daily pastebin goal


a guest Jan 11th, 2019 61 Never
Not a member of Pastebin yet? Sign Up, it unlocks many cool features!
  2. local SynapseXen_IlllIlI='2d2db12ab55b730b8954b47ef24d4f78790192dd592ad1c4259b7f29a7314d56e4b63df8f44ae86f9d812b966f379b95aeeeb132c36b0b2ef9b824742c4f9ac0b8e89a9513d897affe7fac626d41ad085dd1c0c7e9'local SynapseXen_llllIllllIIIl='2f6871ac6d3814c033c727426a12b40272c523fbb61bf86607d5273b2f82816cfc30c70b65e5eba93a25a26a59837c6a5bbbb42fa463b897b36c2214bcab9fca175de9c2afa246d1'local SynapseXen_lIIlIIIlllIIlllIl=126;local SynapseXen_llllIIllIIlIlllII=34;local SynapseXen_lIllIllllllIIl=6022125;local SynapseXen_lIIIIIIlllIIIllIIIl=6821;local SynapseXen_lllIIIIIIIl=function()local SynapseXen_lllIl='6c5147867c5950a3801f9d71402e99794048ca3304416ea6706b05dc230c9c13eceb266108f0e9fdf2692dee58b136e1373f6f3d04c57f444c8c92498ef7289c8e75de778d9adef0a6e2d59855f7be6249d016ba633aef9c70a8b189fd7b853f93'local SynapseXen_lllllIIIIlIlIlIllIl='57410b2d2247425a18dc4287be696806ecdc85b96852cdda6f0dd894e721d27c86b45922b95fe20af67075e4308eb8e31458aa16c1f5dececc1cc638512e6c0e7a887dd652deb743ca49b2b4486e13cce1'local SynapseXen_lIIIlIIllllIlIIIlI='6854ee38abd7bf9003b759f2c7a312a4af4e867ac2e560f73158bb6252ace0b6eec61d2e607c7a53f22447e70ecf8fa108e0a4efb0e7f81d1f45e5fa50de64750da27938cca78b2ab8ad91b646'local SynapseXen_IIllIllIlIlIIIllll='656ba038a7d44930cd3498b4e3fbe36653735ba42bfc9eb4e733d6ba2cf79deffdda4837e44c743bc8b87ac534fe7c7a04bcd578286da227be85b9a3e1cb3440335039b4780b'local SynapseXen_lIIllIIlIlIllIlIl='566c6b58c92aaeea555b31678c05bd7d44893bfef06fb9e48ff72669e4adb5dad58572e608aa2e9ccaeb3b7125d191e4268f72b7f9ef69af1880b2d6dda81280b844'local SynapseXen_Illl='4e74a076a368139e98943c52b9e363087f5f3f4c62850e6b3bb1794b6f01f1941b34e4dfb35f02d7f3b7f6eee37dcbdc7bf50d7429c4a87ce97e5aca3f36d673b30175662deaf627455485169b194b2914f6f0a906f9f9e01dc086c0c9'local SynapseXen_llIlIIlll='6e65056e577482604de8a2d4511a33a3723529d8a363ff30f5447aaeafb0fddbe871f127db0990618619e6a955efd1cac23c4a8f9c249f98b6c53643017002e72cc2bc359e8150e01044'local SynapseXen_IllIlllIIl='5441a681918bb76d084baf5172e174ea3012949a4672428c709306175e1b02b35a9ff18f'local SynapseXen_lIIllIlllIIllIll={AuSqSdbcVKMdPpGJbfC,WGOjrnNaT,GcMoaWQ,iuKrIX,emTLmCrPyXtM,jQFMVCpopp,LfEMJmRFNfmkv,iCyEsZqOBfWbkRR}end;local SynapseXen_IIIlIlIl='4142ed3558578eb7e523def060461c8a14580bc509dfdf70204f30ca3d0c37b94363e81c33f0d90b201b61261fcbca4d0d0b4023ffd4f311e22b86e9752d563b'local SynapseXen_lIlIlIlIlIl=function()local SynapseXen_lllIIlllllIIIIllIIIl='6a5ae24332829c25cefb4c734f19819f5bebd530e4a7525c42537ab7eff6cd0f9ed772ae053a45aa79ff276cdaa95ca1b6a92401c5b8e4a6b836d508ef03ab0b'local SynapseXen_IIlIl={jRRuRjGzgRJ}end;local SynapseXen_IllII=function()local SynapseXen_IlIIllIIll='44539a284b391f8e1af83e0577dba50c6a57840c0066ea65e9a78b75c4e92d3ac03d0f3ddae4f8db898bb69fb5d1e32677'local SynapseXen_IllIlIIlIlIlIIlIlI='434ea638d693c52dd247e857c0f9df213c0e101d4dc321de6c1eeb77ba65240ac8447d'local SynapseXen_IlIllIllIllIIIIlIlll='4c7470b4c1912289e527ac34ebc32a76cb83c90d2b201d845657216ff31bdcfcb2784d8b745d655b6913813462627d74144f3fee6c896fa73604d490638b2d751b0cac4790b21d1e3980ce3ebc042620a974ded8ec7cd4aca03098'local SynapseXen_llIIlll='4f6d88bf444174cba631e886f4b82205254ab3ce4a1b13cfee7e2859feb9986b12c984c883677461b066021b011b611ce2b57bcb62b828d2eed16b28878403236581c5c7ac88149d1dc3bbab65829f32'local SynapseXen_lIlIIIlIIllI='556fa081d7e1c3acd0f7176a23b5f922b717233f755df14ac4abf0d6fd3718437fe5791db9029f6020e77fa994f8b1'local SynapseXen_IIlllIl='6d5117586939b659d19ab8ddded6364a0fa2fb96aae276775df419cdf3d7c4bb25bead043efd0a27cfd6f8bc7437b2af15f7e9'local SynapseXen_IlIlIllIIlIlIlI='694794f752e49c7745b5f8b88ba4b81cf38e30c6248556081b268804b88b1b48edc104ee4564e4da81e074c55ac98007aa7f7c3ddf352d8b266d980a71f502853a4959b5994cc0cd60d91410766bdf22232e620b6833'local SynapseXen_llIII='6c518220eaab7895496dc8e24cd3c61d9f0abdaf1cc093d1f59412a3bfa73cc95da0516abd2d1ac2c520c7ff44fe798034769721e376d9e19befe1d7674ac18e4019'local SynapseXen_IllllIIIl={IouLM,EGrCm,tMXdEmbSHgOtIqBwCoMKxzZs,UJeEly,aRbwPnoeRSMlVTuLcQsIH,lXpCMl,qcMTYqnZsFwT,jMlOOLaYfSaGhHOUApkfQqkr}end;local SynapseXen_lIlIlllIIlIIIlIIlIIl=function()local SynapseXen_lllIl='4b666af7c52afff3af0acb42beb516da6ab8fb3c295f7df0afeacd2ac2b328c43879e86ae1f93e5441560f6fcb7062d59fbac0443d32dac29d25beda7007de0d31604462834780998f9265b3e42f44'local SynapseXen_IIIlllIIllIl='745182915fde52354e312ab31fc1d5d7fe6a0f02fa20f2c3ebe38528a4fb1c48e64c38c58f21213aa50eba835c4167f67d2506c923723d366be8f43f5491'local SynapseXen_lIIIlIlIII='436ab2bf1ca185af588fb929330fbc676481fd67e2a7587a26c9b364cc1983780ae52cb0acd7db04d0d7129643046178692eab851a2e53472ac7e918158dc3984fd841e9936aeedf17f5062a246ec98a309e27c370931c41098e371bf8'local SynapseXen_lIIlllIIlIIlIIIlIIIl='5464a6ccf05803954ee89e70d3298e26c4ebb3bdfc21cea889997507041b08c30c43b616700a58d68fdc52256a7a4f5198ac1948eff65646effedda92d'local SynapseXen_llIIllIllIl={oJsZNsEdoYBb,ZtKkUrBQlCgTac,nTxkjGfDJuIlgNKMwOsL,XzRSh}end;local SynapseXen_IIlIIlllIllIIllIlI='6e756bd78009'local SynapseXen_IIIII=function()local SynapseXen_IIIIIIIl='717611500940d55ec48ab7381c52ec10761ce0448026e8cbfa2a3ac7dfc28703e2c24b52dbbbe3b133f4b4c70c33af2d03a8f55d1a4079fb20cddb320544d830'local SynapseXen_Illl='7475acd75f4f368c821d0808cbe168114ae5f13340c6dbbedfd081f59f2d249d4a8ab4dc99c105c28343bf2273cbe2ca7b96d06f14ef6425b18b9188a6cb'local SynapseXen_IlllIIllIlIIIIIllIlll='475576150771a5e956a496696c2384b789532642e64ae856027e1150cd38974fd58f7c'local SynapseXen_IlIIllllllIIIlll={EYMXuxhuT,TzQuBawLhBdtJzBUtIBrFsFc,JhNJqEeiM}end;local SynapseXen_lIlIlIIlI='756c5305c60390'local SynapseXen_lIIlIlIlIllIllllIIII=function()local SynapseXen_IIIlIIlllI='515a7c38bdd6c185f1f75868d2cf37f6f890e921a444b26651bcbe17499a262c1c4424cbc7572e7e5aaf17de3dbda9'local SynapseXen_IlIIIllIIllllIIll='5366889105501ec38c0fee8af76d36ae6b11c60d0136dbd604029f4b9e6f56137714704f1f194837bf251165a67d123be243c05ab9c122ba6b95fc7e3a54da2a'local SynapseXen_IlllIIIlIlllIIIlll='776e7c6667b1dffc47108d7817dc44d8744c302644a8090b90a4e0ba7614f1b3660ac6370eb70410cc27519c0069248d8d232fd43e065c2f0d7ebcba0b54cc94e7c21d8a04e2cc1012d40b447e6d4f9fce33bae21b6dcd5980f8f1d965fa'local SynapseXen_IlllIlIIlIIllIIl='6562d6a9242926f6c3b126617ad68d98315b535c6bc8d25f2fd22c9d3f526f92cbf0bca590890db9655d1188b3707c1124d77a196111712d4283f6364cffb6b059e967ea02fb7282224bc2989953ec71ec203c6a1d5b2330fbee6e7b2895cdcc3f6b8b'local SynapseXen_llIlllllIlIIIllIlI='457811d427ac4078f58950a34cfe85b75c3aba41ceaba00dc5462b7767cb8fbfbf411e1b799db92d3dc78fc3cd5bd8ea7a72aca096a5547bff4d0be2d7f668628413e336b79efddffdf9f413bc14'local SynapseXen_IllIlII='7246fad4853401aace4b6012c570687e4b1ac36631385cf8bbfa8cd9eb63ee185f637d3a4d2d07cca488d589de622356a6823fda1de3c04896a1006ebe00c9de2f6a0d2ce1a3caaf'local SynapseXen_llIlIII={KnDvFUeOg,WxXkF,MsDQoNcVBQjLeObgtMng,GsKQuJgIn,mqTFnYdDlXUkNt,oSdAgIGnsCI}end;local SynapseXen_IlIlIIIllll='6c6500050eaa'local SynapseXen_lIII=function()local SynapseXen_IIlIIllIIlIIIlll='5569edef626ec0e86e3852de507429d29a5a8fd0a05190436502a73f7370f9a178de0c83b73f82c5ea93c3faf73ba567705731f0576852641241d5c1206dc440afd0e652692a305e8c5797defbdf9eb680f3cbf3bc948db2fbffd2'local SynapseXen_IllllIIIlllIII='626e9a306cd96ff17475d5b9ed34267e04611f08495544d3a0870c11031d2bd8133db9ef90305a9814e047147676625b883ac830785043f5fd63cc4af3658ec4c4faabb5f4738342183f6f880cf15abfe567ae0541'local SynapseXen_llI='5475f4e22e768cc1c04a32eb93b6e044c7238dcfd550e8c07ec2f88cb1847e3d5ad1c8cff49795f93f47ffbeba194d01988f39'local SynapseXen_IIllllIIlllll='45507740c8b7d9f75ca5b62fff4163afa8faffcd53274dfc112b8ede3c0d8f4fcfa43913127862698e8bcce5455179702aa23161d7fceb039cd9287ed9f77735d06bd853e6265c8b1d982aec8ac15aace7e7e0'local SynapseXen_lIIIIllIIlIll='73571105873d568f4f6bb9797ca4b6925034bfed764956d450d23baa3f6cde6d59a6b04431819d94501f'local SynapseXen_llIIIllIl='6741774313155d2f9448fd7b51e530be81d08084966c690361641410f56b6efa8e38b6bf9c0e339fc656e3'local SynapseXen_lIlIlI='6154f4f7f293099b4d5cb9218ea9db62c51045a8c19c5aa258cde8b7d4a77cd765d5'local SynapseXen_llIIllIIII={AtDnQcsgMJtmFTBEouD,sWdSfRbsuICCoSdF,lPZaxFwMrYPgQdQQyXvyY,tyiNKB,FdXfSk,rPrYkTjSLmCVsXyBqtNx,WkiHDkYfM}end;local SynapseXen_IIIIllIllIIllIIIII='4572faea3e127a'local SynapseXen_lllIIIIllIlIIl=function()local SynapseXen_lIIIlIIIIIIllIllIl='6149008e3ee20d7f90674205a4652a6ce4648c9c1df66f7b60f3f393db41a7b3ab159cb9f9f6970d132c319edf265741fe8cb9c352'local SynapseXen_lIIIIIIlIIIIIlIIIll='56708876f09d3d0f112cb5d87a657dc5c62286e7e28fea576e7b061ffbc30d59d0dc8e48172af3bbb900a59d16f4fa506fc0377620b77acabbe76c55448dc1bfc9a03757091c1f395423c3'local SynapseXen_IlIlIIIllllIIll='57490c0282402e2b5f0584bed13b264cdfe8ee4234bcbccadfeedda3a677ce46efca9653190229f4e81a3052a753'local SynapseXen_llIIIlIlIlIlIllIll='76747196288222aa302359675e5c1f23bd86c6001402c8e10f149f456e4c6e90e2b72127e5cfe183bb6f30644cc64e71af5f82d316b32164a169c31c0180a92ec4d0a515aa1f6897cbbe25297f086016642c24e8c16bae3b5854fd79a255'local SynapseXen_lllIllllIlllllIl='45792f15292c5dc469696b5760effe7e23060b07b45f93db7731e10d6b3ce57c26bfdb'local SynapseXen_IIlIlIlIIlIlllIl={sbFWUqNwS,qXuPUYmQPnvfdLZnQ,oAbFsIsK,ZtUVNOBlcyVipQcvCxTeH,jhGXwBaXotwMqRVgMMvEOxzG}end;local SynapseXen_llllIIIIIIIIIlIII='556e7da4c9b5c503a82c0d8efbf11d49ff937a2c8f6959ddd6d7d011bdde19c7ae1bee71'local SynapseXen_llIIIlllIIlII='4f6ee8205dbcc96c985a121b042a799d3c6bb65e01172b422b4c'local SynapseXen_lllIIlIIIlIllllllIl='4c7547d9f9dac4d65c7f9e2b3e61291847527044e39c'local SynapseXen_IlIIIl='54685f661a41229b4e30aebb81ca4180f1ddebf504301c3f3b5f1691'local SynapseXen_IlllIIllIIlIIIIlIl=function()local SynapseXen_IIIlIIlIlIllIllIl='524c712d1a077834c1e17c12b287750d91c7769ca611a69d722c10cecb71db70ab5636'local SynapseXen_lIlIIIIIlllIIIlIIIIl='776e1d439c9d45f86f4188f96ed9ca28872bf41fed0230a3d10988a32802771f2453bcc268f5516b5469bdb9fa3ac703992a96bae8b90bd91b45853a574f'local SynapseXen_IlIIlIl={XwqIzSnRrKTLjxOtIuVn,qIsVRqDsKpPAvcXvMdKEks}end;local SynapseXen_llIIIlIII;local SynapseXen_lIIIllllIlI;local SynapseXen_lIIIIIIlI;local SynapseXen_lllIIIIlIIllIlIIlIIlIl;local SynapseXen_lllllllllIIlIIlIIII;local SynapseXen_llllIIIlIIIIII;local SynapseXen_IIlllIIIlIIIlIIIIlIl;local SynapseXen_lIlllIIlII;local SynapseXen_lIllll;local SynapseXen_IlIIlllIlIl;local SynapseXen_lllIllI=setmetatable;local SynapseXen_IIIIllll=coroutine;local SynapseXen_IllIlIIIlIl=SynapseXen_IIIIllll.create;local SynapseXen_IlIlIlIIlIIIll=SynapseXen_IIIIllll.resume;local SynapseXen_lIIllllIllI=string;local SynapseXen_IIIlIlIlIlIIlIl=SynapseXen_lIIllllIllI.char;local SynapseXen_lIllIIlI=SynapseXen_lIIllllIllI.sub;local SynapseXen_lIlIlllIlllllIllIlIlII=SynapseXen_lIIllllIllI.len;local SynapseXen_IIIll=getfenv;local SynapseXen_IllIIlI=tostring;local SynapseXen_lIllllllIIlIlII=tonumber;local SynapseXen_llllIllIlIl;local SynapseXen_lll;local SynapseXen_lIlIII;local SynapseXen_lIIIllll;local SynapseXen_IIllIIllIl;local SynapseXen_lIIIlIlllIllI=select;local SynapseXen_IIlIllI;local SynapseXen_IIIlIIIllIIl;local SynapseXen_lIllllllIllIIlIIIlllI;local SynapseXen_lIIlIIlIlllIlIlIIll;local SynapseXen_lIllIIII;local SynapseXen_IlIlIlI;local SynapseXen_IIlIIIlI;local SynapseXen_IIllIIlIIIlIIIlIIIIl=function()local SynapseXen_lllIIlIIIIIIIlIIIlII='7670a0e70ce3ffceccf6a434df0f4a233ddd79713cf9d22b845d839b5e8e7c7acc525695619e2674c57f12f390912130a66feb5c5bef77c76231f8c6cb9166a8d4587f752191801d6452942890e64d8ad46b609c'local SynapseXen_IllllllIllI='677976cf18de079d32b8c9067b0a72c1e35741787171ece6109d1f5e363577e45c81bc3defc13607b51881c511ebde0e37088a7d502286bf229ebe98275db687a518e3b5a0f75aaa645f23a49d613a8d8bb1d9f7fd5b8e89'local SynapseXen_lIIIIlllllIlIlllI='5665f4a92d82c3f611a0e0d1695537ff213ef6675d7ac5f6437d020306d53941442bc385'local SynapseXen_llIIllIIIllI='66529a531c9826ba984bf87f16bf3a905dd5317e5f5d90ecb8594f47fbcfac90f26c9e6a0dbafaa8e8c7187ce163de602f1be700bf342f9107ebe522218dd8082f1553d4f84d14360af6f5ae98b51273a13671274771fb4dc095157d04744a2a'local SynapseXen_IIlllIlIIIlIlIlII='7859acf7d178b7889500a621046bfec78869ca718cfec88cb8c9050e1b1ab51cba1254277e2ed839edd69467cd839e21'local SynapseXen_IllIIIIlllllI='6374a050ab35d970b87137990007557666b3b6724fba3a7d474eee2bac6b28b0537041ff69f8c8e12ec2599fd64b6ebffc925b20642f2277209e'local SynapseXen_IlIIII='444ee2d448c2869ee459abf4ed0941802b48ad160c3ff4218e9f014138fb714b434337880bb4c75a783b'local SynapseXen_llIIIII='4275f3ef082425ddfdf07dc23779686c21651e064a6d87e9b2dcefe822c2'local SynapseXen_IIlIIlllIlIl='4c759a86c9569b98ea531d64283a1d5c756399ab275d42066c235f39fc748a4f3290a5c4137e9324a1758b8298e43b69d77587a616002ee0b43634982ffd032a1ba1a8fd0ffb7add41637c3f189fdc81f3875352a88d27a2'local SynapseXen_Ill='797694409109f19d97451e1b36bd634edb1732ab6f22e2675cbdd2e882fd33cc0d7ab4b59f77c1768e8e2ded460fbe3c71e4a20d2667db93268a714d3cd00fb0d614cf3923c108a5'local SynapseXen_IIlIlIIIIlIlllIIl={vxKkWmVsDdBJ,JeDyCmhAbBlbsGJiMVUpmIJ,pgJxLApAqLsnVaLpJLtDoL,TVdwJIpRb,BhgRXxYfCmMzVo,yYpylKLRoOeSQaAz,uKwLzRpIbLNfzAdBCo,UgesJaXsnQKJkPdmWvQEPmP,jzMSmZKn,LZgSvERdPfmz}end;SynapseXen_IlIIlllIlIl=function(SynapseXen_lllllII)local SynapseXen_IIIIlIlIIIIIlI,SynapseXen_IIllIIIIIllIIIIllllII=SynapseXen_lIllIllllllIIl,16384 +SynapseXen_lIIIIIIlllIIIllIIIl;return(SynapseXen_lllllII:gsub('%x%x',function(SynapseXen_IIIIIlllllllIIllIIII)local SynapseXen_lIIIllIllIllllII=SynapseXen_IIIIlIlIIIIIlI%274877906944;local SynapseXen_lIIllllllIIlIllII=(SynapseXen_IIIIlIlIIIIIlI-SynapseXen_lIIIllIllIllllII)/274877906944;local SynapseXen_IlIlIlIIIIIllIlIlI=SynapseXen_lIIllllllIIlIllII%128;SynapseXen_IIIIIlllllllIIllIIII=SynapseXen_lIllllllIIlIlII(SynapseXen_IIIIIlllllllIIllIIII,16)local SynapseXen_IIllIllIlIIllII=(SynapseXen_IIIIIlllllllIIllIIII+ (SynapseXen_lIIllllllIIlIllII-SynapseXen_IlIlIlIIIIIllIlIlI)/128)* (2 *SynapseXen_IlIlIlIIIIIllIlIlI+1)%256;SynapseXen_IIIIlIlIIIIIlI=SynapseXen_lIIIllIllIllllII*SynapseXen_IIllIIIIIllIIIIllllII+SynapseXen_lIIllllllIIlIllII+SynapseXen_IIIIIlllllllIIllIIII+SynapseXen_IIllIllIlIIllII;return string.char(SynapseXen_IIllIllIlIIllII)end))end;local SynapseXen_llIlIIlllllIlllI={}local SynapseXen_IIllIlIlllIllllll={}local SynapseXen_lIlIIIIIlllIlII={}local SynapseXen_lIlIllIIIllIIIlIlII={}for i=65,90 do SynapseXen_llIlIIlllllIlllI[SynapseXen_IlIIlllIlIl(SynapseXen_IIlIIlllIllIIllIlI)..i]=i end;for i=97,122 do SynapseXen_IIllIlIlllIllllll[SynapseXen_IlIIlllIlIl(SynapseXen_IIlIIlllIllIIllIlI)..i]=i end;local SynapseXen_IllllIIllIIIIIlI=function()local SynapseXen_llllIIIlIlIlIl='747ab2ea7bcdf94602ecd94d4aacb8869317ef03a759c55949dec354a561a0d2c60d8447b952e0aa8bdd1d23669cab6a3d2329d941ad90'local SynapseXen_lIlllllIlIIlI='54638eb10590193f02093dcaa9ff746674ecc412242a3ae32f46a26e44dfd12e155b8674ba75f489'local SynapseXen_IIIIIIIIIl={lvdNmWbTzUmZxgThTDQfzUSU,DdXSKsd}end;local SynapseXen_IIllIlIlIIllIIIIlIlII=function(SynapseXen_IIIIIlIlIllI,SynapseXen_lIlII)SynapseXen_lIlIIIIIlllIlII[SynapseXen_IlIIlllIlIl(SynapseXen_lIlIlIIlI)..SynapseXen_IIIlIlIlIlIIlIl(SynapseXen_lIlII)]=SynapseXen_IIIlIlIlIlIIlIl(SynapseXen_lIlII)end;local SynapseXen_IIlIlIIIIIllllIllI=function(SynapseXen_IIIlllIllllII,SynapseXen_IIIIIllllllI)SynapseXen_lIlIllIIIllIIIlIlII[SynapseXen_IlIIlllIlIl(SynapseXen_IlIlIIIllll)..SynapseXen_IIIlIlIlIlIIlIl(SynapseXen_IIIIIllllllI)]=SynapseXen_IIIlIlIlIlIIlIl(SynapseXen_IIIIIllllllI)end;table.foreach(SynapseXen_llIlIIlllllIlllI,SynapseXen_IIllIlIlIIllIIIIlIlII)table.foreach(SynapseXen_IIllIlIlllIllllll,SynapseXen_IIlIlIIIIIllllIllI)local SynapseXen_lIIIlII=function()local SynapseXen_lIIlIlIIIIlIIlI='6c654df26cd2b287dd331c4cb56c30b18c2bcceb655e496488432eeacdf27b9a70dc4341535dcb0b5a3b8be78426f94c0aec1e02f6d782a5ae1dd83e'local SynapseXen_IIlIlII='62712966134e2a9f11da87c08ae96b7c3fe4fecad84840563236003866592d68ef350bb6ab09d3fcb94686fc771bb22033147211c59d46f8826b78812ae5545c973ee217c734b8c5676964ad'local SynapseXen_IlIIlIIllIIIIIIlIllIl='47477166e7031f9ee4e59117835579f56f2392557501918de6837a370dcc0cc06ee10da356224866935588841bd2e51497e2622faf363d195264806ad7ba22f7'local SynapseXen_llIIIlIIIIIllIIIlll='6f5af4732a98041f1c09aad320c7bb643a9b6458f22945545d0c211d8ac9'local SynapseXen_Ill='546d176e79d335079b53791a52874d25dee3a9b3561a5a498aa09b097dedc6fd1785438a220d2d9a53662e1cbf6d95f5fd3ca7d13e39eb80a7ebccf93d270676484b9c84c6ad17c1ea7519d01e4fda759ef76be1'local SynapseXen_IlIlIll={tFrLaCcuMqiMOnZNrCPjuCRq,lDEgLmPd,gOMzDXiBKNtBgrmCzbVs,LdPRGreKvyXOvRfJKaUpybH,cUwCQreNwMEoAnU}end;local SynapseXen_lIlIIlIIlIllIlIlIIIll=SynapseXen_lIlIIIIIlllIlII.uletterA..SynapseXen_lIlIIIIIlllIlII.uletterB..SynapseXen_lIlIIIIIlllIlII.uletterC;local SynapseXen_lIlllIIllIIllIlll=SynapseXen_lIlIIIIIlllIlII.uletterA..SynapseXen_lIlIIIIIlllIlII.uletterB..SynapseXen_lIlIllIIIllIIIlIlII.letterx;local SynapseXen_IIIllIlIllIlllI=SynapseXen_lIlIIIIIlllIlII.uletterA..SynapseXen_lIlIllIIIllIIIlIlII.letters..SynapseXen_lIlIIIIIlllIlII.uletterB..SynapseXen_lIlIllIIIllIIIlIlII.letterx;local SynapseXen_IllIIIIllllIIllIll=SynapseXen_lIlIIIIIlllIlII.uletterM..SynapseXen_lIlIIIIIlllIlII.uletterO..SynapseXen_lIlIIIIIlllIlII.uletterV..SynapseXen_lIlIIIIIlllIlII.uletterE;local SynapseXen_IIllIlllIlIlllIlI=SynapseXen_lIlIIIIIlllIlII.uletterL..SynapseXen_lIlIIIIIlllIlII.uletterO..SynapseXen_lIlIIIIIlllIlII.uletterA..SynapseXen_lIlIIIIIlllIlII.uletterD..SynapseXen_lIlIIIIIlllIlII.uletterK;local SynapseXen_lllllIIIlIIlIIlIIII=SynapseXen_lIlIIIIIlllIlII.uletterL..SynapseXen_lIlIIIIIlllIlII.uletterO..SynapseXen_lIlIIIIIlllIlII.uletterA..SynapseXen_lIlIIIIIlllIlII.uletterD..SynapseXen_lIlIIIIIlllIlII.uletterB..SynapseXen_lIlIIIIIlllIlII.uletterO..SynapseXen_lIlIIIIIlllIlII.uletterO..SynapseXen_lIlIIIIIlllIlII.uletterL;local SynapseXen_llIIIlllIIlIl=SynapseXen_lIlIIIIIlllIlII.uletterL..SynapseXen_lIlIIIIIlllIlII.uletterO..SynapseXen_lIlIIIIIlllIlII.uletterA..SynapseXen_lIlIIIIIlllIlII.uletterD..SynapseXen_lIlIIIIIlllIlII.uletterN..SynapseXen_lIlIIIIIlllIlII.uletterI..SynapseXen_lIlIIIIIlllIlII.uletterL;local SynapseXen_IIIIlllllllIllIll=SynapseXen_lIlIIIIIlllIlII.uletterG..SynapseXen_lIlIIIIIlllIlII.uletterE..SynapseXen_lIlIIIIIlllIlII.uletterT..SynapseXen_lIlIIIIIlllIlII.uletterU..SynapseXen_lIlIIIIIlllIlII.uletterP..SynapseXen_lIlIIIIIlllIlII.uletterV..SynapseXen_lIlIIIIIlllIlII.uletterA..SynapseXen_lIlIIIIIlllIlII.uletterL;local SynapseXen_llIIllI=SynapseXen_lIlIIIIIlllIlII.uletterG..SynapseXen_lIlIIIIIlllIlII.uletterE..SynapseXen_lIlIIIIIlllIlII.uletterT..SynapseXen_lIlIIIIIlllIlII.uletterG..SynapseXen_lIlIIIIIlllIlII.uletterL..SynapseXen_lIlIIIIIlllIlII.uletterO..SynapseXen_lIlIIIIIlllIlII.uletterB..SynapseXen_lIlIIIIIlllIlII.uletterA..SynapseXen_lIlIIIIIlllIlII.uletterL;local SynapseXen_lllIlIIlIIIllIIIIlIlIII=SynapseXen_lIlIIIIIlllIlII.uletterG..SynapseXen_lIlIIIIIlllIlII.uletterE..SynapseXen_lIlIIIIIlllIlII.uletterT..SynapseXen_lIlIIIIIlllIlII.uletterT..SynapseXen_lIlIIIIIlllIlII.uletterA..SynapseXen_lIlIIIIIlllIlII.uletterB..SynapseXen_lIlIIIIIlllIlII.uletterL..SynapseXen_lIlIIIIIlllIlII.uletterE;local SynapseXen_IllIlIIIIIIl=SynapseXen_lIlIIIIIlllIlII.uletterS..SynapseXen_lIlIIIIIlllIlII.uletterE..SynapseXen_lIlIIIIIlllIlII.uletterT..SynapseXen_lIlIIIIIlllIlII.uletterG..SynapseXen_lIlIIIIIlllIlII.uletterL..SynapseXen_lIlIIIIIlllIlII.uletterO..SynapseXen_lIlIIIIIlllIlII.uletterB..SynapseXen_lIlIIIIIlllIlII.uletterA..SynapseXen_lIlIIIIIlllIlII.uletterL;local SynapseXen_lIlllIlIIlIII=SynapseXen_lIlIIIIIlllIlII.uletterS..SynapseXen_lIlIIIIIlllIlII.uletterE..SynapseXen_lIlIIIIIlllIlII.uletterT..SynapseXen_lIlIIIIIlllIlII.uletterU..SynapseXen_lIlIIIIIlllIlII.uletterP..SynapseXen_lIlIIIIIlllIlII.uletterV..SynapseXen_lIlIIIIIlllIlII.uletterA..SynapseXen_lIlIIIIIlllIlII.uletterL;local SynapseXen_IlIlIIIIll=SynapseXen_lIlIIIIIlllIlII.uletterS..SynapseXen_lIlIIIIIlllIlII.uletterE..SynapseXen_lIlIIIIIlllIlII.uletterT..SynapseXen_lIlIIIIIlllIlII.uletterT..SynapseXen_lIlIIIIIlllIlII.uletterA..SynapseXen_lIlIIIIIlllIlII.uletterB..SynapseXen_lIlIIIIIlllIlII.uletterL..SynapseXen_lIlIIIIIlllIlII.uletterE;local SynapseXen_llIIIIlIlIlIllIllIIIlIl=SynapseXen_lIlIIIIIlllIlII.uletterN..SynapseXen_lIlIIIIIlllIlII.uletterE..SynapseXen_lIlIIIIIlllIlII.uletterW..SynapseXen_lIlIIIIIlllIlII.uletterT..SynapseXen_lIlIIIIIlllIlII.uletterA..SynapseXen_lIlIIIIIlllIlII.uletterB..SynapseXen_lIlIIIIIlllIlII.uletterL..SynapseXen_lIlIIIIIlllIlII.uletterE;local SynapseXen_lIIIlIlIlIlII=SynapseXen_lIlIIIIIlllIlII.uletterS..SynapseXen_lIlIIIIIlllIlII.uletterE..SynapseXen_lIlIIIIIlllIlII.uletterL..SynapseXen_lIlIIIIIlllIlII.uletterF;local SynapseXen_IllIIIIIIIlIlIllIIl=SynapseXen_lIlIIIIIlllIlII.uletterA..SynapseXen_lIlIIIIIlllIlII.uletterD..SynapseXen_lIlIIIIIlllIlII.uletterD;local SynapseXen_lIIIIlIlIlIlIlI=SynapseXen_lIlIIIIIlllIlII.uletterS..SynapseXen_lIlIIIIIlllIlII.uletterU..SynapseXen_lIlIIIIIlllIlII.uletterB;local SynapseXen_lllIII=SynapseXen_lIlIIIIIlllIlII.uletterM..SynapseXen_lIlIIIIIlllIlII.uletterU..SynapseXen_lIlIIIIIlllIlII.uletterL;local SynapseXen_llIIIlllIlIlllI=SynapseXen_lIlIIIIIlllIlII.uletterD..SynapseXen_lIlIIIIIlllIlII.uletterI..SynapseXen_lIlIIIIIlllIlII.uletterV;local SynapseXen_llllIIlllllIIlllllIllIlII=SynapseXen_lIlIIIIIlllIlII.uletterM..SynapseXen_lIlIIIIIlllIlII.uletterO..SynapseXen_lIlIIIIIlllIlII.uletterD;local SynapseXen_IllIIIllIlIlIIlIIII=SynapseXen_lIlIIIIIlllIlII.uletterP..SynapseXen_lIlIIIIIlllIlII.uletterO..SynapseXen_lIlIIIIIlllIlII.uletterW;local SynapseXen_IlIlIlllIlllll=SynapseXen_lIlIIIIIlllIlII.uletterU..SynapseXen_lIlIIIIIlllIlII.uletterN..SynapseXen_lIlIIIIIlllIlII.uletterM;local SynapseXen_IIIllllIlIllllll=SynapseXen_lIlIIIIIlllIlII.uletterN..SynapseXen_lIlIIIIIlllIlII.uletterO..SynapseXen_lIlIIIIIlllIlII.uletterT;local SynapseXen_lIIIIIlIIIIlIIlIlIII=SynapseXen_lIlIIIIIlllIlII.uletterL..SynapseXen_lIlIIIIIlllIlII.uletterE..SynapseXen_lIlIIIIIlllIlII.uletterN;local SynapseXen_llIIIlIlIIllIIl=SynapseXen_lIlIIIIIlllIlII.uletterC..SynapseXen_lIlIIIIIlllIlII.uletterO..SynapseXen_lIlIIIIIlllIlII.uletterN..SynapseXen_lIlIIIIIlllIlII.uletterC..SynapseXen_lIlIIIIIlllIlII.uletterA..SynapseXen_lIlIIIIIlllIlII.uletterT;local SynapseXen_lIIIlllIlIlIIlllIIIll=SynapseXen_lIlIIIIIlllIlII.uletterJ..SynapseXen_lIlIIIIIlllIlII.uletterM..SynapseXen_lIlIIIIIlllIlII.uletterP;local SynapseXen_IllIII=SynapseXen_lIlIIIIIlllIlII.uletterE..SynapseXen_lIlIIIIIlllIlII.uletterQ;local SynapseXen_lIl=SynapseXen_lIlIIIIIlllIlII.uletterL..SynapseXen_lIlIIIIIlllIlII.uletterT;local SynapseXen_llIIIIIlI=SynapseXen_lIlIIIIIlllIlII.uletterL..SynapseXen_lIlIIIIIlllIlII.uletterE;local SynapseXen_IIIllIIIIlIIll=SynapseXen_lIlIIIIIlllIlII.uletterT..SynapseXen_lIlIIIIIlllIlII.uletterE..SynapseXen_lIlIIIIIlllIlII.uletterS..SynapseXen_lIlIIIIIlllIlII.uletterT;local SynapseXen_IlIllIIIIIIIIIll=SynapseXen_lIlIIIIIlllIlII.uletterT..SynapseXen_lIlIIIIIlllIlII.uletterE..SynapseXen_lIlIIIIIlllIlII.uletterS..SynapseXen_lIlIIIIIlllIlII.uletterT..SynapseXen_lIlIIIIIlllIlII.uletterS..SynapseXen_lIlIIIIIlllIlII.uletterE..SynapseXen_lIlIIIIIlllIlII.uletterT;local SynapseXen_lllllIIIllIIIIIllIIll=SynapseXen_lIlIIIIIlllIlII.uletterC..SynapseXen_lIlIIIIIlllIlII.uletterA..SynapseXen_lIlIIIIIlllIlII.uletterL..SynapseXen_lIlIIIIIlllIlII.uletterL;local SynapseXen_llIIIIIlIlIllIll=SynapseXen_lIlIIIIIlllIlII.uletterT..SynapseXen_lIlIIIIIlllIlII.uletterA..SynapseXen_lIlIIIIIlllIlII.uletterI..SynapseXen_lIlIIIIIlllIlII.uletterL..SynapseXen_lIlIIIIIlllIlII.uletterC..SynapseXen_lIlIIIIIlllIlII.uletterA..SynapseXen_lIlIIIIIlllIlII.uletterL..SynapseXen_lIlIIIIIlllIlII.uletterL;local SynapseXen_IlllIlIIl=SynapseXen_lIlIIIIIlllIlII.uletterR..SynapseXen_lIlIIIIIlllIlII.uletterE..SynapseXen_lIlIIIIIlllIlII.uletterT..SynapseXen_lIlIIIIIlllIlII.uletterU..SynapseXen_lIlIIIIIlllIlII.uletterR..SynapseXen_lIlIIIIIlllIlII.uletterN;local SynapseXen_lIlIIl=SynapseXen_lIlIIIIIlllIlII.uletterF..SynapseXen_lIlIIIIIlllIlII.uletterO..SynapseXen_lIlIIIIIlllIlII.uletterR..SynapseXen_lIlIIIIIlllIlII.uletterL..SynapseXen_lIlIIIIIlllIlII.uletterO..SynapseXen_lIlIIIIIlllIlII.uletterO..SynapseXen_lIlIIIIIlllIlII.uletterP;local SynapseXen_lIlllllIlIIlIIllll=SynapseXen_lIlIIIIIlllIlII.uletterF..SynapseXen_lIlIIIIIlllIlII.uletterO..SynapseXen_lIlIIIIIlllIlII.uletterR..SynapseXen_lIlIIIIIlllIlII.uletterP..SynapseXen_lIlIIIIIlllIlII.uletterR..SynapseXen_lIlIIIIIlllIlII.uletterE..SynapseXen_lIlIIIIIlllIlII.uletterP;local SynapseXen_IllIlllIIIII=SynapseXen_lIlIIIIIlllIlII.uletterT..SynapseXen_lIlIIIIIlllIlII.uletterF..SynapseXen_lIlIIIIIlllIlII.uletterO..SynapseXen_lIlIIIIIlllIlII.uletterR..SynapseXen_lIlIIIIIlllIlII.uletterL..SynapseXen_lIlIIIIIlllIlII.uletterO..SynapseXen_lIlIIIIIlllIlII.uletterO..SynapseXen_lIlIIIIIlllIlII.uletterP;local SynapseXen_IIIIllIlI=SynapseXen_lIlIIIIIlllIlII.uletterS..SynapseXen_lIlIIIIIlllIlII.uletterE..SynapseXen_lIlIIIIIlllIlII.uletterT..SynapseXen_lIlIIIIIlllIlII.uletterL..SynapseXen_lIlIIIIIlllIlII.uletterI..SynapseXen_lIlIIIIIlllIlII.uletterS..SynapseXen_lIlIIIIIlllIlII.uletterT;local SynapseXen_lIlIIllIlIlIlllIIl=SynapseXen_lIlIIIIIlllIlII.uletterC..SynapseXen_lIlIIIIIlllIlII.uletterL..SynapseXen_lIlIIIIIlllIlII.uletterO..SynapseXen_lIlIIIIIlllIlII.uletterS..SynapseXen_lIlIIIIIlllIlII.uletterE;local SynapseXen_IIIIIII=SynapseXen_lIlIIIIIlllIlII.uletterC..SynapseXen_lIlIIIIIlllIlII.uletterL..SynapseXen_lIlIIIIIlllIlII.uletterO..SynapseXen_lIlIIIIIlllIlII.uletterS..SynapseXen_lIlIIIIIlllIlII.uletterU..SynapseXen_lIlIIIIIlllIlII.uletterR..SynapseXen_lIlIIIIIlllIlII.uletterE;local SynapseXen_llIIlIIIlIlIlllIllII=SynapseXen_lIlIIIIIlllIlII.uletterV..SynapseXen_lIlIIIIIlllIlII.uletterA..SynapseXen_lIlIIIIIlllIlII.uletterR..SynapseXen_lIlIIIIIlllIlII.uletterA..SynapseXen_lIlIIIIIlllIlII.uletterR..SynapseXen_lIlIIIIIlllIlII.uletterG;local SynapseXen_lIlIIlllllIlIIIII={SynapseXen_lIlIIlIIlIllIlIlIIIll,SynapseXen_lIlllIIllIIllIlll,SynapseXen_lIlIIlIIlIllIlIlIIIll,SynapseXen_lIlIIlIIlIllIlIlIIIll,SynapseXen_lIlIIlIIlIllIlIlIIIll,SynapseXen_lIlllIIllIIllIlll,SynapseXen_lIlIIlIIlIllIlIlIIIll,SynapseXen_lIlllIIllIIllIlll,SynapseXen_lIlIIlIIlIllIlIlIIIll,SynapseXen_lIlIIlIIlIllIlIlIIIll,SynapseXen_lIlIIlIIlIllIlIlIIIll,SynapseXen_lIlIIlIIlIllIlIlIIIll,SynapseXen_lIlIIlIIlIllIlIlIIIll,SynapseXen_lIlIIlIIlIllIlIlIIIll,SynapseXen_lIlIIlIIlIllIlIlIIIll,SynapseXen_lIlIIlIIlIllIlIlIIIll,SynapseXen_lIlIIlIIlIllIlIlIIIll,SynapseXen_lIlIIlIIlIllIlIlIIIll,SynapseXen_lIlIIlIIlIllIlIlIIIll,SynapseXen_lIlIIlIIlIllIlIlIIIll,SynapseXen_lIlIIlIIlIllIlIlIIIll,SynapseXen_lIlIIlIIlIllIlIlIIIll,SynapseXen_IIIllIlIllIlllI,SynapseXen_lIlIIlIIlIllIlIlIIIll,SynapseXen_lIlIIlIIlIllIlIlIIIll,SynapseXen_lIlIIlIIlIllIlIlIIIll,SynapseXen_lIlIIlIIlIllIlIlIIIll,SynapseXen_lIlIIlIIlIllIlIlIIIll,SynapseXen_lIlIIlIIlIllIlIlIIIll,SynapseXen_lIlIIlIIlIllIlIlIIIll,SynapseXen_lIlIIlIIlIllIlIlIIIll,SynapseXen_IIIllIlIllIlllI,SynapseXen_IIIllIlIllIlllI,SynapseXen_lIlIIlIIlIllIlIlIIIll,SynapseXen_lIlIIlIIlIllIlIlIIIll,SynapseXen_lIlIIlIIlIllIlIlIIIll,SynapseXen_lIlllIIllIIllIlll,SynapseXen_lIlIIlIIlIllIlIlIIIll}local SynapseXen_lIllllIlIIlIlII={SynapseXen_IllIIIIllllIIllIll,SynapseXen_IIllIlllIlIlllIlI,SynapseXen_lllllIIIlIIlIIlIIII,SynapseXen_llIIIlllIIlIl,SynapseXen_IIIIlllllllIllIll,SynapseXen_llIIllI,SynapseXen_lllIlIIlIIIllIIIIlIlIII,SynapseXen_IllIlIIIIIIl,SynapseXen_lIlllIlIIlIII,SynapseXen_IlIlIIIIll,SynapseXen_llIIIIlIlIlIllIllIIIlIl,SynapseXen_lIIIlIlIlIlII,SynapseXen_IllIIIIIIIlIlIllIIl,SynapseXen_lIIIIlIlIlIlIlI,SynapseXen_lllIII,SynapseXen_llIIIlllIlIlllI,SynapseXen_llllIIlllllIIlllllIllIlII,SynapseXen_IllIIIllIlIlIIlIIII,SynapseXen_IlIlIlllIlllll,SynapseXen_IIIllllIlIllllll,SynapseXen_lIIIIIlIIIIlIIlIlIII,SynapseXen_llIIIlIlIIllIIl,SynapseXen_lIIIlllIlIlIIlllIIIll,SynapseXen_IllIII,SynapseXen_lIl,SynapseXen_llIIIIIlI,SynapseXen_IIIllIIIIlIIll,SynapseXen_IlIllIIIIIIIIIll,SynapseXen_lllllIIIllIIIIIllIIll,SynapseXen_llIIIIIlIlIllIll,SynapseXen_IlllIlIIl,SynapseXen_lIlIIl,SynapseXen_lIlllllIlIIlIIllll,SynapseXen_IllIlllIIIII,SynapseXen_IIIIllIlI,SynapseXen_lIlIIllIlIlIlllIIl,SynapseXen_IIIIIII,SynapseXen_llIIlIIIlIlIlllIllII}local SynapseXen_lIllIIlIIllIIlIll=function()local SynapseXen_IIllIIIlllI='76505986c199f25eb58914e69880b6e6bf7958cb9175367f0e373b40753c05f88cd402b76821c77ea978e1b93a1d5b'local SynapseXen_IlIllllllIllIIlll='7a41890d8b7f82f1354f8d7a351ac7041427b45b758a10380013e3ac58e97c7a1191becf3b9b3880a4b9bcdecfeda11d278fcdbe6ff3'local SynapseXen_lIIIlIlIlIlIIlIlIl='6e7659a9caea8cb50a38737a4be0f33011c7c2d47aaf2af5019343ae946f4f'local SynapseXen_IIlIllIlIIlII='5167f92022bf2784389ad6c6ff800f3de331e0572f2a41b561ad4031b9a4b72c67c8839664'local SynapseXen_lIIIlIIIIlllIIIl='59687ca121acf3555d395fa9a63052ee6cffbf06e21e3d7fd52a2a92efc1251e87e920587cd835ac1ad180e1f84eb528d3390f0170cfb2706b2ff81d1877229c9a59d9f6bea101aa08e54edf2bb2cc375c1096'local SynapseXen_IlllIlIIII={KnAbCPVxNhWFlwoUt,dLxLepOfPoYLGimXlCT,mDHzHQcTnXrfB,iqCXloTTyOdKgkBLfJ,iMnYMaKwIj}end;SynapseXen_IIIlIIIllIIl=function(SynapseXen_lllIIlIll)local SynapseXen_lIIIlIlllIIIl=tonumber(SynapseXen_lllIIlIll)local SynapseXen_lIIlIlIIIIIIlIllIll=''for i=7,0,-1 do local SynapseXen_IIlIIIllIIlI=math.pow(2,i)if SynapseXen_lIIIlIlllIIIl>=SynapseXen_IIlIIIllIIlI then SynapseXen_lIIlIlIIIIIIlIllIll=SynapseXen_lIIlIlIIIIIIlIllIll..'1'SynapseXen_lIIIlIlllIIIl=SynapseXen_lIIIlIlllIIIl-SynapseXen_IIlIIIllIIlI else SynapseXen_lIIlIlIIIIIIlIllIll=SynapseXen_lIIlIlIIIIIIlIllIll..'0'end end;return SynapseXen_lIIlIlIIIIIIlIllIll end;SynapseXen_lIllllllIllIIlIIIlllI=function(SynapseXen_lIllllIIIIlIIII)return tonumber(SynapseXen_lIllllIIIIlIIII,2)end;SynapseXen_lIIlIIlIlllIlIlIIll=function(SynapseXen_lllIIl)local SynapseXen_lIIlllI=SynapseXen_lllIIl:gsub("%s","")local SynapseXen_IIIIlIIIllll=SynapseXen_lIIlllI:gsub("=","")local SynapseXen_lIlllIIII=''local SynapseXen_llIIIlIlII=''for i=1,SynapseXen_lIlIlllIlllllIllIlIlII(SynapseXen_IIIIlIIIllll)do local SynapseXen_IIlIIIl=SynapseXen_lIllIIlI(SynapseXen_lllIIl,i,i)local SynapseXen_lIIIIIl,SynapseXen_lIlIIIlllllII=string.find(SynapseXen_IlIIlllIlIl(SynapseXen_IIIlIlIl),SynapseXen_IIlIIIl)if SynapseXen_lIIIIIl==nil then error("Invalid character '"..SynapseXen_IIlIIIl.."' found.")end;SynapseXen_lIlllIIII=SynapseXen_lIlllIIII..SynapseXen_lIllIIlI(SynapseXen_IIIlIIIllIIl(SynapseXen_lIIIIIl-1),3)end;for i=1,SynapseXen_lIlIlllIlllllIllIlIlII(SynapseXen_lIlllIIII),8 do local SynapseXen_lIlIlIlllllIlIIl=SynapseXen_lIllIIlI(SynapseXen_lIlllIIII,i,i+7)SynapseXen_llIIIlIlII=SynapseXen_llIIIlIlII..SynapseXen_IIIlIlIlIlIIlIl(SynapseXen_lIllllllIllIIlIIIlllI(SynapseXen_lIlIlIlllllIlIIl))end;local SynapseXen_IIllIIlIIIlIl=SynapseXen_lIIlllI:len()-SynapseXen_IIIIlIIIllll:len()if(SynapseXen_IIllIIlIIIlIl==1 or SynapseXen_IIllIIlIIIlIl==2)then SynapseXen_llIIIlIlII=SynapseXen_llIIIlIlII:sub(1,-2)end;return SynapseXen_llIIIlIlII end;SynapseXen_IIlIllI=function(SynapseXen_lllIlllllllllIlIIl)print(SynapseXen_lllIlllllllllIlIIl)end;SynapseXen_lIlIII=function(SynapseXen_IIIIIlI)local SynapseXen_IIllIlIIIIIIllllllII={}local SynapseXen_IIIl=setmetatable({},SynapseXen_IIllIlIIIIIIllllllII)function SynapseXen_IIllIlIIIIIIllllllII:__index(SynapseXen_IlIlIIIIlIl)local SynapseXen_IIIlIllllIlll=SynapseXen_IIIIIlI(SynapseXen_IlIlIIIIlIl)SynapseXen_IIIl[SynapseXen_IlIlIIIIlIl]=SynapseXen_IIIlIllllIlll;return SynapseXen_IIIlIllllIlll end;return SynapseXen_IIIl end;SynapseXen_lIIIllll=function(SynapseXen_llIlIlllIlIIlIIIIIlI,SynapseXen_lIlIlIlllllllII)local function SynapseXen_IlIIIlIIIllIIIlI(SynapseXen_IIIlIIIlllI,SynapseXen_lllI)local SynapseXen_IlIllI,SynapseXen_IlIlllIIIlIIIIll=0,1;while SynapseXen_IIIlIIIlllI~=0 and SynapseXen_lllI~=0 do local SynapseXen_lIIIIlIIIlllIIll,SynapseXen_IIlIIII=SynapseXen_IIIlIIIlllI%SynapseXen_lIlIlIlllllllII,SynapseXen_lllI%SynapseXen_lIlIlIlllllllII;SynapseXen_IlIllI=SynapseXen_IlIllI+SynapseXen_llIlIlllIlIIlIIIIIlI[SynapseXen_lIIIIlIIIlllIIll][SynapseXen_IIlIIII]*SynapseXen_IlIlllIIIlIIIIll;SynapseXen_IIIlIIIlllI=(SynapseXen_IIIlIIIlllI-SynapseXen_lIIIIlIIIlllIIll)/SynapseXen_lIlIlIlllllllII;SynapseXen_lllI=(SynapseXen_lllI-SynapseXen_IIlIIII)/SynapseXen_lIlIlIlllllllII;SynapseXen_IlIlllIIIlIIIIll=SynapseXen_IlIlllIIIlIIIIll*SynapseXen_lIlIlIlllllllII end;SynapseXen_IlIllI=SynapseXen_IlIllI+ (SynapseXen_IIIlIIIlllI+SynapseXen_lllI)*SynapseXen_IlIlllIIIlIIIIll;return SynapseXen_IlIllI end;return SynapseXen_IlIIIlIIIllIIIlI end;SynapseXen_IIllIIllIl=function(SynapseXen_lIIIIIl)local SynapseXen_IIIIllIlIIlI=SynapseXen_lIIIllll(SynapseXen_lIIIIIl,2 ^1)local SynapseXen_llIlllIl=SynapseXen_lIlIII(function(SynapseXen_lIIIIIIIlll)return SynapseXen_lIlIII(function(SynapseXen_IIIlll)return SynapseXen_IIIIllIlIIlI(SynapseXen_lIIIIIIIlll,SynapseXen_IIIlll)end)end)return SynapseXen_lIIIllll(SynapseXen_llIlllIl,2 ^ (SynapseXen_lIIIIIl.n or 1))end;SynapseXen_lll=SynapseXen_IIllIIllIl{[0]={[0]=0,[1]=1},[1]={[0]=1,[1]=0},n=4}SynapseXen_llllIllIlIl=function(SynapseXen_lIllllIlIIllIIlll,SynapseXen_Illll,SynapseXen_IIllll,...)local SynapseXen_IIIllllIlll;if SynapseXen_Illll then SynapseXen_lIllllIlIIllIIlll=SynapseXen_lIllllIlIIllIIlll%2 ^32;SynapseXen_Illll=SynapseXen_Illll%2 ^32;SynapseXen_IIIllllIlll=SynapseXen_lll(SynapseXen_lIllllIlIIllIIlll,SynapseXen_Illll)if SynapseXen_IIllll then SynapseXen_IIIllllIlll=SynapseXen_llllIllIlIl(SynapseXen_IIIllllIlll,SynapseXen_IIllll,...)end;return SynapseXen_IIIllllIlll elseif SynapseXen_lIllllIlIIllIIlll then return SynapseXen_lIllllIlIIllIIlll%MOD else return 0 end end;SynapseXen_lIllIIII=function(SynapseXen_lllIlIllIlIIlIlI,SynapseXen_IlIIlIlIlIllIllIllIIIII,SynapseXen_lIllllllIlllIIl)if SynapseXen_lIllllllIlllIIl then local SynapseXen_IlllIlllII=0;local SynapseXen_IllIIIlIIll=0;for i=SynapseXen_IlIIlIlIlIllIllIllIIIII,SynapseXen_lIllllllIlllIIl do SynapseXen_IlllIlllII=SynapseXen_IlllIlllII+2 ^SynapseXen_IllIIIlIIll*SynapseXen_lIllIIII(SynapseXen_lllIlIllIlIIlIlI,i)SynapseXen_IllIIIlIIll=SynapseXen_IllIIIlIIll+1 end;return SynapseXen_IlllIlllII else local SynapseXen_llIllIlllIlll=2 ^ (SynapseXen_IlIIlIlIlIllIllIllIIIII-1)return(SynapseXen_lllIlIllIlIIlIlI% (SynapseXen_llIllIlllIlll+SynapseXen_llIllIlllIlll)>=SynapseXen_llIllIlllIlll)and 1 or 0 end end;SynapseXen_IlIlIlI=function(SynapseXen_IlIlllIll)local SynapseXen_llllIlllIlIlIllIIllll=1;local SynapseXen_IIlIIIIIlI=''local SynapseXen_lIlIllIlIIIlII;local SynapseXen_IlIllIIllIlIllIII=''if(SynapseXen_IlIlllIll==nil)then error("Nil inputs.")else local SynapseXen_IIIIllIIlllIll=1;while SynapseXen_IIIIllIIlllIll<#SynapseXen_IlIlllIll+1 do local SynapseXen_lIIllIlIIlI=SynapseXen_lIllIIlI(SynapseXen_IlIlllIll,SynapseXen_IIIIllIIlllIll,SynapseXen_IIIIllIIlllIll+3)local SynapseXen_IlIllIIlIlIIlII=SynapseXen_lIIlIIlIlllIlIlIIll(SynapseXen_lIIllIlIIlI)local SynapseXen_lllIllIllllIllI=SynapseXen_IIlllIIIlIIIlIIIIlIl(SynapseXen_IlIllIIlIlIIlII,SynapseXen_llllIIllIIlIlllII)local SynapseXen_IIIIlIIlIlIllll=SynapseXen_lIlllIIlII(SynapseXen_lllIllIllllIllI,SynapseXen_lIIlIIIlllIIlllIl)SynapseXen_IlIllIIllIlIllIII=SynapseXen_IlIllIIllIlIllIII..SynapseXen_IIIlIlIlIlIIlIl(SynapseXen_IIIIlIIlIlIllll)SynapseXen_IIIIllIIlllIll=SynapseXen_IIIIllIIlllIll+4 end end;local SynapseXen_IlIIllI=1;local SynapseXen_IIlIIIIIIIlIllIlllIlI=false;local SynapseXen_llIlII;local SynapseXen_lIlIIIIIIIIIlI;local SynapseXen_lllI,SynapseXen_IlIlIlll;local SynapseXen_lIlIIIIlIIlIlIIlllIIIIIlIIIl,SynapseXen_IIllllI,SynapseXen_lllIIlIIl,SynapseXen_IlIlIllllllIllIllll,SynapseXen_lIIIIlIlll;do function SynapseXen_lIlIIIIlIIlIlIIlllIIIIIlIIIl()local SynapseXen_IIlII=SynapseXen_IlIllIIllIlIllIII:byte(SynapseXen_IlIIllI,SynapseXen_IlIIllI)SynapseXen_IlIIllI=SynapseXen_IlIIllI+1;return SynapseXen_IIlII end;function SynapseXen_IIllllI()local SynapseXen_lIlIIIIlIlIlIlII,SynapseXen_lIIIll,SynapseXen_llIlll,SynapseXen_llIIlIIllIlIIlIl=SynapseXen_IlIllIIllIlIllIII:byte(SynapseXen_IlIIllI,SynapseXen_IlIIllI+3)SynapseXen_IlIIllI=SynapseXen_IlIIllI+4;return SynapseXen_llIIlIIllIlIIlIl*16777216 +SynapseXen_llIlll*65536 +SynapseXen_lIIIll*256 +SynapseXen_lIlIIIIlIlIlIlII end;function SynapseXen_lllIIlIIl()local SynapseXen_IlllIIllIIlIlII=SynapseXen_IIllllI()local SynapseXen_IIIIIlIII=SynapseXen_IIllllI()return SynapseXen_IIIIIlIII*4294967296 +SynapseXen_IlllIIllIIlIlII end;function SynapseXen_IlIlIllllllIllIllll()local SynapseXen_IllIlIIIllIIlllIIIIlI=SynapseXen_IIllllI()local SynapseXen_IllIlllIIlIIIll=SynapseXen_IIllllI()return(-2 *SynapseXen_lIllIIII(SynapseXen_IllIlllIIlIIIll,32)+1)* (2 ^ (SynapseXen_lIllIIII(SynapseXen_IllIlllIIlIIIll,21,31)-1023))* ( (SynapseXen_lIllIIII(SynapseXen_IllIlllIIlIIIll,1,20)* (2 ^32)+SynapseXen_IllIlIIIllIIlllIIIIlI)/ (2 ^52)+1)end;function SynapseXen_lIIIIlIlll(SynapseXen_IlllIlIllIIIIIlIlIlllIIlll)local SynapseXen_llIlIlIll;if SynapseXen_IlllIlIllIIIIIlIlIlllIIlll then SynapseXen_llIlIlIll=SynapseXen_IlIllIIllIlIllIII:sub(SynapseXen_IlIIllI,SynapseXen_IlIIllI+SynapseXen_IlllIlIllIIIIIlIlIlllIIlll-1)SynapseXen_IlIIllI=SynapseXen_IlIIllI+SynapseXen_IlllIlIllIIIIIlIlIlllIIlll else SynapseXen_IlllIlIllIIIIIlIlIlllIIlll=SynapseXen_IlIlIlll()if SynapseXen_IlllIlIllIIIIIlIlIlllIIlll==0 then return end;SynapseXen_llIlIlIll=SynapseXen_IlIllIIllIlIllIII:sub(SynapseXen_IlIIllI,SynapseXen_IlIIllI+SynapseXen_IlllIlIllIIIIIlIlIlllIIlll-1)SynapseXen_IlIIllI=SynapseXen_IlIIllI+SynapseXen_IlllIlIllIIIIIlIlIlllIIlll end;return SynapseXen_llIlIlIll end end;local function SynapseXen_llIlllIIlIllll()local SynapseXen_llIllIllIll;local SynapseXen_lllIIIlIlIlllIlIl={}local SynapseXen_IIlIlIllIllIIIIlII={}local SynapseXen_IlllIlllllIIlllllIIIl={}local SynapseXen_IIlIIlIllIIlIlII={lines={}}SynapseXen_llIllIllIll={instructions=SynapseXen_lllIIIlIlIlllIlIl,constants=SynapseXen_IIlIlIllIllIIIIlII,prototypes=SynapseXen_IlllIlllllIIlllllIIIl,debug=SynapseXen_IIlIIlIllIIlIlII}local SynapseXen_llIllllIIIllIlIlIllI;SynapseXen_llIllIllIll.name=SynapseXen_lIIIIlIlll()SynapseXen_llIllIllIll.first_line=SynapseXen_lllI()SynapseXen_llIllIllIll.last_line=SynapseXen_lllI()if SynapseXen_llIllIllIll.name then SynapseXen_llIllIllIll.name=SynapseXen_llIllIllIll.name:sub(1,-2)end;SynapseXen_llIllIllIll.upvalues=SynapseXen_lIlIIIIlIIlIlIIlllIIIIIlIIIl()SynapseXen_llIllIllIll.arguments=SynapseXen_lIlIIIIlIIlIlIIlllIIIIIlIIIl()SynapseXen_llIllIllIll.varg=SynapseXen_lIlIIIIlIIlIlIIlllIIIIIlIIIl()SynapseXen_llIllIllIll.stack=SynapseXen_lIlIIIIlIIlIlIIlllIIIIIlIIIl()do SynapseXen_llIllllIIIllIlIlIllI=SynapseXen_lllI()for i=1,SynapseXen_llIllllIIIllIlIlIllI do local SynapseXen_llIIIlIlllIllIIl={}local SynapseXen_IIlIlIIIllllll=SynapseXen_IIllllI()local SynapseXen_IlIlllIIIl=SynapseXen_lIllIIII(SynapseXen_IIlIlIIIllllll,1,6)local SynapseXen_lIlll=SynapseXen_lIlIIlllllIlIIIII[SynapseXen_IlIlllIIIl+1]SynapseXen_llIIIlIlllIllIIl.opcode=SynapseXen_IlIlllIIIl;SynapseXen_llIIIlIlllIllIIl.type=SynapseXen_lIlll;SynapseXen_llIIIlIlllIllIIl.A=SynapseXen_lIllIIII(SynapseXen_IIlIlIIIllllll,7,14)if SynapseXen_lIlll=="ABC"then SynapseXen_llIIIlIlllIllIIl.B=SynapseXen_lIllIIII(SynapseXen_IIlIlIIIllllll,24,32)SynapseXen_llIIIlIlllIllIIl.C=SynapseXen_lIllIIII(SynapseXen_IIlIlIIIllllll,15,23)elseif SynapseXen_lIlll=="ABx"then SynapseXen_llIIIlIlllIllIIl.Bx=SynapseXen_lIllIIII(SynapseXen_IIlIlIIIllllll,15,32)elseif SynapseXen_lIlll=="AsBx"then SynapseXen_llIIIlIlllIllIIl.sBx=SynapseXen_lIllIIII(SynapseXen_IIlIlIIIllllll,15,32)-131071 end;SynapseXen_lllIIIlIlIlllIlIl[i]=SynapseXen_llIIIlIlllIllIIl end end;do SynapseXen_llIllllIIIllIlIlIllI=SynapseXen_lllI()for i=1,SynapseXen_llIllllIIIllIlIlIllI do local SynapseXen_lIllIlIll={}local SynapseXen_lIIIIIllIIIIlIII=SynapseXen_lIlIIIIlIIlIlIIlllIIIIIlIIIl()SynapseXen_lIllIlIll.type=SynapseXen_lIIIIIllIIIIlIII;if SynapseXen_lIIIIIllIIIIlIII==1 then SynapseXen_lIllIlIll.data=(SynapseXen_lIlIIIIlIIlIlIIlllIIIIIlIIIl()~=0)elseif SynapseXen_lIIIIIllIIIIlIII==3 then SynapseXen_lIllIlIll.data=SynapseXen_IlIlIllllllIllIllll()elseif SynapseXen_lIIIIIllIIIIlIII==4 then SynapseXen_lIllIlIll.data=SynapseXen_lIIIIlIlll():sub(1,-2)end;SynapseXen_IIlIlIllIllIIIIlII[i-1]=SynapseXen_lIllIlIll end end;do SynapseXen_llIllllIIIllIlIlIllI=SynapseXen_lllI()for i=1,SynapseXen_llIllllIIIllIlIlIllI do SynapseXen_IlllIlllllIIlllllIIIl[i-1]=SynapseXen_llIlllIIlIllll()end end;do local SynapseXen_IlIlIIIllIllllIIlIIl=SynapseXen_IIlIIlIllIIlIlII.lines;SynapseXen_llIllllIIIllIlIlIllI=SynapseXen_lllI()for i=1,SynapseXen_llIllllIIIllIlIlIllI do SynapseXen_IlIlIIIllIllllIIlIIl[i]=SynapseXen_IIllllI()end;SynapseXen_llIllllIIIllIlIlIllI=SynapseXen_lllI()for i=1,SynapseXen_llIllllIIIllIlIlIllI do SynapseXen_lIIIIlIlll():sub(1,-2)SynapseXen_IIllllI()SynapseXen_IIllllI()end;SynapseXen_llIllllIIIllIlIlIllI=SynapseXen_lllI()for i=1,SynapseXen_llIllllIIIllIlIlIllI do SynapseXen_lIIIIlIlll()end end;return SynapseXen_llIllIllIll end;do assert(SynapseXen_lIIIIlIlll(4)=="\27Lua",SynapseXen_IlIIlllIlIl(SynapseXen_lllIIlIIIlIllllllIl))assert(SynapseXen_lIlIIIIlIIlIlIIlllIIIIIlIIIl()==0x51,SynapseXen_IlIIlllIlIl(SynapseXen_llIIIlllIIlII))SynapseXen_lIlIIIIlIIlIlIIlllIIIIIlIIIl()SynapseXen_IIlIIIIIIIlIllIlllIlI=(SynapseXen_lIlIIIIlIIlIlIIlllIIIIIlIIIl()==0)SynapseXen_llIlII=SynapseXen_lIlIIIIlIIlIlIIlllIIIIIlIIIl()SynapseXen_lIlIIIIIIIIIlI=SynapseXen_lIlIIIIlIIlIlIIlllIIIIIlIIIl()if SynapseXen_llIlII==4 then SynapseXen_lllI=SynapseXen_IIllllI elseif SynapseXen_llIlII==8 then SynapseXen_lllI=SynapseXen_lllIIlIIl else error(SynapseXen_llllIIIIIIIIIlIII)end;if SynapseXen_lIlIIIIIIIIIlI==4 then SynapseXen_IlIlIlll=SynapseXen_IIllllI elseif SynapseXen_lIlIIIIIIIIIlI==8 then SynapseXen_IlIlIlll=SynapseXen_lllIIlIIl else error(SynapseXen_IlIIlllIlIl(SynapseXen_llllIIIIIIIIIlIII))end;assert(SynapseXen_lIIIIlIlll(3)=="\4\8\0",SynapseXen_llllIIIIIIIIIlIII)end;return SynapseXen_llIlllIIlIllll()end;local function SynapseXen_IllllIIIIl(...)local SynapseXen_IIIlII=select("#",...)local SynapseXen_lIIllIIllIlIl={...}return SynapseXen_IIIlII,SynapseXen_lIIllIIllIlIl end;SynapseXen_IIlIIIlI=function(SynapseXen_IIlIIIllIllIIIll,SynapseXen_IlIllI)local SynapseXen_IlIIIIllIllllIIIII=SynapseXen_IIlIIIllIllIIIll.instructions;local SynapseXen_lIIIIlIlIIlIl=SynapseXen_IIlIIIllIllIIIll.constants;local SynapseXen_lIllIlIlIlllllllIlI=SynapseXen_IIlIIIllIllIIIll.prototypes;local SynapseXen_llIlIllIIlIlllll,SynapseXen_IllIIllIlIlIIllIIIII;local SynapseXen_lllI;local SynapseXen_lllIIIllIIlIIIl=1;local SynapseXen_IllIIIlIll,SynapseXen_IIIIIIIIIll;local SynapseXen_IIlIlIlllIlIIIIllllII={[0]=function(SynapseXen_lIIlIIIIIIllllIIIl)SynapseXen_llIlIllIIlIlllll[SynapseXen_lIIlIIIIIIllllIIIl.A]=SynapseXen_llIlIllIIlIlllll[SynapseXen_lIIlIIIIIIllllIIIl.B]end,[1]=function(SynapseXen_lllll)SynapseXen_llIlIllIIlIlllll[SynapseXen_lllll.A]=SynapseXen_lIIIIlIlIIlIl[SynapseXen_lllll.Bx].data end,[2]=function(SynapseXen_IIlllIl)SynapseXen_llIlIllIIlIlllll[SynapseXen_IIlllIl.A]=SynapseXen_IIlllIl.B~=0;if SynapseXen_IIlllIl.C~=0 then SynapseXen_lllIIIllIIlIIIl=SynapseXen_lllIIIllIIlIIIl+1 end end,[3]=function(SynapseXen_lIIllIllIllII)local SynapseXen_llllllIllll=SynapseXen_llIlIllIIlIlllll;for i=SynapseXen_lIIllIllIllII.A,SynapseXen_lIIllIllIllII.B do SynapseXen_llllllIllll[i]=nil end end,[4]=function(SynapseXen_IIlIIlIII)SynapseXen_llIlIllIIlIlllll[SynapseXen_IIlIIlIII.A]=SynapseXen_IlIllI[SynapseXen_IIlIIlIII.B]end,[5]=function(SynapseXen_IIIIllIlIllIIIlllIII)local SynapseXen_lllllIIIlIIl=SynapseXen_lIIIIlIlIIlIl[SynapseXen_IIIIllIlIllIIIlllIII.Bx].data;SynapseXen_llIlIllIIlIlllll[SynapseXen_IIIIllIlIllIIIlllIII.A]=SynapseXen_lllI[SynapseXen_lllllIIIlIIl]end,[6]=function(SynapseXen_IIIlIlIlll)local SynapseXen_lIlIIIll=SynapseXen_IIIlIlIlll.C;local SynapseXen_IlIlIIlll=SynapseXen_llIlIllIIlIlllll;SynapseXen_lIlIIIll=SynapseXen_lIlIIIll>255 and SynapseXen_lIIIIlIlIIlIl[SynapseXen_lIlIIIll-256].data or SynapseXen_IlIlIIlll[SynapseXen_lIlIIIll]SynapseXen_IlIlIIlll[SynapseXen_IIIlIlIlll.A]=SynapseXen_IlIlIIlll[SynapseXen_IIIlIlIlll.B][SynapseXen_lIlIIIll]end,[7]=function(SynapseXen_IIlIllIlIIlI)local SynapseXen_lllIlIlIlI=SynapseXen_lIIIIlIlIIlIl[SynapseXen_IIlIllIlIIlI.Bx].data;SynapseXen_lllI[SynapseXen_lllIlIlIlI]=SynapseXen_llIlIllIIlIlllll[SynapseXen_IIlIllIlIIlI.A]end,[8]=function(SynapseXen_IIIllIIIllIIllllIIlI)SynapseXen_IlIllI[SynapseXen_IIIllIIIllIIllllIIlI.B]=SynapseXen_llIlIllIIlIlllll[SynapseXen_IIIllIIIllIIllllIIlI.A]end,[9]=function(SynapseXen_llIlIlIlI)local SynapseXen_lIllllllIIllllIllII=SynapseXen_llIlIlIlI.B;local SynapseXen_IllIl=SynapseXen_llIlIlIlI.C;local SynapseXen_lllllI,SynapseXen_IIIlII=SynapseXen_llIlIllIIlIlllll,SynapseXen_lIIIIlIlIIlIl;SynapseXen_lIllllllIIllllIllII=SynapseXen_lIllllllIIllllIllII>255 and SynapseXen_IIIlII[SynapseXen_lIllllllIIllllIllII-256].data or SynapseXen_lllllI[SynapseXen_lIllllllIIllllIllII]SynapseXen_IllIl=SynapseXen_IllIl>255 and SynapseXen_IIIlII[SynapseXen_IllIl-256].data or SynapseXen_lllllI[SynapseXen_IllIl]SynapseXen_lllllI[SynapseXen_llIlIlIlI.A][SynapseXen_lIllllllIIllllIllII]=SynapseXen_IllIl end,[10]=function(SynapseXen_IlIlI)SynapseXen_llIlIllIIlIlllll[SynapseXen_IlIlI.A]={}end,[11]=function(SynapseXen_llIIIIIIll)local SynapseXen_IllIIIllIllllll=SynapseXen_llIIIIIIll.A;local SynapseXen_lIIllIlIIllIlIlIII=SynapseXen_llIIIIIIll.B;local SynapseXen_lIIllIIIIIlllIllIllIlIlIllll=SynapseXen_llIIIIIIll.C;local SynapseXen_IIllIIlllll=SynapseXen_llIlIllIIlIlllll;SynapseXen_lIIllIlIIllIlIlIII=SynapseXen_IIllIIlllll[SynapseXen_lIIllIlIIllIlIlIII]SynapseXen_lIIllIIIIIlllIllIllIlIlIllll=SynapseXen_lIIllIIIIIlllIllIllIlIlIllll>255 and SynapseXen_lIIIIlIlIIlIl[SynapseXen_lIIllIIIIIlllIllIllIlIlIllll-256].data or SynapseXen_IIllIIlllll[SynapseXen_lIIllIIIIIlllIllIllIlIlIllll]SynapseXen_IIllIIlllll[SynapseXen_IllIIIllIllllll+1]=SynapseXen_lIIllIlIIllIlIlIII;SynapseXen_IIllIIlllll[SynapseXen_IllIIIllIllllll]=SynapseXen_lIIllIlIIllIlIlIII[SynapseXen_lIIllIIIIIlllIllIllIlIlIllll]end,[12]=function(SynapseXen_IllIIIIlIlIlllllIl)local SynapseXen_llllIIllllIlIllllll=SynapseXen_IllIIIIlIlIlllllIl.B;local SynapseXen_llIIIl=SynapseXen_IllIIIIlIlIlllllIl.C;local SynapseXen_lIllIIlIl,SynapseXen_IIIIIllIIlIllIllIlIIl=SynapseXen_llIlIllIIlIlllll,SynapseXen_lIIIIlIlIIlIl;SynapseXen_llllIIllllIlIllllll=SynapseXen_llllIIllllIlIllllll>255 and SynapseXen_IIIIIllIIlIllIllIlIIl[SynapseXen_llllIIllllIlIllllll-256].data or SynapseXen_lIllIIlIl[SynapseXen_llllIIllllIlIllllll]SynapseXen_llIIIl=SynapseXen_llIIIl>255 and SynapseXen_IIIIIllIIlIllIllIlIIl[SynapseXen_llIIIl-256].data or SynapseXen_lIllIIlIl[SynapseXen_llIIIl]SynapseXen_lIllIIlIl[SynapseXen_IllIIIIlIlIlllllIl.A]=SynapseXen_llllIIllllIlIllllll+SynapseXen_llIIIl end,[13]=function(SynapseXen_IlIlIIIllII)local SynapseXen_llIIlI=SynapseXen_IlIlIIIllII.B;local SynapseXen_IllIIllIllIIIIlIIII=SynapseXen_IlIlIIIllII.C;local SynapseXen_IIlIlIIllIIlI,SynapseXen_llllIllllll=SynapseXen_llIlIllIIlIlllll,SynapseXen_lIIIIlIlIIlIl;SynapseXen_llIIlI=SynapseXen_llIIlI>255 and SynapseXen_llllIllllll[SynapseXen_llIIlI-256].data or SynapseXen_IIlIlIIllIIlI[SynapseXen_llIIlI]SynapseXen_IllIIllIllIIIIlIIII=SynapseXen_IllIIllIllIIIIlIIII>255 and SynapseXen_llllIllllll[SynapseXen_IllIIllIllIIIIlIIII-256].data or SynapseXen_IIlIlIIllIIlI[SynapseXen_IllIIllIllIIIIlIIII]SynapseXen_IIlIlIIllIIlI[SynapseXen_IlIlIIIllII.A]=SynapseXen_llIIlI-SynapseXen_IllIIllIllIIIIlIIII end,[14]=function(SynapseXen_IlIlIlIlII)local SynapseXen_lIIIl=SynapseXen_IlIlIlIlII.B;local SynapseXen_IllIIIlll=SynapseXen_IlIlIlIlII.C;local SynapseXen_lllIIIIllIIIlIIIlIl,SynapseXen_llIlIIl=SynapseXen_llIlIllIIlIlllll,SynapseXen_lIIIIlIlIIlIl;SynapseXen_lIIIl=SynapseXen_lIIIl>255 and SynapseXen_llIlIIl[SynapseXen_lIIIl-256].data or SynapseXen_lllIIIIllIIIlIIIlIl[SynapseXen_lIIIl]SynapseXen_IllIIIlll=SynapseXen_IllIIIlll>255 and SynapseXen_llIlIIl[SynapseXen_IllIIIlll-256].data or SynapseXen_lllIIIIllIIIlIIIlIl[SynapseXen_IllIIIlll]SynapseXen_lllIIIIllIIIlIIIlIl[SynapseXen_IlIlIlIlII.A]=SynapseXen_lIIIl*SynapseXen_IllIIIlll end,[15]=function(SynapseXen_IllIllllI)local SynapseXen_lIIIIlIIIIlllIlIl=SynapseXen_IllIllllI.B;local SynapseXen_llllllIIllI=SynapseXen_IllIllllI.C;local SynapseXen_IlIIIIIllI,SynapseXen_llIlIIlIlIllI=SynapseXen_llIlIllIIlIlllll,SynapseXen_lIIIIlIlIIlIl;SynapseXen_lIIIIlIIIIlllIlIl=SynapseXen_lIIIIlIIIIlllIlIl>255 and SynapseXen_llIlIIlIlIllI[SynapseXen_lIIIIlIIIIlllIlIl-256].data or SynapseXen_IlIIIIIllI[SynapseXen_lIIIIlIIIIlllIlIl]SynapseXen_llllllIIllI=SynapseXen_llllllIIllI>255 and SynapseXen_llIlIIlIlIllI[SynapseXen_llllllIIllI-256].data or SynapseXen_IlIIIIIllI[SynapseXen_llllllIIllI]SynapseXen_IlIIIIIllI[SynapseXen_IllIllllI.A]=SynapseXen_lIIIIlIIIIlllIlIl/SynapseXen_llllllIIllI end,[16]=function(SynapseXen_lIlIlIIlllIIIIIllIIIl)local SynapseXen_lllIllIIllllIllIIll=SynapseXen_lIlIlIIlllIIIIIllIIIl.B;local SynapseXen_lIlIlIIIlIllllllI=SynapseXen_lIlIlIIlllIIIIIllIIIl.C;local SynapseXen_IIl,SynapseXen_IlllIIIIllIIIl=SynapseXen_llIlIllIIlIlllll,SynapseXen_lIIIIlIlIIlIl;SynapseXen_lllIllIIllllIllIIll=SynapseXen_lllIllIIllllIllIIll>255 and SynapseXen_IlllIIIIllIIIl[SynapseXen_lllIllIIllllIllIIll-256].data or SynapseXen_IIl[SynapseXen_lllIllIIllllIllIIll]SynapseXen_lIlIlIIIlIllllllI=SynapseXen_lIlIlIIIlIllllllI>255 and SynapseXen_IlllIIIIllIIIl[SynapseXen_lIlIlIIIlIllllllI-256].data or SynapseXen_IIl[SynapseXen_lIlIlIIIlIllllllI]SynapseXen_IIl[SynapseXen_lIlIlIIlllIIIIIllIIIl.A]=SynapseXen_lllIllIIllllIllIIll%SynapseXen_lIlIlIIIlIllllllI end,[17]=function(SynapseXen_lIllIIlllIIIlI)local SynapseXen_lllIIlIlllllIl=SynapseXen_lIllIIlllIIIlI.B;local SynapseXen_lIlIIlIllIIllIllIIllI=SynapseXen_lIllIIlllIIIlI.C;local SynapseXen_IlIllllI,SynapseXen_lIIlIl=SynapseXen_llIlIllIIlIlllll,SynapseXen_lIIIIlIlIIlIl;SynapseXen_lllIIlIlllllIl=SynapseXen_lllIIlIlllllIl>255 and SynapseXen_lIIlIl[SynapseXen_lllIIlIlllllIl-256].data or SynapseXen_IlIllllI[SynapseXen_lllIIlIlllllIl]SynapseXen_lIlIIlIllIIllIllIIllI=SynapseXen_lIlIIlIllIIllIllIIllI>255 and SynapseXen_lIIlIl[SynapseXen_lIlIIlIllIIllIllIIllI-256].data or SynapseXen_IlIllllI[SynapseXen_lIlIIlIllIIllIllIIllI]SynapseXen_IlIllllI[SynapseXen_lIllIIlllIIIlI.A]=SynapseXen_lllIIlIlllllIl^SynapseXen_lIlIIlIllIIllIllIIllI end,[18]=function(SynapseXen_llIIIIlI)SynapseXen_llIlIllIIlIlllll[SynapseXen_llIIIIlI.A]=-SynapseXen_llIlIllIIlIlllll[SynapseXen_llIIIIlI.B]end,[19]=function(SynapseXen_lIllIIIIIllIIIIlllIIIllII)SynapseXen_llIlIllIIlIlllll[SynapseXen_lIllIIIIIllIIIIlllIIIllII.A]=not SynapseXen_llIlIllIIlIlllll[SynapseXen_lIllIIIIIllIIIIlllIIIllII.B]end,[20]=function(SynapseXen_IIIIIllII)SynapseXen_llIlIllIIlIlllll[SynapseXen_IIIIIllII.A]=#SynapseXen_llIlIllIIlIlllll[SynapseXen_IIIIIllII.B]end,[21]=function(SynapseXen_lIlIIlIIlllllIlIIIlll)local SynapseXen_lllIllIIIllIlIIIll=SynapseXen_lIlIIlIIlllllIlIIIlll.B;local SynapseXen_lIIIllI=SynapseXen_llIlIllIIlIlllll[SynapseXen_lllIllIIIllIlIIIll]for i=SynapseXen_lllIllIIIllIlIIIll+1,SynapseXen_lIlIIlIIlllllIlIIIlll.C do SynapseXen_lIIIllI=SynapseXen_lIIIllI..SynapseXen_llIlIllIIlIlllll[i]end;SynapseXen_llIlIllIIlIlllll[SynapseXen_lIlIIlIIlllllIlIIIlll.A]=SynapseXen_lIIIllI end,[22]=function(SynapseXen_IIIlllIIlII)SynapseXen_lllIIIllIIlIIIl=SynapseXen_lllIIIllIIlIIIl+SynapseXen_IIIlllIIlII.sBx end,[23]=function(SynapseXen_lIIllIII)local SynapseXen_llIIIIIIlllIlIll=SynapseXen_lIIllIII.A;local SynapseXen_lIlIll=SynapseXen_lIIllIII.B;local SynapseXen_lIllIllIlllI=SynapseXen_lIIllIII.C;local SynapseXen_IllIIIIllIIIllIIlIlII,SynapseXen_Illllllll=SynapseXen_llIlIllIIlIlllll,SynapseXen_lIIIIlIlIIlIl;SynapseXen_llIIIIIIlllIlIll=SynapseXen_llIIIIIIlllIlIll~=0;SynapseXen_lIlIll=SynapseXen_lIlIll>255 and SynapseXen_Illllllll[SynapseXen_lIlIll-256].data or SynapseXen_IllIIIIllIIIllIIlIlII[SynapseXen_lIlIll]SynapseXen_lIllIllIlllI=SynapseXen_lIllIllIlllI>255 and SynapseXen_Illllllll[SynapseXen_lIllIllIlllI-256].data or SynapseXen_IllIIIIllIIIllIIlIlII[SynapseXen_lIllIllIlllI]if(SynapseXen_lIlIll==SynapseXen_lIllIllIlllI)~=SynapseXen_llIIIIIIlllIlIll then SynapseXen_lllIIIllIIlIIIl=SynapseXen_lllIIIllIIlIIIl+1 end end,[24]=function(SynapseXen_lllllllII)local SynapseXen_llllllllIl=SynapseXen_lllllllII.A;local SynapseXen_lIlIIIIlII=SynapseXen_lllllllII.B;local SynapseXen_IllllIlllllIIlIllllI=SynapseXen_lllllllII.C;local SynapseXen_IIIllII,SynapseXen_lIlIIIII=SynapseXen_llIlIllIIlIlllll,SynapseXen_lIIIIlIlIIlIl;SynapseXen_llllllllIl=SynapseXen_llllllllIl~=0;SynapseXen_lIlIIIIlII=SynapseXen_lIlIIIIlII>255 and SynapseXen_lIlIIIII[SynapseXen_lIlIIIIlII-256].data or SynapseXen_IIIllII[SynapseXen_lIlIIIIlII]SynapseXen_IllllIlllllIIlIllllI=SynapseXen_IllllIlllllIIlIllllI>255 and SynapseXen_lIlIIIII[SynapseXen_IllllIlllllIIlIllllI-256].data or SynapseXen_IIIllII[SynapseXen_IllllIlllllIIlIllllI]if(SynapseXen_lIlIIIIlII<SynapseXen_IllllIlllllIIlIllllI)~=SynapseXen_llllllllIl then SynapseXen_lllIIIllIIlIIIl=SynapseXen_lllIIIllIIlIIIl+1 end end,[25]=function(SynapseXen_llIlIIlIlllllI)local SynapseXen_IlIIlll=SynapseXen_llIlIIlIlllllI.A;local SynapseXen_IlIllII=SynapseXen_llIlIIlIlllllI.B;local SynapseXen_llIlIIlIlIIlIIIIl=SynapseXen_llIlIIlIlllllI.C;local SynapseXen_IllllIIllIIIllIIII,SynapseXen_IlIlIIlllI=SynapseXen_llIlIllIIlIlllll,SynapseXen_lIIIIlIlIIlIl;SynapseXen_IlIIlll=SynapseXen_IlIIlll~=0;SynapseXen_IlIllII=SynapseXen_IlIllII>255 and SynapseXen_IlIlIIlllI[SynapseXen_IlIllII-256].data or SynapseXen_IllllIIllIIIllIIII[SynapseXen_IlIllII]SynapseXen_llIlIIlIlIIlIIIIl=SynapseXen_llIlIIlIlIIlIIIIl>255 and SynapseXen_IlIlIIlllI[SynapseXen_llIlIIlIlIIlIIIIl-256].data or SynapseXen_IllllIIllIIIllIIII[SynapseXen_llIlIIlIlIIlIIIIl]if(SynapseXen_IlIllII<=SynapseXen_llIlIIlIlIIlIIIIl)~=SynapseXen_IlIIlll then SynapseXen_lllIIIllIIlIIIl=SynapseXen_lllIIIllIIlIIIl+1 end end,[26]=function(SynapseXen_lIIIIl)if(not not SynapseXen_llIlIllIIlIlllll[SynapseXen_lIIIIl.A])== (SynapseXen_lIIIIl.C==0)then SynapseXen_lllIIIllIIlIIIl=SynapseXen_lllIIIllIIlIIIl+1 end end,[27]=function(SynapseXen_lllIllIllIII)local SynapseXen_IlIlIIlllI=SynapseXen_llIlIllIIlIlllll;local SynapseXen_IIIIllllllIlIIllIIll=SynapseXen_IlIlIIlllI[SynapseXen_lllIllIllIII.B]if(not not SynapseXen_IIIIllllllIlIIllIIll)== (SynapseXen_lllIllIllIII.C==0)then SynapseXen_lllIIIllIIlIIIl=SynapseXen_lllIIIllIIlIIIl+1 else SynapseXen_IlIlIIlllI[SynapseXen_lllIllIllIII.A]=SynapseXen_IIIIllllllIlIIllIIll end end,[28]=function(SynapseXen_llIlIlllIlllII)local SynapseXen_Illll=SynapseXen_llIlIlllIlllII.A;local SynapseXen_llI=SynapseXen_llIlIlllIlllII.B;local SynapseXen_lIllllIllIIlIIllI=SynapseXen_llIlIlllIlllII.C;local SynapseXen_lIlIIIIllIlIlIllIIllIII=SynapseXen_llIlIllIIlIlllll;local SynapseXen_lIIIlIlIlII,SynapseXen_IIlIIIllIIIIIl;local SynapseXen_llIIIlIlIIlI,SynapseXen_IIIIIIl;SynapseXen_lIIIlIlIlII={}if SynapseXen_llI~=1 then if SynapseXen_llI~=0 then SynapseXen_llIIIlIlIIlI=SynapseXen_Illll+SynapseXen_llI-1 else SynapseXen_llIIIlIlIIlI=SynapseXen_IllIIllIlIlIIllIIIII end;SynapseXen_IIIIIIl=0;for i=SynapseXen_Illll+1,SynapseXen_llIIIlIlIIlI do SynapseXen_IIIIIIl=SynapseXen_IIIIIIl+1;SynapseXen_lIIIlIlIlII[SynapseXen_IIIIIIl]=SynapseXen_lIlIIIIllIlIlIllIIllIII[i]end;SynapseXen_llIIIlIlIIlI,SynapseXen_IIlIIIllIIIIIl=SynapseXen_IllllIIIIl(SynapseXen_lIlIIIIllIlIlIllIIllIII[SynapseXen_Illll](unpack(SynapseXen_lIIIlIlIlII,1,SynapseXen_llIIIlIlIIlI-SynapseXen_Illll)))else SynapseXen_llIIIlIlIIlI,SynapseXen_IIlIIIllIIIIIl=SynapseXen_IllllIIIIl(SynapseXen_lIlIIIIllIlIlIllIIllIII[SynapseXen_Illll]())end;SynapseXen_IllIIllIlIlIIllIIIII=SynapseXen_Illll-1;if SynapseXen_lIllllIllIIlIIllI~=1 then if SynapseXen_lIllllIllIIlIIllI~=0 then SynapseXen_llIIIlIlIIlI=SynapseXen_Illll+SynapseXen_lIllllIllIIlIIllI-2 else SynapseXen_llIIIlIlIIlI=SynapseXen_llIIIlIlIIlI+SynapseXen_Illll end;SynapseXen_IIIIIIl=0;for i=SynapseXen_Illll,SynapseXen_llIIIlIlIIlI do SynapseXen_IIIIIIl=SynapseXen_IIIIIIl+1;SynapseXen_lIlIIIIllIlIlIllIIllIII[i]=SynapseXen_IIlIIIllIIIIIl[SynapseXen_IIIIIIl]end end end,[29]=function(SynapseXen_lllllIIl)local SynapseXen_lIlIIlIlI=SynapseXen_lllllIIl.A;local SynapseXen_IlllIlIlIIlIlIIl=SynapseXen_lllllIIl.B;local SynapseXen_lIlIIIIIl=SynapseXen_lllllIIl.C;local SynapseXen_IllIlIIllIIIlllII=SynapseXen_llIlIllIIlIlllll;local SynapseXen_llIllIl,SynapseXen_lIlIIlIIIlIIlIl;local SynapseXen_IIIIlIlIIl,SynapseXen_lIlllIlIIIlIIlllIlII,SynapseXen_IIIIllIllIlII=SynapseXen_IllIIllIlIlIIllIIIII;SynapseXen_llIllIl={}if SynapseXen_IlllIlIlIIlIlIIl~=1 then if SynapseXen_IlllIlIlIIlIlIIl~=0 then SynapseXen_lIlllIlIIIlIIlllIlII=SynapseXen_lIlIIlIlI+SynapseXen_IlllIlIlIIlIlIIl-1 else SynapseXen_lIlllIlIIIlIIlllIlII=SynapseXen_IIIIlIlIIl end;SynapseXen_IIIIllIllIlII=0;for i=SynapseXen_lIlIIlIlI+1,SynapseXen_lIlllIlIIIlIIlllIlII do SynapseXen_IIIIllIllIlII=SynapseXen_IIIIllIllIlII+1;SynapseXen_llIllIl[#SynapseXen_llIllIl+1]=SynapseXen_IllIlIIllIIIlllII[i]end;SynapseXen_lIlIIlIIIlIIlIl={SynapseXen_IllIlIIllIIIlllII[SynapseXen_lIlIIlIlI](unpack(SynapseXen_llIllIl,1,SynapseXen_lIlllIlIIIlIIlllIlII-SynapseXen_lIlIIlIlI))}else SynapseXen_lIlIIlIIIlIIlIl={SynapseXen_IllIlIIllIIIlllII[SynapseXen_lIlIIlIlI]()}end;return true,SynapseXen_lIlIIlIIIlIIlIl end,[30]=function(SynapseXen_IIII)local SynapseXen_lIIIlllIIIIllIIIII=SynapseXen_IIII.A;local SynapseXen_IllIl=SynapseXen_IIII.B;local SynapseXen_IlIIIlIlllIll=SynapseXen_llIlIllIIlIlllll;local SynapseXen_IllIlllIIlIIl;local SynapseXen_lIllII,SynapseXen_IllIIllIll;if SynapseXen_IllIl==1 then return true end;if SynapseXen_IllIl==0 then SynapseXen_IllIlllIIlIIl=SynapseXen_IllIIllIlIlIIllIIIII else SynapseXen_IllIlllIIlIIl=SynapseXen_lIIIlllIIIIllIIIII+SynapseXen_IllIl-2 end;SynapseXen_IllIIllIll={}local SynapseXen_lIllIlIllIllI=0;for i=SynapseXen_lIIIlllIIIIllIIIII,SynapseXen_IllIlllIIlIIl do SynapseXen_lIllIlIllIllI=SynapseXen_lIllIlIllIllI+1;SynapseXen_IllIIllIll[SynapseXen_lIllIlIllIllI]=SynapseXen_IlIIIlIlllIll[i]end;return true,SynapseXen_IllIIllIll end,[31]=function(SynapseXen_lIIIIIlIIlIllllllI)local SynapseXen_IlIIlII=SynapseXen_lIIIIIlIIlIllllllI.A;local SynapseXen_IlIIlIllllIIII=SynapseXen_llIlIllIIlIlllll;local SynapseXen_lIllIllIll=SynapseXen_IlIIlIllllIIII[SynapseXen_IlIIlII+2]local SynapseXen_IIIllIlIlIl=SynapseXen_IlIIlIllllIIII[SynapseXen_IlIIlII]+SynapseXen_lIllIllIll;SynapseXen_IlIIlIllllIIII[SynapseXen_IlIIlII]=SynapseXen_IIIllIlIlIl;if SynapseXen_lIllIllIll>0 then if SynapseXen_IIIllIlIlIl<=SynapseXen_IlIIlIllllIIII[SynapseXen_IlIIlII+1]then SynapseXen_lllIIIllIIlIIIl=SynapseXen_lllIIIllIIlIIIl+SynapseXen_lIIIIIlIIlIllllllI.sBx;SynapseXen_IlIIlIllllIIII[SynapseXen_IlIIlII+3]=SynapseXen_IIIllIlIlIl end else if SynapseXen_IIIllIlIlIl>=SynapseXen_IlIIlIllllIIII[SynapseXen_IlIIlII+1]then SynapseXen_lllIIIllIIlIIIl=SynapseXen_lllIIIllIIlIIIl+SynapseXen_lIIIIIlIIlIllllllI.sBx;SynapseXen_IlIIlIllllIIII[SynapseXen_IlIIlII+3]=SynapseXen_IIIllIlIlIl end end end,[32]=function(SynapseXen_IllIl)local SynapseXen_llllIlIIlIIIlIlII=SynapseXen_IllIl.A;local SynapseXen_IIlIlIIIllIlIIIlIIIll=SynapseXen_llIlIllIIlIlllll;SynapseXen_IIlIlIIIllIlIIIlIIIll[SynapseXen_llllIlIIlIIIlIlII]=SynapseXen_IIlIlIIIllIlIIIlIIIll[SynapseXen_llllIlIIlIIIlIlII]-SynapseXen_IIlIlIIIllIlIIIlIIIll[SynapseXen_llllIlIIlIIIlIlII+2]SynapseXen_lllIIIllIIlIIIl=SynapseXen_lllIIIllIIlIIIl+SynapseXen_IllIl.sBx end,[33]=function(SynapseXen_IllIIIlIIllIlIIIlIII)local SynapseXen_lIIllIIlIIlllIIIIlIIllI=SynapseXen_IllIIIlIIllIlIIIlIII.A;local SynapseXen_IIIIlllllIIlll=SynapseXen_IllIIIlIIllIlIIIlIII.B;local SynapseXen_IlIIll=SynapseXen_IllIIIlIIllIlIIIlIII.C;local SynapseXen_lIIIllIllIlIllIlI=SynapseXen_llIlIllIIlIlllll;local SynapseXen_IlIlIIIIlllIlIIlIlll=SynapseXen_lIIllIIlIIlllIIIIlIIllI+2;local SynapseXen_IlIllllIl={SynapseXen_lIIIllIllIlIllIlI[SynapseXen_lIIllIIlIIlllIIIIlIIllI](SynapseXen_lIIIllIllIlIllIlI[SynapseXen_lIIllIIlIIlllIIIIlIIllI+1],SynapseXen_lIIIllIllIlIllIlI[SynapseXen_lIIllIIlIIlllIIIIlIIllI+2])}for i=1,SynapseXen_IlIIll do SynapseXen_lIIIllIllIlIllIlI[SynapseXen_IlIlIIIIlllIlIIlIlll+i]=SynapseXen_IlIllllIl[i]end;if SynapseXen_lIIIllIllIlIllIlI[SynapseXen_lIIllIIlIIlllIIIIlIIllI+3]~=nil then SynapseXen_lIIIllIllIlIllIlI[SynapseXen_lIIllIIlIIlllIIIIlIIllI+2]=SynapseXen_lIIIllIllIlIllIlI[SynapseXen_lIIllIIlIIlllIIIIlIIllI+3]else SynapseXen_lllIIIllIIlIIIl=SynapseXen_lllIIIllIIlIIIl+1 end end,[34]=function(SynapseXen_IlIIIlII)local SynapseXen_IIlIll=SynapseXen_IlIIIlII.A;local SynapseXen_IIll=SynapseXen_IlIIIlII.B;local SynapseXen_lIlIllIIllIIlIlIlIlIl=SynapseXen_IlIIIlII.C;local SynapseXen_lllIl=SynapseXen_llIlIllIIlIlllll;if SynapseXen_lIlIllIIllIIlIlIlIlIl==0 then error("Something went wrong here....")else local SynapseXen_lIlIlIlIlIll=(SynapseXen_lIlIllIIllIIlIlIlIlIl-1)*50;local SynapseXen_llIlIlllIlllIIlIIlllI=SynapseXen_lllIl[SynapseXen_IIlIll]if SynapseXen_IIll==0 then SynapseXen_IIll=SynapseXen_IllIIllIlIlIIllIIIII end;for i=1,SynapseXen_IIll do SynapseXen_llIlIlllIlllIIlIIlllI[SynapseXen_lIlIlIlIlIll+i]=SynapseXen_lllIl[SynapseXen_IIlIll+i]end end end,[35]=function(SynapseXen_llIIlIlIIIIIlIIIlll)end,[36]=function(SynapseXen_IIII)local SynapseXen_IlIlIllIl=SynapseXen_lIllIlIlIlllllllIlI[SynapseXen_IIII.Bx]local SynapseXen_llIIIIIIIIIIIIIlIlII=SynapseXen_IlIIIIllIllllIIIII;local SynapseXen_IllI=SynapseXen_llIlIllIIlIlllll;local SynapseXen_lIIllIlIllIlIlIIlII={}local SynapseXen_lllIlIIllIlllIllllIIIll=SynapseXen_lllIllI({},{__index=function(SynapseXen_llIlIlIIl,SynapseXen_IlllIllIIIllIlIlllIl)local SynapseXen_lIlIlIllllllI=SynapseXen_lIIllIlIllIlIlIIlII[SynapseXen_IlllIllIIIllIlIlllIl]return SynapseXen_lIlIlIllllllI.segment[SynapseXen_lIlIlIllllllI.offset]end,__newindex=function(SynapseXen_IllllIIIllIlIIl,SynapseXen_IIlIlIIIIllllllIllIll,SynapseXen_IllIIIIllIlIlIIlllII)local SynapseXen_IIIlll=SynapseXen_lIIllIlIllIlIlIIlII[SynapseXen_IIlIlIIIIllllllIllIll]SynapseXen_IIIlll.segment[SynapseXen_IIIlll.offset]=SynapseXen_IllIIIIllIlIlIIlllII end})for i=1,SynapseXen_IlIlIllIl.upvalues do local SynapseXen_llIIIIlIlIII=SynapseXen_llIIIIIIIIIIIIIlIlII[SynapseXen_lllIIIllIIlIIIl]if SynapseXen_llIIIIlIlIII.opcode==0 then SynapseXen_lIIllIlIllIlIlIIlII[i-1]={segment=SynapseXen_IllI,offset=SynapseXen_llIIIIlIlIII.B}elseif SynapseXen_llIIIIIIIIIIIIIlIlII[SynapseXen_lllIIIllIIlIIIl].opcode==4 then SynapseXen_lIIllIlIllIlIlIIlII[i-1]={segment=SynapseXen_IlIllI,offset=SynapseXen_llIIIIlIlIII.B}end;SynapseXen_lllIIIllIIlIIIl=SynapseXen_lllIIIllIIlIIIl+1 end;local SynapseXen_lIlIlIlIllIlIIlIlIIlI,SynapseXen_IIIllIlII=SynapseXen_IIlIIIlI(SynapseXen_IlIlIllIl,SynapseXen_lllIlIIllIlllIllllIIIll)SynapseXen_IllI[SynapseXen_IIII.A]=SynapseXen_IIIllIlII end,[37]=function(SynapseXen_IlIIIIlllIllIIlII)local SynapseXen_IllIlllIllIlIIllI=SynapseXen_IlIIIIlllIllIIlII.A;local SynapseXen_llIIIIIIIlllIII=SynapseXen_IlIIIIlllIllIIlII.B;local SynapseXen_lIlIlIIIIIIllIl,SynapseXen_llIIlIlI=SynapseXen_llIlIllIIlIlllll,SynapseXen_IllIIIlIll;for i=SynapseXen_IllIlllIllIlIIllI,SynapseXen_IllIlllIllIlIIllI+ (SynapseXen_llIIIIIIIlllIII>0 and SynapseXen_llIIIIIIIlllIII-1 or SynapseXen_IIIIIIIIIll)do SynapseXen_lIlIlIIIIIIllIl[i]=SynapseXen_llIIlIlI[i-SynapseXen_IllIlllIllIlIIllI]end end}local function SynapseXen_IIllIIIIIIl(SynapseXen_IlIlIIllIIIl)local SynapseXen_IIlIIllll=SynapseXen_IIlIIIllIllIIIll.name;local SynapseXen_IllIll=SynapseXen_IIlIIIllIllIIIll.debug.lines[SynapseXen_lllIIIllIIlIIIl]local SynapseXen_IIIl=(SynapseXen_IlIlIIllIIIl:match("^.+:(.+)")or SynapseXen_IlIlIIllIIIl)local SynapseXen_IllIIlIlI=SynapseXen_IIIIllIllIIllIIIII;if SynapseXen_IIlIIllll then SynapseXen_IllIIlIlI=SynapseXen_IIlIIllll end;if SynapseXen_IllIll then SynapseXen_IllIIlIlI=SynapseXen_IllIIlIlI.." - Line: "..SynapseXen_IllIll end;if SynapseXen_IlIlIIllIIIl and type(SynapseXen_IlIlIIllIIIl)=="string"then SynapseXen_IllIIlIlI=SynapseXen_IllIIlIlI.." - Error: "..SynapseXen_IIIl end;if SynapseXen_lllIIIIlIIllIlIIlIIlIl then SynapseXen_lllIIIIlIIllIlIIlIIlIl(SynapseXen_IllIIlI(SynapseXen_IllIll)..":"..SynapseXen_IllIIlI(SynapseXen_IIIl))else error(SynapseXen_IllIIlI(SynapseXen_IllIll)..":"..SynapseXen_IllIIlI(SynapseXen_IIIl),3)end end;local function SynapseXen_IIIIIIlIIIII()local SynapseXen_lIIlIIIlIlIIlIlIIlI=SynapseXen_IlIIIIllIllllIIIII;local SynapseXen_llllllIIllIllIll,SynapseXen_llI,SynapseXen_lIllllIIlIIlIlII,SynapseXen_llllIlIIIlIl;while true do SynapseXen_llllllIIllIllIll=SynapseXen_lIIlIIIlIlIIlIlIIlI[SynapseXen_lllIIIllIIlIIIl]SynapseXen_lllIIIllIIlIIIl=SynapseXen_lllIIIllIIlIIIl+1;SynapseXen_llllIlIIIlIl,SynapseXen_llI,SynapseXen_lIllllIIlIIlIlII=pcall(function()return SynapseXen_IIlIlIlllIlIIIIllllII[SynapseXen_llllllIIllIllIll.opcode](SynapseXen_llllllIIllIllIll)end)if not SynapseXen_llllIlIIIlIl then SynapseXen_IIllIIIIIIl(SynapseXen_llI)break elseif SynapseXen_llI then return SynapseXen_lIllllIIlIIlIlII end end end;local SynapseXen_lIllIlIIIIlIlIlll={}local function SynapseXen_lIIlIIlI(...)local SynapseXen_llllllIllIIllIIIIIlIl={}local SynapseXen_IlIllIllIl={}SynapseXen_IllIIllIlIlIIllIIIII=-1;SynapseXen_llIlIllIIlIlllll=SynapseXen_lllIllI(SynapseXen_llllllIllIIllIIIIIlIl,{__index=SynapseXen_IlIllIllIl,__newindex=function(SynapseXen_lIIIllIlII,SynapseXen_IllIlIll,SynapseXen_lIlllIIIIII)if SynapseXen_IllIlIll>SynapseXen_IllIIllIlIlIIllIIIII and SynapseXen_lIlllIIIIII then SynapseXen_IllIIllIlIlIIllIIIII=SynapseXen_IllIlIll end;SynapseXen_IlIllIllIl[SynapseXen_IllIlIll]=SynapseXen_lIlllIIIIII end})local SynapseXen_lIllIIllIl={...}SynapseXen_IllIIIlIll={}SynapseXen_IIIIIIIIIll=select("#",...)-1;for i=0,SynapseXen_IIIIIIIIIll do SynapseXen_llllllIllIIllIIIIIlIl[i]=SynapseXen_lIllIIllIl[i+1]SynapseXen_IllIIIlIll[i]=SynapseXen_lIllIIllIl[i+1]end;SynapseXen_lllI=SynapseXen_lIIIIIIlI or SynapseXen_IIIll()SynapseXen_lllIIIllIIlIIIl=1;local SynapseXen_llIlIIllIIl=SynapseXen_IllIlIIIlIl(SynapseXen_IIIIIIlIIIII)local SynapseXen_IIlIIIl,SynapseXen_IIlIlIlIIlIlII=SynapseXen_IlIlIlIIlIIIll(SynapseXen_llIlIIllIIl)if SynapseXen_IIlIIIl then if SynapseXen_IIlIlIlIIlIlII then return unpack(SynapseXen_IIlIlIlIIlIlII)end;return else if SynapseXen_lIIIllllIlI then else SynapseXen_IIllIIIIIIl(SynapseXen_IIlIlIlIIlIlII)end end end;return SynapseXen_lIllIlIIIIlIlIlll,SynapseXen_lIIlIIlI end;SynapseXen_IIlllIIIlIIIlIIIIlIl=function(SynapseXen_lllIIlIlIlllI,SynapseXen_IllllIlIIIIIlllllI)return SynapseXen_llllIllIlIl(SynapseXen_lllIIlIlIlllI,SynapseXen_IllllIlIIIIIlllllI)end;SynapseXen_lIlllIIlII=function(SynapseXen_lllllIlIIllIllI,SynapseXen_IlIllIIII)return SynapseXen_llllIllIlIl(SynapseXen_lllllIlIIllIllI,SynapseXen_IlIllIIII)end;SynapseXen_lllllllllIIlIIlIIII=function(SynapseXen_lIIlIllllIlIIlI,SynapseXen_llI,SynapseXen_IllllllI)SynapseXen_lIIIIIIlI=SynapseXen_llI or SynapseXen_IIIll(2)SynapseXen_lllIIIIlIIllIlIIlIIlIl=SynapseXen_IllllllI;local SynapseXen_IIIIlIlIllIllIIIll=SynapseXen_IlIlIlI(SynapseXen_lIIlIllllIlIIlI)local SynapseXen_IIlllIllIllI,SynapseXen_llIIlIllIlIllII=SynapseXen_IIlIIIlI(SynapseXen_IIIIlIlIllIllIIIll)return SynapseXen_llIIlIllIlIllII end;local SynapseXen_lIIlIIIIlI=function()local SynapseXen_lllIllIllIII='5848e876bc95a61bbade1286182cdfa4bf5184a3a2152a23ff5ff8f3f052973bffed0bf9a2558f'local SynapseXen_lIlIIllIlIIllIIlIIIII='714ee2df77c3273b212903788aa74208accf78e4e0e40097a716a1c3b27d15672103a79be031605010b9c89ea9696afcd0bf8c8e2307057c555f04dcaa38979d0631f0d7e2e35cc65a73cdb9a12c8ab1db627f0d8b779a591ac778897b541e954011f4'local SynapseXen_lIIllIIIIlIIlIll={CVJXewNdv,GroYMaKu}end;return SynapseXen_lllllllllIIlIIlIIII('\NzE=\MTY=\NDE=\NjE=\MTM=\OTI=\OTM=\ODg=\ODQ=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTQ=\MA==\MTA1\ODM=\OTI=\OTI=\ODk=\OTI=\OTI=\OTI=\OTA=\Mjg=\Mjg=\OTI=\OTA=\MjIw\Mjg=\OTI=\MjY=\MTU2\Mjg=\OTI=\MjE1\OTI=\Mjk=\OTI=\MTky\MjIw\OTI=\OTM=\MTUz\OTI=\OTI=\OTI=\MTU0\Mjg=\MTU2\OTM=\MTU0\MjIw\MTU2\OTM=\MTU0\Mjg=\MTU3\OTM=\OTA=\MjIx\MTU3\OTM=\OTA=\MTU3\Mjk=\OTQ=\NTY=\OTM=\OTI=\OTI=\Mjc=\OTM=\OTQ=\OTI=\NTY=\Mjk=\OTI=\OTI=\Mjc=\Mjk=\OTQ=\OTI=\MjU=\MjIx\OTQ=\OTI=\MjY=\MTU3\MTU4\OTQ=\MjIx\OTM=\OTU=\OTI=\MA==\MjIx\OTI=\OTM=\MjE3\MjIx\OTQ=\OTI=\MjE4\MTU3\MzA=\OTU=\MTU3\Mjk=\OTU=\OTI=\MTky\MjIx\OTI=\OTM=\MTUz\MjIx\OTQ=\OTI=\MTU0\MTU3\MTU4\OTU=\OTM=\MzA=\OTU=\OTI=\MTI4\MjIx\OTI=\OTM=\ODk=\MjIy\OTQ=\OTI=\OTA=\MTU4\MzA=\ODg=\Mjk=\MjIy\OTU=\OTI=\NjQ=\MjIy\OTI=\OTM=\MjU=\MjIy\OTQ=\OTI=\MjY=\MTU4\MTU4\ODg=\MjIx\MjIy\OTU=\OTI=\MA==\MjIy\OTI=\OTM=\MjE3\MjIy\OTQ=\OTI=\MjE4\MTU4\MzA=\ODk=\MTU3\MjIy\OTU=\OTI=\MTky\MjIy\OTI=\OTM=\MTUz\MjIy\OTQ=\OTI=\MTU0\MTU4\MTU4\ODk=\OTM=\MjIz\OTU=\OTI=\MTI4\MjIy\OTI=\OTM=\ODk=\MjIz\OTQ=\OTI=\OTA=\MTU5\MzA=\OTA=\Mjk=\MTU5\OTU=\OTI=\NjQ=\MjIz\OTI=\OTM=\MjU=\MjIz\OTQ=\OTI=\MjY=\MTU5\MTU4\OTA=\MjIx\MjIz\OTU=\OTI=\MA==\MjIz\OTI=\OTM=\MjE3\MjIz\OTQ=\OTI=\MjE4\MTU5\MzA=\OTE=\MTU3\MzE=\OTU=\OTI=\MTky\MjIz\OTI=\OTM=\MTUz\MjIz\OTQ=\OTI=\MTU0\MTU5\MTU4\OTE=\OTM=\MjQ=\OTU=\OTI=\MTI4\MjIz\OTI=\OTM=\ODk=\MjE2\OTQ=\OTI=\OTA=\MTUy\MzA=\ODQ=\Mjk=\MTUy\OTU=\OTI=\NjQ=\MjE2\OTI=\OTM=\MjU=\MjE2\OTQ=\OTI=\MjY=\MTUy\MTU4\ODQ=\MjIx\MTUy\OTU=\OTI=\MA==\MjE2\OTI=\OTM=\MjE3\MjE2\OTQ=\OTI=\MjE4\MTUy\MzA=\ODU=\MTU3\MTUy\OTU=\OTI=\MTky\MjE2\OTI=\OTM=\MTUz\MjE2\OTQ=\OTI=\MTU0\MTUy\MTU4\ODU=\OTM=\MjU=\OTU=\OTI=\MTI4\MjE2\OTI=\OTM=\ODk=\MjE3\OTQ=\OTI=\OTA=\MTUz\MzA=\ODY=\Mjk=\MjU=\OTU=\OTI=\NjQ=\MjE3\OTI=\OTM=\MjU=\MjE3\OTQ=\OTI=\MjY=\MTUz\MTU4\ODY=\MjIx\MTUz\OTU=\OTI=\MA==\MjE3\OTI=\OTM=\MjE3\MjE3\OTQ=\OTI=\MjE4\MTUz\MzA=\ODc=\MTU3\MjE3\OTU=\OTI=\MTky\MjE3\OTI=\OTM=\MTUz\MjE3\OTQ=\OTI=\MTU0\MTUz\MTU4\ODc=\OTM=\MjE4\OTU=\OTI=\MTI4\MjE3\OTI=\OTM=\ODk=\MjE4\OTQ=\OTI=\OTA=\MTU0\MzA=\ODA=\Mjk=\MjE4\OTU=\OTI=\NjQ=\MjE4\OTI=\OTM=\MjU=\MjE4\OTQ=\OTI=\MjY=\MTU0\MTU4\ODA=\MjIx\MjE4\OTU=\OTI=\MA==\MjE4\OTI=\OTM=\MjE3\MjE4\OTQ=\OTI=\MjE4\MTU0\MzA=\ODE=\MTU3\MjE4\OTU=\OTI=\MTky\MjE4\OTI=\OTM=\MTUz\MjE4\OTQ=\OTI=\MTU0\MTU0\MTU4\ODE=\OTM=\MjE5\OTU=\OTI=\MTI4\MjE4\OTI=\OTM=\ODk=\MjE5\OTQ=\OTI=\OTA=\MTU1\MzA=\ODI=\Mjk=\MjE5\OTU=\OTI=\NjQ=\MjE5\OTI=\OTM=\MjU=\MjE5\OTQ=\OTI=\MjY=\MTU1\MTU4\ODI=\MjIx\Mjc=\OTU=\OTI=\MA==\MjE5\OTI=\OTM=\MjE3\MjE5\OTQ=\OTI=\MjE4\MTU1\MzA=\ODM=\MTU3\Mjc=\OTU=\OTI=\MTky\MjE5\OTI=\OTM=\MTUz\MjE5\OTQ=\OTI=\MTU0\MTU1\MTU4\ODM=\OTM=\MTQ4\OTU=\OTI=\MTI4\MjE5\OTI=\OTM=\ODk=\MjEy\OTQ=\OTI=\OTA=\MTQ4\MzA=\NzY=\Mjk=\MjEy\OTU=\OTI=\NjQ=\MjEy\OTI=\OTM=\MjU=\MjEy\OTQ=\OTI=\MjY=\MTQ4\MTU4\NzY=\MjIx\MjEy\OTU=\OTI=\MA==\MjEy\OTI=\OTM=\MjE3\MjEy\OTQ=\OTI=\MjE4\MTQ4\MzA=\Nzc=\MTU3\MjEy\OTU=\OTI=\MTky\MjEy\OTI=\OTM=\MTUz\MjEy\OTQ=\OTI=\MTU0\MTQ4\MTU4\Nzc=\OTM=\MjEz\OTU=\OTI=\MTI4\MjEy\OTI=\OTM=\ODk=\MjEz\OTQ=\OTI=\OTA=\MTQ5\MzA=\Nzg=\Mjk=\MjEz\OTU=\OTI=\NjQ=\MjEz\OTI=\OTM=\MjU=\MjEz\OTQ=\OTI=\MjY=\MTQ5\MTU4\Nzg=\MjIx\MjEz\OTU=\OTI=\MA==\MjEz\OTI=\OTM=\MjE3\MjEz\OTQ=\OTI=\MjE4\MTQ5\MzA=\Nzk=\MTU3\MjEz\OTU=\OTI=\MTky\MjEz\OTI=\OTM=\MTUz\MjEz\OTQ=\OTI=\MTU0\MTQ5\MTU4\Nzk=\OTM=\MjE0\OTU=\OTI=\MTI4\MjEz\OTI=\OTM=\ODk=\MjE0\OTQ=\OTI=\OTA=\MTUw\MzA=\NzI=\Mjk=\MjI=\OTU=\OTI=\NjQ=\MjE0\OTI=\OTM=\MjU=\MjE0\OTQ=\OTI=\MjY=\MTUw\MTU4\NzI=\MjIx\MjI=\OTU=\OTI=\MA==\MjE0\OTI=\OTM=\MjE3\MjE0\OTQ=\OTI=\MjE4\MTUw\MzA=\NzM=\MTU3\MTUw\OTU=\OTI=\MTky\MjE0\OTI=\OTM=\MTUz\MjE0\OTQ=\OTI=\MTU0\MTUw\MTU4\NzM=\OTM=\MjE1\OTU=\OTI=\MTI4\MjE0\OTI=\OTM=\ODk=\MjE1\OTQ=\OTI=\OTA=\MTUx\MzA=\NzQ=\Mjk=\MjE1\OTU=\OTI=\NjQ=\MjE1\OTI=\OTM=\MjU=\MjE1\OTQ=\OTI=\MjY=\MTUx\MTU4\NzQ=\MjIx\MjE1\OTU=\OTI=\MA==\MjE1\OTI=\OTM=\MjE3\MjE1\OTQ=\OTI=\MjE4\MTUx\MzA=\NzU=\MTU3\MjE1\OTU=\OTI=\MTky\MjE1\OTI=\OTM=\MTUz\MjE1\OTQ=\OTI=\MTU0\MTUx\MTU4\NzU=\OTM=\MjA4\OTU=\OTI=\MTI4\MjE1\OTI=\OTM=\ODk=\MjA4\OTQ=\OTI=\OTA=\MTQ0\MzA=\Njg=\Mjk=\MjA4\OTU=\OTI=\NjQ=\MjA4\OTI=\OTM=\MjU=\MjA4\OTQ=\OTI=\MjY=\MTQ0\MTU4\Njg=\MjIx\MjA4\OTU=\OTI=\MA==\MjA4\OTI=\OTM=\MjE3\MjA4\OTQ=\OTI=\MjE4\MTQ0\MzA=\Njk=\MTU3\MTY=\OTU=\OTI=\MTky\MjA4\OTI=\OTM=\MTUz\MjA4\OTQ=\OTI=\MTU0\MTQ0\MTU4\Njk=\OTM=\MTc=\OTU=\OTI=\MTI4\MjA4\OTI=\OTM=\ODk=\MjA5\OTQ=\OTI=\OTA=\MTQ1\MzA=\NzA=\Mjk=\MTQ1\OTU=\OTI=\NjQ=\MjA5\OTI=\OTM=\MjU=\MjA5\OTQ=\OTI=\MjY=\MTQ1\MTU4\NzA=\MjIx\MjA5\OTU=\OTI=\MA==\MjA5\OTI=\OTM=\MjE3\MjA5\OTQ=\OTI=\MjE4\MTQ1\MzA=\NzE=\MTU3\MjA5\OTU=\OTI=\MTky\MjA5\OTI=\OTM=\MTUz\MjA5\OTQ=\OTI=\MTU0\MTQ1\MTU4\NzE=\OTM=\MjEw\OTU=\OTI=\MTI4\MjA5\OTI=\OTM=\ODk=\MjEw\OTQ=\OTI=\OTA=\MTQ2\MzA=\NjQ=\Mjk=\MjEw\OTU=\OTI=\NjQ=\MjEw\OTI=\OTM=\MjU=\MjEw\OTQ=\OTI=\MjY=\MTQ2\MTU4\NjQ=\MjIx\MjEw\OTU=\OTI=\MA==\MjEw\OTI=\OTM=\MjE3\MjEw\OTQ=\OTI=\MjE4\MTQ2\MzA=\NjU=\MTU3\MjEw\OTU=\OTI=\MTky\MjEw\OTI=\OTM=\MTUz\MjEw\OTQ=\OTI=\MTU0\MTQ2\MTU4\NjU=\OTM=\MjEx\OTU=\OTI=\MTI4\MjEw\OTI=\OTM=\ODk=\MjEx\OTQ=\OTI=\OTA=\MTQ3\MzA=\NjY=\Mjk=\MjEx\OTU=\OTI=\NjQ=\MjEx\OTI=\OTM=\MjU=\MjEx\OTQ=\OTI=\MjY=\MTQ3\MTU4\NjY=\MjIx\MjEx\OTU=\OTI=\MA==\MjEx\OTI=\OTM=\MjE3\MjEx\OTQ=\OTI=\MjE4\MTQ3\MzA=\Njc=\MTU3\MjEx\OTU=\OTI=\MTky\MjEx\OTI=\OTM=\MTUz\MjEx\OTQ=\OTI=\MTU0\MTQ3\MTU4\Njc=\OTM=\MjA0\OTU=\OTI=\MTI4\MjEx\OTI=\OTM=\ODk=\MjA0\OTQ=\OTI=\OTA=\MTQw\MzA=\MTI0\Mjk=\MjA0\OTU=\OTI=\NjQ=\MjA0\OTI=\OTM=\MjU=\MjA0\OTQ=\OTI=\MjY=\MTQw\MTU4\MTI0\MjIx\MjA0\OTU=\OTI=\MA==\MjA0\OTI=\OTM=\MjE3\MjA0\OTQ=\OTI=\MjE4\MTQw\MzA=\MTI1\MTU3\MjA0\OTU=\OTI=\MTky\MjA0\OTI=\OTM=\MTUz\MjA0\OTQ=\OTI=\MTU0\MTQw\MTU4\MTI1\OTM=\MjA1\OTU=\OTI=\MTI4\MjA0\OTI=\OTM=\ODk=\MjA1\OTQ=\OTI=\OTA=\MTQx\MzA=\MTI2\Mjk=\MjA1\OTU=\OTI=\NjQ=\MjA1\OTI=\OTM=\MjU=\MjA1\OTQ=\OTI=\MjY=\MTQx\MTU4\MTI2\MjIx\MjA1\OTU=\OTI=\MA==\MjA1\OTI=\OTM=\MjE3\MjA1\OTQ=\OTI=\MjE4\MTQx\MzA=\MTI3\MTU3\MjA1\OTU=\OTI=\MTky\MjA1\OTI=\OTM=\MTUz\MjA1\OTQ=\OTI=\MTU0\MTQx\MTU4\MTI3\OTM=\MjA2\OTU=\OTI=\MTI4\MjA1\OTI=\OTM=\ODk=\MjA2\OTQ=\OTI=\OTA=\MTQy\MzA=\MTIw\Mjk=\Nzg=\ODg=\OTI=\NjQ=\MjA2\OTI=\OTM=\MjU=\MjA2\OTQ=\OTI=\MjY=\MTQy\MTU4\MTIw\MjIx\MTQ=\OTU=\OTI=\MA==\MjA2\OTI=\OTM=\MjE3\MjA2\OTQ=\OTI=\MjE4\MTQy\MzA=\MTIx\MTU3\MTQ=\OTU=\OTI=\MTky\MjA2\OTI=\OTM=\MTUz\MjA2\OTQ=\OTI=\MTU0\MTQy\MTU4\MTIx\OTM=\MTQz\OTU=\OTI=\MTI4\MjA2\OTI=\OTM=\ODk=\MjA3\OTQ=\OTI=\OTA=\MTQz\MzA=\MTIy\Mjk=\MjA3\OTU=\OTI=\NjQ=\MjA3\OTI=\OTM=\MjU=\MjA3\OTQ=\OTI=\MjY=\MTQz\MTU4\MTIy\MjIx\MjA3\OTU=\OTI=\MA==\MjA3\OTI=\OTM=\MjE3\MjA3\OTQ=\OTI=\MjE4\MTQz\MzA=\MTIz\MTU3\MjA3\OTU=\OTI=\MTky\MjA3\OTI=\OTM=\MTUz\MjA3\OTQ=\OTI=\MTU0\MTQz\MTU4\MTIz\OTM=\MjAw\OTU=\OTI=\MTI4\MjA3\OTI=\OTM=\ODk=\MjAw\OTQ=\OTI=\OTA=\MTM2\MzA=\MTE2\Mjk=\OA==\ODg=\OTI=\NjQ=\MjAw\OTI=\OTM=\MjU=\MjAw\OTQ=\OTI=\MjY=\MTM2\MTU4\MTE2\MjIx\OA==\OTU=\OTI=\MA==\MjAw\OTI=\OTM=\MjE3\MjAw\OTQ=\OTI=\MjE4\MTM2\MzA=\MTE3\MTU3\OA==\OTU=\OTI=\MTky\MjAw\OTI=\OTM=\MTUz\MjAw\OTQ=\OTI=\MTU0\MTM2\MTU4\MTE3\OTM=\MjAx\OTU=\OTI=\MTI4\MjAw\OTI=\OTM=\ODk=\MjAx\OTQ=\OTI=\OTA=\MTM3\MzA=\MTE4\Mjk=\MTM3\OTU=\OTI=\NjQ=\MjAx\OTI=\OTM=\MjU=\MjAx\OTQ=\OTI=\MjY=\MTM3\MTU4\MTE4\MjIx\OQ==\OTU=\OTI=\MA==\MjAx\OTI=\OTM=\MjE3\MjAx\OTQ=\OTI=\MjE4\MTM3\MzA=\MTE5\MTU3\MjAx\OTU=\OTI=\MTky\MjAx\OTI=\OTM=\MjE=\MjIx\MTUy\MjIx\MTUz\NzM=\OTI=\OTI=\MTU0\NzM=\MTUz\MTE5\MjE=\MTU3\MjAx\MjEz\MjEz\Mjk=\MTUz\MjIx\MjEz\Mjk=\MjIx\MjEz\MjEz\MTU3\MjU=\MjE1\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTA=\OTI=\MjIx\MjAy\OTA=\OTI=\MTI4\MjAx\OTI=\OTQ=\MjEz\MTU3\NzM=\MjA4\MjEz\MTU3\MTUz\MjA5\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MTA=\OTE=\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\MTM4\OTE=\OTI=\MTU3\MjAy\OTE=\OTI=\MTI4\MjAx\MjIw\OTQ=\MjEz\MTU3\MjAx\MjIz\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTE=\OTI=\Mjk=\MTA=\ODQ=\OTI=\MjIx\MjAy\OTE=\OTI=\MTU3\MjAy\ODQ=\OTI=\MTI4\MjAx\MjIw\OTQ=\MjEz\MTU3\NzM=\MjA0\MTUz\NzM=\ODU=\OTI=\MTU0\OQ==\MTQ5\MTE5\MTU0\MjAx\MTQ5\MTE5\MjEz\MTU3\MjAx\MjA1\MjEz\MTU3\MTUz\MjA5\MjEz\MTU3\MTUz\MjA3\MTQ5\OTM=\MTUw\MjIx\MTQ5\MjIx\MjIx\MjEz\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\MjAy\OTE=\OTI=\MTI4\MjAx\OTI=\OTQ=\MTQ5\MTU3\NzM=\MjA4\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MTA=\ODY=\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\MjAy\ODY=\OTI=\MTU3\MjAy\OTE=\OTI=\MTI4\MjAx\MjIw\OTQ=\MTQ5\MTU3\MjAx\MjIz\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTE=\OTI=\Mjk=\MTM4\ODY=\OTI=\MjIx\MjAy\OTE=\OTI=\MTU3\MjAy\OTA=\OTI=\MTI4\MjAx\MjIw\OTQ=\MTQ5\MTU3\NzM=\MjA0\ODU=\OTQ=\MTUx\MjIx\ODU=\MjIy\MjIx\MjEz\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTA=\OTI=\MjIx\MjAy\OTA=\OTI=\MTI4\MjAx\OTI=\OTQ=\ODU=\MTU4\NzM=\MjA4\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MTA=\ODc=\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\MjAy\ODc=\OTI=\MTU3\MjAy\OTE=\OTI=\MTI4\MjAx\MjIw\OTQ=\ODU=\MTU4\MjAx\MjIz\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTE=\OTI=\Mjk=\MTM4\ODc=\OTI=\MjIx\MjAy\OTE=\OTI=\MTU3\NzQ=\ODA=\OTI=\MTI4\MjAx\MjIw\OTQ=\ODU=\MTU4\NzM=\MjA0\MTUz\NzM=\ODU=\OTI=\MTU0\OQ==\MTQ0\MTE5\MTU0\MjAx\MTQ0\MTE5\ODU=\MTU4\MjAx\MjA1\MTUz\NzM=\ODU=\OTI=\MTU0\MTM3\MTQ0\MTE5\MTU0\NzM=\MTQ1\MTE5\ODU=\MTU4\MjAx\MTk3\ODU=\MjIy\MTQ1\MTk4\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\NzQ=\ODI=\OTI=\MjIx\NzQ=\ODI=\OTI=\MTI4\MjAx\OTI=\OTQ=\ODU=\MTU4\MjAx\MTk5\ODU=\MjIy\MTQ2\MTky\MjE=\MTU4\MTQ2\MjIx\MjE=\MjIy\MjIx\MjEz\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTA=\OTI=\MjIx\MjAy\OTA=\OTI=\MTI4\MjAx\OTI=\OTQ=\MjE=\MTU4\NzM=\MjA4\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MTA=\ODc=\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\NzQ=\ODM=\OTI=\MTU3\MjAy\OTE=\OTI=\MTI4\MjAx\MjIw\OTQ=\MjE=\MTU4\MjAx\MjIz\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTE=\OTI=\Mjk=\MTM4\ODc=\OTI=\MjIx\MjAy\OTE=\OTI=\MTU3\NzQ=\ODA=\OTI=\MTI4\MjAx\MjIw\OTQ=\MjE=\MTU4\NzM=\MjA0\MTUz\NzM=\ODU=\OTI=\MTU0\OQ==\MTQ0\MTE5\MTU0\MjAx\MTQ0\MTE5\MjE=\MTU4\MjAx\MjA1\MTUz\NzM=\ODU=\OTI=\MTU0\MTM3\MTQ0\MTE5\MTU0\NzM=\MTQ1\MTE5\MjE=\MTU4\MjAx\MTk3\MjE=\MzA=\MTQ3\MTk4\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\NzQ=\ODI=\OTI=\MjIx\NzQ=\ODI=\OTI=\MTI4\MjAx\OTI=\OTQ=\MjE=\MTU4\MjAx\MTk5\MjE=\MjIy\MTQ2\MTky\MjEz\MjIy\MTQ3\MjIx\MjEz\MjIy\MjIx\MjEz\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTA=\OTI=\MjIx\MjAy\OTA=\OTI=\MTI4\MjAx\OTI=\OTQ=\MjEz\MTU4\NzM=\MjA4\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MTA=\ODc=\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\MTM4\ODM=\OTI=\MTU3\MjAy\OTE=\OTI=\MTI4\MjAx\MjIw\OTQ=\MjEz\MTU4\MjAx\MjIz\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTE=\OTI=\Mjk=\MTM4\ODc=\OTI=\MjIx\MjAy\OTE=\OTI=\MTU3\NzQ=\ODA=\OTI=\MTI4\MjAx\MjIw\OTQ=\MjEz\MTU4\NzM=\MjA0\MTUz\NzM=\ODU=\OTI=\MTU0\OQ==\MTQ0\MTE5\MTU0\MjAx\MTQ0\MTE5\MjEz\MTU4\MjAx\MjA1\MTUz\NzM=\ODU=\OTI=\MTU0\MTM3\MTQ0\MTE5\MTU0\NzM=\MTQ1\MTE5\MjEz\MTU4\MjAx\MTk3\MjEz\OTQ=\MTQw\MTk4\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\NzQ=\ODI=\OTI=\MjIx\NzQ=\ODI=\OTI=\MTI4\MjAx\OTI=\OTQ=\MjEz\MTU4\MjAx\MTk5\MjEz\MjIy\MTQ2\MTky\MTQ5\MzA=\MTQw\MjIx\MTQ5\MjIy\MjIx\MjEz\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTA=\OTI=\MjIx\MjAy\OTA=\OTI=\MTI4\MjAx\OTI=\OTQ=\MTQ5\MTU4\NzM=\MjA4\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MTA=\ODc=\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\MjAy\NzY=\OTI=\MTU3\MjAy\OTE=\OTI=\MTI4\MjAx\MjIw\OTQ=\MTQ5\MTU4\MjAx\MjIz\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTE=\OTI=\Mjk=\MTM4\ODc=\OTI=\MjIx\MjAy\OTE=\OTI=\MTU3\NzQ=\ODA=\OTI=\MTI4\MjAx\MjIw\OTQ=\MTQ5\MTU4\NzM=\MjA0\MTUz\NzM=\ODU=\OTI=\MTU0\OQ==\MTQ0\MTE5\MTU0\MjAx\MTQ0\MTE5\MTQ5\MTU4\MjAx\MjA1\MTUz\NzM=\ODU=\OTI=\MTU0\MTM3\MTQ0\MTE5\MTU0\NzM=\MTQ1\MTE5\MTQ5\MTU4\MjAx\MTk3\MTQ5\MTU4\MTQw\MTk4\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\NzQ=\ODI=\OTI=\MjIx\NzQ=\ODI=\OTI=\MTI4\MjAx\OTI=\OTQ=\MTQ5\MTU4\MjAx\MTk5\MTQ5\MjIy\MTQ2\MTky\ODU=\MjIz\MjIx\MjEz\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTA=\OTI=\MjIx\MjAy\OTA=\OTI=\MTI4\MjAx\OTI=\OTQ=\ODU=\MTU5\NzM=\MjA4\ODU=\MjIz\MjY=\MjU0\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MTA=\Nzc=\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\MjAy\Nzc=\OTI=\MTU3\MjAy\OTE=\OTI=\MTI4\MjAx\MjIw\OTQ=\ODU=\MTU5\MjAx\MjIz\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTE=\OTI=\Mjk=\MTM4\Nzc=\OTI=\MjIx\MjAy\OTE=\OTI=\MTU3\NzQ=\Nzg=\OTI=\MTI4\MjAx\MjIw\OTQ=\ODU=\MTU5\NzM=\MjA0\MTUz\NzM=\ODU=\OTI=\MTU0\MTM3\MTQ0\MTE5\MTU0\NzM=\MTQ1\MTE5\ODU=\MTU5\MjAx\MTk3\ODU=\MzE=\MTQy\MTk4\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\MjAy\OTE=\OTI=\MTI4\MjAx\OTI=\OTQ=\ODU=\MTU5\MjAx\MTk5\ODU=\MjIz\MTQy\MTky\MjE=\MTU5\MTQy\MjIx\MjE=\MjIz\MjIx\MjEz\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTA=\OTI=\MjIx\MjAy\OTA=\OTI=\MTI4\MjAx\OTI=\OTQ=\MjE=\MTU5\NzM=\MjA4\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MTA=\ODc=\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\NzQ=\Nzk=\OTI=\MTU3\MjAy\OTE=\OTI=\MTI4\MjAx\MjIw\OTQ=\MjE=\MTU5\MjAx\MjIz\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTE=\OTI=\Mjk=\MTM4\ODc=\OTI=\MjIx\MjAy\OTE=\OTI=\MTU3\NzQ=\ODA=\OTI=\MTI4\MjAx\MjIw\OTQ=\MjE=\MTU5\NzM=\MjA0\MTUz\NzM=\ODU=\OTI=\MTU0\OQ==\MTQ0\MTE5\MTU0\MjAx\MTQ0\MTE5\MjE=\MTU5\MjAx\MjA1\MTUz\NzM=\ODU=\OTI=\MTU0\MTM3\MTQ0\MTE5\MTU0\NzM=\MTQ1\MTE5\MjE=\MTU5\MjAx\MTk3\MjE=\MzE=\MTQz\MTk4\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\NzQ=\ODI=\OTI=\MjIx\NzQ=\ODI=\OTI=\MTI4\MjAx\OTI=\OTQ=\MjE=\MTU5\MjAx\MTk5\MjE=\MjIz\MTQ2\MTky\MjEz\MjIz\MTQz\MjIx\MjEz\MjIz\MjIx\MjEz\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTA=\OTI=\MjIx\MjAy\OTA=\OTI=\MTI4\MjAx\OTI=\OTQ=\MjEz\MTU5\NzM=\MjA4\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MTM4\Nzk=\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\NzQ=\NzI=\OTI=\MTU3\MjAy\OTE=\OTI=\MTI4\MjAx\MjIw\OTQ=\MjEz\MTU5\MjAx\MjIz\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTE=\OTI=\Mjk=\MTA=\NzI=\OTI=\MjIx\MjAy\OTE=\OTI=\MTU3\MjAy\NzI=\OTI=\MTI4\MjAx\MjIw\OTQ=\MjEz\MTU5\NzM=\MjA0\MTUz\NzM=\ODU=\OTI=\MTU0\OQ==\MTQ5\MTE5\MTU0\MjAx\MTQ5\MTE5\MjEz\MTU5\MjAx\MjA1\MTQ5\OTU=\MTUw\MjIx\MTQ5\MjIz\MjIz\MjEz\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\MjAy\OTE=\OTI=\MTI4\MjAx\OTI=\OTQ=\MTQ5\MTU5\NzM=\MjA4\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MTM4\NzI=\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\NzQ=\NzM=\OTI=\MTU3\MjAy\OTE=\OTI=\MTI4\MjAx\MjIw\OTQ=\MTQ5\MTU5\MjAx\MjIz\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTE=\OTI=\Mjk=\MTA=\NzM=\OTI=\MjIx\MjAy\OTE=\OTI=\MTU3\MjAy\OTA=\OTI=\MTI4\MjAx\MjIw\OTQ=\MTQ5\MTU5\NzM=\MjA0\ODU=\MjE2\MjIz\MjEz\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTA=\OTI=\MjIx\MjAy\OTA=\OTI=\MTI4\MjAx\OTI=\OTQ=\ODU=\MTUy\NzM=\MjA4\ODU=\MjE2\MjY=\MjU0\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\NzM=\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\MTM4\NzM=\OTI=\MTU3\MjAy\OTE=\OTI=\MTI4\MjAx\MjIw\OTQ=\ODU=\MTUy\MjAx\MjIz\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTE=\OTI=\Mjk=\NzQ=\NzQ=\OTI=\MjIx\MjAy\OTE=\OTI=\MTU3\NzQ=\Nzg=\OTI=\MTI4\MjAx\MjIw\OTQ=\ODU=\MTUy\NzM=\MjA0\MTUz\NzM=\ODU=\OTI=\MTU0\MTM3\MTQ0\MTE5\MTU0\NzM=\MTQ1\MTE5\ODU=\MTUy\MjAx\MTk3\MTU3\OQ==\NzQ=\OTI=\OTI=\NzQ=\MjIw\OTI=\Mjk=\MjAy\NzQ=\OTI=\MTM3\OQ==\MjAy\MTE5\ODU=\MTUy\MjAx\MTk4\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\MjAy\OTE=\OTI=\MTI4\MjAx\OTI=\OTQ=\ODU=\MTUy\MjAx\MTk5\ODU=\MjE2\MTQy\MTky\MjE=\MjE2\MjIz\MjEz\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTA=\OTI=\MjIx\MjAy\OTA=\OTI=\MTI4\MjAx\OTI=\OTQ=\MjE=\MTUy\NzM=\MjA4\MjE=\MjE2\MjY=\MjU0\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MTM4\NzQ=\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\NzQ=\NzU=\OTI=\MTU3\MjAy\OTE=\OTI=\MTI4\MjAx\MjIw\OTQ=\MjE=\MTUy\MjAx\MjIz\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTE=\OTI=\Mjk=\MTA=\NzU=\OTI=\MjIx\MjAy\OTE=\OTI=\MTU3\MjAy\NzU=\OTI=\MTI4\MjAx\MjIw\OTQ=\MjE=\MTUy\NzM=\MjA0\MTUz\NzM=\ODU=\OTI=\MTU0\MTM3\MTQ0\MTE5\MTU0\NzM=\MTQ1\MTE5\MjE=\MTUy\MjAx\MTk3\MjE=\MTUy\MTM5\MTk4\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\MjAy\OTE=\OTI=\MTI4\MjAx\OTI=\OTQ=\MjE=\MTUy\MjAx\MTk5\MjE=\ODg=\MTMy\MTky\MjEz\MjE2\MjIz\MjEz\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTA=\OTI=\MjIx\MjAy\OTA=\OTI=\MTI4\MjAx\OTI=\OTQ=\MjEz\MTUy\NzM=\MjA4\MjEz\MjE2\MjY=\MjU0\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MTA=\Njg=\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\MjAy\Njg=\OTI=\MTU3\MjAy\OTE=\OTI=\MTI4\MjAx\MjIw\OTQ=\MjEz\MTUy\MjAx\MjIz\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTE=\OTI=\Mjk=\MTM4\Njg=\OTI=\MjIx\MjAy\OTE=\OTI=\MTU3\MjAy\NzU=\OTI=\MTI4\MjAx\MjIw\OTQ=\MjEz\MTUy\NzM=\MjA0\MTUz\NzM=\ODU=\OTI=\MTU0\MTM3\MTQ0\MTE5\MTU0\NzM=\MTQ1\MTE5\MjEz\MTUy\MjAx\MTk3\MjEz\ODg=\MTMz\MTk4\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\MjAy\OTE=\OTI=\MTI4\MjAx\OTI=\OTQ=\MjEz\MTUy\MjAx\MTk5\MjEz\ODg=\MTMy\MTky\MTUz\NzM=\ODU=\OTI=\MTU0\OQ==\MTMz\MTE5\MTU0\MjAx\MTMz\MTE5\MjEz\MTUy\MjAx\MjM4\MTQ5\MTUy\MTMz\MjIx\MTQ5\MjE2\MjIx\MjEz\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTA=\OTI=\MjIx\MjAy\OTA=\OTI=\MTI4\MjAx\OTI=\OTQ=\MTQ5\MTUy\NzM=\MjA4\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\NzQ=\NzA=\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\MTA=\NzA=\OTI=\MTU3\MjAy\OTE=\OTI=\MTI4\MjAx\MjIw\OTQ=\MTQ5\MTUy\MjAx\MjIz\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTE=\OTI=\Mjk=\MTA=\NzI=\OTI=\MjIx\MjAy\OTE=\OTI=\MTU3\MjAy\NzI=\OTI=\MTI4\MjAx\MjIw\OTQ=\MTQ5\MTUy\NzM=\MjA0\MTQ5\MjE2\MTM0\MjA3\MTUz\NzM=\ODU=\OTI=\MTU0\OQ==\MTQ5\MTE5\MTU0\MjAx\MTQ5\MTE5\MTQ5\MTUy\MjAx\MjA1\ODU=\ODk=\MTUw\MjIx\ODU=\MTUz\MjE2\MjEz\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\MjAy\OTE=\OTI=\MTI4\MjAx\OTI=\OTQ=\ODU=\MTUz\NzM=\MjA4\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MTM4\NzI=\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\NzQ=\NzM=\OTI=\MTU3\MjAy\OTE=\OTI=\MTI4\MjAx\MjIw\OTQ=\ODU=\MTUz\MjAx\MjIz\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTE=\OTI=\Mjk=\MTA=\NzM=\OTI=\MjIx\MjAy\OTE=\OTI=\MTU3\MjAy\OTA=\OTI=\MTI4\MjAx\MjIw\OTQ=\ODU=\MTUz\NzM=\MjA0\MjE=\MTUz\MjE2\MjEz\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTA=\OTI=\MjIx\MjAy\OTA=\OTI=\MTI4\MjAx\OTI=\OTQ=\MjE=\MTUz\NzM=\MjA4\MjE=\MjE3\MjY=\MjU0\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\NzM=\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\MTM4\NzM=\OTI=\MTU3\MjAy\OTE=\OTI=\MTI4\MjAx\MjIw\OTQ=\MjE=\MTUz\MjAx\MjIz\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTE=\OTI=\Mjk=\NzQ=\NzQ=\OTI=\MjIx\MjAy\OTE=\OTI=\MTU3\NzQ=\Nzg=\OTI=\MTI4\MjAx\MjIw\OTQ=\MjE=\MTUz\NzM=\MjA0\MTUz\NzM=\ODU=\OTI=\MTU0\MTM3\MTQ0\MTE5\MTU0\NzM=\MTQ1\MTE5\MjE=\MTUz\MjAx\MTk3\MjE=\MjU=\MTQz\MTk4\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\MjAy\OTE=\OTI=\MTI4\MjAx\OTI=\OTQ=\MjE=\MTUz\MjAx\MTk5\MjE=\MjE3\MTQy\MTky\MjEz\MTUz\MTM0\MjIx\MjEz\MTUz\MjE2\MjEz\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTA=\OTI=\MjIx\MjAy\OTA=\OTI=\MTI4\MjAx\OTI=\OTQ=\MjEz\MTUz\NzM=\MjA4\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\NzQ=\NzE=\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\MTA=\NzE=\OTI=\MTU3\MjAy\OTE=\OTI=\MTI4\MjAx\MjIw\OTQ=\MjEz\MTUz\MjAx\MjIz\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTE=\OTI=\Mjk=\MjAy\NzE=\OTI=\MjIx\MjAy\OTE=\OTI=\MTU3\MTM4\NzE=\OTI=\MTI4\MjAx\MjIw\OTQ=\MjEz\MTUz\NzM=\MjA0\MTUz\NzM=\ODU=\OTI=\MTU0\OQ==\MTQ0\MTE5\MTU0\MjAx\MTQ0\MTE5\MjEz\MTUz\MjAx\MjA1\MTUz\NzM=\ODU=\OTI=\MTU0\MTM3\MTQ0\MTE5\MTU0\NzM=\MTQ1\MTE5\MjEz\MTUz\MjAx\MTk3\MjEz\ODk=\MTI4\MTk4\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\NzQ=\ODI=\OTI=\MjIx\NzQ=\ODI=\OTI=\MTI4\MjAx\OTI=\OTQ=\MjEz\MTUz\MjAx\MTk5\MjEz\MjE3\MTQ2\MTky\MTQ5\MjU=\MTI4\MjIx\MTQ5\MTUz\MjE2\MjEz\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTA=\OTI=\MjIx\MjAy\OTA=\OTI=\MTI4\MjAx\OTI=\OTQ=\MTQ5\MTUz\NzM=\MjA4\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\NjQ=\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\MTM4\NjQ=\OTI=\MTU3\MjAy\OTE=\OTI=\MTI4\MjAx\MjIw\OTQ=\MTQ5\MTUz\MjAx\MjIz\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTE=\OTI=\Mjk=\MjAy\NzE=\OTI=\MjIx\MjAy\OTE=\OTI=\MTU3\MTM4\NzE=\OTI=\MTI4\MjAx\MjIw\OTQ=\MTQ5\MTUz\NzM=\MjA0\MTUz\NzM=\ODU=\OTI=\MTU0\OQ==\MTQ0\MTE5\MTU0\MjAx\MTQ0\MTE5\MTQ5\MTUz\MjAx\MjA1\MTUz\NzM=\ODU=\OTI=\MTU0\MTM3\MTQ0\MTE5\MTU0\NzM=\MTQ1\MTE5\MTQ5\MTUz\MjAx\MTk3\MTQ5\ODk=\MTI5\MTk4\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\NzQ=\ODI=\OTI=\MjIx\NzQ=\ODI=\OTI=\MTI4\MjAx\OTI=\OTQ=\MTQ5\MTUz\MjAx\MTk5\MTQ5\MjE3\MTQ2\MTky\ODU=\MjY=\MTI5\MjIx\ODU=\MTU0\MjE2\MjEz\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTA=\OTI=\MjIx\MjAy\OTA=\OTI=\MTI4\MjAx\OTI=\OTQ=\ODU=\MTU0\NzM=\MjA4\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\NjU=\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\MTA=\NzE=\OTI=\MTU3\MjAy\OTE=\OTI=\MTI4\MjAx\MjIw\OTQ=\ODU=\MTU0\MjAx\MjIz\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTE=\OTI=\Mjk=\MjAy\NzE=\OTI=\MjIx\MjAy\OTE=\OTI=\MTU3\MTM4\NzE=\OTI=\MTI4\MjAx\MjIw\OTQ=\ODU=\MTU0\NzM=\MjA0\MTUz\NzM=\ODU=\OTI=\MTU0\OQ==\MTQ0\MTE5\MTU0\MjAx\MTQ0\MTE5\ODU=\MTU0\MjAx\MjA1\MTUz\NzM=\ODU=\OTI=\MTU0\MTM3\MTQ0\MTE5\MTU0\NzM=\MTQ1\MTE5\ODU=\MTU0\MjAx\MTk3\ODU=\MTU0\MTI5\MTk4\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\NzQ=\ODI=\OTI=\MjIx\NzQ=\ODI=\OTI=\MTI4\MjAx\OTI=\OTQ=\ODU=\MTU0\MjAx\MTk5\ODU=\MjE4\MTQ2\MTky\MjE=\OTA=\MTMw\MjIx\MjE=\MTU0\MjE2\MjEz\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTA=\OTI=\MjIx\MjAy\OTA=\OTI=\MTI4\MjAx\OTI=\OTQ=\MjE=\MTU0\NzM=\MjA4\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MTA=\NjY=\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\MjAy\NjY=\OTI=\MTU3\MjAy\OTE=\OTI=\MTI4\MjAx\MjIw\OTQ=\MjE=\MTU0\MjAx\MjIz\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTE=\OTI=\Mjk=\MjAy\NzE=\OTI=\MjIx\MjAy\OTE=\OTI=\MTU3\MTM4\NzE=\OTI=\MTI4\MjAx\MjIw\OTQ=\MjE=\MTU0\NzM=\MjA0\MTUz\NzM=\ODU=\OTI=\MTU0\OQ==\MTQ0\MTE5\MTU0\MjAx\MTQ0\MTE5\MjE=\MTU0\MjAx\MjA1\MTUz\NzM=\ODU=\OTI=\MTU0\MTM3\MTQ0\MTE5\MTU0\NzM=\MTQ1\MTE5\MjE=\MTU0\MjAx\MTk3\MjE=\MTU0\MTMw\MTk4\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\NzQ=\ODI=\OTI=\MjIx\NzQ=\ODI=\OTI=\MTI4\MjAx\OTI=\OTQ=\MjE=\MTU0\MjAx\MTk5\MjE=\MjE4\MTQ2\MTky\MjEz\OTA=\MTMx\MjIx\MjEz\MTU0\MjE2\MjEz\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTA=\OTI=\MjIx\MjAy\OTA=\OTI=\MTI4\MjAx\OTI=\OTQ=\MjEz\MTU0\NzM=\MjA4\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MTA=\Njc=\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\MjAy\NjY=\OTI=\MTU3\MjAy\OTE=\OTI=\MTI4\MjAx\MjIw\OTQ=\MjEz\MTU0\MjAx\MjIz\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTE=\OTI=\Mjk=\MjAy\NzE=\OTI=\MjIx\MjAy\OTE=\OTI=\MTU3\MTM4\NzE=\OTI=\MTI4\MjAx\MjIw\OTQ=\MjEz\MTU0\NzM=\MjA0\MTUz\NzM=\ODU=\OTI=\MTU0\OQ==\MTQ0\MTE5\MTU0\MjAx\MTQ0\MTE5\MjEz\MTU0\MjAx\MjA1\MTUz\NzM=\ODU=\OTI=\MTU0\MTM3\MTQ0\MTE5\MTU0\NzM=\MTQ1\MTE5\MjEz\MTU0\MjAx\MTk3\MjEz\MjE4\MTMx\MTk4\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\NzQ=\ODI=\OTI=\MjIx\NzQ=\ODI=\OTI=\MTI4\MjAx\OTI=\OTQ=\MjEz\MTU0\MjAx\MTk5\MjEz\MjE4\MTQ2\MTky\MTQ5\MTU0\MTMx\MjIx\MTQ5\MTU0\MjE2\MjEz\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTA=\OTI=\MjIx\MjAy\OTA=\OTI=\MTI4\MjAx\OTI=\OTQ=\MTQ5\MTU0\NzM=\MjA4\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\NzQ=\MTI0\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\MjAy\NjY=\OTI=\MTU3\MjAy\OTE=\OTI=\MTI4\MjAx\MjIw\OTQ=\MTQ5\MTU0\MjAx\MjIz\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTE=\OTI=\Mjk=\MjAy\NzE=\OTI=\MjIx\MjAy\OTE=\OTI=\MTU3\MTM4\NzE=\OTI=\MTI4\MjAx\MjIw\OTQ=\MTQ5\MTU0\NzM=\MjA0\MTUz\NzM=\ODU=\OTI=\MTU0\OQ==\MTQ0\MTE5\MTU0\MjAx\MTQ0\MTE5\MTQ5\MTU0\MjAx\MjA1\MTUz\NzM=\ODU=\OTI=\MTU0\MTM3\MTQ0\MTE5\MTU0\NzM=\MTQ1\MTE5\MTQ5\MTU0\MjAx\MTk3\MTQ5\MjY=\MTg4\MTk4\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\NzQ=\ODI=\OTI=\MjIx\NzQ=\ODI=\OTI=\MTI4\MjAx\OTI=\OTQ=\MTQ5\MTU0\MjAx\MTk5\MTQ5\MjE4\MTQ2\MTky\ODU=\MjE5\MTg4\MjIx\ODU=\MTU1\MjE2\MjEz\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTA=\OTI=\MjIx\MjAy\OTA=\OTI=\MTI4\MjAx\OTI=\OTQ=\ODU=\MTU1\NzM=\MjA4\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\NzQ=\NzE=\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\MTM4\MTI0\OTI=\MTU3\MjAy\OTE=\OTI=\MTI4\MjAx\MjIw\OTQ=\ODU=\MTU1\MjAx\MjIz\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTE=\OTI=\Mjk=\MjAy\NzE=\OTI=\MjIx\MjAy\OTE=\OTI=\MTU3\MTM4\NzE=\OTI=\MTI4\MjAx\MjIw\OTQ=\ODU=\MTU1\NzM=\MjA0\MTUz\NzM=\ODU=\OTI=\MTU0\OQ==\MTQ0\MTE5\MTU0\MjAx\MTQ0\MTE5\ODU=\MTU1\MjAx\MjA1\MTUz\NzM=\ODU=\OTI=\MTU0\MTM3\MTQ0\MTE5\MTU0\NzM=\MTQ1\MTE5\ODU=\MTU1\MjAx\MTk3\ODU=\OTE=\MTg5\MTk4\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\NzQ=\ODI=\OTI=\MjIx\NzQ=\ODI=\OTI=\MTI4\MjAx\OTI=\OTQ=\ODU=\MTU1\MjAx\MTk5\ODU=\MjE5\MTQ2\MTky\MjE=\Mjc=\MTg5\MjIx\MjE=\MjE5\MjIx\MjEz\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTA=\OTI=\MjIx\MjAy\OTA=\OTI=\MTI4\MjAx\OTI=\OTQ=\MjE=\MTU1\NzM=\MjA4\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\NzQ=\NzA=\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\MTA=\NzA=\OTI=\MTU3\MjAy\OTE=\OTI=\MTI4\MjAx\MjIw\OTQ=\MjE=\MTU1\MjAx\MjIz\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTE=\OTI=\Mjk=\MTA=\NzI=\OTI=\MjIx\MjAy\OTE=\OTI=\MTU3\MjAy\NzI=\OTI=\MTI4\MjAx\MjIw\OTQ=\MjE=\MTU1\NzM=\MjA0\MjE=\MjE5\MTM0\MjA3\MTUz\NzM=\ODU=\OTI=\MTU0\OQ==\MTQ5\MTE5\MTU0\MjAx\MTQ5\MTE5\MjE=\MTU1\MjAx\MjA1\MjEz\OTE=\MTUw\MjIx\MjEz\Mjc=\MjE5\MjEz\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\MjAy\OTE=\OTI=\MTI4\MjAx\OTI=\OTQ=\MjEz\MTU1\NzM=\MjA4\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MTM4\NzI=\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\NzQ=\NzM=\OTI=\MTU3\MjAy\OTE=\OTI=\MTI4\MjAx\MjIw\OTQ=\MjEz\MTU1\MjAx\MjIz\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTE=\OTI=\Mjk=\MTA=\NzM=\OTI=\MjIx\MjAy\OTE=\OTI=\MTU3\MjAy\OTA=\OTI=\MTI4\MjAx\MjIw\OTQ=\MjEz\MTU1\NzM=\MjA0\MTQ5\Mjc=\MjE5\MjEz\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTA=\OTI=\MjIx\MjAy\OTA=\OTI=\MTI4\MjAx\OTI=\OTQ=\MTQ5\MTU1\NzM=\MjA4\MTQ5\MjE5\MjY=\MjU0\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\NzM=\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\MTM4\NzM=\OTI=\MTU3\MjAy\OTE=\OTI=\MTI4\MjAx\MjIw\OTQ=\MTQ5\MTU1\MjAx\MjIz\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTE=\OTI=\Mjk=\NzQ=\NzQ=\OTI=\MjIx\MjAy\OTE=\OTI=\MTU3\NzQ=\Nzg=\OTI=\MTI4\MjAx\MjIw\OTQ=\MTQ5\MTU1\NzM=\MjA0\MTUz\NzM=\ODU=\OTI=\MTU0\MTM3\MTQ0\MTE5\MTU0\NzM=\MTQ1\MTE5\MTQ5\MTU1\MjAx\MTk3\MTQ5\MjE5\MTQ1\MTk4\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\MjAy\OTE=\OTI=\MTI4\MjAx\OTI=\OTQ=\MTQ5\MTU1\MjAx\MTk5\MTQ5\MjE5\MTQy\MTky\ODU=\MjEy\MTg5\MjIx\ODU=\MjA=\MjE5\MjEz\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTA=\OTI=\MjIx\MjAy\OTA=\OTI=\MTI4\MjAx\OTI=\OTQ=\ODU=\MTQ4\NzM=\MjA4\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MTM4\MTI1\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\NzQ=\MTI2\OTI=\MTU3\MjAy\OTE=\OTI=\MTI4\MjAx\MjIw\OTQ=\ODU=\MTQ4\MjAx\MjIz\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTE=\OTI=\Mjk=\MTM4\ODc=\OTI=\MjIx\MjAy\OTE=\OTI=\MTU3\NzQ=\ODA=\OTI=\MTI4\MjAx\MjIw\OTQ=\ODU=\MTQ4\NzM=\MjA0\MTUz\NzM=\ODU=\OTI=\MTU0\OQ==\MTQ0\MTE5\MTU0\MjAx\MTQ0\MTE5\ODU=\MTQ4\MjAx\MjA1\MTUz\NzM=\ODU=\OTI=\MTU0\MTM3\MTQ0\MTE5\MTU0\NzM=\MTQ1\MTE5\ODU=\MTQ4\MjAx\MTk3\ODU=\MjA=\MTkw\MTk4\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\NzQ=\ODI=\OTI=\MjIx\NzQ=\ODI=\OTI=\MTI4\MjAx\OTI=\OTQ=\ODU=\MTQ4\MjAx\MTk5\ODU=\MjEy\MTQ2\MTky\MjE=\MjEy\MTkw\MjIx\MjE=\MjA=\MjE5\MjEz\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTA=\OTI=\MjIx\MjAy\OTA=\OTI=\MTI4\MjAx\OTI=\OTQ=\MjE=\MTQ4\NzM=\MjA4\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MTM4\MTI2\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\NzQ=\MTI2\OTI=\MTU3\MjAy\OTE=\OTI=\MTI4\MjAx\MjIw\OTQ=\MjE=\MTQ4\MjAx\MjIz\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTE=\OTI=\Mjk=\MTM4\ODc=\OTI=\MjIx\MjAy\OTE=\OTI=\MTU3\NzQ=\ODA=\OTI=\MTI4\MjAx\MjIw\OTQ=\MjE=\MTQ4\NzM=\MjA0\MTUz\NzM=\ODU=\OTI=\MTU0\OQ==\MTQ0\MTE5\MTU0\MjAx\MTQ0\MTE5\MjE=\MTQ4\MjAx\MjA1\MTUz\NzM=\ODU=\OTI=\MTU0\MTM3\MTQ0\MTE5\MTU0\NzM=\MTQ1\MTE5\MjE=\MTQ4\MjAx\MTk3\MjE=\ODQ=\MTkx\MTk4\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\NzQ=\ODI=\OTI=\MjIx\NzQ=\ODI=\OTI=\MTI4\MjAx\OTI=\OTQ=\MjE=\MTQ4\MjAx\MTk5\MjE=\MjEy\MTQ2\MTky\MjEz\MjA=\MTkx\MjIx\MjEz\MjA=\MjE5\MjEz\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTA=\OTI=\MjIx\MjAy\OTA=\OTI=\MTI4\MjAx\OTI=\OTQ=\MjEz\MTQ4\NzM=\MjA4\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\MTI3\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\NzQ=\MTI2\OTI=\MTU3\MjAy\OTE=\OTI=\MTI4\MjAx\MjIw\OTQ=\MjEz\MTQ4\MjAx\MjIz\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTE=\OTI=\Mjk=\MTM4\ODc=\OTI=\MjIx\MjAy\OTE=\OTI=\MTU3\NzQ=\ODA=\OTI=\MTI4\MjAx\MjIw\OTQ=\MjEz\MTQ4\NzM=\MjA0\MTUz\NzM=\ODU=\OTI=\MTU0\OQ==\MTQ0\MTE5\MTU0\MjAx\MTQ0\MTE5\MjEz\MTQ4\MjAx\MjA1\MTUz\NzM=\ODU=\OTI=\MTU0\MTM3\MTQ0\MTE5\MTU0\NzM=\MTQ1\MTE5\MjEz\MTQ4\MjAx\MTk3\MjEz\MTQ4\MTkx\MTk4\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\NzQ=\ODI=\OTI=\MjIx\NzQ=\ODI=\OTI=\MTI4\MjAx\OTI=\OTQ=\MjEz\MTQ4\MjAx\MTk5\MjEz\MjEy\MTQ2\MTky\MTQ5\ODQ=\MTg0\MjIx\MTQ5\MjA=\MjE5\MjEz\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTA=\OTI=\MjIx\MjAy\OTA=\OTI=\MTI4\MjAx\OTI=\OTQ=\MTQ5\MTQ4\NzM=\MjA4\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MTA=\MTIw\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\MjAy\MTIw\OTI=\MTU3\MjAy\OTE=\OTI=\MTI4\MjAx\MjIw\OTQ=\MTQ5\MTQ4\MjAx\MjIz\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTE=\OTI=\Mjk=\MTM4\ODc=\OTI=\MjIx\MjAy\OTE=\OTI=\MTU3\NzQ=\ODA=\OTI=\MTI4\MjAx\MjIw\OTQ=\MTQ5\MTQ4\NzM=\MjA0\MTUz\NzM=\ODU=\OTI=\MTU0\OQ==\MTQ0\MTE5\MTU0\MjAx\MTQ0\MTE5\MTQ5\MTQ4\MjAx\MjA1\MTUz\NzM=\ODU=\OTI=\MTU0\MTM3\MTQ0\MTE5\MTU0\NzM=\MTQ1\MTE5\MTQ5\MTQ4\MjAx\MTk3\MTQ5\MTQ4\MTg0\MTk4\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\NzQ=\ODI=\OTI=\MjIx\NzQ=\ODI=\OTI=\MTI4\MjAx\OTI=\OTQ=\MTQ5\MTQ4\MjAx\MTk5\MTQ5\MjEy\MTQ2\MTky\ODU=\ODU=\MTg1\MjIx\ODU=\MjE=\MjE5\MjEz\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTA=\OTI=\MjIx\MjAy\OTA=\OTI=\MTI4\MjAx\OTI=\OTQ=\ODU=\MTQ5\NzM=\MjA4\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MTM4\MTI2\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\MTA=\MTIx\OTI=\MTU3\MjAy\OTE=\OTI=\MTI4\MjAx\MjIw\OTQ=\ODU=\MTQ5\MjAx\MjIz\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTE=\OTI=\Mjk=\MTM4\ODc=\OTI=\MjIx\MjAy\OTE=\OTI=\MTU3\NzQ=\ODA=\OTI=\MTI4\MjAx\MjIw\OTQ=\ODU=\MTQ5\NzM=\MjA0\MTUz\NzM=\ODU=\OTI=\MTU0\OQ==\MTQ0\MTE5\MTU0\MjAx\MTQ0\MTE5\ODU=\MTQ5\MjAx\MjA1\MTUz\NzM=\ODU=\OTI=\MTU0\MTM3\MTQ0\MTE5\MTU0\NzM=\MTQ1\MTE5\ODU=\MTQ5\MjAx\MTk3\ODU=\MjEz\MTg1\MTk4\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\NzQ=\ODI=\OTI=\MjIx\NzQ=\ODI=\OTI=\MTI4\MjAx\OTI=\OTQ=\ODU=\MTQ5\MjAx\MTk5\ODU=\MjEz\MTQ2\MTky\MjE=\MTQ5\MTg1\MjIx\MjE=\MjE=\MjE5\MjEz\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTA=\OTI=\MjIx\MjAy\OTA=\OTI=\MTI4\MjAx\OTI=\OTQ=\MjE=\MTQ5\NzM=\MjA4\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MTM4\MTI1\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\MTA=\MTIx\OTI=\MTU3\MjAy\OTE=\OTI=\MTI4\MjAx\MjIw\OTQ=\MjE=\MTQ5\MjAx\MjIz\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTE=\OTI=\Mjk=\MTM4\ODc=\OTI=\MjIx\MjAy\OTE=\OTI=\MTU3\NzQ=\ODA=\OTI=\MTI4\MjAx\MjIw\OTQ=\MjE=\MTQ5\NzM=\MjA0\MTUz\NzM=\ODU=\OTI=\MTU0\OQ==\MTQ0\MTE5\MTU0\MjAx\MTQ0\MTE5\MjE=\MTQ5\MjAx\MjA1\MTUz\NzM=\ODU=\OTI=\MTU0\MTM3\MTQ0\MTE5\MTU0\NzM=\MTQ1\MTE5\MjE=\MTQ5\MjAx\MTk3\MjE=\ODU=\MTg2\MTk4\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\NzQ=\ODI=\OTI=\MjIx\NzQ=\ODI=\OTI=\MTI4\MjAx\OTI=\OTQ=\MjE=\MTQ5\MjAx\MTk5\MjE=\MjEz\MTQ2\MTky\MjEz\MjE=\MTg2\MjIx\MjEz\MjE=\MjE5\MjEz\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTA=\OTI=\MjIx\MjAy\OTA=\OTI=\MTI4\MjAx\OTI=\OTQ=\MjEz\MTQ5\NzM=\MjA4\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MTM4\MTI1\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\MjAy\MTIy\OTI=\MTU3\MjAy\OTE=\OTI=\MTI4\MjAx\MjIw\OTQ=\MjEz\MTQ5\MjAx\MjIz\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTE=\OTI=\Mjk=\MTM4\ODc=\OTI=\MjIx\MjAy\OTE=\OTI=\MTU3\NzQ=\ODA=\OTI=\MTI4\MjAx\MjIw\OTQ=\MjEz\MTQ5\NzM=\MjA0\MTUz\NzM=\ODU=\OTI=\MTU0\OQ==\MTQ0\MTE5\MTU0\MjAx\MTQ0\MTE5\MjEz\MTQ5\MjAx\MjA1\MTUz\NzM=\ODU=\OTI=\MTU0\MTM3\MTQ0\MTE5\MTU0\NzM=\MTQ1\MTE5\MjEz\MTQ5\MjAx\MTk3\MjEz\MTQ5\MTg2\MTk4\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\NzQ=\ODI=\OTI=\MjIx\NzQ=\ODI=\OTI=\MTI4\MjAx\OTI=\OTQ=\MjEz\MTQ5\MjAx\MTk5\MjEz\MjEz\MTQ2\MTky\MTQ5\ODU=\MTg3\MjIx\MTQ5\MjE=\MjE5\MjEz\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTA=\OTI=\MjIx\MjAy\OTA=\OTI=\MTI4\MjAx\OTI=\OTQ=\MTQ5\MTQ5\NzM=\MjA4\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MTA=\MTIz\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\MjAy\MTIz\OTI=\MTU3\MjAy\OTE=\OTI=\MTI4\MjAx\MjIw\OTQ=\MTQ5\MTQ5\MjAx\MjIz\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTE=\OTI=\Mjk=\MTM4\ODc=\OTI=\MjIx\MjAy\OTE=\OTI=\MTU3\NzQ=\ODA=\OTI=\MTI4\MjAx\MjIw\OTQ=\MTQ5\MTQ5\NzM=\MjA0\MTUz\NzM=\ODU=\OTI=\MTU0\OQ==\MTQ0\MTE5\MTU0\MjAx\MTQ0\MTE5\MTQ5\MTQ5\MjAx\MjA1\MTUz\NzM=\ODU=\OTI=\MTU0\MTM3\MTQ0\MTE5\MTU0\NzM=\MTQ1\MTE5\MTQ5\MTQ5\MjAx\MTk3\MTQ5\MTQ5\MTg3\MTk4\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\NzQ=\ODI=\OTI=\MjIx\NzQ=\ODI=\OTI=\MTI4\MjAx\OTI=\OTQ=\MTQ5\MTQ5\MjAx\MTk5\MTQ5\MjEz\MTQ2\MTky\ODU=\ODY=\MTgw\MjIx\ODU=\MjE0\MjIx\MjEz\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTA=\OTI=\MjIx\MjAy\OTA=\OTI=\MTI4\MjAx\OTI=\OTQ=\ODU=\MTUw\NzM=\MjA4\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\NzQ=\NzA=\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\MTA=\NzA=\OTI=\MTU3\MjAy\OTE=\OTI=\MTI4\MjAx\MjIw\OTQ=\ODU=\MTUw\MjAx\MjIz\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTE=\OTI=\Mjk=\MTA=\NzI=\OTI=\MjIx\MjAy\OTE=\OTI=\MTU3\MjAy\NzI=\OTI=\MTI4\MjAx\MjIw\OTQ=\ODU=\MTUw\NzM=\MjA0\ODU=\MjE0\MTM0\MjA3\MTUz\NzM=\ODU=\OTI=\MTU0\OQ==\MTQ5\MTE5\MTU0\MjAx\MTQ5\MTE5\ODU=\MTUw\MjAx\MjA1\MjE=\ODY=\MTUw\MjIx\MjE=\ODY=\MjE0\MjEz\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\MjAy\OTE=\OTI=\MTI4\MjAx\OTI=\OTQ=\MjE=\MTUw\NzM=\MjA4\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MTM4\NzI=\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\NzQ=\NzM=\OTI=\MTU3\MjAy\OTE=\OTI=\MTI4\MjAx\MjIw\OTQ=\MjE=\MTUw\MjAx\MjIz\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTE=\OTI=\Mjk=\MTA=\NzM=\OTI=\MjIx\MjAy\OTE=\OTI=\MTU3\MjAy\OTA=\OTI=\MTI4\MjAx\MjIw\OTQ=\MjE=\MTUw\NzM=\MjA0\MjEz\ODY=\MjE0\MjEz\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTA=\OTI=\MjIx\MjAy\OTA=\OTI=\MTI4\MjAx\OTI=\OTQ=\MjEz\MTUw\NzM=\MjA4\MjEz\MjE0\MjY=\MjU0\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\NzM=\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\MTM4\NzM=\OTI=\MTU3\MjAy\OTE=\OTI=\MTI4\MjAx\MjIw\OTQ=\MjEz\MTUw\MjAx\MjIz\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTE=\OTI=\Mjk=\NzQ=\NzQ=\OTI=\MjIx\MjAy\OTE=\OTI=\MTU3\NzQ=\Nzg=\OTI=\MTI4\MjAx\MjIw\OTQ=\MjEz\MTUw\NzM=\MjA0\MTUz\NzM=\ODU=\OTI=\MTU0\MTM3\MTQ0\MTE5\MTU0\NzM=\MTQ1\MTE5\MjEz\MTUw\MjAx\MTk3\MjEz\MjI=\MTgw\MTk4\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\MjAy\OTE=\OTI=\MTI4\MjAx\OTI=\OTQ=\MjEz\MTUw\MjAx\MTk5\MjEz\MjE0\MTQy\MTky\MTQ5\MjE0\MTgw\MjIx\MTQ5\ODY=\MjE0\MjEz\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTA=\OTI=\MjIx\MjAy\OTA=\OTI=\MTI4\MjAx\OTI=\OTQ=\MTQ5\MTUw\NzM=\MjA4\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MTM4\MTE2\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\NzQ=\MTE3\OTI=\MTU3\MjAy\OTE=\OTI=\MTI4\MjAx\MjIw\OTQ=\MTQ5\MTUw\MjAx\MjIz\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTE=\OTI=\Mjk=\MTA=\MTE3\OTI=\MjIx\MjAy\OTE=\OTI=\MTU3\MjAy\MTE3\OTI=\MTI4\MjAx\MjIw\OTQ=\MTQ5\MTUw\NzM=\MjA0\MTUz\NzM=\ODU=\OTI=\MTU0\OQ==\MTQ0\MTE5\MTU0\MjAx\MTQ0\MTE5\MTQ5\MTUw\MjAx\MjA1\MTUz\NzM=\ODU=\OTI=\MTU0\MTM3\MTQ0\MTE5\MTU0\NzM=\MTQ1\MTE5\MTQ5\MTUw\MjAx\MTk3\MTQ5\MTUw\MTgx\MTk4\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\NzQ=\ODI=\OTI=\MjIx\NzQ=\ODI=\OTI=\MTI4\MjAx\OTI=\OTQ=\MTQ5\MTUw\MjAx\MTk5\MTQ5\MjE0\MTQ2\MTky\ODU=\ODc=\MTgy\MjIx\ODU=\ODc=\MjE0\MjEz\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTA=\OTI=\MjIx\MjAy\OTA=\OTI=\MTI4\MjAx\OTI=\OTQ=\ODU=\MTUx\NzM=\MjA4\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MTA=\MTE4\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\NzQ=\MTE3\OTI=\MTU3\MjAy\OTE=\OTI=\MTI4\MjAx\MjIw\OTQ=\ODU=\MTUx\MjAx\MjIz\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTE=\OTI=\Mjk=\MTA=\MTE3\OTI=\MjIx\MjAy\OTE=\OTI=\MTU3\MjAy\MTE3\OTI=\MTI4\MjAx\MjIw\OTQ=\ODU=\MTUx\NzM=\MjA0\MTUz\NzM=\ODU=\OTI=\MTU0\OQ==\MTQ0\MTE5\MTU0\MjAx\MTQ0\MTE5\ODU=\MTUx\MjAx\MjA1\MTUz\NzM=\ODU=\OTI=\MTU0\MTM3\MTQ0\MTE5\MTU0\NzM=\MTQ1\MTE5\ODU=\MTUx\MjAx\MTk3\ODU=\MjE1\MTgy\MTk4\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\NzQ=\ODI=\OTI=\MjIx\NzQ=\ODI=\OTI=\MTI4\MjAx\OTI=\OTQ=\ODU=\MTUx\MjAx\MTk5\ODU=\MjE1\MTQ2\MTky\MjE=\MTUx\MTgy\MjIx\MjE=\ODc=\MjE0\MjEz\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTA=\OTI=\MjIx\MjAy\OTA=\OTI=\MTI4\MjAx\OTI=\OTQ=\MjE=\MTUx\NzM=\MjA4\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\NzQ=\MTE5\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\NzQ=\MTE3\OTI=\MTU3\MjAy\OTE=\OTI=\MTI4\MjAx\MjIw\OTQ=\MjE=\MTUx\MjAx\MjIz\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTE=\OTI=\Mjk=\MTA=\MTE3\OTI=\MjIx\MjAy\OTE=\OTI=\MTU3\MjAy\MTE3\OTI=\MTI4\MjAx\MjIw\OTQ=\MjE=\MTUx\NzM=\MjA0\MTUz\NzM=\ODU=\OTI=\MTU0\OQ==\MTQ0\MTE5\MTU0\MjAx\MTQ0\MTE5\MjE=\MTUx\MjAx\MjA1\MTUz\NzM=\ODU=\OTI=\MTU0\MTM3\MTQ0\MTE5\MTU0\NzM=\MTQ1\MTE5\MjE=\MTUx\MjAx\MTk3\MjE=\MjM=\MTgz\MTk4\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\NzQ=\ODI=\OTI=\MjIx\NzQ=\ODI=\OTI=\MTI4\MjAx\OTI=\OTQ=\MjE=\MTUx\MjAx\MTk5\MjE=\MjE1\MTQ2\MTky\MjEz\MjE1\MTgz\MjIx\MjEz\ODc=\MjE0\MjEz\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTA=\OTI=\MjIx\MjAy\OTA=\OTI=\MTI4\MjAx\OTI=\OTQ=\MjEz\MTUx\NzM=\MjA4\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MTM4\MTE2\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\MTM4\MTE5\OTI=\MTU3\MjAy\OTE=\OTI=\MTI4\MjAx\MjIw\OTQ=\MjEz\MTUx\MjAx\MjIz\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTE=\OTI=\Mjk=\MTA=\MTE3\OTI=\MjIx\MjAy\OTE=\OTI=\MTU3\MjAy\MTE3\OTI=\MTI4\MjAx\MjIw\OTQ=\MjEz\MTUx\NzM=\MjA0\MTUz\NzM=\ODU=\OTI=\MTU0\OQ==\MTQ0\MTE5\MTU0\MjAx\MTQ0\MTE5\MjEz\MTUx\MjAx\MjA1\MTUz\NzM=\ODU=\OTI=\MTU0\MTM3\MTQ0\MTE5\MTU0\NzM=\MTQ1\MTE5\MjEz\MTUx\MjAx\MTk3\MjEz\ODc=\MTc2\MTk4\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\NzQ=\ODI=\OTI=\MjIx\NzQ=\ODI=\OTI=\MTI4\MjAx\OTI=\OTQ=\MjEz\MTUx\MjAx\MTk5\MjEz\MjE1\MTQ2\MTky\MTQ5\MjM=\MTc2\MjIx\MTQ5\ODc=\MjE0\MjEz\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTA=\OTI=\MjIx\MjAy\OTA=\OTI=\MTI4\MjAx\OTI=\OTQ=\MTQ5\MTUx\NzM=\MjA4\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\MTEy\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\MTM4\MTE5\OTI=\MTU3\MjAy\OTE=\OTI=\MTI4\MjAx\MjIw\OTQ=\MTQ5\MTUx\MjAx\MjIz\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTE=\OTI=\Mjk=\MTA=\MTE3\OTI=\MjIx\MjAy\OTE=\OTI=\MTU3\MjAy\MTE3\OTI=\MTI4\MjAx\MjIw\OTQ=\MTQ5\MTUx\NzM=\MjA0\MTUz\NzM=\ODU=\OTI=\MTU0\OQ==\MTQ0\MTE5\MTU0\MjAx\MTQ0\MTE5\MTQ5\MTUx\MjAx\MjA1\MTUz\NzM=\ODU=\OTI=\MTU0\MTM3\MTQ0\MTE5\MTU0\NzM=\MTQ1\MTE5\MTQ5\MTUx\MjAx\MTk3\MTQ5\MTUx\MTc2\MTk4\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\NzQ=\ODI=\OTI=\MjIx\NzQ=\ODI=\OTI=\MTI4\MjAx\OTI=\OTQ=\MTQ5\MTUx\MjAx\MTk5\MTQ5\MjE1\MTQ2\MTky\ODU=\ODA=\MTc3\MjIx\ODU=\ODA=\MjE0\MjEz\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTA=\OTI=\MjIx\MjAy\OTA=\OTI=\MTI4\MjAx\OTI=\OTQ=\ODU=\MTQ0\NzM=\MjA4\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MTA=\MTEz\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\MTM4\MTE5\OTI=\MTU3\MjAy\OTE=\OTI=\MTI4\MjAx\MjIw\OTQ=\ODU=\MTQ0\MjAx\MjIz\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTE=\OTI=\Mjk=\MTA=\MTE3\OTI=\MjIx\MjAy\OTE=\OTI=\MTU3\MjAy\MTE3\OTI=\MTI4\MjAx\MjIw\OTQ=\ODU=\MTQ0\NzM=\MjA0\MTUz\NzM=\ODU=\OTI=\MTU0\OQ==\MTQ0\MTE5\MTU0\MjAx\MTQ0\MTE5\ODU=\MTQ0\MjAx\MjA1\MTUz\NzM=\ODU=\OTI=\MTU0\MTM3\MTQ0\MTE5\MTU0\NzM=\MTQ1\MTE5\ODU=\MTQ0\MjAx\MTk3\ODU=\MjA4\MTc3\MTk4\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\NzQ=\ODI=\OTI=\MjIx\NzQ=\ODI=\OTI=\MTI4\MjAx\OTI=\OTQ=\ODU=\MTQ0\MjAx\MTk5\ODU=\MjA4\MTQ2\MTky\MjE=\MTQ0\MTc3\MjIx\MjE=\ODA=\MjE0\MjEz\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTA=\OTI=\MjIx\MjAy\OTA=\OTI=\MTI4\MjAx\OTI=\OTQ=\MjE=\MTQ0\NzM=\MjA4\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MTM4\MTE2\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\NzQ=\MTE0\OTI=\MTU3\MjAy\OTE=\OTI=\MTI4\MjAx\MjIw\OTQ=\MjE=\MTQ0\MjAx\MjIz\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTE=\OTI=\Mjk=\MTA=\MTE3\OTI=\MjIx\MjAy\OTE=\OTI=\MTU3\MjAy\MTE3\OTI=\MTI4\MjAx\MjIw\OTQ=\MjE=\MTQ0\NzM=\MjA0\MTUz\NzM=\ODU=\OTI=\MTU0\OQ==\MTQ0\MTE5\MTU0\MjAx\MTQ0\MTE5\MjE=\MTQ0\MjAx\MjA1\MTUz\NzM=\ODU=\OTI=\MTU0\MTM3\MTQ0\MTE5\MTU0\NzM=\MTQ1\MTE5\MjE=\MTQ0\MjAx\MTk3\MjE=\MTY=\MTc4\MTk4\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\NzQ=\ODI=\OTI=\MjIx\NzQ=\ODI=\OTI=\MTI4\MjAx\OTI=\OTQ=\MjE=\MTQ0\MjAx\MTk5\MjE=\MjA4\MTQ2\MTky\MjEz\MjA4\MTc4\MjIx\MjEz\MjA4\MjIx\MjEz\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTA=\OTI=\MjIx\MjAy\OTA=\OTI=\MTI4\MjAx\OTI=\OTQ=\MjEz\MTQ0\NzM=\MjA4\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\NzQ=\NzA=\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\MTA=\NzA=\OTI=\MTU3\MjAy\OTE=\OTI=\MTI4\MjAx\MjIw\OTQ=\MjEz\MTQ0\MjAx\MjIz\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTE=\OTI=\Mjk=\MTA=\NzI=\OTI=\MjIx\MjAy\OTE=\OTI=\MTU3\MjAy\NzI=\OTI=\MTI4\MjAx\MjIw\OTQ=\MjEz\MTQ0\NzM=\MjA0\MjEz\MjA4\MTM0\MjA3\MTUz\NzM=\ODU=\OTI=\MTU0\OQ==\MTQ5\MTE5\MTU0\MjAx\MTQ5\MTE5\MjEz\MTQ0\MjAx\MjA1\MTQ5\ODA=\MTUw\MjIx\MTQ5\MjA4\MjA4\MjEz\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\MjAy\OTE=\OTI=\MTI4\MjAx\OTI=\OTQ=\MTQ5\MTQ0\NzM=\MjA4\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MTM4\NzI=\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\NzQ=\NzM=\OTI=\MTU3\MjAy\OTE=\OTI=\MTI4\MjAx\MjIw\OTQ=\MTQ5\MTQ0\MjAx\MjIz\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTE=\OTI=\Mjk=\MTA=\NzM=\OTI=\MjIx\MjAy\OTE=\OTI=\MTU3\MjAy\OTA=\OTI=\MTI4\MjAx\MjIw\OTQ=\MTQ5\MTQ0\NzM=\MjA0\ODU=\MjA5\MjA4\MjEz\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTA=\OTI=\MjIx\MjAy\OTA=\OTI=\MTI4\MjAx\OTI=\OTQ=\ODU=\MTQ1\NzM=\MjA4\ODU=\MjA5\MjY=\MjU0\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\NzM=\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\MTM4\NzM=\OTI=\MTU3\MjAy\OTE=\OTI=\MTI4\MjAx\MjIw\OTQ=\ODU=\MTQ1\MjAx\MjIz\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTE=\OTI=\Mjk=\NzQ=\NzQ=\OTI=\MjIx\MjAy\OTE=\OTI=\MTU3\NzQ=\Nzg=\OTI=\MTI4\MjAx\MjIw\OTQ=\ODU=\MTQ1\NzM=\MjA0\MTUz\NzM=\ODU=\OTI=\MTU0\MTM3\MTQ0\MTE5\MTU0\NzM=\MTQ1\MTE5\ODU=\MTQ1\MjAx\MTk3\ODU=\MTQ1\MTQw\MTk4\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\MjAy\OTE=\OTI=\MTI4\MjAx\OTI=\OTQ=\ODU=\MTQ1\MjAx\MTk5\ODU=\MjA5\MTQy\MTky\MjE=\MTQ1\MTc4\MjIx\MjE=\MjA5\MjA4\MjEz\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTA=\OTI=\MjIx\MjAy\OTA=\OTI=\MTI4\MjAx\OTI=\OTQ=\MjE=\MTQ1\NzM=\MjA4\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MTM4\MTI1\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\NzQ=\MTI2\OTI=\MTU3\MjAy\OTE=\OTI=\MTI4\MjAx\MjIw\OTQ=\MjE=\MTQ1\MjAx\MjIz\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTE=\OTI=\Mjk=\MTM4\ODc=\OTI=\MjIx\MjAy\OTE=\OTI=\MTU3\NzQ=\ODA=\OTI=\MTI4\MjAx\MjIw\OTQ=\MjE=\MTQ1\NzM=\MjA0\MTUz\NzM=\ODU=\OTI=\MTU0\OQ==\MTQ0\MTE5\MTU0\MjAx\MTQ0\MTE5\MjE=\MTQ1\MjAx\MjA1\MTUz\NzM=\ODU=\OTI=\MTU0\MTM3\MTQ0\MTE5\MTU0\NzM=\MTQ1\MTE5\MjE=\MTQ1\MjAx\MTk3\MjE=\ODE=\MTc5\MTk4\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\NzQ=\ODI=\OTI=\MjIx\NzQ=\ODI=\OTI=\MTI4\MjAx\OTI=\OTQ=\MjE=\MTQ1\MjAx\MTk5\MjE=\MjA5\MTQ2\MTky\MjEz\MTc=\MTc5\MjIx\MjEz\MjA5\MjA4\MjEz\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTA=\OTI=\MjIx\MjAy\OTA=\OTI=\MTI4\MjAx\OTI=\OTQ=\MjEz\MTQ1\NzM=\MjA4\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MTM4\MTI2\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\NzQ=\MTI2\OTI=\MTU3\MjAy\OTE=\OTI=\MTI4\MjAx\MjIw\OTQ=\MjEz\MTQ1\MjAx\MjIz\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTE=\OTI=\Mjk=\MTM4\ODc=\OTI=\MjIx\MjAy\OTE=\OTI=\MTU3\NzQ=\ODA=\OTI=\MTI4\MjAx\MjIw\OTQ=\MjEz\MTQ1\NzM=\MjA0\MTUz\NzM=\ODU=\OTI=\MTU0\OQ==\MTQ0\MTE5\MTU0\MjAx\MTQ0\MTE5\MjEz\MTQ1\MjAx\MjA1\MTUz\NzM=\ODU=\OTI=\MTU0\MTM3\MTQ0\MTE5\MTU0\NzM=\MTQ1\MTE5\MjEz\MTQ1\MjAx\MTk3\MjEz\MjA5\MTc5\MTk4\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\NzQ=\ODI=\OTI=\MjIx\NzQ=\ODI=\OTI=\MTI4\MjAx\OTI=\OTQ=\MjEz\MTQ1\MjAx\MTk5\MjEz\MjA5\MTQ2\MTky\MTQ5\MTQ1\MTc5\MjIx\MTQ5\MjA5\MjA4\MjEz\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTA=\OTI=\MjIx\MjAy\OTA=\OTI=\MTI4\MjAx\OTI=\OTQ=\MTQ5\MTQ1\NzM=\MjA4\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\NzQ=\MTA4\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\NzQ=\MTI2\OTI=\MTU3\MjAy\OTE=\OTI=\MTI4\MjAx\MjIw\OTQ=\MTQ5\MTQ1\MjAx\MjIz\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTE=\OTI=\Mjk=\MTM4\ODc=\OTI=\MjIx\MjAy\OTE=\OTI=\MTU3\NzQ=\ODA=\OTI=\MTI4\MjAx\MjIw\OTQ=\MTQ5\MTQ1\NzM=\MjA0\MTUz\NzM=\ODU=\OTI=\MTU0\OQ==\MTQ0\MTE5\MTU0\MjAx\MTQ0\MTE5\MTQ5\MTQ1\MjAx\MjA1\MTUz\NzM=\ODU=\OTI=\MTU0\MTM3\MTQ0\MTE5\MTU0\NzM=\MTQ1\MTE5\MTQ5\MTQ1\MjAx\MTk3\MTQ5\MTc=\MTcy\MTk4\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\NzQ=\ODI=\OTI=\MjIx\NzQ=\ODI=\OTI=\MTI4\MjAx\OTI=\OTQ=\MTQ5\MTQ1\MjAx\MTk5\MTQ5\MjA5\MTQ2\MTky\ODU=\MjEw\MTcy\MjIx\ODU=\MjEw\MjA4\MjEz\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTA=\OTI=\MjIx\MjAy\OTA=\OTI=\MTI4\MjAx\OTI=\OTQ=\ODU=\MTQ2\NzM=\MjA4\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MTM4\MTI1\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\MTM4\MTA4\OTI=\MTU3\MjAy\OTE=\OTI=\MTI4\MjAx\MjIw\OTQ=\ODU=\MTQ2\MjAx\MjIz\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTE=\OTI=\Mjk=\MTM4\ODc=\OTI=\MjIx\MjAy\OTE=\OTI=\MTU3\NzQ=\ODA=\OTI=\MTI4\MjAx\MjIw\OTQ=\ODU=\MTQ2\NzM=\MjA0\MTUz\NzM=\ODU=\OTI=\MTU0\OQ==\MTQ0\MTE5\MTU0\MjAx\MTQ0\MTE5\ODU=\MTQ2\MjAx\MjA1\MTUz\NzM=\ODU=\OTI=\MTU0\MTM3\MTQ0\MTE5\MTU0\NzM=\MTQ1\MTE5\ODU=\MTQ2\MjAx\MTk3\ODU=\ODI=\MTcz\MTk4\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\NzQ=\ODI=\OTI=\MjIx\NzQ=\ODI=\OTI=\MTI4\MjAx\OTI=\OTQ=\ODU=\MTQ2\MjAx\MTk5\ODU=\MjEw\MTQ2\MTky\MjE=\MTg=\MTcz\MjIx\MjE=\MjEw\MjA4\MjEz\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTA=\OTI=\MjIx\MjAy\OTA=\OTI=\MTI4\MjAx\OTI=\OTQ=\MjE=\MTQ2\NzM=\MjA4\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\MTA5\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\MTM4\MTA5\OTI=\MTU3\MjAy\OTE=\OTI=\MTI4\MjAx\MjIw\OTQ=\MjE=\MTQ2\MjAx\MjIz\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTE=\OTI=\Mjk=\MTM4\ODc=\OTI=\MjIx\MjAy\OTE=\OTI=\MTU3\NzQ=\ODA=\OTI=\MTI4\MjAx\MjIw\OTQ=\MjE=\MTQ2\NzM=\MjA0\MTUz\NzM=\ODU=\OTI=\MTU0\OQ==\MTQ0\MTE5\MTU0\MjAx\MTQ0\MTE5\MjE=\MTQ2\MjAx\MjA1\MTUz\NzM=\ODU=\OTI=\MTU0\MTM3\MTQ0\MTE5\MTU0\NzM=\MTQ1\MTE5\MjE=\MTQ2\MjAx\MTk3\MjE=\ODI=\MTc0\MTk4\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\NzQ=\ODI=\OTI=\MjIx\NzQ=\ODI=\OTI=\MTI4\MjAx\OTI=\OTQ=\MjE=\MTQ2\MjAx\MTk5\MjE=\MjEw\MTQ2\MTky\MjEz\MTg=\MTc0\MjIx\MjEz\MjEw\MjA4\MjEz\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTA=\OTI=\MjIx\MjAy\OTA=\OTI=\MTI4\MjAx\OTI=\OTQ=\MjEz\MTQ2\NzM=\MjA4\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\MTEw\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\MTM4\MTA5\OTI=\MTU3\MjAy\OTE=\OTI=\MTI4\MjAx\MjIw\OTQ=\MjEz\MTQ2\MjAx\MjIz\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTE=\OTI=\Mjk=\MTM4\ODc=\OTI=\MjIx\MjAy\OTE=\OTI=\MTU3\NzQ=\ODA=\OTI=\MTI4\MjAx\MjIw\OTQ=\MjEz\MTQ2\NzM=\MjA0\MTUz\NzM=\ODU=\OTI=\MTU0\OQ==\MTQ0\MTE5\MTU0\MjAx\MTQ0\MTE5\MjEz\MTQ2\MjAx\MjA1\MTUz\NzM=\ODU=\OTI=\MTU0\MTM3\MTQ0\MTE5\MTU0\NzM=\MTQ1\MTE5\MjEz\MTQ2\MjAx\MTk3\MjEz\MTQ2\MTc0\MTk4\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\NzQ=\ODI=\OTI=\MjIx\NzQ=\ODI=\OTI=\MTI4\MjAx\OTI=\OTQ=\MjEz\MTQ2\MjAx\MTk5\MjEz\MjEw\MTQ2\MTky\MTQ5\ODI=\MTc1\MjIx\MTQ5\MjEw\MjA4\MjEz\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTA=\OTI=\MjIx\MjAy\OTA=\OTI=\MTI4\MjAx\OTI=\OTQ=\MTQ5\MTQ2\NzM=\MjA4\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MTM4\MTI1\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\MTA=\MTEx\OTI=\MTU3\MjAy\OTE=\OTI=\MTI4\MjAx\MjIw\OTQ=\MTQ5\MTQ2\MjAx\MjIz\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTE=\OTI=\Mjk=\MTM4\ODc=\OTI=\MjIx\MjAy\OTE=\OTI=\MTU3\NzQ=\ODA=\OTI=\MTI4\MjAx\MjIw\OTQ=\MTQ5\MTQ2\NzM=\MjA0\MTUz\NzM=\ODU=\OTI=\MTU0\OQ==\MTQ0\MTE5\MTU0\MjAx\MTQ0\MTE5\MTQ5\MTQ2\MjAx\MjA1\MTUz\NzM=\ODU=\OTI=\MTU0\MTM3\MTQ0\MTE5\MTU0\NzM=\MTQ1\MTE5\MTQ5\MTQ2\MjAx\MTk3\MTQ5\MjEw\MTc1\MTk4\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\NzQ=\ODI=\OTI=\MjIx\NzQ=\ODI=\OTI=\MTI4\MjAx\OTI=\OTQ=\MTQ5\MTQ2\MjAx\MTk5\MTQ5\MjEw\MTQ2\MTky\ODU=\MTQ3\MTc1\MjIx\ODU=\MjEx\MjA4\MjEz\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTA=\OTI=\MjIx\MjAy\OTA=\OTI=\MTI4\MjAx\OTI=\OTQ=\ODU=\MTQ3\NzM=\MjA4\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MTM4\MTI1\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\NzQ=\MTA0\OTI=\MTU3\MjAy\OTE=\OTI=\MTI4\MjAx\MjIw\OTQ=\ODU=\MTQ3\MjAx\MjIz\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTE=\OTI=\Mjk=\MTM4\ODc=\OTI=\MjIx\MjAy\OTE=\OTI=\MTU3\NzQ=\ODA=\OTI=\MTI4\MjAx\MjIw\OTQ=\ODU=\MTQ3\NzM=\MjA0\MTUz\NzM=\ODU=\OTI=\MTU0\OQ==\MTQ0\MTE5\MTU0\MjAx\MTQ0\MTE5\ODU=\MTQ3\MjAx\MjA1\MTUz\NzM=\ODU=\OTI=\MTU0\MTM3\MTQ0\MTE5\MTU0\NzM=\MTQ1\MTE5\ODU=\MTQ3\MjAx\MTk3\ODU=\MTk=\MTY4\MTk4\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\NzQ=\ODI=\OTI=\MjIx\NzQ=\ODI=\OTI=\MTI4\MjAx\OTI=\OTQ=\ODU=\MTQ3\MjAx\MTk5\ODU=\MjEx\MTQ2\MTky\MjE=\MjEx\MTY4\MjIx\MjE=\MjEx\MjA4\MjEz\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTA=\OTI=\MjIx\MjAy\OTA=\OTI=\MTI4\MjAx\OTI=\OTQ=\MjE=\MTQ3\NzM=\MjA4\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\MTA5\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\MTM4\MTA0\OTI=\MTU3\MjAy\OTE=\OTI=\MTI4\MjAx\MjIw\OTQ=\MjE=\MTQ3\MjAx\MjIz\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTE=\OTI=\Mjk=\MTM4\ODc=\OTI=\MjIx\MjAy\OTE=\OTI=\MTU3\NzQ=\ODA=\OTI=\MTI4\MjAx\MjIw\OTQ=\MjE=\MTQ3\NzM=\MjA0\MTUz\NzM=\ODU=\OTI=\MTU0\OQ==\MTQ0\MTE5\MTU0\MjAx\MTQ0\MTE5\MjE=\MTQ3\MjAx\MjA1\MTUz\NzM=\ODU=\OTI=\MTU0\MTM3\MTQ0\MTE5\MTU0\NzM=\MTQ1\MTE5\MjE=\MTQ3\MjAx\MTk3\MjE=\ODM=\MTY5\MTk4\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\NzQ=\ODI=\OTI=\MjIx\NzQ=\ODI=\OTI=\MTI4\MjAx\OTI=\OTQ=\MjE=\MTQ3\MjAx\MTk5\MjE=\MjEx\MTQ2\MTky\MjEz\MTk=\MTY5\MjIx\MjEz\MjEx\MjA4\MjEz\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTA=\OTI=\MjIx\MjAy\OTA=\OTI=\MTI4\MjAx\OTI=\OTQ=\MjEz\MTQ3\NzM=\MjA4\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\MTI3\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\NzQ=\MTA0\OTI=\MTU3\MjAy\OTE=\OTI=\MTI4\MjAx\MjIw\OTQ=\MjEz\MTQ3\MjAx\MjIz\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTE=\OTI=\Mjk=\MTM4\ODc=\OTI=\MjIx\MjAy\OTE=\OTI=\MTU3\NzQ=\ODA=\OTI=\MTI4\MjAx\MjIw\OTQ=\MjEz\MTQ3\NzM=\MjA0\MTUz\NzM=\ODU=\OTI=\MTU0\OQ==\MTQ0\MTE5\MTU0\MjAx\MTQ0\MTE5\MjEz\MTQ3\MjAx\MjA1\MTUz\NzM=\ODU=\OTI=\MTU0\MTM3\MTQ0\MTE5\MTU0\NzM=\MTQ1\MTE5\MjEz\MTQ3\MjAx\MTk3\MjEz\MjEx\MTY5\MTk4\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\NzQ=\ODI=\OTI=\MjIx\NzQ=\ODI=\OTI=\MTI4\MjAx\OTI=\OTQ=\MjEz\MTQ3\MjAx\MTk5\MjEz\MjEx\MTQ2\MTky\MTQ5\MTQ3\MTY5\MjIx\MTQ5\MjEx\MjA4\MjEz\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTA=\OTI=\MjIx\MjAy\OTA=\OTI=\MTI4\MjAx\OTI=\OTQ=\MTQ5\MTQ3\NzM=\MjA4\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MTM4\MTI1\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\NzQ=\MTA2\OTI=\MTU3\MjAy\OTE=\OTI=\MTI4\MjAx\MjIw\OTQ=\MTQ5\MTQ3\MjAx\MjIz\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTE=\OTI=\Mjk=\MTM4\ODc=\OTI=\MjIx\MjAy\OTE=\OTI=\MTU3\NzQ=\ODA=\OTI=\MTI4\MjAx\MjIw\OTQ=\MTQ5\MTQ3\NzM=\MjA0\MTUz\NzM=\ODU=\OTI=\MTU0\OQ==\MTQ0\MTE5\MTU0\MjAx\MTQ0\MTE5\MTQ5\MTQ3\MjAx\MjA1\MTUz\NzM=\ODU=\OTI=\MTU0\MTM3\MTQ0\MTE5\MTU0\NzM=\MTQ1\MTE5\MTQ5\MTQ3\MjAx\MTk3\MTQ5\MTk=\MTcw\MTk4\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\NzQ=\ODI=\OTI=\MjIx\NzQ=\ODI=\OTI=\MTI4\MjAx\OTI=\OTQ=\MTQ5\MTQ3\MjAx\MTk5\MTQ5\MjEx\MTQ2\MTky\ODU=\MjA0\MTcw\MjIx\ODU=\MjA0\MjA4\MjEz\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTA=\OTI=\MjIx\MjAy\OTA=\OTI=\MTI4\MjAx\OTI=\OTQ=\ODU=\MTQw\NzM=\MjA4\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MTM4\MTA2\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\NzQ=\MTA3\OTI=\MTU3\MjAy\OTE=\OTI=\MTI4\MjAx\MjIw\OTQ=\ODU=\MTQw\MjAx\MjIz\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTE=\OTI=\Mjk=\MTM4\ODc=\OTI=\MjIx\MjAy\OTE=\OTI=\MTU3\NzQ=\ODA=\OTI=\MTI4\MjAx\MjIw\OTQ=\ODU=\MTQw\NzM=\MjA0\MTUz\NzM=\ODU=\OTI=\MTU0\OQ==\MTQ0\MTE5\MTU0\MjAx\MTQ0\MTE5\ODU=\MTQw\MjAx\MjA1\MTUz\NzM=\ODU=\OTI=\MTU0\MTM3\MTQ0\MTE5\MTU0\NzM=\MTQ1\MTE5\ODU=\MTQw\MjAx\MTk3\ODU=\MTI=\MTcx\MTk4\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\NzQ=\ODI=\OTI=\MjIx\NzQ=\ODI=\OTI=\MTI4\MjAx\OTI=\OTQ=\ODU=\MTQw\MjAx\MTk5\ODU=\MjA0\MTQ2\MTky\MjE=\MjA0\MTcx\MjIx\MjE=\MjA0\MjA4\MjEz\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTA=\OTI=\MjIx\MjAy\OTA=\OTI=\MTI4\MjAx\OTI=\OTQ=\MjE=\MTQw\NzM=\MjA4\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\MTEw\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\NzQ=\MTA2\OTI=\MTU3\MjAy\OTE=\OTI=\MTI4\MjAx\MjIw\OTQ=\MjE=\MTQw\MjAx\MjIz\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTE=\OTI=\Mjk=\MTM4\ODc=\OTI=\MjIx\MjAy\OTE=\OTI=\MTU3\NzQ=\ODA=\OTI=\MTI4\MjAx\MjIw\OTQ=\MjE=\MTQw\NzM=\MjA0\MTUz\NzM=\ODU=\OTI=\MTU0\OQ==\MTQ0\MTE5\MTU0\MjAx\MTQ0\MTE5\MjE=\MTQw\MjAx\MjA1\MTUz\NzM=\ODU=\OTI=\MTU0\MTM3\MTQ0\MTE5\MTU0\NzM=\MTQ1\MTE5\MjE=\MTQw\MjAx\MTk3\MjE=\MTQw\MTcx\MTk4\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\NzQ=\ODI=\OTI=\MjIx\NzQ=\ODI=\OTI=\MTI4\MjAx\OTI=\OTQ=\MjE=\MTQw\MjAx\MTk5\MjE=\MjA0\MTQ2\MTky\MjEz\NzY=\MTY0\MjIx\MjEz\MjA0\MjA4\MjEz\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTA=\OTI=\MjIx\MjAy\OTA=\OTI=\MTI4\MjAx\OTI=\OTQ=\MjEz\MTQw\NzM=\MjA4\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MTM4\MTI1\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\MTA=\MTAw\OTI=\MTU3\MjAy\OTE=\OTI=\MTI4\MjAx\MjIw\OTQ=\MjEz\MTQw\MjAx\MjIz\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTE=\OTI=\Mjk=\MTM4\ODc=\OTI=\MjIx\MjAy\OTE=\OTI=\MTU3\NzQ=\ODA=\OTI=\MTI4\MjAx\MjIw\OTQ=\MjEz\MTQw\NzM=\MjA0\MTUz\NzM=\ODU=\OTI=\MTU0\OQ==\MTQ0\MTE5\MTU0\MjAx\MTQ0\MTE5\MjEz\MTQw\MjAx\MjA1\MTUz\NzM=\ODU=\OTI=\MTU0\MTM3\MTQ0\MTE5\MTU0\NzM=\MTQ1\MTE5\MjEz\MTQw\MjAx\MTk3\MjEz\MjA0\MTY0\MTk4\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\NzQ=\ODI=\OTI=\MjIx\NzQ=\ODI=\OTI=\MTI4\MjAx\OTI=\OTQ=\MjEz\MTQw\MjAx\MTk5\MjEz\MjA0\MTQ2\MTky\MTQ5\MTQw\MTY0\MjIx\MTQ5\MjA0\MjA4\MjEz\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTA=\OTI=\MjIx\MjAy\OTA=\OTI=\MTI4\MjAx\OTI=\OTQ=\MTQ5\MTQw\NzM=\MjA4\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\MTA5\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\NzQ=\MTAx\OTI=\MTU3\MjAy\OTE=\OTI=\MTI4\MjAx\MjIw\OTQ=\MTQ5\MTQw\MjAx\MjIz\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTE=\OTI=\Mjk=\MTM4\ODc=\OTI=\MjIx\MjAy\OTE=\OTI=\MTU3\NzQ=\ODA=\OTI=\MTI4\MjAx\MjIw\OTQ=\MTQ5\MTQw\NzM=\MjA0\MTUz\NzM=\ODU=\OTI=\MTU0\OQ==\MTQ0\MTE5\MTU0\MjAx\MTQ0\MTE5\MTQ5\MTQw\MjAx\MjA1\MTUz\NzM=\ODU=\OTI=\MTU0\MTM3\MTQ0\MTE5\MTU0\NzM=\MTQ1\MTE5\MTQ5\MTQw\MjAx\MTk3\MTQ5\MTI=\MTY1\MTk4\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\NzQ=\ODI=\OTI=\MjIx\NzQ=\ODI=\OTI=\MTI4\MjAx\OTI=\OTQ=\MTQ5\MTQw\MjAx\MTk5\MTQ5\MjA0\MTQ2\MTky\ODU=\MjA1\MTY1\MjIx\ODU=\MjA1\MjA4\MjEz\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTA=\OTI=\MjIx\MjAy\OTA=\OTI=\MTI4\MjAx\OTI=\OTQ=\ODU=\MTQx\NzM=\MjA4\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MTA=\MTIw\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\MTA=\MTAw\OTI=\MTU3\MjAy\OTE=\OTI=\MTI4\MjAx\MjIw\OTQ=\ODU=\MTQx\MjAx\MjIz\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTE=\OTI=\Mjk=\MTM4\ODc=\OTI=\MjIx\MjAy\OTE=\OTI=\MTU3\NzQ=\ODA=\OTI=\MTI4\MjAx\MjIw\OTQ=\ODU=\MTQx\NzM=\MjA0\MTUz\NzM=\ODU=\OTI=\MTU0\OQ==\MTQ0\MTE5\MTU0\MjAx\MTQ0\MTE5\ODU=\MTQx\MjAx\MjA1\MTUz\NzM=\ODU=\OTI=\MTU0\MTM3\MTQ0\MTE5\MTU0\NzM=\MTQ1\MTE5\ODU=\MTQx\MjAx\MTk3\ODU=\MTQx\MTY1\MTk4\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\NzQ=\ODI=\OTI=\MjIx\NzQ=\ODI=\OTI=\MTI4\MjAx\OTI=\OTQ=\ODU=\MTQx\MjAx\MTk5\ODU=\MjA1\MTQ2\MTky\MjE=\Nzc=\MTY2\MjIx\MjE=\MjA1\MjA4\MjEz\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTA=\OTI=\MjIx\MjAy\OTA=\OTI=\MTI4\MjAx\OTI=\OTQ=\MjE=\MTQx\NzM=\MjA4\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MTM4\MTI1\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\MTA=\MTAy\OTI=\MTU3\MjAy\OTE=\OTI=\MTI4\MjAx\MjIw\OTQ=\MjE=\MTQx\MjAx\MjIz\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTE=\OTI=\Mjk=\MTM4\ODc=\OTI=\MjIx\MjAy\OTE=\OTI=\MTU3\NzQ=\ODA=\OTI=\MTI4\MjAx\MjIw\OTQ=\MjE=\MTQx\NzM=\MjA0\MTUz\NzM=\ODU=\OTI=\MTU0\OQ==\MTQ0\MTE5\MTU0\MjAx\MTQ0\MTE5\MjE=\MTQx\MjAx\MjA1\MTUz\NzM=\ODU=\OTI=\MTU0\MTM3\MTQ0\MTE5\MTU0\NzM=\MTQ1\MTE5\MjE=\MTQx\MjAx\MTk3\MjE=\MjA1\MTY2\MTk4\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\NzQ=\ODI=\OTI=\MjIx\NzQ=\ODI=\OTI=\MTI4\MjAx\OTI=\OTQ=\MjE=\MTQx\MjAx\MTk5\MjE=\MjA1\MTQ2\MTky\MjEz\MTQx\MTY2\MjIx\MjEz\MjA1\MjA4\MjEz\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTA=\OTI=\MjIx\MjAy\OTA=\OTI=\MTI4\MjAx\OTI=\OTQ=\MjEz\MTQx\NzM=\MjA4\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MTM4\MTA2\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\MTA=\MTAy\OTI=\MTU3\MjAy\OTE=\OTI=\MTI4\MjAx\MjIw\OTQ=\MjEz\MTQx\MjAx\MjIz\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTE=\OTI=\Mjk=\MTM4\ODc=\OTI=\MjIx\MjAy\OTE=\OTI=\MTU3\NzQ=\ODA=\OTI=\MTI4\MjAx\MjIw\OTQ=\MjEz\MTQx\NzM=\MjA0\MTUz\NzM=\ODU=\OTI=\MTU0\OQ==\MTQ0\MTE5\MTU0\MjAx\MTQ0\MTE5\MjEz\MTQx\MjAx\MjA1\MTUz\NzM=\ODU=\OTI=\MTU0\MTM3\MTQ0\MTE5\MTU0\NzM=\MTQ1\MTE5\MjEz\MTQx\MjAx\MTk3\MjEz\Nzc=\MTY3\MTk4\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\NzQ=\ODI=\OTI=\MjIx\NzQ=\ODI=\OTI=\MTI4\MjAx\OTI=\OTQ=\MjEz\MTQx\MjAx\MTk5\MjEz\MjA1\MTQ2\MTky\MTQ5\MTM=\MTY3\MjIx\MTQ5\MjA1\MjIx\MjEz\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTA=\OTI=\MjIx\MjAy\OTA=\OTI=\MTI4\MjAx\OTI=\OTQ=\MTQ5\MTQx\NzM=\MjA4\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MTA=\ODc=\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\MjAy\MTAz\OTI=\MTU3\MjAy\OTE=\OTI=\MTI4\MjAx\MjIw\OTQ=\MTQ5\MTQx\MjAx\MjIz\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTE=\OTI=\Mjk=\MTM4\ODc=\OTI=\MjIx\MjAy\OTE=\OTI=\MTU3\NzQ=\ODA=\OTI=\MTI4\MjAx\MjIw\OTQ=\MTQ5\MTQx\NzM=\MjA0\MTUz\NzM=\ODU=\OTI=\MTU0\OQ==\MTQ0\MTE5\MTU0\MjAx\MTQ0\MTE5\MTQ5\MTQx\MjAx\MjA1\MTUz\NzM=\ODU=\OTI=\MTU0\MTM3\MTQ0\MTE5\MTU0\NzM=\MTQ1\MTE5\MTQ5\MTQx\MjAx\MTk3\MTQ5\MTQx\MTY3\MTk4\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\NzQ=\ODI=\OTI=\MjIx\NzQ=\ODI=\OTI=\MTI4\MjAx\OTI=\OTQ=\MTQ5\MTQx\MjAx\MTk5\MTQ5\MjA1\MTQ2\MTky\ODU=\MjA2\MjIx\MjEz\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTA=\OTI=\MjIx\MjAy\OTA=\OTI=\MTI4\MjAx\OTI=\OTQ=\ODU=\MTQy\NzM=\MjA4\ODU=\MjA2\MjY=\MjU0\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\NzQ=\OTY=\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\MTA=\OTY=\OTI=\MTU3\MjAy\OTE=\OTI=\MTI4\MjAx\MjIw\OTQ=\ODU=\MTQy\MjAx\MjIz\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTE=\OTI=\Mjk=\MjAy\OTY=\OTI=\MjIx\MjAy\OTE=\OTI=\MTU3\MTM4\OTY=\OTI=\MTI4\MjAx\MjIw\OTQ=\ODU=\MTQy\NzM=\MjA0\ODU=\MTQ=\MzM=\MTY2\MjE=\MjA2\MTYx\MjIx\MjE=\MjA2\MjIx\MjEz\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTA=\OTI=\MjIx\MjAy\OTA=\OTI=\MTI4\MjAx\OTI=\OTQ=\MjE=\MTQy\NzM=\MjA4\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\NzQ=\NzA=\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\MTA=\NzA=\OTI=\MTU3\MjAy\OTE=\OTI=\MTI4\MjAx\MjIw\OTQ=\MjE=\MTQy\MjAx\MjIz\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTE=\OTI=\Mjk=\MTA=\NzI=\OTI=\MjIx\MjAy\OTE=\OTI=\MTU3\MjAy\NzI=\OTI=\MTI4\MjAx\MjIw\OTQ=\MjE=\MTQy\NzM=\MjA0\MjE=\MjA2\MTM0\MjA3\MTUz\NzM=\ODU=\OTI=\MTU0\OQ==\MTQ5\MTE5\MTU0\MjAx\MTQ5\MTE5\MjE=\MTQy\MjAx\MjA1\MjEz\Nzg=\MTUw\MjIx\MjEz\MTQ=\MjA2\MjEz\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\MjAy\OTE=\OTI=\MTI4\MjAx\OTI=\OTQ=\MjEz\MTQy\NzM=\MjA4\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MTM4\NzI=\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\NzQ=\NzM=\OTI=\MTU3\MjAy\OTE=\OTI=\MTI4\MjAx\MjIw\OTQ=\MjEz\MTQy\MjAx\MjIz\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTE=\OTI=\Mjk=\MTA=\NzM=\OTI=\MjIx\MjAy\OTE=\OTI=\MTU3\MjAy\OTA=\OTI=\MTI4\MjAx\MjIw\OTQ=\MjEz\MTQy\NzM=\MjA0\MTQ5\MTQ=\MjA2\MjEz\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTA=\OTI=\MjIx\MjAy\OTA=\OTI=\MTI4\MjAx\OTI=\OTQ=\MTQ5\MTQy\NzM=\MjA4\MTQ5\MjA2\MjY=\MjU0\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\NzM=\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\MTM4\NzM=\OTI=\MTU3\MjAy\OTE=\OTI=\MTI4\MjAx\MjIw\OTQ=\MTQ5\MTQy\MjAx\MjIz\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTE=\OTI=\Mjk=\NzQ=\NzQ=\OTI=\MjIx\MjAy\OTE=\OTI=\MTU3\NzQ=\Nzg=\OTI=\MTI4\MjAx\MjIw\OTQ=\MTQ5\MTQy\NzM=\MjA0\MTUz\NzM=\ODU=\OTI=\MTU0\MTM3\MTQ0\MTE5\MTU0\NzM=\MTQ1\MTE5\MTQ5\MTQy\MjAx\MTk3\MTQ5\MTQy\MTYx\MTk4\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\MjAy\OTE=\OTI=\MTI4\MjAx\OTI=\OTQ=\MTQ5\MTQy\MjAx\MTk5\MTQ5\MjA2\MTQy\MTky\ODU=\Nzk=\MTYy\MjIx\ODU=\MTU=\MjA2\MjEz\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTA=\OTI=\MjIx\MjAy\OTA=\OTI=\MTI4\MjAx\OTI=\OTQ=\ODU=\MTQz\NzM=\MjA4\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MTA=\MTE4\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\NzQ=\MTE3\OTI=\MTU3\MjAy\OTE=\OTI=\MTI4\MjAx\MjIw\OTQ=\ODU=\MTQz\MjAx\MjIz\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTE=\OTI=\Mjk=\MTA=\MTE3\OTI=\MjIx\MjAy\OTE=\OTI=\MTU3\MjAy\MTE3\OTI=\MTI4\MjAx\MjIw\OTQ=\ODU=\MTQz\NzM=\MjA0\MTUz\NzM=\ODU=\OTI=\MTU0\OQ==\MTQ0\MTE5\MTU0\MjAx\MTQ0\MTE5\ODU=\MTQz\MjAx\MjA1\MTUz\NzM=\ODU=\OTI=\MTU0\MTM3\MTQ0\MTE5\MTU0\NzM=\MTQ1\MTE5\ODU=\MTQz\MjAx\MTk3\ODU=\MTU=\MTYy\MTk4\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\NzQ=\ODI=\OTI=\MjIx\NzQ=\ODI=\OTI=\MTI4\MjAx\OTI=\OTQ=\ODU=\MTQz\MjAx\MTk5\ODU=\MjA3\MTQ2\MTky\MjE=\MjA3\MTYy\MjIx\MjE=\MTU=\MjA2\MjEz\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTA=\OTI=\MjIx\MjAy\OTA=\OTI=\MTI4\MjAx\OTI=\OTQ=\MjE=\MTQz\NzM=\MjA4\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MTA=\MTE4\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\MTM4\OTg=\OTI=\MTU3\MjAy\OTE=\OTI=\MTI4\MjAx\MjIw\OTQ=\MjE=\MTQz\MjAx\MjIz\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTE=\OTI=\Mjk=\MTA=\MTE3\OTI=\MjIx\MjAy\OTE=\OTI=\MTU3\MjAy\MTE3\OTI=\MTI4\MjAx\MjIw\OTQ=\MjE=\MTQz\NzM=\MjA0\MTUz\NzM=\ODU=\OTI=\MTU0\OQ==\MTQ0\MTE5\MTU0\MjAx\MTQ0\MTE5\MjE=\MTQz\MjAx\MjA1\MTUz\NzM=\ODU=\OTI=\MTU0\MTM3\MTQ0\MTE5\MTU0\NzM=\MTQ1\MTE5\MjE=\MTQz\MjAx\MTk3\MjE=\Nzk=\MTYz\MTk4\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\NzQ=\ODI=\OTI=\MjIx\NzQ=\ODI=\OTI=\MTI4\MjAx\OTI=\OTQ=\MjE=\MTQz\MjAx\MTk5\MjE=\MjA3\MTQ2\MTky\MjEz\MTU=\MTYz\MjIx\MjEz\MTU=\MjA2\MjEz\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTA=\OTI=\MjIx\MjAy\OTA=\OTI=\MTI4\MjAx\OTI=\OTQ=\MjEz\MTQz\NzM=\MjA4\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MTA=\MTE4\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\MjAy\OTk=\OTI=\MTU3\MjAy\OTE=\OTI=\MTI4\MjAx\MjIw\OTQ=\MjEz\MTQz\MjAx\MjIz\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTE=\OTI=\Mjk=\MTA=\MTE3\OTI=\MjIx\MjAy\OTE=\OTI=\MTU3\MjAy\MTE3\OTI=\MTI4\MjAx\MjIw\OTQ=\MjEz\MTQz\NzM=\MjA0\MTUz\NzM=\ODU=\OTI=\MTU0\OQ==\MTQ0\MTE5\MTU0\MjAx\MTQ0\MTE5\MjEz\MTQz\MjAx\MjA1\MTUz\NzM=\ODU=\OTI=\MTU0\MTM3\MTQ0\MTE5\MTU0\NzM=\MTQ1\MTE5\MjEz\MTQz\MjAx\MTk3\MjEz\MTQz\MTYz\MTk4\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\NzQ=\ODI=\OTI=\MjIx\NzQ=\ODI=\OTI=\MTI4\MjAx\OTI=\OTQ=\MjEz\MTQz\MjAx\MTk5\MTU3\MjAx\ODI=\OTI=\MjEz\MTQz\MjAx\MTky\MTU3\NzM=\Mjg=\OTI=\MTQ5\MTQz\MjAx\MjIx\MTQ5\MTU=\MjA2\MjEz\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTA=\OTI=\MjIx\MjAy\OTA=\OTI=\MTI4\MjAx\OTI=\OTQ=\MTQ5\MTQz\NzM=\MjA4\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MTA=\MTE4\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\MTA=\Mjg=\OTI=\MTU3\MjAy\OTE=\OTI=\MTI4\MjAx\MjIw\OTQ=\MTQ5\MTQz\MjAx\MjIz\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTE=\OTI=\Mjk=\MTA=\MTE3\OTI=\MjIx\MjAy\OTE=\OTI=\MTU3\MjAy\MTE3\OTI=\MTI4\MjAx\MjIw\OTQ=\MTQ5\MTQz\NzM=\MjA0\MTUz\NzM=\ODU=\OTI=\MTU0\OQ==\MTQ0\MTE5\MTU0\MjAx\MTQ0\MTE5\MTQ5\MTQz\MjAx\MjA1\MTUz\NzM=\ODU=\OTI=\MTU0\MTM3\MTQ0\MTE5\MTU0\NzM=\MTQ1\MTE5\MTQ5\MTQz\MjAx\MTk3\MTU3\MjAx\Mjg=\OTI=\MTQ5\MTQz\MjAx\MTk4\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\NzQ=\ODI=\OTI=\MjIx\NzQ=\ODI=\OTI=\MTI4\MjAx\OTI=\OTQ=\MTQ5\MTQz\MjAx\MTk5\MTU3\MjAx\ODI=\OTI=\MTQ5\MTQz\MjAx\MTky\MTU3\MTM3\Mjg=\OTI=\ODU=\MTM2\MjAx\MjIx\ODU=\OA==\MjA2\MjEz\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\NzQ=\Mjk=\OTI=\Mjk=\NzQ=\Mjk=\OTI=\MjIx\NzQ=\Mjk=\OTI=\MTI4\MjAx\OTI=\OTQ=\ODU=\MTM2\NzM=\MjA4\MTU3\OQ==\Mjk=\OTI=\ODk=\MTA=\OTA=\OTI=\OTA=\MTM4\MzA=\MTEy\Mjk=\MjAy\OTA=\OTI=\MjIx\MjAy\Mjk=\OTI=\MTU3\MjAy\Mjk=\OTI=\NjQ=\MjAy\OTI=\OTQ=\ODU=\NzI=\MjAy\MTE5\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MTM4\Mjk=\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\NzQ=\MzA=\OTI=\MTU3\MjAy\OTE=\OTI=\MTI4\MjAx\MjIw\OTQ=\ODU=\MTM2\MjAx\MjIz\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTE=\OTI=\Mjk=\MTA=\MzA=\OTI=\MjIx\MjAy\OTE=\OTI=\MTU3\MTM4\OTY=\OTI=\MTI4\MjAx\MjIw\OTQ=\ODU=\MTM2\NzM=\MjA0\MTUz\NzM=\ODU=\OTI=\MTU0\MTM3\MTQ0\MTE5\MTU0\NzM=\MTQ1\MTE5\ODU=\MTM2\MjAx\MTk3\MTU3\MjAx\MzA=\OTI=\ODU=\MTM2\MjAx\MTk4\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\MjAy\OTE=\OTI=\MTI4\MjAx\OTI=\OTQ=\ODU=\MTM2\MjAx\MTk5\MTU3\NzM=\Njg=\OTI=\ODU=\MTM2\MjAx\MTky\MjE=\NzI=\MTUw\MjIx\MjE=\OA==\MjA2\MjEz\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\MjAy\OTE=\OTI=\MTI4\MjAx\OTI=\OTQ=\MjE=\MTM2\NzM=\MjA4\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MTM4\NzI=\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\MTM4\MzA=\OTI=\MTU3\MjAy\OTE=\OTI=\MTI4\MjAx\MjIw\OTQ=\MjE=\MTM2\MjAx\MjIz\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTE=\OTI=\Mjk=\MTA=\NzM=\OTI=\MjIx\MjAy\OTE=\OTI=\MTU3\MjAy\OTA=\OTI=\MTI4\MjAx\MjIw\OTQ=\MjE=\MTM2\NzM=\MjA0\MTU3\NzM=\MzE=\OTI=\MjEz\MTM2\MjAx\MjIx\MjEz\MjAw\MjIx\MjEz\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTA=\OTI=\MjIx\MjAy\OTA=\OTI=\MTI4\MjAx\OTI=\OTQ=\MjEz\MTM2\NzM=\MjA4\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\NzQ=\NzA=\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\MTA=\NzA=\OTI=\MTU3\MjAy\OTE=\OTI=\MTI4\MjAx\MjIw\OTQ=\MjEz\MTM2\MjAx\MjIz\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTE=\OTI=\Mjk=\MTA=\NzI=\OTI=\MjIx\MjAy\OTE=\OTI=\MTU3\MjAy\NzI=\OTI=\MTI4\MjAx\MjIw\OTQ=\MjEz\MTM2\NzM=\MjA0\MTU4\NzM=\OTI=\OTI=\MjEz\MTM2\MjAx\MjA3\MTUz\NzM=\ODU=\OTI=\MTU0\OQ==\MTQ5\MTE5\MTU0\MjAx\MTQ5\MTE5\MjEz\MTM2\MjAx\MjA1\MTU3\OQ==\MzE=\OTI=\MTQ5\MTM2\MjAx\MjIx\MTQ5\MjAw\MjAw\MjEz\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTA=\OTI=\MjIx\MjAy\OTA=\OTI=\MTI4\MjAx\OTI=\OTQ=\MTQ5\MTM2\NzM=\MjA4\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\MzE=\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\MTM4\MzE=\OTI=\MTU3\MjAy\OTE=\OTI=\MTI4\MjAx\MjIw\OTQ=\MTQ5\MTM2\MjAx\MjIz\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTE=\OTI=\Mjk=\MTM4\ODc=\OTI=\MjIx\MjAy\OTE=\OTI=\MTU3\NzQ=\ODA=\OTI=\MTI4\MjAx\MjIw\OTQ=\MTQ5\MTM2\NzM=\MjA0\MTUz\NzM=\ODU=\OTI=\MTU0\OQ==\MTQ0\MTE5\MTU0\MjAx\MTQ0\MTE5\MTQ5\MTM2\MjAx\MjA1\MTUz\NzM=\ODU=\OTI=\MTU0\MTM3\MTQ0\MTE5\MTU0\NzM=\MTQ1\MTE5\MTQ5\MTM2\MjAx\MTk3\MTU3\NzM=\MjQ=\OTI=\MTQ5\MTM2\MjAx\MTk4\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\NzQ=\ODI=\OTI=\MjIx\NzQ=\ODI=\OTI=\MTI4\MjAx\OTI=\OTQ=\MTQ5\MTM2\MjAx\MTk5\MTU3\MjAx\ODI=\OTI=\MTQ5\MTM2\MjAx\MTky\ODU=\MjAx\MjAw\MjEz\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTA=\OTI=\MjIx\MjAy\OTA=\OTI=\MTI4\MjAx\OTI=\OTQ=\ODU=\MTM3\NzM=\MjA4\MTU3\MjAx\OTA=\OTI=\ODU=\MTM3\NzM=\MjU0\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\NzM=\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\MTM4\NzM=\OTI=\MTU3\MjAy\OTE=\OTI=\MTI4\MjAx\MjIw\OTQ=\ODU=\MTM3\MjAx\MjIz\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTE=\OTI=\Mjk=\NzQ=\NzQ=\OTI=\MjIx\MjAy\OTE=\OTI=\MTU3\NzQ=\Nzg=\OTI=\MTI4\MjAx\MjIw\OTQ=\ODU=\MTM3\NzM=\MjA0\MTUz\NzM=\ODU=\OTI=\MTU0\MTM3\MTQ0\MTE5\MTU0\NzM=\MTQ1\MTE5\ODU=\MTM3\MjAx\MTk3\MTU3\OQ==\MjQ=\OTI=\ODU=\MTM3\MjAx\MTk4\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\MjAy\OTE=\OTI=\MTI4\MjAx\OTI=\OTQ=\ODU=\MTM3\MjAx\MTk5\MTU3\MjAx\Nzg=\OTI=\ODU=\MTM3\MjAx\MTky\MjE=\NzM=\MTUw\MjIx\MjE=\MjAx\MjAw\MjEz\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\MjAy\OTE=\OTI=\MTI4\MjAx\OTI=\OTQ=\MjE=\MTM3\NzM=\MjA4\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MTM4\NzI=\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\NzQ=\NzM=\OTI=\MTU3\MjAy\OTE=\OTI=\MTI4\MjAx\MjIw\OTQ=\MjE=\MTM3\MjAx\MjIz\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTE=\OTI=\Mjk=\MTA=\NzM=\OTI=\MjIx\MjAy\OTE=\OTI=\MTU3\MjAy\OTA=\OTI=\MTI4\MjAx\MjIw\OTQ=\MjE=\MTM3\NzM=\MjA0\MTU3\MjAx\MjQ=\OTI=\MjEz\MTM3\MjAx\MjIx\MjEz\MjAx\MjAw\MjEz\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\MjAy\OTA=\OTI=\MjIx\MjAy\OTA=\OTI=\MTI4\MjAx\OTI=\OTQ=\MjEz\MTM3\NzM=\MjA4\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\MzE=\OTI=\Mjk=\MjAy\OTE=\OTI=\MjIx\MTM4\MjQ=\OTI=\MTU3\MjAy\OTE=\OTI=\MTI4\MjAx\MjIw\OTQ=\MjEz\MTM3\MjAx\MjIz\MTUz\NzM=\OTE=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTE=\OTI=\Mjk=\MTM4\ODc=\OTI=\MjIx\MjAy\OTE=\OTI=\MTU3\NzQ=\ODA=\OTI=\MTI4\MjAx\MjIw\OTQ=\MjEz\MTM3\NzM=\MjA0\MTUz\NzM=\ODU=\OTI=\MTU0\OQ==\MTQ0\MTE5\MTU0\MjAx\MTQ0\MTE5\MjEz\MTM3\MjAx\MjA1\MTUz\NzM=\ODU=\OTI=\MTU0\MTM3\MTQ0\MTE5\MTU0\NzM=\MTQ1\MTE5\MjEz\MTM3\MjAx\MTk3\MTU3\NzM=\MjU=\OTI=\MjEz\MTM3\MjAx\MTk4\MTUz\OQ==\OTA=\OTI=\MTU0\MTM3\MTU4\MTE5\OTM=\MjAy\OTA=\OTI=\Mjk=\NzQ=\ODI=\OTI=\MjIx\NzQ=\ODI=\OTI=\MTI4\MjAx\OTI=\OTQ=\MjEz\MTM3\MjAx\MTk5\MTU3\MjAx\ODI=\OTI=\MjEz\MTM3\MjAx\MTky\MTU3\OQ==\MjU=\OTI=\MTU0\MTM3\MjAx\MTI3\Mjk=\MjAy\MjU=\OTI=\MTUx\OQ==\MjAy\MTE5\NTY=\MjAy\OTI=\OTI=\OTI=\OTI=\OTI=\MTE3\OTI=\OTI=\MjIw\ODU=\OTI=\OTI=\OTI=\NzI=\OTI=\OTI=\OTI=\Njk=\OTI=\OTI=\MjIw\MTIw\OTI=\OTI=\MjIw\ODI=\OTI=\OTI=\OTI=\OTU=\MTI4\OQ==\MjIw\OTM=\MTU3\OQ==\MjU=\OTI=\MTU0\MTM3\MjAx\OTA=\Mjk=\MjAy\MjU=\OTI=\MTUx\OQ==\MjAy\MTE5\NTY=\MTM4\OTI=\OTI=\OTI=\OTI=\OTI=\MTE3\OTI=\OTI=\MjIw\ODU=\OTI=\OTI=\OTI=\NzI=\OTI=\OTI=\OTI=\Njk=\OTI=\OTI=\MjIw\MTIw\OTI=\OTI=\MjIw\ODI=\OTI=\OTI=\OTI=\OTU=\MTI4\OQ==\MjIw\OTM=\MTU3\OQ==\MjU=\OTI=\MTU0\MTM3\MjAx\ODg=\Mjk=\MjAy\MjU=\OTI=\MTUx\OQ==\MjAy\MTE5\NTY=\NzQ=\OTM=\OTI=\OTI=\OTI=\OTI=\MTE3\OTI=\OTI=\MjIw\ODU=\OTI=\OTI=\OTI=\NzI=\OTI=\OTI=\OTI=\Njk=\OTI=\OTI=\MjIw\MTIw\OTI=\OTI=\MjIw\ODI=\OTI=\OTI=\OTI=\OTU=\MTI4\OQ==\MjIw\OTM=\MTU3\OQ==\MjU=\OTI=\MTU0\MTM3\MjAx\ODk=\Mjk=\MjAy\MjU=\OTI=\MTUx\OQ==\MjAy\MTE5\NTY=\MTA=\OTM=\OTI=\OTI=\OTI=\OTI=\MTE3\OTI=\OTI=\MjIw\ODU=\OTI=\OTI=\OTI=\NzI=\OTI=\OTI=\OTI=\Njk=\OTI=\OTI=\MjIw\MTIw\OTI=\OTI=\MjIw\ODI=\OTI=\OTI=\OTI=\OTU=\MTI4\OQ==\MjIw\OTM=\MTU3\OQ==\MjU=\OTI=\MTU0\MTM3\NzM=\ODk=\Mjk=\MjAy\MjU=\OTI=\MTUx\OQ==\MjAy\MTE5\NTY=\MjAy\OTM=\OTI=\OTI=\OTI=\OTI=\MTE3\OTI=\OTI=\MjIw\ODU=\OTI=\OTI=\OTI=\NzI=\OTI=\OTI=\OTI=\Njk=\OTI=\OTI=\MjIw\MTIw\OTI=\OTI=\MjIw\ODI=\OTI=\OTI=\OTI=\OTU=\MTI4\OQ==\MjIw\OTM=\MTU3\OQ==\MjU=\OTI=\MTU0\MTM3\NzM=\ODg=\Mjk=\MjAy\MjU=\OTI=\MTUx\OQ==\MjAy\MTE5\NTY=\MTM4\OTM=\OTI=\OTI=\OTI=\OTI=\MTE3\OTI=\OTI=\MjIw\ODU=\OTI=\OTI=\OTI=\NzI=\OTI=\OTI=\OTI=\Njk=\OTI=\OTI=\MjIw\MTIw\OTI=\OTI=\MjIw\ODI=\OTI=\OTI=\OTI=\OTU=\MTI4\OQ==\MjIw\OTM=\MTU3\OQ==\MjU=\OTI=\MTU0\MTM3\NzM=\MTE5\Mjk=\MjAy\MjU=\OTI=\MTUx\OQ==\MjAy\MTE5\NTY=\NzQ=\OTQ=\OTI=\MTI4\OQ==\MjIw\OTM=\MTU3\OQ==\MjU=\OTI=\MTU0\MTM3\MjAx\MTE3\Mjk=\MjAy\MjU=\OTI=\MTUx\OQ==\MjAy\MTE5\NTY=\MTA=\OTQ=\OTI=\MTI4\OQ==\MjIw\OTM=\MTU3\OQ==\MjU=\OTI=\MTU0\MTM3\NzM=\ODA=\Mjk=\MjAy\MjU=\OTI=\MTUx\OQ==\MjAy\MTE5\NTY=\MjAy\OTQ=\OTI=\OTI=\OTI=\OTI=\ODA=\MTI4\OQ==\MjIw\OTM=\MTU3\OQ==\MjU=\OTI=\MTU0\MTM3\MjAx\ODA=\Mjk=\MjAy\MjU=\OTI=\MTUx\OQ==\MjAy\MTE5\NTY=\MTM4\OTQ=\OTI=\OTI=\OTI=\MjIw\ODA=\MTI4\OQ==\MjIw\OTM=\MTU3\OQ==\MjU=\OTI=\MTU0\MTM3\NzM=\ODc=\Mjk=\MjAy\MjU=\OTI=\MTUx\OQ==\MjAy\MTE5\NTY=\NzQ=\OTU=\OTI=\OTI=\OTI=\OTI=\ODc=\MTI4\OQ==\MjIw\OTM=\MTU3\OQ==\MjU=\OTI=\MTU0\MTM3\MjAx\ODc=\Mjk=\MjAy\MjU=\OTI=\MTUx\OQ==\MjAy\MTE5\NTY=\MTA=\OTU=\OTI=\OTI=\OTI=\MjIw\ODc=\MTI4\OQ==\MjIw\OTM=\MTU3\OQ==\MjU=\OTI=\MTU0\MTM3\NzM=\ODE=\Mjk=\MjAy\MjU=\OTI=\MTUx\OQ==\MjAy\MTE5\NTY=\MjAy\OTU=\OTI=\OTI=\OTI=\OTI=\ODE=\MTI4\OQ==\MjIw\OTM=\MTU3\OQ==\MjU=\OTI=\MTU0\MTM3\MjAx\ODE=\Mjk=\MjAy\MjU=\OTI=\MTUx\OQ==\MjAy\MTE5\NTY=\MTM4\OTU=\OTI=\OTI=\OTI=\MjIw\ODE=\MTI4\OQ==\MjIw\OTM=\MTU3\OQ==\MjU=\OTI=\MTU0\MTM3\NzM=\ODI=\Mjk=\MjAy\MjU=\OTI=\MTUx\OQ==\MjAy\MTE5\NTY=\NzQ=\ODg=\OTI=\OTI=\OTI=\OTI=\ODI=\OTI=\OTI=\OTI=\OTI=\MTI4\OQ==\MjIw\OTM=\MTU3\OQ==\MjU=\OTI=\MTU0\MTM3\MjAx\NzM=\Mjk=\MjAy\MjU=\OTI=\MTUx\OQ==\MjAy\MTE5\NTY=\MTA=\ODg=\OTI=\MTI4\OQ==\MjIw\OTM=\MTU3\OQ==\MjU=\OTI=\MTU0\MTM3\NzM=\NzU=\Mjk=\MjAy\MjU=\OTI=\MTUx\OQ==\MjAy\MTE5\NTY=\MjAy\ODg=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI4\OQ==\MjIw\OTM=\MTU3\OQ==\MjU=\OTI=\MTU0\MTM3\NzM=\NzQ=\Mjk=\MjAy\MjU=\OTI=\MTUx\OQ==\MjAy\MTE5\NTY=\MTM4\ODg=\OTI=\MTI4\OQ==\MjIw\OTM=\MTU3\OQ==\MjU=\OTI=\MTU0\MTM3\MjAx\NzQ=\Mjk=\MjAy\MjU=\OTI=\MTUx\OQ==\MjAy\MTE5\NTY=\NzQ=\ODk=\OTI=\MTI4\OQ==\MjIw\OTM=\MTU3\OQ==\MjU=\OTI=\MTU0\MTM3\NzM=\Njg=\Mjk=\MjAy\MjU=\OTI=\MTUx\OQ==\MjAy\MTE5\NTY=\MTA=\ODk=\OTI=\MTI4\OQ==\MjIw\OTM=\MTU3\OQ==\MjU=\OTI=\MTU0\MTM3\MjAx\Njg=\Mjk=\MjAy\MjU=\OTI=\MTUx\OQ==\MjAy\MTE5\NTY=\MjAy\ODk=\OTI=\MTI4\OQ==\MjIw\OTM=\MTU3\OQ==\MjU=\OTI=\MTU0\MTM3\MjAx\NzU=\Mjk=\MjAy\MjU=\OTI=\MTUx\OQ==\MjAy\MTE5\NTY=\MTM4\ODk=\OTI=\OTI=\OTI=\MjIw\OTM=\OTI=\OTI=\OTI=\OTQ=\MTI4\OQ==\MjIw\OTM=\MTU3\OQ==\MjU=\OTI=\MTU0\MTM3\MjAx\NjY=\Mjk=\MjAy\MjU=\OTI=\MTUx\OQ==\MjAy\MTE5\NTY=\NzQ=\OTA=\OTI=\MTI4\OQ==\MjIw\OTM=\MTU3\OQ==\MjU=\OTI=\MTU0\MTM3\MjAx\MTI1\Mjk=\MjAy\MjU=\OTI=\MTUx\OQ==\MjAy\MTE5\NTY=\MTA=\OTA=\OTI=\MTI4\OQ==\MjIw\OTM=\MTU3\OQ==\MjU=\OTI=\MTU0\MTM3\MjAx\NzA=\Mjk=\MjAy\MjU=\OTI=\MTUx\OQ==\MjAy\MTE5\NTY=\MjAy\OTA=\OTI=\OTI=\OTI=\OTI=\OTM=\OTI=\OTI=\OTI=\OTI=\MTI4\OQ==\MjIw\OTM=\MTU3\OQ==\MjU=\OTI=\MTU0\MTM3\MjAx\MTI2\Mjk=\MjAy\MjU=\OTI=\MTUx\OQ==\MjAy\MTE5\NTY=\MTM4\OTA=\OTI=\MTI4\OQ==\MjIw\OTM=\MTU3\OQ==\MjU=\OTI=\MTU0\MTM3\NzM=\MTI3\Mjk=\MjAy\MjU=\OTI=\MTUx\OQ==\MjAy\MTE5\NTY=\NzQ=\OTE=\OTI=\MTI4\OQ==\MjIw\OTM=\MTU3\OQ==\MjU=\OTI=\MTU0\MTM3\NzM=\MTI0\Mjk=\MjAy\MjU=\OTI=\MTUx\OQ==\MjAy\MTE5\NTY=\MTA=\OTE=\OTI=\MTI4\OQ==\MjIw\OTM=\MTU3\OQ==\MjU=\OTI=\MTU0\MTM3\MjAx\Njc=\Mjk=\MjAy\MjU=\OTI=\MTUx\OQ==\MjAy\MTE5\NTY=\MjAy\OTE=\OTI=\MTI4\OQ==\MjIw\OTM=\MTU3\OQ==\MjU=\OTI=\MTU0\MTM3\NzM=\NzE=\Mjk=\MjAy\MjU=\OTI=\MTUx\OQ==\MjAy\MTE5\NTY=\MTM4\OTE=\OTI=\OTI=\OTI=\OTI=\OTM=\OTI=\OTI=\OTI=\OTI=\MTI4\OQ==\MjIw\OTM=\MTU3\OQ==\MjU=\OTI=\MTU0\MTM3\MjAx\NzE=\Mjk=\MjAy\MjU=\OTI=\MTUx\OQ==\MjAy\MTE5\NTY=\NzQ=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTM=\OTI=\OTI=\OTI=\OTI=\MTI4\OQ==\MjIw\OTM=\MTU3\OQ==\MjU=\OTI=\MTU0\MTM3\NzM=\NjU=\Mjk=\MjAy\MjU=\OTI=\MTUx\OQ==\MjAy\MTE5\NTY=\MTA=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTM=\OTI=\OTI=\OTI=\OTI=\MTI4\OQ==\MjIw\OTM=\MTU3\OQ==\MjU=\OTI=\MTU0\MTM3\NzM=\NjQ=\Mjk=\MjAy\MjU=\OTI=\MTUx\OQ==\MjAy\MTE5\NTY=\MjAy\ODQ=\OTI=\OTI=\OTI=\OTI=\OTM=\OTI=\OTI=\OTI=\OTI=\MTI4\OQ==\MjIw\OTM=\MTU3\OQ==\MjU=\OTI=\MTU0\MTM3\MjAx\NjQ=\Mjk=\MjAy\MjU=\OTI=\MTUx\OQ==\MjAy\MTE5\NTY=\MTM4\ODQ=\OTI=\OTI=\OTI=\OTI=\OTM=\OTI=\OTI=\OTI=\OTI=\MTI4\OQ==\MjIw\OTM=\MTU3\OQ==\MjU=\OTI=\MTU0\MTM3\MjAx\NjU=\Mjk=\MjAy\MjU=\OTI=\MTUx\OQ==\MjAy\MTE5\NTY=\NzQ=\ODU=\OTI=\OTI=\OTI=\OTI=\OTM=\OTI=\OTI=\OTI=\OTI=\MTI4\OQ==\MjIw\OTM=\MTU3\OQ==\MjU=\OTI=\MTU0\MTM3\NzM=\Njc=\Mjk=\MjAy\MjU=\OTI=\MTUx\OQ==\MjAy\MTE5\NTY=\MTA=\ODU=\OTI=\MTI4\OQ==\MjIw\OTM=\MTU3\OQ==\MjU=\OTI=\MTU0\MTM3\NzM=\NjY=\Mjk=\MjAy\MjU=\OTI=\MTUx\OQ==\MjAy\MTE5\NTY=\MjAy\ODU=\OTI=\MTI4\OQ==\MjIw\OTM=\MTU3\OQ==\MjU=\OTI=\MTU0\MTM3\NzM=\MTI1\Mjk=\MjAy\MjU=\OTI=\MTUx\OQ==\MjAy\MTE5\NTY=\MTM4\ODU=\OTI=\MTI4\OQ==\MjIw\OTM=\MTU3\OQ==\MjU=\OTI=\MTU0\MTM3\NzM=\MTI2\Mjk=\MjAy\MjU=\OTI=\MTUx\OQ==\MjAy\MTE5\NTY=\NzQ=\ODY=\OTI=\MTI4\OQ==\MjIw\OTM=\MTU3\OQ==\MjU=\OTI=\MTU0\MTM3\MjAx\MTI0\Mjk=\MjAy\MjU=\OTI=\MTUx\OQ==\MjAy\MTE5\NTY=\MTA=\ODY=\OTI=\MTI4\OQ==\MjIw\OTM=\MTU3\OQ==\MjU=\OTI=\MTU0\MTM3\NzM=\MTIz\Mjk=\MjAy\MjU=\OTI=\MTUx\OQ==\MjAy\MTE5\NTY=\MjAy\ODY=\OTI=\OTI=\OTI=\OTI=\MTIz\OTI=\OTI=\OTI=\MTE2\MTI4\OQ==\MjIw\OTM=\MTU3\OQ==\MjU=\OTI=\MTU0\MTM3\MjAx\MTIy\Mjk=\MjAy\MjU=\OTI=\MTUx\OQ==\MjAy\MTE5\NTY=\MTM4\ODY=\OTI=\OTI=\OTI=\MjIw\MTIy\OTI=\OTI=\OTI=\MTE2\MTI4\OQ==\MjIw\OTM=\MTU3\OQ==\MjU=\OTI=\MTU0\MTM3\NzM=\MTIy\Mjk=\MjAy\MjU=\OTI=\MTUx\OQ==\MjAy\MTE5\NTY=\NzQ=\ODc=\OTI=\OTI=\OTI=\OTI=\MTIy\OTI=\OTI=\OTI=\MTE2\MTI4\OQ==\MjIw\OTM=\MTU3\OQ==\MjU=\OTI=\MTU0\MTM3\MjAx\MTIz\Mjk=\MjAy\MjU=\OTI=\MTUx\OQ==\MjAy\MTE5\NTY=\MTA=\ODc=\OTI=\OTI=\OTI=\MjIw\MTIz\OTI=\OTI=\OTI=\MTE2\MTI4\OQ==\MjIw\OTM=\MTU3\OQ==\MjU=\OTI=\MTU0\MTM3\NzM=\Nzc=\Mjk=\MjAy\MjU=\OTI=\MTUx\OQ==\MjAy\MTE5\NTY=\MjAy\ODc=\OTI=\MTI4\OQ==\MjIw\OTM=\MTU3\OQ==\MjU=\OTI=\MTU0\MTM3\NzM=\NzY=\Mjk=\MjAy\MjU=\OTI=\MTUx\OQ==\MjAy\MTE5\NTY=\MTM4\ODc=\OTI=\MTI4\OQ==\MjIw\OTM=\MTU3\OQ==\MjU=\OTI=\MTU0\MTM3\MjAx\Nzk=\Mjk=\MjAy\MjU=\OTI=\MTUx\OQ==\MjAy\MTE5\NTY=\NzQ=\ODA=\OTI=\MTI4\OQ==\MjIw\OTM=\MTU3\OQ==\MjU=\OTI=\MTU0\MTM3\MjAx\Nzc=\Mjk=\MjAy\MjU=\OTI=\MTUx\OQ==\MjAy\MTE5\NTY=\MTA=\ODA=\OTI=\MTI4\OQ==\MjIw\OTM=\MTU3\OQ==\MjU=\OTI=\MTU0\MTM3\MjAx\Nzg=\Mjk=\MjAy\MjU=\OTI=\MTUx\OQ==\MjAy\MTE5\NTY=\MjAy\ODA=\OTI=\MTI4\OQ==\MjIw\OTM=\MTU3\OQ==\MjU=\OTI=\MTU0\MTM3\NzM=\Nzg=\Mjk=\MjAy\MjU=\OTI=\MTUx\OQ==\MjAy\MTE5\NTY=\MTM4\ODA=\OTI=\MTI4\OQ==\MjIw\OTM=\MTU3\OQ==\MjU=\OTI=\MTU0\MTM3\NzM=\Nzk=\Mjk=\MjAy\MjU=\OTI=\MTUx\OQ==\MjAy\MTE5\NTY=\NzQ=\ODE=\OTI=\MTI4\OQ==\MjIw\OTM=\MTU3\OQ==\MjU=\OTI=\MTU0\MTM3\MjAx\NzY=\Mjk=\MjAy\MjU=\OTI=\MTUx\OQ==\MjAy\MTE5\NTY=\MTA=\ODE=\OTI=\MTI4\OQ==\MjIw\OTM=\MTUz\MTM3\MjU=\OTI=\MTM0\OQ==\OTI=\OTI=\NzQ=\Mjg=\ODk=\MjIw\MTUz\NzM=\OTI=\OTI=\Mjk=\NzQ=\MjY=\OTI=\MTUx\OQ==\MjAy\MTE5\Mjk=\MTA=\MjY=\OTI=\MTI4\MjAx\MjIw\OTM=\OTM=\MjAy\MjY=\OTI=\NzU=\OTI=\MjAy\MTE5\NzQ=\MjIw\OTI=\MjIw\ODk=\MTM4\MjY=\OTI=\NjQ=\MTA=\MjIw\OTI=\NzQ=\OTI=\MTYx\MzU=\OTM=\NzQ=\Mjc=\OTI=\NzU=\OTI=\MjAy\MTE5\NzQ=\Mjg=\MTYw\MzU=\ODk=\NzQ=\OTI=\OTI=\OTA=\MTA=\Mjg=\MTEy\OTA=\MjAy\Mjg=\MTEy\MjIx\MTA=\Mjc=\OTI=\ODc=\MjAy\NzQ=\MTEy\MjIx\MjAy\Mjc=\OTI=\NjQ=\MTA=\MjIw\OTM=\NzQ=\Mjg=\MTY2\MzU=\MTUz\NzM=\OTQ=\OTI=\OTM=\MTM4\Mjc=\OTI=\MTI4\OQ==\OTI=\OTM=\NjY=\OTI=\MjIw\OTI=\MTI0\OTM=\OTI=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTk=\NjE=\NDk=\NTc=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\NDc=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTY=\NTE=\NjM=\NjE=\NDg=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTg=\NjE=\NDk=\NTc=\OTI=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjc=\NTc=\NDA=\MTc=\NTE=\NDE=\NDc=\NTc=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\NTI=\NjE=\NDY=\NjE=\NjM=\NDA=\NTc=\NDY=\OTI=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OA==\NTE=\NDY=\NDc=\NTE=\OTI=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NTE=\NDc=\NTM=\NDA=\NTM=\NTE=\NTA=\OTI=\ODg=\ODE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTM=\NDE=\NTM=\NjM=\NTU=\MTc=\NTc=\NDc=\NDc=\NjE=\NTk=\NTc=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTc=\NTc=\NDc=\NDc=\NjE=\NTk=\NTc=\OTI=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjE=\NTA=\NDc=\NDA=\NjE=\NTA=\NjM=\NTc=\OTI=\ODg=\ODg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTA=\NTc=\NDM=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTU=\NjM=\NDY=\NTc=\NTc=\NTA=\Mjc=\NDE=\NTM=\OTI=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjY=\NDY=\NjE=\NDk=\NTc=\OTI=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OA==\NTc=\MzY=\NDA=\MzA=\NDE=\NDA=\NDA=\NTE=\NTA=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OA==\NTc=\MzY=\NDA=\MTY=\NjE=\NjI=\NTc=\NDg=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjE=\NDk=\NjE=\NTk=\NTc=\MzA=\NDE=\NDA=\NDA=\NTE=\NTA=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OA==\NTc=\MzY=\NDA=\MzA=\NTE=\MzY=\OTI=\ODg=\ODg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDg=\NTE=\NDg=\OTI=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NjE=\NDY=\NTc=\NTA=\NDA=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\NTE=\NDY=\NTc=\Mjc=\NDE=\NTM=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDk=\NjE=\NTM=\NTA=\OTI=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjk=\NjM=\NDA=\NTM=\NDI=\NTc=\OTI=\OTM=\OTM=\ODg=\Nzc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzA=\NjE=\NjM=\NTU=\NTk=\NDY=\NTE=\NDE=\NTA=\NTY=\MzE=\NTE=\NDg=\NTE=\NDY=\MTEx\OTI=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\NTE=\NDg=\NTE=\NDY=\MTEx\OTI=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTcy\OTk=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjQ=\NDY=\NjE=\NTk=\NTk=\NjE=\NjI=\NDg=\NTc=\OTI=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OQ==\MjQ=\NTM=\NDk=\MTEw\OTI=\OTU=\MjAz\Nw==\NTY=\MzU=\MTYw\MTY=\MTQ3\OTk=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTU=\MTYz\MTU=\MTEw\MzU=\MTQz\MTk5\MTQ2\OTk=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTU=\NTM=\Mzg=\NTc=\OTI=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\MTg4\NTY=\Mjg=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\MjIw\NDQ=\Mjg=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTU=\NDA=\Mzc=\NDg=\NTc=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjU=\NTA=\NDE=\NDk=\OTI=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjY=\NDY=\NjE=\NDk=\NTc=\MTU=\NDA=\Mzc=\NDg=\NTc=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTQ=\NTE=\NjI=\NDg=\NTE=\MzY=\MTQ=\NTE=\NDE=\NTA=\NTY=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTA=\NTM=\NDc=\NTM=\NjI=\NDg=\NTc=\OTI=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTY=\NTc=\NjM=\NTE=\MTA5\OTI=\OTU=\MTQz\NTI=\MTM4\MjIw\MTg2\MjE4\MjEy\OTk=\OTU=\MjUw\MTAw\MTk1\NjY=\OTM=\MTY2\MjMx\OTk=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\MjUy\NjI=\Mjg=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDA=\NTc=\NDg=\NTc=\NDQ=\NTE=\NDY=\NDA=\OTI=\OTU=\Nzc=\MTE5\MjAz\NjY=\MTA5\MTI0\MjI1\OTk=\OTU=\MjM0\MTY4\MTM0\MTYz\ODM=\NzQ=\MTQ3\OTk=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\MTU2\MQ==\Mjg=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTA1\Mjg=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzA=\NDE=\NDA=\NDA=\NTE=\NTA=\MTU=\NDA=\Mzc=\NDg=\NTc=\OTI=\ODg=\NzI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTQ=\NTE=\NjI=\NDg=\NTE=\MzY=\MzA=\NDE=\NDA=\NDA=\NTE=\NTA=\MjQ=\NTc=\NTg=\NjE=\NDE=\NDg=\NDA=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjY=\NTE=\NTA=\NDA=\OTI=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTU=\NjM=\NTM=\MjY=\NTM=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OA==\NTc=\MzY=\NDA=\OTI=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OA==\NTc=\NDg=\NTc=\NDQ=\NTE=\NDY=\NDA=\OTI=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OA==\NTc=\MzY=\NDA=\MzE=\NTE=\NDg=\NTE=\NDY=\MTEx\OTI=\OTU=\MTM4\Mg==\MTY2\MTc=\NzU=\Njg=\MTk2\OTk=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OA==\NTc=\MzY=\NDA=\MTU=\NTM=\Mzg=\NTc=\OTI=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTEy\Mjg=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTg=\NDE=\NTA=\NjM=\NDA=\NTM=\NTE=\NTA=\NDc=\OTI=\OTU=\MTU0\NA==\MzM=\MTg4\MTcy\MTkx\MTM2\OTk=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjY=\NDE=\NTA=\NjM=\NDA=\NTM=\NTE=\NTA=\NDc=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDc=\NDM=\NTE=\NDY=\NTY=\NTg=\NjE=\NDY=\NDk=\OTI=\OTU=\MTI0\OTI=\MTUy\MTk1\MTMz\OTY=\MTM0\OTk=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTU=\NDM=\NTE=\NDY=\NTY=\MjY=\NjE=\NDY=\NDk=\OTI=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDU=\NDE=\NTc=\NDc=\NDA=\OTI=\OTU=\MTg1\MjIy\MjQz\MjI3\MTE=\MTM0\MTMx\OTk=\ODg=\ODI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTM=\NDE=\NTc=\NDc=\NDA=\MTI0\MTIy\MTI0\MTU=\NDA=\NTE=\NDY=\NTc=\OTI=\ODg=\NzU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzA=\NjE=\NjM=\NTU=\NTk=\NDY=\NTE=\NDE=\NTA=\NTY=\OA==\NDY=\NjE=\NTA=\NDc=\NDQ=\NjE=\NDY=\NTc=\NTA=\NjM=\Mzc=\OTI=\OTU=\MTIw\MjI3\NTU=\MjIw\MTEy\NTc=\MjU0\OTk=\OTU=\MTI1\ODU=\MTg1\MTYz\MTU3\OTE=\NTE=\MjI3\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\MjIw\NjE=\Mjg=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTA2\Mjg=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjY=\NTc=\NjE=\NDA=\NDE=\NDY=\NTc=\NDc=\OTI=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTA0\Mjg=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NjE=\NDE=\NDA=\NTE=\NTg=\NjE=\NDY=\NDk=\OTI=\OTU=\MTk2\NjY=\MTI5\MjUy\MjUx\MjAx\MTU5\OTk=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjk=\NDE=\NDA=\NTE=\MjY=\NjE=\NDY=\NDk=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDM=\NTc=\NDg=\NjM=\NTE=\NDk=\NTc=\OTI=\OTU=\MTg1\Njc=\MTU1\MTI0\MTU3\MjQy\MTc0\OTk=\OTU=\MTI1\ODU=\MTg1\MTYz\MTU3\OTE=\MTk1\MjI3\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\Mzg=\Mjg=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NDU=\Mjg=\OTU=\NDY=\NDA=\OTg=\MjIw\MjM3\MjQw\MjQ4\OTk=\OTU=\MTk=\MTc0\MTY2\MTYy\MjA3\MTg4\MjI5\OTk=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NDM=\Mjg=\OTU=\MjM3\MTEx\MjEx\Mjg=\MTMx\MzM=\MTQ1\OTk=\OTU=\NDE=\NzQ=\MTI=\OTI=\MTc0\MjA2\NDk=\MjI3\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\MjUy\NTU=\Mjg=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTE=\NTc=\NDg=\NjM=\NTE=\NDk=\NTc=\MTEy\OTI=\ODg=\OTQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI1\OTI=\OTU=\MjM5\MzA=\NzA=\MTg4\MjU=\MTQ5\MTQx\OTk=\OTU=\MTgx\MTI3\NjY=\MTU2\MjE0\MzA=\MTMy\OTk=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjg=\NTg=\Mjg=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzA=\Mjg=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjA=\NTM=\MTI0\MTI1\OTI=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTA4\Mjg=\OTU=\MTQ0\NzI=\MTc=\OTI=\MjM4\MTQ=\MjEy\MjI3\OTU=\MjAw\MTQy\MTc5\MTk1\MTU1\MjEy\MTc2\OTk=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI0\NTU=\Mjg=\ODg=\MTI1\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\NDY=\NTc=\NTY=\NTM=\NDA=\NDc=\MTI0\NDA=\NTE=\MTI0\MjE=\NDA=\NDc=\MTk=\NTU=\MTI0\NTg=\NTE=\NDY=\MTI0\NDc=\NjM=\NDY=\NTM=\NDQ=\NDA=\NTM=\NTA=\NTk=\MTI0\MTI1\OTI=\ODg=\ODM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OA==\NTc=\MzY=\NDA=\NA==\Mjk=\NDg=\NTM=\NTk=\NTA=\NDk=\NTc=\NTA=\NDA=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTY=\NTc=\NTg=\NDA=\OTI=\ODg=\ODI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NjE=\NDE=\NDA=\NTE=\NTg=\NjE=\NDY=\NDk=\NTg=\NDY=\NjE=\NDk=\NTc=\OTI=\OTU=\MTE5\MzA=\OTc=\MjI3\MTI0\MjM2\MTc0\OTk=\OTU=\MTQ5\MzI=\MzQ=\MTMx\MTM=\MjI4\MTk0\MjI3\OTM=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NjE=\NDE=\NDA=\NTE=\NDg=\NDE=\NTg=\NTg=\Mzc=\OTI=\OTU=\MjIy\ODI=\MTIx\MTI0\Mjc=\MjQz\MjM2\OTk=\OTU=\MTU4\MjI=\OTc=\MjI3\MjM5\MTc1\MTU0\OTk=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\MTU2\OQ==\Mjg=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjk=\Mjg=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTY=\NDE=\NTg=\NTg=\Mzc=\MTI0\MTAy\MTI0\MTk=\MjY=\MjY=\OTI=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NjE=\NDE=\NDA=\NTE=\NDk=\NjE=\NDY=\NTM=\NTA=\NTc=\OTI=\OTU=\MTMx\MTc2\MTY5\OTk=\MTM5\MjAy\MTM2\OTk=\OTU=\MTUz\MTQ5\MjM3\MjIw\MTYz\NTM=\MTU1\OTk=\ODg=\ODE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTc=\NjE=\NDY=\NTM=\NTA=\NTc=\MTI0\MTAy\MTI0\MTk=\MjY=\MjY=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NjE=\NDE=\NDA=\NTE=\NjI=\NDE=\NTk=\NTk=\Mzc=\OTI=\OTU=\OTM=\MTQx\MTI5\MjI3\MTU5\MTQ2\MTkw\OTk=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzA=\NDE=\NTk=\NTk=\Mzc=\MTI0\MTAy\MTI0\MTk=\MjY=\MjY=\OTI=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NjE=\NDE=\NDA=\NTE=\NjI=\NDE=\NDc=\NTE=\OTI=\OTU=\MTE1\MjI4\MTc4\MTYz\MjY=\MjQz\MjM2\OTk=\OTU=\MjIz\Mg==\MTk0\Njc=\MQ==\MjQ4\MTM3\OTk=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzA=\NDE=\NDc=\NTE=\MTI0\MTAy\MTI0\MTk=\MjY=\MjY=\OTI=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NjE=\NDE=\NDA=\NTE=\NTA=\NTE=\NTE=\NjI=\OTI=\OTU=\MTc0\MTE5\MjU1\MzU=\MTc2\NTE=\MTM2\OTk=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTg=\NTE=\NTE=\NjI=\MTI0\MTAy\MTI0\MTk=\MjY=\MjY=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NjE=\NDE=\NDA=\NTE=\NDA=\NTI=\NTM=\NTc=\NTg=\OTI=\OTU=\MTgy\MTg4\OTc=\NjA=\MTg=\MjMx\MTkw\OTk=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OA==\NTI=\NTM=\NTc=\NTg=\MTI0\MTAy\MTI0\MTk=\MjY=\MjY=\OTI=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NjE=\NDE=\NDA=\NTE=\NDQ=\NDg=\NjE=\Mzc=\NTc=\NDY=\OTI=\OTU=\MTUx\MjQz\MTg0\MTYz\MjAx\MTI2\MTg4\OTk=\ODg=\ODI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\NjE=\NDY=\NTA=\NjE=\NTk=\NTc=\MTI0\MTAy\MTI0\MTk=\MjY=\MjY=\OTI=\ODg=\ODI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDA=\NTc=\NDg=\NTc=\NDQ=\NTE=\NDY=\NDA=\NTg=\NDY=\NjE=\NDk=\NTc=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NjI=\NDE=\NTk=\NTk=\Mzc=\NTM=\NDc=\NDg=\NjE=\NTA=\NTY=\OTI=\OTU=\MjA=\MTEy\MTc1\Mw==\MjQ2\OQ==\MjU1\OTk=\OTU=\NzY=\MjQ4\MjAz\MTU2\MTQ5\MTI=\MTU4\OTk=\ODg=\ODE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzA=\NDE=\NTk=\NTk=\Mzc=\MTI0\MjE=\NDc=\NDg=\NjE=\NTA=\NTY=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDA=\NTI=\NTM=\NTc=\NTg=\NTM=\NDc=\NDg=\NjE=\NTA=\NTY=\OTI=\OTU=\NzI=\MTgx\MTEw\MTU2\MTY3\OTA=\MTM4\OTk=\ODg=\ODE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OA==\NTI=\NTM=\NTc=\NTg=\MTI0\MjE=\NDc=\NDg=\NjE=\NTA=\NTY=\OTI=\ODg=\ODE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTg=\NTE=\NTE=\NDc=\NTI=\NjE=\NTM=\NDc=\NDg=\NjE=\NTA=\NTY=\OTI=\OTU=\MTc1\MTgx\MjMx\MTk1\NDI=\Njc=\MTg1\OTk=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjY=\NTE=\NTE=\NDc=\NTI=\NjE=\OTI=\ODg=\ODE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTQ=\NDE=\NTA=\NTk=\NDg=\NTc=\NTM=\NDc=\NDg=\NjE=\NTA=\NTY=\OTI=\OTU=\MTI4\MTY1\NzE=\Mjg=\OTM=\ODA=\MTg1\OTk=\OTU=\MjI5\Mjg=\MTcz\MzU=\MTI1\MjA5\MTQw\OTk=\ODg=\ODI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjI=\NDE=\NTA=\NTk=\NDg=\NTc=\MTI0\MjE=\NDc=\NDg=\NjE=\NTA=\NTY=\OTI=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTA=\NTE=\NTE=\NjI=\NTM=\NDc=\NDg=\NjE=\NTA=\NTY=\OTI=\OTU=\NTg=\MTgy\MjMw\Mw==\MTI1\MjA5\MTQw\OTk=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTg=\NTE=\NTE=\NjI=\MTI0\MjE=\NDc=\NDg=\NjE=\NTA=\NTY=\OTI=\ODg=\ODM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDk=\NjE=\NDY=\NTM=\NTc=\NTQ=\NTE=\NjE=\NTM=\NDc=\NDg=\NjE=\NTA=\NTY=\OTI=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTc=\NjE=\NDY=\NTM=\NTc=\NTQ=\NTE=\NjE=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDc=\NjE=\NTA=\NTQ=\NTM=\NTM=\NDc=\NDg=\NjE=\NTA=\NTY=\OTI=\OTU=\OTM=\MjQ4\MjIy\MTYz\MjM1\MjM0\MTM5\OTk=\ODg=\ODE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTU=\NjE=\NTA=\NTQ=\NTM=\MTI0\MjE=\NDc=\NDg=\NjE=\NTA=\NTY=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTY=\NTc=\NDI=\NTM=\NDg=\NTM=\NDc=\NDg=\NjE=\NTA=\NTY=\OTI=\OTU=\MTUw\MTY4\MTg5\MTMx\MjMx\Mzk=\MTM4\OTk=\OTU=\OTg=\MjU=\MTM1\Njc=\MjA2\Mzk=\MTM5\OTk=\ODg=\ODE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjQ=\NTc=\NDI=\NTM=\NDg=\MTI0\MjE=\NDc=\NDg=\NjE=\NTA=\NTY=\OTI=\ODg=\ODI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTg=\NDE=\NTA=\NjM=\NDA=\NTM=\NTE=\NTA=\NTg=\NDY=\NjE=\NDk=\NTc=\OTI=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjY=\NDE=\NTA=\NjM=\NDA=\NTM=\NTE=\NTA=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NjI=\NjE=\NDc=\NTc=\NDQ=\NDg=\NjE=\NDA=\NTc=\OTI=\OTU=\ODk=\MTk5\MTc2\MTYz\Njk=\MjQy\MjQ1\OTk=\OTU=\NjE=\MTQ2\NTM=\MTk1\NQ==\NzM=\MTU4\OTk=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\MTU2\MA==\Mjg=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTAw\Mjg=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzA=\NjE=\NDc=\NTc=\NDQ=\NDg=\NjE=\NDA=\NTc=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTM=\Mzc=\NTg=\NTc=\OTI=\OTU=\MTky\MTUx\MjA3\MjI3\ODU=\MTQy\MTM4\OTk=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTY=\NTE=\NjE=\NTY=\MTI0\MjE=\NQ==\MTI0\MjY=\MjU=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDc=\NTI=\NjE=\NDA=\NDA=\NTc=\NDY=\NDI=\NjE=\NDc=\NDA=\OTI=\OTU=\NzE=\MjMw\MTMz\Njc=\MTE2\MTA3\MTg1\OTk=\ODg=\Nzc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTY=\NTE=\NjE=\NTY=\MTI0\MTU=\NTI=\NjE=\NDA=\NDA=\NTc=\NDY=\NDI=\NjE=\NDc=\NDA=\OTI=\ODg=\ODE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NjM=\NTE=\NDg=\NDg=\NTc=\NjM=\NDA=\NjM=\NTI=\NTc=\NDc=\NDA=\OTI=\OTU=\MzQ=\ODQ=\Nw==\OTI=\MTM1\MTI0\MTQx\OTk=\ODg=\ODM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\NTE=\NDg=\NDg=\NTc=\NjM=\NDA=\MTE4\MzA=\MTQ=\MTk=\MjM=\MjU=\MTE4\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDA=\NDQ=\NjM=\NTI=\NTc=\NDc=\NDA=\OTI=\OTU=\MjEz\MjA4\MTg2\MzU=\MTY4\MTY0\MTM4\OTk=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OA==\MTI=\MTI0\MzE=\NTI=\NTc=\NDc=\NDA=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDc=\NjM=\NjE=\NTA=\NTA=\NTc=\NDY=\OTI=\OTU=\MTY0\MjQz\MTg2\MTMx\MjM4\MTI3\MTg1\OTk=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTU=\NjM=\NjE=\NTA=\NTA=\NTc=\NDY=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDc=\NTc=\NDY=\NDI=\NTc=\NDY=\NDg=\NjE=\NTk=\OTI=\OTU=\Njk=\MTU4\MTI2\MjUy\NDU=\MjI=\MTMy\OTk=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTU=\NTc=\NDY=\NDI=\NTc=\NDY=\MTI0\MTY=\NjE=\NTk=\OTI=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDU=\NDE=\NTc=\NDc=\NDA=\NTg=\NDY=\NjE=\NDk=\NTc=\OTI=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NjI=\NDE=\NTk=\NTk=\Mzc=\NDU=\NDE=\NTc=\NDc=\NDA=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzA=\NDE=\NTk=\NTk=\Mzc=\MTI0\MTM=\NDE=\NTc=\NDc=\NDA=\OTI=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDg=\NDE=\NTg=\NTg=\Mzc=\NDU=\NDE=\NTc=\NDc=\NDA=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTY=\NDE=\NTg=\NTg=\Mzc=\MTI0\MTM=\NDE=\NTc=\NDc=\NDA=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDk=\NjE=\NDY=\NTM=\NTA=\NTc=\NDU=\NDE=\NTc=\NDc=\NDA=\OTI=\OTU=\MTg4\MjQ2\ODI=\NjA=\NjE=\MjY=\MTg1\OTk=\ODg=\ODE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTc=\NjE=\NDY=\NTM=\NTA=\NTc=\MTI0\MTM=\NDE=\NTc=\NDc=\NDA=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTA=\NTE=\NTE=\NjI=\NTk=\NDE=\NTA=\OTI=\OTU=\MTg4\MTEy\NDg=\MjUy\MTM3\NzQ=\MTQw\OTk=\ODg=\ODM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTg=\NTE=\NTE=\NjI=\MTI0\Mjc=\NDE=\NTA=\MTI0\MTM=\NDE=\NTc=\NDc=\NDA=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTA=\NTE=\NTE=\NjI=\NDc=\NDM=\NTE=\NDY=\NTY=\OTI=\OTU=\Mzg=\MzQ=\NzQ=\MTI0\Nzc=\MTg4\MTM3\OTk=\OTU=\MjI1\MTM0\NjM=\MzU=\Mw==\MjM1\MTQ3\OTk=\ODg=\Nzc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTg=\NTE=\NTE=\NjI=\MTI0\MTU=\NDM=\NTE=\NDY=\NTY=\MTI0\MTM=\NDE=\NTc=\NDc=\NDA=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTA=\NTE=\NTE=\NjI=\NDU=\NDE=\NTc=\NDc=\NDA=\OTI=\OTU=\NTM=\MjI=\MTg1\MTYz\MTgz\MTEw\MTg1\OTk=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTg=\NTE=\NTE=\NjI=\MTI0\MTM=\NDE=\NTc=\NDc=\NDA=\OTI=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDA=\NTI=\NTM=\NTc=\NTg=\NDU=\NDE=\NTc=\NDc=\NDA=\OTI=\OTU=\MTY2\MjUw\Mzc=\Mw==\MjY=\ODk=\MTM5\OTk=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OA==\NTI=\NTM=\NTc=\NTg=\MTI0\MTM=\NDE=\NTc=\NDc=\NDA=\OTI=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTA=\NTE=\NTA=\NTE=\NDc=\NjE=\NDk=\NjE=\NjI=\NTE=\OTI=\OTU=\Ng==\MjQ2\ODQ=\MTU2\ODY=\MTQz\MTg4\OTk=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTg=\NTE=\NTA=\NTE=\NDc=\NjE=\NDk=\NjE=\MTI0\MzA=\NTE=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NjI=\NTM=\NDc=\NTc=\NTA=\NDA=\NTE=\OTI=\OTU=\Mzk=\Mzc=\MTkx\MTk1\NDM=\MjMz\MTg4\OTk=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzA=\NTM=\NDc=\NTc=\NTA=\NDA=\NTE=\OTI=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTU=\NjE=\NDA=\NjE=\NTA=\NjE=\OTI=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjM=\NjE=\NDA=\NjE=\NTA=\NjE=\OTI=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTQ=\NTM=\NDA=\NDA=\NTc=\OTI=\OTU=\MjQ4\ODQ=\MTgw\OTk=\NjU=\ODM=\MTg0\OTk=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjI=\NTM=\NDA=\NDA=\NTc=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTk=\NDY=\Mzc=\NDQ=\NTI=\NTE=\NTA=\OTI=\OTU=\NTk=\OTk=\NTM=\MTg4\MTY3\OTA=\MTM4\OTk=\OTU=\MTUz\MTM5\MTU4\Njc=\MjE0\MTcz\MTkx\OTk=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjc=\NDY=\Mzc=\NDQ=\NTI=\NTE=\NTA=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDM=\NTE=\NTE=\NTY=\NTc=\NTA=\NDc=\NDM=\NTE=\NDY=\NTY=\OTI=\ODg=\ODE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTE=\NTE=\NTE=\NTY=\NTc=\NTA=\MTI0\MTU=\NDM=\NTE=\NDY=\NTY=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDQ=\NTM=\NDQ=\NTc=\OTI=\OTU=\NzY=\MTA2\MTY0\MTk1\OQ==\MjE4\MTg3\OTk=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NTM=\NDQ=\NTc=\OTI=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NjI=\NDg=\NjE=\NjM=\NTU=\NDg=\NTc=\NTk=\OTI=\OTU=\MjE3\Nw==\ODU=\MjUy\MTU4\NTI=\MTg3\OTk=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzA=\NDg=\NjE=\NjM=\NTU=\MTI0\MTY=\NTc=\NTk=\OTI=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDY=\Mzc=\NDE=\NDc=\NTE=\NTU=\NTc=\NTA=\OTI=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTQ=\Mzc=\NDE=\NDc=\NTE=\NTU=\NTc=\NTA=\OTI=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTY=\NTg=\NDc=\NTc=\NDg=\NDg=\NTc=\NDY=\OTI=\OTU=\MTcz\MjEy\Njk=\OTI=\MTY3\MTMx\MTgy\OTk=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjQ=\MjY=\MTI0\MTU=\NTc=\NDg=\NDg=\NTc=\NDY=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTg=\NDg=\NTM=\NTA=\NDA=\NDg=\NTE=\NjM=\NTU=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjY=\NDg=\NTM=\NTA=\NDA=\NDg=\NTE=\NjM=\NTU=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NjE=\NTA=\NDA=\NTM=\NjM=\NTI=\NTc=\NjE=\NDA=\OTI=\OTU=\MTg4\MTE4\MTQ2\MTk1\MTM4\MjAz\MTkw\OTk=\ODg=\Nzg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjk=\NTA=\NDA=\NTM=\MTI0\MzE=\NTI=\NTc=\NjE=\NDA=\MTI0\MzA=\Mzc=\NDQ=\NjE=\NDc=\NDc=\OTI=\OTU=\OTM=\Nzc=\MTYy\Njc=\ODU=\NDI=\MTM3\OTk=\OTU=\NDk=\MTE3\OTM=\MTg4\MTU3\OTE=\MTg3\OTk=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\MjIw\MjE=\Mjg=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\MjIw\MzE=\Mjg=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjE=\NDk=\NjE=\NTk=\NTc=\OTI=\ODg=\NzU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDY=\NjI=\MzY=\NjE=\NDc=\NDc=\NTc=\NDA=\NTM=\NTY=\MTAy\MTE1\MTE1\MTAx\MTA1\MTEx\MTA5\MTAx\MTA4\MTAw\MTEx\MTA4\OTI=\ODg=\ODM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDc=\NDM=\NTE=\NDY=\NTY=\NTg=\NjE=\NDY=\NDk=\NTg=\NDY=\NjE=\NDk=\NTc=\OTI=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTU=\NDM=\NTE=\NDY=\NTY=\MTI0\MjY=\NjE=\NDY=\NDk=\OTI=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTc=\NDU=\NDE=\NTM=\NDQ=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjU=\NDU=\NDE=\NTM=\NDQ=\MTI0\MTAy\MTI0\MTk=\MjY=\MjY=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTY=\NDE=\NDQ=\NTc=\OTI=\OTU=\Nzc=\MjE2\MjQ2\Njc=\MTAz\MTc0\MTQ3\OTk=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjQ=\NDE=\NDQ=\NTc=\MTI0\MTAy\MTI0\MTk=\MjY=\MjY=\OTI=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NjI=\NjE=\NjM=\NTU=\NDQ=\NjE=\NjM=\NTU=\OTI=\OTU=\MTQ1\MTIy\MjI4\OTk=\MjMy\MTI2\MTM5\OTk=\ODg=\ODI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzA=\NjE=\NjM=\NTU=\NDQ=\NjE=\NjM=\NTU=\MTI0\MTAy\MTI0\MTk=\MTg=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTg=\NjE=\NDY=\NDk=\OTI=\OTU=\OTI=\MTM3\NzU=\MTU2\MjAy\MTU4\MTMw\OTk=\ODg=\ODM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjk=\NjM=\NDA=\NTM=\NDI=\NjE=\NDA=\NTc=\MTI0\MTAy\MTI0\MTk=\MjY=\MjY=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDc=\NDM=\NTE=\NDY=\NTY=\NTA=\NjE=\NDk=\NTc=\OTI=\OTU=\MjUx\OTY=\MjMw\Nzc=\NzQ=\NzM=\MTM3\OTk=\ODg=\ODE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzA=\NTE=\NDY=\NTY=\NTc=\NDY=\MzE=\NTE=\NDg=\NTE=\NDY=\MTEx\OTI=\OTU=\NDA=\MTI1\MTY3\MTUz\Nzc=\NzY=\MjUy\OTk=\OTU=\MTAy\MTM2\MTI5\MTMx\NzA=\MjQ=\MTQw\OTk=\OTU=\MTU=\NDg=\Nzc=\MTU2\MTgx\MjM1\MTg1\OTk=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTM=\Mjg=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTU=\NDM=\NTE=\NDY=\NTY=\MTI0\MTg=\NjE=\NDk=\NTc=\OTI=\OTU=\Mzc=\NzQ=\MTY1\MTYz\MjMz\ODM=\MTkx\OTk=\ODg=\ODM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NjE=\NTA=\NDA=\NTM=\NjM=\NTI=\NTc=\NjE=\NDA=\NTg=\NDY=\NjE=\NDk=\NTc=\OTI=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDA=\NDQ=\NjI=\Mzc=\NDQ=\NjE=\NDc=\NDc=\OTI=\OTU=\NjU=\MjM=\Njg=\OTI=\MjI0\Mzk=\MTM4\OTk=\OTU=\NDQ=\MzI=\MTgw\MTg4\NTU=\MTMy\MTU5\OTk=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OA==\MTI=\MTI0\MzA=\Mzc=\NDQ=\NjE=\NDc=\NDc=\OTI=\ODg=\Nzg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjk=\NTA=\NDA=\NTM=\MTEz\MzE=\NTI=\NTc=\NjE=\NDA=\MTI0\MzA=\Mzc=\NDQ=\NjE=\NDc=\NDc=\OTI=\ODg=\ODM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NjE=\NTA=\NDA=\NTM=\NTg=\NjE=\NDY=\NDk=\NjI=\Mzc=\NDQ=\NjE=\NDc=\NDc=\OTI=\OTU=\MjU0\MTQ3\NzU=\MTg4\Ng==\NTY=\MTQw\OTk=\ODg=\Nzc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjk=\NTA=\NDA=\NTM=\MTI0\MjY=\NjE=\NDY=\NDk=\MTI0\MzA=\Mzc=\NDQ=\NjE=\NDc=\NDc=\OTI=\ODg=\Nzc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTc=\NTE=\NDE=\NDc=\NTc=\MzA=\NDE=\NDA=\NDA=\NTE=\NTA=\MTA5\MjQ=\NTE=\NDM=\NTA=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NjM=\NTE=\NTA=\NTA=\NTc=\NjM=\NDA=\OTI=\ODg=\NzU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTM=\NDc=\Mw==\NDQ=\NDY=\NTE=\NDA=\NTE=\NDc=\NDk=\NjE=\NDc=\NTI=\NTc=\NDY=\Mw==\NjM=\NjE=\NDg=\NDg=\NTc=\NDY=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjA=\NDA=\NDA=\NDQ=\Mjc=\NTc=\NDA=\OTI=\ODg=\OTk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTI=\NDA=\NDA=\NDQ=\MTAy\MTE1\MTE1\NTI=\NDM=\NTM=\NTY=\NDM=\NTI=\NTM=\NDA=\NTc=\NDg=\NTM=\NDc=\NDA=\MTE0\MTA4\MTA4\MTA4\NDM=\NTc=\NjI=\NTI=\NTE=\NDc=\NDA=\NjE=\NDQ=\NDQ=\MTE0\NjM=\NTE=\NDk=\MTE1\NDg=\NTE=\NjE=\NTY=\NTc=\NDY=\MTE1\NDg=\NTM=\NDI=\NTc=\NDc=\NTI=\NDE=\NDA=\NTY=\NTE=\NDM=\NTA=\MTE0\NDA=\MzY=\NDA=\OTI=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTk=\NTA=\NDg=\NTM=\NTA=\NTc=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDM=\NjE=\NTM=\NDA=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTk=\NTg=\NTg=\NDg=\NTM=\NTA=\NTc=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjM=\NTM=\NjM=\NTU=\OTI=\ODg=\NzY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\NTE=\NTA=\NDA=\NjE=\NjM=\NDA=\MTEy\MTI0\MjE=\NDA=\NDc=\MTk=\NTU=\MTE0\OTI=\ODg=\NjY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjQ=\NTE=\NTA=\NDA=\MTI0\MjY=\NTE=\NDY=\NTk=\NTc=\NDA=\MTI0\OA==\NTE=\MTI0\OA==\NDE=\NDY=\NTA=\MTI0\MTk=\NTA=\MTI0\MzA=\Mzc=\NDQ=\NjE=\NDc=\NDc=\OTI=\MTA2\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTE=\OTI=\OTI=\OTI=\ODE=\OTI=\OTI=\OTI=\OTI=\OTM=\OTI=\ODg=\ODI=\OTI=\OTI=\OTI=\MjU=\OTI=\OTI=\OTI=\MjY=\Mjg=\MTU2\OTI=\MjIx\MjIw\OTI=\OTI=\MA==\MjIw\OTI=\OTM=\MjE3\OTI=\OTM=\OTI=\MjE4\Mjg=\Mjk=\OTM=\MjE=\MjIw\MjIw\MjIx\MjE=\OTI=\OTI=\MjIz\MjE3\MTU2\OTM=\OTI=\MTU3\OTI=\OTQ=\OTI=\MTky\Mjg=\OTI=\OTM=\MjE1\Mjg=\MTU4\OTI=\MTky\Mjg=\OTI=\OTM=\NjY=\OTI=\MjIw\OTI=\ODY=\OTI=\OTI=\OTI=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjE=\NTA=\NDc=\NDA=\NjE=\NTA=\NjM=\NTc=\OTI=\ODg=\ODg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTA=\NTc=\NDM=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTc=\NTc=\NDc=\NDc=\NjE=\NTk=\NTc=\OTI=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NjE=\NDY=\NTc=\NTA=\NDA=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTk=\NjE=\NDk=\NTc=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTE=\NTE=\NDY=\NTU=\NDc=\NDQ=\NjE=\NjM=\NTc=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OA==\NTc=\MzY=\NDA=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDM=\NjE=\NTM=\NDA=\OTI=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTcy\OTk=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjQ=\NTc=\NDc=\NDA=\NDY=\NTE=\Mzc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\ODM=\OTI=\OTI=\OTI=\NzM=\OTI=\OTI=\OTI=\OTI=\OTM=\OTI=\ODg=\ODI=\OTI=\OTI=\OTI=\MjU=\OTI=\OTI=\OTI=\MjY=\Mjg=\MTU2\OTI=\MjIx\MjIw\OTI=\OTI=\MA==\MjIw\OTI=\OTM=\MjE3\OTI=\OTM=\OTI=\MjE4\Mjg=\Mjk=\OTM=\MjE=\MjIw\MjIw\MjIx\MjE=\OTI=\OTI=\MjIz\MjE3\MTU2\OTM=\OTI=\MTU3\OTI=\OTQ=\OTI=\MTky\Mjg=\OTI=\OTM=\MjE1\Mjg=\MTU4\OTI=\MTky\Mjg=\OTI=\OTM=\NjY=\OTI=\MjIw\OTI=\ODY=\OTI=\OTI=\OTI=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjE=\NTA=\NDc=\NDA=\NjE=\NTA=\NjM=\NTc=\OTI=\ODg=\ODg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTA=\NTc=\NDM=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTc=\NTc=\NDc=\NDc=\NjE=\NTk=\NTc=\OTI=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NjE=\NDY=\NTc=\NTA=\NDA=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTk=\NjE=\NDk=\NTc=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTE=\NTE=\NDY=\NTU=\NDc=\NDQ=\NjE=\NjM=\NTc=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OA==\NTc=\MzY=\NDA=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDM=\NjE=\NTM=\NDA=\OTI=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\ODQ=\Mjg=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjQ=\NTc=\NDc=\NDA=\NDY=\NTE=\Mzc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTk3\OTU=\OTI=\OTI=\MjU1\OTU=\OTI=\OTI=\OTE=\OTI=\OTI=\OTU=\NzU=\OTI=\OTI=\OTI=\ODg=\OTI=\OTI=\OTI=\ODU=\Mjg=\Mjg=\MjIw\ODg=\OTI=\MjIw\OTI=\ODU=\MjIw\Mjg=\MjIw\ODg=\OTI=\OTI=\OTM=\ODU=\MjIw\Mjg=\MjIw\ODg=\OTI=\MjIw\OTM=\ODU=\MjIw\Mjg=\MjIw\ODg=\OTI=\OTI=\OTQ=\ODU=\MjIw\Mjg=\MjIw\ODg=\OTI=\MjIw\OTQ=\ODU=\MjIw\Mjg=\MjIw\ODg=\OTI=\OTI=\OTU=\ODc=\MTU2\Mjg=\OTI=\MjIx\OTI=\OTM=\OTI=\NjQ=\MjIw\MjIw\OTM=\NzA=\OTI=\OTI=\OTI=\NzQ=\MTU2\OTI=\MjIw\ODg=\OTI=\OTI=\OTU=\OTA=\OTI=\Mjk=\OTI=\ODc=\Mjg=\Mjk=\OTI=\NjQ=\Mjg=\OTI=\OTM=\NjY=\OTI=\MjIw\OTI=\OTA=\OTI=\OTI=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTA=\NTM=\NDc=\NTM=\NjI=\NDg=\NTc=\OTI=\OTM=\OTM=\OTM=\OTI=\ODg=\ODM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjY=\NTM=\NTA=\NTY=\MjY=\NTM=\NDY=\NDc=\NDA=\MzE=\NTI=\NTM=\NDg=\NTY=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDM=\NTc=\NDg=\NjM=\NTE=\NDk=\NTc=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjQ=\NTc=\NDc=\NDA=\NDY=\NTE=\Mzc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjQ5\OTU=\OTI=\OTI=\MjQz\OTU=\OTI=\OTI=\OTE=\OTI=\OTI=\OTU=\NzU=\OTI=\OTI=\OTI=\ODg=\OTI=\OTI=\OTI=\ODU=\Mjg=\Mjg=\MjIw\ODg=\OTI=\MjIw\OTI=\ODU=\MjIw\Mjg=\MjIw\ODg=\OTI=\OTI=\OTM=\ODU=\Mjg=\Mjg=\MjIw\ODg=\OTI=\MjIw\OTM=\ODU=\Mjg=\Mjg=\MjIw\ODg=\OTI=\OTI=\OTQ=\ODU=\Mjg=\Mjg=\MjIw\ODg=\OTI=\MjIw\OTQ=\ODU=\Mjg=\Mjg=\MjIw\ODg=\OTI=\OTI=\OTU=\ODc=\MTU2\Mjg=\OTI=\MjIx\OTI=\OTM=\OTI=\NjQ=\MjIw\MjIw\OTM=\NzA=\OTI=\OTI=\OTI=\NzQ=\MTU2\OTI=\MjIw\ODg=\OTI=\OTI=\OTU=\OTA=\OTI=\Mjk=\OTI=\ODc=\Mjg=\Mjk=\OTI=\NjQ=\Mjg=\OTI=\OTM=\NjY=\OTI=\MjIw\OTI=\OTA=\OTI=\OTI=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTA=\NTM=\NDc=\NTM=\NjI=\NDg=\NTc=\OTI=\OTM=\OTI=\OTM=\OTM=\ODg=\ODM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjY=\NTM=\NTA=\NTY=\MjY=\NTM=\NDY=\NDc=\NDA=\MzE=\NTI=\NTM=\NDg=\NTY=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDM=\NTc=\NDg=\NjM=\NTE=\NDk=\NTc=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjQ=\NTc=\NDc=\NDA=\NDY=\NTE=\Mzc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjM3\OTU=\OTI=\OTI=\MjMx\OTU=\OTI=\OTI=\OTE=\OTI=\OTI=\OTU=\NzU=\OTI=\OTI=\OTI=\ODg=\OTI=\OTI=\OTI=\ODU=\Mjg=\Mjg=\MjIw\ODg=\OTI=\MjIw\OTI=\ODU=\Mjg=\Mjg=\MjIw\ODg=\OTI=\OTI=\OTM=\ODU=\MjIw\Mjg=\MjIw\ODg=\OTI=\MjIw\OTM=\ODU=\Mjg=\Mjg=\MjIw\ODg=\OTI=\OTI=\OTQ=\ODU=\Mjg=\Mjg=\MjIw\ODg=\OTI=\MjIw\OTQ=\ODU=\Mjg=\Mjg=\MjIw\ODg=\OTI=\OTI=\OTU=\ODc=\MTU2\Mjg=\OTI=\MjIx\OTI=\OTM=\OTI=\NjQ=\MjIw\MjIw\OTM=\NzA=\OTI=\OTI=\OTI=\NzQ=\MTU2\OTI=\MjIw\ODg=\OTI=\OTI=\OTU=\OTA=\OTI=\Mjk=\OTI=\ODc=\Mjg=\Mjk=\OTI=\NjQ=\Mjg=\OTI=\OTM=\NjY=\OTI=\MjIw\OTI=\OTA=\OTI=\OTI=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTA=\NTM=\NDc=\NTM=\NjI=\NDg=\NTc=\OTI=\OTM=\OTI=\OTM=\OTM=\ODg=\ODM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjY=\NTM=\NTA=\NTY=\MjY=\NTM=\NDY=\NDc=\NDA=\MzE=\NTI=\NTM=\NDg=\NTY=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDM=\NTc=\NDg=\NjM=\NTE=\NDk=\NTc=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjQ=\NTc=\NDc=\NDA=\NDY=\NTE=\Mzc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjI1\OTU=\OTI=\OTI=\MTU1\OTU=\OTI=\OTI=\OTE=\OTI=\OTI=\OTU=\NzU=\OTI=\OTI=\OTI=\ODg=\OTI=\OTI=\OTI=\ODU=\Mjg=\Mjg=\MjIw\ODg=\OTI=\MjIw\OTI=\ODU=\Mjg=\Mjg=\MjIw\ODg=\OTI=\OTI=\OTM=\ODU=\Mjg=\Mjg=\MjIw\ODg=\OTI=\MjIw\OTM=\ODU=\MjIw\Mjg=\MjIw\ODg=\OTI=\OTI=\OTQ=\ODU=\Mjg=\Mjg=\MjIw\ODg=\OTI=\MjIw\OTQ=\ODU=\Mjg=\Mjg=\MjIw\ODg=\OTI=\OTI=\OTU=\ODc=\MTU2\Mjg=\OTI=\MjIx\OTI=\OTM=\OTI=\NjQ=\MjIw\MjIw\OTM=\NzA=\OTI=\OTI=\OTI=\NzQ=\MTU2\OTI=\MjIw\ODg=\OTI=\OTI=\OTU=\OTA=\OTI=\Mjk=\OTI=\ODc=\Mjg=\Mjk=\OTI=\NjQ=\Mjg=\OTI=\OTM=\NjY=\OTI=\MjIw\OTI=\OTA=\OTI=\OTI=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTA=\NTM=\NDc=\NTM=\NjI=\NDg=\NTc=\OTI=\OTM=\OTI=\OTM=\OTM=\ODg=\ODM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjY=\NTM=\NTA=\NTY=\MjY=\NTM=\NDY=\NDc=\NDA=\MzE=\NTI=\NTM=\NDg=\NTY=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDM=\NTc=\NDg=\NjM=\NTE=\NDk=\NTc=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjQ=\NTc=\NDc=\NDA=\NDY=\NTE=\Mzc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTQ5\OTU=\OTI=\OTI=\MTQz\OTU=\OTI=\OTI=\OTE=\OTI=\OTI=\OTU=\NzU=\OTI=\OTI=\OTI=\ODg=\OTI=\OTI=\OTI=\ODU=\Mjg=\Mjg=\MjIw\ODg=\OTI=\MjIw\OTI=\ODU=\Mjg=\Mjg=\MjIw\ODg=\OTI=\OTI=\OTM=\ODU=\Mjg=\Mjg=\MjIw\ODg=\OTI=\MjIw\OTM=\ODU=\Mjg=\Mjg=\MjIw\ODg=\OTI=\OTI=\OTQ=\ODU=\MjIw\Mjg=\MjIw\ODg=\OTI=\MjIw\OTQ=\ODU=\Mjg=\Mjg=\MjIw\ODg=\OTI=\OTI=\OTU=\ODc=\MTU2\Mjg=\OTI=\MjIx\OTI=\OTM=\OTI=\NjQ=\MjIw\MjIw\OTM=\NzA=\OTI=\OTI=\OTI=\NzQ=\MTU2\OTI=\MjIw\ODg=\OTI=\OTI=\OTU=\OTA=\OTI=\Mjk=\OTI=\ODc=\Mjg=\Mjk=\OTI=\NjQ=\Mjg=\OTI=\OTM=\NjY=\OTI=\MjIw\OTI=\OTA=\OTI=\OTI=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTA=\NTM=\NDc=\NTM=\NjI=\NDg=\NTc=\OTI=\OTM=\OTI=\OTM=\OTM=\ODg=\ODM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjY=\NTM=\NTA=\NTY=\MjY=\NTM=\NDY=\NDc=\NDA=\MzE=\NTI=\NTM=\NDg=\NTY=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDM=\NTc=\NDg=\NjM=\NTE=\NDk=\NTc=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjQ=\NTc=\NDc=\NDA=\NDY=\NTE=\Mzc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTM3\OTU=\OTI=\OTI=\MTMx\OTU=\OTI=\OTI=\OTE=\OTI=\OTI=\OTU=\NzU=\OTI=\OTI=\OTI=\ODg=\OTI=\OTI=\OTI=\ODU=\Mjg=\Mjg=\MjIw\ODg=\OTI=\MjIw\OTI=\ODU=\Mjg=\Mjg=\MjIw\ODg=\OTI=\OTI=\OTM=\ODU=\Mjg=\Mjg=\MjIw\ODg=\OTI=\MjIw\OTM=\ODU=\Mjg=\Mjg=\MjIw\ODg=\OTI=\OTI=\OTQ=\ODU=\Mjg=\Mjg=\MjIw\ODg=\OTI=\MjIw\OTQ=\ODU=\MjIw\Mjg=\MjIw\ODg=\OTI=\OTI=\OTU=\ODc=\MTU2\Mjg=\OTI=\MjIx\OTI=\OTM=\OTI=\NjQ=\MjIw\MjIw\OTM=\NzA=\OTI=\OTI=\OTI=\NzQ=\MTU2\OTI=\MjIw\ODg=\OTI=\OTI=\OTU=\OTA=\OTI=\Mjk=\OTI=\ODc=\Mjg=\Mjk=\OTI=\NjQ=\Mjg=\OTI=\OTM=\NjY=\OTI=\MjIw\OTI=\OTA=\OTI=\OTI=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTA=\NTM=\NDc=\NTM=\NjI=\NDg=\NTc=\OTI=\OTM=\OTI=\OTM=\OTM=\ODg=\ODM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjY=\NTM=\NTA=\NTY=\MjY=\NTM=\NDY=\NDc=\NDA=\MzE=\NTI=\NTM=\NDg=\NTY=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDM=\NTc=\NDg=\NjM=\NTE=\NDk=\NTc=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjQ=\NTc=\NDc=\NDA=\NDY=\NTE=\Mzc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTg5\OTU=\OTI=\OTI=\MTcx\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTU=\ODA=\OTI=\OTI=\OTI=\MTIw\OTI=\OTI=\OTI=\OTE=\OTI=\OTI=\OTI=\ODk=\OTI=\OTI=\OTI=\NjQ=\Mjg=\MjIw\OTI=\ODk=\Mjg=\OTI=\OTI=\OTA=\MjIw\Mjg=\OTI=\OTA=\MTU2\Mjg=\OTI=\OTA=\OTI=\Mjk=\OTI=\ODc=\Mjg=\Mjk=\OTI=\MjQ4\Mjg=\OTI=\OTI=\NjQ=\Mjg=\MjIw\OTM=\NjY=\OTI=\MjIw\OTI=\OTA=\OTI=\OTI=\OTI=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NjM=\NTI=\NTc=\NjM=\NTU=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTk=\NjE=\NDk=\NTc=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\NDc=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTY=\NTE=\NjM=\NjE=\NDg=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\OTI=\ODg=\ODM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\NTI=\NjE=\NDY=\NjE=\NjM=\NDA=\NTc=\NDY=\Mjk=\NTY=\NTY=\NTc=\NTY=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NjM=\NTE=\NTA=\NTA=\NTc=\NjM=\NDA=\OTI=\OTQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTkw\OTU=\OTI=\OTI=\MTc0\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\ODI=\MTE3\OTI=\OTI=\OTI=\OTQ=\OTI=\OTI=\OTI=\MjU=\OTI=\OTI=\OTI=\MjE3\Mjg=\OTI=\OTI=\MjE4\MjIw\Mjg=\OTM=\MjE4\MTU2\Mjg=\OTM=\MjE4\OTI=\Mjk=\OTM=\MjE1\Mjg=\Mjk=\OTM=\MTky\OTI=\OTI=\OTM=\MA==\OTI=\OTM=\OTI=\NzQ=\MjIw\ODk=\MjIw\MjE1\MjIx\MTU3\OTQ=\OTM=\MTU4\OTM=\OTI=\MTky\MjIx\MjIw\OTM=\MTk4\OTM=\OTI=\OTI=\NzQ=\Mjg=\ODg=\MjIw\MjE3\OTM=\OTI=\OTI=\MTUx\Mjk=\MTU3\OTQ=\MTI4\OTM=\OTI=\OTM=\MTky\OTM=\OTM=\OTI=\NzQ=\MjIw\OTQ=\MjIw\MTUx\MjIy\Mjk=\ODk=\Mjk=\OTU=\OTQ=\OTI=\MTI4\MjIy\MjIw\OTM=\MTM0\OTQ=\OTI=\OTI=\NzQ=\Mjg=\OTM=\MjIw\MTU0\MzA=\MzA=\ODk=\MTE=\MjIw\MTU4\ODk=\NzQ=\MjIw\OTI=\MjIw\MjEz\MTU4\MTU4\MjE2\MjEz\MzA=\MzE=\MjE4\OTQ=\OTI=\MjIw\OTI=\MjUz\MjIx\OTI=\OTI=\NzQ=\MjIw\MTYw\MzU=\NjE=\MjIw\OTI=\OTI=\NzQ=\MjIw\MTY1\MzU=\MjU=\MjIw\OTU=\OTI=\MjIx\MTU2\OTU=\OTI=\MA==\Mjg=\OTI=\OTM=\NzU=\Mjg=\MzE=\OTI=\NzQ=\OTI=\MTcw\MzU=\NjY=\OTI=\MjIw\OTI=\NzY=\OTI=\OTI=\OTI=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDQ=\NjE=\NTM=\NDY=\NDc=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTk=\NjE=\NDk=\NTc=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\NDc=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTY=\NTE=\NjM=\NjE=\NDg=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\NTI=\NjE=\NDY=\NjE=\NjM=\NDA=\NTc=\NDY=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjc=\NTc=\NDA=\MzE=\NTI=\NTM=\NDg=\NTY=\NDY=\NTc=\NTA=\OTI=\ODg=\ODg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjE=\NDc=\Mjk=\OTI=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTU=\NjM=\NDY=\NTM=\NDQ=\NDA=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTY=\NTE=\NjM=\NjE=\NDg=\MTU=\NjM=\NDY=\NTM=\NDQ=\NDA=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTg=\NjE=\NDk=\NTc=\OTI=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTY=\NTE=\NjM=\NjE=\NDg=\MTU=\NTE=\NDE=\NTA=\NTY=\OTI=\ODg=\Nzk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mzc=\NTE=\NDE=\NTI=\NjE=\NDI=\NTc=\NjE=\NTA=\NjE=\NDk=\NTc=\NTA=\NTE=\NDM=\NDM=\NTE=\NDM=\OTI=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjQ=\NTM=\NDc=\NjE=\NjI=\NDg=\NTc=\NTY=\OTI=\OTM=\OTM=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDM=\NjE=\NTM=\NDA=\OTI=\OTU=\MTk4\MTk3\MTk3\MTk3\MTk3\MTk3\MjI5\OTk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTY4\OTU=\OTI=\OTI=\MTcw\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTQ=\OTU=\OTI=\OTI=\OTI=\ODk=\OTI=\OTI=\OTI=\NjQ=\Mjg=\MjIw\OTI=\NjY=\OTI=\MjIw\OTI=\OTM=\OTI=\OTI=\OTI=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NjM=\NTI=\NTc=\NjM=\NTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTY1\OTU=\OTI=\OTI=\Nzk=\ODg=\OTI=\OTI=\OTI=\OTI=\OTI=\ODQ=\MTA0\OTI=\OTI=\OTI=\ODk=\OTI=\OTI=\OTI=\MjU=\Mjg=\OTI=\OTI=\MjY=\MjIw\MTU2\OTI=\MjY=\MTU2\MTU2\OTI=\MjY=\OTI=\MTU3\OTI=\MjM=\Mjg=\MTU3\OTI=\MA==\OTI=\OTI=\OTM=\NjQ=\OTI=\OTM=\OTI=\NzQ=\MjIw\OTQ=\MjIw\MjM=\MjIx\Mjk=\OTQ=\MTU3\MTU3\OTM=\OTI=\MA==\Mjk=\MjIw\OTM=\MjY=\OTM=\MzA=\OTQ=\MjY=\Mjk=\MTU4\OTQ=\NzU=\MjIw\MTU4\OTQ=\NzQ=\MTU2\OTI=\MjIw\MjY=\Mjk=\MzA=\OTQ=\NzU=\MjIw\MTU4\OTQ=\NzQ=\OTI=\OTI=\MjIw\ODU=\OTM=\MTU5\MjE3\MTI1\MjIw\OTI=\OTI=\NzQ=\MjIw\MTYw\MzU=\ODk=\Mjg=\OTU=\OTI=\Mjk=\MjIw\OTU=\OTI=\MjIx\MTU2\OTU=\OTI=\NjQ=\Mjg=\MjIw\OTM=\ODk=\OTI=\OTI=\OTI=\MjU=\Mjg=\OTI=\OTI=\MjY=\MjIw\MTU2\OTI=\MjY=\MTU2\MTU2\OTI=\MjY=\OTI=\MTU3\OTI=\MjM=\OTI=\MTUy\OTI=\MA==\OTI=\OTI=\OTM=\NjQ=\OTI=\OTM=\OTI=\NzQ=\MjIw\OTM=\MjIw\MjM=\MjIx\Mjk=\OTQ=\MTU3\Mjk=\ODg=\OTI=\MA==\MjIx\MjIw\OTM=\Ng==\OTM=\OTI=\OTI=\NzQ=\Mjg=\OTI=\MjIw\MjM=\MjIx\MjQ=\OTQ=\MA==\Mjk=\OTI=\OTM=\MTI1\MjIw\OTI=\OTI=\NzQ=\MjIw\MTYx\MzU=\ODk=\Mjg=\OTI=\OTI=\OTA=\MjIw\Mjg=\OTI=\OTA=\MTU2\Mjg=\OTI=\OTA=\MTU2\MjQ=\OTI=\ODc=\OTI=\MjU=\OTI=\MjQ4\OTI=\OTI=\OTI=\NjQ=\Mjg=\MjIw\OTM=\NjY=\OTI=\MjIw\OTI=\NzM=\OTI=\OTI=\OTI=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDQ=\NjE=\NTM=\NDY=\NDc=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTk=\NjE=\NDk=\NTc=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\NDc=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTY=\NTE=\NjM=\NjE=\NDg=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\NTI=\NjE=\NDY=\NjE=\NjM=\NDA=\NTc=\NDY=\OTI=\ODg=\ODM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjc=\NTc=\NDA=\MjQ=\NTc=\NDc=\NjM=\NTc=\NTA=\NTY=\NjE=\NTA=\NDA=\NDc=\OTI=\ODg=\ODg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjE=\NDc=\Mjk=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTY=\NTE=\NjM=\NjE=\NDg=\MTU=\NjM=\NDY=\NTM=\NDQ=\NDA=\OTI=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NjE=\NDY=\NTc=\NTA=\NDA=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTg=\NjE=\NDk=\NTc=\OTI=\ODg=\OTM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjQ=\NTM=\NDc=\NjE=\NjI=\NDg=\NTc=\NTY=\OTI=\OTM=\OTM=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDM=\NjE=\NTM=\NDA=\OTI=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI0\Mjg=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjc=\NTc=\NDA=\MzE=\NTI=\NTM=\NDg=\NTY=\NDY=\NTc=\NTA=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTQ=\NTc=\NDk=\NTE=\NDA=\NTc=\MjU=\NDI=\NTc=\NTA=\NDA=\OTI=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTQ=\NTc=\NDk=\NTE=\NDI=\NTc=\OTI=\ODg=\ODM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\NTI=\NjE=\NDY=\NjE=\NjM=\NDA=\NTc=\NDY=\Mjk=\NTY=\NTY=\NTc=\NTY=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NjM=\NTE=\NTA=\NTA=\NTc=\NjM=\NDA=\OTI=\OTM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\ODk=\ODg=\OTI=\OTI=\Nzg=\ODg=\OTI=\OTI=\OTI=\OTI=\OTI=\ODQ=\MTA4\OTI=\OTI=\OTI=\ODk=\OTI=\OTI=\OTI=\Mjk=\Mjg=\OTI=\OTI=\NjQ=\Mjg=\OTI=\OTM=\ODk=\MjIw\OTI=\OTI=\MjU=\MTU2\OTI=\OTI=\MjY=\OTI=\MTU3\OTI=\MjY=\Mjg=\MTU3\OTI=\MjY=\MjIw\MTU3\OTI=\MjM=\MTU2\MTU3\OTI=\MA==\OTI=\OTI=\OTM=\NjQ=\OTI=\OTM=\OTI=\NzQ=\MjIw\OTQ=\MjIw\MjM=\OTM=\MzA=\OTQ=\MTU3\Mjk=\OTQ=\OTI=\MA==\Mjk=\MjIw\OTM=\MjY=\MjIx\MzA=\OTQ=\MjY=\MTU3\MTU4\OTQ=\NzU=\OTI=\MTU5\OTQ=\NzQ=\MTU2\OTI=\MjIw\MjY=\MTU3\MzA=\OTQ=\NzU=\OTI=\MTU5\OTQ=\NzQ=\OTI=\OTI=\MjIw\ODU=\MjIx\MTU5\MjE4\MTI1\MjIw\OTI=\OTI=\NzQ=\MjIw\MTYw\MzU=\ODk=\OTI=\OTI=\OTI=\Mjk=\MTU2\OTU=\OTI=\MjIx\OTI=\ODg=\OTI=\NjQ=\Mjg=\MjIw\OTM=\ODk=\MjIw\OTI=\OTI=\MjU=\MTU2\OTI=\OTI=\MjY=\OTI=\MTU3\OTI=\MjY=\Mjg=\MTU3\OTI=\MjY=\MjIw\MTU3\OTI=\MjM=\Mjg=\MTUy\OTI=\MA==\OTI=\OTI=\OTM=\NjQ=\OTI=\OTM=\OTI=\NzQ=\MjIw\OTM=\MjIw\MjM=\OTM=\MzA=\OTQ=\MTU3\MjIx\ODg=\OTI=\MA==\MjIx\MjIw\OTM=\Ng==\OTM=\OTI=\OTI=\NzQ=\Mjg=\OTI=\MjIw\MjM=\MTU3\MjQ=\OTQ=\MA==\Mjk=\OTI=\OTM=\MTI1\MjIw\OTI=\OTI=\NzQ=\MjIw\MTYx\MzU=\NjY=\OTI=\MjIw\OTI=\NzI=\OTI=\OTI=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDM=\NjE=\NTM=\NDA=\OTI=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTcy\OTk=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDQ=\NjE=\NTM=\NDY=\NDc=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTk=\NjE=\NDk=\NTc=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\NDc=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTY=\NTE=\NjM=\NjE=\NDg=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\NTI=\NjE=\NDY=\NjE=\NjM=\NDA=\NTc=\NDY=\OTI=\ODg=\ODM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjc=\NTc=\NDA=\MjQ=\NTc=\NDc=\NjM=\NTc=\NTA=\NTY=\NjE=\NTA=\NDA=\NDc=\OTI=\ODg=\ODg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjE=\NDc=\Mjk=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTY=\NTE=\NjM=\NjE=\NDg=\MTU=\NjM=\NDY=\NTM=\NDQ=\NDA=\OTI=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NjE=\NDY=\NTc=\NTA=\NDA=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTg=\NjE=\NDk=\NTc=\OTI=\ODg=\OTM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjQ=\NTM=\NDc=\NjE=\NjI=\NDg=\NTc=\NTY=\OTI=\OTM=\OTM=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI0\Mjg=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjc=\NTc=\NDA=\MzE=\NTI=\NTM=\NDg=\NTY=\NDY=\NTc=\NTA=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTQ=\NTc=\NDk=\NTE=\NDA=\NTc=\MjU=\NDI=\NTc=\NTA=\NDA=\OTI=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTQ=\NTc=\NDk=\NTE=\NDI=\NTc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NzM=\ODg=\OTI=\OTI=\MTAx\ODg=\OTI=\OTI=\OTM=\OTI=\OTI=\ODU=\NDQ=\OTI=\OTI=\OTI=\ODg=\OTI=\OTI=\OTI=\OTA=\OTI=\Mjg=\OTI=\NzU=\Mjg=\Mjg=\OTI=\NzQ=\MjIw\Njg=\MjIw\ODg=\OTI=\OTI=\OTI=\ODU=\MjIw\Mjg=\MjIw\ODk=\MTU2\OTI=\OTI=\ODU=\Mjg=\Mjk=\MjIy\ODk=\MTU2\OTI=\OTI=\MjU=\MTU2\OTM=\OTI=\MjY=\OTI=\MTU4\OTI=\MjIx\Mjg=\OTQ=\OTI=\MTU3\MjIw\OTQ=\OTI=\OTM=\Mjk=\OTQ=\OTI=\MA==\MjIw\OTI=\OTQ=\ODU=\Mjg=\OTI=\MjIz\ODk=\MTU2\OTI=\OTI=\ODU=\OTI=\MTU5\MjE3\OTU=\OTI=\OTI=\OTI=\MjU=\Mjg=\OTU=\OTI=\MjE3\MjIw\OTU=\OTI=\MjE1\MTU2\MzE=\OTM=\MTky\OTI=\OTI=\OTM=\MA==\OTI=\OTM=\OTI=\NzQ=\MjIw\OTE=\MjIw\MjE1\OTM=\MTUy\OTQ=\OTM=\MzA=\ODg=\OTI=\MTky\MjIx\MjIw\OTM=\MTk4\OTM=\OTI=\OTI=\NzQ=\Mjg=\OTA=\MjIw\MjE1\MjIx\MTUy\OTQ=\OTM=\MTU4\ODg=\OTI=\MTky\MjIx\MjIw\OTM=\MTk4\Mjk=\OTI=\OTI=\NzQ=\MTU2\ODg=\MjIw\MjE1\MjIx\MTUy\OTQ=\OTM=\OTQ=\ODk=\OTI=\MTky\MjIx\MjIw\OTM=\MTk4\Mjk=\OTI=\OTI=\NzQ=\MjIw\OTU=\MjIw\MjE1\MjIx\MTUy\OTQ=\OTM=\MzA=\ODk=\OTI=\MTky\MjIx\MjIw\OTM=\MTk4\Mjk=\OTI=\OTI=\NzQ=\Mjg=\OTQ=\MjIw\MjE1\MjIx\MTUy\OTQ=\OTM=\MjIy\ODk=\OTI=\MTky\MjIx\MjIw\OTM=\MTk4\Mjk=\OTI=\OTI=\NzQ=\OTI=\OTM=\MjIw\MjE1\MjIx\MTUy\OTQ=\OTM=\MzA=\OTM=\OTI=\MTky\MjIx\MjIw\OTM=\MTk4\OTM=\OTI=\OTI=\NzQ=\OTI=\OTI=\MjIw\OTI=\OTI=\MjIw\OTQ=\NjE=\MjIw\OTI=\OTI=\NzQ=\MjIw\MTcx\MzU=\MjU=\OTI=\OTA=\OTI=\MjE3\Mjg=\OTA=\OTI=\MjE4\MjIw\MjY=\OTM=\MjE4\MTU2\MjY=\OTM=\MjE4\OTI=\Mjc=\OTM=\MA==\MjIw\OTI=\OTM=\Mjc=\MTU2\ODk=\OTI=\MjU=\Mjg=\OTA=\OTI=\MjM=\Mjg=\MTU1\OTI=\MTU3\MjIw\OTE=\OTI=\MA==\MjIw\MjIw\OTM=\MjY=\MTU2\MTU1\OTI=\MjM=\OTI=\MTQ4\OTI=\MTg0\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MA==\Mjg=\MjIw\OTM=\MjU=\Mjg=\ODQ=\OTI=\MA==\MjIw\MjIw\OTI=\Ng==\OTI=\OTI=\OTI=\NzQ=\MjIw\ODk=\MjIw\MjU=\MTU2\OTI=\OTI=\MjY=\MTU2\MTU4\OTI=\NzU=\OTI=\MTU5\OTI=\NzQ=\MTU2\MTYx\MzU=\MjU=\MTU2\OTI=\OTI=\MjY=\MjIw\MTU3\OTI=\MjE3\MTU2\OTM=\OTI=\MjE4\OTI=\MzA=\OTM=\MTU3\Mjg=\OTQ=\OTI=\OTM=\MjIx\OTQ=\OTI=\Mjk=\Mjk=\OTQ=\OTI=\MTky\MjIw\OTI=\OTQ=\NzU=\MjIw\MjIw\OTI=\NzQ=\Mjg=\MTY3\MzU=\MjU=\MTU2\OTI=\OTI=\MjE3\MTU2\OTM=\OTI=\MjE4\OTI=\MzA=\OTM=\MTU3\Mjg=\OTQ=\OTI=\OTM=\MjIx\ODQ=\OTI=\Mjk=\Mjk=\OTQ=\OTI=\MTky\MjIw\OTI=\OTQ=\MjE=\MjIw\OTI=\MjIz\NzQ=\OTI=\MTY1\MzU=\MTI3\OTI=\OTI=\OTI=\NzQ=\MTU2\OTM=\MjIw\ODg=\OTI=\OTI=\OTI=\OTA=\OTI=\Mjg=\OTI=\NzU=\MjIw\Mjg=\OTI=\NzQ=\MTU2\OTI=\MjIw\ODk=\MTU2\OTI=\OTI=\ODU=\MTU2\MjA=\MjIy\ODg=\OTI=\OTI=\OTI=\ODU=\Mjg=\Mjg=\MjIw\NjY=\OTI=\MjIw\OTI=\MTIw\OTI=\OTI=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OA==\NTc=\MzY=\NDA=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzA=\NDE=\NTk=\NTk=\Mzc=\MTI0\MTAy\MTI0\MTk=\MjY=\MjY=\OTI=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzA=\NDE=\NTk=\NTk=\Mzc=\MTI0\MTAy\MTI0\MTk=\MTg=\OTI=\ODg=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mw==\Mjc=\OTI=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDM=\NTI=\NTM=\NDA=\NTc=\NDg=\NTM=\NDc=\NDA=\MTA0\OTI=\ODg=\NzM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzA=\NDE=\NTk=\NTk=\Mzc=\MTI0\NDQ=\NTM=\NDY=\NjE=\NDA=\NTc=\MTE2\MTY=\NDI=\NDg=\MTAy\MTEx\MTA4\MTE3\OTI=\ODg=\ODg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTE=\MjU=\MTE=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTA=\NTc=\NjM=\NDA=\NTE=\NDY=\MTEx\OTI=\ODg=\ODg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTA=\NTc=\NDM=\OTI=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTcy\OTk=\ODg=\ODg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mzc=\NTc=\NDc=\OTI=\OTM=\OTM=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDQ=\NjE=\NTM=\NDY=\NDc=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDM=\NTE=\NDY=\NTU=\NDc=\NDQ=\NjE=\NjM=\NTc=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjc=\NTc=\NDA=\MzE=\NTI=\NTM=\NDg=\NTY=\NDY=\NTc=\NTA=\OTI=\ODg=\ODg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjE=\NDc=\Mjk=\OTI=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjY=\NTE=\NDg=\NTY=\NTc=\NDY=\OTI=\ODg=\ODM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjY=\NTM=\NTA=\NTY=\MjY=\NTM=\NDY=\NDc=\NDA=\MzE=\NTI=\NTM=\NDg=\NTY=\OTI=\ODg=\NzY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTY=\NDE=\NTg=\NTg=\Mzc=\MTE2\MTY=\NDI=\NDg=\MTAy\MTA5\MTA4\MTA4\MTA4\MTE3\OTI=\ODg=\MTI1\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzA=\NTM=\NTk=\MTI0\MjY=\NDE=\NDg=\NDg=\MTI0\MzA=\NTE=\NTY=\Mzc=\MTI0\MzA=\NDE=\NDc=\NTE=\MTI0\MTg=\NTE=\NTE=\NjI=\MTE2\MTY=\NDI=\NDg=\MTAy\MTA1\MTA4\MTA4\MTE3\OTI=\ODg=\NzY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTc=\NjE=\NDY=\NTM=\NTA=\NTc=\MTE2\MTY=\NDI=\NDg=\MTAy\MTEw\MTA4\MTA4\MTE3\OTI=\ODg=\Njg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjk=\NDA=\NDA=\NjE=\NjM=\NTU=\NTM=\NTA=\NTk=\MTI0\MTg=\NTE=\NTE=\NjI=\MTE2\MTY=\NDI=\NDg=\MTAy\MTA5\MTA4\MTA4\MTE3\OTI=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\MTg=\NjE=\NDk=\NTc=\OTI=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDA=\NTE=\NDc=\NDA=\NDY=\NTM=\NTA=\NTk=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTk=\NjE=\NDk=\NTc=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\NDc=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTY=\NTE=\NjM=\NjE=\NDg=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTg=\NjE=\NDk=\NTc=\OTI=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjc=\NTc=\NDA=\MTU=\NTc=\NDY=\NDI=\NTM=\NjM=\NTc=\OTI=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTQ=\NDE=\NTA=\MTU=\NTc=\NDY=\NDI=\NTM=\NjM=\NTc=\OTI=\ODg=\ODI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTQ=\NTc=\NTA=\NTY=\NTc=\NDY=\MTU=\NDA=\NTc=\NDQ=\NDQ=\NTc=\NTY=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NjM=\NTE=\NTA=\NTA=\NTc=\NjM=\NDA=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDM=\NjE=\NTM=\NDA=\OTI=\OTU=\MTk4\MTk3\MTk3\MTk3\MTk3\MTk3\MjI5\OTk=\ODg=\OTM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI2\ODg=\OTI=\OTI=\MTEz\ODg=\OTI=\OTI=\OTM=\OTI=\OTI=\ODU=\MTg=\OTI=\OTI=\OTI=\ODk=\OTI=\OTI=\OTI=\MjQ=\OTI=\OTI=\OTI=\MjM=\Mjg=\MTU2\OTI=\MA==\OTI=\OTI=\OTM=\NjQ=\OTI=\OTM=\OTI=\NzQ=\OTI=\Nzc=\MjIw\MjU=\MjIx\OTI=\OTI=\MjY=\MTU3\MTU2\OTQ=\MjY=\OTM=\MTU3\OTQ=\MjY=\Mjk=\MTU3\OTQ=\Ng==\OTM=\OTI=\OTI=\NzQ=\MjIw\ODM=\MjIw\MjY=\MjIx\Mjk=\OTQ=\MjE3\MTU3\OTM=\OTI=\MjE4\OTM=\MzA=\OTU=\NzU=\MjIw\MjIx\OTQ=\NzQ=\Mjg=\ODI=\MjIw\MjM=\Mjk=\MzA=\OTQ=\MTU3\MjIx\OTQ=\OTI=\MA==\MjIx\MjIw\OTM=\Ng==\OTM=\OTI=\OTI=\NzQ=\OTI=\ODE=\MjIw\MjM=\Mjk=\MzA=\OTQ=\MTU3\MTU3\OTQ=\OTI=\MA==\MjIx\MjIw\OTM=\Ng==\OTM=\OTI=\OTI=\NzQ=\MTU2\ODc=\MjIw\MjY=\MjIx\MzA=\OTQ=\MjE=\Mjk=\MzE=\MjE4\MjY=\MjIx\MzA=\OTQ=\MjE=\MTU3\MzE=\MjE5\MjY=\MjIx\MzA=\OTQ=\MjE3\MjIx\OTI=\OTI=\MjE4\MTU3\Mjg=\OTU=\MjE4\OTM=\Mjk=\OTU=\MjE4\Mjk=\Mjk=\OTU=\MjE4\Mjk=\MjQ=\OTU=\MjE4\MjIx\MjQ=\OTU=\MjE4\MTU3\MjQ=\OTU=\MjEw\OTM=\MjU=\OTU=\MTUz\MjIx\OTI=\OTI=\MTU0\Mjk=\MTUz\OTU=\ODk=\MjIy\ODk=\OTI=\MTU0\OTM=\MjIy\OTU=\MTU0\Mjk=\MTUy\OTU=\MTU0\OTM=\MTUy\OTU=\MjA4\MTU3\OTM=\OTU=\MTUz\MTU3\OTM=\OTI=\MTU0\MTU3\MTUz\OTU=\MjA4\MTU3\OTM=\OTU=\MjE=\MjIx\OTM=\MjEy\MjY=\MTU3\MzA=\OTQ=\MjE=\Mjk=\MzE=\MjE4\MjY=\MTU3\MzA=\OTQ=\MjE=\MTU3\MzE=\MjE5\MjY=\MTU3\MzA=\OTQ=\MjE3\MjIx\OTI=\OTI=\MjE4\MTU3\Mjg=\OTU=\MjE4\OTM=\Mjk=\OTU=\MjE4\Mjk=\Mjk=\OTU=\MjE4\Mjk=\MjQ=\OTU=\MjE4\MjIx\MjQ=\OTU=\MjE4\MTU3\MjQ=\OTU=\MjEw\OTM=\MjY=\OTU=\MTUz\MjIx\OTI=\OTI=\MTU0\Mjk=\MTUz\OTU=\ODk=\MjIy\ODk=\OTI=\MTU0\OTM=\MjIy\OTU=\MTU0\Mjk=\MTUy\OTU=\MTU0\OTM=\MTUy\OTU=\MjA4\MTU3\OTM=\OTU=\MTUz\MTU3\OTM=\OTI=\MTU0\MTU3\MTUz\OTU=\MjA4\MTU3\OTM=\OTU=\MjE=\MjIx\OTM=\MjEy\MTI1\MjIw\OTI=\OTI=\NzQ=\OTI=\MTc4\MzU=\NjY=\OTI=\MjIw\OTI=\Njk=\OTI=\OTI=\OTI=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDQ=\NjE=\NTM=\NDY=\NDc=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjc=\NTc=\NDA=\MzE=\NTI=\NTM=\NDg=\NTY=\NDY=\NTc=\NTA=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTk=\NjE=\NDk=\NTc=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\NDc=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTY=\NTE=\NjM=\NjE=\NDg=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\NTI=\NjE=\NDY=\NjE=\NjM=\NDA=\NTc=\NDY=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTg=\NjE=\NDk=\NTc=\OTI=\ODg=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mw==\Mjc=\OTI=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDM=\NTI=\NTM=\NDA=\NTc=\NDg=\NTM=\NDc=\NDA=\MTA0\OTI=\ODg=\ODM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjY=\NTM=\NTA=\NTY=\MjY=\NTM=\NDY=\NDc=\NDA=\MzE=\NTI=\NTM=\NDg=\NTY=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjA=\NTc=\NjE=\NTY=\OTI=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OA==\NTE=\NDY=\NDc=\NTE=\OTI=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjk=\NTA=\NjM=\NTI=\NTE=\NDY=\NTc=\NTY=\OTI=\OTM=\OTM=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\NjE=\NTA=\MzE=\NTE=\NDg=\NDg=\NTM=\NTY=\NTc=\OTI=\OTM=\OTI=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NTE=\NDc=\NTM=\NDA=\NTM=\NTE=\NTA=\OTI=\ODg=\Nzc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjA=\NDE=\NDk=\NjE=\NTA=\NTE=\NTM=\NTY=\MTQ=\NTE=\NTE=\NDA=\MTI=\NjE=\NDY=\NDA=\OTI=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\MjY=\NDY=\NjE=\NDk=\NTc=\OTI=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDg=\NTE=\NTE=\NTU=\MTA=\NTc=\NjM=\NDA=\NTE=\NDY=\OTI=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\ODA=\Mjg=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTE=\NTE=\NDY=\NTU=\NDc=\NDQ=\NjE=\NjM=\NTc=\OTI=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\MTg=\NjE=\NDk=\NTc=\OTI=\ODg=\ODg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTE=\MjU=\MTE=\OTI=\OTU=\MTEx\MTEx\MTEx\MTEx\MTEx\MTEx\ODc=\Mjg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTAz\ODg=\OTI=\OTI=\Mw==\ODg=\OTI=\OTI=\OTM=\OTI=\OTI=\ODU=\NDQ=\OTI=\OTI=\OTI=\ODg=\OTI=\OTI=\OTI=\OTA=\OTI=\Mjg=\OTI=\NzU=\Mjg=\Mjg=\OTI=\NzQ=\MjIw\Njg=\MjIw\ODg=\OTI=\OTI=\OTI=\ODU=\MjIw\Mjg=\MjIw\ODk=\MTU2\OTI=\OTI=\ODU=\Mjg=\Mjk=\MjIy\ODk=\MTU2\OTI=\OTI=\MjU=\MTU2\OTM=\OTI=\MjY=\OTI=\MTU4\OTI=\MjIx\Mjg=\OTQ=\OTI=\MTU3\MjIw\OTQ=\OTI=\OTM=\Mjk=\OTQ=\OTI=\MA==\MjIw\OTI=\OTQ=\ODU=\Mjg=\OTI=\MjIz\ODk=\MTU2\OTI=\OTI=\ODU=\OTI=\MTU5\MjE3\OTU=\OTI=\OTI=\OTI=\MjU=\Mjg=\OTU=\OTI=\MjE3\MjIw\OTU=\OTI=\MjE1\MTU2\MzE=\OTM=\MTky\OTI=\OTI=\OTM=\MA==\OTI=\OTM=\OTI=\NzQ=\MjIw\OTE=\MjIw\MjE1\OTM=\MTUy\OTQ=\OTM=\MzA=\ODg=\OTI=\MTky\MjIx\MjIw\OTM=\MTk4\OTM=\OTI=\OTI=\NzQ=\Mjg=\OTA=\MjIw\MjE1\MjIx\MTUy\OTQ=\OTM=\MTU4\ODg=\OTI=\MTky\MjIx\MjIw\OTM=\MTk4\Mjk=\OTI=\OTI=\NzQ=\MTU2\ODg=\MjIw\MjE1\MjIx\MTUy\OTQ=\OTM=\MzA=\OTM=\OTI=\MTky\MjIx\MjIw\OTM=\MTk4\Mjk=\OTI=\OTI=\NzQ=\MjIw\OTU=\MjIw\MjE1\MjIx\MTUy\OTQ=\OTM=\OTQ=\ODk=\OTI=\MTky\MjIx\MjIw\OTM=\MTk4\Mjk=\OTI=\OTI=\NzQ=\Mjg=\OTQ=\MjIw\MjE1\MjIx\MTUy\OTQ=\OTM=\MzA=\ODk=\OTI=\MTky\MjIx\MjIw\OTM=\MTk4\Mjk=\OTI=\OTI=\NzQ=\OTI=\OTM=\MjIw\MjE1\MjIx\MTUy\OTQ=\OTM=\MjIy\ODk=\OTI=\MTky\MjIx\MjIw\OTM=\MTk4\OTM=\OTI=\OTI=\NzQ=\OTI=\OTI=\MjIw\OTI=\OTI=\MjIw\OTQ=\NjE=\MjIw\OTI=\OTI=\NzQ=\MjIw\MTcx\MzU=\MjU=\OTI=\OTA=\OTI=\MjE3\Mjg=\OTA=\OTI=\MjE4\MjIw\MjY=\OTM=\MjE4\MTU2\MjY=\OTM=\MjE4\OTI=\Mjc=\OTM=\MA==\MjIw\OTI=\OTM=\Mjc=\MTU2\ODk=\OTI=\MjU=\Mjg=\OTA=\OTI=\MjM=\Mjg=\MTU1\OTI=\MTU3\MjIw\OTE=\OTI=\MA==\MjIw\MjIw\OTM=\MjY=\MTU2\MTU1\OTI=\MjM=\OTI=\MTQ4\OTI=\MTg0\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MA==\Mjg=\MjIw\OTM=\MjU=\Mjg=\ODQ=\OTI=\MA==\MjIw\MjIw\OTI=\Ng==\OTI=\OTI=\OTI=\NzQ=\MjIw\ODk=\MjIw\MjU=\MTU2\OTI=\OTI=\MjY=\MTU2\MTU4\OTI=\NzU=\OTI=\MTU5\OTI=\NzQ=\MTU2\MTYx\MzU=\MjU=\MTU2\OTI=\OTI=\MjY=\MjIw\MTU3\OTI=\MjE3\MTU2\OTM=\OTI=\MjE4\OTI=\MzA=\OTM=\MTU3\Mjg=\OTQ=\OTI=\OTM=\MjIx\OTQ=\OTI=\Mjk=\Mjk=\OTQ=\OTI=\MTky\MjIw\OTI=\OTQ=\NzU=\MjIw\MjIw\OTI=\NzQ=\Mjg=\MTY3\MzU=\MjU=\MTU2\OTI=\OTI=\MjE3\MTU2\OTM=\OTI=\MjE4\OTI=\MzA=\OTM=\MTU3\Mjg=\OTQ=\OTI=\OTM=\MjIx\ODQ=\OTI=\Mjk=\Mjk=\OTQ=\OTI=\MTky\MjIw\OTI=\OTQ=\MjE=\MjIw\OTI=\MjIz\NzQ=\OTI=\MTY1\MzU=\MTI3\OTI=\OTI=\OTI=\NzQ=\MTU2\OTM=\MjIw\ODg=\OTI=\OTI=\OTI=\OTA=\OTI=\Mjg=\OTI=\NzU=\MjIw\Mjg=\OTI=\NzQ=\MTU2\OTI=\MjIw\ODk=\MTU2\OTI=\OTI=\ODU=\MTU2\MjA=\MjIy\ODg=\OTI=\OTI=\OTI=\ODU=\Mjg=\Mjg=\MjIw\NjY=\OTI=\MjIw\OTI=\MTIw\OTI=\OTI=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OA==\NTc=\MzY=\NDA=\OTI=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzA=\NDE=\NDc=\NTE=\MTI0\MTAy\MTI0\MTk=\MjY=\MjY=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzA=\NDE=\NDc=\NTE=\MTI0\MTAy\MTI0\MTk=\MTg=\OTI=\ODg=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mw==\Mjc=\OTI=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDM=\NTI=\NTM=\NDA=\NTc=\NDg=\NTM=\NDc=\NDA=\MTEx\OTI=\ODg=\MTI1\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzA=\NTM=\NTk=\MTI0\MjY=\NDE=\NDg=\NDg=\MTI0\MzA=\NTE=\NTY=\Mzc=\MTI0\MzA=\NDE=\NDc=\NTE=\MTI0\MTg=\NTE=\NTE=\NjI=\MTE2\MTY=\NDI=\NDg=\MTAy\MTA1\MTA4\MTA4\MTE3\OTI=\ODg=\ODg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTE=\MjU=\MTE=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTA=\NTc=\NjM=\NDA=\NTE=\NDY=\MTEx\OTI=\ODg=\ODg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTA=\NTc=\NDM=\OTI=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTcy\OTk=\ODg=\ODg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mzc=\NTc=\NDc=\OTI=\OTM=\OTM=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDQ=\NjE=\NTM=\NDY=\NDc=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDM=\NTE=\NDY=\NTU=\NDc=\NDQ=\NjE=\NjM=\NTc=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjc=\NTc=\NDA=\MzE=\NTI=\NTM=\NDg=\NTY=\NDY=\NTc=\NTA=\OTI=\ODg=\ODg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjE=\NDc=\Mjk=\OTI=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjY=\NTE=\NDg=\NTY=\NTc=\NDY=\OTI=\ODg=\ODM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjY=\NTM=\NTA=\NTY=\MjY=\NTM=\NDY=\NDc=\NDA=\MzE=\NTI=\NTM=\NDg=\NTY=\OTI=\ODg=\NzY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTY=\NDE=\NTg=\NTg=\Mzc=\MTE2\MTY=\NDI=\NDg=\MTAy\MTA5\MTA4\MTA4\MTA4\MTE3\OTI=\ODg=\NzY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTc=\NjE=\NDY=\NTM=\NTA=\NTc=\MTE2\MTY=\NDI=\NDg=\MTAy\MTEw\MTA4\MTA4\MTE3\OTI=\ODg=\Njg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjk=\NDA=\NDA=\NjE=\NjM=\NTU=\NTM=\NTA=\NTk=\MTI0\MTg=\NTE=\NTE=\NjI=\MTE2\MTY=\NDI=\NDg=\MTAy\MTA5\MTA4\MTA4\MTE3\OTI=\ODg=\NzM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzA=\NDE=\NTk=\NTk=\Mzc=\MTI0\NDQ=\NTM=\NDY=\NjE=\NDA=\NTc=\MTE2\MTY=\NDI=\NDg=\MTAy\MTEx\MTA4\MTE3\OTI=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\MTg=\NjE=\NDk=\NTc=\OTI=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDA=\NTE=\NDc=\NDA=\NDY=\NTM=\NTA=\NTk=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTk=\NjE=\NDk=\NTc=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\NDc=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTY=\NTE=\NjM=\NjE=\NDg=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTg=\NjE=\NDk=\NTc=\OTI=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjc=\NTc=\NDA=\MTU=\NTc=\NDY=\NDI=\NTM=\NjM=\NTc=\OTI=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTQ=\NDE=\NTA=\MTU=\NTc=\NDY=\NDI=\NTM=\NjM=\NTc=\OTI=\ODg=\ODI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTQ=\NTc=\NTA=\NTY=\NTc=\NDY=\MTU=\NDA=\NTc=\NDQ=\NDQ=\NTc=\NTY=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NjM=\NTE=\NTA=\NTA=\NTc=\NjM=\NDA=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDM=\NjE=\NTM=\NDA=\OTI=\OTU=\MTk4\MTk3\MTk3\MTk3\MTk3\MTk3\MjI5\OTk=\ODg=\OTM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjA=\ODg=\OTI=\OTI=\MTU=\ODg=\OTI=\OTI=\OTM=\OTI=\OTI=\ODU=\MTg=\OTI=\OTI=\OTI=\ODk=\OTI=\OTI=\OTI=\MjQ=\OTI=\OTI=\OTI=\MjM=\Mjg=\MTU2\OTI=\MA==\OTI=\OTI=\OTM=\NjQ=\OTI=\OTM=\OTI=\NzQ=\OTI=\Nzc=\MjIw\MjU=\MjIx\OTI=\OTI=\MjY=\MTU3\MTU2\OTQ=\MjY=\OTM=\MTU3\OTQ=\MjY=\Mjk=\MTU3\OTQ=\Ng==\OTM=\OTI=\OTI=\NzQ=\MjIw\ODM=\MjIw\MjY=\MjIx\Mjk=\OTQ=\MjE3\MTU3\OTM=\OTI=\MjE4\OTM=\MzA=\OTU=\NzU=\MjIw\MjIx\OTQ=\NzQ=\Mjg=\ODI=\MjIw\MjM=\Mjk=\MzA=\OTQ=\MTU3\MjIx\OTQ=\OTI=\MA==\MjIx\MjIw\OTM=\Ng==\OTM=\OTI=\OTI=\NzQ=\OTI=\ODE=\MjIw\MjM=\Mjk=\MzA=\OTQ=\MTU3\MTU3\OTQ=\OTI=\MA==\MjIx\MjIw\OTM=\Ng==\OTM=\OTI=\OTI=\NzQ=\MTU2\ODc=\MjIw\MjY=\MjIx\MzA=\OTQ=\MjE=\Mjk=\MzE=\MjE4\MjY=\MjIx\MzA=\OTQ=\MjE=\MTU3\MzE=\MjE5\MjY=\MjIx\MzA=\OTQ=\MjE3\MjIx\OTI=\OTI=\MjE4\MTU3\Mjg=\OTU=\MjE4\OTM=\Mjk=\OTU=\MjE4\Mjk=\Mjk=\OTU=\MjE4\Mjk=\MjQ=\OTU=\MjE4\MjIx\MjQ=\OTU=\MjE4\MTU3\MjQ=\OTU=\MjEw\OTM=\MjU=\OTU=\MTUz\MjIx\OTI=\OTI=\MTU0\Mjk=\MTUz\OTU=\ODk=\MjIy\ODk=\OTI=\MTU0\OTM=\MjIy\OTU=\MTU0\Mjk=\MTUy\OTU=\MTU0\OTM=\MTUy\OTU=\MjA4\MTU3\OTM=\OTU=\MTUz\MTU3\OTM=\OTI=\MTU0\MTU3\MTUz\OTU=\MjA4\MTU3\OTM=\OTU=\MjE=\MjIx\OTM=\MjEy\MjY=\MTU3\MzA=\OTQ=\MjE=\Mjk=\MzE=\MjE4\MjY=\MTU3\MzA=\OTQ=\MjE=\MTU3\MzE=\MjE5\MjY=\MTU3\MzA=\OTQ=\MjE3\MjIx\OTI=\OTI=\MjE4\MTU3\Mjg=\OTU=\MjE4\OTM=\Mjk=\OTU=\MjE4\Mjk=\Mjk=\OTU=\MjE4\Mjk=\MjQ=\OTU=\MjE4\MjIx\MjQ=\OTU=\MjE4\MTU3\MjQ=\OTU=\MjEw\OTM=\MjY=\OTU=\MTUz\MjIx\OTI=\OTI=\MTU0\Mjk=\MTUz\OTU=\ODk=\MjIy\ODk=\OTI=\MTU0\OTM=\MjIy\OTU=\MTU0\Mjk=\MTUy\OTU=\MTU0\OTM=\MTUy\OTU=\MjA4\MTU3\OTM=\OTU=\MTUz\MTU3\OTM=\OTI=\MTU0\MTU3\MTUz\OTU=\MjA4\MTU3\OTM=\OTU=\MjE=\MjIx\OTM=\MjEy\MTI1\MjIw\OTI=\OTI=\NzQ=\OTI=\MTc4\MzU=\NjY=\OTI=\MjIw\OTI=\Njk=\OTI=\OTI=\OTI=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDQ=\NjE=\NTM=\NDY=\NDc=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjc=\NTc=\NDA=\MzE=\NTI=\NTM=\NDg=\NTY=\NDY=\NTc=\NTA=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTk=\NjE=\NDk=\NTc=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\NDc=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTY=\NTE=\NjM=\NjE=\NDg=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\NTI=\NjE=\NDY=\NjE=\NjM=\NDA=\NTc=\NDY=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTg=\NjE=\NDk=\NTc=\OTI=\ODg=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mw==\Mjc=\OTI=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDM=\NTI=\NTM=\NDA=\NTc=\NDg=\NTM=\NDc=\NDA=\MTEx\OTI=\ODg=\ODM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjY=\NTM=\NTA=\NTY=\MjY=\NTM=\NDY=\NDc=\NDA=\MzE=\NTI=\NTM=\NDg=\NTY=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjA=\NTc=\NjE=\NTY=\OTI=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OA==\NTE=\NDY=\NDc=\NTE=\OTI=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjk=\NTA=\NjM=\NTI=\NTE=\NDY=\NTc=\NTY=\OTI=\OTM=\OTM=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\NjE=\NTA=\MzE=\NTE=\NDg=\NDg=\NTM=\NTY=\NTc=\OTI=\OTM=\OTI=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NTE=\NDc=\NTM=\NDA=\NTM=\NTE=\NTA=\OTI=\ODg=\Nzc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjA=\NDE=\NDk=\NjE=\NTA=\NTE=\NTM=\NTY=\MTQ=\NTE=\NTE=\NDA=\MTI=\NjE=\NDY=\NDA=\OTI=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\MjY=\NDY=\NjE=\NDk=\NTc=\OTI=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDg=\NTE=\NTE=\NTU=\MTA=\NTc=\NjM=\NDA=\NTE=\NDY=\OTI=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\ODA=\Mjg=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTE=\NTE=\NDY=\NTU=\NDc=\NDQ=\NjE=\NjM=\NTc=\OTI=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\MTg=\NjE=\NDk=\NTc=\OTI=\ODg=\ODg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTE=\MjU=\MTE=\OTI=\OTU=\MTEx\MTEx\MTEx\MTEx\MTEx\MTEx\ODc=\Mjg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NjE=\ODg=\OTI=\OTI=\MjE3\ODg=\OTI=\OTI=\OTM=\OTI=\OTI=\ODU=\NDQ=\OTI=\OTI=\OTI=\ODg=\OTI=\OTI=\OTI=\OTA=\OTI=\Mjg=\OTI=\NzU=\Mjg=\Mjg=\OTI=\NzQ=\MjIw\Njg=\MjIw\ODg=\OTI=\OTI=\OTI=\ODU=\MjIw\Mjg=\MjIw\ODk=\MTU2\OTI=\OTI=\ODU=\Mjg=\Mjk=\MjIy\ODk=\MTU2\OTI=\OTI=\MjU=\MTU2\OTM=\OTI=\MjY=\OTI=\MTU4\OTI=\MjIx\Mjg=\OTQ=\OTI=\MTU3\MjIw\OTQ=\OTI=\OTM=\Mjk=\OTQ=\OTI=\MA==\MjIw\OTI=\OTQ=\ODU=\Mjg=\OTI=\MjIz\ODk=\MTU2\OTI=\OTI=\ODU=\OTI=\MTU5\MjE3\OTU=\OTI=\OTI=\OTI=\MjU=\Mjg=\OTU=\OTI=\MjE3\MjIw\OTU=\OTI=\MjE1\MTU2\MzE=\OTM=\MTky\OTI=\OTI=\OTM=\MA==\OTI=\OTM=\OTI=\NzQ=\MjIw\OTE=\MjIw\MjE1\OTM=\MTUy\OTQ=\OTM=\MzA=\ODg=\OTI=\MTky\MjIx\MjIw\OTM=\MTk4\OTM=\OTI=\OTI=\NzQ=\Mjg=\OTA=\MjIw\MjE1\MjIx\MTUy\OTQ=\OTM=\MzA=\OTM=\OTI=\MTky\MjIx\MjIw\OTM=\MTk4\Mjk=\OTI=\OTI=\NzQ=\MTU2\ODg=\MjIw\MjE1\MjIx\MTUy\OTQ=\OTM=\MTU4\ODg=\OTI=\MTky\MjIx\MjIw\OTM=\MTk4\Mjk=\OTI=\OTI=\NzQ=\MjIw\OTU=\MjIw\MjE1\MjIx\MTUy\OTQ=\OTM=\OTQ=\ODk=\OTI=\MTky\MjIx\MjIw\OTM=\MTk4\Mjk=\OTI=\OTI=\NzQ=\Mjg=\OTQ=\MjIw\MjE1\MjIx\MTUy\OTQ=\OTM=\MzA=\ODk=\OTI=\MTky\MjIx\MjIw\OTM=\MTk4\Mjk=\OTI=\OTI=\NzQ=\OTI=\OTM=\MjIw\MjE1\MjIx\MTUy\OTQ=\OTM=\MjIy\ODk=\OTI=\MTky\MjIx\MjIw\OTM=\MTk4\OTM=\OTI=\OTI=\NzQ=\OTI=\OTI=\MjIw\OTI=\OTI=\MjIw\OTQ=\NjE=\MjIw\OTI=\OTI=\NzQ=\MjIw\MTcx\MzU=\MjU=\OTI=\OTA=\OTI=\MjE3\Mjg=\OTA=\OTI=\MjE4\MjIw\MjY=\OTM=\MjE4\MTU2\MjY=\OTM=\MjE4\OTI=\Mjc=\OTM=\MA==\MjIw\OTI=\OTM=\Mjc=\MTU2\ODk=\OTI=\MjU=\Mjg=\OTA=\OTI=\MjM=\Mjg=\MTU1\OTI=\MTU3\MjIw\OTE=\OTI=\MA==\MjIw\MjIw\OTM=\MjY=\MTU2\MTU1\OTI=\MjM=\OTI=\MTQ4\OTI=\MTg0\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MA==\Mjg=\MjIw\OTM=\MjU=\Mjg=\ODQ=\OTI=\MA==\MjIw\MjIw\OTI=\Ng==\OTI=\OTI=\OTI=\NzQ=\MjIw\ODk=\MjIw\MjU=\MTU2\OTI=\OTI=\MjY=\MTU2\MTU4\OTI=\NzU=\OTI=\MTU5\OTI=\NzQ=\MTU2\MTYx\MzU=\MjU=\MTU2\OTI=\OTI=\MjY=\MjIw\MTU3\OTI=\MjE3\MTU2\OTM=\OTI=\MjE4\OTI=\MzA=\OTM=\MTU3\Mjg=\OTQ=\OTI=\OTM=\MjIx\OTQ=\OTI=\Mjk=\Mjk=\OTQ=\OTI=\MTky\MjIw\OTI=\OTQ=\NzU=\MjIw\MjIw\OTI=\NzQ=\Mjg=\MTY3\MzU=\MjU=\MTU2\OTI=\OTI=\MjE3\MTU2\OTM=\OTI=\MjE4\OTI=\MzA=\OTM=\MTU3\Mjg=\OTQ=\OTI=\OTM=\MjIx\ODQ=\OTI=\Mjk=\Mjk=\OTQ=\OTI=\MTky\MjIw\OTI=\OTQ=\MjE=\MjIw\OTI=\MjIz\NzQ=\OTI=\MTY1\MzU=\MTI3\OTI=\OTI=\OTI=\NzQ=\MTU2\OTM=\MjIw\ODg=\OTI=\OTI=\OTI=\OTA=\OTI=\Mjg=\OTI=\NzU=\MjIw\Mjg=\OTI=\NzQ=\MTU2\OTI=\MjIw\ODk=\MTU2\OTI=\OTI=\ODU=\MTU2\MjA=\MjIy\ODg=\OTI=\OTI=\OTI=\ODU=\Mjg=\Mjg=\MjIw\NjY=\OTI=\MjIw\OTI=\MTIw\OTI=\OTI=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OA==\NTc=\MzY=\NDA=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTY=\NDE=\NTg=\NTg=\Mzc=\MTI0\MTAy\MTI0\MTk=\MjY=\MjY=\OTI=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTY=\NDE=\NTg=\NTg=\Mzc=\MTI0\MTAy\MTI0\MTk=\MTg=\OTI=\ODg=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mw==\Mjc=\OTI=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDM=\NTI=\NTM=\NDA=\NTc=\NDg=\NTM=\NDc=\NDA=\MTEw\OTI=\ODg=\NzY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTY=\NDE=\NTg=\NTg=\Mzc=\MTE2\MTY=\NDI=\NDg=\MTAy\MTA5\MTA4\MTA4\MTA4\MTE3\OTI=\ODg=\ODg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTE=\MjU=\MTE=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTA=\NTc=\NjM=\NDA=\NTE=\NDY=\MTEx\OTI=\ODg=\ODg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTA=\NTc=\NDM=\OTI=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTcy\OTk=\ODg=\ODg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mzc=\NTc=\NDc=\OTI=\OTM=\OTM=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDQ=\NjE=\NTM=\NDY=\NDc=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDM=\NTE=\NDY=\NTU=\NDc=\NDQ=\NjE=\NjM=\NTc=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjc=\NTc=\NDA=\MzE=\NTI=\NTM=\NDg=\NTY=\NDY=\NTc=\NTA=\OTI=\ODg=\ODg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjE=\NDc=\Mjk=\OTI=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjY=\NTE=\NDg=\NTY=\NTc=\NDY=\OTI=\ODg=\ODM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjY=\NTM=\NTA=\NTY=\MjY=\NTM=\NDY=\NDc=\NDA=\MzE=\NTI=\NTM=\NDg=\NTY=\OTI=\ODg=\MTI1\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzA=\NTM=\NTk=\MTI0\MjY=\NDE=\NDg=\NDg=\MTI0\MzA=\NTE=\NTY=\Mzc=\MTI0\MzA=\NDE=\NDc=\NTE=\MTI0\MTg=\NTE=\NTE=\NjI=\MTE2\MTY=\NDI=\NDg=\MTAy\MTA1\MTA4\MTA4\MTE3\OTI=\ODg=\NzY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTc=\NjE=\NDY=\NTM=\NTA=\NTc=\MTE2\MTY=\NDI=\NDg=\MTAy\MTEw\MTA4\MTA4\MTE3\OTI=\ODg=\Njg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjk=\NDA=\NDA=\NjE=\NjM=\NTU=\NTM=\NTA=\NTk=\MTI0\MTg=\NTE=\NTE=\NjI=\MTE2\MTY=\NDI=\NDg=\MTAy\MTA5\MTA4\MTA4\MTE3\OTI=\ODg=\NzM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzA=\NDE=\NTk=\NTk=\Mzc=\MTI0\NDQ=\NTM=\NDY=\NjE=\NDA=\NTc=\MTE2\MTY=\NDI=\NDg=\MTAy\MTEx\MTA4\MTE3\OTI=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\MTg=\NjE=\NDk=\NTc=\OTI=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDA=\NTE=\NDc=\NDA=\NDY=\NTM=\NTA=\NTk=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTk=\NjE=\NDk=\NTc=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\NDc=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTY=\NTE=\NjM=\NjE=\NDg=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTg=\NjE=\NDk=\NTc=\OTI=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjc=\NTc=\NDA=\MTU=\NTc=\NDY=\NDI=\NTM=\NjM=\NTc=\OTI=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTQ=\NDE=\NTA=\MTU=\NTc=\NDY=\NDI=\NTM=\NjM=\NTc=\OTI=\ODg=\ODI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTQ=\NTc=\NTA=\NTY=\NTc=\NDY=\MTU=\NDA=\NTc=\NDQ=\NDQ=\NTc=\NTY=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NjM=\NTE=\NTA=\NTA=\NTc=\NjM=\NDA=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDM=\NjE=\NTM=\NDA=\OTI=\OTU=\MTk4\MTk3\MTk3\MTk3\MTk3\MTk3\MjI5\OTk=\ODg=\OTM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTA=\ODg=\OTI=\OTI=\Mzc=\ODg=\OTI=\OTI=\OTM=\OTI=\OTI=\ODU=\MTg=\OTI=\OTI=\OTI=\ODk=\OTI=\OTI=\OTI=\MjQ=\OTI=\OTI=\OTI=\MjM=\Mjg=\MTU2\OTI=\MA==\OTI=\OTI=\OTM=\NjQ=\OTI=\OTM=\OTI=\NzQ=\OTI=\Nzc=\MjIw\MjU=\MjIx\OTI=\OTI=\MjY=\MTU3\MTU2\OTQ=\MjY=\OTM=\MTU3\OTQ=\MjY=\Mjk=\MTU3\OTQ=\Ng==\OTM=\OTI=\OTI=\NzQ=\MjIw\ODM=\MjIw\MjY=\MjIx\Mjk=\OTQ=\MjE3\MTU3\OTM=\OTI=\MjE4\OTM=\MzA=\OTU=\NzU=\MjIw\MjIx\OTQ=\NzQ=\Mjg=\ODI=\MjIw\MjM=\Mjk=\MzA=\OTQ=\MTU3\MjIx\OTQ=\OTI=\MA==\MjIx\MjIw\OTM=\Ng==\OTM=\OTI=\OTI=\NzQ=\OTI=\ODE=\MjIw\MjM=\Mjk=\MzA=\OTQ=\MTU3\MTU3\OTQ=\OTI=\MA==\MjIx\MjIw\OTM=\Ng==\OTM=\OTI=\OTI=\NzQ=\MTU2\ODc=\MjIw\MjY=\MjIx\MzA=\OTQ=\MjE=\Mjk=\MzE=\MjE4\MjY=\MjIx\MzA=\OTQ=\MjE=\MTU3\MzE=\MjE5\MjY=\MjIx\MzA=\OTQ=\MjE3\MjIx\OTI=\OTI=\MjE4\MTU3\Mjg=\OTU=\MjE4\OTM=\Mjk=\OTU=\MjE4\Mjk=\Mjk=\OTU=\MjE4\Mjk=\MjQ=\OTU=\MjE4\MjIx\MjQ=\OTU=\MjE4\MTU3\MjQ=\OTU=\MjEw\OTM=\MjU=\OTU=\MTUz\MjIx\OTI=\OTI=\MTU0\Mjk=\MTUz\OTU=\ODk=\MjIy\ODk=\OTI=\MTU0\OTM=\MjIy\OTU=\MTU0\Mjk=\MTUy\OTU=\MTU0\OTM=\MTUy\OTU=\MjA4\MTU3\OTM=\OTU=\MTUz\MTU3\OTM=\OTI=\MTU0\MTU3\MTUz\OTU=\MjA4\MTU3\OTM=\OTU=\MjE=\MjIx\OTM=\MjEy\MjY=\MTU3\MzA=\OTQ=\MjE=\Mjk=\MzE=\MjE4\MjY=\MTU3\MzA=\OTQ=\MjE=\MTU3\MzE=\MjE5\MjY=\MTU3\MzA=\OTQ=\MjE3\MjIx\OTI=\OTI=\MjE4\MTU3\Mjg=\OTU=\MjE4\OTM=\Mjk=\OTU=\MjE4\Mjk=\Mjk=\OTU=\MjE4\Mjk=\MjQ=\OTU=\MjE4\MjIx\MjQ=\OTU=\MjE4\MTU3\MjQ=\OTU=\MjEw\OTM=\MjY=\OTU=\MTUz\MjIx\OTI=\OTI=\MTU0\Mjk=\MTUz\OTU=\ODk=\MjIy\ODk=\OTI=\MTU0\OTM=\MjIy\OTU=\MTU0\Mjk=\MTUy\OTU=\MTU0\OTM=\MTUy\OTU=\MjA4\MTU3\OTM=\OTU=\MTUz\MTU3\OTM=\OTI=\MTU0\MTU3\MTUz\OTU=\MjA4\MTU3\OTM=\OTU=\MjE=\MjIx\OTM=\MjEy\MTI1\MjIw\OTI=\OTI=\NzQ=\OTI=\MTc4\MzU=\NjY=\OTI=\MjIw\OTI=\Njk=\OTI=\OTI=\OTI=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDQ=\NjE=\NTM=\NDY=\NDc=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjc=\NTc=\NDA=\MzE=\NTI=\NTM=\NDg=\NTY=\NDY=\NTc=\NTA=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTk=\NjE=\NDk=\NTc=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\NDc=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTY=\NTE=\NjM=\NjE=\NDg=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\NTI=\NjE=\NDY=\NjE=\NjM=\NDA=\NTc=\NDY=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTg=\NjE=\NDk=\NTc=\OTI=\ODg=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mw==\Mjc=\OTI=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDM=\NTI=\NTM=\NDA=\NTc=\NDg=\NTM=\NDc=\NDA=\MTEw\OTI=\ODg=\ODM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjY=\NTM=\NTA=\NTY=\MjY=\NTM=\NDY=\NDc=\NDA=\MzE=\NTI=\NTM=\NDg=\NTY=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjA=\NTc=\NjE=\NTY=\OTI=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OA==\NTE=\NDY=\NDc=\NTE=\OTI=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjk=\NTA=\NjM=\NTI=\NTE=\NDY=\NTc=\NTY=\OTI=\OTM=\OTM=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\NjE=\NTA=\MzE=\NTE=\NDg=\NDg=\NTM=\NTY=\NTc=\OTI=\OTM=\OTI=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NTE=\NDc=\NTM=\NDA=\NTM=\NTE=\NTA=\OTI=\ODg=\Nzc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjA=\NDE=\NDk=\NjE=\NTA=\NTE=\NTM=\NTY=\MTQ=\NTE=\NTE=\NDA=\MTI=\NjE=\NDY=\NDA=\OTI=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\MjY=\NDY=\NjE=\NDk=\NTc=\OTI=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDg=\NTE=\NTE=\NTU=\MTA=\NTc=\NjM=\NDA=\NTE=\NDY=\OTI=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\ODA=\Mjg=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTE=\NTE=\NDY=\NTU=\NDc=\NDQ=\NjE=\NjM=\NTc=\OTI=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\MTg=\NjE=\NDk=\NTc=\OTI=\ODg=\ODg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTE=\MjU=\MTE=\OTI=\OTU=\MTEx\MTEx\MTEx\MTEx\MTEx\MTEx\ODc=\Mjg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjE5\ODg=\OTI=\OTI=\MjQ3\ODg=\OTI=\OTI=\OTM=\OTI=\OTI=\ODU=\NDQ=\OTI=\OTI=\OTI=\ODg=\OTI=\OTI=\OTI=\OTA=\OTI=\Mjg=\OTI=\NzU=\Mjg=\Mjg=\OTI=\NzQ=\MjIw\Njg=\MjIw\ODg=\OTI=\OTI=\OTI=\ODU=\MjIw\Mjg=\MjIw\ODk=\MTU2\OTI=\OTI=\ODU=\Mjg=\Mjk=\MjIy\ODk=\MTU2\OTI=\OTI=\MjU=\MTU2\OTM=\OTI=\MjY=\OTI=\MTU4\OTI=\MjIx\Mjg=\OTQ=\OTI=\MTU3\MjIw\OTQ=\OTI=\OTM=\Mjk=\OTQ=\OTI=\MA==\MjIw\OTI=\OTQ=\ODU=\Mjg=\OTI=\MjIz\ODk=\MTU2\OTI=\OTI=\ODU=\OTI=\MTU5\MjE3\OTU=\OTI=\OTI=\OTI=\MjU=\Mjg=\OTU=\OTI=\MjE3\MjIw\OTU=\OTI=\MjE1\MTU2\MzE=\OTM=\MTky\OTI=\OTI=\OTM=\MA==\OTI=\OTM=\OTI=\NzQ=\MjIw\OTE=\MjIw\MjE1\OTM=\MTUy\OTQ=\OTM=\MzA=\ODg=\OTI=\MTky\MjIx\MjIw\OTM=\MTk4\OTM=\OTI=\OTI=\NzQ=\Mjg=\OTA=\MjIw\MjE1\MjIx\MTUy\OTQ=\OTM=\MTU4\ODg=\OTI=\MTky\MjIx\MjIw\OTM=\MTk4\Mjk=\OTI=\OTI=\NzQ=\MTU2\ODg=\MjIw\MjE1\MjIx\MTUy\OTQ=\OTM=\OTQ=\ODk=\OTI=\MTky\MjIx\MjIw\OTM=\MTk4\Mjk=\OTI=\OTI=\NzQ=\MjIw\OTU=\MjIw\MjE1\MjIx\MTUy\OTQ=\OTM=\MzA=\OTM=\OTI=\MTky\MjIx\MjIw\OTM=\MTk4\Mjk=\OTI=\OTI=\NzQ=\Mjg=\OTQ=\MjIw\MjE1\MjIx\MTUy\OTQ=\OTM=\MzA=\ODk=\OTI=\MTky\MjIx\MjIw\OTM=\MTk4\Mjk=\OTI=\OTI=\NzQ=\OTI=\OTM=\MjIw\MjE1\MjIx\MTUy\OTQ=\OTM=\MjIy\ODk=\OTI=\MTky\MjIx\MjIw\OTM=\MTk4\OTM=\OTI=\OTI=\NzQ=\OTI=\OTI=\MjIw\OTI=\OTI=\MjIw\OTQ=\NjE=\MjIw\OTI=\OTI=\NzQ=\MjIw\MTcx\MzU=\MjU=\OTI=\OTA=\OTI=\MjE3\Mjg=\OTA=\OTI=\MjE4\MjIw\MjY=\OTM=\MjE4\MTU2\MjY=\OTM=\MjE4\OTI=\Mjc=\OTM=\MA==\MjIw\OTI=\OTM=\Mjc=\MTU2\ODk=\OTI=\MjU=\Mjg=\OTA=\OTI=\MjM=\Mjg=\MTU1\OTI=\MTU3\MjIw\OTE=\OTI=\MA==\MjIw\MjIw\OTM=\MjY=\MTU2\MTU1\OTI=\MjM=\OTI=\MTQ4\OTI=\MTg0\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MA==\Mjg=\MjIw\OTM=\MjU=\Mjg=\ODQ=\OTI=\MA==\MjIw\MjIw\OTI=\Ng==\OTI=\OTI=\OTI=\NzQ=\MjIw\ODk=\MjIw\MjU=\MTU2\OTI=\OTI=\MjY=\MTU2\MTU4\OTI=\NzU=\OTI=\MTU5\OTI=\NzQ=\MTU2\MTYx\MzU=\MjU=\MTU2\OTI=\OTI=\MjY=\MjIw\MTU3\OTI=\MjE3\MTU2\OTM=\OTI=\MjE4\OTI=\MzA=\OTM=\MTU3\Mjg=\OTQ=\OTI=\OTM=\MjIx\OTQ=\OTI=\Mjk=\Mjk=\OTQ=\OTI=\MTky\MjIw\OTI=\OTQ=\NzU=\MjIw\MjIw\OTI=\NzQ=\Mjg=\MTY3\MzU=\MjU=\MTU2\OTI=\OTI=\MjE3\MTU2\OTM=\OTI=\MjE4\OTI=\MzA=\OTM=\MTU3\Mjg=\OTQ=\OTI=\OTM=\MjIx\ODQ=\OTI=\Mjk=\Mjk=\OTQ=\OTI=\MTky\MjIw\OTI=\OTQ=\MjE=\MjIw\OTI=\MjIz\NzQ=\OTI=\MTY1\MzU=\MTI3\OTI=\OTI=\OTI=\NzQ=\MTU2\OTM=\MjIw\ODg=\OTI=\OTI=\OTI=\OTA=\OTI=\Mjg=\OTI=\NzU=\MjIw\Mjg=\OTI=\NzQ=\MTU2\OTI=\MjIw\ODk=\MTU2\OTI=\OTI=\ODU=\MTU2\MjA=\MjIy\ODg=\OTI=\OTI=\OTI=\ODU=\Mjg=\Mjg=\MjIw\NjY=\OTI=\MjIw\OTI=\MTIw\OTI=\OTI=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OA==\NTc=\MzY=\NDA=\OTI=\ODg=\ODE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTc=\NjE=\NDY=\NTM=\NTA=\NTc=\MTI0\MTAy\MTI0\MTk=\MjY=\MjY=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTc=\NjE=\NDY=\NTM=\NTA=\NTc=\MTI0\MTAy\MTI0\MTk=\MTg=\OTI=\ODg=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mw==\Mjc=\OTI=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDM=\NTI=\NTM=\NDA=\NTc=\NDg=\NTM=\NDc=\NDA=\MTA5\OTI=\ODg=\NzY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTc=\NjE=\NDY=\NTM=\NTA=\NTc=\MTE2\MTY=\NDI=\NDg=\MTAy\MTEw\MTA4\MTA4\MTE3\OTI=\ODg=\ODg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTE=\MjU=\MTE=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTA=\NTc=\NjM=\NDA=\NTE=\NDY=\MTEx\OTI=\ODg=\ODg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTA=\NTc=\NDM=\OTI=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTcy\OTk=\ODg=\ODg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mzc=\NTc=\NDc=\OTI=\OTM=\OTM=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDQ=\NjE=\NTM=\NDY=\NDc=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDM=\NTE=\NDY=\NTU=\NDc=\NDQ=\NjE=\NjM=\NTc=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjc=\NTc=\NDA=\MzE=\NTI=\NTM=\NDg=\NTY=\NDY=\NTc=\NTA=\OTI=\ODg=\ODg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjE=\NDc=\Mjk=\OTI=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjY=\NTE=\NDg=\NTY=\NTc=\NDY=\OTI=\ODg=\ODM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjY=\NTM=\NTA=\NTY=\MjY=\NTM=\NDY=\NDc=\NDA=\MzE=\NTI=\NTM=\NDg=\NTY=\OTI=\ODg=\NzY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTY=\NDE=\NTg=\NTg=\Mzc=\MTE2\MTY=\NDI=\NDg=\MTAy\MTA5\MTA4\MTA4\MTA4\MTE3\OTI=\ODg=\MTI1\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzA=\NTM=\NTk=\MTI0\MjY=\NDE=\NDg=\NDg=\MTI0\MzA=\NTE=\NTY=\Mzc=\MTI0\MzA=\NDE=\NDc=\NTE=\MTI0\MTg=\NTE=\NTE=\NjI=\MTE2\MTY=\NDI=\NDg=\MTAy\MTA1\MTA4\MTA4\MTE3\OTI=\ODg=\Njg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjk=\NDA=\NDA=\NjE=\NjM=\NTU=\NTM=\NTA=\NTk=\MTI0\MTg=\NTE=\NTE=\NjI=\MTE2\MTY=\NDI=\NDg=\MTAy\MTA5\MTA4\MTA4\MTE3\OTI=\ODg=\NzM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzA=\NDE=\NTk=\NTk=\Mzc=\MTI0\NDQ=\NTM=\NDY=\NjE=\NDA=\NTc=\MTE2\MTY=\NDI=\NDg=\MTAy\MTEx\MTA4\MTE3\OTI=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\MTg=\NjE=\NDk=\NTc=\OTI=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDA=\NTE=\NDc=\NDA=\NDY=\NTM=\NTA=\NTk=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTk=\NjE=\NDk=\NTc=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\NDc=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTY=\NTE=\NjM=\NjE=\NDg=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTg=\NjE=\NDk=\NTc=\OTI=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjc=\NTc=\NDA=\MTU=\NTc=\NDY=\NDI=\NTM=\NjM=\NTc=\OTI=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTQ=\NDE=\NTA=\MTU=\NTc=\NDY=\NDI=\NTM=\NjM=\NTc=\OTI=\ODg=\ODI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTQ=\NTc=\NTA=\NTY=\NTc=\NDY=\MTU=\NDA=\NTc=\NDQ=\NDQ=\NTc=\NTY=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NjM=\NTE=\NTA=\NTA=\NTc=\NjM=\NDA=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDM=\NjE=\NTM=\NDA=\OTI=\OTU=\MTk4\MTk3\MTk3\MTk3\MTk3\MTk3\MjI5\OTk=\ODg=\OTM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjAw\ODg=\OTI=\OTI=\MTk1\ODg=\OTI=\OTI=\OTM=\OTI=\OTI=\ODU=\MTg=\OTI=\OTI=\OTI=\ODk=\OTI=\OTI=\OTI=\MjQ=\OTI=\OTI=\OTI=\MjM=\Mjg=\MTU2\OTI=\MA==\OTI=\OTI=\OTM=\NjQ=\OTI=\OTM=\OTI=\NzQ=\OTI=\Nzc=\MjIw\MjU=\MjIx\OTI=\OTI=\MjY=\MTU3\MTU2\OTQ=\MjY=\OTM=\MTU3\OTQ=\MjY=\Mjk=\MTU3\OTQ=\Ng==\OTM=\OTI=\OTI=\NzQ=\MjIw\ODM=\MjIw\MjY=\MjIx\Mjk=\OTQ=\MjE3\MTU3\OTM=\OTI=\MjE4\OTM=\MzA=\OTU=\NzU=\MjIw\MjIx\OTQ=\NzQ=\Mjg=\ODI=\MjIw\MjM=\Mjk=\MzA=\OTQ=\MTU3\MjIx\OTQ=\OTI=\MA==\MjIx\MjIw\OTM=\Ng==\OTM=\OTI=\OTI=\NzQ=\OTI=\ODE=\MjIw\MjM=\Mjk=\MzA=\OTQ=\MTU3\MTU3\OTQ=\OTI=\MA==\MjIx\MjIw\OTM=\Ng==\OTM=\OTI=\OTI=\NzQ=\MTU2\ODc=\MjIw\MjY=\MjIx\MzA=\OTQ=\MjE=\Mjk=\MzE=\MjE4\MjY=\MjIx\MzA=\OTQ=\MjE=\MTU3\MzE=\MjE5\MjY=\MjIx\MzA=\OTQ=\MjE3\MjIx\OTI=\OTI=\MjE4\MTU3\Mjg=\OTU=\MjE4\OTM=\Mjk=\OTU=\MjE4\Mjk=\Mjk=\OTU=\MjE4\Mjk=\MjQ=\OTU=\MjE4\MjIx\MjQ=\OTU=\MjE4\MTU3\MjQ=\OTU=\MjEw\OTM=\MjU=\OTU=\MTUz\MjIx\OTI=\OTI=\MTU0\Mjk=\MTUz\OTU=\ODk=\MjIy\ODk=\OTI=\MTU0\OTM=\MjIy\OTU=\MTU0\Mjk=\MTUy\OTU=\MTU0\OTM=\MTUy\OTU=\MjA4\MTU3\OTM=\OTU=\MTUz\MTU3\OTM=\OTI=\MTU0\MTU3\MTUz\OTU=\MjA4\MTU3\OTM=\OTU=\MjE=\MjIx\OTM=\MjEy\MjY=\MTU3\MzA=\OTQ=\MjE=\Mjk=\MzE=\MjE4\MjY=\MTU3\MzA=\OTQ=\MjE=\MTU3\MzE=\MjE5\MjY=\MTU3\MzA=\OTQ=\MjE3\MjIx\OTI=\OTI=\MjE4\MTU3\Mjg=\OTU=\MjE4\OTM=\Mjk=\OTU=\MjE4\Mjk=\Mjk=\OTU=\MjE4\Mjk=\MjQ=\OTU=\MjE4\MjIx\MjQ=\OTU=\MjE4\MTU3\MjQ=\OTU=\MjEw\OTM=\MjY=\OTU=\MTUz\MjIx\OTI=\OTI=\MTU0\Mjk=\MTUz\OTU=\ODk=\MjIy\ODk=\OTI=\MTU0\OTM=\MjIy\OTU=\MTU0\Mjk=\MTUy\OTU=\MTU0\OTM=\MTUy\OTU=\MjA4\MTU3\OTM=\OTU=\MTUz\MTU3\OTM=\OTI=\MTU0\MTU3\MTUz\OTU=\MjA4\MTU3\OTM=\OTU=\MjE=\MjIx\OTM=\MjEy\MTI1\MjIw\OTI=\OTI=\NzQ=\OTI=\MTc4\MzU=\NjY=\OTI=\MjIw\OTI=\Njk=\OTI=\OTI=\OTI=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDQ=\NjE=\NTM=\NDY=\NDc=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjc=\NTc=\NDA=\MzE=\NTI=\NTM=\NDg=\NTY=\NDY=\NTc=\NTA=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTk=\NjE=\NDk=\NTc=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\NDc=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTY=\NTE=\NjM=\NjE=\NDg=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\NTI=\NjE=\NDY=\NjE=\NjM=\NDA=\NTc=\NDY=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTg=\NjE=\NDk=\NTc=\OTI=\ODg=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mw==\Mjc=\OTI=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDM=\NTI=\NTM=\NDA=\NTc=\NDg=\NTM=\NDc=\NDA=\MTA5\OTI=\ODg=\ODM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjY=\NTM=\NTA=\NTY=\MjY=\NTM=\NDY=\NDc=\NDA=\MzE=\NTI=\NTM=\NDg=\NTY=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjA=\NTc=\NjE=\NTY=\OTI=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OA==\NTE=\NDY=\NDc=\NTE=\OTI=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjk=\NTA=\NjM=\NTI=\NTE=\NDY=\NTc=\NTY=\OTI=\OTM=\OTM=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\NjE=\NTA=\MzE=\NTE=\NDg=\NDg=\NTM=\NTY=\NTc=\OTI=\OTM=\OTI=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NTE=\NDc=\NTM=\NDA=\NTM=\NTE=\NTA=\OTI=\ODg=\Nzc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjA=\NDE=\NDk=\NjE=\NTA=\NTE=\NTM=\NTY=\MTQ=\NTE=\NTE=\NDA=\MTI=\NjE=\NDY=\NDA=\OTI=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\MjY=\NDY=\NjE=\NDk=\NTc=\OTI=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDg=\NTE=\NTE=\NTU=\MTA=\NTc=\NjM=\NDA=\NTE=\NDY=\OTI=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\ODA=\Mjg=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTE=\NTE=\NDY=\NTU=\NDc=\NDQ=\NjE=\NjM=\NTc=\OTI=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\MTg=\NjE=\NDk=\NTc=\OTI=\ODg=\ODg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTE=\MjU=\MTE=\OTI=\OTU=\MTEx\MTEx\MTEx\MTEx\MTEx\MTEx\ODc=\Mjg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjQx\ODg=\OTI=\OTI=\MTQx\ODg=\OTI=\OTI=\OTM=\OTI=\OTI=\ODU=\NDQ=\OTI=\OTI=\OTI=\ODg=\OTI=\OTI=\OTI=\OTA=\OTI=\Mjg=\OTI=\NzU=\Mjg=\Mjg=\OTI=\NzQ=\MjIw\Njg=\MjIw\ODg=\OTI=\OTI=\OTI=\ODU=\MjIw\Mjg=\MjIw\ODk=\MTU2\OTI=\OTI=\ODU=\Mjg=\Mjk=\MjIy\ODk=\MTU2\OTI=\OTI=\MjU=\MTU2\OTM=\OTI=\MjY=\OTI=\MTU4\OTI=\MjIx\Mjg=\OTQ=\OTI=\MTU3\MjIw\OTQ=\OTI=\OTM=\Mjk=\OTQ=\OTI=\MA==\MjIw\OTI=\OTQ=\ODU=\Mjg=\OTI=\MjIz\ODk=\MTU2\OTI=\OTI=\ODU=\OTI=\MTU5\MjE3\OTU=\OTI=\OTI=\OTI=\MjU=\Mjg=\OTU=\OTI=\MjE3\MjIw\OTU=\OTI=\MjE1\MTU2\MzE=\OTM=\MTky\OTI=\OTI=\OTM=\MA==\OTI=\OTM=\OTI=\NzQ=\MjIw\OTE=\MjIw\MjE1\OTM=\MTUy\OTQ=\OTM=\MzA=\ODg=\OTI=\MTky\MjIx\MjIw\OTM=\MTk4\OTM=\OTI=\OTI=\NzQ=\Mjg=\OTA=\MjIw\MjE1\MjIx\MTUy\OTQ=\OTM=\MTU4\ODg=\OTI=\MTky\MjIx\MjIw\OTM=\MTk4\Mjk=\OTI=\OTI=\NzQ=\MTU2\ODg=\MjIw\MjE1\MjIx\MTUy\OTQ=\OTM=\OTQ=\ODk=\OTI=\MTky\MjIx\MjIw\OTM=\MTk4\Mjk=\OTI=\OTI=\NzQ=\MjIw\OTU=\MjIw\MjE1\MjIx\MTUy\OTQ=\OTM=\MzA=\ODk=\OTI=\MTky\MjIx\MjIw\OTM=\MTk4\Mjk=\OTI=\OTI=\NzQ=\Mjg=\OTQ=\MjIw\MjE1\MjIx\MTUy\OTQ=\OTM=\MzA=\OTM=\OTI=\MTky\MjIx\MjIw\OTM=\MTk4\Mjk=\OTI=\OTI=\NzQ=\OTI=\OTM=\MjIw\MjE1\MjIx\MTUy\OTQ=\OTM=\MjIy\ODk=\OTI=\MTky\MjIx\MjIw\OTM=\MTk4\OTM=\OTI=\OTI=\NzQ=\OTI=\OTI=\MjIw\OTI=\OTI=\MjIw\OTQ=\NjE=\MjIw\OTI=\OTI=\NzQ=\MjIw\MTcx\MzU=\MjU=\OTI=\OTA=\OTI=\MjE3\Mjg=\OTA=\OTI=\MjE4\MjIw\MjY=\OTM=\MjE4\MTU2\MjY=\OTM=\MjE4\OTI=\Mjc=\OTM=\MA==\MjIw\OTI=\OTM=\Mjc=\MTU2\ODk=\OTI=\MjU=\Mjg=\OTA=\OTI=\MjM=\Mjg=\MTU1\OTI=\MTU3\MjIw\OTE=\OTI=\MA==\MjIw\MjIw\OTM=\MjY=\MTU2\MTU1\OTI=\MjM=\OTI=\MTQ4\OTI=\MTg0\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MA==\Mjg=\MjIw\OTM=\MjU=\Mjg=\ODQ=\OTI=\MA==\MjIw\MjIw\OTI=\Ng==\OTI=\OTI=\OTI=\NzQ=\MjIw\ODk=\MjIw\MjU=\MTU2\OTI=\OTI=\MjY=\MTU2\MTU4\OTI=\NzU=\OTI=\MTU5\OTI=\NzQ=\MTU2\MTYx\MzU=\MjU=\MTU2\OTI=\OTI=\MjY=\MjIw\MTU3\OTI=\MjE3\MTU2\OTM=\OTI=\MjE4\OTI=\MzA=\OTM=\MTU3\Mjg=\OTQ=\OTI=\OTM=\MjIx\OTQ=\OTI=\Mjk=\Mjk=\OTQ=\OTI=\MTky\MjIw\OTI=\OTQ=\NzU=\MjIw\MjIw\OTI=\NzQ=\Mjg=\MTY3\MzU=\MjU=\MTU2\OTI=\OTI=\MjE3\MTU2\OTM=\OTI=\MjE4\OTI=\MzA=\OTM=\MTU3\Mjg=\OTQ=\OTI=\OTM=\MjIx\ODQ=\OTI=\Mjk=\Mjk=\OTQ=\OTI=\MTky\MjIw\OTI=\OTQ=\MjE=\MjIw\OTI=\MjIz\NzQ=\OTI=\MTY1\MzU=\MTI3\OTI=\OTI=\OTI=\NzQ=\MTU2\OTM=\MjIw\ODg=\OTI=\OTI=\OTI=\OTA=\OTI=\Mjg=\OTI=\NzU=\MjIw\Mjg=\OTI=\NzQ=\MTU2\OTI=\MjIw\ODk=\MTU2\OTI=\OTI=\ODU=\MTU2\MjA=\MjIy\ODg=\OTI=\OTI=\OTI=\ODU=\Mjg=\Mjg=\MjIw\NjY=\OTI=\MjIw\OTI=\MTIw\OTI=\OTI=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OA==\NTc=\MzY=\NDA=\OTI=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTg=\NTE=\NTE=\NjI=\MTI0\MTAy\MTI0\MTk=\MjY=\MjY=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTg=\NTE=\NTE=\NjI=\MTI0\MTAy\MTI0\MTk=\MTg=\OTI=\ODg=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mw==\Mjc=\OTI=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDM=\NTI=\NTM=\NDA=\NTc=\NDg=\NTM=\NDc=\NDA=\MTA1\OTI=\ODg=\Njg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjk=\NDA=\NDA=\NjE=\NjM=\NTU=\NTM=\NTA=\NTk=\MTI0\MTg=\NTE=\NTE=\NjI=\MTE2\MTY=\NDI=\NDg=\MTAy\MTA5\MTA4\MTA4\MTE3\OTI=\ODg=\ODg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTE=\MjU=\MTE=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTA=\NTc=\NjM=\NDA=\NTE=\NDY=\MTEx\OTI=\ODg=\ODg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTA=\NTc=\NDM=\OTI=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTcy\OTk=\ODg=\ODg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mzc=\NTc=\NDc=\OTI=\OTM=\OTM=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDQ=\NjE=\NTM=\NDY=\NDc=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDM=\NTE=\NDY=\NTU=\NDc=\NDQ=\NjE=\NjM=\NTc=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjc=\NTc=\NDA=\MzE=\NTI=\NTM=\NDg=\NTY=\NDY=\NTc=\NTA=\OTI=\ODg=\ODg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjE=\NDc=\Mjk=\OTI=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjY=\NTE=\NDg=\NTY=\NTc=\NDY=\OTI=\ODg=\ODM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjY=\NTM=\NTA=\NTY=\MjY=\NTM=\NDY=\NDc=\NDA=\MzE=\NTI=\NTM=\NDg=\NTY=\OTI=\ODg=\NzY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTY=\NDE=\NTg=\NTg=\Mzc=\MTE2\MTY=\NDI=\NDg=\MTAy\MTA5\MTA4\MTA4\MTA4\MTE3\OTI=\ODg=\MTI1\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzA=\NTM=\NTk=\MTI0\MjY=\NDE=\NDg=\NDg=\MTI0\MzA=\NTE=\NTY=\Mzc=\MTI0\MzA=\NDE=\NDc=\NTE=\MTI0\MTg=\NTE=\NTE=\NjI=\MTE2\MTY=\NDI=\NDg=\MTAy\MTA1\MTA4\MTA4\MTE3\OTI=\ODg=\NzY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTc=\NjE=\NDY=\NTM=\NTA=\NTc=\MTE2\MTY=\NDI=\NDg=\MTAy\MTEw\MTA4\MTA4\MTE3\OTI=\ODg=\NzM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzA=\NDE=\NTk=\NTk=\Mzc=\MTI0\NDQ=\NTM=\NDY=\NjE=\NDA=\NTc=\MTE2\MTY=\NDI=\NDg=\MTAy\MTEx\MTA4\MTE3\OTI=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\MTg=\NjE=\NDk=\NTc=\OTI=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDA=\NTE=\NDc=\NDA=\NDY=\NTM=\NTA=\NTk=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTk=\NjE=\NDk=\NTc=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\NDc=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTY=\NTE=\NjM=\NjE=\NDg=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTg=\NjE=\NDk=\NTc=\OTI=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjc=\NTc=\NDA=\MTU=\NTc=\NDY=\NDI=\NTM=\NjM=\NTc=\OTI=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTQ=\NDE=\NTA=\MTU=\NTc=\NDY=\NDI=\NTM=\NjM=\NTc=\OTI=\ODg=\ODI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTQ=\NTc=\NTA=\NTY=\NTc=\NDY=\MTU=\NDA=\NTc=\NDQ=\NDQ=\NTc=\NTY=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NjM=\NTE=\NTA=\NTA=\NTc=\NjM=\NDA=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDM=\NjE=\NTM=\NDA=\OTI=\OTU=\MTk4\MTk3\MTk3\MTk3\MTk3\MTk3\MjI5\OTk=\ODg=\OTM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjMw\ODg=\OTI=\OTI=\MTUz\ODg=\OTI=\OTI=\OTM=\OTI=\OTI=\ODU=\MTg=\OTI=\OTI=\OTI=\ODk=\OTI=\OTI=\OTI=\MjQ=\OTI=\OTI=\OTI=\MjM=\Mjg=\MTU2\OTI=\MA==\OTI=\OTI=\OTM=\NjQ=\OTI=\OTM=\OTI=\NzQ=\OTI=\Nzc=\MjIw\MjU=\MjIx\OTI=\OTI=\MjY=\MTU3\MTU2\OTQ=\MjY=\OTM=\MTU3\OTQ=\MjY=\Mjk=\MTU3\OTQ=\Ng==\OTM=\OTI=\OTI=\NzQ=\MjIw\ODM=\MjIw\MjY=\MjIx\Mjk=\OTQ=\MjE3\MTU3\OTM=\OTI=\MjE4\OTM=\MzA=\OTU=\NzU=\MjIw\MjIx\OTQ=\NzQ=\Mjg=\ODI=\MjIw\MjM=\Mjk=\MzA=\OTQ=\MTU3\MjIx\OTQ=\OTI=\MA==\MjIx\MjIw\OTM=\Ng==\OTM=\OTI=\OTI=\NzQ=\OTI=\ODE=\MjIw\MjM=\Mjk=\MzA=\OTQ=\MTU3\MTU3\OTQ=\OTI=\MA==\MjIx\MjIw\OTM=\Ng==\OTM=\OTI=\OTI=\NzQ=\MTU2\ODc=\MjIw\MjY=\MjIx\MzA=\OTQ=\MjE=\Mjk=\MzE=\MjE4\MjY=\MjIx\MzA=\OTQ=\MjE=\MTU3\MzE=\MjE5\MjY=\MjIx\MzA=\OTQ=\MjE3\MjIx\OTI=\OTI=\MjE4\MTU3\Mjg=\OTU=\MjE4\OTM=\Mjk=\OTU=\MjE4\Mjk=\Mjk=\OTU=\MjE4\Mjk=\MjQ=\OTU=\MjE4\MjIx\MjQ=\OTU=\MjE4\MTU3\MjQ=\OTU=\MjEw\OTM=\MjU=\OTU=\MTUz\MjIx\OTI=\OTI=\MTU0\Mjk=\MTUz\OTU=\ODk=\MjIy\ODk=\OTI=\MTU0\OTM=\MjIy\OTU=\MTU0\Mjk=\MTUy\OTU=\MTU0\OTM=\MTUy\OTU=\MjA4\MTU3\OTM=\OTU=\MTUz\MTU3\OTM=\OTI=\MTU0\MTU3\MTUz\OTU=\MjA4\MTU3\OTM=\OTU=\MjE=\MjIx\OTM=\MjEy\MjY=\MTU3\MzA=\OTQ=\MjE=\Mjk=\MzE=\MjE4\MjY=\MTU3\MzA=\OTQ=\MjE=\MTU3\MzE=\MjE5\MjY=\MTU3\MzA=\OTQ=\MjE3\MjIx\OTI=\OTI=\MjE4\MTU3\Mjg=\OTU=\MjE4\OTM=\Mjk=\OTU=\MjE4\Mjk=\Mjk=\OTU=\MjE4\Mjk=\MjQ=\OTU=\MjE4\MjIx\MjQ=\OTU=\MjE4\MTU3\MjQ=\OTU=\MjEw\OTM=\MjY=\OTU=\MTUz\MjIx\OTI=\OTI=\MTU0\Mjk=\MTUz\OTU=\ODk=\MjIy\ODk=\OTI=\MTU0\OTM=\MjIy\OTU=\MTU0\Mjk=\MTUy\OTU=\MTU0\OTM=\MTUy\OTU=\MjA4\MTU3\OTM=\OTU=\MTUz\MTU3\OTM=\OTI=\MTU0\MTU3\MTUz\OTU=\MjA4\MTU3\OTM=\OTU=\MjE=\MjIx\OTM=\MjEy\MTI1\MjIw\OTI=\OTI=\NzQ=\OTI=\MTc4\MzU=\NjY=\OTI=\MjIw\OTI=\Njk=\OTI=\OTI=\OTI=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDQ=\NjE=\NTM=\NDY=\NDc=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjc=\NTc=\NDA=\MzE=\NTI=\NTM=\NDg=\NTY=\NDY=\NTc=\NTA=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTk=\NjE=\NDk=\NTc=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\NDc=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTY=\NTE=\NjM=\NjE=\NDg=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\NTI=\NjE=\NDY=\NjE=\NjM=\NDA=\NTc=\NDY=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTg=\NjE=\NDk=\NTc=\OTI=\ODg=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mw==\Mjc=\OTI=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDM=\NTI=\NTM=\NDA=\NTc=\NDg=\NTM=\NDc=\NDA=\MTA1\OTI=\ODg=\ODM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjY=\NTM=\NTA=\NTY=\MjY=\NTM=\NDY=\NDc=\NDA=\MzE=\NTI=\NTM=\NDg=\NTY=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjA=\NTc=\NjE=\NTY=\OTI=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OA==\NTE=\NDY=\NDc=\NTE=\OTI=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjk=\NTA=\NjM=\NTI=\NTE=\NDY=\NTc=\NTY=\OTI=\OTM=\OTM=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\NjE=\NTA=\MzE=\NTE=\NDg=\NDg=\NTM=\NTY=\NTc=\OTI=\OTM=\OTI=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NTE=\NDc=\NTM=\NDA=\NTM=\NTE=\NTA=\OTI=\ODg=\Nzc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjA=\NDE=\NDk=\NjE=\NTA=\NTE=\NTM=\NTY=\MTQ=\NTE=\NTE=\NDA=\MTI=\NjE=\NDY=\NDA=\OTI=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\MjY=\NDY=\NjE=\NDk=\NTc=\OTI=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDg=\NTE=\NTE=\NTU=\MTA=\NTc=\NjM=\NDA=\NTE=\NDY=\OTI=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\ODA=\Mjg=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTE=\NTE=\NDY=\NTU=\NDc=\NDQ=\NjE=\NjM=\NTc=\OTI=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\MTg=\NjE=\NDk=\NTc=\OTI=\ODg=\ODg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTE=\MjU=\MTE=\OTI=\OTU=\MTEx\MTEx\MTEx\MTEx\MTEx\MTEx\ODc=\Mjg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTQz\ODg=\OTI=\OTI=\MTY2\ODg=\OTI=\OTI=\OTM=\OTI=\OTI=\ODY=\NDE=\OTI=\OTI=\OTI=\ODg=\OTI=\OTI=\OTI=\OTA=\OTI=\Mjg=\OTI=\NzU=\Mjg=\Mjg=\OTI=\NzQ=\MTU2\Njk=\MjIw\ODg=\OTI=\OTI=\OTI=\ODU=\MjIw\Mjg=\MjIw\ODk=\MTU2\OTI=\OTI=\ODU=\Mjg=\Mjk=\MjIy\ODk=\MTU2\OTI=\OTI=\MjU=\MTU2\OTM=\OTI=\MjY=\OTI=\MTU4\OTI=\MjIx\Mjg=\OTQ=\OTI=\MTU3\MjIw\OTQ=\OTI=\OTM=\Mjk=\OTQ=\OTI=\MA==\MjIw\OTI=\OTQ=\ODU=\Mjg=\OTI=\MjIz\ODk=\MTU2\OTI=\OTI=\ODU=\Mjg=\MTU3\MjE3\OTU=\OTI=\MjIw\OTI=\MjE3\OTI=\OTU=\OTI=\MTUz\Mjg=\OTU=\OTI=\MTUx\MjIw\MTU5\OTM=\MTI4\OTI=\OTI=\OTM=\MTky\OTI=\OTM=\OTI=\NzQ=\MTU2\ODQ=\MjIw\MTUx\MTU3\MzE=\OTU=\Mjk=\OTQ=\ODg=\OTI=\MTI4\MjIx\MjIw\OTM=\MTM0\OTM=\OTI=\OTI=\NzQ=\MjIw\OTE=\MjIw\MTUx\Mjk=\MjQ=\OTU=\Mjk=\MjIy\ODg=\OTI=\MTI4\MjIx\MjIw\OTM=\MTM0\Mjk=\OTI=\OTI=\NzQ=\OTI=\OTA=\MjIw\MTUx\Mjk=\MjQ=\OTU=\Mjk=\MTU4\ODg=\OTI=\MTI4\MjIx\MjIw\OTM=\MTM0\Mjk=\OTI=\OTI=\NzQ=\MTU2\ODg=\MjIw\MTUx\Mjk=\MjQ=\OTU=\Mjk=\OTQ=\ODk=\OTI=\MTI4\MjIx\MjIw\OTM=\MTM0\Mjk=\OTI=\OTI=\NzQ=\MjIw\OTU=\MjIw\MTUx\Mjk=\MjQ=\OTU=\Mjk=\MzA=\ODk=\OTI=\MTI4\MjIx\MjIw\OTM=\MTM0\Mjk=\OTI=\OTI=\NzQ=\Mjg=\OTQ=\MjIw\MTUx\Mjk=\MjQ=\OTU=\Mjk=\MjIy\ODk=\OTI=\MTI4\MjIx\MjIw\OTM=\MTM0\Mjk=\OTI=\OTI=\NzQ=\OTI=\OTM=\MjIw\MTUx\Mjk=\MjQ=\OTU=\Mjk=\MTU4\ODk=\OTI=\MTI4\MjIx\MjIw\OTM=\MTM0\OTM=\OTI=\OTI=\NzQ=\OTI=\OTI=\MjIw\Mjg=\OTI=\OTI=\OTU=\MjUz\MjIw\OTI=\OTI=\NzQ=\Mjg=\MTcw\MzU=\MjE3\Mjg=\OTA=\OTI=\MTUz\MjIw\OTA=\OTI=\MTU0\MTU2\MTU0\OTM=\MTU0\OTI=\MTU1\OTM=\MTU0\Mjg=\MTU1\OTM=\MTky\MjIw\OTI=\OTM=\MjE5\OTI=\OTA=\OTI=\MjE3\MjIw\OTA=\OTI=\MjE1\MjIw\Mjc=\OTM=\OTM=\MTU3\OTE=\OTI=\MTky\MjIw\MjIw\OTM=\MjE4\OTI=\MjA=\OTM=\MjE1\Mjg=\MjA=\OTM=\MTIw\OTM=\OTI=\OTI=\OTI=\OTI=\MjIw\OTI=\MTky\Mjg=\MjIw\OTM=\MjE3\MjIw\ODQ=\OTI=\MTky\MjIw\MjIw\OTI=\MTk4\OTI=\OTI=\OTI=\NzQ=\MjIw\ODk=\MjIw\MjE3\MTU2\OTI=\OTI=\MjE4\MTU2\MzA=\OTM=\NzU=\Mjg=\Mjk=\OTM=\NzQ=\MTU2\MTYx\MzU=\MjE3\MTU2\OTI=\OTI=\MjE4\MjIw\Mjk=\OTM=\MTUz\MTU2\OTM=\OTI=\MTU0\OTI=\MTU4\OTM=\OTM=\Mjk=\OTQ=\OTI=\Mjk=\MjIx\OTQ=\OTI=\MjIx\Mjk=\OTQ=\OTI=\MTI4\MjIw\OTI=\OTQ=\NzU=\MTU2\OTI=\OTM=\NzQ=\Mjg=\MTY3\MzU=\MjE3\MTU2\OTI=\OTI=\MTUz\MTU2\OTM=\OTI=\MTU0\OTI=\MTU4\OTM=\OTM=\Mjk=\OTQ=\OTI=\Mjk=\MTU3\ODQ=\OTI=\MjIx\Mjk=\OTQ=\OTI=\MTI4\MjIw\OTI=\OTQ=\MjEz\MTU2\OTI=\MjIz\NzQ=\OTI=\MTY1\MzU=\MTI3\OTI=\OTI=\OTI=\NzQ=\MTU2\OTM=\MjIw\ODg=\OTI=\OTI=\OTI=\OTA=\OTI=\Mjg=\OTI=\NzU=\MjIw\Mjg=\OTI=\NzQ=\MTU2\OTI=\MjIw\ODk=\MTU2\OTI=\OTI=\ODU=\OTI=\MjE=\MjIy\ODg=\OTI=\OTI=\OTI=\ODU=\Mjg=\Mjg=\MjIw\NjY=\OTI=\MjIw\OTI=\MTIx\OTI=\OTI=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OA==\NTc=\MzY=\NDA=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OA==\NTI=\NTM=\NTc=\NTg=\MTI0\MTAy\MTI0\MTk=\MjY=\MjY=\OTI=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OA==\NTI=\NTM=\NTc=\NTg=\MTI0\MTAy\MTI0\MTk=\MTg=\OTI=\ODg=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mw==\Mjc=\OTI=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDA=\NTI=\NTM=\NTc=\NTg=\OTI=\OTM=\OTM=\ODg=\ODg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTE=\MjU=\MTE=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTA=\NTc=\NjM=\NDA=\NTE=\NDY=\MTEx\OTI=\ODg=\ODg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTA=\NTc=\NDM=\OTI=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTcy\OTk=\ODg=\ODg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mzc=\NTc=\NDc=\OTI=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDQ=\NjE=\NTM=\NDY=\NDc=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDM=\NTE=\NDY=\NTU=\NDc=\NDQ=\NjE=\NjM=\NTc=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjc=\NTc=\NDA=\MzE=\NTI=\NTM=\NDg=\NTY=\NDY=\NTc=\NTA=\OTI=\ODg=\ODg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjE=\NDc=\Mjk=\OTI=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjY=\NTE=\NDg=\NTY=\NTc=\NDY=\OTI=\ODg=\ODM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjY=\NTM=\NTA=\NTY=\MjY=\NTM=\NDY=\NDc=\NDA=\MzE=\NTI=\NTM=\NDg=\NTY=\OTI=\ODg=\NzY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTY=\NDE=\NTg=\NTg=\Mzc=\MTE2\MTY=\NDI=\NDg=\MTAy\MTA5\MTA4\MTA4\MTA4\MTE3\OTI=\ODg=\MTI1\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzA=\NTM=\NTk=\MTI0\MjY=\NDE=\NDg=\NDg=\MTI0\MzA=\NTE=\NTY=\Mzc=\MTI0\MzA=\NDE=\NDc=\NTE=\MTI0\MTg=\NTE=\NTE=\NjI=\MTE2\MTY=\NDI=\NDg=\MTAy\MTA1\MTA4\MTA4\MTE3\OTI=\ODg=\NzY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTc=\NjE=\NDY=\NTM=\NTA=\NTc=\MTE2\MTY=\NDI=\NDg=\MTAy\MTEw\MTA4\MTA4\MTE3\OTI=\ODg=\Njg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjk=\NDA=\NDA=\NjE=\NjM=\NTU=\NTM=\NTA=\NTk=\MTI0\MTg=\NTE=\NTE=\NjI=\MTE2\MTY=\NDI=\NDg=\MTAy\MTA5\MTA4\MTA4\MTE3\OTI=\ODg=\NzM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzA=\NDE=\NTk=\NTk=\Mzc=\MTI0\NDQ=\NTM=\NDY=\NjE=\NDA=\NTc=\MTE2\MTY=\NDI=\NDg=\MTAy\MTEx\MTA4\MTE3\OTI=\ODg=\ODE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OA==\NTI=\NTM=\NTc=\NTg=\MTE2\NDg=\NDI=\NDg=\MTAy\MTA1\MTE3\OTI=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\MTg=\NjE=\NDk=\NTc=\OTI=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDA=\NTE=\NDc=\NDA=\NDY=\NTM=\NTA=\NTk=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTk=\NjE=\NDk=\NTc=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\NDc=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTY=\NTE=\NjM=\NjE=\NDg=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTg=\NjE=\NDk=\NTc=\OTI=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjc=\NTc=\NDA=\MTU=\NTc=\NDY=\NDI=\NTM=\NjM=\NTc=\OTI=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTQ=\NDE=\NTA=\MTU=\NTc=\NDY=\NDI=\NTM=\NjM=\NTc=\OTI=\ODg=\ODI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTQ=\NTc=\NTA=\NTY=\NTc=\NDY=\MTU=\NDA=\NTc=\NDQ=\NDQ=\NTc=\NTY=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NjM=\NTE=\NTA=\NTA=\NTc=\NjM=\NDA=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDM=\NjE=\NTM=\NDA=\OTI=\OTU=\MTk4\MTk3\MTk3\MTk3\MTk3\MTk3\MjI5\OTk=\OTM=\OTI=\OTM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTg5\ODg=\OTI=\OTI=\MTc4\ODg=\OTI=\OTI=\OTM=\OTI=\OTI=\ODU=\MTI=\OTI=\OTI=\OTI=\ODk=\OTI=\OTI=\OTI=\OTA=\Mjg=\Mjg=\OTI=\NzU=\MjIw\Mjg=\OTI=\NzQ=\MjIw\Nzg=\MjIw\ODk=\MTU2\OTI=\OTI=\MjQ=\OTI=\OTI=\OTI=\MjM=\OTI=\MTU3\OTI=\MA==\OTI=\OTI=\OTM=\NjQ=\OTI=\OTM=\OTI=\NzQ=\MjIw\NzY=\MjIw\MjU=\Mjk=\OTM=\OTI=\MjY=\MjIx\MTU3\OTQ=\MjY=\MTU3\MTU3\OTQ=\MjY=\OTM=\MTU4\OTQ=\Ng==\OTM=\OTI=\OTI=\NzQ=\OTI=\ODM=\MjIw\MjY=\Mjk=\MzA=\OTQ=\NzU=\MjIw\MTU4\OTQ=\NzQ=\Mjg=\ODI=\MjIw\MjM=\MTU3\MzA=\OTQ=\MTU3\OTM=\OTU=\OTI=\MA==\MjIx\MjIw\OTM=\Ng==\OTM=\OTI=\OTI=\NzQ=\OTI=\ODE=\MjIw\MjM=\MTU3\MzA=\OTQ=\MTU3\Mjk=\OTU=\OTI=\MA==\MjIx\MjIw\OTM=\Ng==\OTM=\OTI=\OTI=\NzQ=\MTU2\ODc=\MjIw\MjY=\OTM=\MzE=\OTQ=\MjE=\MjIx\Mjg=\MjE5\MjY=\OTM=\MzE=\OTQ=\MjE=\OTM=\MTUy\MjE5\MjY=\OTM=\MzE=\OTQ=\MjE3\Mjk=\OTM=\OTI=\MjE4\MjIx\Mjk=\OTU=\MjE4\MTU3\Mjk=\OTU=\MjE4\OTM=\MzA=\OTU=\MjE4\MjIx\MjQ=\OTU=\MjE4\MTU3\MjQ=\OTU=\MjE4\OTM=\MjU=\OTU=\MjEw\Mjk=\MjU=\OTU=\MTUz\Mjk=\OTM=\OTI=\MTU0\MjIx\MTUz\OTU=\ODk=\MTU4\ODk=\OTI=\MTU0\OTM=\MjIy\OTU=\MTU0\MjIx\MTUy\OTU=\MTU0\Mjk=\MTUy\OTU=\MjA4\MTU3\OTM=\OTU=\MTUz\OTM=\OTI=\OTI=\MTU0\OTM=\MTU0\OTU=\MjA4\MTU3\OTM=\OTU=\MjE=\MjIx\MjIx\MjEy\MjY=\Mjk=\MzE=\OTQ=\MjE=\MjIx\Mjg=\MjE5\MjY=\Mjk=\MzE=\OTQ=\MjE=\OTM=\MTUy\MjE5\MjY=\Mjk=\MzE=\OTQ=\MjE3\Mjk=\OTM=\OTI=\MjE4\MjIx\Mjk=\OTU=\MjE4\MTU3\Mjk=\OTU=\MjE4\OTM=\MzA=\OTU=\MjE4\MjIx\MjQ=\OTU=\MjE4\MTU3\MjQ=\OTU=\MjE4\OTM=\MjU=\OTU=\MjEw\Mjk=\MjY=\OTU=\MTUz\Mjk=\OTM=\OTI=\MTU0\MjIx\MTUz\OTU=\ODk=\MTU4\ODk=\OTI=\MTU0\OTM=\MjIy\OTU=\MTU0\MjIx\MTUy\OTU=\MTU0\Mjk=\MTUy\OTU=\MjA4\MTU3\OTM=\OTU=\MTUz\OTM=\OTI=\OTI=\MTU0\OTM=\MTU0\OTU=\MjA4\MTU3\OTM=\OTU=\MjE=\MjIx\MjIx\MjEy\MTI1\MjIw\OTI=\OTI=\NzQ=\MjIw\MTc4\MzU=\NjY=\OTI=\MjIw\OTI=\NzA=\OTI=\OTI=\OTI=\ODg=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mw==\Mjc=\OTI=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDA=\NTI=\NTM=\NTc=\NTg=\OTI=\OTM=\OTM=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDQ=\NjE=\NTM=\NDY=\NDc=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjc=\NTc=\NDA=\MzE=\NTI=\NTM=\NDg=\NTY=\NDY=\NTc=\NTA=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTk=\NjE=\NDk=\NTc=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\NDc=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTY=\NTE=\NjM=\NjE=\NDg=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\NTI=\NjE=\NDY=\NjE=\NjM=\NDA=\NTc=\NDY=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTg=\NjE=\NDk=\NTc=\OTI=\ODg=\ODE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OA==\NTI=\NTM=\NTc=\NTg=\MTE2\NDg=\NDI=\NDg=\MTAy\MTA1\MTE3\OTI=\ODg=\ODM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjY=\NTM=\NTA=\NTY=\MjY=\NTM=\NDY=\NDc=\NDA=\MzE=\NTI=\NTM=\NDg=\NTY=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjA=\NTc=\NjE=\NTY=\OTI=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OA==\NTE=\NDY=\NDc=\NTE=\OTI=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjk=\NTA=\NjM=\NTI=\NTE=\NDY=\NTc=\NTY=\OTI=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\NjE=\NTA=\MzE=\NTE=\NDg=\NDg=\NTM=\NTY=\NTc=\OTI=\OTM=\OTI=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NTE=\NDc=\NTM=\NDA=\NTM=\NTE=\NTA=\OTI=\ODg=\Nzc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjA=\NDE=\NDk=\NjE=\NTA=\NTE=\NTM=\NTY=\MTQ=\NTE=\NTE=\NDA=\MTI=\NjE=\NDY=\NDA=\OTI=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\MjY=\NDY=\NjE=\NDk=\NTc=\OTI=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDg=\NTE=\NTE=\NTU=\MTA=\NTc=\NjM=\NDA=\NTE=\NDY=\OTI=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\ODA=\Mjg=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTE=\NTE=\NDY=\NTU=\NDc=\NDQ=\NjE=\NjM=\NTc=\OTI=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\MTg=\NjE=\NDk=\NTc=\OTI=\ODg=\ODg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTE=\MjU=\MTE=\OTI=\OTU=\MTEx\MTEx\MTEx\MTEx\MTEx\MTEx\ODc=\Mjg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTYw\ODg=\OTI=\OTI=\NjQ=\ODk=\OTI=\OTI=\OTQ=\OTI=\OTI=\ODk=\OTc=\OTI=\OTI=\OTI=\ODg=\OTI=\OTI=\OTI=\OTA=\OTI=\Mjg=\OTI=\NzU=\Mjg=\Mjg=\OTI=\NzQ=\MTU2\ODc=\MjIw\ODg=\OTI=\OTI=\OTI=\ODU=\MjIw\Mjg=\MjIw\ODk=\MTU2\OTI=\OTI=\ODU=\Mjg=\Mjk=\MjIy\ODk=\MTU2\OTM=\OTI=\MjU=\OTI=\OTQ=\OTI=\MjY=\Mjg=\MTU4\OTI=\MjY=\MjIw\MTU4\OTI=\MjY=\MTU2\MTU4\OTI=\NjQ=\MjIw\OTI=\OTM=\OTE=\MjIw\OTM=\OTI=\ODk=\OTI=\OTQ=\OTI=\ODc=\OTI=\MzE=\OTI=\MjIx\Mjg=\OTU=\OTI=\NjQ=\MjIw\MjIw\OTM=\OTA=\MjIw\MzE=\OTI=\ODc=\MTU2\MzE=\OTI=\MjQ4\OTI=\OTI=\OTI=\ODg=\OTI=\MjIw\OTI=\NjQ=\Mjg=\MjIw\OTM=\ODk=\OTI=\ODg=\OTI=\NjQ=\MjIw\MjIw\OTI=\NzA=\OTI=\OTI=\OTI=\NzQ=\MTU2\OTE=\MjIw\ODk=\MTU2\OTI=\OTI=\OTA=\Mjg=\MjQ=\OTI=\NzU=\Mjg=\Mjk=\OTI=\NzQ=\MTU2\MTYx\MzU=\ODk=\MTU2\OTI=\OTI=\OTA=\MjIw\MjQ=\OTI=\MjU=\MTU2\ODg=\OTI=\MjY=\OTI=\MTUz\OTI=\MjIx\Mjg=\ODk=\OTI=\MTU3\MjIw\ODk=\OTI=\OTM=\Mjk=\ODk=\OTI=\MA==\MjIw\OTI=\OTQ=\NzU=\Mjg=\OTI=\OTI=\NzQ=\Mjg=\MTY3\MzU=\ODk=\MTU2\OTI=\OTI=\MjU=\MTU2\ODg=\OTI=\MjY=\OTI=\MTUz\OTI=\MjIx\Mjg=\ODk=\OTI=\MTU3\MTU2\ODk=\OTI=\OTM=\Mjk=\ODk=\OTI=\MA==\MjIw\OTI=\OTQ=\ODU=\Mjg=\OTI=\MjEz\NzQ=\OTI=\MTY1\MzU=\NzQ=\MTU2\OTM=\MjIw\ODg=\OTI=\OTI=\OTI=\OTA=\OTI=\Mjg=\OTI=\NzU=\MjIw\Mjg=\OTI=\NzQ=\MTU2\OTI=\MjIw\ODk=\MTU2\OTI=\OTI=\ODU=\OTI=\MjY=\MjIy\ODg=\OTI=\OTI=\OTI=\ODU=\Mjg=\Mjg=\MjIw\NjY=\OTI=\MjIw\OTI=\Njk=\OTI=\OTI=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OA==\NTc=\MzY=\NDA=\OTI=\ODg=\ODI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\NjE=\NDY=\NTA=\NjE=\NTk=\NTc=\MTI0\MTAy\MTI0\MTk=\MjY=\MjY=\OTI=\ODg=\ODE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\NjE=\NDY=\NTA=\NjE=\NTk=\NTc=\MTI0\MTAy\MTI0\MTk=\MTg=\OTI=\ODg=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mw==\Mjc=\OTI=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTI=\NDE=\NDk=\NjE=\NTA=\NDc=\OTI=\OTM=\OTM=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\MTg=\NjE=\NDk=\NTc=\OTI=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDA=\NTE=\NDc=\NDA=\NDY=\NTM=\NTA=\NTk=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTk=\NjE=\NDk=\NTc=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\NDc=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTY=\NTE=\NjM=\NjE=\NDg=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTg=\NjE=\NDk=\NTc=\OTI=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjc=\NTc=\NDA=\MTU=\NTc=\NDY=\NDI=\NTM=\NjM=\NTc=\OTI=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTQ=\NDE=\NTA=\MTU=\NTc=\NDY=\NDI=\NTM=\NjM=\NTc=\OTI=\ODg=\ODI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTQ=\NTc=\NTA=\NTY=\NTc=\NDY=\MTU=\NDA=\NTc=\NDQ=\NDQ=\NTc=\NTY=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NjM=\NTE=\NTA=\NTA=\NTc=\NjM=\NDA=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDM=\NjE=\NTM=\NDA=\OTI=\ODg=\ODg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mzc=\NTc=\NDc=\OTI=\ODg=\ODg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTE=\MjU=\MTE=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTA=\NTc=\NjM=\NDA=\NTE=\NDY=\MTEx\OTI=\ODg=\ODg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTA=\NTc=\NDM=\OTI=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTcy\OTk=\OTU=\MTk4\MTk3\MTk3\MTk3\MTk3\MTk3\MjI5\OTk=\OTM=\OTI=\OTM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTM=\ODk=\OTI=\OTI=\NzY=\ODk=\OTI=\OTI=\OTM=\OTI=\OTI=\ODI=\NjA=\OTI=\OTI=\OTI=\ODk=\OTI=\OTI=\OTI=\OTA=\Mjg=\Mjg=\OTI=\NzU=\MjIw\Mjg=\OTI=\NzQ=\MjIw\NzQ=\MjIw\ODk=\MTU2\OTI=\OTI=\MjU=\OTI=\OTM=\OTI=\MjY=\Mjg=\MTU3\OTI=\MjM=\MjIw\MTU3\OTI=\MA==\OTI=\OTI=\OTM=\NjQ=\OTI=\OTM=\OTI=\NzQ=\Mjg=\NzI=\MjIw\MjU=\MTU3\OTI=\OTI=\MjE3\OTM=\OTM=\OTI=\MjE4\MTU3\Mjk=\OTU=\MjE1\MjIx\Mjk=\OTU=\MTky\OTM=\OTI=\OTM=\MA==\OTM=\OTM=\OTI=\NzQ=\OTI=\Nzg=\MjIw\MjE3\OTQ=\OTM=\OTI=\MjE4\MzA=\Mjk=\ODk=\MjE4\OTQ=\MzA=\ODk=\MjE4\MzA=\MzA=\ODk=\MTk4\OTQ=\OTI=\OTI=\NzQ=\MjIw\NzY=\MjIw\MjE4\MjIy\MTU4\ODg=\MTU0\MjIy\MzA=\OTQ=\NzU=\MTU2\OTQ=\ODk=\NzQ=\MjIw\ODM=\MjIw\MjE4\MjIy\MTU4\ODg=\MTUy\OTQ=\OTI=\OTI=\MTU0\MjIy\MTU4\ODk=\MTE=\MTU2\OTQ=\ODk=\NzQ=\Mjg=\ODI=\MjIw\MjE1\MTU4\MTU4\ODg=\OTM=\OTU=\OTU=\OTI=\MTky\MjIy\MjIw\OTM=\MTk4\OTQ=\OTI=\OTI=\NzQ=\OTI=\ODE=\MjIw\MjE1\MTU4\MTU4\ODg=\OTM=\MzE=\OTU=\OTI=\MTky\MjIy\MjIw\OTM=\MTk4\OTQ=\OTI=\OTI=\NzQ=\MTU2\ODc=\MjIw\MjE4\OTQ=\MTU5\ODg=\MjEz\MjIy\Mjg=\MjE5\MjE4\OTQ=\MTU5\ODg=\MjEz\OTQ=\MTUy\MjE5\MjE4\OTQ=\MTU5\ODg=\MTUz\OTQ=\OTM=\OTI=\MTU0\MzA=\MTU3\ODk=\MTU0\OTQ=\MTU4\ODk=\MTU0\MzA=\MTU4\ODk=\MTU0\MjIy\MTUy\ODk=\MTU0\MTU4\MTUy\ODk=\MTU0\OTQ=\MTUz\ODk=\MTQ2\MzA=\MTUz\ODk=\ODk=\OTU=\OTM=\OTI=\OTA=\MTU5\Mjk=\OTA=\MjU=\MjIz\ODk=\OTI=\OTA=\MzE=\OTU=\OTA=\OTA=\MjIz\MjQ=\OTA=\OTA=\MzE=\MjQ=\OTA=\MTQ0\OTQ=\MjIz\ODk=\ODk=\OTU=\OTI=\OTI=\OTA=\MTU5\MjU=\OTA=\MTQ0\OTQ=\MjIz\ODk=\MjEz\MTU4\MjIy\MjEy\MjE4\MzA=\MTU5\ODg=\MjEz\MjIy\Mjg=\MjE5\MjE4\MzA=\MTU5\ODg=\MjEz\OTQ=\MTUy\MjE5\MjE4\MzA=\MTU5\ODg=\MTUz\OTQ=\OTM=\OTI=\MTU0\MzA=\MTU3\ODk=\MTU0\OTQ=\MTU4\ODk=\MTU0\MzA=\MTU4\ODk=\MTU0\MjIy\MTUy\ODk=\MTU0\MTU4\MTUy\ODk=\MTU0\OTQ=\MTUz\ODk=\MTQ2\OTQ=\MTU0\ODk=\ODk=\OTU=\OTM=\OTI=\OTA=\MTU5\Mjk=\OTA=\MjU=\MjIz\ODk=\OTI=\OTA=\MzE=\OTU=\OTA=\OTA=\MjIz\MjQ=\OTA=\OTA=\MzE=\MjQ=\OTA=\MTQ0\OTQ=\MjIz\ODk=\ODk=\OTU=\OTI=\OTI=\OTA=\MTU5\MjU=\OTA=\MTQ0\OTQ=\MjIz\ODk=\MjEz\MTU4\MjIy\MjEy\NjE=\MjIx\OTI=\OTI=\NzQ=\OTI=\MTc3\MzU=\MTI1\MjIw\OTI=\OTI=\NzQ=\MTU2\MTgy\MzU=\NjY=\OTI=\MjIw\OTI=\Njk=\OTI=\OTI=\OTI=\ODg=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mw==\Mjc=\OTI=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTI=\NDE=\NDk=\NjE=\NTA=\NDc=\OTI=\OTM=\OTM=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDQ=\NjE=\NTM=\NDY=\NDc=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTk=\NjE=\NDk=\NTc=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\NDc=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjc=\NTc=\NDA=\MzE=\NTI=\NTM=\NDg=\NTY=\NDY=\NTc=\NTA=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTE=\NTE=\NDY=\NTU=\NDc=\NDQ=\NjE=\NjM=\NTc=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTY=\NTE=\NjM=\NjE=\NDg=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\NTI=\NjE=\NDY=\NjE=\NjM=\NDA=\NTc=\NDY=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTg=\NjE=\NDk=\NTc=\OTI=\ODg=\ODM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjY=\NTM=\NTA=\NTY=\MjY=\NTM=\NDY=\NDc=\NDA=\MzE=\NTI=\NTM=\NDg=\NTY=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjA=\NTc=\NjE=\NTY=\OTI=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OA==\NTE=\NDY=\NDc=\NTE=\OTI=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjk=\NTA=\NjM=\NTI=\NTE=\NDY=\NTc=\NTY=\OTI=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\NjE=\NTA=\MzE=\NTE=\NDg=\NDg=\NTM=\NTY=\NTc=\OTI=\OTM=\OTI=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NTE=\NDc=\NTM=\NDA=\NTM=\NTE=\NTA=\OTI=\ODg=\Nzc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjA=\NDE=\NDk=\NjE=\NTA=\NTE=\NTM=\NTY=\MTQ=\NTE=\NTE=\NDA=\MTI=\NjE=\NDY=\NDA=\OTI=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\MjY=\NDY=\NjE=\NDk=\NTc=\OTI=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDg=\NTE=\NTE=\NTU=\MTA=\NTc=\NjM=\NDA=\NTE=\NDY=\OTI=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\ODA=\Mjg=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\MTg=\NjE=\NDk=\NTc=\OTI=\ODg=\ODg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTE=\MjU=\MTE=\OTI=\OTU=\MTEx\MTEx\MTEx\MTEx\MTEx\MTEx\ODc=\Mjg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NjY=\ODk=\OTI=\OTI=\MTE1\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\ODQ=\MTI=\OTI=\OTI=\OTI=\ODk=\OTI=\OTI=\OTI=\OTA=\Mjg=\Mjg=\OTI=\ODc=\MjIw\Mjg=\OTI=\MjIx\MTU2\OTI=\OTI=\NjQ=\MjIw\MjIw\OTM=\NzA=\Mjg=\OTI=\OTI=\NzQ=\OTI=\ODI=\MjIw\ODk=\OTI=\OTM=\OTI=\OTA=\Mjg=\Mjk=\OTI=\Mjk=\MjIw\OTM=\OTI=\NjQ=\MjIw\OTI=\OTM=\ODU=\MTU2\MTU2\MjIz\MjU=\Mjg=\OTQ=\OTI=\ODU=\Mjg=\OTI=\MjE2\ODU=\MTU2\MzA=\MjE3\MjU=\Mjg=\OTU=\OTI=\MjY=\Mjg=\MTU3\OTI=\MjIx\MjIw\OTU=\OTI=\MTU3\MTU2\OTU=\OTI=\OTM=\MjIx\OTU=\OTI=\MA==\MjIw\OTI=\OTQ=\ODU=\Mjg=\OTI=\MjE4\MjU=\Mjg=\OTU=\OTI=\MjY=\Mjg=\MTU3\OTI=\MjIx\Mjg=\ODg=\OTI=\MTU3\MjIw\ODg=\OTI=\OTM=\Mjk=\ODg=\OTI=\MA==\MjIw\OTI=\OTQ=\ODU=\Mjg=\OTI=\MjEy\MjU=\MTU2\ODg=\OTI=\MA==\MjIw\MjIw\OTI=\Ng==\OTI=\OTI=\OTI=\NzQ=\MjIw\OTE=\MjIw\MjU=\OTI=\ODk=\OTI=\MjY=\Mjg=\MTUz\OTI=\MjE3\Mjg=\OTQ=\OTI=\MjE4\MjIw\MjU=\OTM=\MjEx\MTU2\MjU=\OTM=\MA==\MjIw\OTI=\OTM=\MTk=\MTU2\MTUz\OTI=\MTY=\OTI=\MTU0\OTI=\MjE3\OTI=\ODk=\OTI=\MjE4\Mjg=\MjU=\OTM=\MTUz\Mjg=\OTQ=\OTI=\MTU0\MjIw\MTUz\OTM=\MTky\MjIw\OTI=\OTM=\MjEx\MTU2\MjU=\OTM=\MjA4\OTI=\MjY=\OTM=\MTUz\OTI=\ODk=\OTI=\MTU0\Mjg=\MTUz\OTM=\ODk=\Mjk=\OTQ=\OTI=\OTA=\MjIx\MjU=\OTQ=\ODI=\Mjk=\MjY=\OTQ=\MTI4\MjIw\OTI=\OTM=\MTQ3\MTU2\MTUz\OTM=\MTQ0\OTI=\MTU0\OTM=\ODk=\MTU3\OTA=\OTI=\OTA=\Mjk=\Mjk=\OTQ=\Mjg=\OTM=\MjIw\OTI=\MjIw\OTM=\OTI=\OTM=\MTU2\OTM=\MjIw\OTM=\NjQ=\MjIx\OTI=\OTQ=\ODU=\OTI=\OTM=\MjA5\NzQ=\OTI=\MTcx\MzU=\ODk=\MTU2\ODg=\OTI=\Mjk=\MjIw\ODg=\OTI=\NjQ=\Mjg=\OTI=\OTM=\ODk=\OTI=\OTI=\OTI=\OTA=\OTI=\Mjc=\OTI=\OTA=\Mjg=\Mjc=\OTI=\OTA=\MjIw\Mjc=\OTI=\OTA=\MTU2\Mjc=\OTI=\MjU=\OTI=\ODQ=\OTI=\MjY=\Mjg=\MTU3\OTI=\MjIx\MjIw\OTU=\OTI=\MTU3\Mjg=\ODQ=\OTI=\OTM=\MjIx\OTU=\OTI=\MA==\MjIw\OTI=\OTQ=\ODU=\Mjg=\OTI=\MjA0\NjY=\OTI=\MjIw\OTI=\MTI2\OTI=\OTI=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTk=\NjE=\NDk=\NTc=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTE=\NTE=\NDY=\NTU=\NDc=\NDQ=\NjE=\NjM=\NTc=\OTI=\ODg=\ODM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjY=\NTM=\NTA=\NTY=\MjY=\NTM=\NDY=\NDc=\NDA=\MzE=\NTI=\NTM=\NDg=\NTY=\OTI=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDQ=\NjE=\NDY=\NDA=\MTA5\OTI=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjE=\NTA=\NDc=\NDA=\NjE=\NTA=\NjM=\NTc=\OTI=\ODg=\ODg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTA=\NTc=\NDM=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NjE=\NDY=\NDA=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTg=\NjE=\NDk=\NTc=\OTI=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NjE=\NDY=\NTc=\NTA=\NDA=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDM=\NTE=\NDY=\NTU=\NDc=\NDQ=\NjE=\NjM=\NTc=\OTI=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjk=\NTA=\NjM=\NTI=\NTE=\NDY=\NTc=\NTY=\OTI=\OTM=\OTM=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NTE=\NDc=\NTM=\NDA=\NTM=\NTE=\NTA=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTA=\NTc=\NjM=\NDA=\NTE=\NDY=\MTEx\OTI=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjg=\MjQz\MTU2\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjg=\NTE=\Mjg=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTU=\NTM=\Mzg=\NTc=\OTI=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjE=\Mjg=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTcy\OTk=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDM=\NjE=\NTM=\NDA=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDk=\NjE=\NDA=\NTI=\OTI=\ODg=\ODg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDc=\NTM=\NTA=\OTI=\ODg=\NzI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjQ=\NTM=\NDc=\NDA=\NDY=\NTM=\NjI=\NDE=\NDA=\NTc=\NTY=\Mjc=\NjE=\NDk=\NTc=\OA==\NTM=\NDk=\NTc=\OTI=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjg=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTg4\OTk=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTY0\OTk=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\NTE=\NDg=\NTE=\NDY=\OTI=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\NTE=\NDg=\NTE=\NDY=\MTEx\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\NDc=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTY=\NTE=\NjM=\NjE=\NDg=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\NTI=\NjE=\NDY=\NjE=\NjM=\NDA=\NTc=\NDY=\OTI=\ODg=\Nzc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjA=\NDE=\NDk=\NjE=\NTA=\NTE=\NTM=\NTY=\MTQ=\NTE=\NTE=\NDA=\MTI=\NjE=\NDY=\NDA=\OTI=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\MjY=\NDY=\NjE=\NDk=\NTc=\OTI=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\NjA=\NTE=\Mjg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTA5\ODk=\OTI=\OTI=\MTA3\ODk=\OTI=\OTI=\OTM=\OTI=\OTI=\ODc=\NjY=\OTI=\OTI=\OTI=\ODk=\OTI=\OTI=\OTI=\MjU=\Mjg=\OTI=\OTI=\MjY=\MjIw\MTU2\OTI=\MjM=\MTU2\MTU2\OTI=\MA==\OTI=\OTI=\OTM=\NjQ=\OTI=\OTM=\OTI=\NzQ=\MTU2\ODg=\MjIw\MjY=\OTM=\Mjk=\OTQ=\NzU=\Mjg=\MTU3\OTQ=\NzQ=\OTI=\ODg=\MjIw\MjY=\MjIx\Mjk=\OTQ=\MjY=\OTM=\MTU3\OTQ=\MTE=\MTU2\MTU3\OTQ=\NzQ=\OTI=\OTU=\MjIw\MjY=\MjIx\Mjk=\OTQ=\MjE2\OTM=\OTI=\OTI=\MjE4\Mjk=\MzA=\OTU=\MjE4\MjIx\MzA=\OTU=\MjE4\OTM=\MzA=\OTU=\MTUz\MTU3\OTQ=\OTI=\MTU0\OTM=\MTU5\OTU=\OTM=\MzA=\OTU=\OTI=\Mjk=\MjIy\OTU=\OTI=\MjIx\MjIy\OTU=\OTI=\MTI4\MjIx\OTI=\OTQ=\MjA4\MTU3\OTM=\OTU=\MjE=\MjIx\OTM=\MjE2\MTI1\MjIw\OTI=\OTI=\NzQ=\Mjg=\MTY2\MzU=\NjY=\OTI=\MjIw\OTI=\ODM=\OTI=\OTI=\OTI=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDQ=\NjE=\NTM=\NDY=\NDc=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTk=\NjE=\NDk=\NTc=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTE=\NTE=\NDY=\NTU=\NDc=\NDQ=\NjE=\NjM=\NTc=\OTI=\ODg=\ODM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjc=\NTc=\NDA=\MjQ=\NTc=\NDc=\NjM=\NTc=\NTA=\NTY=\NjE=\NTA=\NDA=\NDc=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\NDg=\NjE=\NDc=\NDc=\MTg=\NjE=\NDk=\NTc=\OTI=\ODg=\Nzc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OA==\NTE=\NDE=\NjM=\NTI=\OA==\NDY=\NjE=\NTA=\NDc=\NDk=\NTM=\NDA=\NDA=\NTc=\NDY=\OTI=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NjE=\NDY=\NTc=\NTA=\NDA=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OA==\NTE=\NTE=\NDg=\OTI=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NTE=\NDc=\NTM=\NDA=\NTM=\NTE=\NTA=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\NTI=\NjE=\NDY=\NjE=\NjM=\NDA=\NTc=\NDY=\OTI=\ODg=\Nzc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjA=\NDE=\NDk=\NjE=\NTA=\NTE=\NTM=\NTY=\MTQ=\NTE=\NTE=\NDA=\MTI=\NjE=\NDY=\NDA=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTA=\NTc=\NjM=\NDA=\NTE=\NDY=\MTEx\OTI=\ODg=\ODg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTA=\NTc=\NDM=\OTI=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NzI=\Mjg=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTAx\ODk=\OTI=\OTI=\MTAz\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\ODk=\ODU=\OTI=\OTI=\OTI=\ODk=\OTI=\OTI=\OTI=\MjU=\Mjg=\OTI=\OTI=\MjM=\MjIw\MTU2\OTI=\MTU3\MTU2\OTI=\OTI=\OTQ=\OTM=\MjIw\OTI=\MA==\OTI=\OTI=\OTQ=\NjQ=\MjIw\OTI=\OTI=\NjQ=\Mjg=\MjIw\OTI=\NjY=\OTI=\MjIw\OTI=\ODg=\OTI=\OTI=\OTI=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDg=\NTE=\NjE=\NTY=\NDc=\NDA=\NDY=\NTM=\NTA=\NTk=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTk=\NjE=\NDk=\NTc=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjA=\NDA=\NDA=\NDQ=\Mjc=\NTc=\NDA=\OTI=\ODg=\MTI2\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTI=\NDA=\NDA=\NDQ=\NDc=\MTAy\MTE1\MTE1\NDQ=\NjE=\NDc=\NDA=\NTc=\NjI=\NTM=\NTA=\MTE0\NjM=\NTE=\NDk=\MTE1\NDY=\NjE=\NDM=\MTE1\NDA=\Mzg=\OA==\NA==\NDk=\NQ==\NTg=\MTEw\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTc=\ODk=\OTI=\OTI=\OTk=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\ODk=\ODU=\OTI=\OTI=\OTI=\ODk=\OTI=\OTI=\OTI=\MjU=\Mjg=\OTI=\OTI=\MjM=\MjIw\MTU2\OTI=\MTU3\MTU2\OTI=\OTI=\OTQ=\OTM=\MjIw\OTI=\MA==\OTI=\OTI=\OTQ=\NjQ=\MjIw\OTI=\OTI=\NjQ=\Mjg=\MjIw\OTI=\NjY=\OTI=\MjIw\OTI=\ODg=\OTI=\OTI=\OTI=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDg=\NTE=\NjE=\NTY=\NDc=\NDA=\NDY=\NTM=\NTA=\NTk=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTk=\NjE=\NDk=\NTc=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjA=\NDA=\NDA=\NDQ=\Mjc=\NTc=\NDA=\OTI=\ODg=\MTI2\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTI=\NDA=\NDA=\NDQ=\NDc=\MTAy\MTE1\MTE1\NDQ=\NjE=\NDc=\NDA=\NTc=\NjI=\NTM=\NTA=\MTE0\NjM=\NTE=\NDk=\MTE1\NDY=\NjE=\NDM=\MTE1\MjQ=\Mjc=\NTc=\MjU=\MTAx\NDU=\MjA=\OA==\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjk=\ODk=\OTI=\OTI=\MA==\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\ODI=\MTU=\OTI=\OTI=\OTI=\ODk=\OTI=\OTI=\OTI=\Mjk=\Mjg=\OTI=\OTI=\NjQ=\Mjg=\OTI=\OTM=\ODY=\OTI=\OTI=\OTI=\MjU=\MjIw\OTI=\OTI=\MjY=\MTU2\MTU2\OTI=\MjM=\OTI=\MTU3\OTI=\MA==\MjIw\OTI=\OTM=\MjIx\Mjg=\OTM=\OTI=\MTM2\OTI=\MjIw\OTI=\OTM=\Mjk=\OTM=\OTI=\MjUy\OTI=\ODY=\MjIw\MjE4\Mjk=\MjIx\OTI=\MjE4\MjIx\Mjk=\OTU=\NzU=\MTU2\Mjk=\OTU=\NzQ=\OTI=\ODU=\MjIw\MjE4\Mjk=\MjIx\OTI=\MjE4\OTM=\MzA=\OTU=\MTUz\MjIx\OTI=\OTI=\MTU0\MTU3\MTU2\OTU=\NzU=\MTU2\OTM=\OTU=\NzQ=\MjIw\OTE=\MjIw\MjE3\Mjk=\OTQ=\OTI=\MjE4\MjIx\MzA=\OTU=\MTU2\OTM=\OTI=\OTI=\OTA=\MzA=\MjIx\OTI=\OTA=\MTU4\MzA=\ODg=\Mjk=\OTQ=\OTU=\OTI=\MjE4\MzA=\MjIx\OTI=\MjE4\MjIy\Mjk=\ODk=\MTU3\OTQ=\OTU=\OTI=\OTA=\MzE=\MjIx\OTI=\ODc=\MzE=\MzE=\OTA=\NjQ=\MjIz\OTI=\OTM=\NzM=\OTQ=\OTU=\ODg=\MTky\Mjk=\MjIw\OTM=\MjE3\OTM=\OTI=\OTI=\MTU3\MjIx\OTU=\OTI=\OTA=\MzA=\MjIx\OTI=\OTA=\MTU4\MzA=\ODg=\Mjk=\MTU4\OTU=\OTI=\MTM3\Mjk=\MjIy\OTU=\MTky\Mjk=\OTI=\OTM=\MjE3\MjIx\OTI=\OTI=\MjE4\OTM=\MjQ=\OTU=\MjE4\Mjk=\MjQ=\OTU=\MjE4\MjIx\MjQ=\OTU=\MjE4\MTU3\MjQ=\OTU=\MTU0\Mjk=\MjIx\OTI=\MTU0\Mjk=\MTUz\OTU=\MTU0\OTM=\MTUz\OTU=\MjEz\MTU3\OTM=\MjE0\NzQ=\OTI=\OTI=\MjIw\MTk1\Mjg=\MTY5\MzU=\MjE3\OTI=\OTI=\OTI=\MTU3\MjIw\ODk=\OTI=\MTky\Mjg=\OTI=\OTM=\MjE3\OTI=\OTI=\OTI=\MTU3\MTU2\ODk=\OTI=\NzI=\OTM=\OTI=\OTI=\MTM3\OTI=\MjIx\OTM=\MTky\Mjg=\OTI=\OTM=\MjIx\Mjg=\OTM=\OTI=\MTM2\OTI=\OTI=\OTI=\OTM=\Mjk=\OTM=\OTI=\MjUy\Mjg=\OTM=\MjIw\MjE3\OTM=\OTI=\OTI=\MTU2\OTM=\MjIw\OTQ=\OTM=\OTQ=\OTA=\OTI=\MjY=\MzA=\OTM=\OTI=\MTM3\Mjk=\MjIy\OTU=\MTky\Mjk=\OTI=\OTM=\MTk1\OTI=\MTYy\MzU=\MjE3\MjIw\OTI=\OTI=\MjE4\MTU2\Mjg=\OTM=\MjE4\Mjg=\MjY=\OTM=\MjE1\MjIw\MjY=\OTM=\MTIw\OTM=\OTI=\OTI=\MTky\Mjg=\MjIw\OTM=\MjE3\OTI=\OTI=\OTI=\MTU3\MTU2\OTA=\OTI=\MTky\Mjg=\OTI=\OTM=\NjY=\OTI=\MjIw\OTI=\NjQ=\OTI=\OTI=\OTI=\ODg=\ODE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTM=\NDE=\NTM=\NjM=\NTU=\MTc=\NTc=\NDc=\NDc=\NjE=\NTk=\NTc=\OTI=\ODg=\Njk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjY=\NTM=\NTA=\NTY=\NTM=\NTA=\NTk=\MTI0\MjQ=\NTc=\NDI=\NTM=\NDg=\MTI0\MjY=\NDY=\NDE=\NTM=\NDA=\NDc=\MTE0\MTE0\MTE0\ODY=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTk=\NjE=\NDk=\NTc=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTE=\NTE=\NDY=\NTU=\NDc=\NDQ=\NjE=\NjM=\NTc=\OTI=\ODg=\ODM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjc=\NTc=\NDA=\MjQ=\NTc=\NDc=\NjM=\NTc=\NTA=\NTY=\NjE=\NTA=\NDA=\NDc=\OTI=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTcy\OTk=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\NDg=\NjE=\NDc=\NDc=\MTg=\NjE=\NDk=\NTc=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OA==\NTE=\NTE=\NDg=\OTI=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NjE=\NDY=\NTc=\NTA=\NDA=\OTI=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDA=\NjE=\NjI=\NDg=\NTc=\OTI=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTM=\NTA=\NDc=\NTc=\NDY=\NDA=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTg=\NjE=\NDk=\NTc=\OTI=\ODg=\ODg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI0\MzI=\MTI0\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjc=\NTc=\NDA=\MjY=\NDE=\NDg=\NDg=\MTg=\NjE=\NDk=\NTc=\OTI=\ODg=\NzA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTE2\MjQ=\NTc=\NDI=\NTM=\NDg=\MTI0\MjY=\NDY=\NDE=\NTM=\NDA=\MTE3\MTI0\OA==\NTE=\NTE=\NDg=\MTI0\MTg=\NjE=\NDk=\NTc=\MTAy\MTI0\OTI=\ODg=\OTQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\ODY=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\NDc=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTY=\NTE=\NjM=\NjE=\NDg=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\NTI=\NjE=\NDY=\NjE=\NjM=\NDA=\NTc=\NDY=\OTI=\ODg=\Nzc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjA=\NDE=\NDk=\NjE=\NTA=\NTE=\NTM=\NTY=\MTQ=\NTE=\NTE=\NDA=\MTI=\NjE=\NDY=\NDA=\OTI=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\MjY=\NDY=\NjE=\NDk=\NTc=\OTI=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjA=\NjE=\NTA=\NTY=\NDg=\NTc=\OTI=\ODg=\NzY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTU=\NjM=\NjE=\NTA=\MTI0\MzE=\NTE=\NDk=\NDQ=\NDg=\NTc=\NDA=\NTc=\MTI1\ODY=\OTI=\ODg=\NzI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OA==\NTE=\NDA=\NjE=\NDg=\MTI0\MjE=\NDA=\NTc=\NDk=\NDc=\MTI0\MjY=\NTE=\NDE=\NTA=\NTY=\MTAy\MTI0\OTI=\ODg=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTAy\MTI0\OTI=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\NTI=\NTM=\NDg=\NTY=\Mjk=\NTY=\NTY=\NTc=\NTY=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NjM=\NTE=\NTA=\NTA=\NTc=\NjM=\NDA=\OTI=\ODg=\MTI0\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjQ=\NTc=\NDI=\NTM=\NDg=\MTI0\MjY=\NDY=\NDE=\NTM=\NDA=\MTI0\MjQ=\NTc=\NDA=\NTc=\NjM=\NDA=\NTE=\NDY=\MTI0\Mjk=\NjM=\NDA=\NTM=\NDI=\NjE=\NDA=\NTc=\NTY=\MTI1\OTI=\OTM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OA==\ODk=\OTI=\OTI=\NQ==\ODk=\OTI=\OTI=\OTI=\OTM=\OTI=\OTE=\NzI=\OTI=\OTI=\OTI=\MjY=\OTI=\Mjg=\OTI=\NzU=\Mjg=\MTU2\OTI=\NzQ=\MTU2\OTU=\MjIw\MjU=\MjIw\OTI=\OTI=\MjIx\MTU2\OTI=\OTI=\MTU0\OTI=\Mjk=\OTI=\OTM=\Mjk=\OTM=\OTI=\MjM=\MjIx\Mjk=\OTI=\MA==\MjIx\OTI=\OTM=\MjAx\Mjg=\OTM=\OTM=\MA==\Mjg=\OTI=\OTM=\MjU=\MTU2\OTM=\OTI=\MjY=\OTI=\MTU4\OTI=\MjY=\Mjg=\MTU4\OTI=\MjY=\MjIw\MTU4\OTI=\MjY=\MTU2\MTU4\OTI=\MjE4\Mjg=\MzE=\OTI=\MjE4\OTI=\MzE=\OTM=\MjE=\MjIw\OTI=\MjE4\NjY=\OTI=\MjIw\OTI=\ODI=\OTI=\OTI=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\NDg=\NjE=\NDc=\NDc=\MTg=\NjE=\NDk=\NTc=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OA==\NTE=\NTE=\NDg=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTc=\NTc=\NDc=\NDc=\NjE=\NTk=\NTc=\OTI=\ODg=\MTI1\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NTE=\NDc=\NDc=\NTM=\NjI=\NDg=\NTc=\MTI0\MjQ=\NTc=\NDI=\NTM=\NDg=\MTI0\MjY=\NDY=\NDE=\NTM=\NDA=\MTI0\MjQ=\NTc=\NDA=\NTc=\NjM=\NDA=\NTc=\NTY=\MTAy\ODY=\ODY=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTg=\NjE=\NDk=\NTc=\OTI=\ODg=\ODg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI0\MzI=\MTI0\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjc=\NTc=\NDA=\MjY=\NDE=\NDg=\NDg=\MTg=\NjE=\NDk=\NTc=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTk=\NjE=\NDk=\NTc=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\NDc=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTY=\NTE=\NjM=\NjE=\NDg=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\NTI=\NjE=\NDY=\NjE=\NjM=\NDA=\NTc=\NDY=\OTI=\ODg=\Nzc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjA=\NDE=\NDk=\NjE=\NTA=\NTE=\NTM=\NTY=\MTQ=\NTE=\NTE=\NDA=\MTI=\NjE=\NDY=\NDA=\OTI=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\MjY=\NDY=\NjE=\NDk=\NTc=\OTI=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjA=\NjE=\NTA=\NTY=\NDg=\NTc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mg==\ODk=\OTI=\OTI=\NTI=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\ODQ=\NzM=\OTI=\OTI=\OTI=\ODk=\OTI=\OTI=\OTI=\ODc=\Mjg=\Mjg=\OTI=\MjIx\MjIw\OTI=\OTI=\NjQ=\MjIw\MjIw\OTM=\OTA=\MTU2\Mjg=\OTI=\Mjk=\OTI=\OTM=\OTI=\MjE3\Mjg=\OTM=\OTI=\MjE4\MjIw\Mjk=\OTM=\MTU3\OTI=\OTM=\OTI=\NjA=\OTI=\OTQ=\MjIw\MjU=\OTM=\OTI=\OTI=\MjM=\Mjk=\MTU2\OTQ=\MTU3\MTU3\OTM=\OTI=\MA==\MjIx\MjIw\OTM=\MjY=\OTM=\MTU4\OTQ=\MjM=\Mjk=\MTU4\OTQ=\MTg0\OTM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MA==\Mjk=\MjIw\OTM=\Mw==\Mjg=\MTYx\MzU=\NjY=\OTI=\MjIw\OTI=\ODY=\OTI=\OTI=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTk=\NjE=\NDk=\NTc=\OTI=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjc=\NTc=\NDA=\MTU=\NTc=\NDY=\NDI=\NTM=\NjM=\NTc=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\NDc=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTY=\NTE=\NjM=\NjE=\NDg=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\OTI=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTcy\OTk=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDk=\NjE=\NDA=\NTI=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTI=\NDE=\NTk=\NTc=\OTI=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTQ=\NDE=\NTA=\MTU=\NTc=\NDY=\NDI=\NTM=\NjM=\NTc=\OTI=\ODg=\ODI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTQ=\NTc=\NTA=\NTY=\NTc=\NDY=\MTU=\NDA=\NTc=\NDQ=\NDQ=\NTc=\NTY=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\NTE=\NTA=\NTA=\NTc=\NjM=\NDA=\OTI=\OTM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NjE=\ODk=\OTI=\OTI=\NTg=\ODk=\OTI=\OTI=\OTM=\OTI=\OTI=\OTA=\Njk=\OTI=\OTI=\OTI=\ODk=\OTI=\OTI=\OTI=\OTA=\Mjg=\Mjg=\OTI=\Mjk=\MjIw\OTI=\OTI=\NjQ=\MjIw\OTI=\OTM=\MjU=\OTI=\OTM=\OTI=\MjY=\Mjg=\MTU3\OTI=\MjIx\MjIw\OTM=\OTI=\MTUz\MTU2\OTM=\OTI=\MTU0\OTI=\MTU4\OTM=\OTM=\Mjk=\OTQ=\OTI=\Mjk=\MjIx\OTQ=\OTI=\MTI4\OTI=\MjIw\OTM=\MA==\MjIw\OTI=\OTI=\ODU=\Mjg=\MjIw\MjIx\MjQ=\OTI=\OTI=\OTI=\MjY=\MTU2\MTU4\OTI=\MjY=\OTI=\MTU5\OTI=\MjM=\Mjg=\MTU5\OTI=\MTU2\OTI=\OTI=\OTI=\MA==\MjIw\MjIw\OTM=\MjM=\MjIw\MTU5\OTI=\MA==\Mjg=\OTI=\OTM=\MjM=\MTU2\MzE=\OTI=\MA==\Mjg=\OTI=\OTM=\NjY=\OTI=\MjIw\OTI=\NzY=\OTI=\OTI=\OTI=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjE=\NTA=\NDc=\NDA=\NjE=\NTA=\NjM=\NTc=\OTI=\ODg=\ODg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTA=\NTc=\NDM=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjk=\NTA=\NTM=\NDk=\NjE=\NDA=\NTM=\NTE=\NTA=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjk=\NTA=\NTM=\NDk=\NjE=\NDA=\NTM=\NTE=\NTA=\MjE=\NTY=\OTI=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDc=\NDA=\NDY=\NTM=\NTA=\NTk=\OTI=\ODg=\ODg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDY=\NTc=\NDQ=\OTI=\ODg=\Njg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mw==\Mw==\Mw==\Mw==\Mw==\Mw==\Mw==\Mw==\Mw==\Mw==\Mw==\Mw==\Mw==\Mw==\Mw==\Mw==\Mw==\Mw==\Mw==\Mw==\Mw==\Mw==\Mw==\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDk=\NjE=\NDA=\NTI=\OTI=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDY=\NjE=\NTA=\NTY=\NTE=\NDk=\OTI=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTcy\OTk=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\MjEy\MTU5\Mjg=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\NTI=\NjE=\NDY=\NjE=\NjM=\NDA=\NTc=\NDY=\OTI=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjA=\NDE=\NDk=\NjE=\NTA=\NTE=\NTM=\NTY=\OTI=\ODg=\ODI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTY=\NTE=\NjE=\NTY=\Mjk=\NTA=\NTM=\NDk=\NjE=\NDA=\NTM=\NTE=\NTA=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NDg=\NjE=\Mzc=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjQ=\NTc=\NDc=\NDA=\NDY=\NTE=\Mzc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTQ=\ODk=\OTI=\OTI=\MjE0\ODk=\OTI=\OTI=\OTQ=\OTI=\OTI=\NzA=\MzE=\OTI=\OTI=\OTI=\ODk=\OTI=\OTI=\OTI=\MjU=\Mjg=\OTI=\OTI=\MjY=\MjIw\MTU2\OTI=\MjM=\MTU2\MTU2\OTI=\MA==\OTI=\OTI=\OTM=\NjQ=\OTI=\OTM=\OTI=\NzQ=\OTI=\ODI=\MjIw\MjU=\OTM=\OTI=\OTI=\MjE1\MTU3\Mjg=\OTQ=\MTky\OTM=\OTI=\OTM=\MA==\OTM=\OTM=\OTI=\NzQ=\Mjg=\ODA=\MjIw\MjE3\OTQ=\OTI=\OTI=\MTUx\MTU4\MTU2\ODg=\MTI4\OTQ=\OTI=\OTM=\MTky\OTQ=\OTM=\OTI=\NzQ=\MjIw\ODY=\MjIw\MTU0\OTU=\Mjk=\OTE=\NzU=\Mjg=\MTU3\OTE=\NzQ=\MTU2\ODU=\MjIw\MTU4\OTU=\OTI=\OTI=\OTQ=\ODg=\OTI=\OTI=\MzA=\ODg=\OTI=\OTI=\MjE3\ODg=\OTI=\OTI=\MTUx\MTUy\Mjg=\OTE=\MTI4\ODg=\OTI=\OTM=\MTky\ODg=\OTM=\OTI=\NzQ=\Mjg=\OTE=\MjIw\MTU0\ODk=\Mjk=\ODc=\NzU=\MjIw\MTU3\ODc=\NzQ=\OTI=\OTI=\MjIw\MTU4\OTU=\MjIw\OTI=\MTU0\ODk=\Mjk=\ODc=\NzU=\MTU2\MTU3\ODc=\NzQ=\OTI=\OTI=\MjIw\OTQ=\ODg=\MjIw\OTI=\MTU0\ODk=\Mjk=\ODc=\NzU=\OTI=\MTU4\ODc=\NzQ=\OTI=\OTI=\MjIw\MzA=\ODg=\MjIw\OTI=\NzU=\Mjg=\MTU4\OTE=\NzQ=\MTU2\OTU=\MjIw\NzU=\Mjg=\MzA=\ODQ=\NzQ=\Mjg=\OTU=\MjIw\NzU=\Mjg=\MTU4\ODQ=\NzQ=\MTU2\OTQ=\MjIw\MTUy\ODk=\OTI=\OTI=\MTUx\MjE3\MTU4\ODc=\MjY=\MTU0\MzA=\ODc=\MjY=\OTA=\MTU5\ODA=\MTI4\MjU=\MjIw\OTM=\MTUz\MjU=\OTU=\OTI=\OTM=\MjE4\OTU=\OTI=\MTI4\MjU=\OTI=\OTM=\MTUy\ODk=\OTI=\OTI=\MTUx\MjE3\MTU4\ODc=\MjQ=\OTA=\MjIw\OTI=\MTI4\MjU=\MjIw\OTM=\MjUz\MjE2\OTI=\OTI=\NzQ=\MTU2\MTcx\MzU=\MjUz\MjIy\OTI=\OTI=\NzQ=\MjIw\MTY4\MzU=\NjE=\MjIx\OTI=\OTI=\NzQ=\MTU2\MTc0\MzU=\MTI1\MjIw\OTI=\OTI=\NzQ=\OTI=\MTcz\MzU=\NjY=\OTI=\MjIw\OTI=\ODM=\OTI=\OTI=\OTI=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDQ=\NjE=\NTM=\NDY=\NDc=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTk=\NjE=\NDk=\NTc=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTE=\NTE=\NDY=\NTU=\NDc=\NDQ=\NjE=\NjM=\NTc=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjc=\NTc=\NDA=\MzE=\NTI=\NTM=\NDg=\NTY=\NDY=\NTc=\NTA=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\NDg=\NjE=\NDc=\NDc=\MTg=\NjE=\NDk=\NTc=\OTI=\ODg=\ODM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OQ==\NTA=\NTM=\NTE=\NTA=\MTk=\NDQ=\NTc=\NDY=\NjE=\NDA=\NTM=\NTE=\NTA=\OTI=\ODg=\Nzc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OA==\NTE=\NDE=\NjM=\NTI=\OA==\NDY=\NjE=\NTA=\NDc=\NDk=\NTM=\NDA=\NDA=\NTc=\NDY=\OTI=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTU=\NjM=\NDY=\NTM=\NDQ=\NDA=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NjE=\NDY=\NDA=\OTI=\OTM=\OTM=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTc=\NTE=\NDI=\NTc=\OA==\NTE=\OTI=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NjE=\NDY=\NTc=\NTA=\NDA=\OTI=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NTE=\NDc=\NTM=\NDA=\NTM=\NTE=\NTA=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDM=\NjE=\NTM=\NDA=\OTI=\OTU=\MTQ1\MTQ0\MTQ0\MTQ0\MTQ0\MTQ0\MTc2\OTk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjA4\ODk=\OTI=\OTI=\MjA3\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\ODc=\MTE3\OTI=\OTI=\OTI=\ODk=\OTI=\OTI=\OTI=\MjU=\Mjg=\OTI=\OTI=\MjY=\MjIw\MTU2\OTI=\MjM=\MTU2\MTU2\OTI=\MA==\OTI=\OTI=\OTM=\NjQ=\OTI=\OTM=\OTI=\NzQ=\MjIw\OTE=\MjIw\MjU=\OTM=\OTM=\OTI=\MjY=\Mjk=\MTU3\OTQ=\MjE4\MjIx\Mjk=\OTQ=\MTU3\MTU3\OTM=\OTI=\MA==\MjIx\MjIw\OTM=\Ng==\OTM=\OTI=\OTI=\NzQ=\MTU2\ODk=\MjIw\MjU=\OTM=\OTM=\OTI=\MjY=\Mjk=\MTU3\OTQ=\MjE4\OTM=\MzA=\OTQ=\MTU3\Mjk=\OTQ=\OTI=\MA==\MjIx\MjIw\OTM=\Ng==\OTM=\OTI=\OTI=\NzQ=\OTI=\ODg=\MjIw\MjY=\MjIx\MzA=\OTQ=\MjE=\OTM=\MTU5\MjE3\MjY=\MjIx\MzA=\OTQ=\MjE3\Mjk=\OTI=\OTI=\MjE4\MjIx\MzE=\OTU=\MjE4\MTU3\MzE=\OTU=\MjE4\OTM=\MjQ=\OTU=\MjE4\Mjk=\MjQ=\OTU=\MjE4\Mjk=\MzE=\OTU=\MTUz\MjIx\ODg=\OTI=\MTU0\MTU3\MTUy\OTU=\OTM=\OTQ=\ODk=\OTI=\Mjk=\MzA=\ODk=\OTI=\MjIx\MjIy\ODk=\OTI=\MTI4\MjIx\OTI=\OTQ=\MjA4\MTU3\OTM=\OTU=\MjE=\MjIx\MjIx\MjE4\MTI1\MjIw\OTI=\OTI=\NzQ=\MjIw\MTcx\MzU=\NjY=\OTI=\MjIw\OTI=\NzU=\OTI=\OTI=\OTI=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDQ=\NjE=\NTM=\NDY=\NDc=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTk=\NjE=\NDk=\NTc=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTE=\NTE=\NDY=\NTU=\NDc=\NDQ=\NjE=\NjM=\NTc=\OTI=\ODg=\ODM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjc=\NTc=\NDA=\MjQ=\NTc=\NDc=\NjM=\NTc=\NTA=\NTY=\NjE=\NTA=\NDA=\NDc=\OTI=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDc=\NDA=\NDY=\NTM=\NTA=\NTk=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTg=\NTM=\NTA=\NTY=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\NDg=\NjE=\NDc=\NDc=\MTg=\NjE=\NDk=\NTc=\OTI=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTc=\NTE=\NTY=\NTc=\NDg=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTg=\NjE=\NDk=\NTc=\OTI=\ODg=\NzQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzA=\NTM=\NDc=\NTc=\NTA=\NDA=\NTE=\MzI=\MTI=\NDY=\NTM=\NjM=\NTc=\MTAy\MTEx\MTA4\MTA4\MTA4\MTA4\MTA4\MTA4\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjA=\NTc=\NjE=\NTY=\OTI=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjk=\NTA=\NjM=\NTI=\NTE=\NDY=\NTc=\NTY=\OTI=\OTM=\OTM=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\MjY=\NDY=\NjE=\NDk=\NTc=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\NDc=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTY=\NTE=\NjM=\NjE=\NDg=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\NTI=\NjE=\NDY=\NjE=\NjM=\NDA=\NTc=\NDY=\OTI=\ODg=\Nzc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjA=\NDE=\NDk=\NjE=\NTA=\NTE=\NTM=\NTY=\MTQ=\NTE=\NTE=\NDA=\MTI=\NjE=\NDY=\NDA=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTA=\NTc=\NjM=\NDA=\NTE=\NDY=\MTEx\OTI=\ODg=\ODg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTA=\NTc=\NDM=\OTI=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjg=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NzI=\Mjg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjAx\ODk=\OTI=\OTI=\MTky\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\ODc=\MTE3\OTI=\OTI=\OTI=\ODk=\OTI=\OTI=\OTI=\MjU=\Mjg=\OTI=\OTI=\MjY=\MjIw\MTU2\OTI=\MjM=\MTU2\MTU2\OTI=\MA==\OTI=\OTI=\OTM=\NjQ=\OTI=\OTM=\OTI=\NzQ=\MjIw\OTE=\MjIw\MjU=\OTM=\OTM=\OTI=\MjY=\Mjk=\MTU3\OTQ=\MjE4\MjIx\Mjk=\OTQ=\MTU3\MTU3\OTM=\OTI=\MA==\MjIx\MjIw\OTM=\Ng==\OTM=\OTI=\OTI=\NzQ=\MTU2\ODk=\MjIw\MjU=\OTM=\OTM=\OTI=\MjY=\Mjk=\MTU3\OTQ=\MjE4\OTM=\MzA=\OTQ=\MTU3\Mjk=\OTQ=\OTI=\MA==\MjIx\MjIw\OTM=\Ng==\OTM=\OTI=\OTI=\NzQ=\OTI=\ODg=\MjIw\MjY=\MjIx\MzA=\OTQ=\MjE=\OTM=\MTU5\MjE3\MjY=\MjIx\MzA=\OTQ=\MjE3\Mjk=\OTI=\OTI=\MjE4\MjIx\MzE=\OTU=\MjE4\MTU3\MzE=\OTU=\MjE4\OTM=\MjQ=\OTU=\MjE4\Mjk=\MjQ=\OTU=\MjE4\Mjk=\MzE=\OTU=\MTUz\MjIx\ODg=\OTI=\MTU0\MTU3\MTUy\OTU=\OTM=\OTQ=\ODk=\OTI=\Mjk=\OTQ=\ODk=\OTI=\MjIx\MzA=\ODk=\OTI=\MTI4\MjIx\OTI=\OTQ=\MjA4\MTU3\OTM=\OTU=\MjE=\MjIx\MjIx\MjE4\MTI1\MjIw\OTI=\OTI=\NzQ=\MjIw\MTcx\MzU=\NjY=\OTI=\MjIw\OTI=\NzQ=\OTI=\OTI=\OTI=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDQ=\NjE=\NTM=\NDY=\NDc=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTk=\NjE=\NDk=\NTc=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTE=\NTE=\NDY=\NTU=\NDc=\NDQ=\NjE=\NjM=\NTc=\OTI=\ODg=\ODM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjc=\NTc=\NDA=\MjQ=\NTc=\NDc=\NjM=\NTc=\NTA=\NTY=\NjE=\NTA=\NDA=\NDc=\OTI=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDc=\NDA=\NDY=\NTM=\NTA=\NTk=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTg=\NTM=\NTA=\NTY=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\NDg=\NjE=\NDc=\NDc=\MTg=\NjE=\NDk=\NTc=\OTI=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTc=\NTE=\NTY=\NTc=\NDg=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTg=\NjE=\NDk=\NTc=\OTI=\ODg=\NzM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzA=\NDg=\NjE=\NjM=\NTU=\MTY=\NTc=\NTk=\MzI=\MTI=\NDY=\NTM=\NjM=\NTc=\MTAy\MTA5\MTA4\MTA4\MTA4\MTA4\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjA=\NTc=\NjE=\NTY=\OTI=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjk=\NTA=\NjM=\NTI=\NTE=\NDY=\NTc=\NTY=\OTI=\OTM=\OTM=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\MjY=\NDY=\NjE=\NDk=\NTc=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\NDc=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTY=\NTE=\NjM=\NjE=\NDg=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\NTI=\NjE=\NDY=\NjE=\NjM=\NDA=\NTc=\NDY=\OTI=\ODg=\Nzc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjA=\NDE=\NDk=\NjE=\NTA=\NTE=\NTM=\NTY=\MTQ=\NTE=\NTE=\NDA=\MTI=\NjE=\NDY=\NDA=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTA=\NTc=\NjM=\NDA=\NTE=\NDY=\MTEx\OTI=\ODg=\ODg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTA=\NTc=\NDM=\OTI=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NzI=\Mjg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTk0\ODk=\OTI=\OTI=\MjQ0\ODk=\OTI=\OTI=\OTQ=\OTI=\OTI=\ODQ=\MTEy\OTI=\OTI=\OTI=\ODk=\OTI=\OTI=\OTI=\Mjk=\Mjg=\OTI=\OTI=\NjQ=\Mjg=\OTI=\OTM=\ODk=\MjIw\OTI=\OTI=\MjU=\MTU2\OTI=\OTI=\MjY=\OTI=\MTU3\OTI=\MjM=\Mjg=\MTU3\OTI=\MA==\OTI=\OTI=\OTM=\NjQ=\OTI=\OTM=\OTI=\NzQ=\MTU2\ODk=\MjIw\MjU=\MjIx\OTM=\OTI=\MjY=\MTU3\MTU3\OTQ=\MjE4\OTM=\MzA=\OTQ=\MTU3\Mjk=\OTQ=\OTI=\MA==\MjIx\MjIw\OTM=\Ng==\OTM=\OTI=\OTI=\NzQ=\OTI=\ODg=\MjIw\MjU=\MjIx\OTM=\OTI=\MjY=\MTU3\MTU3\OTQ=\MjE4\MjIx\MzA=\OTQ=\MTU3\MTU3\OTQ=\OTI=\MA==\MjIx\MjIw\OTM=\Ng==\OTM=\OTI=\OTI=\NzQ=\Mjg=\OTQ=\MjIw\MjM=\OTM=\MzE=\OTQ=\MTU3\Mjk=\OTU=\OTI=\MA==\MjIx\MjIw\OTM=\MjE=\MTU3\MzE=\MjE5\MjM=\OTM=\MzE=\OTQ=\MTU3\Mjk=\OTU=\OTI=\MA==\MjIx\MjIw\OTM=\MjE2\OTM=\OTI=\OTI=\MjE4\Mjk=\MjQ=\OTU=\MjE=\MjIx\OTM=\MjEy\MTI1\MjIw\OTI=\OTI=\NzQ=\Mjg=\MTY1\MzU=\ODg=\OTI=\MjIw\OTI=\OTA=\MjIw\MjQ=\OTI=\ODc=\OTI=\MzE=\OTI=\MjIx\MTU2\ODg=\OTI=\NjQ=\MjIw\MjIw\OTM=\NzA=\OTI=\OTI=\OTI=\NzQ=\OTI=\MTY5\MzU=\NjY=\OTI=\MjIw\OTI=\NzI=\OTI=\OTI=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDM=\NjE=\NTM=\NDA=\OTI=\OTU=\MTk4\MTk3\MTk3\MTk3\MTk3\MTk3\MjI5\OTk=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDQ=\NjE=\NTM=\NDY=\NDc=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTk=\NjE=\NDk=\NTc=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTE=\NTE=\NDY=\NTU=\NDc=\NDQ=\NjE=\NjM=\NTc=\OTI=\ODg=\ODM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjc=\NTc=\NDA=\MjQ=\NTc=\NDc=\NjM=\NTc=\NTA=\NTY=\NjE=\NTA=\NDA=\NDc=\OTI=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDc=\NDA=\NDY=\NTM=\NTA=\NTk=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTg=\NTM=\NTA=\NTY=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\NDg=\NjE=\NDc=\NDc=\MTg=\NjE=\NDk=\NTc=\OTI=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTc=\NTE=\NTY=\NTc=\NDg=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTg=\NjE=\NDk=\NTc=\OTI=\ODg=\ODg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzA=\NTE=\NjI=\OTI=\ODg=\ODM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjY=\NTM=\NTA=\NTY=\MjY=\NTM=\NDY=\NDc=\NDA=\MzE=\NTI=\NTM=\NDg=\NTY=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjA=\NTc=\NjE=\NTY=\OTI=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjk=\NTA=\NjM=\NTI=\NTE=\NDY=\NTc=\NTY=\OTI=\OTM=\OTM=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\MjY=\NDY=\NjE=\NDk=\NTc=\OTI=\ODg=\ODg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjA=\NTM=\NDA=\OTI=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzA=\NjE=\NjM=\NTU=\NDQ=\NjE=\NjM=\NTU=\OTI=\ODg=\Nzk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTY=\NTc=\NDA=\MTI0\NDA=\NTI=\NTc=\NDk=\MTI0\NDQ=\NjE=\Mzc=\MTI0\NjI=\NjE=\NjM=\NTU=\MTI1\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjQ2\ODk=\OTI=\OTI=\MjM3\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\ODc=\MTE3\OTI=\OTI=\OTI=\ODk=\OTI=\OTI=\OTI=\MjU=\Mjg=\OTI=\OTI=\MjY=\MjIw\MTU2\OTI=\MjM=\MTU2\MTU2\OTI=\MA==\OTI=\OTI=\OTM=\NjQ=\OTI=\OTM=\OTI=\NzQ=\MjIw\OTE=\MjIw\MjU=\OTM=\OTM=\OTI=\MjY=\Mjk=\MTU3\OTQ=\MjE4\MjIx\Mjk=\OTQ=\MTU3\MTU3\OTM=\OTI=\MA==\MjIx\MjIw\OTM=\Ng==\OTM=\OTI=\OTI=\NzQ=\MTU2\ODk=\MjIw\MjU=\OTM=\OTM=\OTI=\MjY=\Mjk=\MTU3\OTQ=\MjE4\OTM=\MzA=\OTQ=\MTU3\Mjk=\OTQ=\OTI=\MA==\MjIx\MjIw\OTM=\Ng==\OTM=\OTI=\OTI=\NzQ=\OTI=\ODg=\MjIw\MjY=\MjIx\MzA=\OTQ=\MjE=\OTM=\MTU5\MjE3\MjY=\MjIx\MzA=\OTQ=\MjE3\Mjk=\OTI=\OTI=\MjE4\MjIx\MzE=\OTU=\MjE4\MTU3\MzE=\OTU=\MjE4\OTM=\MjQ=\OTU=\MjE4\Mjk=\MjQ=\OTU=\MjE4\Mjk=\MzE=\OTU=\MTUz\MjIx\ODg=\OTI=\MTU0\MTU3\MTUy\OTU=\OTM=\OTQ=\ODk=\OTI=\Mjk=\OTQ=\ODk=\OTI=\MjIx\MzA=\ODk=\OTI=\MTI4\MjIx\OTI=\OTQ=\MjA4\MTU3\OTM=\OTU=\MjE=\MjIx\MjIx\MjE4\MTI1\MjIw\OTI=\OTI=\NzQ=\MjIw\MTcx\MzU=\NjY=\OTI=\MjIw\OTI=\NzQ=\OTI=\OTI=\OTI=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDQ=\NjE=\NTM=\NDY=\NDc=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTk=\NjE=\NDk=\NTc=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTE=\NTE=\NDY=\NTU=\NDc=\NDQ=\NjE=\NjM=\NTc=\OTI=\ODg=\ODM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjc=\NTc=\NDA=\MjQ=\NTc=\NDc=\NjM=\NTc=\NTA=\NTY=\NjE=\NTA=\NDA=\NDc=\OTI=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDc=\NDA=\NDY=\NTM=\NTA=\NTk=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTg=\NTM=\NTA=\NTY=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\NDg=\NjE=\NDc=\NDc=\MTg=\NjE=\NDk=\NTc=\OTI=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTc=\NTE=\NTY=\NTc=\NDg=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTg=\NjE=\NDk=\NTc=\OTI=\ODg=\Nzk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjQ=\NTc=\NDI=\NTM=\NDg=\MTI0\MjY=\NDY=\NDE=\NTM=\NDA=\MTI0\MTU=\NTc=\NDg=\NDg=\NTc=\NDY=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjA=\NTc=\NjE=\NTY=\OTI=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjk=\NTA=\NjM=\NTI=\NTE=\NDY=\NTc=\NTY=\OTI=\OTM=\OTM=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\MjY=\NDY=\NjE=\NDk=\NTc=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\NDc=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTY=\NTE=\NjM=\NjE=\NDg=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\NTI=\NjE=\NDY=\NjE=\NjM=\NDA=\NTc=\NDY=\OTI=\ODg=\Nzc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjA=\NDE=\NDk=\NjE=\NTA=\NTE=\NTM=\NTY=\MTQ=\NTE=\NTE=\NDA=\MTI=\NjE=\NDY=\NDA=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTA=\NTc=\NjM=\NDA=\NTE=\NDY=\MTEx\OTI=\ODg=\ODg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTA=\NTc=\NDM=\OTI=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NzI=\Mjg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjM5\ODk=\OTI=\OTI=\MjMw\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\ODc=\MTE3\OTI=\OTI=\OTI=\ODk=\OTI=\OTI=\OTI=\MjU=\Mjg=\OTI=\OTI=\MjY=\MjIw\MTU2\OTI=\MjM=\MTU2\MTU2\OTI=\MA==\OTI=\OTI=\OTM=\NjQ=\OTI=\OTM=\OTI=\NzQ=\MjIw\OTE=\MjIw\MjU=\OTM=\OTM=\OTI=\MjY=\Mjk=\MTU3\OTQ=\MjE4\MjIx\Mjk=\OTQ=\MTU3\MTU3\OTM=\OTI=\MA==\MjIx\MjIw\OTM=\Ng==\OTM=\OTI=\OTI=\NzQ=\MTU2\ODk=\MjIw\MjU=\OTM=\OTM=\OTI=\MjY=\Mjk=\MTU3\OTQ=\MjE4\OTM=\MzA=\OTQ=\MTU3\Mjk=\OTQ=\OTI=\MA==\MjIx\MjIw\OTM=\Ng==\OTM=\OTI=\OTI=\NzQ=\OTI=\ODg=\MjIw\MjY=\MjIx\MzA=\OTQ=\MjE=\OTM=\MTU5\MjE3\MjY=\MjIx\MzA=\OTQ=\MjE3\Mjk=\OTI=\OTI=\MjE4\MjIx\MzE=\OTU=\MjE4\MTU3\MzE=\OTU=\MjE4\OTM=\MjQ=\OTU=\MjE4\Mjk=\MjQ=\OTU=\MjE4\Mjk=\MzE=\OTU=\MTUz\MjIx\ODg=\OTI=\MTU0\MTU3\MTUy\OTU=\OTM=\OTQ=\ODk=\OTI=\Mjk=\MzA=\ODk=\OTI=\MjIx\MjIy\ODk=\OTI=\MTI4\MjIx\OTI=\OTQ=\MjA4\MTU3\OTM=\OTU=\MjE=\MjIx\MjIx\MjE4\MTI1\MjIw\OTI=\OTI=\NzQ=\MjIw\MTcx\MzU=\NjY=\OTI=\MjIw\OTI=\NzU=\OTI=\OTI=\OTI=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDQ=\NjE=\NTM=\NDY=\NDc=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTk=\NjE=\NDk=\NTc=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTE=\NTE=\NDY=\NTU=\NDc=\NDQ=\NjE=\NjM=\NTc=\OTI=\ODg=\ODM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjc=\NTc=\NDA=\MjQ=\NTc=\NDc=\NjM=\NTc=\NTA=\NTY=\NjE=\NTA=\NDA=\NDc=\OTI=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDc=\NDA=\NDY=\NTM=\NTA=\NTk=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTg=\NTM=\NTA=\NTY=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\NDg=\NjE=\NDc=\NDc=\MTg=\NjE=\NDk=\NTc=\OTI=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTc=\NTE=\NTY=\NTc=\NDg=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTg=\NjE=\NDk=\NTc=\OTI=\ODg=\NzM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjY=\NDg=\NTM=\NTA=\NDA=\NDg=\NTE=\NjM=\NTU=\MzI=\MTI=\NDY=\NTM=\NjM=\NTc=\MTAy\MTEw\MTA1\MTA4\MTA4\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjA=\NTc=\NjE=\NTY=\OTI=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjk=\NTA=\NjM=\NTI=\NTE=\NDY=\NTc=\NTY=\OTI=\OTM=\OTM=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\MjY=\NDY=\NjE=\NDk=\NTc=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\NDc=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTY=\NTE=\NjM=\NjE=\NDg=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\NTI=\NjE=\NDY=\NjE=\NjM=\NDA=\NTc=\NDY=\OTI=\ODg=\Nzc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjA=\NDE=\NDk=\NjE=\NTA=\NTE=\NTM=\NTY=\MTQ=\NTE=\NTE=\NDA=\MTI=\NjE=\NDY=\NDA=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTA=\NTc=\NjM=\NDA=\NTE=\NDY=\MTEx\OTI=\ODg=\ODg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTA=\NTc=\NDM=\OTI=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjg=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NzI=\Mjg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjI0\ODk=\OTI=\OTI=\MTU5\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\ODc=\MTE3\OTI=\OTI=\OTI=\ODk=\OTI=\OTI=\OTI=\MjU=\Mjg=\OTI=\OTI=\MjY=\MjIw\MTU2\OTI=\MjM=\MTU2\MTU2\OTI=\MA==\OTI=\OTI=\OTM=\NjQ=\OTI=\OTM=\OTI=\NzQ=\MjIw\OTE=\MjIw\MjU=\OTM=\OTM=\OTI=\MjY=\Mjk=\MTU3\OTQ=\MjE4\MjIx\Mjk=\OTQ=\MTU3\MTU3\OTM=\OTI=\MA==\MjIx\MjIw\OTM=\Ng==\OTM=\OTI=\OTI=\NzQ=\MTU2\ODk=\MjIw\MjU=\OTM=\OTM=\OTI=\MjY=\Mjk=\MTU3\OTQ=\MjE4\OTM=\MzA=\OTQ=\MTU3\Mjk=\OTQ=\OTI=\MA==\MjIx\MjIw\OTM=\Ng==\OTM=\OTI=\OTI=\NzQ=\OTI=\ODg=\MjIw\MjY=\MjIx\MzA=\OTQ=\MjE=\OTM=\MTU5\MjE3\MjY=\MjIx\MzA=\OTQ=\MjE3\Mjk=\OTI=\OTI=\MjE4\MjIx\MzE=\OTU=\MjE4\MTU3\MzE=\OTU=\MjE4\OTM=\MjQ=\OTU=\MjE4\Mjk=\MjQ=\OTU=\MjE4\Mjk=\MzE=\OTU=\MTUz\MjIx\ODg=\OTI=\MTU0\MTU3\MTUy\OTU=\OTM=\OTQ=\ODk=\OTI=\Mjk=\MzA=\ODk=\OTI=\MjIx\MjIy\ODk=\OTI=\MTI4\MjIx\OTI=\OTQ=\MjA4\MTU3\OTM=\OTU=\MjE=\MjIx\MjIx\MjE4\MTI1\MjIw\OTI=\OTI=\NzQ=\MjIw\MTcx\MzU=\NjY=\OTI=\MjIw\OTI=\NzU=\OTI=\OTI=\OTI=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDQ=\NjE=\NTM=\NDY=\NDc=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTk=\NjE=\NDk=\NTc=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTE=\NTE=\NDY=\NTU=\NDc=\NDQ=\NjE=\NjM=\NTc=\OTI=\ODg=\ODM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjc=\NTc=\NDA=\MjQ=\NTc=\NDc=\NjM=\NTc=\NTA=\NTY=\NjE=\NTA=\NDA=\NDc=\OTI=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDc=\NDA=\NDY=\NTM=\NTA=\NTk=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTg=\NTM=\NTA=\NTY=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\NDg=\NjE=\NDc=\NDc=\MTg=\NjE=\NDk=\NTc=\OTI=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTc=\NTE=\NTY=\NTc=\NDg=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTg=\NjE=\NDk=\NTc=\OTI=\ODg=\NzQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjc=\NDY=\Mzc=\NDQ=\NTI=\NTE=\NTA=\MzI=\MTI=\NDY=\NTM=\NjM=\NTc=\MTAy\MTA3\MTA1\MTA4\MTA4\MTA4\MTA4\MTA4\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjA=\NTc=\NjE=\NTY=\OTI=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjk=\NTA=\NjM=\NTI=\NTE=\NDY=\NTc=\NTY=\OTI=\OTM=\OTM=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\MjY=\NDY=\NjE=\NDk=\NTc=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\NDc=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTY=\NTE=\NjM=\NjE=\NDg=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\NTI=\NjE=\NDY=\NjE=\NjM=\NDA=\NTc=\NDY=\OTI=\ODg=\Nzc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjA=\NDE=\NDk=\NjE=\NTA=\NTE=\NTM=\NTY=\MTQ=\NTE=\NTE=\NDA=\MTI=\NjE=\NDY=\NDA=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTA=\NTc=\NjM=\NDA=\NTE=\NDY=\MTEx\OTI=\ODg=\ODg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTA=\NTc=\NDM=\OTI=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjg=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NzI=\Mjg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTUz\ODk=\OTI=\OTI=\MTQ0\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\ODc=\MTE3\OTI=\OTI=\OTI=\ODk=\OTI=\OTI=\OTI=\MjU=\Mjg=\OTI=\OTI=\MjY=\MjIw\MTU2\OTI=\MjM=\MTU2\MTU2\OTI=\MA==\OTI=\OTI=\OTM=\NjQ=\OTI=\OTM=\OTI=\NzQ=\MjIw\OTE=\MjIw\MjU=\OTM=\OTM=\OTI=\MjY=\Mjk=\MTU3\OTQ=\MjE4\MjIx\Mjk=\OTQ=\MTU3\MTU3\OTM=\OTI=\MA==\MjIx\MjIw\OTM=\Ng==\OTM=\OTI=\OTI=\NzQ=\MTU2\ODk=\MjIw\MjU=\OTM=\OTM=\OTI=\MjY=\Mjk=\MTU3\OTQ=\MjE4\OTM=\MzA=\OTQ=\MTU3\Mjk=\OTQ=\OTI=\MA==\MjIx\MjIw\OTM=\Ng==\OTM=\OTI=\OTI=\NzQ=\OTI=\ODg=\MjIw\MjY=\MjIx\MzA=\OTQ=\MjE=\OTM=\MTU5\MjE3\MjY=\MjIx\MzA=\OTQ=\MjE3\Mjk=\OTI=\OTI=\MjE4\MjIx\MzE=\OTU=\MjE4\MTU3\MzE=\OTU=\MjE4\OTM=\MjQ=\OTU=\MjE4\Mjk=\MjQ=\OTU=\MjE4\Mjk=\MzE=\OTU=\MTUz\MjIx\ODg=\OTI=\MTU0\MTU3\MTUy\OTU=\OTM=\OTQ=\ODk=\OTI=\Mjk=\MzA=\ODk=\OTI=\MjIx\MjIy\ODk=\OTI=\MTI4\MjIx\OTI=\OTQ=\MjA4\MTU3\OTM=\OTU=\MjE=\MjIx\MjIx\MjE4\MTI1\MjIw\OTI=\OTI=\NzQ=\MjIw\MTcx\MzU=\NjY=\OTI=\MjIw\OTI=\NzU=\OTI=\OTI=\OTI=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDQ=\NjE=\NTM=\NDY=\NDc=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTk=\NjE=\NDk=\NTc=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTE=\NTE=\NDY=\NTU=\NDc=\NDQ=\NjE=\NjM=\NTc=\OTI=\ODg=\ODM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjc=\NTc=\NDA=\MjQ=\NTc=\NDc=\NjM=\NTc=\NTA=\NTY=\NjE=\NTA=\NDA=\NDc=\OTI=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDc=\NDA=\NDY=\NTM=\NTA=\NTk=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTg=\NTM=\NTA=\NTY=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\NDg=\NjE=\NDc=\NDc=\MTg=\NjE=\NDk=\NTc=\OTI=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTc=\NTE=\NTY=\NTc=\NDg=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTg=\NjE=\NDk=\NTc=\OTI=\ODg=\Nzg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjI=\NTM=\NDA=\NDA=\NTc=\MzI=\MTI=\NDY=\NTM=\NjM=\NTc=\MTAy\MTA2\MTA1\MTA4\MTA4\MTA4\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjA=\NTc=\NjE=\NTY=\OTI=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjk=\NTA=\NjM=\NTI=\NTE=\NDY=\NTc=\NTY=\OTI=\OTM=\OTM=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\MjY=\NDY=\NjE=\NDk=\NTc=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\NDc=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTY=\NTE=\NjM=\NjE=\NDg=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\NTI=\NjE=\NDY=\NjE=\NjM=\NDA=\NTc=\NDY=\OTI=\ODg=\Nzc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjA=\NDE=\NDk=\NjE=\NTA=\NTE=\NTM=\NTY=\MTQ=\NTE=\NTE=\NDA=\MTI=\NjE=\NDY=\NDA=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTA=\NTc=\NjM=\NDA=\NTE=\NDY=\MTEx\OTI=\ODg=\ODg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTA=\NTc=\NDM=\OTI=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjg=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NzI=\Mjg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTQ2\ODk=\OTI=\OTI=\MTMy\ODk=\OTI=\OTI=\OTQ=\OTI=\OTI=\ODQ=\MTEy\OTI=\OTI=\OTI=\ODk=\OTI=\OTI=\OTI=\Mjk=\Mjg=\OTI=\OTI=\NjQ=\Mjg=\OTI=\OTM=\ODk=\MjIw\OTI=\OTI=\MjU=\MTU2\OTI=\OTI=\MjY=\OTI=\MTU3\OTI=\MjM=\Mjg=\MTU3\OTI=\MA==\OTI=\OTI=\OTM=\NjQ=\OTI=\OTM=\OTI=\NzQ=\MTU2\ODk=\MjIw\MjU=\MjIx\OTM=\OTI=\MjY=\MTU3\MTU3\OTQ=\MjE4\OTM=\MzA=\OTQ=\MTU3\Mjk=\OTQ=\OTI=\MA==\MjIx\MjIw\OTM=\Ng==\OTM=\OTI=\OTI=\NzQ=\OTI=\ODg=\MjIw\MjU=\MjIx\OTM=\OTI=\MjY=\MTU3\MTU3\OTQ=\MjE4\MjIx\MzA=\OTQ=\MTU3\MTU3\OTQ=\OTI=\MA==\MjIx\MjIw\OTM=\Ng==\OTM=\OTI=\OTI=\NzQ=\Mjg=\OTQ=\MjIw\MjM=\OTM=\MzE=\OTQ=\MTU3\Mjk=\OTU=\OTI=\MA==\MjIx\MjIw\OTM=\MjE=\MTU3\MzE=\MjE5\MjM=\OTM=\MzE=\OTQ=\MTU3\Mjk=\OTU=\OTI=\MA==\MjIx\MjIw\OTM=\MjE2\OTM=\OTI=\OTI=\MjE4\Mjk=\MjQ=\OTU=\MjE=\MjIx\OTM=\MjEy\MTI1\MjIw\OTI=\OTI=\NzQ=\Mjg=\MTY1\MzU=\ODg=\OTI=\MjIw\OTI=\OTA=\MjIw\MjQ=\OTI=\ODc=\OTI=\MzE=\OTI=\MjIx\MTU2\ODg=\OTI=\NjQ=\MjIw\MjIw\OTM=\NzA=\OTI=\OTI=\OTI=\NzQ=\OTI=\MTY5\MzU=\NjY=\OTI=\MjIw\OTI=\NzI=\OTI=\OTI=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDM=\NjE=\NTM=\NDA=\OTI=\OTU=\MTk4\MTk3\MTk3\MTk3\MTk3\MTk3\MjI5\OTk=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDQ=\NjE=\NTM=\NDY=\NDc=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTk=\NjE=\NDk=\NTc=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTE=\NTE=\NDY=\NTU=\NDc=\NDQ=\NjE=\NjM=\NTc=\OTI=\ODg=\ODM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjc=\NTc=\NDA=\MjQ=\NTc=\NDc=\NjM=\NTc=\NTA=\NTY=\NjE=\NTA=\NDA=\NDc=\OTI=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDc=\NDA=\NDY=\NTM=\NTA=\NTk=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTg=\NTM=\NTA=\NTY=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\NDg=\NjE=\NDc=\NDc=\MTg=\NjE=\NDk=\NTc=\OTI=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTc=\NTE=\NTY=\NTc=\NDg=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTg=\NjE=\NDk=\NTc=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OA==\NTI=\NjE=\NDA=\MTI0\NTA=\NTE=\NTE=\NjI=\OTI=\ODg=\ODM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjY=\NTM=\NTA=\NTY=\MjY=\NTM=\NDY=\NDc=\NDA=\MzE=\NTI=\NTM=\NDg=\NTY=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjA=\NTc=\NjE=\NTY=\OTI=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjk=\NTA=\NjM=\NTI=\NTE=\NDY=\NTc=\NTY=\OTI=\OTM=\OTM=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\MjY=\NDY=\NjE=\NDk=\NTc=\OTI=\ODg=\ODg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjA=\NTM=\NDA=\OTI=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzA=\NjE=\NjM=\NTU=\NDQ=\NjE=\NjM=\NTU=\OTI=\ODg=\Nzc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OA==\NTI=\NTc=\MTI0\MTU=\NDA=\NDY=\NTE=\NTA=\NTk=\NTc=\NDc=\NDA=\MTE0\MTE0\MTE0\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTM0\ODk=\OTI=\OTI=\MTg0\ODk=\OTI=\OTI=\OTQ=\OTI=\OTI=\ODQ=\MTEy\OTI=\OTI=\OTI=\ODk=\OTI=\OTI=\OTI=\Mjk=\Mjg=\OTI=\OTI=\NjQ=\Mjg=\OTI=\OTM=\ODk=\MjIw\OTI=\OTI=\MjU=\MTU2\OTI=\OTI=\MjY=\OTI=\MTU3\OTI=\MjM=\Mjg=\MTU3\OTI=\MA==\OTI=\OTI=\OTM=\NjQ=\OTI=\OTM=\OTI=\NzQ=\MTU2\ODk=\MjIw\MjU=\MjIx\OTM=\OTI=\MjY=\MTU3\MTU3\OTQ=\MjE4\OTM=\MzA=\OTQ=\MTU3\Mjk=\OTQ=\OTI=\MA==\MjIx\MjIw\OTM=\Ng==\OTM=\OTI=\OTI=\NzQ=\OTI=\ODg=\MjIw\MjU=\MjIx\OTM=\OTI=\MjY=\MTU3\MTU3\OTQ=\MjE4\MjIx\MzA=\OTQ=\MTU3\MTU3\OTQ=\OTI=\MA==\MjIx\MjIw\OTM=\Ng==\OTM=\OTI=\OTI=\NzQ=\Mjg=\OTQ=\MjIw\MjM=\OTM=\MzE=\OTQ=\MTU3\Mjk=\OTU=\OTI=\MA==\MjIx\MjIw\OTM=\MjE=\MTU3\MzE=\MjE5\MjM=\OTM=\MzE=\OTQ=\MTU3\Mjk=\OTU=\OTI=\MA==\MjIx\MjIw\OTM=\MjE2\OTM=\OTI=\OTI=\MjE4\Mjk=\MjQ=\OTU=\MjE=\MjIx\OTM=\MjEy\MTI1\MjIw\OTI=\OTI=\NzQ=\Mjg=\MTY1\MzU=\ODg=\OTI=\MjIw\OTI=\OTA=\MjIw\MjQ=\OTI=\ODc=\OTI=\MzE=\OTI=\MjIx\MTU2\ODg=\OTI=\NjQ=\MjIw\MjIw\OTM=\NzA=\OTI=\OTI=\OTI=\NzQ=\OTI=\MTY5\MzU=\NjY=\OTI=\MjIw\OTI=\NzI=\OTI=\OTI=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDM=\NjE=\NTM=\NDA=\OTI=\OTU=\MTk4\MTk3\MTk3\MTk3\MTk3\MTk3\MjI5\OTk=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDQ=\NjE=\NTM=\NDY=\NDc=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTk=\NjE=\NDk=\NTc=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTE=\NTE=\NDY=\NTU=\NDc=\NDQ=\NjE=\NjM=\NTc=\OTI=\ODg=\ODM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjc=\NTc=\NDA=\MjQ=\NTc=\NDc=\NjM=\NTc=\NTA=\NTY=\NjE=\NTA=\NDA=\NDc=\OTI=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDc=\NDA=\NDY=\NTM=\NTA=\NTk=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTg=\NTM=\NTA=\NTY=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\NDg=\NjE=\NDc=\NDc=\MTg=\NjE=\NDk=\NTc=\OTI=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTc=\NTE=\NTY=\NTc=\NDg=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTg=\NjE=\NDk=\NTc=\OTI=\ODg=\ODM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjE=\NTA=\NTQ=\NDE=\NDY=\NTc=\NTY=\MTI0\NDQ=\NTM=\NDY=\NjE=\NDA=\NTc=\OTI=\ODg=\ODM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjY=\NTM=\NTA=\NTY=\MjY=\NTM=\NDY=\NDc=\NDA=\MzE=\NTI=\NTM=\NDg=\NTY=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjA=\NTc=\NjE=\NTY=\OTI=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjk=\NTA=\NjM=\NTI=\NTE=\NDY=\NTc=\NTY=\OTI=\OTM=\OTM=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\MjY=\NDY=\NjE=\NDk=\NTc=\OTI=\ODg=\ODg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjA=\NTM=\NDA=\OTI=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzA=\NjE=\NjM=\NTU=\NDQ=\NjE=\NjM=\NTU=\OTI=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTc=\NjE=\NDY=\NTM=\NTA=\NTc=\NDc=\MTI1\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTg2\ODk=\OTI=\OTI=\MTcy\ODk=\OTI=\OTI=\OTQ=\OTI=\OTI=\ODQ=\MTEy\OTI=\OTI=\OTI=\ODk=\OTI=\OTI=\OTI=\Mjk=\Mjg=\OTI=\OTI=\NjQ=\Mjg=\OTI=\OTM=\ODk=\MjIw\OTI=\OTI=\MjU=\MTU2\OTI=\OTI=\MjY=\OTI=\MTU3\OTI=\MjM=\Mjg=\MTU3\OTI=\MA==\OTI=\OTI=\OTM=\NjQ=\OTI=\OTM=\OTI=\NzQ=\MTU2\ODk=\MjIw\MjU=\MjIx\OTM=\OTI=\MjY=\MTU3\MTU3\OTQ=\MjE4\OTM=\MzA=\OTQ=\MTU3\Mjk=\OTQ=\OTI=\MA==\MjIx\MjIw\OTM=\Ng==\OTM=\OTI=\OTI=\NzQ=\OTI=\ODg=\MjIw\MjU=\MjIx\OTM=\OTI=\MjY=\MTU3\MTU3\OTQ=\MjE4\MjIx\MzA=\OTQ=\MTU3\MTU3\OTQ=\OTI=\MA==\MjIx\MjIw\OTM=\Ng==\OTM=\OTI=\OTI=\NzQ=\Mjg=\OTQ=\MjIw\MjM=\OTM=\MzE=\OTQ=\MTU3\Mjk=\OTU=\OTI=\MA==\MjIx\MjIw\OTM=\MjE=\MTU3\MzE=\MjE5\MjM=\OTM=\MzE=\OTQ=\MTU3\Mjk=\OTU=\OTI=\MA==\MjIx\MjIw\OTM=\MjE2\OTM=\OTI=\OTI=\MjE4\Mjk=\MjQ=\OTU=\MjE=\MjIx\OTM=\MjEy\MTI1\MjIw\OTI=\OTI=\NzQ=\Mjg=\MTY1\MzU=\ODg=\OTI=\MjIw\OTI=\OTA=\MjIw\MjQ=\OTI=\ODc=\OTI=\MzE=\OTI=\MjIx\MTU2\ODg=\OTI=\NjQ=\MjIw\MjIw\OTM=\NzA=\OTI=\OTI=\OTI=\NzQ=\OTI=\MTY5\MzU=\NjY=\OTI=\MjIw\OTI=\NzI=\OTI=\OTI=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDM=\NjE=\NTM=\NDA=\OTI=\OTU=\MTk4\MTk3\MTk3\MTk3\MTk3\MTk3\MjI5\OTk=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDQ=\NjE=\NTM=\NDY=\NDc=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTk=\NjE=\NDk=\NTc=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTE=\NTE=\NDY=\NTU=\NDc=\NDQ=\NjE=\NjM=\NTc=\OTI=\ODg=\ODM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjc=\NTc=\NDA=\MjQ=\NTc=\NDc=\NjM=\NTc=\NTA=\NTY=\NjE=\NTA=\NDA=\NDc=\OTI=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDc=\NDA=\NDY=\NTM=\NTA=\NTk=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTg=\NTM=\NTA=\NTY=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\NDg=\NjE=\NDc=\NDc=\MTg=\NjE=\NDk=\NTc=\OTI=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTc=\NTE=\NTY=\NTc=\NDg=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTg=\NjE=\NDk=\NTc=\OTI=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTU=\NjE=\NTY=\MTI0\NTA=\NTE=\NTE=\NjI=\OTI=\ODg=\ODM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjY=\NTM=\NTA=\NTY=\MjY=\NTM=\NDY=\NDc=\NDA=\MzE=\NTI=\NTM=\NDg=\NTY=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjA=\NTc=\NjE=\NTY=\OTI=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjk=\NTA=\NjM=\NTI=\NTE=\NDY=\NTc=\NTY=\OTI=\OTM=\OTM=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\MjY=\NDY=\NjE=\NDk=\NTc=\OTI=\ODg=\ODg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjA=\NTM=\NDA=\OTI=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzA=\NjE=\NjM=\NTU=\NDQ=\NjE=\NjM=\NTU=\OTI=\ODg=\Nzk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjk=\NTA=\NTA=\NTE=\Mzc=\NTM=\NTA=\NTk=\MTI0\NTA=\NTE=\NTE=\NjI=\NDc=\MTE0\MTE0\MTE0\MTE0\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTc0\ODk=\OTI=\OTI=\MTYw\ODk=\OTI=\OTI=\OTQ=\OTI=\OTI=\ODQ=\MTEy\OTI=\OTI=\OTI=\ODk=\OTI=\OTI=\OTI=\Mjk=\Mjg=\OTI=\OTI=\NjQ=\Mjg=\OTI=\OTM=\ODk=\MjIw\OTI=\OTI=\MjU=\MTU2\OTI=\OTI=\MjY=\OTI=\MTU3\OTI=\MjM=\Mjg=\MTU3\OTI=\MA==\OTI=\OTI=\OTM=\NjQ=\OTI=\OTM=\OTI=\NzQ=\MTU2\ODk=\MjIw\MjU=\MjIx\OTM=\OTI=\MjY=\MTU3\MTU3\OTQ=\MjE4\OTM=\MzA=\OTQ=\MTU3\Mjk=\OTQ=\OTI=\MA==\MjIx\MjIw\OTM=\Ng==\OTM=\OTI=\OTI=\NzQ=\OTI=\ODg=\MjIw\MjU=\MjIx\OTM=\OTI=\MjY=\MTU3\MTU3\OTQ=\MjE4\MjIx\MzA=\OTQ=\MTU3\MTU3\OTQ=\OTI=\MA==\MjIx\MjIw\OTM=\Ng==\OTM=\OTI=\OTI=\NzQ=\Mjg=\OTQ=\MjIw\MjM=\OTM=\MzE=\OTQ=\MTU3\Mjk=\OTU=\OTI=\MA==\MjIx\MjIw\OTM=\MjE=\MTU3\MzE=\MjE5\MjM=\OTM=\MzE=\OTQ=\MTU3\Mjk=\OTU=\OTI=\MA==\MjIx\MjIw\OTM=\MjE2\OTM=\OTI=\OTI=\MjE4\Mjk=\MjQ=\OTU=\MjE=\MjIx\OTM=\MjEy\MTI1\MjIw\OTI=\OTI=\NzQ=\Mjg=\MTY1\MzU=\ODg=\OTI=\MjIw\OTI=\OTA=\MjIw\MjQ=\OTI=\ODc=\OTI=\MzE=\OTI=\MjIx\MTU2\ODg=\OTI=\NjQ=\MjIw\MjIw\OTM=\NzA=\OTI=\OTI=\OTI=\NzQ=\OTI=\MTY5\MzU=\NjY=\OTI=\MjIw\OTI=\NzI=\OTI=\OTI=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDM=\NjE=\NTM=\NDA=\OTI=\OTU=\MTk4\MTk3\MTk3\MTk3\MTk3\MTk3\MjI5\OTk=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDQ=\NjE=\NTM=\NDY=\NDc=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTk=\NjE=\NDk=\NTc=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTE=\NTE=\NDY=\NTU=\NDc=\NDQ=\NjE=\NjM=\NTc=\OTI=\ODg=\ODM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjc=\NTc=\NDA=\MjQ=\NTc=\NDc=\NjM=\NTc=\NTA=\NTY=\NjE=\NTA=\NDA=\NDc=\OTI=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDc=\NDA=\NDY=\NTM=\NTA=\NTk=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTg=\NTM=\NTA=\NTY=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\NDg=\NjE=\NDc=\NDc=\MTg=\NjE=\NDk=\NTc=\OTI=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTc=\NTE=\NTY=\NTc=\NDg=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTg=\NjE=\NDk=\NTc=\OTI=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjc=\NDE=\NTA=\MTI0\NTA=\NTE=\NTE=\NjI=\OTI=\ODg=\ODM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjY=\NTM=\NTA=\NTY=\MjY=\NTM=\NDY=\NDc=\NDA=\MzE=\NTI=\NTM=\NDg=\NTY=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjA=\NTc=\NjE=\NTY=\OTI=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjk=\NTA=\NjM=\NTI=\NTE=\NDY=\NTc=\NTY=\OTI=\OTM=\OTM=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\MjY=\NDY=\NjE=\NDk=\NTc=\OTI=\ODg=\ODg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjA=\NTM=\NDA=\OTI=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzA=\NjE=\NjM=\NTU=\NDQ=\NjE=\NjM=\NTU=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OA==\NTI=\NTc=\MTI0\NTk=\NDE=\NTA=\NTA=\NTc=\NDY=\MTI1\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTYy\ODk=\OTI=\OTI=\ODQ=\OTA=\OTI=\OTI=\OTQ=\OTI=\OTI=\ODQ=\MTEy\OTI=\OTI=\OTI=\ODk=\OTI=\OTI=\OTI=\Mjk=\Mjg=\OTI=\OTI=\NjQ=\Mjg=\OTI=\OTM=\ODk=\MjIw\OTI=\OTI=\MjU=\MTU2\OTI=\OTI=\MjY=\OTI=\MTU3\OTI=\MjM=\Mjg=\MTU3\OTI=\MA==\OTI=\OTI=\OTM=\NjQ=\OTI=\OTM=\OTI=\NzQ=\MTU2\ODk=\MjIw\MjU=\MjIx\OTM=\OTI=\MjY=\MTU3\MTU3\OTQ=\MjE4\OTM=\MzA=\OTQ=\MTU3\Mjk=\OTQ=\OTI=\MA==\MjIx\MjIw\OTM=\Ng==\OTM=\OTI=\OTI=\NzQ=\OTI=\ODg=\MjIw\MjU=\MjIx\OTM=\OTI=\MjY=\MTU3\MTU3\OTQ=\MjE4\MjIx\MzA=\OTQ=\MTU3\MTU3\OTQ=\OTI=\MA==\MjIx\MjIw\OTM=\Ng==\OTM=\OTI=\OTI=\NzQ=\Mjg=\OTQ=\MjIw\MjM=\OTM=\MzE=\OTQ=\MTU3\Mjk=\OTU=\OTI=\MA==\MjIx\MjIw\OTM=\MjE=\MTU3\MzE=\MjE5\MjM=\OTM=\MzE=\OTQ=\MTU3\Mjk=\OTU=\OTI=\MA==\MjIx\MjIw\OTM=\MjE2\OTM=\OTI=\OTI=\MjE4\Mjk=\MjQ=\OTU=\MjE=\MjIx\OTM=\MjEy\MTI1\MjIw\OTI=\OTI=\NzQ=\Mjg=\MTY1\MzU=\ODg=\OTI=\MjIw\OTI=\OTA=\MjIw\MjQ=\OTI=\ODc=\OTI=\MzE=\OTI=\MjIx\MTU2\ODg=\OTI=\NjQ=\MjIw\MjIw\OTM=\NzA=\OTI=\OTI=\OTI=\NzQ=\OTI=\MTY5\MzU=\NjY=\OTI=\MjIw\OTI=\NzI=\OTI=\OTI=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDM=\NjE=\NTM=\NDA=\OTI=\OTU=\MTk4\MTk3\MTk3\MTk3\MTk3\MTk3\MjI5\OTk=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDQ=\NjE=\NTM=\NDY=\NDc=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTk=\NjE=\NDk=\NTc=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTE=\NTE=\NDY=\NTU=\NDc=\NDQ=\NjE=\NjM=\NTc=\OTI=\ODg=\ODM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjc=\NTc=\NDA=\MjQ=\NTc=\NDc=\NjM=\NTc=\NTA=\NTY=\NjE=\NTA=\NDA=\NDc=\OTI=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDc=\NDA=\NDY=\NTM=\NTA=\NTk=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTg=\NTM=\NTA=\NTY=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\NDg=\NjE=\NDc=\NDc=\MTg=\NjE=\NDk=\NTc=\OTI=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTc=\NTE=\NTY=\NTc=\NDg=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTg=\NjE=\NDk=\NTc=\OTI=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTU=\NDM=\NTE=\NDY=\NTY=\MTI0\NTA=\NTE=\NTE=\NjI=\OTI=\ODg=\ODM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjY=\NTM=\NTA=\NTY=\MjY=\NTM=\NDY=\NDc=\NDA=\MzE=\NTI=\NTM=\NDg=\NTY=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjA=\NTc=\NjE=\NTY=\OTI=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjk=\NTA=\NjM=\NTI=\NTE=\NDY=\NTc=\NTY=\OTI=\OTM=\OTM=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\MjY=\NDY=\NjE=\NDk=\NTc=\OTI=\ODg=\ODg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjA=\NTM=\NDA=\OTI=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzA=\NjE=\NjM=\NTU=\NDQ=\NjE=\NjM=\NTU=\OTI=\ODg=\ODE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTU=\NDM=\NTE=\NDY=\NTY=\MTI0\MTc=\NjE=\NDc=\NDA=\NTc=\NDY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\ODY=\OTA=\OTI=\OTI=\NzI=\OTA=\OTI=\OTI=\OTQ=\OTI=\OTI=\ODQ=\MTEy\OTI=\OTI=\OTI=\ODk=\OTI=\OTI=\OTI=\Mjk=\Mjg=\OTI=\OTI=\NjQ=\Mjg=\OTI=\OTM=\ODk=\MjIw\OTI=\OTI=\MjU=\MTU2\OTI=\OTI=\MjY=\OTI=\MTU3\OTI=\MjM=\Mjg=\MTU3\OTI=\MA==\OTI=\OTI=\OTM=\NjQ=\OTI=\OTM=\OTI=\NzQ=\MTU2\ODk=\MjIw\MjU=\MjIx\OTM=\OTI=\MjY=\MTU3\MTU3\OTQ=\MjE4\OTM=\MzA=\OTQ=\MTU3\Mjk=\OTQ=\OTI=\MA==\MjIx\MjIw\OTM=\Ng==\OTM=\OTI=\OTI=\NzQ=\OTI=\ODg=\MjIw\MjU=\MjIx\OTM=\OTI=\MjY=\MTU3\MTU3\OTQ=\MjE4\MjIx\MzA=\OTQ=\MTU3\MTU3\OTQ=\OTI=\MA==\MjIx\MjIw\OTM=\Ng==\OTM=\OTI=\OTI=\NzQ=\Mjg=\OTQ=\MjIw\MjM=\OTM=\MzE=\OTQ=\MTU3\Mjk=\OTU=\OTI=\MA==\MjIx\MjIw\OTM=\MjE=\MTU3\MzE=\MjE5\MjM=\OTM=\MzE=\OTQ=\MTU3\Mjk=\OTU=\OTI=\MA==\MjIx\MjIw\OTM=\MjE2\OTM=\OTI=\OTI=\MjE4\Mjk=\MjQ=\OTU=\MjE=\MjIx\OTM=\MjEy\MTI1\MjIw\OTI=\OTI=\NzQ=\Mjg=\MTY1\MzU=\ODg=\OTI=\MjIw\OTI=\OTA=\MjIw\MjQ=\OTI=\ODc=\OTI=\MzE=\OTI=\MjIx\MTU2\ODg=\OTI=\NjQ=\MjIw\MjIw\OTM=\NzA=\OTI=\OTI=\OTI=\NzQ=\OTI=\MTY5\MzU=\NjY=\OTI=\MjIw\OTI=\NzI=\OTI=\OTI=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDM=\NjE=\NTM=\NDA=\OTI=\OTU=\MTk4\MTk3\MTk3\MTk3\MTk3\MTk3\MjI5\OTk=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDQ=\NjE=\NTM=\NDY=\NDc=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTk=\NjE=\NDk=\NTc=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTE=\NTE=\NDY=\NTU=\NDc=\NDQ=\NjE=\NjM=\NTc=\OTI=\ODg=\ODM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjc=\NTc=\NDA=\MjQ=\NTc=\NDc=\NjM=\NTc=\NTA=\NTY=\NjE=\NTA=\NDA=\NDc=\OTI=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDc=\NDA=\NDY=\NTM=\NTA=\NTk=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTg=\NTM=\NTA=\NTY=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\NDg=\NjE=\NDc=\NDc=\MTg=\NjE=\NDk=\NTc=\OTI=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTc=\NTE=\NTY=\NTc=\NDg=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTg=\NjE=\NDk=\NTc=\OTI=\ODg=\ODE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzA=\NTM=\NTk=\MTI0\NTI=\NTc=\NjE=\NTY=\MTI0\NjI=\NTE=\Mzc=\OTI=\ODg=\ODM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjY=\NTM=\NTA=\NTY=\MjY=\NTM=\NDY=\NDc=\NDA=\MzE=\NTI=\NTM=\NDg=\NTY=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjA=\NTc=\NjE=\NTY=\OTI=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjk=\NTA=\NjM=\NTI=\NTE=\NDY=\NTc=\NTY=\OTI=\OTM=\OTM=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\MjY=\NDY=\NjE=\NDk=\NTc=\OTI=\ODg=\ODg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjA=\NTM=\NDA=\OTI=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzA=\NjE=\NjM=\NTU=\NDQ=\NjE=\NjM=\NTU=\OTI=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OA==\NTI=\NTM=\NTc=\NTg=\MTI1\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NzQ=\OTA=\OTI=\OTI=\NjU=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\ODc=\MTE3\OTI=\OTI=\OTI=\ODk=\OTI=\OTI=\OTI=\MjU=\Mjg=\OTI=\OTI=\MjY=\MjIw\MTU2\OTI=\MjM=\MTU2\MTU2\OTI=\MA==\OTI=\OTI=\OTM=\NjQ=\OTI=\OTM=\OTI=\NzQ=\MjIw\OTE=\MjIw\MjU=\OTM=\OTM=\OTI=\MjY=\Mjk=\MTU3\OTQ=\MjE4\MjIx\Mjk=\OTQ=\MTU3\MTU3\OTM=\OTI=\MA==\MjIx\MjIw\OTM=\Ng==\OTM=\OTI=\OTI=\NzQ=\MTU2\ODk=\MjIw\MjU=\OTM=\OTM=\OTI=\MjY=\Mjk=\MTU3\OTQ=\MjE4\OTM=\MzA=\OTQ=\MTU3\Mjk=\OTQ=\OTI=\MA==\MjIx\MjIw\OTM=\Ng==\OTM=\OTI=\OTI=\NzQ=\OTI=\ODg=\MjIw\MjY=\MjIx\MzA=\OTQ=\MjE=\OTM=\MTU5\MjE3\MjY=\MjIx\MzA=\OTQ=\MjE3\Mjk=\OTI=\OTI=\MjE4\MjIx\MzE=\OTU=\MjE4\MTU3\MzE=\OTU=\MjE4\OTM=\MjQ=\OTU=\MjE4\Mjk=\MjQ=\OTU=\MjE4\Mjk=\MzE=\OTU=\MTUz\MjIx\ODg=\OTI=\MTU0\MTU3\MTUy\OTU=\OTM=\OTQ=\ODk=\OTI=\Mjk=\MzA=\ODk=\OTI=\MjIx\MjIy\ODk=\OTI=\MTI4\MjIx\OTI=\OTQ=\MjA4\MTU3\OTM=\OTU=\MjE=\MjIx\MjIx\MjE4\MTI1\MjIw\OTI=\OTI=\NzQ=\MjIw\MTcx\MzU=\NjY=\OTI=\MjIw\OTI=\NzU=\OTI=\OTI=\OTI=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDQ=\NjE=\NTM=\NDY=\NDc=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTk=\NjE=\NDk=\NTc=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTE=\NTE=\NDY=\NTU=\NDc=\NDQ=\NjE=\NjM=\NTc=\OTI=\ODg=\ODM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjc=\NTc=\NDA=\MjQ=\NTc=\NDc=\NjM=\NTc=\NTA=\NTY=\NjE=\NTA=\NDA=\NDc=\OTI=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDc=\NDA=\NDY=\NTM=\NTA=\NTk=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTg=\NTM=\NTA=\NTY=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\NDg=\NjE=\NDc=\NDc=\MTg=\NjE=\NDk=\NTc=\OTI=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTc=\NTE=\NTY=\NTc=\NDg=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTg=\NjE=\NDk=\NTc=\OTI=\ODg=\Nzg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjM=\NjE=\NDA=\NjE=\NTA=\NjE=\MzI=\MTI=\NDY=\NTM=\NjM=\NTc=\MTAy\MTA1\MTA4\MTA4\MTA4\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjA=\NTc=\NjE=\NTY=\OTI=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjk=\NTA=\NjM=\NTI=\NTE=\NDY=\NTc=\NTY=\OTI=\OTM=\OTM=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\MjY=\NDY=\NjE=\NDk=\NTc=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\NDc=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTY=\NTE=\NjM=\NjE=\NDg=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\NTI=\NjE=\NDY=\NjE=\NjM=\NDA=\NTc=\NDY=\OTI=\ODg=\Nzc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjA=\NDE=\NDk=\NjE=\NTA=\NTE=\NTM=\NTY=\MTQ=\NTE=\NTE=\NDA=\MTI=\NjE=\NDY=\NDA=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTA=\NTc=\NjM=\NDA=\NTE=\NDY=\MTEx\OTI=\ODg=\ODg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTA=\NTc=\NDM=\OTI=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjg=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NzI=\Mjg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Njc=\OTA=\OTI=\OTI=\MTIy\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\ODc=\MTE3\OTI=\OTI=\OTI=\ODk=\OTI=\OTI=\OTI=\MjU=\Mjg=\OTI=\OTI=\MjY=\MjIw\MTU2\OTI=\MjM=\MTU2\MTU2\OTI=\MA==\OTI=\OTI=\OTM=\NjQ=\OTI=\OTM=\OTI=\NzQ=\MjIw\OTE=\MjIw\MjU=\OTM=\OTM=\OTI=\MjY=\Mjk=\MTU3\OTQ=\MjE4\MjIx\Mjk=\OTQ=\MTU3\MTU3\OTM=\OTI=\MA==\MjIx\MjIw\OTM=\Ng==\OTM=\OTI=\OTI=\NzQ=\MTU2\ODk=\MjIw\MjU=\OTM=\OTM=\OTI=\MjY=\Mjk=\MTU3\OTQ=\MjE4\OTM=\MzA=\OTQ=\MTU3\Mjk=\OTQ=\OTI=\MA==\MjIx\MjIw\OTM=\Ng==\OTM=\OTI=\OTI=\NzQ=\OTI=\ODg=\MjIw\MjY=\MjIx\MzA=\OTQ=\MjE=\OTM=\MTU5\MjE3\MjY=\MjIx\MzA=\OTQ=\MjE3\Mjk=\OTI=\OTI=\MjE4\MjIx\MzE=\OTU=\MjE4\MTU3\MzE=\OTU=\MjE4\OTM=\MjQ=\OTU=\MjE4\Mjk=\MjQ=\OTU=\MjE4\Mjk=\MzE=\OTU=\MTUz\MjIx\ODg=\OTI=\MTU0\MTU3\MTUy\OTU=\OTM=\OTQ=\ODk=\OTI=\Mjk=\MzA=\ODk=\OTI=\MjIx\MjIy\ODk=\OTI=\MTI4\MjIx\OTI=\OTQ=\MjA4\MTU3\OTM=\OTU=\MjE=\MjIx\MjIx\MjE4\MTI1\MjIw\OTI=\OTI=\NzQ=\MjIw\MTcx\MzU=\NjY=\OTI=\MjIw\OTI=\NzU=\OTI=\OTI=\OTI=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDQ=\NjE=\NTM=\NDY=\NDc=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTk=\NjE=\NDk=\NTc=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTE=\NTE=\NDY=\NTU=\NDc=\NDQ=\NjE=\NjM=\NTc=\OTI=\ODg=\ODM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjc=\NTc=\NDA=\MjQ=\NTc=\NDc=\NjM=\NTc=\NTA=\NTY=\NjE=\NTA=\NDA=\NDc=\OTI=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDc=\NDA=\NDY=\NTM=\NTA=\NTk=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTg=\NTM=\NTA=\NTY=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\NDg=\NjE=\NDc=\NDc=\MTg=\NjE=\NDk=\NTc=\OTI=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTc=\NTE=\NTY=\NTc=\NDg=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTg=\NjE=\NDk=\NTc=\OTI=\ODg=\Njk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTg=\NTE=\NTA=\NTE=\NDc=\NjE=\NDk=\NjE=\MTI0\MzA=\NTE=\MzI=\MTI=\NDY=\NTM=\NjM=\NTc=\MTAy\MTA5\MTA1\MTA4\MTA4\MTA4\MTA4\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjA=\NTc=\NjE=\NTY=\OTI=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjk=\NTA=\NjM=\NTI=\NTE=\NDY=\NTc=\NTY=\OTI=\OTM=\OTM=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\MjY=\NDY=\NjE=\NDk=\NTc=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\NDc=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTY=\NTE=\NjM=\NjE=\NDg=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\NTI=\NjE=\NDY=\NjE=\NjM=\NDA=\NTc=\NDY=\OTI=\ODg=\Nzc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjA=\NDE=\NDk=\NjE=\NTA=\NTE=\NTM=\NTY=\MTQ=\NTE=\NTE=\NDA=\MTI=\NjE=\NDY=\NDA=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTA=\NTc=\NjM=\NDA=\NTE=\NDY=\MTEx\OTI=\ODg=\ODg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTA=\NTc=\NDM=\OTI=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjg=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NzI=\Mjg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTE2\OTA=\OTI=\OTI=\MTE1\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\ODc=\MTE3\OTI=\OTI=\OTI=\ODk=\OTI=\OTI=\OTI=\MjU=\Mjg=\OTI=\OTI=\MjY=\MjIw\MTU2\OTI=\MjM=\MTU2\MTU2\OTI=\MA==\OTI=\OTI=\OTM=\NjQ=\OTI=\OTM=\OTI=\NzQ=\MjIw\OTE=\MjIw\MjU=\OTM=\OTM=\OTI=\MjY=\Mjk=\MTU3\OTQ=\MjE4\MjIx\Mjk=\OTQ=\MTU3\MTU3\OTM=\OTI=\MA==\MjIx\MjIw\OTM=\Ng==\OTM=\OTI=\OTI=\NzQ=\MTU2\ODk=\MjIw\MjU=\OTM=\OTM=\OTI=\MjY=\Mjk=\MTU3\OTQ=\MjE4\OTM=\MzA=\OTQ=\MTU3\Mjk=\OTQ=\OTI=\MA==\MjIx\MjIw\OTM=\Ng==\OTM=\OTI=\OTI=\NzQ=\OTI=\ODg=\MjIw\MjY=\MjIx\MzA=\OTQ=\MjE=\OTM=\MTU5\MjE3\MjY=\MjIx\MzA=\OTQ=\MjE3\Mjk=\OTI=\OTI=\MjE4\MjIx\MzE=\OTU=\MjE4\MTU3\MzE=\OTU=\MjE4\OTM=\MjQ=\OTU=\MjE4\Mjk=\MjQ=\OTU=\MjE4\Mjk=\MzE=\OTU=\MTUz\MjIx\ODg=\OTI=\MTU0\MTU3\MTUy\OTU=\OTM=\OTQ=\ODk=\OTI=\Mjk=\MzA=\ODk=\OTI=\MjIx\MjIy\ODk=\OTI=\MTI4\MjIx\OTI=\OTQ=\MjA4\MTU3\OTM=\OTU=\MjE=\MjIx\MjIx\MjE4\MTI1\MjIw\OTI=\OTI=\NzQ=\MjIw\MTcx\MzU=\NjY=\OTI=\MjIw\OTI=\NzU=\OTI=\OTI=\OTI=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDQ=\NjE=\NTM=\NDY=\NDc=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTk=\NjE=\NDk=\NTc=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTE=\NTE=\NDY=\NTU=\NDc=\NDQ=\NjE=\NjM=\NTc=\OTI=\ODg=\ODM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjc=\NTc=\NDA=\MjQ=\NTc=\NDc=\NjM=\NTc=\NTA=\NTY=\NjE=\NTA=\NDA=\NDc=\OTI=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDc=\NDA=\NDY=\NTM=\NTA=\NTk=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTg=\NTM=\NTA=\NTY=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\NDg=\NjE=\NDc=\NDc=\MTg=\NjE=\NDk=\NTc=\OTI=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTc=\NTE=\NTY=\NTc=\NDg=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTg=\NjE=\NDk=\NTc=\OTI=\ODg=\Nzc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NTM=\NDQ=\NTc=\MzI=\MTI=\NDY=\NTM=\NjM=\NTc=\MTAy\MTEx\MTA4\MTA4\MTA4\MTA4\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjA=\NTc=\NjE=\NTY=\OTI=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjk=\NTA=\NjM=\NTI=\NTE=\NDY=\NTc=\NTY=\OTI=\OTM=\OTM=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\MjY=\NDY=\NjE=\NDk=\NTc=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\NDc=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTY=\NTE=\NjM=\NjE=\NDg=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\NTI=\NjE=\NDY=\NjE=\NjM=\NDA=\NTc=\NDY=\OTI=\ODg=\Nzc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjA=\NDE=\NDk=\NjE=\NTA=\NTE=\NTM=\NTY=\MTQ=\NTE=\NTE=\NDA=\MTI=\NjE=\NDY=\NDA=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTA=\NTc=\NjM=\NDA=\NTE=\NDY=\MTEx\OTI=\ODg=\ODg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTA=\NTc=\NDM=\OTI=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjg=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NzI=\Mjg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTA5\OTA=\OTI=\OTI=\MTAw\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\ODc=\MTE3\OTI=\OTI=\OTI=\ODk=\OTI=\OTI=\OTI=\MjU=\Mjg=\OTI=\OTI=\MjY=\MjIw\MTU2\OTI=\MjM=\MTU2\MTU2\OTI=\MA==\OTI=\OTI=\OTM=\NjQ=\OTI=\OTM=\OTI=\NzQ=\MjIw\OTE=\MjIw\MjU=\OTM=\OTM=\OTI=\MjY=\Mjk=\MTU3\OTQ=\MjE4\MjIx\Mjk=\OTQ=\MTU3\MTU3\OTM=\OTI=\MA==\MjIx\MjIw\OTM=\Ng==\OTM=\OTI=\OTI=\NzQ=\MTU2\ODk=\MjIw\MjU=\OTM=\OTM=\OTI=\MjY=\Mjk=\MTU3\OTQ=\MjE4\OTM=\MzA=\OTQ=\MTU3\Mjk=\OTQ=\OTI=\MA==\MjIx\MjIw\OTM=\Ng==\OTM=\OTI=\OTI=\NzQ=\OTI=\ODg=\MjIw\MjY=\MjIx\MzA=\OTQ=\MjE=\OTM=\MTU5\MjE3\MjY=\MjIx\MzA=\OTQ=\MjE3\Mjk=\OTI=\OTI=\MjE4\MjIx\MzE=\OTU=\MjE4\MTU3\MzE=\OTU=\MjE4\OTM=\MjQ=\OTU=\MjE4\Mjk=\MjQ=\OTU=\MjE4\Mjk=\MzE=\OTU=\MTUz\MjIx\ODg=\OTI=\MTU0\MTU3\MTUy\OTU=\OTM=\OTQ=\ODk=\OTI=\Mjk=\OTQ=\ODk=\OTI=\MjIx\MzA=\ODk=\OTI=\MTI4\MjIx\OTI=\OTQ=\MjA4\MTU3\OTM=\OTU=\MjE=\MjIx\MjIx\MjE4\MTI1\MjIw\OTI=\OTI=\NzQ=\MjIw\MTcx\MzU=\NjY=\OTI=\MjIw\OTI=\NzQ=\OTI=\OTI=\OTI=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDQ=\NjE=\NTM=\NDY=\NDc=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTk=\NjE=\NDk=\NTc=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTE=\NTE=\NDY=\NTU=\NDc=\NDQ=\NjE=\NjM=\NTc=\OTI=\ODg=\ODM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjc=\NTc=\NDA=\MjQ=\NTc=\NDc=\NjM=\NTc=\NTA=\NTY=\NjE=\NTA=\NDA=\NDc=\OTI=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDc=\NDA=\NDY=\NTM=\NTA=\NTk=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTg=\NTM=\NTA=\NTY=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\NDg=\NjE=\NDc=\NDc=\MTg=\NjE=\NDk=\NTc=\OTI=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTc=\NTE=\NTY=\NTc=\NDg=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTg=\NjE=\NDk=\NTc=\OTI=\ODg=\NzM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTQ=\Mzc=\NDE=\NDc=\NTE=\NTU=\NTc=\NTA=\MzI=\MTI=\NDY=\NTM=\NjM=\NTc=\MTAy\MTA3\MTA1\MTA4\MTA4\MTA4\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjA=\NTc=\NjE=\NTY=\OTI=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjk=\NTA=\NjM=\NTI=\NTE=\NDY=\NTc=\NTY=\OTI=\OTM=\OTM=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\MjY=\NDY=\NjE=\NDk=\NTc=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\NDc=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTY=\NTE=\NjM=\NjE=\NDg=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\NTI=\NjE=\NDY=\NjE=\NjM=\NDA=\NTc=\NDY=\OTI=\ODg=\Nzc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjA=\NDE=\NDk=\NjE=\NTA=\NTE=\NTM=\NTY=\MTQ=\NTE=\NTE=\NDA=\MTI=\NjE=\NDY=\NDA=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTA=\NTc=\NjM=\NDA=\NTE=\NDY=\MTEx\OTI=\ODg=\ODg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTA=\NTc=\NDM=\OTI=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NzI=\Mjg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTAy\OTA=\OTI=\OTI=\Mjk=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\ODc=\MTE3\OTI=\OTI=\OTI=\ODk=\OTI=\OTI=\OTI=\MjU=\Mjg=\OTI=\OTI=\MjY=\MjIw\MTU2\OTI=\MjM=\MTU2\MTU2\OTI=\MA==\OTI=\OTI=\OTM=\NjQ=\OTI=\OTM=\OTI=\NzQ=\MjIw\OTE=\MjIw\MjU=\OTM=\OTM=\OTI=\MjY=\Mjk=\MTU3\OTQ=\MjE4\MjIx\Mjk=\OTQ=\MTU3\MTU3\OTM=\OTI=\MA==\MjIx\MjIw\OTM=\Ng==\OTM=\OTI=\OTI=\NzQ=\MTU2\ODk=\MjIw\MjU=\OTM=\OTM=\OTI=\MjY=\Mjk=\MTU3\OTQ=\MjE4\OTM=\MzA=\OTQ=\MTU3\Mjk=\OTQ=\OTI=\MA==\MjIx\MjIw\OTM=\Ng==\OTM=\OTI=\OTI=\NzQ=\OTI=\ODg=\MjIw\MjY=\MjIx\MzA=\OTQ=\MjE=\OTM=\MTU5\MjE3\MjY=\MjIx\MzA=\OTQ=\MjE3\Mjk=\OTI=\OTI=\MjE4\MjIx\MzE=\OTU=\MjE4\MTU3\MzE=\OTU=\MjE4\OTM=\MjQ=\OTU=\MjE4\Mjk=\MjQ=\OTU=\MjE4\Mjk=\MzE=\OTU=\MTUz\MjIx\ODg=\OTI=\MTU0\MTU3\MTUy\OTU=\OTM=\OTQ=\ODk=\OTI=\Mjk=\MzA=\ODk=\OTI=\MjIx\MjIy\ODk=\OTI=\MTI4\MjIx\OTI=\OTQ=\MjA4\MTU3\OTM=\OTU=\MjE=\MjIx\MjIx\MjE4\MTI1\MjIw\OTI=\OTI=\NzQ=\MjIw\MTcx\MzU=\NjY=\OTI=\MjIw\OTI=\NzU=\OTI=\OTI=\OTI=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDQ=\NjE=\NTM=\NDY=\NDc=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTk=\NjE=\NDk=\NTc=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTE=\NTE=\NDY=\NTU=\NDc=\NDQ=\NjE=\NjM=\NTc=\OTI=\ODg=\ODM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjc=\NTc=\NDA=\MjQ=\NTc=\NDc=\NjM=\NTc=\NTA=\NTY=\NjE=\NTA=\NDA=\NDc=\OTI=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDc=\NDA=\NDY=\NTM=\NTA=\NTk=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTg=\NTM=\NTA=\NTY=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\NDg=\NjE=\NDc=\NDc=\MTg=\NjE=\NDk=\NTc=\OTI=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTc=\NTE=\NTY=\NTc=\NDg=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTg=\NjE=\NDk=\NTc=\OTI=\ODg=\NzU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTE=\NTE=\NTE=\NTY=\NTc=\NTA=\MTI0\MTU=\NDM=\NTE=\NDY=\NTY=\MzI=\MTI=\NDY=\NTM=\NjM=\NTc=\MTAy\MTA5\MTA4\MTA4\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjA=\NTc=\NjE=\NTY=\OTI=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjk=\NTA=\NjM=\NTI=\NTE=\NDY=\NTc=\NTY=\OTI=\OTM=\OTM=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\MjY=\NDY=\NjE=\NDk=\NTc=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\NDc=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTY=\NTE=\NjM=\NjE=\NDg=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\NTI=\NjE=\NDY=\NjE=\NjM=\NDA=\NTc=\NDY=\OTI=\ODg=\Nzc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjA=\NDE=\NDk=\NjE=\NTA=\NTE=\NTM=\NTY=\MTQ=\NTE=\NTE=\NDA=\MTI=\NjE=\NDY=\NDA=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTA=\NTc=\NjM=\NDA=\NTE=\NDY=\MTEx\OTI=\ODg=\ODg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTA=\NTc=\NDM=\OTI=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjg=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NzI=\Mjg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\OTA=\OTI=\OTI=\OA==\OTA=\OTI=\OTI=\OTQ=\OTI=\OTI=\OTE=\MTE1\OTI=\OTI=\OTI=\ODg=\OTI=\OTI=\OTI=\OTA=\OTI=\Mjg=\OTI=\NzU=\Mjg=\Mjg=\OTI=\NzQ=\Mjg=\ODQ=\MjIw\ODg=\OTI=\OTI=\OTI=\ODU=\MjIw\Mjg=\MjIw\ODk=\MTU2\OTI=\OTI=\ODU=\Mjg=\Mjk=\MjIy\ODk=\MjIw\OTM=\OTI=\NjQ=\MjIw\MjIw\OTI=\NzA=\OTI=\OTI=\OTI=\NzQ=\Mjg=\ODQ=\MjIw\ODk=\MTU2\OTI=\OTI=\OTA=\OTI=\Mjk=\OTI=\NzU=\Mjg=\Mjk=\OTI=\NzQ=\MTU2\MTYx\MzU=\ODk=\MTU2\OTM=\OTI=\MjU=\OTI=\OTQ=\OTI=\MjY=\Mjg=\MTU4\OTI=\MjY=\MjIw\MTU4\OTI=\MjM=\MTU2\MTU4\OTI=\MA==\OTI=\OTI=\OTM=\NjQ=\OTI=\OTM=\OTI=\NzQ=\Mjg=\OTQ=\MjIw\MjY=\OTM=\MzE=\OTQ=\MjE2\OTM=\MjIw\OTI=\MjE4\OTM=\Mjg=\OTU=\NzU=\MjIw\MjIx\OTQ=\NzQ=\OTI=\OTM=\MjIw\MjU=\OTM=\OTQ=\OTI=\MjY=\Mjk=\MTU4\OTQ=\MjY=\MjIx\MTU4\OTQ=\MjY=\MjIx\MTU5\OTQ=\ODU=\Mjk=\MjIx\MjE4\MTI1\MjIw\OTI=\OTI=\NzQ=\MTU2\MTYw\MzU=\NzQ=\MjIw\MTY0\MzU=\NzQ=\MTU2\OTM=\MjIw\ODg=\OTI=\OTI=\OTI=\OTA=\OTI=\Mjg=\OTI=\NzU=\MjIw\Mjg=\OTI=\NzQ=\MTU2\OTI=\MjIw\ODg=\OTI=\OTI=\OTI=\ODU=\Mjg=\Mjg=\MjIw\ODk=\MTU2\OTI=\OTI=\ODU=\MTU2\MzE=\MjIy\NjY=\OTI=\MjIw\OTI=\NzY=\OTI=\OTI=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OA==\NTc=\MzY=\NDA=\OTI=\ODg=\ODM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzA=\NjE=\NjM=\NTU=\NDQ=\NjE=\NjM=\NTU=\MTI0\MTAy\MTI0\MTk=\MjY=\MjY=\OTI=\ODg=\ODI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzA=\NjE=\NjM=\NTU=\NDQ=\NjE=\NjM=\NTU=\MTI0\MTAy\MTI0\MTk=\MTg=\OTI=\ODg=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mw==\Mjc=\OTI=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NjI=\NjE=\NjM=\NTU=\NDQ=\NjE=\NjM=\NTU=\OTI=\OTM=\OTM=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDM=\NjE=\NTM=\NDA=\OTI=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDQ=\NjE=\NTM=\NDY=\NDc=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTk=\NjE=\NDk=\NTc=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\NDc=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTY=\NTE=\NjM=\NjE=\NDg=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjc=\NTc=\NDA=\MzE=\NTI=\NTM=\NDg=\NTY=\NDY=\NTc=\NTA=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTg=\NjE=\NDk=\NTc=\OTI=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NjE=\NDY=\NTc=\NTA=\NDA=\OTI=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzA=\NjE=\NjM=\NTU=\NDQ=\NjE=\NjM=\NTU=\OTI=\OTM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTA=\OTA=\OTI=\OTI=\NTk=\OTA=\OTI=\OTI=\OTQ=\OTI=\OTI=\OTE=\MTE1\OTI=\OTI=\OTI=\ODg=\OTI=\OTI=\OTI=\OTA=\OTI=\Mjg=\OTI=\NzU=\Mjg=\Mjg=\OTI=\NzQ=\Mjg=\ODQ=\MjIw\ODg=\OTI=\OTI=\OTI=\ODU=\MjIw\Mjg=\MjIw\ODk=\MTU2\OTI=\OTI=\ODU=\Mjg=\Mjk=\MjIy\ODk=\MjIw\OTM=\OTI=\NjQ=\MjIw\MjIw\OTI=\NzA=\OTI=\OTI=\OTI=\NzQ=\Mjg=\ODQ=\MjIw\ODk=\MTU2\OTI=\OTI=\OTA=\OTI=\Mjk=\OTI=\NzU=\Mjg=\Mjk=\OTI=\NzQ=\MTU2\MTYx\MzU=\ODk=\MTU2\OTM=\OTI=\MjU=\OTI=\OTQ=\OTI=\MjY=\Mjg=\MTU4\OTI=\MjY=\MjIw\MTU4\OTI=\MjY=\MTU2\MTU4\OTI=\MjM=\OTI=\MTU5\OTI=\MA==\OTI=\OTI=\OTM=\NjQ=\OTI=\OTM=\OTI=\NzQ=\OTI=\OTQ=\MjIw\MjY=\Mjk=\MzE=\OTQ=\MjE2\OTM=\MjIw\OTI=\MjE4\OTM=\Mjg=\OTU=\NzU=\MjIw\MjIx\OTQ=\NzQ=\MTU2\OTI=\MjIw\MjU=\OTM=\OTQ=\OTI=\MjY=\Mjk=\MTU4\OTQ=\MjY=\MjIx\MTU4\OTQ=\ODU=\Mjk=\OTM=\MjE5\MTI1\MjIw\OTI=\OTI=\NzQ=\OTI=\MTYx\MzU=\NzQ=\MjIw\MTY0\MzU=\NzQ=\MTU2\OTM=\MjIw\ODg=\OTI=\OTI=\OTI=\OTA=\OTI=\Mjg=\OTI=\NzU=\MjIw\Mjg=\OTI=\NzQ=\MTU2\OTI=\MjIw\ODg=\OTI=\OTI=\OTI=\ODU=\Mjg=\Mjg=\MjIw\ODk=\MTU2\OTI=\OTI=\ODU=\MTU2\MzE=\MjIy\NjY=\OTI=\MjIw\OTI=\NzY=\OTI=\OTI=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OA==\NTc=\MzY=\NDA=\OTI=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjQ=\NDE=\NDQ=\NTc=\MTI0\MTAy\MTI0\MTk=\MjY=\MjY=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjQ=\NDE=\NDQ=\NTc=\MTI0\MTAy\MTI0\MTk=\MTg=\OTI=\ODg=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mw==\Mjc=\OTI=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDc=\NDM=\NTE=\NDY=\NTY=\OTI=\OTM=\OTM=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDM=\NjE=\NTM=\NDA=\OTI=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDQ=\NjE=\NTM=\NDY=\NDc=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTk=\NjE=\NDk=\NTc=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\NDc=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTY=\NTE=\NjM=\NjE=\NDg=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\OTI=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzA=\NjE=\NjM=\NTU=\NDQ=\NjE=\NjM=\NTU=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjc=\NTc=\NDA=\MzE=\NTI=\NTM=\NDg=\NTY=\NDY=\NTc=\NTA=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTg=\NjE=\NDk=\NTc=\OTI=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NjE=\NDY=\NTc=\NTA=\NDA=\OTI=\OTM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTM=\OTA=\OTI=\OTI=\Mzg=\OTA=\OTI=\OTI=\OTQ=\OTI=\OTI=\OTE=\MTA4\OTI=\OTI=\OTI=\ODg=\OTI=\OTI=\OTI=\OTA=\OTI=\Mjg=\OTI=\NzU=\Mjg=\Mjg=\OTI=\NzQ=\MjIw\ODQ=\MjIw\ODg=\OTI=\OTI=\OTI=\ODU=\MjIw\Mjg=\MjIw\ODk=\MTU2\OTI=\OTI=\ODU=\Mjg=\Mjk=\MjIy\ODk=\MjIw\OTM=\OTI=\NjQ=\MjIw\MjIw\OTI=\NzA=\OTI=\OTI=\OTI=\NzQ=\MjIw\ODQ=\MjIw\ODk=\MTU2\OTI=\OTI=\OTA=\OTI=\Mjk=\OTI=\NzU=\Mjg=\Mjk=\OTI=\NzQ=\MTU2\MTYx\MzU=\ODk=\MTU2\OTM=\OTI=\MjU=\OTI=\OTQ=\OTI=\MjY=\Mjg=\MTU4\OTI=\MjY=\MjIw\MTU4\OTI=\MjY=\MTU2\MTU4\OTI=\MjM=\OTI=\MTU5\OTI=\MA==\OTI=\OTI=\OTM=\NjQ=\OTI=\OTM=\OTI=\NzQ=\Mjg=\OTQ=\MjIw\MjY=\Mjk=\MzE=\OTQ=\MjE2\OTM=\MjIw\OTI=\MjE4\OTM=\Mjg=\OTU=\NzU=\MjIw\MjIx\OTQ=\NzQ=\OTI=\OTM=\MjIw\MjU=\OTM=\OTQ=\OTI=\MjY=\Mjk=\MTU4\OTQ=\MjY=\MjIx\MTU4\OTQ=\MjY=\MTU3\MTU5\OTQ=\ODU=\Mjk=\OTM=\MjE5\MTI1\MjIw\OTI=\OTI=\NzQ=\MTU2\MTYw\MzU=\NzQ=\Mjg=\MTY0\MzU=\NzQ=\MTU2\OTM=\MjIw\ODg=\OTI=\OTI=\OTI=\OTA=\OTI=\Mjg=\OTI=\NzU=\MjIw\Mjg=\OTI=\NzQ=\MTU2\OTI=\MjIw\ODg=\OTI=\OTI=\OTI=\ODU=\Mjg=\Mjg=\MjIw\ODk=\MTU2\OTI=\OTI=\ODU=\OTI=\MjQ=\MjIy\NjY=\OTI=\MjIw\OTI=\Nzc=\OTI=\OTI=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OA==\NTc=\MzY=\NDA=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjU=\NDU=\NDE=\NTM=\NDQ=\MTI0\MTAy\MTI0\MTk=\MjY=\MjY=\OTI=\ODg=\ODc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjU=\NDU=\NDE=\NTM=\NDQ=\MTI0\MTAy\MTI0\MTk=\MTg=\OTI=\ODg=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mw==\Mjc=\OTI=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTc=\NDU=\NDE=\NTM=\NDQ=\OTI=\OTM=\OTM=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDM=\NjE=\NTM=\NDA=\OTI=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDQ=\NjE=\NTM=\NDY=\NDc=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTk=\NjE=\NDk=\NTc=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\NDc=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTY=\NTE=\NjM=\NjE=\NDg=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\OTI=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzA=\NjE=\NjM=\NTU=\NDQ=\NjE=\NjM=\NTU=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjc=\NTc=\NDA=\MzE=\NTI=\NTM=\NDg=\NTY=\NDY=\NTc=\NTA=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTg=\NjE=\NDk=\NTc=\OTI=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NjE=\NDY=\NTc=\NTA=\NDA=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\NTI=\NjE=\NDY=\NjE=\NjM=\NDA=\NTc=\NDY=\OTI=\OTM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzI=\OTA=\OTI=\OTI=\MjE1\OTA=\OTI=\OTI=\OTQ=\OTI=\OTI=\OTE=\MTEz\OTI=\OTI=\OTI=\ODg=\OTI=\OTI=\OTI=\OTA=\OTI=\Mjg=\OTI=\NzU=\Mjg=\Mjg=\OTI=\NzQ=\MTU2\OTE=\MjIw\ODg=\OTI=\OTI=\OTI=\ODU=\MjIw\Mjg=\MjIw\ODk=\MTU2\OTI=\OTI=\ODU=\Mjg=\Mjk=\MjIy\ODk=\MjIw\OTM=\OTI=\NjQ=\MjIw\MjIw\OTI=\NzA=\OTI=\OTI=\OTI=\NzQ=\MTU2\OTE=\MjIw\ODk=\MTU2\OTI=\OTI=\OTA=\OTI=\Mjk=\OTI=\NzU=\Mjg=\Mjk=\OTI=\NzQ=\MTU2\MTYx\MzU=\ODk=\MTU2\OTM=\OTI=\MjU=\OTI=\OTQ=\OTI=\MjY=\Mjg=\MTU4\OTI=\MjY=\MjIw\MTU4\OTI=\MjY=\MTU2\MTU4\OTI=\MjM=\OTI=\MTU5\OTI=\MA==\OTI=\OTI=\OTM=\NjQ=\OTI=\OTM=\OTI=\NzQ=\MjIw\OTM=\MjIw\MjY=\Mjk=\MzE=\OTQ=\MjE2\OTM=\MjIw\OTI=\MjE4\OTM=\Mjg=\OTU=\NzU=\MjIw\MjIx\OTQ=\NzQ=\Mjg=\OTI=\MjIw\MjM=\MjIx\MzE=\OTQ=\MA==\Mjk=\OTI=\OTM=\MTI1\MjIw\OTI=\OTI=\NzQ=\MjIw\MTYx\MzU=\NzQ=\OTI=\MTY1\MzU=\NzQ=\MTU2\OTM=\MjIw\ODg=\OTI=\OTI=\OTI=\OTA=\OTI=\Mjg=\OTI=\NzU=\MjIw\Mjg=\OTI=\NzQ=\MTU2\OTI=\MjIw\ODg=\OTI=\OTI=\OTI=\ODU=\Mjg=\Mjg=\MjIw\ODk=\MTU2\OTI=\OTI=\ODU=\MTU2\MzE=\MjIy\NjY=\OTI=\MjIw\OTI=\NzY=\OTI=\OTI=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OA==\NTc=\MzY=\NDA=\OTI=\ODg=\ODM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjk=\NjM=\NDA=\NTM=\NDI=\NjE=\NDA=\NTc=\MTI0\MTAy\MTI0\MTk=\MjY=\MjY=\OTI=\ODg=\ODI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjk=\NjM=\NDA=\NTM=\NDI=\NjE=\NDA=\NTc=\MTI0\MTAy\MTI0\MTk=\MTg=\OTI=\ODg=\OTU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mw==\Mjc=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTg=\NjE=\NDY=\NDk=\OTI=\OTM=\OTM=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDM=\NjE=\NTM=\NDA=\OTI=\ODg=\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NDQ=\NjE=\NTM=\NDY=\NDc=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTk=\NjE=\NDk=\NTc=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\NDc=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTY=\NTE=\NjM=\NjE=\NDg=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\NTI=\NjE=\NDY=\NjE=\NjM=\NDA=\NTc=\NDY=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjc=\NTc=\NDA=\MzE=\NTI=\NTM=\NDg=\NTY=\NDY=\NTc=\NTA=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTg=\NjE=\NDk=\NTc=\OTI=\ODg=\ODU=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\Mjk=\NjM=\NDA=\NTM=\NDI=\NjE=\NDA=\NTc=\OTI=\OTM=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjA5\OTA=\OTI=\OTI=\MjEx\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\ODk=\ODE=\OTI=\OTI=\OTI=\ODk=\OTI=\OTI=\OTI=\OTA=\Mjg=\Mjg=\OTI=\OTA=\MjIw\Mjg=\OTI=\OTA=\MTU2\Mjg=\OTI=\OTA=\OTI=\Mjk=\OTI=\MjU=\Mjg=\OTM=\OTI=\MjY=\MjIw\MTU3\OTI=\MjIx\MTU2\OTM=\OTI=\MTU3\OTI=\OTQ=\OTI=\OTM=\Mjk=\OTQ=\OTI=\MA==\MjIw\OTI=\OTQ=\ODU=\Mjg=\MjIw\MjIy\NjY=\OTI=\MjIw\OTI=\ODY=\OTI=\OTI=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTk=\NjE=\NDk=\NTc=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\NDc=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTY=\NTE=\NjM=\NjE=\NDg=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\NTI=\NjE=\NDY=\NjE=\NjM=\NDA=\NTc=\NDY=\OTI=\ODg=\Nzc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjA=\NDE=\NDk=\NjE=\NTA=\NTE=\NTM=\NTY=\MTQ=\NTE=\NTE=\NDA=\MTI=\NjE=\NDY=\NDA=\OTI=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\MjY=\NDY=\NjE=\NDk=\NTc=\OTI=\ODg=\ODg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTA=\NTc=\NDM=\OTI=\OTU=\MTc=\NzY=\NDE=\Njc=\MTcy\Mzg=\MjU0\MTU2\OTU=\Mg==\MjE3\MjAw\MTk1\OA==\MTg5\MTEw\Mjg=\OTU=\OA==\MTQ=\MTIz\MjUy\MTAx\MjQ4\MjQy\MTU2\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjA1\OTA=\OTI=\OTI=\MjA3\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\ODk=\ODE=\OTI=\OTI=\OTI=\ODk=\OTI=\OTI=\OTI=\OTA=\Mjg=\Mjg=\OTI=\OTA=\MjIw\Mjg=\OTI=\OTA=\MTU2\Mjg=\OTI=\OTA=\OTI=\Mjk=\OTI=\MjU=\Mjg=\OTM=\OTI=\MjY=\MjIw\MTU3\OTI=\MjIx\MTU2\OTM=\OTI=\MTU3\OTI=\OTQ=\OTI=\OTM=\Mjk=\OTQ=\OTI=\MA==\MjIw\OTI=\OTQ=\ODU=\Mjg=\MjIw\MjIy\NjY=\OTI=\MjIw\OTI=\ODY=\OTI=\OTI=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTk=\NjE=\NDk=\NTc=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\NDc=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTY=\NTE=\NjM=\NjE=\NDg=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\NTI=\NjE=\NDY=\NjE=\NjM=\NDA=\NTc=\NDY=\OTI=\ODg=\Nzc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjA=\NDE=\NDk=\NjE=\NTA=\NTE=\NTM=\NTY=\MTQ=\NTE=\NTE=\NDA=\MTI=\NjE=\NDY=\NDA=\OTI=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\MjY=\NDY=\NjE=\NDk=\NTc=\OTI=\ODg=\ODg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTA=\NTc=\NDM=\OTI=\OTU=\MjI=\OTE=\MTgz\MTYz\NDg=\NDI=\MjM2\MTU2\OTU=\MTgz\Njk=\MTkx\OTk=\MjMy\Mjk=\ODA=\Mjg=\OTU=\MTA4\MTE1\MTU2\OTg=\MTY2\MjY=\MjA3\Mjg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjAx\OTA=\OTI=\OTI=\MjAz\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\ODk=\ODE=\OTI=\OTI=\OTI=\ODk=\OTI=\OTI=\OTI=\OTA=\Mjg=\Mjg=\OTI=\OTA=\MjIw\Mjg=\OTI=\OTA=\MTU2\Mjg=\OTI=\OTA=\OTI=\Mjk=\OTI=\MjU=\Mjg=\OTM=\OTI=\MjY=\MjIw\MTU3\OTI=\MjIx\MTU2\OTM=\OTI=\MTU3\OTI=\OTQ=\OTI=\OTM=\Mjk=\OTQ=\OTI=\MA==\MjIw\OTI=\OTQ=\ODU=\Mjg=\MjIw\MjIy\NjY=\OTI=\MjIw\OTI=\ODY=\OTI=\OTI=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTk=\NjE=\NDk=\NTc=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\NDc=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTY=\NTE=\NjM=\NjE=\NDg=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\NTI=\NjE=\NDY=\NjE=\NjM=\NDA=\NTc=\NDY=\OTI=\ODg=\Nzc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjA=\NDE=\NDk=\NjE=\NTA=\NTE=\NTM=\NTY=\MTQ=\NTE=\NTE=\NDA=\MTI=\NjE=\NDY=\NDA=\OTI=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\MjY=\NDY=\NjE=\NDk=\NTc=\OTI=\ODg=\ODg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTA=\NTc=\NDM=\OTI=\OTU=\MTM=\MTA5\MTQ2\MTMx\MjQ4\MTgz\MjUy\Mjg=\OTU=\MTMy\MjA=\OA==\MjUy\MTYx\MjMz\Njk=\Mjg=\OTU=\MTQ5\MjEw\MjA5\Mjg=\MzI=\Mw==\MjQ1\MTU2\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTk3\OTA=\OTI=\OTI=\MTk5\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\ODk=\ODE=\OTI=\OTI=\OTI=\ODk=\OTI=\OTI=\OTI=\OTA=\Mjg=\Mjg=\OTI=\OTA=\MjIw\Mjg=\OTI=\OTA=\MTU2\Mjg=\OTI=\OTA=\OTI=\Mjk=\OTI=\MjU=\Mjg=\OTM=\OTI=\MjY=\MjIw\MTU3\OTI=\MjIx\MTU2\OTM=\OTI=\MTU3\OTI=\OTQ=\OTI=\OTM=\Mjk=\OTQ=\OTI=\MA==\MjIw\OTI=\OTQ=\ODU=\Mjg=\MjIw\MjIy\NjY=\OTI=\MjIw\OTI=\ODY=\OTI=\OTI=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTk=\NjE=\NDk=\NTc=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\NDc=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTY=\NTE=\NjM=\NjE=\NDg=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\NTI=\NjE=\NDY=\NjE=\NjM=\NDA=\NTc=\NDY=\OTI=\ODg=\Nzc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjA=\NDE=\NDk=\NjE=\NTA=\NTE=\NTM=\NTY=\MTQ=\NTE=\NTE=\NDA=\MTI=\NjE=\NDY=\NDA=\OTI=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\MjY=\NDY=\NjE=\NDk=\NTc=\OTI=\ODg=\ODg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTA=\NTc=\NDM=\OTI=\OTU=\MTA0\NTI=\MTgw\MTk1\NA==\MTU4\MjM3\MTU2\OTU=\Mw==\MTM3\MTAw\Njc=\MTU1\ODg=\MTY0\MjI3\OTU=\MTcx\MTQ0\MjA2\OTI=\MjU=\MTgz\MjUy\MTU2\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTkz\OTA=\OTI=\OTI=\MTk1\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\ODk=\ODE=\OTI=\OTI=\OTI=\ODk=\OTI=\OTI=\OTI=\OTA=\Mjg=\Mjg=\OTI=\OTA=\MjIw\Mjg=\OTI=\OTA=\MTU2\Mjg=\OTI=\OTA=\OTI=\Mjk=\OTI=\MjU=\Mjg=\OTM=\OTI=\MjY=\MjIw\MTU3\OTI=\MjIx\MTU2\OTM=\OTI=\MTU3\OTI=\OTQ=\OTI=\OTM=\Mjk=\OTQ=\OTI=\MA==\MjIw\OTI=\OTQ=\ODU=\Mjg=\MjIw\MjIy\NjY=\OTI=\MjIw\OTI=\ODY=\OTI=\OTI=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTk=\NjE=\NDk=\NTc=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\NDc=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTY=\NTE=\NjM=\NjE=\NDg=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\NTI=\NjE=\NDY=\NjE=\NjM=\NDA=\NTc=\NDY=\OTI=\ODg=\Nzc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjA=\NDE=\NDk=\NjE=\NTA=\NTE=\NTM=\NTY=\MTQ=\NTE=\NTE=\NDA=\MTI=\NjE=\NDY=\NDA=\OTI=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\MjY=\NDY=\NjE=\NDk=\NTc=\OTI=\ODg=\ODg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTA=\NTc=\NDM=\OTI=\OTU=\MTA0\NTI=\MTgw\MTk1\NA==\MTU4\MjM3\MTU2\OTU=\Mw==\MTM3\MTAw\Njc=\MTU1\ODg=\MTY0\MjI3\OTU=\MTcx\MTQ0\MjA2\OTI=\MjU=\MTgz\MjUy\MTU2\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjUz\OTA=\OTI=\OTI=\MjU1\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\ODk=\ODE=\OTI=\OTI=\OTI=\ODk=\OTI=\OTI=\OTI=\OTA=\Mjg=\Mjg=\OTI=\OTA=\MjIw\Mjg=\OTI=\OTA=\MTU2\Mjg=\OTI=\OTA=\OTI=\Mjk=\OTI=\MjU=\Mjg=\OTM=\OTI=\MjY=\MjIw\MTU3\OTI=\MjIx\MTU2\OTM=\OTI=\MTU3\OTI=\OTQ=\OTI=\OTM=\Mjk=\OTQ=\OTI=\MA==\MjIw\OTI=\OTQ=\ODU=\Mjg=\MjIw\MjIy\NjY=\OTI=\MjIw\OTI=\ODY=\OTI=\OTI=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTk=\NjE=\NDk=\NTc=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\NDc=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTY=\NTE=\NjM=\NjE=\NDg=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\NTI=\NjE=\NDY=\NjE=\NjM=\NDA=\NTc=\NDY=\OTI=\ODg=\Nzc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjA=\NDE=\NDk=\NjE=\NTA=\NTE=\NTM=\NTY=\MTQ=\NTE=\NTE=\NDA=\MTI=\NjE=\NDY=\NDA=\OTI=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\MjY=\NDY=\NjE=\NDk=\NTc=\OTI=\ODg=\ODg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTA=\NTc=\NDM=\OTI=\OTU=\MTY2\MTM3\NjQ=\MTI0\MTAw\MTI=\MjUx\Mjg=\OTU=\MTk0\MjE0\MjUx\NjA=\MjE3\MjA2\OTM=\Mjg=\OTU=\MTI1\OTQ=\ODI=\MjUz\MTgy\MTUx\MTk2\Mjg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjQ5\OTA=\OTI=\OTI=\MjUx\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\ODk=\ODE=\OTI=\OTI=\OTI=\ODk=\OTI=\OTI=\OTI=\OTA=\Mjg=\Mjg=\OTI=\OTA=\MjIw\Mjg=\OTI=\OTA=\MTU2\Mjg=\OTI=\OTA=\OTI=\Mjk=\OTI=\MjU=\Mjg=\OTM=\OTI=\MjY=\MjIw\MTU3\OTI=\MjIx\MTU2\OTM=\OTI=\MTU3\OTI=\OTQ=\OTI=\OTM=\Mjk=\OTQ=\OTI=\MA==\MjIw\OTI=\OTQ=\ODU=\Mjg=\MjIw\MjIy\NjY=\OTI=\MjIw\OTI=\ODY=\OTI=\OTI=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTk=\NjE=\NDk=\NTc=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\NDc=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTY=\NTE=\NjM=\NjE=\NDg=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\NTI=\NjE=\NDY=\NjE=\NjM=\NDA=\NTc=\NDY=\OTI=\ODg=\Nzc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjA=\NDE=\NDk=\NjE=\NTA=\NTE=\NTM=\NTY=\MTQ=\NTE=\NTE=\NDA=\MTI=\NjE=\NDY=\NDA=\OTI=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\MjY=\NDY=\NjE=\NDk=\NTc=\OTI=\ODg=\ODg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTA=\NTc=\NDM=\OTI=\OTU=\MjEz\MTQy\MTMw\MTg4\NTU=\MjQw\MjAw\MTU2\OTU=\MTY=\Njk=\MTAw\MjUy\MjQ5\MTQx\MzA=\Mjg=\OTU=\MjAx\ODI=\MTM4\MTYz\Njk=\MTg4\MjM5\Mjg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjQ1\OTA=\OTI=\OTI=\MjQ3\OTA=\OTI=\OTI=\OTI=\OTI=\OTI=\ODk=\ODE=\OTI=\OTI=\OTI=\ODk=\OTI=\OTI=\OTI=\OTA=\Mjg=\Mjg=\OTI=\OTA=\MjIw\Mjg=\OTI=\OTA=\MTU2\Mjg=\OTI=\OTA=\OTI=\Mjk=\OTI=\MjU=\Mjg=\OTM=\OTI=\MjY=\MjIw\MTU3\OTI=\MjIx\MTU2\OTM=\OTI=\MTU3\OTI=\OTQ=\OTI=\OTM=\Mjk=\OTQ=\OTI=\MA==\MjIw\OTI=\OTQ=\ODU=\Mjg=\MjIw\MjIy\NjY=\OTI=\MjIw\OTI=\ODY=\OTI=\OTI=\OTI=\ODg=\ODk=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTk=\NjE=\NDk=\NTc=\OTI=\ODg=\ODQ=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\NDc=\OTI=\ODg=\ODA=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MTY=\NTE=\NjM=\NjE=\NDg=\MTI=\NDg=\NjE=\Mzc=\NTc=\NDY=\OTI=\ODg=\ODY=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\NTI=\NjE=\NDY=\NjE=\NjM=\NDA=\NTc=\NDY=\OTI=\ODg=\Nzc=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MjA=\NDE=\NDk=\NjE=\NTA=\NTE=\NTM=\NTY=\MTQ=\NTE=\NTE=\NDA=\MTI=\NjE=\NDY=\NDA=\OTI=\ODg=\OTE=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\MzE=\MjY=\NDY=\NjE=\NDk=\NTc=\OTI=\ODg=\ODg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\NTA=\NTc=\NDM=\OTI=\OTU=\MTA4\NDc=\NDQ=\MTk1\ODc=\MTQx\OTY=\MTU2\OTU=\Nzk=\MTE1\MjQ2\MjUy\MTYx\MTc1\OTQ=\Mjg=\OTU=\MjM4\MTM0\MTYw\MjI3\MTgy\MjE2\MjIx\Mjg=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=\OTI=',SynapseXen_IIIll())()
RAW Paste Data