Empourt

CmHax

Sep 23rd, 2020
1,494
Never
Not a member of Pastebin yet? Sign Up, it unlocks many cool features!
  1. --[[
  2. IronBrew:tm: obfuscation; Version 2.7.2
  3. ]]
  4. return(function(llIllIIIIIIl,lllllIlIlIlIlll,IlllIlIIlllIlIlllIlIlI)local lIIIIIlIIIllII=string.char;local lIIIIlllIllllI=string.sub;local IIllllIllIIlIIll=table.concat;local IIIIlIlllllIIIlIlIIIIIlI=math.ldexp;local IIIIlIlIIlIlIlI=getfenv or function()return _ENV end;local llIIIIlIlII=select;local IIlIIlllllIlIllllllll=unpack or table.unpack;local lIIIlllI=tonumber;local function IllIlIIIIIlIllIIlII(llIllIIIIIIl)local lIIIIIllIIlIIlIlll,llIllllllIIlIllIlIII,IIIIlIllIlIIlIIllIIlIIlIl="","",{}local IIlIIlllllIlIllllllll=256;local IllIIIllIlllIIllllIlIlIl={}for lllllIlIlIlIlll=0,IIlIIlllllIlIllllllll-1 do IllIIIllIlllIIllllIlIlIl[lllllIlIlIlIlll]=lIIIIIlIIIllII(lllllIlIlIlIlll)end;local lllllIlIlIlIlll=1;local function lIIIIIlIIlIIlIII()local lIIIIIllIIlIIlIlll=lIIIlllI(lIIIIlllIllllI(llIllIIIIIIl,lllllIlIlIlIlll,lllllIlIlIlIlll),36)lllllIlIlIlIlll=lllllIlIlIlIlll+1;local llIllllllIIlIllIlIII=lIIIlllI(lIIIIlllIllllI(llIllIIIIIIl,lllllIlIlIlIlll,lllllIlIlIlIlll+lIIIIIllIIlIIlIlll-1),36)lllllIlIlIlIlll=lllllIlIlIlIlll+lIIIIIllIIlIIlIlll;return llIllllllIIlIllIlIII end;lIIIIIllIIlIIlIlll=lIIIIIlIIIllII(lIIIIIlIIlIIlIII())IIIIlIllIlIIlIIllIIlIIlIl[1]=lIIIIIllIIlIIlIlll;while lllllIlIlIlIlll<#llIllIIIIIIl do local lllllIlIlIlIlll=lIIIIIlIIlIIlIII()if IllIIIllIlllIIllllIlIlIl[lllllIlIlIlIlll]then llIllllllIIlIllIlIII=IllIIIllIlllIIllllIlIlIl[lllllIlIlIlIlll]else llIllllllIIlIllIlIII=lIIIIIllIIlIIlIlll..lIIIIlllIllllI(lIIIIIllIIlIIlIlll,1,1)end;IllIIIllIlllIIllllIlIlIl[IIlIIlllllIlIllllllll]=lIIIIIllIIlIIlIlll..lIIIIlllIllllI(llIllllllIIlIllIlIII,1,1)IIIIlIllIlIIlIIllIIlIIlIl[#IIIIlIllIlIIlIIllIIlIIlIl+1],lIIIIIllIIlIIlIlll,IIlIIlllllIlIllllllll=llIllllllIIlIllIlIII,llIllllllIIlIllIlIII,IIlIIlllllIlIllllllll+1 end;return table.concat(IIIIlIllIlIIlIIllIIlIIlIl)end;local lIIIlllI=IllIlIIIIIlIllIIlII('25F24F27524F24727625Y26P26K26J27226P27026Y24F24C27626P26Y26G24F24627625O27026L26Y26Y26P26026I26U24F24A27626126L27226Q27H24527926Q27226W26Y25V27227126Y26R24F24827625N26Y26F26J26526O26F24F28827528M28O26526I26J26J26O26P24F24928226O26R26Z26Y26L24F24427625T26I26Q28G26L25L27226R26I27H27P27528Q29729K29M27H24B29E28527H28127527026O26I26P26J24F29W27526G27226U2A62A824F29126L26X28027626426Q25Z27228S29527525R27227T2A52A727626W29Y28J27625R26R27226E29A26K29C27625V26O27029L2B22B429A24F24327625K2AB26J26126O26L26426V26U29827O2B12B32B526L27X27Z2BI27525P26Y26K26Y26J25S26P25O26N27226G26P24E2752A024F26X28428624F23Z27626527227026S26W26L2A326P26Z2642972BO24S2942AK2CZ26L2D128K2752CJ26O26Q25P26026524D27627523J26O26724F23T2CO2CQ2CS2CU2A426Z25N28427B2CB2AU27026E2DF2DG24F23324G24F2402CO2BO29926L25O26U26D26Y25R26U26F28H2E02E12752782AR26O26K2AC26U2922AJ27525M26326U26Q24T24D25E23L22H22O26F25X21Z24G24D26K23922A23K24722A21W2E42AE2EB2ED2EJ27625I2DK2D724F25L26U2EP27126R27H2EM24F25P2CV26Z26U26X26E2B827526627F26V2BO25R26O26U2AV2FP25L26Y2702AG2EZ2EK23J2F825L22A24R23J26D23V23D2F822J21825123J21O26N23I2F825I1X26N21S25Q21324D2672FL27524N2HB25E24723825C1G22L2362E42AQ24F25H27A29928S2CH25Y28A28C24F23S27626L27126F27226K2C526J26U26Z24L24W24W24S24Q24O24V24P24M2IE24N24O2G524F2HV28B26Y2CY26R2D02HC24F25X2DK29P24F27R29L26Y25N26E26N29V27626226P29G2ET2IZ26R26U27G2IM25O2JD27G26427V26J2BG2AE2C32GI28T27Q2JI26Y2J02FV24D21323L1Q2382H81X2E427J2A126Q26Z2BH2E726L2E92IR2IT25S1D24K23K26O22F142F822M25P24T26726O1N2H22HC22N25C2HB2EK2672DK2AE2BN2AV28U2IZ2A326L27G25O27E2B72AE28W2A62422AK25S25U25U26625T26325B25Z26225P26225A2JR28V28N26J2KD2D52LT24F2LD2JV26Y26Z24E2CF2FX2M12EC26Y2IU24Z2DK29D2LU28O25K28426N2J52K82FP2702K72IS26O26N24D22M22523226823F26U23H2F825124Q22T23K24F142KT2EK25W2DK2K524F25S2612612B02K626Z2I728624D23L23025127525C22D2F82E122N2FN2BU27525O25R26625U25B25K26625Y25N2772762MN26Z2A22A426J24D1P162IL26C22L21T2NS2E125E2DK2L42NY2O025B26425S25M25T2O62HO29T29N2B72IY2A22DQ2I727L2AW2A92MI2CH2FP2O727527A27C27E2JF2NB27L27N2HO27R26L26U26N2A62HO2AS2AU2PQ2762OZ2C42CM27625U2A32C528Y29029224U26326O2CD2NG24F2CY26P27L2GI2CF27523W2DG2PR2AT2JL2D22752PW2B72CH2OB2AV2CH2PW2PC24F2O92QS2AD28L2LV2P72AF2BO26X2CF2M52QA25V25S25S25R25Y25T2602R32AA2AC2IU2E32R32AY2CL2L42602C625O29A26H2JE27H2FP2BE2BX2LB2AK26V2722A62FX29127C2PN26P26W27I2O82K72SB2752ND2NF27625W2DG23Y2EK24F25B2EK2CF2SO2E12SQ2EK2DF2SR2DG2NB24F2QG2762SR2R72SZ2SN2752T32ST2T42CF2812T22T42952CN27629W2T02762T02SW27628K2TL27529W2552DG24H2T427824B2SH24F2TT2QG24L2TJ2T124J2E128K24V2DG29W2IY2SM2TO2T42U727629528823X2LS2752ME2752952T32752TC2CF29D2UQ2R32762DF2DF2HO24F23L2T92A72TX2V02CF2TW27625X2T42T52SM2U12UO2SN24I2V12TN2VF2T32TQ24R2T42DM2CF27P2V62752VN24F2552VL2VR2TU2V22762VS2VA2V92752IL2VD2UT2SY2DF2TK2752UW2SB2SR2WB29W2WD24F2DF2BI2TF2V52WH24F23X2T624F2LF2UP2WP2CF2412WN27527J2E62SS2SB2SV2WT2PY2WO2SB2SL2E12AE2WS2AW2TH2VA29W2XC2SR2XE2WW2XG2AW2UY27J2X92WP2XO2SM2UU2VS2VQ2IV2V92U12XP25B2VF2DG2VH2X82VT2562762632T42VP2TX2Y62V52TX2V82U02U22UP2U42Y024F2UE2TP2QW2UB2SP2YJ2QJ24F2QI24F2662YF2752TF2WN24Q2YV2UC2DF2X52CF2SY2WA2XQ2Z62SV28K2T02WF2X32ZC2V12TB2Z62YL2WG2UX2VA2WB28K24923U2R32CF2E02N42SM2ZT2W224F24Z2WM2XC2YT2YV2NW2EL27927B27D27F27H2PI27M2QN2IZ27S2PO2R02A92BL24D22R21I23222525U27125R2HN2B12QL2AV2OY29L2P02JB2QV2LC2R22762YS2YY2Z02SU2WW2T42Z52WM2Z72WB2UI2T42AE23X2E62DF2CH24F24X2T42WB2492TR2CF2WO2ZB2TX311R2VE2W22952UT311X2X32TN2ZD2ZL2UF31232DF27P2WK2O72DF2X92812QG2YU2XP24F2WV2762FX2PE31072PH27K310B2PL310E2PP310C2PS2QM310V29U2S0310H2RJ310K310M310O310Q2JB2QZ310Y310W2MA2Z72AE2AG2R62YL2MF2A62NB2SG2DG2V027523X2YZ2XX31162Z32SE2DG2IU313R2WM2XY2W22WF2VI311E311V2T3281311D2ZK313K2E627J2PB311L2WB2UX27P2DF2WV2VJ2TX314E2VY27523M2T4313V2W82O7314M2WM27P2VU2WM2QI2CF2882XT314U314I24F23R314L2VF314N278314P31262VT23O2WM3151314V314Z315B314Z2782SQ31532T429D24V2DK31572BI314P2YL315L2WM2LF2WV2XT315G2G631022PB312J31062PG3109312N2PK27Q312Q2PU2AR310T2A62IY26328426W2AY2FU26Y2R82HO2662GI26U26H27H2762IY313L31152E12Z22WP3119313S2UV313U313Y315Q2DK2TA2D2315R2CF2ZN315X312F2FX2QW312K3162313Q2PJ310C2PM310F2RM2AZ2RP2RR2RT2RV2PY2EU2C526L27A26N28Z2RS26L2RU2JF2L4317U28Z26526Y2AY2932FP2QC2QE26J2T0317B2FP25W26Y26E2CY2992R32J82JA2FP25V26Y26X26J26626R316824F312T2QT2762CJ2AZ2GF2FS26U316H2R72TI2Y42UP2D12T0311Q2Z82T1319C2T82WB27J2AQ3177311M314Z2ZA314Z2572XV2ZW3140313Z313V3141319R2CF2952552Y42WU2T428K2XT314H314X319P2TI319V2AW319T2T428131762D22TV2TX319O315H2W2311Q2LS2WB2UP315I314N31562SB2492622T423P319K2XT31AV2YB27631AH2752VC2E131AA2WL31B52AJ31B7319X2VL2CF31B131AF31B031A631B4313Y31B631BI2AJ31AD2952D7312E31AJ2WZ2WN314K313N316U31172Z43116311B2WM313P2AE2UT31422WX310C2U227J2X22WM319J2ZJ2O72ZO2ZQ2V92ZV2E12ZY312A2V931BP2TI26O2QG23X2YX2W931BV313P3119319C313P31CS2T3316V2ZZ2YO311C2Z631CS314A311727J311J319C31D027J31CS27J31C8311729W2UY31C531D32AW31CS2XH31D02812PB2YL31DK312C319D2AJ28131D029531DI2AJ31DK2UN31DU31DY31C027531782E129531DK319M2XA28K28K31D0278317B31E62WM31EF2W22SR31EG31E52BU2UA27528831DQ2O728831D027P31CS27P314C311728831EQ2B831ET27P29D31D028831CS28831EV311729D2L42762BI31ET2882BI2DF2UE31F62K92UE27829D2LF2UE28829D2WV2YK2B82E62X529D2X72VA29D29D2WO2SR31G42YR31G32B823V31172LF2ZP2E131FR2WM2YX2PY315K2DG2DM2HZ2UE2UR3150317Q2CF2YX31G024F31AV2XA31G831592X52BI23N2762X52LF31H3313K2752WV31H72DG31FV31GI2WP23Q2B831GP24F314K2V031HI2N42SO31GV25931DU31G831D02BI25831H42752LF2SW2X52WV319O31H82E52W127629D311H31GS24F2LS31G52UK24F31HQ31GY2B82Z22E6315O31H42642WQ2VT31HW312G2W12X52E62TR31GG31I42DF31282Y431GL2T42542HY2YP2WM29D253317Q31IX2T431GV2NO31IG31F731172BI25031IP2LF31JH31IV2LF31J92WM2522B831GV31GX31GA29D31H027531H231JI24F31HB31I031JZ2EK31HD31JN2DF31HG31J02DF31HK31FD31IE31HR31IH31JF2ZX31JY31HZ31H924F24Y31IP2E62UC31I731HE2WM31IB31KB31IF31JT31EO2BI311L31I32LF24W31IP31FW31KM24F31L131IV31I82TF2DF31IZ31J42DF24U2T52UE2DF24T24F2D131JR31KD31JU31KF313M31GD24F31LP31K131LP31I631IQ31K524F2VL31IC2B82IL31JD24F24P31KV24N31J831M431JQ31ID2XW31KV31HT31IO31KZ31MF31172WV31IU311731IT31K331IW31M824M31HH2Z624K24F2U42UE27J29D2VF2TF27J2CN31D029D31JS31G72B831JV2K931LS31HX31LR31L231NC31IV2WV31JN27J31K731KB31N531ID31LN31H131K231MG31KI31IQ31KO31LW317Q27J2TT31M029D31KU31N631JE31NO2E431NQ31H42E62WV2DK313K2DF31KN31MN31L831C531KS31HP31LM31KW31IR31NB31BP31K131NR2E626531OD31KQ27J31LB31GV31M231KV31IM31O124F2Y631N02QB31MR2SB31AT2NF31LL31M331N831JX31O531I32WV31NT31NG31NV24F2RG31J027J25Z2IN31J427J2V82SJ31MW24F25V31PN2UE29W29D25U317Q29W31N231NK31OI31PA31NE31LQ31NA31IQ31LU31ID31PG2TF29W31NJ31P831KV31Q531K031NB31NR31PE31MN31QC2YL31NX31KT31OI31ME25T31KH31ND25S31L431NT31OE2AW31OG31ID31O031NM31OJ31NR2LF25R31ND31OO24F31OQ31L731KQ29W31OU31ID31OW31OZ31OY31R531P12YL31IM31J029W31AT25Q31Q331P931KF31QJ31IN31QL31I531QB31RF31PI31P429W31PM25Y31J429W31PQ31S831PT31PV2CG2B825P317Q28131Q231QG31OZ31Q531Q82LF31Q82WV31LU31GC31K42CM2HZ28131QF31ID31NL2B831NN31JW31NP31LQ31RZ31PF31KQ28131QQ31OH31M331ME31O431T431ND25O31QY31OR31JN28131R22B831R431T031R631JY2O631PD31OK31I431RD31HC31MO2TF28131RH31M131OI31RL31TO31RN2AJ31RP31J428131AT25M31RU31QH31RW31QV31TS31T631TJ31S331J028131S631U82XU31PR31SE31PU31S72UE29529D25L317Q2TE31EO31N431Q431LO31JY31SP31Q631LV31QO2D231SX2B831SZ31GZ31UE31PC31MI31S02B831V729531T931R331QS31KF25K31UF31VF31TG31I331OC31RE31JN29531TL31NZ31VM31NO31R724F25J31RA31L431TV31LV31R029531U029D31RJ31R531U331G831U529531U731UT24F31AT25I31UC31SL31VD31TE313K31KL31QM31NF31KQ29531PJ31J429531UM31WJ31SA31WJ31UR31J428K29D25H317Q28K31Q231CE2UL2UO2ZV311F31M72BI25G31DU2BI2BI2742762LF2UL31FG31EJ2DG2BI2T331CE31XU2V124F2ZV2CH23X31M72LF31XJ2XA2LF2LF31XN31KJ2C12DG31JM311A31NB31XV2ZP31YD31XE2TG31H431M72WV31Y52VA2WV2WV31Y931I42WR2DG31PG2FL314H319W2ZP2WV31DC31CG316Z313K31M72E631YO2SR2E62E631YS2CN312H2DG31I82FL2E631YG31I42XC2QG31CH31YL2PY31Z82YW2PY31YS2SL31BR27631Q22FL2CN2UO31CM2DG');local lllllIlIlIlIlll=(bit or bit32);local IIIIlIllIlIIlIIllIIlIIlIl=lllllIlIlIlIlll and lllllIlIlIlIlll.bxor or function(lllllIlIlIlIlll,lIIIIIllIIlIIlIlll)local llIllllllIIlIllIlIII,IIIIlIllIlIIlIIllIIlIIlIl,lIIIIlllIllllI=1,0,10 while lllllIlIlIlIlll>0 and lIIIIIllIIlIIlIlll>0 do local IllIIIllIlllIIllllIlIlIl,lIIIIlllIllllI=lllllIlIlIlIlll%2,lIIIIIllIIlIIlIlll%2 if IllIIIllIlllIIllllIlIlIl~=lIIIIlllIllllI then IIIIlIllIlIIlIIllIIlIIlIl=IIIIlIllIlIIlIIllIIlIIlIl+llIllllllIIlIllIlIII end lllllIlIlIlIlll,lIIIIIllIIlIIlIlll,llIllllllIIlIllIlIII=(lllllIlIlIlIlll-IllIIIllIlllIIllllIlIlIl)/2,(lIIIIIllIIlIIlIlll-lIIIIlllIllllI)/2,llIllllllIIlIllIlIII*2 end if lllllIlIlIlIlll<lIIIIIllIIlIIlIlll then lllllIlIlIlIlll=lIIIIIllIIlIIlIlll end while lllllIlIlIlIlll>0 do local lIIIIIllIIlIIlIlll=lllllIlIlIlIlll%2 if lIIIIIllIIlIIlIlll>0 then IIIIlIllIlIIlIIllIIlIIlIl=IIIIlIllIlIIlIIllIIlIIlIl+llIllllllIIlIllIlIII end lllllIlIlIlIlll,llIllllllIIlIllIlIII=(lllllIlIlIlIlll-lIIIIIllIIlIIlIlll)/2,llIllllllIIlIllIlIII*2 end return IIIIlIllIlIIlIIllIIlIIlIl end local function llIllllllIIlIllIlIII(lIIIIIllIIlIIlIlll,lllllIlIlIlIlll,llIllllllIIlIllIlIII)if llIllllllIIlIllIlIII then local lllllIlIlIlIlll=(lIIIIIllIIlIIlIlll/2^(lllllIlIlIlIlll-1))%2^((llIllllllIIlIllIlIII-1)-(lllllIlIlIlIlll-1)+1);return lllllIlIlIlIlll-lllllIlIlIlIlll%1;else local lllllIlIlIlIlll=2^(lllllIlIlIlIlll-1);return(lIIIIIllIIlIIlIlll%(lllllIlIlIlIlll+lllllIlIlIlIlll)>=lllllIlIlIlIlll)and 1 or 0;end;end;local lllllIlIlIlIlll=1;local function lIIIIIllIIlIIlIlll()local llIllllllIIlIllIlIII,lIIIIIllIIlIIlIlll,IllIIIllIlllIIllllIlIlIl,lIIIIlllIllllI=llIllIIIIIIl(lIIIlllI,lllllIlIlIlIlll,lllllIlIlIlIlll+3);llIllllllIIlIllIlIII=IIIIlIllIlIIlIIllIIlIIlIl(llIllllllIIlIllIlIII,159)lIIIIIllIIlIIlIlll=IIIIlIllIlIIlIIllIIlIIlIl(lIIIIIllIIlIIlIlll,159)IllIIIllIlllIIllllIlIlIl=IIIIlIllIlIIlIIllIIlIIlIl(IllIIIllIlllIIllllIlIlIl,159)lIIIIlllIllllI=IIIIlIllIlIIlIIllIIlIIlIl(lIIIIlllIllllI,159)lllllIlIlIlIlll=lllllIlIlIlIlll+4;return(lIIIIlllIllllI*16777216)+(IllIIIllIlllIIllllIlIlIl*65536)+(lIIIIIllIIlIIlIlll*256)+llIllllllIIlIllIlIII;end;local function lIIIIIlIIlIIlIII()local lIIIIIllIIlIIlIlll=IIIIlIllIlIIlIIllIIlIIlIl(llIllIIIIIIl(lIIIlllI,lllllIlIlIlIlll,lllllIlIlIlIlll),159);lllllIlIlIlIlll=lllllIlIlIlIlll+1;return lIIIIIllIIlIIlIlll;end;local function IllIIIllIlllIIllllIlIlIl()local lIIIIIllIIlIIlIlll,llIllllllIIlIllIlIII=llIllIIIIIIl(lIIIlllI,lllllIlIlIlIlll,lllllIlIlIlIlll+2);lIIIIIllIIlIIlIlll=IIIIlIllIlIIlIIllIIlIIlIl(lIIIIIllIIlIIlIlll,159)llIllllllIIlIllIlIII=IIIIlIllIlIIlIIllIIlIIlIl(llIllllllIIlIllIlIII,159)lllllIlIlIlIlll=lllllIlIlIlIlll+2;return(llIllllllIIlIllIlIII*256)+lIIIIIllIIlIIlIlll;end;local function llIIIllIllIllI()local IIIIlIllIlIIlIIllIIlIIlIl=lIIIIIllIIlIIlIlll();local lllllIlIlIlIlll=lIIIIIllIIlIIlIlll();local lIIIIlllIllllI=1;local IIIIlIllIlIIlIIllIIlIIlIl=(llIllllllIIlIllIlIII(lllllIlIlIlIlll,1,20)*(2^32))+IIIIlIllIlIIlIIllIIlIIlIl;local lIIIIIllIIlIIlIlll=llIllllllIIlIllIlIII(lllllIlIlIlIlll,21,31);local lllllIlIlIlIlll=((-1)^llIllllllIIlIllIlIII(lllllIlIlIlIlll,32));if(lIIIIIllIIlIIlIlll==0)then if(IIIIlIllIlIIlIIllIIlIIlIl==0)then return lllllIlIlIlIlll*0;else lIIIIIllIIlIIlIlll=1;lIIIIlllIllllI=0;end;elseif(lIIIIIllIIlIIlIlll==2047)then return(IIIIlIllIlIIlIIllIIlIIlIl==0)and(lllllIlIlIlIlll*(1/0))or(lllllIlIlIlIlll*(0/0));end;return IIIIlIlllllIIIlIlIIIIIlI(lllllIlIlIlIlll,lIIIIIllIIlIIlIlll-1023)*(lIIIIlllIllllI+(IIIIlIllIlIIlIIllIIlIIlIl/(2^52)));end;local IllIlIIIIIlIllIIlII=lIIIIIllIIlIIlIlll;local function IIIIlIlllllIIIlIlIIIIIlI(lIIIIIllIIlIIlIlll)local llIllllllIIlIllIlIII;if(not lIIIIIllIIlIIlIlll)then lIIIIIllIIlIIlIlll=IllIlIIIIIlIllIIlII();if(lIIIIIllIIlIIlIlll==0)then return'';end;end;llIllllllIIlIllIlIII=lIIIIlllIllllI(lIIIlllI,lllllIlIlIlIlll,lllllIlIlIlIlll+lIIIIIllIIlIIlIlll-1);lllllIlIlIlIlll=lllllIlIlIlIlll+lIIIIIllIIlIIlIlll;local lIIIIIllIIlIIlIlll={}for lllllIlIlIlIlll=1,#llIllllllIIlIllIlIII do lIIIIIllIIlIIlIlll[lllllIlIlIlIlll]=lIIIIIlIIIllII(IIIIlIllIlIIlIIllIIlIIlIl(llIllIIIIIIl(lIIIIlllIllllI(llIllllllIIlIllIlIII,lllllIlIlIlIlll,lllllIlIlIlIlll)),159))end return IIllllIllIIlIIll(lIIIIIllIIlIIlIlll);end;local lllllIlIlIlIlll=lIIIIIllIIlIIlIlll;local function lIIIIIll(...)return{...},llIIIIlIlII('#',...)end local function lIIIlllI()local llIllIIIIIIl={};local IIIIlIllIlIIlIIllIIlIIlIl={};local lllllIlIlIlIlll={};local lIIIIIlIIIllII={[#{{400;836;811;734};{700;375;898;25};}]=IIIIlIllIlIIlIIllIIlIIlIl,[#{{600;385;356;36};"1 + 1 = 111";"1 + 1 = 111";}]=nil,[#{"1 + 1 = 111";"1 + 1 = 111";{855;564;333;327};"1 + 1 = 111";}]=lllllIlIlIlIlll,[#{"1 + 1 = 111";}]=llIllIIIIIIl,};local lllllIlIlIlIlll=lIIIIIllIIlIIlIlll()local lIIIIlllIllllI={}for llIllllllIIlIllIlIII=1,lllllIlIlIlIlll do local lIIIIIllIIlIIlIlll=lIIIIIlIIlIIlIII();local lllllIlIlIlIlll;if(lIIIIIllIIlIIlIlll==1)then lllllIlIlIlIlll=(lIIIIIlIIlIIlIII()~=0);elseif(lIIIIIllIIlIIlIlll==2)then lllllIlIlIlIlll=llIIIllIllIllI();elseif(lIIIIIllIIlIIlIlll==0)then lllllIlIlIlIlll=IIIIlIlllllIIIlIlIIIIIlI();end;lIIIIlllIllllI[llIllllllIIlIllIlIII]=lllllIlIlIlIlll;end;for lllllIlIlIlIlll=1,lIIIIIllIIlIIlIlll()do IIIIlIllIlIIlIIllIIlIIlIl[lllllIlIlIlIlll-1]=lIIIlllI();end;for lIIIlllI=1,lIIIIIllIIlIIlIlll()do local lllllIlIlIlIlll=lIIIIIlIIlIIlIII();if(llIllllllIIlIllIlIII(lllllIlIlIlIlll,1,1)==0)then local IIIIlIllIlIIlIIllIIlIIlIl=llIllllllIIlIllIlIII(lllllIlIlIlIlll,2,3);local IIlIIlllllIlIllllllll=llIllllllIIlIllIlIII(lllllIlIlIlIlll,4,6);local lllllIlIlIlIlll={IllIIIllIlllIIllllIlIlIl(),IllIIIllIlllIIllllIlIlIl(),nil,nil};if(IIIIlIllIlIIlIIllIIlIIlIl==0)then lllllIlIlIlIlll[#("uLG")]=IllIIIllIlllIIllllIlIlIl();lllllIlIlIlIlll[#("Djcm")]=IllIIIllIlllIIllllIlIlIl();elseif(IIIIlIllIlIIlIIllIIlIIlIl==1)then lllllIlIlIlIlll[#("2fx")]=lIIIIIllIIlIIlIlll();elseif(IIIIlIllIlIIlIIllIIlIIlIl==2)then lllllIlIlIlIlll[#("0sV")]=lIIIIIllIIlIIlIlll()-(2^16)elseif(IIIIlIllIlIIlIIllIIlIIlIl==3)then lllllIlIlIlIlll[#("p2J")]=lIIIIIllIIlIIlIlll()-(2^16)lllllIlIlIlIlll[#("kvsV")]=IllIIIllIlllIIllllIlIlIl();end;if(llIllllllIIlIllIlIII(IIlIIlllllIlIllllllll,1,1)==1)then lllllIlIlIlIlll[#("ux")]=lIIIIlllIllllI[lllllIlIlIlIlll[#("Qi")]]end if(llIllllllIIlIllIlIII(IIlIIlllllIlIllllllll,2,2)==1)then lllllIlIlIlIlll[#("eS8")]=lIIIIlllIllllI[lllllIlIlIlIlll[#("BkR")]]end if(llIllllllIIlIllIlIII(IIlIIlllllIlIllllllll,3,3)==1)then lllllIlIlIlIlll[#("yskn")]=lIIIIlllIllllI[lllllIlIlIlIlll[#("yJRV")]]end llIllIIIIIIl[lIIIlllI]=lllllIlIlIlIlll;end end;lIIIIIlIIIllII[3]=lIIIIIlIIlIIlIII();return lIIIIIlIIIllII;end;local function IIllllIllIIlIIll(lllllIlIlIlIlll,llIllIIIIIIl,IllIIIllIlllIIllllIlIlIl)lllllIlIlIlIlll=(lllllIlIlIlIlll==true and lIIIlllI())or lllllIlIlIlIlll;return(function(...)local IIIIlIllIlIIlIIllIIlIIlIl=lllllIlIlIlIlll[1];local lIIIIlllIllllI=lllllIlIlIlIlll[3];local IllIlIIIIIlIllIIlII=lllllIlIlIlIlll[2];local IIIIlIlllllIIIlIlIIIIIlI=lIIIIIll local lIIIIIllIIlIIlIlll=1;local lIIIlllI=-1;local IIIIlIlIIlIlIlI={};local lIIIIIlIIIllII={...};local lIIIIIlIIlIIlIII=llIIIIlIlII('#',...)-1;local llIIIIlIlII={};local llIllllllIIlIllIlIII={};for lllllIlIlIlIlll=0,lIIIIIlIIlIIlIII do if(lllllIlIlIlIlll>=lIIIIlllIllllI)then IIIIlIlIIlIlIlI[lllllIlIlIlIlll-lIIIIlllIllllI]=lIIIIIlIIIllII[lllllIlIlIlIlll+1];else llIllllllIIlIllIlIII[lllllIlIlIlIlll]=lIIIIIlIIIllII[lllllIlIlIlIlll+#{{92;822;138;753};}];end;end;local lllllIlIlIlIlll=lIIIIIlIIlIIlIII-lIIIIlllIllllI+1 local lllllIlIlIlIlll;local lIIIIlllIllllI;while true do lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];lIIIIlllIllllI=lllllIlIlIlIlll[#("B")];if lIIIIlllIllllI<=#("clsMOW7J9H3X5YUUjkez5CTclSrUUFIkWOI")then if lIIIIlllIllllI<=#("0iP2b0pSZXyHKJx3P")then if lIIIIlllIllllI<=#("9LDqA6Fm")then if lIIIIlllIllllI<=#("E8T")then if lIIIIlllIllllI<=#{"1 + 1 = 111";}then if lIIIIlllIllllI==#("")then llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Mc")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("QCk")]][lllllIlIlIlIlll[#("sNbM")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Du")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#{{524;750;858;10};"1 + 1 = 111";"1 + 1 = 111";}]][lllllIlIlIlIlll[#("8rQa")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("H4")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("ucb")]][lllllIlIlIlIlll[#("x0UI")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("NN")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("qV1")]][lllllIlIlIlIlll[#("QsjX")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("a4")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("t89")]][lllllIlIlIlIlll[#("ogdC")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#{"1 + 1 = 111";"1 + 1 = 111";}]][lllllIlIlIlIlll[#("aO1")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("sqEJ")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];lIIIIIllIIlIIlIlll=lllllIlIlIlIlll[#("tPk")];else local lIIIIlllIllllI;llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("RH")]]=IllIIIllIlllIIllllIlIlIl[lllllIlIlIlIlll[#("f8R")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("WE")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("3IJ")]][lllllIlIlIlIlll[#("Cysp")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("MS")]]=lllllIlIlIlIlll[#("5qt")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("cm")]]=llIllIIIIIIl[lllllIlIlIlIlll[#("i6o")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];lIIIIlllIllllI=lllllIlIlIlIlll[#("LJ")]llIllllllIIlIllIlIII[lIIIIlllIllllI]=llIllllllIIlIllIlIII[lIIIIlllIllllI](IIlIIlllllIlIllllllll(llIllllllIIlIllIlIII,lIIIIlllIllllI+1,lllllIlIlIlIlll[#("0Cu")]))lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Ex")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("0TN")]][lllllIlIlIlIlll[#("ZiAP")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Gb")]][lllllIlIlIlIlll[#("l48")]]=lllllIlIlIlIlll[#("3Psr")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("it")]][lllllIlIlIlIlll[#{"1 + 1 = 111";"1 + 1 = 111";{135;361;245;992};}]]=lllllIlIlIlIlll[#("HJMS")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];do return end;end;elseif lIIIIlllIllllI>#("3b")then local lllllIlIlIlIlll=lllllIlIlIlIlll[#("aY")]llIllllllIIlIllIlIII[lllllIlIlIlIlll]=llIllllllIIlIllIlIII[lllllIlIlIlIlll](llIllllllIIlIllIlIII[lllllIlIlIlIlll+1])else local lIIIIlllIllllI;llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("SU")]]=lllllIlIlIlIlll[#("r7T")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];lIIIIlllIllllI=lllllIlIlIlIlll[#("3g")]llIllllllIIlIllIlIII[lIIIIlllIllllI]=llIllllllIIlIllIlIII[lIIIIlllIllllI](IIlIIlllllIlIllllllll(llIllllllIIlIllIlIII,lIIIIlllIllllI+1,lllllIlIlIlIlll[#("u1n")]))lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("R8")]][lllllIlIlIlIlll[#("mCt")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("ez30")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("l0")]]=IllIIIllIlllIIllllIlIlIl[lllllIlIlIlIlll[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("O1")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#{"1 + 1 = 111";"1 + 1 = 111";{73;65;191;253};}]][lllllIlIlIlIlll[#("mKJg")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("LF")]]=lllllIlIlIlIlll[#("t1x")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("eb")]]=lllllIlIlIlIlll[#("uo8")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#{{748;531;503;844};"1 + 1 = 111";}]]=lllllIlIlIlIlll[#("KHZ")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("2S")]]=lllllIlIlIlIlll[#("E6f")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];lIIIIlllIllllI=lllllIlIlIlIlll[#("DJ")]llIllllllIIlIllIlIII[lIIIIlllIllllI]=llIllllllIIlIllIlIII[lIIIIlllIllllI](IIlIIlllllIlIllllllll(llIllllllIIlIllIlIII,lIIIIlllIllllI+1,lllllIlIlIlIlll[#("n22")]))lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("xV")]][lllllIlIlIlIlll[#("nMg")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("RXhR")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("O3")]]=IllIIIllIlllIIllllIlIlIl[lllllIlIlIlIlll[#("zKY")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Uj")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("o4N")]][lllllIlIlIlIlll[#{{610;50;38;148};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#{"1 + 1 = 111";{55;894;99;413};}]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("D4d")]][lllllIlIlIlIlll[#("I3FK")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("2r")]][lllllIlIlIlIlll[#("Kvb")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#{"1 + 1 = 111";{78;14;74;665};{19;178;281;345};"1 + 1 = 111";}]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("M1")]][lllllIlIlIlIlll[#{{57;671;852;683};"1 + 1 = 111";"1 + 1 = 111";}]]=lllllIlIlIlIlll[#("TOW8")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("hH")]]=IllIIIllIlllIIllllIlIlIl[lllllIlIlIlIlll[#("NXJ")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("f5")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("GE0")]][lllllIlIlIlIlll[#("cEC6")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("W0")]]=lllllIlIlIlIlll[#("V6O")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("ua")]]=lllllIlIlIlIlll[#("V88")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("1o")]]=lllllIlIlIlIlll[#("ByU")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];lIIIIlllIllllI=lllllIlIlIlIlll[#("yZ")]llIllllllIIlIllIlIII[lIIIIlllIllllI]=llIllllllIIlIllIlIII[lIIIIlllIllllI](IIlIIlllllIlIllllllll(llIllllllIIlIllIlIII,lIIIIlllIllllI+1,lllllIlIlIlIlll[#("32d")]))lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#{{760;108;724;54};{947;683;826;204};}]][lllllIlIlIlIlll[#("2PL")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("O1")]][lllllIlIlIlIlll[#("1We")]]=lllllIlIlIlIlll[#("gILq")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("ML")]][lllllIlIlIlIlll[#("DBV")]]=lllllIlIlIlIlll[#("9frc")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Da")]][lllllIlIlIlIlll[#("afe")]]=lllllIlIlIlIlll[#{"1 + 1 = 111";{565;218;497;882};"1 + 1 = 111";{666;226;376;837};}];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("bq")]][lllllIlIlIlIlll[#("dhl")]]=lllllIlIlIlIlll[#("AYbh")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("ev")]][lllllIlIlIlIlll[#("pvP")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("dajD")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IllIIIllIlllIIllllIlIlIl[lllllIlIlIlIlll[#("xqQ")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("21")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("EDW")]][lllllIlIlIlIlll[#("FfIu")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#{{439;819;616;238};"1 + 1 = 111";}]]=lllllIlIlIlIlll[#("T9Z")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("RM")]]=lllllIlIlIlIlll[#("28P")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("mE")]]=lllllIlIlIlIlll[#("1Po")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];lIIIIlllIllllI=lllllIlIlIlIlll[#("BS")]llIllllllIIlIllIlIII[lIIIIlllIllllI]=llIllllllIIlIllIlIII[lIIIIlllIllllI](IIlIIlllllIlIllllllll(llIllllllIIlIllIlIII,lIIIIlllIllllI+1,lllllIlIlIlIlll[#("nxU")]))lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("lD")]][lllllIlIlIlIlll[#("t9M")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("9Kee")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("DE")]]=IllIIIllIlllIIllllIlIlIl[lllllIlIlIlIlll[#("QHt")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Pt")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("9aE")]][lllllIlIlIlIlll[#("alFN")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("8s")]]=lllllIlIlIlIlll[#("gJG")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("IX")]]=lllllIlIlIlIlll[#{"1 + 1 = 111";{707;280;276;111};{829;241;345;754};}];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("v8")]]=lllllIlIlIlIlll[#{"1 + 1 = 111";"1 + 1 = 111";{949;677;917;279};}];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];lIIIIlllIllllI=lllllIlIlIlIlll[#("pb")]llIllllllIIlIllIlIII[lIIIIlllIllllI]=llIllllllIIlIllIlIII[lIIIIlllIllllI](IIlIIlllllIlIllllllll(llIllllllIIlIllIlIII,lIIIIlllIllllI+1,lllllIlIlIlIlll[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]))lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("53")]][lllllIlIlIlIlll[#("gvy")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("OxU6")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("m5")]]=IllIIIllIlllIIllllIlIlIl[lllllIlIlIlIlll[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Cq")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("0be")]][lllllIlIlIlIlll[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("WL")]]=lllllIlIlIlIlll[#("Qs2")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("92")]]=lllllIlIlIlIlll[#("Ee2")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("x6")]]=lllllIlIlIlIlll[#("inQ")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Fn")]]=lllllIlIlIlIlll[#("FTe")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];lIIIIlllIllllI=lllllIlIlIlIlll[#("mW")]llIllllllIIlIllIlIII[lIIIIlllIllllI]=llIllllllIIlIllIlIII[lIIIIlllIllllI](IIlIIlllllIlIllllllll(llIllllllIIlIllIlIII,lIIIIlllIllllI+1,lllllIlIlIlIlll[#("hHs")]))lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("zi")]][lllllIlIlIlIlll[#("2SA")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("BHl3")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("W0")]]=IllIIIllIlllIIllllIlIlIl[lllllIlIlIlIlll[#("NEd")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("4k")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("xck")]][lllllIlIlIlIlll[#("fzis")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Tq")]]=lllllIlIlIlIlll[#("6Qu")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("oq")]]=lllllIlIlIlIlll[#("uaL")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("xm")]]=lllllIlIlIlIlll[#("uvD")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#{"1 + 1 = 111";"1 + 1 = 111";}]]=lllllIlIlIlIlll[#("QlF")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];lIIIIlllIllllI=lllllIlIlIlIlll[#("lJ")]llIllllllIIlIllIlIII[lIIIIlllIllllI]=llIllllllIIlIllIlIII[lIIIIlllIllllI](IIlIIlllllIlIllllllll(llIllllllIIlIllIlIII,lIIIIlllIllllI+1,lllllIlIlIlIlll[#("qfx")]))lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("a9")]][lllllIlIlIlIlll[#("SLt")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("4I6L")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#{{11;472;20;691};{669;460;372;718};}]]=IllIIIllIlllIIllllIlIlIl[lllllIlIlIlIlll[#("3oo")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("KS")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#{{902;372;597;540};{362;155;412;542};{633;702;39;606};}]][lllllIlIlIlIlll[#{"1 + 1 = 111";{363;576;308;569};"1 + 1 = 111";{864;838;115;159};}]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("uX")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("dcp")]][lllllIlIlIlIlll[#("oszi")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("iP")]][lllllIlIlIlIlll[#("ygW")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("RqmA")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("b1")]][lllllIlIlIlIlll[#("65h")]]=lllllIlIlIlIlll[#("uCvV")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("0p")]]=IllIIIllIlllIIllllIlIlIl[lllllIlIlIlIlll[#("pH7")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("rh")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("9pE")]][lllllIlIlIlIlll[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("oi")]]=lllllIlIlIlIlll[#("Q15")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#{"1 + 1 = 111";{366;680;361;304};}]]=lllllIlIlIlIlll[#("vye")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("zn")]]=lllllIlIlIlIlll[#("WLx")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];lIIIIlllIllllI=lllllIlIlIlIlll[#("5W")]llIllllllIIlIllIlIII[lIIIIlllIllllI]=llIllllllIIlIllIlIII[lIIIIlllIllllI](IIlIIlllllIlIllllllll(llIllllllIIlIllIlIII,lIIIIlllIllllI+1,lllllIlIlIlIlll[#("AvZ")]))lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Ci")]][lllllIlIlIlIlll[#("5PA")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Mcmn")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("3i")]][lllllIlIlIlIlll[#("tpx")]]=lllllIlIlIlIlll[#{{750;275;824;448};"1 + 1 = 111";"1 + 1 = 111";{682;39;971;622};}];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("C4")]][lllllIlIlIlIlll[#("DWR")]]=lllllIlIlIlIlll[#("s5TC")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Wn")]][lllllIlIlIlIlll[#("qWa")]]=lllllIlIlIlIlll[#("hidc")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Ns")]][lllllIlIlIlIlll[#("MOA")]]=lllllIlIlIlIlll[#("YlSD")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("rv")]][lllllIlIlIlIlll[#("h3D")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("sS")]]=IllIIIllIlllIIllllIlIlIl[lllllIlIlIlIlll[#{{377;273;971;348};"1 + 1 = 111";"1 + 1 = 111";}]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("yH")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("J3g")]][lllllIlIlIlIlll[#("nONd")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Xg")]]=lllllIlIlIlIlll[#("RuG")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("I5")]]=lllllIlIlIlIlll[#("0t8")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("nn")]]=lllllIlIlIlIlll[#("Fi2")];end;elseif lIIIIlllIllllI<=#("mxflb")then if lIIIIlllIllllI>#("zuUk")then local lIIIIIllIIlIIlIlll=lllllIlIlIlIlll[#("KJ")]llIllllllIIlIllIlIII[lIIIIIllIIlIIlIlll]=llIllllllIIlIllIlIII[lIIIIIllIIlIIlIlll](IIlIIlllllIlIllllllll(llIllllllIIlIllIlIII,lIIIIIllIIlIIlIlll+1,lllllIlIlIlIlll[#("QS0")]))else local lIIIlllI;local lIIIIlllIllllI;llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("96")]]=IllIIIllIlllIIllllIlIlIl[lllllIlIlIlIlll[#("KMM")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("d0")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("5NF")]][lllllIlIlIlIlll[#("lgkd")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("lD")]]=lllllIlIlIlIlll[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("C0")]]=llIllIIIIIIl[lllllIlIlIlIlll[#("4an")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];lIIIIlllIllllI=lllllIlIlIlIlll[#("og")]llIllllllIIlIllIlIII[lIIIIlllIllllI]=llIllllllIIlIllIlIII[lIIIIlllIllllI](IIlIIlllllIlIllllllll(llIllllllIIlIllIlIII,lIIIIlllIllllI+1,lllllIlIlIlIlll[#("QYP")]))lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("pN")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("qQ4")]][lllllIlIlIlIlll[#("pht8")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#{{90;31;685;349};{641;323;875;834};}]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Q9R")]][lllllIlIlIlIlll[#("zS4z")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Xf")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("b3t")]][lllllIlIlIlIlll[#("tti0")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#{{809;273;461;913};{173;541;229;850};}]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("ZvW")]][lllllIlIlIlIlll[#{"1 + 1 = 111";"1 + 1 = 111";{923;642;335;610};"1 + 1 = 111";}]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("3J")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("ru7")]][lllllIlIlIlIlll[#("5oJs")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];lIIIIlllIllllI=lllllIlIlIlIlll[#("Od")];lIIIlllI=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#{{425;128;86;355};"1 + 1 = 111";"1 + 1 = 111";}]];llIllllllIIlIllIlIII[lIIIIlllIllllI+1]=lIIIlllI;llIllllllIIlIllIlIII[lIIIIlllIllllI]=lIIIlllI[lllllIlIlIlIlll[#("OsQu")]];end;elseif lIIIIlllIllllI<=#("iPGnP7")then local lIIIIlllIllllI;llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Mr")]]=llIllIIIIIIl[lllllIlIlIlIlll[#("mtG")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("mp")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("4s4")]][lllllIlIlIlIlll[#("a7ar")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Nl")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("c4T")]][lllllIlIlIlIlll[#("Q1U5")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];lIIIIlllIllllI=lllllIlIlIlIlll[#{{22;765;266;95};"1 + 1 = 111";}]llIllllllIIlIllIlIII[lIIIIlllIllllI]=llIllllllIIlIllIlIII[lIIIIlllIllllI](llIllllllIIlIllIlIII[lIIIIlllIllllI+1])lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];if not llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("qt")]]then lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;else lIIIIIllIIlIIlIlll=lllllIlIlIlIlll[#("Rsf")];end;elseif lIIIIlllIllllI==#("KSTyZaW")then local lIIIIlllIllllI;local IllIIIllIlllIIllllIlIlIl;llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("S7")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("6Fa")]][lllllIlIlIlIlll[#("TqWQ")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("0K")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("fWZ")]][lllllIlIlIlIlll[#("4GWb")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("gm")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("oqr")]][lllllIlIlIlIlll[#("1xcA")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("eu")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("0Lf")]][lllllIlIlIlIlll[#("bIbT")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("ps")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("JEf")]][lllllIlIlIlIlll[#("gcKo")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];IllIIIllIlllIIllllIlIlIl=lllllIlIlIlIlll[#("4Y")];lIIIIlllIllllI=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Dnf")]];llIllllllIIlIllIlIII[IllIIIllIlllIIllllIlIlIl+1]=lIIIIlllIllllI;llIllllllIIlIllIlIII[IllIIIllIlllIIllllIlIlIl]=lIIIIlllIllllI[lllllIlIlIlIlll[#("vs1u")]];else llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("ZN")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("9Cs")]]-lllllIlIlIlIlll[#("KKYD")];end;elseif lIIIIlllIllllI<=#("gVgrrPuyCk4A")then if lIIIIlllIllllI<=#("daMUcOutmY")then if lIIIIlllIllllI>#("ssttWZIez")then local lIIIIlllIllllI;llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Dd")]]=IllIIIllIlllIIllllIlIlIl[lllllIlIlIlIlll[#("N2o")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("kv")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("obh")]][lllllIlIlIlIlll[#("OD2b")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Jf")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("DZu")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];lIIIIlllIllllI=lllllIlIlIlIlll[#("WB")]llIllllllIIlIllIlIII[lIIIIlllIllllI]=llIllllllIIlIllIlIII[lIIIIlllIllllI](llIllllllIIlIllIlIII[lIIIIlllIllllI+1])lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("jl")]]();else if not llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("zY")]]then lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;else lIIIIIllIIlIIlIlll=lllllIlIlIlIlll[#("E8p")];end;end;elseif lIIIIlllIllllI==#("gOnD3FYqdcV")then local lllllIlIlIlIlll=lllllIlIlIlIlll[#("pG")]local IIIIlIllIlIIlIIllIIlIIlIl,lIIIIIllIIlIIlIlll=IIIIlIlllllIIIlIlIIIIIlI(llIllllllIIlIllIlIII[lllllIlIlIlIlll](llIllllllIIlIllIlIII[lllllIlIlIlIlll+1]))lIIIlllI=lIIIIIllIIlIIlIlll+lllllIlIlIlIlll-1 local lIIIIIllIIlIIlIlll=0;for lllllIlIlIlIlll=lllllIlIlIlIlll,lIIIlllI do lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;llIllllllIIlIllIlIII[lllllIlIlIlIlll]=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];end;else lIIIIIllIIlIIlIlll=lllllIlIlIlIlll[#("bJb")];end;elseif lIIIIlllIllllI<=#("IGRgNWxCz37F98")then if lIIIIlllIllllI==#("bMNNZbj7xyqji")then llIllllllIIlIllIlIII[lllllIlIlIlIlll[#{"1 + 1 = 111";"1 + 1 = 111";}]][lllllIlIlIlIlll[#("Z6u")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("iGOO")]];else local lIIIIlllIllllI;llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("5y")]]=IllIIIllIlllIIllllIlIlIl[lllllIlIlIlIlll[#("nTD")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("jX")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Ast")]][lllllIlIlIlIlll[#("O5LB")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("DC")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("E54")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];lIIIIlllIllllI=lllllIlIlIlIlll[#("9p")]llIllllllIIlIllIlIII[lIIIIlllIllllI]=llIllllllIIlIllIlIII[lIIIIlllIllllI](llIllllllIIlIllIlIII[lIIIIlllIllllI+1])lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("nP")]]();end;elseif lIIIIlllIllllI<=#("djV0VVYMPlWS62n")then llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("LI")]]=lllllIlIlIlIlll[#("bsf")];elseif lIIIIlllIllllI>#("TE4jXPBA5GyJtTvM")then llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("fs")]]=llIllIIIIIIl[lllllIlIlIlIlll[#("EUs")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("xg")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("jP2")]][lllllIlIlIlIlll[#("hZac")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("sG")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("7CQ")]][lllllIlIlIlIlll[#("RRIX")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#{"1 + 1 = 111";"1 + 1 = 111";}]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("B1e")]][lllllIlIlIlIlll[#("LOCQ")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("T4")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("IcV")]][lllllIlIlIlIlll[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Dp")]]=llIllIIIIIIl[lllllIlIlIlIlll[#("Jz5")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("az")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("GR6")]][lllllIlIlIlIlll[#("JPaz")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("ns")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("d3L")]][lllllIlIlIlIlll[#("Ky54")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("3j")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Dn7")]][lllllIlIlIlIlll[#("ARA1")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Qk")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#{"1 + 1 = 111";"1 + 1 = 111";{582;261;335;740};}]][lllllIlIlIlIlll[#("UJW3")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("oO")]][lllllIlIlIlIlll[#("17V")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("64eg")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("8C")]]=llIllIIIIIIl[lllllIlIlIlIlll[#("N3m")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("aI")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("1oY")]][lllllIlIlIlIlll[#("Ee7I")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("V0")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("HKo")]][lllllIlIlIlIlll[#{{374;244;822;803};"1 + 1 = 111";{303;531;878;943};"1 + 1 = 111";}]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];if(llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Hk")]]==lllllIlIlIlIlll[#("DZLq")])then lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;else lIIIIIllIIlIIlIlll=lllllIlIlIlIlll[#{{18;68;98;307};"1 + 1 = 111";"1 + 1 = 111";}];end;else local llIllIIIIIIl;local lIIIIlllIllllI;llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Kp")]]=IllIIIllIlllIIllllIlIlIl[lllllIlIlIlIlll[#("TsC")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("9U")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#{{952;760;345;46};{668;191;82;9};{526;621;104;446};}]][lllllIlIlIlIlll[#("sWNJ")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("qK")]]=lllllIlIlIlIlll[#("49c")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];lIIIIlllIllllI=lllllIlIlIlIlll[#("Y2")]llIllllllIIlIllIlIII[lIIIIlllIllllI]=llIllllllIIlIllIlIII[lIIIIlllIllllI](llIllllllIIlIllIlIII[lIIIIlllIllllI+1])lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("5E")]]=IllIIIllIlllIIllllIlIlIl[lllllIlIlIlIlll[#("8nO")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("lM")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("O7H")]][lllllIlIlIlIlll[#("3nLD")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("2e")]]=lllllIlIlIlIlll[#("EtS")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];lIIIIlllIllllI=lllllIlIlIlIlll[#("iV")]llIllllllIIlIllIlIII[lIIIIlllIllllI]=llIllllllIIlIllIlIII[lIIIIlllIllllI](llIllllllIIlIllIlIII[lIIIIlllIllllI+1])lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("fD")]]=IllIIIllIlllIIllllIlIlIl[lllllIlIlIlIlll[#("eLm")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Qo")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("82p")]][lllllIlIlIlIlll[#("SWQt")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("bR")]]=lllllIlIlIlIlll[#("xKY")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];lIIIIlllIllllI=lllllIlIlIlIlll[#("hs")]llIllllllIIlIllIlIII[lIIIIlllIllllI]=llIllllllIIlIllIlIII[lIIIIlllIllllI](llIllllllIIlIllIlIII[lIIIIlllIllllI+1])lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("KR")]]=IllIIIllIlllIIllllIlIlIl[lllllIlIlIlIlll[#("GQg")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("S7")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("59T")]][lllllIlIlIlIlll[#("OK3Q")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#{{227;110;465;958};"1 + 1 = 111";}]]=lllllIlIlIlIlll[#("l1a")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];lIIIIlllIllllI=lllllIlIlIlIlll[#("0f")]llIllllllIIlIllIlIII[lIIIIlllIllllI]=llIllllllIIlIllIlIII[lIIIIlllIllllI](llIllllllIIlIllIlIII[lIIIIlllIllllI+1])lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IllIIIllIlllIIllllIlIlIl[lllllIlIlIlIlll[#("5NB")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("5O")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("LM8")]][lllllIlIlIlIlll[#("GBx2")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#{{204;15;349;948};"1 + 1 = 111";}]]=lllllIlIlIlIlll[#("LM9")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];lIIIIlllIllllI=lllllIlIlIlIlll[#("43")]llIllllllIIlIllIlIII[lIIIIlllIllllI]=llIllllllIIlIllIlIII[lIIIIlllIllllI](llIllllllIIlIllIlIII[lIIIIlllIllllI+1])lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("SK")]]=IllIIIllIlllIIllllIlIlIl[lllllIlIlIlIlll[#("Ueo")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("LX")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#{{385;758;591;324};"1 + 1 = 111";"1 + 1 = 111";}]][lllllIlIlIlIlll[#("eNk5")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("1X")]]=lllllIlIlIlIlll[#("Agf")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];lIIIIlllIllllI=lllllIlIlIlIlll[#("cM")]llIllllllIIlIllIlIII[lIIIIlllIllllI]=llIllllllIIlIllIlIII[lIIIIlllIllllI](llIllllllIIlIllIlIII[lIIIIlllIllllI+1])lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("4j")]]=IllIIIllIlllIIllllIlIlIl[lllllIlIlIlIlll[#("01R")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("2t")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("L0O")]][lllllIlIlIlIlll[#("47F3")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("2p")]]=lllllIlIlIlIlll[#("K47")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];lIIIIlllIllllI=lllllIlIlIlIlll[#("Nu")]llIllllllIIlIllIlIII[lIIIIlllIllllI]=llIllllllIIlIllIlIII[lIIIIlllIllllI](llIllllllIIlIllIlIII[lIIIIlllIllllI+1])lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("tf")]]=IllIIIllIlllIIllllIlIlIl[lllllIlIlIlIlll[#("Cy3")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#{{266;98;77;602};"1 + 1 = 111";}]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Ly6")]][lllllIlIlIlIlll[#("jqGL")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("zP")]]=lllllIlIlIlIlll[#("Q15")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];lIIIIlllIllllI=lllllIlIlIlIlll[#("ja")]llIllllllIIlIllIlIII[lIIIIlllIllllI]=llIllllllIIlIllIlIII[lIIIIlllIllllI](llIllllllIIlIllIlIII[lIIIIlllIllllI+1])lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("So")]]=IllIIIllIlllIIllllIlIlIl[lllllIlIlIlIlll[#("VRi")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("y9")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("qM2")]][lllllIlIlIlIlll[#("pEFm")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("3t")]]=lllllIlIlIlIlll[#("HDb")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("sb")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("5FZ")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];lIIIIlllIllllI=lllllIlIlIlIlll[#("8e")]llIllllllIIlIllIlIII[lIIIIlllIllllI]=llIllllllIIlIllIlIII[lIIIIlllIllllI](IIlIIlllllIlIllllllll(llIllllllIIlIllIlIII,lIIIIlllIllllI+1,lllllIlIlIlIlll[#("8WP")]))lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("4b")]]=IllIIIllIlllIIllllIlIlIl[lllllIlIlIlIlll[#("h3J")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("3f")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("PZX")]][lllllIlIlIlIlll[#("sPU9")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Qq")]]=lllllIlIlIlIlll[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("jY")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("5ZT")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];lIIIIlllIllllI=lllllIlIlIlIlll[#("rN")]llIllllllIIlIllIlIII[lIIIIlllIllllI]=llIllllllIIlIllIlIII[lIIIIlllIllllI](IIlIIlllllIlIllllllll(llIllllllIIlIllIlIII,lIIIIlllIllllI+1,lllllIlIlIlIlll[#("Ra7")]))lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("gV")]]=IllIIIllIlllIIllllIlIlIl[lllllIlIlIlIlll[#("biY")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Tj")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("vi0")]][lllllIlIlIlIlll[#("255a")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#{"1 + 1 = 111";"1 + 1 = 111";}]]=lllllIlIlIlIlll[#("Jl5")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("gU")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("lfU")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];lIIIIlllIllllI=lllllIlIlIlIlll[#{{344;360;745;269};{163;632;321;966};}]llIllllllIIlIllIlIII[lIIIIlllIllllI]=llIllllllIIlIllIlIII[lIIIIlllIllllI](IIlIIlllllIlIllllllll(llIllllllIIlIllIlIII,lIIIIlllIllllI+1,lllllIlIlIlIlll[#("hX7")]))lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#{"1 + 1 = 111";{852;804;147;190};}]][lllllIlIlIlIlll[#("Z1P")]]=lllllIlIlIlIlll[#("2AVz")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("WF")]][lllllIlIlIlIlll[#("kcY")]]=lllllIlIlIlIlll[#("qdPS")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("kq")]][lllllIlIlIlIlll[#{{256;74;416;104};{38;78;575;712};{785;595;518;485};}]]=lllllIlIlIlIlll[#("UqWB")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("hb")]][lllllIlIlIlIlll[#("ZSY")]]=lllllIlIlIlIlll[#{"1 + 1 = 111";{605;729;735;401};"1 + 1 = 111";{794;727;533;621};}];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Po")]]=IllIIIllIlllIIllllIlIlIl[lllllIlIlIlIlll[#("fK9")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("OL")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("9QD")]][lllllIlIlIlIlll[#{{512;120;314;984};{127;265;182;95};"1 + 1 = 111";"1 + 1 = 111";}]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("bl")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("qxY")]][lllllIlIlIlIlll[#("z2lO")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];lIIIIlllIllllI=lllllIlIlIlIlll[#("vo")];llIllIIIIIIl=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("f1V")]];llIllllllIIlIllIlIII[lIIIIlllIllllI+1]=llIllIIIIIIl;llIllllllIIlIllIlIII[lIIIIlllIllllI]=llIllIIIIIIl[lllllIlIlIlIlll[#("8bFB")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("bQ")]]=lllllIlIlIlIlll[#("dGi")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];lIIIIlllIllllI=lllllIlIlIlIlll[#("xW")]llIllllllIIlIllIlIII[lIIIIlllIllllI]=llIllllllIIlIllIlIII[lIIIIlllIllllI](IIlIIlllllIlIllllllll(llIllllllIIlIllIlIII,lIIIIlllIllllI+1,lllllIlIlIlIlll[#("DCY")]))lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("n9")]][lllllIlIlIlIlll[#("uUv")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#{{962;695;315;505};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("NM")]][lllllIlIlIlIlll[#("h7f")]]=lllllIlIlIlIlll[#("mYWV")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("GG")]][lllllIlIlIlIlll[#("qVW")]]=lllllIlIlIlIlll[#("b2t3")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("s6")]][lllllIlIlIlIlll[#("YBC")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("XNea")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("oM")]]=IllIIIllIlllIIllllIlIlIl[lllllIlIlIlIlll[#("zRe")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("iJ")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("n8a")]][lllllIlIlIlIlll[#("6pnI")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("fC")]]=lllllIlIlIlIlll[#("kj4")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("uQ")]]=lllllIlIlIlIlll[#("KOG")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Yk")]]=lllllIlIlIlIlll[#("VPl")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];lIIIIlllIllllI=lllllIlIlIlIlll[#("lU")]llIllllllIIlIllIlIII[lIIIIlllIllllI]=llIllllllIIlIllIlIII[lIIIIlllIllllI](IIlIIlllllIlIllllllll(llIllllllIIlIllIlIII,lIIIIlllIllllI+1,lllllIlIlIlIlll[#("tZZ")]))lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("fY")]][lllllIlIlIlIlll[#("quI")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#{"1 + 1 = 111";{630;850;268;554};{424;502;550;532};{598;919;744;989};}]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("J3")]][lllllIlIlIlIlll[#("emf")]]=lllllIlIlIlIlll[#("SWvA")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#{{179;88;647;976};{810;202;422;938};}]][lllllIlIlIlIlll[#("d8W")]]=lllllIlIlIlIlll[#("07hr")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Bi")]]=IllIIIllIlllIIllllIlIlIl[lllllIlIlIlIlll[#("xag")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#{"1 + 1 = 111";{226;764;734;48};}]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("UBD")]][lllllIlIlIlIlll[#("njz7")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Wh")]]=lllllIlIlIlIlll[#("cW4")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("W2")]]=lllllIlIlIlIlll[#("ojX")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("tq")]]=lllllIlIlIlIlll[#("pmZ")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("m2")]]=lllllIlIlIlIlll[#("1VH")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];lIIIIlllIllllI=lllllIlIlIlIlll[#("CY")]llIllllllIIlIllIlIII[lIIIIlllIllllI]=llIllllllIIlIllIlIII[lIIIIlllIllllI](IIlIIlllllIlIllllllll(llIllllllIIlIllIlIII,lIIIIlllIllllI+1,lllllIlIlIlIlll[#("AQZ")]))lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("5u")]][lllllIlIlIlIlll[#("dsp")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("GJrU")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("tn")]]=IllIIIllIlllIIllllIlIlIl[lllllIlIlIlIlll[#("2Up")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("aP")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("J0F")]][lllllIlIlIlIlll[#{"1 + 1 = 111";{958;584;817;580};"1 + 1 = 111";{916;555;920;782};}]];end;elseif lIIIIlllIllllI<=#("5vUmPnmIz6B1herURPXp8TzSu4")then if lIIIIlllIllllI<=#("yor6ZjEbHDEepRMyS9JYB")then if lIIIIlllIllllI<=#{{237;857;656;282};"1 + 1 = 111";{565;115;181;882};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{146;168;617;481};{566;185;526;34};{1;960;102;57};{537;942;589;83};{304;415;404;801};{966;681;428;435};"1 + 1 = 111";"1 + 1 = 111";{101;398;128;607};"1 + 1 = 111";{663;623;512;153};"1 + 1 = 111";}then if lIIIIlllIllllI>#{{785;856;689;6};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{233;286;11;470};{159;622;658;230};{481;998;721;972};{85;629;811;100};{280;119;906;495};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{259;974;967;477};"1 + 1 = 111";}then local IIIIlIllIlIIlIIllIIlIIlIl=lllllIlIlIlIlll[#("fC")];local lIIIIIllIIlIIlIlll=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("x1q")]];llIllllllIIlIllIlIII[IIIIlIllIlIIlIIllIIlIIlIl+1]=lIIIIIllIIlIIlIlll;llIllllllIIlIllIlIII[IIIIlIllIlIIlIIllIIlIIlIl]=lIIIIIllIIlIIlIlll[lllllIlIlIlIlll[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];else llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("MP")]]();end;elseif lIIIIlllIllllI==#("pZJCMtq2trSy1kyvIACa")then local lIIIIIllIIlIIlIlll=lllllIlIlIlIlll[#("dX")]llIllllllIIlIllIlIII[lIIIIIllIIlIIlIlll]=llIllllllIIlIllIlIII[lIIIIIllIIlIIlIlll](IIlIIlllllIlIllllllll(llIllllllIIlIllIlIII,lIIIIIllIIlIIlIlll+1,lllllIlIlIlIlll[#("B5e")]))else local lIIIlllI=IllIlIIIIIlIllIIlII[lllllIlIlIlIlll[#("A7v")]];local IIlIIlllllIlIllllllll;local lIIIIlllIllllI={};IIlIIlllllIlIllllllll=IlllIlIIlllIlIlllIlIlI({},{__index=function(lIIIIIllIIlIIlIlll,lllllIlIlIlIlll)local lllllIlIlIlIlll=lIIIIlllIllllI[lllllIlIlIlIlll];return lllllIlIlIlIlll[1][lllllIlIlIlIlll[2]];end,__newindex=function(llIllllllIIlIllIlIII,lllllIlIlIlIlll,lIIIIIllIIlIIlIlll)local lllllIlIlIlIlll=lIIIIlllIllllI[lllllIlIlIlIlll]lllllIlIlIlIlll[1][lllllIlIlIlIlll[2]]=lIIIIIllIIlIIlIlll;end;});for IllIIIllIlllIIllllIlIlIl=1,lllllIlIlIlIlll[#("uX6s")]do lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;local lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];if lllllIlIlIlIlll[#("d")]==31 then lIIIIlllIllllI[IllIIIllIlllIIllllIlIlIl-1]={llIllllllIIlIllIlIII,lllllIlIlIlIlll[#("im3")]};else lIIIIlllIllllI[IllIIIllIlllIIllllIlIlIl-1]={llIllIIIIIIl,lllllIlIlIlIlll[#("Dm5")]};end;llIIIIlIlII[#llIIIIlIlII+1]=lIIIIlllIllllI;end;llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Jc")]]=IIllllIllIIlIIll(lIIIlllI,IIlIIlllllIlIllllllll,IllIIIllIlllIIllllIlIlIl);end;elseif lIIIIlllIllllI<=#("20qrfOkI2Cgu5znlYKqqQcd")then if lIIIIlllIllllI>#("v56A61oBq7x9sjHQftBZLc")then local lIIIIlllIllllI;llIllllllIIlIllIlIII[lllllIlIlIlIlll[#{"1 + 1 = 111";"1 + 1 = 111";}]][lllllIlIlIlIlll[#{"1 + 1 = 111";"1 + 1 = 111";{988;552;157;374};}]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("oH4G")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("RV")]]=IllIIIllIlllIIllllIlIlIl[lllllIlIlIlIlll[#("HsU")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("iv")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("3bK")]][lllllIlIlIlIlll[#{{353;715;365;380};"1 + 1 = 111";{705;699;926;187};"1 + 1 = 111";}]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#{{412;952;39;183};"1 + 1 = 111";}]]=lllllIlIlIlIlll[#("S7l")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("lF")]]=lllllIlIlIlIlll[#{"1 + 1 = 111";{608;624;780;344};"1 + 1 = 111";}];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("to")]]=lllllIlIlIlIlll[#("L4I")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];lIIIIlllIllllI=lllllIlIlIlIlll[#("hV")]llIllllllIIlIllIlIII[lIIIIlllIllllI]=llIllllllIIlIllIlIII[lIIIIlllIllllI](IIlIIlllllIlIllllllll(llIllllllIIlIllIlIII,lIIIIlllIllllI+1,lllllIlIlIlIlll[#("6yC")]))lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("4Q")]][lllllIlIlIlIlll[#("1Os")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("W1pT")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("LS")]]=IllIIIllIlllIIllllIlIlIl[lllllIlIlIlIlll[#("4Aq")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("aj")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("6H7")]][lllllIlIlIlIlll[#("ZKqU")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#{"1 + 1 = 111";{448;621;149;968};}]]=lllllIlIlIlIlll[#("lKb")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("yU")]]=lllllIlIlIlIlll[#("x7i")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("3M")]]=lllllIlIlIlIlll[#("a3g")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("L1")]]=lllllIlIlIlIlll[#("UBD")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];lIIIIlllIllllI=lllllIlIlIlIlll[#("Sv")]llIllllllIIlIllIlIII[lIIIIlllIllllI]=llIllllllIIlIllIlIII[lIIIIlllIllllI](IIlIIlllllIlIllllllll(llIllllllIIlIllIlIII,lIIIIlllIllllI+1,lllllIlIlIlIlll[#("6YX")]))lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("sA")]][lllllIlIlIlIlll[#("0dN")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Vrvu")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("GU")]]=IllIIIllIlllIIllllIlIlIl[lllllIlIlIlIlll[#("ToE")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("DB")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Qtd")]][lllllIlIlIlIlll[#("Hy8g")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Lr")]]=lllllIlIlIlIlll[#("eus")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Bg")]]=lllllIlIlIlIlll[#{{911;257;400;30};"1 + 1 = 111";{225;905;96;666};}];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#{{251;180;466;103};"1 + 1 = 111";}]]=lllllIlIlIlIlll[#("oqP")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("5z")]]=lllllIlIlIlIlll[#("I2L")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];lIIIIlllIllllI=lllllIlIlIlIlll[#("BY")]llIllllllIIlIllIlIII[lIIIIlllIllllI]=llIllllllIIlIllIlIII[lIIIIlllIllllI](IIlIIlllllIlIllllllll(llIllllllIIlIllIlIII,lIIIIlllIllllI+1,lllllIlIlIlIlll[#("6K5")]))lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("2A")]][lllllIlIlIlIlll[#("TYr")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Angf")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("cG")]]=IllIIIllIlllIIllllIlIlIl[lllllIlIlIlIlll[#("7WO")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("jm")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("D0G")]][lllllIlIlIlIlll[#("8PVQ")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("ns")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Zhu")]][lllllIlIlIlIlll[#("ZjrX")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("CF")]][lllllIlIlIlIlll[#("iDX")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("MdZN")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("G1")]][lllllIlIlIlIlll[#("eX4")]]=lllllIlIlIlIlll[#("VGlk")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("FW")]]=IllIIIllIlllIIllllIlIlIl[lllllIlIlIlIlll[#("zPR")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("mD")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Nav")]][lllllIlIlIlIlll[#("7lJN")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("yQ")]]=lllllIlIlIlIlll[#{"1 + 1 = 111";{42;697;736;355};"1 + 1 = 111";}];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("fX")]]=lllllIlIlIlIlll[#("dkd")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("11")]]=lllllIlIlIlIlll[#("GLH")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];lIIIIlllIllllI=lllllIlIlIlIlll[#("zO")]llIllllllIIlIllIlIII[lIIIIlllIllllI]=llIllllllIIlIllIlIII[lIIIIlllIllllI](IIlIIlllllIlIllllllll(llIllllllIIlIllIlIII,lIIIIlllIllllI+1,lllllIlIlIlIlll[#("V8i")]))lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("7B")]][lllllIlIlIlIlll[#("Hkv")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("CIRU")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("xC")]][lllllIlIlIlIlll[#("Xid")]]=lllllIlIlIlIlll[#("IVjj")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#{"1 + 1 = 111";"1 + 1 = 111";}]][lllllIlIlIlIlll[#("4ST")]]=lllllIlIlIlIlll[#("jYLG")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("WE")]][lllllIlIlIlIlll[#("fXF")]]=lllllIlIlIlIlll[#("LaIc")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Xz")]][lllllIlIlIlIlll[#("FAr")]]=lllllIlIlIlIlll[#("EIvU")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("35")]][lllllIlIlIlIlll[#("2ex")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("4b59")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#{"1 + 1 = 111";{160;861;741;816};}]]=IllIIIllIlllIIllllIlIlIl[lllllIlIlIlIlll[#("zRq")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("gP")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("qGZ")]][lllllIlIlIlIlll[#("Xfij")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("kd")]]=lllllIlIlIlIlll[#("Hqu")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("yx")]]=lllllIlIlIlIlll[#("O1s")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Qc")]]=lllllIlIlIlIlll[#("1tx")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];lIIIIlllIllllI=lllllIlIlIlIlll[#("eJ")]llIllllllIIlIllIlIII[lIIIIlllIllllI]=llIllllllIIlIllIlIII[lIIIIlllIllllI](IIlIIlllllIlIllllllll(llIllllllIIlIllIlIII,lIIIIlllIllllI+1,lllllIlIlIlIlll[#("BWa")]))lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Gi")]][lllllIlIlIlIlll[#("fe3")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("qDHa")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("yY")]]=IllIIIllIlllIIllllIlIlIl[lllllIlIlIlIlll[#("QoI")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("SM")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Yye")]][lllllIlIlIlIlll[#("03Qf")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("gr")]]=lllllIlIlIlIlll[#{{221;707;631;273};"1 + 1 = 111";"1 + 1 = 111";}];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("y8")]]=lllllIlIlIlIlll[#("2rV")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Kf")]]=lllllIlIlIlIlll[#("CcY")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];lIIIIlllIllllI=lllllIlIlIlIlll[#("x1")]llIllllllIIlIllIlIII[lIIIIlllIllllI]=llIllllllIIlIllIlIII[lIIIIlllIllllI](IIlIIlllllIlIllllllll(llIllllllIIlIllIlIII,lIIIIlllIllllI+1,lllllIlIlIlIlll[#("hbc")]))lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("fm")]][lllllIlIlIlIlll[#("SbG")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("75P1")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Qa")]]=IllIIIllIlllIIllllIlIlIl[lllllIlIlIlIlll[#("QIx")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("xf")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("MEV")]][lllllIlIlIlIlll[#("6OHv")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("WT")]]=lllllIlIlIlIlll[#("T2O")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("hx")]]=lllllIlIlIlIlll[#("Wmz")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("R5")]]=lllllIlIlIlIlll[#("P8C")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Ry")]]=lllllIlIlIlIlll[#("blq")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];lIIIIlllIllllI=lllllIlIlIlIlll[#{"1 + 1 = 111";{503;880;253;761};}]llIllllllIIlIllIlIII[lIIIIlllIllllI]=llIllllllIIlIllIlIII[lIIIIlllIllllI](IIlIIlllllIlIllllllll(llIllllllIIlIllIlIII,lIIIIlllIllllI+1,lllllIlIlIlIlll[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]))lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("ba")]][lllllIlIlIlIlll[#("m8U")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#{{334;478;321;364};"1 + 1 = 111";{355;696;60;537};{729;692;400;440};}]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Fg")]]=IllIIIllIlllIIllllIlIlIl[lllllIlIlIlIlll[#("1CA")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("3R")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("nDV")]][lllllIlIlIlIlll[#("GZkG")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("PA")]]=lllllIlIlIlIlll[#("HDg")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("6S")]]=lllllIlIlIlIlll[#("yI1")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Au")]]=lllllIlIlIlIlll[#("MV4")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Vt")]]=lllllIlIlIlIlll[#("JxM")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];lIIIIlllIllllI=lllllIlIlIlIlll[#("Iq")]llIllllllIIlIllIlIII[lIIIIlllIllllI]=llIllllllIIlIllIlIII[lIIIIlllIllllI](IIlIIlllllIlIllllllll(llIllllllIIlIllIlIII,lIIIIlllIllllI+1,lllllIlIlIlIlll[#("qt5")]))lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("i2")]][lllllIlIlIlIlll[#("rgf")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("ePBU")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("fQ")]]=IllIIIllIlllIIllllIlIlIl[lllllIlIlIlIlll[#("h2y")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("SD")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Wfd")]][lllllIlIlIlIlll[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("MO")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("mdM")]][lllllIlIlIlIlll[#("L2pH")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("C2")]][lllllIlIlIlIlll[#("eRP")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("8xdE")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("E3")]][lllllIlIlIlIlll[#("zrc")]]=lllllIlIlIlIlll[#("jJXh")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IllIIIllIlllIIllllIlIlIl[lllllIlIlIlIlll[#("eam")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("2U")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("06c")]][lllllIlIlIlIlll[#("eFDi")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("er")]]=lllllIlIlIlIlll[#("Hzh")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#{"1 + 1 = 111";{517;127;112;491};}]]=lllllIlIlIlIlll[#("yxC")];else do return end;end;elseif lIIIIlllIllllI<=#("WkjUZkTiZWs6jRVLanQd8bo2")then if(llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("mE")]]==lllllIlIlIlIlll[#("bSjv")])then lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;else lIIIIIllIIlIIlIlll=lllllIlIlIlIlll[#("jGi")];end;elseif lIIIIlllIllllI>#("dLkvLoxs9kpWhzpHYImanx8uT")then llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Xv")]]=(lllllIlIlIlIlll[#("SSH")]~=0);else local lllllIlIlIlIlll=lllllIlIlIlIlll[#("WX")]local IIIIlIllIlIIlIIllIIlIIlIl,lIIIIIllIIlIIlIlll=IIIIlIlllllIIIlIlIIIIIlI(llIllllllIIlIllIlIII[lllllIlIlIlIlll](llIllllllIIlIllIlIII[lllllIlIlIlIlll+1]))lIIIlllI=lIIIIIllIIlIIlIlll+lllllIlIlIlIlll-1 local lIIIIIllIIlIIlIlll=0;for lllllIlIlIlIlll=lllllIlIlIlIlll,lIIIlllI do lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;llIllllllIIlIllIlIII[lllllIlIlIlIlll]=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];end;end;elseif lIIIIlllIllllI<=#("L596U5reWKJWnI6NkHFZ2YAHjEc2BQ")then if lIIIIlllIllllI<=#("ZNkNBtcAtEdMQ7btPeKmCZ3IXGCX")then if lIIIIlllIllllI==#("3zNg7Tjd4FthhluZmTJhjxY1Dka")then if(llIllllllIIlIllIlIII[lllllIlIlIlIlll[#{"1 + 1 = 111";{378;354;718;343};}]]<lllllIlIlIlIlll[#("rE50")])then lIIIIIllIIlIIlIlll=lllllIlIlIlIlll[#("Vdz")];else lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;end;else llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Wu")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Pm8")]][lllllIlIlIlIlll[#("Ego4")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#{{332;600;775;161};{703;922;914;926};}]][lllllIlIlIlIlll[#("dOQ")]]=lllllIlIlIlIlll[#("b6Au")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Gr")]]=llIllIIIIIIl[lllllIlIlIlIlll[#("Q3E")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("HA")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("ckO")]][lllllIlIlIlIlll[#("jVR0")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Pq")]][lllllIlIlIlIlll[#("6kk")]]=lllllIlIlIlIlll[#("G2t1")];end;elseif lIIIIlllIllllI==#("M042piBfAFSo2qUJqfuOJTKX2PhGL")then local lIIIlllI;local lIIIIlllIllllI;llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("7b")]]=IllIIIllIlllIIllllIlIlIl[lllllIlIlIlIlll[#("piJ")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Ak")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("iGT")]][lllllIlIlIlIlll[#("N9zd")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("zA")]]=lllllIlIlIlIlll[#("DRT")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("pP")]]=llIllIIIIIIl[lllllIlIlIlIlll[#("HDn")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];lIIIIlllIllllI=lllllIlIlIlIlll[#("VS")]llIllllllIIlIllIlIII[lIIIIlllIllllI]=llIllllllIIlIllIlIII[lIIIIlllIllllI](IIlIIlllllIlIllllllll(llIllllllIIlIllIlIII,lIIIIlllIllllI+1,lllllIlIlIlIlll[#("Bhx")]))lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#{{963;984;505;789};{314;559;291;35};}]]=IllIIIllIlllIIllllIlIlIl[lllllIlIlIlIlll[#("Qt0")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];lIIIIlllIllllI=lllllIlIlIlIlll[#("8g")];lIIIlllI=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("csE")]];llIllllllIIlIllIlIII[lIIIIlllIllllI+1]=lIIIlllI;llIllllllIIlIllIlIII[lIIIIlllIllllI]=lIIIlllI[lllllIlIlIlIlll[#("2S3A")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("jq")]]=lllllIlIlIlIlll[#("dUJ")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];lIIIIlllIllllI=lllllIlIlIlIlll[#("Kb")]llIllllllIIlIllIlIII[lIIIIlllIllllI]=llIllllllIIlIllIlIII[lIIIIlllIllllI](IIlIIlllllIlIllllllll(llIllllllIIlIllIlIII,lIIIIlllIllllI+1,lllllIlIlIlIlll[#("3Rt")]))lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("uP")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Nf0")]][lllllIlIlIlIlll[#("FBnh")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];lIIIIlllIllllI=lllllIlIlIlIlll[#{{829;874;63;247};"1 + 1 = 111";}];lIIIlllI=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("4tO")]];llIllllllIIlIllIlIII[lIIIIlllIllllI+1]=lIIIlllI;llIllllllIIlIllIlIII[lIIIIlllIllllI]=lIIIlllI[lllllIlIlIlIlll[#("ct2Q")]];else local lIIIIlllIllllI;llIllllllIIlIllIlIII[lllllIlIlIlIlll[#{{693;810;650;175};{596;63;584;593};}]]=IllIIIllIlllIIllllIlIlIl[lllllIlIlIlIlll[#("kRs")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("MZ")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("6tx")]][lllllIlIlIlIlll[#("ifio")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("xy")]]=lllllIlIlIlIlll[#("XBb")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("3I")]]=llIllIIIIIIl[lllllIlIlIlIlll[#("ss0")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];lIIIIlllIllllI=lllllIlIlIlIlll[#("6U")]llIllllllIIlIllIlIII[lIIIIlllIllllI]=llIllllllIIlIllIlIII[lIIIIlllIllllI](IIlIIlllllIlIllllllll(llIllllllIIlIllIlIII,lIIIIlllIllllI+1,lllllIlIlIlIlll[#("bls")]))lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("tH")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("ii3")]][lllllIlIlIlIlll[#{"1 + 1 = 111";{894;771;249;941};"1 + 1 = 111";{752;274;160;151};}]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("rQ")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("iSR")]][lllllIlIlIlIlll[#("Ake3")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("SX")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("rZZ")]][lllllIlIlIlIlll[#("ESkF")]];end;elseif lIIIIlllIllllI<=#("NXTABdKC18UpARaup2NpLyZvk3qh9Lb4")then if lIIIIlllIllllI==#("N24GC0Q8Ynv3ss3WIAo3ukp8yoHXCDq")then llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("fZ")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("P1f")]];else llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("ae")]]=(lllllIlIlIlIlll[#("94L")]~=0);end;elseif lIIIIlllIllllI<=#("0VWZgYXc6qWjEC2KyvBlWajDM6ins3Hv7")then llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("ft")]]=IllIIIllIlllIIllllIlIlIl[lllllIlIlIlIlll[#("xUX")]];elseif lIIIIlllIllllI==#("dIHdPTMm7ezgE5x7AgbfkZLtnjQKUcTBle")then if llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("AP")]]then lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;else lIIIIIllIIlIIlIlll=lllllIlIlIlIlll[#("Pzn")];end;else llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("ty")]][lllllIlIlIlIlll[#("oaH")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("tda4")]];end;elseif lIIIIlllIllllI<=#("tdtQRJKdedFCm0vDAu2nn6m0GdcC4u74AHd3gAtGLWHpSSETyKtgt")then if lIIIIlllIllllI<=#("kx0EkOHhiTfLcQXCvaavNCA7hXJsetb1LIxQcNpQ9DNX")then if lIIIIlllIllllI<=#("hPY55nsf7nS63vxendZRn9EthzTVtxkZMXaiVxi")then if lIIIIlllIllllI<=#("SWNuOTjr2LVzYf5hkEYHEIWKd3ufuos05S8Cx")then if lIIIIlllIllllI==#("PypC2SMVbH227qJMMkacrUze6Os5EfgDVbZB")then local lllllIlIlIlIlll=lllllIlIlIlIlll[#{{949;614;369;648};"1 + 1 = 111";}]llIllllllIIlIllIlIII[lllllIlIlIlIlll](IIlIIlllllIlIllllllll(llIllllllIIlIllIlIII,lllllIlIlIlIlll+1,lIIIlllI))else if(llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Fp")]]~=lllllIlIlIlIlll[#("THKO")])then lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;else lIIIIIllIIlIIlIlll=lllllIlIlIlIlll[#("b50")];end;end;elseif lIIIIlllIllllI==#("cQd8r2YmDqbrtgYCt258kGoARq6Azg6ChuJF6e")then if llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("aN")]]then lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;else lIIIIIllIIlIIlIlll=lllllIlIlIlIlll[#{{70;431;494;292};"1 + 1 = 111";"1 + 1 = 111";}];end;else if(llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("aa")]]~=lllllIlIlIlIlll[#("m9Oa")])then lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;else lIIIIIllIIlIIlIlll=lllllIlIlIlIlll[#("MbH")];end;end;elseif lIIIIlllIllllI<=#("2L1DyqNk8saCj3CgHBNrb6yYvtJj8ItFo2cysc0jd")then if lIIIIlllIllllI>#{{55;48;271;647};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{865;729;632;930};"1 + 1 = 111";{44;902;348;582};"1 + 1 = 111";{508;545;942;528};{592;286;111;705};"1 + 1 = 111";{310;582;442;110};{458;837;280;770};{665;620;469;462};"1 + 1 = 111";{30;397;373;378};"1 + 1 = 111";{583;37;383;994};{514;105;178;514};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{572;868;20;2};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{521;967;284;86};{182;114;240;516};{944;805;225;173};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{620;421;798;5};{648;226;418;356};"1 + 1 = 111";"1 + 1 = 111";{19;774;202;172};"1 + 1 = 111";{360;662;934;98};}then if(llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("IO")]]<lllllIlIlIlIlll[#("H1ka")])then lIIIIIllIIlIIlIlll=lllllIlIlIlIlll[#("LPp")];else lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;end;else if not llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("5y")]]then lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;else lIIIIIllIIlIIlIlll=lllllIlIlIlIlll[#("nG0")];end;end;elseif lIIIIlllIllllI<=#("UFqlD4gkp4XDK3Hi2CGSLBID1Ic76OBGQ8C5StUvU3")then local lIIIIlllIllllI;llIllllllIIlIllIlIII[lllllIlIlIlIlll[#{{308;156;747;822};"1 + 1 = 111";}]]=IllIIIllIlllIIllllIlIlIl[lllllIlIlIlIlll[#("KIv")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Mv")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("vBk")]][lllllIlIlIlIlll[#("1zhY")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("kY")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Fyf")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];lIIIIlllIllllI=lllllIlIlIlIlll[#("WH")]llIllllllIIlIllIlIII[lIIIIlllIllllI]=llIllllllIIlIllIlIII[lIIIIlllIllllI](llIllllllIIlIllIlIII[lIIIIlllIllllI+1])lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#{{384;389;649;591};{239;114;691;805};}]]();elseif lIIIIlllIllllI>#("JXaObBhHobs3t6Xu42ioMEqWLCLBJRj8S38P03aGYgl")then local lIIIIIllIIlIIlIlll=lllllIlIlIlIlll[#("DH")]llIllllllIIlIllIlIII[lIIIIIllIIlIIlIlll](IIlIIlllllIlIllllllll(llIllllllIIlIllIlIII,lIIIIIllIIlIIlIlll+1,lllllIlIlIlIlll[#("sgu")]))else llIllllllIIlIllIlIII[lllllIlIlIlIlll[#{"1 + 1 = 111";"1 + 1 = 111";}]]();end;elseif lIIIIlllIllllI<=#("yfi8490ELP5fGocK0R8I1ulA7hEa1MBFsWzGtMGJ1Qxc83jM")then if lIIIIlllIllllI<=#("BQgiONc4SbWGZM8nAWTZHpnlzQl7iBd82kB5txPjvLLLTc")then if lIIIIlllIllllI>#{{583;276;77;239};"1 + 1 = 111";{778;626;863;44};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{509;9;678;563};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{217;184;353;75};{871;741;222;992};{37;734;167;668};"1 + 1 = 111";{346;294;737;630};{902;614;891;730};"1 + 1 = 111";{815;522;894;669};{919;265;913;557};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{567;595;381;612};{293;352;82;775};{626;4;365;83};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{821;174;205;38};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{768;359;885;855};{439;485;211;617};"1 + 1 = 111";{672;938;437;833};{683;448;63;751};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}then local lllllIlIlIlIlll=lllllIlIlIlIlll[#("ce")]llIllllllIIlIllIlIII[lllllIlIlIlIlll]=llIllllllIIlIllIlIII[lllllIlIlIlIlll](llIllllllIIlIllIlIII[lllllIlIlIlIlll+1])else local lIIIIlllIllllI;llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("3a")]]=lllllIlIlIlIlll[#("bdH")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];lIIIIlllIllllI=lllllIlIlIlIlll[#{"1 + 1 = 111";"1 + 1 = 111";}]llIllllllIIlIllIlIII[lIIIIlllIllllI]=llIllllllIIlIllIlIII[lIIIIlllIllllI](IIlIIlllllIlIllllllll(llIllllllIIlIllIlIII,lIIIIlllIllllI+1,lllllIlIlIlIlll[#("Dxh")]))lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("dE")]][lllllIlIlIlIlll[#("nZ1")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("0s")]][lllllIlIlIlIlll[#("iWg")]]=lllllIlIlIlIlll[#("uiyg")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("eh")]][lllllIlIlIlIlll[#("jzi")]]=lllllIlIlIlIlll[#("efoZ")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("zu")]][lllllIlIlIlIlll[#("JCQ")]]=lllllIlIlIlIlll[#("SBPn")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Fn")]][lllllIlIlIlIlll[#("sRU")]]=lllllIlIlIlIlll[#("AHde")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("lt")]][lllllIlIlIlIlll[#("5pQ")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("NHku")]];end;elseif lIIIIlllIllllI>#("RTqZtO5zx2u4G90sxF0ExtsFDzapJY5KGzB0mgv8G7qpozv")then local lIIIIlllIllllI;llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("8e")]]=IllIIIllIlllIIllllIlIlIl[lllllIlIlIlIlll[#("uFz")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("zE")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("8tO")]][lllllIlIlIlIlll[#("55m2")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("F8")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Bak")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];lIIIIlllIllllI=lllllIlIlIlIlll[#("WT")]llIllllllIIlIllIlIII[lIIIIlllIllllI]=llIllllllIIlIllIlIII[lIIIIlllIllllI](llIllllllIIlIllIlIII[lIIIIlllIllllI+1])lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("pI")]]();lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];do return end;else llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("IS")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("JkL")]];end;elseif lIIIIlllIllllI<=#("SWEVN5qyAWv4NQ0J7VzhJ9gqj17AccqdddHWuj6LhdAAVBvZgR")then if lIIIIlllIllllI==#("D9oySPmLV71uyFs1JjdoXYY9FKQFSGhsvUYdYPZhhJkNqTc5D")then local lllllIlIlIlIlll=lllllIlIlIlIlll[#{{142;637;792;806};{963;440;218;58};}]llIllllllIIlIllIlIII[lllllIlIlIlIlll](IIlIIlllllIlIllllllll(llIllllllIIlIllIlIII,lllllIlIlIlIlll+1,lIIIlllI))else if(llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("sy")]]~=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{512;33;263;974};}]])then lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;else lIIIIIllIIlIIlIlll=lllllIlIlIlIlll[#("qvh")];end;end;elseif lIIIIlllIllllI<=#("WQdDFOlp3i8S3pZJ9NRoc4t6hoOkTWHVchTCo2oj2JWQiAQ5YRT")then llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Xc")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("81k")]][lllllIlIlIlIlll[#("dMHD")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("eH")]]=IllIIIllIlllIIllllIlIlIl[lllllIlIlIlIlll[#("ykm")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("gR")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("N3A")]][lllllIlIlIlIlll[#("CNuQ")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("dN")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("iyP")]][lllllIlIlIlIlll[#("AT4y")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];if(llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("IP")]]~=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Xrql")]])then lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;else lIIIIIllIIlIIlIlll=lllllIlIlIlIlll[#("x7V")];end;elseif lIIIIlllIllllI>#("nnH2vgvqaaGgLnPVHytgzIvEhOYRJTxbdhHZL1fiH8j1cQe5V4yB")then local lIIIIlllIllllI;llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("hv")]]=IllIIIllIlllIIllllIlIlIl[lllllIlIlIlIlll[#("V5c")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("yr")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("qjX")]][lllllIlIlIlIlll[#{{152;851;627;736};{251;562;17;277};{9;953;69;642};"1 + 1 = 111";}]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("5j")]]=lllllIlIlIlIlll[#("gb8")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("l6")]]=llIllIIIIIIl[lllllIlIlIlIlll[#("hXF")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];lIIIIlllIllllI=lllllIlIlIlIlll[#("dy")]llIllllllIIlIllIlIII[lIIIIlllIllllI]=llIllllllIIlIllIlIII[lIIIIlllIllllI](IIlIIlllllIlIllllllll(llIllllllIIlIllIlIII,lIIIIlllIllllI+1,lllllIlIlIlIlll[#("tZW")]))else if(llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("rQ")]]==lllllIlIlIlIlll[#("j3vV")])then lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;else lIIIIIllIIlIIlIlll=lllllIlIlIlIlll[#("h2K")];end;end;elseif lIIIIlllIllllI<=#("NaQ2dUSsOSrOFdEQ0kPrlKAyFBCJ26Ou5OAg16HhxZ2p1mINLo5UTilcKrxMsj")then if lIIIIlllIllllI<=#("Rd7T0NxZ3NI4xRkHr3Z7Ob3LXDyHJK5Znzkm4ERaoAchlnZuAVfSElWQk")then if lIIIIlllIllllI<=#("5yoZqsSTR7G8MYmYTo9WAJOcgXEmucNFbJIsVziTzDH1YCjrGPDHRy6")then if lIIIIlllIllllI>#("UmTDZFyOtb6dp3dtfqx6cWnOOmRQKfYOMlJIQQ44e2IXGgbMLiCAb9")then local lIIIIIlIIIllII;local llIIIIlIlII,IIllllIllIIlIIll;local lIIIIIlIIlIIlIII;local lIIIIlllIllllI;llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("RM")]]=llIllIIIIIIl[lllllIlIlIlIlll[#("Lny")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("rA")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("F7v")]][lllllIlIlIlIlll[#("GoTb")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("LQ")]]=llIllIIIIIIl[lllllIlIlIlIlll[#("Lri")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#{"1 + 1 = 111";"1 + 1 = 111";}]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#{{578;948;59;244};"1 + 1 = 111";"1 + 1 = 111";}]][lllllIlIlIlIlll[#("Y9Lu")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("X9")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("xeQ")]][lllllIlIlIlIlll[#("9mF2")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#{{542;825;680;204};{634;638;90;8};}]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("50Z")]]-lllllIlIlIlIlll[#("laYq")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("y4")]][lllllIlIlIlIlll[#("2mt")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("e5a1")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#{{856;409;511;934};{463;400;468;507};}]]=IllIIIllIlllIIllllIlIlIl[lllllIlIlIlIlll[#("l6S")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];lIIIIlllIllllI=lllllIlIlIlIlll[#("f3")];lIIIIIlIIlIIlIII=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("uF7")]];llIllllllIIlIllIlIII[lIIIIlllIllllI+1]=lIIIIIlIIlIIlIII;llIllllllIIlIllIlIII[lIIIIlllIllllI]=lIIIIIlIIlIIlIII[lllllIlIlIlIlll[#("gIi0")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("vc")]]=lllllIlIlIlIlll[#{{129;330;686;490};"1 + 1 = 111";"1 + 1 = 111";}];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];lIIIIlllIllllI=lllllIlIlIlIlll[#("nV")]llIllllllIIlIllIlIII[lIIIIlllIllllI]=llIllllllIIlIllIlIII[lIIIIlllIllllI](IIlIIlllllIlIllllllll(llIllllllIIlIllIlIII,lIIIIlllIllllI+1,lllllIlIlIlIlll[#("PP8")]))lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];lIIIIlllIllllI=lllllIlIlIlIlll[#("W1")];lIIIIIlIIlIIlIII=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("OCO")]];llIllllllIIlIllIlIII[lIIIIlllIllllI+1]=lIIIIIlIIlIIlIII;llIllllllIIlIllIlIII[lIIIIlllIllllI]=lIIIIIlIIlIIlIII[lllllIlIlIlIlll[#("JrKS")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#{"1 + 1 = 111";{475;607;198;182};}]]=IllIIIllIlllIIllllIlIlIl[lllllIlIlIlIlll[#("FIC")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("2X")]]=llIllIIIIIIl[lllllIlIlIlIlll[#{"1 + 1 = 111";{679;756;286;355};"1 + 1 = 111";}]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("vq")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("ybt")]][lllllIlIlIlIlll[#("k92c")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("2z")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("NYh")]][lllllIlIlIlIlll[#("YR6B")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Ca")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("KpT")]][lllllIlIlIlIlll[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{564;649;194;740};}]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("74")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("PqB")]][lllllIlIlIlIlll[#("ifeE")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];lIIIIlllIllllI=lllllIlIlIlIlll[#("LP")]llIIIIlIlII,IIllllIllIIlIIll=IIIIlIlllllIIIlIlIIIIIlI(llIllllllIIlIllIlIII[lIIIIlllIllllI](llIllllllIIlIllIlIII[lIIIIlllIllllI+1]))lIIIlllI=IIllllIllIIlIIll+lIIIIlllIllllI-1 lIIIIIlIIIllII=0;for lllllIlIlIlIlll=lIIIIlllIllllI,lIIIlllI do lIIIIIlIIIllII=lIIIIIlIIIllII+1;llIllllllIIlIllIlIII[lllllIlIlIlIlll]=llIIIIlIlII[lIIIIIlIIIllII];end;lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];lIIIIlllIllllI=lllllIlIlIlIlll[#("Jl")]llIllllllIIlIllIlIII[lIIIIlllIllllI](IIlIIlllllIlIllllllll(llIllllllIIlIllIlIII,lIIIIlllIllllI+1,lIIIlllI))lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("1o")]]=(lllllIlIlIlIlll[#("BH6")]~=0);lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];lIIIIIllIIlIIlIlll=lllllIlIlIlIlll[#("29R")];else llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("TB")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("IMc")]][lllllIlIlIlIlll[#("Ln2N")]];end;elseif lIIIIlllIllllI>#("89eZMYReonsBduFOzxD1jnAiIkfeBNyMN1LJL1rfyYsKnP8rfEcdIhkU")then llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("7b")]]=llIllIIIIIIl[lllllIlIlIlIlll[#("FPR")]];else local lIIIIlllIllllI;llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("aF")]]=IllIIIllIlllIIllllIlIlIl[lllllIlIlIlIlll[#("2nP")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("KG")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("suF")]][lllllIlIlIlIlll[#("p1UV")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("FQ")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Htp")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];lIIIIlllIllllI=lllllIlIlIlIlll[#("4n")]llIllllllIIlIllIlIII[lIIIIlllIllllI]=llIllllllIIlIllIlIII[lIIIIlllIllllI](llIllllllIIlIllIlIII[lIIIIlllIllllI+1])lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("N4")]]();end;elseif lIIIIlllIllllI<=#("6rBTMNLZQXlU6dIexEv4042mY97LueFR0aPK0xVkSUI1WHjBF8kNYZSbzo5")then if lIIIIlllIllllI>#("QaFMsF35z8naTkmgxaBq0Ggv322arNkMBiFSp6JrOncGVk4NNMOzYPXj4j")then llIllllllIIlIllIlIII[lllllIlIlIlIlll[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IllIIIllIlllIIllllIlIlIl[lllllIlIlIlIlll[#("Ttc")]];else llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("ll")]]=llIllIIIIIIl[lllllIlIlIlIlll[#("gRM")]];end;elseif lIIIIlllIllllI<=#("BM2OVYMJLQF0BBjMNEKLS7pyQ8VYWuvYfniPVKqRiLt7iVn8PckPtJ9DxE7W")then llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("s8")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("cv1")]][lllllIlIlIlIlll[#("SMW7")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("yb")]][lllllIlIlIlIlll[#("t3U")]]=lllllIlIlIlIlll[#("miVE")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("8N")]]=llIllIIIIIIl[lllllIlIlIlIlll[#{{326;707;722;240};"1 + 1 = 111";"1 + 1 = 111";}]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("I4")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("IxB")]][lllllIlIlIlIlll[#("y8JV")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("YC")]][lllllIlIlIlIlll[#("LQD")]]=lllllIlIlIlIlll[#("OxbA")];elseif lIIIIlllIllllI==#{{580;783;19;25};{931;691;426;517};"1 + 1 = 111";"1 + 1 = 111";{782;657;503;604};{389;690;414;986};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{549;399;316;110};{592;121;269;34};"1 + 1 = 111";{265;978;858;46};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{186;540;754;959};{501;161;411;603};{11;539;701;123};"1 + 1 = 111";{343;187;19;299};"1 + 1 = 111";{547;551;452;705};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{622;279;261;667};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{199;674;124;335};{776;428;320;198};"1 + 1 = 111";"1 + 1 = 111";{254;500;678;562};{152;857;119;279};{952;823;264;105};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{918;143;332;347};{978;290;384;838};{670;737;69;267};"1 + 1 = 111";{755;306;403;510};{25;311;773;272};"1 + 1 = 111";"1 + 1 = 111";{468;209;446;88};{917;420;521;986};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}then llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("2y")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("beT")]][lllllIlIlIlIlll[#("Eng0")]];else llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Of")]][lllllIlIlIlIlll[#("TsR")]]=lllllIlIlIlIlll[#("7hoX")];end;elseif lIIIIlllIllllI<=#("MkKBTogtKPY4Vg8IdncAv1ocKDySU98oWae9LQTmaIozAhpjPFaBjYNU6I1p0yJLRKi")then if lIIIIlllIllllI<=#("b86xF0zXMZMCnodp8Ie7ytddZDxM8OSZ9FiQIN5tzZhh5zbMutMjGkxR53HbDWZ8")then if lIIIIlllIllllI==#("XDSfxRvMUJIm6iBCVqOcJtYiBUPf41Majai6tG7NpHVMZF9UgKSGk6IDPKONcpR")then llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("iO")]]=lllllIlIlIlIlll[#("JXG")];else llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("dn")]][lllllIlIlIlIlll[#("dct")]]=lllllIlIlIlIlll[#("66lp")];end;elseif lIIIIlllIllllI<=#("6Hc5aEiotbWbIlt6V49ujgZmDPrT1uLa02PrCdUMCDljkG5DqS1hqxT0S0Dvmzy8B")then do return end;elseif lIIIIlllIllllI==#("lPGbERkx3R4Qc7UYCjDDUEjZKMLyAcenSzup6onk64Dc5bXGLy6oF7bSGQC2gW61MR")then local lIIIlllI=IllIlIIIIIlIllIIlII[lllllIlIlIlIlll[#("vrB")]];local IIlIIlllllIlIllllllll;local lIIIIlllIllllI={};IIlIIlllllIlIllllllll=IlllIlIIlllIlIlllIlIlI({},{__index=function(lIIIIIllIIlIIlIlll,lllllIlIlIlIlll)local lllllIlIlIlIlll=lIIIIlllIllllI[lllllIlIlIlIlll];return lllllIlIlIlIlll[1][lllllIlIlIlIlll[2]];end,__newindex=function(llIllllllIIlIllIlIII,lllllIlIlIlIlll,lIIIIIllIIlIIlIlll)local lllllIlIlIlIlll=lIIIIlllIllllI[lllllIlIlIlIlll]lllllIlIlIlIlll[1][lllllIlIlIlIlll[2]]=lIIIIIllIIlIIlIlll;end;});for IllIIIllIlllIIllllIlIlIl=1,lllllIlIlIlIlll[#("8Pn9")]do lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;local lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];if lllllIlIlIlIlll[#("W")]==31 then lIIIIlllIllllI[IllIIIllIlllIIllllIlIlIl-1]={llIllllllIIlIllIlIII,lllllIlIlIlIlll[#("KEf")]};else lIIIIlllIllllI[IllIIIllIlllIIllllIlIlIl-1]={llIllIIIIIIl,lllllIlIlIlIlll[#{"1 + 1 = 111";"1 + 1 = 111";{113;916;551;42};}]};end;llIIIIlIlII[#llIIIIlIlII+1]=lIIIIlllIllllI;end;llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Li")]]=IIllllIllIIlIIll(lIIIlllI,IIlIIlllllIlIllllllll,IllIIIllIlllIIllllIlIlIl);else local lIIIIlllIllllI;llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("IW")]]=lllllIlIlIlIlll[#("2MO")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("6R")]]=lllllIlIlIlIlll[#("nFN")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("ml")]]=lllllIlIlIlIlll[#("MtO")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];lIIIIlllIllllI=lllllIlIlIlIlll[#("KH")]llIllllllIIlIllIlIII[lIIIIlllIllllI]=llIllllllIIlIllIlIII[lIIIIlllIllllI](IIlIIlllllIlIllllllll(llIllllllIIlIllIlIII,lIIIIlllIllllI+1,lllllIlIlIlIlll[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]))lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#{{941;813;132;972};"1 + 1 = 111";}]][lllllIlIlIlIlll[#("8u1")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("atKa")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("gZ")]][lllllIlIlIlIlll[#("c4f")]]=lllllIlIlIlIlll[#("NOg0")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("HT")]][lllllIlIlIlIlll[#("odG")]]=lllllIlIlIlIlll[#("30ut")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("DH")]][lllllIlIlIlIlll[#("9Rx")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("FG6N")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IllIIIllIlllIIllllIlIlIl[lllllIlIlIlIlll[#("Cvv")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Pu")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("ifK")]][lllllIlIlIlIlll[#("e376")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("mx")]]=lllllIlIlIlIlll[#("zx4")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("O9")]]=lllllIlIlIlIlll[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];lIIIIlllIllllI=lllllIlIlIlIlll[#("I1")]llIllllllIIlIllIlIII[lIIIIlllIllllI]=llIllllllIIlIllIlIII[lIIIIlllIllllI](IIlIIlllllIlIllllllll(llIllllllIIlIllIlIII,lIIIIlllIllllI+1,lllllIlIlIlIlll[#{{3;244;875;347};{203;281;623;937};{426;846;842;888};}]))lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("9P")]][lllllIlIlIlIlll[#("Fus")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("BXty")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("3e")]]=IllIIIllIlllIIllllIlIlIl[lllllIlIlIlIlll[#("Hul")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("7x")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("9f8")]][lllllIlIlIlIlll[#("8jbl")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("P6")]]=lllllIlIlIlIlll[#("6qK")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("1e")]]=lllllIlIlIlIlll[#("jF0")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("te")]]=lllllIlIlIlIlll[#("Ush")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];lIIIIlllIllllI=lllllIlIlIlIlll[#("UV")]llIllllllIIlIllIlIII[lIIIIlllIllllI]=llIllllllIIlIllIlIII[lIIIIlllIllllI](IIlIIlllllIlIllllllll(llIllllllIIlIllIlIII,lIIIIlllIllllI+1,lllllIlIlIlIlll[#("9cR")]))lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("lI")]][lllllIlIlIlIlll[#("ZCG")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("jNfu")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Qx")]][lllllIlIlIlIlll[#("OG3")]]=lllllIlIlIlIlll[#("sazm")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Ii")]]=IllIIIllIlllIIllllIlIlIl[lllllIlIlIlIlll[#("cyB")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("kJ")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("3AJ")]][lllllIlIlIlIlll[#("gM1J")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("SH")]]=lllllIlIlIlIlll[#("yag")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#{{168;524;194;648};"1 + 1 = 111";}]]=lllllIlIlIlIlll[#("Zy4")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Go")]]=lllllIlIlIlIlll[#("pkg")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("da")]]=lllllIlIlIlIlll[#("mN9")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];lIIIIlllIllllI=lllllIlIlIlIlll[#("Av")]llIllllllIIlIllIlIII[lIIIIlllIllllI]=llIllllllIIlIllIlIII[lIIIIlllIllllI](IIlIIlllllIlIllllllll(llIllllllIIlIllIlIII,lIIIIlllIllllI+1,lllllIlIlIlIlll[#("Oxv")]))lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("ft")]][lllllIlIlIlIlll[#("Jfq")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("DTK0")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("3X")]]=IllIIIllIlllIIllllIlIlIl[lllllIlIlIlIlll[#("yDX")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("nY")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("ec9")]][lllllIlIlIlIlll[#("gvNE")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("un")]]=lllllIlIlIlIlll[#("UYr")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Az")]]=lllllIlIlIlIlll[#("6u9")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("4E")]]=lllllIlIlIlIlll[#("HaN")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Bj")]]=lllllIlIlIlIlll[#("AR3")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];lIIIIlllIllllI=lllllIlIlIlIlll[#("vN")]llIllllllIIlIllIlIII[lIIIIlllIllllI]=llIllllllIIlIllIlIII[lIIIIlllIllllI](IIlIIlllllIlIllllllll(llIllllllIIlIllIlIII,lIIIIlllIllllI+1,lllllIlIlIlIlll[#("y6j")]))lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Vo")]][lllllIlIlIlIlll[#("dbU")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#{{199;123;626;302};"1 + 1 = 111";{889;326;301;7};{880;134;662;644};}]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Ti")]][lllllIlIlIlIlll[#("UQ8")]]=lllllIlIlIlIlll[#("UYi4")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Dq")]][lllllIlIlIlIlll[#("LiB")]]=lllllIlIlIlIlll[#("2AL6")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#{{45;811;310;445};"1 + 1 = 111";}]]=IllIIIllIlllIIllllIlIlIl[lllllIlIlIlIlll[#("kWC")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Cq")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("uaH")]][lllllIlIlIlIlll[#("eFVs")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("0F")]]=lllllIlIlIlIlll[#("x4a")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("7v")]]=lllllIlIlIlIlll[#("CXa")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Vg")]]=lllllIlIlIlIlll[#("Jyy")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];lIIIIlllIllllI=lllllIlIlIlIlll[#("Ki")]llIllllllIIlIllIlIII[lIIIIlllIllllI]=llIllllllIIlIllIlIII[lIIIIlllIllllI](IIlIIlllllIlIllllllll(llIllllllIIlIllIlIII,lIIIIlllIllllI+1,lllllIlIlIlIlll[#("3Cq")]))lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("a8")]][lllllIlIlIlIlll[#("e9o")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Y5UG")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("UU")]]=IllIIIllIlllIIllllIlIlIl[lllllIlIlIlIlll[#("vN0")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("zi")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("JAs")]][lllllIlIlIlIlll[#("pJlc")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("LE")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("pFe")]][lllllIlIlIlIlll[#("Y9Mr")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("J1")]][lllllIlIlIlIlll[#("z0k")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("7qxK")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("QI")]]=IllIIIllIlllIIllllIlIlIl[lllllIlIlIlIlll[#("bk1")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("AC")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("QsX")]][lllllIlIlIlIlll[#("rE7b")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("NK")]]=lllllIlIlIlIlll[#("Ust")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Zy")]]=lllllIlIlIlIlll[#("GUt")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("j9")]]=lllllIlIlIlIlll[#("Vr7")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Qi")]]=lllllIlIlIlIlll[#("dL9")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];lIIIIlllIllllI=lllllIlIlIlIlll[#("bD")]llIllllllIIlIllIlIII[lIIIIlllIllllI]=llIllllllIIlIllIlIII[lIIIIlllIllllI](IIlIIlllllIlIllllllll(llIllllllIIlIllIlIII,lIIIIlllIllllI+1,lllllIlIlIlIlll[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]))lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Zg")]][lllllIlIlIlIlll[#{"1 + 1 = 111";{572;461;44;100};{855;244;490;613};}]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#{{483;391;467;224};"1 + 1 = 111";"1 + 1 = 111";{342;430;834;642};}]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("hd")]][lllllIlIlIlIlll[#{"1 + 1 = 111";{869;862;346;310};{861;328;335;11};}]]=lllllIlIlIlIlll[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{823;917;960;313};}];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("lp")]][lllllIlIlIlIlll[#("isK")]]=lllllIlIlIlIlll[#("4KmQ")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#{{475;501;680;651};"1 + 1 = 111";}]][lllllIlIlIlIlll[#{{586;86;306;291};"1 + 1 = 111";"1 + 1 = 111";}]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("kNgL")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Af")]]=IllIIIllIlllIIllllIlIlIl[lllllIlIlIlIlll[#("gJh")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("2k")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("kUN")]][lllllIlIlIlIlll[#("2Yte")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("tx")]]=lllllIlIlIlIlll[#("3Ag")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("I5")]]=lllllIlIlIlIlll[#("lZC")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("zp")]]=lllllIlIlIlIlll[#("2T4")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];lIIIIlllIllllI=lllllIlIlIlIlll[#("C4")]llIllllllIIlIllIlIII[lIIIIlllIllllI]=llIllllllIIlIllIlIII[lIIIIlllIllllI](IIlIIlllllIlIllllllll(llIllllllIIlIllIlIII,lIIIIlllIllllI+1,lllllIlIlIlIlll[#("KpC")]))lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("QI")]][lllllIlIlIlIlll[#("dBm")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("YhkA")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("O1")]]=IllIIIllIlllIIllllIlIlIl[lllllIlIlIlIlll[#("R35")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("or")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("6U4")]][lllllIlIlIlIlll[#("u8TF")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("eC")]]=lllllIlIlIlIlll[#("o43")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("NX")]]=lllllIlIlIlIlll[#("xLk")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#{{772;338;234;557};{564;853;787;179};}]]=lllllIlIlIlIlll[#("9pS")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];lIIIIlllIllllI=lllllIlIlIlIlll[#("JY")]llIllllllIIlIllIlIII[lIIIIlllIllllI]=llIllllllIIlIllIlIII[lIIIIlllIllllI](IIlIIlllllIlIllllllll(llIllllllIIlIllIlIII,lIIIIlllIllllI+1,lllllIlIlIlIlll[#("0pl")]))lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("tS")]][lllllIlIlIlIlll[#{{732;261;465;173};{489;525;245;210};{467;229;230;706};}]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("h5l8")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#{{515;671;437;431};"1 + 1 = 111";}]]=IllIIIllIlllIIllllIlIlIl[lllllIlIlIlIlll[#("hSC")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("xT")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("HkA")]][lllllIlIlIlIlll[#("mPIb")]];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("9U")]]=lllllIlIlIlIlll[#("FRE")];lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;lllllIlIlIlIlll=IIIIlIllIlIIlIIllIIlIIlIl[lIIIIIllIIlIIlIlll];llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("Qv")]]=lllllIlIlIlIlll[#("4He")];end;elseif lIIIIlllIllllI<=#("NME2m5sH0ag4IYfWbf0SVyNUqXvdj7MBodj3hGTslBlRzW3db94VV8mp9UMAJox2yQQEO")then if lIIIIlllIllllI>#("PGvHGul5uE3rcjc1Pp143x4tU7dstTfAzZtzAoC1deAhHqmmZHbAMUssLcXJq2MMzE2n")then if(llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("fV")]]~=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("xdQm")]])then lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;else lIIIIIllIIlIIlIlll=lllllIlIlIlIlll[#("Zvv")];end;else local lIIIIIllIIlIIlIlll=lllllIlIlIlIlll[#("hO")]llIllllllIIlIllIlIII[lIIIIIllIIlIIlIlll](IIlIIlllllIlIllllllll(llIllllllIIlIllIlIII,lIIIIIllIIlIIlIlll+1,lllllIlIlIlIlll[#("fKz")]))end;elseif lIIIIlllIllllI<=#("OCAYa0Z7XXDU0EWRQXPHbXxC2KkCXScy9xlfLLM3DuYpuZBzZ4SQnQY0e86APxjeUeVErR")then lIIIIIllIIlIIlIlll=lllllIlIlIlIlll[#("S4M")];elseif lIIIIlllIllllI>#("ekVdQ8hgdjWN2axksJubNPmnglUGqe6giYOGCNh1712p3Uqey3C47QEz8H7FoM08mPEex0S")then llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("qo")]]=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#("SZQ")]]-lllllIlIlIlIlll[#("Pxxr")];else local IIIIlIllIlIIlIIllIIlIIlIl=lllllIlIlIlIlll[#("e5")];local lIIIIIllIIlIIlIlll=llIllllllIIlIllIlIII[lllllIlIlIlIlll[#{{53;224;778;680};{479;664;737;830};{400;630;981;994};}]];llIllllllIIlIllIlIII[IIIIlIllIlIIlIIllIIlIIlIl+1]=lIIIIIllIIlIIlIlll;llIllllllIIlIllIlIII[IIIIlIllIlIIlIIllIIlIIlIl]=lIIIIIllIIlIIlIlll[lllllIlIlIlIlll[#("nXJf")]];end;lIIIIIllIIlIIlIlll=lIIIIIllIIlIIlIlll+1;end;end);end;return IIllllIllIIlIIll(true,{},IIIIlIlIIlIlIlI())();end)(string.byte,table.insert,setmetatable);
RAW Paste Data