bobokoebe

One Piece Awakening

Mar 29th, 2020
5,073
Never
Not a member of Pastebin yet? Sign Up, it unlocks many cool features!
  1. --[[
  2. IronBrew:tm: obfuscation; Version 2.7.2
  3. ]]
  4. local madebybobo_lllIIlIlllIIIIIlIlllIII=string.byte;local madebybobo_lIIllIlI=string.char;local madebybobo_llIllIIIlIIll=string.sub;local madebybobo_lIllllllIlIlll=table.concat;local madebybobo_lIlIlllllIlIllllIIIIllllI=table.insert;local madebybobo_IIIIlIIlIIIIlI=math.ldexp;local madebybobo_lllIlIlll=getfenv or function()return _ENV end;local madebybobo_lIlIlllllIlIllllIIIIllllI=setmetatable;local madebybobo_lIIlIlIllIIIlllIIIIll=select;local madebybobo_lIIIlIIl=unpack or table.unpack;local madebybobo_IlIIlIIIIIlIlIl=tonumber;local function madebybobo_lIIIlllIllIllI(madebybobo_lIIIlIIl)local madebybobo_llIllIIlIIlIIllIlIllIIIII,madebybobo_lIIllIlIIIIlIIllIIIIlllI,madebybobo_IIIllIIIlIIIIIIl="","",{}local madebybobo_IlIlIllllIIl=256;local madebybobo_lllIIlIlllIIIIIlIlllIII={}for madebybobo_lIlIlllllIlIllllIIIIllllI=0,madebybobo_IlIlIllllIIl-1 do madebybobo_lllIIlIlllIIIIIlIlllIII[madebybobo_lIlIlllllIlIllllIIIIllllI]=madebybobo_lIIllIlI(madebybobo_lIlIlllllIlIllllIIIIllllI)end;local madebybobo_lIlIlllllIlIllllIIIIllllI=1;local function madebybobo_IlIllIllIIllIlIllllIl()local madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_IlIIlIIIIIlIlIl(madebybobo_llIllIIIlIIll(madebybobo_lIIIlIIl,madebybobo_lIlIlllllIlIllllIIIIllllI,madebybobo_lIlIlllllIlIllllIIIIllllI),36)madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_lIlIlllllIlIllllIIIIllllI+1;local madebybobo_lIIllIlIIIIlIIllIIIIlllI=madebybobo_IlIIlIIIIIlIlIl(madebybobo_llIllIIIlIIll(madebybobo_lIIIlIIl,madebybobo_lIlIlllllIlIllllIIIIllllI,madebybobo_lIlIlllllIlIllllIIIIllllI+madebybobo_llIllIIlIIlIIllIlIllIIIII-1),36)madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_lIlIlllllIlIllllIIIIllllI+madebybobo_llIllIIlIIlIIllIlIllIIIII;return madebybobo_lIIllIlIIIIlIIllIIIIlllI end;madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_lIIllIlI(madebybobo_IlIllIllIIllIlIllllIl())madebybobo_IIIllIIIlIIIIIIl[1]=madebybobo_llIllIIlIIlIIllIlIllIIIII;while madebybobo_lIlIlllllIlIllllIIIIllllI<#madebybobo_lIIIlIIl do local madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IlIllIllIIllIlIllllIl()if madebybobo_lllIIlIlllIIIIIlIlllIII[madebybobo_lIlIlllllIlIllllIIIIllllI]then madebybobo_lIIllIlIIIIlIIllIIIIlllI=madebybobo_lllIIlIlllIIIIIlIlllIII[madebybobo_lIlIlllllIlIllllIIIIllllI]else madebybobo_lIIllIlIIIIlIIllIIIIlllI=madebybobo_llIllIIlIIlIIllIlIllIIIII..madebybobo_llIllIIIlIIll(madebybobo_llIllIIlIIlIIllIlIllIIIII,1,1)end;madebybobo_lllIIlIlllIIIIIlIlllIII[madebybobo_IlIlIllllIIl]=madebybobo_llIllIIlIIlIIllIlIllIIIII..madebybobo_llIllIIIlIIll(madebybobo_lIIllIlIIIIlIIllIIIIlllI,1,1)madebybobo_IIIllIIIlIIIIIIl[#madebybobo_IIIllIIIlIIIIIIl+1],madebybobo_llIllIIlIIlIIllIlIllIIIII,madebybobo_IlIlIllllIIl=madebybobo_lIIllIlIIIIlIIllIIIIlllI,madebybobo_lIIllIlIIIIlIIllIIIIlllI,madebybobo_IlIlIllllIIl+1 end;return table.concat(madebybobo_IIIllIIIlIIIIIIl)end;local madebybobo_IlIIlIIIIIlIlIl=madebybobo_lIIIlllIllIllI('23023727523423D2752371V1S1I1N1017111Q1T1K23423B2791K1I1U1M23423827921N17171321G1M1723422A2791R27W131022122K22K131I27F1M1H27I22L1G1S1U22K111I1422K21W21521X2131921H1T1523423J27921C111M1I171M21027I1N1S1427L2792961B28123E2792131M1V1M131S11171023429I275212171Q1V1Q29X1M29S27T2752921M1N2A029S23F27921E1N1N21R1I1H29L23421Y2912932A829R23D21M1T29P1Q22122B21J28N1K1K27I1K23D141I1V1V1A2AV21221M23D1H1S2BD1O1S28F1M2AV1W1G27H132AP29T2AC2AE2131S2AZ29M2342AB27521129Y1V1I1K1M1123422P27921J1M1529Y22B21H11162A022B1W29L29M2C623927U161T2962C62BY23721I1B1327B2932C627M2A51R27D23423A29J1Q1N1629S29U2372BL1Q1M2CR1Q27F2342CO27521J1S1G1729P2BX2911Q2CC29Z1I1T2DT27521328N1529L2C529D27521K2B123423427921D2BE2D627921Q1I1A2DS2DD2AD1N21D1627W1S2DZ2DD21C1R2A21722B21I10132DL2BR2EO1S1B23423I2791Z2C21A2C522B21N2A02BD2F723H2792C0101Q1H29M2FF2FH2F623422X27928E2B522B1I22B2BD29522B22J2AI22B27I22B2B42CS22I23721B27922P2202792362GF2752GJ23527922B2GL2372GJ2EC2C82372EC2D227923727M2GJ2GY2GR2GZ2H22H22GN2H22GM2372GP2H32752D72792EC2GQ21V21M2GV2372CO2A422J2H32EC2GN2HB2H72372HE2752GX2GJ21V2HW2HL2372CU2372GN27M2HR2762792HV2HU2GI2372HZ2IB2CO2DD2HK2D72I72H42EC27822P22Q2I123C2GY2GW2I12GJ22B21F2H42GJ2902IO2I12F927523522C2372A42IS2H427T2IV2IX2H02372J02IP2CO2FK2J42J62JB2J927M2JM2IW2IY2JF2372J12CO23G2792J52J72I42JN2JZ2JC2JR2JG2I122R2JX2JL2HK2HF2JA2H32JQ2JE2K52CO2IP2JK2JZ2GX2HK2JO2KD2JD2H32KG2JT2K82JZ2IA2IT2JP2KP2IZ2JT2JH23722O2KT27T2DM2I82KN2K32KF2L02I122V2L42JZ2KB2L82HA2KY2JS2JU23722U2LE2I32KW2KO2K42LB2CO22T2LE2IH2LQ2L92KQ2LT23722S2LE2782LG2K22LI2LS2LL22Z2LE2IR2M62KX2M92L122Y2LE2902ME2LR2I62372FV2LL22W2LE2J32L72M72KE2K02332M12322LE2JJ2MU2MF2MN2KR2312LE2JW2ML2LZ2GN2MP2L12742KJ27T2K72NA2752222IC2752KI2JS2762HT21821G2342HT2ES2E72372B42A02NX27O27Q27S2FA2FC2C529S2MD23721R2DP2B52FB2EJ2E62EU2D428N2DQ2E62NI23721N161U2DY1S2D91X1S1S171Z1I29Q2F32A52CF27P27R2DD21029P1O2F11I1G27R2L61Y162EX2AA2FL2C12C32C52362N727522P22K2H32H12HL2282792JM2HW2252PW2HC2212K02PT2392PV2GN2PX2GZ2PZ2752JM23B2QA2I22Q12K02GY22R21I2H32GN2GN2PQ2PS2GO22M2QP2GN23929I2GJ2FK2GJ2GJ2QD2792QX2Q92792N02GJ2QO2GS2GY2R22QY2KS2H32GX2HB2RB2D72RF2H32CO2RI2GJ27T2RL2QF2GU2I52GO2J42K02782HS2K02IR2RW2GN2902RZ2QF2S229I2NI2GJ29I2RR2792QV2NK2NM2H22MK2GV2NR2NT2NV2DZ2GX2NZ2812GX2O227R2J82OE2FD112O82792OB1G2OD2O62C62OH2OZ2PB2CS2342OM2OO2OQ2AS2OT2OV2OX2OZ2812L621C2P32O32P62P82PA2PC2NX21P1Z21C29S2GU2372CA2DW2CE2CG2CI2CK2B62PM2N02PP2PR2RB2752Q52Q02PT2R02QB2QG2GN2Q42Q62M72PY2U92R32752AB2H12Q22HT2752QJ2QL2K02R72HC2HA2QR2RB2QT2PV2GJ2MY2UA2QE2V22JT2U52KA2752RA2H32GU2QZ2RS2QP2RH2GQ2GJ2RK2VH2JZ2RO2AB2RQ2H42752S22RV2RT2GN2RY2VT2JS2S22AB2S42372S62372S82VP2752SB2372NL2GQ2H52SF2NU2792NS2WD2752NW2SL1I2O02SO2P42O42752SS2O72342O92SX2SZ2OF2T12912OI2T42OL2CP2T92OS1N2OU2OW2OY2P02TG2TI2P52792P7112P928C2TN2PE2PG27F29S2L62OO2CR2U22GF2V72UF2UJ2UI2UC2UN2Q32792U82Q72UV2UB2M72Y32UM2752UO2H22UR2H92QN2XS2QQ2QS2PU2H32V52XV2372V52UU2HG2V92QP2R62GQ2RE2VK2VG2QP2VJ2QP2RN2VK2VN2RT2YS2K02GN2VS2Z32372VV2Z62S12VW2VZ2VW2S52GQ2W42KL2W72W92UV2GY2WC2SH2WG2372WI2792SM2O12WN2SR2T02SV2752WU1V2WQ2WX2D32T32OK2C62T72OP2OR2TB2X72TE2P12372TH28N2TJ2XD2TL2XH2PD2792PF2PH2E02CV2CX2CZ2PM2PO2V62QP2U72PV2XW2792Y32PX2Y82XT2Y12V32UJ2Y52UD2Y92QK2YB310V2U62UW2YF2QU2H32VA2Y32R22Y32R5311D2V82372VA2YQ2RD2VE2RG2HA2VK2YW2RB2YY2QP2Z02K02Z22QM2372Z531252Z831252ZA2Z62ZC2Z62ZE2H32ZG2GY2ZI2SD2ZL2HF2ZN2SJ2NX2ZS2WM2O32ZV2WW2ZX2OA2OC31002T02BQ31032OJ2T531072X3310A2TD2X92912XB31302372XE2XG2PB310L275310N2XL2NX2EV27D2362MY2U4310W2YG2U72Y22QE2CO2XX2UE2XZ2W42JM2QZ2QE31122QH2792YA2Z62UU2PT22B2UX2US2U82GJ2MR3116275314F311O2YN311Q2YP2RC2VD2VQ2YT311W2YV314R311Z314T2H331222S9314R312531272RX314Z2K0312B3125312D3125312F2S731232GY2Y62W8312K2792ZM2WE2SI2792ZQ275312Q27N2ZU2O5312U2WS2SW312X3101313B313L31322X12752T831092X52TC2X82TF3139310G2XC275313D2TM313G237313I29R2EG2E12D92DB313N2XR313Q2U8313S314G2IU2Y72XY2U7313Z2QP311131192QI311B31472YD2VQ314B2H9314D237314I2YJ314I2YM2R9314M2VC2W52RO2YU2RB311Y2H331202RB314X317F2VW31512VU31532S0317S2S32ZD2W12ZF315B279315D2ZJ2PT312L2NQ315I2ZO315L2NY2WK2SN315O312S315Q2ST312V2ZZ315V2T2315Y31062X231622X6313731662P23168313B316B310K310D316F2DC2792DF2DH29X27F2PN316M311E316O2UH2UK2UH31132XZ2UG2Q8316X31413180316Y31453170312531482YE2UY2HL2SB311J2QE311L2QE311N317B2R1317D2YR311U2H3317H2RJ314V2RM31A42RP2Z12VE3150317U31293154317U31572K031592W3317Z2W62HC31822H52NP2SG3186312O2WJ2WL318C2SQ318E2WR2WT315U312Z318J2X0318L316031082TA3163310B3138318R2WN2TK2XF316C318W2XK316G2L62DO2DQ29P2362U3311O2XT310Z2YJ3143313X310X2K0319E31422RD2QE315D2Y8316Z2US2YC313Q314A311G2V02YK313T2792YL2V7314K311R314N317O2VF31A6317J31A52VM2RC314Y2VR31AB317U31552K031AF2GN31AH312H2SA31AL315F275315H2752WF31AR2ZR318A2ZT318D2WP2ZW315S2ZY31AZ2WW315W2WZ31052T6318M31B6318O3165310D310F31BB310I31BD318V2XJ310O2CU21C2DV29Y1Q2DY31BM31952UV311H2I02RB2Y32JE319F316S31BT319P31CT316W31BZ319I2UQ319K2UT3172311F319O31762YI319931CC2HP317C2RB311S314O31A631A22VI31A6317L314W31CN31CH31AA2S231AC317T2VY317U31CW31AJ31AI2H131AM2WB312M31AQ315K2SK31D631AT2752SP2WO2373101318G31DE2ST31DG3104313331DK2X431DM310C2XA318S31BC313E2XI310M31BG2PI2E12E32E5113194313P31962DD2JE319G31E6319931BS31E42W42Y631GJ2QF313W311A31C331BO319N314C319Q31EF319X31GQ319V31CD31ET2QP317E2Z2311V2RO31CK2VL2YZ31F331242RU31CQ2S231CS2GN31CU31AI2W231CX31AK31FE31D031AO2ZO31D431FJ312P31D7312R31AV31DA315R31AY2SY312Y31DF31B131DI3134318N316431G1316731DQ316A310J313F31BF310O2GX2E927J31E231GF31GN311031GZ31GK31EA237319B316U31EE31E731EG31GS31C2311C319M317331C72YH31CA27531ER2R831H031H5319Z314P31CI31H931F031A6317N31HE2Z431HG2VW31HI317V312E317X312G31FC312J2WA2SE31FH31D3315J2WH31FK315M31HW31AU31FP31FR31DC312W31I2318I2WY31FW315Z2ON31B531FZ31I931B9310E313A31G431BE31DU313J2YN2EE1H316L31IM31BP316R2YJ313V31EB31IN311531BY2XU31C1319J31GU31J131EM314C31C831783199317A31H331J92RB31H631A02GJ31EY2I12RO31F12GJ31JH31A931HF31F631CR31AE31FA31JP315A314Y31GR2SC31JT318431AP31JW318731JZ318931FM23731FO312T318F31K5318H31B031K9318K31DJ31B4313531B7318P31DO31KI31DR31G5316D318X316H2372EI2EK31GD310U31L431E52JR31GQ31E931BX31GS2Q431GO31IP31LW31IS314431EI31L331EL31C631EN31GY31IW31J9311M2VB31LB2YO31EU31CG31H731A131CJ31JF31CM2VO31JI312631JK2Z931LR2W031HM31JR31CZ31LY2792FV27631HX27727927Z172CK112CC2TN31KJ31DT2WY31DV2792AR27F2DY2TN2YN1T1M29C2SF21D2C12G2111N21G2CH2NX1W1Q1927R2HV21221J1Q1U21T31AN22R2IX31AN2GV2O921E1V2B41A1021O1T2BT1323623631MQ313A2L62X8319131AN23N22431MF23721D2PB1O1K111S2CQ1N21C1S2CZ21S31DO31QB29P31QD2J81L31Q61U1X21G21D2H51J1G31PD2H223321F2342LV27531Q21G31Q431Q631Q82E22DY2PA2931T1G1A23726H26I31RD31RD24Q31PZ2HV28C1Q2SU31K531O92EV29Y1N31R731MQ21C27B31OP23731PA2PP2LD31JT2HB2GY2QN2RT314K31S22K031S131IO317E2HV31JE2VO2J82IC319L2RT2DD2S22CO2GU2IM2GK2H42O92GU2D72M52RC2CO2O92JX2I12GN2W22AB2GN2IE2KZ2F92VO31SB2VW31SK2I82N231SW31252NI2GN2JW311S2EC31SI2I82EC31T82H42OM31SQ2Z731SN2CO31TN2UC31SV2I827T31SY2RT2AB2GT2I82TT2HB2EC2EC2L32GU27M31RZ2RC2D72LN2PP313S31SS2KB2CO31TX2K02IP2EC2IE2GN2LV2M331SL2372MB31JC2GX2MI31IO2IA2I82HD2W52372V72JQ2Y631O42262QF31TC2QK2AB2JW2L52K72EC22N2US2Y331VF31HP31O22UQ31JV2372WF2GX2FN31P3310P2DR1T2OP2AI2D129J1M29G31PE31QV31RI2WK31RL31O631M831AX31O828031RO1V31RQ2DH2NX1T2WN31I12WV31FU31I531FX31MG31I831B8318B27531P131VR2J82111M31BK1131QD31OO31OQ23522H313Y31ES31NF2I831GQ2GC2R62PR31EC2QO31U42YE2GX2D231V62HQ2K02U831SM316Q27831GQ2IR2R631UK2IB31N931252GT2IR2QT31SN2EC2J831U32HK312D31XE2LX31V02RT2I02KL2J62IV2QR2L531NU22P2D72AB31Y12UL2QF312D2AB2AB2Z831YN31NU2DM27T314I2AB2Y3314I2Y331YB311F31YE2S12MI27T27T31T431YK2N9314R31YQ2K72GU2W7314R29I2W42GU31XO2VE27827831S331TP31492752IR31XX315C31TP31UI27T2FK2AB2392K72GN2L32H92Y3320131LX2ZK27931Z831HS2NT2J82CC2FN2FP31P427931RJ31W531K231W731RL2O931RN1R31RP31RR2GX21P31WH315T31K72T031PQ31FV31ME31I731DL31KF2812SF31R41T31R62DH31R923721S321B321C24G22431832GY31PY23631VF31KR31X431GK31MZ31KZ31YK31N2319C31IV311031IX31992W731L131N931J031XQ2V831NS31LN2GN2YU31252L62K031S52UV2IT27931X9311F2CO2D727T31YG2KK2VE31Z42IB2HB322M312D322M31YE2I12MI31A52Y3322U3199322E2QO31KV31J22CO31UH23722D2L32CO2N7315A2Y3323931992292KD2QR322G31NU31C6323331TP2HI2I12902F92Y3322Z2PR3231322F31SX32352242I1322E2FK323Q323F2I131SR323U31SU2ID2HJ2CO2902JW31ZY2H32IP32022QE324E3205321G31ZP2HF31W331RK29S31O631OF31IF2HV1W320O28731RM31WA320O31WC31RR320K31FS320V31I431MD31B231Q03161321131WP31MK318S31BI27H2E4112L22GF313O2UV317E2HT2RO2EC2RO27M317G2GY2H931PE31FC2K731XA2IB325M22L2IB2D72YW2D7322H314R326431JN326729I2HB2CO27M2Z8323K2782NI324432332OM2Y62I5321V315E31VK237');local madebybobo_lIlIlllllIlIllllIIIIllllI=bit32 or require('bit');local madebybobo_IIIllIIIlIIIIIIl=madebybobo_lIlIlllllIlIllllIIIIllllI and madebybobo_lIlIlllllIlIllllIIIIllllI.bxor or function(madebybobo_lIlIlllllIlIllllIIIIllllI,madebybobo_lIIllIlIIIIlIIllIIIIlllI)local madebybobo_llIllIIlIIlIIllIlIllIIIII,madebybobo_IIIllIIIlIIIIIIl=1,0 while madebybobo_lIlIlllllIlIllllIIIIllllI>0 and madebybobo_lIIllIlIIIIlIIllIIIIlllI>0 do local madebybobo_IlIlIllllIIl,madebybobo_llIllIIIlIIll=madebybobo_lIlIlllllIlIllllIIIIllllI%2,madebybobo_lIIllIlIIIIlIIllIIIIlllI%2 if madebybobo_IlIlIllllIIl~=madebybobo_llIllIIIlIIll then madebybobo_IIIllIIIlIIIIIIl=madebybobo_IIIllIIIlIIIIIIl+madebybobo_llIllIIlIIlIIllIlIllIIIII end madebybobo_lIlIlllllIlIllllIIIIllllI,madebybobo_lIIllIlIIIIlIIllIIIIlllI,madebybobo_llIllIIlIIlIIllIlIllIIIII=(madebybobo_lIlIlllllIlIllllIIIIllllI-madebybobo_IlIlIllllIIl)/2,(madebybobo_lIIllIlIIIIlIIllIIIIlllI-madebybobo_llIllIIIlIIll)/2,madebybobo_llIllIIlIIlIIllIlIllIIIII*2 end if madebybobo_lIlIlllllIlIllllIIIIllllI<madebybobo_lIIllIlIIIIlIIllIIIIlllI then madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_lIIllIlIIIIlIIllIIIIlllI end while madebybobo_lIlIlllllIlIllllIIIIllllI>0 do local madebybobo_lIIllIlIIIIlIIllIIIIlllI=madebybobo_lIlIlllllIlIllllIIIIllllI%2 if madebybobo_lIIllIlIIIIlIIllIIIIlllI>0 then madebybobo_IIIllIIIlIIIIIIl=madebybobo_IIIllIIIlIIIIIIl+madebybobo_llIllIIlIIlIIllIlIllIIIII end madebybobo_lIlIlllllIlIllllIIIIllllI,madebybobo_llIllIIlIIlIIllIlIllIIIII=(madebybobo_lIlIlllllIlIllllIIIIllllI-madebybobo_lIIllIlIIIIlIIllIIIIlllI)/2,madebybobo_llIllIIlIIlIIllIlIllIIIII*2 end return madebybobo_IIIllIIIlIIIIIIl end local function madebybobo_lIIllIlIIIIlIIllIIIIlllI(madebybobo_llIllIIlIIlIIllIlIllIIIII,madebybobo_lIlIlllllIlIllllIIIIllllI,madebybobo_lIIllIlIIIIlIIllIIIIlllI)if madebybobo_lIIllIlIIIIlIIllIIIIlllI then local madebybobo_lIlIlllllIlIllllIIIIllllI=(madebybobo_llIllIIlIIlIIllIlIllIIIII/2^(madebybobo_lIlIlllllIlIllllIIIIllllI-1))%2^((madebybobo_lIIllIlIIIIlIIllIIIIlllI-1)-(madebybobo_lIlIlllllIlIllllIIIIllllI-1)+1);return madebybobo_lIlIlllllIlIllllIIIIllllI-madebybobo_lIlIlllllIlIllllIIIIllllI%1;else local madebybobo_lIlIlllllIlIllllIIIIllllI=2^(madebybobo_lIlIlllllIlIllllIIIIllllI-1);return(madebybobo_llIllIIlIIlIIllIlIllIIIII%(madebybobo_lIlIlllllIlIllllIIIIllllI+madebybobo_lIlIlllllIlIllllIIIIllllI)>=madebybobo_lIlIlllllIlIllllIIIIllllI)and 1 or 0;end;end;local madebybobo_lIlIlllllIlIllllIIIIllllI=1;local function madebybobo_llIllIIlIIlIIllIlIllIIIII()local madebybobo_llIllIIlIIlIIllIlIllIIIII,madebybobo_lIIllIlIIIIlIIllIIIIlllI,madebybobo_llIllIIIlIIll,madebybobo_IlIlIllllIIl=madebybobo_lllIIlIlllIIIIIlIlllIII(madebybobo_IlIIlIIIIIlIlIl,madebybobo_lIlIlllllIlIllllIIIIllllI,madebybobo_lIlIlllllIlIllllIIIIllllI+3);madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_IIIllIIIlIIIIIIl(madebybobo_llIllIIlIIlIIllIlIllIIIII,115)madebybobo_lIIllIlIIIIlIIllIIIIlllI=madebybobo_IIIllIIIlIIIIIIl(madebybobo_lIIllIlIIIIlIIllIIIIlllI,115)madebybobo_llIllIIIlIIll=madebybobo_IIIllIIIlIIIIIIl(madebybobo_llIllIIIlIIll,115)madebybobo_IlIlIllllIIl=madebybobo_IIIllIIIlIIIIIIl(madebybobo_IlIlIllllIIl,115)madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_lIlIlllllIlIllllIIIIllllI+4;return(madebybobo_IlIlIllllIIl*16777216)+(madebybobo_llIllIIIlIIll*65536)+(madebybobo_lIIllIlIIIIlIIllIIIIlllI*256)+madebybobo_llIllIIlIIlIIllIlIllIIIII;end;local function madebybobo_IlIllIllIIllIlIllllIl()local madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_IIIllIIIlIIIIIIl(madebybobo_lllIIlIlllIIIIIlIlllIII(madebybobo_IlIIlIIIIIlIlIl,madebybobo_lIlIlllllIlIllllIIIIllllI,madebybobo_lIlIlllllIlIllllIIIIllllI),115);madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_lIlIlllllIlIllllIIIIllllI+1;return madebybobo_llIllIIlIIlIIllIlIllIIIII;end;local function madebybobo_IlIlIllllIIl()local madebybobo_llIllIIlIIlIIllIlIllIIIII,madebybobo_lIIllIlIIIIlIIllIIIIlllI=madebybobo_lllIIlIlllIIIIIlIlllIII(madebybobo_IlIIlIIIIIlIlIl,madebybobo_lIlIlllllIlIllllIIIIllllI,madebybobo_lIlIlllllIlIllllIIIIllllI+2);madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_IIIllIIIlIIIIIIl(madebybobo_llIllIIlIIlIIllIlIllIIIII,115)madebybobo_lIIllIlIIIIlIIllIIIIlllI=madebybobo_IIIllIIIlIIIIIIl(madebybobo_lIIllIlIIIIlIIllIIIIlllI,115)madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_lIlIlllllIlIllllIIIIllllI+2;return(madebybobo_lIIllIlIIIIlIIllIIIIlllI*256)+madebybobo_llIllIIlIIlIIllIlIllIIIII;end;local function madebybobo_IlIIlIlllllIIIIlI()local madebybobo_IIIllIIIlIIIIIIl=madebybobo_llIllIIlIIlIIllIlIllIIIII();local madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_llIllIIlIIlIIllIlIllIIIII();local madebybobo_llIllIIIlIIll=1;local madebybobo_IIIllIIIlIIIIIIl=(madebybobo_lIIllIlIIIIlIIllIIIIlllI(madebybobo_lIlIlllllIlIllllIIIIllllI,1,20)*(2^32))+madebybobo_IIIllIIIlIIIIIIl;local madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_lIIllIlIIIIlIIllIIIIlllI(madebybobo_lIlIlllllIlIllllIIIIllllI,21,31);local madebybobo_lIlIlllllIlIllllIIIIllllI=((-1)^madebybobo_lIIllIlIIIIlIIllIIIIlllI(madebybobo_lIlIlllllIlIllllIIIIllllI,32));if(madebybobo_llIllIIlIIlIIllIlIllIIIII==0)then if(madebybobo_IIIllIIIlIIIIIIl==0)then return madebybobo_lIlIlllllIlIllllIIIIllllI*0;else madebybobo_llIllIIlIIlIIllIlIllIIIII=1;madebybobo_llIllIIIlIIll=0;end;elseif(madebybobo_llIllIIlIIlIIllIlIllIIIII==2047)then return(madebybobo_IIIllIIIlIIIIIIl==0)and(madebybobo_lIlIlllllIlIllllIIIIllllI*(1/0))or(madebybobo_lIlIlllllIlIllllIIIIllllI*(0/0));end;return madebybobo_IIIIlIIlIIIIlI(madebybobo_lIlIlllllIlIllllIIIIllllI,madebybobo_llIllIIlIIlIIllIlIllIIIII-1023)*(madebybobo_llIllIIIlIIll+(madebybobo_IIIllIIIlIIIIIIl/(2^52)));end;local madebybobo_IIIIlIIlIIIIlI=madebybobo_llIllIIlIIlIIllIlIllIIIII;local function madebybobo_lIIIlllIllIllI(madebybobo_llIllIIlIIlIIllIlIllIIIII)local madebybobo_lIIllIlIIIIlIIllIIIIlllI;if(not madebybobo_llIllIIlIIlIIllIlIllIIIII)then madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_IIIIlIIlIIIIlI();if(madebybobo_llIllIIlIIlIIllIlIllIIIII==0)then return'';end;end;madebybobo_lIIllIlIIIIlIIllIIIIlllI=madebybobo_llIllIIIlIIll(madebybobo_IlIIlIIIIIlIlIl,madebybobo_lIlIlllllIlIllllIIIIllllI,madebybobo_lIlIlllllIlIllllIIIIllllI+madebybobo_llIllIIlIIlIIllIlIllIIIII-1);madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_lIlIlllllIlIllllIIIIllllI+madebybobo_llIllIIlIIlIIllIlIllIIIII;local madebybobo_llIllIIlIIlIIllIlIllIIIII={}for madebybobo_lIlIlllllIlIllllIIIIllllI=1,#madebybobo_lIIllIlIIIIlIIllIIIIlllI do madebybobo_llIllIIlIIlIIllIlIllIIIII[madebybobo_lIlIlllllIlIllllIIIIllllI]=madebybobo_lIIllIlI(madebybobo_IIIllIIIlIIIIIIl(madebybobo_lllIIlIlllIIIIIlIlllIII(madebybobo_llIllIIIlIIll(madebybobo_lIIllIlIIIIlIIllIIIIlllI,madebybobo_lIlIlllllIlIllllIIIIllllI,madebybobo_lIlIlllllIlIllllIIIIllllI)),115))end return madebybobo_lIllllllIlIlll(madebybobo_llIllIIlIIlIIllIlIllIIIII);end;local madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_llIllIIlIIlIIllIlIllIIIII;local function madebybobo_lIIllIllIlllIIllIl(...)return{...},madebybobo_lIIlIlIllIIIlllIIIIll('#',...)end local function madebybobo_lIllllllIlIlll()local madebybobo_lIIIlIIl={};local madebybobo_IlIIlIIIIIlIlIl={};local madebybobo_lIlIlllllIlIllllIIIIllllI={};local madebybobo_lIIllIlI={madebybobo_lIIIlIIl,madebybobo_IlIIlIIIIIlIlIl,nil,madebybobo_lIlIlllllIlIllllIIIIllllI};local madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_llIllIIlIIlIIllIlIllIIIII()local madebybobo_llIllIIIlIIll={}for madebybobo_lIIllIlIIIIlIIllIIIIlllI=1,madebybobo_lIlIlllllIlIllllIIIIllllI do local madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_IlIllIllIIllIlIllllIl();local madebybobo_lIlIlllllIlIllllIIIIllllI;if(madebybobo_llIllIIlIIlIIllIlIllIIIII==1)then madebybobo_lIlIlllllIlIllllIIIIllllI=(madebybobo_IlIllIllIIllIlIllllIl()~=0);elseif(madebybobo_llIllIIlIIlIIllIlIllIIIII==0)then madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IlIIlIlllllIIIIlI();elseif(madebybobo_llIllIIlIIlIIllIlIllIIIII==3)then madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_lIIIlllIllIllI();end;madebybobo_llIllIIIlIIll[madebybobo_lIIllIlIIIIlIIllIIIIlllI]=madebybobo_lIlIlllllIlIllllIIIIllllI;end;madebybobo_lIIllIlI[3]=madebybobo_IlIllIllIIllIlIllllIl();for madebybobo_IlIIlIIIIIlIlIl=1,madebybobo_llIllIIlIIlIIllIlIllIIIII()do local madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IlIllIllIIllIlIllllIl();if(madebybobo_lIIllIlIIIIlIIllIIIIlllI(madebybobo_lIlIlllllIlIllllIIIIllllI,1,1)==0)then local madebybobo_IIIllIIIlIIIIIIl=madebybobo_lIIllIlIIIIlIIllIIIIlllI(madebybobo_lIlIlllllIlIllllIIIIllllI,2,3);local madebybobo_lllIIlIlllIIIIIlIlllIII=madebybobo_lIIllIlIIIIlIIllIIIIlllI(madebybobo_lIlIlllllIlIllllIIIIllllI,4,6);local madebybobo_lIlIlllllIlIllllIIIIllllI={madebybobo_IlIlIllllIIl(),madebybobo_IlIlIllllIIl(),nil,nil};if(madebybobo_IIIllIIIlIIIIIIl==0)then madebybobo_lIlIlllllIlIllllIIIIllllI[#("mLk")]=madebybobo_IlIlIllllIIl();madebybobo_lIlIlllllIlIllllIIIIllllI[#("jd0S")]=madebybobo_IlIlIllllIIl();elseif(madebybobo_IIIllIIIlIIIIIIl==1)then madebybobo_lIlIlllllIlIllllIIIIllllI[#("eM2")]=madebybobo_llIllIIlIIlIIllIlIllIIIII();elseif(madebybobo_IIIllIIIlIIIIIIl==2)then madebybobo_lIlIlllllIlIllllIIIIllllI[#("tQe")]=madebybobo_llIllIIlIIlIIllIlIllIIIII()-(2^16)elseif(madebybobo_IIIllIIIlIIIIIIl==3)then madebybobo_lIlIlllllIlIllllIIIIllllI[#("go7")]=madebybobo_llIllIIlIIlIIllIlIllIIIII()-(2^16)madebybobo_lIlIlllllIlIllllIIIIllllI[#("gtUY")]=madebybobo_IlIlIllllIIl();end;if(madebybobo_lIIllIlIIIIlIIllIIIIlllI(madebybobo_lllIIlIlllIIIIIlIlllIII,1,1)==1)then madebybobo_lIlIlllllIlIllllIIIIllllI[#("lL")]=madebybobo_llIllIIIlIIll[madebybobo_lIlIlllllIlIllllIIIIllllI[#("zx")]]end if(madebybobo_lIIllIlIIIIlIIllIIIIlllI(madebybobo_lllIIlIlllIIIIIlIlllIII,2,2)==1)then madebybobo_lIlIlllllIlIllllIIIIllllI[#("nsk")]=madebybobo_llIllIIIlIIll[madebybobo_lIlIlllllIlIllllIIIIllllI[#("g4Y")]]end if(madebybobo_lIIllIlIIIIlIIllIIIIlllI(madebybobo_lllIIlIlllIIIIIlIlllIII,3,3)==1)then madebybobo_lIlIlllllIlIllllIIIIllllI[#("bsMI")]=madebybobo_llIllIIIlIIll[madebybobo_lIlIlllllIlIllllIIIIllllI[#("k8XE")]]end madebybobo_lIIIlIIl[madebybobo_IlIIlIIIIIlIlIl]=madebybobo_lIlIlllllIlIllllIIIIllllI;end end;for madebybobo_lIlIlllllIlIllllIIIIllllI=1,madebybobo_llIllIIlIIlIIllIlIllIIIII()do madebybobo_IlIIlIIIIIlIlIl[madebybobo_lIlIlllllIlIllllIIIIllllI-1]=madebybobo_lIllllllIlIlll();end;return madebybobo_lIIllIlI;end;local function madebybobo_IIIIlIIlIIIIlI(madebybobo_lIlIlllllIlIllllIIIIllllI,madebybobo_llIllIIlIIlIIllIlIllIIIII,madebybobo_IlIlIllllIIl)local madebybobo_lIIllIlIIIIlIIllIIIIlllI=madebybobo_lIlIlllllIlIllllIIIIllllI[1];local madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_lIlIlllllIlIllllIIIIllllI[2];local madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_lIlIlllllIlIllllIIIIllllI[3];return function(...)local madebybobo_IIIllIIIlIIIIIIl=madebybobo_lIIllIlIIIIlIIllIIIIlllI;local madebybobo_lIllllllIlIlll=madebybobo_llIllIIlIIlIIllIlIllIIIII;local madebybobo_llIllIIIlIIll=madebybobo_lIlIlllllIlIllllIIIIllllI;local madebybobo_IlIIlIIIIIlIlIl=madebybobo_lIIllIllIlllIIllIl local madebybobo_llIllIIlIIlIIllIlIllIIIII=1;local madebybobo_lllIIlIlllIIIIIlIlllIII=-1;local madebybobo_lllIlIlll={};local madebybobo_lIIllIlI={...};local madebybobo_IlIllIllIIllIlIllllIl=madebybobo_lIIlIlIllIIIlllIIIIll('#',...)-1;local madebybobo_lIlIlllllIlIllllIIIIllllI={};local madebybobo_lIIllIlIIIIlIIllIIIIlllI={};for madebybobo_lIlIlllllIlIllllIIIIllllI=0,madebybobo_IlIllIllIIllIlIllllIl do if(madebybobo_lIlIlllllIlIllllIIIIllllI>=madebybobo_llIllIIIlIIll)then madebybobo_lllIlIlll[madebybobo_lIlIlllllIlIllllIIIIllllI-madebybobo_llIllIIIlIIll]=madebybobo_lIIllIlI[madebybobo_lIlIlllllIlIllllIIIIllllI+1];else madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI]=madebybobo_lIIllIlI[madebybobo_lIlIlllllIlIllllIIIIllllI+1];end;end;local madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IlIllIllIIllIlIllllIl-madebybobo_llIllIIIlIIll+1 local madebybobo_lIlIlllllIlIllllIIIIllllI;local madebybobo_llIllIIIlIIll;while true do madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_llIllIIIlIIll=madebybobo_lIlIlllllIlIllllIIIIllllI[#("g")];if madebybobo_llIllIIIlIIll<=#("6Fxuz65cLqVJOGbZgsOThCuS2CbN1Sk4rjBV")then if madebybobo_llIllIIIlIIll<=#("xeQcOE6XnegTX2gVJ")then if madebybobo_llIllIIIlIIll<=#("EjOC74sl")then if madebybobo_llIllIIIlIIll<=#("g1r")then if madebybobo_llIllIIIlIIll<=#("e")then if madebybobo_llIllIIIlIIll>#("")then local madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_lIlIlllllIlIllllIIIIllllI[#("Jj")]madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI](madebybobo_lIIIlIIl(madebybobo_lIIllIlIIIIlIIllIIIIlllI,madebybobo_lIlIlllllIlIllllIIIIllllI+1,madebybobo_lllIIlIlllIIIIIlIlllIII))else if(madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("ki")]]~=madebybobo_lIlIlllllIlIllllIIIIllllI[#("jzq0")])then madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;else madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_lIlIlllllIlIllllIIIIllllI[#("S2N")];end;end;elseif madebybobo_llIllIIIlIIll==#("Tn")then madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("OV")]]();madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("W3")]]=madebybobo_IlIlIllllIIl[madebybobo_lIlIlllllIlIllllIIIIllllI[#("UgA")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("pB")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("Gcd")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("FuR3")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("1u")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("p36")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("OHvi")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("ni")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("K2S")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("uEWQ")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("Ye")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("6dc")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("1lK6")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("HE")]]=madebybobo_IlIlIllllIIl[madebybobo_lIlIlllllIlIllllIIIIllllI[#("EgG")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("uL")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("0xO")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("r49r")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("VZ")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("Xbh")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("muWN")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("A9")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("9Zt")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("UXaE")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("3r")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("p7j")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("VM0E")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("jk")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("kUe")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("F7DA")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("6e")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("vQv")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("Qlhs")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_lIlIlllllIlIllllIIIIllllI[#("mWm")];else local madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_lIlIlllllIlIllllIIIIllllI[#("n2")]madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_llIllIIlIIlIIllIlIllIIIII](madebybobo_lIIIlIIl(madebybobo_lIIllIlIIIIlIIllIIIIlllI,madebybobo_llIllIIlIIlIIllIlIllIIIII+1,madebybobo_lIlIlllllIlIllllIIIIllllI[#("ZNJ")]))end;elseif madebybobo_llIllIIIlIIll<=#("QD7z4")then if madebybobo_llIllIIIlIIll==#("y43d")then madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("Eu")]]();madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("ml")]]=madebybobo_IlIlIllllIIl[madebybobo_lIlIlllllIlIllllIIIIllllI[#("LZr")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("bU")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("yWA")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("8Zts")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("ZN")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("VVF")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("LvAU")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("Nt")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("IFW")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("tVSc")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("Kb")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("39Y")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("IEss")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("R0")]]=madebybobo_IlIlIllllIIl[madebybobo_lIlIlllllIlIllllIIIIllllI[#("ckn")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("h8")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("bAf")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("oufD")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("3d")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("YCv")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("uBJo")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("e1")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("qQM")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("amEi")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("at")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("PaQ")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("5DRI")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("k0")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("tZJ")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("Amgv")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("DJ")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("lLR")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("ToAd")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_lIlIlllllIlIllllIIIIllllI[#("9nV")];else madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("gz")]]=madebybobo_IlIlIllllIIl[madebybobo_lIlIlllllIlIllllIIIIllllI[#("YZM")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("ad")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("Mhh")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("l3Y2")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("RH")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("QzB")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("NT1q")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("Vv")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("AiE")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("jXkr")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];if(madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("uH")]]==madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("hrJ5")]])then madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;else madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_lIlIlllllIlIllllIIIIllllI[#("3vt")];end;end;elseif madebybobo_llIllIIIlIIll<=#("ejSi6M")then madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("pv")]]=madebybobo_IlIlIllllIIl[madebybobo_lIlIlllllIlIllllIIIIllllI[#("sAA")]];elseif madebybobo_llIllIIIlIIll>#("5hVUDLZ")then local madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_lIlIlllllIlIllllIIIIllllI[#("ns")]madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI](madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI+1])else madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("q7")]]=madebybobo_IlIlIllllIIl[madebybobo_lIlIlllllIlIllllIIIIllllI[#("MN8")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("eZ")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("Tyb")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("fXUH")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("bC")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("RFI")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("boTs")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("4h")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("elY")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("fbGT")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];if(madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("BK")]]==madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("hyL3")]])then madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;else madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_lIlIlllllIlIllllIIIIllllI[#("2RS")];end;end;elseif madebybobo_llIllIIIlIIll<=#("5JcDlj2X3IHV")then if madebybobo_llIllIIIlIIll<=#("XK9zhecRJx")then if madebybobo_llIllIIIlIIll==#("PbYfm5axJ")then if not madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("lh")]]then madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;else madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_lIlIlllllIlIllllIIIIllllI[#("zpl")];end;else if(madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("zm")]]==madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("mLB7")]])then madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;else madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_lIlIlllllIlIllllIIIIllllI[#("gZY")];end;end;elseif madebybobo_llIllIIIlIIll>#("TY2A2QlxZKA")then madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("hs")]]();madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("6Q")]]=madebybobo_IlIlIllllIIl[madebybobo_lIlIlllllIlIllllIIIIllllI[#("32H")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("K5")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("zzY")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("NbYo")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("3p")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("iSp")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("BQFM")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("F0")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("xZM")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("zir2")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("v6")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("KcX")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("z9I7")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("uQ")]]=madebybobo_IlIlIllllIIl[madebybobo_lIlIlllllIlIllllIIIIllllI[#("HVa")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("x1")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("RFX")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("hrCa")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("M3")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("B5t")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("TRPB")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("Kd")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("JyR")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("ExX4")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("DZ")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("7jc")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("9AFq")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#{"Retard gonna sey they are gonna deobfuscate this";"1 + 1 = 111";}]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("y0A")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("AH3t")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("yi")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("CAI")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("9gTQ")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_lIlIlllllIlIllllIIIIllllI[#("NqE")];else local madebybobo_llIllIIIlIIll;local madebybobo_IlIllIllIIllIlIllllIl;local madebybobo_lIIllIlI,madebybobo_IIIIlIIlIIIIlI;local madebybobo_lIIlIlIllIIIlllIIIIll;local madebybobo_llIllIIIlIIll;madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("HB")]]=madebybobo_IlIlIllllIIl[madebybobo_lIlIlllllIlIllllIIIIllllI[#("chg")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("9a")]]=madebybobo_IlIlIllllIIl[madebybobo_lIlIlllllIlIllllIIIIllllI[#("15R")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("l6")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("MCH")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#{"Wally is cute";{934519;494709;854765;200555};"spoodercraft says bim bam boom";"spoodercraft says bim bam boom";}]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_llIllIIIlIIll=madebybobo_lIlIlllllIlIllllIIIIllllI[#("9Z")];madebybobo_lIIlIlIllIIIlllIIIIll=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("zvT")]];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_llIllIIIlIIll+1]=madebybobo_lIIlIlIllIIIlllIIIIll;madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_llIllIIIlIIll]=madebybobo_lIIlIlIllIIIlllIIIIll[madebybobo_lIlIlllllIlIllllIIIIllllI[#("vKYp")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_llIllIIIlIIll=madebybobo_lIlIlllllIlIllllIIIIllllI[#("Qd")]madebybobo_lIIllIlI,madebybobo_IIIIlIIlIIIIlI=madebybobo_IlIIlIIIIIlIlIl(madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_llIllIIIlIIll](madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_llIllIIIlIIll+1]))madebybobo_lllIIlIlllIIIIIlIlllIII=madebybobo_IIIIlIIlIIIIlI+madebybobo_llIllIIIlIIll-1 madebybobo_IlIllIllIIllIlIllllIl=0;for madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_llIllIIIlIIll,madebybobo_lllIIlIlllIIIIIlIlllIII do madebybobo_IlIllIllIIllIlIllllIl=madebybobo_IlIllIllIIllIlIllllIl+1;madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI]=madebybobo_lIIllIlI[madebybobo_IlIllIllIIllIlIllllIl];end;madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_llIllIIIlIIll=madebybobo_lIlIlllllIlIllllIIIIllllI[#("CU")]madebybobo_lIIllIlI={madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_llIllIIIlIIll](madebybobo_lIIIlIIl(madebybobo_lIIllIlIIIIlIIllIIIIlllI,madebybobo_llIllIIIlIIll+1,madebybobo_lllIIlIlllIIIIIlIlllIII))};madebybobo_IlIllIllIIllIlIllllIl=0;for madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_llIllIIIlIIll,madebybobo_lIlIlllllIlIllllIIIIllllI[#("Uaex")]do madebybobo_IlIllIllIIllIlIllllIl=madebybobo_IlIllIllIIllIlIllllIl+1;madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI]=madebybobo_lIIllIlI[madebybobo_IlIllIllIIllIlIllllIl];end madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_lIlIlllllIlIllllIIIIllllI[#("hX7")];end;elseif madebybobo_llIllIIIlIIll<=#("ZhIWvuGXpvm3Yk")then if madebybobo_llIllIIIlIIll>#("XL7HjlWeVg8pz")then madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("qt")]]();madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("Z9")]]=madebybobo_IlIlIllllIIl[madebybobo_lIlIlllllIlIllllIIIIllllI[#("aht")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("pB")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("v0k")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("bvxF")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("j2")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("6nT")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("8Frf")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("X8")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("Co1")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("Lyhh")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("eY")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("rJ7")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("M79t")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("Iy")]]=madebybobo_IlIlIllllIIl[madebybobo_lIlIlllllIlIllllIIIIllllI[#("Cjd")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("vA")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("smW")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("B4uA")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("nK")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("QKC")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("AMp6")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("cW")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("tde")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("zDGz")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("Kj")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("YAW")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("OUnC")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("lg")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("VA6")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("SVxx")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("yR")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("SxW")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("7DQo")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_lIlIlllllIlIllllIIIIllllI[#("ErQ")];else local madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_lIlIlllllIlIllllIIIIllllI[#("PT")]madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_llIllIIlIIlIIllIlIllIIIII](madebybobo_lIIIlIIl(madebybobo_lIIllIlIIIIlIIllIIIIlllI,madebybobo_llIllIIlIIlIIllIlIllIIIII+1,madebybobo_lIlIlllllIlIllllIIIIllllI[#("Z57")]))end;elseif madebybobo_llIllIIIlIIll<=#("uUWSXlQIAKP0VSx")then local madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_lIlIlllllIlIllllIIIIllllI[#("Cc")]local madebybobo_IIIllIIIlIIIIIIl,madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IlIIlIIIIIlIlIl(madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_llIllIIlIIlIIllIlIllIIIII](madebybobo_lIIIlIIl(madebybobo_lIIllIlIIIIlIIllIIIIlllI,madebybobo_llIllIIlIIlIIllIlIllIIIII+1,madebybobo_lIlIlllllIlIllllIIIIllllI[#("exy")])))madebybobo_lllIIlIlllIIIIIlIlllIII=madebybobo_lIlIlllllIlIllllIIIIllllI+madebybobo_llIllIIlIIlIIllIlIllIIIII-1 local madebybobo_lIlIlllllIlIllllIIIIllllI=0;for madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII,madebybobo_lllIIlIlllIIIIIlIlllIII do madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_lIlIlllllIlIllllIIIIllllI+1;madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_llIllIIlIIlIIllIlIllIIIII]=madebybobo_IIIllIIIlIIIIIIl[madebybobo_lIlIlllllIlIllllIIIIllllI];end;elseif madebybobo_llIllIIIlIIll==#("8MRuyV1dqPddWPxf")then local madebybobo_IIIllIIIlIIIIIIl=madebybobo_lIlIlllllIlIllllIIIIllllI[#("bm")];local madebybobo_IlIlIllllIIl=madebybobo_lIlIlllllIlIllllIIIIllllI[#("WaUv")];local madebybobo_llIllIIIlIIll=madebybobo_IIIllIIIlIIIIIIl+2 local madebybobo_IIIllIIIlIIIIIIl={madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_IIIllIIIlIIIIIIl](madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_IIIllIIIlIIIIIIl+1],madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_llIllIIIlIIll])};for madebybobo_lIlIlllllIlIllllIIIIllllI=1,madebybobo_IlIlIllllIIl do madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_llIllIIIlIIll+madebybobo_lIlIlllllIlIllllIIIIllllI]=madebybobo_IIIllIIIlIIIIIIl[madebybobo_lIlIlllllIlIllllIIIIllllI];end;local madebybobo_IIIllIIIlIIIIIIl=madebybobo_IIIllIIIlIIIIIIl[1]if madebybobo_IIIllIIIlIIIIIIl then madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_llIllIIIlIIll]=madebybobo_IIIllIIIlIIIIIIl madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_lIlIlllllIlIllllIIIIllllI[#("deL")];else madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;end;else madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("yM")]]=madebybobo_lIlIlllllIlIllllIIIIllllI[#("V31")];end;elseif madebybobo_llIllIIIlIIll<=#("65MBla8Opky1sAdRkhxIdDJ3SC")then if madebybobo_llIllIIIlIIll<=#("iMVVnKTZXVkXLSQiLEl7o")then if madebybobo_llIllIIIlIIll<=#("xMHaHdEvTST20bEAkrK")then if madebybobo_llIllIIIlIIll==#("q6auV0yt7AHF3ipjnn")then local madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_lIlIlllllIlIllllIIIIllllI[#("q4")]local madebybobo_llIllIIIlIIll={madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_llIllIIlIIlIIllIlIllIIIII](madebybobo_lIIIlIIl(madebybobo_lIIllIlIIIIlIIllIIIIlllI,madebybobo_llIllIIlIIlIIllIlIllIIIII+1,madebybobo_lllIIlIlllIIIIIlIlllIII))};local madebybobo_IIIllIIIlIIIIIIl=0;for madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_llIllIIlIIlIIllIlIllIIIII,madebybobo_lIlIlllllIlIllllIIIIllllI[#("hb7D")]do madebybobo_IIIllIIIlIIIIIIl=madebybobo_IIIllIIIlIIIIIIl+1;madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI]=madebybobo_llIllIIIlIIll[madebybobo_IIIllIIIlIIIIIIl];end else if(madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("L4")]]~=madebybobo_lIlIlllllIlIllllIIIIllllI[#("vou8")])then madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;else madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_lIlIlllllIlIllllIIIIllllI[#("k6O")];end;end;elseif madebybobo_llIllIIIlIIll>#("PuBbDdT1OOls3xOTAMmo")then madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("ZL")]]={};else local madebybobo_llIllIIIlIIll;local madebybobo_IlIllIllIIllIlIllllIl;local madebybobo_lIIlIlIllIIIlllIIIIll,madebybobo_IIIIlIIlIIIIlI;local madebybobo_lIIllIlI;local madebybobo_llIllIIIlIIll;madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("Nm")]]=madebybobo_IlIlIllllIIl[madebybobo_lIlIlllllIlIllllIIIIllllI[#("X6q")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_llIllIIIlIIll=madebybobo_lIlIlllllIlIllllIIIIllllI[#("PJ")];madebybobo_lIIllIlI=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("mPn")]];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_llIllIIIlIIll+1]=madebybobo_lIIllIlI;madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_llIllIIIlIIll]=madebybobo_lIIllIlI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("h1Tq")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("sM")]]=madebybobo_lIlIlllllIlIllllIIIIllllI[#("BNL")];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_llIllIIIlIIll=madebybobo_lIlIlllllIlIllllIIIIllllI[#("9R")]madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_llIllIIIlIIll]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_llIllIIIlIIll](madebybobo_lIIIlIIl(madebybobo_lIIllIlIIIIlIIllIIIIlllI,madebybobo_llIllIIIlIIll+1,madebybobo_lIlIlllllIlIllllIIIIllllI[#("33a")]))madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("Y2")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("fn0")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("2TIm")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("p4")]]=madebybobo_IlIlIllllIIl[madebybobo_lIlIlllllIlIllllIIIIllllI[#("bN7")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("3m")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("YKN")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("PH7F")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("yO")]]=madebybobo_lIlIlllllIlIllllIIIIllllI[#("Gy8")];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_llIllIIIlIIll=madebybobo_lIlIlllllIlIllllIIIIllllI[#("Hs")]madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_llIllIIIlIIll]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_llIllIIIlIIll](madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_llIllIIIlIIll+1])madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("cK")]]=madebybobo_IlIlIllllIIl[madebybobo_lIlIlllllIlIllllIIIIllllI[#("NYV")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("3J")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("O5O")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("66ap")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("bb")]]=madebybobo_lIlIlllllIlIllllIIIIllllI[#("jCS")];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("6W")]]=madebybobo_lIlIlllllIlIllllIIIIllllI[#("DlD")];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("uS")]]=madebybobo_lIlIlllllIlIllllIIIIllllI[#("2Cs")];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("8z")]]=madebybobo_lIlIlllllIlIllllIIIIllllI[#("gn1")];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_llIllIIIlIIll=madebybobo_lIlIlllllIlIllllIIIIllllI[#("hD")]madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_llIllIIIlIIll]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_llIllIIIlIIll](madebybobo_lIIIlIIl(madebybobo_lIIllIlIIIIlIIllIIIIlllI,madebybobo_llIllIIIlIIll+1,madebybobo_lIlIlllllIlIllllIIIIllllI[#("9Ko")]))madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("Sv")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("byA")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("yTk3")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("I5")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("PdW")]]=madebybobo_lIlIlllllIlIllllIIIIllllI[#("NXVN")];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("bp")]]=madebybobo_IlIlIllllIIl[madebybobo_lIlIlllllIlIllllIIIIllllI[#("hhU")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("Ei")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("JBq")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("DAyQ")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("Ep")]]=madebybobo_lIlIlllllIlIllllIIIIllllI[#("5Gn")];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_llIllIIIlIIll=madebybobo_lIlIlllllIlIllllIIIIllllI[#("Rf")]madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_llIllIIIlIIll]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_llIllIIIlIIll](madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_llIllIIIlIIll+1])madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("bX")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("hU6")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("gTz2")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("ht")]]=madebybobo_IlIlIllllIIl[madebybobo_lIlIlllllIlIllllIIIIllllI[#("eaC")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("3J")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("7M3")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("cDIc")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("Xz")]]=madebybobo_lIlIlllllIlIllllIIIIllllI[#("Rby")];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("pz")]]=madebybobo_lIlIlllllIlIllllIIIIllllI[#("cPW")];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("mu")]]=madebybobo_lIlIlllllIlIllllIIIIllllI[#("AxU")];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("lv")]]=madebybobo_lIlIlllllIlIllllIIIIllllI[#("Sjz")];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_llIllIIIlIIll=madebybobo_lIlIlllllIlIllllIIIIllllI[#("Ra")]madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_llIllIIIlIIll]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_llIllIIIlIIll](madebybobo_lIIIlIIl(madebybobo_lIIllIlIIIIlIIllIIIIlllI,madebybobo_llIllIIIlIIll+1,madebybobo_lIlIlllllIlIllllIIIIllllI[#("6sn")]))madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("8D")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("vMG")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("KdCz")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("n1")]]=madebybobo_IlIlIllllIIl[madebybobo_lIlIlllllIlIllllIIIIllllI[#("Bx8")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("Jq")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("Mvi")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("AofO")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("Wg")]]=madebybobo_lIlIlllllIlIllllIIIIllllI[#("oPD")];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("lK")]]=madebybobo_lIlIlllllIlIllllIIIIllllI[#("cGH")];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("1O")]]=madebybobo_lIlIlllllIlIllllIIIIllllI[#("UZm")];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_llIllIIIlIIll=madebybobo_lIlIlllllIlIllllIIIIllllI[#("4n")]madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_llIllIIIlIIll]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_llIllIIIlIIll](madebybobo_lIIIlIIl(madebybobo_lIIllIlIIIIlIIllIIIIlllI,madebybobo_llIllIIIlIIll+1,madebybobo_lIlIlllllIlIllllIIIIllllI[#("amu")]))madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("sn")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("MWE")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("zQZI")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("Aq")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("zAT")]]=madebybobo_lIlIlllllIlIllllIIIIllllI[#("e84A")];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("WG")]]=madebybobo_IlIlIllllIIl[madebybobo_lIlIlllllIlIllllIIIIllllI[#("Ggt")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_llIllIIIlIIll=madebybobo_lIlIlllllIlIllllIIIIllllI[#("Fu")];madebybobo_lIIllIlI=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("QhX")]];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_llIllIIIlIIll+1]=madebybobo_lIIllIlI;madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_llIllIIIlIIll]=madebybobo_lIIllIlI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("ojqT")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_llIllIIIlIIll=madebybobo_lIlIlllllIlIllllIIIIllllI[#("ej")]madebybobo_lIIlIlIllIIIlllIIIIll,madebybobo_IIIIlIIlIIIIlI=madebybobo_IlIIlIIIIIlIlIl(madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_llIllIIIlIIll](madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_llIllIIIlIIll+1]))madebybobo_lllIIlIlllIIIIIlIlllIII=madebybobo_IIIIlIIlIIIIlI+madebybobo_llIllIIIlIIll-1 madebybobo_IlIllIllIIllIlIllllIl=0;for madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_llIllIIIlIIll,madebybobo_lllIIlIlllIIIIIlIlllIII do madebybobo_IlIllIllIIllIlIllllIl=madebybobo_IlIllIllIIllIlIllllIl+1;madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI]=madebybobo_lIIlIlIllIIIlllIIIIll[madebybobo_IlIllIllIIllIlIllllIl];end;madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_llIllIIIlIIll=madebybobo_lIlIlllllIlIllllIIIIllllI[#("FQ")]madebybobo_lIIlIlIllIIIlllIIIIll={madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_llIllIIIlIIll](madebybobo_lIIIlIIl(madebybobo_lIIllIlIIIIlIIllIIIIlllI,madebybobo_llIllIIIlIIll+1,madebybobo_lllIIlIlllIIIIIlIlllIII))};madebybobo_IlIllIllIIllIlIllllIl=0;for madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_llIllIIIlIIll,madebybobo_lIlIlllllIlIllllIIIIllllI[#("mHhA")]do madebybobo_IlIllIllIIllIlIllllIl=madebybobo_IlIllIllIIllIlIllllIl+1;madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI]=madebybobo_lIIlIlIllIIIlllIIIIll[madebybobo_IlIllIllIIllIlIllllIl];end madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_lIlIlllllIlIllllIIIIllllI[#("ooG")];end;elseif madebybobo_llIllIIIlIIll<=#("Qkysko8SWul7p5q04Hqc8TP")then if madebybobo_llIllIIIlIIll>#("gNhpA0Ib8v8kcTrYUj2tav")then local madebybobo_llIllIIIlIIll=madebybobo_lIlIlllllIlIllllIIIIllllI[#("bn")];local madebybobo_IlIlIllllIIl=madebybobo_lIlIlllllIlIllllIIIIllllI[#("4lid")];local madebybobo_IIIllIIIlIIIIIIl=madebybobo_llIllIIIlIIll+2 local madebybobo_llIllIIIlIIll={madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_llIllIIIlIIll](madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_llIllIIIlIIll+1],madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_IIIllIIIlIIIIIIl])};for madebybobo_lIlIlllllIlIllllIIIIllllI=1,madebybobo_IlIlIllllIIl do madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_IIIllIIIlIIIIIIl+madebybobo_lIlIlllllIlIllllIIIIllllI]=madebybobo_llIllIIIlIIll[madebybobo_lIlIlllllIlIllllIIIIllllI];end;local madebybobo_llIllIIIlIIll=madebybobo_llIllIIIlIIll[1]if madebybobo_llIllIIIlIIll then madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_IIIllIIIlIIIIIIl]=madebybobo_llIllIIIlIIll madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_lIlIlllllIlIllllIIIIllllI[#("Q0N")];else madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;end;else local madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_lIlIlllllIlIllllIIIIllllI[#("5E")]local madebybobo_IIIllIIIlIIIIIIl,madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IlIIlIIIIIlIlIl(madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_llIllIIlIIlIIllIlIllIIIII](madebybobo_lIIIlIIl(madebybobo_lIIllIlIIIIlIIllIIIIlllI,madebybobo_llIllIIlIIlIIllIlIllIIIII+1,madebybobo_lIlIlllllIlIllllIIIIllllI[#("W8T")])))madebybobo_lllIIlIlllIIIIIlIlllIII=madebybobo_lIlIlllllIlIllllIIIIllllI+madebybobo_llIllIIlIIlIIllIlIllIIIII-1 local madebybobo_lIlIlllllIlIllllIIIIllllI=0;for madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII,madebybobo_lllIIlIlllIIIIIlIlllIII do madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_lIlIlllllIlIllllIIIIllllI+1;madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_llIllIIlIIlIIllIlIllIIIII]=madebybobo_IIIllIIIlIIIIIIl[madebybobo_lIlIlllllIlIllllIIIIllllI];end;end;elseif madebybobo_llIllIIIlIIll<=#("Cx3Fe5lT7FMmIhSs5Wj846fX")then local madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_lIlIlllllIlIllllIIIIllllI[#("kb")]madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI]()elseif madebybobo_llIllIIIlIIll>#("pDrY0uWV9P2HvEgXMbPAGURc0")then if madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("mt")]]then madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;else madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_lIlIlllllIlIllllIIIIllllI[#("AVq")];end;else local madebybobo_llIllIIIlIIll;madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("qW")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("bdc")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("JuxV")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("5P")]]=madebybobo_IlIlIllllIIl[madebybobo_lIlIlllllIlIllllIIIIllllI[#("2Eg")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("4Y")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("6yc")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("ouTy")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("HX")]]=madebybobo_IlIlIllllIIl[madebybobo_lIlIlllllIlIllllIIIIllllI[#("l1J")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("Kq")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("bhF")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("A41i")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("3g")]]=madebybobo_IlIlIllllIIl[madebybobo_lIlIlllllIlIllllIIIIllllI[#("Rro")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("kx")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("jd2")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("eJhm")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("P2")]]=madebybobo_IlIlIllllIIl[madebybobo_lIlIlllllIlIllllIIIIllllI[#("RmP")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("Tx")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("ZeO")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("BXTB")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_llIllIIIlIIll=madebybobo_lIlIlllllIlIllllIIIIllllI[#("Co")]madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_llIllIIIlIIll]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_llIllIIIlIIll](madebybobo_lIIIlIIl(madebybobo_lIIllIlIIIIlIIllIIIIlllI,madebybobo_llIllIIIlIIll+1,madebybobo_lIlIlllllIlIllllIIIIllllI[#("e7l")]))madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("kJ")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("iRg")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("2gQx")]];end;elseif madebybobo_llIllIIIlIIll<=#("H0yUGrfsYC34gj0CJDZWKsdkr4BxPGW")then if madebybobo_llIllIIIlIIll<=#("73X5xoiLBcPO3S5FKelnmexoWmDM")then if madebybobo_llIllIIIlIIll>#("TNsQO6mv4ettouINzrJ85WLuId3")then local madebybobo_llIllIIIlIIll;local madebybobo_IlIllIllIIllIlIllllIl;local madebybobo_lIIllIlI,madebybobo_IIIIlIIlIIIIlI;local madebybobo_lIIlIlIllIIIlllIIIIll;local madebybobo_llIllIIIlIIll;madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("bn")]]=madebybobo_IlIlIllllIIl[madebybobo_lIlIlllllIlIllllIIIIllllI[#("YQo")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("aj")]]=madebybobo_IlIlIllllIIl[madebybobo_lIlIlllllIlIllllIIIIllllI[#("zfE")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("ML")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("qGI")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("mIWz")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("gF")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("ZqQ")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("UMie")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_llIllIIIlIIll=madebybobo_lIlIlllllIlIllllIIIIllllI[#("vu")];madebybobo_lIIlIlIllIIIlllIIIIll=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("LQh")]];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_llIllIIIlIIll+1]=madebybobo_lIIlIlIllIIIlllIIIIll;madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_llIllIIIlIIll]=madebybobo_lIIlIlIllIIIlllIIIIll[madebybobo_lIlIlllllIlIllllIIIIllllI[#("4A3u")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_llIllIIIlIIll=madebybobo_lIlIlllllIlIllllIIIIllllI[#("Gr")]madebybobo_lIIllIlI,madebybobo_IIIIlIIlIIIIlI=madebybobo_IlIIlIIIIIlIlIl(madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_llIllIIIlIIll](madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_llIllIIIlIIll+1]))madebybobo_lllIIlIlllIIIIIlIlllIII=madebybobo_IIIIlIIlIIIIlI+madebybobo_llIllIIIlIIll-1 madebybobo_IlIllIllIIllIlIllllIl=0;for madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_llIllIIIlIIll,madebybobo_lllIIlIlllIIIIIlIlllIII do madebybobo_IlIllIllIIllIlIllllIl=madebybobo_IlIllIllIIllIlIllllIl+1;madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI]=madebybobo_lIIllIlI[madebybobo_IlIllIllIIllIlIllllIl];end;madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_llIllIIIlIIll=madebybobo_lIlIlllllIlIllllIIIIllllI[#("uc")]madebybobo_lIIllIlI={madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_llIllIIIlIIll](madebybobo_lIIIlIIl(madebybobo_lIIllIlIIIIlIIllIIIIlllI,madebybobo_llIllIIIlIIll+1,madebybobo_lllIIlIlllIIIIIlIlllIII))};madebybobo_IlIllIllIIllIlIllllIl=0;for madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_llIllIIIlIIll,madebybobo_lIlIlllllIlIllllIIIIllllI[#("sQ9P")]do madebybobo_IlIllIllIIllIlIllllIl=madebybobo_IlIllIllIIllIlIllllIl+1;madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI]=madebybobo_lIIllIlI[madebybobo_IlIllIllIIllIlIllllIl];end madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_lIlIlllllIlIllllIIIIllllI[#("Ssg")];else if(madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("UM")]]==madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("ve6D")]])then madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;else madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_lIlIlllllIlIllllIIIIllllI[#("n6I")];end;end;elseif madebybobo_llIllIIIlIIll<=#("JikWHUSzx7pWTjQ9147TZMy43N56c")then local madebybobo_llIllIIIlIIll;local madebybobo_IlIllIllIIllIlIllllIl;local madebybobo_lIIllIlI,madebybobo_IIIIlIIlIIIIlI;local madebybobo_lIIlIlIllIIIlllIIIIll;local madebybobo_llIllIIIlIIll;madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("Wl")]]=madebybobo_IlIlIllllIIl[madebybobo_lIlIlllllIlIllllIIIIllllI[#("6UN")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("FC")]]=madebybobo_IlIlIllllIIl[madebybobo_lIlIlllllIlIllllIIIIllllI[#("k67")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("vx")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("Y8b")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("WM5g")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_llIllIIIlIIll=madebybobo_lIlIlllllIlIllllIIIIllllI[#("KJ")];madebybobo_lIIlIlIllIIIlllIIIIll=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("SyD")]];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_llIllIIIlIIll+1]=madebybobo_lIIlIlIllIIIlllIIIIll;madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_llIllIIIlIIll]=madebybobo_lIIlIlIllIIIlllIIIIll[madebybobo_lIlIlllllIlIllllIIIIllllI[#("iPv9")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_llIllIIIlIIll=madebybobo_lIlIlllllIlIllllIIIIllllI[#("n2")]madebybobo_lIIllIlI,madebybobo_IIIIlIIlIIIIlI=madebybobo_IlIIlIIIIIlIlIl(madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_llIllIIIlIIll](madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_llIllIIIlIIll+1]))madebybobo_lllIIlIlllIIIIIlIlllIII=madebybobo_IIIIlIIlIIIIlI+madebybobo_llIllIIIlIIll-1 madebybobo_IlIllIllIIllIlIllllIl=0;for madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_llIllIIIlIIll,madebybobo_lllIIlIlllIIIIIlIlllIII do madebybobo_IlIllIllIIllIlIllllIl=madebybobo_IlIllIllIIllIlIllllIl+1;madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI]=madebybobo_lIIllIlI[madebybobo_IlIllIllIIllIlIllllIl];end;madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_llIllIIIlIIll=madebybobo_lIlIlllllIlIllllIIIIllllI[#("5J")]madebybobo_lIIllIlI={madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_llIllIIIlIIll](madebybobo_lIIIlIIl(madebybobo_lIIllIlIIIIlIIllIIIIlllI,madebybobo_llIllIIIlIIll+1,madebybobo_lllIIlIlllIIIIIlIlllIII))};madebybobo_IlIllIllIIllIlIllllIl=0;for madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_llIllIIIlIIll,madebybobo_lIlIlllllIlIllllIIIIllllI[#("2hC7")]do madebybobo_IlIllIllIIllIlIllllIl=madebybobo_IlIllIllIIllIlIllllIl+1;madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI]=madebybobo_lIIllIlI[madebybobo_IlIllIllIIllIlIllllIl];end madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_lIlIlllllIlIllllIIIIllllI[#("H4Y")];elseif madebybobo_llIllIIIlIIll==#("iLcQXV3HXENipBcXpWgLDNfjR7Vp34")then madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("fI")]]();madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("Jx")]]=madebybobo_IlIlIllllIIl[madebybobo_lIlIlllllIlIllllIIIIllllI[#("qxj")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("H6")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("KxK")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("DAcM")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("tZ")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("KhR")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("a4y3")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("oq")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("IAv")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("lgak")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("On")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("2IJ")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("iMtR")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("mg")]]=madebybobo_IlIlIllllIIl[madebybobo_lIlIlllllIlIllllIIIIllllI[#("tna")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("sV")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("PGb")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("hQbK")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("mW")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("ZWK")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("od3j")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("ir")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("iUY")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("kobO")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("7A")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("LlA")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("6btV")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("kP")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("xC3")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("2ncV")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("Gn")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("qJd")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("bOl8")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_lIlIlllllIlIllllIIIIllllI[#("c6C")];else local madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_lIlIlllllIlIllllIIIIllllI[#("p7")]local madebybobo_IIIllIIIlIIIIIIl,madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_IlIIlIIIIIlIlIl(madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI](madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI+1]))madebybobo_lllIIlIlllIIIIIlIlllIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+madebybobo_lIlIlllllIlIllllIIIIllllI-1 local madebybobo_llIllIIlIIlIIllIlIllIIIII=0;for madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_lIlIlllllIlIllllIIIIllllI,madebybobo_lllIIlIlllIIIIIlIlllIII do madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI]=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];end;end;elseif madebybobo_llIllIIIlIIll<=#("WxAZOTdv4guhEgRv62fxjZBFFF38Z9OO2")then if madebybobo_llIllIIIlIIll>#("1W0MyemAlFiGLdaLZyXHP654ti0eG5CQ")then madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("Nb")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("v5E")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("pYVI")]];else madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("Ru")]]();madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("CK")]]=madebybobo_IlIlIllllIIl[madebybobo_lIlIlllllIlIllllIIIIllllI[#("xGW")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("9S")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("voQ")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("WyDj")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("OX")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("Hyt")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("6aom")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("pv")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("LW6")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("7exA")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("pz")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("iVF")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("grI9")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("Hx")]]=madebybobo_IlIlIllllIIl[madebybobo_lIlIlllllIlIllllIIIIllllI[#("tsx")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("ce")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("DTs")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("3Oqs")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("Hi")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("uM7")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("L24g")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("i7")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("qVm")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("xDEV")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("NQ")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("zvC")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("IJkt")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("KG")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("Vfk")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("19ZK")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("DR")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("ppR")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("6rV2")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_lIlIlllllIlIllllIIIIllllI[#("aUZ")];end;elseif madebybobo_llIllIIIlIIll<=#("Yo4GtEbjTO6x93Z7nkp1u9505sonh3qcCr")then madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("U8")]]=(madebybobo_lIlIlllllIlIllllIIIIllllI[#("BMT")]~=0);elseif madebybobo_llIllIIIlIIll>#("YffG3Vy6s9IuoahrVlZ3ZteKapYcZx34Rga")then madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("bH")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("jRL")]]=madebybobo_lIlIlllllIlIllllIIIIllllI[#("8pWb")];else if madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("rp")]]then madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;else madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_lIlIlllllIlIllllIIIIllllI[#("6XD")];end;end;elseif madebybobo_llIllIIIlIIll<=#("iPxf7dM1y89naMG0My8FbGFO7ug5fNNi9pjfZT5VRmlcpKbn1cstiG0")then if madebybobo_llIllIIIlIIll<=#("jTiN6RVVu1oVCAb2DmXYuCzxt3edut9DAI6gLsYaCBRyv")then if madebybobo_llIllIIIlIIll<=#("VCbA05TbrRtVsdNSBb2Vv4E5rjyXx3VabdhNc4Dd")then if madebybobo_llIllIIIlIIll<=#("yqoW09UyUaPGK417fiRI5Oy6tTp69QGIYa7Noi")then if madebybobo_llIllIIIlIIll>#("jOzN3fFBipP6WWGYU2rDgUYydEgRK7nT6RH3G")then madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("o9")]]={};else madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("1f")]]();end;elseif madebybobo_llIllIIIlIIll>#("E0YrgRuUTWrlnU6QuAZbJz8X1lb59foMrSzCOYN")then local madebybobo_IlIlIllllIIl;local madebybobo_llIllIIIlIIll;madebybobo_llIllIIIlIIll=madebybobo_lIlIlllllIlIllllIIIIllllI[#("iO")]madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_llIllIIIlIIll]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_llIllIIIlIIll](madebybobo_lIIIlIIl(madebybobo_lIIllIlIIIIlIIllIIIIlllI,madebybobo_llIllIIIlIIll+1,madebybobo_lIlIlllllIlIllllIIIIllllI[#("AgI")]))madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_llIllIIIlIIll=madebybobo_lIlIlllllIlIllllIIIIllllI[#("R4")];madebybobo_IlIlIllllIIl=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("J1s")]];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_llIllIIIlIIll+1]=madebybobo_IlIlIllllIIl;madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_llIllIIIlIIll]=madebybobo_IlIlIllllIIl[madebybobo_lIlIlllllIlIllllIIIIllllI[#("ihjS")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("O0")]]={};madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("sa")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("sxg")]]=madebybobo_lIlIlllllIlIllllIIIIllllI[#("efhX")];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_llIllIIIlIIll=madebybobo_lIlIlllllIlIllllIIIIllllI[#{{236762;893563;295006;58363};"Arilis ate a panda once kiriot is sad and aztup too";}]madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_llIllIIIlIIll]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_llIllIIIlIIll](madebybobo_lIIIlIIl(madebybobo_lIIllIlIIIIlIIllIIIIlllI,madebybobo_llIllIIIlIIll+1,madebybobo_lIlIlllllIlIllllIIIIllllI[#("iE0")]))madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_llIllIIIlIIll=madebybobo_lIlIlllllIlIllllIIIIllllI[#("hX")];madebybobo_IlIlIllllIIl=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("bc2")]];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_llIllIIIlIIll+1]=madebybobo_IlIlIllllIIl;madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_llIllIIIlIIll]=madebybobo_IlIlIllllIIl[madebybobo_lIlIlllllIlIllllIIIIllllI[#("FLLC")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("6X")]]={};madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("Qb")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("XxW")]]=madebybobo_lIlIlllllIlIllllIIIIllllI[#("Igoo")];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_llIllIIIlIIll=madebybobo_lIlIlllllIlIllllIIIIllllI[#("Uo")]madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_llIllIIIlIIll]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_llIllIIIlIIll](madebybobo_lIIIlIIl(madebybobo_lIIllIlIIIIlIIllIIIIlllI,madebybobo_llIllIIIlIIll+1,madebybobo_lIlIlllllIlIllllIIIIllllI[#("cj5")]))madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_llIllIIIlIIll=madebybobo_lIlIlllllIlIllllIIIIllllI[#("i3")];madebybobo_IlIlIllllIIl=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("UZl")]];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_llIllIIIlIIll+1]=madebybobo_IlIlIllllIIl;madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_llIllIIIlIIll]=madebybobo_IlIlIllllIIl[madebybobo_lIlIlllllIlIllllIIIIllllI[#("4YQ8")]];else madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("KV")]]=madebybobo_IIIIlIIlIIIIlI(madebybobo_lIllllllIlIlll[madebybobo_lIlIlllllIlIllllIIIIllllI[#("NpC")]],nil,madebybobo_IlIlIllllIIl);end;elseif madebybobo_llIllIIIlIIll<=#("ctVuzyTEWqvheFCe2bB5PzUNIQ3FvFbGWS8oOOyECI")then if madebybobo_llIllIIIlIIll>#("STgIXptJNyRCOKhWTEohqo0vvHnBnN6Ehpc3Chgob")then madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("fB")]]();madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("lW")]]=madebybobo_IlIlIllllIIl[madebybobo_lIlIlllllIlIllllIIIIllllI[#("R1R")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("rf")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("Ccr")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("tgck")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("7T")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("GF4")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("gRCW")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("Vp")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("0yL")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("BzDD")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("bg")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("52h")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("V1cW")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("24")]]=madebybobo_IlIlIllllIIl[madebybobo_lIlIlllllIlIllllIIIIllllI[#("u3Y")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("qC")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("6Kc")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("uQtv")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("T6")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("liL")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("1bHv")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("HG")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("bRG")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("tBln")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("WT")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("uTi")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("8d7v")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("G6")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("eSh")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("YjZM")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("86")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("op1")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#{"1 + 1 = 111";"Retard gonna sey they are gonna deobfuscate this";{744296;286940;282693;350943};"youtube.com/watch?v=pjJ2w1FX_Wg";}]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_lIlIlllllIlIllllIIIIllllI[#("nqb")];else madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("3P")]]();madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("pT")]]=madebybobo_IlIlIllllIIl[madebybobo_lIlIlllllIlIllllIIIIllllI[#("izY")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("b8")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("drm")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("dW4i")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("th")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("aY2")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("NWRX")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("VR")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("4bO")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("ejgR")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("sY")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("2BK")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("9mp5")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("oD")]]=madebybobo_IlIlIllllIIl[madebybobo_lIlIlllllIlIllllIIIIllllI[#("Tx8")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("hU")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("Vqk")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("R4Re")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("kl")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("TQq")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("l1Ro")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("qo")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("gZU")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("nq8B")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("vc")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("2Rh")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("HHcd")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("m8")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("GrU")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("lxjV")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("La")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("0UN")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("Ochg")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_lIlIlllllIlIllllIIIIllllI[#("LRD")];end;elseif madebybobo_llIllIIIlIIll<=#("ziequPH2OanA2E3Ulqc3u9CntzHntLx9fuZSqfmI4v8")then local madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_lIlIlllllIlIllllIIIIllllI[#("tS")]madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI]()elseif madebybobo_llIllIIIlIIll>#("qSxIaS60miLzQ165hsIdNntIOlDfeE88aF7Mb9nMPHX7")then madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("Qn")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("RZb")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#{{771498;845645;491851;186978};"Kiriot love sex";{443863;756730;202111;480686};{17083;367940;906812;404422};}]];else local madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_lIlIlllllIlIllllIIIIllllI[#("lb")]madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI](madebybobo_lIIIlIIl(madebybobo_lIIllIlIIIIlIIllIIIIlllI,madebybobo_lIlIlllllIlIllllIIIIllllI+1,madebybobo_lllIIlIlllIIIIIlIlllIII))end;elseif madebybobo_llIllIIIlIIll<=#("AbAiqBLX5scyZ4Yo0WSjMzk3u4if6ygBxYnkd7Ydylfm5omfAx")then if madebybobo_llIllIIIlIIll<=#("UeXhb0HYvrG1HlMabQNl38OWBs88fRdPJKvvKQmuGiCV1tI")then if madebybobo_llIllIIIlIIll>#("tolzWl5WBaQS1JSPo1r70pAuErPVH35gV8O1FO2yPK5JaE")then madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("yn")]]=madebybobo_IlIlIllllIIl[madebybobo_lIlIlllllIlIllllIIIIllllI[#("Bmc")]];else madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("oT")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("hGh")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("jfZh")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("kW")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("I7r")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("VfCK")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("hf")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("rcr")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("YkQQ")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("sU")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("tHR")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("Dklb")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("P7")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("NRW")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("tU5B")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("MJ")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("O7f")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("jTLi")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("LS")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("mEn")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("ZBim")]];end;elseif madebybobo_llIllIIIlIIll<=#("7AWGacKkdY15FHkpHfJ7341jL84squ0taYSuUx5ekXLdOTy0")then madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("p5")]]();elseif madebybobo_llIllIIIlIIll>#("tyEBHKdJM5bhr3T7H5QYZFkkEWfsXG2KdY66x3DoOWhB36331")then local madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_lIlIlllllIlIllllIIIIllllI[#("2C")];local madebybobo_IIIllIIIlIIIIIIl=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("Y9l")]];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_llIllIIlIIlIIllIlIllIIIII+1]=madebybobo_IIIllIIIlIIIIIIl;madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_llIllIIlIIlIIllIlIllIIIII]=madebybobo_IIIllIIIlIIIIIIl[madebybobo_lIlIlllllIlIllllIIIIllllI[#("CR4f")]];else local madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_lIlIlllllIlIllllIIIIllllI[#("m9")]local madebybobo_IIIllIIIlIIIIIIl,madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_IlIIlIIIIIlIlIl(madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI](madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI+1]))madebybobo_lllIIlIlllIIIIIlIlllIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+madebybobo_lIlIlllllIlIllllIIIIllllI-1 local madebybobo_llIllIIlIIlIIllIlIllIIIII=0;for madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_lIlIlllllIlIllllIIIIllllI,madebybobo_lllIIlIlllIIIIIlIlllIII do madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI]=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];end;end;elseif madebybobo_llIllIIIlIIll<=#{"1 + 1 = 111";{112392;256290;744051;719521};"Arilis ate a panda once kiriot is sad and aztup too";{648600;723470;775380;569501};"Retard gonna sey they are gonna deobfuscate this";{365356;475831;32468;655636};"Wally is cute";"Kiriot is a panda !";{916077;37905;249042;613901};"Arilis ate a panda once kiriot is sad and aztup too";"spoodercraft says bim bam boom";"Arilis ate a panda once kiriot is sad and aztup too";{362563;324399;72517;824503};"1 + 1 = 111";{675371;543915;581426;777320};"spoodercraft says bim bam boom";{875270;789277;186741;105775};"spoodercraft says bim bam boom";{418605;486944;291063;832749};{502783;276676;835188;704338};"Retard gonna sey they are gonna deobfuscate this";"Retard gonna sey they are gonna deobfuscate this";"spoodercraft says bim bam boom";"spoodercraft says bim bam boom";"1 + 1 = 111";{946893;475316;552963;577644};"Kiriot love sex";"Arilis ate a panda once kiriot is sad and aztup too";"Kiriot is a panda !";"youtube.com/watch?v=pjJ2w1FX_Wg";{177939;712165;551905;151946};"Wally is cute";"spoodercraft says bim bam boom";"Arilis ate a panda once kiriot is sad and aztup too";"Kiriot love sex";{830053;733947;46192;663074};{919232;175724;660819;238586};{720502;744812;580504;832708};"1 + 1 = 111";"1 + 1 = 111";"Arilis ate a panda once kiriot is sad and aztup too";{17898;633053;144885;630333};{582887;777724;829717;894709};"Arilis ate a panda once kiriot is sad and aztup too";{303841;490806;78018;929486};{174269;834972;628149;207490};{5393;143451;166080;487220};{763322;982275;381159;689337};"Kiriot love sex";"spoodercraft says bim bam boom";{820231;501157;730449;733786};"spoodercraft says bim bam boom";}then if madebybobo_llIllIIIlIIll==#("eGEvq1LBEbz1rseS9JctZdHRSRpcxv0PDpxk5SMjIRobI1DM6sy")then madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("73")]]();madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("lg")]]=madebybobo_IlIlIllllIIl[madebybobo_lIlIlllllIlIllllIIIIllllI[#("Pu4")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("Qb")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("jAT")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("f5Jy")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("tD")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("DJ5")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("DxBh")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("lb")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("ArD")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("WmYt")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("na")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("hJh")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("zjzU")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("sJ")]]=madebybobo_IlIlIllllIIl[madebybobo_lIlIlllllIlIllllIIIIllllI[#("Bbh")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("tW")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("Agh")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("bEss")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("u9")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("U9p")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("ycDZ")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("Ts")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("0NG")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("Wpf2")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("A5")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("NRs")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("zkHM")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#{"Kiriot love sex";"Kiriot love sex";}]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("83I")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("WrDF")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("SE")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("bHM")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("MMZt")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_lIlIlllllIlIllllIIIIllllI[#("bej")];else madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("V5")]]=madebybobo_IIIIlIIlIIIIlI(madebybobo_lIllllllIlIlll[madebybobo_lIlIlllllIlIllllIIIIllllI[#("1Co")]],nil,madebybobo_IlIlIllllIIl);end;elseif madebybobo_llIllIIIlIIll<=#("0gha9WNKMJeilUyc53Xr72ViZFi1oOge78YxhvliecI9Nf0XEAQcF")then madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("Gr")]]=madebybobo_lIlIlllllIlIllllIIIIllllI[#("mTK")];elseif madebybobo_llIllIIIlIIll>#("47u9kEOWv7D9lm5b4KRPm5uWFUPuxY8dJ0d0bikSErQKHN3N2CFgv0")then madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("2d")]]();madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("WO")]]=madebybobo_IlIlIllllIIl[madebybobo_lIlIlllllIlIllllIIIIllllI[#("sPi")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("p3")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("sOS")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("rskq")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("SO")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("VEH")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("MMq0")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#{"youtube.com/watch?v=pjJ2w1FX_Wg";{527558;927553;68029;161270};}]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("q4V")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("B3ML")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("F7")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("Dcj")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("Gh62")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("24")]]=madebybobo_IlIlIllllIIl[madebybobo_lIlIlllllIlIllllIIIIllllI[#("Emc")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("ZZ")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("0bB")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("nNW0")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("gG")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("y2V")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("TaYX")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("zH")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("hp5")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("Wnix")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("5X")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("UfX")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("EfYV")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("qC")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("YZj")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("W4Ql")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("46")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("HU8")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("2Q1O")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_lIlIlllllIlIllllIIIIllllI[#("QRl")];else madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("3k")]]();madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("QP")]]=madebybobo_IlIlIllllIIl[madebybobo_lIlIlllllIlIllllIIIIllllI[#("JQJ")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("Vk")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("MDN")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("FP6Z")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("Uq")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("msz")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("PHto")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("XN")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("TNs")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("LYE5")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("Qc")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("9DX")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("nVox")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("oQ")]]=madebybobo_IlIlIllllIIl[madebybobo_lIlIlllllIlIllllIIIIllllI[#("pWe")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("30")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("dGi")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("Bsld")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("VW")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("cET")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("t6Ky")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("Lp")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("RLt")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("dikY")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("lL")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("QZR")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("gqti")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("e8")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("CGk")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("6WJx")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("Hi")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("BpY")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("8BVG")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_lIlIlllllIlIllllIIIIllllI[#("C67")];end;elseif madebybobo_llIllIIIlIIll<=#("9NJEBYszH9zBvje9Wz9k5oUp20cD5t2ST6enDPU4l2jKhmIDXDTRvP8U2sMLVZEn")then if madebybobo_llIllIIIlIIll<=#("RRAe1HhPe8cfkhPsJQCLkvd7tujciixy5CBFiz55LbrR6PSk6smjbN7uOCU")then if madebybobo_llIllIIIlIIll<=#("xeG6MOjSRjjkUH9iexaPM8f06mvsFf1QOAJHGuerGaEXibzFOYqrBf3y8")then if madebybobo_llIllIIIlIIll==#("9zs0mLsEHu7DNTrTjMFsS5Y0PQZKoIGkI0vP9PY2FPFeIllH9S6r3Q7e")then local madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_lIlIlllllIlIllllIIIIllllI[#("8v")]madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_llIllIIlIIlIIllIlIllIIIII]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_llIllIIlIIlIIllIlIllIIIII](madebybobo_lIIIlIIl(madebybobo_lIIllIlIIIIlIIllIIIIlllI,madebybobo_llIllIIlIIlIIllIlIllIIIII+1,madebybobo_lIlIlllllIlIllllIIIIllllI[#("4Y4")]))else do return end;end;elseif madebybobo_llIllIIIlIIll>#("ClGWTo8ZW4XyMUFYMYdAUsEFrKGMnr12qdIErgWAGoVqyjx8BEq24O1iRa")then local madebybobo_lIIllIlI;local madebybobo_IIIIlIIlIIIIlI,madebybobo_lIIlIlIllIIIlllIIIIll;local madebybobo_IlIllIllIIllIlIllllIl;local madebybobo_llIllIIIlIIll;madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("4O")]]=madebybobo_IlIlIllllIIl[madebybobo_lIlIlllllIlIllllIIIIllllI[#("M5c")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("Qh")]]=madebybobo_IlIlIllllIIl[madebybobo_lIlIlllllIlIllllIIIIllllI[#("uHo")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_llIllIIIlIIll=madebybobo_lIlIlllllIlIllllIIIIllllI[#("hL")];madebybobo_IlIllIllIIllIlIllllIl=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("KRm")]];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_llIllIIIlIIll+1]=madebybobo_IlIllIllIIllIlIllllIl;madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_llIllIIIlIIll]=madebybobo_IlIllIllIIllIlIllllIl[madebybobo_lIlIlllllIlIllllIIIIllllI[#("hBFp")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("QQ")]]=madebybobo_lIlIlllllIlIllllIIIIllllI[#("s1u")];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("Ia")]]=(madebybobo_lIlIlllllIlIllllIIIIllllI[#("WF4")]~=0);madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_llIllIIIlIIll=madebybobo_lIlIlllllIlIllllIIIIllllI[#("P5")]madebybobo_IIIIlIIlIIIIlI,madebybobo_lIIlIlIllIIIlllIIIIll=madebybobo_IlIIlIIIIIlIlIl(madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_llIllIIIlIIll](madebybobo_lIIIlIIl(madebybobo_lIIllIlIIIIlIIllIIIIlllI,madebybobo_llIllIIIlIIll+1,madebybobo_lIlIlllllIlIllllIIIIllllI[#("MJn")])))madebybobo_lllIIlIlllIIIIIlIlllIII=madebybobo_lIIlIlIllIIIlllIIIIll+madebybobo_llIllIIIlIIll-1 madebybobo_lIIllIlI=0;for madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_llIllIIIlIIll,madebybobo_lllIIlIlllIIIIIlIlllIII do madebybobo_lIIllIlI=madebybobo_lIIllIlI+1;madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI]=madebybobo_IIIIlIIlIIIIlI[madebybobo_lIIllIlI];end;madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_llIllIIIlIIll=madebybobo_lIlIlllllIlIllllIIIIllllI[#("1j")]madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_llIllIIIlIIll]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_llIllIIIlIIll](madebybobo_lIIIlIIl(madebybobo_lIIllIlIIIIlIIllIIIIlllI,madebybobo_llIllIIIlIIll+1,madebybobo_lllIIlIlllIIIIIlIlllIII))madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_llIllIIIlIIll=madebybobo_lIlIlllllIlIllllIIIIllllI[#("nJ")]madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_llIllIIIlIIll]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_llIllIIIlIIll]()madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_llIllIIIlIIll=madebybobo_lIlIlllllIlIllllIIIIllllI[#("7T")];madebybobo_IlIllIllIIllIlIllllIl=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("SnO")]];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_llIllIIIlIIll+1]=madebybobo_IlIllIllIIllIlIllllIl;madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_llIllIIIlIIll]=madebybobo_IlIllIllIIllIlIllllIl[madebybobo_lIlIlllllIlIllllIIIIllllI[#("lE2g")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("Nj")]]={};else madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("fp")]]=(madebybobo_lIlIlllllIlIllllIIIIllllI[#("HFX")]~=0);end;elseif madebybobo_llIllIIIlIIll<=#("iTvLEd5gIlaGGcO3FHnhimIkUb97MmzWrMNRkOqnDcZWA7U0qUxLE3u6kk1Dd")then if madebybobo_llIllIIIlIIll>#("EvXoo4z7T1p9OgyWUWqjR10XryqQG9WYjFID9lT0BtbGvEooJyAfl4qMG970")then local madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_lIlIlllllIlIllllIIIIllllI[#("V9")]madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI](madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI+1])else if(madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("ff")]]==madebybobo_lIlIlllllIlIllllIIIIllllI[#("T65f")])then madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;else madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_lIlIlllllIlIllllIIIIllllI[#("QHZ")];end;end;elseif madebybobo_llIllIIIlIIll<=#("TBUeC0iI4XJcBSy0uCXjchhJRMoo579o2mS2rC3OfRPL0cVm3WlHjRLLskxZL4")then madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_lIlIlllllIlIllllIIIIllllI[#("WL7")];elseif madebybobo_llIllIIIlIIll>#("6XuknaFJ2IjduDHSP0cvjWCekMgKgedcleSXG2Hlyms99OpiVCR9IIDkvp9M35C")then local madebybobo_IIIllIIIlIIIIIIl=madebybobo_lIlIlllllIlIllllIIIIllllI[#("QD")];local madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("rC4")]];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_IIIllIIIlIIIIIIl+1]=madebybobo_llIllIIlIIlIIllIlIllIIIII;madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_IIIllIIIlIIIIIIl]=madebybobo_llIllIIlIIlIIllIlIllIIIII[madebybobo_lIlIlllllIlIllllIIIIllllI[#("COPE")]];else if(madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("9F")]]==madebybobo_lIlIlllllIlIllllIIIIllllI[#("6BfY")])then madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;else madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_lIlIlllllIlIllllIIIIllllI[#("dQL")];end;end;elseif madebybobo_llIllIIIlIIll<=#("Eg1pUUmXs086EDeHv7YPyeEOMHCp25rDUFF3X9zbo4QSKGR2kDp6gXBzMmOmr64yIFm98")then if madebybobo_llIllIIIlIIll<=#("TxJWADzWeg0KeAQvv7dfqKvlTs9sjesR39T2yty7aZiIxS2FRmjp534jbydhEgNaXj")then if madebybobo_llIllIIIlIIll==#("fQY8bJgfBBYZaAEL64dWaeJ19qpD3mhUmcXY3niQYYESmJcR9FRfUxPah68UtNlos")then madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("TH")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("MXC")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("OUY0")]];else madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("B1")]]();madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("qh")]]=madebybobo_IlIlIllllIIl[madebybobo_lIlIlllllIlIllllIIIIllllI[#("3kk")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("BQ")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("Spy")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("3kdi")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("LS")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#{{53389;644194;771668;863780};"1 + 1 = 111";"Wally is cute";}]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("MO4p")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("GF")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("3tC")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("Myno")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("FL")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("bKy")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("a0Ec")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("6W")]]=madebybobo_IlIlIllllIIl[madebybobo_lIlIlllllIlIllllIIIIllllI[#("I9D")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("hK")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("ODT")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("uVq7")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("nk")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("NdE")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("RuRZ")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("pn")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("dy9")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("CPcv")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("Un")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("vXd")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("I2Wd")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("Qm")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("m0c")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("YTAo")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("QY")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("pZ0")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("Jn17")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_lIlIlllllIlIllllIIIIllllI[#("nZJ")];end;elseif madebybobo_llIllIIIlIIll<=#("M8NQSSWy7mL0OBoJEyGcaZxWR6pyxkMoAi6ddtW8txADAqrHGUjXTqdWM18WDzaWKvB")then local madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_lIlIlllllIlIllllIIIIllllI[#("hu")]madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_llIllIIlIIlIIllIlIllIIIII]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_llIllIIlIIlIIllIlIllIIIII](madebybobo_lIIIlIIl(madebybobo_lIIllIlIIIIlIIllIIIIlllI,madebybobo_llIllIIlIIlIIllIlIllIIIII+1,madebybobo_lIlIlllllIlIllllIIIIllllI[#("zq1")]))elseif madebybobo_llIllIIIlIIll==#("FlFkMHTOA3xAPS2MbYFifkBmuaF4vN2dZWctp9llIzvSFIgVGzUV0sAtUsZLcYrXasL3")then madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_lIlIlllllIlIllllIIIIllllI[#("Say")];else madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("gE")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("GuE")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("YpWe")]];end;elseif madebybobo_llIllIIIlIIll<=#("IvcNtKQYTRX4Uz72hmHvSK7jLjUhJRl7ng8cSiHSTGbLcQsAu43gdH67z3cj0JpbGZQOA4k")then if madebybobo_llIllIIIlIIll>#("PYNmJxh41uWPYf3RjaNYgy2kq9fmaO9AT5Bo4TzcVhrFXLnA59Ezrv2r6D6Jr44muv52PP")then if not madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("qj")]]then madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;else madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_lIlIlllllIlIllllIIIIllllI[#("ODc")];end;else madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("nF")]]();madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("GW")]]=madebybobo_IlIlIllllIIl[madebybobo_lIlIlllllIlIllllIIIIllllI[#("u6A")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("6t")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("H18")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("i4g1")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("yd")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("7t5")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("r6fv")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("Gk")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("NaY")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("6u1n")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("c1")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("FDu")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("heAu")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("l0")]]=madebybobo_IlIlIllllIIl[madebybobo_lIlIlllllIlIllllIIIIllllI[#("HfX")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("iY")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("zZa")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("Luba")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("qZ")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("xnF")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("EETz")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("Ta")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("Xuz")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("l386")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#{"spoodercraft says bim bam boom";{350532;413435;653068;932477};}]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("ztF")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("NW5T")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("Sb")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("sk5")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("1OdB")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("jo")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("fJL")]]=madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("nvOQ")]];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl[madebybobo_llIllIIlIIlIIllIlIllIIIII];madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_lIlIlllllIlIllllIIIIllllI[#("HQt")];end;elseif madebybobo_llIllIIIlIIll<=#("AMLd8fxxPWPqakKiydjrBWZV0nekBPuUqmdXQs3lKfqWMO3cVmIZGxvNX0mVbm69C49XgXCe")then do return end;elseif madebybobo_llIllIIIlIIll>#("7SvGcimtcAnhFo41Aa0gikyjquROf57UDQIO9hUR9B8WS27Qe6RXM8bXumoSBJnhCDPZQq1rp")then local madebybobo_IIIllIIIlIIIIIIl=madebybobo_lIlIlllllIlIllllIIIIllllI[#("BT")]local madebybobo_llIllIIIlIIll={madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_IIIllIIIlIIIIIIl](madebybobo_lIIIlIIl(madebybobo_lIIllIlIIIIlIIllIIIIlllI,madebybobo_IIIllIIIlIIIIIIl+1,madebybobo_lllIIlIlllIIIIIlIlllIII))};local madebybobo_llIllIIlIIlIIllIlIllIIIII=0;for madebybobo_lIlIlllllIlIllllIIIIllllI=madebybobo_IIIllIIIlIIIIIIl,madebybobo_lIlIlllllIlIllllIIIIllllI[#("TZBh")]do madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI]=madebybobo_llIllIIIlIIll[madebybobo_llIllIIlIIlIIllIlIllIIIII];end else madebybobo_lIIllIlIIIIlIIllIIIIlllI[madebybobo_lIlIlllllIlIllllIIIIllllI[#("bs")]][madebybobo_lIlIlllllIlIllllIIIIllllI[#("hp9")]]=madebybobo_lIlIlllllIlIllllIIIIllllI[#("X3fh")];end;madebybobo_llIllIIlIIlIIllIlIllIIIII=madebybobo_llIllIIlIIlIIllIlIllIIIII+1;end;end;end;return madebybobo_IIIIlIIlIIIIlI(madebybobo_lIllllllIlIlll(),{},madebybobo_lllIlIlll())();
RAW Paste Data