Ima3ine

Untitled

Jan 22nd, 2023
201
0
Never
Not a member of Pastebin yet? Sign Up, it unlocks many cool features!
text 4.60 KB | None | 0 0
  1. -- [[ Catalyst Admin 0.1 ]] --
  2.  
  3. script.Parent = nil
  4. Player = game.Players.LocalPlayer
  5. Character = Player.Character
  6. Tablets = {}
  7. Settings = {}
  8. Settings.Size = Vector3.new(1.5,0.05,2.5)
  9. Settings.Trans = 0.5
  10. Settings.SelBox = true
  11. script.Name = "CA"
  12.  
  13. trans = 0
  14. function _NOT_FOR_USE_()
  15. for i,v in pairs(Tablets) do
  16. for e = 1, #Tablets do
  17. game.Workspace["CA_TAB::"..Character.Name]:Remove()
  18. end
  19. for a = 1, 100 do
  20. pcall(function()
  21. table.remove(Tablets, a)
  22. end)
  23. end
  24. Tablets = {}
  25. end
  26. end
  27.  
  28. function Dismiss()
  29. _NOT_FOR_USE_()
  30. end
  31.  
  32. function Tablet(Message, Color)
  33. if not Color then
  34. Color = "Bright blue"
  35. end
  36. tablet = Instance.new("Part", Workspace)
  37. tablet.Name = "CA_TAB::"..Character.Name
  38. tablet.BrickColor = BrickColor.new("White")
  39. tablet.CanCollide = false
  40. tablet.FormFactor = "Custom"
  41. tablet.TopSurface = 0
  42. tablet.BottomSurface = 0
  43. tablet.Size = Settings.Size
  44. tablet.Transparency = Settings.Trans
  45. tablet.Anchored = true
  46. if Settings.SelBox == true then
  47. sel = Instance.new("SelectionBox", tablet)
  48. sel.Name = "TabSelection"
  49. sel.Adornee = tablet
  50. sel.Color = BrickColor.new(Color)
  51. sel.Transparency = 0.5
  52. end
  53. local BGUI = Instance.new("BillboardGui")
  54. BGUI.Name = "AdminGUI"
  55. BGUI.Size = UDim2.new(0,1,0,1)
  56. BGUI.StudsOffset = Vector3.new(0,2.5,0)
  57. BGUI.Parent = tablet
  58. BGUI.Adornee = tablet
  59. local BText = Instance.new("TextLabel",BGUI)
  60. BText.Name = "Admin"
  61. BText.FontSize = "Size18"
  62. BText.TextStrokeTransparency = 0
  63. BText.TextColor3 = BrickColor.new(Color).Color
  64. BText.Font = "ArialBold"
  65. BText.Text = Message
  66. table.insert(Tablets, {MSG = Message, tablet = tablet})
  67. wait()
  68. end
  69. Tablet(" :: CATALYST 0.1 :: ")
  70. Tablet("Say 'help' for help on the system.")
  71. Tablet("Say 'cmds' for commands built-in.")
  72.  
  73. function match(name)
  74. c = {}
  75. for i,v in pairs(game.Players:GetChildren()) do
  76. if v.Name:sub(1,name:len()):lower() == name:lower() then
  77. return v
  78. end
  79. end
  80. return c
  81. end
  82.  
  83. function Info(Message)
  84. Tablet(Message, "Really red")
  85. wait(5)
  86. for i = 1, #Tablets do
  87. if Tablets[i].MSG == Message then
  88. Tablets[i].tablet:Remove()
  89. table.remove(Tablets, i)
  90. end
  91. end
  92. end
  93.  
  94. Player.chatted:connect(function(msg)
  95. if string.sub(msg,1,4) == "cmds" then
  96. Tablet(" :: COMMANDS :: ")
  97. Tablet("kill")
  98. Tablet("kick")
  99. Tablet("getinfo")
  100. Tablet("cmds")
  101. Tablet("help")
  102. Tablet("ping")
  103. Tablet("ff")
  104. Tablet("unff")
  105. elseif string.sub(msg,1,2) == "ff" then
  106. v = match(msg:sub(4))
  107. Instance.new("ForceField", v.Character).Name = "Catalyst_FF"
  108. Info(" :: Gave a Force Field to "..v.Name.." :: ")
  109. elseif string.sub(msg,1,4) == "unff" then
  110. v = match(msg:sub(6))
  111. ff = v.Character:FindFirstChild("Catalyst_FF")
  112. if ff then
  113. ff:Remove()
  114. Info(" :: Removed "..v.Name.."'s Force Field :: ")
  115. end
  116. elseif string.sub(msg,1,4) == "ping" then
  117. pty = msg:sub(6)
  118. if pty == "players" then
  119. for i,v in pairs(game.Players:GetChildren()) do
  120. Tablet(v.Name)
  121. wait()
  122. end
  123. elseif pty == "" then
  124. Info("Pong!")
  125. else
  126. Info(pty)
  127. end
  128. elseif string.sub(msg,1,4) == "help" then
  129. Tablet(" :: CATALYST HELP :: ")
  130. Tablet("See 'cmds' for commands.")
  131. Tablet("Do not distribute.")
  132. elseif string.sub(msg,1,4) == "kill" then
  133. v = match(msg:sub(6))
  134. v.Character:BreakJoints()
  135. Info(" :: Killed "..v.Name.." :: ")
  136. elseif string.sub(msg,1,4) == "kick" then
  137. v = match(msg:sub(6))
  138. v:Remove()
  139. Info(" :: Kicked "..v.Name.." :: ")
  140. elseif string.sub(msg,1,7) == "getinfo" then
  141. v = match(msg:sub(9))
  142. mt = tostring(v.MembershipType):sub(21)
  143. Tablet(" :: "..v.Name.."'s Info :: ")
  144. Tablet("Membership: "..mt)
  145. Tablet("Age: "..v.AccountAge)
  146. Tablet("ID: "..v.userId)
  147. elseif string.sub(msg,1,7) == "dismiss" then
  148. Dismiss()
  149. elseif string.sub(msg,1,5) == "50tst" then
  150. for i = 1, 50 do
  151. Tablet("Testing. TAB#: "..i)
  152. end
  153. end
  154. end)
  155. Rotation = 0
  156. while wait(0.00000001) do
  157. Rotation = Rotation + 0.000008
  158. if Rotation >= 360 then
  159. Rotation = 0
  160. end
  161. pcall(function()
  162. ntabs = #Tablets
  163. radius = 5 + (ntabs * 0.5)
  164. for i,v in pairs(Tablets) do
  165. pcall(function()
  166. Pos = Character.Torso.CFrame
  167. x = math.cos((i / ntabs - (0.5 / ntabs)) * math.pi) * radius
  168. y = 0
  169. z = math.sin((i / ntabs - (0.5 / ntabs)) * math.pi) * radius
  170. tabPos = Pos:toWorldSpace(CFrame.new(x,y,z):inverse())
  171. pcall(function() Tablets[i].tablet.CFrame = (CFrame.new(tabPos.p, Pos.p) * CFrame.Angles(math.rad(-75),0,0)) end)
  172. end)
  173. end
  174. end)
  175. end
  176.  
  177. --mediafire gtfo password
Add Comment
Please, Sign In to add comment