Not a member of Pastebin yet?
Sign Up,
it unlocks many cool features!
- --MADE BY OneLegend (NOT THE SCRIPT) LOCAL SCRIPT: JUST RUN!
- c,d=pcall(function()
- ply = game.Players.LocalPlayer
- char = ply.Character
- torso = char.Torso
- head = char.Torso
- track = false --- for tracking function
- char.Humanoid.MaxHealth,char.Humanoid.Health,char.Humanoid.WalkSpeed = 9000,9000,30
- dmg = 50
- Bo = {["T"] = char["Torso"], ["H"] = char.Head}
- Bo.Arms = {["R"] = char["Right Arm"], ["L"] = char["Left Arm"]}
- Bo.Legs = {["L"] = char["Left Leg"], ["R"] = char["Right Leg"]}
- Bo.Shls = {["R"] = torso["Right Shoulder"], ["L"] = torso["Left Shoulder"]}
- rarm = char["Right Arm"]
- rw,lw = Instance.new("Weld"),Instance.new("Weld")
- normpos = Bo.Shls.R.C0
- function lock(a) ---- updating this for 2 hands
- if a == 1 then
- ---RIGHT---
- rw.Parent = torso
- rw.C0,rw.C1 = Bo.Shls.R.C0 ,Bo.Shls.R.C1
- rw.Part0,rw.Part1 = Bo.Shls.R.Part0 ,Bo.Shls.R.Part1
- Bo.Shls.R.Parent = nil
- ---LEFT---
- lw.Parent = torso
- lw.Part0,lw.Part1 = Bo.Shls.L.Part0 ,Bo.Shls.L.Part1
- lw.C0,lw.C1 = Bo.Shls.L.C0 ,Bo.Shls.L.C1
- elseif a == 0 then
- Bo.Shls.R.Parent = torso
- rw.Parent = nil
- Bo.Shls.L.Parent = torso
- lw.Parent = nil
- end
- end
- cfn,ang = CFrame.new,CFrame.Angles
- v3n = Vector3.new
- attacks = {
- ["slash"] = CFrame.Angles(1,2,3)
- }
- sword = Instance.new("Model",char)
- meshids = {["blast"] = 20329976, ["penguin"] = 15853464, ["ring"] = 3270017,
- ["spike"] = 1033714,["cone"] = 1082802,["crown"] = 20329976,["crossbow"] = 15886761,
- ["cloud"] = 1095708,["mjolnir"] = 1279013,["diamond"] = 9756362, ["hand"] = 37241605,
- ["fist"] = 65322375,["skull"] = 36869983,["totem"] = 35624068,["spikeb"] = 9982590,["dragon"] = 58430372}---some meshids
- ------TOOOOOLS------
- T = {["P"] = function(x,y,z,color,transparency,cancollide,anchored)
- c = Instance.new("Part",sword)
- c.TopSurface,c.BottomSurface = 0,0
- c.formFactor = "Custom"
- c.Size = Vector3.new(x,y,z)
- c.BrickColor = BrickColor.new(color)
- c.Transparency = transparency
- c.CanCollide = cancollide
- if anchored ~= nil then c.Anchored = anchored end
- return c
- end
- ,
- ["C"] = function(func) coroutine.resume(coroutine.create(func)) end
- ,
- ["W"] = function(part0,part1,x,y,z,rx,ry,rz)
- w = Instance.new("Weld",sword)
- w.Part0,w.Part1 = part0,part1
- w.C1 = CFrame.new(x,y,z) * CFrame.Angles(rx,ry,rz)
- return w
- end
- ,
- ["BG"] = function(parent)
- local c = Instance.new("BodyGyro",parent)
- c.P = 20e+003
- c.cframe = parent.CFrame
- c.maxTorque = Vector3.new(c.P,c.P,c.P)
- return c
- end
- ,
- ["BP"] = function(parent,position)
- local bp = Instance.new("BodyPosition",parent)
- bp.maxForce = Vector3.new()*math.huge
- bp.position = position
- return bp
- end
- ,
- ["F"] = function(parent,size,heat,color,secondcolor)
- f = Instance.new("Fire",parent)
- f.Size = size
- f.Heat = heat
- if color ~= nil then f.Color = BrickColor.new(color).Color end
- if secondcolor ~= nil then f.SecondaryColor = BrickColor.new(secondcolor).Color end
- return f
- end
- ,
- ["Track"] = function(obj,s,t,lt)
- coroutine.resume(coroutine.create(function()
- while track do
- old = obj.Position
- wait()
- new = obj.Position
- mag = (old-new).magnitude
- dist = (old+new)/2
- ray = T.P(s,mag+.2,s,obj.Color,t,false,true)
- Instance.new("CylinderMesh",ray)
- ray.CFrame = CFrame.new(dist,old)*ang(math.pi/2,0,0)
- game:GetService("Debris"):AddItem(ray,lt)
- end
- end)) end,
- ["D"] = function(hit) if hit.Parent:findFirstChild("Humanoid") then h=hit.Parent.Humanoid h.Health = h.Health -dmg end end
- ,
- ["FM"] = function(parent,meshid,x,y,z,meshtexture)
- if meshid == "cylinder" then
- mesh = Instance.new("CylinderMesh",parent)
- mesh.Scale = Vector3.new(x,y,z)
- return mesh
- else
- mesh = Instance.new("SpecialMesh",parent)
- if meshid ~= "sphere" then
- mesh.MeshId = "rbxassetid://"..meshids[meshid]
- else mesh.MeshType = 3 end
- mesh.Scale = Vector3.new(x,y,z)
- if meshtexture ~= nil then
- mesh.TextureId = "rbxassetid://"..textureids[meshtexture]
- end
- return mesh
- end
- end
- }
- --------------------------------------------------
- ---MATH SHORTENINGS---
- M = {["R"] = function(a,b) return math.random(a,b) end,
- ["Cos"] = function(a) return math.cos(a) end,
- ["Sin"] = function(a) return math.sin(a) end,
- ["D"] = function(a) return math.rad(a) end
- }
- ---------------------------
- --[[tutorial to using shortenings
- T.P(sizex,sizey,sizez,brickcolor,transparency,cancollide,anchored)
- T.W(part0,part1,x,y,z,rx,ry,rz)
- T.F(parent,size,heat,color,secondarycolor)
- T.FM(parent,meshid(see the list),scalex,scaley,scalez,textureid(optional) ) --- most usefull
- M.R(a,b) creates a randomvalue beetwen a and b
- ]]--
- p = T.P(.7,2,.7,"Bright blue",.5,false,false) --- The handle in 1 line O_O
- p.Name = "Handle"
- p.Position = torso.Position --p.CFrame = p.CFrame * CFrame.new(torso.X, torso.Y, torso.Z)
- T.FM(p,"cylinder",1,1,1) --- cylindermesh
- hw = T.W(p,torso,0,0,1,0,0,M.D(-45))
- holdpos = cfn(0,-1.5,0)*ang(math.pi/2,0,0)
- torsopos = cfn(0,0,1)*ang(0,0,M.D(-45))
- crystal = T.P(1,1,1,"Bright red",.5,false,false)
- T.W(crystal,p,0,1,0,0,0,0)
- T.FM(crystal,"diamond",.5,1,.5)
- p.Touched:connect(function(h)
- T.D(h)
- end)
- c=nil
- mainweld = nil
- radius = 1
- main = T.P(1,1,1,"White",1,false,false)
- mainweld = T.W(main,p,0,-1.5,0,0,0,0)
- ----SHIELD----
- sp = T.P(2,4,.5,"Magenta",.5,false,false)
- sp2 = T.P(1,4,.5,"Magenta",.5,false,false)
- sp3 = T.P(1,4,.5,"Magenta",.5,false,false)
- --sp,sp2,sp3.Transparency = 0.5,0.5,0.5
- T.W(sp2,sp,-1.4,0,.15,0,M.D(20),0)
- T.W(sp3,sp,1.4,0,.15,0,M.D(-20),0)
- mw = T.W(sp,Bo.Arms.L,-.5,0,0,0,math.pi/2,0,0)
- ----------------------------------------
- for i = 1,360,60 do --- I weld diamonds to part at bottom of handle
- c = T.P(1,1,1,"White",.5,false,false)
- T.FM(c,"diamond",.5,1.4,.5)
- T.W(c,main,M.Cos(M.D(i))*radius,0,M.Sin(M.D(i))*radius,0,0,0)
- end
- T.C(function() -- ROTATE
- while true do
- wait()
- mainweld.C1 = mainweld.C1 * ang(0,M.D(10),0)
- end
- end)
- T.C(function()
- while wait(0.1) do
- for i = 0,1,0.1 do
- p.Transparency = i
- wait()
- end
- for i = 1,0,0.1 do
- p.Transparency = i
- wait()
- end
- end
- end) -- Same as coroutine.create
- p2 = p:Clone()
- p2.Parent = sword
- p2.Size = Vector3.new(1,6,1)
- p2.Touched:connect(function(hit) T.D(hit,5) end)
- p3 = T.P(1,3,1,"Black",.5,false,false)
- T.FM(p3,"spike",1,3,1)
- T.W(p3,p2,0,-4,0,math.pi,0,0)
- Instance.new("Sparkles",p)
- w=Instance.new("Weld",p)
- w.Part0 = p
- w.Part1 = p2
- w.C1 = cfn(0,4,0)
- end)
- if c == true then
- print("Sucsess loading")
- else
- print(d)
- end
- bg = nil
- bp = nil
- ---------ANIMATIONS--------------
- function BBGui(Text,Adornee,Par)
- b=Instance.new("BillboardGui",Par)
- b.Adornee = Adornee
- f=Instance.new("Frame",b)
- f.BackgroundTransparency = 1
- t=Instance.new("TextLabel",b)
- t.Text = Text
- t.TextColor3 = Color3.new(1,0,1)
- return b
- end
- anims = {}
- anims.Twirl = function()
- rw.C0 = rw.C0 * ang(-math.pi/2,0,0)
- hw.C0 = hw.C0 * ang(math.pi/2,0,0)
- bg = T.BG(head)
- for i = 1,360*5,20 do
- bg.cframe = bg.cframe * ang(0,math.rad(20),0) --rw.C0 = rw.C0 * ang(i)
- local ball = T.P(2,2,2,"Lime green",.5,false,false)
- ball.Position = (p3.CFrame * cfn(0,p3.Size.y/2,0)).p
- bv = Instance.new("BodyVelocity",ball)
- bv.maxForce = Vector3.new()*math.huge
- bv.velocity = cfn(torso.Position,p3.Position).lookVector * 300
- delay(.1,function()
- local pos = cfn(ball.Position)
- T.C(function()
- local pa = T.P(1,1,1,"White",0,false,true)
- pa.CFrame = pos
- msh = T.FM(pa,"sphere",1,1,1)
- for i = 1,30 do
- wait()
- pa.Size = v3n(i,i,i)
- pa.CFrame = pos
- pa.Transparency = i/30
- end
- pa:Remove()
- end)
- ball:Remove()
- end)
- wait()
- end
- bg:Remove()
- rw.C0 = rw.C0 * ang(math.pi/2,0,0)
- hw.C0 = hw.C0 * ang(-math.pi/2,0,0)
- end
- anims.Fire = function()
- local f=Instance.new("Fire",p3)
- dmg = 40
- delay(20,function()
- f:remove()
- dmg = 20
- end)
- end
- anims.ShieldUp = function()
- for i = 1,50,20 do
- wait()
- lw.C0 = lw.C0 * ang(0,0,M.D(-20))
- end
- for i = 1,50,20 do
- wait()
- lw.C0 = lw.C0 * ang(M.D(20),0,0)
- end
- end
- anims.ShieldDown = function()
- for i = 1,50,20 do
- wait()
- lw.C0 = lw.C0 * ang(M.D(-20),0,0)
- end
- for i = 1,50,20 do
- wait()
- lw.C0 = lw.C0 * ang(0,0,M.D(20))
- end
- end
- anims.Equip = function()
- for i = 1,220,20 do
- wait()
- rw.C0 = rw.C0 * ang(0,0,M.D(20))
- end
- hw.Part1,hw.C1 = Bo.Arms.R,holdpos
- for i = 1,220-90,20 do
- wait()
- rw.C0 = rw.C0 * ang(0,0,M.D(-20))
- end
- rw.C0 = normpos*ang(0,0,math.pi/2)
- end
- anims.UnEquip = function()
- for i = 1,180,20 do
- wait()
- rw.C0 = rw.C0 * ang(0,0,M.D(20))
- end
- hw.Part1,hw.C1 = torso,torsopos
- for i = 1,220,20 do
- wait()
- rw.C0 = rw.C0 * ang(0,0,M.D(-20))
- end
- end
- anims.Equip2 = function()
- for i = 1,90,5 do
- wait()
- rw.C0 = rw.C0 * ang(0,0,M.D(5))
- end rw.C0 = normpos * ang(0,0,M.D(90)) end
- anims.UnEquip2 = function()
- for i = 90,0,-20 do
- wait()
- rw.C0 = rw.C0 * ang(0,0,M.D(-20))
- end
- end
- anims.Slash = function()
- for i = 1,90,20 do
- rw.C0 = rw.C0 * ang(0,M.D(20),0)
- wait()
- end
- for i = 90,1,-20 do
- rw.C0 = rw.C0 * ang(0,0,M.D(-20))
- wait()
- end
- for i = 90,1,-20 do
- rw.C0 = rw.C0 * ang(0,0,M.D(20))
- wait()
- end
- for i = 1,90,20 do
- rw.C0 = rw.C0 * ang(0,M.D(-20),0)
- wait()
- end
- end
- anims.Fist = function(mouse)
- pa = T.P(1,1,1,"Black",.5,false,false)
- --[[p=Instance.new("Part",Workspace)
- p.Anchored = true --flying fist? ya]]--
- T.FM(p,"fist",1,1,1)
- T.W(p,Bo.Arms.L,0,-2,0,0,0,0)
- end
- anims.dragon = function(mouse)
- local endpos = mouse.hit.p
- for i = 1,90,20 do
- lw.C0 = lw.C0 * ang(0,0,M.D(-20))
- end
- for i = 1,50,10 do
- lw.C0 = lw.C0 * ang(M.D(-10),0,0)
- end
- local ray = T.P(5,1,5,"Bright red",.5,false,true)
- startpos = sp.CFrame * cfn(0,0,-1)
- T.FM(ray,"cylinder",1,1,1)
- ray.CFrame = startpos
- mag = (startpos.p-endpos).magnitude
- local head = T.P(1,1,1,"Bright red",.5,false,true)
- T.FM(head,"dragon",4,4,4)
- for i = 1,mag do
- wait()
- startpos = sp.CFrame * cfn(0,0,-1)
- ray.Size = v3n(5,i,5)
- ray.CFrame = (cfn(startpos.p,endpos)*cfn(0,0,-ray.Size.y/2))*ang(math.pi/2,0,0)
- head.CFrame = ray.CFrame * cfn(0,-ray.Size.y/2,0) * ang(-math.pi/2,0,0)
- end
- for i = 1,50,10 do
- lw.C0 = lw.C0 * ang(M.D(10),0,0)
- end
- for i = 1,90,20 do
- lw.C0 = lw.C0 * ang(0,0,M.D(20))
- end
- ray:Remove() head:Remove()
- end
- swirling = false
- anims.Swirl = function(mouse)
- if swirling == false and mouse.Target ~= nil then
- swirling = true
- eff = function(a)
- T.C(function()
- wait()
- local p = T.P(1,1,1,"Black",.5,false,true)
- p.CFrame = a
- local msh = T.FM(p,"blast",1,1,1)
- for i = 1,30 do
- wait()
- msh.Scale = Vector3.new(i,i/2,i)
- p.Transparency = i/30
- end
- p:Remove()
- end)
- end
- rw.C0 = normpos * ang(0,0,math.pi)
- hw.C0 = hw.C0 * ang(math.pi/2,0,0)
- bg = T.BG(torso)
- local original = bg.cframe
- --T.C(function() while swirling do wait() bg.cframe = bg.cframe * ang(0,M.D(100),0) end end)
- eff(torso.CFrame *cfn(0,-3,0))
- bp = T.BP(torso,torso.Position + v3n(0,70,0))
- while (bp.position-torso.Position).magnitude > 3 do wait() end --- waits
- if mouse.Target ~= nil then
- bg.cframe = cfn(torso.Position,mouse.hit.p) * ang(-math.pi/2,0,0)
- bp.position = (mouse.hit.p + v3n(0,3,0))
- eff(bg.cframe * ang(math.pi,0,0))
- while (bp.position-torso.Position).magnitude > 5 do wait() end --- waits
- bg.cframe = original bp:Remove()
- game:GetService("Debris"):AddItem(bg,.5)
- rw.C0 = normpos * ang(0,0,math.pi/2)
- hw.C0 = hw.C0 * ang(-math.pi/2,0,0)
- swirling = false
- end
- else
- bp:Remove() bg:Remove() rw.C0 = normpos * ang(0,0,math.pi/2)
- hw.C0 = hw.C0 * ang(-math.pi/2,0,0)
- end
- end
- radi = 5
- atk = {"Twirl","Fire","Swirl","Dragon","Slash","Fist","ShieldUp"}
- function createhumanoid(name,part,parent)
- mo = Instance.new("Model",parent)
- mo.Name = name
- part.Name = "Head"
- part.Parent = mo
- tor = T.P(.1,.1,.1,"White",1,false,false)
- tor.Name = "Torso"
- tor.Parent = mo
- T.W(tor,part,0,0,0,0,0,0)
- hum = Instance.new("Humanoid",mo)
- hum.Health = 0
- hum.MaxHealth = 0
- end
- ---------------------------------
- tab = nil
- scrbox = nil
- current = 1
- function scroll(direction)
- if scrbox ~= nil then
- current = current+(direction)
- if current > #atk then current = 1
- elseif current < 1 then current = #atk
- end
- scrbox.Adornee = tab:GetChildren()[current]
- end
- end
- ply.Chatted:connect(function(msg)
- if msg == "#accept" and mod ~= nil then
- anims[atk[current]]()
- end
- end)
- function showtablets()
- if tab == nil then
- tab = Instance.new("Model",sword)
- for i,v in pairs(atk) do
- tp = T.P(2,1.5,2,"Black",.5,false,false)
- tp.Parent = tab
- createhumanoid(v,tp,tab)
- local bp = T.BP(tp,torso.Position)
- T.C(function()
- while true do
- wait()
- o = 360/#atk*i
- bp.position = torso.Position + v3n(M.Cos(M.D(o))*radi,0,M.Sin(M.D(o))*radi)
- end
- end)
- end
- scrbox = Instance.new("SelectionBox",Workspace)
- scrbox.Adornee = tab:GetChildren()[current]
- elseif tab ~= nil then tab:Remove() tab = nil
- end
- end
- -------------------------------------
- hopper = Instance.new("HopperBin",ply.Backpack)
- hopper.Name = "Crystal Lance"
- hopper.Deselected:connect(function()
- anims.UnEquip()
- lock(0) track = false
- end)
- hopper.Selected:connect(function(mouse)
- lock(1)
- anims.Equip()
- track = true
- T.Track(p2,.3,.5,1)
- mouse.KeyUp:connect(function(key)
- if key == string.char(48) then anims.ShieldDown()
- end end)
- mouse.KeyDown:connect(function(key)
- k=key:lower()
- if k == "f" then anims.Slash()
- elseif k == "q" then anims.UnEquip2() wait(1) anims.Equip2()
- elseif k == "t" then anims.Twirl()
- elseif key == "r" then anims.Swirl(mouse)
- elseif key == "k" then anims.Fire()
- elseif key == string.char(48) then anims.ShieldUp()
- elseif key == "j" then anims.Fist(mouse)
- elseif key == "g" then anims.dragon(mouse)
- elseif key == "x" then showtablets()
- elseif key == "z" then scroll(-1) elseif key == "c" then scroll(1)
- elseif key == "v" then if scrbox ~= nil then anims[scrbox.Adornee.Name](mouse) end
- end
- end)
- end)
Add Comment
Please, Sign In to add comment