API tools faq
paste
Advertisement
Scripter_RobloxDood

Untitled

Scripter_RobloxDood
Jun 14th, 2018
34
0
Never
Add comment
Not a member of Pastebin yet? Sign Up, it unlocks many cool features!
text 202.82 KB | None | 0 0
raw download clone embed print report
  1. --credit to dreamer#1453 im not leaking this edit lmao
  2. ------------------------------Nazi Armlet-----------------------------------------------
  3. guigroup=Instance.new("BillboardGui")
  4. guigroup.Parent=game.Players.LocalPlayer.Character.Head
  5. guigroup.Adornee=game.Players.LocalPlayer.Character.Head
  6. guigroup.Size = UDim2.new(1,0,1,0)
  7. guigroup.StudsOffset=Vector3.new(0.5, 6, 0)
  8. oooo1 = Instance.new("TextLabel")
  9. Kills = Instance.new("IntValue")
  10. Kills.Parent = game.Players.LocalPlayer.Character
  11. Kills.Name = ""
  12. oooo1.Text = ""
  13. if
  14. game.Players.LocalPlayer.Name == ""
  15. then
  16. oooo1.Text = ""
  17. end
  18. oooo1.Size = UDim2.new(0,200,0,200)
  19. oooo1.BackgroundColor3 = Color3.new(1, 1, 1)
  20. oooo1.BackgroundTransparency = 1
  21. oooo1.Parent = guigroup
  22. oooo1.AnchorPoint = Vector2.new(0.5, 0.9)
  23. oooo1.Size = UDim2.new(3.5,0,3.5,0)
  24. oooo1.TextScaled = true
  25. ko1 = Instance.new("TextLabel")
  26. ko1.Name = ""
  27. ko1.Parent = guigroup
  28. ko1.BackgroundColor3 = Color3.new(1, 1, 1)
  29. ko1.BackgroundTransparency = 1
  30. ko1.TextColor3 = Color3.new(1, 0, 0)
  31. ko1.TextScaled = false
  32. ko1.TextWrapped = false
  33. ko1.AnchorPoint = Vector2.new(0.5, 0.3)
  34. game.Players.LocalPlayer.Character.Humanoid.NameOcclusion = "NoOcclusion"
  35. game.Players.LocalPlayer.Character.Humanoid.HealthDisplayType = "AlwaysOff"
  36. game.Players.LocalPlayer.Character.Humanoid.MaxHealth = 999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999
  37. game.Players.LocalPlayer.Character.Humanoid.Health = 999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999
  38. local runDummyScript = function(f,scri)
  39. local oldenv = getfenv(f)
  40. local newenv = setmetatable({}, {
  41. __index = function(_, k)
  42. if k:lower() == 'script' then
  43. return scri
  44. else
  45. return oldenv[k]
  46. end
  47. end
  48. })
  49. setfenv(f, newenv)
  50. ypcall(function() f() end)
  51. end
  52. cors = {}
  53. mas = Instance.new("Model",game:GetService("Lighting"))
  54. mas.Name = "CompiledModel"
  55. o1 = Instance.new("Model")
  56. o2 = Instance.new("Part")
  57. o3 = Instance.new("BlockMesh")
  58. o4 = Instance.new("Part")
  59. o5 = Instance.new("BlockMesh")
  60. o6 = Instance.new("CFrameValue")
  61. o7 = Instance.new("Weld")
  62. o8 = Instance.new("Part")
  63. o9 = Instance.new("BlockMesh")
  64. o10 = Instance.new("CFrameValue")
  65. o11 = Instance.new("Weld")
  66. o12 = Instance.new("Part")
  67. o13 = Instance.new("BlockMesh")
  68. o14 = Instance.new("CFrameValue")
  69. o15 = Instance.new("Weld")
  70. o16 = Instance.new("Part")
  71. o17 = Instance.new("BlockMesh")
  72. o18 = Instance.new("CFrameValue")
  73. o19 = Instance.new("Weld")
  74. o20 = Instance.new("Part")
  75. o21 = Instance.new("BlockMesh")
  76. o22 = Instance.new("CFrameValue")
  77. o23 = Instance.new("Weld")
  78. o24 = Instance.new("Part")
  79. o25 = Instance.new("BlockMesh")
  80. o26 = Instance.new("CFrameValue")
  81. o27 = Instance.new("Weld")
  82. o28 = Instance.new("Part")
  83. o29 = Instance.new("CFrameValue")
  84. o30 = Instance.new("Weld")
  85. o31 = Instance.new("Part")
  86. o32 = Instance.new("CFrameValue")
  87. o33 = Instance.new("Weld")
  88. o34 = Instance.new("Part")
  89. o35 = Instance.new("SpecialMesh")
  90. o36 = Instance.new("CFrameValue")
  91. o37 = Instance.new("Weld")
  92. weldtoarm = Instance.new("Weld")
  93. o1.Name = "Armlet"
  94. o1.Parent = mas
  95. o2.Name = "svatic1"
  96. o2.Parent = o1
  97. o2.Material = Enum.Material.SmoothPlastic
  98. o2.BrickColor = BrickColor.new("Really black")
  99. o2.Position = Vector3.new(9.5394268, 1.15889382, -30.4923649)
  100. o2.Rotation = Vector3.new(34.4199982, -4.80000019, 153.710007)
  101. o2.Size = Vector3.new(0.831344962, 0.831338942, 0.831339061)
  102. o2.CFrame = CFrame.new(9.5394268, 1.15889382, -30.4923649, -0.893398523, -0.441397756, -0.0837334841, 0.407822043, -0.718593299, -0.563310921, 0.188470751, -0.537409127, 0.822001636)
  103. o2.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  104. o2.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  105. o2.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  106. o2.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  107. o2.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  108. o2.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  109. o2.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  110. o2.Position = Vector3.new(9.5394268, 1.15889382, -30.4923649)
  111. o2.Orientation = Vector3.new(34.2900009, -5.82000017, 150.419998)
  112. o2.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  113. o3.Parent = o2
  114. o3.Scale = Vector3.new(0.999996185, 0.598279178, 0.0991418734)
  115. o3.Scale = Vector3.new(0.999996185, 0.598279178, 0.0991418734)
  116. o4.Name = "svatic2"
  117. o4.Parent = o1
  118. o4.Material = Enum.Material.SmoothPlastic
  119. o4.BrickColor = BrickColor.new("Really black")
  120. o4.Position = Vector3.new(9.51736546, 1.06919134, -30.4028416)
  121. o4.Rotation = Vector3.new(34.4199982, -4.80000019, 153.710007)
  122. o4.Size = Vector3.new(0.831344962, 0.831338942, 0.831339061)
  123. o4.CFrame = CFrame.new(9.51736546, 1.06919134, -30.4028416, -0.893398523, -0.441397756, -0.0837334841, 0.407822043, -0.718593299, -0.563310921, 0.188470751, -0.537409127, 0.822001636)
  124. o4.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  125. o4.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  126. o4.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  127. o4.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  128. o4.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  129. o4.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  130. o4.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  131. o4.Position = Vector3.new(9.51736546, 1.06919134, -30.4028416)
  132. o4.Orientation = Vector3.new(34.2900009, -5.82000017, 150.419998)
  133. o4.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  134. o5.Parent = o4
  135. o5.Scale = Vector3.new(0.999996185, 0.100022063, 0.348278195)
  136. o5.Scale = Vector3.new(0.999996185, 0.100022063, 0.348278195)
  137. o6.Name = "qRelativeCFrameWeldValue"
  138. o6.Parent = o4
  139. o6.Value = CFrame.new(0, -0.0218372345, -0.105447769, 1, 0, 0, 0, 1, 0, 0, 0, 1)
  140. o7.Name = "qCFrameWeldThingy"
  141. o7.Parent = o4
  142. o7.C1 = CFrame.new(0, -0.0260860808, -0.125964642, 1, 0, 0, 0, 1, 0, 0, 0, 1)
  143. o7.Part0 = o2
  144. o7.Part1 = o4
  145. o8.Name = "svatic3"
  146. o8.Parent = o1
  147. o8.Material = Enum.Material.SmoothPlastic
  148. o8.BrickColor = BrickColor.new("Really black")
  149. o8.Position = Vector3.new(9.50574112, 1.21955931, -30.7833157)
  150. o8.Rotation = Vector3.new(34.4199982, -4.80000019, 153.710007)
  151. o8.Size = Vector3.new(0.831344962, 0.831338942, 0.831339061)
  152. o8.CFrame = CFrame.new(9.50574112, 1.21955931, -30.7833157, -0.893398523, -0.441397756, -0.0837334841, 0.407822043, -0.718593299, -0.563310921, 0.188470751, -0.537409127, 0.822001636)
  153. o8.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  154. o8.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  155. o8.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  156. o8.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  157. o8.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  158. o8.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  159. o8.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  160. o8.Position = Vector3.new(9.50574112, 1.21955931, -30.7833157)
  161. o8.Orientation = Vector3.new(34.2900009, -5.82000017, 150.419998)
  162. o8.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  163. o9.Parent = o8
  164. o9.Scale = Vector3.new(0.999996185, 0.348996192, 0.0991418734)
  165. o9.Scale = Vector3.new(0.999996185, 0.348996192, 0.0991418734)
  166. o10.Name = "qRelativeCFrameWeldValue"
  167. o10.Parent = o8
  168. o10.Value = CFrame.new(0, -0.106843948, 0.226449966, 1, 0, 0, 0, 1, 0, 0, 0, 1)
  169. o11.Name = "qCFrameWeldThingy"
  170. o11.Parent = o8
  171. o11.C1 = CFrame.new(0, -0.127632454, 0.270510107, 1, 0, 0, 0, 1, 0, 0, 0, 1)
  172. o11.Part0 = o2
  173. o11.Part1 = o8
  174. o12.Name = "svatic4"
  175. o12.Parent = o1
  176. o12.Material = Enum.Material.SmoothPlastic
  177. o12.BrickColor = BrickColor.new("Really black")
  178. o12.Position = Vector3.new(9.40566349, 0.893889546, -30.553009)
  179. o12.Rotation = Vector3.new(34.4199982, -4.80000019, 153.710007)
  180. o12.Size = Vector3.new(0.831344962, 0.831338942, 0.831339061)
  181. o12.CFrame = CFrame.new(9.40566349, 0.893889546, -30.553009, -0.893398523, -0.441397756, -0.0837334841, 0.407822043, -0.718593299, -0.563310921, 0.188470751, -0.537409127, 0.822001636)
  182. o12.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  183. o12.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  184. o12.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  185. o12.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  186. o12.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  187. o12.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  188. o12.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  189. o12.Position = Vector3.new(9.40566349, 0.893889546, -30.553009)
  190. o12.Orientation = Vector3.new(34.2900009, -5.82000017, 150.419998)
  191. o12.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  192. o13.Parent = o12
  193. o13.Scale = Vector3.new(0.999996185, 0.100022063, 0.364750892)
  194. o13.Scale = Vector3.new(0.999996185, 0.100022063, 0.364750892)
  195. o14.Name = "qRelativeCFrameWeldValue"
  196. o14.Parent = o12
  197. o14.Value = CFrame.new(0, -0.236118317, -0.0926094055, 1, 0, 0, 0, 1, 0, 0, 0, 1)
  198. o15.Name = "qCFrameWeldThingy"
  199. o15.Parent = o12
  200. o15.C1 = CFrame.new(0, -0.28205961, -0.110628322, 1, 0, 0, 0, 1, 0, 0, 0, 1)
  201. o15.Part0 = o2
  202. o15.Part1 = o12
  203. o16.Name = "svatic5"
  204. o16.Parent = o1
  205. o16.Material = Enum.Material.SmoothPlastic
  206. o16.BrickColor = BrickColor.new("Really black")
  207. o16.Position = Vector3.new(9.65675831, 1.39117944, -30.4388123)
  208. o16.Rotation = Vector3.new(34.4199982, -4.80000019, 153.710007)
  209. o16.Size = Vector3.new(0.831344962, 0.831338942, 0.831339061)
  210. o16.CFrame = CFrame.new(9.65675831, 1.39117944, -30.4388123, -0.893398523, -0.441397756, -0.0837334841, 0.407822043, -0.718593299, -0.563310921, 0.188470751, -0.537409127, 0.822001636)
  211. o16.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  212. o16.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  213. o16.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  214. o16.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  215. o16.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  216. o16.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  217. o16.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  218. o16.Position = Vector3.new(9.65675831, 1.39117944, -30.4388123)
  219. o16.Orientation = Vector3.new(34.2900009, -5.82000017, 150.419998)
  220. o16.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  221. o17.Parent = o16
  222. o17.Scale = Vector3.new(0.999996185, 0.100022063, 0.336512148)
  223. o17.Scale = Vector3.new(0.999996185, 0.100022063, 0.336512148)
  224. o18.Name = "qRelativeCFrameWeldValue"
  225. o18.Parent = o16
  226. o18.Value = CFrame.new(0, 0.207174301, 0.080909729, 1, 0, 0, 0, 1, 0, 0, 0, 1)
  227. o19.Name = "qCFrameWeldThingy"
  228. o19.Parent = o16
  229. o19.C1 = CFrame.new(0, 0.247483984, 0.096652247, 1, 0, 0, 0, 1, 0, 0, 0, 1)
  230. o19.Part0 = o2
  231. o19.Part1 = o16
  232. o20.Name = "svatic6"
  233. o20.Parent = o1
  234. o20.Material = Enum.Material.SmoothPlastic
  235. o20.BrickColor = BrickColor.new("Really black")
  236. o20.Position = Vector3.new(9.54831028, 1.05523241, -30.2259464)
  237. o20.Rotation = Vector3.new(34.4199982, -4.80000019, 153.710007)
  238. o20.Size = Vector3.new(0.831344962, 0.831338942, 0.831339061)
  239. o20.CFrame = CFrame.new(9.54831028, 1.05523241, -30.2259464, -0.893398523, -0.441397756, -0.0837334841, 0.407822043, -0.718593299, -0.563310921, 0.188470751, -0.537409127, 0.822001636)
  240. o20.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  241. o20.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  242. o20.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  243. o20.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  244. o20.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  245. o20.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  246. o20.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  247. o20.Position = Vector3.new(9.54831028, 1.05523241, -30.2259464)
  248. o20.Orientation = Vector3.new(34.2900009, -5.82000017, 150.419998)
  249. o20.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  250. o21.Parent = o20
  251. o21.Scale = Vector3.new(0.999996185, 0.348996192, 0.0991418734)
  252. o21.Scale = Vector3.new(0.999996185, 0.348996192, 0.0991418734)
  253. o22.Name = "qRelativeCFrameWeldValue"
  254. o22.Parent = o20
  255. o22.Value = CFrame.new(0, 0.0607795715, -0.231582642, 1, 0, 0, 0, 1, 0, 0, 0, 1)
  256. o23.Name = "qCFrameWeldThingy"
  257. o23.Parent = o20
  258. o23.C1 = CFrame.new(0, 0.0726053864, -0.276641428, 1, 0, 0, 0, 1, 0, 0, 0, 1)
  259. o23.Part0 = o2
  260. o23.Part1 = o20
  261. o24.Name = "svatic7"
  262. o24.Parent = o1
  263. o24.Material = Enum.Material.SmoothPlastic
  264. o24.BrickColor = BrickColor.new("Really black")
  265. o24.Position = Vector3.new(9.53892517, 1.21178222, -30.6091824)
  266. o24.Rotation = Vector3.new(34.4199982, -4.80000019, 153.710007)
  267. o24.Size = Vector3.new(0.831344962, 0.831338942, 0.831339061)
  268. o24.CFrame = CFrame.new(9.53892517, 1.21178222, -30.6091824, -0.893398523, -0.441397756, -0.0837334841, 0.407822043, -0.718593299, -0.563310921, 0.188470751, -0.537409127, 0.822001636)
  269. o24.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  270. o24.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  271. o24.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  272. o24.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  273. o24.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  274. o24.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  275. o24.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  276. o24.Position = Vector3.new(9.53892517, 1.21178222, -30.6091824)
  277. o24.Orientation = Vector3.new(34.2900009, -5.82000017, 150.419998)
  278. o24.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  279. o25.Parent = o24
  280. o25.Scale = Vector3.new(0.999996185, 0.100022063, 0.348278195)
  281. o25.Scale = Vector3.new(0.999996185, 0.100022063, 0.348278195)
  282. o26.Name = "qRelativeCFrameWeldValue"
  283. o26.Parent = o24
  284. o26.Value = CFrame.new(0, -0.0209236145, 0.105287552, 1, 0, 0, 0, 1, 0, 0, 0, 1)
  285. o27.Name = "qCFrameWeldThingy"
  286. o27.Parent = o24
  287. o27.C1 = CFrame.new(0, -0.0249946993, 0.125773236, 1, 0, 0, 0, 1, 0, 0, 0, 1)
  288. o27.Part0 = o2
  289. o27.Part1 = o24
  290. o28.Name = "Right Arm"
  291. o28.Parent = o1
  292. o28.Material = Enum.Material.SmoothPlastic
  293. o28.BrickColor = BrickColor.new("Really black")
  294. o28.Transparency = 1
  295. o28.Position = Vector3.new(9.33767605, 1.24664795, -30.4727879)
  296. o28.Rotation = Vector3.new(114.800003, 63.2999992, -39.2599983)
  297. o28.FormFactor = Enum.FormFactor.Symmetric
  298. o28.Size = Vector3.new(2.09252977, 1.04626489, 1.04626489)
  299. o28.CFrame = CFrame.new(9.33767605, 1.24664795, -30.4727879, 0.347877979, 0.284306079, 0.893393397, 0.893409908, 0.188386172, -0.407835245, -0.284253061, 0.940042913, -0.188466549)
  300. o28.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  301. o28.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  302. o28.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  303. o28.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  304. o28.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  305. o28.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  306. o28.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  307. o28.Position = Vector3.new(9.33767605, 1.24664795, -30.4727879)
  308. o28.Orientation = Vector3.new(24.0699997, 101.910004, 78.0899963)
  309. o28.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  310. weldtoarm.Parent = o28
  311. weldtoarm.Part0 = o28
  312. weldtoarm.Part1 = game.Players.LocalPlayer.Character["Right Arm"]
  313. weldtoarm.C0 = CFrame.new(0, 0, 0)*CFrame.fromEulerAnglesXYZ(1.55, math.pi, 1.55)
  314. o29.Name = "qRelativeCFrameWeldValue"
  315. o29.Parent = o28
  316. o29.Value = CFrame.new(-0.00221943855, 0.0187721252, 0.183933258, -1.47819519e-05, -0.642790794, -0.766052902, 1.11595e-09, -0.766052902, 0.642790794, -1, 9.50084723e-06, 1.13244741e-05)
  317. o30.Name = "qCFrameWeldThingy"
  318. o30.Parent = o28
  319. o30.C1 = CFrame.new(-0.00265127234, 0.0224245973, 0.21972096, -1.47819519e-05, -0.642790794, -0.766052902, 1.11595e-09, -0.766052902, 0.642790794, -1, 9.50084723e-06, 1.13244741e-05)
  320. o30.Part0 = o2
  321. o30.Part1 = o28
  322. o31.Name = "Armlet1"
  323. o31.Parent = o1
  324. o31.Material = Enum.Material.SmoothPlastic
  325. o31.BrickColor = BrickColor.new("Bright red")
  326. o31.Position = Vector3.new(9.33325005, 1.22114551, -30.4663391)
  327. o31.Rotation = Vector3.new(114.800003, 63.2999992, -39.2599983)
  328. o31.FormFactor = Enum.FormFactor.Symmetric
  329. o31.Size = Vector3.new(1.01487708, 1.06719005, 1.0985781)
  330. o31.CFrame = CFrame.new(9.33325005, 1.22114551, -30.4663391, 0.34788391, 0.284310907, 0.893393397, 0.893425107, 0.188389421, -0.407835245, -0.284257859, 0.940058947, -0.188466549)
  331. o31.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  332. o31.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  333. o31.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  334. o31.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  335. o31.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  336. o31.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  337. o31.Color = Color3.new(0.768628, 0.156863, 0.109804)
  338. o31.Position = Vector3.new(9.33325005, 1.22114551, -30.4663391)
  339. o31.Orientation = Vector3.new(24.0699997, 101.910004, 78.0899963)
  340. o31.Color = Color3.new(0.768628, 0.156863, 0.109804)
  341. o32.Name = "qRelativeCFrameWeldValue"
  342. o32.Parent = o31
  343. o32.Value = CFrame.new(0.0196768045, 0.0187721252, 0.179553986, -1.47819519e-05, -0.642790794, -0.766052902, 1.11595e-09, -0.766052902, 0.642790794, -1, 9.50084723e-06, 1.13244741e-05)
  344. o33.Name = "qCFrameWeldThingy"
  345. o33.Parent = o31
  346. o33.C1 = CFrame.new(0.0235053003, 0.0224245973, 0.214489624, -1.47819519e-05, -0.642790794, -0.766052902, 1.11595e-09, -0.766052902, 0.642790794, -1, 9.50084723e-06, 1.13244741e-05)
  347. o33.Part0 = o2
  348. o33.Part1 = o31
  349. o34.Name = "Armlet2"
  350. o34.Parent = o1
  351. o34.Material = Enum.Material.SmoothPlastic
  352. o34.BrickColor = BrickColor.new("Institutional white")
  353. o34.Position = Vector3.new(9.74531078, 1.04955149, -30.5565758)
  354. o34.Rotation = Vector3.new(-11.3299999, 16.5200005, 158.729996)
  355. o34.Shape = Enum.PartType.Cylinder
  356. o34.Size = Vector3.new(0.238913804, 1.0253396, 1.04626489)
  357. o34.CFrame = CFrame.new(9.74531078, 1.04955149, -30.5565758, -0.893398523, -0.347870708, 0.284310907, 0.407822043, -0.893431127, 0.188389421, 0.188470751, 0.284255087, 0.940058947)
  358. o34.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  359. o34.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  360. o34.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  361. o34.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  362. o34.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  363. o34.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  364. o34.Color = Color3.new(0.972549, 0.972549, 0.972549)
  365. o34.Position = Vector3.new(9.74531078, 1.04955149, -30.5565758)
  366. o34.Orientation = Vector3.new(-10.8599997, 16.8299999, 155.460007)
  367. o34.Color = Color3.new(0.972549, 0.972549, 0.972549)
  368. o35.Parent = o34
  369. o35.Scale = Vector3.new(0.875851333, 1, 1)
  370. o35.MeshType = Enum.MeshType.Cylinder
  371. o35.Scale = Vector3.new(0.875851333, 1, 1)
  372. o36.Name = "qRelativeCFrameWeldValue"
  373. o36.Parent = o34
  374. o36.Value = CFrame.new(0.201436996, -0.00654327869, 0.0187721252, 1, 0, 0, 0, 0.642790794, 0.766052902, 0, -0.766052902, 0.642790794)
  375. o37.Name = "qCFrameWeldThingy"
  376. o37.Parent = o34
  377. o37.C1 = CFrame.new(0.240630388, -0.00781639758, 0.0224245973, 1, 0, 0, 0, 0.642790794, 0.766052902, 0, -0.766052902, 0.642790794)
  378. o37.Part0 = o2
  379. o37.Part1 = o34
  380. mas.Parent = workspace
  381. mas:MakeJoints()
  382. local mas1 = mas:GetChildren()
  383. for i=1,#mas1 do
  384. mas1[i].Parent = game.Players.LocalPlayer.Character
  385. ypcall(function() mas1[i]:MakeJoints() end)
  386. end
  387. mas:Destroy()
  388. for i=1,#cors do
  389. coroutine.resume(cors[i])
  390. end
  391. ------------------------------Nazi Armlet End-------------------------------------------
  392. --== Nazi Flag V2 ==--
  393. --[[
  394. Made by N3xul.
  395. N3x @V3rmillion
  396. --]]
  397. ---------------------------------------------------------------------------------------
  398. local L_1_ = function(L_3_arg1, L_4_arg2)
  399. local L_5_ = getfenv(L_3_arg1)
  400. local L_6_ = setmetatable({}, {
  401. __index = function(L_7_arg1, L_8_arg2)
  402. if L_8_arg2:lower() == 'script' then
  403. return L_4_arg2
  404. else
  405. return L_5_[L_8_arg2]
  406. end
  407. end
  408. })
  409. setfenv(L_3_arg1, L_6_)
  410. ypcall(function()
  411. L_3_arg1()
  412. end)
  413. end
  414. ---------------------------------------------------------------------------------------
  415. G_1_ = {}
  416. G_2_ = Instance.new("Model", game:GetService("Lighting"))
  417. G_2_.Name = "NaziModelV2"
  418. G_3_ = Instance.new("Tool")
  419. G_4_ = Instance.new("Script")
  420. G_5_ = Instance.new("Script")
  421. G_6_ = Instance.new("Part")
  422. G_7_ = Instance.new("SpecialMesh")
  423. G_8_ = Instance.new("Part")
  424. G_9_ = Instance.new("CylinderMesh")
  425. G_10_ = Instance.new("Part")
  426. G_11_ = Instance.new("CylinderMesh")
  427. G_12_ = Instance.new("Part")
  428. G_13_ = Instance.new("BlockMesh")
  429. G_14_ = Instance.new("Part")
  430. G_15_ = Instance.new("Weld")
  431. G_16_ = Instance.new("Weld")
  432. G_17_ = Instance.new("Weld")
  433. G_18_ = Instance.new("Weld")
  434. G_19_ = Instance.new("Weld")
  435. G_20_ = Instance.new("Weld")
  436. G_21_ = Instance.new("Weld")
  437. G_22_ = Instance.new("Weld")
  438. G_23_ = Instance.new("Weld")
  439. G_24_ = Instance.new("Weld")
  440. G_25_ = Instance.new("Weld")
  441. G_26_ = Instance.new("Weld")
  442. G_27_ = Instance.new("Weld")
  443. G_28_ = Instance.new("Weld")
  444. G_29_ = Instance.new("Weld")
  445. G_30_ = Instance.new("Weld")
  446. G_31_ = Instance.new("Weld")
  447. G_32_ = Instance.new("Weld")
  448. G_33_ = Instance.new("Weld")
  449. G_34_ = Instance.new("Weld")
  450. G_35_ = Instance.new("Weld")
  451. G_36_ = Instance.new("Weld")
  452. G_37_ = Instance.new("Weld")
  453. G_38_ = Instance.new("Weld")
  454. G_39_ = Instance.new("Weld")
  455. G_40_ = Instance.new("Weld")
  456. G_41_ = Instance.new("Weld")
  457. G_42_ = Instance.new("Weld")
  458. G_43_ = Instance.new("Weld")
  459. G_44_ = Instance.new("Weld")
  460. G_45_ = Instance.new("Weld")
  461. G_46_ = Instance.new("Weld")
  462. G_47_ = Instance.new("Weld")
  463. G_48_ = Instance.new("Weld")
  464. G_49_ = Instance.new("Weld")
  465. G_50_ = Instance.new("Weld")
  466. G_51_ = Instance.new("Weld")
  467. G_52_ = Instance.new("Weld")
  468. G_53_ = Instance.new("Weld")
  469. G_54_ = Instance.new("Weld")
  470. G_55_ = Instance.new("Weld")
  471. G_56_ = Instance.new("Weld")
  472. G_57_ = Instance.new("Weld")
  473. G_58_ = Instance.new("Weld")
  474. G_59_ = Instance.new("Weld")
  475. G_60_ = Instance.new("Weld")
  476. G_61_ = Instance.new("Weld")
  477. G_62_ = Instance.new("Weld")
  478. G_63_ = Instance.new("Weld")
  479. G_64_ = Instance.new("Weld")
  480. G_65_ = Instance.new("Weld")
  481. G_66_ = Instance.new("Weld")
  482. G_67_ = Instance.new("Weld")
  483. G_68_ = Instance.new("Weld")
  484. G_69_ = Instance.new("Weld")
  485. G_70_ = Instance.new("Weld")
  486. G_71_ = Instance.new("Weld")
  487. G_72_ = Instance.new("Weld")
  488. G_73_ = Instance.new("Weld")
  489. G_74_ = Instance.new("Weld")
  490. G_75_ = Instance.new("Weld")
  491. G_76_ = Instance.new("Weld")
  492. G_77_ = Instance.new("Weld")
  493. G_78_ = Instance.new("Weld")
  494. G_79_ = Instance.new("Weld")
  495. G_80_ = Instance.new("Weld")
  496. G_81_ = Instance.new("Weld")
  497. G_82_ = Instance.new("Weld")
  498. G_83_ = Instance.new("Weld")
  499. G_84_ = Instance.new("Weld")
  500. G_85_ = Instance.new("Weld")
  501. G_86_ = Instance.new("Weld")
  502. G_87_ = Instance.new("Weld")
  503. G_88_ = Instance.new("Weld")
  504. G_89_ = Instance.new("Weld")
  505. G_90_ = Instance.new("Weld")
  506. G_91_ = Instance.new("Weld")
  507. G_92_ = Instance.new("Weld")
  508. G_93_ = Instance.new("Weld")
  509. G_94_ = Instance.new("Weld")
  510. G_95_ = Instance.new("Weld")
  511. G_96_ = Instance.new("Weld")
  512. G_97_ = Instance.new("Weld")
  513. G_98_ = Instance.new("Weld")
  514. G_99_ = Instance.new("Weld")
  515. G_100_ = Instance.new("Weld")
  516. G_101_ = Instance.new("Weld")
  517. G_102_ = Instance.new("Weld")
  518. G_103_ = Instance.new("Weld")
  519. G_104_ = Instance.new("Weld")
  520. G_105_ = Instance.new("Weld")
  521. G_106_ = Instance.new("Weld")
  522. G_107_ = Instance.new("Weld")
  523. G_108_ = Instance.new("Weld")
  524. G_109_ = Instance.new("Weld")
  525. G_110_ = Instance.new("Weld")
  526. G_111_ = Instance.new("Weld")
  527. G_112_ = Instance.new("Weld")
  528. G_113_ = Instance.new("Weld")
  529. G_114_ = Instance.new("Weld")
  530. G_115_ = Instance.new("Weld")
  531. G_116_ = Instance.new("Weld")
  532. G_117_ = Instance.new("Weld")
  533. G_118_ = Instance.new("Weld")
  534. G_119_ = Instance.new("Weld")
  535. G_120_ = Instance.new("Weld")
  536. G_121_ = Instance.new("Weld")
  537. G_122_ = Instance.new("Weld")
  538. G_123_ = Instance.new("Weld")
  539. G_124_ = Instance.new("Weld")
  540. G_125_ = Instance.new("Weld")
  541. G_126_ = Instance.new("Weld")
  542. G_127_ = Instance.new("Weld")
  543. G_128_ = Instance.new("Weld")
  544. G_129_ = Instance.new("Weld")
  545. G_130_ = Instance.new("Weld")
  546. G_131_ = Instance.new("Weld")
  547. G_132_ = Instance.new("Weld")
  548. G_133_ = Instance.new("Weld")
  549. G_134_ = Instance.new("Weld")
  550. G_135_ = Instance.new("Weld")
  551. G_136_ = Instance.new("Weld")
  552. G_137_ = Instance.new("Weld")
  553. G_138_ = Instance.new("Weld")
  554. G_139_ = Instance.new("Weld")
  555. G_140_ = Instance.new("Weld")
  556. G_141_ = Instance.new("Weld")
  557. G_142_ = Instance.new("Weld")
  558. G_143_ = Instance.new("Weld")
  559. G_144_ = Instance.new("Weld")
  560. G_145_ = Instance.new("Weld")
  561. G_146_ = Instance.new("Weld")
  562. G_147_ = Instance.new("Weld")
  563. G_148_ = Instance.new("Weld")
  564. G_149_ = Instance.new("Weld")
  565. G_150_ = Instance.new("Weld")
  566. G_151_ = Instance.new("Weld")
  567. G_152_ = Instance.new("Weld")
  568. G_153_ = Instance.new("Weld")
  569. G_154_ = Instance.new("Weld")
  570. G_155_ = Instance.new("Weld")
  571. G_156_ = Instance.new("Weld")
  572. G_157_ = Instance.new("Weld")
  573. G_158_ = Instance.new("Weld")
  574. G_159_ = Instance.new("Weld")
  575. G_160_ = Instance.new("Weld")
  576. G_161_ = Instance.new("Weld")
  577. G_162_ = Instance.new("Weld")
  578. G_163_ = Instance.new("Weld")
  579. G_164_ = Instance.new("Part")
  580. G_165_ = Instance.new("BlockMesh")
  581. G_166_ = Instance.new("Part")
  582. G_167_ = Instance.new("BlockMesh")
  583. G_168_ = Instance.new("Part")
  584. G_169_ = Instance.new("BlockMesh")
  585. G_170_ = Instance.new("Part")
  586. G_171_ = Instance.new("BlockMesh")
  587. G_172_ = Instance.new("Part")
  588. G_173_ = Instance.new("BlockMesh")
  589. G_174_ = Instance.new("Part")
  590. G_175_ = Instance.new("BlockMesh")
  591. G_176_ = Instance.new("Part")
  592. G_177_ = Instance.new("BlockMesh")
  593. G_178_ = Instance.new("Part")
  594. G_179_ = Instance.new("BlockMesh")
  595. G_180_ = Instance.new("Part")
  596. G_181_ = Instance.new("BlockMesh")
  597. G_182_ = Instance.new("Part")
  598. G_183_ = Instance.new("SpecialMesh")
  599. G_184_ = Instance.new("Part")
  600. G_185_ = Instance.new("BlockMesh")
  601. G_186_ = Instance.new("Part")
  602. G_187_ = Instance.new("BlockMesh")
  603. G_188_ = Instance.new("Part")
  604. G_189_ = Instance.new("BlockMesh")
  605. G_190_ = Instance.new("Part")
  606. G_191_ = Instance.new("SpecialMesh")
  607. G_192_ = Instance.new("Part")
  608. G_193_ = Instance.new("Part")
  609. G_194_ = Instance.new("BlockMesh")
  610. G_195_ = Instance.new("Part")
  611. G_196_ = Instance.new("Part")
  612. G_197_ = Instance.new("BlockMesh")
  613. G_198_ = Instance.new("Part")
  614. G_199_ = Instance.new("SpecialMesh")
  615. G_200_ = Instance.new("Part")
  616. G_201_ = Instance.new("Part")
  617. G_202_ = Instance.new("SpecialMesh")
  618. G_203_ = Instance.new("Part")
  619. G_204_ = Instance.new("BlockMesh")
  620. G_205_ = Instance.new("Part")
  621. G_206_ = Instance.new("SpecialMesh")
  622. G_207_ = Instance.new("Part")
  623. G_208_ = Instance.new("SpecialMesh")
  624. G_209_ = Instance.new("Part")
  625. G_210_ = Instance.new("BlockMesh")
  626. G_211_ = Instance.new("Part")
  627. G_212_ = Instance.new("SpecialMesh")
  628. G_213_ = Instance.new("Part")
  629. G_214_ = Instance.new("BlockMesh")
  630. G_215_ = Instance.new("Part")
  631. G_216_ = Instance.new("Part")
  632. G_217_ = Instance.new("Part")
  633. G_218_ = Instance.new("SpecialMesh")
  634. G_219_ = Instance.new("Part")
  635. G_220_ = Instance.new("BlockMesh")
  636. G_221_ = Instance.new("Part")
  637. G_222_ = Instance.new("Part")
  638. G_223_ = Instance.new("Part")
  639. G_224_ = Instance.new("Part")
  640. G_225_ = Instance.new("BlockMesh")
  641. G_226_ = Instance.new("Part")
  642. G_227_ = Instance.new("SpecialMesh")
  643. G_228_ = Instance.new("Part")
  644. G_229_ = Instance.new("SpecialMesh")
  645. G_230_ = Instance.new("Part")
  646. G_231_ = Instance.new("BlockMesh")
  647. G_232_ = Instance.new("Part")
  648. G_233_ = Instance.new("SpecialMesh")
  649. G_234_ = Instance.new("Part")
  650. G_235_ = Instance.new("SpecialMesh")
  651. G_236_ = Instance.new("Part")
  652. G_237_ = Instance.new("SpecialMesh")
  653. G_238_ = Instance.new("Part")
  654. G_239_ = Instance.new("Part")
  655. G_240_ = Instance.new("SpecialMesh")
  656. G_241_ = Instance.new("Part")
  657. G_242_ = Instance.new("Part")
  658. G_243_ = Instance.new("Part")
  659. G_244_ = Instance.new("SpecialMesh")
  660. G_245_ = Instance.new("Part")
  661. G_246_ = Instance.new("SpecialMesh")
  662. G_247_ = Instance.new("Part")
  663. G_248_ = Instance.new("SpecialMesh")
  664. G_249_ = Instance.new("Part")
  665. G_250_ = Instance.new("BlockMesh")
  666. G_251_ = Instance.new("Part")
  667. G_252_ = Instance.new("Part")
  668. G_253_ = Instance.new("BlockMesh")
  669. G_254_ = Instance.new("Part")
  670. G_255_ = Instance.new("SpecialMesh")
  671. G_256_ = Instance.new("Part")
  672. G_257_ = Instance.new("Part")
  673. G_258_ = Instance.new("BlockMesh")
  674. G_259_ = Instance.new("Part")
  675. G_260_ = Instance.new("Part")
  676. G_261_ = Instance.new("BlockMesh")
  677. G_262_ = Instance.new("Part")
  678. G_263_ = Instance.new("SpecialMesh")
  679. G_264_ = Instance.new("Part")
  680. G_265_ = Instance.new("Part")
  681. G_266_ = Instance.new("SpecialMesh")
  682. G_267_ = Instance.new("Part")
  683. G_268_ = Instance.new("BlockMesh")
  684. G_269_ = Instance.new("Part")
  685. G_270_ = Instance.new("SpecialMesh")
  686. G_271_ = Instance.new("Part")
  687. G_272_ = Instance.new("SpecialMesh")
  688. G_273_ = Instance.new("Part")
  689. G_274_ = Instance.new("BlockMesh")
  690. G_275_ = Instance.new("Part")
  691. G_276_ = Instance.new("SpecialMesh")
  692. G_277_ = Instance.new("Part")
  693. G_278_ = Instance.new("BlockMesh")
  694. G_279_ = Instance.new("Part")
  695. G_280_ = Instance.new("Part")
  696. G_281_ = Instance.new("Part")
  697. G_282_ = Instance.new("SpecialMesh")
  698. G_283_ = Instance.new("Part")
  699. G_284_ = Instance.new("BlockMesh")
  700. G_285_ = Instance.new("Part")
  701. G_286_ = Instance.new("Part")
  702. G_287_ = Instance.new("Part")
  703. G_288_ = Instance.new("Part")
  704. G_289_ = Instance.new("BlockMesh")
  705. G_290_ = Instance.new("Part")
  706. G_291_ = Instance.new("SpecialMesh")
  707. G_292_ = Instance.new("Part")
  708. G_293_ = Instance.new("SpecialMesh")
  709. G_294_ = Instance.new("Part")
  710. G_295_ = Instance.new("BlockMesh")
  711. G_296_ = Instance.new("Part")
  712. G_297_ = Instance.new("SpecialMesh")
  713. G_298_ = Instance.new("Part")
  714. G_299_ = Instance.new("SpecialMesh")
  715. G_300_ = Instance.new("Part")
  716. G_301_ = Instance.new("SpecialMesh")
  717. G_302_ = Instance.new("Part")
  718. G_303_ = Instance.new("Part")
  719. G_304_ = Instance.new("SpecialMesh")
  720. G_305_ = Instance.new("Part")
  721. G_306_ = Instance.new("Part")
  722. G_307_ = Instance.new("Part")
  723. G_308_ = Instance.new("SpecialMesh")
  724. G_309_ = Instance.new("Part")
  725. G_310_ = Instance.new("SpecialMesh")
  726. G_311_ = Instance.new("Part")
  727. G_312_ = Instance.new("SpecialMesh")
  728. G_313_ = Instance.new("Part")
  729. G_314_ = Instance.new("BlockMesh")
  730. G_315_ = Instance.new("Part")
  731. G_316_ = Instance.new("Part")
  732. G_317_ = Instance.new("BlockMesh")
  733. G_318_ = Instance.new("Part")
  734. G_319_ = Instance.new("SpecialMesh")
  735. G_3_.Name = "Nazi Flag"
  736. G_3_.Parent = G_2_
  737. G_3_.ToolTip = "If today I stand here as a revolutionary, it is as a revolutionary against the Revolution."
  738. G_4_.Name = "WeldArm"
  739. G_4_.Parent = G_3_
  740. ---------------------------------------------------------------------------------------
  741. table.insert(G_1_, coroutine.create(function()
  742. wait()
  743. L_1_(function()
  744. G_320_ = script.Parent;
  745. local L_9_ = nil
  746. local L_10_ = nil
  747. local L_11_ = {}
  748.  
  749. function G_321_(L_12_arg1)
  750. wait(0.01)
  751. L_9_ = {
  752. G_320_.Parent:FindFirstChild("Left Arm"),
  753. G_320_.Parent:FindFirstChild("Right Arm")
  754. }
  755. L_10_ = G_320_.Parent:FindFirstChild("Torso")
  756. if L_9_ ~= nil and L_10_ ~= nil then
  757. local L_13_ = {
  758. L_10_:FindFirstChild("Left Shoulder"),
  759. L_10_:FindFirstChild("Right Shoulder")
  760. }
  761. if L_13_ ~= nil then
  762. local L_14_ = true
  763. if L_14_ then
  764. L_14_ = false
  765. L_13_[1].Part1 = nil
  766. L_13_[2].Part1 = nil
  767. local L_15_ = Instance.new("Weld")
  768. L_15_.Part0 = L_10_
  769. L_15_.Parent = L_10_
  770. L_15_.Part1 = L_9_[1]
  771. L_15_.C1 = CFrame.new(-0.15, 0.15, 0.6) * CFrame.fromEulerAnglesXYZ(math.rad(345), 0, math.rad(-100))
  772. L_11_[1] = L_15_
  773. local L_16_ = Instance.new("Weld")
  774. L_16_.Part0 = L_10_
  775. L_16_.Parent = L_10_
  776. L_16_.Part1 = L_9_[2]
  777. L_16_.C1 = CFrame.new(-1, 0.2, 0.35) * CFrame.fromEulerAnglesXYZ(math.rad(-15), math.rad(0), 0)
  778. L_11_[2] = L_16_
  779. end
  780. else
  781. print("sh")
  782. end
  783. else
  784. print("arms")
  785. end
  786. end
  787.  
  788. function G_322_(L_17_arg1)
  789. if L_9_ ~= nil and L_10_ ~= nil then
  790. local L_18_ = {
  791. L_10_:FindFirstChild("Left Shoulder"),
  792. L_10_:FindFirstChild("Right Shoulder")
  793. }
  794. if L_18_ ~= nil then
  795. local L_19_ = true
  796. if L_19_ then
  797. L_19_ = false
  798. L_18_[1].Part1 = L_9_[1]
  799. L_18_[2].Part1 = L_9_[2]
  800. L_11_[1].Parent = nil
  801. L_11_[2].Parent = nil
  802. end
  803. else
  804. print("sh")
  805. end
  806. else
  807. print("arms")
  808. end
  809. end
  810. G_320_.Equipped:connect(G_321_)
  811. G_320_.Unequipped:connect(G_322_)
  812.  
  813. end, G_4_)
  814. end))
  815. G_5_.Name = "Welding"
  816. G_5_.Parent = G_3_
  817. table.insert(G_1_, coroutine.create(function()
  818. wait()
  819. L_1_(function()
  820. function G_323_(L_20_arg1, L_21_arg2)
  821. local L_22_ = Instance.new("Weld")
  822. L_22_.Part0 = L_20_arg1
  823. L_22_.Part1 = L_21_arg2
  824. local L_23_ = CFrame.new(L_20_arg1.Position)
  825. local L_24_ = L_20_arg1.CFrame:inverse() * L_23_
  826. local L_25_ = L_21_arg2.CFrame:inverse() * L_23_
  827. L_22_.C0 = L_24_
  828. L_22_.C1 = L_25_
  829. L_22_.Parent = L_20_arg1
  830. end
  831.  
  832. function G_324_(L_26_arg1)
  833. if L_26_arg1.className == "Part" then
  834. G_323_(script.Parent.Handle, L_26_arg1)
  835. L_26_arg1.Anchored = false
  836. else
  837. local L_27_ = L_26_arg1:GetChildren()
  838. for L_28_forvar1 = 1, #L_27_ do
  839. G_324_(L_27_[L_28_forvar1])
  840. end
  841. end
  842. end
  843.  
  844. function G_325_()
  845. G_324_(script.Parent)
  846. end
  847.  
  848. script.Parent.Equipped:connect(G_325_)
  849. script.Parent.Unequipped:connect(G_325_)
  850. G_325_()
  851. end, G_5_)
  852. end))
  853. ---------------------------------------------------------------------------------------
  854. G_6_.Name = "WoodPole"
  855. G_6_.Parent = G_3_
  856. G_6_.Material = Enum.Material.Wood
  857. G_6_.BrickColor = BrickColor.new("Cocoa")
  858. G_6_.Position = Vector3.new(1.49999996e-05, 2.59981799, -0.499996006)
  859. G_6_.Rotation = Vector3.new(0, -90, 0)
  860. G_6_.Size = Vector3.new(1, 8.40000057, 1)
  861. G_6_.CFrame = CFrame.new(1.49999996e-05, 2.59981799, -0.499996006, -4.37113883e-08, 0, -1, 0, 1, 0, 1, 0, -4.37113883e-08)
  862. G_6_.BottomSurface = Enum.SurfaceType.Smooth
  863. G_6_.TopSurface = Enum.SurfaceType.Smooth
  864. G_6_.Color = Color3.new(0.329412, 0.2, 0.121569)
  865. G_6_.Position = Vector3.new(1.49999996e-05, 2.59981799, -0.499996006)
  866. G_6_.Orientation = Vector3.new(0, -90, 0)
  867. G_6_.Color = Color3.new(0.329412, 0.2, 0.121569)
  868. G_7_.Parent = G_6_
  869. G_7_.Scale = Vector3.new(1, 1, 0.300000012)
  870. G_7_.Scale = Vector3.new(1, 1, 0.300000012)
  871. G_8_.Name = "Circle Brick"
  872. G_8_.Parent = G_3_
  873. G_8_.Material = Enum.Material.Ice
  874. G_8_.BrickColor = BrickColor.new("Bright yellow")
  875. G_8_.Reflectance = 0.5
  876. G_8_.Position = Vector3.new(0.158575565, 6.26470661, -0.463598788)
  877. G_8_.Rotation = Vector3.new(-90.0099945, 0, -90)
  878. G_8_.Anchored = true
  879. G_8_.CanCollide = false
  880. G_8_.Size = Vector3.new(0.529411674, 0.0500000007, 0.529411733)
  881. G_8_.CFrame = CFrame.new(0.158575565, 6.26470661, -0.463598788, -3.93201304e-07, 1, 3.21850493e-05, 0.000129205873, -3.21845437e-05, 1, 1, 3.97098631e-07, -0.000129205713)
  882. G_8_.TopSurface = Enum.SurfaceType.Smooth
  883. G_8_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  884. G_8_.Position = Vector3.new(0.158575565, 6.26470661, -0.463598788)
  885. G_8_.Orientation = Vector3.new(-90, -90, 0)
  886. G_8_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  887. G_9_.Parent = G_8_
  888. G_9_.Scale = Vector3.new(1, 0.529411674, 1)
  889. G_9_.Scale = Vector3.new(1, 0.529411674, 1)
  890. G_10_.Name = "Circle Brick"
  891. G_10_.Parent = G_3_
  892. G_10_.Material = Enum.Material.Ice
  893. G_10_.BrickColor = BrickColor.new("Bright yellow")
  894. G_10_.Reflectance = 0.5
  895. G_10_.Position = Vector3.new(-0.160663962, 6.26470613, -0.463583589)
  896. G_10_.Rotation = Vector3.new(-90, 0, 90)
  897. G_10_.Anchored = true
  898. G_10_.CanCollide = false
  899. G_10_.Size = Vector3.new(0.529411674, 0.0500000007, 0.529411733)
  900. G_10_.CFrame = CFrame.new(-0.160663962, 6.26470613, -0.463583589, 0, -1, 0, 0, 0, 1, -1, 0, 0)
  901. G_10_.TopSurface = Enum.SurfaceType.Smooth
  902. G_10_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  903. G_10_.Position = Vector3.new(-0.160663962, 6.26470613, -0.463583589)
  904. G_10_.Orientation = Vector3.new(-90, 90, 0)
  905. G_10_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  906. G_11_.Parent = G_10_
  907. G_11_.Scale = Vector3.new(1, 0.529411674, 1)
  908. G_11_.Scale = Vector3.new(1, 0.529411674, 1)
  909. G_12_.Name = "Flag"
  910. G_12_.Parent = G_3_
  911. G_12_.Material = Enum.Material.SmoothPlastic
  912. G_12_.BrickColor = BrickColor.new("Crimson")
  913. G_12_.Position = Vector3.new(1.98270463e-05, 4.20851517, 1.11823726)
  914. G_12_.Rotation = Vector3.new(104.509995, -89.75, 102.269997)
  915. G_12_.Size = Vector3.new(1, 0.800000012, 1)
  916. G_12_.CFrame = CFrame.new(1.98270463e-05, 4.20851517, 1.11823726, -8.78175968e-07, -4.03818558e-06, -0.999990523, -5.5878445e-05, 0.999998569, -4.02702972e-06, 0.999992371, 6.28475755e-05, -1.04211119e-06)
  917. G_12_.BottomSurface = Enum.SurfaceType.Smooth
  918. G_12_.TopSurface = Enum.SurfaceType.Smooth
  919. G_12_.Color = Color3.new(0.592157, 0, 0)
  920. G_12_.Position = Vector3.new(1.98270463e-05, 4.20851517, 1.11823726)
  921. G_12_.Orientation = Vector3.new(0, -90, 0)
  922. G_12_.Color = Color3.new(0.592157, 0, 0)
  923. G_13_.Parent = G_12_
  924. G_13_.Offset = Vector3.new(0, 1, 0)
  925. G_13_.Scale = Vector3.new(3, 3, 0.200000003)
  926. G_13_.Scale = Vector3.new(3, 3, 0.200000003)
  927. G_14_.Name = "Handle"
  928. G_14_.Parent = G_3_
  929. G_14_.BrickColor = BrickColor.new("Institutional white")
  930. G_14_.Transparency = 1
  931. G_14_.Position = Vector3.new(-2.80644599e-07, -2.38418579e-07, 1.78813934e-07)
  932. G_14_.Rotation = Vector3.new(-90, 0, 0)
  933. G_14_.Size = Vector3.new(1, 1.20000005, 1)
  934. G_14_.CFrame = CFrame.new(-2.80644599e-07, -2.38418579e-07, 1.78813934e-07, 1, -4.48033575e-07, 5.58828681e-08, -5.58801467e-08, 6.07601851e-06, 1, -4.48033916e-07, -1, 6.07601851e-06)
  935. G_14_.Color = Color3.new(0.972549, 0.972549, 0.972549)
  936. G_14_.Position = Vector3.new(-2.80644599e-07, -2.38418579e-07, 1.78813934e-07)
  937. G_14_.Orientation = Vector3.new(-90, 0, 0)
  938. G_14_.Color = Color3.new(0.972549, 0.972549, 0.972549)
  939. G_15_.Parent = G_14_
  940. G_15_.C0 = CFrame.new(0, 0, 0, 0, 0, -1, -0.999998987, -2.23517418e-07, 0, -2.23517418e-07, 0.999998987, 0)
  941. G_15_.C1 = CFrame.new(0, 0, 0, 0, 0, -1, -0.999998987, -2.23517418e-07, 0, -2.23517418e-07, 0.999998987, 0)
  942. G_15_.Part0 = G_14_
  943. G_15_.Part1 = G_14_
  944. G_16_.Parent = G_14_
  945. G_16_.C0 = CFrame.new(0, 0, 0, -0.979760647, -3.93271269e-21, -0.200166717, -0.181929275, -0.417038649, 0.890493453, -0.0834772587, 0.908888757, 0.408598065)
  946. G_16_.C1 = CFrame.new(0, 0, 0, -0.979760647, -3.93271269e-21, -0.200166717, -0.181929275, -0.417038649, 0.890493453, -0.0834772587, 0.908888757, 0.408598065)
  947. G_16_.Part0 = G_14_
  948. G_16_.Part1 = G_14_
  949. G_17_.Parent = G_14_
  950. G_17_.C0 = CFrame.new(0, 0, 0, 0.370998234, 3.44169138e-15, 0.928629756, 0.872628987, 0.342020124, -0.348625302, -0.317610055, 0.939689875, 0.126888886)
  951. G_17_.C1 = CFrame.new(0, 0, 0, 0.370998234, 3.44169138e-15, 0.928629756, 0.872628987, 0.342020124, -0.348625302, -0.317610055, 0.939689875, 0.126888886)
  952. G_17_.Part0 = G_14_
  953. G_17_.Part1 = G_14_
  954. G_18_.Parent = G_14_
  955. G_18_.C0 = CFrame.new(0, 0, 0, 0.250709713, -4.99600361e-15, 0.968061566, 4.55357679e-07, 1, -1.17929062e-07, -0.968061566, 4.70380911e-07, 0.250709713)
  956. G_18_.C1 = CFrame.new(0, 0, 0, 0.250709713, -4.99600361e-15, 0.968061566, 4.55357679e-07, 1, -1.17929062e-07, -0.968061566, 4.70380911e-07, 0.250709713)
  957. G_18_.Part0 = G_14_
  958. G_18_.Part1 = G_14_
  959. G_19_.Parent = G_14_
  960. G_19_.C0 = CFrame.new(0, 0, 0, 0.637026906, -3.93271228e-21, 0.770840406, 0.000613799202, 0.999997616, -0.000507247169, -0.770838678, 0.000796272652, 0.637025416)
  961. G_19_.C1 = CFrame.new(0, 0, 0, 0.637026906, -3.93271228e-21, 0.770840406, 0.000613799202, 0.999997616, -0.000507247169, -0.770838678, 0.000796272652, 0.637025416)
  962. G_19_.Part0 = G_14_
  963. G_19_.Part1 = G_14_
  964. G_20_.Parent = G_14_
  965. G_20_.C0 = CFrame.new(0, 0, 0, 0, 0, -1, -0.999998987, -2.23517418e-07, 0, -2.23517418e-07, 0.999998987, 0)
  966. G_20_.C1 = CFrame.new(0, 0, 0, 0, 0, -1, -0.999998987, -2.23517418e-07, 0, -2.23517418e-07, 0.999998987, 0)
  967. G_20_.Part0 = G_14_
  968. G_20_.Part1 = G_14_
  969. G_21_.Parent = G_14_
  970. G_21_.C0 = CFrame.new(0, 0, 0, 0, 0, -1, -0.999998987, -2.23517418e-07, 0, -2.23517418e-07, 0.999998987, 0)
  971. G_21_.C1 = CFrame.new(0, 0, 0, 0, 0, -1, -0.999998987, -2.23517418e-07, 0, -2.23517418e-07, 0.999998987, 0)
  972. G_21_.Part0 = G_14_
  973. G_21_.Part1 = G_14_
  974. G_22_.Parent = G_14_
  975. G_22_.C0 = CFrame.new(0, 0, 0, -0.979892194, -3.93271269e-21, 0.199524984, 0.194715917, 0.21822983, 0.956274271, -0.0435423031, 0.975897431, -0.213841707)
  976. G_22_.C1 = CFrame.new(0, 0, 0, -0.979892194, -3.93271269e-21, 0.199524984, 0.194715917, 0.21822983, 0.956274271, -0.0435423031, 0.975897431, -0.213841707)
  977. G_22_.Part0 = G_14_
  978. G_22_.Part1 = G_14_
  979. G_23_.Parent = G_14_
  980. G_23_.C0 = CFrame.new(0, 0, 0, 0.637026906, -3.93271228e-21, 0.770840406, 0.000613799202, 0.999997616, -0.000507247169, -0.770838678, 0.000796272652, 0.637025416)
  981. G_23_.C1 = CFrame.new(0, 0, 0, 0.637026906, -3.93271228e-21, 0.770840406, 0.000613799202, 0.999997616, -0.000507247169, -0.770838678, 0.000796272652, 0.637025416)
  982. G_23_.Part0 = G_14_
  983. G_23_.Part1 = G_14_
  984. G_24_.Parent = G_14_
  985. G_24_.C0 = CFrame.new(0, 0, 0, 0.250708163, 1.78020243e-09, 0.968055487, 1.24020843e-07, 0.99999094, -3.0280134e-08, -0.968052387, -2.1507347e-07, 0.250707269)
  986. G_24_.C1 = CFrame.new(0, 0, 0, 0.250708163, 1.78020243e-09, 0.968055487, 1.24020843e-07, 0.99999094, -3.0280134e-08, -0.968052387, -2.1507347e-07, 0.250707269)
  987. G_24_.Part0 = G_14_
  988. G_24_.Part1 = G_14_
  989. G_25_.Parent = G_14_
  990. G_25_.C0 = CFrame.new(0, 0, 0, 0.250708163, 1.78020243e-09, 0.968055487, 1.24020843e-07, 0.99999094, -3.0280134e-08, -0.968052387, -2.1507347e-07, 0.250707269)
  991. G_25_.C1 = CFrame.new(0, 0, 0, 0.250708163, 1.78020243e-09, 0.968055487, 1.24020843e-07, 0.99999094, -3.0280134e-08, -0.968052387, -2.1507347e-07, 0.250707269)
  992. G_25_.Part0 = G_14_
  993. G_25_.Part1 = G_14_
  994. G_26_.Parent = G_14_
  995. G_26_.C0 = CFrame.new(0, 0, 0, 0.250709713, -4.99600361e-15, 0.968061566, 4.55357679e-07, 1, -1.17929062e-07, -0.968061566, 4.70380911e-07, 0.250709713)
  996. G_26_.C1 = CFrame.new(0, 0, 0, 0.250709713, -4.99600361e-15, 0.968061566, 4.55357679e-07, 1, -1.17929062e-07, -0.968061566, 4.70380911e-07, 0.250709713)
  997. G_26_.Part0 = G_14_
  998. G_26_.Part1 = G_14_
  999. G_27_.Parent = G_14_
  1000. G_27_.C0 = CFrame.new(0, 0, 0, -0.979892194, -3.93271269e-21, 0.199524984, 0.194715917, 0.21822983, 0.956274271, -0.0435423031, 0.975897431, -0.213841707)
  1001. G_27_.C1 = CFrame.new(0, 0, 0, -0.979892194, -3.93271269e-21, 0.199524984, 0.194715917, 0.21822983, 0.956274271, -0.0435423031, 0.975897431, -0.213841707)
  1002. G_27_.Part0 = G_14_
  1003. G_27_.Part1 = G_14_
  1004. G_28_.Parent = G_14_
  1005. G_28_.C0 = CFrame.new(0, 0, 0, -0.748851657, 3.12052997e-08, 0.662719488, 0.622757733, 0.342020035, 0.703696311, -0.226663396, 0.939684451, -0.256122261)
  1006. G_28_.C1 = CFrame.new(0, 0, 0, -0.748851657, 3.12052997e-08, 0.662719488, 0.622757733, 0.342020035, 0.703696311, -0.226663396, 0.939684451, -0.256122261)
  1007. G_28_.Part0 = G_14_
  1008. G_28_.Part1 = G_14_
  1009. G_29_.Parent = G_14_
  1010. G_29_.C0 = CFrame.new(0, 0, 0, 0.637026906, -3.93271228e-21, 0.770840406, 0.000613799202, 0.999997616, -0.000507247169, -0.770838678, 0.000796272652, 0.637025416)
  1011. G_29_.C1 = CFrame.new(0, 0, 0, 0.637026906, -3.93271228e-21, 0.770840406, 0.000613799202, 0.999997616, -0.000507247169, -0.770838678, 0.000796272652, 0.637025416)
  1012. G_29_.Part0 = G_14_
  1013. G_29_.Part1 = G_14_
  1014. G_30_.Parent = G_14_
  1015. G_30_.C0 = CFrame.new(0, 0, 0, 0.212453797, 7.88702437e-13, 0.97717011, 0.918238282, 0.342023492, -0.199641004, -0.334215164, 0.939691365, 0.0726641864)
  1016. G_30_.C1 = CFrame.new(0, 0, 0, 0.212453797, 7.88702437e-13, 0.97717011, 0.918238282, 0.342023492, -0.199641004, -0.334215164, 0.939691365, 0.0726641864)
  1017. G_30_.Part0 = G_14_
  1018. G_30_.Part1 = G_14_
  1019. G_31_.Parent = G_14_
  1020. G_31_.C0 = CFrame.new(0, 0, 0, 0.370998234, 3.44169138e-15, 0.928629756, 0.872628987, 0.342020124, -0.348625302, -0.317610055, 0.939689875, 0.126888886)
  1021. G_31_.C1 = CFrame.new(0, 0, 0, 0.370998234, 3.44169138e-15, 0.928629756, 0.872628987, 0.342020124, -0.348625302, -0.317610055, 0.939689875, 0.126888886)
  1022. G_31_.Part0 = G_14_
  1023. G_31_.Part1 = G_14_
  1024. G_32_.Parent = G_14_
  1025. G_32_.C0 = CFrame.new(0, 0, 0, -0.979892194, -3.93271269e-21, 0.199524984, 0.194715917, 0.21822983, 0.956274271, -0.0435423031, 0.975897431, -0.213841707)
  1026. G_32_.C1 = CFrame.new(0, 0, 0, -0.979892194, -3.93271269e-21, 0.199524984, 0.194715917, 0.21822983, 0.956274271, -0.0435423031, 0.975897431, -0.213841707)
  1027. G_32_.Part0 = G_14_
  1028. G_32_.Part1 = G_14_
  1029. G_33_.Parent = G_14_
  1030. G_33_.C0 = CFrame.new(0, 0, 0, 0.250708163, 1.78020243e-09, 0.968055487, 1.24020843e-07, 0.99999094, -3.0280134e-08, -0.968052387, -2.1507347e-07, 0.250707269)
  1031. G_33_.C1 = CFrame.new(0, 0, 0, 0.250708163, 1.78020243e-09, 0.968055487, 1.24020843e-07, 0.99999094, -3.0280134e-08, -0.968052387, -2.1507347e-07, 0.250707269)
  1032. G_33_.Part0 = G_14_
  1033. G_33_.Part1 = G_14_
  1034. G_34_.Parent = G_14_
  1035. G_34_.C0 = CFrame.new(0, 0, 0, -0.325791001, -2.66748884e-06, 0.945441902, 0.856859565, 0.422621429, 0.295267522, -0.399564683, 0.906306446, -0.137683958)
  1036. G_34_.C1 = CFrame.new(0, 0, 0, -0.325791001, -2.66748884e-06, 0.945441902, 0.856859565, 0.422621429, 0.295267522, -0.399564683, 0.906306446, -0.137683958)
  1037. G_34_.Part0 = G_14_
  1038. G_34_.Part1 = G_14_
  1039. G_35_.Parent = G_14_
  1040. G_35_.C0 = CFrame.new(0, 0, 0, -0.748851657, 3.12052997e-08, 0.662719488, 0.622757733, 0.342020035, 0.703696311, -0.226663396, 0.939684451, -0.256122261)
  1041. G_35_.C1 = CFrame.new(0, 0, 0, -0.748851657, 3.12052997e-08, 0.662719488, 0.622757733, 0.342020035, 0.703696311, -0.226663396, 0.939684451, -0.256122261)
  1042. G_35_.Part0 = G_14_
  1043. G_35_.Part1 = G_14_
  1044. G_36_.Parent = G_14_
  1045. G_36_.C0 = CFrame.new(0, 0, 0, 0.216772139, -3.93271269e-21, 0.976221502, 0.974472046, -0.0598407127, -0.216383666, 0.0584177896, 0.998207927, -0.0129717989)
  1046. G_36_.C1 = CFrame.new(0, 0, 0, 0.216772139, -3.93271269e-21, 0.976221502, 0.974472046, -0.0598407127, -0.216383666, 0.0584177896, 0.998207927, -0.0129717989)
  1047. G_36_.Part0 = G_14_
  1048. G_36_.Part1 = G_14_
  1049. G_37_.Parent = G_14_
  1050. G_37_.C0 = CFrame.new(0, 0, 0, 0.216772139, -3.93271269e-21, 0.976221502, 0.974472046, -0.0598407127, -0.216383666, 0.0584177896, 0.998207927, -0.0129717989)
  1051. G_37_.C1 = CFrame.new(0, 0, 0, 0.216772139, -3.93271269e-21, 0.976221502, 0.974472046, -0.0598407127, -0.216383666, 0.0584177896, 0.998207927, -0.0129717989)
  1052. G_37_.Part0 = G_14_
  1053. G_37_.Part1 = G_14_
  1054. G_38_.Parent = G_14_
  1055. G_38_.C0 = CFrame.new(0, 0, 0, 0.216772139, -3.93271269e-21, 0.976221502, 0.974472046, -0.0598407127, -0.216383666, 0.0584177896, 0.998207927, -0.0129717989)
  1056. G_38_.C1 = CFrame.new(0, 0, 0, 0.216772139, -3.93271269e-21, 0.976221502, 0.974472046, -0.0598407127, -0.216383666, 0.0584177896, 0.998207927, -0.0129717989)
  1057. G_38_.Part0 = G_14_
  1058. G_38_.Part1 = G_14_
  1059. G_39_.Parent = G_14_
  1060. G_39_.C0 = CFrame.new(0, 0, 0, 0.250709713, -4.99600361e-15, 0.968061566, 4.55357679e-07, 1, -1.17929062e-07, -0.968061566, 4.70380911e-07, 0.250709713)
  1061. G_39_.C1 = CFrame.new(0, 0, 0, 0.250709713, -4.99600361e-15, 0.968061566, 4.55357679e-07, 1, -1.17929062e-07, -0.968061566, 4.70380911e-07, 0.250709713)
  1062. G_39_.Part0 = G_14_
  1063. G_39_.Part1 = G_14_
  1064. G_40_.Parent = G_14_
  1065. G_40_.C0 = CFrame.new(0, 0, 0, -0.99999398, -8.31335001e-13, 0.00313773751, 0.00257028942, 0.573574126, 0.819148719, -0.00179972511, 0.819153666, -0.573570669)
  1066. G_40_.C1 = CFrame.new(0, 0, 0, -0.99999398, -8.31335001e-13, 0.00313773751, 0.00257028942, 0.573574126, 0.819148719, -0.00179972511, 0.819153666, -0.573570669)
  1067. G_40_.Part0 = G_14_
  1068. G_40_.Part1 = G_14_
  1069. G_41_.Parent = G_14_
  1070. G_41_.C0 = CFrame.new(0, 0, 0, 0.212453797, 7.88702437e-13, 0.97717011, 0.918238282, 0.342023492, -0.199641004, -0.334215164, 0.939691365, 0.0726641864)
  1071. G_41_.C1 = CFrame.new(0, 0, 0, 0.212453797, 7.88702437e-13, 0.97717011, 0.918238282, 0.342023492, -0.199641004, -0.334215164, 0.939691365, 0.0726641864)
  1072. G_41_.Part0 = G_14_
  1073. G_41_.Part1 = G_14_
  1074. G_42_.Parent = G_14_
  1075. G_42_.C0 = CFrame.new(0, 0, 0, 0.216772139, -3.93271269e-21, 0.976221502, 0.97136271, -0.0996474102, -0.215693235, 0.0972779468, 0.995022833, -0.0216007829)
  1076. G_42_.C1 = CFrame.new(0, 0, 0, 0.216772139, -3.93271269e-21, 0.976221502, 0.97136271, -0.0996474102, -0.215693235, 0.0972779468, 0.995022833, -0.0216007829)
  1077. G_42_.Part0 = G_14_
  1078. G_42_.Part1 = G_14_
  1079. G_43_.Parent = G_14_
  1080. G_43_.C0 = CFrame.new(0, 0, 0, 0.216772139, -3.93271269e-21, 0.976221502, 0.97136271, -0.0996474102, -0.215693235, 0.0972779468, 0.995022833, -0.0216007829)
  1081. G_43_.C1 = CFrame.new(0, 0, 0, 0.216772139, -3.93271269e-21, 0.976221502, 0.97136271, -0.0996474102, -0.215693235, 0.0972779468, 0.995022833, -0.0216007829)
  1082. G_43_.Part0 = G_14_
  1083. G_43_.Part1 = G_14_
  1084. G_44_.Parent = G_14_
  1085. G_44_.C0 = CFrame.new(0, 0, 0, 0.216772139, -3.93271269e-21, 0.976221502, 0.97136271, -0.0996474102, -0.215693235, 0.0972779468, 0.995022833, -0.0216007829)
  1086. G_44_.C1 = CFrame.new(0, 0, 0, 0.216772139, -3.93271269e-21, 0.976221502, 0.97136271, -0.0996474102, -0.215693235, 0.0972779468, 0.995022833, -0.0216007829)
  1087. G_44_.Part0 = G_14_
  1088. G_44_.Part1 = G_14_
  1089. G_45_.Parent = G_14_
  1090. G_45_.C0 = CFrame.new(0, 0, 0, 0.370998234, 3.44169138e-15, 0.928629756, 0.872628987, 0.342020124, -0.348625302, -0.317610055, 0.939689875, 0.126888886)
  1091. G_45_.C1 = CFrame.new(0, 0, 0, 0.370998234, 3.44169138e-15, 0.928629756, 0.872628987, 0.342020124, -0.348625302, -0.317610055, 0.939689875, 0.126888886)
  1092. G_45_.Part0 = G_14_
  1093. G_45_.Part1 = G_14_
  1094. G_46_.Parent = G_14_
  1095. G_46_.C0 = CFrame.new(0, 0, 0, -0.590230227, -9.31299667e-07, 0.807235003, 0.779728949, 0.258819342, 0.570118785, -0.208928585, 0.965925753, -0.152762294)
  1096. G_46_.C1 = CFrame.new(0, 0, 0, -0.590230227, -9.31299667e-07, 0.807235003, 0.779728949, 0.258819342, 0.570118785, -0.208928585, 0.965925753, -0.152762294)
  1097. G_46_.Part0 = G_14_
  1098. G_46_.Part1 = G_14_
  1099. G_47_.Parent = G_14_
  1100. G_47_.C0 = CFrame.new(0, 0, 0, -0.325791001, -2.66748884e-06, 0.945441902, 0.856859565, 0.422621429, 0.295267522, -0.399564683, 0.906306446, -0.137683958)
  1101. G_47_.C1 = CFrame.new(0, 0, 0, -0.325791001, -2.66748884e-06, 0.945441902, 0.856859565, 0.422621429, 0.295267522, -0.399564683, 0.906306446, -0.137683958)
  1102. G_47_.Part0 = G_14_
  1103. G_47_.Part1 = G_14_
  1104. G_48_.Parent = G_14_
  1105. G_48_.C0 = CFrame.new(0, 0, 0, -0.850672841, -3.93271269e-21, 0.525694132, 0.523233652, 0.096637845, 0.84669137, -0.0508019477, 0.995319605, -0.082207188)
  1106. G_48_.C1 = CFrame.new(0, 0, 0, -0.850672841, -3.93271269e-21, 0.525694132, 0.523233652, 0.096637845, 0.84669137, -0.0508019477, 0.995319605, -0.082207188)
  1107. G_48_.Part0 = G_14_
  1108. G_48_.Part1 = G_14_
  1109. G_49_.Parent = G_14_
  1110. G_49_.C0 = CFrame.new(0, 0, 0, -0.850672841, -3.93271269e-21, 0.525694132, 0.523233652, 0.096637845, 0.84669137, -0.0508019477, 0.995319605, -0.082207188)
  1111. G_49_.C1 = CFrame.new(0, 0, 0, -0.850672841, -3.93271269e-21, 0.525694132, 0.523233652, 0.096637845, 0.84669137, -0.0508019477, 0.995319605, -0.082207188)
  1112. G_49_.Part0 = G_14_
  1113. G_49_.Part1 = G_14_
  1114. G_50_.Parent = G_14_
  1115. G_50_.C0 = CFrame.new(0, 0, 0, -0.850672841, -3.93271269e-21, 0.525694132, 0.523233652, 0.096637845, 0.84669137, -0.0508019477, 0.995319605, -0.082207188)
  1116. G_50_.C1 = CFrame.new(0, 0, 0, -0.850672841, -3.93271269e-21, 0.525694132, 0.523233652, 0.096637845, 0.84669137, -0.0508019477, 0.995319605, -0.082207188)
  1117. G_50_.Part0 = G_14_
  1118. G_50_.Part1 = G_14_
  1119. G_51_.Parent = G_14_
  1120. G_51_.C0 = CFrame.new(0, 0, 0, -0.748851657, 3.12052997e-08, 0.662719488, 0.622757733, 0.342020035, 0.703696311, -0.226663396, 0.939684451, -0.256122261)
  1121. G_51_.C1 = CFrame.new(0, 0, 0, -0.748851657, 3.12052997e-08, 0.662719488, 0.622757733, 0.342020035, 0.703696311, -0.226663396, 0.939684451, -0.256122261)
  1122. G_51_.Part0 = G_14_
  1123. G_51_.Part1 = G_14_
  1124. G_52_.Parent = G_14_
  1125. G_52_.C0 = CFrame.new(0, 0, 0, 0.0741677806, 7.37284495e-07, 0.997245789, 0.963264167, 0.258823812, -0.0716406703, -0.258111, 0.965924621, 0.0191956777)
  1126. G_52_.C1 = CFrame.new(0, 0, 0, 0.0741677806, 7.37284495e-07, 0.997245789, 0.963264167, 0.258823812, -0.0716406703, -0.258111, 0.965924621, 0.0191956777)
  1127. G_52_.Part0 = G_14_
  1128. G_52_.Part1 = G_14_
  1129. G_53_.Parent = G_14_
  1130. G_53_.C0 = CFrame.new(0, 0, 0, -0.99999398, -8.31335001e-13, 0.00313773751, 0.00257028942, 0.573574126, 0.819148719, -0.00179972511, 0.819153666, -0.573570669)
  1131. G_53_.C1 = CFrame.new(0, 0, 0, -0.99999398, -8.31335001e-13, 0.00313773751, 0.00257028942, 0.573574126, 0.819148719, -0.00179972511, 0.819153666, -0.573570669)
  1132. G_53_.Part0 = G_14_
  1133. G_53_.Part1 = G_14_
  1134. G_54_.Parent = G_14_
  1135. G_54_.C0 = CFrame.new(0, 0, 0, -0.748860121, -3.93271269e-21, 0.662726998, 0.585522592, 0.468421876, 0.66162163, -0.310435832, 0.883504927, -0.350782454)
  1136. G_54_.C1 = CFrame.new(0, 0, 0, -0.748860121, -3.93271269e-21, 0.662726998, 0.585522592, 0.468421876, 0.66162163, -0.310435832, 0.883504927, -0.350782454)
  1137. G_54_.Part0 = G_14_
  1138. G_54_.Part1 = G_14_
  1139. G_55_.Parent = G_14_
  1140. G_55_.C0 = CFrame.new(0, 0, 0, -0.748860121, -3.93271269e-21, 0.662726998, 0.585522592, 0.468421876, 0.66162163, -0.310435832, 0.883504927, -0.350782454)
  1141. G_55_.C1 = CFrame.new(0, 0, 0, -0.748860121, -3.93271269e-21, 0.662726998, 0.585522592, 0.468421876, 0.66162163, -0.310435832, 0.883504927, -0.350782454)
  1142. G_55_.Part0 = G_14_
  1143. G_55_.Part1 = G_14_
  1144. G_56_.Parent = G_14_
  1145. G_56_.C0 = CFrame.new(0, 0, 0, -0.748860121, -3.93271269e-21, 0.662726998, 0.585522592, 0.468421876, 0.66162163, -0.310435832, 0.883504927, -0.350782454)
  1146. G_56_.C1 = CFrame.new(0, 0, 0, -0.748860121, -3.93271269e-21, 0.662726998, 0.585522592, 0.468421876, 0.66162163, -0.310435832, 0.883504927, -0.350782454)
  1147. G_56_.Part0 = G_14_
  1148. G_56_.Part1 = G_14_
  1149. G_57_.Parent = G_14_
  1150. G_57_.C0 = CFrame.new(0, 0, 0, 0.212453797, 7.88702437e-13, 0.97717011, 0.918238282, 0.342023492, -0.199641004, -0.334215164, 0.939691365, 0.0726641864)
  1151. G_57_.C1 = CFrame.new(0, 0, 0, 0.212453797, 7.88702437e-13, 0.97717011, 0.918238282, 0.342023492, -0.199641004, -0.334215164, 0.939691365, 0.0726641864)
  1152. G_57_.Part0 = G_14_
  1153. G_57_.Part1 = G_14_
  1154. G_58_.Parent = G_14_
  1155. G_58_.C0 = CFrame.new(0, 0, 0, 0.140859097, -3.33955086e-12, 0.990028322, 0.956296325, 0.258810073, -0.136059761, -0.256229311, 0.965928257, 0.0364557579)
  1156. G_58_.C1 = CFrame.new(0, 0, 0, 0.140859097, -3.33955086e-12, 0.990028322, 0.956296325, 0.258810073, -0.136059761, -0.256229311, 0.965928257, 0.0364557579)
  1157. G_58_.Part0 = G_14_
  1158. G_58_.Part1 = G_14_
  1159. G_59_.Parent = G_14_
  1160. G_59_.C0 = CFrame.new(0, 0, 0, -0.590230227, -9.31299667e-07, 0.807235003, 0.779728949, 0.258819342, 0.570118785, -0.208928585, 0.965925753, -0.152762294)
  1161. G_59_.C1 = CFrame.new(0, 0, 0, -0.590230227, -9.31299667e-07, 0.807235003, 0.779728949, 0.258819342, 0.570118785, -0.208928585, 0.965925753, -0.152762294)
  1162. G_59_.Part0 = G_14_
  1163. G_59_.Part1 = G_14_
  1164. G_60_.Parent = G_14_
  1165. G_60_.C0 = CFrame.new(0, 0, 0, -0.999991477, -3.93271269e-21, 0.00392904878, 0.00317039154, 0.590673447, 0.806903839, -0.00232078484, 0.806910694, -0.59066844)
  1166. G_60_.C1 = CFrame.new(0, 0, 0, -0.999991477, -3.93271269e-21, 0.00392904878, 0.00317039154, 0.590673447, 0.806903839, -0.00232078484, 0.806910694, -0.59066844)
  1167. G_60_.Part0 = G_14_
  1168. G_60_.Part1 = G_14_
  1169. G_61_.Parent = G_14_
  1170. G_61_.C0 = CFrame.new(0, 0, 0, -0.999991477, -3.93271269e-21, 0.00392904878, 0.00317039154, 0.590673447, 0.806903839, -0.00232078484, 0.806910694, -0.59066844)
  1171. G_61_.C1 = CFrame.new(0, 0, 0, -0.999991477, -3.93271269e-21, 0.00392904878, 0.00317039154, 0.590673447, 0.806903839, -0.00232078484, 0.806910694, -0.59066844)
  1172. G_61_.Part0 = G_14_
  1173. G_61_.Part1 = G_14_
  1174. G_62_.Parent = G_14_
  1175. G_62_.C0 = CFrame.new(0, 0, 0, -0.999991477, -3.93271269e-21, 0.00392904878, 0.00317039154, 0.590673447, 0.806903839, -0.00232078484, 0.806910694, -0.59066844)
  1176. G_62_.C1 = CFrame.new(0, 0, 0, -0.999991477, -3.93271269e-21, 0.00392904878, 0.00317039154, 0.590673447, 0.806903839, -0.00232078484, 0.806910694, -0.59066844)
  1177. G_62_.Part0 = G_14_
  1178. G_62_.Part1 = G_14_
  1179. G_63_.Parent = G_14_
  1180. G_63_.C0 = CFrame.new(0, 0, 0, -0.325791001, -2.66748884e-06, 0.945441902, 0.856859565, 0.422621429, 0.295267522, -0.399564683, 0.906306446, -0.137683958)
  1181. G_63_.C1 = CFrame.new(0, 0, 0, -0.325791001, -2.66748884e-06, 0.945441902, 0.856859565, 0.422621429, 0.295267522, -0.399564683, 0.906306446, -0.137683958)
  1182. G_63_.Part0 = G_14_
  1183. G_63_.Part1 = G_14_
  1184. G_64_.Parent = G_14_
  1185. G_64_.C0 = CFrame.new(0, 0, 0, -0.405301601, 1.85437976e-08, 0.91418308, 0.883032978, 0.258819044, 0.391491324, -0.236607939, 0.965925872, -0.104899786)
  1186. G_64_.C1 = CFrame.new(0, 0, 0, -0.405301601, 1.85437976e-08, 0.91418308, 0.883032978, 0.258819044, 0.391491324, -0.236607939, 0.965925872, -0.104899786)
  1187. G_64_.Part0 = G_14_
  1188. G_64_.Part1 = G_14_
  1189. G_65_.Parent = G_14_
  1190. G_65_.C0 = CFrame.new(0, 0, 0, 0.0741677806, 7.37284495e-07, 0.997245789, 0.963264167, 0.258823812, -0.0716406703, -0.258111, 0.965924621, 0.0191956777)
  1191. G_65_.C1 = CFrame.new(0, 0, 0, 0.0741677806, 7.37284495e-07, 0.997245789, 0.963264167, 0.258823812, -0.0716406703, -0.258111, 0.965924621, 0.0191956777)
  1192. G_65_.Part0 = G_14_
  1193. G_65_.Part1 = G_14_
  1194. G_66_.Parent = G_14_
  1195. G_66_.C0 = CFrame.new(0, 0, 0, -0.325791866, -3.93271269e-21, 0.945440471, 0.880585551, -0.363990992, 0.303443342, 0.344131827, 0.931402445, 0.118585303)
  1196. G_66_.C1 = CFrame.new(0, 0, 0, -0.325791866, -3.93271269e-21, 0.945440471, 0.880585551, -0.363990992, 0.303443342, 0.344131827, 0.931402445, 0.118585303)
  1197. G_66_.Part0 = G_14_
  1198. G_66_.Part1 = G_14_
  1199. G_67_.Parent = G_14_
  1200. G_67_.C0 = CFrame.new(0, 0, 0, -0.325791866, -3.93271269e-21, 0.945440471, 0.880585551, -0.363990992, 0.303443342, 0.344131827, 0.931402445, 0.118585303)
  1201. G_67_.C1 = CFrame.new(0, 0, 0, -0.325791866, -3.93271269e-21, 0.945440471, 0.880585551, -0.363990992, 0.303443342, 0.344131827, 0.931402445, 0.118585303)
  1202. G_67_.Part0 = G_14_
  1203. G_67_.Part1 = G_14_
  1204. G_68_.Parent = G_14_
  1205. G_68_.C0 = CFrame.new(0, 0, 0, -0.325791866, -3.93271269e-21, 0.945440471, 0.880585551, -0.363990992, 0.303443342, 0.344131827, 0.931402445, 0.118585303)
  1206. G_68_.C1 = CFrame.new(0, 0, 0, -0.325791866, -3.93271269e-21, 0.945440471, 0.880585551, -0.363990992, 0.303443342, 0.344131827, 0.931402445, 0.118585303)
  1207. G_68_.Part0 = G_14_
  1208. G_68_.Part1 = G_14_
  1209. G_69_.Parent = G_14_
  1210. G_69_.C0 = CFrame.new(0, 0, 0, -0.99999398, -8.31335001e-13, 0.00313773751, 0.00257028942, 0.573574126, 0.819148719, -0.00179972511, 0.819153666, -0.573570669)
  1211. G_69_.C1 = CFrame.new(0, 0, 0, -0.99999398, -8.31335001e-13, 0.00313773751, 0.00257028942, 0.573574126, 0.819148719, -0.00179972511, 0.819153666, -0.573570669)
  1212. G_69_.Part0 = G_14_
  1213. G_69_.Part1 = G_14_
  1214. G_70_.Parent = G_14_
  1215. G_70_.C0 = CFrame.new(0, 0, 0, -0.0434554219, 2.57927013e-12, 0.999053955, 0.965008557, 0.258831978, 0.0419745632, -0.258587062, 0.965922296, -0.0112476517)
  1216. G_70_.C1 = CFrame.new(0, 0, 0, -0.0434554219, 2.57927013e-12, 0.999053955, 0.965008557, 0.258831978, 0.0419745632, -0.258587062, 0.965922296, -0.0112476517)
  1217. G_70_.Part0 = G_14_
  1218. G_70_.Part1 = G_14_
  1219. G_71_.Parent = G_14_
  1220. G_71_.C0 = CFrame.new(0, 0, 0, 0.140859097, -3.33955086e-12, 0.990028322, 0.956296325, 0.258810073, -0.136059761, -0.256229311, 0.965928257, 0.0364557579)
  1221. G_71_.C1 = CFrame.new(0, 0, 0, 0.140859097, -3.33955086e-12, 0.990028322, 0.956296325, 0.258810073, -0.136059761, -0.256229311, 0.965928257, 0.0364557579)
  1222. G_71_.Part0 = G_14_
  1223. G_71_.Part1 = G_14_
  1224. G_72_.Parent = G_14_
  1225. G_72_.C0 = CFrame.new(0, 0, 0, -0.99999398, -3.93271269e-21, 0.00313773751, 0.00312333554, -0.095701538, 0.995404065, 0.000300286309, 0.995410085, 0.0957009643)
  1226. G_72_.C1 = CFrame.new(0, 0, 0, -0.99999398, -3.93271269e-21, 0.00313773751, 0.00312333554, -0.095701538, 0.995404065, 0.000300286309, 0.995410085, 0.0957009643)
  1227. G_72_.Part0 = G_14_
  1228. G_72_.Part1 = G_14_
  1229. G_73_.Parent = G_14_
  1230. G_73_.C0 = CFrame.new(0, 0, 0, -0.99999398, -3.93271269e-21, 0.00313773751, 0.00312333554, -0.095701538, 0.995404065, 0.000300286309, 0.995410085, 0.0957009643)
  1231. G_73_.C1 = CFrame.new(0, 0, 0, -0.99999398, -3.93271269e-21, 0.00313773751, 0.00312333554, -0.095701538, 0.995404065, 0.000300286309, 0.995410085, 0.0957009643)
  1232. G_73_.Part0 = G_14_
  1233. G_73_.Part1 = G_14_
  1234. G_74_.Parent = G_14_
  1235. G_74_.C0 = CFrame.new(0, 0, 0, -0.99999398, -3.93271269e-21, 0.00313773751, 0.00312333554, -0.095701538, 0.995404065, 0.000300286309, 0.995410085, 0.0957009643)
  1236. G_74_.C1 = CFrame.new(0, 0, 0, -0.99999398, -3.93271269e-21, 0.00313773751, 0.00312333554, -0.095701538, 0.995404065, 0.000300286309, 0.995410085, 0.0957009643)
  1237. G_74_.Part0 = G_14_
  1238. G_74_.Part1 = G_14_
  1239. G_75_.Parent = G_14_
  1240. G_75_.C0 = CFrame.new(0, 0, 0, -0.590230227, -9.31299667e-07, 0.807235003, 0.779728949, 0.258819342, 0.570118785, -0.208928585, 0.965925753, -0.152762294)
  1241. G_75_.C1 = CFrame.new(0, 0, 0, -0.590230227, -9.31299667e-07, 0.807235003, 0.779728949, 0.258819342, 0.570118785, -0.208928585, 0.965925753, -0.152762294)
  1242. G_75_.Part0 = G_14_
  1243. G_75_.Part1 = G_14_
  1244. G_76_.Parent = G_14_
  1245. G_76_.C0 = CFrame.new(0, 0, 0, -0.47474581, 7.40539235e-07, 0.880123019, 0.850133717, 0.258818567, 0.458569169, -0.227791816, 0.965925992, -0.122873664)
  1246. G_76_.C1 = CFrame.new(0, 0, 0, -0.47474581, 7.40539235e-07, 0.880123019, 0.850133717, 0.258818567, 0.458569169, -0.227791816, 0.965925992, -0.122873664)
  1247. G_76_.Part0 = G_14_
  1248. G_76_.Part1 = G_14_
  1249. G_77_.Parent = G_14_
  1250. G_77_.C0 = CFrame.new(0, 0, 0, -0.405301601, 1.85437976e-08, 0.91418308, 0.883032978, 0.258819044, 0.391491324, -0.236607939, 0.965925872, -0.104899786)
  1251. G_77_.C1 = CFrame.new(0, 0, 0, -0.405301601, 1.85437976e-08, 0.91418308, 0.883032978, 0.258819044, 0.391491324, -0.236607939, 0.965925872, -0.104899786)
  1252. G_77_.Part0 = G_14_
  1253. G_77_.Part1 = G_14_
  1254. G_78_.Parent = G_14_
  1255. G_78_.C0 = CFrame.new(0, 0, 0, 0.415782541, -3.93271269e-21, -0.909463048, -0.905445874, -0.0938860625, -0.413946003, -0.0853859037, 0.995582938, -0.0390361845)
  1256. G_78_.C1 = CFrame.new(0, 0, 0, 0.415782541, -3.93271269e-21, -0.909463048, -0.905445874, -0.0938860625, -0.413946003, -0.0853859037, 0.995582938, -0.0390361845)
  1257. G_78_.Part0 = G_14_
  1258. G_78_.Part1 = G_14_
  1259. G_79_.Parent = G_14_
  1260. G_79_.C0 = CFrame.new(0, 0, 0, 0.415782541, -3.93271269e-21, -0.909463048, -0.905445874, -0.0938860625, -0.413946003, -0.0853859037, 0.995582938, -0.0390361845)
  1261. G_79_.C1 = CFrame.new(0, 0, 0, 0.415782541, -3.93271269e-21, -0.909463048, -0.905445874, -0.0938860625, -0.413946003, -0.0853859037, 0.995582938, -0.0390361845)
  1262. G_79_.Part0 = G_14_
  1263. G_79_.Part1 = G_14_
  1264. G_80_.Parent = G_14_
  1265. G_80_.C0 = CFrame.new(0, 0, 0, 0.415782541, -3.93271269e-21, -0.909463048, -0.905445874, -0.0938860625, -0.413946003, -0.0853859037, 0.995582938, -0.0390361845)
  1266. G_80_.C1 = CFrame.new(0, 0, 0, 0.415782541, -3.93271269e-21, -0.909463048, -0.905445874, -0.0938860625, -0.413946003, -0.0853859037, 0.995582938, -0.0390361845)
  1267. G_80_.Part0 = G_14_
  1268. G_80_.Part1 = G_14_
  1269. G_81_.Parent = G_14_
  1270. G_81_.C0 = CFrame.new(0, 0, 0, 0.0741677806, 7.37284495e-07, 0.997245789, 0.963264167, 0.258823812, -0.0716406703, -0.258111, 0.965924621, 0.0191956777)
  1271. G_81_.C1 = CFrame.new(0, 0, 0, 0.0741677806, 7.37284495e-07, 0.997245789, 0.963264167, 0.258823812, -0.0716406703, -0.258111, 0.965924621, 0.0191956777)
  1272. G_81_.Part0 = G_14_
  1273. G_81_.Part1 = G_14_
  1274. G_82_.Parent = G_14_
  1275. G_82_.C0 = CFrame.new(0, 0, 0, -0.0912770778, 1.60582658e-12, 0.995824099, 0.961889267, 0.25883013, 0.0881666094, -0.257749289, 0.965922832, -0.0236252565)
  1276. G_82_.C1 = CFrame.new(0, 0, 0, -0.0912770778, 1.60582658e-12, 0.995824099, 0.961889267, 0.25883013, 0.0881666094, -0.257749289, 0.965922832, -0.0236252565)
  1277. G_82_.Part0 = G_14_
  1278. G_82_.Part1 = G_14_
  1279. G_83_.Parent = G_14_
  1280. G_83_.C0 = CFrame.new(0, 0, 0, -0.0434554219, 2.57927013e-12, 0.999053955, 0.965008557, 0.258831978, 0.0419745632, -0.258587062, 0.965922296, -0.0112476517)
  1281. G_83_.C1 = CFrame.new(0, 0, 0, -0.0434554219, 2.57927013e-12, 0.999053955, 0.965008557, 0.258831978, 0.0419745632, -0.258587062, 0.965922296, -0.0112476517)
  1282. G_83_.Part0 = G_14_
  1283. G_83_.Part1 = G_14_
  1284. G_84_.Parent = G_14_
  1285. G_84_.C0 = CFrame.new(0, 0, 0, 0.074167937, -3.93271269e-21, 0.997244477, 0.927819431, -0.366588563, -0.0690045953, 0.365578413, 0.930383146, -0.0271891169)
  1286. G_84_.C1 = CFrame.new(0, 0, 0, 0.074167937, -3.93271269e-21, 0.997244477, 0.927819431, -0.366588563, -0.0690045953, 0.365578413, 0.930383146, -0.0271891169)
  1287. G_84_.Part0 = G_14_
  1288. G_84_.Part1 = G_14_
  1289. G_85_.Parent = G_14_
  1290. G_85_.C0 = CFrame.new(0, 0, 0, 0.074167937, -3.93271269e-21, 0.997244477, 0.927819431, -0.366588563, -0.0690045953, 0.365578413, 0.930383146, -0.0271891169)
  1291. G_85_.C1 = CFrame.new(0, 0, 0, 0.074167937, -3.93271269e-21, 0.997244477, 0.927819431, -0.366588563, -0.0690045953, 0.365578413, 0.930383146, -0.0271891169)
  1292. G_85_.Part0 = G_14_
  1293. G_85_.Part1 = G_14_
  1294. G_86_.Parent = G_14_
  1295. G_86_.C0 = CFrame.new(0, 0, 0, 0.074167937, -3.93271269e-21, 0.997244477, 0.927819431, -0.366588563, -0.0690045953, 0.365578413, 0.930383146, -0.0271891169)
  1296. G_86_.C1 = CFrame.new(0, 0, 0, 0.074167937, -3.93271269e-21, 0.997244477, 0.927819431, -0.366588563, -0.0690045953, 0.365578413, 0.930383146, -0.0271891169)
  1297. G_86_.Part0 = G_14_
  1298. G_86_.Part1 = G_14_
  1299. G_87_.Parent = G_14_
  1300. G_87_.C0 = CFrame.new(0, 0, 0, 0.140859097, -3.33955086e-12, 0.990028322, 0.956296325, 0.258810073, -0.136059761, -0.256229311, 0.965928257, 0.0364557579)
  1301. G_87_.C1 = CFrame.new(0, 0, 0, 0.140859097, -3.33955086e-12, 0.990028322, 0.956296325, 0.258810073, -0.136059761, -0.256229311, 0.965928257, 0.0364557579)
  1302. G_87_.Part0 = G_14_
  1303. G_87_.Part1 = G_14_
  1304. G_88_.Parent = G_14_
  1305. G_88_.C0 = CFrame.new(0, 0, 0, -0.731341481, 1.66188094e-08, 0.682011545, 0.658772647, 0.258819073, 0.706421554, -0.176517606, 0.965925872, -0.189285114)
  1306. G_88_.C1 = CFrame.new(0, 0, 0, -0.731341481, 1.66188094e-08, 0.682011545, 0.658772647, 0.258819073, 0.706421554, -0.176517606, 0.965925872, -0.189285114)
  1307. G_88_.Part0 = G_14_
  1308. G_88_.Part1 = G_14_
  1309. G_89_.Parent = G_14_
  1310. G_89_.C0 = CFrame.new(0, 0, 0, -0.47474581, 7.40539235e-07, 0.880123019, 0.850133717, 0.258818567, 0.458569169, -0.227791816, 0.965925992, -0.122873664)
  1311. G_89_.C1 = CFrame.new(0, 0, 0, -0.47474581, 7.40539235e-07, 0.880123019, 0.850133717, 0.258818567, 0.458569169, -0.227791816, 0.965925992, -0.122873664)
  1312. G_89_.Part0 = G_14_
  1313. G_89_.Part1 = G_14_
  1314. G_90_.Parent = G_14_
  1315. G_90_.C0 = CFrame.new(0, 0, 0, 0.140859097, -3.93271269e-21, 0.990028322, 0.889176905, 0.439724326, -0.126510173, -0.43533954, 0.898132801, 0.0619391724)
  1316. G_90_.C1 = CFrame.new(0, 0, 0, 0.140859097, -3.93271269e-21, 0.990028322, 0.889176905, 0.439724326, -0.126510173, -0.43533954, 0.898132801, 0.0619391724)
  1317. G_90_.Part0 = G_14_
  1318. G_90_.Part1 = G_14_
  1319. G_91_.Parent = G_14_
  1320. G_91_.C0 = CFrame.new(0, 0, 0, 0.140859097, -3.93271269e-21, 0.990028322, 0.889176905, 0.439724326, -0.126510173, -0.43533954, 0.898132801, 0.0619391724)
  1321. G_91_.C1 = CFrame.new(0, 0, 0, 0.140859097, -3.93271269e-21, 0.990028322, 0.889176905, 0.439724326, -0.126510173, -0.43533954, 0.898132801, 0.0619391724)
  1322. G_91_.Part0 = G_14_
  1323. G_91_.Part1 = G_14_
  1324. G_92_.Parent = G_14_
  1325. G_92_.C0 = CFrame.new(0, 0, 0, 0.140859097, -3.93271269e-21, 0.990028322, 0.889176905, 0.439724326, -0.126510173, -0.43533954, 0.898132801, 0.0619391724)
  1326. G_92_.C1 = CFrame.new(0, 0, 0, 0.140859097, -3.93271269e-21, 0.990028322, 0.889176905, 0.439724326, -0.126510173, -0.43533954, 0.898132801, 0.0619391724)
  1327. G_92_.Part0 = G_14_
  1328. G_92_.Part1 = G_14_
  1329. G_93_.Parent = G_14_
  1330. G_93_.C0 = CFrame.new(0, 0, 0, -0.405301601, 1.85437976e-08, 0.91418308, 0.883032978, 0.258819044, 0.391491324, -0.236607939, 0.965925872, -0.104899786)
  1331. G_93_.C1 = CFrame.new(0, 0, 0, -0.405301601, 1.85437976e-08, 0.91418308, 0.883032978, 0.258819044, 0.391491324, -0.236607939, 0.965925872, -0.104899786)
  1332. G_93_.Part0 = G_14_
  1333. G_93_.Part1 = G_14_
  1334. G_94_.Parent = G_14_
  1335. G_94_.C0 = CFrame.new(0, 0, 0, 0.0731284618, 1.8971491e-12, 0.997321367, 0.963335097, 0.258831561, -0.0706364214, -0.258138239, 0.965922475, 0.0189279504)
  1336. G_94_.C1 = CFrame.new(0, 0, 0, 0.0731284618, 1.8971491e-12, 0.997321367, 0.963335097, 0.258831561, -0.0706364214, -0.258138239, 0.965922475, 0.0189279504)
  1337. G_94_.Part0 = G_14_
  1338. G_94_.Part1 = G_14_
  1339. G_95_.Parent = G_14_
  1340. G_95_.C0 = CFrame.new(0, 0, 0, -0.0912770778, 1.60582658e-12, 0.995824099, 0.961889267, 0.25883013, 0.0881666094, -0.257749289, 0.965922832, -0.0236252565)
  1341. G_95_.C1 = CFrame.new(0, 0, 0, -0.0912770778, 1.60582658e-12, 0.995824099, 0.961889267, 0.25883013, 0.0881666094, -0.257749289, 0.965922832, -0.0236252565)
  1342. G_95_.Part0 = G_14_
  1343. G_95_.Part1 = G_14_
  1344. G_96_.Parent = G_14_
  1345. G_96_.C0 = CFrame.new(0, 0, 0, -0.405301124, -3.93271269e-21, 0.914181769, 0.88220942, 0.262153298, 0.391126215, -0.239655763, 0.965026259, -0.106251024)
  1346. G_96_.C1 = CFrame.new(0, 0, 0, -0.405301124, -3.93271269e-21, 0.914181769, 0.88220942, 0.262153298, 0.391126215, -0.239655763, 0.965026259, -0.106251024)
  1347. G_96_.Part0 = G_14_
  1348. G_96_.Part1 = G_14_
  1349. G_97_.Parent = G_14_
  1350. G_97_.C0 = CFrame.new(0, 0, 0, -0.405301124, -3.93271269e-21, 0.914181769, 0.88220942, 0.262153298, 0.391126215, -0.239655763, 0.965026259, -0.106251024)
  1351. G_97_.C1 = CFrame.new(0, 0, 0, -0.405301124, -3.93271269e-21, 0.914181769, 0.88220942, 0.262153298, 0.391126215, -0.239655763, 0.965026259, -0.106251024)
  1352. G_97_.Part0 = G_14_
  1353. G_97_.Part1 = G_14_
  1354. G_98_.Parent = G_14_
  1355. G_98_.C0 = CFrame.new(0, 0, 0, -0.405301124, -3.93271269e-21, 0.914181769, 0.88220942, 0.262153298, 0.391126215, -0.239655763, 0.965026259, -0.106251024)
  1356. G_98_.C1 = CFrame.new(0, 0, 0, -0.405301124, -3.93271269e-21, 0.914181769, 0.88220942, 0.262153298, 0.391126215, -0.239655763, 0.965026259, -0.106251024)
  1357. G_98_.Part0 = G_14_
  1358. G_98_.Part1 = G_14_
  1359. G_99_.Parent = G_14_
  1360. G_99_.C0 = CFrame.new(0, 0, 0, -0.0434554219, 2.57927013e-12, 0.999053955, 0.965008557, 0.258831978, 0.0419745632, -0.258587062, 0.965922296, -0.0112476517)
  1361. G_99_.C1 = CFrame.new(0, 0, 0, -0.0434554219, 2.57927013e-12, 0.999053955, 0.965008557, 0.258831978, 0.0419745632, -0.258587062, 0.965922296, -0.0112476517)
  1362. G_99_.Part0 = G_14_
  1363. G_99_.Part1 = G_14_
  1364. G_100_.Parent = G_14_
  1365. G_100_.C0 = CFrame.new(0, 0, 0, 0.88960129, 1.26743032e-06, 0.456738055, 0.441174865, 0.25881815, -0.859289289, -0.118213169, 0.96592617, 0.230244383)
  1366. G_100_.C1 = CFrame.new(0, 0, 0, 0.88960129, 1.26743032e-06, 0.456738055, 0.441174865, 0.25881815, -0.859289289, -0.118213169, 0.96592617, 0.230244383)
  1367. G_100_.Part0 = G_14_
  1368. G_100_.Part1 = G_14_
  1369. G_101_.Parent = G_14_
  1370. G_101_.C0 = CFrame.new(0, 0, 0, -0.731341481, 1.66188094e-08, 0.682011545, 0.658772647, 0.258819073, 0.706421554, -0.176517606, 0.965925872, -0.189285114)
  1371. G_101_.C1 = CFrame.new(0, 0, 0, -0.731341481, 1.66188094e-08, 0.682011545, 0.658772647, 0.258819073, 0.706421554, -0.176517606, 0.965925872, -0.189285114)
  1372. G_101_.Part0 = G_14_
  1373. G_101_.Part1 = G_14_
  1374. G_102_.Parent = G_14_
  1375. G_102_.C0 = CFrame.new(0, 0, 0, -0.0434554219, -3.93271269e-21, 0.999053955, 0.998663485, 0.0279545076, 0.0434384383, -0.0279280618, 0.999609172, -0.00121477491)
  1376. G_102_.C1 = CFrame.new(0, 0, 0, -0.0434554219, -3.93271269e-21, 0.999053955, 0.998663485, 0.0279545076, 0.0434384383, -0.0279280618, 0.999609172, -0.00121477491)
  1377. G_102_.Part0 = G_14_
  1378. G_102_.Part1 = G_14_
  1379. G_103_.Parent = G_14_
  1380. G_103_.C0 = CFrame.new(0, 0, 0, -0.0434554219, -3.93271269e-21, 0.999053955, 0.998663485, 0.0279545076, 0.0434384383, -0.0279280618, 0.999609172, -0.00121477491)
  1381. G_103_.C1 = CFrame.new(0, 0, 0, -0.0434554219, -3.93271269e-21, 0.999053955, 0.998663485, 0.0279545076, 0.0434384383, -0.0279280618, 0.999609172, -0.00121477491)
  1382. G_103_.Part0 = G_14_
  1383. G_103_.Part1 = G_14_
  1384. G_104_.Parent = G_14_
  1385. G_104_.C0 = CFrame.new(0, 0, 0, -0.0434554219, -3.93271269e-21, 0.999053955, 0.998663485, 0.0279545076, 0.0434384383, -0.0279280618, 0.999609172, -0.00121477491)
  1386. G_104_.C1 = CFrame.new(0, 0, 0, -0.0434554219, -3.93271269e-21, 0.999053955, 0.998663485, 0.0279545076, 0.0434384383, -0.0279280618, 0.999609172, -0.00121477491)
  1387. G_104_.Part0 = G_14_
  1388. G_104_.Part1 = G_14_
  1389. G_105_.Parent = G_14_
  1390. G_105_.C0 = CFrame.new(0, 0, 0, -0.47474581, 7.40539235e-07, 0.880123019, 0.850133717, 0.258818567, 0.458569169, -0.227791816, 0.965925992, -0.122873664)
  1391. G_105_.C1 = CFrame.new(0, 0, 0, -0.47474581, 7.40539235e-07, 0.880123019, 0.850133717, 0.258818567, 0.458569169, -0.227791816, 0.965925992, -0.122873664)
  1392. G_105_.Part0 = G_14_
  1393. G_105_.Part1 = G_14_
  1394. G_106_.Parent = G_14_
  1395. G_106_.C0 = CFrame.new(0, 0, 0, 0.999465704, -2.17852175e-07, -0.0326874293, -0.0315736085, 0.258815795, -0.96541059, 0.00846023485, 0.965926647, 0.258677512)
  1396. G_106_.C1 = CFrame.new(0, 0, 0, 0.999465704, -2.17852175e-07, -0.0326874293, -0.0315736085, 0.258815795, -0.96541059, 0.00846023485, 0.965926647, 0.258677512)
  1397. G_106_.Part0 = G_14_
  1398. G_106_.Part1 = G_14_
  1399. G_107_.Parent = G_14_
  1400. G_107_.C0 = CFrame.new(0, 0, 0, 0.0731284618, 1.8971491e-12, 0.997321367, 0.963335097, 0.258831561, -0.0706364214, -0.258138239, 0.965922475, 0.0189279504)
  1401. G_107_.C1 = CFrame.new(0, 0, 0, 0.0731284618, 1.8971491e-12, 0.997321367, 0.963335097, 0.258831561, -0.0706364214, -0.258138239, 0.965922475, 0.0189279504)
  1402. G_107_.Part0 = G_14_
  1403. G_107_.Part1 = G_14_
  1404. G_108_.Parent = G_14_
  1405. G_108_.C0 = CFrame.new(0, 0, 0, -0.474745095, -3.93271269e-21, 0.880121827, 0.810554802, 0.389662981, 0.437220067, -0.342950881, 0.920957506, -0.184990585)
  1406. G_108_.C1 = CFrame.new(0, 0, 0, -0.474745095, -3.93271269e-21, 0.880121827, 0.810554802, 0.389662981, 0.437220067, -0.342950881, 0.920957506, -0.184990585)
  1407. G_108_.Part0 = G_14_
  1408. G_108_.Part1 = G_14_
  1409. G_109_.Parent = G_14_
  1410. G_109_.C0 = CFrame.new(0, 0, 0, -0.474745095, -3.93271269e-21, 0.880121827, 0.810554802, 0.389662981, 0.437220067, -0.342950881, 0.920957506, -0.184990585)
  1411. G_109_.C1 = CFrame.new(0, 0, 0, -0.474745095, -3.93271269e-21, 0.880121827, 0.810554802, 0.389662981, 0.437220067, -0.342950881, 0.920957506, -0.184990585)
  1412. G_109_.Part0 = G_14_
  1413. G_109_.Part1 = G_14_
  1414. G_110_.Parent = G_14_
  1415. G_110_.C0 = CFrame.new(0, 0, 0, -0.474745095, -3.93271269e-21, 0.880121827, 0.810554802, 0.389662981, 0.437220067, -0.342950881, 0.920957506, -0.184990585)
  1416. G_110_.C1 = CFrame.new(0, 0, 0, -0.474745095, -3.93271269e-21, 0.880121827, 0.810554802, 0.389662981, 0.437220067, -0.342950881, 0.920957506, -0.184990585)
  1417. G_110_.Part0 = G_14_
  1418. G_110_.Part1 = G_14_
  1419. G_111_.Parent = G_14_
  1420. G_111_.C0 = CFrame.new(0, 0, 0, -0.0912770778, 1.60582658e-12, 0.995824099, 0.961889267, 0.25883013, 0.0881666094, -0.257749289, 0.965922832, -0.0236252565)
  1421. G_111_.C1 = CFrame.new(0, 0, 0, -0.0912770778, 1.60582658e-12, 0.995824099, 0.961889267, 0.25883013, 0.0881666094, -0.257749289, 0.965922832, -0.0236252565)
  1422. G_111_.Part0 = G_14_
  1423. G_111_.Part1 = G_14_
  1424. G_112_.Parent = G_14_
  1425. G_112_.C0 = CFrame.new(0, 0, 0, 0.611500084, -1.41398004e-12, -0.791242719, -0.764281929, 0.258818001, -0.59066391, 0.204787865, 0.965926111, 0.158267245)
  1426. G_112_.C1 = CFrame.new(0, 0, 0, 0.611500084, -1.41398004e-12, -0.791242719, -0.764281929, 0.258818001, -0.59066391, 0.204787865, 0.965926111, 0.158267245)
  1427. G_112_.Part0 = G_14_
  1428. G_112_.Part1 = G_14_
  1429. G_113_.Parent = G_14_
  1430. G_113_.C0 = CFrame.new(0, 0, 0, 0.88960129, 1.26743032e-06, 0.456738055, 0.441174865, 0.25881815, -0.859289289, -0.118213169, 0.96592617, 0.230244383)
  1431. G_113_.C1 = CFrame.new(0, 0, 0, 0.88960129, 1.26743032e-06, 0.456738055, 0.441174865, 0.25881815, -0.859289289, -0.118213169, 0.96592617, 0.230244383)
  1432. G_113_.Part0 = G_14_
  1433. G_113_.Part1 = G_14_
  1434. G_114_.Parent = G_14_
  1435. G_114_.C0 = CFrame.new(0, 0, 0, -0.0912770778, -3.93271269e-21, 0.995824099, 0.929939866, -0.357692361, 0.0852381438, 0.356198668, 0.9338395, 0.0326491147)
  1436. G_114_.C1 = CFrame.new(0, 0, 0, -0.0912770778, -3.93271269e-21, 0.995824099, 0.929939866, -0.357692361, 0.0852381438, 0.356198668, 0.9338395, 0.0326491147)
  1437. G_114_.Part0 = G_14_
  1438. G_114_.Part1 = G_14_
  1439. G_115_.Parent = G_14_
  1440. G_115_.C0 = CFrame.new(0, 0, 0, -0.0912770778, -3.93271269e-21, 0.995824099, 0.929939866, -0.357692361, 0.0852381438, 0.356198668, 0.9338395, 0.0326491147)
  1441. G_115_.C1 = CFrame.new(0, 0, 0, -0.0912770778, -3.93271269e-21, 0.995824099, 0.929939866, -0.357692361, 0.0852381438, 0.356198668, 0.9338395, 0.0326491147)
  1442. G_115_.Part0 = G_14_
  1443. G_115_.Part1 = G_14_
  1444. G_116_.Parent = G_14_
  1445. G_116_.C0 = CFrame.new(0, 0, 0, -0.0912770778, -3.93271269e-21, 0.995824099, 0.929939866, -0.357692361, 0.0852381438, 0.356198668, 0.9338395, 0.0326491147)
  1446. G_116_.C1 = CFrame.new(0, 0, 0, -0.0912770778, -3.93271269e-21, 0.995824099, 0.929939866, -0.357692361, 0.0852381438, 0.356198668, 0.9338395, 0.0326491147)
  1447. G_116_.Part0 = G_14_
  1448. G_116_.Part1 = G_14_
  1449. G_117_.Parent = G_14_
  1450. G_117_.C0 = CFrame.new(0, 0, 0, -0.731341481, 1.66188094e-08, 0.682011545, 0.658772647, 0.258819073, 0.706421554, -0.176517606, 0.965925872, -0.189285114)
  1451. G_117_.C1 = CFrame.new(0, 0, 0, -0.731341481, 1.66188094e-08, 0.682011545, 0.658772647, 0.258819073, 0.706421554, -0.176517606, 0.965925872, -0.189285114)
  1452. G_117_.Part0 = G_14_
  1453. G_117_.Part1 = G_14_
  1454. G_118_.Parent = G_14_
  1455. G_118_.C0 = CFrame.new(0, 0, 0, 0.00123544212, 5.05585263e-08, -0.999999285, -0.965925992, 0.258816004, -0.0011933333, 0.258815825, 0.965926647, 0.00031980098)
  1456. G_118_.C1 = CFrame.new(0, 0, 0, 0.00123544212, 5.05585263e-08, -0.999999285, -0.965925992, 0.258816004, -0.0011933333, 0.258815825, 0.965926647, 0.00031980098)
  1457. G_118_.Part0 = G_14_
  1458. G_118_.Part1 = G_14_
  1459. G_119_.Parent = G_14_
  1460. G_119_.C0 = CFrame.new(0, 0, 0, 0.999465704, -2.17852175e-07, -0.0326874293, -0.0315736085, 0.258815795, -0.96541059, 0.00846023485, 0.965926647, 0.258677512)
  1461. G_119_.C1 = CFrame.new(0, 0, 0, 0.999465704, -2.17852175e-07, -0.0326874293, -0.0315736085, 0.258815795, -0.96541059, 0.00846023485, 0.965926647, 0.258677512)
  1462. G_119_.Part0 = G_14_
  1463. G_119_.Part1 = G_14_
  1464. G_120_.Parent = G_14_
  1465. G_120_.C0 = CFrame.new(0, 0, 0, -0.731340468, -3.93271269e-21, 0.682010651, 0.658581018, 0.259860188, 0.706216216, -0.177227423, 0.965646267, -0.190046266)
  1466. G_120_.C1 = CFrame.new(0, 0, 0, -0.731340468, -3.93271269e-21, 0.682010651, 0.658581018, 0.259860188, 0.706216216, -0.177227423, 0.965646267, -0.190046266)
  1467. G_120_.Part0 = G_14_
  1468. G_120_.Part1 = G_14_
  1469. G_121_.Parent = G_14_
  1470. G_121_.C0 = CFrame.new(0, 0, 0, -0.731340468, -3.93271269e-21, 0.682010651, 0.658581018, 0.259860188, 0.706216216, -0.177227423, 0.965646267, -0.190046266)
  1471. G_121_.C1 = CFrame.new(0, 0, 0, -0.731340468, -3.93271269e-21, 0.682010651, 0.658581018, 0.259860188, 0.706216216, -0.177227423, 0.965646267, -0.190046266)
  1472. G_121_.Part0 = G_14_
  1473. G_121_.Part1 = G_14_
  1474. G_122_.Parent = G_14_
  1475. G_122_.C0 = CFrame.new(0, 0, 0, -0.731340468, -3.93271269e-21, 0.682010651, 0.658581018, 0.259860188, 0.706216216, -0.177227423, 0.965646267, -0.190046266)
  1476. G_122_.C1 = CFrame.new(0, 0, 0, -0.731340468, -3.93271269e-21, 0.682010651, 0.658581018, 0.259860188, 0.706216216, -0.177227423, 0.965646267, -0.190046266)
  1477. G_122_.Part0 = G_14_
  1478. G_122_.Part1 = G_14_
  1479. G_123_.Parent = G_14_
  1480. G_123_.C0 = CFrame.new(0, 0, 0, 0.0731284618, 1.8971491e-12, 0.997321367, 0.963335097, 0.258831561, -0.0706364214, -0.258138239, 0.965922475, 0.0189279504)
  1481. G_123_.C1 = CFrame.new(0, 0, 0, 0.0731284618, 1.8971491e-12, 0.997321367, 0.963335097, 0.258831561, -0.0706364214, -0.258138239, 0.965922475, 0.0189279504)
  1482. G_123_.Part0 = G_14_
  1483. G_123_.Part1 = G_14_
  1484. G_124_.Parent = G_14_
  1485. G_124_.C0 = CFrame.new(0, 0, 0, -0.176956683, 1.04023457e-11, -0.984217405, -0.950676382, 0.258836508, 0.170926198, 0.254751414, 0.965921164, -0.0458028466)
  1486. G_124_.C1 = CFrame.new(0, 0, 0, -0.176956683, 1.04023457e-11, -0.984217405, -0.950676382, 0.258836508, 0.170926198, 0.254751414, 0.965921164, -0.0458028466)
  1487. G_124_.Part0 = G_14_
  1488. G_124_.Part1 = G_14_
  1489. G_125_.Parent = G_14_
  1490. G_125_.C0 = CFrame.new(0, 0, 0, 0.611500084, -1.41398004e-12, -0.791242719, -0.764281929, 0.258818001, -0.59066391, 0.204787865, 0.965926111, 0.158267245)
  1491. G_125_.C1 = CFrame.new(0, 0, 0, 0.611500084, -1.41398004e-12, -0.791242719, -0.764281929, 0.258818001, -0.59066391, 0.204787865, 0.965926111, 0.158267245)
  1492. G_125_.Part0 = G_14_
  1493. G_125_.Part1 = G_14_
  1494. G_126_.Parent = G_14_
  1495. G_126_.C0 = CFrame.new(0, 0, 0, 0.0731284618, -3.93271269e-21, 0.997321367, 0.806938887, 0.587662518, -0.059168689, -0.586088359, 0.809106171, 0.0429748558)
  1496. G_126_.C1 = CFrame.new(0, 0, 0, 0.0731284618, -3.93271269e-21, 0.997321367, 0.806938887, 0.587662518, -0.059168689, -0.586088359, 0.809106171, 0.0429748558)
  1497. G_126_.Part0 = G_14_
  1498. G_126_.Part1 = G_14_
  1499. G_127_.Parent = G_14_
  1500. G_127_.C0 = CFrame.new(0, 0, 0, 0.0731284618, -3.93271269e-21, 0.997321367, 0.806938887, 0.587662518, -0.059168689, -0.586088359, 0.809106171, 0.0429748558)
  1501. G_127_.C1 = CFrame.new(0, 0, 0, 0.0731284618, -3.93271269e-21, 0.997321367, 0.806938887, 0.587662518, -0.059168689, -0.586088359, 0.809106171, 0.0429748558)
  1502. G_127_.Part0 = G_14_
  1503. G_127_.Part1 = G_14_
  1504. G_128_.Parent = G_14_
  1505. G_128_.C0 = CFrame.new(0, 0, 0, 0.0731284618, -3.93271269e-21, 0.997321367, 0.806938887, 0.587662518, -0.059168689, -0.586088359, 0.809106171, 0.0429748558)
  1506. G_128_.C1 = CFrame.new(0, 0, 0, 0.0731284618, -3.93271269e-21, 0.997321367, 0.806938887, 0.587662518, -0.059168689, -0.586088359, 0.809106171, 0.0429748558)
  1507. G_128_.Part0 = G_14_
  1508. G_128_.Part1 = G_14_
  1509. G_129_.Parent = G_14_
  1510. G_129_.C0 = CFrame.new(0, 0, 0, 0.88960129, 1.26743032e-06, 0.456738055, 0.441174865, 0.25881815, -0.859289289, -0.118213169, 0.96592617, 0.230244383)
  1511. G_129_.C1 = CFrame.new(0, 0, 0, 0.88960129, 1.26743032e-06, 0.456738055, 0.441174865, 0.25881815, -0.859289289, -0.118213169, 0.96592617, 0.230244383)
  1512. G_129_.Part0 = G_14_
  1513. G_129_.Part1 = G_14_
  1514. G_130_.Parent = G_14_
  1515. G_130_.C0 = CFrame.new(0, 0, 0, -0.426380157, -3.39468215e-07, -0.904544115, -0.873722672, 0.258818805, 0.411851525, 0.234112889, 0.965925992, -0.110355474)
  1516. G_130_.C1 = CFrame.new(0, 0, 0, -0.426380157, -3.39468215e-07, -0.904544115, -0.873722672, 0.258818805, 0.411851525, 0.234112889, 0.965925992, -0.110355474)
  1517. G_130_.Part0 = G_14_
  1518. G_130_.Part1 = G_14_
  1519. G_131_.Parent = G_14_
  1520. G_131_.C0 = CFrame.new(0, 0, 0, 0.00123544212, 5.05585263e-08, -0.999999285, -0.965925992, 0.258816004, -0.0011933333, 0.258815825, 0.965926647, 0.00031980098)
  1521. G_131_.C1 = CFrame.new(0, 0, 0, 0.00123544212, 5.05585263e-08, -0.999999285, -0.965925992, 0.258816004, -0.0011933333, 0.258815825, 0.965926647, 0.00031980098)
  1522. G_131_.Part0 = G_14_
  1523. G_131_.Part1 = G_14_
  1524. G_132_.Parent = G_14_
  1525. G_132_.C0 = CFrame.new(0, 0, 0, 0.889600217, -3.93271269e-21, 0.456737489, 0.454952627, 0.0883199647, -0.886123776, -0.0403390378, 0.996092141, 0.0785694569)
  1526. G_132_.C1 = CFrame.new(0, 0, 0, 0.889600217, -3.93271269e-21, 0.456737489, 0.454952627, 0.0883199647, -0.886123776, -0.0403390378, 0.996092141, 0.0785694569)
  1527. G_132_.Part0 = G_14_
  1528. G_132_.Part1 = G_14_
  1529. G_133_.Parent = G_14_
  1530. G_133_.C0 = CFrame.new(0, 0, 0, 0.889600217, -3.93271269e-21, 0.456737489, 0.454952627, 0.0883199647, -0.886123776, -0.0403390378, 0.996092141, 0.0785694569)
  1531. G_133_.C1 = CFrame.new(0, 0, 0, 0.889600217, -3.93271269e-21, 0.456737489, 0.454952627, 0.0883199647, -0.886123776, -0.0403390378, 0.996092141, 0.0785694569)
  1532. G_133_.Part0 = G_14_
  1533. G_133_.Part1 = G_14_
  1534. G_134_.Parent = G_14_
  1535. G_134_.C0 = CFrame.new(0, 0, 0, 0.889600217, -3.93271269e-21, 0.456737489, 0.454952627, 0.0883199647, -0.886123776, -0.0403390378, 0.996092141, 0.0785694569)
  1536. G_134_.C1 = CFrame.new(0, 0, 0, 0.889600217, -3.93271269e-21, 0.456737489, 0.454952627, 0.0883199647, -0.886123776, -0.0403390378, 0.996092141, 0.0785694569)
  1537. G_134_.Part0 = G_14_
  1538. G_134_.Part1 = G_14_
  1539. G_135_.Parent = G_14_
  1540. G_135_.C0 = CFrame.new(0, 0, 0, 0.999465704, -2.17852175e-07, -0.0326874293, -0.0315736085, 0.258815795, -0.96541059, 0.00846023485, 0.965926647, 0.258677512)
  1541. G_135_.C1 = CFrame.new(0, 0, 0, 0.999465704, -2.17852175e-07, -0.0326874293, -0.0315736085, 0.258815795, -0.96541059, 0.00846023485, 0.965926647, 0.258677512)
  1542. G_135_.Part0 = G_14_
  1543. G_135_.Part1 = G_14_
  1544. G_136_.Parent = G_14_
  1545. G_136_.C0 = CFrame.new(0, 0, 0, 0.24251622, -2.50666687e-08, 0.970137596, 0.937083483, 0.258813679, -0.234253451, -0.251095384, 0.965923488, 0.0627691448)
  1546. G_136_.C1 = CFrame.new(0, 0, 0, 0.24251622, -2.50666687e-08, 0.970137596, 0.937083483, 0.258813679, -0.234253451, -0.251095384, 0.965923488, 0.0627691448)
  1547. G_136_.Part0 = G_14_
  1548. G_136_.Part1 = G_14_
  1549. G_137_.Parent = G_14_
  1550. G_137_.C0 = CFrame.new(0, 0, 0, -0.176956683, 1.04023457e-11, -0.984217405, -0.950676382, 0.258836508, 0.170926198, 0.254751414, 0.965921164, -0.0458028466)
  1551. G_137_.C1 = CFrame.new(0, 0, 0, -0.176956683, 1.04023457e-11, -0.984217405, -0.950676382, 0.258836508, 0.170926198, 0.254751414, 0.965921164, -0.0458028466)
  1552. G_137_.Part0 = G_14_
  1553. G_137_.Part1 = G_14_
  1554. G_138_.Parent = G_14_
  1555. G_138_.C0 = CFrame.new(0, 0, 0, 0.999464273, -3.93271269e-21, -0.0326873511, -0.0325972922, -0.0741798282, -0.996710658, -0.0024247421, 0.997244895, -0.0741400868)
  1556. G_138_.C1 = CFrame.new(0, 0, 0, 0.999464273, -3.93271269e-21, -0.0326873511, -0.0325972922, -0.0741798282, -0.996710658, -0.0024247421, 0.997244895, -0.0741400868)
  1557. G_138_.Part0 = G_14_
  1558. G_138_.Part1 = G_14_
  1559. G_139_.Parent = G_14_
  1560. G_139_.C0 = CFrame.new(0, 0, 0, 0.999464273, -3.93271269e-21, -0.0326873511, -0.0325972922, -0.0741798282, -0.996710658, -0.0024247421, 0.997244895, -0.0741400868)
  1561. G_139_.C1 = CFrame.new(0, 0, 0, 0.999464273, -3.93271269e-21, -0.0326873511, -0.0325972922, -0.0741798282, -0.996710658, -0.0024247421, 0.997244895, -0.0741400868)
  1562. G_139_.Part0 = G_14_
  1563. G_139_.Part1 = G_14_
  1564. G_140_.Parent = G_14_
  1565. G_140_.C0 = CFrame.new(0, 0, 0, 0.999464273, -3.93271269e-21, -0.0326873511, -0.0325972922, -0.0741798282, -0.996710658, -0.0024247421, 0.997244895, -0.0741400868)
  1566. G_140_.C1 = CFrame.new(0, 0, 0, 0.999464273, -3.93271269e-21, -0.0326873511, -0.0325972922, -0.0741798282, -0.996710658, -0.0024247421, 0.997244895, -0.0741400868)
  1567. G_140_.Part0 = G_14_
  1568. G_140_.Part1 = G_14_
  1569. G_141_.Parent = G_14_
  1570. G_141_.C0 = CFrame.new(0, 0, 0, 0.611500084, -1.41398004e-12, -0.791242719, -0.764281929, 0.258818001, -0.59066391, 0.204787865, 0.965926111, 0.158267245)
  1571. G_141_.C1 = CFrame.new(0, 0, 0, 0.611500084, -1.41398004e-12, -0.791242719, -0.764281929, 0.258818001, -0.59066391, 0.204787865, 0.965926111, 0.158267245)
  1572. G_141_.Part0 = G_14_
  1573. G_141_.Part1 = G_14_
  1574. G_142_.Parent = G_14_
  1575. G_142_.C0 = CFrame.new(0, 0, 0, 0.24251622, -2.50666687e-08, 0.970137596, 0.937083483, 0.258813679, -0.234253451, -0.251095384, 0.965923488, 0.0627691448)
  1576. G_142_.C1 = CFrame.new(0.499996185, -2.59981823, 1.52587891e-05, -0.937089622, -0.258805424, 0.23425433, -0.251083314, 0.965927601, 0.06276609, -0.242516831, 1.28433996e-07, -0.970142305)
  1577. G_142_.Part0 = G_14_
  1578. G_142_.Part1 = G_6_
  1579. G_143_.Parent = G_14_
  1580. G_143_.C0 = CFrame.new(0, 0, 0, -0.426380157, -3.39468215e-07, -0.904544115, -0.873722672, 0.258818805, 0.411851525, 0.234112889, 0.965925992, -0.110355474)
  1581. G_143_.C1 = CFrame.new(0, 0, 0, -0.426380157, -3.39468215e-07, -0.904544115, -0.873722672, 0.258818805, 0.411851525, 0.234112889, 0.965925992, -0.110355474)
  1582. G_143_.Part0 = G_14_
  1583. G_143_.Part1 = G_14_
  1584. G_144_.Parent = G_14_
  1585. G_144_.C0 = CFrame.new(0, 0, 0, 0.611500084, -3.93271269e-21, -0.791242719, -0.777024746, -0.188720495, -0.600511968, -0.149323717, 0.982030869, -0.115402602)
  1586. G_144_.C1 = CFrame.new(0, 0, 0, 0.611500084, -3.93271269e-21, -0.791242719, -0.777024746, -0.188720495, -0.600511968, -0.149323717, 0.982030869, -0.115402602)
  1587. G_144_.Part0 = G_14_
  1588. G_144_.Part1 = G_14_
  1589. G_145_.Parent = G_14_
  1590. G_145_.C0 = CFrame.new(0, 0, 0, 0.611500084, -3.93271269e-21, -0.791242719, -0.777024746, -0.188720495, -0.600511968, -0.149323717, 0.982030869, -0.115402602)
  1591. G_145_.C1 = CFrame.new(0, 0, 0, 0.611500084, -3.93271269e-21, -0.791242719, -0.777024746, -0.188720495, -0.600511968, -0.149323717, 0.982030869, -0.115402602)
  1592. G_145_.Part0 = G_14_
  1593. G_145_.Part1 = G_14_
  1594. G_146_.Parent = G_14_
  1595. G_146_.C0 = CFrame.new(0, 0, 0, 0.611500084, -3.93271269e-21, -0.791242719, -0.777024746, -0.188720495, -0.600511968, -0.149323717, 0.982030869, -0.115402602)
  1596. G_146_.C1 = CFrame.new(0, 0, 0, 0.611500084, -3.93271269e-21, -0.791242719, -0.777024746, -0.188720495, -0.600511968, -0.149323717, 0.982030869, -0.115402602)
  1597. G_146_.Part0 = G_14_
  1598. G_146_.Part1 = G_14_
  1599. G_147_.Parent = G_14_
  1600. G_147_.C0 = CFrame.new(0, 0, 0, 0.00123544212, 5.05585263e-08, -0.999999285, -0.965925992, 0.258816004, -0.0011933333, 0.258815825, 0.965926647, 0.00031980098)
  1601. G_147_.C1 = CFrame.new(0, 0, 0, 0.00123544212, 5.05585263e-08, -0.999999285, -0.965925992, 0.258816004, -0.0011933333, 0.258815825, 0.965926647, 0.00031980098)
  1602. G_147_.Part0 = G_14_
  1603. G_147_.Part1 = G_14_
  1604. G_148_.Parent = G_14_
  1605. G_148_.C0 = CFrame.new(0, 0, 0, 0.24251622, -2.50666687e-08, 0.970137596, 0.937083483, 0.258813679, -0.234253451, -0.251095384, 0.965923488, 0.0627691448)
  1606. G_148_.C1 = CFrame.new(0, 0, 0, 0.24251622, -2.50666687e-08, 0.970137596, 0.937083483, 0.258813679, -0.234253451, -0.251095384, 0.965923488, 0.0627691448)
  1607. G_148_.Part0 = G_14_
  1608. G_148_.Part1 = G_14_
  1609. G_149_.Parent = G_14_
  1610. G_149_.C0 = CFrame.new(0, 0, 0, 0.00123557448, -3.93271269e-21, -0.999998093, -0.788335383, 0.615243852, -0.000974048919, 0.61524266, 0.788336873, 0.000760179595)
  1611. G_149_.C1 = CFrame.new(0, 0, 0, 0.00123557448, -3.93271269e-21, -0.999998093, -0.788335383, 0.615243852, -0.000974048919, 0.61524266, 0.788336873, 0.000760179595)
  1612. G_149_.Part0 = G_14_
  1613. G_149_.Part1 = G_14_
  1614. G_150_.Parent = G_14_
  1615. G_150_.C0 = CFrame.new(0, 0, 0, 0.00123557448, -3.93271269e-21, -0.999998093, -0.788335383, 0.615243852, -0.000974048919, 0.61524266, 0.788336873, 0.000760179595)
  1616. G_150_.C1 = CFrame.new(0, 0, 0, 0.00123557448, -3.93271269e-21, -0.999998093, -0.788335383, 0.615243852, -0.000974048919, 0.61524266, 0.788336873, 0.000760179595)
  1617. G_150_.Part0 = G_14_
  1618. G_150_.Part1 = G_14_
  1619. G_151_.Parent = G_14_
  1620. G_151_.C0 = CFrame.new(0, 0, 0, 0.00123557448, -3.93271269e-21, -0.999998093, -0.788335383, 0.615243852, -0.000974048919, 0.61524266, 0.788336873, 0.000760179595)
  1621. G_151_.C1 = CFrame.new(0, 0, 0, 0.00123557448, -3.93271269e-21, -0.999998093, -0.788335383, 0.615243852, -0.000974048919, 0.61524266, 0.788336873, 0.000760179595)
  1622. G_151_.Part0 = G_14_
  1623. G_151_.Part1 = G_14_
  1624. G_152_.Parent = G_14_
  1625. G_152_.C0 = CFrame.new(0, 0, 0, -0.176956683, 1.04023457e-11, -0.984217405, -0.950676382, 0.258836508, 0.170926198, 0.254751414, 0.965921164, -0.0458028466)
  1626. G_152_.C1 = CFrame.new(0, 0, 0, -0.176956683, 1.04023457e-11, -0.984217405, -0.950676382, 0.258836508, 0.170926198, 0.254751414, 0.965921164, -0.0458028466)
  1627. G_152_.Part0 = G_14_
  1628. G_152_.Part1 = G_14_
  1629. G_153_.Parent = G_14_
  1630. G_153_.C0 = CFrame.new(0, 0, 0, -0.979760647, -3.93271269e-21, -0.200166717, -0.181929275, -0.417038649, 0.890493453, -0.0834772587, 0.908888757, 0.408598065)
  1631. G_153_.C1 = CFrame.new(0, 0, 0, -0.979760647, -3.93271269e-21, -0.200166717, -0.181929275, -0.417038649, 0.890493453, -0.0834772587, 0.908888757, 0.408598065)
  1632. G_153_.Part0 = G_14_
  1633. G_153_.Part1 = G_14_
  1634. G_154_.Parent = G_14_
  1635. G_154_.C0 = CFrame.new(0, 0, 0, -0.176956683, -3.93271269e-21, -0.984217405, -0.9520787, -0.253459662, 0.171178326, -0.249459416, 0.967345953, 0.0448513813)
  1636. G_154_.C1 = CFrame.new(0, 0, 0, -0.176956683, -3.93271269e-21, -0.984217405, -0.9520787, -0.253459662, 0.171178326, -0.249459416, 0.967345953, 0.0448513813)
  1637. G_154_.Part0 = G_14_
  1638. G_154_.Part1 = G_14_
  1639. G_155_.Parent = G_14_
  1640. G_155_.C0 = CFrame.new(0, 0, 0, -0.176956683, -3.93271269e-21, -0.984217405, -0.9520787, -0.253459662, 0.171178326, -0.249459416, 0.967345953, 0.0448513813)
  1641. G_155_.C1 = CFrame.new(0, 0, 0, -0.176956683, -3.93271269e-21, -0.984217405, -0.9520787, -0.253459662, 0.171178326, -0.249459416, 0.967345953, 0.0448513813)
  1642. G_155_.Part0 = G_14_
  1643. G_155_.Part1 = G_14_
  1644. G_156_.Parent = G_14_
  1645. G_156_.C0 = CFrame.new(0, 0, 0, -0.176956683, -3.93271269e-21, -0.984217405, -0.9520787, -0.253459662, 0.171178326, -0.249459416, 0.967345953, 0.0448513813)
  1646. G_156_.C1 = CFrame.new(0, 0, 0, -0.176956683, -3.93271269e-21, -0.984217405, -0.9520787, -0.253459662, 0.171178326, -0.249459416, 0.967345953, 0.0448513813)
  1647. G_156_.Part0 = G_14_
  1648. G_156_.Part1 = G_14_
  1649. G_157_.Parent = G_14_
  1650. G_157_.C0 = CFrame.new(0, 0, 0, -0.426380157, -3.39468215e-07, -0.904544115, -0.873722672, 0.258818805, 0.411851525, 0.234112889, 0.965925992, -0.110355474)
  1651. G_157_.C1 = CFrame.new(0, 0, 0, -0.426380157, -3.39468215e-07, -0.904544115, -0.873722672, 0.258818805, 0.411851525, 0.234112889, 0.965925992, -0.110355474)
  1652. G_157_.Part0 = G_14_
  1653. G_157_.Part1 = G_14_
  1654. G_158_.Parent = G_14_
  1655. G_158_.C0 = CFrame.new(0, 0, 0, -0.979760647, -3.93271269e-21, -0.200166717, -0.181929275, -0.417038649, 0.890493453, -0.0834772587, 0.908888757, 0.408598065)
  1656. G_158_.C1 = CFrame.new(0, 0, 0, -0.979760647, -3.93271269e-21, -0.200166717, -0.181929275, -0.417038649, 0.890493453, -0.0834772587, 0.908888757, 0.408598065)
  1657. G_158_.Part0 = G_14_
  1658. G_158_.Part1 = G_14_
  1659. G_159_.Parent = G_14_
  1660. G_159_.C0 = CFrame.new(0, 0, 0, 0.24251622, -2.50666687e-08, 0.970137596, 0.937083483, 0.258813679, -0.234253451, -0.251095384, 0.965923488, 0.0627691448)
  1661. G_159_.C1 = CFrame.new(-1.11798096, -4.20858383, 3.81469727e-05, -0.937076747, -0.258870542, 0.234250262, -0.251143396, 0.965912104, 0.0627769455, -0.242516235, -3.59013075e-06, -0.970147371)
  1662. G_159_.Part0 = G_14_
  1663. G_159_.Part1 = G_12_
  1664. G_160_.Parent = G_14_
  1665. G_160_.C0 = CFrame.new(0, 0, 0, -0.426379502, -3.93271269e-21, -0.904542983, -0.847110033, 0.350651234, 0.399307013, 0.317179114, 0.936506093, -0.149510503)
  1666. G_160_.C1 = CFrame.new(0, 0, 0, -0.426379502, -3.93271269e-21, -0.904542983, -0.847110033, 0.350651234, 0.399307013, 0.317179114, 0.936506093, -0.149510503)
  1667. G_160_.Part0 = G_14_
  1668. G_160_.Part1 = G_14_
  1669. G_161_.Parent = G_14_
  1670. G_161_.C0 = CFrame.new(0, 0, 0, -0.426379502, -3.93271269e-21, -0.904542983, -0.847110033, 0.350651234, 0.399307013, 0.317179114, 0.936506093, -0.149510503)
  1671. G_161_.C1 = CFrame.new(0, 0, 0, -0.426379502, -3.93271269e-21, -0.904542983, -0.847110033, 0.350651234, 0.399307013, 0.317179114, 0.936506093, -0.149510503)
  1672. G_161_.Part0 = G_14_
  1673. G_161_.Part1 = G_14_
  1674. G_162_.Parent = G_14_
  1675. G_162_.C0 = CFrame.new(0, 0, 0, -0.426379502, -3.93271269e-21, -0.904542983, -0.847110033, 0.350651234, 0.399307013, 0.317179114, 0.936506093, -0.149510503)
  1676. G_162_.C1 = CFrame.new(0, 0, 0, -0.426379502, -3.93271269e-21, -0.904542983, -0.847110033, 0.350651234, 0.399307013, 0.317179114, 0.936506093, -0.149510503)
  1677. G_162_.Part0 = G_14_
  1678. G_162_.Part1 = G_14_
  1679. G_163_.Parent = G_14_
  1680. G_163_.C0 = CFrame.new(0, 0, 0, 0.24251622, -2.50666687e-08, 0.970137596, 0.937083483, 0.258813679, -0.234253451, -0.251095384, 0.965923488, 0.0627691448)
  1681. G_163_.C1 = CFrame.new(0, 0, 0, 0.24251622, -2.50666687e-08, 0.970137596, 0.937083483, 0.258813679, -0.234253451, -0.251095384, 0.965923488, 0.0627691448)
  1682. G_163_.Part0 = G_14_
  1683. G_163_.Part1 = G_14_
  1684. G_164_.Parent = G_3_
  1685. G_164_.Material = Enum.Material.SmoothPlastic
  1686. G_164_.BrickColor = BrickColor.new("Really black")
  1687. G_164_.Position = Vector3.new(0.0981919989, 5.20197296, 1.05291605)
  1688. G_164_.Rotation = Vector3.new(135, 0, -90)
  1689. G_164_.Anchored = true
  1690. G_164_.Size = Vector3.new(0.0500000007, 0.0500000007, 0.0500000007)
  1691. G_164_.CFrame = CFrame.new(0.0981919989, 5.20197296, 1.05291605, 1.05528628e-07, 1, 6.18172393e-08, 0.707106769, -3.09086197e-08, -0.707106769, -0.707106769, 1.183314e-07, -0.707106769)
  1692. G_164_.TopSurface = Enum.SurfaceType.Smooth
  1693. G_164_.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  1694. G_164_.Position = Vector3.new(0.0981919989, 5.20197296, 1.05291605)
  1695. G_164_.Orientation = Vector3.new(45, 180, 90)
  1696. G_164_.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  1697. G_165_.Parent = G_164_
  1698. G_165_.Scale = Vector3.new(12.3000011, 0.409999996, 4.10000038)
  1699. G_165_.Scale = Vector3.new(12.3000011, 0.409999996, 4.10000038)
  1700. G_166_.Parent = G_3_
  1701. G_166_.Material = Enum.Material.SmoothPlastic
  1702. G_166_.BrickColor = BrickColor.new("Really black")
  1703. G_166_.Position = Vector3.new(-0.101504996, 5.20277309, 1.03442001)
  1704. G_166_.Rotation = Vector3.new(135, 0.00999999978, 90)
  1705. G_166_.Anchored = true
  1706. G_166_.Size = Vector3.new(0.0500000007, 0.0500000007, 0.0500000007)
  1707. G_166_.CFrame = CFrame.new(-0.101504996, 5.20277309, 1.03442001, 5.09341626e-05, -1, 0.000123512742, -0.707106769, -0.000123352584, -0.707106769, 0.707106829, -5.1320807e-05, -0.707106769)
  1708. G_166_.TopSurface = Enum.SurfaceType.Smooth
  1709. G_166_.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  1710. G_166_.Position = Vector3.new(-0.101504996, 5.20277309, 1.03442001)
  1711. G_166_.Orientation = Vector3.new(45, 179.98999, -90.0099945)
  1712. G_166_.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  1713. G_167_.Parent = G_166_
  1714. G_167_.Scale = Vector3.new(12.3000088, 0.409999996, 4.10000229)
  1715. G_167_.Scale = Vector3.new(12.3000088, 0.409999996, 4.10000229)
  1716. G_168_.Parent = G_3_
  1717. G_168_.Material = Enum.Material.SmoothPlastic
  1718. G_168_.BrickColor = BrickColor.new("Really black")
  1719. G_168_.Position = Vector3.new(-0.101549, 5.6376462, 0.889469981)
  1720. G_168_.Rotation = Vector3.new(135, 0.00999999978, 90)
  1721. G_168_.Anchored = true
  1722. G_168_.Size = Vector3.new(0.0500000007, 0.0500000007, 0.0500000007)
  1723. G_168_.CFrame = CFrame.new(-0.101549, 5.6376462, 0.889469981, 5.09341626e-05, -1, 0.000123512742, -0.707106769, -0.000123352584, -0.707106769, 0.707106829, -5.1320807e-05, -0.707106769)
  1724. G_168_.TopSurface = Enum.SurfaceType.Smooth
  1725. G_168_.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  1726. G_168_.Position = Vector3.new(-0.101549, 5.6376462, 0.889469981)
  1727. G_168_.Orientation = Vector3.new(45, 179.98999, -90.0099945)
  1728. G_168_.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  1729. G_169_.Parent = G_168_
  1730. G_169_.Scale = Vector3.new(4.10000181, 0.409999996, 12.3000078)
  1731. G_169_.Scale = Vector3.new(4.10000181, 0.409999996, 12.3000078)
  1732. G_170_.Parent = G_3_
  1733. G_170_.Material = Enum.Material.SmoothPlastic
  1734. G_170_.BrickColor = BrickColor.new("Really black")
  1735. G_170_.Position = Vector3.new(0.0981329978, 4.76712608, 0.907956004)
  1736. G_170_.Rotation = Vector3.new(45, -0.00999999978, -90)
  1737. G_170_.Anchored = true
  1738. G_170_.Size = Vector3.new(0.0500000007, 0.0500000007, 0.0500000007)
  1739. G_170_.CFrame = CFrame.new(0.0981329978, 4.76712608, 0.907956004, -5.10334939e-05, 1, -0.000123413411, -0.707106769, -0.000123352584, -0.707106769, -0.707106829, 5.11803373e-05, 0.707106769)
  1740. G_170_.TopSurface = Enum.SurfaceType.Smooth
  1741. G_170_.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  1742. G_170_.Position = Vector3.new(0.0981329978, 4.76712608, 0.907956004)
  1743. G_170_.Orientation = Vector3.new(45, -0.00999999978, -90.0099945)
  1744. G_170_.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  1745. G_171_.Parent = G_170_
  1746. G_171_.Scale = Vector3.new(4.10000181, 0.409999996, 12.3000078)
  1747. G_171_.Scale = Vector3.new(4.10000181, 0.409999996, 12.3000078)
  1748. G_172_.Parent = G_3_
  1749. G_172_.Material = Enum.Material.SmoothPlastic
  1750. G_172_.BrickColor = BrickColor.new("Really black")
  1751. G_172_.Position = Vector3.new(0.0981789976, 5.34695196, 0.618050992)
  1752. G_172_.Rotation = Vector3.new(135, 0, -90)
  1753. G_172_.Anchored = true
  1754. G_172_.Size = Vector3.new(0.0500000007, 0.0500000007, 0.0500000007)
  1755. G_172_.CFrame = CFrame.new(0.0981789976, 5.34695196, 0.618050992, 1.05528628e-07, 1, 6.18172393e-08, 0.707106769, -3.09086197e-08, -0.707106769, -0.707106769, 1.183314e-07, -0.707106769)
  1756. G_172_.TopSurface = Enum.SurfaceType.Smooth
  1757. G_172_.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  1758. G_172_.Position = Vector3.new(0.0981789976, 5.34695196, 0.618050992)
  1759. G_172_.Orientation = Vector3.new(45, 180, 90)
  1760. G_172_.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  1761. G_173_.Parent = G_172_
  1762. G_173_.Scale = Vector3.new(4.0999999, 0.409999967, 12.3000002)
  1763. G_173_.Scale = Vector3.new(4.0999999, 0.409999967, 12.3000002)
  1764. G_174_.Parent = G_3_
  1765. G_174_.Material = Enum.Material.SmoothPlastic
  1766. G_174_.BrickColor = BrickColor.new("Really black")
  1767. G_174_.Position = Vector3.new(0.0981789976, 5.20199394, 1.05292296)
  1768. G_174_.Rotation = Vector3.new(45, -0.00999999978, -90)
  1769. G_174_.Anchored = true
  1770. G_174_.Size = Vector3.new(0.0500000007, 0.0500000007, 0.0500000007)
  1771. G_174_.CFrame = CFrame.new(0.0981789976, 5.20199394, 1.05292296, -5.10334939e-05, 1, -0.000123413411, -0.707106769, -0.000123352584, -0.707106769, -0.707106829, 5.11803373e-05, 0.707106769)
  1772. G_174_.TopSurface = Enum.SurfaceType.Smooth
  1773. G_174_.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  1774. G_174_.Position = Vector3.new(0.0981789976, 5.20199394, 1.05292296)
  1775. G_174_.Orientation = Vector3.new(45, -0.00999999978, -90.0099945)
  1776. G_174_.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  1777. G_175_.Parent = G_174_
  1778. G_175_.Scale = Vector3.new(12.3000088, 0.409999996, 4.10000229)
  1779. G_175_.Scale = Vector3.new(12.3000088, 0.409999996, 4.10000229)
  1780. G_176_.Parent = G_3_
  1781. G_176_.Material = Enum.Material.SmoothPlastic
  1782. G_176_.BrickColor = BrickColor.new("Really black")
  1783. G_176_.Position = Vector3.new(0.0982230008, 5.63687086, 1.19787502)
  1784. G_176_.Rotation = Vector3.new(45, -0.00999999978, -90)
  1785. G_176_.Anchored = true
  1786. G_176_.Size = Vector3.new(0.0500000007, 0.0500000007, 0.0500000007)
  1787. G_176_.CFrame = CFrame.new(0.0982230008, 5.63687086, 1.19787502, -5.10334939e-05, 1, -0.000123413411, -0.707106769, -0.000123352584, -0.707106769, -0.707106829, 5.11803373e-05, 0.707106769)
  1788. G_176_.TopSurface = Enum.SurfaceType.Smooth
  1789. G_176_.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  1790. G_176_.Position = Vector3.new(0.0982230008, 5.63687086, 1.19787502)
  1791. G_176_.Orientation = Vector3.new(45, -0.00999999978, -90.0099945)
  1792. G_176_.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  1793. G_177_.Parent = G_176_
  1794. G_177_.Scale = Vector3.new(4.10000181, 0.409999996, 12.3000078)
  1795. G_177_.Scale = Vector3.new(4.10000181, 0.409999996, 12.3000078)
  1796. G_178_.Parent = G_3_
  1797. G_178_.Material = Enum.Material.SmoothPlastic
  1798. G_178_.BrickColor = BrickColor.new("Really black")
  1799. G_178_.Position = Vector3.new(-0.101531997, 5.05777216, 0.599551976)
  1800. G_178_.Rotation = Vector3.new(45, 0, 90)
  1801. G_178_.Anchored = true
  1802. G_178_.Size = Vector3.new(0.0500000007, 0.0500000007, 0.0500000007)
  1803. G_178_.CFrame = CFrame.new(-0.101531997, 5.05777216, 0.599551976, -4.37113883e-08, -1, 0, 0.707106769, -3.09086197e-08, -0.707106769, 0.707106769, -3.09086197e-08, 0.707106769)
  1804. G_178_.TopSurface = Enum.SurfaceType.Smooth
  1805. G_178_.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  1806. G_178_.Position = Vector3.new(-0.101531997, 5.05777216, 0.599551976)
  1807. G_178_.Orientation = Vector3.new(45, 0, 90)
  1808. G_178_.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  1809. G_179_.Parent = G_178_
  1810. G_179_.Scale = Vector3.new(4.0999999, 0.409999967, 12.3000002)
  1811. G_179_.Scale = Vector3.new(4.0999999, 0.409999967, 12.3000002)
  1812. G_180_.Parent = G_3_
  1813. G_180_.Material = Enum.Material.SmoothPlastic
  1814. G_180_.BrickColor = BrickColor.new("Really black")
  1815. G_180_.Position = Vector3.new(-0.101458997, 4.76790714, 1.17938602)
  1816. G_180_.Rotation = Vector3.new(135, 0.00999999978, 90)
  1817. G_180_.Anchored = true
  1818. G_180_.Size = Vector3.new(0.0500000007, 0.0500000007, 0.0500000007)
  1819. G_180_.CFrame = CFrame.new(-0.101458997, 4.76790714, 1.17938602, 5.09341626e-05, -1, 0.000123512742, -0.707106769, -0.000123352584, -0.707106769, 0.707106829, -5.1320807e-05, -0.707106769)
  1820. G_180_.TopSurface = Enum.SurfaceType.Smooth
  1821. G_180_.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  1822. G_180_.Position = Vector3.new(-0.101458997, 4.76790714, 1.17938602)
  1823. G_180_.Orientation = Vector3.new(45, 179.98999, -90.0099945)
  1824. G_180_.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  1825. G_181_.Parent = G_180_
  1826. G_181_.Scale = Vector3.new(4.10000181, 0.409999996, 12.3000078)
  1827. G_181_.Scale = Vector3.new(4.10000181, 0.409999996, 12.3000078)
  1828. G_182_.Parent = G_3_
  1829. G_182_.Material = Enum.Material.SmoothPlastic
  1830. G_182_.BrickColor = BrickColor.new("Lily white")
  1831. G_182_.Position = Vector3.new(-0.0932620019, 5.22326517, 1.04470396)
  1832. G_182_.Rotation = Vector3.new(90, 0, 0)
  1833. G_182_.Anchored = true
  1834. G_182_.Shape = Enum.PartType.Cylinder
  1835. G_182_.Size = Vector3.new(0.0500000007, 0.0500000007, 0.0500000007)
  1836. G_182_.CFrame = CFrame.new(-0.0932620019, 5.22326517, 1.04470396, 1, 0, 0, 0, -4.37113883e-08, -1, 0, 1, -4.37113883e-08)
  1837. G_182_.BottomSurface = Enum.SurfaceType.Smooth
  1838. G_182_.TopSurface = Enum.SurfaceType.Smooth
  1839. G_182_.Color = Color3.new(0.929412, 0.913726, 0.913726)
  1840. G_182_.Position = Vector3.new(-0.0932620019, 5.22326517, 1.04470396)
  1841. G_182_.Orientation = Vector3.new(90, 0, 0)
  1842. G_182_.Color = Color3.new(0.929412, 0.913726, 0.913726)
  1843. G_183_.Parent = G_182_
  1844. G_183_.Scale = Vector3.new(0.409999967, 30.7500038, 45.1000099)
  1845. G_183_.MeshType = Enum.MeshType.Cylinder
  1846. G_183_.Scale = Vector3.new(0.409999967, 30.7500038, 45.1000099)
  1847. G_184_.Parent = G_3_
  1848. G_184_.Material = Enum.Material.SmoothPlastic
  1849. G_184_.BrickColor = BrickColor.new("Really black")
  1850. G_184_.Position = Vector3.new(-0.101504996, 5.34773302, 1.46928799)
  1851. G_184_.Rotation = Vector3.new(45, 0, 90)
  1852. G_184_.Anchored = true
  1853. G_184_.Size = Vector3.new(0.0500000007, 0.0500000007, 0.0500000007)
  1854. G_184_.CFrame = CFrame.new(-0.101504996, 5.34773302, 1.46928799, -4.37113883e-08, -1, 0, 0.707106769, -3.09086197e-08, -0.707106769, 0.707106769, -3.09086197e-08, 0.707106769)
  1855. G_184_.TopSurface = Enum.SurfaceType.Smooth
  1856. G_184_.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  1857. G_184_.Position = Vector3.new(-0.101504996, 5.34773302, 1.46928799)
  1858. G_184_.Orientation = Vector3.new(45, 0, 90)
  1859. G_184_.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  1860. G_185_.Parent = G_184_
  1861. G_185_.Scale = Vector3.new(4.0999999, 0.409999967, 12.3000002)
  1862. G_185_.Scale = Vector3.new(4.0999999, 0.409999967, 12.3000002)
  1863. G_186_.Parent = G_3_
  1864. G_186_.Material = Enum.Material.SmoothPlastic
  1865. G_186_.BrickColor = BrickColor.new("Really black")
  1866. G_186_.Position = Vector3.new(-0.101517998, 5.20275211, 1.03442705)
  1867. G_186_.Rotation = Vector3.new(45, 0, 90)
  1868. G_186_.Anchored = true
  1869. G_186_.Size = Vector3.new(0.0500000007, 0.0500000007, 0.0500000007)
  1870. G_186_.CFrame = CFrame.new(-0.101517998, 5.20275211, 1.03442705, -4.37113883e-08, -1, 0, 0.707106769, -3.09086197e-08, -0.707106769, 0.707106769, -3.09086197e-08, 0.707106769)
  1871. G_186_.TopSurface = Enum.SurfaceType.Smooth
  1872. G_186_.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  1873. G_186_.Position = Vector3.new(-0.101517998, 5.20275211, 1.03442705)
  1874. G_186_.Orientation = Vector3.new(45, 0, 90)
  1875. G_186_.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  1876. G_187_.Parent = G_186_
  1877. G_187_.Scale = Vector3.new(12.3000011, 0.409999996, 4.10000038)
  1878. G_187_.Scale = Vector3.new(12.3000011, 0.409999996, 4.10000038)
  1879. G_188_.Parent = G_3_
  1880. G_188_.Material = Enum.Material.SmoothPlastic
  1881. G_188_.BrickColor = BrickColor.new("Really black")
  1882. G_188_.Position = Vector3.new(0.0982059985, 5.05698919, 1.487795)
  1883. G_188_.Rotation = Vector3.new(135, 0, -90)
  1884. G_188_.Anchored = true
  1885. G_188_.Size = Vector3.new(0.0500000007, 0.0500000007, 0.0500000007)
  1886. G_188_.CFrame = CFrame.new(0.0982059985, 5.05698919, 1.487795, 1.05528628e-07, 1, 6.18172393e-08, 0.707106769, -3.09086197e-08, -0.707106769, -0.707106769, 1.183314e-07, -0.707106769)
  1887. G_188_.TopSurface = Enum.SurfaceType.Smooth
  1888. G_188_.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  1889. G_188_.Position = Vector3.new(0.0982059985, 5.05698919, 1.487795)
  1890. G_188_.Orientation = Vector3.new(45, 180, 90)
  1891. G_188_.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  1892. G_189_.Parent = G_188_
  1893. G_189_.Scale = Vector3.new(4.0999999, 0.409999967, 12.3000002)
  1894. G_189_.Scale = Vector3.new(4.0999999, 0.409999967, 12.3000002)
  1895. G_190_.Parent = G_3_
  1896. G_190_.Material = Enum.Material.SmoothPlastic
  1897. G_190_.BrickColor = BrickColor.new("Lily white")
  1898. G_190_.Position = Vector3.new(0.0899360031, 5.22248507, 1.04263902)
  1899. G_190_.Rotation = Vector3.new(90, 0, 180)
  1900. G_190_.Anchored = true
  1901. G_190_.Shape = Enum.PartType.Cylinder
  1902. G_190_.Size = Vector3.new(0.0500000007, 0.0500000007, 0.0500000007)
  1903. G_190_.CFrame = CFrame.new(0.0899360031, 5.22248507, 1.04263902, -1, -8.74227766e-08, 3.82137093e-15, 0, -4.37113883e-08, -1, 8.74227766e-08, -1, 4.37113883e-08)
  1904. G_190_.BottomSurface = Enum.SurfaceType.Smooth
  1905. G_190_.TopSurface = Enum.SurfaceType.Smooth
  1906. G_190_.Color = Color3.new(0.929412, 0.913726, 0.913726)
  1907. G_190_.Position = Vector3.new(0.0899360031, 5.22248507, 1.04263902)
  1908. G_190_.Orientation = Vector3.new(90, -180, 0)
  1909. G_190_.Color = Color3.new(0.929412, 0.913726, 0.913726)
  1910. G_191_.Parent = G_190_
  1911. G_191_.Scale = Vector3.new(0.409999967, 30.7500038, 45.1000099)
  1912. G_191_.MeshType = Enum.MeshType.Cylinder
  1913. G_191_.Scale = Vector3.new(0.409999967, 30.7500038, 45.1000099)
  1914. G_192_.Parent = G_3_
  1915. G_192_.Material = Enum.Material.Ice
  1916. G_192_.BrickColor = BrickColor.new("Bright yellow")
  1917. G_192_.Reflectance = 0.5
  1918. G_192_.Position = Vector3.new(0.112259537, 6.74117947, -1.02615499)
  1919. G_192_.Rotation = Vector3.new(179.98999, -90, 0)
  1920. G_192_.Anchored = true
  1921. G_192_.Size = Vector3.new(0.727940977, 0.0794117525, 0.0661764666)
  1922. G_192_.CFrame = CFrame.new(0.112259537, 6.74117947, -1.02615499, 3.10037976e-05, 3.0861971e-05, -1, -9.12893593e-05, -1, -3.08652525e-05, -1, 9.12901596e-05, -3.10007235e-05)
  1923. G_192_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  1924. G_192_.Position = Vector3.new(0.112259537, 6.74117947, -1.02615499)
  1925. G_192_.Orientation = Vector3.new(0, -90, -179.98999)
  1926. G_192_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  1927. G_193_.Parent = G_3_
  1928. G_193_.BrickColor = BrickColor.new("Br. yellowish orange")
  1929. G_193_.Reflectance = 0.5
  1930. G_193_.Position = Vector3.new(0.185044914, 6.26469135, -0.562865317)
  1931. G_193_.Rotation = Vector3.new(-180, 0, -90)
  1932. G_193_.Anchored = true
  1933. G_193_.CanCollide = false
  1934. G_193_.Size = Vector3.new(0.0661764592, 0.0500000007, 0.264705867)
  1935. G_193_.CFrame = CFrame.new(0.185044914, 6.26469135, -0.562865317, -3.0908519e-05, 1, 4.84791144e-07, 1, 3.09089737e-05, 3.06605415e-07, 3.06745392e-07, 4.84537452e-07, -1)
  1936. G_193_.TopSurface = Enum.SurfaceType.Smooth
  1937. G_193_.Color = Color3.new(0.886275, 0.603922, 0.247059)
  1938. G_193_.Position = Vector3.new(0.185044914, 6.26469135, -0.562865317)
  1939. G_193_.Orientation = Vector3.new(0, 180, 90)
  1940. G_193_.Color = Color3.new(0.886275, 0.603922, 0.247059)
  1941. G_194_.Parent = G_193_
  1942. G_194_.Scale = Vector3.new(1, 0.529411674, 1)
  1943. G_194_.Scale = Vector3.new(1, 0.529411674, 1)
  1944. G_195_.Parent = G_3_
  1945. G_195_.Material = Enum.Material.Ice
  1946. G_195_.BrickColor = BrickColor.new("Bright yellow")
  1947. G_195_.Reflectance = 0.5
  1948. G_195_.Position = Vector3.new(0.112257451, 6.63530016, -0.993060589)
  1949. G_195_.Rotation = Vector3.new(179.98999, -90, 0)
  1950. G_195_.Anchored = true
  1951. G_195_.Size = Vector3.new(0.661764622, 0.0794117525, 0.0661764666)
  1952. G_195_.CFrame = CFrame.new(0.112257451, 6.63530016, -0.993060589, 3.10037976e-05, 3.0861971e-05, -1, -9.12893593e-05, -1, -3.08652525e-05, -1, 9.12901596e-05, -3.10007235e-05)
  1953. G_195_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  1954. G_195_.Position = Vector3.new(0.112257451, 6.63530016, -0.993060589)
  1955. G_195_.Orientation = Vector3.new(0, -90, -179.98999)
  1956. G_195_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  1957. G_196_.Parent = G_3_
  1958. G_196_.Material = Enum.Material.Ice
  1959. G_196_.BrickColor = BrickColor.new("Br. yellowish orange")
  1960. G_196_.Reflectance = 0.5
  1961. G_196_.Position = Vector3.new(0.112228304, 6.68834591, 0.098853454)
  1962. G_196_.Rotation = Vector3.new(179.98999, 90, 0)
  1963. G_196_.Anchored = true
  1964. G_196_.CanCollide = false
  1965. G_196_.Size = Vector3.new(0.727940977, 0.0500000007, 0.0661764666)
  1966. G_196_.CFrame = CFrame.new(0.112228304, 6.68834591, 0.098853454, 3.00304073e-05, 3.09544739e-05, 1, 0.000152000081, -1, 3.09503594e-05, 1, 0.000151999018, -3.00353695e-05)
  1967. G_196_.Color = Color3.new(0.886275, 0.603922, 0.247059)
  1968. G_196_.Position = Vector3.new(0.112228304, 6.68834591, 0.098853454)
  1969. G_196_.Orientation = Vector3.new(0, 90, 179.98999)
  1970. G_196_.Color = Color3.new(0.886275, 0.603922, 0.247059)
  1971. G_197_.Parent = G_196_
  1972. G_197_.Scale = Vector3.new(1, 0.529411674, 1)
  1973. G_197_.Scale = Vector3.new(1, 0.529411674, 1)
  1974. G_198_.Name = "Smooth Block Model"
  1975. G_198_.Parent = G_3_
  1976. G_198_.Material = Enum.Material.Ice
  1977. G_198_.BrickColor = BrickColor.new("Bright yellow")
  1978. G_198_.Reflectance = 0.5
  1979. G_198_.Position = Vector3.new(0.112255245, 6.51619673, -0.562885582)
  1980. G_198_.Rotation = Vector3.new(-180, 0, 0)
  1981. G_198_.Anchored = true
  1982. G_198_.Size = Vector3.new(0.0661764592, 0.158823505, 0.198529392)
  1983. G_198_.CFrame = CFrame.new(0.112255245, 6.51619673, -0.562885582, 1, 4.35009861e-05, 5.28503222e-07, 4.35014445e-05, -1, 2.62890154e-07, 5.28253224e-07, -2.63019359e-07, -1)
  1984. G_198_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  1985. G_198_.Position = Vector3.new(0.112255245, 6.51619673, -0.562885582)
  1986. G_198_.Orientation = Vector3.new(0, 180, 180)
  1987. G_198_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  1988. G_199_.Parent = G_198_
  1989. G_199_.MeshType = Enum.MeshType.Wedge
  1990. G_200_.Parent = G_3_
  1991. G_200_.Material = Enum.Material.Ice
  1992. G_200_.BrickColor = BrickColor.new("Bright yellow")
  1993. G_200_.Reflectance = 0.5
  1994. G_200_.Position = Vector3.new(0.1122289, 6.74128675, 0.0988496393)
  1995. G_200_.Rotation = Vector3.new(179.98999, 90, 0)
  1996. G_200_.Anchored = true
  1997. G_200_.Size = Vector3.new(0.727940977, 0.0794117525, 0.0661764666)
  1998. G_200_.CFrame = CFrame.new(0.1122289, 6.74128675, 0.0988496393, 3.00304073e-05, 3.09544739e-05, 1, 0.000152000081, -1, 3.09503594e-05, 1, 0.000151999018, -3.00353695e-05)
  1999. G_200_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2000. G_200_.Position = Vector3.new(0.1122289, 6.74128675, 0.0988496393)
  2001. G_200_.Orientation = Vector3.new(0, 90, 179.98999)
  2002. G_200_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2003. G_201_.Name = "Smooth Block Model"
  2004. G_201_.Parent = G_3_
  2005. G_201_.Material = Enum.Material.Ice
  2006. G_201_.BrickColor = BrickColor.new("Bright yellow")
  2007. G_201_.Reflectance = 0.5
  2008. G_201_.Position = Vector3.new(0.112219721, 6.84721279, 0.562077045)
  2009. G_201_.Rotation = Vector3.new(-180, 0, 0)
  2010. G_201_.Anchored = true
  2011. G_201_.Size = Vector3.new(0.0661764592, 0.0794117525, 0.0661764666)
  2012. G_201_.CFrame = CFrame.new(0.112219721, 6.84721279, 0.562077045, 1, 4.35009861e-05, 5.28501403e-07, 4.35014445e-05, -1, 2.62890154e-07, 5.28255043e-07, -2.63019359e-07, -1)
  2013. G_201_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2014. G_201_.Position = Vector3.new(0.112219721, 6.84721279, 0.562077045)
  2015. G_201_.Orientation = Vector3.new(0, 180, 180)
  2016. G_201_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2017. G_202_.Parent = G_201_
  2018. G_202_.MeshType = Enum.MeshType.Wedge
  2019. G_203_.Parent = G_3_
  2020. G_203_.BrickColor = BrickColor.new("Br. yellowish orange")
  2021. G_203_.Reflectance = 0.5
  2022. G_203_.Position = Vector3.new(0.185044914, 6.13236713, -0.46358639)
  2023. G_203_.Rotation = Vector3.new(89.9899979, 0, -90)
  2024. G_203_.Anchored = true
  2025. G_203_.CanCollide = false
  2026. G_203_.Size = Vector3.new(0.0661764592, 0.0500000007, 0.198529392)
  2027. G_203_.CFrame = CFrame.new(0.185044914, 6.13236713, -0.46358639, 4.84831105e-07, 1, 5.37966371e-05, -0.00012920874, 5.37971573e-05, -1, -1, 4.77621654e-07, 0.000129208638)
  2028. G_203_.TopSurface = Enum.SurfaceType.Smooth
  2029. G_203_.Color = Color3.new(0.886275, 0.603922, 0.247059)
  2030. G_203_.Position = Vector3.new(0.185044914, 6.13236713, -0.46358639)
  2031. G_203_.Orientation = Vector3.new(90, 90, 0)
  2032. G_203_.Color = Color3.new(0.886275, 0.603922, 0.247059)
  2033. G_204_.Parent = G_203_
  2034. G_204_.Scale = Vector3.new(1, 0.529411674, 1)
  2035. G_204_.Scale = Vector3.new(1, 0.529411674, 1)
  2036. G_205_.Name = "Smooth Block Model"
  2037. G_205_.Parent = G_3_
  2038. G_205_.Material = Enum.Material.Ice
  2039. G_205_.BrickColor = BrickColor.new("Bright yellow")
  2040. G_205_.Reflectance = 0.5
  2041. G_205_.Position = Vector3.new(0.112218171, 6.74132442, 0.495908648)
  2042. G_205_.Rotation = Vector3.new(-180, 0, 0)
  2043. G_205_.Anchored = true
  2044. G_205_.Size = Vector3.new(0.0661764592, 0.0794117525, 0.0661764666)
  2045. G_205_.CFrame = CFrame.new(0.112218171, 6.74132442, 0.495908648, 1, 4.35009861e-05, 5.28501403e-07, 4.35014445e-05, -1, 2.62890154e-07, 5.28255043e-07, -2.63019359e-07, -1)
  2046. G_205_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2047. G_205_.Position = Vector3.new(0.112218171, 6.74132442, 0.495908648)
  2048. G_205_.Orientation = Vector3.new(0, 180, 180)
  2049. G_205_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2050. G_206_.Parent = G_205_
  2051. G_206_.MeshType = Enum.MeshType.Wedge
  2052. G_207_.Name = "Smooth Block Model"
  2053. G_207_.Parent = G_3_
  2054. G_207_.Material = Enum.Material.Ice
  2055. G_207_.BrickColor = BrickColor.new("Bright yellow")
  2056. G_207_.Reflectance = 0.5
  2057. G_207_.Position = Vector3.new(0.11224249, 6.47649574, -0.232004493)
  2058. G_207_.Rotation = Vector3.new(-180, 0, 180)
  2059. G_207_.Anchored = true
  2060. G_207_.Size = Vector3.new(0.0661764592, 0.0794117525, 0.0661764666)
  2061. G_207_.CFrame = CFrame.new(0.11224249, 6.47649574, -0.232004493, -1, -4.35941765e-05, 4.41080772e-07, -4.35946276e-05, 1, 2.62892769e-07, -4.40830718e-07, 2.63031012e-07, -1)
  2062. G_207_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2063. G_207_.Position = Vector3.new(0.11224249, 6.47649574, -0.232004493)
  2064. G_207_.Orientation = Vector3.new(0, 180, 0)
  2065. G_207_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2066. G_208_.Parent = G_207_
  2067. G_208_.MeshType = Enum.MeshType.Wedge
  2068. G_209_.Parent = G_3_
  2069. G_209_.BrickColor = BrickColor.new("Br. yellowish orange")
  2070. G_209_.Reflectance = 0.5
  2071. G_209_.Position = Vector3.new(0.185040504, 6.26471233, -0.331247061)
  2072. G_209_.Rotation = Vector3.new(0, 0, -90)
  2073. G_209_.Anchored = true
  2074. G_209_.CanCollide = false
  2075. G_209_.Size = Vector3.new(0.0661764592, 0.0500000007, 0.198529392)
  2076. G_209_.CFrame = CFrame.new(0.185040504, 6.26471233, -0.331247061, 3.09085153e-05, 1, -4.84787449e-07, -1, 3.09089737e-05, -2.19177494e-07, -2.19317499e-07, 4.84537452e-07, 1)
  2077. G_209_.TopSurface = Enum.SurfaceType.Smooth
  2078. G_209_.Color = Color3.new(0.886275, 0.603922, 0.247059)
  2079. G_209_.Position = Vector3.new(0.185040504, 6.26471233, -0.331247061)
  2080. G_209_.Orientation = Vector3.new(0, 0, -90)
  2081. G_209_.Color = Color3.new(0.886275, 0.603922, 0.247059)
  2082. G_210_.Parent = G_209_
  2083. G_210_.Scale = Vector3.new(1, 0.529411674, 1)
  2084. G_210_.Scale = Vector3.new(1, 0.529411674, 1)
  2085. G_211_.Name = "Smooth Block Model"
  2086. G_211_.Parent = G_3_
  2087. G_211_.Material = Enum.Material.Ice
  2088. G_211_.BrickColor = BrickColor.new("Bright yellow")
  2089. G_211_.Reflectance = 0.5
  2090. G_211_.Position = Vector3.new(0.112255126, 6.4764533, -0.695238411)
  2091. G_211_.Anchored = true
  2092. G_211_.Size = Vector3.new(0.0661764592, 0.0794117525, 0.0661764666)
  2093. G_211_.CFrame = CFrame.new(0.112255126, 6.4764533, -0.695238411, 1, -4.37445124e-07, -5.28503222e-07, 4.37896233e-07, 1, -2.62890154e-07, 5.2824231e-07, 2.63044825e-07, 1)
  2094. G_211_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2095. G_211_.Position = Vector3.new(0.112255126, 6.4764533, -0.695238411)
  2096. G_211_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2097. G_212_.Parent = G_211_
  2098. G_212_.MeshType = Enum.MeshType.Wedge
  2099. G_213_.Parent = G_3_
  2100. G_213_.BrickColor = BrickColor.new("Br. yellowish orange")
  2101. G_213_.Reflectance = 0.5
  2102. G_213_.Position = Vector3.new(0.185040981, 6.39705563, -0.463614762)
  2103. G_213_.Rotation = Vector3.new(89.9899979, 0, -90)
  2104. G_213_.Anchored = true
  2105. G_213_.CanCollide = false
  2106. G_213_.Size = Vector3.new(0.0661764592, 0.0500000007, 0.198529392)
  2107. G_213_.CFrame = CFrame.new(0.185040981, 6.39705563, -0.463614762, 4.84831105e-07, 1, 5.37966371e-05, -0.00012920874, 5.37971573e-05, -1, -1, 4.77621654e-07, 0.000129208638)
  2108. G_213_.TopSurface = Enum.SurfaceType.Smooth
  2109. G_213_.Color = Color3.new(0.886275, 0.603922, 0.247059)
  2110. G_213_.Position = Vector3.new(0.185040981, 6.39705563, -0.463614762)
  2111. G_213_.Orientation = Vector3.new(90, 90, 0)
  2112. G_213_.Color = Color3.new(0.886275, 0.603922, 0.247059)
  2113. G_214_.Parent = G_213_
  2114. G_214_.Scale = Vector3.new(1, 0.529411674, 1)
  2115. G_214_.Scale = Vector3.new(1, 0.529411674, 1)
  2116. G_215_.Parent = G_3_
  2117. G_215_.Material = Enum.Material.Ice
  2118. G_215_.BrickColor = BrickColor.new("Bright yellow")
  2119. G_215_.Reflectance = 0.5
  2120. G_215_.Position = Vector3.new(0.112242848, 6.83387947, -0.463656843)
  2121. G_215_.Rotation = Vector3.new(-0.00999999978, -90, 0)
  2122. G_215_.Anchored = true
  2123. G_215_.Size = Vector3.new(0.132352918, 0.47647053, 0.0661764666)
  2124. G_215_.CFrame = CFrame.new(0.112242848, 6.83387947, -0.463656843, -3.10001269e-05, 3.00002212e-05, -1, 0.000152000066, 1, 2.99950625e-05, 1, -0.000151998989, -3.1004427e-05)
  2125. G_215_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2126. G_215_.Position = Vector3.new(0.112242848, 6.83387947, -0.463656843)
  2127. G_215_.Orientation = Vector3.new(0, -90, 0.00999999978)
  2128. G_215_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2129. G_216_.Parent = G_3_
  2130. G_216_.Material = Enum.Material.Ice
  2131. G_216_.BrickColor = BrickColor.new("Bright yellow")
  2132. G_216_.Reflectance = 0.5
  2133. G_216_.Position = Vector3.new(0.112255365, 6.75445175, -0.596001804)
  2134. G_216_.Rotation = Vector3.new(-0.00999999978, -90, 0)
  2135. G_216_.Anchored = true
  2136. G_216_.Size = Vector3.new(0.132352918, 0.31764701, 0.0661764666)
  2137. G_216_.CFrame = CFrame.new(0.112255365, 6.75445175, -0.596001804, -3.10001269e-05, 3.00002212e-05, -1, 0.000152000066, 1, 2.99950625e-05, 1, -0.000151998989, -3.1004427e-05)
  2138. G_216_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2139. G_216_.Position = Vector3.new(0.112255365, 6.75445175, -0.596001804)
  2140. G_216_.Orientation = Vector3.new(0, -90, 0.00999999978)
  2141. G_216_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2142. G_217_.Name = "Smooth Block Model"
  2143. G_217_.Parent = G_3_
  2144. G_217_.Material = Enum.Material.Ice
  2145. G_217_.BrickColor = BrickColor.new("Bright yellow")
  2146. G_217_.Reflectance = 0.5
  2147. G_217_.Position = Vector3.new(0.112255484, 6.99269056, -0.56293577)
  2148. G_217_.Anchored = true
  2149. G_217_.Size = Vector3.new(0.0661764592, 0.158823505, 0.0661764666)
  2150. G_217_.CFrame = CFrame.new(0.112255484, 6.99269056, -0.56293577, 1, -4.37445124e-07, -5.28503222e-07, 4.37896233e-07, 1, -2.62890154e-07, 5.28240491e-07, 2.63044825e-07, 1)
  2151. G_217_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2152. G_217_.Position = Vector3.new(0.112255484, 6.99269056, -0.56293577)
  2153. G_217_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2154. G_218_.Parent = G_217_
  2155. G_218_.MeshType = Enum.MeshType.Wedge
  2156. G_219_.Parent = G_3_
  2157. G_219_.Material = Enum.Material.Ice
  2158. G_219_.BrickColor = BrickColor.new("Br. yellowish orange")
  2159. G_219_.Reflectance = 0.5
  2160. G_219_.Position = Vector3.new(0.112260729, 6.89999771, -1.0923388)
  2161. G_219_.Rotation = Vector3.new(179.98999, -90, 0)
  2162. G_219_.Anchored = true
  2163. G_219_.CanCollide = false
  2164. G_219_.Size = Vector3.new(0.860293984, 0.0500000007, 0.0661764666)
  2165. G_219_.CFrame = CFrame.new(0.112260729, 6.89999771, -1.0923388, 3.10037976e-05, 3.0861971e-05, -1, -9.12893593e-05, -1, -3.08652525e-05, -1, 9.12901596e-05, -3.10007235e-05)
  2166. G_219_.Color = Color3.new(0.886275, 0.603922, 0.247059)
  2167. G_219_.Position = Vector3.new(0.112260729, 6.89999771, -1.0923388)
  2168. G_219_.Orientation = Vector3.new(0, -90, -179.98999)
  2169. G_219_.Color = Color3.new(0.886275, 0.603922, 0.247059)
  2170. G_220_.Parent = G_219_
  2171. G_220_.Scale = Vector3.new(1, 0.529411674, 1)
  2172. G_220_.Scale = Vector3.new(1, 0.529411674, 1)
  2173. G_221_.Parent = G_3_
  2174. G_221_.Material = Enum.Material.Ice
  2175. G_221_.BrickColor = BrickColor.new("Bright yellow")
  2176. G_221_.Reflectance = 0.5
  2177. G_221_.Position = Vector3.new(0.112259418, 6.95293903, -1.09234118)
  2178. G_221_.Rotation = Vector3.new(179.98999, -90, 0)
  2179. G_221_.Anchored = true
  2180. G_221_.Size = Vector3.new(0.860293984, 0.0794117525, 0.0661764666)
  2181. G_221_.CFrame = CFrame.new(0.112259418, 6.95293903, -1.09234118, 3.10037976e-05, 3.0861971e-05, -1, -9.12893593e-05, -1, -3.08652525e-05, -1, 9.12901596e-05, -3.10007235e-05)
  2182. G_221_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2183. G_221_.Position = Vector3.new(0.112259418, 6.95293903, -1.09234118)
  2184. G_221_.Orientation = Vector3.new(0, -90, -179.98999)
  2185. G_221_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2186. G_222_.Parent = G_3_
  2187. G_222_.Material = Enum.Material.Ice
  2188. G_222_.BrickColor = BrickColor.new("Bright yellow")
  2189. G_222_.Reflectance = 0.5
  2190. G_222_.Position = Vector3.new(0.112261146, 6.84705877, -1.05924892)
  2191. G_222_.Rotation = Vector3.new(179.98999, -90, 0)
  2192. G_222_.Anchored = true
  2193. G_222_.Size = Vector3.new(0.79411751, 0.0794117525, 0.0661764666)
  2194. G_222_.CFrame = CFrame.new(0.112261146, 6.84705877, -1.05924892, 3.10037976e-05, 3.0861971e-05, -1, -9.12893593e-05, -1, -3.08652525e-05, -1, 9.12901596e-05, -3.10007235e-05)
  2195. G_222_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2196. G_222_.Position = Vector3.new(0.112261146, 6.84705877, -1.05924892)
  2197. G_222_.Orientation = Vector3.new(0, -90, -179.98999)
  2198. G_222_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2199. G_223_.Parent = G_3_
  2200. G_223_.Material = Enum.Material.Ice
  2201. G_223_.BrickColor = BrickColor.new("Bright yellow")
  2202. G_223_.Reflectance = 0.5
  2203. G_223_.Position = Vector3.new(0.11222735, 6.63540125, 0.0657695383)
  2204. G_223_.Rotation = Vector3.new(179.98999, 90, 0)
  2205. G_223_.Anchored = true
  2206. G_223_.Size = Vector3.new(0.661764622, 0.0794117525, 0.0661764666)
  2207. G_223_.CFrame = CFrame.new(0.11222735, 6.63540125, 0.0657695383, 3.00304073e-05, 3.09544739e-05, 1, 0.000152000081, -1, 3.09503594e-05, 1, 0.000151999018, -3.00353695e-05)
  2208. G_223_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2209. G_223_.Position = Vector3.new(0.11222735, 6.63540125, 0.0657695383)
  2210. G_223_.Orientation = Vector3.new(0, 90, 179.98999)
  2211. G_223_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2212. G_224_.Parent = G_3_
  2213. G_224_.Material = Enum.Material.Ice
  2214. G_224_.BrickColor = BrickColor.new("Br. yellowish orange")
  2215. G_224_.Reflectance = 0.5
  2216. G_224_.Position = Vector3.new(0.112257034, 6.68823862, -1.0261507)
  2217. G_224_.Rotation = Vector3.new(179.98999, -90, 0)
  2218. G_224_.Anchored = true
  2219. G_224_.CanCollide = false
  2220. G_224_.Size = Vector3.new(0.727940977, 0.0500000007, 0.0661764666)
  2221. G_224_.CFrame = CFrame.new(0.112257034, 6.68823862, -1.0261507, 3.10037976e-05, 3.0861971e-05, -1, -9.12893593e-05, -1, -3.08652525e-05, -1, 9.12901596e-05, -3.10007235e-05)
  2222. G_224_.Color = Color3.new(0.886275, 0.603922, 0.247059)
  2223. G_224_.Position = Vector3.new(0.112257034, 6.68823862, -1.0261507)
  2224. G_224_.Orientation = Vector3.new(0, -90, -179.98999)
  2225. G_224_.Color = Color3.new(0.886275, 0.603922, 0.247059)
  2226. G_225_.Parent = G_224_
  2227. G_225_.Scale = Vector3.new(1, 0.529411674, 1)
  2228. G_225_.Scale = Vector3.new(1, 0.529411674, 1)
  2229. G_226_.Name = "Smooth Block Model"
  2230. G_226_.Parent = G_3_
  2231. G_226_.Material = Enum.Material.Ice
  2232. G_226_.BrickColor = BrickColor.new("Bright yellow")
  2233. G_226_.Reflectance = 0.5
  2234. G_226_.Position = Vector3.new(0.112243563, 7.11182404, -0.430594742)
  2235. G_226_.Rotation = Vector3.new(-180, 0, 180)
  2236. G_226_.Anchored = true
  2237. G_226_.Size = Vector3.new(0.0661764592, 0.0794117525, 0.0661764666)
  2238. G_226_.CFrame = CFrame.new(0.112243563, 7.11182404, -0.430594742, -1, -4.35941765e-05, 4.41080772e-07, -4.35946276e-05, 1, 2.62892769e-07, -4.40830718e-07, 2.63045564e-07, -1)
  2239. G_226_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2240. G_226_.Position = Vector3.new(0.112243563, 7.11182404, -0.430594742)
  2241. G_226_.Orientation = Vector3.new(0, 180, 0)
  2242. G_226_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2243. G_227_.Parent = G_226_
  2244. G_227_.MeshType = Enum.MeshType.Wedge
  2245. G_228_.Name = "Smooth Block Model"
  2246. G_228_.Parent = G_3_
  2247. G_228_.Material = Enum.Material.Ice
  2248. G_228_.BrickColor = BrickColor.new("Bright yellow")
  2249. G_228_.Reflectance = 0.5
  2250. G_228_.Position = Vector3.new(0.112271219, 6.7411418, -1.42321157)
  2251. G_228_.Rotation = Vector3.new(0, 0, -180)
  2252. G_228_.Anchored = true
  2253. G_228_.Size = Vector3.new(0.0661764592, 0.0794117525, 0.0661764666)
  2254. G_228_.CFrame = CFrame.new(0.112271219, 6.7411418, -1.42321157, -1, 3.47230525e-07, -4.4108441e-07, -3.47681663e-07, -1, -2.62892769e-07, -4.40819804e-07, -2.63047639e-07, 1)
  2255. G_228_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2256. G_228_.Position = Vector3.new(0.112271219, 6.7411418, -1.42321157)
  2257. G_228_.Orientation = Vector3.new(0, 0, -180)
  2258. G_228_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2259. G_229_.Parent = G_228_
  2260. G_229_.MeshType = Enum.MeshType.Wedge
  2261. G_230_.Parent = G_3_
  2262. G_230_.Material = Enum.Material.Ice
  2263. G_230_.BrickColor = BrickColor.new("Br. yellowish orange")
  2264. G_230_.Reflectance = 0.5
  2265. G_230_.Position = Vector3.new(0.112231046, 6.90011692, 0.165014014)
  2266. G_230_.Rotation = Vector3.new(179.98999, 90, 0)
  2267. G_230_.Anchored = true
  2268. G_230_.CanCollide = false
  2269. G_230_.Size = Vector3.new(0.860293984, 0.0500000007, 0.0661764666)
  2270. G_230_.CFrame = CFrame.new(0.112231046, 6.90011692, 0.165014014, 3.00304073e-05, 3.09544739e-05, 1, 0.000152000081, -1, 3.09503594e-05, 1, 0.000151999018, -3.00353695e-05)
  2271. G_230_.Color = Color3.new(0.886275, 0.603922, 0.247059)
  2272. G_230_.Position = Vector3.new(0.112231046, 6.90011692, 0.165014014)
  2273. G_230_.Orientation = Vector3.new(0, 90, 179.98999)
  2274. G_230_.Color = Color3.new(0.886275, 0.603922, 0.247059)
  2275. G_231_.Parent = G_230_
  2276. G_231_.Scale = Vector3.new(1, 0.529411674, 1)
  2277. G_231_.Scale = Vector3.new(1, 0.529411674, 1)
  2278. G_232_.Name = "Smooth Block Model"
  2279. G_232_.Parent = G_3_
  2280. G_232_.Material = Enum.Material.Ice
  2281. G_232_.BrickColor = BrickColor.new("Bright yellow")
  2282. G_232_.Reflectance = 0.5
  2283. G_232_.Position = Vector3.new(0.112275869, 6.95289469, -1.55557609)
  2284. G_232_.Rotation = Vector3.new(0, 0, -180)
  2285. G_232_.Anchored = true
  2286. G_232_.Size = Vector3.new(0.0661764592, 0.0794117525, 0.0661764666)
  2287. G_232_.CFrame = CFrame.new(0.112275869, 6.95289469, -1.55557609, -1, 3.47230525e-07, -4.41080772e-07, -3.47681663e-07, -1, -2.62892769e-07, -4.40819804e-07, -2.63047639e-07, 1)
  2288. G_232_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2289. G_232_.Position = Vector3.new(0.112275869, 6.95289469, -1.55557609)
  2290. G_232_.Orientation = Vector3.new(0, 0, -180)
  2291. G_232_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2292. G_233_.Parent = G_232_
  2293. G_233_.MeshType = Enum.MeshType.Wedge
  2294. G_234_.Name = "Smooth Block Model"
  2295. G_234_.Parent = G_3_
  2296. G_234_.Material = Enum.Material.Ice
  2297. G_234_.BrickColor = BrickColor.new("Bright yellow")
  2298. G_234_.Reflectance = 0.5
  2299. G_234_.Position = Vector3.new(0.112265736, 6.63526535, -1.35702896)
  2300. G_234_.Rotation = Vector3.new(0, 0, -180)
  2301. G_234_.Anchored = true
  2302. G_234_.Size = Vector3.new(0.0661764592, 0.0794117525, 0.0661764666)
  2303. G_234_.CFrame = CFrame.new(0.112265736, 6.63526535, -1.35702896, -1, 3.47230525e-07, -4.4108441e-07, -3.47681663e-07, -1, -2.62892769e-07, -4.40819804e-07, -2.63047639e-07, 1)
  2304. G_234_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2305. G_234_.Position = Vector3.new(0.112265736, 6.63526535, -1.35702896)
  2306. G_234_.Orientation = Vector3.new(0, 0, -180)
  2307. G_234_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2308. G_235_.Parent = G_234_
  2309. G_235_.MeshType = Enum.MeshType.Wedge
  2310. G_236_.Name = "Smooth Block Model"
  2311. G_236_.Parent = G_3_
  2312. G_236_.Material = Enum.Material.Ice
  2313. G_236_.BrickColor = BrickColor.new("Bright yellow")
  2314. G_236_.Reflectance = 0.5
  2315. G_236_.Position = Vector3.new(0.112231046, 7.10526752, -0.569561779)
  2316. G_236_.Rotation = Vector3.new(89.9899979, 0.0199999996, -180)
  2317. G_236_.Anchored = true
  2318. G_236_.Size = Vector3.new(0.0661764592, 0.0794117525, 0.0661764666)
  2319. G_236_.CFrame = CFrame.new(0.112231046, 7.10526752, -0.569561779, -0.99999994, 3.09922179e-05, 0.00036660186, -0.000366605149, -9.12814721e-05, -0.99999994, -3.09584939e-05, -1, 9.12926771e-05)
  2320. G_236_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2321. G_236_.Position = Vector3.new(0.112231046, 7.10526752, -0.569561779)
  2322. G_236_.Orientation = Vector3.new(89.9799957, 76.0199966, -103.979996)
  2323. G_236_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2324. G_237_.Parent = G_236_
  2325. G_237_.MeshType = Enum.MeshType.Wedge
  2326. G_238_.Parent = G_3_
  2327. G_238_.Material = Enum.Material.Ice
  2328. G_238_.BrickColor = BrickColor.new("Bright yellow")
  2329. G_238_.Reflectance = 0.5
  2330. G_238_.Position = Vector3.new(0.112230569, 6.95305872, 0.165009961)
  2331. G_238_.Rotation = Vector3.new(179.98999, 90, 0)
  2332. G_238_.Anchored = true
  2333. G_238_.Size = Vector3.new(0.860293984, 0.0794117525, 0.0661764666)
  2334. G_238_.CFrame = CFrame.new(0.112230569, 6.95305872, 0.165009961, 3.00304073e-05, 3.09544739e-05, 1, 0.000152000081, -1, 3.09503594e-05, 1, 0.000151999018, -3.00353695e-05)
  2335. G_238_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2336. G_238_.Position = Vector3.new(0.112230569, 6.95305872, 0.165009961)
  2337. G_238_.Orientation = Vector3.new(0, 90, 179.98999)
  2338. G_238_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2339. G_239_.Name = "Smooth Block Model"
  2340. G_239_.Parent = G_3_
  2341. G_239_.Material = Enum.Material.Ice
  2342. G_239_.BrickColor = BrickColor.new("Bright yellow")
  2343. G_239_.Reflectance = 0.5
  2344. G_239_.Position = Vector3.new(0.11224702, 6.51621532, -0.364359528)
  2345. G_239_.Rotation = Vector3.new(0, 0, -180)
  2346. G_239_.Anchored = true
  2347. G_239_.Size = Vector3.new(0.0661764592, 0.158823505, 0.198529392)
  2348. G_239_.CFrame = CFrame.new(0.11224702, 6.51621532, -0.364359528, -1, 3.47230525e-07, -4.41080772e-07, -3.47681663e-07, -1, -2.62892769e-07, -4.40819804e-07, -2.63047639e-07, 1)
  2349. G_239_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2350. G_239_.Position = Vector3.new(0.11224702, 6.51621532, -0.364359528)
  2351. G_239_.Orientation = Vector3.new(0, 0, -180)
  2352. G_239_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2353. G_240_.Parent = G_239_
  2354. G_240_.MeshType = Enum.MeshType.Wedge
  2355. G_241_.Parent = G_3_
  2356. G_241_.Material = Enum.Material.Ice
  2357. G_241_.BrickColor = BrickColor.new("Bright yellow")
  2358. G_241_.Reflectance = 0.5
  2359. G_241_.Position = Vector3.new(0.112242132, 7.11181736, -0.496771157)
  2360. G_241_.Rotation = Vector3.new(-0.00999999978, -90, 0)
  2361. G_241_.Anchored = true
  2362. G_241_.Size = Vector3.new(0.0661764592, 0.0794117525, 0.0661764666)
  2363. G_241_.CFrame = CFrame.new(0.112242132, 7.11181736, -0.496771157, -3.10001269e-05, 3.00002212e-05, -1, 0.000152000066, 1, 2.99950625e-05, 1, -0.000151998989, -3.1004427e-05)
  2364. G_241_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2365. G_241_.Position = Vector3.new(0.112242132, 7.11181736, -0.496771157)
  2366. G_241_.Orientation = Vector3.new(0, -90, 0.00999999978)
  2367. G_241_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2368. G_242_.Parent = G_3_
  2369. G_242_.Material = Enum.Material.Ice
  2370. G_242_.BrickColor = BrickColor.new("Bright yellow")
  2371. G_242_.Reflectance = 0.5
  2372. G_242_.Position = Vector3.new(0.112242848, 6.75447607, -0.331295341)
  2373. G_242_.Rotation = Vector3.new(-0.00999999978, -90, 0)
  2374. G_242_.Anchored = true
  2375. G_242_.Size = Vector3.new(0.132352918, 0.31764701, 0.0661764666)
  2376. G_242_.CFrame = CFrame.new(0.112242848, 6.75447607, -0.331295341, -3.10001269e-05, 3.00002212e-05, -1, 0.000152000066, 1, 2.99950625e-05, 1, -0.000151998989, -3.1004427e-05)
  2377. G_242_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2378. G_242_.Position = Vector3.new(0.112242848, 6.75447607, -0.331295341)
  2379. G_242_.Orientation = Vector3.new(0, -90, 0.00999999978)
  2380. G_242_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2381. G_243_.Name = "Smooth Block Model"
  2382. G_243_.Parent = G_3_
  2383. G_243_.Material = Enum.Material.Ice
  2384. G_243_.BrickColor = BrickColor.new("Bright yellow")
  2385. G_243_.Reflectance = 0.5
  2386. G_243_.Position = Vector3.new(0.112214118, 6.95310211, 0.628246725)
  2387. G_243_.Rotation = Vector3.new(-180, 0, 0)
  2388. G_243_.Anchored = true
  2389. G_243_.Size = Vector3.new(0.0661764592, 0.0794117525, 0.0661764666)
  2390. G_243_.CFrame = CFrame.new(0.112214118, 6.95310211, 0.628246725, 1, 4.35009861e-05, 5.28503222e-07, 4.35014445e-05, -1, 2.62890154e-07, 5.28253224e-07, -2.63019359e-07, -1)
  2391. G_243_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2392. G_243_.Position = Vector3.new(0.112214118, 6.95310211, 0.628246725)
  2393. G_243_.Orientation = Vector3.new(0, 180, 180)
  2394. G_243_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2395. G_244_.Parent = G_243_
  2396. G_244_.MeshType = Enum.MeshType.Wedge
  2397. G_245_.Name = "Smooth Block Model"
  2398. G_245_.Parent = G_3_
  2399. G_245_.Material = Enum.Material.Ice
  2400. G_245_.BrickColor = BrickColor.new("Bright yellow")
  2401. G_245_.Reflectance = 0.5
  2402. G_245_.Position = Vector3.new(0.112243921, 6.99270868, -0.364405662)
  2403. G_245_.Rotation = Vector3.new(-180, 0, 180)
  2404. G_245_.Anchored = true
  2405. G_245_.Size = Vector3.new(0.0661764592, 0.158823505, 0.0661764666)
  2406. G_245_.CFrame = CFrame.new(0.112243921, 6.99270868, -0.364405662, -1, -4.35941765e-05, 4.41080772e-07, -4.35946276e-05, 1, 2.62892769e-07, -4.40830718e-07, 2.63045564e-07, -1)
  2407. G_245_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2408. G_245_.Position = Vector3.new(0.112243921, 6.99270868, -0.364405662)
  2409. G_245_.Orientation = Vector3.new(0, 180, 0)
  2410. G_245_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2411. G_246_.Parent = G_245_
  2412. G_246_.MeshType = Enum.MeshType.Wedge
  2413. G_247_.Name = "Smooth Block Model"
  2414. G_247_.Parent = G_3_
  2415. G_247_.Material = Enum.Material.Ice
  2416. G_247_.BrickColor = BrickColor.new("Bright yellow")
  2417. G_247_.Reflectance = 0.5
  2418. G_247_.Position = Vector3.new(0.112219959, 6.63543558, 0.429740101)
  2419. G_247_.Rotation = Vector3.new(-180, 0, 0)
  2420. G_247_.Anchored = true
  2421. G_247_.Size = Vector3.new(0.0661764592, 0.0794117525, 0.0661764666)
  2422. G_247_.CFrame = CFrame.new(0.112219959, 6.63543558, 0.429740101, 1, 4.35009861e-05, 5.28501403e-07, 4.35014445e-05, -1, 2.62890154e-07, 5.28255043e-07, -2.63019359e-07, -1)
  2423. G_247_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2424. G_247_.Position = Vector3.new(0.112219959, 6.63543558, 0.429740101)
  2425. G_247_.Orientation = Vector3.new(0, 180, 180)
  2426. G_247_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2427. G_248_.Parent = G_247_
  2428. G_248_.MeshType = Enum.MeshType.Wedge
  2429. G_249_.Parent = G_3_
  2430. G_249_.Material = Enum.Material.Ice
  2431. G_249_.BrickColor = BrickColor.new("Br. yellowish orange")
  2432. G_249_.Reflectance = 0.5
  2433. G_249_.Position = Vector3.new(0.112258703, 6.79411793, -1.05924702)
  2434. G_249_.Rotation = Vector3.new(179.98999, -90, 0)
  2435. G_249_.Anchored = true
  2436. G_249_.CanCollide = false
  2437. G_249_.Size = Vector3.new(0.79411751, 0.0500000007, 0.0661764666)
  2438. G_249_.CFrame = CFrame.new(0.112258703, 6.79411793, -1.05924702, 3.10037976e-05, 3.0861971e-05, -1, -9.12893593e-05, -1, -3.08652525e-05, -1, 9.12901596e-05, -3.10007235e-05)
  2439. G_249_.Color = Color3.new(0.886275, 0.603922, 0.247059)
  2440. G_249_.Position = Vector3.new(0.112258703, 6.79411793, -1.05924702)
  2441. G_249_.Orientation = Vector3.new(0, -90, -179.98999)
  2442. G_249_.Color = Color3.new(0.886275, 0.603922, 0.247059)
  2443. G_250_.Parent = G_249_
  2444. G_250_.Scale = Vector3.new(1, 0.529411674, 1)
  2445. G_250_.Scale = Vector3.new(1, 0.529411674, 1)
  2446. G_251_.Parent = G_3_
  2447. G_251_.Material = Enum.Material.Ice
  2448. G_251_.BrickColor = BrickColor.new("Bright yellow")
  2449. G_251_.Reflectance = 0.5
  2450. G_251_.Position = Vector3.new(0.112228543, 6.84717274, 0.13192974)
  2451. G_251_.Rotation = Vector3.new(179.98999, 90, 0)
  2452. G_251_.Anchored = true
  2453. G_251_.Size = Vector3.new(0.79411751, 0.0794117525, 0.0661764666)
  2454. G_251_.CFrame = CFrame.new(0.112228543, 6.84717274, 0.13192974, 3.00304073e-05, 3.09544739e-05, 1, 0.000152000081, -1, 3.09503594e-05, 1, 0.000151999018, -3.00353695e-05)
  2455. G_251_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2456. G_251_.Position = Vector3.new(0.112228543, 6.84717274, 0.13192974)
  2457. G_251_.Orientation = Vector3.new(0, 90, 179.98999)
  2458. G_251_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2459. G_252_.Parent = G_3_
  2460. G_252_.Material = Enum.Material.Ice
  2461. G_252_.BrickColor = BrickColor.new("Br. yellowish orange")
  2462. G_252_.Reflectance = 0.5
  2463. G_252_.Position = Vector3.new(0.112228006, 6.79423189, 0.131933793)
  2464. G_252_.Rotation = Vector3.new(179.98999, 90, 0)
  2465. G_252_.Anchored = true
  2466. G_252_.CanCollide = false
  2467. G_252_.Size = Vector3.new(0.79411751, 0.0500000007, 0.0661764666)
  2468. G_252_.CFrame = CFrame.new(0.112228006, 6.79423189, 0.131933793, 3.00304073e-05, 3.09544739e-05, 1, 0.000152000081, -1, 3.09503594e-05, 1, 0.000151999018, -3.00353695e-05)
  2469. G_252_.Color = Color3.new(0.886275, 0.603922, 0.247059)
  2470. G_252_.Position = Vector3.new(0.112228006, 6.79423189, 0.131933793)
  2471. G_252_.Orientation = Vector3.new(0, 90, 179.98999)
  2472. G_252_.Color = Color3.new(0.886275, 0.603922, 0.247059)
  2473. G_253_.Parent = G_252_
  2474. G_253_.Scale = Vector3.new(1, 0.529411674, 1)
  2475. G_253_.Scale = Vector3.new(1, 0.529411674, 1)
  2476. G_254_.Name = "Smooth Block Model"
  2477. G_254_.Parent = G_3_
  2478. G_254_.Material = Enum.Material.Ice
  2479. G_254_.BrickColor = BrickColor.new("Bright yellow")
  2480. G_254_.Reflectance = 0.5
  2481. G_254_.Position = Vector3.new(0.112269968, 6.84701824, -1.4893918)
  2482. G_254_.Rotation = Vector3.new(0, 0, -180)
  2483. G_254_.Anchored = true
  2484. G_254_.Size = Vector3.new(0.0661764592, 0.0794117525, 0.0661764666)
  2485. G_254_.CFrame = CFrame.new(0.112269968, 6.84701824, -1.4893918, -1, 3.47230525e-07, -4.4108441e-07, -3.47681663e-07, -1, -2.62892769e-07, -4.40819804e-07, -2.63047639e-07, 1)
  2486. G_254_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2487. G_254_.Position = Vector3.new(0.112269968, 6.84701824, -1.4893918)
  2488. G_254_.Orientation = Vector3.new(0, 0, -180)
  2489. G_254_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2490. G_255_.Parent = G_254_
  2491. G_255_.MeshType = Enum.MeshType.Wedge
  2492. G_256_.Parent = G_3_
  2493. G_256_.Material = Enum.Material.Ice
  2494. G_256_.BrickColor = BrickColor.new("Bright yellow")
  2495. G_256_.Reflectance = 0.5
  2496. G_256_.Position = Vector3.new(-0.114377975, 6.74127579, 0.0988858715)
  2497. G_256_.Rotation = Vector3.new(180, 90, 0)
  2498. G_256_.Anchored = true
  2499. G_256_.Size = Vector3.new(0.727940977, 0.0794117525, 0.0661764666)
  2500. G_256_.CFrame = CFrame.new(-0.114377975, 6.74127579, 0.0988858715, -3.09999996e-05, 0, 1, 0, -1, 0, 1, 0, 3.09999996e-05)
  2501. G_256_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2502. G_256_.Position = Vector3.new(-0.114377975, 6.74127579, 0.0988858715)
  2503. G_256_.Orientation = Vector3.new(0, 90, 180)
  2504. G_256_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2505. G_257_.Parent = G_3_
  2506. G_257_.BrickColor = BrickColor.new("Br. yellowish orange")
  2507. G_257_.Reflectance = 0.5
  2508. G_257_.Position = Vector3.new(-0.187134981, 6.26468801, -0.364316583)
  2509. G_257_.Rotation = Vector3.new(-0.00999999978, 0, 90)
  2510. G_257_.Anchored = true
  2511. G_257_.CanCollide = false
  2512. G_257_.Size = Vector3.new(0.0661764592, 0.0500000007, 0.264705867)
  2513. G_257_.CFrame = CFrame.new(-0.187134981, 6.26468801, -0.364316583, -7.6999997e-05, -1, -1.76329991e-08, 1, -7.6999997e-05, 0.000228999997, -0.000228999997, 0, 1)
  2514. G_257_.TopSurface = Enum.SurfaceType.Smooth
  2515. G_257_.Color = Color3.new(0.886275, 0.603922, 0.247059)
  2516. G_257_.Position = Vector3.new(-0.187134981, 6.26468801, -0.364316583)
  2517. G_257_.Orientation = Vector3.new(-0.00999999978, 0, 90)
  2518. G_257_.Color = Color3.new(0.886275, 0.603922, 0.247059)
  2519. G_258_.Parent = G_257_
  2520. G_258_.Scale = Vector3.new(1, 0.529411674, 1)
  2521. G_258_.Scale = Vector3.new(1, 0.529411674, 1)
  2522. G_259_.Parent = G_3_
  2523. G_259_.Material = Enum.Material.Ice
  2524. G_259_.BrickColor = BrickColor.new("Bright yellow")
  2525. G_259_.Reflectance = 0.5
  2526. G_259_.Position = Vector3.new(-0.114372015, 6.6353879, 0.0658108741)
  2527. G_259_.Rotation = Vector3.new(180, 90, 0)
  2528. G_259_.Anchored = true
  2529. G_259_.Size = Vector3.new(0.661764622, 0.0794117525, 0.0661764666)
  2530. G_259_.CFrame = CFrame.new(-0.114372015, 6.6353879, 0.0658108741, -3.09999996e-05, 0, 1, 0, -1, 0, 1, 0, 3.09999996e-05)
  2531. G_259_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2532. G_259_.Position = Vector3.new(-0.114372015, 6.6353879, 0.0658108741)
  2533. G_259_.Orientation = Vector3.new(0, 90, 180)
  2534. G_259_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2535. G_260_.Parent = G_3_
  2536. G_260_.Material = Enum.Material.Ice
  2537. G_260_.BrickColor = BrickColor.new("Br. yellowish orange")
  2538. G_260_.Reflectance = 0.5
  2539. G_260_.Position = Vector3.new(-0.114341974, 6.68823719, -1.02611172)
  2540. G_260_.Rotation = Vector3.new(-180, -90, 0)
  2541. G_260_.Anchored = true
  2542. G_260_.CanCollide = false
  2543. G_260_.Size = Vector3.new(0.727940977, 0.0500000007, 0.0661764666)
  2544. G_260_.CFrame = CFrame.new(-0.114341974, 6.68823719, -1.02611172, -3.09999996e-05, 0, -1, 0, -1, 0, -1, 0, 3.09999996e-05)
  2545. G_260_.Color = Color3.new(0.886275, 0.603922, 0.247059)
  2546. G_260_.Position = Vector3.new(-0.114341974, 6.68823719, -1.02611172)
  2547. G_260_.Orientation = Vector3.new(0, -90, 180)
  2548. G_260_.Color = Color3.new(0.886275, 0.603922, 0.247059)
  2549. G_261_.Parent = G_260_
  2550. G_261_.Scale = Vector3.new(1, 0.529411674, 1)
  2551. G_261_.Scale = Vector3.new(1, 0.529411674, 1)
  2552. G_262_.Name = "Smooth Block Model"
  2553. G_262_.Parent = G_3_
  2554. G_262_.Material = Enum.Material.Ice
  2555. G_262_.BrickColor = BrickColor.new("Bright yellow")
  2556. G_262_.Reflectance = 0.5
  2557. G_262_.Position = Vector3.new(-0.114362001, 6.51619577, -0.364344597)
  2558. G_262_.Rotation = Vector3.new(-0.00999999978, 0, -180)
  2559. G_262_.Anchored = true
  2560. G_262_.Size = Vector3.new(0.0661764592, 0.158823505, 0.198529392)
  2561. G_262_.CFrame = CFrame.new(-0.114362001, 6.51619577, -0.364344597, -1, 0, 0, 0, -1, 0.000213000007, 0, 0.000213000007, 1)
  2562. G_262_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2563. G_262_.Position = Vector3.new(-0.114362001, 6.51619577, -0.364344597)
  2564. G_262_.Orientation = Vector3.new(-0.00999999978, 0, 180)
  2565. G_262_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2566. G_263_.Parent = G_262_
  2567. G_263_.MeshType = Enum.MeshType.Wedge
  2568. G_264_.Parent = G_3_
  2569. G_264_.Material = Enum.Material.Ice
  2570. G_264_.BrickColor = BrickColor.new("Bright yellow")
  2571. G_264_.Reflectance = 0.5
  2572. G_264_.Position = Vector3.new(-0.114344954, 6.74117899, -1.02612364)
  2573. G_264_.Rotation = Vector3.new(-180, -90, 0)
  2574. G_264_.Anchored = true
  2575. G_264_.Size = Vector3.new(0.727940977, 0.0794117525, 0.0661764666)
  2576. G_264_.CFrame = CFrame.new(-0.114344954, 6.74117899, -1.02612364, -3.09999996e-05, 0, -1, 0, -1, 0, -1, 0, 3.09999996e-05)
  2577. G_264_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2578. G_264_.Position = Vector3.new(-0.114344954, 6.74117899, -1.02612364)
  2579. G_264_.Orientation = Vector3.new(0, -90, 180)
  2580. G_264_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2581. G_265_.Name = "Smooth Block Model"
  2582. G_265_.Parent = G_3_
  2583. G_265_.Material = Enum.Material.Ice
  2584. G_265_.BrickColor = BrickColor.new("Bright yellow")
  2585. G_265_.Reflectance = 0.5
  2586. G_265_.Position = Vector3.new(-0.114346027, 6.84702015, -1.4893657)
  2587. G_265_.Rotation = Vector3.new(-0.00999999978, 0, -180)
  2588. G_265_.Anchored = true
  2589. G_265_.Size = Vector3.new(0.0661764592, 0.0794117525, 0.0661764666)
  2590. G_265_.CFrame = CFrame.new(-0.114346027, 6.84702015, -1.4893657, -1, 0, 0, 0, -1, 0.000213000007, 0, 0.000213000007, 1)
  2591. G_265_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2592. G_265_.Position = Vector3.new(-0.114346027, 6.84702015, -1.4893657)
  2593. G_265_.Orientation = Vector3.new(-0.00999999978, 0, 180)
  2594. G_265_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2595. G_266_.Parent = G_265_
  2596. G_266_.MeshType = Enum.MeshType.Wedge
  2597. G_267_.Parent = G_3_
  2598. G_267_.BrickColor = BrickColor.new("Br. yellowish orange")
  2599. G_267_.Reflectance = 0.5
  2600. G_267_.Position = Vector3.new(-0.187127948, 6.13235378, -0.463572562)
  2601. G_267_.Rotation = Vector3.new(90, 0, 90)
  2602. G_267_.Anchored = true
  2603. G_267_.CanCollide = false
  2604. G_267_.Size = Vector3.new(0.0661764592, 0.0500000007, 0.198529392)
  2605. G_267_.CFrame = CFrame.new(-0.187127948, 6.13235378, -0.463572562, 0, -1, 0, 0, 0, -1, 1, 0, 0)
  2606. G_267_.TopSurface = Enum.SurfaceType.Smooth
  2607. G_267_.Color = Color3.new(0.886275, 0.603922, 0.247059)
  2608. G_267_.Position = Vector3.new(-0.187127948, 6.13235378, -0.463572562)
  2609. G_267_.Orientation = Vector3.new(90, -90, 0)
  2610. G_267_.Color = Color3.new(0.886275, 0.603922, 0.247059)
  2611. G_268_.Parent = G_267_
  2612. G_268_.Scale = Vector3.new(1, 0.529411674, 1)
  2613. G_268_.Scale = Vector3.new(1, 0.529411674, 1)
  2614. G_269_.Name = "Smooth Block Model"
  2615. G_269_.Parent = G_3_
  2616. G_269_.Material = Enum.Material.Ice
  2617. G_269_.BrickColor = BrickColor.new("Bright yellow")
  2618. G_269_.Reflectance = 0.5
  2619. G_269_.Position = Vector3.new(-0.114337087, 6.74114418, -1.42318165)
  2620. G_269_.Rotation = Vector3.new(-0.00999999978, 0, -180)
  2621. G_269_.Anchored = true
  2622. G_269_.Size = Vector3.new(0.0661764592, 0.0794117525, 0.0661764666)
  2623. G_269_.CFrame = CFrame.new(-0.114337087, 6.74114418, -1.42318165, -1, 0, 0, 0, -1, 0.000213000007, 0, 0.000213000007, 1)
  2624. G_269_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2625. G_269_.Position = Vector3.new(-0.114337087, 6.74114418, -1.42318165)
  2626. G_269_.Orientation = Vector3.new(-0.00999999978, 0, 180)
  2627. G_269_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2628. G_270_.Parent = G_269_
  2629. G_270_.MeshType = Enum.MeshType.Wedge
  2630. G_271_.Name = "Smooth Block Model"
  2631. G_271_.Parent = G_3_
  2632. G_271_.Material = Enum.Material.Ice
  2633. G_271_.BrickColor = BrickColor.new("Bright yellow")
  2634. G_271_.Reflectance = 0.5
  2635. G_271_.Position = Vector3.new(-0.114343047, 6.47644806, -0.695219159)
  2636. G_271_.Rotation = Vector3.new(-0.00999999978, 0, 0)
  2637. G_271_.Anchored = true
  2638. G_271_.Size = Vector3.new(0.0661764592, 0.0794117525, 0.0661764666)
  2639. G_271_.CFrame = CFrame.new(-0.114343047, 6.47644806, -0.695219159, 1, 0, 0, 0, 1, 0.000213000007, 0, -0.000213000007, 1)
  2640. G_271_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2641. G_271_.Position = Vector3.new(-0.114343047, 6.47644806, -0.695219159)
  2642. G_271_.Orientation = Vector3.new(-0.00999999978, 0, 0)
  2643. G_271_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2644. G_272_.Parent = G_271_
  2645. G_272_.MeshType = Enum.MeshType.Wedge
  2646. G_273_.Parent = G_3_
  2647. G_273_.BrickColor = BrickColor.new("Br. yellowish orange")
  2648. G_273_.Reflectance = 0.5
  2649. G_273_.Position = Vector3.new(-0.18712604, 6.26468086, -0.595938087)
  2650. G_273_.Rotation = Vector3.new(179.98999, 0, 90)
  2651. G_273_.Anchored = true
  2652. G_273_.CanCollide = false
  2653. G_273_.Size = Vector3.new(0.0661764592, 0.0500000007, 0.198529392)
  2654. G_273_.CFrame = CFrame.new(-0.18712604, 6.26468086, -0.595938087, 7.6999997e-05, -1, 1.76329991e-08, -1, -7.6999997e-05, -0.000228999997, 0.000228999997, 0, -1)
  2655. G_273_.TopSurface = Enum.SurfaceType.Smooth
  2656. G_273_.Color = Color3.new(0.886275, 0.603922, 0.247059)
  2657. G_273_.Position = Vector3.new(-0.18712604, 6.26468086, -0.595938087)
  2658. G_273_.Orientation = Vector3.new(0.00999999978, 180, -90)
  2659. G_273_.Color = Color3.new(0.886275, 0.603922, 0.247059)
  2660. G_274_.Parent = G_273_
  2661. G_274_.Scale = Vector3.new(1, 0.529411674, 1)
  2662. G_274_.Scale = Vector3.new(1, 0.529411674, 1)
  2663. G_275_.Name = "Smooth Block Model"
  2664. G_275_.Parent = G_3_
  2665. G_275_.Material = Enum.Material.Ice
  2666. G_275_.BrickColor = BrickColor.new("Bright yellow")
  2667. G_275_.Reflectance = 0.5
  2668. G_275_.Position = Vector3.new(-0.114356995, 6.47648478, -0.231983125)
  2669. G_275_.Rotation = Vector3.new(-180, 0, -180)
  2670. G_275_.Anchored = true
  2671. G_275_.Size = Vector3.new(0.0661764592, 0.0794117525, 0.0661764666)
  2672. G_275_.CFrame = CFrame.new(-0.114356995, 6.47648478, -0.231983125, -1, 0, 0, 0, 1, 0, 0, 0, -1)
  2673. G_275_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2674. G_275_.Position = Vector3.new(-0.114356995, 6.47648478, -0.231983125)
  2675. G_275_.Orientation = Vector3.new(0, 180, 0)
  2676. G_275_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2677. G_276_.Parent = G_275_
  2678. G_276_.MeshType = Enum.MeshType.Wedge
  2679. G_277_.Parent = G_3_
  2680. G_277_.BrickColor = BrickColor.new("Br. yellowish orange")
  2681. G_277_.Reflectance = 0.5
  2682. G_277_.Position = Vector3.new(-0.187136054, 6.39704323, -0.463590562)
  2683. G_277_.Rotation = Vector3.new(90, 0, 90)
  2684. G_277_.Anchored = true
  2685. G_277_.CanCollide = false
  2686. G_277_.Size = Vector3.new(0.0661764592, 0.0500000007, 0.198529392)
  2687. G_277_.CFrame = CFrame.new(-0.187136054, 6.39704323, -0.463590562, 0, -1, 0, 0, 0, -1, 1, 0, 0)
  2688. G_277_.TopSurface = Enum.SurfaceType.Smooth
  2689. G_277_.Color = Color3.new(0.886275, 0.603922, 0.247059)
  2690. G_277_.Position = Vector3.new(-0.187136054, 6.39704323, -0.463590562)
  2691. G_277_.Orientation = Vector3.new(90, -90, 0)
  2692. G_277_.Color = Color3.new(0.886275, 0.603922, 0.247059)
  2693. G_278_.Parent = G_277_
  2694. G_278_.Scale = Vector3.new(1, 0.529411674, 1)
  2695. G_278_.Scale = Vector3.new(1, 0.529411674, 1)
  2696. G_279_.Parent = G_3_
  2697. G_279_.Material = Enum.Material.Ice
  2698. G_279_.BrickColor = BrickColor.new("Bright yellow")
  2699. G_279_.Reflectance = 0.5
  2700. G_279_.Position = Vector3.new(-0.114367008, 6.83387804, -0.463630557)
  2701. G_279_.Rotation = Vector3.new(0, 90, 0)
  2702. G_279_.Anchored = true
  2703. G_279_.Size = Vector3.new(0.132352918, 0.47647053, 0.0661764666)
  2704. G_279_.CFrame = CFrame.new(-0.114367008, 6.83387804, -0.463630557, 3.09999996e-05, 0, 1, 0, 1, 0, -1, 0, 3.09999996e-05)
  2705. G_279_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2706. G_279_.Position = Vector3.new(-0.114367008, 6.83387804, -0.463630557)
  2707. G_279_.Orientation = Vector3.new(0, 90, 0)
  2708. G_279_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2709. G_280_.Parent = G_3_
  2710. G_280_.Material = Enum.Material.Ice
  2711. G_280_.BrickColor = BrickColor.new("Bright yellow")
  2712. G_280_.Reflectance = 0.5
  2713. G_280_.Position = Vector3.new(-0.114373088, 6.75446177, -0.331270576)
  2714. G_280_.Rotation = Vector3.new(0, 90, 0)
  2715. G_280_.Anchored = true
  2716. G_280_.Size = Vector3.new(0.132352918, 0.31764701, 0.0661764666)
  2717. G_280_.CFrame = CFrame.new(-0.114373088, 6.75446177, -0.331270576, 3.09999996e-05, 0, 1, 0, 1, 0, -1, 0, 3.09999996e-05)
  2718. G_280_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2719. G_280_.Position = Vector3.new(-0.114373088, 6.75446177, -0.331270576)
  2720. G_280_.Orientation = Vector3.new(0, 90, 0)
  2721. G_280_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2722. G_281_.Name = "Smooth Block Model"
  2723. G_281_.Parent = G_3_
  2724. G_281_.Material = Enum.Material.Ice
  2725. G_281_.BrickColor = BrickColor.new("Bright yellow")
  2726. G_281_.Reflectance = 0.5
  2727. G_281_.Position = Vector3.new(-0.114390016, 6.99269676, -0.364379585)
  2728. G_281_.Rotation = Vector3.new(-180, 0, -180)
  2729. G_281_.Anchored = true
  2730. G_281_.Size = Vector3.new(0.0661764592, 0.158823505, 0.0661764666)
  2731. G_281_.CFrame = CFrame.new(-0.114390016, 6.99269676, -0.364379585, -1, 0, 0, 0, 1, 0, 0, 0, -1)
  2732. G_281_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2733. G_281_.Position = Vector3.new(-0.114390016, 6.99269676, -0.364379585)
  2734. G_281_.Orientation = Vector3.new(0, 180, 0)
  2735. G_281_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2736. G_282_.Parent = G_281_
  2737. G_282_.MeshType = Enum.MeshType.Wedge
  2738. G_283_.Parent = G_3_
  2739. G_283_.Material = Enum.Material.Ice
  2740. G_283_.BrickColor = BrickColor.new("Br. yellowish orange")
  2741. G_283_.Reflectance = 0.5
  2742. G_283_.Position = Vector3.new(-0.114387035, 6.90010405, 0.165039882)
  2743. G_283_.Rotation = Vector3.new(180, 90, 0)
  2744. G_283_.Anchored = true
  2745. G_283_.CanCollide = false
  2746. G_283_.Size = Vector3.new(0.860293984, 0.0500000007, 0.0661764666)
  2747. G_283_.CFrame = CFrame.new(-0.114387035, 6.90010405, 0.165039882, -3.09999996e-05, 0, 1, 0, -1, 0, 1, 0, 3.09999996e-05)
  2748. G_283_.Color = Color3.new(0.886275, 0.603922, 0.247059)
  2749. G_283_.Position = Vector3.new(-0.114387035, 6.90010405, 0.165039882)
  2750. G_283_.Orientation = Vector3.new(0, 90, 180)
  2751. G_283_.Color = Color3.new(0.886275, 0.603922, 0.247059)
  2752. G_284_.Parent = G_283_
  2753. G_284_.Scale = Vector3.new(1, 0.529411674, 1)
  2754. G_284_.Scale = Vector3.new(1, 0.529411674, 1)
  2755. G_285_.Parent = G_3_
  2756. G_285_.Material = Enum.Material.Ice
  2757. G_285_.BrickColor = BrickColor.new("Bright yellow")
  2758. G_285_.Reflectance = 0.5
  2759. G_285_.Position = Vector3.new(-0.114389062, 6.95304585, 0.165032879)
  2760. G_285_.Rotation = Vector3.new(180, 90, 0)
  2761. G_285_.Anchored = true
  2762. G_285_.Size = Vector3.new(0.860293984, 0.0794117525, 0.0661764666)
  2763. G_285_.CFrame = CFrame.new(-0.114389062, 6.95304585, 0.165032879, -3.09999996e-05, 0, 1, 0, -1, 0, 1, 0, 3.09999996e-05)
  2764. G_285_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2765. G_285_.Position = Vector3.new(-0.114389062, 6.95304585, 0.165032879)
  2766. G_285_.Orientation = Vector3.new(0, 90, 180)
  2767. G_285_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2768. G_286_.Parent = G_3_
  2769. G_286_.Material = Enum.Material.Ice
  2770. G_286_.BrickColor = BrickColor.new("Bright yellow")
  2771. G_286_.Reflectance = 0.5
  2772. G_286_.Position = Vector3.new(-0.114385962, 6.84716177, 0.131959885)
  2773. G_286_.Rotation = Vector3.new(180, 90, 0)
  2774. G_286_.Anchored = true
  2775. G_286_.Size = Vector3.new(0.79411751, 0.0794117525, 0.0661764666)
  2776. G_286_.CFrame = CFrame.new(-0.114385962, 6.84716177, 0.131959885, -3.09999996e-05, 0, 1, 0, -1, 0, 1, 0, 3.09999996e-05)
  2777. G_286_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2778. G_286_.Position = Vector3.new(-0.114385962, 6.84716177, 0.131959885)
  2779. G_286_.Orientation = Vector3.new(0, 90, 180)
  2780. G_286_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2781. G_287_.Parent = G_3_
  2782. G_287_.Material = Enum.Material.Ice
  2783. G_287_.BrickColor = BrickColor.new("Bright yellow")
  2784. G_287_.Reflectance = 0.5
  2785. G_287_.Position = Vector3.new(-0.114336014, 6.63529921, -0.993022084)
  2786. G_287_.Rotation = Vector3.new(-180, -90, 0)
  2787. G_287_.Anchored = true
  2788. G_287_.Size = Vector3.new(0.661764622, 0.0794117525, 0.0661764666)
  2789. G_287_.CFrame = CFrame.new(-0.114336014, 6.63529921, -0.993022084, -3.09999996e-05, 0, -1, 0, -1, 0, -1, 0, 3.09999996e-05)
  2790. G_287_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2791. G_287_.Position = Vector3.new(-0.114336014, 6.63529921, -0.993022084)
  2792. G_287_.Orientation = Vector3.new(0, -90, 180)
  2793. G_287_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2794. G_288_.Parent = G_3_
  2795. G_288_.Material = Enum.Material.Ice
  2796. G_288_.BrickColor = BrickColor.new("Br. yellowish orange")
  2797. G_288_.Reflectance = 0.5
  2798. G_288_.Position = Vector3.new(-0.114370942, 6.68833303, 0.0988918766)
  2799. G_288_.Rotation = Vector3.new(180, 90, 0)
  2800. G_288_.Anchored = true
  2801. G_288_.CanCollide = false
  2802. G_288_.Size = Vector3.new(0.727940977, 0.0500000007, 0.0661764666)
  2803. G_288_.CFrame = CFrame.new(-0.114370942, 6.68833303, 0.0988918766, -3.09999996e-05, 0, 1, 0, -1, 0, 1, 0, 3.09999996e-05)
  2804. G_288_.Color = Color3.new(0.886275, 0.603922, 0.247059)
  2805. G_288_.Position = Vector3.new(-0.114370942, 6.68833303, 0.0988918766)
  2806. G_288_.Orientation = Vector3.new(0, 90, 180)
  2807. G_288_.Color = Color3.new(0.886275, 0.603922, 0.247059)
  2808. G_289_.Parent = G_288_
  2809. G_289_.Scale = Vector3.new(1, 0.529411674, 1)
  2810. G_289_.Scale = Vector3.new(1, 0.529411674, 1)
  2811. G_290_.Name = "Smooth Block Model"
  2812. G_290_.Parent = G_3_
  2813. G_290_.Material = Enum.Material.Ice
  2814. G_290_.BrickColor = BrickColor.new("Bright yellow")
  2815. G_290_.Reflectance = 0.5
  2816. G_290_.Position = Vector3.new(-0.114382982, 7.11180878, -0.496744573)
  2817. G_290_.Rotation = Vector3.new(-0.00999999978, 0, 0)
  2818. G_290_.Anchored = true
  2819. G_290_.Size = Vector3.new(0.0661764592, 0.0794117525, 0.0661764666)
  2820. G_290_.CFrame = CFrame.new(-0.114382982, 7.11180878, -0.496744573, 1, 0, 0, 0, 1, 0.000213000007, 0, -0.000213000007, 1)
  2821. G_290_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2822. G_290_.Position = Vector3.new(-0.114382982, 7.11180878, -0.496744573)
  2823. G_290_.Orientation = Vector3.new(-0.00999999978, 0, 0)
  2824. G_290_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2825. G_291_.Parent = G_290_
  2826. G_291_.MeshType = Enum.MeshType.Wedge
  2827. G_292_.Name = "Smooth Block Model"
  2828. G_292_.Parent = G_3_
  2829. G_292_.Material = Enum.Material.Ice
  2830. G_292_.BrickColor = BrickColor.new("Bright yellow")
  2831. G_292_.Reflectance = 0.5
  2832. G_292_.Position = Vector3.new(-0.114392042, 6.74130821, 0.495941401)
  2833. G_292_.Rotation = Vector3.new(-180, 0, 0)
  2834. G_292_.Anchored = true
  2835. G_292_.Size = Vector3.new(0.0661764592, 0.0794117525, 0.0661764666)
  2836. G_292_.CFrame = CFrame.new(-0.114392042, 6.74130821, 0.495941401, 1, 0, 0, 0, -1, 0, 0, 0, -1)
  2837. G_292_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2838. G_292_.Position = Vector3.new(-0.114392042, 6.74130821, 0.495941401)
  2839. G_292_.Orientation = Vector3.new(0, 180, 180)
  2840. G_292_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2841. G_293_.Parent = G_292_
  2842. G_293_.MeshType = Enum.MeshType.Wedge
  2843. G_294_.Parent = G_3_
  2844. G_294_.Material = Enum.Material.Ice
  2845. G_294_.BrickColor = BrickColor.new("Br. yellowish orange")
  2846. G_294_.Reflectance = 0.5
  2847. G_294_.Position = Vector3.new(-0.114356041, 6.89999723, -1.09231484)
  2848. G_294_.Rotation = Vector3.new(-180, -90, 0)
  2849. G_294_.Anchored = true
  2850. G_294_.CanCollide = false
  2851. G_294_.Size = Vector3.new(0.860293984, 0.0500000007, 0.0661764666)
  2852. G_294_.CFrame = CFrame.new(-0.114356041, 6.89999723, -1.09231484, -3.09999996e-05, 0, -1, 0, -1, 0, -1, 0, 3.09999996e-05)
  2853. G_294_.Color = Color3.new(0.886275, 0.603922, 0.247059)
  2854. G_294_.Position = Vector3.new(-0.114356041, 6.89999723, -1.09231484)
  2855. G_294_.Orientation = Vector3.new(0, -90, 180)
  2856. G_294_.Color = Color3.new(0.886275, 0.603922, 0.247059)
  2857. G_295_.Parent = G_294_
  2858. G_295_.Scale = Vector3.new(1, 0.529411674, 1)
  2859. G_295_.Scale = Vector3.new(1, 0.529411674, 1)
  2860. G_296_.Name = "Smooth Block Model"
  2861. G_296_.Parent = G_3_
  2862. G_296_.Material = Enum.Material.Ice
  2863. G_296_.BrickColor = BrickColor.new("Bright yellow")
  2864. G_296_.Reflectance = 0.5
  2865. G_296_.Position = Vector3.new(-0.114405036, 6.9530859, 0.628265858)
  2866. G_296_.Rotation = Vector3.new(-180, 0, 0)
  2867. G_296_.Anchored = true
  2868. G_296_.Size = Vector3.new(0.0661764592, 0.0794117525, 0.0661764666)
  2869. G_296_.CFrame = CFrame.new(-0.114405036, 6.9530859, 0.628265858, 1, 0, 0, 0, -1, 0, 0, 0, -1)
  2870. G_296_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2871. G_296_.Position = Vector3.new(-0.114405036, 6.9530859, 0.628265858)
  2872. G_296_.Orientation = Vector3.new(0, 180, 180)
  2873. G_296_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2874. G_297_.Parent = G_296_
  2875. G_297_.MeshType = Enum.MeshType.Wedge
  2876. G_298_.Name = "Smooth Block Model"
  2877. G_298_.Parent = G_3_
  2878. G_298_.Material = Enum.Material.Ice
  2879. G_298_.BrickColor = BrickColor.new("Bright yellow")
  2880. G_298_.Reflectance = 0.5
  2881. G_298_.Position = Vector3.new(-0.114374995, 6.6354208, 0.429778397)
  2882. G_298_.Rotation = Vector3.new(-180, 0, 0)
  2883. G_298_.Anchored = true
  2884. G_298_.Size = Vector3.new(0.0661764592, 0.0794117525, 0.0661764666)
  2885. G_298_.CFrame = CFrame.new(-0.114374995, 6.6354208, 0.429778397, 1, 0, 0, 0, -1, 0, 0, 0, -1)
  2886. G_298_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2887. G_298_.Position = Vector3.new(-0.114374995, 6.6354208, 0.429778397)
  2888. G_298_.Orientation = Vector3.new(0, 180, 180)
  2889. G_298_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2890. G_299_.Parent = G_298_
  2891. G_299_.MeshType = Enum.MeshType.Wedge
  2892. G_300_.Name = "Smooth Block Model"
  2893. G_300_.Parent = G_3_
  2894. G_300_.Material = Enum.Material.Ice
  2895. G_300_.BrickColor = BrickColor.new("Bright yellow")
  2896. G_300_.Reflectance = 0.5
  2897. G_300_.Position = Vector3.new(-0.114372015, 7.10527277, -0.357776582)
  2898. G_300_.Rotation = Vector3.new(90, -0.0199999996, 0)
  2899. G_300_.Anchored = true
  2900. G_300_.Size = Vector3.new(0.0661764592, 0.0794117525, 0.0661764666)
  2901. G_300_.CFrame = CFrame.new(-0.114372015, 7.10527277, -0.357776582, 1, -3.09999996e-05, -0.000306000002, -0.000306000002, 0, -1, 3.09999996e-05, 1, -9.48599954e-09)
  2902. G_300_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2903. G_300_.Position = Vector3.new(-0.114372015, 7.10527277, -0.357776582)
  2904. G_300_.Orientation = Vector3.new(90, 0, 0)
  2905. G_300_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2906. G_301_.Parent = G_300_
  2907. G_301_.MeshType = Enum.MeshType.Wedge
  2908. G_302_.Parent = G_3_
  2909. G_302_.Material = Enum.Material.Ice
  2910. G_302_.BrickColor = BrickColor.new("Bright yellow")
  2911. G_302_.Reflectance = 0.5
  2912. G_302_.Position = Vector3.new(-0.114363074, 6.95293808, -1.0923208)
  2913. G_302_.Rotation = Vector3.new(-180, -90, 0)
  2914. G_302_.Anchored = true
  2915. G_302_.Size = Vector3.new(0.860293984, 0.0794117525, 0.0661764666)
  2916. G_302_.CFrame = CFrame.new(-0.114363074, 6.95293808, -1.0923208, -3.09999996e-05, 0, -1, 0, -1, 0, -1, 0, 3.09999996e-05)
  2917. G_302_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2918. G_302_.Position = Vector3.new(-0.114363074, 6.95293808, -1.0923208)
  2919. G_302_.Orientation = Vector3.new(0, -90, 180)
  2920. G_302_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2921. G_303_.Name = "Smooth Block Model"
  2922. G_303_.Parent = G_3_
  2923. G_303_.Material = Enum.Material.Ice
  2924. G_303_.BrickColor = BrickColor.new("Bright yellow")
  2925. G_303_.Reflectance = 0.5
  2926. G_303_.Position = Vector3.new(-0.114353061, 6.51619005, -0.562869072)
  2927. G_303_.Rotation = Vector3.new(-180, 0, 0)
  2928. G_303_.Anchored = true
  2929. G_303_.Size = Vector3.new(0.0661764592, 0.158823505, 0.198529392)
  2930. G_303_.CFrame = CFrame.new(-0.114353061, 6.51619005, -0.562869072, 1, 0, 0, 0, -1, 0, 0, 0, -1)
  2931. G_303_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2932. G_303_.Position = Vector3.new(-0.114353061, 6.51619005, -0.562869072)
  2933. G_303_.Orientation = Vector3.new(0, 180, 180)
  2934. G_303_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2935. G_304_.Parent = G_303_
  2936. G_304_.MeshType = Enum.MeshType.Wedge
  2937. G_305_.Parent = G_3_
  2938. G_305_.Material = Enum.Material.Ice
  2939. G_305_.BrickColor = BrickColor.new("Bright yellow")
  2940. G_305_.Reflectance = 0.5
  2941. G_305_.Position = Vector3.new(-0.114382029, 7.11181688, -0.430566609)
  2942. G_305_.Rotation = Vector3.new(0, 90, 0)
  2943. G_305_.Anchored = true
  2944. G_305_.Size = Vector3.new(0.0661764592, 0.0794117525, 0.0661764666)
  2945. G_305_.CFrame = CFrame.new(-0.114382029, 7.11181688, -0.430566609, 3.09999996e-05, 0, 1, 0, 1, 0, -1, 0, 3.09999996e-05)
  2946. G_305_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2947. G_305_.Position = Vector3.new(-0.114382029, 7.11181688, -0.430566609)
  2948. G_305_.Orientation = Vector3.new(0, 90, 0)
  2949. G_305_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2950. G_306_.Parent = G_3_
  2951. G_306_.Material = Enum.Material.Ice
  2952. G_306_.BrickColor = BrickColor.new("Bright yellow")
  2953. G_306_.Reflectance = 0.5
  2954. G_306_.Position = Vector3.new(-0.114359975, 6.75445223, -0.595980167)
  2955. G_306_.Rotation = Vector3.new(0, 90, 0)
  2956. G_306_.Anchored = true
  2957. G_306_.Size = Vector3.new(0.132352918, 0.31764701, 0.0661764666)
  2958. G_306_.CFrame = CFrame.new(-0.114359975, 6.75445223, -0.595980167, 3.09999996e-05, 0, 1, 0, 1, 0, -1, 0, 3.09999996e-05)
  2959. G_306_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2960. G_306_.Position = Vector3.new(-0.114359975, 6.75445223, -0.595980167)
  2961. G_306_.Orientation = Vector3.new(0, 90, 0)
  2962. G_306_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2963. G_307_.Name = "Smooth Block Model"
  2964. G_307_.Parent = G_3_
  2965. G_307_.Material = Enum.Material.Ice
  2966. G_307_.BrickColor = BrickColor.new("Bright yellow")
  2967. G_307_.Reflectance = 0.5
  2968. G_307_.Position = Vector3.new(-0.114346027, 6.95289612, -1.55555284)
  2969. G_307_.Rotation = Vector3.new(-0.00999999978, 0, -180)
  2970. G_307_.Anchored = true
  2971. G_307_.Size = Vector3.new(0.0661764592, 0.0794117525, 0.0661764666)
  2972. G_307_.CFrame = CFrame.new(-0.114346027, 6.95289612, -1.55555284, -1, 0, 0, 0, -1, 0.000213000007, 0, 0.000213000007, 1)
  2973. G_307_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2974. G_307_.Position = Vector3.new(-0.114346027, 6.95289612, -1.55555284)
  2975. G_307_.Orientation = Vector3.new(-0.00999999978, 0, 180)
  2976. G_307_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2977. G_308_.Parent = G_307_
  2978. G_308_.MeshType = Enum.MeshType.Wedge
  2979. G_309_.Name = "Smooth Block Model"
  2980. G_309_.Parent = G_3_
  2981. G_309_.Material = Enum.Material.Ice
  2982. G_309_.BrickColor = BrickColor.new("Bright yellow")
  2983. G_309_.Reflectance = 0.5
  2984. G_309_.Position = Vector3.new(-0.114374042, 6.99268389, -0.56291306)
  2985. G_309_.Rotation = Vector3.new(-0.00999999978, 0, 0)
  2986. G_309_.Anchored = true
  2987. G_309_.Size = Vector3.new(0.0661764592, 0.158823505, 0.0661764666)
  2988. G_309_.CFrame = CFrame.new(-0.114374042, 6.99268389, -0.56291306, 1, 0, 0, 0, 1, 0.000213000007, 0, -0.000213000007, 1)
  2989. G_309_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2990. G_309_.Position = Vector3.new(-0.114374042, 6.99268389, -0.56291306)
  2991. G_309_.Orientation = Vector3.new(-0.00999999978, 0, 0)
  2992. G_309_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  2993. G_310_.Parent = G_309_
  2994. G_310_.MeshType = Enum.MeshType.Wedge
  2995. G_311_.Name = "Smooth Block Model"
  2996. G_311_.Parent = G_3_
  2997. G_311_.Material = Enum.Material.Ice
  2998. G_311_.BrickColor = BrickColor.new("Bright yellow")
  2999. G_311_.Reflectance = 0.5
  3000. G_311_.Position = Vector3.new(-0.114331007, 6.63526583, -1.35699284)
  3001. G_311_.Rotation = Vector3.new(-0.00999999978, 0, -180)
  3002. G_311_.Anchored = true
  3003. G_311_.Size = Vector3.new(0.0661764592, 0.0794117525, 0.0661764666)
  3004. G_311_.CFrame = CFrame.new(-0.114331007, 6.63526583, -1.35699284, -1, 0, 0, 0, -1, 0.000213000007, 0, 0.000213000007, 1)
  3005. G_311_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  3006. G_311_.Position = Vector3.new(-0.114331007, 6.63526583, -1.35699284)
  3007. G_311_.Orientation = Vector3.new(-0.00999999978, 0, 180)
  3008. G_311_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  3009. G_312_.Parent = G_311_
  3010. G_312_.MeshType = Enum.MeshType.Wedge
  3011. G_313_.Parent = G_3_
  3012. G_313_.Material = Enum.Material.Ice
  3013. G_313_.BrickColor = BrickColor.new("Br. yellowish orange")
  3014. G_313_.Reflectance = 0.5
  3015. G_313_.Position = Vector3.new(-0.114382029, 6.79422188, 0.131966874)
  3016. G_313_.Rotation = Vector3.new(180, 90, 0)
  3017. G_313_.Anchored = true
  3018. G_313_.CanCollide = false
  3019. G_313_.Size = Vector3.new(0.79411751, 0.0500000007, 0.0661764666)
  3020. G_313_.CFrame = CFrame.new(-0.114382029, 6.79422188, 0.131966874, -3.09999996e-05, 0, 1, 0, -1, 0, 1, 0, 3.09999996e-05)
  3021. G_313_.Color = Color3.new(0.886275, 0.603922, 0.247059)
  3022. G_313_.Position = Vector3.new(-0.114382029, 6.79422188, 0.131966874)
  3023. G_313_.Orientation = Vector3.new(0, 90, 180)
  3024. G_313_.Color = Color3.new(0.886275, 0.603922, 0.247059)
  3025. G_314_.Parent = G_313_
  3026. G_314_.Scale = Vector3.new(1, 0.529411674, 1)
  3027. G_314_.Scale = Vector3.new(1, 0.529411674, 1)
  3028. G_315_.Parent = G_3_
  3029. G_315_.Material = Enum.Material.Ice
  3030. G_315_.BrickColor = BrickColor.new("Bright yellow")
  3031. G_315_.Reflectance = 0.5
  3032. G_315_.Position = Vector3.new(-0.114351988, 6.84705687, -1.05922067)
  3033. G_315_.Rotation = Vector3.new(-180, -90, 0)
  3034. G_315_.Anchored = true
  3035. G_315_.Size = Vector3.new(0.79411751, 0.0794117525, 0.0661764666)
  3036. G_315_.CFrame = CFrame.new(-0.114351988, 6.84705687, -1.05922067, -3.09999996e-05, 0, -1, 0, -1, 0, -1, 0, 3.09999996e-05)
  3037. G_315_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  3038. G_315_.Position = Vector3.new(-0.114351988, 6.84705687, -1.05922067)
  3039. G_315_.Orientation = Vector3.new(0, -90, 180)
  3040. G_315_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  3041. G_316_.Parent = G_3_
  3042. G_316_.Material = Enum.Material.Ice
  3043. G_316_.BrickColor = BrickColor.new("Br. yellowish orange")
  3044. G_316_.Reflectance = 0.5
  3045. G_316_.Position = Vector3.new(-0.114349008, 6.79411793, -1.05921566)
  3046. G_316_.Rotation = Vector3.new(-180, -90, 0)
  3047. G_316_.Anchored = true
  3048. G_316_.CanCollide = false
  3049. G_316_.Size = Vector3.new(0.79411751, 0.0500000007, 0.0661764666)
  3050. G_316_.CFrame = CFrame.new(-0.114349008, 6.79411793, -1.05921566, -3.09999996e-05, 0, -1, 0, -1, 0, -1, 0, 3.09999996e-05)
  3051. G_316_.Color = Color3.new(0.886275, 0.603922, 0.247059)
  3052. G_316_.Position = Vector3.new(-0.114349008, 6.79411793, -1.05921566)
  3053. G_316_.Orientation = Vector3.new(0, -90, 180)
  3054. G_316_.Color = Color3.new(0.886275, 0.603922, 0.247059)
  3055. G_317_.Parent = G_316_
  3056. G_317_.Scale = Vector3.new(1, 0.529411674, 1)
  3057. G_317_.Scale = Vector3.new(1, 0.529411674, 1)
  3058. G_318_.Name = "Smooth Block Model"
  3059. G_318_.Parent = G_3_
  3060. G_318_.Material = Enum.Material.Ice
  3061. G_318_.BrickColor = BrickColor.new("Bright yellow")
  3062. G_318_.Reflectance = 0.5
  3063. G_318_.Position = Vector3.new(-0.114395022, 6.84720087, 0.562101841)
  3064. G_318_.Rotation = Vector3.new(-180, 0, 0)
  3065. G_318_.Anchored = true
  3066. G_318_.Size = Vector3.new(0.0661764592, 0.0794117525, 0.0661764666)
  3067. G_318_.CFrame = CFrame.new(-0.114395022, 6.84720087, 0.562101841, 1, 0, 0, 0, -1, 0, 0, 0, -1)
  3068. G_318_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  3069. G_318_.Position = Vector3.new(-0.114395022, 6.84720087, 0.562101841)
  3070. G_318_.Orientation = Vector3.new(0, 180, 180)
  3071. G_318_.Color = Color3.new(0.956863, 0.803922, 0.184314)
  3072. G_319_.Parent = G_318_
  3073. G_319_.MeshType = Enum.MeshType.Wedge
  3074. G_2_.Parent = workspace
  3075. G_2_:MakeJoints()
  3076. ---------------------------------------------------------------------------------------
  3077. local L_2_ = G_2_:GetChildren()
  3078. for L_29_forvar1 = 1, #L_2_ do
  3079. L_2_[L_29_forvar1].Parent = game:GetService("Players").LocalPlayer.Backpack
  3080. ypcall(function()
  3081. L_2_[L_29_forvar1]:MakeJoints()
  3082. end)
  3083. end
  3084. G_2_:Destroy()
  3085. for L_30_forvar1 = 1, #G_1_ do
  3086. coroutine.resume(G_1_[L_30_forvar1])
  3087. end
  3088. --lollllll
  3089. wait(0.2)
  3090. p = game.Players.LocalPlayer
  3091. char = p.Character
  3092. torso = char.Torso
  3093. hed = char.Head
  3094. neck = char.Torso.Neck
  3095. hum = char.Humanoid
  3096. hum.MaxHealth = math.huge
  3097. ypcall(function()
  3098. shirt = Instance.new("Shirt", char)
  3099. shirt.Name = "Shirt"
  3100. pants = Instance.new("Pants", char)
  3101. pants.Name = "Pants"
  3102. char.Shirt.ShirtTemplate = "rbxassetid://161035905"
  3103. char.Pants.PantsTemplate = "rbxassetid://161035882"
  3104. end)
  3105. crosshair = Instance.new("BillboardGui",chara)
  3106. crosshair.Size = UDim2.new(10,0,10,0)
  3107. crosshair.Enabled = false
  3108. imgl = Instance.new("ImageLabel",crosshair)
  3109. imgl.Position = UDim2.new(0,0,0,0)
  3110. imgl.Size = UDim2.new(1,0,1,0)
  3111. imgl.Image = "rbxassetid://160506713"
  3112. imgl.BackgroundTransparency = 1
  3113. imgl.ImageTransparency = .7
  3114. imgl.ImageColor3 = Color3.new(0,0,0)
  3115.  
  3116. CV="Maroon"
  3117. Player = game.Players.LocalPlayer
  3118. Character = Player.Character
  3119. local txt = Instance.new("BillboardGui", Character)
  3120. txt.Adornee = Character .Head
  3121. txt.Name = "_status"
  3122. txt.Size = UDim2.new(2, 0, 1.2, 0)
  3123. txt.StudsOffset = Vector3.new(-9, 8, 0)
  3124. local text = Instance.new("TextLabel", txt)
  3125. text.Size = UDim2.new(10, 0, 7, 0)
  3126. text.FontSize = "Size24"
  3127. text.TextScaled = true
  3128. text.TextTransparency = 0
  3129. text.BackgroundTransparency = 1
  3130. text.TextTransparency = 0
  3131. text.TextStrokeTransparency = 0
  3132. text.Font = "Bodoni"
  3133. text.TextStrokeColor3 = Color3.new(255,255,255)
  3134.  
  3135. v=Instance.new("Part")
  3136. v.Name = "ColorBrick"
  3137. v.Parent=Player.Character
  3138. v.FormFactor="Symmetric"
  3139. v.Anchored=true
  3140. v.CanCollide=false
  3141. v.BottomSurface="Smooth"
  3142. v.TopSurface="Smooth"
  3143. v.Size=Vector3.new(10,5,3)
  3144. v.Transparency=1
  3145. v.CFrame=Character.Torso.CFrame
  3146. v.BrickColor=BrickColor.new(CV)
  3147. v.Transparency=1
  3148. text.TextColor3 = Color3.new(0,0,0)
  3149. v.Shape="Block"
  3150. text.Text = "Nazi officer"
  3151. -----------------------------------------
  3152.  
  3153. plr=game:service'Players'.LocalPlayer
  3154. ch,char=plr.Character,plr.Character
  3155. hum=ch.Humanoid
  3156. tor,torso,rootpart,rj=ch.Torso,ch.Torso,ch.HumanoidRootPart,ch.HumanoidRootPart.RootJoint
  3157. m,mouse=plr:GetMouse(),plr:GetMouse()
  3158. cfn,ang,mr,int=CFrame.new,CFrame.Angles,math.rad,Instance.new
  3159. bc=BrickColor.new
  3160. head=ch.Head
  3161. cam=workspace.CurrentCamera
  3162.  
  3163. rj.C0=cfn()
  3164. rj.C1=cfn()
  3165.  
  3166. sheathed=false
  3167. jammed=false
  3168.  
  3169.  
  3170.  
  3171.  
  3172.  
  3173.  
  3174.  
  3175.  
  3176.  
  3177.  
  3178.  
  3179. local minimumsize = Vector3.new(0.7,0.7,0.7) --Minimumsize for a part to get divided,higher numbers = less detailed and bigger/less bricks
  3180. local surface_between_splitted_parts = 'SmoothNoOutlines' --the surface between splitted parts
  3181. --local fragmented = workspace:FindFirstChild("Fragmented")
  3182. local fragmentable = workspace --all fragmentable objects should be stored in here
  3183. local list = {}
  3184. local brickcount = 0
  3185. --local m = Instance.new("Hint",workspace)
  3186. local storage = {}
  3187. local fillup = 1000 --it constantly generates new parts until it reaches this number(hacky way to prevent lagspikes if there is a large explosion),change it to 0 if you don´t want it to generate (useless) parts.
  3188. local maximumstorage = 2000 --it will recycle parts if the number of parts in the storage doesnt exceed this number
  3189. local storage_position = Vector3.new(0,0,5000) --place them somewhere off the map
  3190. local stored_partsize = Vector3.new(1,1,1) --make them small
  3191. local parts_created_per_frame = 5 --number of parts being created per frame to fill up the storage
  3192.  
  3193.  
  3194. function fragmentate(cframe,size,color,explosion_position,explosion_blastradius,backsurface,bottomsurface,frontsurface,leftsurface,rightsurface,topsurface,transparency,reflectance)
  3195. local xi = size.X >= minimumsize.X*(1+explosion_blastradius/16) and 2 or 1 --to reduce the lagg in large explosions we increase minimumsize based on the explosionradius...
  3196. local yi = size.Y >= minimumsize.Y*(1+explosion_blastradius/16) and 2 or 1
  3197. local zi = size.Z >= minimumsize.Z*(1+explosion_blastradius/16) and 2 or 1
  3198. if xi == 1 and yi == 1 and zi == 1 or (cframe.p-explosion_position).magnitude > size.magnitude/2 + explosion_blastradius then --don´t fragmentate parts, that are too small to fragmentate or too far away from the explosion
  3199. if xi == 1 and yi == 1 and zi == 1 then return end --optional
  3200. if #storage > 0 then
  3201. local p = storage[1]
  3202. p.BrickColor = color
  3203. p.Size = size
  3204. p.BackSurface = backsurface
  3205. p.BottomSurface = bottomsurface
  3206. p.FrontSurface = frontsurface
  3207. p.LeftSurface = leftsurface
  3208. p.RightSurface = rightsurface
  3209. p.TopSurface = topsurface
  3210. p.Transparency = transparency
  3211. p.CFrame = cframe
  3212. p.Reflectance = reflectance
  3213. table.remove(storage,1)
  3214. else
  3215. local p = Instance.new("Part",fragmentable)
  3216. p.BrickColor = color
  3217. p.FormFactor = "Custom"
  3218. p.Size = size
  3219. p.BackSurface = backsurface
  3220. p.BottomSurface = bottomsurface
  3221. p.FrontSurface = frontsurface
  3222. p.LeftSurface = leftsurface
  3223. p.RightSurface = rightsurface
  3224. p.TopSurface = topsurface
  3225. p.Transparency = transparency
  3226. if p.Transparency>0.285 then
  3227. p.Anchored = false
  3228. else
  3229. p.Anchored=true
  3230. p.Material='Wood'
  3231. end
  3232. p.CFrame = cframe
  3233. p.Reflectance = reflectance
  3234. end
  3235. --p:MakeJoints()
  3236. -- m.Text = m.Text+1
  3237. return --stop the function
  3238. end
  3239. local mody = math.random(-125,125)/1000 --some randomization
  3240. for y = 1,yi do
  3241. if math.random()> 0.5 then
  3242. local modx = math.random(-125,125)/1000
  3243. for x = 1,xi do
  3244. local modz = math.random(-125,125)/1000
  3245. for z = 1,zi do --offset = x/xi-0.75+modx)
  3246. fragmentate(cframe*CFrame.new(size.X*(xi==1 and 0 or x/xi-0.75+modx),size.Y*(yi==1 and 0 or y/yi-0.75+mody),size.Z*(zi==1 and 0 or z/zi-0.75+modz)), --maths
  3247. Vector3.new(xi == 2 and size.X*(1-2*math.abs(x/xi-0.75+modx)) or size.X,yi == 2 and size.Y*(1-2*math.abs(y/yi-0.75+mody)) or size.Y,
  3248. zi == 2 and size.Z*(1-2*math.abs(z/zi-0.75+modz)) or size.Z or agent767_was_here),color,explosion_position,explosion_blastradius,
  3249. z~=zi and surface_between_splitted_parts or backsurface,y==2 and surface_between_splitted_parts or bottomsurface,
  3250. z==2 and surface_between_splitted_parts or frontsurface,x==2 and surface_between_splitted_parts or leftsurface,x~=xi and surface_between_splitted_parts or rightsurface,
  3251. y~=yi and surface_between_splitted_parts or topsurface,transparency,reflectance)
  3252. end
  3253.  
  3254. end
  3255. else
  3256. local modz = math.random(-125,125)/1000
  3257. for z = 1,zi do
  3258. local modx = math.random(-125,125)/1000
  3259. for x = 1,xi do
  3260. fragmentate(cframe*CFrame.new(size.X*(xi==1 and 0 or x/xi-0.75+modx),size.Y*(yi==1 and 0 or y/yi-0.75+mody),size.Z*(zi==1 and 0 or z/zi-0.75+modz)),
  3261. Vector3.new(xi == 2 and size.X*(1-2*math.abs(x/xi-0.75+modx)) or size.X,yi == 2 and size.Y*(1-2*math.abs(y/yi-0.75+mody)) or size.Y,
  3262. zi == 2 and size.Z*(1-2*math.abs(z/zi-0.75+modz)) or size.Z),color,explosion_position,explosion_blastradius,
  3263. z~=zi and surface_between_splitted_parts or backsurface,y==2 and surface_between_splitted_parts or bottomsurface,
  3264. z==2 and surface_between_splitted_parts or frontsurface,x==2 and surface_between_splitted_parts or leftsurface,x~=xi and surface_between_splitted_parts or rightsurface,
  3265. y~=yi and surface_between_splitted_parts or topsurface,transparency,reflectance)
  3266. end
  3267. end
  3268. end
  3269. end
  3270. end
  3271.  
  3272. function start_fragmentation(position,radius)
  3273. local search = Region3.new(position-Vector3.new(radius,radius,radius)*1.1,position+Vector3.new(radius,radius,radius)*1.1)
  3274. repeat
  3275. local finish = false
  3276. local parts = workspace:FindPartsInRegion3WithIgnoreList(search,list,100) --maximum number of parts that FindPartsInRegion3 can find is 100, so we have to do this to find them all
  3277. for i = 1,#parts do
  3278. table.insert(list,1,parts[i])
  3279. end
  3280. finish = true
  3281. until #parts < 100 and finish
  3282. print(#list)
  3283. local t = tick()
  3284. for i = 1,#list do
  3285. local p = list[i]
  3286. if p:IsDescendantOf(fragmentable) and p:GetMass()<3000 and p.Transparency>0.285 and p.Name~='Base' and p:IsDescendantOf(ch)==false then
  3287. fragmentate(p.CFrame,p.Size,p.BrickColor,position,radius,p.BackSurface,p.BottomSurface,p.FrontSurface,p.LeftSurface,p.RightSurface,p.TopSurface,p.Transparency,p.Reflectance)
  3288. if #storage < maximumstorage and p.Shape == "Block" then --recycle them
  3289. p.Anchored = false
  3290. p.FormFactor = "Custom"
  3291. p.Size = stored_partsize
  3292. p.Position = storage_position
  3293. table.insert(storage,1,p)
  3294. else --storage is full
  3295. p:Destroy()
  3296. end
  3297. -- m.Text = m.Text-1
  3298. end
  3299. if p:IsDescendantOf(fragmentable) and p:GetMass()<53000 and p.Transparency<0.05 and p.Name~='Base' and tostring(p.Material)=='Enum.Material.Wood' and p:IsDescendantOf(ch)==false then
  3300. fragmentate(p.CFrame,p.Size,p.BrickColor,position,radius,p.BackSurface,p.BottomSurface,p.FrontSurface,p.LeftSurface,p.RightSurface,p.TopSurface,p.Transparency,p.Reflectance)
  3301. if #storage < maximumstorage and p.Shape == "Block" then --recycle them
  3302. p.Anchored = true
  3303. p.Material='Wood'
  3304. p.FormFactor = "Custom"
  3305. p.Size = stored_partsize
  3306. p.Position = storage_position
  3307. table.insert(storage,1,p)
  3308. else --storage is full
  3309. p:Destroy()
  3310. end
  3311. -- m.Text = m.Text-1
  3312. end
  3313. end
  3314. list = {}
  3315. -- print(tick()-t)
  3316. end
  3317.  
  3318. --[[
  3319. spawn(function()
  3320. while wait() do --oh noes,a loop! So inefficient!
  3321. if #storage < fillup then
  3322. for i = 1, parts_created_per_frame do --creates parts to fill up the storage
  3323. local p = Instance.new("Part",fragmentable)
  3324. p.Anchored = false
  3325. p.FormFactor = "Custom"
  3326. p.Size = stored_partsize
  3327. p.Position = storage_position
  3328. table.insert(storage,1,p)
  3329. end
  3330. end
  3331. end
  3332. end)
  3333. ]]
  3334.  
  3335.  
  3336.  
  3337.  
  3338.  
  3339.  
  3340.  
  3341.  
  3342.  
  3343.  
  3344.  
  3345.  
  3346.  
  3347.  
  3348.  
  3349.  
  3350.  
  3351.  
  3352.  
  3353.  
  3354.  
  3355.  
  3356.  
  3357. --local blankn=22416261
  3358.  
  3359. --172121567
  3360.  
  3361. crosshairs={
  3362. {38140824};
  3363. {38140833};
  3364. {38140839};
  3365. {38140843};
  3366. {38140852};
  3367. {38140910};
  3368. {38140915};
  3369. {38140923};
  3370. {38140928};
  3371. {38140931};
  3372. {38208259};
  3373. {38208275};
  3374. {38208284};
  3375. {38208303};
  3376. {38208310};
  3377. {38208325};
  3378. {38208330};
  3379. {38208352};
  3380. {38208359};
  3381. {38208377}
  3382. }
  3383.  
  3384. bulletholes={
  3385. 172274695;
  3386. 172274721
  3387. }
  3388.  
  3389. for _,v in pairs(crosshairs) do
  3390. game:service'ContentProvider':Preload('rbxassetid://' .. tostring(v[1]-1))
  3391. end
  3392.  
  3393. currentIco=2
  3394. switchIco=function(num)
  3395. if num<20 then
  3396. else
  3397. num=20
  3398. end
  3399. mouse.Icon='rbxassetid://' .. tostring(crosshairs[num][1]-1)
  3400. currentIco=num
  3401. end
  3402.  
  3403. switchIco(currentIco)
  3404.  
  3405. heldDown=false
  3406.  
  3407. spreadint=1
  3408. --[[Settings]]--
  3409. recoil=false -- Set to true for added realism
  3410. magCapacity=20 -- How much a magazine can hold at once
  3411. magAmmo=20 -- How much ammo is in the mag
  3412. crosshairSpread=5
  3413. spread=1
  3414. pAmmunition=true -- more damage if true
  3415.  
  3416.  
  3417. jamRate=500 -- How often the gun jams(the more the less) (no less than 1)
  3418.  
  3419. primaryColor='Really black'
  3420. secondaryColor='Really black'
  3421.  
  3422. slideReflectance=0.01
  3423. slideMaterial='Plastic'
  3424.  
  3425. --[[Attachments]]--
  3426.  
  3427. silencer=true
  3428. highCapMag=false -- High capacity magazine
  3429. laser=true
  3430. automatic=false
  3431. grip=true
  3432.  
  3433.  
  3434. getSound=function(id)
  3435. game:service'ContentProvider':Preload('rbxassetid'..tostring(id))
  3436. local s=int("Sound",ch.Head)
  3437. s.SoundId='rbxassetid://' .. tostring(id)
  3438. s.Volume=1
  3439. return s
  3440. end
  3441.  
  3442. local fireSound=getSound(151997297--[[10209842]])
  3443. fireSound.Pitch=1.3
  3444. --1.8
  3445.  
  3446. local releaseSound=getSound(10209813)
  3447. releaseSound.Pitch=4
  3448.  
  3449. local reloadSound=getSound(10209636)
  3450. reloadSound.Pitch=3
  3451.  
  3452. local magazinelockSound=getSound(152206337)
  3453. magazinelockSound.Pitch=1.4
  3454.  
  3455. local slideBackSound=getSound(152206263)
  3456. slideBackSound.Pitch=2.5
  3457.  
  3458. local slideForwardSound=getSound(152206302)
  3459. slideForwardSound.Pitch=2.5
  3460.  
  3461. local emptySound=getSound(2697295)
  3462. emptySound.Pitch=5
  3463.  
  3464. local glassBreakSound=getSound(144884907)
  3465.  
  3466. local woodImpact=getSound(142082171)
  3467.  
  3468. local fleshImpact=getSound(144884872)
  3469. fleshImpact.Pitch=1.7
  3470.  
  3471. if ch:findFirstChild("Tec-99") then
  3472. ch['Tec-99']:Destroy()
  3473. end
  3474.  
  3475. local tube=int("Model",ch)
  3476. tube.Name='Tec-99'
  3477. local hopper=Instance.new('HopperBin',plr.Backpack)
  3478. hopper.Name=tube.Name
  3479. Weld = function(p0,p1,x,y,z,rx,ry,rz,par)--recommend to use this with my weld. use this function only with arm lockers.
  3480. p0.Position = p1.Position
  3481. local w = Instance.new('Motor',par or p0)
  3482. w.Part0 = p1
  3483. w.Part1 = p0
  3484. w.C0 = CFrame.new(x or 0,y or 0,z or 0)*CFrame.Angles(rx or 0,ry or 0,rz or 0)
  3485. w.MaxVelocity = .1
  3486. return w
  3487. end
  3488. function clerp(c1,c2,sp)
  3489. local R1,R2,R3 = c1:toEulerAnglesXYZ()
  3490. local R21,R22,R23 = c2:toEulerAnglesXYZ()
  3491. return CFrame.new(
  3492. c1.X + (c2.X-c1.X)*sp,
  3493. c1.Y + (c2.Y-c1.Y)*sp,
  3494. c1.Z + (c2.Z-c1.Z)*sp)*CFrame.Angles(
  3495. R1 + (R21-R1)*sp,
  3496. R2 + (R22-R2)*sp,
  3497. R3 + (R23-R3)*sp
  3498. )
  3499. end
  3500.  
  3501. tweenTable={}
  3502. Tween = function(Weld, Stop, Step,a)
  3503. ypcall(function()
  3504. local func = function()
  3505. local Start = Weld.C1
  3506. local X1, Y1, Z1 = Start:toEulerAnglesXYZ()
  3507. local Stop = Stop
  3508. local X2, Y2, Z2 = Stop:toEulerAnglesXYZ()
  3509. if not Step then Step=0.1 end
  3510. table.insert(tweenTable,{th=0,Weld=Weld,Step=Step,Start=Start,X1=X1,Y1=Y1,Z1=Z1,Stop=Stop,X2=X2,Y2=Y2,Z2=Z2})
  3511. end
  3512. if a then coroutine.wrap(func)() else func() end
  3513. end)
  3514. end
  3515. weld=function(p0,p1,c0)
  3516. local w=Instance.new("Weld",p0)
  3517. w.Part0=p0
  3518. w.Part1=p1
  3519. w.C0=c0
  3520. return w
  3521. end
  3522. cp=function(parent,color,size,anchored,cancollide)
  3523. local newp=Instance.new("Part",parent)
  3524. newp.TopSurface='SmoothNoOutlines'
  3525. newp.BottomSurface='SmoothNoOutlines'
  3526. newp.FrontSurface='SmoothNoOutlines'
  3527. newp.BackSurface='SmoothNoOutlines'
  3528. newp.RightSurface='SmoothNoOutlines'
  3529. newp.LeftSurface='SmoothNoOutlines'
  3530. newp.FormFactor="Custom"
  3531. newp.BrickColor=bc(color)
  3532. newp.Size=size
  3533. newp.Anchored=anchored
  3534. newp.CanCollide=cancollide
  3535. newp:BreakJoints()
  3536. return newp
  3537. end
  3538.  
  3539. initializeJoints=function()
  3540. rabr = cp(tube,'White',Vector3.new(1,1,1),false,false) rabr.Transparency = 1 rabr.Name='Locker'
  3541. rabr.Position = torso.Position
  3542. rw = Weld(rabr,torso,1.5,.5,0,0,0,0) rw.Parent = tube rw.Name = 'rw'
  3543. w = Instance.new("Weld",tube)
  3544. w.Part0,w.Part1 = ch['Right Arm'],rabr
  3545. w.C1 = CFrame.new(0,-.5,0)
  3546. labr = cp(tube,'White',Vector3.new(1,1,1),false,false) labr.Transparency = 1 labr.Name='Locker'
  3547. labr.Position = torso.Position
  3548. lw = Weld(labr,torso,-1.5,.5,0,0,0,0) lw.Parent = tube lw.Name = 'lw'
  3549. ww = Instance.new("Weld",tube)
  3550. ww.Part0,ww.Part1 = ch['Left Arm'],labr
  3551. ww.C1 = CFrame.new(0,-.5,0)
  3552. end
  3553.  
  3554. initializeJoints()
  3555.  
  3556. --[[ leg locks
  3557. rabl = cp(tube,'White',Vector3.new(1,1,1),false,false) rabl.Transparency = 1 rabl.Name='Locker'
  3558. rabl.Position = torso.Position
  3559. rwl = Weld(rabl,torso,0.5,-1.5,0,0,0,0) rwl.Parent = tube rwl.Name = 'rwl'
  3560. wl = Instance.new("Weld",tube)
  3561. wl.Part0,wl.Part1 = ch['Right Leg'],rabl
  3562. wl.C1 = CFrame.new(0,-.5,0)
  3563. labl = cp(tube,'White',Vector3.new(1,1,1),false,false) labl.Transparency = 1 labl.Name='Locker'
  3564. labl.Position = torso.Position
  3565. lwl = Weld(labl,torso,-0.5,-1.5,0,0,0,0) lwl.Parent = tube lwl.Name = 'lwl'
  3566. wwl = Instance.new("Weld",tube)
  3567. wwl.Part0,wwl.Part1 = ch['Left Leg'],labl
  3568. wwl.C1 = CFrame.new(0,-.5,0)
  3569. ]]
  3570. --weld(ch['HumanoidRootPart'],torso,cfn())
  3571.  
  3572.  
  3573. local counter=Instance.new('ScreenGui',plr.PlayerGui)
  3574. local frame=Instance.new('Frame',counter)
  3575. frame.Size=UDim2.new(0.25,0,0.3,0)
  3576.  
  3577. frame.Position=UDim2.new(0.1,0,0.4,0)
  3578. frame.BackgroundTransparency=1
  3579.  
  3580. local ammocounter=Instance.new('TextLabel',frame)
  3581. ammocounter.Size=UDim2.new(1,0,0.3,0)
  3582. ammocounter.Position=UDim2.new(0,0,0.2,0)
  3583. ammocounter.BackgroundTransparency=1
  3584. ammocounter.TextColor3=BrickColor.new('White').Color
  3585. ammocounter.Font='SourceSansBold'
  3586. ammocounter.FontSize='Size18'
  3587. ammocounter.Text=''
  3588. ammocounter.TextXAlignment='Left'
  3589.  
  3590.  
  3591. local bg = Instance.new("BodyGyro",rootpart)
  3592. bg.maxTorque = Vector3.new(math.huge,math.huge,math.huge)
  3593. bg.P = 10000
  3594. bg.D = 100
  3595.  
  3596.  
  3597. cyl=function(prt)
  3598. local c=int("CylinderMesh",prt)
  3599. return c
  3600. end
  3601. blo=function(prt)
  3602. local c=int("BlockMesh",prt)
  3603. return c
  3604. end
  3605.  
  3606. if laser then
  3607. aLaser=cp(tube,'Really red',Vector3.new(0.2,0.2,0.2))
  3608. aLaser.Transparency=1
  3609. cyl(aLaser).Scale=Vector3.new(0.25,1,0.25)
  3610. aLaser.Anchored=true
  3611. end
  3612.  
  3613. local handle=cp(tube,primaryColor,Vector3.new(0.2,0.6,0.3))
  3614. blo(handle).Scale=Vector3.new(1.15,0.9,1)
  3615. local mw=weld(ch['Right Arm'],handle,cfn(-0.4,-1,-0.19)*ang(mr(-101.5),0,0)*cfn()*ang(0,mr(-30),mr(-5)))
  3616.  
  3617. local framepiece1=cp(tube,primaryColor,Vector3.new(0.2,0.2,0.9))
  3618. blo(framepiece1).Scale=Vector3.new(1.15,0.5,1)
  3619. weld(handle,framepiece1,cfn(0,0.354,-0.3)*ang(mr(11.5),0,0))
  3620.  
  3621. local barrel=cp(tube,'Medium stone grey',Vector3.new(0.2,0.2,0.2))
  3622. cyl(barrel).Scale=Vector3.new(0.7,1.2,0.7)
  3623. weld(framepiece1,barrel,cfn(0,0.15,-0.1)*ang(mr(-90),0,0))
  3624.  
  3625. local sbarrel=cp(tube,'Really black',Vector3.new(0.2,0.3,0.2))
  3626. cyl(sbarrel).Scale=Vector3.new(0.7,1.5,0.7)
  3627. weld(barrel,sbarrel,cfn(0,0.35,0))
  3628. local hole=cp(tube,'White',Vector3.new(0.2,0.2,0.2))
  3629. hole.Transparency=1
  3630. weld(sbarrel,hole,cfn(0,0.2,0))
  3631. local flash=int('PointLight',hole)
  3632. flash.Enabled=false
  3633. flash.Range=10
  3634. flash.Color=BrickColor.new('Neon orange').Color
  3635.  
  3636.  
  3637. local slide1=cp(tube,secondaryColor,Vector3.new(0.2,0.2,0.4))
  3638. slide1.CanCollide=false
  3639. blo(slide1).Scale=Vector3.new(0.7,1,1.1)
  3640. slideweld1=weld(framepiece1,slide1,cfn(0,0.15,0.23))
  3641. slide1.Reflectance=slideReflectance
  3642. slide1.Material=slideMaterial
  3643.  
  3644. local slide2=cp(tube,secondaryColor,Vector3.new(0.2,0.2,0.4))
  3645. slide2.CanCollide=false
  3646. blo(slide2).Scale=Vector3.new(0.7,1,1.1)
  3647. slideweld2=weld(slide1,slide2,cfn(0,0,-0.666))
  3648. slide2.Reflectance=slideReflectance
  3649. slide2.Material=slideMaterial
  3650.  
  3651. local slideside1=cp(tube,secondaryColor,Vector3.new(0.2,0.2,1.1))
  3652. slideside1.CanCollide=true
  3653. blo(slideside1).Scale=Vector3.new(0.25,1,1)
  3654. weld(slide1,slideside1,cfn(-0.09,0,-0.335))
  3655. slideside1.Reflectance=slideReflectance
  3656. slideside1.Material=slideMaterial
  3657.  
  3658. local slideside2=cp(tube,secondaryColor, Vector3.new(0.2,0.2,0.4))
  3659. slideside2.CanCollide=true
  3660. blo(slideside2).Scale=Vector3.new(0.25,1,1.1)
  3661. weld(slide1,slideside2,cfn(0.09,0,0))
  3662. slideside2.Reflectance=slideReflectance
  3663. slideside2.Material=slideMaterial
  3664.  
  3665. local slideside3=cp(tube,secondaryColor, Vector3.new(0.2,0.2,0.3))
  3666. slideside3.CanCollide=true
  3667. blo(slideside3).Scale=Vector3.new(0.25,0.6,0.78)
  3668. weld(slideside2,slideside3,cfn(0,-0.04,-0.335))
  3669. slideside3.Reflectance=slideReflectance
  3670. slideside3.Material=slideMaterial
  3671.  
  3672. local slideside4=cp(tube,secondaryColor, Vector3.new(0.2,0.2,0.4))
  3673. blo(slideside4).Scale=Vector3.new(0.25,1,1.1)
  3674. weld(slide2,slideside4,cfn(0.09,0,0))
  3675. slideside4.Reflectance=slideReflectance
  3676. slideside4.Material=slideMaterial
  3677.  
  3678. local mgs=cp(tube,primaryColor,Vector3.new(0.2,0.2,0.2))
  3679. blo(mgs).Scale=Vector3.new(1.15,0.425,0.245)
  3680. weld(handle,mgs,cfn(0,-0.3,0.125))
  3681.  
  3682. --[[Trigger]]--
  3683. local tp1=cp(tube,primaryColor,Vector3.new(0.2,0.2,0.2))
  3684. blo(tp1).Scale=Vector3.new(0.6,0.1,0.8)
  3685. weld(framepiece1,tp1,cfn(0,-0.22,0.13))
  3686.  
  3687. local tp2=cp(tube,primaryColor,Vector3.new(0.2,0.2,0.2))
  3688. blo(tp2).Scale=Vector3.new(0.6,0.1,1.19)
  3689. weld(framepiece1,tp2,cfn(0,-0.14,-0.0265)*ang(mr(45),0,0))
  3690.  
  3691. local trigger1=cp(tube,'Really black',Vector3.new(0.2,0.2,0.2))
  3692. blo(trigger1).Scale=Vector3.new(0.3,0.4,0.16)
  3693. weld(framepiece1,trigger1,cfn(0,-0.07,0.09))
  3694.  
  3695. local trigger2=cp(tube,'Really black',Vector3.new(0.2,0.2,0.2))
  3696. blo(trigger2).Scale=Vector3.new(0.3,0.3,0.16)
  3697. weld(trigger1,trigger2,cfn(0,-0.06,-0.015)*ang(mr(30),0,0))
  3698.  
  3699.  
  3700. --[[Magazine]]--
  3701.  
  3702. local magh=cp(tube,'Really black',Vector3.new(0.2,0.5,0.2))
  3703. blo(magh).Scale=Vector3.new(0.6,1,1)
  3704. local magweld=weld(handle,magh,cfn(0,-0.025,0))
  3705.  
  3706. local bottom=cp(tube,'Really black',Vector3.new(0.2,0.2,0.3))
  3707. blo(bottom).Scale=Vector3.new(1.15,0.385,0.8)
  3708. bottomweld=weld(magh,bottom,cfn(0,-0.28,-0.015))
  3709.  
  3710. if highCapMag then
  3711. magweld:Destroy()
  3712. magh.Size=Vector3.new(0.2,0.7,0.2)
  3713. magweld=weld(handle,magh,cfn(0,-0.125,0))
  3714. bottomweld:Destroy()
  3715. bottomweld=weld(magh,bottom,cfn(0,-0.38,-0.015))
  3716. magCapacity=magCapacity+23
  3717. magAmmo=magAmmo+23
  3718. end
  3719.  
  3720. --[[Sights]]--
  3721. local backsight1=cp(tube,'Black',Vector3.new(0.2,0.2,0.2))
  3722. blo(backsight1).Scale=Vector3.new(0.3,0.3,0.3)
  3723. weld(slide1,backsight1,cfn(0.06,0.1,0.13))
  3724. local backsight2=cp(tube,'Black',Vector3.new(0.2,0.2,0.2))
  3725. blo(backsight2).Scale=Vector3.new(0.3,0.3,0.3)
  3726. weld(slide1,backsight2,cfn(-0.06,0.1,0.13))
  3727.  
  3728. local frontsight=cp(tube,'Black',Vector3.new(0.2,0.2,0.2))
  3729. blo(frontsight).Scale=Vector3.new(0.3,0.3,0.3)
  3730. weld(slide1,frontsight,cfn(0,0.1,-0.85))
  3731.  
  3732. local dot1=cp(tube,'Lime green',Vector3.new(0.2,0.2,0.2))
  3733. cyl(dot1).Scale=Vector3.new(0.1,0.31,0.1)
  3734. weld(backsight1,dot1,cfn(0,0.014,0)*ang(mr(-90),0,0))
  3735.  
  3736. local dot2=cp(tube,'Lime green',Vector3.new(0.2,0.2,0.2))
  3737. cyl(dot2).Scale=Vector3.new(0.1,0.31,0.1)
  3738. weld(backsight2,dot2,cfn(0,0.014,0)*ang(mr(-90),0,0))
  3739.  
  3740. local dot3=cp(tube,'Lime green',Vector3.new(0.2,0.2,0.2))
  3741. cyl(dot3).Scale=Vector3.new(0.1,0.31,0.1)
  3742. weld(frontsight,dot3,cfn(0,0.014,0)*ang(mr(-90),0,0))
  3743.  
  3744. local ba=cp(tube,secondaryColor,Vector3.new(0.2,0.2,0.2))
  3745. blo(ba).Scale=Vector3.new(1.15,0.5,1)
  3746. weld(framepiece1,ba,cfn(0,0,-0.55))
  3747. ba.Reflectance=slideReflectance
  3748. ba.Material=slideMaterial
  3749.  
  3750. local weirdholethatpistolshave=cp(tube,'Really black', Vector3.new(0.2,0.2,0.2))
  3751. cyl(weirdholethatpistolshave).Scale=Vector3.new(0.4,1.01,0.4)
  3752. weld(ba,weirdholethatpistolshave,cfn(0,0,0)*ang(mr(-90),0,0))
  3753.  
  3754. --[[Tactical Rails]]--
  3755.  
  3756. local r1=cp(tube,primaryColor,Vector3.new(0.2,0.2,0.2))
  3757. blo(r1).Scale=Vector3.new(1.15,0.2,0.25)
  3758. weld(framepiece1,r1,cfn(0,-0.05,-0.17))
  3759.  
  3760. local r2=cp(tube,primaryColor,Vector3.new(0.2,0.2,0.2))
  3761. blo(r2).Scale=Vector3.new(1.15,0.2,0.25)
  3762. weld(framepiece1,r2,cfn(0,-0.05,-0.27))
  3763.  
  3764. local r3=cp(tube,primaryColor,Vector3.new(0.2,0.2,0.2))
  3765. blo(r3).Scale=Vector3.new(1.15,0.2,0.25)
  3766. weld(framepiece1,r3,cfn(0,-0.05,-0.37))
  3767.  
  3768. if laser then
  3769. local base=cp(tube,primaryColor,Vector3.new(0.2,0.2,0.3))
  3770. blo(base).Scale=Vector3.new(1.15,1,1)
  3771. weld(r2,base,cfn(0,-0.05,0))
  3772. basehole=cp(tube,'White',Vector3.new(0.2,0.2,0.2))
  3773. cyl(basehole).Scale=Vector3.new(0.4,0.4,0.4)
  3774. weld(base,basehole,cfn(0,0,-0.13)*ang(mr(-90),0,0))
  3775. end
  3776.  
  3777. if silencer then
  3778. local sil=cp(tube,'Really black',Vector3.new(0.2,0.3,0.2))
  3779. fireSound.SoundId='rbxassetid://153230595'
  3780. fireSound.Pitch=1
  3781. cyl(sil).Scale=Vector3.new(0.94,1.8,0.94)
  3782. weld(hole,sil,cfn(0,0.29,0))
  3783. end
  3784.  
  3785. if grip then
  3786. local base=cp(tube,primaryColor,Vector3.new(0.2,0.2,0.3))
  3787. blo(base).Scale=Vector3.new(1.15,1,1)
  3788. weld(r2,base,cfn(0,-0.05,0))
  3789. local hd=cp(tube,primaryColor,Vector3.new(0.2,0.6,0.2))
  3790. cyl(hd)
  3791. weld(base,hd,cfn(0,-0.3,0))
  3792. crosshairSpread=3
  3793. spreadint=spreadint-0.3
  3794. end
  3795.  
  3796. --[[Test Functions]]--
  3797.  
  3798. local debounce=false
  3799. local out=false
  3800. local bs=false
  3801. cockSlide=function() -- hahaha yes i know
  3802. slideBackSound:Play()
  3803. if magAmmo<1 and out==true and bs==false then
  3804. wait()
  3805. slideweld1.C0=slideweld1.C0*cfn(0,0,0.22)
  3806. else
  3807. for i=1,2 do
  3808. wait()
  3809. slideweld1.C0=slideweld1.C0*cfn(0,0,0.22)
  3810. end
  3811. end
  3812. local ajar=false
  3813. if magAmmo==1 then
  3814. ajar=true
  3815. end
  3816. if magAmmo>0 then
  3817. createShell()
  3818. --magAmmo=magAmmo-1
  3819. ammocounter.Text=''
  3820. for i=1,magAmmo do
  3821. ammocounter.Text=ammocounter.Text .. 'I'
  3822. end
  3823. end
  3824. wait(0.15)
  3825. slideForwardSound:Play()
  3826. for i=1,2 do
  3827. wait()
  3828. slideweld1.C0=slideweld1.C0*cfn(0,0,-0.22)
  3829. end
  3830. if ajar==true then
  3831. out=true
  3832. slideweld1.C0=cfn(0,0.15,0.23)
  3833. slideweld1.C0=slideweld1.C0*cfn(0,0,0.22)
  3834. end
  3835. end
  3836.  
  3837. --fx
  3838. local firefx=cp(tube,'Neon orange',Vector3.new(0.7,1.1,0.7))
  3839. firefx.Transparency=1
  3840. local mesh=Instance.new('SpecialMesh',firefx)
  3841. mesh.MeshType='Sphere'
  3842. firefx.Material='Neon'
  3843. weld(hole,firefx,cfn(0,1,0))
  3844.  
  3845. local smokefx=Instance.new('Smoke',hole)
  3846. smokefx.Enabled=false
  3847. barrel.CanCollide=true
  3848.  
  3849.  
  3850.  
  3851.  
  3852. local oc = oc or function(...) return ... end
  3853.  
  3854. function ragJoint(hit,r,d)
  3855. Spawn(oc(function()
  3856. d = d or 0
  3857. local rpar,r0,r1 = r.Parent,r.Part0,r.Part1
  3858. if d > 0 then wait(d) end
  3859. local p = hit:Clone()
  3860. p:BreakJoints()
  3861. p:ClearAllChildren()
  3862. p.FormFactor = "Custom"
  3863. p.Size = p.Size/2
  3864. p.Transparency = 1
  3865. p.CanCollide = true
  3866. p.Name = "Colliduh"
  3867. p.Parent = hit
  3868. local w = Instance.new("Weld",p)
  3869. w.Part0 = hit
  3870. w.Part1 = p
  3871. w.C0 = CFrame.new(0,-p.Size.Y/2,0)
  3872. local rot = Instance.new("Rotate",rpar)
  3873. rot.Name = r.Name
  3874. rot.Part0 = r0
  3875. rot.Part1 = r1
  3876. rot.C0 = r.C0
  3877. rot.C1 = r.C1
  3878. r0.Velocity = Vector3.new()
  3879. r1.Velocity = Vector3.new()
  3880. r:Destroy()
  3881. end))
  3882. end
  3883.  
  3884.  
  3885. createShell=function()
  3886. local shell=cp(tube,'Deep orange',Vector3.new(0.2,0.3,0.2))
  3887. shell.CanCollide=true
  3888. shell.Reflectance=0.3
  3889. cyl(shell)
  3890. shell.CFrame=barrel.CFrame*ang(mr(-90),0,0)
  3891. magAmmo=magAmmo-1
  3892. ammocounter.Text=''
  3893. for i=1,magAmmo do
  3894. ammocounter.Text=ammocounter.Text .. 'I'
  3895. end
  3896. game.Debris:AddItem(shell,3)
  3897. end
  3898.  
  3899. reloadPistol=function()
  3900. local current=magAmmo
  3901. Tween(lw,cfn())
  3902. Tween(rw,cfn()*ang(mr(-102),0,0))
  3903. wait(0.4)
  3904. releaseSound:Play()
  3905. bottom.Transparency=1
  3906. magh.Transparency=1
  3907. local mag1=magh:clone()
  3908. mag1.Transparency=0
  3909. mag1.Weld:Destroy''
  3910. local mag2=bottom:clone()
  3911. mag2.Transparency=0
  3912. mag1:BreakJoints''
  3913. mag2:BreakJoints''
  3914. local bm1=mag1:clone()
  3915. local bm2=mag2:clone()
  3916. mag1.Parent=tube
  3917. mag2.Parent=tube
  3918. mag1.CFrame=magh.CFrame
  3919. weld(mag1,mag2,cfn(0,-0.28,-0.015))
  3920. magAmmo=0
  3921. ammocounter.Text=''
  3922. for i=1,magAmmo do
  3923. ammocounter.Text=ammocounter.Text .. 'I'
  3924. end
  3925. wait()
  3926. mag1.CanCollide=true
  3927. mag2.CanCollide=true
  3928. game.Debris:AddItem(mag1,2)
  3929. game.Debris:AddItem(mag2,2)
  3930. wait(0.1)
  3931. Tween(lw,cfn()*ang(mr(25),0,0))
  3932. bm1.Parent=tube
  3933. bm2.Parent=tube
  3934. weld(bm1,bm2,cfn(0,-0.28,-0.015))
  3935. local fa=weld(ch['Left Arm'],bm1,cfn(0,-1.1,0)*ang(mr(-90),0,0))
  3936. wait(0.1)
  3937. Tween(lw,cfn(0,1.4,0)*ang(mr(-109),mr(60),mr(10)),0.07)
  3938. wait(0.25)
  3939. magazinelockSound:Play()
  3940. wait()
  3941. -- reloadSound:Play()
  3942. fa:Destroy''
  3943. bm1:Destroy''
  3944. bm2:Destroy''
  3945. bottom.Transparency=0
  3946. magh.Transparency=0
  3947. local totalcap=0
  3948. if current<1 then --none in chamber reload
  3949. --slideweld1.C0=cfn(0,0,0.45)
  3950. Tween(rw,cfn(0,0.7,0)*ang(mr(-90),mr(-30),0))
  3951. Tween(lw,cfn(0,0.7,0)*ang(mr(-115),mr(35),0))
  3952. wait(0.1)
  3953. spawn(function()
  3954. cockSlide()
  3955. end)
  3956. Tween(lw,cfn(0,0.7,0)*ang(mr(-115),mr(55),0))
  3957. wait(0.3)
  3958. totalcap=magCapacity
  3959. else
  3960. totalcap=magCapacity+1
  3961. end
  3962. magAmmo=totalcap
  3963. out=false
  3964. ammocounter.Text=''
  3965. for i=1,magAmmo do
  3966. ammocounter.Text=ammocounter.Text .. 'I'
  3967. end
  3968. restorePosition()
  3969. end
  3970.  
  3971. firePistol=function()
  3972. switchIco(currentIco+crosshairSpread)
  3973. if not jammed and not out then
  3974. spread=spread+spreadint
  3975. end
  3976. print(spread)
  3977. fireSound.Pitch=math.random(math.random(fireSound.Pitch-0.2,fireSound.Pitch-0.1),math.random(fireSound.Pitch,fireSound.Pitch+0.1))
  3978. if magAmmo>0 and jammed==false then
  3979. local ajar=false
  3980. if magAmmo==1 then
  3981. ajar=true
  3982. end
  3983. user=ch
  3984. local ray = Ray.new(hole.CFrame.p, ((m.Hit.p+Vector3.new(math.random(-spread,spread)/6.35,math.random(-spread,spread)/6.35,math.random(-spread,spread)/6.35) )- hole.CFrame.p).unit*300)
  3985. local hit, position = game.Workspace:FindPartOnRay(ray, user)
  3986. if hit then
  3987. if hit.Transparency>0.285 and hit:GetMass()<3000 and hit.Parent.className~='Hat' then
  3988. local temps=glassBreakSound:clone()
  3989. temps.Parent=hit
  3990. temps.Pitch=math.random(math.random(temps.Pitch-0.2,temps.Pitch-0.1),math.random(temps.Pitch,temps.Pitch+0.1))
  3991. temps:Play''
  3992. start_fragmentation(position,.25)
  3993. end
  3994. if tostring(hit.Material)=='Enum.Material.Wood' and hit.Transparency<0.05 then
  3995. local temps=woodImpact:clone()
  3996. temps.Volume=1
  3997. temps.Pitch=math.random(math.random(temps.Pitch-0.2,temps.Pitch-0.1),math.random(temps.Pitch,temps.Pitch+0.1))
  3998. temps.Parent=hit
  3999. temps:Play''
  4000. start_fragmentation(position,.15)
  4001. end
  4002. ypcall(function()
  4003. if hit and hit.Parent and hit.Parent:findFirstChild'Humanoid' then
  4004. local temps=fleshImpact:clone()
  4005. temps.Parent=hit
  4006. temps:Play()
  4007. if hit.Name~='Head' then
  4008. if pAmmunition==true then
  4009. hit.Parent.Humanoid:TakeDamage(math.random(30,65))
  4010. else
  4011. hit.Parent.Humanoid:TakeDamage(math.random(10,24))
  4012. end
  4013. local guy=hit.Parent
  4014. if guy.Name~='TheDarkRevenant' then
  4015. for i,v in pairs(guy:GetChildren()) do
  4016. if v.className=='Hat' then
  4017. v.Handle:BreakJoints()
  4018. end
  4019. local r = guy.Torso:FindFirstChild(v.Name:gsub("Arm","Shoulder"):gsub("Leg","Hip"))
  4020. if v:IsA("BasePart") and r then
  4021. ragJoint(v,r,.1)
  4022. elseif v:IsA("Humanoid") then
  4023. spawn(function()
  4024. wait(0.5)
  4025. v.PlatformStand = true
  4026. v.Changed:connect(function()
  4027. v.PlatformStand = true
  4028. end)
  4029. end)
  4030. end
  4031. end
  4032. end
  4033.  
  4034. else
  4035. if hit.Parent.Name~='TheDarkRevenant' then
  4036. hit.Parent:BreakJoints()
  4037. end
  4038. end
  4039. end
  4040.  
  4041. if hit.Parent.className=='Hat' then
  4042. hit.CanCollide=true
  4043. hit:BreakJoints()
  4044. hit.Velocity=m.Hit.p*5
  4045. end
  4046. end)
  4047. end
  4048. if m.Target then
  4049. local p = Instance.new("Part")
  4050. p.formFactor = "Custom"
  4051. p.Size = Vector3.new(0.5,0.5,0.5)
  4052. p.Transparency = 1
  4053. p.CanCollide = false
  4054. p.Locked = true
  4055. p.CFrame = CFrame.new(position.x,position.y,position.z)--mouse.Target.CFrame+(mouse.Hit.p-mouse.Target.Position)
  4056. local w = Instance.new("Weld")
  4057. w.Part0 = mouse.Target
  4058. w.Part1 = p
  4059. w.C0 = mouse.Target.CFrame:inverse()
  4060. w.C1 = p.CFrame:inverse()
  4061. w.Parent = p
  4062. local d = Instance.new("Decal")
  4063. d.Parent = p
  4064. d.Face = mouse.TargetSurface
  4065. d.Texture = 'rbxassetid://' .. tostring(bulletholes[math.random(#bulletholes)]-2)
  4066. p.Parent = tube
  4067. game.Debris:AddItem(p,6)
  4068. end
  4069. if recoil==true then
  4070. cam:SetRoll(math.random(-2,2))
  4071. cam:TiltUnits(0.501)
  4072. end
  4073. local th=cp(tube,"Really black",Vector3.new(1,1,1))
  4074. th.CanCollide=false
  4075. th.Anchored=true
  4076. th.CFrame=CFrame.new(position.x,position.y,position.z)
  4077. local spm=Instance.new('SpecialMesh',th)
  4078. spm.MeshType='Sphere'
  4079. spm.Scale=Vector3.new(0.05,0.05,0.05)
  4080. spawn(function()
  4081. for i=1,5 do
  4082. wait()
  4083. spm.Scale=spm.Scale+Vector3.new(0.16,0.16,0.16)
  4084. th.Transparency=th.Transparency+0.2
  4085. end
  4086. th:Destroy()
  4087. end)
  4088. fireSound:Play()
  4089. spawn(function()
  4090. firefx.Transparency=0
  4091. wait()
  4092. firefx.Transparency=1
  4093. end)
  4094. spawn(function()
  4095. flash.Enabled=true
  4096. for i=1,2 do
  4097. wait()
  4098. slideweld1.C0=slideweld1.C0*cfn(0,0,0.22)
  4099. end
  4100. flash.Enabled=false
  4101. createShell()
  4102. for i=1,2 do
  4103. wait()
  4104. slideweld1.C0=slideweld1.C0*cfn(0,0,-0.22)
  4105. end
  4106. slideweld1.C0=cfn(0,0.15,0.23)
  4107. if ajar==true then
  4108. out=true
  4109. slideweld1.C0=cfn(0,0.15,0.23)
  4110. slideweld1.C0=slideweld1.C0*cfn(0,0,0.22)
  4111. end
  4112. end)
  4113. ammocounter.Text=''
  4114. for i=1,magAmmo do
  4115. ammocounter.Text=ammocounter.Text .. 'I'
  4116. end
  4117. wait()
  4118. Tween(rw,cfn(0,0.7,0)*ang(mr(-100),mr(-30),0),0.62)
  4119. if not grip then
  4120. Tween(lw,cfn(0,0.7,0)*ang(mr(-100),mr(30),0),0.62)
  4121. else
  4122. Tween(lw,cfn(0,1.3,0)*ang(mr(-100),mr(30),0),0.62)
  4123. end
  4124. wait(0.065)
  4125. restorePosition(0.3)
  4126. else
  4127. if magAmmo<1 then
  4128. slideweld1.C0=cfn(0,0.15,0.23)
  4129. slideweld1.C0=slideweld1.C0*cfn(0,0,0.22)
  4130. end
  4131. emptySound:Play()
  4132. end
  4133. if math.random(jamRate)==jamRate and magAmmo>0 then
  4134. jammed=true
  4135. end
  4136. end
  4137.  
  4138. debounced=function()
  4139. if sheathed==false and debounce==false then
  4140. return true
  4141. end
  4142. end
  4143.  
  4144. mouse.Button1Down:connect(function()
  4145. if debounced() then
  4146. if automatic==false then
  4147. debounce=true
  4148. firePistol()
  4149. debounce=false
  4150. else
  4151. heldDown=true
  4152. firePistol()
  4153. end
  4154. end
  4155. end)
  4156.  
  4157. mouse.Button1Up:connect(function()
  4158. heldDown=false
  4159. end)
  4160.  
  4161. sheathGun=function()
  4162. ammocounter.Visible=false
  4163. if laser then
  4164. laserEnabled=false
  4165. aLaser.Transparency=1
  4166. end
  4167. Tween(rw,cfn())
  4168. Tween(lw,cfn())
  4169. wait(0.1)
  4170. mw:Destroy''
  4171. mw=nil
  4172. mw=weld(tor,handle,cfn(1.11,-1.09,0)*ang(mr(-111.5),0,0))
  4173. labr:Destroy()
  4174. rabr:Destroy()
  4175. bg.maxTorque=Vector3.new()
  4176. sheathed=true
  4177. end
  4178.  
  4179. unsheathGun=function()
  4180. ammocounter.Visible=true
  4181. mw:Destroy''
  4182. mw=nil
  4183. initializeJoints()
  4184. mw=weld(ch['Right Arm'],handle,cfn(-0.4,-1,-0.19)*ang(mr(-101.5),0,0)*cfn()*ang(0,mr(-30),mr(-5)))
  4185. restorePosition()
  4186. bg.maxTorque = Vector3.new(math.huge,math.huge,math.huge)
  4187. sheathed=false
  4188. end
  4189.  
  4190. laserEnabled=false
  4191.  
  4192. mouse.KeyDown:connect(function(key)
  4193. if key=='r' and debounced() then
  4194. debounce=true
  4195. reloadPistol()
  4196. debounce=false
  4197. elseif key=='f' and debounced() then
  4198. debounce=true
  4199. bs=true
  4200. Tween(rw,cfn(0,0.7,0)*ang(mr(-90),mr(-30),0))
  4201. Tween(lw,cfn(0,0.7,0)*ang(mr(-115),mr(35),0))
  4202. wait(0.1)
  4203. spawn(function()
  4204. cockSlide()
  4205. end)
  4206. Tween(lw,cfn(0,0.7,0)*ang(mr(-115),mr(55),0))
  4207. wait(0.3)
  4208. jammed=false
  4209. restorePosition()
  4210. bs=false
  4211. debounce=false
  4212. elseif key=='l' and debounced() then
  4213. if not laserEnabled then
  4214. laserEnabled=true
  4215. aLaser.Transparency=0.35
  4216. else
  4217. laserEnabled=false
  4218. aLaser.Transparency=1
  4219. end
  4220. end
  4221. end)
  4222.  
  4223. restorePosition=function(speed)
  4224. if not grip then
  4225. Tween(rw,cfn(0,0.7,0)*ang(mr(-90),mr(-30),0),speed)
  4226. Tween(lw,cfn(0,0.7,0)*ang(mr(-90),mr(30),0),speed)
  4227. else
  4228. Tween(rw,cfn(0,0.7,0)*ang(mr(-90),mr(-30),0),speed)
  4229. Tween(lw,cfn(0,1.3,0)*ang(mr(-90),mr(30),0),speed)
  4230. end
  4231. end
  4232.  
  4233. hopper.Selected:connect(function()
  4234. unsheathGun()
  4235. end)
  4236.  
  4237. hopper.Deselected:connect(function()
  4238. sheathGun()
  4239. end)
  4240.  
  4241. game:service'RunService'.RenderStepped:connect(function()
  4242. bg.cframe = CFrame.new(rootpart.Position,mouse.Hit.p*Vector3.new(1,0,1)+rootpart.Position*Vector3.new(0,1,0))
  4243. if laserEnabled==true then
  4244. local user=ch
  4245. local ray = Ray.new(hole.CFrame.p, (m.Hit.p - hole.CFrame.p).unit*300)
  4246. local hit, position = game.Workspace:FindPartOnRay(ray, user)
  4247. local distance = (position - basehole.CFrame.p).magnitude
  4248. aLaser.Size=Vector3.new(0.2,distance,0.2)
  4249. aLaser.CFrame=CFrame.new(position, basehole.CFrame.p) * CFrame.new(0, 0, -distance/2) * ang(mr(-90),0,0)
  4250. end
  4251. for _,v in pairs(tweenTable) do
  4252. if v.Weld.C1==v.Stop then
  4253. table.remove(tweenTable,_)
  4254. else
  4255. if v.th<0.9 then
  4256. v.th=v.th+v.Step
  4257. i=v.th
  4258. v.Weld.C1 = CFrame.new( (v.Start.p.X * (1 - i)) + (v.Stop.p.X * i),
  4259. (v.Start.p.Y * (1 - i)) + (v.Stop.p.Y * i),
  4260. (v.Start.p.Z * (1 - i)) + (v.Stop.p.Z * i)) * CFrame.fromEulerAnglesXYZ(
  4261. (v.X1 * (1 - i)) + (v.X2 * i), (v.Y1 * (1 - i)) + (v.Y2 * i),
  4262. (v.Z1 * (1 - i)) + (v.Z2 * i) )
  4263. else
  4264. v.Weld.C1 = v.Stop
  4265. end
  4266. end
  4267. end
  4268. end)
  4269. for i=1,magAmmo do
  4270. ammocounter.Text=ammocounter.Text .. 'I'
  4271. end
  4272.  
  4273. sheathGun()
  4274.  
  4275. spawn(function()
  4276. while wait(0.07) do
  4277. if heldDown==true then
  4278. spawn(function()
  4279. firePistol()
  4280. end)
  4281. end
  4282. end
  4283. end)
  4284. m.TargetFilter=tube
  4285.  
  4286. while wait(0.03) do
  4287. if spread>1 then
  4288. spread=spread-spreadint/4
  4289. end
  4290. if spread<1 then
  4291. spread=1
  4292. end
  4293. if currentIco>2 then
  4294. switchIco(currentIco-1)
  4295. end
  4296. end
  4297.  
  4298. --hl/https://httpget-inumeration.c9.io/mp45.lua
  4299. --local/game.Players.Conmiro:Destroy''
  4300. ---------------------------------------------------
Advertisement
Add Comment
Please, Sign In to add comment
Advertisement
Public Pastes
Advertisement
We use cookies for various purposes including analytics. By continuing to use Pastebin, you agree to our use of cookies as described in the Cookies Policy.  OK, I Understand
Not a member of Pastebin yet?
Sign Up, it unlocks many cool features!