ly")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("Mjd")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("5c")]]=(the_IlIIIIIlIlIIlIl[#("usB")]~=0);the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{{406;309;817;745};"1 + 1 = 111";}]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("pJq")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("lc")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";{935;414;697;331};}]][the_IlIIIIIlIlIIlIl[#("BulV")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Xj")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("p5a")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("s7")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("BRs")]][the_IlIIIIIlIlIIlIl[#("lt8u")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("eW")]]=the_IlIIIIIlIlIIlIl[#("Cs9")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("nl")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("vr")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("Dhe")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("VV")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("WhY")]][the_IlIIIIIlIlIIlIl[#("4eJc")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Ws")]]=the_IlIIIIIlIlIIlIl[#("HCK")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("OO")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Ra")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("R5f")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{{14;561;2;953};"1 + 1 = 111";}]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("jZD")]][the_IlIIIIIlIlIIlIl[#("cCBK")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("qG")]]=the_IlIIIIIlIlIIlIl[#("zBc")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("N1")]the_lIlIIIllI,the_IIIllIlIIIlIllIlIIIIIl=the_IIlIIlIIIlllllllllIIlIII(the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1]))the_IIIIllIlIlIIIlIIlIlIIlI=the_IIIllIlIIIlIllIlIIIIIl+the_IlIllIIIIl-1 the_IIIIIIIlIIllllIIl=0;for the_IlIIIIIlIlIIlIl=the_IlIllIIIIl,the_IIIIllIlIlIIIlIIlIlIIlI do the_IIIIIIIlIIllllIIl=the_IIIIIIIlIIllllIIl+1;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl]=the_lIlIIIllI[the_IIIIIIIlIIllllIIl];end;the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("K4")]the_lIlIIIllI,the_IIIllIlIIIlIllIlIIIIIl=the_IIlIIlIIIlllllllllIIlIII(the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IIIIllIlIlIIIlIIlIlIIlI)))the_IIIIllIlIlIIIlIIlIlIIlI=the_IIIllIlIIIlIllIlIIIIIl+the_IlIllIIIIl-1 the_IIIIIIIlIIllllIIl=0;for the_IlIIIIIlIlIIlIl=the_IlIllIIIIl,the_IIIIllIlIlIIIlIIlIlIIlI do the_IIIIIIIlIIllllIIl=the_IIIIIIIlIIllllIIl+1;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl]=the_lIlIIIllI[the_IIIIIIIlIIllllIIl];end;the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("j0")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IIIIllIlIlIIIlIIlIlIIlI))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Tx")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("Gno")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("8J")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("0qQ")]][the_IlIIIIIlIlIIlIl[#("vFvK")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("yh")]]=the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";{923;772;109;796};}];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("uz")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("F1s")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("oi")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("BXO")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("vo0")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("bM")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("aj")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("LYN")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("u7")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("Z1L")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("NS")]][the_IlIIIIIlIlIIlIl[#{{280;96;57;780};{829;840;354;35};{347;806;919;604};}]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("JkZi")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("nk")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("23C")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("dN")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("WID")]];end;elseif the_IlIllIIIIl>#("Bi37SvYIKXW4GicL0t80lMFZn7lFh9Rci6zM6XosyntSpHl9qscffpxZOeUUjsBLfTVJUB")then the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("m4")]]=the_IIIIIIIlIIllllIIl[the_IlIIIIIlIlIIlIl[#("58a")]];else local the_lIlIIIllI;local the_llIlIIIllllllllIIIlllll,the_lIlllIlIIllllIIllI;local the_IIIllIlIIIlIllIlIIIIIl;local the_IlIllIIIIl;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("6S")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("GiS")]][the_IlIIIIIlIlIIlIl[#("DZOe")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("uH")]]=the_IlIIIIIlIlIIlIl[#("Xoc")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("35")]]=the_IlIIIIIlIlIIlIl[#("yTt")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("ey")]]=the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{135;112;716;453};"1 + 1 = 111";}];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("3I")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("08b")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Hi")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("8UC")]]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("L8Ah")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("7y")]][the_IlIIIIIlIlIIlIl[#("vyb")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("yy4k")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Gv")]]=the_IIIIIIIlIIllllIIl[the_IlIIIIIlIlIIlIl[#("VKK")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("uj")]]=the_IIIIIIIlIIllllIIl[the_IlIIIIIlIlIIlIl[#("Yvh")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Rr")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("ian")]][the_IlIIIIIlIlIIlIl[#("QCR1")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("qc")];the_IIIllIlIIIlIllIlIIIIIl=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("OMk")]];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1]=the_IIIllIlIIIlIllIlIIIIIl;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IIIllIlIIIlIllIlIIIIIl[the_IlIIIIIlIlIIlIl[#("fvaS")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("pf")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("KzM")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("FP")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("x9A")]][the_IlIIIIIlIlIIlIl[#("59MG")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("rC")]]=the_IlIIIIIlIlIIlIl[#("6ls")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("Qko")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Su")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("npG")]][the_IlIIIIIlIlIIlIl[#("aE0F")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("JG")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("iRo")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Wo")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("4Et")]]/the_IlIIIIIlIlIIlIl[#("fAFD")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("0B")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Ka")]]=the_IlIIIIIlIlIIlIl[#("Ukk")]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("ectX")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("ol")]]=the_IlIIIIIlIlIIlIl[#("Ks6")]-the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("7Kkl")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("vX")]]=the_IlIIIIIlIlIIlIl[#("VqB")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("EO")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("kNQ")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("zc")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("dvb")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("dP")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("VXO")]][the_IlIIIIIlIlIIlIl[#("hE8Q")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("y7")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("fxb")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("HN")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("ktZ")]][the_IlIIIIIlIlIIlIl[#("gY6O")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("ui")]]=the_IlIIIIIlIlIIlIl[#("QJm")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("qF")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Sz")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("a6m")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("H4")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("osO")]][the_IlIIIIIlIlIIlIl[#("Mv3D")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("pd")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("YUN")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("zl")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("aMo")]][the_IlIIIIIlIlIIlIl[#("4IA7")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("7n")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("Dvf")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("jj")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("GWq")]]/the_IlIIIIIlIlIIlIl[#("p7o9")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("aT")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("KD")]]=the_IlIIIIIlIlIIlIl[#("qdW")]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("cbn8")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Jc")]]=the_IlIIIIIlIlIIlIl[#("BIf")]+the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("vZB8")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("I4")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{{559;989;560;899};{831;155;708;73};}]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("A4M")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("JW")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("iOU")]][the_IlIIIIIlIlIIlIl[#("HGjT")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Z2")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("jRK")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("ZX")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("TG2")]][the_IlIIIIIlIlIIlIl[#("qD1Y")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Q8")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("fpz")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("cJ")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Epp")]]/the_IlIIIIIlIlIIlIl[#("Sj1b")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("il")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("sq")]]=the_IlIIIIIlIlIIlIl[#("P9g")]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Akn3")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("nh")]]=the_IlIIIIIlIlIIlIl[#("HnF")]-the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("kp8r")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("k7")]the_llIlIIIllllllllIIIlllll,the_lIlllIlIIllllIIllI=the_IIlIIlIIIlllllllllIIlIII(the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1]))the_IIIIllIlIlIIIlIIlIlIIlI=the_lIlllIlIIllllIIllI+the_IlIllIIIIl-1 the_lIlIIIllI=0;for the_IlIIIIIlIlIIlIl=the_IlIllIIIIl,the_IIIIllIlIlIIIlIIlIlIIlI do the_lIlIIIllI=the_lIlIIIllI+1;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl]=the_llIlIIIllllllllIIIlllll[the_lIlIIIllI];end;the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("qS")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IIIIllIlIlIIIlIIlIlIIlI))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("mI")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Pcf")]]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("eL7j")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Cz")]]=the_IlIIIIIlIlIIlIl[#("9hA")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("Ct")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("MNX")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("vl")]][the_IlIIIIIlIlIIlIl[#("m5E")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("X544")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("74")]]=the_IIIIIIIlIIllllIIl[the_IlIIIIIlIlIIlIl[#("kmv")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("SG")]]=the_IIIIIIIlIIllllIIl[the_IlIIIIIlIlIIlIl[#("jVg")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("9A")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("OzC")]][the_IlIIIIIlIlIIlIl[#("yyQ0")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("fI")];the_IIIllIlIIIlIllIlIIIIIl=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("HJ6")]];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1]=the_IIIllIlIIIlIllIlIIIIIl;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IIIllIlIIIlIllIlIIIIIl[the_IlIIIIIlIlIIlIl[#{{519;523;875;120};{324;966;141;507};"1 + 1 = 111";{898;945;34;597};}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Hv")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("mtR")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("sP")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("BWK")]][the_IlIIIIIlIlIIlIl[#("3kmj")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("pI")]]=the_IlIIIIIlIlIIlIl[#("ZKT")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";}]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("CBa")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("OK")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Fv9")]][the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{48;101;93;210};}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("6Q")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("1tg")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("R7")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("55C")]]/the_IlIIIIIlIlIIlIl[#("rI2b")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#{{113;529;116;16};"1 + 1 = 111";}]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("CC")]]=the_IlIIIIIlIlIIlIl[#("Qqr")]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{{779;237;112;818};"1 + 1 = 111";{673;793;563;128};"1 + 1 = 111";}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("yr")]]=the_IlIIIIIlIlIIlIl[#{{816;192;737;182};{856;479;922;192};"1 + 1 = 111";}]-the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Xo6W")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Ag")]]=the_IlIIIIIlIlIIlIl[#("oYu")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("r5")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("Myv")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{{269;239;840;69};"1 + 1 = 111";}]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("bpS")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("xf")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("zSP")]][the_IlIIIIIlIlIIlIl[#("bEx1")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("1E")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("JMd")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("ce")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("mWU")]][the_IlIIIIIlIlIIlIl[#("eZoN")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("sc")]]=the_IlIIIIIlIlIIlIl[#("taq")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("1z")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("TR")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("sQk")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{307;202;444;116};}]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("ZhF")]][the_IlIIIIIlIlIIlIl[#("4zYg")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("D1")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("aLR")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Wd")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("7I2")]][the_IlIIIIIlIlIIlIl[#("kyoH")]];end;elseif the_IlIllIIIIl<=#("dePC8rWJRWloY7M73KJ82dFjeXTMGVMp0O9aBXzH1Fd87eMOEW29kDW9KFxkJjc5j5zk7MHgk")then if the_IlIllIIIIl==#{"1 + 1 = 111";"1 + 1 = 111";{201;814;392;333};"1 + 1 = 111";"1 + 1 = 111";{254;574;770;285};"1 + 1 = 111";{587;300;139;119};"1 + 1 = 111";{108;643;322;697};{387;11;717;142};"1 + 1 = 111";{685;43;777;136};"1 + 1 = 111";{927;183;306;674};{813;720;937;65};"1 + 1 = 111";{36;220;507;932};"1 + 1 = 111";"1 + 1 = 111";{407;193;947;647};{175;628;455;784};"1 + 1 = 111";"1 + 1 = 111";{228;897;189;112};{739;904;156;327};{722;846;911;235};"1 + 1 = 111";{66;780;566;619};{825;626;473;870};"1 + 1 = 111";{31;127;758;302};{408;370;724;235};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{280;511;765;589};{995;104;95;600};"1 + 1 = 111";"1 + 1 = 111";{866;361;618;76};"1 + 1 = 111";{445;391;490;877};"1 + 1 = 111";{223;581;7;202};"1 + 1 = 111";{438;757;43;467};{702;532;446;233};"1 + 1 = 111";{545;773;392;252};"1 + 1 = 111";"1 + 1 = 111";{547;219;881;383};{22;47;846;89};{580;47;703;806};"1 + 1 = 111";{722;998;532;28};{795;960;455;381};{244;320;205;388};"1 + 1 = 111";"1 + 1 = 111";{621;248;816;273};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{734;902;765;523};{363;563;283;253};{376;922;979;867};"1 + 1 = 111";{346;239;872;698};"1 + 1 = 111";}then local the_lIlIIIllI;local the_lIlllIlIIllllIIllI,the_llIlIIIllllllllIIIlllll;local the_IIIllIlIIIlIllIlIIIIIl;local the_IlIllIIIIl;the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("mok")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Bv")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("hh")]]=(the_IlIIIIIlIlIIlIl[#("MfE")]~=0);the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#{{644;623;829;64};{550;473;60;609};{14;94;705;350};}]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("lt")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("C8")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("dZf")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("XA")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("hXq")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Ff")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("ehz")]][the_IlIIIIIlIlIIlIl[#("ZGPY")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("JI")];the_IIIllIlIIIlIllIlIIIIIl=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("m7k")]];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1]=the_IIIllIlIIIlIllIlIIIIIl;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IIIllIlIIIlIllIlIIIIIl[the_IlIIIIIlIlIIlIl[#("qz5q")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("zJ")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("4L4")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("7z")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("4es")]][the_IlIIIIIlIlIIlIl[#("OnAS")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("C3")]]=the_IlIIIIIlIlIIlIl[#{{27;898;794;553};"1 + 1 = 111";{25;877;789;547};}];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("xe")]]=the_IlIIIIIlIlIIlIl[#("mfW")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("dM")]]=the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{365;938;630;186};"1 + 1 = 111";}];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("ql")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("Gfv")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("lQ")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("qHM")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{{565;52;457;867};"1 + 1 = 111";}]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{{925;703;640;51};{124;803;569;276};{327;517;345;119};}]][the_IlIIIIIlIlIIlIl[#{{370;529;91;580};"1 + 1 = 111";{672;161;271;836};"1 + 1 = 111";}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("sM")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("4Gk")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("08")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("YaH")]][the_IlIIIIIlIlIIlIl[#("Dtpm")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("an")]]=the_IlIIIIIlIlIIlIl[#("HaW")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("Pb")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Cj")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("Zdi")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("pU")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("us0")]][the_IlIIIIIlIlIIlIl[#("qRKx")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Nf")]]=the_IlIIIIIlIlIIlIl[#("t9C")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("xU")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Pn")]]=the_IlIIIIIlIlIIlIl[#("oUy")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("uy")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("Dmo")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("NQ")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Hsr")]]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("zaz0")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("EP")]]=the_IlIIIIIlIlIIlIl[#("5Jq")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("1M")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("GPO")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Bv")]][the_IlIIIIIlIlIIlIl[#("tIu")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("GZJF")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("5y")]]=the_IIIIIIIlIIllllIIl[the_IlIIIIIlIlIIlIl[#("yNU")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("4Z")]]=the_IIIIIIIlIIllllIIl[the_IlIIIIIlIlIIlIl[#("dMu")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{747;407;760;302};}]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("dv8")]][the_IlIIIIIlIlIIlIl[#("P47U")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("Pf")];the_IIIllIlIIIlIllIlIIIIIl=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1]=the_IIIllIlIIIlIllIlIIIIIl;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IIIllIlIIIlIllIlIIIIIl[the_IlIIIIIlIlIIlIl[#("Q8fd")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("05")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("W0q")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Nk")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("VBc")]][the_IlIIIIIlIlIIlIl[#("6Sen")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("2Q")]]=the_IlIIIIIlIlIIlIl[#("czN")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Nc")]]=the_IlIIIIIlIlIIlIl[#("u6F")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("G7")]]=the_IlIIIIIlIlIIlIl[#("zk9")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("6z")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("CR2")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Fl")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("8xO")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("bC")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("LlY")]][the_IlIIIIIlIlIIlIl[#("GqCQ")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("oV")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("iuU")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("2i")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("rYD")]][the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{82;199;491;142};"1 + 1 = 111";{124;931;111;719};}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("68")]]=the_IlIIIIIlIlIIlIl[#("K8F")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("fO")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("5o")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("8QK")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("lI")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("0rQ")]][the_IlIIIIIlIlIIlIl[#("OYKg")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("bs")]]=the_IlIIIIIlIlIIlIl[#("kQ1")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("nz")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Hp")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#{{464;719;979;525};"1 + 1 = 111";"1 + 1 = 111";}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Yk")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("XDk")]][the_IlIIIIIlIlIIlIl[#("1Pk5")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("CY")]]=the_IlIIIIIlIlIIlIl[#("KqF")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("Fy")]the_lIlllIlIIllllIIllI,the_llIlIIIllllllllIIIlllll=the_IIlIIlIIIlllllllllIIlIII(the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1]))the_IIIIllIlIlIIIlIIlIlIIlI=the_llIlIIIllllllllIIIlllll+the_IlIllIIIIl-1 the_lIlIIIllI=0;for the_IlIIIIIlIlIIlIl=the_IlIllIIIIl,the_IIIIllIlIlIIIlIIlIlIIlI do the_lIlIIIllI=the_lIlIIIllI+1;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl]=the_lIlllIlIIllllIIllI[the_lIlIIIllI];end;the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("ua")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IIIIllIlIlIIIlIIlIlIIlI))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("xQ")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{718;783;775;27};"1 + 1 = 111";}]]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("JvFc")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{{59;490;413;587};"1 + 1 = 111";}]]=the_IlIIIIIlIlIIlIl[#("Scp")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("Va")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("lo6")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Rs")]][the_IlIIIIIlIlIIlIl[#("XHT")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("rLG6")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("d9")]]=the_IIIIIIIlIIllllIIl[the_IlIIIIIlIlIIlIl[#("Gxl")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("aa")]]=the_IIIIIIIlIIllllIIl[the_IlIIIIIlIlIIlIl[#("DPG")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Hv")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("pej")]][the_IlIIIIIlIlIIlIl[#("R5lx")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("6i")];the_IIIllIlIIIlIllIlIIIIIl=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("XPd")]];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1]=the_IIIllIlIIIlIllIlIIIIIl;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IIIllIlIIIlIllIlIIIIIl[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";{775;998;475;726};"1 + 1 = 111";}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("RN")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("kK5")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("pA")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("3gU")]][the_IlIIIIIlIlIIlIl[#("0v9q")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("b0")]]=the_IlIIIIIlIlIIlIl[#("By3")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("hP")]]=the_IlIIIIIlIlIIlIl[#("AqL")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("rC")]]=the_IlIIIIIlIlIIlIl[#("U2u")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("JV")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("fcI")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("xh")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("FDt")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("pz")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("2iQ")]][the_IlIIIIIlIlIIlIl[#("2z9I")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("uF")]]=the_IlIIIIIlIlIIlIl[#("koh")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("dY")]]=the_IlIIIIIlIlIIlIl[#("L3z")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("OB")]]=the_IlIIIIIlIlIIlIl[#("Ndc")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("qf")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#{{409;535;258;797};{611;893;618;348};"1 + 1 = 111";}]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("DF")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("D3v")]]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("qHjJ")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("tP")]]=the_IlIIIIIlIlIIlIl[#("t0M")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("f6")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("byt")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("HS")]][the_IlIIIIIlIlIIlIl[#("Wgp")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("jVAp")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("x7")]]=the_IIIIIIIlIIllllIIl[the_IlIIIIIlIlIIlIl[#("SvI")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("PJ")]]=the_IIIIIIIlIIllllIIl[the_IlIIIIIlIlIIlIl[#("iyP")]];else the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{{561;393;838;514};"1 + 1 = 111";}]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("D5K")]][the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("7rLN")]]];end;elseif the_IlIllIIIIl==#("cnEPkeslPiRROf2f5FfvkdpeVY5S3907Y9OSJUUYz7PMRKZb51g75bB98A4viKrPrU2OCjGkVq")then local the_lIlllIlIIllllIIllI;local the_IIIllIlIIIlIllIlIIIIIl;local the_llIlIIIllllllllIIIlllll,the_lIlIIIllI;local the_IlIllIIIIl;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("b5")]]=the_IlIIIIIlIlIIlIl[#{{814;373;670;411};"1 + 1 = 111";{456;414;380;554};}];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("D7")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{{898;156;317;400};"1 + 1 = 111";}]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("7uj")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("eb")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("XUm")]][the_IlIIIIIlIlIIlIl[#("SNmb")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("mf")]]=the_IlIIIIIlIlIIlIl[#("M9l")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("Nc")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("zj")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("J9N")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("EX")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("YVx")]][the_IlIIIIIlIlIIlIl[#("EXVp")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("YR")]]=the_IlIIIIIlIlIIlIl[#("pu0")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("f9")]the_llIlIIIllllllllIIIlllll,the_lIlIIIllI=the_IIlIIlIIIlllllllllIIlIII(the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1]))the_IIIIllIlIlIIIlIIlIlIIlI=the_lIlIIIllI+the_IlIllIIIIl-1 the_IIIllIlIIIlIllIlIIIIIl=0;for the_IlIIIIIlIlIIlIl=the_IlIllIIIIl,the_IIIIllIlIlIIIlIIlIlIIlI do the_IIIllIlIIIlIllIlIIIIIl=the_IIIllIlIIIlIllIlIIIIIl+1;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl]=the_llIlIIIllllllllIIIlllll[the_IIIllIlIIIlIllIlIIIIIl];end;the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("Ht")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IIIIllIlIlIIIlIIlIlIIlI))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("HC")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]]*the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("mxoG")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Q1")]]=the_IlIIIIIlIlIIlIl[#("qLh")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("Bm")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#("NND")]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("gD")]][the_IlIIIIIlIlIIlIl[#("7pF")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("2M8x")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("mj")]]=the_IIIIIIIlIIllllIIl[the_IlIIIIIlIlIIlIl[#("ioJ")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("sb")]]=the_IIIIIIIlIIllllIIl[the_IlIIIIIlIlIIlIl[#("mBr")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("JI")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("rem")]][the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{356;677;580;829};"1 + 1 = 111";"1 + 1 = 111";}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("XI")];the_lIlllIlIIllllIIllI=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("guC")]];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1]=the_lIlllIlIIllllIIllI;the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_lIlllIlIIllllIIllI[the_IlIIIIIlIlIIlIl[#("E7MM")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("hP")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("EeV")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("kX")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("sYd")]][the_IlIIIIIlIlIIlIl[#("IUvE")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("xH")]]=the_IlIIIIIlIlIIlIl[#{{473;837;180;71};"1 + 1 = 111";"1 + 1 = 111";}];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("SQ")]]=the_IlIIIIIlIlIIlIl[#("HmJ")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("R7")]]=the_IlIIIIIlIlIIlIl[#("pzq")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("T7")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIlIlIllIIlllIIlIl(the_IlIlIIIllIlIIIIlIIlIIIlll,the_IlIllIIIIl+1,the_IlIIIIIlIlIIlIl[#{{978;350;604;331};{199;933;615;17};{795;586;413;765};}]))the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("9x")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("n7g")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("fL")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("z2C")]][the_IlIIIIIlIlIIlIl[#("om7q")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("8W")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("k06")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("u7")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("FmP")]][the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{781;1;798;793};{796;543;686;703};{681;84;107;221};}]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("xU")]]=the_IlIIIIIlIlIIlIl[#("kIr")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("CI")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Cp")]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("0u7")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("8T")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";"1 + 1 = 111";{295;518;633;498};}]][the_IlIIIIIlIlIIlIl[#("XH4R")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("9F")]]=the_IlIIIIIlIlIIlIl[#("dBZ")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#("oM")]the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1])the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#{"1 + 1 = 111";{24;990;33;878};}]]=the_IlIlllIIIlllIlIIlIl[the_IlIIIIIlIlIIlIl[#("m9d")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("tX")]]=the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("R1M")]][the_IlIIIIIlIlIIlIl[#("vtoI")]];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIIIIIlIlIIlIl[#("Xc")]]=the_IlIIIIIlIlIIlIl[#("ktW")];the_lIIlIIlllIl=the_lIIlIIlllIl+1;the_IlIIIIIlIlIIlIl=the_IllIIIIIlIlIllIIIIlIl[the_lIIlIIlllIl];the_IlIllIIIIl=the_IlIIIIIlIlIIlIl[#{{24;270;475;828};"1 + 1 = 111";}]the_llIlIIIllllllllIIIlllll,the_lIlIIIllI=the_IIlIIlIIIlllllllllIIlIII(the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl](the_IlIlIIIllIlIIIIlIIlIIIlll[the_IlIllIIIIl+1]))the_IIIIllIlIlIIIlIIlIlIIlI=the_lIlIIIllI+the_IlIllIIIIl-1 the_IIIllIlIIIlIllIlIIIIIl=0;for the_IlIIIIIlIlIIlIl=the_IlIllIIIIl,the_IIIIllIlIlIIIlIIlIlIIlI do the_IIIllIlIIIlIllIlIIIIIl=the_III
RAW Paste Data