SHARE
TWEET

Untitled

ToxicWHOMakesGUIS Apr 4th, 2019 (edited) 722 Never
Not a member of Pastebin yet? Sign Up, it unlocks many cool features!
  1. --// Obfuscated by https://Aspectnetwork.net/Obfuscator \\--
  2. --// Version: 6 \\--
  3.  
  4. local Doomspire_IlIlI='2d2d9872910eb8004d76ac8fb6f9ea35cace47bd32a527065b110b4d6bae54e5e37c889768e02231d556dc8dfc46dc50b4c71b727960b2381a722c1affb87a517672cc00fcbebfd1b92b854396d23564d9ec152313'local Doomspire_IIlllIIllIIIlIllI='2f6858a0f8b6de11b82cbdb320cf614f42986b6d722b0a1e35dd3dcaa0ea68581e7d88230f0e34ae28c9ceefbdea64f46f370e526d9ccb3e7bbd36d3269928b5f8255fa169'local Doomspire_lIIllIllll=143;local Doomspire_IIlIllIIllIIlllIIl=52;local Doomspire_IIlIlllIll=9257102;local Doomspire_IIIIIlIlIlIIlIIllI=9324;local Doomspire_lllllllIIllIllllIlIlI=function()local Doomspire_llllIllIlllIIIll='5351116aa67b1b4c4fee4b83ac428669076794d8d2ba0348385535e1bdfe9b'local Doomspire_lllIIlIIllIIII='434e2ce808d2d2af2ec511293a52d06263ce98b7e49dfbad1c76afc081481fb996a1a93c8b34e575825e87d4634d77b15fc449d7aa20ae20612502485879a8a3f2c873c71a2d127d2c01e295391ed8a93e'local Doomspire_lllIIIl='4a4601734aa11c6bebf723a1f57e169df7c70083bc90a5cdc048cc3e4fc08b4fc44301cd79da78ce97158c5929349dd59e88a206b66506384f69501a10'local Doomspire_IIIIIIlllIlllII={DIEkQGadb,sbLlHXpU,zcHvMM}end;local Doomspire_lIIIllIllllllIIIIllIl='4142742f39af9cb4ffdc20a9d1f0a639b3ea449380cdd34fda09110a9d392c6924d7cab252e571b888b19016043e61dbd272c672ea6a81e5e969c15aecc17a67'local Doomspire_lIlIIIlllllIllllIl=function()local Doomspire_IlllllIlIl='756d3fa0a41a46661b9b7327631d546bc147d0e7bf84354d2cf9a59be587ded52de35c598819059b3dc9d54a5fe492f38a0fd7a6fe9e1ebb5fe779fddcbac870c74243e357e0469d924a1daf50c0e087728b90e3f2293c643e0fea61a3678dfcb3af'local Doomspire_lIlIlIlIIllIlIlIl={xvJHrWpYkX}end;local Doomspire_llIllIIlIIIIIll=function()local Doomspire_IIIIlIIlIllIll='7158b038c231b52b63206a2e4c650c96ed5682d44431f1d47a21c2392c09bb05a92a56523b2ce475b3a49a612ddad817340194c0b6df860de408b7d3966f5f8e3843436fa9bbc43c46f74bd5cb2ec8558116d10c564dbdf2ee324583fe84'local Doomspire_IlllIIlIllI='486d2dadaa54a5923c521fe6a136a5f25515a3034285f2ac9850af1ac7af14556253f17b33680119f8c6e038d84f0e9ac6933cd093a86c16544ed0462872addaa0b9f5c2e244a7e105'local Doomspire_IIIlIIIIIIIllIl='7158eedfc80ced3a2b82aa0fac086fd162999d2d56fd707564cc0ffbccadbc9c4849d5ae6a'local Doomspire_lIIIIIllIllIIIIIlI={iEbjWGqdyNyLwlPAgPKJtoXCO,BtJdYZlDmWy,JZoaTTqLyOXebQyYzYFkhiMo}end;local Doomspire_llllIIlIlIl=function()local Doomspire_llIIlIIIIllll='4d7a7bcd982d360c3983248c937e7191daec9f3690c672b8d3db2f1fb8a9580005ac41d2bac20d29dd2e'local Doomspire_Il='554f09b62f23ca378a58746ed9e83807613b38fce892c90846d3243fc23edc9555422612b5'local Doomspire_IllI='4f52e5b201d42b9178edc6cb8f3ab1579ef3297ddc788412ec61a366432487c1d525c5e279fc3810a56159ce609a88'local Doomspire_IIlllIIIllllll='436a01e877a8bc0d88fc2e1a5b1a07635eba8f8307104e4aa2b225300c3b3cba97f700ad013ee76015d22b0e2263aa96e7d332ce8cc447c4be'local Doomspire_IIIlIII='6c7a35bba43c7dc52b08b3e2949b9967d2d08f341f0416091dc0e151a18ac4eb3a69684643672fc3638ba55248a20e73'local Doomspire_IIIIIIllIllIllIIlIII={ZzLaMlPxoSzuPcFSmFvPPqG,KUOat,KCxYvIJjy,PqPOcQARxMiiDxUkCeQapw,XLByfgDZxeJOLfXktvQdL}end;local Doomspire_lllllllI='6e75c23d8371'local Doomspire_IllllllII=function()local Doomspire_llIllIIIlIIIl='554c3e4aea388eced81567486cee8f2b2c8f5015eda305dcc2d76c54629f697969'local Doomspire_llIIll='6e7a24c4828e74d0aa6bdb3d6fca12b80b6534e5d31682c14fe27aa81ac3a47c3c76d9977c9e951cba147fa422e3a0141cf5a03b54eef28d'local Doomspire_lIlIlIIIlIlIIllllI='5959d5cd1cb1e5a3d0170798b0a746f08cf881a66279788f6a582f0b915f75f4'local Doomspire_IIIlIIIIllIIllllIlIl='7664c38579ee9df9b62fb7479fb2852fa35d7f6bb6eb3d68c05d3e3015e6a87d145fc9d58ca2d322862141fc3e50a04f1acbcf4cd9763c7c886f6474fb81fb5e7cc65a1f6eaca0aff7dd7a2ac76885980e9601fb7e8a'local Doomspire_lIllllIllI='5577f82661f3dd2612ffe82dec01348e493bd3b8c0e67da5a11f2c890906cf5a3d7149f66b6e4cc91d1c6ce28aa8752f56d54370847b456ed046d6db'local Doomspire_IIIIlI='6d7a6b800395c0543a8e513b56158167e3817e53240441afb9f4eff25ad3d4cae7988cd503170644bd16c16b9c102c222aec6970399f227cd9119774c240'local Doomspire_lIIlllllI={uBvEicGOAozQB,NtZVReAWoQgFXoRjuojnANfq,iceNosKmXVNoNI,tZqOqBcCrOShViAxjVlNzSC,xTIEfjB,iYKAtZkLsFNbHxjkaQeTZ}end;local Doomspire_llIIIIIIIlIIlllllll='756c6adf00cb43'local Doomspire_lIIIIIIlIllIlll=function()local Doomspire_llIllIlllIIIlllIIIIllIlI='6e6eded6bf37c452cc6558a60f422cc7cf92f73cca71f5d2850272bf85ef5ff3527431668eb88b5b942fbef12659ff51c73695dc3654b0e4f011d880ca9990c31b346a43508a36ff9be6'local Doomspire_IIIllIIlIII='75474fcd141f67fe6695034a5acb9fa85d8158e49418866f4437092d3a893fb1bbb6f6a05f6dad8790bdb9ca7dae447b5e187fe196048528ff108dd77554ff852623eedb3aac3f86d497eb3edf1b6f58b1ad8cee59dab7810c191b01'local Doomspire_III='5950a0a949ca94796cdf27bcce99be3bbdec8f213eca45e0e9e4f35e215a1da5265dfba9c610'local Doomspire_lIIIllIllIl='4a62466586cd095a7530d72ad42baee6f53d75f7316fbca6db71be76ee3943feb84250605848075b383b91371ac942bfaddd9bef3dc1fa5d738d9b67b428a9612066e06a46d1ebd94892'local Doomspire_IIlIIIllIIlllIllI='49757b15383ec5849dac7c76e8837b4d330aee82e403ab5ad260d2e064cb5b4280ac71af343edd828d4a1f6bff1aeef0c3a9762990c09cd8d9688c'local Doomspire_IIlIlIl='5370ef0cf8aa60e7e6ff576d060bc532fee748b542f2340068a246c491cef0760618f4171816ffeacb60cb7430869d4060804b4eed516530be03754ea978d105d3a91363404e9d0f80be1b7485422f26d74dd58e66dfe62b0d085d3ae7'local Doomspire_llIllIlIIllllI='6457841da77753080c2baf7e38c228552c9d2aa1e6c90ab444fb4946c31032c0911d4b8400492d680228ed8f1668e5f014bc46b59bcc6ab1787763189dd24466782af7808c4423541895b940dc349cd459a9b408d2cfd701d58cf91478aa15'local Doomspire_lllIllIlIIII='594a6bf57b7f963342f79d368c8a5ad8479ee20630d97efb18509c4bb16e5f090c5dca1ea2c477da48a833fd619ae42a3568e938782184bd16'local Doomspire_IIIIllIlIIlIIlIII='5877c3df2f166e214ba61fa6df314a0ba30bc0fb25af1331e01a23fdf6af9d42d9fc9ca4674bc1e5e1d64682'local Doomspire_llllIIIllIllIIllIlIl='66752d4f6de7d03544f1c14228d03a44c0a4c927b70a34d23498792eaf839d095bf3a0df67d6a0199144ab0e1ffe99b315b56a035a2f1adc3edae11d9ada2743c4f601f1f58cdfff0942377f3bba2339cd6f0701221f'local Doomspire_IllIllIlIIlIlllIl={IcLOfBuTd,RAFgPlk,lIrPsMeFiUHgWa,SJTKpLtyrUah,yUlKcqYjfXiIHUzRVq,yYxFkJoCVsOgBDafoMV,EWjCLxvWpKeRqLrLRoAfIqa,uQpAYuPjOMcPkyUn,yOhSuLWxViqD,mKzWhXXq}end;local Doomspire_llllII='6c654fdf0772'local Doomspire_lIlIl=function()local Doomspire_IIlII='52419f61c366049482578ab3c4886156ab70b4d14eab6f1cfdd5eedd7f92702ff9bfb2d10de151'local Doomspire_III={pyXgZHrxJeZrWpHPjKnDzeZP}end;local Doomspire_lIIllllllllIIIlll='4572b9b2742b08'local Doomspire_llIll=function()local Doomspire_IIIIllIllll='6c63f792edf81b2795fbffbd0c7fa422677f16ed5e45714b0ff693b254ff6bc298afb0caf64df8b6bd1ad323190a494f49371242d4b53cc3443e4b31a54346a2bf615390a9a9c7'local Doomspire_IIIlIlIIllIlllIllllI='714d3e80f3286cd4099be6b8453b19de9284bb83e719fc08e430f79b7d751d26c917f3e641be2962777b7355078d9ea504354651ad28e0f1a9a22e23ad5f26de95dc747109723c19a02e7b57529a415b1479e5ec54f771d5f7cf5f6e'local Doomspire_lllIlIlllIIIIIllllIlll='6b480089aee8209c70204d2f6415fb3e37ab89eb4a6fcf0cd0c83860c55e'local Doomspire_IlIlIIIIIllIIIII='4f701aecdeb8c2becc3e43d34750b3ffc768753c6174f60bfcee2771e5b49dd0661a0eb3c25485a4'local Doomspire_lIIlIlII='434274e8c112728213985b31eb1e78fcdb57a5e7fb14f6cbbd83d83844a4a64c582701'local Doomspire_lIllII='4e4b0af58dbd8e55687e909764ecad69201e62aea9fdd53738e888837a031eaab465d5e3727e5fc7742ac16ba1380b3861779db9ab78bc44ca2859624d6651752b251918a674c9e9ea09bc4f12134f90496570405e2374a7aca70cad3016dc68327f23'local Doomspire_lII='724c3e141b11892ed68233acb701721532b6ae13877eefaf99c274cfe66fd960802fb2fa6d2db75c37994730613700d3a51686e5724d1fe6c2e35a7142e612748e7b1f8fecef1ae00bd787708914e214f7856cdac24b2564dd7537ac'local Doomspire_lIllIIIlIIIlllllIlII='7671ba6135fb07447b81bf5012bd8656bded463cce383f895789c607cc7a816f9b8863816742ec303d56cc85d83a5c9ff18737e948e4b3d90df2e0687f188a0aba7e2564'local Doomspire_IlllI='45439f264d79c423ff58c17e614eeeb0089e5cff73262087902689e9e84a29a1e93a652476c963231a158f'local Doomspire_lllIlIlIIIIlII={AzzBjYbHSs,FGavWxghFEESrPmaDh,uODwnNGqsHQz,jVkKgHC,GdguHxIpkOQeAzAyXGAk,aXTsVXbApLrHayTjOmRw,BePrZgHllsNEWj,IJgorZBHbMvjDCr,zTOoGUoThUhyUmLd}end;local Doomspire_lIllIIIllIlIlll='556e84e8fb8412b6afae88668e294025532f56f52d75e123558194eb5a9240dc4c616520'local Doomspire_IllIIlI='4f6ef70c30d165db33b806bc773cdd8fb5aae9ba89e2a8fe0e66'local Doomspire_llIlIIIIllII='4c753eebb15ff155dde796879b76f203481e46e261f3'local Doomspire_llIl='546896d6ac2abfac10c8ac172a0e99ee012f386ef90f7634b56a52db'local Doomspire_IllllIIlllll=function()local Doomspire_IIIlllIllIllllII='6a762ce34bda2a15c698da2534f2efe025bfbcaa69358407363022182dcde830962ba684eb75'local Doomspire_Il='46614f80b04b252092afc5984d66de7ab9719ab919e32dd4188e87a8a73e10e6643d0a2782a024cdc90cc50f38c42ebc3bcae184fc946fa5da64044602a63c57363f2bcfb6'local Doomspire_IlIllI='664d841df18b4f717148000ccaf5afce252cacc88312f843bccc522bf411d4856a81815d90e3752ac253ebc534c1a5df3994eb0c3b74abd0a1f0dc5a71aae125562573a0f74827b6622097a66bea571365bfa2b727e2e1e41b39a19a119b'local Doomspire_llIIlI='4f46c2bfb52e5ab73736560b815d2eec6162a9daf3cab6cb7d7947ed3c177dc324d46b8ac98dbc21318099a4db9398b35c729774c1b79d809b7e8146d4b24f82b00a783aabf0eac9df394a1c2bedeba96d80'local Doomspire_IllllIIIllIIIlIIl='5569b1b62f4fdad6e7ee0101c17b4a491dff2d2a9efd37c0c8e91392076f67c3ceff47835f8470be4f34af4c95f7030be32178524a4ef13e5a4a1114c606655ce1e4fa4c15b3865fd5f850ee68'local Doomspire_IllIIllllIllIl={JbUcOv,uEgaUmKMbIiDtLcL,EXPhxLoGbSgHRwXrq,PKIoLrFXwwGVwsXyr,vTmNwvAZdUrTDm}end;local Doomspire_IllIl;local Doomspire_llllIIIlllllI;local Doomspire_lI;local Doomspire_lllIIlIl;local Doomspire_llIlIllIllIllIIlll;local Doomspire_lIIIIIIIllIIIll;local Doomspire_IIlIlllII;local Doomspire_lIlllIIIIIlllIIll;local Doomspire_lIlIlllIIllllIlII;local Doomspire_lIIlIIllIllI;local Doomspire_IlIlIlIlIII=setmetatable;local Doomspire_lllllllIIIlIIIll=coroutine;local Doomspire_IIlIlIlIlIIllIlIIl=Doomspire_lllllllIIIlIIIll.create;local Doomspire_IIlIlIIlllllllIIIll=Doomspire_lllllllIIIlIIIll.resume;local Doomspire_lIIlllIlllIIll=string;local Doomspire_lllIIllIIlIII=Doomspire_lIIlllIlllIIll.char;local Doomspire_IIlIIllllIIllIl=Doomspire_lIIlllIlllIIll.sub;local Doomspire_IIIll=Doomspire_lIIlllIlllIIll.len;local Doomspire_IlIIIIIIlIllll=getfenv;local Doomspire_lIIIIIIlIIIll=tostring;local Doomspire_lIIIIII=tonumber;local Doomspire_llIIllIIlllllllIlI;local Doomspire_llllIllIlIlIIlIIII;local Doomspire_IIIIllIlIllll;local Doomspire_lIllIIlI;local Doomspire_IIllIIIlIIIIIIlIllIlI;local Doomspire_lIlllIIllllIlIIlII=select;local Doomspire_Ill;local Doomspire_IIIlI;local Doomspire_lllll;local Doomspire_lIlIlllIIlIIIIIllIIlllIl;local Doomspire_IlllIlIIIllIIIIIIIlIIIllI;local Doomspire_IlIlllIlIII;local Doomspire_IlIlllllllII;local Doomspire_lllIIIllIIlIl=function()local Doomspire_llIIllIllIllIlIllIl='524550739607ff91291e60ea14d19996d86d6a773b0900d25362c091a0f6bbbfb19f4a0c2ee2c25e0f03f21d5ee705d28aab1489b5926bc05448bc2e8a329d'local Doomspire_lIllIlIlIIIll={zABvbvWOKrKg}end;Doomspire_lIIlIIllIllI=function(Doomspire_lIIIlIllIlIlIllIIll)local Doomspire_llIllIIlllllIIlIIIl,Doomspire_IlllIlllIlIIIIIIlI=Doomspire_IIlIlllIll,16384 +Doomspire_IIIIIlIlIlIIlIIllI;return(Doomspire_lIIIlIllIlIlIllIIll:gsub('%x%x',function(Doomspire_lIlIIIII)local Doomspire_IIIIIIIl=Doomspire_llIllIIlllllIIlIIIl%274877906944;local Doomspire_lIIlIlIllIIIllIlIllII=(Doomspire_llIllIIlllllIIlIIIl-Doomspire_IIIIIIIl)/274877906944;local Doomspire_IIIlIllIllI=Doomspire_lIIlIlIllIIIllIlIllII%128;Doomspire_lIlIIIII=Doomspire_lIIIIII(Doomspire_lIlIIIII,16)local Doomspire_IlIIIlllII=(Doomspire_lIlIIIII+ (Doomspire_lIIlIlIllIIIllIlIllII-Doomspire_IIIlIllIllI)/128)* (2 *Doomspire_IIIlIllIllI+1)%256;Doomspire_llIllIIlllllIIlIIIl=Doomspire_IIIIIIIl*Doomspire_IlllIlllIlIIIIIIlI+Doomspire_lIIlIlIllIIIllIlIllII+Doomspire_lIlIIIII+Doomspire_IlIIIlllII;return string.char(Doomspire_IlIIIlllII)end))end;local Doomspire_IIIl={}local Doomspire_llIlIlIlllIIIllllIlIlIII={}local Doomspire_IlllIIll={}local Doomspire_lllIIIlllIIllIlIIIlll={}for i=65,90 do Doomspire_IIIl[Doomspire_lIIlIIllIllI(Doomspire_lllllllI)..i]=i end;for i=97,122 do Doomspire_llIlIlIlllIIIllllIlIlIII[Doomspire_lIIlIIllIllI(Doomspire_lllllllI)..i]=i end;local Doomspire_IlllIIIllIllIlIIlII=function()local Doomspire_lllIllIlIlIIII='434c8d6adf95a0842536360ef1ee0eda3133f7c352b200cf203e08112c9d792967fb54e2cf895359b9b189935fde15a42a5b54c506fac28d5f34c2a1388aa18163e4c35fc3c9f03c1ec7bd341927c076fc24562369'local Doomspire_lIlIII={JOaNiZfQAqYnNkoDrNwrLo}end;local Doomspire_IlIIIlllIllII=function(Doomspire_IlIIIIlIlI,Doomspire_IlIIIlllIl)Doomspire_IlllIIll[Doomspire_lIIlIIllIllI(Doomspire_llIIIIIIIlIIlllllll)..Doomspire_lllIIllIIlIII(Doomspire_IlIIIlllIl)]=Doomspire_lllIIllIIlIII(Doomspire_IlIIIlllIl)end;local Doomspire_lIlIIlllIllllIlII=function(Doomspire_IlIIlII,Doomspire_llIIlIIIIIlllllIllll)Doomspire_lllIIIlllIIllIlIIIlll[Doomspire_lIIlIIllIllI(Doomspire_llllII)..Doomspire_lllIIllIIlIII(Doomspire_llIIlIIIIIlllllIllll)]=Doomspire_lllIIllIIlIII(Doomspire_llIIlIIIIIlllllIllll)end;table.foreach(Doomspire_IIIl,Doomspire_IlIIIlllIllII)table.foreach(Doomspire_llIlIlIlllIIIllllIlIlIII,Doomspire_lIlIIlllIllllIlII)local Doomspire_IllIIlIlIIlllllllIl=function()local Doomspire_IllIlIlIIlIIlllIlIl='6a42d414fa053791173d154958e3a1f10ea0c26a7dd9ae7db8d24ee7c78b5153de6a14f6776a428c973fed9c07637d5fa90a15ba2feca9c366b9c77fa43cd2e46faf62ec1c0120e49ad52ee2ff5cfb3b0612c074eb34a2e4cfad357c'local Doomspire_IIllIIIllIIllIllIlII='6d43f7ad2b12f9a3cfd2c9c94edb64942701e605753efb86dbb3e2baff6d982f1f5c7b8e7cbbd24687f9435d5f490a696c5f27cb451d77e8caf2f3a93b1554987f3ea63bf6b2967363df5123014bc3156330b1d02f34c583272eddc9aa18780264'local Doomspire_IlIIIIlll='6a531a7730304b0be95e7cbff4fccc55218fe8bfbc557db095b28183ee6111d038134cdc2d5a8b4771bbfc6f06a1c8dcab26bed5403c8f64b9'local Doomspire_lIlIIllIllIIl='6552e52635117be3859e03f196bdefd76a89eb8ec3aba69bfc88500f52c1c3796505f88d55c2565aebbea0f071f05348b7eae9'local Doomspire_lllIlII='4266f8bffb8c8a5636792b72a0ae9b9b46e3b300839db2480d21dc6c4b23c675ce1284a4e105452a13c1402e51'local Doomspire_IlIIIIlIIlIlllllll='7250b0a4f35e257fe0080dff43e7e4758bbe331483c12a26e816735e4fb677d263bbf8300281ae9e4843d4b37e8ba117b17fe2ffdb19d0374f4f57be817c6b59573ccf29598135e9c0253865f441f901eb260c'local Doomspire_lIIlIIlIll='436cdeec432ffab3e8b2e932c6e3cd337d1e16d4f1a32bb26afdadf2f0a91358c6d868cdf8dfef7de5b1272c54'local Doomspire_lIIIIIIIIllIlIIIIlll='53469f9b01d67b8c804ad3870244465eeed498e4e6eb5260d597126667251e0b3a5c47cf60a93bce3f37da74509da471661aaddc7a16196f7dadf79bca5b7c8f'local Doomspire_lllIIIIII='4673ef152a9ec607480adf218976f3bda2ef9bd510a6ab15e11a98719b72ac570a'local Doomspire_IIIllllIl='6355239beb829a00d4daaf2a2fd8530d52c7472dfe8ccca8cf1baaac5d941576f3b77782413b6a742186622695279cdead4b30caf4d0b7dfb60f6acfeb224d33741c1602822509295b1abee0a1743767d4c64dc2d837f00685f5450962c5186f95a1'local Doomspire_IIlIIllIIII={pbDnPZyG,HUpUqiH,kZrElLbIAbTFqydIXerXSgWm,VutyXcjNXNZkAa,wDdSEfXmunqEvkEFNFDyQtF,QjQkEgUnVKhRrrC,OApBoGpiTp,iBfbRqcdKMiOlHVeAaZKyK,BXhJcXKdXpc,qVclTvZuOZBe}end;local Doomspire_IIIllIIIIllIlIIIlIllI=Doomspire_IlllIIll.uletterA..Doomspire_IlllIIll.uletterB..Doomspire_IlllIIll.uletterC;local Doomspire_lIIIIlIlIII=Doomspire_IlllIIll.uletterA..Doomspire_IlllIIll.uletterB..Doomspire_lllIIIlllIIllIlIIIlll.letterx;local Doomspire_IIllllI=Doomspire_IlllIIll.uletterA..Doomspire_lllIIIlllIIllIlIIIlll.letters..Doomspire_IlllIIll.uletterB..Doomspire_lllIIIlllIIllIlIIIlll.letterx;local Doomspire_IIIIIlIllIlIlllllI=Doomspire_IlllIIll.uletterM..Doomspire_IlllIIll.uletterO..Doomspire_IlllIIll.uletterV..Doomspire_IlllIIll.uletterE;local Doomspire_lllllIIIIllllllIlIIIl=Doomspire_IlllIIll.uletterL..Doomspire_IlllIIll.uletterO..Doomspire_IlllIIll.uletterA..Doomspire_IlllIIll.uletterD..Doomspire_IlllIIll.uletterK;local Doomspire_lIIIlIlIIIIllIII=Doomspire_IlllIIll.uletterL..Doomspire_IlllIIll.uletterO..Doomspire_IlllIIll.uletterA..Doomspire_IlllIIll.uletterD..Doomspire_IlllIIll.uletterB..Doomspire_IlllIIll.uletterO..Doomspire_IlllIIll.uletterO..Doomspire_IlllIIll.uletterL;local Doomspire_lIIII=Doomspire_IlllIIll.uletterL..Doomspire_IlllIIll.uletterO..Doomspire_IlllIIll.uletterA..Doomspire_IlllIIll.uletterD..Doomspire_IlllIIll.uletterN..Doomspire_IlllIIll.uletterI..Doomspire_IlllIIll.uletterL;local Doomspire_IIlIIIllllIIlllIlIIll=Doomspire_IlllIIll.uletterG..Doomspire_IlllIIll.uletterE..Doomspire_IlllIIll.uletterT..Doomspire_IlllIIll.uletterU..Doomspire_IlllIIll.uletterP..Doomspire_IlllIIll.uletterV..Doomspire_IlllIIll.uletterA..Doomspire_IlllIIll.uletterL;local Doomspire_lIlI=Doomspire_IlllIIll.uletterG..Doomspire_IlllIIll.uletterE..Doomspire_IlllIIll.uletterT..Doomspire_IlllIIll.uletterG..Doomspire_IlllIIll.uletterL..Doomspire_IlllIIll.uletterO..Doomspire_IlllIIll.uletterB..Doomspire_IlllIIll.uletterA..Doomspire_IlllIIll.uletterL;local Doomspire_lIIIlllIIIlIlIll=Doomspire_IlllIIll.uletterG..Doomspire_IlllIIll.uletterE..Doomspire_IlllIIll.uletterT..Doomspire_IlllIIll.uletterT..Doomspire_IlllIIll.uletterA..Doomspire_IlllIIll.uletterB..Doomspire_IlllIIll.uletterL..Doomspire_IlllIIll.uletterE;local Doomspire_lllIIlIlllI=Doomspire_IlllIIll.uletterS..Doomspire_IlllIIll.uletterE..Doomspire_IlllIIll.uletterT..Doomspire_IlllIIll.uletterG..Doomspire_IlllIIll.uletterL..Doomspire_IlllIIll.uletterO..Doomspire_IlllIIll.uletterB..Doomspire_IlllIIll.uletterA..Doomspire_IlllIIll.uletterL;local Doomspire_IIlllI=Doomspire_IlllIIll.uletterS..Doomspire_IlllIIll.uletterE..Doomspire_IlllIIll.uletterT..Doomspire_IlllIIll.uletterU..Doomspire_IlllIIll.uletterP..Doomspire_IlllIIll.uletterV..Doomspire_IlllIIll.uletterA..Doomspire_IlllIIll.uletterL;local Doomspire_lllllllllIIl=Doomspire_IlllIIll.uletterS..Doomspire_IlllIIll.uletterE..Doomspire_IlllIIll.uletterT..Doomspire_IlllIIll.uletterT..Doomspire_IlllIIll.uletterA..Doomspire_IlllIIll.uletterB..Doomspire_IlllIIll.uletterL..Doomspire_IlllIIll.uletterE;local Doomspire_lIIlllllIIIllllIl=Doomspire_IlllIIll.uletterN..Doomspire_IlllIIll.uletterE..Doomspire_IlllIIll.uletterW..Doomspire_IlllIIll.uletterT..Doomspire_IlllIIll.uletterA..Doomspire_IlllIIll.uletterB..Doomspire_IlllIIll.uletterL..Doomspire_IlllIIll.uletterE;local Doomspire_IlIIIlIlllIIlll=Doomspire_IlllIIll.uletterS..Doomspire_IlllIIll.uletterE..Doomspire_IlllIIll.uletterL..Doomspire_IlllIIll.uletterF;local Doomspire_lIlIIIIIlIIlIIIll=Doomspire_IlllIIll.uletterA..Doomspire_IlllIIll.uletterD..Doomspire_IlllIIll.uletterD;local Doomspire_IlIIl=Doomspire_IlllIIll.uletterS..Doomspire_IlllIIll.uletterU..Doomspire_IlllIIll.uletterB;local Doomspire_IIIllIlIIIlIlII=Doomspire_IlllIIll.uletterM..Doomspire_IlllIIll.uletterU..Doomspire_IlllIIll.uletterL;local Doomspire_lllIllIlllIllIlllI=Doomspire_IlllIIll.uletterD..Doomspire_IlllIIll.uletterI..Doomspire_IlllIIll.uletterV;local Doomspire_lIIlIllll=Doomspire_IlllIIll.uletterM..Doomspire_IlllIIll.uletterO..Doomspire_IlllIIll.uletterD;local Doomspire_IlIIIlIlIlllI=Doomspire_IlllIIll.uletterP..Doomspire_IlllIIll.uletterO..Doomspire_IlllIIll.uletterW;local Doomspire_IIlIIIIlII=Doomspire_IlllIIll.uletterU..Doomspire_IlllIIll.uletterN..Doomspire_IlllIIll.uletterM;local Doomspire_IlIIIIIIIIII=Doomspire_IlllIIll.uletterN..Doomspire_IlllIIll.uletterO..Doomspire_IlllIIll.uletterT;local Doomspire_IllIIlll=Doomspire_IlllIIll.uletterL..Doomspire_IlllIIll.uletterE..Doomspire_IlllIIll.uletterN;local Doomspire_IIIIII=Doomspire_IlllIIll.uletterC..Doomspire_IlllIIll.uletterO..Doomspire_IlllIIll.uletterN..Doomspire_IlllIIll.uletterC..Doomspire_IlllIIll.uletterA..Doomspire_IlllIIll.uletterT;local Doomspire_IlIlIlIIll=Doomspire_IlllIIll.uletterJ..Doomspire_IlllIIll.uletterM..Doomspire_IlllIIll.uletterP;local Doomspire_llIllllIIIIlIIIIlIlI=Doomspire_IlllIIll.uletterE..Doomspire_IlllIIll.uletterQ;local Doomspire_lIIlllIlIIlII=Doomspire_IlllIIll.uletterL..Doomspire_IlllIIll.uletterT;local Doomspire_IIIIIIIIIIIlIIIIIll=Doomspire_IlllIIll.uletterL..Doomspire_IlllIIll.uletterE;local Doomspire_lIIIIlIlllIllIllIllI=Doomspire_IlllIIll.uletterT..Doomspire_IlllIIll.uletterE..Doomspire_IlllIIll.uletterS..Doomspire_IlllIIll.uletterT;local Doomspire_IIll=Doomspire_IlllIIll.uletterT..Doomspire_IlllIIll.uletterE..Doomspire_IlllIIll.uletterS..Doomspire_IlllIIll.uletterT..Doomspire_IlllIIll.uletterS..Doomspire_IlllIIll.uletterE..Doomspire_IlllIIll.uletterT;local Doomspire_lllIlllIlllIIllII=Doomspire_IlllIIll.uletterC..Doomspire_IlllIIll.uletterA..Doomspire_IlllIIll.uletterL..Doomspire_IlllIIll.uletterL;local Doomspire_lIllIlIll=Doomspire_IlllIIll.uletterT..Doomspire_IlllIIll.uletterA..Doomspire_IlllIIll.uletterI..Doomspire_IlllIIll.uletterL..Doomspire_IlllIIll.uletterC..Doomspire_IlllIIll.uletterA..Doomspire_IlllIIll.uletterL..Doomspire_IlllIIll.uletterL;local Doomspire_IIlIIIIIIIllllIlllIlI=Doomspire_IlllIIll.uletterR..Doomspire_IlllIIll.uletterE..Doomspire_IlllIIll.uletterT..Doomspire_IlllIIll.uletterU..Doomspire_IlllIIll.uletterR..Doomspire_IlllIIll.uletterN;local Doomspire_IllIlIl=Doomspire_IlllIIll.uletterF..Doomspire_IlllIIll.uletterO..Doomspire_IlllIIll.uletterR..Doomspire_IlllIIll.uletterL..Doomspire_IlllIIll.uletterO..Doomspire_IlllIIll.uletterO..Doomspire_IlllIIll.uletterP;local Doomspire_lIlIlIlIIlII=Doomspire_IlllIIll.uletterF..Doomspire_IlllIIll.uletterO..Doomspire_IlllIIll.uletterR..Doomspire_IlllIIll.uletterP..Doomspire_IlllIIll.uletterR..Doomspire_IlllIIll.uletterE..Doomspire_IlllIIll.uletterP;local Doomspire_llIlllIlllIIlIIIIllI=Doomspire_IlllIIll.uletterT..Doomspire_IlllIIll.uletterF..Doomspire_IlllIIll.uletterO..Doomspire_IlllIIll.uletterR..Doomspire_IlllIIll.uletterL..Doomspire_IlllIIll.uletterO..Doomspire_IlllIIll.uletterO..Doomspire_IlllIIll.uletterP;local Doomspire_lIlIlIIllIl=Doomspire_IlllIIll.uletterS..Doomspire_IlllIIll.uletterE..Doomspire_IlllIIll.uletterT..Doomspire_IlllIIll.uletterL..Doomspire_IlllIIll.uletterI..Doomspire_IlllIIll.uletterS..Doomspire_IlllIIll.uletterT;local Doomspire_lIIIllIIIIlIlIlI=Doomspire_IlllIIll.uletterC..Doomspire_IlllIIll.uletterL..Doomspire_IlllIIll.uletterO..Doomspire_IlllIIll.uletterS..Doomspire_IlllIIll.uletterE;local Doomspire_IllllllIIIIII=Doomspire_IlllIIll.uletterC..Doomspire_IlllIIll.uletterL..Doomspire_IlllIIll.uletterO..Doomspire_IlllIIll.uletterS..Doomspire_IlllIIll.uletterU..Doomspire_IlllIIll.uletterR..Doomspire_IlllIIll.uletterE;local Doomspire_lllII=Doomspire_IlllIIll.uletterV..Doomspire_IlllIIll.uletterA..Doomspire_IlllIIll.uletterR..Doomspire_IlllIIll.uletterA..Doomspire_IlllIIll.uletterR..Doomspire_IlllIIll.uletterG;local Doomspire_llllIIllll={Doomspire_IIIllIIIIllIlIIIlIllI,Doomspire_lIIIIlIlIII,Doomspire_IIIllIIIIllIlIIIlIllI,Doomspire_IIIllIIIIllIlIIIlIllI,Doomspire_IIIllIIIIllIlIIIlIllI,Doomspire_lIIIIlIlIII,Doomspire_IIIllIIIIllIlIIIlIllI,Doomspire_lIIIIlIlIII,Doomspire_IIIllIIIIllIlIIIlIllI,Doomspire_IIIllIIIIllIlIIIlIllI,Doomspire_IIIllIIIIllIlIIIlIllI,Doomspire_IIIllIIIIllIlIIIlIllI,Doomspire_IIIllIIIIllIlIIIlIllI,Doomspire_IIIllIIIIllIlIIIlIllI,Doomspire_IIIllIIIIllIlIIIlIllI,Doomspire_IIIllIIIIllIlIIIlIllI,Doomspire_IIIllIIIIllIlIIIlIllI,Doomspire_IIIllIIIIllIlIIIlIllI,Doomspire_IIIllIIIIllIlIIIlIllI,Doomspire_IIIllIIIIllIlIIIlIllI,Doomspire_IIIllIIIIllIlIIIlIllI,Doomspire_IIIllIIIIllIlIIIlIllI,Doomspire_IIllllI,Doomspire_IIIllIIIIllIlIIIlIllI,Doomspire_IIIllIIIIllIlIIIlIllI,Doomspire_IIIllIIIIllIlIIIlIllI,Doomspire_IIIllIIIIllIlIIIlIllI,Doomspire_IIIllIIIIllIlIIIlIllI,Doomspire_IIIllIIIIllIlIIIlIllI,Doomspire_IIIllIIIIllIlIIIlIllI,Doomspire_IIIllIIIIllIlIIIlIllI,Doomspire_IIllllI,Doomspire_IIllllI,Doomspire_IIIllIIIIllIlIIIlIllI,Doomspire_IIIllIIIIllIlIIIlIllI,Doomspire_IIIllIIIIllIlIIIlIllI,Doomspire_lIIIIlIlIII,Doomspire_IIIllIIIIllIlIIIlIllI}local Doomspire_llIllIIlIlll={Doomspire_IIIIIlIllIlIlllllI,Doomspire_lllllIIIIllllllIlIIIl,Doomspire_lIIIlIlIIIIllIII,Doomspire_lIIII,Doomspire_IIlIIIllllIIlllIlIIll,Doomspire_lIlI,Doomspire_lIIIlllIIIlIlIll,Doomspire_lllIIlIlllI,Doomspire_IIlllI,Doomspire_lllllllllIIl,Doomspire_lIIlllllIIIllllIl,Doomspire_IlIIIlIlllIIlll,Doomspire_lIlIIIIIlIIlIIIll,Doomspire_IlIIl,Doomspire_IIIllIlIIIlIlII,Doomspire_lllIllIlllIllIlllI,Doomspire_lIIlIllll,Doomspire_IlIIIlIlIlllI,Doomspire_IIlIIIIlII,Doomspire_IlIIIIIIIIII,Doomspire_IllIIlll,Doomspire_IIIIII,Doomspire_IlIlIlIIll,Doomspire_llIllllIIIIlIIIIlIlI,Doomspire_lIIlllIlIIlII,Doomspire_IIIIIIIIIIIlIIIIIll,Doomspire_lIIIIlIlllIllIllIllI,Doomspire_IIll,Doomspire_lllIlllIlllIIllII,Doomspire_lIllIlIll,Doomspire_IIlIIIIIIIllllIlllIlI,Doomspire_IllIlIl,Doomspire_lIlIlIlIIlII,Doomspire_llIlllIlllIIlIIIIllI,Doomspire_lIlIlIIllIl,Doomspire_lIIIllIIIIlIlIlI,Doomspire_IllllllIIIIII,Doomspire_lllII}local Doomspire_lIlIllllllll=function()local Doomspire_llIlIl='754c9f807d712ede42f8d5c61beb28ca59f458dd14742e2d7174e38852a1a0f14e8ba160e07308d88c4f357d2d0ceac8db594d26e9c764fd92f0d9594ed0a9352759c8525be4'local Doomspire_lIIlllIIIlIIl='714f62dac323149842da6d1481cac9eff54b268d8d571bf8040750ac5802f89e0e7a522c08a5cbde9a52409450479871e91d8e569d05400362153eba36b93c7685ed7b524cebdc79db195fcbc42459802ec3f9f9e40679725ec76d384e6ae293'local Doomspire_llIIllIIl='445a7b9bddd3f1264ad0d03cc4921ba801d0f5427b452eb72e32260ff21557e7d240fd07474b95cf55028af5b47e953e72573a'local Doomspire_llIIlllIIIIllIII='4349d44179e499042c62ae0595a590bc045b5ee89b75d1f68125a88f3365b66862d1afc78bdffbf51be395ddf65807316c8e24bcdd6be1842db7b15561ee4e26d16e45bd72d7cd5ac4c3ca58773272b83929ea93e15f18ee128b5d7e'local Doomspire_lIlllll='716d2db28e4530c1f3fe98157963c6d748c96167afeddf02e8cd87bd90ae7570afed33ad5e84eda411132ef522649157ef2a4f3d89b508f2d8'local Doomspire_lIlIllIlIlllllIll='424a2c53bc79b8201450fe1ab6ffa49dee44ef498fdf43f807e81c68738a8829915b8b'local Doomspire_IIIIIlIlIlllI='4a6cee5c573e731cdc9859261b6111ee34ea18bdaa5c95dfc01e811c3840a6ce2d0dee2dd42afff0f4dc87d68ab73f2fc272d194e28e35c49c2e2d58d5'local Doomspire_IIllIIllIIllIlllIllIIll='4c6def6abd205fcc6b920985627c36db60f113f12da9812f38f2aa206263503e813493e212883c361ec376784ccf5a587be10efe9b940d2a9cb35323248cd7c3ef0d81e00332b0278e78b9841c83ec4015dd2496f8'local Doomspire_lIlIllIIlIIIIIIll='6463b0ec8b3a1163ceea44cbd545d09813ed78ba2b30f7c8d7f41c15089135d1650cb6c9112069ed383fc12c'local Doomspire_lIll={fOkOlQ,LQmoMwlRSjMiWaGISvWllx,aLWrmXLlAf,PwJOsk,CeoFifAxJKgJEc,KkIKz,TQzzOoWTiMxWsZWxwOu,WePfdPAyVIrZj,WwDYvrJsUsWpEKsLBhasJoE}end;Doomspire_IIIlI=function(Doomspire_llllIllllIIllllI)local Doomspire_IlllIIllIllIlIllIIIllIlll=tonumber(Doomspire_llllIllllIIllllI)local Doomspire_lllIlllIlllllIlI=''for i=7,0,-1 do local Doomspire_IlIIIIllll=math.pow(2,i)if Doomspire_IlllIIllIllIlIllIIIllIlll>=Doomspire_IlIIIIllll then Doomspire_lllIlllIlllllIlI=Doomspire_lllIlllIlllllIlI..'1'Doomspire_IlllIIllIllIlIllIIIllIlll=Doomspire_IlllIIllIllIlIllIIIllIlll-Doomspire_IlIIIIllll else Doomspire_lllIlllIlllllIlI=Doomspire_lllIlllIlllllIlI..'0'end end;return Doomspire_lllIlllIlllllIlI end;Doomspire_lllll=function(Doomspire_lIlllIllllIlllIIlll)return tonumber(Doomspire_lIlllIllllIlllIIlll,2)end;Doomspire_lIlIlllIIlIIIIIllIIlllIl=function(Doomspire_IlIllllllIlllI)local Doomspire_lIlIlll=Doomspire_IlIllllllIlllI:gsub("%s","")local Doomspire_IllIIllIIIll=Doomspire_lIlIlll:gsub("=","")local Doomspire_IIIIllIlIll=''local Doomspire_IIIIlIllIIIlIl=''for i=1,Doomspire_IIIll(Doomspire_IllIIllIIIll)do local Doomspire_lllIIl=Doomspire_IIlIIllllIIllIl(Doomspire_IlIllllllIlllI,i,i)local Doomspire_IlIllIIII,Doomspire_llllIIllII=string.find(Doomspire_lIIlIIllIllI(Doomspire_lIIIllIllllllIIIIllIl),Doomspire_lllIIl)if Doomspire_IlIllIIII==nil then error("Invalid character '"..Doomspire_lllIIl.."' found.")end;Doomspire_IIIIllIlIll=Doomspire_IIIIllIlIll..Doomspire_IIlIIllllIIllIl(Doomspire_IIIlI(Doomspire_IlIllIIII-1),3)end;for i=1,Doomspire_IIIll(Doomspire_IIIIllIlIll),8 do local Doomspire_lIlIIlIIIllIIllIlIlIl=Doomspire_IIlIIllllIIllIl(Doomspire_IIIIllIlIll,i,i+7)Doomspire_IIIIlIllIIIlIl=Doomspire_IIIIlIllIIIlIl..Doomspire_lllIIllIIlIII(Doomspire_lllll(Doomspire_lIlIIlIIIllIIllIlIlIl))end;local Doomspire_lIllllllll=Doomspire_lIlIlll:len()-Doomspire_IllIIllIIIll:len()if(Doomspire_lIllllllll==1 or Doomspire_lIllllllll==2)then Doomspire_IIIIlIllIIIlIl=Doomspire_IIIIlIllIIIlIl:sub(1,-2)end;return Doomspire_IIIIlIllIIIlIl end;Doomspire_Ill=function(Doomspire_Il)print(Doomspire_Il)end;Doomspire_IIIIllIlIllll=function(Doomspire_lIIllIlllI)local Doomspire_lIIlIIllll={}local Doomspire_llIllllIII=setmetatable({},Doomspire_lIIlIIllll)function Doomspire_lIIlIIllll:__index(Doomspire_lIIIlIIlIIIIIlIlIIIIl)local Doomspire_IllIlIllll=Doomspire_lIIllIlllI(Doomspire_lIIIlIIlIIIIIlIlIIIIl)Doomspire_llIllllIII[Doomspire_lIIIlIIlIIIIIlIlIIIIl]=Doomspire_IllIlIllll;return Doomspire_IllIlIllll end;return Doomspire_llIllllIII end;Doomspire_lIllIIlI=function(Doomspire_IlIIlIlIllllIIIIIlllI,Doomspire_IlIllIIlIIlIIlIlll)local function Doomspire_IlllIIlIlIII(Doomspire_IIlIlIIlIl,Doomspire_IlIlIIIlIlIIlIIlI)local Doomspire_llIIIlllllIlll,Doomspire_IIIlIlIlIIlll=0,1;while Doomspire_IIlIlIIlIl~=0 and Doomspire_IlIlIIIlIlIIlIIlI~=0 do local Doomspire_IIlllIlIlIll,Doomspire_IllIIIllIl=Doomspire_IIlIlIIlIl%Doomspire_IlIllIIlIIlIIlIlll,Doomspire_IlIlIIIlIlIIlIIlI%Doomspire_IlIllIIlIIlIIlIlll;Doomspire_llIIIlllllIlll=Doomspire_llIIIlllllIlll+Doomspire_IlIIlIlIllllIIIIIlllI[Doomspire_IIlllIlIlIll][Doomspire_IllIIIllIl]*Doomspire_IIIlIlIlIIlll;Doomspire_IIlIlIIlIl=(Doomspire_IIlIlIIlIl-Doomspire_IIlllIlIlIll)/Doomspire_IlIllIIlIIlIIlIlll;Doomspire_IlIlIIIlIlIIlIIlI=(Doomspire_IlIlIIIlIlIIlIIlI-Doomspire_IllIIIllIl)/Doomspire_IlIllIIlIIlIIlIlll;Doomspire_IIIlIlIlIIlll=Doomspire_IIIlIlIlIIlll*Doomspire_IlIllIIlIIlIIlIlll end;Doomspire_llIIIlllllIlll=Doomspire_llIIIlllllIlll+ (Doomspire_IIlIlIIlIl+Doomspire_IlIlIIIlIlIIlIIlI)*Doomspire_IIIlIlIlIIlll;return Doomspire_llIIIlllllIlll end;return Doomspire_IlllIIlIlIII end;Doomspire_IIllIIIlIIIIIIlIllIlI=function(Doomspire_IlIII)local Doomspire_IllIlIlIIl=Doomspire_lIllIIlI(Doomspire_IlIII,2 ^1)local Doomspire_llIlIlIll=Doomspire_IIIIllIlIllll(function(Doomspire_IIllIllIIl)return Doomspire_IIIIllIlIllll(function(Doomspire_lII)return Doomspire_IllIlIlIIl(Doomspire_IIllIllIIl,Doomspire_lII)end)end)return Doomspire_lIllIIlI(Doomspire_llIlIlIll,2 ^ (Doomspire_IlIII.n or 1))end;Doomspire_llllIllIlIlIIlIIII=Doomspire_IIllIIIlIIIIIIlIllIlI{[0]={[0]=0,[1]=1},[1]={[0]=1,[1]=0},n=4}Doomspire_llIIllIIlllllllIlI=function(Doomspire_lIIIIIIlIIIllllIlllIIllllll,Doomspire_IlIIlIIIIllIIIIIII,Doomspire_lII,...)local Doomspire_llIlIlllllllIIllIllIl;if Doomspire_IlIIlIIIIllIIIIIII then Doomspire_lIIIIIIlIIIllllIlllIIllllll=Doomspire_lIIIIIIlIIIllllIlllIIllllll%2 ^32;Doomspire_IlIIlIIIIllIIIIIII=Doomspire_IlIIlIIIIllIIIIIII%2 ^32;Doomspire_llIlIlllllllIIllIllIl=Doomspire_llllIllIlIlIIlIIII(Doomspire_lIIIIIIlIIIllllIlllIIllllll,Doomspire_IlIIlIIIIllIIIIIII)if Doomspire_lII then Doomspire_llIlIlllllllIIllIllIl=Doomspire_llIIllIIlllllllIlI(Doomspire_llIlIlllllllIIllIllIl,Doomspire_lII,...)end;return Doomspire_llIlIlllllllIIllIllIl elseif Doomspire_lIIIIIIlIIIllllIlllIIllllll then return Doomspire_lIIIIIIlIIIllllIlllIIllllll%MOD else return 0 end end;Doomspire_IlllIlIIIllIIIIIIIlIIIllI=function(Doomspire_lIIllIlI,Doomspire_IlIIIIIlllllIllIlI,Doomspire_lIllII)if Doomspire_lIllII then local Doomspire_IIII=0;local Doomspire_IlIIllIlllIIlIllIIlII=0;for i=Doomspire_IlIIIIIlllllIllIlI,Doomspire_lIllII do Doomspire_IIII=Doomspire_IIII+2 ^Doomspire_IlIIllIlllIIlIllIIlII*Doomspire_IlllIlIIIllIIIIIIIlIIIllI(Doomspire_lIIllIlI,i)Doomspire_IlIIllIlllIIlIllIIlII=Doomspire_IlIIllIlllIIlIllIIlII+1 end;return Doomspire_IIII else local Doomspire_lIlIlllIl=2 ^ (Doomspire_IlIIIIIlllllIllIlI-1)return(Doomspire_lIIllIlI% (Doomspire_lIlIlllIl+Doomspire_lIlIlllIl)>=Doomspire_lIlIlllIl)and 1 or 0 end end;Doomspire_IlIlllIlIII=function(Doomspire_lIllIIlIlIIlIlIIIIlI)local Doomspire_llIIIIlIlIlI=1;local Doomspire_III=''local Doomspire_IIllII;local Doomspire_IlIIlIIllllllIII=''if(Doomspire_lIllIIlIlIIlIlIIIIlI==nil)then error("Nil inputs.")else local Doomspire_IIlIIIIllI=1;while Doomspire_IIlIIIIllI<#Doomspire_lIllIIlIlIIlIlIIIIlI+1 do local Doomspire_IIIIIllllllI=Doomspire_IIlIIllllIIllIl(Doomspire_lIllIIlIlIIlIlIIIIlI,Doomspire_IIlIIIIllI,Doomspire_IIlIIIIllI+3)local Doomspire_llIIIllllIIIIllIlll=Doomspire_lIlIlllIIlIIIIIllIIlllIl(Doomspire_IIIIIllllllI)local Doomspire_llIlIIll=Doomspire_IIlIlllII(Doomspire_llIIIllllIIIIllIlll,Doomspire_IIlIllIIllIIlllIIl)local Doomspire_llllIIllIlIIlIIIIlIIl=Doomspire_lIlllIIIIIlllIIll(Doomspire_llIlIIll,Doomspire_lIIllIllll)Doomspire_IlIIlIIllllllIII=Doomspire_IlIIlIIllllllIII..Doomspire_lllIIllIIlIII(Doomspire_llllIIllIlIIlIIIIlIIl)Doomspire_IIlIIIIllI=Doomspire_IIlIIIIllI+4 end end;local Doomspire_llII=1;local Doomspire_IIIII=false;local Doomspire_IIlllllllIIIIIIIll;local Doomspire_llIlIlll;local Doomspire_IlIIll,Doomspire_lllllIIIIIlIlIIIIIl;local Doomspire_IIllIl,Doomspire_lllIlIlII,Doomspire_lIIIllIlIII,Doomspire_lIIIlllIlI,Doomspire_lIIIIlIIIIIlIIlIlII;do function Doomspire_IIllIl()local Doomspire_IllIlllll=Doomspire_IlIIlIIllllllIII:byte(Doomspire_llII,Doomspire_llII)Doomspire_llII=Doomspire_llII+1;return Doomspire_IllIlllll end;function Doomspire_lllIlIlII()local Doomspire_lIlIlI,Doomspire_lIIlllIIllIlllIII,Doomspire_lllIIlllIlII,Doomspire_IIIIIIlIllII=Doomspire_IlIIlIIllllllIII:byte(Doomspire_llII,Doomspire_llII+3)Doomspire_llII=Doomspire_llII+4;return Doomspire_IIIIIIlIllII*16777216 +Doomspire_lllIIlllIlII*65536 +Doomspire_lIIlllIIllIlllIII*256 +Doomspire_lIlIlI end;function Doomspire_lIIIllIlIII()local Doomspire_lIIIIll=Doomspire_lllIlIlII()local Doomspire_llIIIIII=Doomspire_lllIlIlII()return Doomspire_llIIIIII*4294967296 +Doomspire_lIIIIll end;function Doomspire_lIIIlllIlI()local Doomspire_llllIIllllllII=Doomspire_lllIlIlII()local Doomspire_IlIllIIIIlI=Doomspire_lllIlIlII()return(-2 *Doomspire_IlllIlIIIllIIIIIIIlIIIllI(Doomspire_IlIllIIIIlI,32)+1)* (2 ^ (Doomspire_IlllIlIIIllIIIIIIIlIIIllI(Doomspire_IlIllIIIIlI,21,31)-1023))* ( (Doomspire_IlllIlIIIllIIIIIIIlIIIllI(Doomspire_IlIllIIIIlI,1,20)* (2 ^32)+Doomspire_llllIIllllllII)/ (2 ^52)+1)end;function Doomspire_lIIIIlIIIIIlIIlIlII(Doomspire_IlllIlIIllIlllIIllII)local Doomspire_lIlIIllIIIIIllllIll;if Doomspire_IlllIlIIllIlllIIllII then Doomspire_lIlIIllIIIIIllllIll=Doomspire_IlIIlIIllllllIII:sub(Doomspire_llII,Doomspire_llII+Doomspire_IlllIlIIllIlllIIllII-1)Doomspire_llII=Doomspire_llII+Doomspire_IlllIlIIllIlllIIllII else Doomspire_IlllIlIIllIlllIIllII=Doomspire_lllllIIIIIlIlIIIIIl()if Doomspire_IlllIlIIllIlllIIllII==0 then return end;Doomspire_lIlIIllIIIIIllllIll=Doomspire_IlIIlIIllllllIII:sub(Doomspire_llII,Doomspire_llII+Doomspire_IlllIlIIllIlllIIllII-1)Doomspire_llII=Doomspire_llII+Doomspire_IlllIlIIllIlllIIllII end;return Doomspire_lIlIIllIIIIIllllIll end end;local function Doomspire_IIIIIlIllIIIll()local Doomspire_lIIllllIIllIIlIlIl;local Doomspire_lIllIlIllIIll={}local Doomspire_lllIllIlI={}local Doomspire_IIllIlIllI={}local Doomspire_IIIIll={lines={}}Doomspire_lIIllllIIllIIlIlIl={instructions=Doomspire_lIllIlIllIIll,constants=Doomspire_lllIllIlI,prototypes=Doomspire_IIllIlIllI,debug=Doomspire_IIIIll}local Doomspire_IlllIlIIII;Doomspire_lIIllllIIllIIlIlIl.name=Doomspire_lIIIIlIIIIIlIIlIlII()Doomspire_lIIllllIIllIIlIlIl.first_line=Doomspire_IlIIll()Doomspire_lIIllllIIllIIlIlIl.last_line=Doomspire_IlIIll()if Doomspire_lIIllllIIllIIlIlIl.name then Doomspire_lIIllllIIllIIlIlIl.name=Doomspire_lIIllllIIllIIlIlIl.name:sub(1,-2)end;Doomspire_lIIllllIIllIIlIlIl.upvalues=Doomspire_IIllIl()Doomspire_lIIllllIIllIIlIlIl.arguments=Doomspire_IIllIl()Doomspire_lIIllllIIllIIlIlIl.varg=Doomspire_IIllIl()Doomspire_lIIllllIIllIIlIlIl.stack=Doomspire_IIllIl()do Doomspire_IlllIlIIII=Doomspire_IlIIll()for i=1,Doomspire_IlllIlIIII do local Doomspire_IIlIlIlIl={}local Doomspire_lllIlllllI=Doomspire_lllIlIlII()local Doomspire_IIlllIlllIIIlIllII=Doomspire_IlllIlIIIllIIIIIIIlIIIllI(Doomspire_lllIlllllI,1,6)local Doomspire_IIllIlIII=Doomspire_llllIIllll[Doomspire_IIlllIlllIIIlIllII+1]Doomspire_IIlIlIlIl.opcode=Doomspire_IIlllIlllIIIlIllII;Doomspire_IIlIlIlIl.type=Doomspire_IIllIlIII;Doomspire_IIlIlIlIl.A=Doomspire_IlllIlIIIllIIIIIIIlIIIllI(Doomspire_lllIlllllI,7,14)if Doomspire_IIllIlIII=="ABC"then Doomspire_IIlIlIlIl.B=Doomspire_IlllIlIIIllIIIIIIIlIIIllI(Doomspire_lllIlllllI,24,32)Doomspire_IIlIlIlIl.C=Doomspire_IlllIlIIIllIIIIIIIlIIIllI(Doomspire_lllIlllllI,15,23)elseif Doomspire_IIllIlIII=="ABx"then Doomspire_IIlIlIlIl.Bx=Doomspire_IlllIlIIIllIIIIIIIlIIIllI(Doomspire_lllIlllllI,15,32)elseif Doomspire_IIllIlIII=="AsBx"then Doomspire_IIlIlIlIl.sBx=Doomspire_IlllIlIIIllIIIIIIIlIIIllI(Doomspire_lllIlllllI,15,32)-131071 end;Doomspire_lIllIlIllIIll[i]=Doomspire_IIlIlIlIl end end;do Doomspire_IlllIlIIII=Doomspire_IlIIll()for i=1,Doomspire_IlllIlIIII do local Doomspire_IlIIIIlIlllIlIlIIII={}local Doomspire_IlIIllIlIlII=Doomspire_IIllIl()Doomspire_IlIIIIlIlllIlIlIIII.type=Doomspire_IlIIllIlIlII;if Doomspire_IlIIllIlIlII==1 then Doomspire_IlIIIIlIlllIlIlIIII.data=(Doomspire_IIllIl()~=0)elseif Doomspire_IlIIllIlIlII==3 then Doomspire_IlIIIIlIlllIlIlIIII.data=Doomspire_lIIIlllIlI()elseif Doomspire_IlIIllIlIlII==4 then Doomspire_IlIIIIlIlllIlIlIIII.data=Doomspire_lIIIIlIIIIIlIIlIlII():sub(1,-2)end;Doomspire_lllIllIlI[i-1]=Doomspire_IlIIIIlIlllIlIlIIII end end;do Doomspire_IlllIlIIII=Doomspire_IlIIll()for i=1,Doomspire_IlllIlIIII do Doomspire_IIllIlIllI[i-1]=Doomspire_IIIIIlIllIIIll()end end;do local Doomspire_IIIlIllllllI=Doomspire_IIIIll.lines;Doomspire_IlllIlIIII=Doomspire_IlIIll()for i=1,Doomspire_IlllIlIIII do Doomspire_IIIlIllllllI[i]=Doomspire_lllIlIlII()end;Doomspire_IlllIlIIII=Doomspire_IlIIll()for i=1,Doomspire_IlllIlIIII do Doomspire_lIIIIlIIIIIlIIlIlII():sub(1,-2)Doomspire_lllIlIlII()Doomspire_lllIlIlII()end;Doomspire_IlllIlIIII=Doomspire_IlIIll()for i=1,Doomspire_IlllIlIIII do Doomspire_lIIIIlIIIIIlIIlIlII()end end;return Doomspire_lIIllllIIllIIlIlIl end;do assert(Doomspire_lIIIIlIIIIIlIIlIlII(4)=="\27Lua",Doomspire_lIIlIIllIllI(Doomspire_llIlIIIIllII))assert(Doomspire_IIllIl()==0x51,Doomspire_lIIlIIllIllI(Doomspire_IllIIlI))Doomspire_IIllIl()Doomspire_IIIII=(Doomspire_IIllIl()==0)Doomspire_IIlllllllIIIIIIIll=Doomspire_IIllIl()Doomspire_llIlIlll=Doomspire_IIllIl()if Doomspire_IIlllllllIIIIIIIll==4 then Doomspire_IlIIll=Doomspire_lllIlIlII elseif Doomspire_IIlllllllIIIIIIIll==8 then Doomspire_IlIIll=Doomspire_lIIIllIlIII else error(Doomspire_lIllIIIllIlIlll)end;if Doomspire_llIlIlll==4 then Doomspire_lllllIIIIIlIlIIIIIl=Doomspire_lllIlIlII elseif Doomspire_llIlIlll==8 then Doomspire_lllllIIIIIlIlIIIIIl=Doomspire_lIIIllIlIII else error(Doomspire_lIIlIIllIllI(Doomspire_lIllIIIllIlIlll))end;assert(Doomspire_lIIIIlIIIIIlIIlIlII(3)=="\4\8\0",Doomspire_lIllIIIllIlIlll)end;return Doomspire_IIIIIlIllIIIll()end;local function Doomspire_IlIIIlIlIl(...)local Doomspire_lIIIIlllIIllII=select("#",...)local Doomspire_IIIIIllIIIIIIl={...}return Doomspire_lIIIIlllIIllII,Doomspire_IIIIIllIIIIIIl end;Doomspire_IlIlllllllII=function(Doomspire_III,Doomspire_IlIIlllII)local Doomspire_llIlllIlII=Doomspire_III.instructions;local Doomspire_IlIIIIIlllIIIIIlll=Doomspire_III.constants;local Doomspire_lIlIlIllIIIIIlI=Doomspire_III.prototypes;local Doomspire_IlllIIllIllllIlIIIl,Doomspire_IIlIllIlIlIIIllIIIllI;local Doomspire_llllIIIlIlIII;local Doomspire_lIlIIlIIllIIlIIIlIIII=1;local Doomspire_lIIIIIIIlIllIl,Doomspire_IllIlIIIlllI;local Doomspire_IlIllIIIl={[0]=function(Doomspire_lllIIIllIIll)Doomspire_IlllIIllIllllIlIIIl[Doomspire_lllIIIllIIll.A]=Doomspire_IlllIIllIllllIlIIIl[Doomspire_lllIIIllIIll.B]end,[1]=function(Doomspire_IlIlIIl)Doomspire_IlllIIllIllllIlIIIl[Doomspire_IlIlIIl.A]=Doomspire_IlIIIIIlllIIIIIlll[Doomspire_IlIlIIl.Bx].data end,[2]=function(Doomspire_IIIlIIIlllIll)Doomspire_IlllIIllIllllIlIIIl[Doomspire_IIIlIIIlllIll.A]=Doomspire_IIIlIIIlllIll.B~=0;if Doomspire_IIIlIIIlllIll.C~=0 then Doomspire_lIlIIlIIllIIlIIIlIIII=Doomspire_lIlIIlIIllIIlIIIlIIII+1 end end,[3]=function(Doomspire_lIIlllll)local Doomspire_IlIllllIIll=Doomspire_IlllIIllIllllIlIIIl;for i=Doomspire_lIIlllll.A,Doomspire_lIIlllll.B do Doomspire_IlIllllIIll[i]=nil end end,[4]=function(Doomspire_lIlIlIIIlllIIIIlIII)Doomspire_IlllIIllIllllIlIIIl[Doomspire_lIlIlIIIlllIIIIlIII.A]=Doomspire_IlIIlllII[Doomspire_lIlIlIIIlllIIIIlIII.B]end,[5]=function(Doomspire_lIllIllIlII)local Doomspire_llIllI=Doomspire_IlIIIIIlllIIIIIlll[Doomspire_lIllIllIlII.Bx].data;Doomspire_IlllIIllIllllIlIIIl[Doomspire_lIllIllIlII.A]=Doomspire_llllIIIlIlIII[Doomspire_llIllI]end,[6]=function(Doomspire_IlIIIlIlllIlIIIl)local Doomspire_IlIlIllIIlIIIIlIIlIl=Doomspire_IlIIIlIlllIlIIIl.C;local Doomspire_IllIIlIIIlll=Doomspire_IlllIIllIllllIlIIIl;Doomspire_IlIlIllIIlIIIIlIIlIl=Doomspire_IlIlIllIIlIIIIlIIlIl>255 and Doomspire_IlIIIIIlllIIIIIlll[Doomspire_IlIlIllIIlIIIIlIIlIl-256].data or Doomspire_IllIIlIIIlll[Doomspire_IlIlIllIIlIIIIlIIlIl]Doomspire_IllIIlIIIlll[Doomspire_IlIIIlIlllIlIIIl.A]=Doomspire_IllIIlIIIlll[Doomspire_IlIIIlIlllIlIIIl.B][Doomspire_IlIlIllIIlIIIIlIIlIl]end,[7]=function(Doomspire_lIIIIIIIIIllllI)local Doomspire_llIlIllII=Doomspire_IlIIIIIlllIIIIIlll[Doomspire_lIIIIIIIIIllllI.Bx].data;Doomspire_llllIIIlIlIII[Doomspire_llIlIllII]=Doomspire_IlllIIllIllllIlIIIl[Doomspire_lIIIIIIIIIllllI.A]end,[8]=function(Doomspire_IlIIIllllllIIIlII)Doomspire_IlIIlllII[Doomspire_IlIIIllllllIIIlII.B]=Doomspire_IlllIIllIllllIlIIIl[Doomspire_IlIIIllllllIIIlII.A]end,[9]=function(Doomspire_IIIIlIlIIlIIllIIII)local Doomspire_llIlllllIlllllIlllll=Doomspire_IIIIlIlIIlIIllIIII.B;local Doomspire_llIIllIIl=Doomspire_IIIIlIlIIlIIllIIII.C;local Doomspire_llIllI,Doomspire_llIIIIIllIIl=Doomspire_IlllIIllIllllIlIIIl,Doomspire_IlIIIIIlllIIIIIlll;Doomspire_llIlllllIlllllIlllll=Doomspire_llIlllllIlllllIlllll>255 and Doomspire_llIIIIIllIIl[Doomspire_llIlllllIlllllIlllll-256].data or Doomspire_llIllI[Doomspire_llIlllllIlllllIlllll]Doomspire_llIIllIIl=Doomspire_llIIllIIl>255 and Doomspire_llIIIIIllIIl[Doomspire_llIIllIIl-256].data or Doomspire_llIllI[Doomspire_llIIllIIl]Doomspire_llIllI[Doomspire_IIIIlIlIIlIIllIIII.A][Doomspire_llIlllllIlllllIlllll]=Doomspire_llIIllIIl end,[10]=function(Doomspire_IIII)Doomspire_IlllIIllIllllIlIIIl[Doomspire_IIII.A]={}end,[11]=function(Doomspire_IlIlllllIIlIlIlIll)local Doomspire_llllIIlIIllI=Doomspire_IlIlllllIIlIlIlIll.A;local Doomspire_llllI=Doomspire_IlIlllllIIlIlIlIll.B;local Doomspire_IllIlIlIlllI=Doomspire_IlIlllllIIlIlIlIll.C;local Doomspire_IIllIlllll=Doomspire_IlllIIllIllllIlIIIl;Doomspire_llllI=Doomspire_IIllIlllll[Doomspire_llllI]Doomspire_IllIlIlIlllI=Doomspire_IllIlIlIlllI>255 and Doomspire_IlIIIIIlllIIIIIlll[Doomspire_IllIlIlIlllI-256].data or Doomspire_IIllIlllll[Doomspire_IllIlIlIlllI]Doomspire_IIllIlllll[Doomspire_llllIIlIIllI+1]=Doomspire_llllI;Doomspire_IIllIlllll[Doomspire_llllIIlIIllI]=Doomspire_llllI[Doomspire_IllIlIlIlllI]end,[12]=function(Doomspire_llIIIlIlIlI)local Doomspire_lIllll=Doomspire_llIIIlIlIlI.B;local Doomspire_IIlIllllIIIlIlIIIIIlI=Doomspire_llIIIlIlIlI.C;local Doomspire_lllIll,Doomspire_llIIllIlllIlIIlII=Doomspire_IlllIIllIllllIlIIIl,Doomspire_IlIIIIIlllIIIIIlll;Doomspire_lIllll=Doomspire_lIllll>255 and Doomspire_llIIllIlllIlIIlII[Doomspire_lIllll-256].data or Doomspire_lllIll[Doomspire_lIllll]Doomspire_IIlIllllIIIlIlIIIIIlI=Doomspire_IIlIllllIIIlIlIIIIIlI>255 and Doomspire_llIIllIlllIlIIlII[Doomspire_IIlIllllIIIlIlIIIIIlI-256].data or Doomspire_lllIll[Doomspire_IIlIllllIIIlIlIIIIIlI]Doomspire_lllIll[Doomspire_llIIIlIlIlI.A]=Doomspire_lIllll+Doomspire_IIlIllllIIIlIlIIIIIlI end,[13]=function(Doomspire_IllIIlllllIIlIIlI)local Doomspire_IllllIlI=Doomspire_IllIIlllllIIlIIlI.B;local Doomspire_IIIIIlIIllllIlllII=Doomspire_IllIIlllllIIlIIlI.C;local Doomspire_lIIlIlllIllIlI,Doomspire_lIlllIllIlIIIIIIllIl=Doomspire_IlllIIllIllllIlIIIl,Doomspire_IlIIIIIlllIIIIIlll;Doomspire_IllllIlI=Doomspire_IllllIlI>255 and Doomspire_lIlllIllIlIIIIIIllIl[Doomspire_IllllIlI-256].data or Doomspire_lIIlIlllIllIlI[Doomspire_IllllIlI]Doomspire_IIIIIlIIllllIlllII=Doomspire_IIIIIlIIllllIlllII>255 and Doomspire_lIlllIllIlIIIIIIllIl[Doomspire_IIIIIlIIllllIlllII-256].data or Doomspire_lIIlIlllIllIlI[Doomspire_IIIIIlIIllllIlllII]Doomspire_lIIlIlllIllIlI[Doomspire_IllIIlllllIIlIIlI.A]=Doomspire_IllllIlI-Doomspire_IIIIIlIIllllIlllII end,[14]=function(Doomspire_llIIlIl)local Doomspire_IIIllIIIlIlllIIlIlIllIIlll=Doomspire_llIIlIl.B;local Doomspire_IIIIIllIllIlIlIII=Doomspire_llIIlIl.C;local Doomspire_llIIIl,Doomspire_lIIlllllI=Doomspire_IlllIIllIllllIlIIIl,Doomspire_IlIIIIIlllIIIIIlll;Doomspire_IIIllIIIlIlllIIlIlIllIIlll=Doomspire_IIIllIIIlIlllIIlIlIllIIlll>255 and Doomspire_lIIlllllI[Doomspire_IIIllIIIlIlllIIlIlIllIIlll-256].data or Doomspire_llIIIl[Doomspire_IIIllIIIlIlllIIlIlIllIIlll]Doomspire_IIIIIllIllIlIlIII=Doomspire_IIIIIllIllIlIlIII>255 and Doomspire_lIIlllllI[Doomspire_IIIIIllIllIlIlIII-256].data or Doomspire_llIIIl[Doomspire_IIIIIllIllIlIlIII]Doomspire_llIIIl[Doomspire_llIIlIl.A]=Doomspire_IIIllIIIlIlllIIlIlIllIIlll*Doomspire_IIIIIllIllIlIlIII end,[15]=function(Doomspire_llIlI)local Doomspire_Illll=Doomspire_llIlI.B;local Doomspire_IIIlIIlI=Doomspire_llIlI.C;local Doomspire_lllIIIlIIIllI,Doomspire_IIlIIIIIlIlIlllllI=Doomspire_IlllIIllIllllIlIIIl,Doomspire_IlIIIIIlllIIIIIlll;Doomspire_Illll=Doomspire_Illll>255 and Doomspire_IIlIIIIIlIlIlllllI[Doomspire_Illll-256].data or Doomspire_lllIIIlIIIllI[Doomspire_Illll]Doomspire_IIIlIIlI=Doomspire_IIIlIIlI>255 and Doomspire_IIlIIIIIlIlIlllllI[Doomspire_IIIlIIlI-256].data or Doomspire_lllIIIlIIIllI[Doomspire_IIIlIIlI]Doomspire_lllIIIlIIIllI[Doomspire_llIlI.A]=Doomspire_Illll/Doomspire_IIIlIIlI end,[16]=function(Doomspire_IIIlIIlIlIlIlIl)local Doomspire_IIllIIIIllllIlIlllIlIIIll=Doomspire_IIIlIIlIlIlIlIl.B;local Doomspire_llIlIIlllllI=Doomspire_IIIlIIlIlIlIlIl.C;local Doomspire_IllIIllllIl,Doomspire_IlIIllllII=Doomspire_IlllIIllIllllIlIIIl,Doomspire_IlIIIIIlllIIIIIlll;Doomspire_IIllIIIIllllIlIlllIlIIIll=Doomspire_IIllIIIIllllIlIlllIlIIIll>255 and Doomspire_IlIIllllII[Doomspire_IIllIIIIllllIlIlllIlIIIll-256].data or Doomspire_IllIIllllIl[Doomspire_IIllIIIIllllIlIlllIlIIIll]Doomspire_llIlIIlllllI=Doomspire_llIlIIlllllI>255 and Doomspire_IlIIllllII[Doomspire_llIlIIlllllI-256].data or Doomspire_IllIIllllIl[Doomspire_llIlIIlllllI]Doomspire_IllIIllllIl[Doomspire_IIIlIIlIlIlIlIl.A]=Doomspire_IIllIIIIllllIlIlllIlIIIll%Doomspire_llIlIIlllllI end,[17]=function(Doomspire_lIllIllIIlIIlIIIl)local Doomspire_IlllIlIIlIIllIIll=Doomspire_lIllIllIIlIIlIIIl.B;local Doomspire_IlIIIl=Doomspire_lIllIllIIlIIlIIIl.C;local Doomspire_lllIIIllIlIIIIlIllI,Doomspire_llllIlIIllIlI=Doomspire_IlllIIllIllllIlIIIl,Doomspire_IlIIIIIlllIIIIIlll;Doomspire_IlllIlIIlIIllIIll=Doomspire_IlllIlIIlIIllIIll>255 and Doomspire_llllIlIIllIlI[Doomspire_IlllIlIIlIIllIIll-256].data or Doomspire_lllIIIllIlIIIIlIllI[Doomspire_IlllIlIIlIIllIIll]Doomspire_IlIIIl=Doomspire_IlIIIl>255 and Doomspire_llllIlIIllIlI[Doomspire_IlIIIl-256].data or Doomspire_lllIIIllIlIIIIlIllI[Doomspire_IlIIIl]Doomspire_lllIIIllIlIIIIlIllI[Doomspire_lIllIllIIlIIlIIIl.A]=Doomspire_IlllIlIIlIIllIIll^Doomspire_IlIIIl end,[18]=function(Doomspire_lIIlIIIIIIlllIIlIII)Doomspire_IlllIIllIllllIlIIIl[Doomspire_lIIlIIIIIIlllIIlIII.A]=-Doomspire_IlllIIllIllllIlIIIl[Doomspire_lIIlIIIIIIlllIIlIII.B]end,[19]=function(Doomspire_IlllllIllllllIIII)Doomspire_IlllIIllIllllIlIIIl[Doomspire_IlllllIllllllIIII.A]=not Doomspire_IlllIIllIllllIlIIIl[Doomspire_IlllllIllllllIIII.B]end,[20]=function(Doomspire_IllIlIIIllI)Doomspire_IlllIIllIllllIlIIIl[Doomspire_IllIlIIIllI.A]=#Doomspire_IlllIIllIllllIlIIIl[Doomspire_IllIlIIIllI.B]end,[21]=function(Doomspire_IlllllIlIlllllIlllIlI)local Doomspire_IllIlIIlIIlllIIlll=Doomspire_IlllllIlIlllllIlllIlI.B;local Doomspire_IIlIIllIIIlIllllll=Doomspire_IlllIIllIllllIlIIIl[Doomspire_IllIlIIlIIlllIIlll]for i=Doomspire_IllIlIIlIIlllIIlll+1,Doomspire_IlllllIlIlllllIlllIlI.C do Doomspire_IIlIIllIIIlIllllll=Doomspire_IIlIIllIIIlIllllll..Doomspire_IlllIIllIllllIlIIIl[i]end;Doomspire_IlllIIllIllllIlIIIl[Doomspire_IlllllIlIlllllIlllIlI.A]=Doomspire_IIlIIllIIIlIllllll end,[22]=function(Doomspire_lIlIlII)Doomspire_lIlIIlIIllIIlIIIlIIII=Doomspire_lIlIIlIIllIIlIIIlIIII+Doomspire_lIlIlII.sBx end,[23]=function(Doomspire_lIlIIIIIl)local Doomspire_lIlllllIIIIllIllIlII=Doomspire_lIlIIIIIl.A;local Doomspire_IlIlIlllIl=Doomspire_lIlIIIIIl.B;local Doomspire_llIIIIllIlIIIll=Doomspire_lIlIIIIIl.C;local Doomspire_IllIIlIlllllIIIIllII,Doomspire_llII=Doomspire_IlllIIllIllllIlIIIl,Doomspire_IlIIIIIlllIIIIIlll;Doomspire_lIlllllIIIIllIllIlII=Doomspire_lIlllllIIIIllIllIlII~=0;Doomspire_IlIlIlllIl=Doomspire_IlIlIlllIl>255 and Doomspire_llII[Doomspire_IlIlIlllIl-256].data or Doomspire_IllIIlIlllllIIIIllII[Doomspire_IlIlIlllIl]Doomspire_llIIIIllIlIIIll=Doomspire_llIIIIllIlIIIll>255 and Doomspire_llII[Doomspire_llIIIIllIlIIIll-256].data or Doomspire_IllIIlIlllllIIIIllII[Doomspire_llIIIIllIlIIIll]if(Doomspire_IlIlIlllIl==Doomspire_llIIIIllIlIIIll)~=Doomspire_lIlllllIIIIllIllIlII then Doomspire_lIlIIlIIllIIlIIIlIIII=Doomspire_lIlIIlIIllIIlIIIlIIII+1 end end,[24]=function(Doomspire_IIIlIIIIlIIIlIlIl)local Doomspire_IllIIIlIlll=Doomspire_IIIlIIIIlIIIlIlIl.A;local Doomspire_llIIlIlIIIIlllll=Doomspire_IIIlIIIIlIIIlIlIl.B;local Doomspire_IllllllllIlIllll=Doomspire_IIIlIIIIlIIIlIlIl.C;local Doomspire_lIlIllll,Doomspire_IlIIlIIlll=Doomspire_IlllIIllIllllIlIIIl,Doomspire_IlIIIIIlllIIIIIlll;Doomspire_IllIIIlIlll=Doomspire_IllIIIlIlll~=0;Doomspire_llIIlIlIIIIlllll=Doomspire_llIIlIlIIIIlllll>255 and Doomspire_IlIIlIIlll[Doomspire_llIIlIlIIIIlllll-256].data or Doomspire_lIlIllll[Doomspire_llIIlIlIIIIlllll]Doomspire_IllllllllIlIllll=Doomspire_IllllllllIlIllll>255 and Doomspire_IlIIlIIlll[Doomspire_IllllllllIlIllll-256].data or Doomspire_lIlIllll[Doomspire_IllllllllIlIllll]if(Doomspire_llIIlIlIIIIlllll<Doomspire_IllllllllIlIllll)~=Doomspire_IllIIIlIlll then Doomspire_lIlIIlIIllIIlIIIlIIII=Doomspire_lIlIIlIIllIIlIIIlIIII+1 end end,[25]=function(Doomspire_llIllIlIIlIl)local Doomspire_IllllIIlllIllIlII=Doomspire_llIllIlIIlIl.A;local Doomspire_IlIlllIlIIllIlllIIl=Doomspire_llIllIlIIlIl.B;local Doomspire_IlllIlllll=Doomspire_llIllIlIIlIl.C;local Doomspire_IlllIllIllIlIlllII,Doomspire_IlIlIIIlIIllIlIl=Doomspire_IlllIIllIllllIlIIIl,Doomspire_IlIIIIIlllIIIIIlll;Doomspire_IllllIIlllIllIlII=Doomspire_IllllIIlllIllIlII~=0;Doomspire_IlIlllIlIIllIlllIIl=Doomspire_IlIlllIlIIllIlllIIl>255 and Doomspire_IlIlIIIlIIllIlIl[Doomspire_IlIlllIlIIllIlllIIl-256].data or Doomspire_IlllIllIllIlIlllII[Doomspire_IlIlllIlIIllIlllIIl]Doomspire_IlllIlllll=Doomspire_IlllIlllll>255 and Doomspire_IlIlIIIlIIllIlIl[Doomspire_IlllIlllll-256].data or Doomspire_IlllIllIllIlIlllII[Doomspire_IlllIlllll]if(Doomspire_IlIlllIlIIllIlllIIl<=Doomspire_IlllIlllll)~=Doomspire_IllllIIlllIllIlII then Doomspire_lIlIIlIIllIIlIIIlIIII=Doomspire_lIlIIlIIllIIlIIIlIIII+1 end end,[26]=function(Doomspire_IllIlllllIllllIl)if(not not Doomspire_IlllIIllIllllIlIIIl[Doomspire_IllIlllllIllllIl.A])== (Doomspire_IllIlllllIllllIl.C==0)then Doomspire_lIlIIlIIllIIlIIIlIIII=Doomspire_lIlIIlIIllIIlIIIlIIII+1 end end,[27]=function(Doomspire_IIllllIIIIllI)local Doomspire_lllllllIIIIIlIIIIIllllII=Doomspire_IlllIIllIllllIlIIIl;local Doomspire_IllllIl=Doomspire_lllllllIIIIIlIIIIIllllII[Doomspire_IIllllIIIIllI.B]if(not not Doomspire_IllllIl)== (Doomspire_IIllllIIIIllI.C==0)then Doomspire_lIlIIlIIllIIlIIIlIIII=Doomspire_lIlIIlIIllIIlIIIlIIII+1 else Doomspire_lllllllIIIIIlIIIIIllllII[Doomspire_IIllllIIIIllI.A]=Doomspire_IllllIl end end,[28]=function(Doomspire_IIIlIIlIllllIlII)local Doomspire_IlIIllllllII=Doomspire_IIIlIIlIllllIlII.A;local Doomspire_IIlIlIIIlll=Doomspire_IIIlIIlIllllIlII.B;local Doomspire_lllIlIIIIIllllIllll=Doomspire_IIIlIIlIllllIlII.C;local Doomspire_lIllIIlIIIIIIIIIlI=Doomspire_IlllIIllIllllIlIIIl;local Doomspire_IIIIIII,Doomspire_lIlIlIlllIllllllIIlI;local Doomspire_IlIllIlII,Doomspire_llIIIllllIIlIllIllIlllII;Doomspire_IIIIIII={}if Doomspire_IIlIlIIIlll~=1 then if Doomspire_IIlIlIIIlll~=0 then Doomspire_IlIllIlII=Doomspire_IlIIllllllII+Doomspire_IIlIlIIIlll-1 else Doomspire_IlIllIlII=Doomspire_IIlIllIlIlIIIllIIIllI end;Doomspire_llIIIllllIIlIllIllIlllII=0;for i=Doomspire_IlIIllllllII+1,Doomspire_IlIllIlII do Doomspire_llIIIllllIIlIllIllIlllII=Doomspire_llIIIllllIIlIllIllIlllII+1;Doomspire_IIIIIII[Doomspire_llIIIllllIIlIllIllIlllII]=Doomspire_lIllIIlIIIIIIIIIlI[i]end;Doomspire_IlIllIlII,Doomspire_lIlIlIlllIllllllIIlI=Doomspire_IlIIIlIlIl(Doomspire_lIllIIlIIIIIIIIIlI[Doomspire_IlIIllllllII](unpack(Doomspire_IIIIIII,1,Doomspire_IlIllIlII-Doomspire_IlIIllllllII)))else Doomspire_IlIllIlII,Doomspire_lIlIlIlllIllllllIIlI=Doomspire_IlIIIlIlIl(Doomspire_lIllIIlIIIIIIIIIlI[Doomspire_IlIIllllllII]())end;Doomspire_IIlIllIlIlIIIllIIIllI=Doomspire_IlIIllllllII-1;if Doomspire_lllIlIIIIIllllIllll~=1 then if Doomspire_lllIlIIIIIllllIllll~=0 then Doomspire_IlIllIlII=Doomspire_IlIIllllllII+Doomspire_lllIlIIIIIllllIllll-2 else Doomspire_IlIllIlII=Doomspire_IlIllIlII+Doomspire_IlIIllllllII end;Doomspire_llIIIllllIIlIllIllIlllII=0;for i=Doomspire_IlIIllllllII,Doomspire_IlIllIlII do Doomspire_llIIIllllIIlIllIllIlllII=Doomspire_llIIIllllIIlIllIllIlllII+1;Doomspire_lIllIIlIIIIIIIIIlI[i]=Doomspire_lIlIlIlllIllllllIIlI[Doomspire_llIIIllllIIlIllIllIlllII]end end end,[29]=function(Doomspire_IIllIlllllIlI)local Doomspire_llIIlIlIlllIlllIIllIIIlIIIIl=Doomspire_IIllIlllllIlI.A;local Doomspire_IIlIIlIlIlIIIIlIIlII=Doomspire_IIllIlllllIlI.B;local Doomspire_lIllIlIllllIllIlll=Doomspire_IIllIlllllIlI.C;local Doomspire_lllIIlIIIIlIllIIlll=Doomspire_IlllIIllIllllIlIIIl;local Doomspire_lIIll,Doomspire_llllIIllllI;local Doomspire_lllIIllllIIIlllIIlIlI,Doomspire_lllllIllIlIIllIlIlIl,Doomspire_IIlllIIllllIlIl=Doomspire_IIlIllIlIlIIIllIIIllI;Doomspire_lIIll={}if Doomspire_IIlIIlIlIlIIIIlIIlII~=1 then if Doomspire_IIlIIlIlIlIIIIlIIlII~=0 then Doomspire_lllllIllIlIIllIlIlIl=Doomspire_llIIlIlIlllIlllIIllIIIlIIIIl+Doomspire_IIlIIlIlIlIIIIlIIlII-1 else Doomspire_lllllIllIlIIllIlIlIl=Doomspire_lllIIllllIIIlllIIlIlI end;Doomspire_IIlllIIllllIlIl=0;for i=Doomspire_llIIlIlIlllIlllIIllIIIlIIIIl+1,Doomspire_lllllIllIlIIllIlIlIl do Doomspire_IIlllIIllllIlIl=Doomspire_IIlllIIllllIlIl+1;Doomspire_lIIll[#Doomspire_lIIll+1]=Doomspire_lllIIlIIIIlIllIIlll[i]end;Doomspire_llllIIllllI={Doomspire_lllIIlIIIIlIllIIlll[Doomspire_llIIlIlIlllIlllIIllIIIlIIIIl](unpack(Doomspire_lIIll,1,Doomspire_lllllIllIlIIllIlIlIl-Doomspire_llIIlIlIlllIlllIIllIIIlIIIIl))}else Doomspire_llllIIllllI={Doomspire_lllIIlIIIIlIllIIlll[Doomspire_llIIlIlIlllIlllIIllIIIlIIIIl]()}end;return true,Doomspire_llllIIllllI end,[30]=function(Doomspire_lllllIllI)local Doomspire_IIlIIIIlIIIlIlIIIlI=Doomspire_lllllIllI.A;local Doomspire_IllllIIlIIlIllIllIlll=Doomspire_lllllIllI.B;local Doomspire_llIIIlIIlIIllIll=Doomspire_IlllIIllIllllIlIIIl;local Doomspire_llII;local Doomspire_llllIlllll,Doomspire_IlIlIIIIllIlIIlIl;if Doomspire_IllllIIlIIlIllIllIlll==1 then return true end;if Doomspire_IllllIIlIIlIllIllIlll==0 then Doomspire_llII=Doomspire_IIlIllIlIlIIIllIIIllI else Doomspire_llII=Doomspire_IIlIIIIlIIIlIlIIIlI+Doomspire_IllllIIlIIlIllIllIlll-2 end;Doomspire_IlIlIIIIllIlIIlIl={}local Doomspire_IllIIllIIIlllllIllI=0;for i=Doomspire_IIlIIIIlIIIlIlIIIlI,Doomspire_llII do Doomspire_IllIIllIIIlllllIllI=Doomspire_IllIIllIIIlllllIllI+1;Doomspire_IlIlIIIIllIlIIlIl[Doomspire_IllIIllIIIlllllIllI]=Doomspire_llIIIlIIlIIllIll[i]end;return true,Doomspire_IlIlIIIIllIlIIlIl end,[31]=function(Doomspire_lIIlllllIllll)local Doomspire_IIlIlIllIIIlIIIIIIlIlIllI=Doomspire_lIIlllllIllll.A;local Doomspire_IIlIIIlll=Doomspire_IlllIIllIllllIlIIIl;local Doomspire_lllIllIIlIlIllIIIlllIl=Doomspire_IIlIIIlll[Doomspire_IIlIlIllIIIlIIIIIIlIlIllI+2]local Doomspire_lIllllIIIIIII=Doomspire_IIlIIIlll[Doomspire_IIlIlIllIIIlIIIIIIlIlIllI]+Doomspire_lllIllIIlIlIllIIIlllIl;Doomspire_IIlIIIlll[Doomspire_IIlIlIllIIIlIIIIIIlIlIllI]=Doomspire_lIllllIIIIIII;if Doomspire_lllIllIIlIlIllIIIlllIl>0 then if Doomspire_lIllllIIIIIII<=Doomspire_IIlIIIlll[Doomspire_IIlIlIllIIIlIIIIIIlIlIllI+1]then Doomspire_lIlIIlIIllIIlIIIlIIII=Doomspire_lIlIIlIIllIIlIIIlIIII+Doomspire_lIIlllllIllll.sBx;Doomspire_IIlIIIlll[Doomspire_IIlIlIllIIIlIIIIIIlIlIllI+3]=Doomspire_lIllllIIIIIII end else if Doomspire_lIllllIIIIIII>=Doomspire_IIlIIIlll[Doomspire_IIlIlIllIIIlIIIIIIlIlIllI+1]then Doomspire_lIlIIlIIllIIlIIIlIIII=Doomspire_lIlIIlIIllIIlIIIlIIII+Doomspire_lIIlllllIllll.sBx;Doomspire_IIlIIIlll[Doomspire_IIlIlIllIIIlIIIIIIlIlIllI+3]=Doomspire_lIllllIIIIIII end end end,[32]=function(Doomspire_lIlllllIIl)local Doomspire_llIIIllIlIIIlIlllI=Doomspire_lIlllllIIl.A;local Doomspire_IlIIIIIllIlIII=Doomspire_IlllIIllIllllIlIIIl;Doomspire_IlIIIIIllIlIII[Doomspire_llIIIllIlIIIlIlllI]=Doomspire_IlIIIIIllIlIII[Doomspire_llIIIllIlIIIlIlllI]-Doomspire_IlIIIIIllIlIII[Doomspire_llIIIllIlIIIlIlllI+2]Doomspire_lIlIIlIIllIIlIIIlIIII=Doomspire_lIlIIlIIllIIlIIIlIIII+Doomspire_lIlllllIIl.sBx end,[33]=function(Doomspire_llIlIII)local Doomspire_llIIllIlIl=Doomspire_llIlIII.A;local Doomspire_IIlIIIllllIIIllII=Doomspire_llIlIII.B;local Doomspire_llIIllI=Doomspire_llIlIII.C;local Doomspire_llIlIlllIlIlllIIIl=Doomspire_IlllIIllIllllIlIIIl;local Doomspire_llIllllIlIIlIIll=Doomspire_llIIllIlIl+2;local Doomspire_IlIlllIlIllIII={Doomspire_llIlIlllIlIlllIIIl[Doomspire_llIIllIlIl](Doomspire_llIlIlllIlIlllIIIl[Doomspire_llIIllIlIl+1],Doomspire_llIlIlllIlIlllIIIl[Doomspire_llIIllIlIl+2])}for i=1,Doomspire_llIIllI do Doomspire_llIlIlllIlIlllIIIl[Doomspire_llIllllIlIIlIIll+i]=Doomspire_IlIlllIlIllIII[i]end;if Doomspire_llIlIlllIlIlllIIIl[Doomspire_llIIllIlIl+3]~=nil then Doomspire_llIlIlllIlIlllIIIl[Doomspire_llIIllIlIl+2]=Doomspire_llIlIlllIlIlllIIIl[Doomspire_llIIllIlIl+3]else Doomspire_lIlIIlIIllIIlIIIlIIII=Doomspire_lIlIIlIIllIIlIIIlIIII+1 end end,[34]=function(Doomspire_IllIlIIlIIIllll)local Doomspire_IIIIlllIIIlllll=Doomspire_IllIlIIlIIIllll.A;local Doomspire_IlIlIIllIl=Doomspire_IllIlIIlIIIllll.B;local Doomspire_IlIl=Doomspire_IllIlIIlIIIllll.C;local Doomspire_lllIIlIlI=Doomspire_IlllIIllIllllIlIIIl;if Doomspire_IlIl==0 then error("Something went wrong here....")else local Doomspire_IIlIlIIlI=(Doomspire_IlIl-1)*50;local Doomspire_lIIlI=Doomspire_lllIIlIlI[Doomspire_IIIIlllIIIlllll]if Doomspire_IlIlIIllIl==0 then Doomspire_IlIlIIllIl=Doomspire_IIlIllIlIlIIIllIIIllI end;for i=1,Doomspire_IlIlIIllIl do Doomspire_lIIlI[Doomspire_IIlIlIIlI+i]=Doomspire_lllIIlIlI[Doomspire_IIIIlllIIIlllll+i]end end end,[35]=function(Doomspire_lIIIllIIIIllIllI)end,[36]=function(Doomspire_lIlllII)local Doomspire_lIIIll=Doomspire_lIlIlIllIIIIIlI[Doomspire_lIlllII.Bx]local Doomspire_llllIl=Doomspire_llIlllIlII;local Doomspire_lIIlIIIllI=Doomspire_IlllIIllIllllIlIIIl;local Doomspire_IllIll={}local Doomspire_lIIlIIlIIIllIIIllIlIl=Doomspire_IlIlIlIlIII({},{__index=function(Doomspire_lIIll,Doomspire_lllllllIllIIIllIllI)local Doomspire_IIIlllllI=Doomspire_IllIll[Doomspire_lllllllIllIIIllIllI]return Doomspire_IIIlllllI.segment[Doomspire_IIIlllllI.offset]end,__newindex=function(Doomspire_llIIlIIlIIl,Doomspire_llIlIIIIIIll,Doomspire_IIlllIIIlIIII)local Doomspire_llIllIlIIIlllIlllllIIl=Doomspire_IllIll[Doomspire_llIlIIIIIIll]Doomspire_llIllIlIIIlllIlllllIIl.segment[Doomspire_llIllIlIIIlllIlllllIIl.offset]=Doomspire_IIlllIIIlIIII end})for i=1,Doomspire_lIIIll.upvalues do local Doomspire_lllllIlllI=Doomspire_llllIl[Doomspire_lIlIIlIIllIIlIIIlIIII]if Doomspire_lllllIlllI.opcode==0 then Doomspire_IllIll[i-1]={segment=Doomspire_lIIlIIIllI,offset=Doomspire_lllllIlllI.B}elseif Doomspire_llllIl[Doomspire_lIlIIlIIllIIlIIIlIIII].opcode==4 then Doomspire_IllIll[i-1]={segment=Doomspire_IlIIlllII,offset=Doomspire_lllllIlllI.B}end;Doomspire_lIlIIlIIllIIlIIIlIIII=Doomspire_lIlIIlIIllIIlIIIlIIII+1 end;local Doomspire_lIlIIIII,Doomspire_lIlIIlllIlIIllII=Doomspire_IlIlllllllII(Doomspire_lIIIll,Doomspire_lIIlIIlIIIllIIIllIlIl)Doomspire_lIIlIIIllI[Doomspire_lIlllII.A]=Doomspire_lIlIIlllIlIIllII end,[37]=function(Doomspire_lllllIl)local Doomspire_llIlIlIlIlllIIlII=Doomspire_lllllIl.A;local Doomspire_llIlIllIllIlIlII=Doomspire_lllllIl.B;local Doomspire_lIIIIlIlIllI,Doomspire_lIllllll=Doomspire_IlllIIllIllllIlIIIl,Doomspire_lIIIIIIIlIllIl;for i=Doomspire_llIlIlIlIlllIIlII,Doomspire_llIlIlIlIlllIIlII+ (Doomspire_llIlIllIllIlIlII>0 and Doomspire_llIlIllIllIlIlII-1 or Doomspire_IllIlIIIlllI)do Doomspire_lIIIIlIlIllI[i]=Doomspire_lIllllll[i-Doomspire_llIlIlIlIlllIIlII]end end}local function Doomspire_IlIlIIIllllIIllIlII(Doomspire_IIIllIlll)local Doomspire_lIlIIll=Doomspire_III.name;local Doomspire_IIlllIlII=Doomspire_III.debug.lines[Doomspire_lIlIIlIIllIIlIIIlIIII]local Doomspire_lIIllIllIIlIll=(Doomspire_IIIllIlll:match("^.+:(.+)")or Doomspire_IIIllIlll)local Doomspire_IlIlllllIlIlllll=Doomspire_lIIllllllllIIIlll;if Doomspire_lIlIIll then Doomspire_IlIlllllIlIlllll=Doomspire_lIlIIll end;if Doomspire_IIlllIlII then Doomspire_IlIlllllIlIlllll=Doomspire_IlIlllllIlIlllll.." - Line: "..Doomspire_IIlllIlII end;if Doomspire_IIIllIlll and type(Doomspire_IIIllIlll)=="string"then Doomspire_IlIlllllIlIlllll=Doomspire_IlIlllllIlIlllll.." - Error: "..Doomspire_lIIllIllIIlIll end;if Doomspire_lllIIlIl then Doomspire_lllIIlIl(Doomspire_lIIIIIIlIIIll(Doomspire_IIlllIlII)..":"..Doomspire_lIIIIIIlIIIll(Doomspire_lIIllIllIIlIll))else error(Doomspire_lIIIIIIlIIIll(Doomspire_IIlllIlII)..":"..Doomspire_lIIIIIIlIIIll(Doomspire_lIIllIllIIlIll),3)end end;local function Doomspire_llIIll()local Doomspire_IllIIlIlI=Doomspire_llIlllIlII;local Doomspire_IllIlllIll,Doomspire_IllIIII,Doomspire_llllIlIIllIlIIIIII,Doomspire_IIIlIlIlIll;while true do Doomspire_IllIlllIll=Doomspire_IllIIlIlI[Doomspire_lIlIIlIIllIIlIIIlIIII]Doomspire_lIlIIlIIllIIlIIIlIIII=Doomspire_lIlIIlIIllIIlIIIlIIII+1;Doomspire_IIIlIlIlIll,Doomspire_IllIIII,Doomspire_llllIlIIllIlIIIIII=pcall(function()return Doomspire_IlIllIIIl[Doomspire_IllIlllIll.opcode](Doomspire_IllIlllIll)end)if not Doomspire_IIIlIlIlIll then Doomspire_IlIlIIIllllIIllIlII(Doomspire_IllIIII)break elseif Doomspire_IllIIII then return Doomspire_llllIlIIllIlIIIIII end end end;local Doomspire_lllIlIIllIlIlIlI={}local function Doomspire_lIlIIIIlIIIlIlIll(...)local Doomspire_lIlIIlllI={}local Doomspire_IIIIIlIlIllIIlIIIIlI={}Doomspire_IIlIllIlIlIIIllIIIllI=-1;Doomspire_IlllIIllIllllIlIIIl=Doomspire_IlIlIlIlIII(Doomspire_lIlIIlllI,{__index=Doomspire_IIIIIlIlIllIIlIIIIlI,__newindex=function(Doomspire_IlllIlIll,Doomspire_IIlllIll,Doomspire_IIIIIlIlllI)if Doomspire_IIlllIll>Doomspire_IIlIllIlIlIIIllIIIllI and Doomspire_IIIIIlIlllI then Doomspire_IIlIllIlIlIIIllIIIllI=Doomspire_IIlllIll end;Doomspire_IIIIIlIlIllIIlIIIIlI[Doomspire_IIlllIll]=Doomspire_IIIIIlIlllI end})local Doomspire_lllIII={...}Doomspire_lIIIIIIIlIllIl={}Doomspire_IllIlIIIlllI=select("#",...)-1;for i=0,Doomspire_IllIlIIIlllI do Doomspire_lIlIIlllI[i]=Doomspire_lllIII[i+1]Doomspire_lIIIIIIIlIllIl[i]=Doomspire_lllIII[i+1]end;Doomspire_llllIIIlIlIII=Doomspire_lI or Doomspire_IlIIIIIIlIllll()Doomspire_lIlIIlIIllIIlIIIlIIII=1;local Doomspire_IIIllllllllllIIllI=Doomspire_IIlIlIlIlIIllIlIIl(Doomspire_llIIll)local Doomspire_IIIlIIIlll,Doomspire_IIlIIIIIIIllIllIIllII=Doomspire_IIlIlIIlllllllIIIll(Doomspire_IIIllllllllllIIllI)if Doomspire_IIIlIIIlll then if Doomspire_IIlIIIIIIIllIllIIllII then return unpack(Doomspire_IIlIIIIIIIllIllIIllII)end;return else if Doomspire_llllIIIlllllI then else Doomspire_IlIlIIIllllIIllIlII(Doomspire_IIlIIIIIIIllIllIIllII)end end end;return Doomspire_lllIlIIllIlIlIlI,Doomspire_lIlIIIIlIIIlIlIll end;Doomspire_IIlIlllII=function(Doomspire_lllIIIIlllIlIllllII,Doomspire_IIIlIIIIIIIlIlIII)return Doomspire_llIIllIIlllllllIlI(Doomspire_lllIIIIlllIlIllllII,Doomspire_IIIlIIIIIIIlIlIII)end;Doomspire_lIlllIIIIIlllIIll=function(Doomspire_Illll,Doomspire_IllIllIlII)return Doomspire_llIIllIIlllllllIlI(Doomspire_Illll,Doomspire_IllIllIlII)end;Doomspire_llIlIllIllIllIIlll=function(Doomspire_IIlllIllIll,Doomspire_IIllIIIIllllllIIlIl,Doomspire_IlIlllIIIllIlIIIllII)Doomspire_lI=Doomspire_IIllIIIIllllllIIlIl or Doomspire_IlIIIIIIlIllll(2)Doomspire_lllIIlIl=Doomspire_IlIlllIIIllIlIIIllII;local Doomspire_IIIlIlllIlIIIIIIlllI=Doomspire_IlIlllIlIII(Doomspire_IIlllIllIll)local Doomspire_llIlIlIIIIlIIlIIIl,Doomspire_llllIIllllIllll=Doomspire_IlIlllllllII(Doomspire_IIIlIlllIlIIIIIIlllI)return Doomspire_llllIIllllIllll end;local Doomspire_llIIlIIIIl=function()local Doomspire_IIlIIIllIllllIIIIII='5270ee3d203291437d20cd4ecaa22075fefb0fc6a87d57d5e26dcd2c0f32c0c48290eb37487d150f16e67583c8742c42093180b22b52c1176345a1e753dc33fc74e60096f2855e9d85706e3067cec82824964e155841724032ec2a4ff2337e'local Doomspire_IIIllIIl={ToWiYDi}end;return Doomspire_llIlIllIllIllIIlll('\MTYw\MjQ3\MjA2\MjE4\MjM0\MTg3\MTg2\MTkx\MTc5\MTkx\MTc5\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg1\MjUy\NTY=\MTc4\MTg3\MTg3\MTkw\MTg3\MTg3\MTg3\MTg5\MjUx\MjUx\MTg3\MjUw\NTk=\MTg3\MTg3\MTY3\NTk=\MTg3\MTg2\MjU0\MTg3\MTg3\MTg3\MjUz\MjUx\MTIz\MTg3\NTg=\MTIz\MTg3\MTg3\MjMx\NTk=\MTg3\MTg2\NjI=\MTg3\MTg3\MTg3\NjE=\MjUx\MjUx\MTg2\MTIy\MTIz\MTg3\MTg3\Mzk=\NTk=\MTg3\MTg2\MTI2\MTg3\MTg3\MTg3\MTI1\MjUx\MTIz\MTg2\MTg2\MTIy\MTg3\MTg3\MTAz\NTk=\MTg3\MTg2\MTkw\MTg2\MTg3\MTg3\MTg5\MjUw\MjUx\MTg1\MjUw\MTIy\MTg3\MTg3\MTY3\NTg=\MTg3\MTg2\MjU0\MTg2\MTg3\MTg3\MjUz\MjUw\MTIz\MTg1\NTg=\MTIy\MTg3\MTg3\MjMx\NTg=\MTg3\MTg2\NjI=\MTg2\MTg3\MTg3\NjE=\MjUw\MjUx\MTg0\MTIy\MTIy\MTg3\MTg3\Mzk=\NTg=\MTg3\MTg2\MTI2\MTg2\MTg3\MTg3\MTI1\MjUw\MTIz\MTg0\MTg2\MTIx\MTg3\MTg3\MTAz\NTg=\MTg3\MTg2\MTkw\MTg1\MTg3\MTg3\MTg5\MjQ5\MjUx\MTkx\MjUw\MTIx\MTg3\MTg3\MTY3\NTc=\MTg3\MTg2\MjU0\MTg1\MTg3\MTg3\MjUz\MjQ5\MTIz\MTkx\NTg=\MTIx\MTg3\MTg3\MjMx\NTc=\MTg3\MTg2\NjI=\MTg1\MTg3\MTg3\NjE=\MjQ5\MjUx\MTkw\MTIy\MTg1\MTg2\MTg3\Mzk=\NTc=\MTg3\MTg2\MTI2\MTg1\MTg3\MTg3\MTI1\MjQ5\MTIz\MTkw\MTg2\MjQ4\MTg2\MTg3\MTAz\NTc=\MTg3\MTg2\MTkw\MTg0\MTg3\MTg3\MTg5\MjQ4\MjUx\MTg5\MjUw\MTIw\MTg3\MTg3\MTY3\NTY=\MTg3\MTg2\MjU0\MTg0\MTg3\MTg3\MjUz\MjQ4\MTIz\MTg5\NTg=\MjQ4\MTg2\MTg3\MjMx\NTY=\MTg3\MTg2\NjI=\MTg0\MTg3\MTg3\NjE=\MjQ4\MjUx\MTg4\MTIy\MTIw\MTg3\MTg3\Mzk=\NTY=\MTg3\MTg2\MTI2\MTg0\MTg3\MTg3\MTI1\MjQ4\MTIz\MTg4\MTg2\MjU1\MTg2\MTg3\MTAz\NTY=\MTg3\MTg2\MTkw\MTkx\MTg3\MTg3\MTg5\MjU1\MjUx\MTc5\MjUw\MTI3\MTg3\MTg3\MTY3\NjM=\MTg3\MTg2\MjU0\MTkx\MTg3\MTg3\MjUz\MjU1\MTIz\MTc5\NTg=\MjU1\MTg2\MTg3\MjMx\NjM=\MTg3\MTg2\NjI=\MTkx\MTg3\MTg3\NjE=\MjU1\MjUx\MTc4\MTIy\MTI3\MTg3\MTg3\Mzk=\NjM=\MTg3\MTg2\MTI2\MTkx\MTg3\MTg3\MTI1\MjU1\MTIz\MTc4\MTg2\MTI2\MTg3\MTg3\MTAz\NjM=\MTg3\MTg2\MTkw\MTkw\MTg3\MTg3\MTg5\MjU0\MjUx\MTc3\MjUw\MTI2\MTg3\MTg3\MTY3\NjI=\MTg3\MTg2\MjU0\MTkw\MTg3\MTg3\MjUz\MjU0\MTIz\MTc3\NTg=\MTI2\MTg3\MTg3\MjMx\NjI=\MTg3\MTg2\NjI=\MTkw\MTg3\MTg3\NjE=\MjU0\MjUx\MTc2\MTIy\MTI2\MTg3\MTg3\Mzk=\NjI=\MTg3\MTg2\MTI2\MTkw\MTg3\MTg3\MTI1\MjU0\MTIz\MTc2\MTg2\MTI1\MTg3\MTg3\MTAz\NjI=\MTg3\MTg2\MTkw\MTg5\MTg3\MTg3\MTg5\MjUz\MjUx\MTgz\MjUw\MTI1\MTg3\MTg3\MTY3\NjE=\MTg3\MTg2\MjU0\MTg5\MTg3\MTg3\MjUz\MjUz\MTIz\MTgz\NTg=\MTI1\MTg3\MTg3\MjMx\NjE=\MTg3\MTg2\NjI=\MTg5\MTg3\MTg3\NjE=\MjUz\MjUx\MTgy\MTIy\MTI1\MTg3\MTg3\Mzk=\NjE=\MTg3\MTg2\MTI2\MTg5\MTg3\MTg3\MTI1\MjUz\MTIz\MTgy\MTg2\MTg4\MTg2\MTg3\MTAz\NjE=\MTg3\MTg2\MTkw\MTg4\MTg3\MTg3\MTg5\MjUy\MjUx\MTgx\MjUw\MjUy\MTg2\MTg3\MTY3\NjA=\MTg3\MTg2\MjU0\MTg4\MTg3\MTg3\MjUz\MjUy\MTIz\MTgx\NTg=\MTI0\MTg3\MTg3\MjMx\NjA=\MTg3\MTg2\NjI=\MTg4\MTg3\MTg3\NjE=\MjUy\MjUx\MTgw\MTIy\MjUy\MTg2\MTg3\Mzk=\NjA=\MTg3\MTg2\MTI2\MTg4\MTg3\MTg3\MTI1\MjUy\MTIz\MTgw\MTg2\MTE1\MTg3\MTg3\MTAz\NjA=\MTg3\MTg2\MTkw\MTc5\MTg3\MTg3\MTg5\MjQz\MjUx\MTcx\MjUw\MjQz\MTg2\MTg3\MTY3\NTE=\MTg3\MTg2\MjU0\MTc5\MTg3\MTg3\MjUz\MjQz\MTIz\MTcx\NTg=\MTE1\MTg3\MTg3\MjMx\NTE=\MTg3\MTg2\NjI=\MTc5\MTg3\MTg3\NjE=\MjQz\MjUx\MTcw\MTIy\MjQz\MTg2\MTg3\Mzk=\NTE=\MTg3\MTg2\MTI2\MTc5\MTg3\MTg3\MTI1\MjQz\MTIz\MTcw\MTg2\MTE0\MTg3\MTg3\MTAz\NTE=\MTg3\MTg2\MTkw\MTc4\MTg3\MTg3\MTg5\MjQy\MjUx\MTY5\MjUw\MTE0\MTg3\MTg3\MTY3\NTA=\MTg3\MTg2\MjU0\MTc4\MTg3\MTg3\MjUz\MjQy\MTIz\MTY5\NTg=\MTE0\MTg3\MTg3\MjMx\NTA=\MTg3\MTg2\NjI=\MTc4\MTg3\MTg3\NjE=\MjQy\MjUx\MTY4\MTIy\MTE0\MTg3\MTg3\Mzk=\NTA=\MTg3\MTg2\MTI2\MTc4\MTg3\MTg3\MTI1\MjQy\MTIz\MTY4\MTg2\MTEz\MTg3\MTg3\MTAz\NTA=\MTg3\MTg2\MTkw\MTc3\MTg3\MTg3\MTg5\MjQx\MjUx\MTc1\MjUw\MTEz\MTg3\MTg3\MTY3\NDk=\MTg3\MTg2\MjU0\MTc3\MTg3\MTg3\MjUz\MjQx\MTIz\MTc1\NTg=\MTEz\MTg3\MTg3\MjMx\NDk=\MTg3\MTg2\NjI=\MTc3\MTg3\MTg3\NjE=\MjQx\MjUx\MTc0\MTIy\MTEz\MTg3\MTg3\Mzk=\NDk=\MTg3\MTg2\MTI2\MTc3\MTg3\MTg3\MTI1\MjQx\MTIz\MTc0\MTg2\MTEy\MTg3\MTg3\MTAz\NDk=\MTg3\MTg2\MTkw\MTc2\MTg3\MTg3\MTg5\MjQw\MjUx\MTcz\MjUw\MTEy\MTg3\MTg3\MTY3\NDg=\MTg3\MTg2\MjU0\MTc2\MTg3\MTg3\MjUz\MjQw\MTIz\MTcz\NTg=\MTc2\MTg2\MTg3\MjMx\NDg=\MTg3\MTg2\NjI=\MTc2\MTg3\MTg3\NjE=\MjQw\MjUx\MTcy\MTIy\MjQw\MTg2\MTg3\Mzk=\NDg=\MTg3\MTg2\MTI2\MTc2\MTg3\MTg3\MTI1\MjQw\MTIz\MTcy\MTg2\MTE5\MTg3\MTg3\MTAz\NDg=\MTg3\MTg2\MTkw\MTgz\MTg3\MTg3\MTg5\MjQ3\MjUx\MTYz\MjUw\MjQ3\MTg2\MTg3\MTY3\NTU=\MTg3\MTg2\MjU0\MTgz\MTg3\MTg3\MjUz\MjQ3\MTIz\MTYz\NTg=\MTE5\MTg3\MTg3\MjMx\NTU=\MTg3\MTg2\NjI=\MTgz\MTg3\MTg3\NjE=\MjQ3\MjUx\MTYy\MTIy\MjQ3\MTg2\MTg3\Mzk=\NTU=\MTg3\MTg2\MTI2\MTgz\MTg3\MTg3\MTI1\MjQ3\MTIz\MTYy\MTg2\MTE4\MTg3\MTg3\MTAz\NTU=\MTg3\MTg2\MTkw\MTgy\MTg3\MTg3\MTg5\MjQ2\MjUx\MTYx\MjUw\MjQ2\MTg2\MTg3\MTY3\NTQ=\MTg3\MTg2\MjU0\MTgy\MTg3\MTg3\MjUz\MjQ2\MTIz\MTYx\NTg=\MTE4\MTg3\MTg3\MjMx\NTQ=\MTg3\MTg2\NjI=\MTgy\MTg3\MTg3\NjE=\MjQ2\MjUx\MTYw\MTIy\MTE4\MTg3\MTg3\Mzk=\NTQ=\MTg3\MTg2\MTI2\MTgy\MTg3\MTg3\MTI1\MjQ2\MTIz\MTYw\MTg2\MTE3\MTg3\MTg3\MTAz\NTQ=\MTg3\MTg2\MTkw\MTgx\MTg3\MTg3\MTg5\MjQ1\MjUx\MTY3\MjUw\MTE3\MTg3\MTg3\MTY3\NTM=\MTg3\MTg2\MjU0\MTgx\MTg3\MTg3\MjUz\MjQ1\MTIz\MTY3\NTg=\MTE3\MTg3\MTg3\MjMx\NTM=\MTg3\MTg2\NjI=\MTgx\MTg3\MTg3\NjE=\MjQ1\MjUx\MTY2\MTIy\MTE3\MTg3\MTg3\Mzk=\NTM=\MTg3\MTg2\MTI2\MTgx\MTg3\MTg3\MTI1\MjQ1\MTIz\MTY2\MTg2\MTE2\MTg3\MTg3\MTAz\NTM=\MTg3\MTg2\MTkw\MTgw\MTg3\MTg3\MTg5\MjQ0\MjUx\MTY1\MjUw\MTE2\MTg3\MTg3\MTY3\NTI=\MTg3\MTg2\MjU0\MTgw\MTg3\MTg3\MjUz\MjQ0\MTIz\MTY1\NTg=\MTE2\MTg3\MTg3\MjMx\NTI=\MTg3\MTg2\NjI=\MTgw\MTg3\MTg3\NjE=\MjQ0\MjUx\MTY0\MTIy\MTE2\MTg3\MTg3\Mzk=\NTI=\MTg3\MTg2\MTI2\MTgw\MTg3\MTg3\MTI1\MjQ0\MTIz\MTY0\MTg2\MTcx\MTg2\MTg3\MTAz\NTI=\MTg3\MTg2\MTkw\MTcx\MTg3\MTg3\MTg5\MjM1\MjUx\MTU1\MjUw\MTcx\MTg2\MTg3\MTY3\NDM=\MTg3\MTg2\MjU0\MTcx\MTg3\MTg3\MjUz\MjM1\MTIz\MTU1\NTg=\MTcx\MTg2\MTg3\MjMx\NDM=\MTg3\MTg2\MTc4\MTIz\MjUw\NTY=\NjI=\MjM1\MTg1\MTg3\NjE=\NDM=\MjQ5\MTU0\MTc4\NTk=\MTcx\NjM=\MjQy\MTIz\MjQ5\NTY=\MjQy\MTg3\MTg3\NjM=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\NDM=\MTg0\MTg3\MTg2\NDI=\MTg0\MTg3\MjUw\NDI=\MTg0\MTg3\Mzk=\NDM=\MTg3\MTg1\MjQy\NTk=\MTcx\NjE=\MjQy\MTg3\MTI3\NjA=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTA3\MTkx\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MTcw\MTkw\MTg3\NTg=\MTcw\MTkx\MTg3\Mzk=\NDM=\NTk=\MTg1\MjQy\NTk=\NDM=\NTE=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\NDI=\MTkw\MTg3\MjUw\MTcw\MTkx\MTg3\NTg=\MTA2\MTkw\MTg3\Mzk=\NDM=\NTk=\MTg1\MjQy\NTk=\NDM=\NDk=\MjQy\MjUx\MjUz\NTU=\MjQy\MTIz\MjUz\NTQ=\MjQy\MTIz\MjUz\NTM=\MjQy\MTIz\MTI1\NTM=\NTA=\NTk=\MjUy\NTY=\NTA=\MjUx\MTg3\NjM=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MTcw\MTkx\MTg3\Mzk=\NDM=\MTg3\MTg1\NTA=\NTk=\MTcx\NjE=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\NDI=\MTkw\MTg3\MjUw\MTcw\MTkx\MTg3\NTg=\MTA2\MTg4\MTg3\Mzk=\NDM=\NTk=\MTg1\NTA=\NTk=\NDM=\NDk=\MTE0\MTg3\MjQz\NTY=\MTE0\NTk=\MTg3\NjM=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MTcw\MTkx\MTg3\Mzk=\NDM=\MTg3\MTg1\MTE0\NTk=\MTcx\NjE=\MTE0\NTk=\MTE1\NDM=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTA3\MTc5\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MTcw\MTc4\MTg3\NTg=\MTcw\MTkx\MTg3\Mzk=\NDM=\NTk=\MTg1\MTE0\NTk=\NDM=\NTE=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\NDI=\MTkw\MTg3\MjUw\MTcw\MTkx\MTg3\NTg=\MjM0\MTc4\MTg3\Mzk=\NDM=\NTk=\MTg1\MTE0\NTk=\NDM=\NDk=\MTc4\MTg2\MjQz\NTY=\MTc4\NTg=\MTg3\NjM=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MTcw\MTkx\MTg3\Mzk=\NDM=\MTg3\MTg1\MTc4\NTg=\MTcx\NjE=\MTc4\NTg=\MTE0\NDM=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTA3\MTc5\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MTA2\MTc4\MTg3\NTg=\MTcw\MTkx\MTg3\Mzk=\NDM=\NTk=\MTg1\MTc4\NTg=\NDM=\NTE=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\NDI=\MTkw\MTg3\MjUw\MTcw\MTkx\MTg3\NTg=\MjM0\MTc4\MTg3\Mzk=\NDM=\NTk=\MTg1\MTc4\NTg=\NDM=\NDk=\MjQy\MTg2\MjQz\NTY=\MjQy\NTg=\MTg3\NjM=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MTcw\MTkx\MTg3\Mzk=\NDM=\MTg3\MTg1\MjQy\NTg=\MTcx\NjE=\MjQy\MTg2\MTEz\NDM=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MjM0\MTc3\MTg3\NTg=\MTcw\MTkx\MTg3\Mzk=\NDM=\NTk=\MTg1\MjQy\NTg=\NDM=\NTE=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\NDI=\MTkw\MTg3\MjUw\MTcw\MTkx\MTg3\NTg=\MjM0\MTc4\MTg3\Mzk=\NDM=\NTk=\MTg1\MjQy\NTg=\NDM=\NDk=\NTA=\NTg=\MjQx\NTY=\NTA=\MjUw\MTg3\NjM=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MTcw\MTkx\MTg3\Mzk=\NDM=\MTg3\MTg1\NTA=\NTg=\MTcx\NjE=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTA3\MTc5\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MTA2\MTc3\MTg3\NTg=\MTcw\MTkx\MTg3\Mzk=\NDM=\NTk=\MTg1\NTA=\NTg=\NDM=\NTE=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\NDI=\MTkw\MTg3\MjUw\MTcw\MTkx\MTg3\NTg=\MTA2\MTg4\MTg3\Mzk=\NDM=\NTk=\MTg1\NTA=\NTg=\NDM=\NDk=\MTE0\MTg2\MjQz\NTY=\MTE0\NTg=\MTg2\NjM=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MTcw\MTkx\MTg3\Mzk=\NDM=\MTg3\MTg1\MTE0\NTg=\MTcx\NjE=\MTE0\NTg=\MTE0\NDM=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MTcw\MTc2\MTg3\NTg=\MTcw\MTkx\MTg3\Mzk=\NDM=\NTk=\MTg1\MTE0\NTg=\NDM=\NTE=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\NDI=\MTkw\MTg3\MjUw\MTcw\MTkx\MTg3\NTg=\MjM0\MTc4\MTg3\Mzk=\NDM=\NTk=\MTg1\MTE0\NTg=\NDM=\NDk=\MTc4\MTg1\MjQz\NTY=\MTc4\NTc=\MTg2\NjM=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MTcw\MTkx\MTg3\Mzk=\NDM=\MTg3\MTg1\MTc4\NTc=\MTcx\NjE=\MTc4\MjQ5\MTEy\NDM=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTA3\MTc5\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\NDI=\MTc2\MTg3\NTg=\MTcw\MTkx\MTg3\Mzk=\NDM=\NTk=\MTg1\MTc4\NTc=\NDM=\NTE=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\NDI=\MTkw\MTg3\MjUw\MTcw\MTkx\MTg3\NTg=\MjM0\MTc4\MTg3\Mzk=\NDM=\NTk=\MTg1\MTc4\NTc=\NDM=\NDk=\MjQy\MTg1\MjQz\NTY=\MjQy\NTc=\MTg2\NjM=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MTcw\MTkx\MTg3\Mzk=\NDM=\MTg3\MTg1\MjQy\NTc=\MTcx\NjE=\MjQy\MTIx\MTEy\NDM=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTA3\MTc5\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MTcw\MTgz\MTg3\NTg=\MTcw\MTkx\MTg3\Mzk=\NDM=\NTk=\MTg1\MjQy\NTc=\NDM=\NTE=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\NDI=\MTkw\MTg3\MjUw\MTcw\MTkx\MTg3\NTg=\MjM0\MTc4\MTg3\Mzk=\NDM=\NTk=\MTg1\MjQy\NTc=\NDM=\NDk=\NTA=\MjQ5\MjQ3\NTY=\NTA=\MjQ5\MTg3\NjM=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MjM1\MTc3\MTg3\MTg2\MjM0\MTc3\MTg3\MjUw\MjM0\MTc3\MTg3\Mzk=\NDM=\MTg3\MTg1\NTA=\NTc=\MTcx\NjE=\NTA=\MjQ5\MTEz\NDM=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\NDM=\MTgz\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MTA2\MTgz\MTg3\NTg=\MTcw\MTkx\MTg3\Mzk=\NDM=\NTk=\MTg1\NTA=\NTc=\NDM=\NTE=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTcw\MTgy\MTg3\MjUw\MTcw\MTkx\MTg3\NTg=\MjM0\MTgy\MTg3\Mzk=\NDM=\NTk=\MTg1\NTA=\NTc=\NDM=\NDk=\NjI=\MTA3\MTgy\MTg3\NjE=\NDM=\MjQ2\MTU0\NjE=\MTcx\MjQ1\MTU0\NTA=\NTc=\MTcx\MzI=\NTA=\NTc=\MTE3\Mzk=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MjM1\MTc3\MTg3\MTg2\MjM0\MTc3\MTg3\MjUw\MjM0\MTc3\MTg3\Mzk=\NDM=\MTg3\MTg1\NTA=\NTc=\NDM=\Mzg=\NTA=\MTIx\MjUz\Mzc=\NTA=\NTc=\MTE2\Mzc=\NTA=\MTIx\MTI1\MzY=\MTE0\MTg1\MjM1\NTY=\MTE0\MjQ5\MTg3\NjM=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MTcw\MTkx\MTg3\Mzk=\NDM=\MTg3\MTg1\MTE0\NTc=\MTcx\NjE=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\NDM=\MTcx\MTg3\MTg2\MjM0\MTc3\MTg3\MjUw\MjM0\MTc3\MTg3\Mzk=\NDM=\MTg3\MTg1\MTE0\NTc=\NDM=\Mjc=\MTE0\MTg1\MTI3\NjA=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTA3\MTcx\MTg3\MTg2\MTcw\MTcw\MTg3\MjUw\MjM0\MTcw\MTg3\NTg=\NDI=\MTcw\MTg3\Mzk=\NDM=\NTk=\MTg1\MTE0\NTc=\NDM=\NTE=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTA2\MTcw\MTg3\MjUw\MTcw\MTkx\MTg3\NTg=\MTcw\MTY5\MTg3\Mzk=\NDM=\NTk=\MTg1\MTE0\NTc=\NDM=\NDk=\NjI=\MTA3\MTgy\MTg3\NjE=\NDM=\MjQ2\MTU0\NjE=\MjM1\MjMz\MTU0\MTE0\NTc=\MTcx\MzI=\MTE0\NTc=\MTA1\Mzk=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MjM1\MTc3\MTg3\MTg2\MjM0\MTc3\MTg3\MjUw\MjM0\MTc3\MTg3\Mzk=\NDM=\MTg3\MTg1\MTE0\NTc=\NDM=\Mzg=\MTE0\MTIx\MjUz\Mzc=\MTE0\NTc=\MTE2\Mzc=\MTE0\MTIx\MTI1\MzY=\NjE=\MTA3\MTA1\MTkw\NDg=\MTcx\MjMy\MTU0\MTU5\MTcw\MTg3\MTg3\MTg3\MTg3\MTg3\MTY5\Mzk=\MjM1\NTk=\MTg2\MTc4\MjQ4\MjMy\NTY=\MTc4\MTIw\MTg1\NjM=\MTc4\MTIw\MjUz\NTQ=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\NDM=\MTY4\MTg3\MTg2\MTA2\MTY4\MTg3\MjUw\MTcw\MTc1\MTg3\Mzk=\NDM=\MTg3\MTg1\MTc4\NTY=\MTcx\NjE=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\NDM=\MTcx\MTg3\MTg2\MjM0\MTc3\MTg3\MjUw\MjM0\MTc3\MTg3\Mzk=\NDM=\MTg3\MTg1\MTc4\NTY=\NDM=\Mjc=\MTc4\MTg0\MTI3\NjA=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MjM0\MTc1\MTg3\NTg=\MTcw\MTkx\MTg3\Mzk=\NDM=\NTk=\MTg1\MTc4\NTY=\NDM=\NTE=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MjM1\MTc3\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\NDI=\MTc1\MTg3\NTg=\MTcw\MTkx\MTg3\Mzk=\NDM=\NTk=\MTg1\MTc4\NTY=\NDM=\NDk=\MjQy\MTIw\MjM5\NTY=\MjQy\MjQ4\MTg3\NjM=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MTcw\MTkx\MTg3\Mzk=\NDM=\MTg3\MTg1\MjQy\NTY=\MTcx\NjE=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\NDM=\MTcx\MTg3\MTg2\MjM0\MTc3\MTg3\MjUw\MjM0\MTc3\MTg3\Mzk=\NDM=\MTg3\MTg1\MjQy\NTY=\NDM=\Mjc=\MjQy\MTg0\MTI3\NjA=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTA3\MTcx\MTg3\MTg2\MTcw\MTcw\MTg3\MjUw\MTcw\MTc0\MTg3\NTg=\NDI=\MTcw\MTg3\Mzk=\NDM=\NTk=\MTg1\MjQy\NTY=\NDM=\NTE=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTA2\MTcw\MTg3\MjUw\MTcw\MTkx\MTg3\NTg=\MTcw\MTY5\MTg3\Mzk=\NDM=\NTk=\MTg1\MjQy\NTY=\NDM=\NDk=\NjI=\MTA3\MTgy\MTg3\NjE=\NDM=\MjQ2\MTU0\NjE=\MjM1\MjMz\MTU0\MjQy\NTY=\MTcx\MzI=\MjQy\MjQ4\MTEw\Mzk=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MjM1\MTc3\MTg3\MTg2\MjM0\MTc3\MTg3\MjUw\MjM0\MTc3\MTg3\Mzk=\NDM=\MTg3\MTg1\MjQy\NTY=\NDM=\Mzg=\MjQy\MTIw\MjUz\Mzc=\MjQy\NTY=\MTE2\Mzc=\MjQy\MTIw\MTI1\MzY=\NjE=\MTA3\MTA1\MTg5\NDg=\MTcx\MjMy\MTU0\MTU5\MjM0\MTg3\MTg3\MTg3\MTg3\MTg3\MTYw\Mzk=\MjM1\NTk=\MTg2\NTA=\MjQ4\MjMy\NTY=\NTA=\MjQ4\MTg0\NjM=\NTA=\MTIw\MjUz\NTQ=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\NDM=\MTY4\MTg3\MTg2\MTA2\MTY4\MTg3\MjUw\MTcw\MTc1\MTg3\Mzk=\NDM=\MTg3\MTg1\NTA=\NTY=\MTcx\NjE=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\NDM=\MTcx\MTg3\MTg2\MjM0\MTc3\MTg3\MjUw\MjM0\MTc3\MTg3\Mzk=\NDM=\MTg3\MTg1\NTA=\NTY=\NDM=\Mjc=\NTA=\MTg0\MTI3\NjA=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MjM0\MTc1\MTg3\NTg=\MTcw\MTkx\MTg3\Mzk=\NDM=\NTk=\MTg1\NTA=\NTY=\NDM=\NTE=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MjM1\MTc3\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\NDI=\MTc1\MTg3\NTg=\MTcw\MTkx\MTg3\Mzk=\NDM=\NTk=\MTg1\NTA=\NTY=\NDM=\NDk=\MTE0\NTY=\MjM4\NTY=\MTE0\MjQ4\MTg3\NjM=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MTcw\MTkx\MTg3\Mzk=\NDM=\MTg3\MTg1\MTE0\NTY=\MTcx\NjE=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\NDM=\MTcx\MTg3\MTg2\MjM0\MTc3\MTg3\MjUw\MjM0\MTc3\MTg3\Mzk=\NDM=\MTg3\MTg1\MTE0\NTY=\NDM=\Mjc=\MTE0\MTg0\MTI3\NjA=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTA3\MTcx\MTg3\MTg2\MTcw\MTcw\MTg3\MjUw\MTA2\MTc0\MTg3\NTg=\NDI=\MTcw\MTg3\Mzk=\NDM=\NTk=\MTg1\MTE0\NTY=\NDM=\NTE=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTA2\MTcw\MTg3\MjUw\MTcw\MTkx\MTg3\NTg=\MTcw\MTY5\MTg3\Mzk=\NDM=\NTk=\MTg1\MTE0\NTY=\NDM=\NDk=\NjI=\MTA3\MTgy\MTg3\NjE=\NDM=\MjQ2\MTU0\NjE=\MjM1\MjMz\MTU0\MTE0\NTY=\MTcx\MzI=\MTE0\MTg0\MTA5\Mzk=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MjM1\MTc3\MTg3\MTg2\MjM0\MTc3\MTg3\MjUw\MjM0\MTc3\MTg3\Mzk=\NDM=\MTg3\MTg1\MTE0\NTY=\NDM=\Mzg=\MTE0\MTIw\MjUz\Mzc=\MTE0\NTY=\MTE2\Mzc=\MTE0\MTIw\MTI1\MzY=\NjE=\MTA3\MTA1\MTg4\NDg=\MTcx\MjMy\MTU0\MTU5\NDI=\MTg3\MTg3\MTg3\MTg3\MTg3\MTc4\Mzk=\MjM1\NTk=\MTg2\MTc4\MjU1\MjMy\NTY=\MTc4\MTI3\MTg0\NjM=\MTc4\MTI3\MjUz\NTQ=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\NDM=\MTY4\MTg3\MTg2\MTA2\MTY4\MTg3\MjUw\MTcw\MTc1\MTg3\Mzk=\NDM=\MTg3\MTg1\MTc4\NjM=\MTcx\NjE=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\NDM=\MTcx\MTg3\MTg2\MjM0\MTc3\MTg3\MjUw\MjM0\MTc3\MTg3\Mzk=\NDM=\MTg3\MTg1\MTc4\NjM=\NDM=\Mjc=\MTc4\MTkx\MTI3\NjA=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MjM0\MTc1\MTg3\NTg=\MTcw\MTkx\MTg3\Mzk=\NDM=\NTk=\MTg1\MTc4\NjM=\NDM=\NTE=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MjM1\MTc3\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\NDI=\MTc1\MTg3\NTg=\MTcw\MTkx\MTg3\Mzk=\NDM=\NTk=\MTg1\MTc4\NjM=\NDM=\NDk=\MjQy\MjU1\MjM3\NTY=\MjQy\MTkx\MTg3\NjM=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MTcw\MTkx\MTg3\Mzk=\NDM=\MTg3\MTg1\MjQy\NjM=\MTcx\NjE=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\NDM=\MTcx\MTg3\MTg2\MjM0\MTc3\MTg3\MjUw\MjM0\MTc3\MTg3\Mzk=\NDM=\MTg3\MTg1\MjQy\NjM=\NDM=\Mjc=\MjQy\MTkx\MTI3\NjA=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\NDM=\MTcz\MTg3\MTg2\MTcw\MTcw\MTg3\MjUw\MTA2\MTcz\MTg3\NTg=\NDI=\MTcw\MTg3\Mzk=\NDM=\NTk=\MTg1\MjQy\NjM=\NDM=\NTE=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTA2\MTcw\MTg3\MjUw\MTcw\MTkx\MTg3\NTg=\MTcw\MTY5\MTg3\Mzk=\NDM=\NTk=\MTg1\MjQy\NjM=\NDM=\NDk=\NjI=\MTA3\MTgy\MTg3\NjE=\NDM=\MjQ2\MTU0\NjE=\MjM1\MjMz\MTU0\MjQy\NjM=\MTcx\MzI=\MjQy\MTkx\MTA4\Mzk=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MjM1\MTc3\MTg3\MTg2\MjM0\MTc3\MTg3\MjUw\MjM0\MTc3\MTg3\Mzk=\NDM=\MTg3\MTg1\MjQy\NjM=\NDM=\Mzg=\MjQy\MTI3\MjUz\Mzc=\MjQy\NjM=\MTE2\Mzc=\MjQy\MTI3\MTI1\MzY=\MjQy\MTI3\MjUz\NTQ=\MjQy\MTI3\MjUz\NTM=\MjQy\MTI3\MTI1\NTM=\NjE=\MTA3\MTA1\MTc5\NDg=\MTcx\MjMy\MTU0\MTU5\MTA2\MTg3\MTg3\MTg3\MTg3\NTk=\MTg3\Mzk=\MjM1\NTk=\MTg2\NTA=\MjU1\MjM2\NTY=\NTA=\MTkx\MTg3\NjM=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\NDM=\MTg0\MTg3\MTg2\NDI=\MTg0\MTg3\MjUw\NDI=\MTg0\MTg3\Mzk=\NDM=\MTg3\MTg1\NTA=\NjM=\MTcx\NjE=\NTA=\MTkx\MTI3\NjA=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\NDM=\MTcy\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MTcw\MTkw\MTg3\NTg=\MTcw\MTkx\MTg3\Mzk=\NDM=\NTk=\MTg1\NTA=\NjM=\NDM=\NTE=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTA2\MTcy\MTg3\MjUw\MTcw\MTkx\MTg3\NTg=\MTA2\MTkw\MTg3\Mzk=\NDM=\NTk=\MTg1\NTA=\NjM=\NDM=\NDk=\NTA=\MjU1\MjUz\NTU=\MTE0\NjM=\MjUy\NTY=\MTE0\NjM=\MTkx\NjM=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MTcw\MTkx\MTg3\Mzk=\NDM=\MTg3\MTg1\MTE0\NjM=\MTcx\NjE=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTA2\MTcy\MTg3\MjUw\MTcw\MTkx\MTg3\NTg=\MTA2\MTg4\MTg3\Mzk=\NDM=\NTk=\MTg1\MTE0\NjM=\NDM=\NDk=\MTc4\MTkw\MjQz\NTY=\MTc4\MTI2\MTkx\NjM=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MTcw\MTkx\MTg3\Mzk=\NDM=\MTg3\MTg1\MTc4\NjI=\MTcx\NjE=\MTc4\NjI=\MTE1\NDM=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTYz\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MTcw\MTc4\MTg3\NTg=\MTcw\MTkx\MTg3\Mzk=\NDM=\NTk=\MTg1\MTc4\NjI=\NDM=\NTE=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTA2\MTcy\MTg3\MjUw\MTcw\MTkx\MTg3\NTg=\MjM0\MTc4\MTg3\Mzk=\NDM=\NTk=\MTg1\MTc4\NjI=\NDM=\NDk=\MjQy\MTkw\MjQz\NTY=\MjQy\MTI2\MTkx\NjM=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MTcw\MTkx\MTg3\Mzk=\NDM=\MTg3\MTg1\MjQy\NjI=\MTcx\NjE=\MjQy\NjI=\MTE0\NDM=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTYz\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MjM0\MTYz\MTg3\NTg=\MTcw\MTkx\MTg3\Mzk=\NDM=\NTk=\MTg1\MjQy\NjI=\NDM=\NTE=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTA2\MTcy\MTg3\MjUw\MTcw\MTkx\MTg3\NTg=\MjM0\MTc4\MTg3\Mzk=\NDM=\NTk=\MTg1\MjQy\NjI=\NDM=\NDk=\NTA=\MTkw\MjQz\NTY=\NTA=\MTI2\MTkx\NjM=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MTcw\MTkx\MTg3\Mzk=\NDM=\MTg3\MTg1\NTA=\NjI=\MTcx\NjE=\NTA=\MTkw\MTEz\NDM=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MjM0\MTc3\MTg3\NTg=\MTcw\MTkx\MTg3\Mzk=\NDM=\NTk=\MTg1\NTA=\NjI=\NDM=\NTE=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTA2\MTcy\MTg3\MjUw\MTcw\MTkx\MTg3\NTg=\MjM0\MTc4\MTg3\Mzk=\NDM=\NTk=\MTg1\NTA=\NjI=\NDM=\NDk=\MTE0\NjI=\MjQx\NTY=\MTE0\NjI=\MTkx\NjM=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MTcw\MTkx\MTg3\Mzk=\NDM=\MTg3\MTg1\MTE0\NjI=\MTcx\NjE=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTYz\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\NDI=\MTYz\MTg3\NTg=\MTcw\MTkx\MTg3\Mzk=\NDM=\NTk=\MTg1\MTE0\NjI=\NDM=\NTE=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTA2\MTcy\MTg3\MjUw\MTcw\MTkx\MTg3\NTg=\MTA2\MTg4\MTg3\Mzk=\NDM=\NTk=\MTg1\MTE0\NjI=\NDM=\NDk=\MTc4\MTg5\MjQz\NTY=\MTc4\MTI1\MTkw\NjM=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MTcw\MTkx\MTg3\Mzk=\NDM=\MTg3\MTg1\MTc4\NjE=\MTcx\NjE=\MTc4\NjE=\MTE0\NDM=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MTcw\MTc2\MTg3\NTg=\MTcw\MTkx\MTg3\Mzk=\NDM=\NTk=\MTg1\MTc4\NjE=\NDM=\NTE=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTA2\MTcy\MTg3\MjUw\MTcw\MTkx\MTg3\NTg=\MjM0\MTc4\MTg3\Mzk=\NDM=\NTk=\MTg1\MTc4\NjE=\NDM=\NDk=\MjQy\MTg5\MjQz\NTY=\MjQy\MTI1\MTkw\NjM=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MTcw\MTkx\MTg3\Mzk=\NDM=\MTg3\MTg1\MjQy\NjE=\MTcx\NjE=\MjQy\MjUz\MTEy\NDM=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTA3\MTc5\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MTA2\MTYz\MTg3\NTg=\MTcw\MTkx\MTg3\Mzk=\NDM=\NTk=\MTg1\MjQy\NjE=\NDM=\NTE=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTcw\MTYy\MTg3\MjUw\MTcw\MTkx\MTg3\NTg=\MjM0\MTc4\MTg3\Mzk=\NDM=\NTk=\MTg1\MjQy\NjE=\NDM=\NDk=\NTA=\MTg5\MjQz\NTY=\NTA=\MTI1\MTkw\NjM=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MTcw\MTkx\MTg3\Mzk=\NDM=\MTg3\MTg1\NTA=\NjE=\MTcx\NjE=\NTA=\MTI1\MTEy\NDM=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTA3\MTc5\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MjM0\MTYy\MTg3\NTg=\MTcw\MTkx\MTg3\Mzk=\NDM=\NTk=\MTg1\NTA=\NjE=\NDM=\NTE=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTcw\MTYy\MTg3\MjUw\MTcw\MTkx\MTg3\NTg=\MjM0\MTc4\MTg3\Mzk=\NDM=\NTk=\MTg1\NTA=\NjE=\NDM=\NDk=\MTE0\MjUz\MjQ3\NTY=\MTE0\NjE=\MTkx\NjM=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MjM1\MTc3\MTg3\MTg2\MjM0\MTc3\MTg3\MjUw\MjM0\MTc3\MTg3\Mzk=\NDM=\MTg3\MTg1\MTE0\NjE=\MTcx\NjE=\MTE0\MjUz\MTEz\NDM=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\NDM=\MTYy\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MTA2\MTgz\MTg3\NTg=\MTcw\MTkx\MTg3\Mzk=\NDM=\NTk=\MTg1\MTE0\NjE=\NDM=\NTE=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTcw\MTgy\MTg3\MjUw\MTcw\MTkx\MTg3\NTg=\MjM0\MTgy\MTg3\Mzk=\NDM=\NTk=\MTg1\MTE0\NjE=\NDM=\NDk=\NjI=\MTA3\MTgy\MTg3\NjE=\NDM=\MjQ2\MTU0\NjE=\MTcx\MjQ1\MTU0\MTE0\NjE=\MTcx\MzI=\MTE0\MTg5\MTA5\Mzk=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MjM1\MTc3\MTg3\MTg2\MjM0\MTc3\MTg3\MjUw\MjM0\MTc3\MTg3\Mzk=\NDM=\MTg3\MTg1\MTE0\NjE=\NDM=\Mzg=\MTE0\MTI1\MjUz\Mzc=\MTE0\NjE=\MTE2\Mzc=\MTE0\MTI1\MTI1\MzY=\MTc4\MTI0\MjI2\NTY=\MTc4\NjA=\MTkx\NjM=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MTcw\MTkx\MTg3\Mzk=\NDM=\MTg3\MTg1\MTc4\NjA=\MTcx\NjE=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\NDM=\MTcx\MTg3\MTg2\MjM0\MTc3\MTg3\MjUw\MjM0\MTc3\MTg3\Mzk=\NDM=\MTg3\MTg1\MTc4\NjA=\NDM=\Mjc=\MTc4\MTg4\MTI3\NjA=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTYx\MTg3\MTg2\MTcw\MTcw\MTg3\MjUw\MjM0\MTYx\MTg3\NTg=\NDI=\MTcw\MTg3\Mzk=\NDM=\NTk=\MTg1\MTc4\NjA=\NDM=\NTE=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\NDI=\MTYx\MTg3\MjUw\MTcw\MTkx\MTg3\NTg=\MTcw\MTY5\MTg3\Mzk=\NDM=\NTk=\MTg1\MTc4\NjA=\NDM=\NDk=\NjI=\MTA3\MTgy\MTg3\NjE=\NDM=\MjQ2\MTU0\NjE=\MjM1\MjMz\MTU0\MTc4\NjA=\MTcx\MzI=\MTc4\MTI0\OTg=\Mzk=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MjM1\MTc3\MTg3\MTg2\MjM0\MTc3\MTg3\MjUw\MjM0\MTc3\MTg3\Mzk=\NDM=\MTg3\MTg1\MTc4\NjA=\NDM=\Mzg=\MTc4\MTI0\MjUz\Mzc=\MTc4\NjA=\MTE2\Mzc=\MTc4\MTI0\MTI1\MzY=\NjE=\MTA3\MjMz\MTgx\NDg=\MTcx\MjMy\MTU0\MTU5\MTcw\MTg2\MTg3\Mzk=\MjM1\NTk=\MTg2\MjQy\MjUy\MjMy\NTY=\MjQy\MTg4\MTg4\NjM=\MjQy\MTI0\MjUz\NTQ=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\NDM=\MTY4\MTg3\MTg2\MTA2\MTY4\MTg3\MjUw\MTcw\MTc1\MTg3\Mzk=\NDM=\MTg3\MTg1\MjQy\NjA=\MTcx\NjE=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\NDM=\MTcx\MTg3\MTg2\MjM0\MTc3\MTg3\MjUw\MjM0\MTc3\MTg3\Mzk=\NDM=\MTg3\MTg1\MjQy\NjA=\NDM=\Mjc=\MjQy\MTg4\MTI3\NjA=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MjM0\MTc1\MTg3\NTg=\MTcw\MTkx\MTg3\Mzk=\NDM=\NTk=\MTg1\MjQy\NjA=\NDM=\NTE=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MjM1\MTc3\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\NDI=\MTc1\MTg3\NTg=\MTcw\MTkx\MTg3\Mzk=\NDM=\NTk=\MTg1\MjQy\NjA=\NDM=\NDk=\NTA=\MTI0\MjI1\NTY=\NTA=\NjA=\MTkx\NjM=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MTcw\MTkx\MTg3\Mzk=\NDM=\MTg3\MTg1\NTA=\NjA=\MTcx\NjE=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\NDM=\MTcx\MTg3\MTg2\MjM0\MTc3\MTg3\MjUw\MjM0\MTc3\MTg3\Mzk=\NDM=\MTg3\MTg1\NTA=\NjA=\NDM=\Mjc=\NTA=\MTg4\MTI3\NjA=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTYw\MTg3\MTg2\MTcw\MTcw\MTg3\MjUw\MjM0\MTYw\MTg3\NTg=\NDI=\MTcw\MTg3\Mzk=\NDM=\NTk=\MTg1\NTA=\NjA=\NDM=\NTE=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\NDI=\MTYx\MTg3\MjUw\MTcw\MTkx\MTg3\NTg=\MTcw\MTY5\MTg3\Mzk=\NDM=\NTk=\MTg1\NTA=\NjA=\NDM=\NDk=\NjI=\MTA3\MTgy\MTg3\NjE=\NDM=\MjQ2\MTU0\NjE=\MjM1\MjMz\MTU0\NTA=\NjA=\MTcx\MzI=\NTA=\MTI0\OTc=\Mzk=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MjM1\MTc3\MTg3\MTg2\MjM0\MTc3\MTg3\MjUw\MjM0\MTc3\MTg3\Mzk=\NDM=\MTg3\MTg1\NTA=\NjA=\NDM=\Mzg=\NTA=\MTI0\MjUz\Mzc=\NTA=\NjA=\MTE2\Mzc=\NTA=\MTI0\MTI1\MzY=\NjE=\MTA3\MjMz\MTgw\NDg=\MTcx\MjMy\MTU0\MTU5\MjM0\MTg2\MTg3\Mzk=\MjM1\NTk=\MTg2\MTE0\MjUy\MjMy\NTY=\MTE0\NjA=\MTg4\NjM=\MTE0\MTI0\MjUz\NTQ=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\NDM=\MTY4\MTg3\MTg2\MTA2\MTY4\MTg3\MjUw\MTcw\MTc1\MTg3\Mzk=\NDM=\MTg3\MTg1\MTE0\NjA=\MTcx\NjE=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\NDM=\MTcx\MTg3\MTg2\MjM0\MTc3\MTg3\MjUw\MjM0\MTc3\MTg3\Mzk=\NDM=\MTg3\MTg1\MTE0\NjA=\NDM=\Mjc=\MTE0\MTg4\MTI3\NjA=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MjM0\MTc1\MTg3\NTg=\MTcw\MTkx\MTg3\Mzk=\NDM=\NTk=\MTg1\MTE0\NjA=\NDM=\NTE=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MjM1\MTc3\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\NDI=\MTc1\MTg3\NTg=\MTcw\MTkx\MTg3\Mzk=\NDM=\NTk=\MTg1\MTE0\NjA=\NDM=\NDk=\MTc4\NTE=\MjI0\NTY=\MTc4\NTE=\MTkx\NjM=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MTcw\MTkx\MTg3\Mzk=\NDM=\MTg3\MTg1\MTc4\NTE=\MTcx\NjE=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\NDM=\MTcx\MTg3\MTg2\MjM0\MTc3\MTg3\MjUw\MjM0\MTc3\MTg3\Mzk=\NDM=\MTg3\MTg1\MTc4\NTE=\NDM=\Mjc=\MTc4\MTc5\MTI3\NjA=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTYw\MTg3\MTg2\MTcw\MTcw\MTg3\MjUw\MTA2\MTYw\MTg3\NTg=\NDI=\MTcw\MTg3\Mzk=\NDM=\NTk=\MTg1\MTc4\NTE=\NDM=\NTE=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\NDI=\MTYx\MTg3\MjUw\MTcw\MTkx\MTg3\NTg=\MTcw\MTY5\MTg3\Mzk=\NDM=\NTk=\MTg1\MTc4\NTE=\NDM=\NDk=\NjI=\MTA3\MTgy\MTg3\NjE=\NDM=\MjQ2\MTU0\NjE=\MjM1\MjMz\MTU0\MTc4\NTE=\MTcx\MzI=\MTc4\NTE=\OTY=\Mzk=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MjM1\MTc3\MTg3\MTg2\MjM0\MTc3\MTg3\MjUw\MjM0\MTc3\MTg3\Mzk=\NDM=\MTg3\MTg1\MTc4\NTE=\NDM=\Mzg=\MTc4\MTE1\MjUz\Mzc=\MTc4\NTE=\MTE2\Mzc=\MTc4\MTE1\MTI1\MzY=\NjE=\MTA3\MjMz\MTcx\NDg=\MTcx\MjMy\MTU0\MTU5\NDI=\MTg2\MTg3\Mzk=\MjM1\NTk=\MTg2\MjQy\MjQz\MjMy\NTY=\MjQy\MTc5\MTc5\NjM=\MjQy\MTE1\MjUz\NTQ=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\NDM=\MTY4\MTg3\MTg2\MTA2\MTY4\MTg3\MjUw\MTcw\MTc1\MTg3\Mzk=\NDM=\MTg3\MTg1\MjQy\NTE=\MTcx\NjE=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\NDM=\MTcx\MTg3\MTg2\MjM0\MTc3\MTg3\MjUw\MjM0\MTc3\MTg3\Mzk=\NDM=\MTg3\MTg1\MjQy\NTE=\NDM=\Mjc=\MjQy\MTc5\MTI3\NjA=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MjM0\MTc1\MTg3\NTg=\MTcw\MTkx\MTg3\Mzk=\NDM=\NTk=\MTg1\MjQy\NTE=\NDM=\NTE=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MjM1\MTc3\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\NDI=\MTc1\MTg3\NTg=\MTcw\MTkx\MTg3\Mzk=\NDM=\NTk=\MTg1\MjQy\NTE=\NDM=\NDk=\NTA=\MTc5\MjMx\NTY=\NTA=\NTE=\MTkx\NjM=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MTcw\MTkx\MTg3\Mzk=\NDM=\MTg3\MTg1\NTA=\NTE=\MTcx\NjE=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\NDM=\MTcx\MTg3\MTg2\MjM0\MTc3\MTg3\MjUw\MjM0\MTc3\MTg3\Mzk=\NDM=\MTg3\MTg1\NTA=\NTE=\NDM=\Mjc=\NTA=\MTc5\MTI3\NjA=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTYx\MTg3\MTg2\MTcw\MTcw\MTg3\MjUw\MjM0\MTY3\MTg3\NTg=\NDI=\MTcw\MTg3\Mzk=\NDM=\NTk=\MTg1\NTA=\NTE=\NDM=\NTE=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\NDI=\MTYx\MTg3\MjUw\MTcw\MTkx\MTg3\NTg=\MTcw\MTY5\MTg3\Mzk=\NDM=\NTk=\MTg1\NTA=\NTE=\NDM=\NDk=\NjI=\MTA3\MTgy\MTg3\NjE=\NDM=\MjQ2\MTU0\NjE=\MjM1\MjMz\MTU0\NTA=\NTE=\MTcx\MzI=\NTA=\MTc5\MTAz\Mzk=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MjM1\MTc3\MTg3\MTg2\MjM0\MTc3\MTg3\MjUw\MjM0\MTc3\MTg3\Mzk=\NDM=\MTg3\MTg1\NTA=\NTE=\NDM=\Mzg=\NTA=\MTE1\MjUz\Mzc=\NTA=\NTE=\MTE2\Mzc=\NTA=\MTE1\MTI1\MzY=\NjE=\MTA3\MjMz\MTcw\NDg=\MTcx\MjMy\MTU0\MTU5\MTA2\MTg2\MTg3\Mzk=\MjM1\NTk=\MTg2\MTE0\MjQz\MjMy\NTY=\MTE0\NTE=\MTc5\NjM=\MTE0\MTE1\MjUz\NTQ=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\NDM=\MTY4\MTg3\MTg2\MTA2\MTY4\MTg3\MjUw\MTcw\MTc1\MTg3\Mzk=\NDM=\MTg3\MTg1\MTE0\NTE=\MTcx\NjE=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\NDM=\MTcx\MTg3\MTg2\MjM0\MTc3\MTg3\MjUw\MjM0\MTc3\MTg3\Mzk=\NDM=\MTg3\MTg1\MTE0\NTE=\NDM=\Mjc=\MTE0\MTc5\MTI3\NjA=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MjM0\MTc1\MTg3\NTg=\MTcw\MTkx\MTg3\Mzk=\NDM=\NTk=\MTg1\MTE0\NTE=\NDM=\NTE=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MjM1\MTc3\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\NDI=\MTc1\MTg3\NTg=\MTcw\MTkx\MTg3\Mzk=\NDM=\NTk=\MTg1\MTE0\NTE=\NDM=\NDk=\MTc4\NTA=\MjMz\NTY=\MTc4\MTc4\MTg3\NjM=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\NDM=\MTg0\MTg3\MTg2\NDI=\MTg0\MTg3\MjUw\NDI=\MTg0\MTg3\Mzk=\NDM=\MTg3\MTg1\MTc4\NTA=\MTcx\NjE=\MTc4\MTc4\MTI3\NjA=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\NDM=\MTY3\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MTcw\MTkw\MTg3\NTg=\MTcw\MTkx\MTg3\Mzk=\NDM=\NTk=\MTg1\MTc4\NTA=\NDM=\NTE=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTA2\MTcy\MTg3\MjUw\MTcw\MTkx\MTg3\NTg=\MTA2\MTkw\MTg3\Mzk=\NDM=\NTk=\MTg1\MTc4\NTA=\NDM=\NDk=\MTc4\MjQy\MjUz\NTU=\MjQy\NTA=\MjUy\NTY=\MjQy\MTc4\MTc4\NjM=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MTcw\MTkx\MTg3\Mzk=\NDM=\MTg3\MTg1\MjQy\NTA=\MTcx\NjE=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTA2\MTcy\MTg3\MjUw\MTcw\MTkx\MTg3\NTg=\MTA2\MTg4\MTg3\Mzk=\NDM=\NTk=\MTg1\MjQy\NTA=\NDM=\NDk=\NTA=\MTc4\MjQz\NTY=\NTA=\MjQy\MTc4\NjM=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MTcw\MTkx\MTg3\Mzk=\NDM=\MTg3\MTg1\NTA=\NTA=\MTcx\NjE=\NTA=\NTA=\MTE1\NDM=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTYz\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MTcw\MTc4\MTg3\NTg=\MTcw\MTkx\MTg3\Mzk=\NDM=\NTk=\MTg1\NTA=\NTA=\NDM=\NTE=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTA2\MTcy\MTg3\MjUw\MTcw\MTkx\MTg3\NTg=\MjM0\MTc4\MTg3\Mzk=\NDM=\NTk=\MTg1\NTA=\NTA=\NDM=\NDk=\MTE0\MTc4\MjQz\NTY=\MTE0\MjQy\MTc4\NjM=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MTcw\MTkx\MTg3\Mzk=\NDM=\MTg3\MTg1\MTE0\NTA=\MTcx\NjE=\MTE0\NTA=\MTE0\NDM=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTYz\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MjM0\MTYz\MTg3\NTg=\MTcw\MTkx\MTg3\Mzk=\NDM=\NTk=\MTg1\MTE0\NTA=\NDM=\NTE=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTA2\MTcy\MTg3\MjUw\MTcw\MTkx\MTg3\NTg=\MjM0\MTc4\MTg3\Mzk=\NDM=\NTk=\MTg1\MTE0\NTA=\NDM=\NDk=\MTc4\MTc3\MjQz\NTY=\MTc4\MjQx\MTc4\NjM=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MTcw\MTkx\MTg3\Mzk=\NDM=\MTg3\MTg1\MTc4\NDk=\MTcx\NjE=\MTc4\MTc3\MTEz\NDM=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MjM0\MTc3\MTg3\NTg=\MTcw\MTkx\MTg3\Mzk=\NDM=\NTk=\MTg1\MTc4\NDk=\NDM=\NTE=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTA2\MTcy\MTg3\MjUw\MTcw\MTkx\MTg3\NTg=\MjM0\MTc4\MTg3\Mzk=\NDM=\NTk=\MTg1\MTc4\NDk=\NDM=\NDk=\MjQy\NDk=\MjQx\NTY=\MjQy\MTc3\MTc4\NjM=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MTcw\MTkx\MTg3\Mzk=\NDM=\MTg3\MTg1\MjQy\NDk=\MTcx\NjE=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTYz\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\NDI=\MTYz\MTg3\NTg=\MTcw\MTkx\MTg3\Mzk=\NDM=\NTk=\MTg1\MjQy\NDk=\NDM=\NTE=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTA2\MTcy\MTg3\MjUw\MTcw\MTkx\MTg3\NTg=\MTA2\MTg4\MTg3\Mzk=\NDM=\NTk=\MTg1\MjQy\NDk=\NDM=\NDk=\NTA=\MTc3\MjQz\NTY=\NTA=\MjQx\MTc3\NjM=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MTcw\MTkx\MTg3\Mzk=\NDM=\MTg3\MTg1\NTA=\NDk=\MTcx\NjE=\NTA=\NDk=\MTE0\NDM=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MTcw\MTc2\MTg3\NTg=\MTcw\MTkx\MTg3\Mzk=\NDM=\NTk=\MTg1\NTA=\NDk=\NDM=\NTE=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTA2\MTcy\MTg3\MjUw\MTcw\MTkx\MTg3\NTg=\MjM0\MTc4\MTg3\Mzk=\NDM=\NTk=\MTg1\NTA=\NDk=\NDM=\NDk=\MTE0\MTc3\MjQz\NTY=\MTE0\MjQx\MTc3\NjM=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MTcw\MTkx\MTg3\Mzk=\NDM=\MTg3\MTg1\MTE0\NDk=\MTcx\NjE=\MTE0\MjQx\MTEy\NDM=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTA3\MTc5\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MTA2\MTYz\MTg3\NTg=\MTcw\MTkx\MTg3\Mzk=\NDM=\NTk=\MTg1\MTE0\NDk=\NDM=\NTE=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTcw\MTYy\MTg3\MjUw\MTcw\MTkx\MTg3\NTg=\MjM0\MTc4\MTg3\Mzk=\NDM=\NTk=\MTg1\MTE0\NDk=\NDM=\NDk=\MTc4\MTc2\MjQz\NTY=\MTc4\MjQw\MTc3\NjM=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MTcw\MTkx\MTg3\Mzk=\NDM=\MTg3\MTg1\MTc4\NDg=\MTcx\NjE=\MTc4\MTEy\MTEy\NDM=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTA3\MTc5\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MjM0\MTYy\MTg3\NTg=\MTcw\MTkx\MTg3\Mzk=\NDM=\NTk=\MTg1\MTc4\NDg=\NDM=\NTE=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTcw\MTYy\MTg3\MjUw\MTcw\MTkx\MTg3\NTg=\MjM0\MTc4\MTg3\Mzk=\NDM=\NTk=\MTg1\MTc4\NDg=\NDM=\NDk=\MjQy\MjQw\MjQ3\NTY=\MjQy\MTc2\MTc4\NjM=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MjM1\MTc3\MTg3\MTg2\MjM0\MTc3\MTg3\MjUw\MjM0\MTc3\MTg3\Mzk=\NDM=\MTg3\MTg1\MjQy\NDg=\MTcx\NjE=\MjQy\MjQw\MTEz\NDM=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTA3\MTY3\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MTA2\MTgz\MTg3\NTg=\MTcw\MTkx\MTg3\Mzk=\NDM=\NTk=\MTg1\MjQy\NDg=\NDM=\NTE=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTcw\MTgy\MTg3\MjUw\MTcw\MTkx\MTg3\NTg=\MjM0\MTgy\MTg3\Mzk=\NDM=\NTk=\MTg1\MjQy\NDg=\NDM=\NDk=\NjI=\MTA3\MTgy\MTg3\NjE=\NDM=\MjQ2\MTU0\NjE=\MTcx\MjQ1\MTU0\MjQy\NDg=\MTcx\MzI=\MjQy\NDg=\MTA1\Mzk=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MjM1\MTc3\MTg3\MTg2\MjM0\MTc3\MTg3\MjUw\MjM0\MTc3\MTg3\Mzk=\NDM=\MTg3\MTg1\MjQy\NDg=\NDM=\Mzg=\MjQy\MTEy\MjUz\Mzc=\MjQy\NDg=\MTE2\Mzc=\MjQy\MTEy\MTI1\MzY=\NTA=\MTc2\MjMw\NTY=\NTA=\MTc2\MTc4\NjM=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MTcw\MTkx\MTg3\Mzk=\NDM=\MTg3\MTg1\NTA=\NDg=\MTcx\NjE=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\NDM=\MTcx\MTg3\MTg2\MjM0\MTc3\MTg3\MjUw\MjM0\MTc3\MTg3\Mzk=\NDM=\MTg3\MTg1\NTA=\NDg=\NDM=\Mjc=\NTA=\MTc2\MTI3\NjA=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTYw\MTg3\MTg2\MTcw\MTcw\MTg3\MjUw\MjM0\MTYw\MTg3\NTg=\NDI=\MTcw\MTg3\Mzk=\NDM=\NTk=\MTg1\NTA=\NDg=\NDM=\NTE=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\NDI=\MTYx\MTg3\MjUw\MTcw\MTkx\MTg3\NTg=\MTcw\MTY5\MTg3\Mzk=\NDM=\NTk=\MTg1\NTA=\NDg=\NDM=\NDk=\NjI=\MTA3\MTgy\MTg3\NjE=\NDM=\MjQ2\MTU0\NjE=\MjM1\MjMz\MTU0\NTA=\NDg=\MTcx\MzI=\NTA=\MjQw\MTAy\Mzk=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MjM1\MTc3\MTg3\MTg2\MjM0\MTc3\MTg3\MjUw\MjM0\MTc3\MTg3\Mzk=\NDM=\MTg3\MTg1\NTA=\NDg=\NDM=\Mzg=\NTA=\MTEy\MjUz\Mzc=\NTA=\NDg=\MTE2\Mzc=\NTA=\MTEy\MTI1\MzY=\NjE=\MTA3\MjMz\MTcy\NDg=\MTcx\MjMy\MTU0\MTU5\MTcw\MTg1\MTg3\Mzk=\MjM1\NTk=\MTg2\MTE0\MjQw\MjMy\NTY=\MTE0\NDg=\MTc2\NjM=\MTE0\MTEy\MjUz\NTQ=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\NDM=\MTY4\MTg3\MTg2\MTA2\MTY4\MTg3\MjUw\MTcw\MTc1\MTg3\Mzk=\NDM=\MTg3\MTg1\MTE0\NDg=\MTcx\NjE=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\NDM=\MTcx\MTg3\MTg2\MjM0\MTc3\MTg3\MjUw\MjM0\MTc3\MTg3\Mzk=\NDM=\MTg3\MTg1\MTE0\NDg=\NDM=\Mjc=\MTE0\MTc2\MTI3\NjA=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MjM0\MTc1\MTg3\NTg=\MTcw\MTkx\MTg3\Mzk=\NDM=\NTk=\MTg1\MTE0\NDg=\NDM=\NTE=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MjM1\MTc3\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\NDI=\MTc1\MTg3\NTg=\MTcw\MTkx\MTg3\Mzk=\NDM=\NTk=\MTg1\MTE0\NDg=\NDM=\NDk=\MTc4\NTU=\MjMw\NTY=\MTc4\MTgz\MTc4\NjM=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MTcw\MTkx\MTg3\Mzk=\NDM=\MTg3\MTg1\MTc4\NTU=\MTcx\NjE=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\NDM=\MTcx\MTg3\MTg2\MjM0\MTc3\MTg3\MjUw\MjM0\MTc3\MTg3\Mzk=\NDM=\MTg3\MTg1\MTc4\NTU=\NDM=\Mjc=\MTc4\MTgz\MTI3\NjA=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTYw\MTg3\MTg2\MTcw\MTcw\MTg3\MjUw\MTA2\MTYw\MTg3\NTg=\NDI=\MTcw\MTg3\Mzk=\NDM=\NTk=\MTg1\MTc4\NTU=\NDM=\NTE=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\NDI=\MTYx\MTg3\MjUw\MTcw\MTkx\MTg3\NTg=\MTcw\MTY5\MTg3\Mzk=\NDM=\NTk=\MTg1\MTc4\NTU=\NDM=\NDk=\NjI=\MTA3\MTgy\MTg3\NjE=\NDM=\MjQ2\MTU0\NjE=\MjM1\MjMz\MTU0\MTc4\NTU=\MTcx\MzI=\MTc4\NTU=\MTAy\Mzk=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MjM1\MTc3\MTg3\MTg2\MjM0\MTc3\MTg3\MjUw\MjM0\MTc3\MTg3\Mzk=\NDM=\MTg3\MTg1\MTc4\NTU=\NDM=\Mzg=\MTc4\MTE5\MjUz\Mzc=\MTc4\NTU=\MTE2\Mzc=\MTc4\MTE5\MTI1\MzY=\NjE=\MTA3\MjMz\MTYz\NDg=\MTcx\MjMy\MTU0\MTU5\MjM0\MTg1\MTg3\Mzk=\MjM1\NTk=\MTg2\MjQy\MjQ3\MjMy\NTY=\MjQy\MTgz\MTgz\NjM=\MjQy\MTE5\MjUz\NTQ=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\NDM=\MTY4\MTg3\MTg2\MTA2\MTY4\MTg3\MjUw\MTcw\MTc1\MTg3\Mzk=\NDM=\MTg3\MTg1\MjQy\NTU=\MTcx\NjE=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\NDM=\MTcx\MTg3\MTg2\MjM0\MTc3\MTg3\MjUw\MjM0\MTc3\MTg3\Mzk=\NDM=\MTg3\MTg1\MjQy\NTU=\NDM=\Mjc=\MjQy\MTgz\MTI3\NjA=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MjM0\MTc1\MTg3\NTg=\MTcw\MTkx\MTg3\Mzk=\NDM=\NTk=\MTg1\MjQy\NTU=\NDM=\NTE=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MjM1\MTc3\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\NDI=\MTc1\MTg3\NTg=\MTcw\MTkx\MTg3\Mzk=\NDM=\NTk=\MTg1\MjQy\NTU=\NDM=\NDk=\NTA=\MTE5\MjMw\NTY=\NTA=\MTgz\MTc4\NjM=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MTcw\MTkx\MTg3\Mzk=\NDM=\MTg3\MTg1\NTA=\NTU=\MTcx\NjE=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\NDM=\MTcx\MTg3\MTg2\MjM0\MTc3\MTg3\MjUw\MjM0\MTc3\MTg3\Mzk=\NDM=\MTg3\MTg1\NTA=\NTU=\NDM=\Mjc=\NTA=\MTgz\MTI3\NjA=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTYx\MTg3\MTg2\MTcw\MTcw\MTg3\MjUw\MjM0\MTY3\MTg3\NTg=\NDI=\MTcw\MTg3\Mzk=\NDM=\NTk=\MTg1\NTA=\NTU=\NDM=\NTE=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\NDI=\MTYx\MTg3\MjUw\MTcw\MTkx\MTg3\NTg=\MTcw\MTY5\MTg3\Mzk=\NDM=\NTk=\MTg1\NTA=\NTU=\NDM=\NDk=\NjI=\MTA3\MTgy\MTg3\NjE=\NDM=\MjQ2\MTU0\NjE=\MjM1\MjMz\MTU0\NTA=\NTU=\MTcx\MzI=\NTA=\MTgz\MTAx\Mzk=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MjM1\MTc3\MTg3\MTg2\MjM0\MTc3\MTg3\MjUw\MjM0\MTc3\MTg3\Mzk=\NDM=\MTg3\MTg1\NTA=\NTU=\NDM=\Mzg=\NTA=\MTE5\MjUz\Mzc=\NTA=\NTU=\MTE2\Mzc=\NTA=\MTE5\MTI1\MzY=\NjE=\MTA3\MjMz\MTYy\NDg=\MTcx\MjMy\MTU0\MTU5\NDI=\MTg1\MTg3\Mzk=\MjM1\NTk=\MTg2\MTE0\MjQ3\MjMy\NTY=\MTE0\NTU=\MTgz\NjM=\MTE0\MTE5\MjUz\NTQ=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\NDM=\MTY4\MTg3\MTg2\MTA2\MTY4\MTg3\MjUw\MTcw\MTc1\MTg3\Mzk=\NDM=\MTg3\MTg1\MTE0\NTU=\MTcx\NjE=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\NDM=\MTcx\MTg3\MTg2\MjM0\MTc3\MTg3\MjUw\MjM0\MTc3\MTg3\Mzk=\NDM=\MTg3\MTg1\MTE0\NTU=\NDM=\Mjc=\MTE0\MTgz\MTI3\NjA=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MjM0\MTc1\MTg3\NTg=\MTcw\MTkx\MTg3\Mzk=\NDM=\NTk=\MTg1\MTE0\NTU=\NDM=\NTE=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MjM1\MTc3\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\NDI=\MTc1\MTg3\NTg=\MTcw\MTkx\MTg3\Mzk=\NDM=\NTk=\MTg1\MTE0\NTU=\NDM=\NDk=\MTc4\MjQ2\MjI5\NTY=\MTc4\MTgy\MTc4\NjM=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MTcw\MTkx\MTg3\Mzk=\NDM=\MTg3\MTg1\MTc4\NTQ=\MTcx\NjE=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\NDM=\MTcx\MTg3\MTg2\MjM0\MTc3\MTg3\MjUw\MjM0\MTc3\MTg3\Mzk=\NDM=\MTg3\MTg1\MTc4\NTQ=\NDM=\Mjc=\MTc4\MTgy\MTI3\NjA=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTYx\MTg3\MTg2\MTcw\MTcw\MTg3\MjUw\MjM0\MTYx\MTg3\NTg=\NDI=\MTcw\MTg3\Mzk=\NDM=\NTk=\MTg1\MTc4\NTQ=\NDM=\NTE=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\NDI=\MTYx\MTg3\MjUw\MTcw\MTkx\MTg3\NTg=\MTcw\MTY5\MTg3\Mzk=\NDM=\NTk=\MTg1\MTc4\NTQ=\NDM=\NDk=\NjI=\MTA3\MTgy\MTg3\NjE=\NDM=\MjQ2\MTU0\NjE=\MjM1\MjMz\MTU0\MTc4\NTQ=\MTcx\MzI=\MTc4\NTQ=\MTAx\Mzk=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MjM1\MTc3\MTg3\MTg2\MjM0\MTc3\MTg3\MjUw\MjM0\MTc3\MTg3\Mzk=\NDM=\MTg3\MTg1\MTc4\NTQ=\NDM=\Mzg=\MTc4\MTE4\MjUz\Mzc=\MTc4\NTQ=\MTE2\Mzc=\MTc4\MTE4\MTI1\MzY=\NjE=\MTA3\MjMz\MTYx\NDg=\MTcx\MjMy\MTU0\MTU5\MTA2\MTg1\MTg3\Mzk=\MjM1\NTk=\MTg2\MjQy\MjQ2\MjMy\NTY=\MjQy\MTgy\MTgy\NjM=\MjQy\MTE4\MjUz\NTQ=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\NDM=\MTY4\MTg3\MTg2\MTA2\MTY4\MTg3\MjUw\MTcw\MTc1\MTg3\Mzk=\NDM=\MTg3\MTg1\MjQy\NTQ=\MTcx\NjE=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\NDM=\MTcx\MTg3\MTg2\MjM0\MTc3\MTg3\MjUw\MjM0\MTc3\MTg3\Mzk=\NDM=\MTg3\MTg1\MjQy\NTQ=\NDM=\Mjc=\MjQy\MTgy\MTI3\NjA=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MjM0\MTc1\MTg3\NTg=\MTcw\MTkx\MTg3\Mzk=\NDM=\NTk=\MTg1\MjQy\NTQ=\NDM=\NTE=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MjM1\MTc3\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\NDI=\MTc1\MTg3\NTg=\MTcw\MTkx\MTg3\Mzk=\NDM=\NTk=\MTg1\MjQy\NTQ=\NDM=\NDk=\NTA=\MTE4\MjI5\NTY=\NTA=\MTgy\MTg3\NjM=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\NDM=\MTg0\MTg3\MTg2\NDI=\MTg0\MTg3\MjUw\NDI=\MTg0\MTg3\Mzk=\NDM=\MTg3\MTg1\NTA=\NTQ=\MTcx\NjE=\NTA=\MTgy\MTI3\NjA=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTY0\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MjM0\MTY0\MTg3\NTg=\MTcw\MTkx\MTg3\Mzk=\NDM=\NTk=\MTg1\NTA=\NTQ=\NDM=\NTE=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\NDI=\MTY0\MTg3\MjUw\MTcw\MTkx\MTg3\NTg=\MTA2\MTY0\MTg3\Mzk=\NDM=\NTk=\MTg1\NTA=\NTQ=\NDM=\NDk=\NTA=\MjQ2\MjUz\NTU=\MTE0\NTQ=\MjUy\NTY=\MTE0\NTQ=\MTgy\NjM=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MTcw\MTkx\MTg3\Mzk=\NDM=\MTg3\MTg1\MTE0\NTQ=\MTcx\NjE=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\NDI=\MTY0\MTg3\MjUw\MTcw\MTkx\MTg3\NTg=\MTA2\MTg4\MTg3\Mzk=\NDM=\NTk=\MTg1\MTE0\NTQ=\NDM=\NDk=\MTc4\MTgx\MjQz\NTY=\MTc4\MTE3\MTgy\NjM=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MTcw\MTkx\MTg3\Mzk=\NDM=\MTg3\MTg1\MTc4\NTM=\MTcx\NjE=\MTc4\NTM=\MTE1\NDM=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTU1\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MTcw\MTc4\MTg3\NTg=\MTcw\MTkx\MTg3\Mzk=\NDM=\NTk=\MTg1\MTc4\NTM=\NDM=\NTE=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MjM0\MTU1\MTg3\MjUw\MTcw\MTkx\MTg3\NTg=\MjM0\MTc4\MTg3\Mzk=\NDM=\NTk=\MTg1\MTc4\NTM=\NDM=\NDk=\MjQy\MTgx\MjQz\NTY=\MjQy\MTE3\MTgy\NjM=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MTcw\MTkx\MTg3\Mzk=\NDM=\MTg3\MTg1\MjQy\NTM=\MTcx\NjE=\MjQy\NTM=\MTE0\NDM=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTU1\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MjM0\MTYz\MTg3\NTg=\MTcw\MTkx\MTg3\Mzk=\NDM=\NTk=\MTg1\MjQy\NTM=\NDM=\NTE=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MjM0\MTU1\MTg3\MjUw\MTcw\MTkx\MTg3\NTg=\MjM0\MTc4\MTg3\Mzk=\NDM=\NTk=\MTg1\MjQy\NTM=\NDM=\NDk=\NTA=\MTgx\MjQz\NTY=\NTA=\MTE3\MTgy\NjM=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MTcw\MTkx\MTg3\Mzk=\NDM=\MTg3\MTg1\NTA=\NTM=\MTcx\NjE=\NTA=\MTgx\MTEz\NDM=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MjM0\MTc3\MTg3\NTg=\MTcw\MTkx\MTg3\Mzk=\NDM=\NTk=\MTg1\NTA=\NTM=\NDM=\NTE=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\NDI=\MTY0\MTg3\MjUw\MTcw\MTkx\MTg3\NTg=\MjM0\MTc4\MTg3\Mzk=\NDM=\NTk=\MTg1\NTA=\NTM=\NDM=\NDk=\MTE0\NTM=\MjQx\NTY=\MTE0\NTM=\MTgy\NjM=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MTcw\MTkx\MTg3\Mzk=\NDM=\MTg3\MTg1\MTE0\NTM=\MTcx\NjE=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\NDM=\MTU1\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MTA2\MTU1\MTg3\NTg=\MTcw\MTkx\MTg3\Mzk=\NDM=\NTk=\MTg1\MTE0\NTM=\NDM=\NTE=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MjM0\MTU1\MTg3\MjUw\MTcw\MTkx\MTg3\NTg=\MTA2\MTg4\MTg3\Mzk=\NDM=\NTk=\MTg1\MTE0\NTM=\NDM=\NDk=\MTc4\MTgw\MjQz\NTY=\MTc4\MTE2\MTgx\NjM=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MTcw\MTkx\MTg3\Mzk=\NDM=\MTg3\MTg1\MTc4\NTI=\MTcx\NjE=\MTc4\NTI=\MTE0\NDM=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MTcw\MTc2\MTg3\NTg=\MTcw\MTkx\MTg3\Mzk=\NDM=\NTk=\MTg1\MTc4\NTI=\NDM=\NTE=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MjM0\MTU1\MTg3\MjUw\MTcw\MTkx\MTg3\NTg=\MjM0\MTc4\MTg3\Mzk=\NDM=\NTk=\MTg1\MTc4\NTI=\NDM=\NDk=\MjQy\MTgw\MjQz\NTY=\MjQy\MTE2\MTgx\NjM=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MTcw\MTkx\MTg3\Mzk=\NDM=\MTg3\MTg1\MjQy\NTI=\MTcx\NjE=\MjQy\MjQ0\MTEy\NDM=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTU0\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MTA2\MTYz\MTg3\NTg=\MTcw\MTkx\MTg3\Mzk=\NDM=\NTk=\MTg1\MjQy\NTI=\NDM=\NTE=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MjM0\MTU0\MTg3\MjUw\MTcw\MTkx\MTg3\NTg=\MjM0\MTc4\MTg3\Mzk=\NDM=\NTk=\MTg1\MjQy\NTI=\NDM=\NDk=\NTA=\MTgw\MjQz\NTY=\NTA=\MTE2\MTgx\NjM=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MTcw\MTkx\MTg3\Mzk=\NDM=\MTg3\MTg1\NTA=\NTI=\MTcx\NjE=\NTA=\MTE2\MTEy\NDM=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTU0\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MjM0\MTYy\MTg3\NTg=\MTcw\MTkx\MTg3\Mzk=\NDM=\NTk=\MTg1\NTA=\NTI=\NDM=\NTE=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MjM0\MTU0\MTg3\MjUw\MTcw\MTkx\MTg3\NTg=\MjM0\MTc4\MTg3\Mzk=\NDM=\NTk=\MTg1\NTA=\NTI=\NDM=\NDk=\MTE0\MjQ0\MjQ3\NTY=\MTE0\NTI=\MTgy\NjM=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MjM1\MTc3\MTg3\MTg2\MjM0\MTc3\MTg3\MjUw\MjM0\MTc3\MTg3\Mzk=\NDM=\MTg3\MTg1\MTE0\NTI=\MTcx\NjE=\MTE0\MjQ0\MTEz\NDM=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\NDM=\MTU0\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MTA2\MTU0\MTg3\NTg=\MTcw\MTkx\MTg3\Mzk=\NDM=\NTk=\MTg1\MTE0\NTI=\NDM=\NTE=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTcw\MTUz\MTg3\MjUw\MTcw\MTkx\MTg3\NTg=\MjM0\MTgy\MTg3\Mzk=\NDM=\NTk=\MTg1\MTE0\NTI=\NDM=\NDk=\NjI=\MTA3\MTgy\MTg3\NjE=\NDM=\MjQ2\MTU0\NjE=\MTcx\MjQ1\MTU0\MTE0\NTI=\MTcx\MzI=\MTE0\MjQ0\ODk=\Mzk=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MjM1\MTc3\MTg3\MTg2\MjM0\MTc3\MTg3\MjUw\MjM0\MTc3\MTg3\Mzk=\NDM=\MTg3\MTg1\MTE0\NTI=\NDM=\Mzg=\MTE0\MTE2\MjUz\Mzc=\MTE0\NTI=\MTE2\Mzc=\MTE0\MTE2\MTI1\MzY=\MTc4\NDM=\MTgy\NjM=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MjM1\MTc3\MTg3\MTg2\MjM0\MTc3\MTg3\MjUw\MjM0\MTc3\MTg3\Mzk=\NDM=\MTg3\MTg1\MTc4\NDM=\MTcx\NjE=\MTc4\MjM1\MTEz\NDM=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\NDM=\MTUz\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MTA2\MTUz\MTg3\NTg=\MTcw\MTkx\MTg3\Mzk=\NDM=\NTk=\MTg1\MTc4\NDM=\NDM=\NTE=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\MTcw\MTUy\MTg3\MjUw\MTcw\MTkx\MTg3\NTg=\MjM0\MTUy\MTg3\Mzk=\NDM=\NTk=\MTg1\MTc4\NDM=\NDM=\NDk=\NjI=\MTA3\MTgy\MTg3\NjE=\NDM=\MjQ2\MTU0\NjE=\MjM1\MjMz\MTU0\MTc4\NDM=\MTcx\MzI=\MTc4\NDM=\ODg=\Mzk=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MjM1\MTc3\MTg3\MTg2\MjM0\MTc3\MTg3\MjUw\MjM0\MTc3\MTg3\Mzk=\NDM=\MTg3\MTg1\MTc4\NDM=\NDM=\Mzg=\MTc4\MTA3\ODg=\Mzc=\MTc4\MTA3\MTI1\MzY=\NjI=\MTA3\MTgy\MTg3\NjE=\MTcx\MjIz\MTU0\NjE=\MjM1\MjIz\MTU0\MTc4\NDM=\MTcx\MTE1\NjI=\MTA3\MTgy\MTg3\NjE=\NDM=\MjIz\MTU0\NjE=\MTA3\MjIz\MTU0\MTc4\NDM=\MTcx\MTE0\MjQy\NDM=\MTgy\NjM=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MjM1\MTc3\MTg3\MTg2\MjM0\MTc3\MTg3\MjUw\MjM0\MTc3\MTg3\Mzk=\NDM=\MTg3\MTg1\MjQy\NDM=\MTcx\NjE=\MjQy\MjM1\MTEz\NDM=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTU4\MTg3\MTg2\MTcw\MTkx\MTg3\MjUw\MjM0\MTU4\MTg3\NTg=\MTcw\MTkx\MTg3\Mzk=\NDM=\NTk=\MTg1\MjQy\NDM=\NDM=\NTE=\NjI=\NDM=\MTkx\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MTcx\MTkx\MTg3\MTg2\NDI=\MTU4\MTg3\MjUw\MTcw\MTkx\MTg3\NTg=\MTA2\MTU4\MTg3\Mzk=\NDM=\NTk=\MTg1\MjQy\NDM=\NDM=\NDk=\NjI=\MTA3\MTgy\MTg3\NjE=\NDM=\MjQ2\MTU0\NjE=\MjM1\MjMz\MTU0\MjQy\NDM=\MTcx\MzI=\MjQy\MTcx\OTM=\Mzk=\NjI=\MjM1\MTg0\MTg3\NjE=\MjM1\MjUx\MTU0\MTIy\MjM1\MTc3\MTg3\MTg2\MjM0\MTc3\MTg3\MjUw\MjM0\MTc3\MTg3\Mzk=\NDM=\MTg3\MTg1\MjQy\NDM=\NDM=\Mzg=\MjQy\MjM1\OTM=\Mzc=\MjQy\MTA3\MTI1\MzY=\NjI=\MTA3\MTgy\MTg3\NjE=\MTcx\MjIz\MTU0\NjE=\MjM1\MjIz\MTU0\MjQy\NDM=\MTcx\MTE1\NjI=\MTA3\MTgy\MTg3\NjE=\NDM=\MjIz\MTU0\NjE=\MTA3\MjIz\MTU0\MjQy\NDM=\MTcx\MTE0\MTY1\MTg3\NTk=\MTg3\MzM=\MTg3\MTg3\MTg3\MTkx\MTc4\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjQy\MjEz\MjAw\MjA3\MjE4\MjEz\MjE2\MjIy\MTg3\MTkx\MTkx\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjEz\MjIy\MjA0\MTg3\MTkx\MTc3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjMy\MjE2\MjAx\MjIy\MjIy\MjEz\MjUy\MjA2\MjEw\MTg3\MTkx\MTg5\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjUz\MjAx\MjE4\MjE0\MjIy\MTg3\MTkx\MTc3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjM5\MjIy\MTk1\MjA3\MjQ3\MjE4\MjE3\MjIy\MjE1\MTg3\MTkx\MTc2\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjM5\MjIy\MTk1\MjA3\MjQ5\MjA2\MjA3\MjA3\MjEy\MjEz\MTg3\MTkx\MTkw\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjQ1\MjE4\MjE0\MjIy\MTg3\MTkx\MTcw\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjM4\MTMx\MTM3\MTMw\MjUy\MjI2\MjQz\MTQz\MjMz\MTMx\MTMw\MTQw\MTQz\MjU0\MTMx\MjUz\MTg3\MTkx\MTg4\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjM1\MjE4\MjAx\MjIy\MjEz\MjA3\MTg3\MTkx\MTkw\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjIw\MjE4\MjE0\MjIy\MTg3\MTkx\MTc5\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjQ4\MjEy\MjAx\MjIy\MjUy\MjA2\MjEw\MTg3\MTkx\MTc3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjQ2\MjE4\MjEw\MjEz\MjUz\MjAx\MjE4\MjE0\MjIy\MTg3\MTkx\MTcw\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjQ5\MjE4\MjE2\MjA4\MjIw\MjAx\MjEy\MjA2\MjEz\MjIz\MjQ4\MjEy\MjE1\MjEy\MjAx\MTM2\MTg3\MTkx\MTg4\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjQ4\MjEy\MjE1\MjEy\MjAx\MTM2\MTg3\MTg0\MzM=\MTky\MjQz\Njc=\MTAx\MTAw\MTAw\MTMy\MTkx\MTcx\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjQ5\MjEy\MjAx\MjIz\MjIy\MjAx\MjMy\MjEw\MTkz\MjIy\MjM1\MjEw\MTk1\MjIy\MjE1\MTg3\MTg0\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTkx\MTc4\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjM1\MjEy\MjAw\MjEw\MjA3\MjEw\MjEy\MjEz\MTg3\MTkx\MTg5\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjM4\MjU1\MjEw\MjE0\MTM3\MTg3\MTg0\MjI0\MzA=\MTEw\MTMy\MjAy\MTE1\OTk=\MTMy\MTg0\NDA=\MjMy\MTk4\MTAw\Mjk=\MTM1\MTA3\MTMy\MTkx\MTkw\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjMy\MjEw\MTkz\MjIy\MTg3\MTg0\MTg3\MTg3\MTg3\MTg3\MTg3\OTE=\MjA1\MjUx\MTg0\MTg3\MTg3\MTg3\MTg3\MTg3\MjE5\MTk5\MjUx\MTkx\MTc5\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjM3\MjEw\MjAw\MjEw\MjE3\MjE1\MjIy\MTg3\MTg2\MTg3\MTkx\MTg4\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjUw\MjE2\MjA3\MjEw\MjA1\MjIy\MTg3\MTg2\MTg2\MTkx\MTc2\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjMy\MjIy\MjE1\MjIy\MjE2\MjA3\MjE4\MjE3\MjE1\MjIy\MTg3\MTkx\MTc3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjU1\MjAx\MjE4\MjIw\MjIw\MjE4\MjE3\MjE1\MjIy\MTg3\MTkx\MTg4\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjM5\MjEy\MjAz\MjQ5\MjE4\MjAx\MTg3\MTg0\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTM0\MjUx\MTkx\MTkw\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjUz\MjE4\MjIz\MjIy\MTg3\MTkx\MTcy\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjQ5\MjE4\MjE2\MjA4\MjIw\MjAx\MjEy\MjA2\MjEz\MjIz\MjM5\MjAx\MjE4\MjEz\MjAw\MjAz\MjE4\MjAx\MjIy\MjEz\MjE2\MTk0\MTg3\MTg0\MTc4\MTg3\MTg3\Mjc=\MzQ=\MzQ=\ODI=\MTMy\MTg0\MjQ5\MjMw\MTM=\MjI4\ODc=\MjE4\MjIx\NA==\MTg0\MjA1\MTY0\MQ==\MTk2\MTE=\MTAz\NzI=\MTMy\MTg0\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTY3\MjUx\MTg0\ODY=\Njg=\Njg=\NA==\MTE5\MTE5\ODc=\MTMy\MTg0\ODc=\MTMz\MjA3\Njg=\MjE5\Mg==\NzY=\MTMy\MTg0\MTY4\MTg3\MTg3\MjUx\MTM2\MTM2\ODg=\MTMy\MTg0\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\NzU=\MTMy\MTkx\MTc3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjQ5\MjEy\MjA3\MjA3\MjEy\MjE0\MjQ5\MjE4\MjAx\MTg3\MTg0\MjE5\MTk2\NQ==\MzY=\MjI=\ODk=\ODY=\MTMy\MTg0\MTQ1\MjQx\MTAz\MTMy\MTUy\MTUx\OTI=\NA==\MTg0\NzY=\Njg=\Njg=\MjI4\MjIx\MjIx\OTM=\MTMy\MTg0\Nw==\MTQy\Ng==\MTk2\NjM=\OTQ=\MTAx\NA==\MTg0\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\OTE=\MTMy\MTg0\MjQw\MjE=\NTY=\Njg=\NjM=\OTQ=\MTE3\NA==\MTkx\MTg5\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjM5\MjEw\MjA3\MjE1\MjIy\MTg3\MTg0\NTA=\MTU5\MjQx\OTE=\MjE=\NDY=\MjQ=\MTMy\MTg0\NDg=\MjUx\MjQ4\MzY=\NDE=\ODE=\MTIz\MTMy\MTg0\MTg3\MTg3\MTg3\MTg3\MTg3\OTE=\MjA3\MjUx\MTg0\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjQ3\MjUx\MTkx\MTkw\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjUz\MjEy\MjEz\MjA3\MTg3\MTkx\MTkw\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjU0\MjEz\MjA2\MjE0\MTg3\MTkx\MTgw\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjMy\MjEy\MjA2\MjAx\MjE2\MjIy\MjMy\MjE4\MjEz\MjAw\MjQ5\MjEy\MjE1\MjIz\MTg3\MTkx\MTkw\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjM5\MjIy\MTk1\MjA3\MTg3\MTkx\MTc0\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjU1\MjEy\MjEy\MjE0\MjAw\MjAz\MjEw\MjAx\MjIy\MTU1\MjUz\MjA2\MjE2\MjA4\MjIy\MjAx\MTU1\MTM4\MTQ5\MTM5\MTg3\MTkx\MTc2\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjM5\MjIy\MTk1\MjA3\MjQ4\MjEy\MjE1\MjEy\MjAx\MTM2\MTg3\MTkx\MTc2\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjM5\MjIy\MTk1\MjA3\MjMy\MjE2\MjE4\MjE1\MjIy\MjIz\MTg3\MTkx\MTc4\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjM5\MjIy\MTk1\MjA3\MjMy\MjEw\MTkz\MjIy\MTg3\MTg0\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTUx\MjUx\MTkx\MTgz\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjM5\MjIy\MTk1\MjA3\MjM2\MjAx\MjE4\MjAz\MjAz\MjIy\MjIz\MTg3\MTkx\MTgw\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjUz\MjA2\MjEz\MjE2\MjA3\MjEw\MjEy\MjEz\MjQ5\MjA2\MjA3\MjA3\MjEy\MjEz\MTg3\MTkx\MTgy\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjQ5\MjEy\MjAx\MjIz\MjIy\MjAx\MjQ4\MjEy\MjE1\MjEy\MjAx\MTM2\MTg3\MTg0\MjMw\MjM0\MjQx\MTc5\MjM3\MjM4\OTQ=\MTMy\MTg0\NjQ=\MTc0\NQ==\MTg3\NzI=\MTcy\NzU=\MTMy\MTg0\MTg3\MTg3\MTg3\MTg3\MTg3\OTE=\MjA2\MTIz\MTg0\NDc=\MjM1\Ng==\MTAw\MjA=\MjQ3\OTU=\MTMy\MTg0\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjI2\MTIz\MTg0\MTg3\MTg3\MTg3\MTg3\MTg3\NDM=\MjA3\MjUx\MTg0\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjQy\MjUx\MTkx\MTcx\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjMy\MjEy\MjA2\MjAx\MjE2\MjIy\MjMy\MjE4\MjEz\MjAw\MjQ3\MjEw\MjIw\MjEx\MjA3\MTg3\MTkx\MTc3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjUz\MjA2\MjEz\MjE2\MjA3\MjEw\MjEy\MjEz\MjAw\MTg3\MTkx\MTY5\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjQ2\MjEy\MjA2\MjAw\MjIy\MjQ5\MjA2\MjA3\MjA3\MjEy\MjEz\MTM4\MjQ4\MjE1\MjEw\MjE2\MjA4\MTg3\MTkx\MTc5\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjQ4\MjEy\MjEz\MjEz\MjIy\MjE2\MjA3\MTg3\MTkx\MTg5\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjMy\MjEx\MjE4\MjIz\MjIy\MTg3\MTg0\MTk=\MTY1\MjEw\MjAz\MjI0\MjI0\OTY=\MTMy\MTg0\MjA3\MTU2\OTk=\MTk2\Mzg=\MzI=\OTY=\MTMy\MTg0\OTY=\MTc0\NjU=\MjE5\MTYy\MTYw\OTY=\MTMy\MTg0\MzQ=\MjM5\MTIz\MTk2\ODA=\MjM0\NzU=\MTMy\MTg0\NDI=\ODE=\Mzk=\MzY=\MzQ=\MzQ=\MTg=\MTMy\MTkx\MTgy\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjQ4\MjAx\MjIy\MjIz\MjEw\MjA3\MjQ5\MjA2\MjA3\MjA3\MjEy\MjEz\MTg3\MTg0\OTI=\NDA=\MTQ5\MjE5\MjA1\Ng==\ODM=\MTMy\MTkx\MTcz\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjQ4\MjAx\MjIy\MjIz\MjEw\MjA3\MTU1\MTQ0\MTU1\MjQy\MjEz\MjAw\MjA3\MjAx\MjA2\MjE2\MjA3\MjEw\MjEy\MjEz\MjAw\MTg3\MTkx\MTcx\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjM5\MjIy\MjE1\MjIy\MjAz\MjEy\MjAx\MjA3\MjAw\MjQ5\MjA2\MjA3\MjA3\MjEy\MjEz\MTg3\MTg0\MTQy\MTE2\MTM=\MTMy\Nw==\NDA=\MTAw\MTMy\MTkx\MTc3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjM5\MjIy\MjE1\MjIy\MjAz\MjEy\MjAx\MjA3\MjAw\MTg3\MTkx\MTc3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjQ0\MjAz\MjIy\MjEz\MjQ4\MjE1\MjEy\MjAw\MjIy\MTg3\MTg0\MTY0\MzM=\MjU1\NTk=\MTk4\MTY=\ODk=\MTMy\MTg0\MTk5\MTgw\MTQ1\NTk=\MjQz\MjAz\ODE=\MTMy\MTkx\MTcw\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjQ0\MjAz\MjIy\MjEz\MTU1\MTQ4\MTU1\MjQ4\MjE1\MjEy\MjAw\MjIy\MTU1\MjUy\MjA2\MjEw\MTg3\MTkx\MTc4\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjM5\MjIy\MjE1\MjIy\MjAz\MjEy\MjAx\MjA3\MTg3\MTg0\MjIw\MTc0\MTU5\MTU1\Mjc=\MTg4\ODg=\MTMy\MTg0\MTg3\MTg3\MTg3\MTg3\MTg3\MTE=\MjAw\MjUx\MTg0\MTM3\OA==\MjA1\MTU1\NjE=\MjE4\MjIx\NA==\MTg0\MTMy\NDY=\MTc=\MTY0\MjE4\Mg==\NzY=\MTMy\MTg0\MjE1\MzQ=\MTcw\NTk=\MjI=\ODk=\ODY=\MTMy\MTg0\MjEw\MTAw\NjE=\MjI4\NjM=\OTQ=\MTAx\NA==\MTg0\MTg3\MTg3\MTg3\MTg3\MTg3\MTIz\MjAw\MjUx\MTg0\MTU2\MTIz\MzQ=\MjE5\NjM=\OTQ=\MTE3\NA==\MTg0\MTI5\OQ==\Nzc=\MjI4\Nzg=\MjM=\Mjk=\NA==\MTkx\MTg4\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjI2\MjIy\MjE1\MjE1\MjEy\MjA0\MTg3\MTg0\MTY4\ODM=\Mw==\NA==\MTY0\ODg=\NzM=\MTMy\MTg0\OA==\MjM=\Njk=\MTk2\MTA2\NTc=\OTU=\MTMy\MTg0\MTg3\MTg3\MTg3\MTg3\MTg3\NzU=\MjAz\MjUx\MTkx\MTg5\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjUy\MjAx\MjIy\MjIy\MjEz\MTg3\MTg0\MTAw\MTQx\MjMy\MTU0\MTY1\MTE0\NzM=\MTMy\MTg0\MzM=\MjMy\NzM=\MTk2\NTg=\MTE2\ODM=\MTMy\MTkx\MTkw\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjQ5\MjE1\MjA2\MjIy\MTg3\MTg0\NTg=\NjU=\OTQ=\MTk2\MTM4\MTY3\ODY=\MTMy\MTkx\MTkx\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjMz\MjIy\MjIz\MTg3\MTg0\MjAy\NjA=\MTMw\NTk=\Njg=\Njg=\MTAw\MTMy\MTg0\MTk0\MzQ=\MTkz\MjUx\MjQ2\ODA=\MTE1\MTMy\MTg0\ODI=\MjIw\MTM=\MjI4\MTIy\MjE1\MjQ=\NA==\MTkx\MTc5\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjQw\MjEw\MjE1\MjE1\MjUw\MjE1\MjE1\MTg3\MTkx\MTU3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjQw\MjEw\MjE1\MjE1\MTU1\MjE4\MjE1\MjE1\MTU1\MjI0\MjA0\MjEy\MjAx\MjA4\MjAw\MTU1\MjE3\MjIy\MjAw\MjA3\MTU1\MjA0\MjEw\MjA3\MjEx\MTU1\MjIx\MjEy\MjAx\MjE2\MjIy\MjIx\MjEw\MjIy\MjE1\MjIz\MjMw\MTg3\MTkx\MTg5\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjMy\MjAz\MjIy\MjIy\MjIz\MTg3\MTkx\MTg5\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjMz\MjIy\MjE4\MjE2\MjEx\MTg3\MTkx\MTc3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjMz\MjIy\MjE4\MjE2\MjEx\MTU1\MjQz\MjE4\MTk1\MTg3\MTkx\MTc5\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjM5\MjAz\MjA3\MjEy\MjE4\MjE1\MjE1\MTg3\MTkx\MTc3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjM5\MjM1\MTU1\MjA3\MjEy\MTU1\MjE4\MjE1\MjE1\MTg3\MTkx\MTg4\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjQ4\MjAx\MjIy\MjIz\MjEw\MjA3\MTg3\MTg0\MjQ5\MjQ0\MTc3\MTIz\MTUw\MTg1\MTA1\MTMy\MTg0\MjQy\ODI=\MjM2\MTg3\ODI=\MjQ2\MTk5\MTMy\MTg0\MTg3\MTg3\MTg3\MTg3\MTg3\MzU=\NTE=\MjUx\MTg0\MTg3\MTg3\MTg3\MTg3\MTg3\MTIz\MjE1\MjUx\MTg0\MTUz\NDQ=\OTE=\Njg=\MjAy\MjE4\MjIx\NA==\MTg0\MTg3\MTg3\MTg3\MTg3\MTg3\MTE=\NTE=\MjUx\MTg0\MTI4\MTA2\MjIz\MjUx\MjA1\MjE4\MjIx\NA==\MTg0\MTg5\MTUx\MTQ0\OTE=\MjI=\ODk=\ODY=\MTMy\MTg0\MzI=\NzM=\MjA2\Njg=\MTAz\MjE4\MjIx\NA==\MTg0\MTg3\MTg3\MTg3\MTg3\MTg3\MTIz\NTE=\MjUx\MTg0\MjE5\NA==\MTAx\Njg=\NzM=\NTA=\MTE=\NA==\MTg0\MTk1\Mjc=\Nzg=\MTIz\MTUx\NTU=\NA==\MTMy\MTg0\MTg3\MTg3\MTg3\MTg3\MTg3\MTQ3\NDk=\MjUx\MTkx\MTcy\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjQ4\MjAx\MjIy\MjIz\MjEw\MjA3\MTU1\MTU1\MTQ0\MTU1\MjQy\MjEz\MjAw\MjA3\MjAx\MjA2\MjE2\MjA3\MjEw\MjEy\MjEz\MjAw\MTg3\MTg0\NjA=\MjI4\NTA=\NQ==\Ng==\NDU=\NTU=\MTMy\MTg0\MTgx\OTI=\MTU0\MTU1\MjQ2\MTY0\MTEx\MTMy\MTg0\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjA4\MjUx\MTg0\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjI5\MjUx\MTkx\MjE3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjQ4\MjAx\MjIy\MjIz\MjEw\MjA3\MTI5\MTc3\MTc3\MjM4\MjQy\MTU1\MjU1\MjIy\MjAw\MjEw\MjIw\MjEz\MjIy\MjIz\MTU1\MjE3\MTk0\MTU1\MjM5\MjEy\MTk1\MjEw\MjE2\MTUy\MTM3\MTQw\MTMw\MTMw\MTc3\MTc3\MjMy\MjE2\MjAx\MjEw\MjAz\MjA3\MjIy\MjIz\MTU1\MjE3\MTk0\MTU1\MjM5\MjEy\MTk1\MjEw\MjE2\MTUy\MTM3\MTQw\MTMw\MTMw\MTc3\MTc3\MjM1\MjEy\MjAw\MjA3\MjIy\MjIz\MTU1\MjEy\MjEz\MTU1\MjA1\MTM2\MjAx\MjE0\MjEw\MjE1\MjE1\MjEw\MjEy\MjEz\MTU1\MjE3\MTk0\MTI5\MTU1\MjEw\MjEw\MjM5\MjEy\MTk1\MjEw\MjE2\MjEw\MjA3\MTk0\MTc3\MTc3\MTg3\MTg0\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTQ5\MjUx\MTkx\MTgw\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjM5\MjIy\MTk1\MjA3\MjI3\MjUw\MjE1\MjEw\MjIw\MjEz\MjE0\MjIy\MjEz\MjA3\MTg3\MTkx\MTkw\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjQ3\MjIy\MjIx\MjA3\MTg3\MTkx\MTgw\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjM5\MjIy\MTk1\MjA3\MjI2\MjUw\MjE1\MjEw\MjIw\MjEz\MjE0\MjIy\MjEz\MjA3\MTg3\MTkx\MTkx\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjM5\MjEy\MjAz\MTg3\MTg0\MjUw\MTU0\MTQy\Njg=\MjU0\MjM3\MTE0\MTMy\MTg0\MTAy\MjI4\MTY3\OTE=\MjAx\ODE=\MTA5\MTMy\MTg0\MTg3\MTg3\MTg3\MTg3\MTg3\MTU1\NTc=\MjUx\MTg0\MTg3\MTg3\MTg3\MTg3\MTg3\NTk=\MjMw\MjUx\MTkx\Mw==\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjM5\MjEy\MTU1\MjA2\MjAw\MjIy\MTU1\MjA3\MjEx\MjEw\MjAw\MTU1\MjAw\MjE2\MjAx\MjEw\MjAz\MjA3\MTUx\MTU1\MjEz\MjE4\MjA1\MjEw\MjIw\MjE4\MjA3\MjIy\MTU1\MjA3\MjEx\MjAx\MjEy\MjA2\MjIw\MjEx\MTU1\MjA3\MjEx\MjIy\MTU1\MjE0\MjIy\MjEz\MjA2\MTUx\MTU1\MjE4\MjEz\MjIz\MTU1\MjIx\MjA2\MjEz\MjE2\MjA3\MjEw\MjEy\MjEz\MjAw\MTUx\MTU1\MTk0\MjEy\MjA2\MTU1\MjE2\MjE4\MjEz\MTU1\MjA2\MjAw\MjIy\MTU1\MjAx\MjIy\MjE4\MjE2\MjEx\MTUx\MTU1\MjA3\MjAz\MTU1\MjA3\MjEy\MTU1\MjE4\MjE1\MjE1\MTUx\MTU1\MjAw\MjAz\MjIy\MjIy\MjIz\MTUx\MTU1\MjE4\MjEz\MjIz\MTU1\MjEw\MjEz\MTU1\MjA3\MjEx\MjIy\MTU1\MjA3\MjIy\MjE1\MjIy\MjAz\MjEy\MjAx\MjA3\MjAw\MTU1\MjE0\MjIy\MjEz\MjA2\MTUx\MTU1\MTk0\MjEy\MjA2\MTU1\MjE2\MjE4\MjEz\MTU1\MjA3\MjIy\MjE1\MjIy\MjAz\MjEy\MjAx\MjA3\MTU1\MjA3\MjEy\MTU1\MjA3\MjEx\MjIy\MTU1\MjE3\MjEy\MjA3\MjA3\MjEy\MjE0\MjAw\MTU1\MjEy\MjIx\MTU1\MjE3\MjE4\MjAw\MjIy\MjAw\MTUx\MTU1\MjE4\MjEz\MjIz\MTU1\MjE3\MjE1\MjEy\MjA0\MTU1\MjIy\MjE0\MTU1\MjA2\MjAz\MTQ5\MTg3\MTg0\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTMw\MjUx\MTgz\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjU=\MTg3\MTg3\MTg3\Mjg=\MTg3\MTg3\MTg3\MTg2\MTg3\MTg3\MTg1\MTgz\MTg3\MTg3\MTg3\MTkx\MTg3\MTg3\MTg3\MjU1\MTg3\MTg3\MTg3\MjUz\MTg3\MTIz\MTg3\MjMy\MTg3\NTk=\MTg3\MTc4\MjUx\MTg3\NTk=\MTkx\MTg3\MTg3\MTg3\MTc4\NTk=\MTIz\NTk=\MTkx\MTg3\MTg3\MTg3\MTc4\NTk=\MTIz\NTg=\MTkx\MTg3\MTg3\MTg3\MTc4\NTk=\MjUx\NTc=\MTY1\MTg3\NTk=\MTg3\MTkw\MTg3\MTg3\MTg3\MTkx\MTc5\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjM3\MjEw\MjAw\MjEw\MjE3\MjE1\MjIy\MTg3\MTkx\MTg4\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjUw\MjE2\MjA3\MjEw\MjA1\MjIy\MTg3\MTg2\MTg2\MTkx\MTc2\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjMy\MjIy\MjE1\MjIy\MjE2\MjA3\MjE4\MjE3\MjE1\MjIy\MTg3\MTkx\MTc3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjU1\MjAx\MjE4\MjIw\MjIw\MjE4\MjE3\MjE1\MjIy\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\NA==\MTg3\MTg3\MTg3\MTI3\MTg3\MTg3\MTg3\MTg2\MTg3\MTg3\MTg1\MTgz\MTg3\MTg3\MTg3\MTkx\MTg3\MTg3\MTg3\MjU1\MTg3\MTg3\MTg3\MjUz\MTg3\MTIz\MTg3\MjMy\MTg3\NTk=\MTg3\MTc4\MjUx\MTg3\NTk=\MTkx\MTg3\MTg3\MTg3\MTc4\NTk=\MTIz\NTk=\MTkx\MTg3\MTg3\MTg3\MTc4\NTk=\MTIz\NTg=\MTkx\MTg3\MTg3\MTg3\MTc4\NTk=\MjUx\NTc=\MTY1\MTg3\NTk=\MTg3\MTkw\MTg3\MTg3\MTg3\MTkx\MTc5\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjM3\MjEw\MjAw\MjEw\MjE3\MjE1\MjIy\MTg3\MTkx\MTc2\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjMy\MjIy\MjE1\MjIy\MjE2\MjA3\MjE4\MjE3\MjE1\MjIy\MTg3\MTg2\MTg2\MTkx\MTg4\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjUw\MjE2\MjA3\MjEw\MjA1\MjIy\MTg3\MTkx\MTc3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjU1\MjAx\MjE4\MjIw\MjIw\MjE4\MjE3\MjE1\MjIy\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTAz\MTg3\MTg3\MTg3\OTA=\MTg3\MTg3\MTg3\MTg2\MTg3\MTg3\MTg1\MTgz\MTg3\MTg3\MTg3\MTkx\MTg3\MTg3\MTg3\MjU1\MTg3\MTg3\MTg3\MjUz\MTg3\MTIz\MTg3\MjMy\MTg3\NTk=\MTg3\MTc4\MjUx\MTg3\NTk=\MTkx\MTg3\MTg3\MTg3\MTc4\NTk=\MTIz\NTk=\MTkx\MTg3\MTg3\MTg3\MTc4\NTk=\MTIz\NTg=\MTkx\MTg3\MTg3\MTg3\MTc4\NTk=\MjUx\NTc=\MTY1\MTg3\NTk=\MTg3\MTkw\MTg3\MTg3\MTg3\MTkx\MTc5\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjM3\MjEw\MjAw\MjEw\MjE3\MjE1\MjIy\MTg3\MTkx\MTg4\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjUw\MjE2\MjA3\MjEw\MjA1\MjIy\MTg3\MTg2\MTg2\MTkx\MTc2\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjMy\MjIy\MjE1\MjIy\MjE2\MjA3\MjE4\MjE3\MjE1\MjIy\MTg3\MTkx\MTc3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjU1\MjAx\MjE4\MjIw\MjIw\MjE4\MjE3\MjE1\MjIy\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\NzA=\MTg3\MTg3\MTg3\Njg=\MTg3\MTg3\MTg3\MTg2\MTg3\MTg3\MTg1\MTg5\MTg3\MTg3\MTg3\MTkx\MTg3\MTg3\MTg3\MjU1\MTg3\MTg3\MTg3\MjUz\MTg3\MTIz\MTg3\MjMy\MTg3\NTk=\MTg3\MTc4\MjUx\MTg3\NTk=\MTY1\MTg3\NTk=\MTg3\MTg2\MTg3\MTg3\MTg3\MTkx\MTc5\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjM3\MjEw\MjAw\MjEw\MjE3\MjE1\MjIy\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjI3\MTg2\MTg3\MTg3\MjI1\MTg2\MTg3\MTg3\MTg3\MTg3\MTg3\MTkw\MTgy\MTg3\MTg3\MTg3\MTkw\MTg3\MTg3\MTg3\MTg5\MjUx\MjUx\MTg3\MTg5\NTk=\MjUx\MTg3\MTg5\MTIz\MjUx\MTg3\MTg5\MTg3\MjUw\MTg3\MjU0\MjUx\MTg2\MTg3\MjUz\NTk=\MTIy\MTg3\NTg=\MTIz\MTg2\MTg3\MTIy\MTg3\MTg1\MTg3\MTg2\MjUw\MTg1\MTg3\MjMx\NTk=\MTg3\MTg1\MTc4\MjUx\NTk=\NTc=\MTY1\MTg3\NTk=\MTg3\MTc3\MTg3\MTg3\MTg3\MTkx\MTkw\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjIw\MjE4\MjE0\MjIy\MTg3\MTkx\MTc5\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjM1\MjE1\MjE4\MTk0\MjIy\MjAx\MjAw\MTg3\MTkx\MTgz\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjQ3\MjEy\MjE2\MjE4\MjE1\MjM1\MjE1\MjE4\MTk0\MjIy\MjAx\MTg3\MTkx\MTc3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjQ4\MjEx\MjE4\MjAx\MjE4\MjE2\MjA3\MjIy\MjAx\MTg3\MTkx\MTcw\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjQz\MjA2\MjE0\MjE4\MjEz\MjEy\MjEw\MjIz\MjMz\MjEy\MjEy\MjA3\MjM1\MjE4\MjAx\MjA3\MTg3\MTkx\MTg4\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjQ4\MjUz\MjAx\MjE4\MjE0\MjIy\MTg3\MTkx\MTkx\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjEz\MjIy\MjA0\MTg3\MTg0\MTc=\Mg==\MTAz\MjE5\MTk=\MjI4\MjE5\MjUx\MTg0\MjM2\MjA1\MTIy\OTE=\MzM=\MzQ=\MTQw\MjUx\MTg0\MjUw\MTk5\OTU=\Njg=\MTUy\MTAy\MTgy\MTIz\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjAx\MTg2\MTg3\MTg3\MjA3\MTg2\MTg3\MTg3\MTg3\MTg3\MTg3\MTkw\MTgy\MTg3\MTg3\MTg3\MTkw\MTg3\MTg3\MTg3\MTg5\MjUx\MjUx\MTg3\MTg5\NTk=\MjUx\MTg3\MTg5\MTIz\MjUx\MTg3\MTg5\MTg3\MjUw\MTg3\MjU0\MjUx\MTg2\MTg3\MjUz\NTk=\MTIy\MTg3\NTg=\MTIz\MTg2\MTg3\MTIy\MTg3\MTg1\MTg3\MTg2\MjUw\MTg1\MTg3\MjMx\NTk=\MTg3\MTg1\MTc4\MjUx\NTk=\NTc=\MTY1\MTg3\NTk=\MTg3\MTc3\MTg3\MTg3\MTg3\MTkx\MTkw\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjIw\MjE4\MjE0\MjIy\MTg3\MTkx\MTc5\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjM1\MjE1\MjE4\MTk0\MjIy\MjAx\MjAw\MTg3\MTkx\MTgz\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjQ3\MjEy\MjE2\MjE4\MjE1\MjM1\MjE1\MjE4\MTk0\MjIy\MjAx\MTg3\MTkx\MTc3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjQ4\MjEx\MjE4\MjAx\MjE4\MjE2\MjA3\MjIy\MjAx\MTg3\MTkx\MTcw\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjQz\MjA2\MjE0\MjE4\MjEz\MjEy\MjEw\MjIz\MjMz\MjEy\MjEy\MjA3\MjM1\MjE4\MjAx\MjA3\MTg3\MTkx\MTg4\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjQ4\MjUz\MjAx\MjE4\MjE0\MjIy\MTg3\MTkx\MTkx\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjEz\MjIy\MjA0\MTg3\MTg0\ODc=\MTIw\MTM0\MjUx\MTMz\MTky\ODE=\NA==\MTg0\MjM2\MjA1\MTIy\OTE=\MzM=\MzQ=\MTQw\MjUx\MTg0\MTM3\MjI2\MTAz\MTk2\MjIz\OTI=\MjI5\MTIz\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\NTU=\MTg2\MTg3\MTg3\NTM=\MTg2\MTg3\MTg3\MTg3\MTg3\MTg3\MTkw\MTgy\MTg3\MTg3\MTg3\MTkw\MTg3\MTg3\MTg3\MTg5\MjUx\MjUx\MTg3\MTg5\NTk=\MjUx\MTg3\MTg5\MTIz\MjUx\MTg3\MTg5\MTg3\MjUw\MTg3\MjU0\MjUx\MTg2\MTg3\MjUz\NTk=\MTIy\MTg3\NTg=\MTIz\MTg2\MTg3\MTIy\MTg3\MTg1\MTg3\MTg2\MjUw\MTg1\MTg3\MjMx\NTk=\MTg3\MTg1\MTc4\MjUx\NTk=\NTc=\MTY1\MTg3\NTk=\MTg3\MTc3\MTg3\MTg3\MTg3\MTkx\MTkw\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjIw\MjE4\MjE0\MjIy\MTg3\MTkx\MTc5\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjM1\MjE1\MjE4\MTk0\MjIy\MjAx\MjAw\MTg3\MTkx\MTgz\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjQ3\MjEy\MjE2\MjE4\MjE1\MjM1\MjE1\MjE4\MTk0\MjIy\MjAx\MTg3\MTkx\MTc3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjQ4\MjEx\MjE4\MjAx\MjE4\MjE2\MjA3\MjIy\MjAx\MTg3\MTkx\MTcw\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjQz\MjA2\MjE0\MjE4\MjEz\MjEy\MjEw\MjIz\MjMz\MjEy\MjEy\MjA3\MjM1\MjE4\MjAx\MjA3\MTg3\MTkx\MTg4\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjQ4\MjUz\MjAx\MjE4\MjE0\MjIy\MTg3\MTkx\MTkx\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjEz\MjIy\MjA0\MTg3\MTg0\NDI=\MTY1\MTY5\MTg3\MTc1\MQ==\NzI=\NA==\MTg0\NDQ=\MjQ4\MjUw\MTAw\MTE5\MTE5\MTMx\MjUx\MTg0\OA==\MTE3\Njc=\NQ==\Mw==\NDA=\MjE5\MjUx\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\Mjk=\MTg2\MTg3\MTg3\MTk=\MTg2\MTg3\MTg3\MTg3\MTg3\MTg3\MTkw\MTgy\MTg3\MTg3\MTg3\MTkw\MTg3\MTg3\MTg3\MTg5\MjUx\MjUx\MTg3\MTg5\NTk=\MjUx\MTg3\MTg5\MTIz\MjUx\MTg3\MTg5\MTg3\MjUw\MTg3\MjU0\MjUx\MTg2\MTg3\MjUz\NTk=\MTIy\MTg3\NTg=\MTIz\MTg2\MTg3\MTIy\MTg3\MTg1\MTg3\MTg2\MjUw\MTg1\MTg3\MjMx\NTk=\MTg3\MTg1\MTc4\MjUx\NTk=\NTc=\MTY1\MTg3\NTk=\MTg3\MTc3\MTg3\MTg3\MTg3\MTkx\MTkw\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjIw\MjE4\MjE0\MjIy\MTg3\MTkx\MTc5\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjM1\MjE1\MjE4\MTk0\MjIy\MjAx\MjAw\MTg3\MTkx\MTgz\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjQ3\MjEy\MjE2\MjE4\MjE1\MjM1\MjE1\MjE4\MTk0\MjIy\MjAx\MTg3\MTkx\MTc3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjQ4\MjEx\MjE4\MjAx\MjE4\MjE2\MjA3\MjIy\MjAx\MTg3\MTkx\MTcw\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjQz\MjA2\MjE0\MjE4\MjEz\MjEy\MjEw\MjIz\MjMz\MjEy\MjEy\MjA3\MjM1\MjE4\MjAx\MjA3\MTg3\MTkx\MTg4\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjQ4\MjUz\MjAx\MjE4\MjE0\MjIy\MTg3\MTkx\MTkx\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjEz\MjIy\MjA0\MTg3\MTg0\MjQ=\MjA0\MTQ1\OTE=\Mzc=\MTE4\MjI4\MTIz\MTg0\Mg==\MjQ5\MTgx\MTg3\MTc2\MTA4\MTQw\MjUx\MTg0\MjA4\MjI0\MTMw\MTU1\MjE=\MTIy\MTg0\MTIz\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTc3\MTg1\MTg3\MTg3\MTY1\MTg1\MTg3\MTg3\MTg3\MTg3\MTg3\MTgy\MTQw\MTg3\MTg3\MTg3\MTkw\MTg3\MTg3\MTg3\MTg5\MjUx\MjUx\MTg3\MTg5\NTk=\MjUx\MTg3\MTg5\MTIz\MjUx\MTg3\MTc2\MTg3\MjUw\MTg3\NTg=\MjUx\MTg2\MTg3\MTY3\NTk=\NTk=\MTg2\MTYx\MTg3\MTg3\MTg3\MTcz\NTk=\MTg1\NTk=\MTkw\MTg3\MTg3\MTg3\MTg5\MjUx\MjUx\MTg3\MTg5\NTk=\MjUx\MTg3\MTg5\MTIz\MjUx\MTg3\MTg5\MjUx\MjUw\MTg3\MjU0\MTg3\MTg3\MTg3\MjUz\MjUx\MTIz\MTg3\MjUz\NTk=\MTIz\MTg3\MjUz\MTIz\MTIy\MTg3\MTc4\MjUx\MTg3\NTY=\MTcz\MTIz\Njg=\MTk2\MTg2\MTg3\MTg1\MTg3\MjUw\MjUx\MTg1\MTg3\NTg=\MTg3\MTg1\MTg3\MTU1\MTg3\MTg4\NTk=\MTkw\NTg=\MTg1\MTg3\MjUw\MTIy\MTg1\MTg3\MTY3\MjUw\MTg3\MTg2\MTkw\MTg2\MTg0\MTg3\MjU0\MTg2\MTg3\MTg3\MjUz\MjUw\MTIz\MTg1\MjQw\MjUw\MTIw\MTg1\MjMx\MTg2\MTg3\MTg2\MTY3\MTg2\MTg2\MTg3\MTcz\MTg3\MTkx\NTk=\MTYx\MTg1\MTg3\MTg3\MTcz\NTk=\MTg0\NTk=\MjU0\MTg1\MTg3\MTg3\MjUz\MjQ5\MTIz\MTkx\MjUz\NTc=\MTIz\MTkx\MjUz\MTIx\MTIy\MTkx\MjUz\NTc=\MTIw\MTkx\MjUz\MTIx\MTIw\MTkx\NjE=\MTIx\MjUw\MTkx\NjE=\NTc=\MjQ4\MTkw\MTI2\MTg1\MTkx\MTg3\MTI1\MjQ5\MTI3\MTkw\MTg3\MTg0\NTk=\MTkx\MTAz\NTc=\MTg3\MTg2\NTA=\MTIx\MTg1\NTE=\MTI2\NTc=\MTkx\MTg3\MTAz\MjQ5\NTk=\MTg3\MTU0\NTg=\MTg3\MTg3\MTcz\MTg3\NjQ=\MTk2\MTY0\MjUx\Njc=\MTk2\MTY1\MTg3\NTk=\MTg3\MTY4\MTg3\MTg3\MTg3\MTkx\MTkw\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjIw\MjE4\MjE0\MjIy\MTg3\MTkx\MTc5\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjM1\MjE1\MjE4\MTk0\MjIy\MjAx\MjAw\MTg3\MTkx\MTgz\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjQ3\MjEy\MjE2\MjE4\MjE1\MjM1\MjE1\MjE4\MTk0\MjIy\MjAx\MTg3\MTkx\MTc4\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjQ5\MjE4\MjE2\MjA4\MjAz\MjE4\MjE2\MjA4\MTg3\MTkx\MTgw\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjUz\MjEw\MjEz\MjIz\MjUz\MjEw\MjAx\MjAw\MjA3\MjQ4\MjEx\MjEw\MjE1\MjIz\MTg3\MTkx\MTg5\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjMy\MjA0\MjEy\MjAx\MjIz\MTg3\MTkx\MTg4\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjM1\MjE4\MjAx\MjIy\MjEz\MjA3\MTg3\MTkx\MTc3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjQ4\MjEx\MjE4\MjAx\MjE4\MjE2\MjA3\MjIy\MjAx\MTg3\MTg0\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\NzU=\MTMy\MTg0\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjQy\MjUx\MTkx\MTkw\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjA0\MjE4\MjEw\MjA3\MTg3\MTg0\MzM=\MzQ=\MzQ=\MzQ=\MzQ=\MzQ=\Mg==\MTMy\MTkx\MTg5\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjAz\MjE4\MjEw\MjAx\MjAw\MTg3\MTkx\MTc2\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjUy\MjIy\MjA3\MjM1\MjE1\MjE4\MTk0\MjIy\MjAx\MjAw\MTg3\MTkx\MTcw\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjQz\MjA2\MjE0\MjE4\MjEz\MjEy\MjEw\MjIz\MjMz\MjEy\MjEy\MjA3\MjM1\MjE4\MjAx\MjA3\MTg3\MTkx\MTc4\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjM1\MjEy\MjAw\MjEw\MjA3\MjEw\MjEy\MjEz\MTg3\MTkx\MTg4\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjQ4\MjUz\MjAx\MjE4\MjE0\MjIy\MTg3\MTkx\MTkx\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjEz\MjIy\MjA0\MTg3\MTkx\MTgz\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjE0\MjEy\MjA2\MjAw\MjIy\MTM4\MjE2\MjE1\MjEw\MjE2\MjA4\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTQx\MTg1\MTg3\MTg3\MTI5\MTg1\MTg3\MTg3\MTg3\MTg3\MTg3\MTg1\MTgy\MTg3\MTg3\MTg3\MTkw\MTg3\MTg3\MTg3\MjUw\MjUx\MTg3\MTg3\MTY3\NTk=\MTg3\MTg2\MTYx\MTg3\MTg3\MTg3\MTcz\NTk=\MTg2\NTk=\MTkw\NTk=\MTg3\MTg3\MTg5\MTIz\MjUx\MTg3\MTg5\MTg3\MjUw\MTg3\MTg5\MjUx\MjUw\MTg3\MTg5\NTk=\MjUw\MTg3\MTc4\MTg3\MTIx\NTY=\MTcz\MTIz\NzE=\MTk2\MTY1\MTg3\NTk=\MTg3\MTc4\MTg3\MTg3\MTg3\MTkx\MTkw\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjA0\MjE4\MjEw\MjA3\MTg3\MTg0\MzM=\MzQ=\MzQ=\MzQ=\MzQ=\MzQ=\Mg==\MTMy\MTkx\MTkw\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjIw\MjE4\MjE0\MjIy\MTg3\MTkx\MTc5\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjM1\MjE1\MjE4\MTk0\MjIy\MjAx\MjAw\MTg3\MTkx\MTgz\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjQ3\MjEy\MjE2\MjE4\MjE1\MjM1\MjE1\MjE4\MTk0\MjIy\MjAx\MTg3\MTkx\MTc3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjQ4\MjEx\MjE4\MjAx\MjE4\MjE2\MjA3\MjIy\MjAx\MTg3\MTkx\MTc4\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjQz\MjA2\MjE0\MjE4\MjEz\MjEy\MjEw\MjIz\MTg3\MTkx\MTc3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjM2\MjE4\MjE1\MjA4\MjMy\MjAz\MjIy\MjIy\MjIz\MTg3\MTg0\MTg3\MTg3\MTg3\MTg3\MTg3\NTk=\MjM3\MjUx\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjMz\MTg1\MTg3\MTg3\MjM3\MTg1\MTg3\MTg3\MTg3\MTg3\MTg3\MTg5\MTY0\MTg3\MTg3\MTg3\MTkw\MTg3\MTg3\MTg3\MTg5\MjUx\MjUx\MTg3\MjUw\NTk=\MTg3\MTg3\NjI=\MTIz\MTg3\MTg3\NjE=\MTg3\MjUw\MTg2\NjE=\MjUx\MjUw\MTg2\NjE=\NTk=\MjUw\MTg2\NjE=\MTIz\MjUw\MTg2\NjE=\MTg3\MjQ5\MTg2\MTY3\NTk=\NTk=\MTg2\MjU0\MTIz\MTg3\MTg3\MjUz\MTg3\MTIy\MTg3\MjUz\MjUx\MTIy\MTg3\MjUz\NTk=\MTIy\MTg3\MjUz\MTIz\MTIy\MTg3\MjUz\MTg3\MTIx\MTg3\MTc4\MjUx\NTk=\NjM=\MjU0\MTIz\MTg3\MTg3\MjUz\MTg3\MTIy\MTg3\MjUz\MjUx\MTIy\MTg3\MjUz\NTk=\MTIy\MTg3\MjUz\MTIz\MTIy\MTg3\MjUz\MTg3\MTIx\MTg3\NjI=\MTIz\MTg1\MTg3\NjE=\MjUx\MjUx\MTg2\MTIy\MTg3\MTg0\MTg3\MTg2\MTg2\MTg0\MTg3\MjUw\MjUw\MTg0\MTg3\Mzk=\NTk=\MTg3\MTg1\MjQy\NTk=\MTg3\NjI=\MTY1\MTg3\NTk=\MTg3\MTgx\MTg3\MTg3\MTg3\MTkx\MTc4\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjQy\MjEz\MjAw\MjA3\MjE4\MjEz\MjE2\MjIy\MTg3\MTkx\MTkx\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjEz\MjIy\MjA0\MTg3\MTkx\MTgy\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjMy\MjIy\MjE1\MjIy\MjE2\MjA3\MjEw\MjEy\MjEz\MjQ5\MjEy\MTk1\MTg3\MTkx\MTkw\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjIw\MjE4\MjE0\MjIy\MTg3\MTkx\MTc5\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjM1\MjE1\MjE4\MTk0\MjIy\MjAx\MjAw\MTg3\MTkx\MTgz\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjQ3\MjEy\MjE2\MjE4\MjE1\MjM1\MjE1\MjE4\MTk0\MjIy\MjAx\MTg3\MTkx\MTc4\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjQ5\MjE4\MjE2\MjA4\MjAz\MjE4\MjE2\MjA4\MTg3\MTkx\MTg5\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjMy\MjA0\MjEy\MjAx\MjIz\MTg3\MTkx\MTg4\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjQz\MjE4\MjEz\MjIz\MjE1\MjIy\MTg3\MTkx\MTc5\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjUw\MjIz\MjEy\MjAx\MjEz\MjIy\MjIy\MTg3\MTkx\MTkw\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjMy\MjEw\MTkz\MjIy\MTg3\MTkx\MTc5\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjM3\MjIy\MjE2\MjA3\MjEy\MjAx\MTM2\MTg3\MTg0\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\NzU=\MTMy\MTg0\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTMz\MjUx\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjEz\MTg1\MTg3\MTg3\MTky\MTg1\MTg3\MTg3\MTg3\MTg3\MTg3\MTc4\MTY3\MTg3\MTg3\MTg3\MTkw\MTg3\MTg3\MTg3\MTg5\MjUx\MjUx\MTg3\MTg5\NTk=\MjUx\MTg3\MTg5\MTIz\MjUx\MTg3\MTg5\MTg3\MjUw\MTg3\MjU0\MjUx\MTg2\MTg3\NjI=\MTg3\MTg3\MTg3\NjE=\MjUx\MjUx\MTg2\NDg=\NTk=\MjUw\MTg2\Mzk=\MTg3\MTg3\MTg2\MjMx\MTg3\MTg2\MTg3\MTcz\MTg3\MTg0\NTk=\MjI1\MTg2\MTg3\MTg3\MTcz\NTk=\MTg1\NTk=\NjE=\MTIy\MTIz\MTg1\NjE=\MTg2\MjUw\MTg0\NjE=\MTIy\MjUw\MTg0\MTI2\MTg2\MTg1\MTg3\MTI1\MjUw\MTIx\MTg0\MTg3\MTg1\MTg3\MTg0\MTAz\NTg=\MTg3\MTg2\MTc4\MTIz\MTg2\NjM=\MTI2\NTg=\MTg1\MTg3\MTg2\MTIx\MTg1\MTg3\MTAz\MjUw\MTg3\MTg2\MjE4\NTk=\MTg3\MTg3\MTcz\MTg3\NzE=\MTk2\MTY1\MTg3\NTk=\MTg3\MTgz\MTg3\MTg3\MTg3\MTkx\MTkw\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjIw\MjE4\MjE0\MjIy\MTg3\MTkx\MTc5\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjM1\MjE1\MjE4\MTk0\MjIy\MjAx\MjAw\MTg3\MTkx\MTgz\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjQ3\MjEy\MjE2\MjE4\MjE1\MjM1\MjE1\MjE4\MTk0\MjIy\MjAx\MTg3\MTkx\MTc3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjQ4\MjEx\MjE4\MjAx\MjE4\MjE2\MjA3\MjIy\MjAx\MTg3\MTkx\MTcw\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjQz\MjA2\MjE0\MjE4\MjEz\MjEy\MjEw\MjIz\MjMz\MjEy\MjEy\MjA3\MjM1\MjE4\MjAx\MjA3\MTg3\MTkx\MTg5\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjAz\MjE4\MjEw\MjAx\MjAw\MTg3\MTkx\MTc2\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjUy\MjIy\MjA3\MjM1\MjE1\MjE4\MTk0\MjIy\MjAx\MjAw\MTg3\MTkx\MTc4\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjM1\MjEy\MjAw\MjEw\MjA3\MjEw\MjEy\MjEz\MTg3\MTkx\MTg4\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjQ4\MjUz\MjAx\MjE4\MjE0\MjIy\MTg3\MTkx\MTkx\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjEz\MjIy\MjA0\MTg3\MTkx\MTkw\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MjA0\MjE4\MjEw\MjA3\MTg3\MTg0\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\NzU=\MTMy\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3\MTg3',Doomspire_IlIIIIIIlIllll())()
RAW Paste Data
We use cookies for various purposes including analytics. By continuing to use Pastebin, you agree to our use of cookies as described in the Cookies Policy. OK, I Understand
 
Top