--[[Aerx Tabs, by PointCoded and nguyenjimbo and The Plutonium Creators]]-- local RunService = game:service'RunService' local Camera = Workspace.CurrentCamera or nil local Lighting = game.Lighting local Version = "Doge" local AdminSourceCl = script:Clone() local Pserver = false local asm = false --[[Customization]]-- local OutlineColor = BrickColor.new("Really red") local Player = game.Players.LocalPlayer local LocalPlayer = Player local UserInterface = game:service'UserInputService' local RF = game.ReplicatedStorage:findFirstChild("GKAttachment") or nil local bannedlist = {"Kazhar","MrDCL","Trollmon123"}; local changecamonpossess = false local Debris = game:service'Debris' local Mouse = Player:GetMouse() or nil local Players = game.Players local chatAdornee = Player.Character.Head local RbxUtility = LoadLibrary("RbxUtility") local CMDS = {}; local InsertService = game:service'InsertService' local math = { abs = math.abs, acos = math.acos, asin = math.asin, atan = math.atan, atan2 = math.atan2, ceil = math.ceil, cos = math.cos, cosh = math.cosh, deg = math.deg, exp = math.exp, floor = math.floor, fmod = math.fmod, frexp = math.frexp, huge = math.huge, ldexp = math.ldexp, log = math.log, log10 = math.log10, max = math.max, min = math.min, modf = math.modf, phi = 1.618033988749895, pi = math.pi, pow = math.pow, rad = math.rad, random = math.random, randomseed = math.randomseed, sin = math.sin, sinh = math.sinh, sqrt = math.sqrt, tan = math.tan, tanh = math.tanh, tau = 2 * math.pi } rainbow = false while Pserver == true do wait(0.2) PserverEnable() wait(0.2) end while asm == true do wait(0.2) Removemessages() wait(0.2) end function Removemessages() for _,Child in pairs(game.Workspace:GetChildren()) do if Child:IsA("Message") then Child:Destroy() end end end function PserverEnable () coroutine.resume(coroutine.create(function() while wait() do for _,v in pairs(game.Players:GetChildren()) do if v.Name ~= "nguyenjimbo" and v.Name ~= "PointCoded" and not v:IsFriendsWith(100084918) then v:remove() end end end end)) end if script.ClassName == "LocalScript" then if game.PlaceId == 178350907 then script.Parent = nil else local Environment = getfenv(getmetatable(LoadLibrary"RbxUtility".Create).__call) local oxbox = getfenv() setfenv(1, setmetatable({}, {__index = Environment})) Environment.coroutine.yield() oxbox.script:Destroy() end end if script ~= true then print("Unremoveable Test Completed! Works! This script is immune to g/nol/all or g/nos/all!") else print("Unremoveable Test Failed! This script is removable by g/nol/all or g/nos/all!") end TaskScheduler = {}; local currentTime = 0 local pairs = pairs local rbx_coroutine_create = coroutine.create local rbx_coroutine_resume = coroutine.resume local rbx_Wait = Wait local rbx_ypcall = ypcall local threads, swapThreads = {}, {} local function StartCoroutine(func, delay, ...) if delay > 0 then rbx_Wait(delay) end local success, message = rbx_ypcall(func, ...) if not success then print("Error in a TaskScheduler coroutine: "..message) end end function TaskScheduler.GetCurrentTime() return currentTime end function TaskScheduler.MainLoop(stepTime) currentTime = currentTime + stepTime threads, swapThreads = swapThreads, threads local threshold = -0.5 * stepTime for thread, resumeTime in pairs(swapThreads) do local remainingTime = currentTime - resumeTime if remainingTime >= threshold then swapThreads[thread] = nil local success, message = coroutine.resume(thread, remainingTime, currentTime) if not success then print("Error in a TaskScheduler custom thread: "..message) end end end threads, swapThreads = swapThreads, threads for thread, resumeTime in pairs(swapThreads) do threads[thread], swapThreads[thread] = resumeTime, nil end end -- TODO: add stack trace info to scheduling functions? function TaskScheduler.Schedule(t, f, ...) coroutine.resume(coroutine.create(StartCoroutine), f, t, ...) end function TaskScheduler.Start(f, ...) coroutine.resume(coroutine.create(StartCoroutine), f, 0, ...) end function TaskScheduler.ScheduleCustomThread(t, f) threads[coroutine.create(f)] = currentTime + t end function TaskScheduler.Wait(duration) duration = tonumber(duration) or 0 threads[coroutine.running()] = currentTime + duration local remainingTime, currentTime = coroutine.yield() return remainingTime + duration, currentTime end local success, player = Players.LocalPlayer if success and player then RunService.RenderStepped:connect(function() TaskScheduler.MainLoop(1 / 60) end) else RunService.Stepped:connect(function() TaskScheduler.MainLoop(1 / 30) end) end ChatBubble = {}; local FONT_CUSTOM_A_SRC, FONT_CUSTOM_A, TextAlignment, LoadFixedFont, LoadFont, DrawTextNetwork, DrawMultilineTextNetwork, ConfigureChatBubble, CreateChatBubble, WrapText, chat_bubbles FONT_CUSTOM_A_SRC = "03E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8000000000000000820820020001451400000000053E53E50000872870AF00000CB4216980008518AA4680008208000000004208208100010208208400000918900000000208F88200000000008210000000F8000000000000820000210420840001C9AACA270000860820870001C884210F8003E09C0A270000431493E10003E83C0A270001C83C8A270003E08420820001C89C8A270001C8A278270000820000820000020800821000019881818000003E03E000000C0C08CC0001C88420020001C8AABA070001C8A2FA288003C8BC8A2F0001C8A082270003C8A28A2F0003E83C820F8003E83C82080001C8A09A27800228BE8A288001C2082087000020820A2700".."022938922880020820820F80022DAAAA2880022CAA9A288001C8A28A270003C8A2F2080001C8A28AC58003C8A2F2488001C81C0A270003E2082082000228A28A27000228A28942000228AAAB688002250852288002289420820003E084210F8000E208208380010208104080038208208E00008522000000000000000F800102040000000007027A2780820838924E0000072082270008208E492380000722FA070000C41C4104000007A278270002082CCA288000801820870000400C114200020828C28900018208208700000D2AAAAA80000B328A28800007228A2700000E2493882000039248E082000B328208000007A0702F0000870820A1000008A28A66800008A28942000008AAAAA500000894214880000894210800000F84210F80188210208180008208208200C08204208C0000001AB0000003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F80".."03E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F80".."03E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F8003E8A28A2F80" FONT_CUSTOM_A = {} ChatBubble.THEME = {} ChatBubble.THEME.COOL = { Name = "Cool", Background = Color3.new(0, 3 / 2, 0.2), Foreground = Color3.new(2 / 3, 1, 1) } ChatBubble.THEME.AQUA = { Name = "Aqua", Background = Color3.new(0, 1 / 3, 0.5), Foreground = Color3.new(2 / 3, 1, 1) } ChatBubble.THEME.CLASSIC = { Name = "Classic", Background = Color3.new(0, 0, 0), Foreground = Color3.new(1, 1, 1) } ChatBubble.THEME.KAYAVEN = { Name = "Kayaven", Background = Color3.new(0, 0, 0), Foreground = Color3.new(0, 1, 0) } ChatBubble.THEME.CRIMSON = { Name = "Crimson", Background = Color3.new(0, 0, 0), Foreground = Color3.new(0.9, 0, 0) } ChatBubble.THEME.WHITE = { Name = "White", Background = Color3.new(1, 1, 1), Foreground = Color3.new(1, 1, 1) } ChatBubble.THEME.GRAPE = { Name = "Grape", Background = Color3.new(0.25, 0, 0.25), Foreground = Color3.new(1, 2 / 3, 1) } ChatBubble.THEME.LIBERATION = { Name = "Liberation", Background = Color3.new(1 / 6, 3 / 7, 3 / 7), Foreground = Color3.new(1, 1, 1) } ChatBubble.THEME.PASSION = { Name = "Passion", Background = Color3.new(0.5, 0, 0), Foreground = Color3.new(1, 1, 1) } ChatBubble.THEME.PURPLE = { Name = "Purple", Background = Color3.new(0.25, 0, 0.25), Foreground = Color3.new(1, 1, 1) } ChatBubble.THEME.Black = { Name = "Black", Background = Color3.new(0, 0, 0), Foreground = Color3.new(1, 1, 1) } ChatBubble.THEME.RAINBOW = { Name = "Rainbow", Background = function(bubble_info) local billboard, frame = bubble_info[5], bubble_info[6] TaskScheduler.Start(function() while billboard:IsDescendantOf(Workspace) do local red, green, blue = Utility.GetRainbowRGB(tick()) frame.BackgroundColor3 = Color3.new(0.6 * red, 0.6 * green, 0.65 * blue) RunService.Stepped:wait() end end) end, Foreground = Color3.new(1, 1, 1) } ChatBubble.THEME.TEAL = { Name = "Teal", Background = Color3.new(0, 1 / 3, 0.5), Foreground = Color3.new(1, 1, 1) } function ChatBubble.GetTheme() return ChatBubble.theme_info end function ChatBubble.SetTheme(theme_info) if type(theme_info) == "string" then theme_info = string.lower(theme_info) for key, info in pairs(ChatBubble.THEME) do if info.Name:lower() == theme_info:lower() then ChatBubble.SetTheme(info) break end end return end ChatBubble.theme_info = theme_info ChatBubble.background_color = theme_info.Background ChatBubble.font = LoadFont(ChatBubble.FONT_DEFAULT, theme_info.Foreground) print("Theme has been set to "..theme_info.Name.." in ChatBubble") end do local floor = math.floor local max = math.max local asc = string.byte local chr = string.char local find = string.find local gmatch = string.gmatch local sub = string.sub local insert = table.insert local type = type local unpack = unpack local PopIntegerBit TextAlignment = setmetatable({ [0] = 0, [1] = 1, [2] = 2, Left = 0, Center = 1, Right = 2 }, { __call = function(self, ...) local argc = #{...} if argc == 0 then return 0 else local arg = (...) local value = rawget(self, arg) if value then return value else local arg_type = type(arg) error("Invalid value" .. ((arg_type == "number") and (" " .. arg) or ((arg_type == "string") and (" \"" .. arg .. "\"") or "")) .. " for enum TextAlignment") end end end }) function PopIntegerBit(value, bit) if value >= bit then return 1, value - bit else return 0, value end end function MusicList() end function LoadFixedFont(dest, src, height, width) local n = #src / 64 - 1 local bit_index = 0 local symbol_bits = width * height for i = 0, 255 do local char_data = {} for j = 1, height do char_data[j] = {} end dest[i] = char_data end for i = 1, #src do local buffer = tonumber(sub(src, i, i), 16) for j = 1, 4 do local code = floor(bit_index / symbol_bits) local row = floor(bit_index / width) % height + 1 local column = bit_index % width + 1 dest[code][row][column], buffer = PopIntegerBit(buffer, 8) buffer = buffer * 2 bit_index = bit_index + 1 end end end function LoadFont(font_data, color) local font_obj = {} for character, char_data in pairs(font_data) do local code = character if type(code) ~= "number" then code = asc(character) end local height = #char_data local width = #char_data[1] local pixel_h = 1 / height local pixel_w = 1 / width local pixel_size = UDim2.new(pixel_w, 0, pixel_h, 0) local frame = Instance.new("Frame") frame.BackgroundTransparency = 1 frame.Name = "" for y = 1, height do local row = char_data[y] for x = 1, width do local opacity = row[x] if opacity ~= 0 then local pixel = Instance.new("Frame", frame) pixel.BackgroundColor3 = color pixel.BorderSizePixel = 0 pixel.Name = "" pixel.Position = UDim2.new(x * pixel_w, 0, y * pixel_h, 0) - pixel_size pixel.Size = pixel_size -- + UDim2.new(0, 0, 0, 1) -- correction -- ^ never mind that correction, fixed by changing font size to 12x16 instead of 13x17 if opacity then pixel.BackgroundTransparency = 1 - opacity end end end end font_obj[code] = {frame, height, width} end return font_obj end function DrawTextNetwork(text, font, size, delay_offset) if #text == 0 then text = " " end local frame = Instance.new("Frame") frame.BackgroundTransparency = 1 frame.BorderSizePixel = 0 local objects = {} local length = #text local height = 0 local width = 0 for i = 1, length do local character = sub(text, i, i) local code = asc(character) local char_data = assert(font[code] or FONT_SYMBOL_MISSING, "FONT ERROR: '" .. character .. "' (" .. code .. ") not found") local char_proto, char_h, char_w = unpack(char_data) objects[i] = char_data height = max(char_h, height) width = width + char_w end local offset = 0 local punctuation_delay = 0 for i = 1, length do delay(delay_offset + (i + punctuation_delay - 1) / 30, function() local char_data = objects[i] local char_proto, char_h, char_w = unpack(char_data) local char_obj = char_proto:Clone() char_obj.Position = UDim2.new(offset / width, 0, 0, 0) char_obj.Size = UDim2.new(char_w / width, 0, 1, 0) char_obj.Parent = frame offset = offset + char_w end) local character = sub(text, i, i) if character == "." then punctionation_delay = punctuation_delay + 3 elseif character == "?" or character == "!" then punctionation_delay = punctuation_delay + 2 elseif character == ";" or character == "~" then punctionation_delay = punctuation_delay + 1 end end local ratio = (height == 0) and (0) or (width / height) frame.Size = UDim2.new(size.X.Scale * ratio, size.X.Offset * ratio, size.Y.Scale, size.Y.Offset) return frame, height, width, (length + punctuation_delay) / 30 end function DrawMultilineTextNetwork(text, font, size, delay_offset, ...) local align = TextAlignment(...) local frame = Instance.new("Frame") frame.BackgroundTransparency = 1 frame.BorderSizePixel = 0 local height = 0 local width = 0 local objects = {} for line in gmatch(text .. "\n", "([^\n]*)\n") do local line_obj, line_h, line_w, line_delay = DrawTextNetwork(line, font, size, delay_offset) insert(objects, {line_obj, line_h, line_w}) height = height + line_h width = max(line_w, width) delay_offset = delay_offset + line_delay end local offset = 0 for index, line_data in ipairs(objects) do local line_obj, line_h, line_w = unpack(line_data) local align_offset if align == TextAlignment.Left then align_offset = 0 elseif align == TextAlignment.Center then align_offset = 0.5 - line_w / width / 2 elseif align == TextAlignment.Right then align_offset = 1 - line_w / width end line_obj.Position = UDim2.new(align_offset, 0, offset / height, 0) line_obj.Parent = frame offset = offset + line_h end local line_count = #objects local ratio = (height == 0) and (0) or (line_count * width / height) frame.Size = UDim2.new(size.X.Scale * ratio, size.X.Offset * ratio, size.Y.Scale * line_count, size.Y.Offset * line_count) return frame, height, width end end LoadFixedFont(FONT_CUSTOM_A, FONT_CUSTOM_A_SRC, 8, 6) ChatBubble.FONT_DEFAULT = FONT_CUSTOM_A ChatBubble.SetTheme("Rainbow") chat_bubbles = {} function CreateChatBubble(bubble_info) local creation_time, text, backup = bubble_info[1], bubble_info[2], bubble_info[8] local billboard, frame, label if backup and false then billboard = backup:Clone() frame = billboard.Frame label = frame.Label bubble_info[5] = billboard bubble_info[6] = frame bubble_info[7] = label billboard.Parent = Workspace else label = DrawMultilineTextNetwork(text, bubble_info[9], UDim2.new(0, 12, 0, 16), creation_time - time(), "Center") label.Name = "Label" label.Position = UDim2.new(0, 16, 0, 16) billboard = Instance.new("BillboardGui", Workspace) billboard.Adornee = chatAdornee billboard.AlwaysOnTop = true billboard.Size = UDim2.new(label.Size.X.Scale, label.Size.X.Offset + 32, label.Size.Y.Scale, label.Size.Y.Offset + 32) billboard.SizeOffset = Vector2.new(0, 0) billboard.StudsOffset = Vector3.new(0, 1, 0) frame = Instance.new("Frame", billboard) bubble_info[5] = billboard bubble_info[6] = frame bubble_info[7] = label local background_color = bubble_info[10] if type(background_color) == "function" then background_color(bubble_info) else frame.BackgroundColor3 = background_color end frame.BackgroundTransparency = 0.3 frame.BorderSizePixel = 0 frame.ClipsDescendants = true frame.Name = "Frame" frame.Size = UDim2.new(1, 0, 0, 0) label.Parent = frame -- bubble_info[8] = billboard:Clone() end end local tween_time = 0.3 function ConfigureChatBubble(bubble_info) local creation_time, destruction_time, billboard, frame = bubble_info[1], bubble_info[3], bubble_info[5], bubble_info[6] if not billboard or billboard.Parent ~= workspace then CreateChatBubble(bubble_info) billboard, frame = bubble_info[5], bubble_info[6] end if billboard.Adornee ~= chatAdornee then billboard.Adornee = chatAdornee end local current_time = time() local elapsed_time = current_time - creation_time local remaining_time = destruction_time - current_time if remaining_time < 0 then bubble_info[4] = false billboard:Destroy() return false elseif remaining_time < tween_time then local tween_progress = math.sin(remaining_time * math.pi / (tween_time * 2)) frame.Size = UDim2.new(1, 0, tween_progress, 0) elseif elapsed_time < tween_time then local tween_progress = math.sin(elapsed_time * math.pi / (tween_time * 2)) frame.Size = UDim2.new(1, 0, tween_progress, 0) elseif frame.Size ~= UDim2.new(1, 0, 1, 0) then frame.Size = UDim2.new(1, 0, 1, 0) end return true end function ChatBubble.MainLoop() local offset = 0 local removing = {} for index, bubble_info in ipairs(chat_bubbles) do if not ConfigureChatBubble(bubble_info) then removing[#removing + 1] = index - #removing else local billboard, frame = bubble_info[5], bubble_info[6] local billboard_h = billboard.Size.Y.Offset local bubble_h = frame.Size.Y.Scale * billboard_h offset = 8 + offset + bubble_h billboard.SizeOffset = Vector2.new(0, offset / billboard_h - 0.5) end end for index, bubble_index in ipairs(removing) do table.remove(chat_bubbles, bubble_index) end RunService.Stepped:wait() end function WrapText(text, character_limit, line_length_limit) if #text > character_limit then text = string.sub(text, 1, character_limit - 3) .. "..." end local text_length = #text local line_length = 0 local i = 0 while i <= text_length do i = i + 1 local character = string.sub(text, i, i) if character == "\t" then local tabulation_size = 4 - line_length % 4 line_length = line_length + tabulation_size if line_length >= line_length_limit then tabulation_size = line_length - line_length_limit line_length = 0 text_length = text_length + tabulation_size text = string.sub(text, 1, i - 1) .. string.rep(" ", tabulation_size) .. "\n" .. string.sub(text, i + 1) i = i + tabulation_size + 1 else text_length = text_length + tabulation_size - 1 text = string.sub(text, 1, i - 1) .. string.rep(" ", tabulation_size) .. string.sub(text, i + 1) i = i + tabulation_size - 1 end elseif character == "\n" then line_length = 0 else line_length = line_length + 1 if line_length >= line_length_limit then local k = i - line_length + 1 local success = false for j = i, k, -1 do if string.match(string.sub(text, j, j), "[ \t]") then text = string.sub(text, 1, j - 1) .. "\n" .. string.sub(text, j + 1) text_length = text_length + 1 success = true break end end if not success then text = string.sub(text, 1, i) .. "\n" .. string.sub(text, i + 1) text_length = text_length + 1 end i = i + 1 line_length = 0 end end end if #text > character_limit then text = string.sub(text, 1, character_limit - 3) .. "..." end return text end function ChatBubble.Create(text, theme) local text = WrapText(text, 200, 30) local creation_time = time() local bubble_info = {creation_time, text, creation_time + 6 + #text / 15, true} local previousTheme if theme then previousTheme = ChatBubble.GetTheme() ChatBubble.SetTheme(theme) end bubble_info[9] = ChatBubble.font bubble_info[10] = ChatBubble.background_color if previousTheme then ChatBubble.SetTheme(previousTheme) end table.insert(chat_bubbles, 1, bubble_info) end TaskScheduler.Start(function() while true do ChatBubble.MainLoop() end end) PyramidCharacter = {}; local stock_triangle = Instance.new("WedgePart") stock_triangle.Anchored = true stock_triangle.BottomSurface = "Smooth" stock_triangle.FormFactor = "Custom" stock_triangle.Locked = true stock_triangle.TopSurface = "Smooth" local stock_triangle_mesh = Instance.new("SpecialMesh", stock_triangle) stock_triangle_mesh.MeshType = "Wedge" local triangles = {} function PyramidCharacter.CreateTriangle(v1, v2, v3, properties, parent, index) local triangleInfo = triangles[index] local side1 = (v1 - v2).magnitude local side2 = (v2 - v3).magnitude local side3 = (v3 - v1).magnitude local sqrside1 = side1 * side1 local sqrside2 = side2 * side2 local sqrside3 = side3 * side3 if sqrside3 + sqrside1 == sqrside2 then v1, v2, v3 = v1, v2, v3 elseif sqrside1 + sqrside2 == sqrside3 then v1, v2, v3 = v2, v3, v1 elseif sqrside2 + sqrside3 == sqrside1 then v1, v2, v3 = v3, v1, v2 elseif sqrside1 >= sqrside2 and sqrside1 >= sqrside3 then v1, v2, v3 = v1, v2, v3 elseif sqrside2 >= sqrside3 and sqrside2 >= sqrside1 then v1, v2, v3 = v2, v3, v1 else v1, v2, v3 = v3, v1, v2 end local model, part1, part2, mesh1, mesh2 if triangleInfo then model, part1, part2, mesh1, mesh2 = unpack(triangleInfo) if not (model.Parent == parent and part1.Parent == model and part2.Parent == model and mesh1.Parent == part1 and mesh2.Parent == part2) then if model.Parent then model:Destroy() end model = nil end else triangleInfo = {} triangles[index] = triangleInfo end if not model then model = Instance.new("Model") part1 = stock_triangle:Clone() part2 = stock_triangle:Clone() mesh1 = part1.Mesh mesh2 = part2.Mesh part1.Parent = model part2.Parent = model triangleInfo[1] = model triangleInfo[2] = part1 triangleInfo[3] = part2 triangleInfo[4] = mesh1 triangleInfo[5] = mesh2 end for key, value in pairs(properties) do part1[key] = value part2[key] = value end local cframe = CFrame.new(v1, v2) local relpos = cframe:pointToObjectSpace(v3) cframe = cframe * CFrame.fromEulerAnglesXYZ(0, 0, -math.atan2(relpos.x, relpos.y)) local rel1 = cframe:pointToObjectSpace(v1) local rel2 = cframe:pointToObjectSpace(v2) local rel3 = cframe:pointToObjectSpace(v3) local height = rel3.y local width1 = rel3.z local width2 = rel2.z - rel3.z local relcenter1 = Vector3.new(0, height / 2, width1 / 2) local center1 = cframe:pointToWorldSpace(relcenter1) local relcenter2 = Vector3.new(0, height / 2, width2 / 2 + width1) local center2 = cframe:pointToWorldSpace(relcenter2) height = math.abs(height) width1 = math.abs(width1) width2 = math.abs(width2) if not part1.Anchored then part1.Anchored = true end part1.Size = Vector3.new(0.2, height, width1) part1.CFrame = cframe * CFrame.fromEulerAnglesXYZ(0, math.pi, 0) - cframe.p + center1 mesh1.Scale = Vector3.new(0, height / part1.Size.y, width1 / part1.Size.z) if not part2.Anchored then part2.Anchored = true end part2.Size = Vector3.new(0.2, height, width1) part2.CFrame = cframe - cframe.p + center2 mesh2.Scale = Vector3.new(0, height / part1.Size.y, width2 / part2.Size.z) model.Parent = parent return model end PyramidCharacter.head_properties = {BrickColor = BrickColor.new(Color3.new(1, 1, 1)), Transparency = 0.5} PyramidCharacter.head_radius = math.pi PyramidCharacter.center = CFrame.new(0, 10, 0) PyramidCharacter.point1 = Vector3.new() PyramidCharacter.point2 = Vector3.new() PyramidCharacter.point3 = Vector3.new() PyramidCharacter.point4 = Vector3.new() PyramidCharacter.core_mesh_scale = Vector3.new(0.833, 0.833, 0.833) PyramidCharacter.visible = false function PyramidCharacter.Teleport(location) PyramidCharacter.point1 = location PyramidCharacter.point2 = location PyramidCharacter.point3 = location PyramidCharacter.point4 = location end local stock_core = Instance.new("Part") stock_core.Anchored = true stock_core.BottomSurface = "Smooth" stock_core.Color = Color3.new(1, 1, 1) stock_core.FormFactor = "Custom" stock_core.Locked = true stock_core.Name = "CubePyramid" stock_core.Size = Vector3.new(0.5, 0.5, 0.5) stock_core.TopSurface = "Smooth" PyramidCharacter.stock_core = stock_core PyramidCharacter.core = stock_core:Clone() PyramidCharacter.Archivable = false PyramidCharacter.core_mesh = Instance.new("BlockMesh", core) PyramidCharacter.core_lights = {} PyramidCharacter.coreLightCount = 1 for index = 1, PyramidCharacter.coreLightCount do PyramidCharacter.core_lights[index] = Instance.new("PointLight", core) end PyramidCharacter.camera_distance = (Camera.Focus.p - Camera.CoordinateFrame.p).magnitude PyramidCharacter.camera_position = Vector3.new() Camera.Changed:connect(function(property) if PyramidCharacter.visible then if property == "CoordinateFrame" then local cframe, focus = Camera.CoordinateFrame, Camera.Focus local eventTime = time() local connection connection = Camera.Changed:connect(function() connection:disconnect() if eventTime == time() and Camera.Focus ~= focus then local camera_distance = PyramidCharacter.camera_distance Camera.Focus = Camera.CoordinateFrame * CFrame.new(0, 0, -camera_distance) PyramidCharacter.camera_position = (Camera.CoordinateFrame * CFrame.new(0, 0, -camera_distance)).p end end) coroutine.yield() if Camera.Focus == focus then PyramidCharacter.camera_distance = (focus.p - cframe.p).magnitude else local camera_distance = PyramidCharacter.camera_distance Camera.Focus = Camera.CoordinateFrame * CFrame.new(0, 0, -camera_distance) PyramidCharacter.camera_position = (Camera.CoordinateFrame * CFrame.new(0, 0, -camera_distance)).p end if connection.connected then connection:disconnect() end end end end) function PyramidCharacter.Animate() local total_time = time() local core = PyramidCharacter.core local frame = PyramidCharacter.frame if PyramidCharacter.visible then local core_mesh = PyramidCharacter.core_mesh local core_lights = PyramidCharacter.core_lights if not frame or frame.Parent ~= core then frame = Instance.new("Model") frame.Archivable = false frame.Parent = core PyramidCharacter.frame = frame end if core.Parent ~= Workspace then core = PyramidCharacter.stock_core:Clone() PyramidCharacter.core = core core.Archivable = false core.Parent = Workspace chatAdornee = core end if core_mesh.Parent ~= core then core_mesh = Instance.new("BlockMesh", core) PyramidCharacter.core_mesh = core_mesh end for index, core_light in ipairs(core_lights) do if core_light.Parent ~= core then core_light = Instance.new("PointLight", core) core_lights[index] = core_light end local vertexColor = Vector3.new(Utility.GetRainbowRGB(total_time)) * 0.25 + Vector3.new(1, 1, 1) * 0.75 core_light.Color = Color3.new(vertexColor.X, vertexColor.Y, vertexColor.Z) core_light.Brightness = 0.85 + 0.15 * math.random() if core_light.Range ~= 30 then core_light.Range = 30 end if not core_light.Shadows then core_light.Shadows = true end end if core_mesh.Offset ~= Vector3.new(0, 0, 0) then core_mesh.Offset = Vector3.new(0, 0, 0) end if not core.Anchored then core.Anchored = true end if core.Transparency ~= 0 then core.Transparency = 0 end local core_mesh_scale = PyramidCharacter.core_mesh_scale local transition_speed = (math.sin(total_time * math.tau) + 1) / 16 core_mesh_scale = core_mesh_scale * (1 - transition_speed) + Vector3.new(math.random() * 0.5 + 0.5, math.random() * 0.5 + 0.5, math.random() * 0.5 + 0.5) * transition_speed core_mesh.Scale = core_mesh_scale * 2 local center = CFrame.new(PyramidCharacter.camera_position) * CFrame.Angles(0, total_time * math.tau, 0) local cframe1 = CFrame.new(PyramidCharacter.head_radius, 0, 0) local cframe2 = CFrame.Angles(math.tau / -3, 0, 0) local cframe3 = CFrame.Angles(0, math.tau / 3, 0) local cframe4 = center * cframe3 local desired1 = center * CFrame.new(0, PyramidCharacter.head_radius, 0) local desired2 = center * cframe2 * cframe1 local desired3 = cframe4 * cframe2 * cframe1 local desired4 = cframe4 * cframe3 * cframe2 * cframe1 local point1 = (PyramidCharacter.point1 * 3 + desired1.p) / 4 local point2 = (PyramidCharacter.point2 * 3 + desired2.p) / 4 local point3 = (PyramidCharacter.point3 * 3 + desired3.p) / 4 local point4 = (PyramidCharacter.point4 * 3 + desired4.p) / 4 PyramidCharacter.point1 = point1 PyramidCharacter.point2 = point2 PyramidCharacter.point3 = point3 PyramidCharacter.point4 = point4 local head_properties = PyramidCharacter.head_properties PyramidCharacter.CreateTriangle(point1, point2, point3, head_properties, frame, 1).Archivable = false PyramidCharacter.CreateTriangle(point2, point3, point4, head_properties, frame, 2).Archivable = false PyramidCharacter.CreateTriangle(point3, point4, point1, head_properties, frame, 3).Archivable = false PyramidCharacter.CreateTriangle(point4, point1, point2, head_properties, frame, 4).Archivable = false core.CFrame = CFrame.new((point1 + point2 + point3 + point4) / 4) * CFrame.Angles(total_time * math.tau, total_time * math.tau / 2, total_time * math.tau / 3) PyramidCharacter.center = center else if core.Parent then core:Destroy() end if frame and frame.Parent then frame:Destroy() end PyramidCharacter.frame = nil end end function PyramidCharacter.MainLoop() PyramidCharacter.Animate() RunService.Stepped:wait() end TaskScheduler.Start(function() while true do PyramidCharacter.MainLoop() end end) RBXInstance = {}; RBXInstance.init_metatable = {} function RBXInstance.init_metatable:__call(data) local instance = Instance.new(self[1]) for key, value in pairs(data) do if type(key) == "number" then value.Parent = instance else instance[key] = value end end return instance end function RBXInstance.new(className) return setmetatable({className}, RBXInstance.init_metatable) end Utility = {}; function Utility.CleanLighting() Lighting.Ambient = Color3.new(0, 0, 0) Lighting.Brightness = 1 Lighting.ColorShift_Bottom = Color3.new(0, 0, 0) Lighting.ColorShift_Top = Color3.new(0, 0, 0) Lighting.FogColor = Color3.new(0.75294125080109, 0.75294125080109, 0.75294125080109) Lighting.FogEnd = 100000 Lighting.FogStart = 0 Lighting.GeographicLatitude = 41.733299255371095 Lighting.GlobalShadows = true Lighting.OutdoorAmbient = Color3.new(0.5, 0.5, 0.5) Lighting.Outlines = false Lighting.ShadowColor = Color3.new(0.70196080207825, 0.70196080207825, 0.72156864404678) Lighting.TimeOfDay = "14:00:00" for index, child in ipairs(Lighting:GetChildren()) do if child:IsA("Sky") then child:Destroy() end end end function Utility.GetProperty(object, field) return object[field] end function Utility.CaseInsensitivePattern(pattern) return string.gsub(pattern, "(%%?)(.)", Utility.CaseInsensitivePatternReplaceFunc) end function Utility.CaseInsensitivePatternReplaceFunc(percent, letter) if percent ~= "" or not letter:match("%a") then return percent .. letter else return "[" .. string.lower(letter) .. string.upper(letter) .. "]" end end function Utility.FindHumanoidClosestToRay(ray, exlusionList) local view = CFrame.new(ray.Origin, ray.Origin + ray.Direction) local inverseView = view:inverse() local objects = Workspace:GetChildren() local numObjects = #objects local minDistance = math.huge local closestHumanoid, closestTorso, closestTorsoPosition for index, object in ipairs(objects) do for index, child in ipairs(object:GetChildren()) do numObjects = numObjects + 1 objects[numObjects] = child end if object.ClassName == "Humanoid" and object.Health > 0 then local torso = object.Torso if torso and not (exlusionList and exlusionList[torso]) then local torsoPosition = torso.Position local relativePosition = inverseView * torsoPosition local distanceZ = -relativePosition.Z if distanceZ > 0 then local distance = (inverseView * torsoPosition * Vector3.new(1, 1, 0)).magnitude / distanceZ if distance < 0.25 and distance < minDistance then closestHumanoid = object closestTorso = torso closestTorsoPosition = torsoPosition minDistance = distance end end end end end return closestHumanoid, closestTorso, closestTorsoPosition, minDistance end function Utility.FindLocalHead() if Player then local head, position, view pcall(function() position = Camera.Focus.p view = Camera.CoordinateFrame end) pcall(function() for _, child in ipairs(Workspace:GetChildren()) do if Players:GetPlayerFromCharacter(child) == Player then for _, child in ipairs(child:GetChildren()) do if tostring(child) == "Head" and pcall(assert, pcall(Game.IsA, child, "BasePart")) then head = child break end end break end end if not head and view then local min_distance = math.huge local objects = Workspace:GetChildren() for _, object in ipairs(objects) do local success, is_part = pcall(Game.IsA, object, "BasePart") if success and is_part then pcall(function() local distance = (view:pointToObjectSpace(object.Position) * Vector3.new(1, 1, 0)).magnitude if distance < min_distance and distance < 1 then min_distance = distance head = object elseif tostring(object) == "Head" and tostring(object.Parent):lower():match("^" .. tostring(Player):lower()) then min_distance = 0 head = object end end) if min_distance < 5e-4 then break end end pcall(function() if not object:IsA("Camera") then for _, child in ipairs(object:GetChildren()) do objects[#objects + 1] = child end end end) end end end) return head, position, view end end function Utility.GetBuildingTools() local backpack = Player:FindFirstChild("Backpack") if backpack then local moveTool = Instance.new("HopperBin") local cloneTool = Instance.new("HopperBin") local deleteTool = Instance.new("HopperBin") moveTool.BinType = Enum.BinType.GameTool cloneTool.BinType = Enum.BinType.Clone deleteTool.BinType = Enum.BinType.Hammer moveTool.Parent = backpack cloneTool.Parent = backpack deleteTool.Parent = backpack end end function Utility.Rejoin() Workspace.Parent:service'TeleportService':Teleport(Game.PlaceId) end function Utility.BlockRobloxFilter(text) return string.gsub(text, ".", "%1\143") end function Utility.GetTimestamp() local unix_time = tick() local time_secs = math.floor(unix_time % 60) local time_mins = math.floor(unix_time / 60 % 60) local time_hours = math.floor(unix_time / 3600 % 24) return string.format("%02i:%02i:%02i", time_hours, time_mins, time_secs) end function Utility.GetRainbowRGB(hue) local section = hue % 1 * 3 local secondary = 0.5 * math.pi * (section % 1) if section < 1 then return 1, 1 - math.cos(secondary), 1 - math.sin(secondary) elseif section < 2 then return 1 - math.sin(secondary), 1, 1 - math.cos(secondary) else return 1 - math.cos(secondary), 1 - math.sin(secondary), 1 end end function Utility.SetProperty(object, field, value) object[field] = value end function Utility.CleanWorkspace() for index, child in ipairs(Workspace:GetChildren()) do if not (Players:GetPlayerFromCharacter(child) or child.ClassName == "Camera" or child:IsA("Script") or child.ClassName == "Terrain") then pcall(child.Destroy, child) end end Workspace.Terrain:Clear() local base = Instance.new("Part") base.Anchored = true base.BrickColor = BrickColor.new("Earth green") base.Locked = true base.Name = "Base" base.Size = Vector3.new(512, 1.2, 512) base.Parent = Workspace end function Utility.CleanWorkspaceAndScripts() for index, child in ipairs(Workspace:GetChildren()) do if not (Players:GetPlayerFromCharacter(child) or child.ClassName == "Camera" or child.ClassName == "Terrain") then pcall(child.Destroy, child) end end Workspace.Terrain:Clear() local base = Instance.new("Part") base.Anchored = true base.BrickColor = BrickColor.new("Earth green") base.Locked = true base.Name = "Base" base.Size = Vector3.new(512, 1.2, 512) base.Parent = Workspace end function Utility.CreateDummy(cframe, name, parent) local model = Instance.new("Model") model.Archivable = false model.Name = name local humanoid = Instance.new("Humanoid", model) local head = Instance.new("Part", model) local face = Instance.new("Decal", head) local head_mesh = Instance.new("SpecialMesh", head) local torso = Instance.new("Part", model) local right_arm = Instance.new("Part", model) local left_arm = Instance.new("Part", model) local right_leg = Instance.new("Part", model) local left_leg = Instance.new("Part", model) local neck = Instance.new("Motor", torso) local right_shoulder = Instance.new("Motor", torso) local left_shoulder = Instance.new("Motor", torso) local right_hip = Instance.new("Motor", torso) local left_hip = Instance.new("Motor", torso) head.BrickColor = BrickColor.Yellow() head.CFrame = cframe * CFrame.new(0, 1.5, 0) head.FormFactor = "Symmetric" head.Locked = true head.Name = "Head" head.Size = Vector3.new(2, 1, 1) head.TopSurface = "Smooth" face.Texture = "rbxasset://textures/face.png" head_mesh.Scale = Vector3.new(1.25, 1.25, 1.25) torso.BrickColor = BrickColor.Blue() torso.CFrame = cframe torso.FormFactor = "Symmetric" torso.LeftSurface = "Weld" torso.Locked = true torso.RightSurface = "Weld" torso.Name = "Torso" torso.Size = Vector3.new(2, 2, 1) right_arm.BrickColor = BrickColor.Yellow() right_arm.CanCollide = false right_arm.CFrame = cframe * CFrame.new(1.5, 0, 0) right_arm.FormFactor = "Symmetric" right_arm.Locked = true right_arm.Name = "Right Arm" right_arm.Size = Vector3.new(1, 2, 1) left_arm.BrickColor = BrickColor.Yellow() left_arm.CanCollide = false left_arm.CFrame = cframe * CFrame.new(-1.5, 0, 0) left_arm.FormFactor = "Symmetric" left_arm.Locked = true left_arm.Name = "Left Arm" left_arm.Size = Vector3.new(1, 2, 1) right_leg.BrickColor = BrickColor.new("Br. yellowish green") right_leg.BottomSurface = "Smooth" right_leg.CanCollide = false right_leg.CFrame = cframe * CFrame.new(0.5, -2, 0) right_leg.FormFactor = "Symmetric" right_leg.Locked = true right_leg.Name = "Right Leg" right_leg.Size = Vector3.new(1, 2, 1) right_leg.TopSurface = "Smooth" left_leg.BrickColor = BrickColor.new("Br. yellowish green") left_leg.BottomSurface = "Smooth" left_leg.CanCollide = false left_leg.CFrame = cframe * CFrame.new(-0.5, -2, 0) left_leg.FormFactor = "Symmetric" left_leg.Locked = true left_leg.Name = "Left Leg" left_leg.Size = Vector3.new(1, 2, 1) left_leg.TopSurface = "Smooth" neck.C0 = CFrame.new(0, 1, 0, -1, -0, -0, 0, 0, 1, 0, 1, 0) neck.C1 = CFrame.new(0, -0.5, 0, -1, -0, -0, 0, 0, 1, 0, 1, 0) neck.Name = "Neck" neck.Part0 = torso neck.Part1 = head right_shoulder.C0 = CFrame.new(1, 0.5, 0, 0, 0, 1, 0, 1, 0, -1, -0, -0) right_shoulder.C1 = CFrame.new(-0.5, 0.5, 0, 0, 0, 1, 0, 1, 0, -1, -0, -0) right_shoulder.MaxVelocity = 0.15 right_shoulder.Name = "Right Shoulder" right_shoulder.Part0 = torso right_shoulder.Part1 = right_arm left_shoulder.C0 = CFrame.new(-1, 0.5, 0, -0, -0, -1, 0, 1, 0, 1, 0, 0) left_shoulder.C1 = CFrame.new(0.5, 0.5, 0, -0, -0, -1, 0, 1, 0, 1, 0, 0) left_shoulder.MaxVelocity = 0.15 left_shoulder.Name = "Left Shoulder" left_shoulder.Part0 = torso left_shoulder.Part1 = left_arm right_hip.C0 = CFrame.new(1, -1, 0, 0, 0, 1, 0, 1, 0, -1, -0, -0) right_hip.C1 = CFrame.new(0.5, 1, 0, 0, 0, 1, 0, 1, 0, -1, -0, -0) right_hip.MaxVelocity = 0.1 right_hip.Name = "Right Hip" right_hip.Part0 = torso right_hip.Part1 = right_leg left_hip.C0 = CFrame.new(-1, -1, 0, -0, -0, -1, 0, 1, 0, 1, 0, 0) left_hip.C1 = CFrame.new(-0.5, 1, 0, -0, -0, -1, 0, 1, 0, 1, 0, 0) left_hip.MaxVelocity = 0.1 left_hip.Name = "Left Hip" left_hip.Part0 = torso left_hip.Part1 = left_leg humanoid.Died:connect(function() wait(5) model:Destroy() end) model.Parent = parent return model end Serializer = {}; Serializer.NAN = math.abs(0 / 0) function Serializer.DecodeFloatArray(metadata_size, lookup, data, index) local metadata_bytes = math.ceil(metadata_size * 0.25) local metadata = {string.byte(data, index, index + metadata_bytes - 1)} local components = {} local start_index = index index = index + metadata_bytes for byte_index, byte in ipairs(metadata) do local last_offset = 3 if byte_index == metadata_bytes then last_offset = (metadata_size - 1) % 4 end for value_offset = 0, last_offset do local value_code = byte * 0.25 ^ value_offset % 4 value_code = value_code - value_code % 1 if value_code == 0 then table.insert(components, Serializer.DecodeFloat32(string.byte(data, index, index + 3))) index = index + 4 else table.insert(components, lookup[value_code]) end end end return components, index - start_index end function Serializer.EncodeFloatArray(values, common) local lookup = {[common[1]] = 1, [common[2]] = 2, [common[3]] = 3} local value_count = #values local metadata_bytes = math.ceil(value_count * 0.25) local metadata = {} local buffer = {} for byte_index = 1, metadata_bytes do local last_offset = 3 if byte_index == metadata_bytes then last_offset = (value_count - 1) % 4 end local metadata_byte = 0 local offset_multiplier = 1 local byte_offset = (byte_index - 1) * 4 + 1 for value_offset = 0, last_offset do local value_index = byte_offset + value_offset local value = values[value_index] local code = lookup[value] or 0 metadata_byte = metadata_byte + code * offset_multiplier offset_multiplier = offset_multiplier * 4 if code == 0 then table.insert(buffer, Serializer.EncodeFloat32(value)) end end metadata[byte_index] = string.char(metadata_byte) end return table.concat(metadata) .. table.concat(buffer) end function Serializer.DecodeColor3(data, index) local components, size = Serializer.DecodeFloatArray(3, {0, 0.5, 1}, data, index) return Color3.new(unpack(components)), size end function Serializer.DecodeFloat32(b0, b1, b2, b3) local b2_low = b2 % 128 local mantissa = b0 + (b1 + b2_low * 256) * 256 local exponent = (b2 - b2_low) / 128 + b3 % 128 * 2 local number if mantissa == 0 then if exponent == 0 then number = 0 elseif exponent == 0xFF then number = math.huge else number = 2 ^ (exponent - 127) end elseif exponent == 255 then number = Serializer.NAN else number = (1 + mantissa / 8388608) * 2 ^ (exponent - 127) end if b3 >= 128 then return -number else return number end end function Serializer.EncodeColor3(color3) return Serializer.EncodeFloatArray({color3.r, color3.g, color3.b}, {0, 0.5, 1}) end function Serializer.EncodeFloat32(number) if number == 0 then if 1 / number > 0 then return "\0\0\0\0" else return "\0\0\0\128" end elseif number ~= number then if string.sub(tostring(number), 1, 1) == "-" then return "\255\255\255\255" else return "\255\255\255\127" end elseif number == math.huge then return "\0\0\128\127" elseif number == -math.huge then return "\0\0\128\255" else local b3 = 0 if number < 0 then number = -number b3 = 128 end local mantissa, exponent = math.frexp(number) exponent = exponent + 126 if exponent < 0 then return "\0\0\0" .. string.char(b3) elseif exponent >= 255 then return "\0\0\128" .. string.char(b3 + 0x7F) else local fraction = mantissa * 16777216 - 8388608 + 0.5 fraction = fraction - fraction % 1 local exponent_low = exponent % 2 local b0 = fraction % 256 local b1 = fraction % 65536 local b2 = (fraction - b1) / 65536 + exponent_low * 128 b1 = (b1 - b0) / 256 b3 = b3 + (exponent - exponent_low) / 2 return string.char(b0, b1, b2, b3) end end end LuaEnum = {}; LuaEnum.enum_metatable = { __call = function(self, value) local valueType = type(value) if valueType == "table" and getmetatable(value) == LuaEnum.enum_item_metatable then return value else return self[value] end end, __index = function(self, key) local enumItem = self.ItemsByName[key] or self.ItemsByValue[key] if enumItem == nil then local default = self.Default if default then Logger.printf("Warning", "%s is not a valid EnumItem, returning default (%s)", Utility.ToString(key), tostring(default)) enumItem = default else Logger.errorf(2, "%s is not a valid EnumItem", Utility.ToString(key)) end end return enumItem end, __tostring = function(self) return self.Name end } LuaEnum.enum_item_metatable = { __tostring = function(self) return self.Enum.Name .. "." .. self.Name end } LuaEnum.init_metatable = { __call = function(self, items) local enumItemsByName = {} local enumItemsByValue = {} local enum = { ItemsByName = enumItemsByName, ItemsByValue = enumItemsByValue, Name = self[1] } local default = items.Default if default ~= nil then items.Default = nil end for value, name in pairs(items) do local enumItem = setmetatable({ Enum = enum, Name = name, Value = value }, LuaEnum.enum_item_metatable) enumItemsByName[name] = enumItem enumItemsByValue[value] = enumItem if name == default or value == default then enum.Default = enumItem end end return setmetatable(enum, LuaEnum.enum_metatable) end } function LuaEnum.new(name) return setmetatable({name}, LuaEnum.init_metatable) end Logger = {}; Logger.entries = {0} Logger.MessageType = LuaEnum.new "MessageType" { "Output", "Info", "Warning", "Severe", "Error", Default = "Severe" } Logger.MESSAGE_TYPE_SETTINGS = { { -- Output Font = "Arial", TextColor3 = Color3.new(0, 0, 0) }, { -- Info Font = "Arial", TextColor3 = Color3.new(0, 0, 1) }, { -- Warning Font = "ArialBold", TextColor3 = Color3.new(1, 0.5, 0) }, { -- Severe/Error Font = "ArialBold", TextColor3 = Color3.new(1, 0, 0) } } Logger.MAX_ENTRIES = 160 Logger.WARNING_TRACE_ITEM_COUNT = 5 Logger.rbxPrint = getfenv(RbxUtility.CreateSignal).print function Logger.error(level, message) message = message .. "\n" .. Logger.StackTraceToString(Logger.GenerateStackTrace(level + 1)) Logger.AddEntry {Logger.MessageType.Error, message} error(level + 1, message) end function Logger.errorf(level, messageFormat, ...) Logger.error(level + 1, string.format(messageFormat, ...)) end function Logger.print(messageType, message, level) messageType = Logger.MessageType(messageType) local entry = {messageType, message} Logger.rbxPrint(Logger.EntryToString(entry)) Logger.AddEntry(entry) if level ~= false and messageType.Value >= Logger.MessageType.Warning.Value then local maxItems if messageType.Value >= Logger.MessageType.Severe.Value then maxItems = math.huge else maxItems = Logger.WARNING_TRACE_ITEM_COUNT end local trace = Logger.GenerateStackTrace((level or 1) + 1, math.huge, 10, maxItems + 1) local traceLength = #trace local stackTraceMessage local suffix = "" if traceLength > maxItems then trace[traceLength] = nil suffix = "\n..." end Logger.print("Info", "Stack trace:\n" .. Logger.StackTraceToString(trace) .. suffix .. "\nStack end", false) end end function Logger.printf(messageType, messageFormat, ...) Logger.print(messageType, string.format(messageFormat, ...), 2) end function Logger.AddEntry(entry) local entries = Logger.entries if entries[1] >= Logger.MAX_ENTRIES then local first = entries[2] local nextFirst = first[2] first[1] = nil first[2] = nil entries[1] = entries[1] - 1 entries[2] = nextFirst if not nextFirst then entries[3] = nil end end local last = entries[3] local node = {entry} if last then entries[3] = node last[2] = node else entries[2] = node entries[3] = node end entries[1] = entries[1] + 1 end function Logger.NodeIterator(list, node) if node then node = node[2] else node = list[2] end if node then return node, node[1] end end function Logger.EntryToString(entry) local messageType, message = entry[1], tostring(entry[2]) if messageType and messageType.Value >= Logger.MessageType.Info.Value then return messageType.Name .. ": " .. message else return message end end function Logger.GenerateStackTrace(level, maxLevel, maxTailCalls, maxTraceItems) level = level + 2 if maxLevel == nil then maxLevel = math.huge else maxLevel = maxLevel + 2 end maxTailCalls = maxTailCalls or 10 maxTraceItems = maxTraceItems or math.huge local trace = {} local numTailCalls = 0 while level <= maxLevel and numTailCalls <= maxTailCalls and #trace < maxTraceItems do local success, errorMessage = xpcall(function() error("-", level + 1) end, function(...) return ... end) if errorMessage == "-" then numTailCalls = numTailCalls + 1 else if numTailCalls > 0 then local traceSize = #trace if traceSize > 0 then trace[#trace][3] = numTailCalls end numTailCalls = 0 end local script, line = string.match(errorMessage, "(.*):(%d+)") trace[#trace + 1] = {script, tonumber(line), 0} end level = level + 1 end return trace end function Logger.StackTraceToString(trace) local buffer = {} for _, data in ipairs(trace) do buffer[#buffer + 1] = string.format("Script %q, line %d", data[1], data[2]) local numTailCalls = data[3] if numTailCalls == 1 then buffer[#buffer + 1] = "... 1 tail call" elseif numTailCalls > 1 then buffer[#buffer + 1] = string.format("... %d tail calls", numTailCalls) end end return table.concat(buffer, "\n") end function Logger.MessageOutFunc(message, messageType) if AdvancedGUI and AdvancedGUI.Print then local messageTypeValue if messageType == Enum.MessageType.MessageOutput then local tagName, untaggedMessage = string.match(message, "(%a+): (.*)") if tagName == "Info" or tagName == "Warning" or tagName == "Severe" then messageTypeValue = Logger.MessageType[tagName].Value message = untaggedMessage else messageTypeValue = Logger.MessageType.Output.Value end else messageTypeValue = messageType.Value + 1 end AdvancedGUI.PrintFormat(Logger.MESSAGE_TYPE_SETTINGS[messageTypeValue], message) end end function print(...) local args = {...} local buffer = {} for index = 1, select("#", ...) do buffer[index] = tostring(args[index]) end local message = table.concat(buffer, "\t") Logger.print("Output", message) end CharacterAppearance = {}; CharacterAppearance.defaultAppearanceId = 2 CharacterAppearance.stock = {} function CharacterAppearance.Create(properties) local id = properties.Id local bodyColors = Instance.new("BodyColors") bodyColors.HeadColor = properties.HeadColor bodyColors.TorsoColor = properties.TorsoColor bodyColors.RightArmColor = properties.RightArmColor bodyColors.LeftArmColor = properties.LeftArmColor bodyColors.RightLegColor = properties.RightLegColor bodyColors.LeftLegColor = properties.LeftLegColor local characterObjects = {bodyColors} local headObjects = {} local data = { characterObjects = characterObjects, headObjects = headObjects, tshirt = properties.TShirt } for _, assetId in ipairs(properties.CharacterAssets) do TaskScheduler.Start(CharacterAppearance.LoadAsset, characterObjects, assetId) end for _, assetId in ipairs(properties.HeadAssets) do TaskScheduler.Start(CharacterAppearance.LoadAsset, headObjects, assetId) end CharacterAppearance.stock[id] = data end function CharacterAppearance.GetDefaultAppearance() return CharacterAppearance.stock[CharacterAppearance.defaultAppearanceId] end function CharacterAppearance.LoadAsset(objects, assetId) local asset = InsertService:LoadAsset(assetId) for _, child in ipairs(asset:GetChildren()) do child.Archivable = true table.insert(objects, child:Clone()) end end CharacterAppearance.Create { Id = 1, HeadColor = BrickColor.new("Institutional white"), TorsoColor = BrickColor.new("Institutional white"), RightArmColor = BrickColor.new("Institutional white"), LeftArmColor = BrickColor.new("Institutional white"), RightLegColor = BrickColor.new("Institutional white"), LeftLegColor = BrickColor.new("Institutional white"), CharacterAssets = { 90825058, 90825211, 27112056, 27112052, 27112039, 27112025, 27112068, 38322996 }, HeadAssets = { 20722130, 8330576 } } CharacterAppearance.Create { Id = 2, HeadColor = BrickColor.new("Institutional white"), TorsoColor = BrickColor.new("Institutional white"), RightArmColor = BrickColor.new("Institutional white"), LeftArmColor = BrickColor.new("Institutional white"), RightLegColor = BrickColor.new("Institutional white"), LeftLegColor = BrickColor.new("Institutional white"), CharacterAssets = { 90825058, 90825211, 11748356, 1029025, 1235488, 27112056, 27112052, 27112039, 27112025, 27112068 }, HeadAssets = { 20722130 } } CharacterAppearance.Create { Id = 3, HeadColor = BrickColor.new("Pastel brown"), TorsoColor = BrickColor.new("Pastel brown"), RightArmColor = BrickColor.new("Pastel brown"), LeftArmColor = BrickColor.new("Pastel brown"), RightLegColor = BrickColor.new("White"), LeftLegColor = BrickColor.new("White"), CharacterAssets = { 134289125, 48474356, 100339040, 46302558, 153955895 }, HeadAssets = {}, TShirt = "rbxassetid://148856353" } CharacterAppearance.Create { Id = 4, HeadColor = BrickColor.new("Pastel brown"), TorsoColor = BrickColor.new("Pastel brown"), RightArmColor = BrickColor.new("Pastel brown"), LeftArmColor = BrickColor.new("Pastel brown"), RightLegColor = BrickColor.new("White"), LeftLegColor = BrickColor.new("White"), CharacterAssets = { 129458426, 96678344, 184489190 }, HeadAssets = {}, TShirt = "rbxassetid://160146697" } GraphicalEffects = {}; local MESH_IDS = {"rbxassetid://15310891"} local SOUND_IDS = {"rbxassetid://2248511", "rbxassetid://1369158"} local TEXTURE_IDS = {"rbxassetid://36527089", "rbxassetid://122610943", "rbxassetid://126561317", "rbxassetid://127033719"} local preloadConnections = {} local reloadingPreloads = false function GraphicalEffects.InitPreloads() local preload_part = Instance.new("Part") GraphicalEffects.preload_part = preload_part preload_part.Anchored = true preload_part.Archivable = false preload_part.BottomSurface = "Smooth" preload_part.CanCollide = false preload_part.CFrame = CFrame.new(math.huge, math.huge, math.huge) preload_part.FormFactor = "Custom" preload_part.Locked = true preload_part.Name = "Asset Preloader" preload_part.Size = Vector3.new(0.2, 0.2, 0.2) preload_part.TopSurface = "Smooth" preload_part.Transparency = 1 preloadConnections[preload_part] = preload_part.AncestryChanged:connect(GraphicalEffects.PreloadsAncestryChanged) for _, mesh_id in ipairs(MESH_IDS) do local mesh = Instance.new("SpecialMesh") mesh.MeshType = "FileMesh" mesh.MeshId = mesh_id preloadConnections[mesh] = mesh.AncestryChanged:connect(GraphicalEffects.PreloadsAncestryChanged) mesh.Parent = preload_part end for _, sound_id in ipairs(SOUND_IDS) do local sound = Instance.new("Sound") sound.SoundId = sound_id sound.Volume = 0 preloadConnections[sound] = sound.AncestryChanged:connect(GraphicalEffects.PreloadsAncestryChanged) sound.Parent = preload_part end for _, texture_id in ipairs(TEXTURE_IDS) do local decal = Instance.new("Decal") decal.Texture = texture_id preloadConnections[decal] = decal.AncestryChanged:connect(GraphicalEffects.PreloadsAncestryChanged) decal.Parent = preload_part end preload_part.Parent = Workspace end function GraphicalEffects.PreloadsAncestryChanged(child, parent) if not reloadingPreloads and parent ~= GraphicalEffects.preload_part and parent ~= Workspace then reloadingPreloads = true for _, connection in pairs(preloadConnections) do connection:disconnect() preloadConnections[_] = nil end wait(1) reloadingPreloads = false GraphicalEffects.InitPreloads() end end GraphicalEffects.InitPreloads() -- Hyper beam function GraphicalEffects.FireSpaceHyperBeam(target, power, duration, radius, height, deviation) local stepTime, gameTime = 1 / 30, TaskScheduler.GetCurrentTime() local frames = duration * 30 local beamColorOffset = 0.75 * tick() -- math.random() local blastPressure = power * 62500 + 250000 local beamPart = Instance.new("Part") local beamMesh = Instance.new("SpecialMesh", beamPart) local explosion = Instance.new("Explosion") local sound = Instance.new("Sound", beamPart) beamPart.Anchored = true beamPart.CanCollide = false beamPart.CFrame = CFrame.new(target, target + Vector3.new(deviation * (math.random() - 0.5), deviation * (math.random() - 0.5), height)) beamPart.FormFactor = "Custom" beamPart.Locked = true beamPart.Size = Vector3.new(0.2, 0.2, 0.2) beamMesh.MeshId = "rbxassetid://15310891" beamMesh.MeshType = "FileMesh" beamMesh.TextureId = "rbxassetid://36527089" local beamGlowPart1 = beamPart:Clone() local beamGlowMesh1 = beamMesh:Clone() local beamGlowPart2 = beamPart:Clone() local beamGlowMesh2 = beamMesh:Clone() local beamLight = Instance.new("PointLight", beamPart) beamLight.Range = power * 2 beamLight.Shadows = true explosion.BlastPressure = blastPressure explosion.BlastRadius = power explosion.Position = target sound.SoundId = "rbxassetid://2248511" sound.Volume = 1 local explosionHitConnection = explosion.Hit:connect(function(part, distance) if not part.Anchored and part:GetMass() < power * power then pcall(part.BreakJoints, part) part.Color = Color3.new(Utility.GetRainbowRGB(1.5 * gameTime + beamColorOffset)) end end) beamPart.Transparency = 0.5 beamPart.Archivable = false beamGlowPart1.Transparency = 0.75 beamGlowPart2.Transparency = 0.75 beamGlowMesh1.Parent = beamGlowPart1 beamGlowPart1.Parent = beamPart beamGlowMesh2.Parent = beamGlowPart2 beamGlowPart2.Parent = beamPart beamPart.Parent = workspace explosion.Parent = workspace for frame = 1, frames do local progress = frame / frames local alpha = 1 - math.sin(0.5 * math.pi * progress) local scale = 0.4 * alpha local glowScale1 = alpha * (0.5 + 0.5 * math.sin(math.tau * (8 * gameTime + beamColorOffset))) local glowScale2 = alpha * (0.5 + 0.5 * math.cos(math.tau * (8 * gameTime + beamColorOffset))) local vertexColor = Vector3.new(Utility.GetRainbowRGB(1.5 * gameTime + beamColorOffset)) beamLight.Brightness = 1 - progress beamLight.Color = Color3.new(vertexColor.x, vertexColor.y, vertexColor.z) beamMesh.Scale = Vector3.new(radius * scale, 9000, radius * scale) beamMesh.VertexColor = vertexColor beamGlowMesh1.Scale = Vector3.new(1.2 * radius * glowScale1, 9000, 1.2 * radius * glowScale1) beamGlowMesh1.VertexColor = vertexColor beamGlowMesh2.Scale = Vector3.new(1.2 * radius * glowScale2, 9000, 1.2 * radius * glowScale2) beamGlowMesh2.VertexColor = vertexColor RunService.Stepped:wait() gameTime = TaskScheduler.GetCurrentTime() if frame <= 2 then local explosion = Instance.new("Explosion") explosion.BlastPressure = (1 - progress) * blastPressure explosion.BlastRadius = (1 - progress) * power explosion.Position = target explosion.Parent = Workspace if frame == 2 then sound:Play() end end end pcall(beamPart.Destroy, beamPart) explosionHitConnection:disconnect() end function GraphicalEffects.SpaceHyperBeam(target, power, duration, radius, height, deviation) TaskScheduler.Start(GraphicalEffects.FireSpaceHyperBeam, target, power or 12, duration or 1.5, radius or 6, height or 600, deviation or 20) end function GraphicalEffects.CrystalRing(data) data = data or {} local crystal_count = data.crystal_count or 10 local crystal_color = data.crystal_color or BrickColor.new("Bright red") local crystal_scale = data.crystal_scale or Vector3.new(2 / 3, 2, 2 / 3) local fade_out_color = data.fade_out_color or BrickColor.new("Really black") local radius = radius or 1.25 * crystal_count / math.pi local spawn_duration = data.spawn_duration or 0.065 local full_spawn_duration = spawn_duration * crystal_count local float_duration = data.float_duration or 5 local wave_amplitude = data.wave_amplitude or 0.5 local wave_period = data.wave_period or 1 local appear_duration = data.appear_duration or 0.1 local disappear_duration = data.disappear_duration or 0.5 local base_part = data.base_part local offset_cframe if data.position then offset_cframe = CFrame.new(data.position) if base_part then offset_cframe = base_part.CFrame:toObjectSpace(offset_cframe) end else offset_cframe = CFrame.new() end local crystal_template = Instance.new("Part") crystal_template.Anchored = true crystal_template.Locked = true crystal_template.CanCollide = false crystal_template.BottomSurface = "Smooth" crystal_template.TopSurface = "Smooth" crystal_template.BrickColor = crystal_color crystal_template.FormFactor = "Symmetric" crystal_template.Size = Vector3.new(1, 1, 1) local crystal_light = Instance.new("PointLight", crystal_template) crystal_light.Brightness = 0.1 / crystal_count crystal_light.Color = crystal_color.Color crystal_light.Name = "Light" crystal_light.Range = radius crystal_light.Shadows = true local crystal_mesh = Instance.new("SpecialMesh", crystal_template) crystal_mesh.MeshId = "rbxassetid://9756362" crystal_mesh.MeshType = "FileMesh" crystal_mesh.Name = "Mesh" crystal_mesh.Scale = crystal_scale local crystal_model = Instance.new("Model") crystal_model.Archivable = false crystal_model.Name = "Crystal Model" crystal_model.Parent = Workspace local crystals = {} local lights = {} local meshes = {} for index = 1, crystal_count do local crystal = crystal_template:Clone() crystal.Parent = crystal_model crystals[index] = crystal lights[index] = crystal.Light meshes[index] = crystal.Mesh end local start_time = tick() repeat local base_cframe = offset_cframe if base_part then base_cframe = base_part.CFrame * base_cframe end local elapsed_time = tick() - start_time for index, crystal in ipairs(crystals) do local crystal_time = elapsed_time - index * spawn_duration local disappear_time = crystal_time - float_duration local offset if crystal_time < 0 then offset = 0 elseif crystal_time < appear_duration then offset = radius * crystal_time / appear_duration else offset = radius end local wave_offset if disappear_time >= 0 then local disappear_progress = disappear_time / disappear_duration if disappear_progress > 1 then if crystal.Parent then crystal:Destroy() end else local inverse_progress = 1 - disappear_progress local light = lights[index] local mesh = meshes[index] crystal.BrickColor = fade_out_color light.Brightness = 2 * inverse_progress light.Range = 2 * radius mesh.Scale = crystal_scale * inverse_progress end wave_offset = 0 else wave_offset = wave_amplitude * math.sin(math.tau * (elapsed_time - index / crystal_count * 3) / wave_period) end local rotation_angle = (tick() * 0.5 + (index - 1) / crystal_count) % 1 * math.tau crystal.CFrame = base_cframe * CFrame.Angles(0, rotation_angle, 0) * CFrame.new(0, wave_offset, -offset) end RunService.Stepped:wait() until elapsed_time >= float_duration + full_spawn_duration + disappear_duration if crystal_model.Parent then crystal_model:Destroy() end end GraphicalEffects.magicCircleData = {} GraphicalEffects.MAGIC_CIRCLE_DEFAULT_OFFSET = 6.25 function GraphicalEffects.AnimateMagicCircle(data) local frame, direction, magic_circle_model, magic_circle_part, magic_circle_light, magic_circle_decal_back, magic_circle_decal_front, duration, stay, magic_circle_adornee_func, magic_circle_offset = unpack(data) frame = frame + 1 data[1] = frame local transparency = (frame / duration) ^ stay local opacity = 1 - transparency if frame == duration then pcall(Game.Destroy, magic_circle_model) GraphicalEffects.magicCircleData[data] = nil else if magic_circle_model.Parent ~= Workspace then pcall(Utility.SetProperty, magic_circle_model, "Parent", Workspace) end local magic_circle_adornee = magic_circle_adornee_func() magic_circle_position = magic_circle_adornee.Position + direction * magic_circle_offset local magic_circle_cframe = CFrame.new(magic_circle_position, magic_circle_position + direction) * CFrame.Angles(0, 0, math.tau * frame / 25) magic_circle_part.CFrame = magic_circle_cframe magic_circle_light.Brightness = opacity magic_circle_decal_back.Transparency = transparency magic_circle_decal_front.Transparency = transparency end end function GraphicalEffects.CreateMagicCircle(target, magic_circle_scale, magic_circle_image, light_color, duration, stay, magic_circle_adornee_func, magic_circle_offset) local magic_circle_adornee = magic_circle_adornee_func() if magic_circle_adornee then local origin = magic_circle_adornee.Position local direction = (target - origin).unit local magic_circle_position = origin + direction * magic_circle_offset local magic_circle_cframe = CFrame.new(magic_circle_position, magic_circle_position + direction) local magic_circle_model = Instance.new("Model") local magic_circle_part = Instance.new("Part", magic_circle_model) local magic_circle_mesh = Instance.new("BlockMesh", magic_circle_part) local magic_circle_light = Instance.new("PointLight", magic_circle_part) local magic_circle_decal_back = Instance.new("Decal", magic_circle_part) local magic_circle_decal_front = Instance.new("Decal", magic_circle_part) magic_circle_model.Archivable = false magic_circle_part.Anchored = true magic_circle_part.BottomSurface = "Smooth" magic_circle_part.CanCollide = false magic_circle_part.CFrame = magic_circle_cframe magic_circle_part.FormFactor = "Custom" magic_circle_part.Locked = true magic_circle_part.Size = Vector3.new(0.2, 0.2, 0.2) magic_circle_part.TopSurface = "Smooth" magic_circle_part.Transparency = 1 magic_circle_mesh.Scale = Vector3.new(60, 60, 0) * magic_circle_scale magic_circle_light.Color = light_color magic_circle_light.Range = 16 * magic_circle_scale magic_circle_light.Shadows = true magic_circle_decal_back.Face = "Back" magic_circle_decal_back.Texture = magic_circle_image magic_circle_decal_front.Face = "Front" magic_circle_decal_front.Texture = magic_circle_image magic_circle_model.Parent = Workspace local data = {0, direction, magic_circle_model, magic_circle_part, magic_circle_light, magic_circle_decal_back, magic_circle_decal_front, duration, stay, magic_circle_adornee_func, magic_circle_offset} GraphicalEffects.magicCircleData[data] = true return data end end GraphicalEffects.missileData = {} GraphicalEffects.missileParts = {} function GraphicalEffects.AnimateMissile(data) local frame, missilePart, targetPart, timeCreated, direction, touchedConnection, explodeRequested, bodyGyro, swooshSound, magicCircleData, lifeTime, pointOnPart, flipped = unpack(data) frame = frame + 1 data[1] = frame if flipped then direction = -direction end if frame <= 10 then if frame == 2 then swooshSound:Play() end missilePart.Anchored = true local progress = frame / 10 missilePart.Size = Vector3.new(1, 1, progress * 4) local magicCirclePart = magicCircleData[4] local magicCirclePosition = magicCirclePart.Position local missileOffset = 2 * progress * direction local missilePosition = magicCirclePosition + missileOffset missilePart.CFrame = CFrame.new(missilePosition, missilePosition + direction) --missilePart.Transparency = 0.5 * (1 - progress) if frame == 10 then touchedConnection = missilePart.Touched:connect(function(hit) if hit.CanCollide and hit.Parent and not GraphicalEffects.missileParts[hit] then touchedConnection:disconnect() data[7] = true end end) data[6] = touchedConnection end else missilePart.Anchored = false local missilePosition = missilePart.Position local targetPosition = targetPart.CFrame * pointOnPart local distanceVector = targetPosition - missilePosition local elapsedTime = time() - timeCreated local targetParent = targetPart.Parent if explodeRequested or (targetParent and distanceVector.magnitude < 10) or elapsedTime > lifeTime then GraphicalEffects.missileData[data] = nil GraphicalEffects.missileParts[missilePart] = nil touchedConnection:disconnect() if missilePart.Parent then missilePart:Destroy() local explosion = Instance.new("Explosion") explosion.BlastRadius = 12.5 explosion.Position = missilePosition local explosionHitConnection = explosion.Hit:connect(function(hit, distance) local missileData = GraphicalEffects.missileParts[hit] if missileData and distance < 3 then missileData[7] = true else pcall(hit.BreakJoints, hit) end end) explosion.Parent = Workspace TaskScheduler.Schedule(1, explosionHitConnection.disconnect, explosionHitConnection) end else local targetInWorkspace = targetPart:IsDescendantOf(Workspace) if targetInWorkspace then direction = distanceVector.unit data[5] = direction end local speed = 14 + elapsedTime * 10 local gyroD if elapsedTime < 42.5 and targetInWorkspace then gyroD = 1000 - elapsedTime * 15 else gyroD = 100 bodyGyro.maxTorque = Vector3.new(0, 0, 0) if elapsedTime + 7.5 < lifeTime then data[11] = elapsedTime + 7.5 end end bodyGyro.D = gyroD bodyGyro.cframe = CFrame.new(Vector3.new(), direction) missilePart.Velocity = missilePart.CFrame.lookVector * speed end end end function GraphicalEffects.ShootMissile(targetPart, pointOnPart, direction, magic_circle_adornee_func, magic_circle_offset, flipped) if not magic_circle_offset then magic_circle_offset = GraphicalEffects.MAGIC_CIRCLE_DEFAULT_OFFSET end local targetPosition = targetPart.Position local headPosition = chatAdornee.Position local origin = CFrame.new(headPosition, headPosition + direction) + direction * magic_circle_offset local missilePart = Instance.new("Part") local antiGravityForce = Instance.new("BodyForce", missilePart) local bodyGyro = Instance.new("BodyGyro", missilePart) local explosionSound = Instance.new("Sound", missilePart) local swooshSound = Instance.new("Sound", missilePart) antiGravityForce.force = Vector3.new(0, 196.2 * 4, 0) bodyGyro.D = 1000 bodyGyro.maxTorque = Vector3.new(1, 1, 1) explosionSound.PlayOnRemove = true explosionSound.SoundId = "rbxasset://sounds/collide.wav" explosionSound.Volume = 1 missilePart.Anchored = true missilePart.BackSurface = "Studs" missilePart.BottomSurface = "Studs" missilePart.BrickColor = BrickColor.Red() missilePart.CFrame = origin missilePart.FormFactor = "Custom" missilePart.FrontSurface = "Studs" missilePart.LeftSurface = "Studs" missilePart.Locked = true missilePart.RightSurface = "Studs" missilePart.Size = Vector3.new(1, 1, 0.2) missilePart.TopSurface = "Studs" --missilePart.Transparency = 0.5 swooshSound.Looped = true swooshSound.SoundId = "rbxasset://sounds/Rocket whoosh 01.wav" swooshSound.Volume = 0.7 local magicCircleData = GraphicalEffects.CreateMagicCircle(headPosition + direction * 1000, 0.875, "rbxassetid://127033719", Color3.new(1, 1, 1), 40, 4, magic_circle_adornee_func or function() return chatAdornee end, magic_circle_offset) local data = {0, missilePart, targetPart, time(), direction, false, false, bodyGyro, swooshSound, magicCircleData, 50, pointOnPart, flipped} missilePart.Parent = Workspace GraphicalEffects.missileData[data] = true GraphicalEffects.missileParts[missilePart] = data end function GraphicalEffects.CubicInterpolate(y0, y1, y2, y3, mu) local a0, a1, a2, a3, mu2 mu2 = mu * mu a0 = y3 - y2 - y0 + y1 a1 = y0 - y1 - a0 a2 = y2 - y0 a3 = y1 return a0 * mu * mu2 + a1 * mu2 + a2 * mu + a3 end function GraphicalEffects.JointCrap(model, cycletime) if model then local cycletime = cycletime or (0.75 * (1 + math.random() * 4)) local offsetradius = 0.75 local rotationoffset = math.pi local joints = {} local stack = model:GetChildren() while #stack ~= 0 do local object = stack[#stack] table.remove(stack) for index, child in ipairs(object:GetChildren()) do table.insert(stack, child) end if object:IsA("JointInstance") then table.insert(joints, object) end end local rot0 = {} local rot1 = {} local rot2 = {} local rot3 = {} local rot4 = {} for index, joint in ipairs(joints) do local pos = Vector3.new(math.random() - 0.5, math.random() - 0.5, math.random() - 0.5).unit * offsetradius local rot = Vector3.new(math.random(), math.random(), math.random()) * rotationoffset rot0[index] = {joint.C0, joint.C1} rot = Vector3.new(rot.x % (math.tau), rot.y % (math.tau), rot.z % (math.tau)) rot2[index] = {pos, rot} pos = Vector3.new(math.random() - 0.5, math.random() - 0.5, math.random() - 0.5).unit * offsetradius rot = rot + Vector3.new(math.random(), math.random(), math.random()) * rotationoffset rot = Vector3.new(rot.x % (math.tau), rot.y % (math.tau), rot.z % (math.tau)) rot3[index] = {pos, rot} pos = Vector3.new(math.random() - 0.5, math.random() - 0.5, math.random() - 0.5).unit * offsetradius rot = rot + Vector3.new(math.random(), math.random(), math.random()) * rotationoffset rot = Vector3.new(rot.x % (math.tau), rot.y % (math.tau), rot.z % (math.tau)) rot4[index] = {pos, rot} end while model.Parent do for i, j in ipairs(joints) do local pos = Vector3.new(math.random() - 0.5, math.random() - 0.5, math.random() - 0.5).unit * offsetradius local rot = rot4[i][2] + Vector3.new(math.random(), math.random(), math.random()) * rotationoffset rot = Vector3.new(rot.x % (math.tau), rot.y % (math.tau), rot.z % (math.tau)) rot1[i], rot2[i], rot3[i], rot4[i] = rot2[i], rot3[i], rot4[i], {pos, rot} end local start = tick() while true do local ctime = tick() local elapsed = ctime - start if elapsed > cycletime then break end local progress = elapsed / cycletime for index, joint in ipairs(joints) do local v0, v1, v2, v3, v4 = rot0[index], rot1[index], rot2[index], rot3[index], rot4[index] local p1, p2, p3, p4, r1, r2, r3, r4 = v1[1], v2[1], v3[1], v4[1], v1[2], v2[2], v3[2], v4[2] local px = GraphicalEffects.CubicInterpolate(p1.x, p2.x, p3.x, p4.x, progress) local py = GraphicalEffects.CubicInterpolate(p1.y, p2.y, p3.y, p4.y, progress) local pz = GraphicalEffects.CubicInterpolate(p1.z, p2.z, p3.z, p4.z, progress) local rx = GraphicalEffects.CubicInterpolate(r1.x, r2.x, r3.x, r4.x, progress) local ry = GraphicalEffects.CubicInterpolate(r1.y, r2.y, r3.y, r4.y, progress) local rz = GraphicalEffects.CubicInterpolate(r1.z, r2.z, r3.z, r4.z, progress) local cframe = CFrame.new(px, py, pz) * CFrame.Angles(rx, ry, rz) joint.C0 = v0[1] * cframe joint.C1 = v0[2] * cframe:inverse() end RunService.Stepped:wait() end end end end GraphicalEffects.LASER_WIDTH = 0.15 GraphicalEffects.LASER_MAGIC_CIRCLE_DISTANCE = 6.25 GraphicalEffects.laser_data = {} --GraphicalEffects.fragmentation = {} function GraphicalEffects.AnimateLaserOfDeath(data) local frame, directionOrientation, direction, magic_circle_model, laser_part, laser_mesh, magic_circle_part, magic_circle_light, magic_circle_decal_back, magic_circle_decal_front, sound, laser_scale, fragmentation_size, duration, laser_lights, laser_effects, stay, light_effects = unpack(data) local laser_color = laser_part.Color frame = frame + 1 data[1] = frame local transparency = (frame / duration) ^ stay local opacity = 1 - transparency if frame == 2 then sound:Play() end if frame == duration then pcall(Game.Destroy, magic_circle_model) GraphicalEffects.laser_data[data] = nil else if magic_circle_model.Parent ~= Workspace then pcall(Utility.SetProperty, magic_circle_model, "Parent", Workspace) end local laser_distance = 0 local origin = chatAdornee.CFrame if not light_effects then direction = (origin * directionOrientation - origin.p).unit end local magic_circle_position = origin.p + direction * GraphicalEffects.LASER_MAGIC_CIRCLE_DISTANCE local magic_circle_cframe = CFrame.new(magic_circle_position, magic_circle_position + direction) * CFrame.Angles(0, 0, math.tau * frame / 25) local loop_scale = (laser_scale - 1) / 10 for x_offset = -loop_scale, loop_scale, 2 do for y_offset = -loop_scale, loop_scale, 2 do local origin_position = magic_circle_cframe * Vector3.new(x_offset, y_offset, 0) for index = 1, 8 do local part, position for ray_index = 1, 10 do local ray = Ray.new(origin_position + direction * (999 * (ray_index - 1)), direction * 999) part, position = Workspace:FindPartOnRay(ray, magic_circle_model) if part then break end end if part then laser_distance = (position - origin_position).magnitude if frame % 8 == 1 and index == 1 then Instance.new("Explosion", Workspace).Position = position end if not part:IsA("Terrain") then pcall(part.BreakJoints, part) local is_block = part:IsA("Part") and part.Shape == Enum.PartType.Block local mass = part:GetMass() local size = part.Size if (is_block and ((size.X < fragmentation_size and size.Y < fragmentation_size and size.Z < fragmentation_size) or (not part.Anchored and mass < 750))) or (not is_block and mass < 250000) then local part_transparency = math.max(part.Transparency + 0.007 * fragmentation_size, 0.5) if part_transparency >= 0.5 then -- temporarily to minimize debris pcall(Game.Destroy, part) else local cframe = part.CFrame part.Anchored = false part.BrickColor = BrickColor.new("Medium stone grey") part.CanCollide = true if part:IsA("FormFactorPart") then part.FormFactor = "Custom" end part.Size = size - Vector3.new(0.135, 0.135, 0.135) * fragmentation_size part.Transparency = part_transparency part.CFrame = cframe + direction * 5 part.Velocity = part.Velocity + direction * 40 end elseif is_block then local parts = {part} local model = Instance.new("Model", part.Parent) model.Name = "Fragments" if size.X >= fragmentation_size then size = Vector3.new(0.5, 1, 1) * size local archivable = part.Archivable local cframe = part.CFrame part.FormFactor = "Custom" part.Size = size part.Archivable = true local part_clone = part:Clone() part.Archivable = archivable part_clone.Archivable = archivable part.CFrame = cframe * CFrame.new(-0.5 * size.X, 0, 0) part_clone.CFrame = cframe * CFrame.new(0.5 * size.X, 0, 0) part_clone.Parent = model parts[2] = part_clone end if size.Y >= fragmentation_size then size = Vector3.new(1, 0.5, 1) * size for part_index = 1, #parts do local part = parts[part_index] local archivable = part.Archivable local cframe = part.CFrame part.FormFactor = "Custom" part.Size = size part.Archivable = true local part_clone = part:Clone() part.Archivable = archivable part_clone.Archivable = archivable part.CFrame = cframe * CFrame.new(0, -0.5 * size.Y, 0) part_clone.CFrame = cframe * CFrame.new(0, 0.5 * size.Y, 0) part_clone.Parent = model table.insert(parts, part_clone) end end if size.Z >= fragmentation_size then size = Vector3.new(1, 1, 0.5) * size for part_index = 1, #parts do local part = parts[part_index] local archivable = part.Archivable local cframe = part.CFrame part.FormFactor = "Custom" part.Size = size part.Archivable = true local part_clone = part:Clone() part.Archivable = archivable part_clone.Archivable = archivable part.CFrame = cframe * CFrame.new(0, 0, -0.5 * size.Z) part_clone.CFrame = cframe * CFrame.new(0, 0, 0.5 * size.Z) part_clone.Parent = model table.insert(parts, part_clone) end end for _, part in ipairs(parts) do part:MakeJoints() end else break end end else laser_distance = 9990 break end end end end local laser_cframe = magic_circle_cframe * CFrame.Angles(-0.5 * math.pi, 0, 0) local laser_width = GraphicalEffects.LASER_WIDTH * opacity * laser_scale local laser_mesh_offset = Vector3.new(0, 0.5 * laser_distance, 0) laser_part.CFrame = laser_cframe if laser_effects then local laser_effect_data_1, laser_effect_data_2 = laser_effects[1], laser_effects[2] local laser_effect_1, laser_effect_mesh_1 = laser_effect_data_1[1], laser_effect_data_1[2] local laser_effect_2, laser_effect_mesh_2 = laser_effect_data_2[1], laser_effect_data_2[2] laser_effect_1.CFrame = laser_cframe laser_effect_2.CFrame = laser_cframe laser_effect_mesh_1.Offset = laser_mesh_offset laser_effect_mesh_2.Offset = laser_mesh_offset local game_time = time() local effect_scale_1 = 0.5 + 0.5 * math.sin(16 * math.pi * game_time) local effect_scale_2 = 0.5 + 0.5 * math.cos(16 * math.pi * game_time) laser_effect_mesh_1.Scale = 5 * Vector3.new(laser_width * effect_scale_1, laser_distance, laser_width * effect_scale_1) laser_effect_mesh_2.Scale = 5 * Vector3.new(laser_width * effect_scale_2, laser_distance, laser_width * effect_scale_2) laser_width = laser_width * 0.25 end laser_mesh.Offset = laser_mesh_offset laser_mesh.Scale = 5 * Vector3.new(laser_width, laser_distance, laser_width) magic_circle_part.CFrame = magic_circle_cframe magic_circle_light.Brightness = opacity magic_circle_decal_back.Transparency = transparency magic_circle_decal_front.Transparency = transparency if light_effects then for index, data in ipairs(laser_lights) do local laser_spotlight_part, laser_spotlight = data[1], data[2] local laser_spotlight_offset = 30 * (index - 1) if laser_spotlight_offset <= laser_distance then laser_spotlight_part.CFrame = magic_circle_cframe * CFrame.new(0, 0, -laser_spotlight_offset) laser_spotlight.Brightness = opacity laser_spotlight.Enabled = true else laser_spotlight.Enabled = false end end end end end function GraphicalEffects.ShootLaserOfDeath(target, data) if chatAdornee then data = data or {} local brickcolor = data.brickcolor or BrickColor.new("Really black") local duration = data.duration or 40 local fragmentation_size = data.fragmentation_size or 3 local laser_scale = data.laser_scale or 1 local light_color = data.light_color or Color3.new(1, 0.5, 1) local magic_circle_image = data.magic_circle_image or "rbxassetid://122610943" local magic_circle_scale = data.magic_circle_scale or 1 local sound_volume = data.sound_volume or 1 / 3 local special_effects = data.special_effects local stay = data.stay or 4 local origin = chatAdornee.CFrame local directionOrientation = origin:pointToObjectSpace(target) local direction = (target - origin.p).unit local magic_circle_position = origin.p + direction * GraphicalEffects.LASER_MAGIC_CIRCLE_DISTANCE local magic_circle_cframe = CFrame.new(magic_circle_position, magic_circle_position + direction) local magic_circle_model = Instance.new("Model") local laser_part = Instance.new("Part", magic_circle_model) local laser_mesh = Instance.new("CylinderMesh", laser_part) local magic_circle_part = Instance.new("Part", magic_circle_model) local magic_circle_mesh = Instance.new("BlockMesh", magic_circle_part) local magic_circle_light = Instance.new("PointLight", magic_circle_part) local magic_circle_decal_back = Instance.new("Decal", magic_circle_part) local magic_circle_decal_front = Instance.new("Decal", magic_circle_part) local sound = Instance.new("Sound", magic_circle_part) sound.Pitch = 1.25 sound.SoundId = "rbxassetid://2248511" sound.Volume = sound_volume magic_circle_model.Archivable = false laser_part.Anchored = true laser_part.BottomSurface = "Smooth" laser_part.BrickColor = brickcolor laser_part.CanCollide = false laser_part.CFrame = magic_circle_cframe * CFrame.Angles(-0.5 * math.pi, 0, 0) laser_part.FormFactor = "Custom" laser_part.Locked = true laser_part.Size = Vector3.new(0.2, 0.2, 0.2) laser_part.TopSurface = "Smooth" laser_mesh.Offset = Vector3.new(0, 0, 0) laser_mesh.Name = "Mesh" laser_mesh.Scale = 5 * laser_scale * Vector3.new(GraphicalEffects.LASER_WIDTH, 0, GraphicalEffects.LASER_WIDTH) magic_circle_part.Anchored = true magic_circle_part.BottomSurface = "Smooth" magic_circle_part.CanCollide = false magic_circle_part.CFrame = magic_circle_cframe magic_circle_part.FormFactor = "Custom" magic_circle_part.Locked = true magic_circle_part.Size = Vector3.new(0.2, 0.2, 0.2) magic_circle_part.TopSurface = "Smooth" magic_circle_part.Transparency = 1 magic_circle_mesh.Scale = Vector3.new(60, 60, 0) * magic_circle_scale magic_circle_light.Color = light_color magic_circle_light.Range = 16 * magic_circle_scale magic_circle_light.Shadows = true magic_circle_decal_back.Face = "Back" magic_circle_decal_back.Texture = magic_circle_image magic_circle_decal_front.Face = "Front" magic_circle_decal_front.Texture = magic_circle_image magic_circle_model.Parent = Workspace local laser_color = brickcolor.Color local laser_lights = {} local light_effects = laser_color.r + laser_color.g + laser_color.b > 0.25 if light_effects then local laser_spotlight_part_template = Instance.new("Part") local laser_spotlight_light_template = Instance.new("SpotLight", laser_spotlight_part_template) laser_spotlight_part_template.Anchored = true laser_spotlight_part_template.Anchored = true laser_spotlight_part_template.BottomSurface = "Smooth" laser_spotlight_part_template.CanCollide = false laser_spotlight_part_template.FormFactor = "Custom" laser_spotlight_part_template.Locked = true laser_spotlight_part_template.Size = Vector3.new(0.2, 0.2, 0.2) laser_spotlight_part_template.TopSurface = "Smooth" laser_spotlight_part_template.Transparency = 1 laser_spotlight_light_template.Angle = 45 laser_spotlight_light_template.Color = laser_color laser_spotlight_light_template.Enabled = true laser_spotlight_light_template.Name = "Light" laser_spotlight_light_template.Range = 60 for index = 1, 40 do local laser_spotlight_part = laser_spotlight_part_template:Clone() laser_spotlight_part.CFrame = magic_circle_cframe * CFrame.new(0, 0, -30 * (index - 1)) laser_spotlight_part.Parent = magic_circle_model laser_lights[index] = {laser_spotlight_part, laser_spotlight_part.Light} end end local laser_effects if special_effects then laser_effects = {} local laser_effect_1 = laser_part:Clone() laser_effect_1.BrickColor = special_effects laser_effect_1.Transparency = 0.5 local laser_effect_2 = laser_effect_1:Clone() laser_effects[1], laser_effects[2] = {laser_effect_1, laser_effect_1.Mesh}, {laser_effect_2, laser_effect_2.Mesh} laser_effect_1.Parent = magic_circle_model laser_effect_2.Parent = magic_circle_model end GraphicalEffects.laser_data[{0, directionOrientation, direction, magic_circle_model, laser_part, laser_mesh, magic_circle_part, magic_circle_light, magic_circle_decal_back, magic_circle_decal_front, sound, laser_scale, fragmentation_size, duration, laser_lights, laser_effects, stay, light_effects}] = true end end function GraphicalEffects.SpawnSapientRock(position) local part = Instance.new("Part", Workspace) local size = 8 + math.random(0, 5) part.BottomSurface = "Smooth" part.TopSurface = "Smooth" part.Material = "Slate" part.Locked = true part.Shape = "Ball" part.FormFactor = "Custom" part.Size = Vector3.new(size, size, size) part.Position = position local bodypos = Instance.new("BodyPosition", part) bodypos.maxForce = Vector3.new(0, 0, 0) local angry = false local damage_ready = true local torso_following local torso_changed = -1000 local touched_conn = part.Touched:connect(function(hit) local character = hit.Parent if character then local humanoid for _, child in ipairs(character:GetChildren()) do if child:IsA("Humanoid") then humanoid = child break end end if humanoid then if angry then if damage_ready then damage_ready = false humanoid:TakeDamage(100) wait(1) damage_ready = true angry = false part.BrickColor = BrickColor.new("Medium stone grey") end else local torso = humanoid.Torso if torso then torso_following = torso torso_changed = tick() end end end end end) TaskScheduler.Start(function() while part.Parent == Workspace do if torso_following then bodypos.position = torso_following.Position if tick() - torso_changed > 60 or not torso_following.Parent then torso_following = nil bodypos.maxForce = Vector3.new(0, 0, 0) angry = false part.BrickColor = BrickColor.new("Medium stone grey") else local speed = angry and Vector3.new(16, 16, 16) or Vector3.new(6, 0, 6) bodypos.maxForce = part:GetMass() * speed if part.Position.Y < -250 then part.Velocity = Vector3.new() part.Position = torso_following.Position + Vector3.new(0, 80, 0) part.BrickColor = BrickColor.new("Bright red") angry = true torso_changed = tick() end end end RunService.Stepped:wait() end touched_conn:disconnect() end) TaskScheduler.Start(function() while part.Parent == Workspace do wait(25 + math.random() * 10) local next_size = 8 + math.random() * 5 if math.random(100) == 1 then next_size = next_size * (2 + 6 * math.random()) end next_size = math.floor(next_size + 0.5) local start_time = tick() local mesh = Instance.new("SpecialMesh", part) mesh.MeshType = "Sphere" repeat local elapsed_time = tick() - start_time local alpha = math.cos(elapsed_time * math.pi * 0.5) local interpolated_size = size * alpha + next_size * (1 - alpha) local size_vector = Vector3.new(interpolated_size, interpolated_size, interpolated_size) local cframe = part.CFrame part.Size = size_vector part.CFrame = cframe mesh.Scale = size_vector / part.Size RunService.Stepped:wait() until tick() - start_time >= 1 mesh:Destroy() local cframe = part.CFrame part.Size = Vector3.new(next_size, next_size, next_size) part.CFrame = cframe size = next_size end end) end function GraphicalEffects.MainLoop() RunService.Stepped:wait() for data in pairs(GraphicalEffects.magicCircleData) do GraphicalEffects.AnimateMagicCircle(data) end for data in pairs(GraphicalEffects.laser_data) do GraphicalEffects.AnimateLaserOfDeath(data) end for data in pairs(GraphicalEffects.missileData) do GraphicalEffects.AnimateMissile(data) end end TaskScheduler.Start(function() while true do GraphicalEffects.MainLoop() end end) PlayerControl = {}; PlayerControl.fly_acceleration = 10 PlayerControl.fly_basespeed = 250 PlayerControl.fly_speed = PlayerControl.fly_basespeed PlayerControl.featherfallEnabled = true PlayerControl.pushable = false PlayerControl.rolling = false PlayerControl.rollingAngle = 0 PlayerControl.rollingOffset = 0 PlayerControl.rollingMaxOffset = 3 PlayerControl.rollingSpeed = 1 / 50 PlayerControl.characterEnabled = false PlayerControl.characterMode = "normal" local character = nil local flying, flyingMomentum, flyingTilt = false, Vector3.new(), 0 local pose, regeneratingHealth, jumpDebounce = "Standing", false, false -- TODO: make local variables public local model, bodyColors, leftArmMesh, leftLegMesh, rightArmMesh, rightLegMesh, torsoMesh, wildcardHat, wildcardHandle, wildcardMesh, pants, shirt, humanoid, head, leftArm, leftLeg, rightArm, rightLeg, torso, rootPart, rootJoint, face, soundFreeFalling, soundGettingUp, soundRunning, leftHip, leftShoulder, rightHip, rightShoulder, neck, wildcardWeld, feetPart, feetWeld, feetTouchInterest, bodyGyro, bodyVelocity, headMesh, torsoLight local AnimateCharacter local UserInterface = game:service'UserInputService' local chatBubbles = {} local chatCharacterLimit = 240 function PlayerControl.CreateCharacter() local characterMode = PlayerControl.characterMode if characterMode == "normal" then if not PlayerControl.characterEnabled then return end local appearance = CharacterAppearance.GetDefaultAppearance() local active = true local torsoCFrame = (torso and torso.CFrame) or PlayerControl.torso_cframe or CFrame.new(0, 10, 0) if torsoCFrame.p.Y < -450 then torsoCFrame = CFrame.new(0, 10, 0) end local rootPartCFrame = (rootPart and rootPart.CFrame) or PlayerControl.torso_cframe or CFrame.new(0, 10, 0) if rootPartCFrame.p.Y < -450 then rootPartCFrame = CFrame.new(0, 10, 0) end local cameraCFrame = Camera.CoordinateFrame local connections = {} local feetTouching = {} local previousWalkSpeed = 0 local prevLeftHip, prevLeftShoulder, prevRightHip, prevRightShoulder = leftHip, leftShoulder, rightHip, rightShoulder model = Instance.new("Model") humanoid = Instance.new("Humanoid", model) head = Instance.new("Part", model) leftArm = Instance.new("Part", model) leftLeg = Instance.new("Part", model) rightArm = Instance.new("Part", model) rightLeg = Instance.new("Part", model) torso = Instance.new("Part", model) rootPart = Instance.new("Part", model) soundFallingDown = Instance.new("Sound", head) soundFreeFalling = Instance.new("Sound", head) soundGettingUp = Instance.new("Sound", head) soundJumping = Instance.new("Sound", head) soundRunning = Instance.new("Sound", head) leftHip = Instance.new("Motor", torso) leftShoulder = Instance.new("Motor", torso) rightHip = Instance.new("Motor", torso) rightShoulder = Instance.new("Motor", torso) neck = Instance.new("Motor", torso) rootJoint = Instance.new("Motor", rootPart) feetPart = Instance.new("Part", model) feetWeld = Instance.new("Weld", torso) bodyGyro = Instance.new("BodyGyro", rootPart) bodyVelocity = Instance.new("BodyVelocity", rootPart) model.Archivable = false model.Name = user_name or Player.Name model.PrimaryPart = head humanoid.LeftLeg = leftLeg humanoid.RightLeg = rightLeg humanoid.Torso = rootPart head.CFrame = torsoCFrame * CFrame.new(0, 1.5, 0) head.FormFactor = "Symmetric" head.Locked = true head.Name = "Head" head.Size = Vector3.new(2, 1, 1) head.TopSurface = "Smooth" leftArm.CanCollide = false leftArm.CFrame = torsoCFrame * CFrame.new(-1.5, 0, 0) leftArm.FormFactor = "Symmetric" leftArm.Locked = true leftArm.Name = "Left Arm" leftArm.Size = Vector3.new(1, 2, 1) leftLeg.BottomSurface = "Smooth" leftLeg.CanCollide = false leftLeg.CFrame = torsoCFrame * CFrame.new(-0.5, -2, 0) leftLeg.FormFactor = "Symmetric" leftLeg.Locked = true leftLeg.Name = "Left Leg" leftLeg.Size = Vector3.new(1, 2, 1) leftLeg.TopSurface = "Smooth" rightArm.CanCollide = false rightArm.CFrame = torsoCFrame * CFrame.new(1.5, 0, 0) rightArm.FormFactor = "Symmetric" rightArm.Locked = true rightArm.Name = "Right Arm" rightArm.Size = Vector3.new(1, 2, 1) rightLeg.BottomSurface = "Smooth" rightLeg.CanCollide = false rightLeg.CFrame = torsoCFrame * CFrame.new(0.5, -2, 0) rightLeg.FormFactor = "Symmetric" rightLeg.Locked = true rightLeg.Name = "Right Leg" rightLeg.Size = Vector3.new(1, 2, 1) rightLeg.TopSurface = "Smooth" torso.CFrame = torsoCFrame torso.FormFactor = "Symmetric" torso.LeftSurface = "Weld" torso.Locked = true torso.RightSurface = "Weld" torso.Name = "Torso" torso.Size = Vector3.new(2, 2, 1) rootPart.BottomSurface = "Smooth" rootPart.BrickColor = BrickColor.Blue() rootPart.CFrame = rootPartCFrame rootPart.FormFactor = "Symmetric" rootPart.LeftSurface = "Weld" rootPart.Locked = true rootPart.RightSurface = "Weld" rootPart.Name = "HumanoidRootPart" rootPart.Size = Vector3.new(2, 2, 1) rootPart.TopSurface = "Smooth" rootPart.Transparency = 1 soundFreeFalling.Archivable = false soundFreeFalling.SoundId = "rbxasset://sounds/swoosh.wav" soundGettingUp.Archivable = false soundGettingUp.SoundId = "rbxasset://sounds/hit.wav" soundRunning.Archivable = false soundRunning.SoundId = "rbxasset://sounds/bfsl-minifigfoots1.mp3" soundRunning.Looped = true leftHip.C0 = CFrame.new(-1, -1, 0, -0, -0, -1, 0, 1, 0, 1, 0, 0) leftHip.C1 = CFrame.new(-0.5, 1, 0, -0, -0, -1, 0, 1, 0, 1, 0, 0) leftHip.MaxVelocity = 0.1 leftHip.Name = "Left Hip" leftHip.Part0 = torso leftHip.Part1 = leftLeg leftShoulder.C0 = CFrame.new(-1, 0.5, 0, -0, -0, -1, 0, 1, 0, 1, 0, 0) leftShoulder.C1 = CFrame.new(0.5, 0.5, 0, -0, -0, -1, 0, 1, 0, 1, 0, 0) leftShoulder.MaxVelocity = 0.15 leftShoulder.Name = "Left Shoulder" leftShoulder.Part0 = torso leftShoulder.Part1 = leftArm rightHip.C0 = CFrame.new(1, -1, 0, 0, 0, 1, 0, 1, 0, -1, -0, -0) rightHip.C1 = CFrame.new(0.5, 1, 0, 0, 0, 1, 0, 1, 0, -1, -0, -0) rightHip.MaxVelocity = 0.1 rightHip.Name = "Right Hip" rightHip.Part0 = torso rightHip.Part1 = rightLeg rightShoulder.C0 = CFrame.new(1, 0.5, 0, 0, 0, 1, 0, 1, 0, -1, -0, -0) rightShoulder.C1 = CFrame.new(-0.5, 0.5, 0, 0, 0, 1, 0, 1, 0, -1, -0, -0) rightShoulder.MaxVelocity = 0.15 rightShoulder.Name = "Right Shoulder" rightShoulder.Part0 = torso rightShoulder.Part1 = rightArm if prevLeftHip then leftHip.CurrentAngle = prevLeftHip.CurrentAngle leftHip.DesiredAngle = prevLeftHip.DesiredAngle end if prevLeftShoulder then leftShoulder.CurrentAngle = prevLeftShoulder.CurrentAngle leftShoulder.DesiredAngle = prevLeftShoulder.DesiredAngle end if prevRightHip then rightHip.CurrentAngle = prevRightHip.CurrentAngle rightHip.DesiredAngle = prevRightHip.DesiredAngle end if prevRightShoulder then rightShoulder.CurrentAngle = prevRightShoulder.CurrentAngle rightShoulder.DesiredAngle = prevRightShoulder.DesiredAngle end neck.C0 = CFrame.new(0, 1, 0, -1, -0, -0, 0, 0, 1, 0, 1, 0) neck.C1 = CFrame.new(0, -0.5, 0, -1, -0, -0, 0, 0, 1, 0, 1, 0) neck.Name = "Neck" neck.Part0 = torso neck.Part1 = head rootJoint.C0 = CFrame.new(0, 0, 0, -1, 0, 0, 0, 0, 1, 0, 1, 0) rootJoint.C1 = CFrame.new(0, 0, 0, -1, 0, 0, 0, 0, 1, 0, 1, 0) rootJoint.Name = "RootJoint" rootJoint.Part0 = rootPart rootJoint.Part1 = torso feetPart.BottomSurface = "Smooth" feetPart.CanCollide = false feetPart.CFrame = torsoCFrame * CFrame.new(0, -3.1, 0) feetPart.FormFactor = "Custom" feetPart.Locked = true feetPart.Name = "Platform" feetPart.Size = Vector3.new(1.8, 0.2, 0.8) feetPart.TopSurface = "Smooth" feetPart.Transparency = 1 feetWeld.C0 = CFrame.new(0, -3, 0) feetWeld.C1 = CFrame.new(0, 0.1, 0) feetWeld.Name = "PlatformWeld" feetWeld.Part0 = torso feetWeld.Part1 = feetPart table.insert(connections, feetPart.Touched:connect(function(hit) feetTouching[hit] = true end)) table.insert(connections, feetPart.TouchEnded:connect(function(hit) feetTouching[hit] = nil end)) feetTouchInterest = feetPart:FindFirstChild("TouchInterest") bodyGyro.D = 3250 bodyGyro.P = 400000 bodyGyro.maxTorque = Vector3.new(1000000000, 0, 1000000000) bodyVelocity.P = 5000 bodyVelocity.maxForce = Vector3.new(0, 0, 0) bodyVelocity.velocity = Vector3.new(0, 0, 0) torsoLight = Instance.new("PointLight", torso) torsoLight.Brightness = 0.4 torsoLight.Color = Color3.new(1, 1, 1) torsoLight.Range = 16 torsoLight.Shadows = true local ff1, ff2, ff3, ff4, ff5, ff6, ff7, ff8, ff9 = Instance.new("ForceField", head), Instance.new("ForceField", leftArm), Instance.new("ForceField", leftLeg), Instance.new("ForceField", rightArm), Instance.new("ForceField", rightLeg), Instance.new("ForceField", torso), Instance.new("ForceField", wildcardHandle), Instance.new("ForceField", feetPart), Instance.new("ForceField", rootPart) local forcefields = {[ff1] = head, [ff2] = leftArm, [ff3] = leftLeg, [ff4] = rightArm, [ff5] = rightLeg, [ff6] = torso, [ff7] = wildcardHandle, [ff8] = feetPart, [ff9] = rootPart} local objects = {[humanoid] = true, [head] = true, [leftArm] = true, [leftLeg] = true, [rightArm] = true, [rightLeg] = true, [torso] = true, [rootPart] = true, [rootJoint] = true, [soundFreeFalling] = true, [soundGettingUp] = true, [soundRunning] = true, [leftHip] = true, [leftShoulder] = true, [rightHip] = true, [rightShoulder] = true, [neck] = true, [feetPart] = true, [feetWeld] = true, [feetTouchInterest] = true, [bodyGyro] = true, [bodyVelocity] = true, [ff1] = true, [ff2] = true, [ff3] = true, [ff4] = true, [ff5] = true, [ff6] = true, [ff7] = true, [ff8] = true, [ff9] = true} local tshirtUrl = appearance.tshirt if tshirtUrl then local tshirt = Instance.new("Decal", torso) tshirt.Name = "roblox" tshirt.Texture = tshirtUrl objects[tshirt] = true end for _, template in ipairs(appearance.characterObjects) do local object = template:Clone() local newObjects = {object} for _, object in ipairs(newObjects) do objects[object] = true for _, child in ipairs(object:GetChildren()) do table.insert(newObjects, child) end end if object:IsA("BodyColors") then head.BrickColor = object.HeadColor leftArm.BrickColor = object.LeftArmColor leftLeg.BrickColor = object.LeftLegColor rightArm.BrickColor = object.RightArmColor rightLeg.BrickColor = object.RightLegColor torso.BrickColor = object.TorsoColor elseif object:IsA("Hat") then local handle = object:FindFirstChild("Handle") if handle and handle:IsA("BasePart") then local weld = Instance.new("Weld", head) weld.C0 = CFrame.new(0, 0.5, 0) local attachmentPos = object.AttachmentPos local attachmentRight = object.AttachmentRight local attachmentUp = object.AttachmentUp local attachmentForward = object.AttachmentForward weld.C1 = CFrame.new(attachmentPos.X, attachmentPos.Y, attachmentPos.Z, attachmentRight.X, attachmentUp.X, -attachmentForward.X, attachmentRight.Y, attachmentUp.Y, -attachmentForward.Y, attachmentRight.Z, attachmentUp.Z, -attachmentForward.Z) weld.Name = "HeadWeld" weld.Part0 = head weld.Part1 = handle handle.Parent = model local antiGravity = Instance.new("BodyForce", handle) antiGravity.force = Vector3.new(0, handle:GetMass() * 196.2, 0) objects[object] = false object.Parent = nil objects[weld] = true end end object.Parent = model end local facePresent = false local headMeshPresent = false for _, template in ipairs(appearance.headObjects) do local object = template:Clone() local newObjects = {object} for _, object in ipairs(newObjects) do objects[object] = true for _, child in ipairs(object:GetChildren()) do table.insert(newObjects, child) end end if object:IsA("DataModelMesh") then headMeshPresent = true elseif object:IsA("Decal") then facePresent = true end object.Parent = head end if not facePresent then local face = Instance.new("Decal", head) face.Texture = "rbxasset://textures/face.png" objects[face] = true end if not headMeshPresent then local headMesh = Instance.new("SpecialMesh", head) headMesh.Scale = Vector3.new(1.25, 1.25, 1.25) objects[headMesh] = true end table.insert(connections, model.DescendantAdded:connect(function(object) local success, is_localscript = pcall(Game.IsA, object, "LocalScript") if success and is_localscript then pcall(Utility.SetProperty, object, "Disabled", true) local changed_connection = pcall(object.Changed.connect, object.Changed, function(property) if property == "Disabled" and not object.Disabled then pcall(Utility.SetProperty, object, "Disabled", true) object:Destroy() end end) end if not objects[object] then object:Destroy() end end)) model.Parent = Workspace Player.Character = model Camera.CameraSubject = humanoid Camera.CameraType = "Track" Camera.CoordinateFrame = cameraCFrame local IsStanding local RegenerateHealth local ResetCharacter function IsStanding() return not not next(feetTouching) end function RegenerateHealth() if humanoid.Health < 1 then humanoid.Health = 100 elseif not regeneratingHealth then regeneratingHealth = true local elapsedTime = wait(1) regeneratingHealth = false if humanoid.Health < 100 then humanoid.Health = math.min(humanoid.Health + elapsedTime, 100) end end end function ResetCharacter() for index, connection in ipairs(connections) do connection:disconnect() end active = false end table.insert(connections, model.AncestryChanged:connect(ResetCharacter)) table.insert(connections, model.DescendantRemoving:connect(function(object) local parent = forcefields[object] if parent then forcefields[object] = nil local new_forcefield = Instance.new("ForceField") forcefields[new_forcefield] = parent objects[new_forcefield] = true new_forcefield.Parent = parent elseif objects[object] then ResetCharacter() end end)) table.insert(connections, humanoid.HealthChanged:connect(RegenerateHealth)) table.insert(connections, humanoid.Climbing:connect(function() pose = "Climbing" end)) table.insert(connections, humanoid.FallingDown:connect(function(state) pose = "FallingDown" end)) table.insert(connections, humanoid.FreeFalling:connect(function(state) pose = "FreeFall" if state then soundFreeFalling:Play() else soundFreeFalling:Pause() end end)) table.insert(connections, humanoid.GettingUp:connect(function(state) pose = "GettingUp" if state then soundGettingUp:Play() else soundGettingUp:Pause() end end)) table.insert(connections, humanoid.PlatformStanding:connect(function() pose = "PlatformStanding" end)) table.insert(connections, humanoid.Seated:connect(function() pose = "Seated" end)) table.insert(connections, humanoid.Swimming:connect(function(speed) if speed > 0 then pose = "Swimming" else pose = "Standing" end end)) local previousRootPartCFrame = rootPart.CFrame TaskScheduler.Start(function() while active do local totalTime = TaskScheduler.GetCurrentTime() local stepTime = 1 / 60 if not PlayerControl.characterEnabled then ResetCharacter() break end torsoLight.Brightness = 0.5 + 0.15 * math.sin(totalTime * 0.75 * math.pi) local featherfallEnabled = PlayerControl.IsFeatherfallEnabled() local rootPartCFrame = rootPart.CFrame if not jumpDebounce and UserInterface:IsKeyDown(Enum.KeyCode.Space) then if humanoid.Sit then humanoid.Sit = false end if IsStanding() then jumpDebounce = true pose = "Jumping" rootPart.Velocity = Vector3.new(rootPart.Velocity.X, 50, rootPart.Velocity.Z) torso.Velocity = Vector3.new(torso.Velocity.X, 50, torso.Velocity.Z) TaskScheduler.Schedule(1, function() if pose == "Jumping" then pose = "FreeFall" end jumpDebounce = false humanoid.Jump = false end) end end local cameraCFrame = Camera.CoordinateFrame local cameraDirection = cameraCFrame.lookVector if flying then if PlayerControl.rolling then local rootPartCFrame = rootPart.CFrame local speed = (rootPartCFrame - rootPartCFrame.p):pointToObjectSpace(rootPart.Velocity).Y local decay = 0.5 ^ stepTime if math.abs(speed) <= 50 then PlayerControl.rollingAngle = (((PlayerControl.rollingAngle + 0.5) % 1 - 0.5) * decay) % 1 PlayerControl.rollingOffset = PlayerControl.rollingOffset * decay else PlayerControl.rollingAngle = (PlayerControl.rollingAngle + stepTime * speed * PlayerControl.rollingSpeed) % 1 PlayerControl.rollingOffset = (PlayerControl.rollingOffset + PlayerControl.rollingMaxOffset * (1 / decay - 1)) * decay end rootJoint.C0 = (CFrame.new(0, 0, 0, -1, 0, 0, 0, 0, 1, 0, 1, 0) * CFrame.Angles(PlayerControl.rollingAngle * 2 * math.pi, 0, 0)) * CFrame.new(0, -PlayerControl.rollingOffset, 0) else rootJoint.C0 = CFrame.new(0, 0, 0, -1, 0, 0, 0, 0, 1, 0, 1, 0) PlayerControl.rollingAngle = 0 PlayerControl.rollingOffset = 0 end rightShoulder.MaxVelocity = 0.5 leftShoulder.MaxVelocity = 0.5 rightShoulder.DesiredAngle = 0 leftShoulder.DesiredAngle = 0 rightHip.DesiredAngle = 0 leftHip.DesiredAngle = 0 bodyGyro.D = 500 bodyGyro.P = 1e6 bodyGyro.maxTorque = Vector3.new(1e6, 1e6, 1e6) bodyVelocity.P = 1250 bodyVelocity.maxForce = Vector3.new(1e6, 1e6, 1e6) local movementRight = 0 local movementForward = 0 local movementUp = 0 if UserInterface:IsKeyDown(Enum.KeyCode.A) and not UserInterface:IsKeyDown(Enum.KeyCode.D) then movementRight = -1 elseif UserInterface:IsKeyDown(Enum.KeyCode.D) then movementRight = 1 end if UserInterface:IsKeyDown(Enum.KeyCode.W) then movementUp = 0.2 if not UserInterface:IsKeyDown(Enum.KeyCode.S) then movementForward = -1 end elseif UserInterface:IsKeyDown(Enum.KeyCode.S) then movementForward = 1 end local movement = PlayerControl.fly_acceleration * cameraCFrame:vectorToWorldSpace(Vector3.new(movementRight, movementUp, movementForward)) local previousMomentum = flyingMomentum local previousTilt = flyingTilt flyingMomentum = movement + flyingMomentum * (1 - PlayerControl.fly_acceleration / PlayerControl.fly_speed) flyingTilt = ((flyingMomentum * Vector3.new(1, 0, 1)).unit:Cross((previousMomentum * Vector3.new(1, 0, 1)).unit)).Y if flyingTilt ~= flyingTilt or flyingTilt == math.huge then flyingTilt = 0 end local absoluteTilt = math.abs(flyingTilt) if absoluteTilt > 0.06 or absoluteTilt < 0.0001 then if math.abs(previousTilt) > 0.0001 then flyingTilt = previousTilt * 0.9 else flyingTilt = 0 end else flyingTilt = previousTilt * 0.77 + flyingTilt * 0.25 end previousTilt = flyingTilt if flyingMomentum.magnitude < 0.1 then flyingMomentum = Vector3.new(0, 0, 0) -- bodyGyro.cframe = cameraCFrame else local momentumOrientation = CFrame.new(Vector3.new(0, 0, 0), flyingMomentum) local tiltOrientation = CFrame.Angles(0, 0, -20 * flyingTilt) bodyGyro.cframe = momentumOrientation * tiltOrientation * CFrame.Angles(-0.5 * math.pi * math.min(flyingMomentum.magnitude / PlayerControl.fly_speed, 1), 0, 0) end bodyVelocity.velocity = flyingMomentum + Vector3.new(0, 0.15695775618683547, 0) rootPart.Velocity = flyingMomentum previousMomentum = flyingMomentum else rootJoint.C0 = CFrame.new(0, 0, 0, -1, 0, 0, 0, 0, 1, 0, 1, 0) PlayerControl.rollingAngle = 0 PlayerControl.rollingOffset = 0 bodyGyro.D = 3250 bodyGyro.P = 400000 bodyVelocity.P = 5000 local cameraDirection = cameraCFrame.lookVector local walkDirection = Vector3.new(0, 0, 0) local walkSpeed = 16 if UserInterface:IsKeyDown(Enum.KeyCode.W) then if UserInterface:IsKeyDown(Enum.KeyCode.A) then walkDirection = Vector3.new(cameraDirection.X + cameraDirection.Z, 0, cameraDirection.Z - cameraDirection.X).unit elseif UserInterface:IsKeyDown(Enum.KeyCode.D) then walkDirection = Vector3.new(cameraDirection.X - cameraDirection.Z, 0, cameraDirection.Z + cameraDirection.X).unit else walkDirection = Vector3.new(cameraDirection.X, 0, cameraDirection.Z).unit end elseif UserInterface:IsKeyDown(Enum.KeyCode.S) then if UserInterface:IsKeyDown(Enum.KeyCode.A) then walkDirection = Vector3.new(-cameraDirection.X + cameraDirection.Z, 0, -cameraDirection.Z - cameraDirection.X).unit elseif UserInterface:IsKeyDown(Enum.KeyCode.D) then walkDirection = Vector3.new(-cameraDirection.X - cameraDirection.Z, 0, -cameraDirection.Z + cameraDirection.X).unit else walkDirection = Vector3.new(-cameraDirection.X, 0, -cameraDirection.Z).unit end elseif UserInterface:IsKeyDown(Enum.KeyCode.A) then walkDirection = Vector3.new(cameraDirection.Z, 0, -cameraDirection.X).unit elseif UserInterface:IsKeyDown(Enum.KeyCode.D) then walkDirection = Vector3.new(-cameraDirection.Z, 0, cameraDirection.X).unit else walkSpeed = 0 end if walkSpeed ~= previousWalkSpeed then if walkSpeed > 0 then soundRunning:Play() else soundRunning:Pause() end end if walkSpeed > 0 then if pose ~= "Jumping" then if IsStanding() then pose = "Running" else pose = "FreeFall" end end bodyGyro.cframe = CFrame.new(Vector3.new(), walkDirection) bodyGyro.maxTorque = Vector3.new(1000000000, 1000000000, 1000000000) bodyVelocity.maxForce = Vector3.new(1000000, maxForceY, 1000000) else if pose ~= "Jumping" then if IsStanding() then pose = "Standing" else pose = "FreeFall" end end -- TODO: find and fix bug that causes torso to rotate back to some angle bodyGyro.maxTorque = Vector3.new(1000000000, 1000000000, 1000000000) -- Vector3.new(1000000000, 0, 1000000000) if PlayerControl.pushable then bodyVelocity.maxForce = Vector3.new(0, 0, 0) else bodyVelocity.maxForce = Vector3.new(1000000, 0, 1000000) end end if featherfallEnabled then local velocity = rootPart.Velocity if velocity.Y > 50 then rootPart.Velocity = Vector3.new(velocity.X, 50, velocity.Z) elseif velocity.Y < -50 then rootPart.Velocity = Vector3.new(velocity.X, -50, velocity.Z) end local distanceVector = rootPartCFrame.p - previousRootPartCFrame.p local offsetX, offsetY, offsetZ = distanceVector.X, distanceVector.Y, distanceVector.Z local MAX_MOVEMENT = 50 * 0.03333333507180214 if offsetX > MAX_MOVEMENT then offsetX = MAX_MOVEMENT elseif offsetX < -MAX_MOVEMENT then offsetX = -MAX_MOVEMENT end if offsetY > MAX_MOVEMENT then offsetY = MAX_MOVEMENT elseif offsetY < -MAX_MOVEMENT then offsetY = -MAX_MOVEMENT end if offsetZ > MAX_MOVEMENT then offsetZ = MAX_MOVEMENT elseif offsetZ < -MAX_MOVEMENT then offsetZ = -MAX_MOVEMENT end local offset = Vector3.new(offsetX, offsetY, offsetZ) if offset ~= distanceVector then rootPartCFrame = previousRootPartCFrame + offset --rootPart.CFrame = rootPartCFrame end end local walkingVelocity = walkDirection * walkSpeed bodyVelocity.velocity = walkingVelocity if not jumpDebounce and math.abs(rootPart.Velocity.Y) <= 0.1 then rootPart.Velocity = Vector3.new(walkingVelocity.X, rootPart.Velocity.Y, walkingVelocity.Z) end previousWalkSpeed = walkSpeed if pose == "Jumping" or jumpDebounce then rightShoulder.MaxVelocity = 0.5 leftShoulder.MaxVelocity = 0.5 rightShoulder.DesiredAngle = 3.14 leftShoulder.DesiredAngle = -3.14 rightHip.DesiredAngle = 0 leftHip.DesiredAngle = 0 elseif pose == "FreeFall" then rightShoulder.MaxVelocity = 0.5 leftShoulder.MaxVelocity = 0.5 rightShoulder.DesiredAngle = 3.14 leftShoulder.DesiredAngle = -3.14 rightHip.DesiredAngle = 0 leftHip.DesiredAngle = 0 elseif pose == "Seated" then rightShoulder.MaxVelocity = 0.15 leftShoulder.MaxVelocity = 0.15 rightShoulder.DesiredAngle = 3.14 / 2 leftShoulder.DesiredAngle = -3.14 / 2 rightHip.DesiredAngle = 3.14 / 2 leftHip.DesiredAngle = -3.14 / 2 else local climbFudge = 0 local amplitude local frequency if pose == "Running" then rightShoulder.MaxVelocity = 0.15 leftShoulder.MaxVelocity = 0.15 amplitude = 1 frequency = 9 elseif (pose == "Climbing") then rightShoulder.MaxVelocity = 0.5 leftShoulder.MaxVelocity = 0.5 amplitude = 1 frequency = 9 climbFudge = 3.14 else amplitude = 0.1 frequency = 1 end local desiredAngle = amplitude * math.sin(totalTime * frequency) rightShoulder.DesiredAngle = desiredAngle + climbFudge leftShoulder.DesiredAngle = desiredAngle - climbFudge rightHip.DesiredAngle = -desiredAngle leftHip.DesiredAngle = -desiredAngle end end previousRootPartCFrame = rootPartCFrame RunService.RenderStepped:wait() end if model.Parent ~= nil then model.Parent = nil end PlayerControl.CreateCharacter() end) humanoid.Health = 100 character = model chatAdornee = head elseif characterMode == "pyramid" then if PlayerControl.characterEnabled then Camera.CameraType = "Fixed" PyramidCharacter.camera_distance = (Camera.Focus.p - Camera.CoordinateFrame.p).magnitude PyramidCharacter.camera_position = Camera.Focus.p PyramidCharacter.Teleport(Camera.Focus.p) PyramidCharacter.visible = true Player.Character = nil else PyramidCharacter.visible = false end end end function PlayerControl.GetCharacter() return character end function PlayerControl.GetHead() local characterMode = PlayerControl.characterMode if characterMode == "normal" then return head elseif characterMode == "pyramid" then return PyramidCharacter.core end end function PlayerControl.GetHumanoid() return humanoid end function PlayerControl.GetRootPart() return rootPart end function PlayerControl.GetTorso() return torso end function PlayerControl.IsEnabled() return PlayerControl.characterEnabled end function PlayerControl.IsFeatherfallEnabled() return PlayerControl.featherfallEnabled end function PlayerControl.IsPushable() return PlayerControl.pushable end function PlayerControl.IsRolling() return PlayerControl.rolling end function PlayerControl.ResetCharacter() if character and character.Parent then character.Parent = nil end PyramidCharacter.visible = false end function PlayerControl.SetEnabled(state, no_animation) state = not not state if state ~= PlayerControl.characterEnabled then PlayerControl.characterEnabled = state local characterMode = PlayerControl.characterMode if characterMode == "normal" then local torso = PlayerControl.GetRootPart() local rootPart = PlayerControl.GetRootPart() if rootPart then if PlayerControl.characterEnabled then local torso_cframe = Camera.Focus:toWorldSpace(PlayerControl.hide_torso_object_cframe) PlayerControl.torso_cframe = torso_cframe torso.CFrame = torso_cframe rootPart.CFrame = torso_cframe else PlayerControl.hide_torso_object_cframe = Camera.Focus:toObjectSpace(rootPart.CFrame) end else PlayerControl.torso_cframe = Camera.Focus end if PlayerControl.characterEnabled then PlayerControl.CreateCharacter() RunService.Stepped:wait() coroutine.yield() if not no_animation then GraphicalEffects.CrystalRing({base_part = PlayerControl.GetTorso(), crystal_color = BrickColor.new("Institutional white"), float_duration = 2}) end else Player.Character = nil Camera.CameraType = "Fixed" if not no_animation then GraphicalEffects.CrystalRing({position = PlayerControl.GetTorso().Position, crystal_color = BrickColor.new("Institutional white"), float_duration = 2}) end end else if state then PlayerControl.CreateCharacter() RunService.Stepped:wait() coroutine.yield() if not no_animation then GraphicalEffects.CrystalRing({base_part = PyramidCharacter.core, crystal_color = BrickColor.new("Institutional white"), float_duration = 2}) end else PyramidCharacter.visible = false if not no_animation then GraphicalEffects.CrystalRing({position = PyramidCharacter.core.Position, crystal_color = BrickColor.new("Institutional white"), float_duration = 2}) end end end end end function PlayerControl.SetFeatherfallEnabled(state) state = not not state if state ~= PlayerControl.featherfallEnabled then PlayerControl.featherfallEnabled = state if state then Logger.print("Info", "Featherfall enabled in PlayerControl") else Logger.print("Info", "Featherfall disabled in PlayerControl") end end end function PlayerControl.SetPushable(state) state = not not state if state ~= PlayerControl.pushable then PlayerControl.pushable = state if state then Logger.print("Info", "Pushing enabled in PlayerControl") else Logger.print("Info", "Pushing disabled in PlayerControl") end end end function PlayerControl.SetRolling(state) state = not not state if state ~= PlayerControl.rolling then PlayerControl.rolling = state if state then Logger.print("Info", "Rolling fly mode enabled in PlayerControl") else Logger.print("Info", "Rolling fly mode disabled in PlayerControl") end end end function PlayerControl.StartFlying() PlayerControl.fly_speed = PlayerControl.fly_basespeed if torso then flyingMomentum = torso.Velocity + torso.CFrame.lookVector * 3 + Vector3.new(0, 10, 0) else flyingMomentum = Vector3.new() end flyingTilt = 0 flying = true end function PlayerControl.StopFlying() if bodyGyro.cframe then local lookVector = bodyGyro.cframe.lookVector if lookVector.X ~= 0 or lookVector.Z ~= 0 then bodyGyro.cframe = CFrame.new(Vector3.new(), Vector3.new(lookVector.X, 0, lookVector.Z)) end end flying = false end local previousTime = 0 ControllerCommands = {}; ControllerCommands = {}; ControllerCommands.BALEFIRE_SPEED = 40 function ControllerCommands.BalefireAtMouse() local head = chatAdornee if head then local target = Mouse.Hit.p local origin = head.Position local direction = (target - origin).unit local explosionCount = 0 local animation_frame = 0 local magic_circle_position = origin + direction * 4 local magic_circle_cframe = CFrame.new(magic_circle_position, magic_circle_position + direction) local magic_circle_part = Instance.new("Part") local magic_circle_mesh = Instance.new("BlockMesh", magic_circle_part) local magic_circle_light = Instance.new("PointLight", magic_circle_part) local magic_circle_decal_back = Instance.new("Decal", magic_circle_part) local magic_circle_decal_front = Instance.new("Decal", magic_circle_part) magic_circle_part.Anchored = true magic_circle_part.Archivable = false magic_circle_part.BottomSurface = "Smooth" magic_circle_part.CanCollide = false magic_circle_part.CFrame = magic_circle_cframe magic_circle_part.FormFactor = "Custom" magic_circle_part.Locked = true magic_circle_part.Size = Vector3.new(0.2, 0.2, 0.2) magic_circle_part.TopSurface = "Smooth" magic_circle_part.Transparency = 1 magic_circle_mesh.Scale = Vector3.new(60, 60, 0) magic_circle_light.Color = Color3.new(1, 0.5, 1) magic_circle_light.Range = 16 magic_circle_light.Shadows = true magic_circle_decal_back.Face = "Back" magic_circle_decal_back.Texture = "rbxassetid://122610943" magic_circle_decal_front.Face = "Front" magic_circle_decal_front.Texture = "rbxassetid://122610943" local function NextExplosion() explosionCount = explosionCount + 1 Instance.new("Explosion", Workspace).Position = origin + direction * (explosionCount * 8 + 4) end local function AnimateMagicCircle() animation_frame = animation_frame + 1 local transparency = (animation_frame / 40) ^ 3 if animation_frame == 40 then pcall(Game.Destroy, magic_circle_part) else if magic_circle_part.Parent ~= Workspace then pcall(Utility.SetProperty, magic_circle_part, "Parent", Workspace) end head = PlayerControl.GetHead() if head then magic_circle_position = head.Position + direction * 4 end magic_circle_part.CFrame = CFrame.new(magic_circle_position, magic_circle_position + direction) * CFrame.Angles(0, 0, math.tau * animation_frame / 40 * 1.5) magic_circle_light.Brightness = 1 - transparency magic_circle_decal_back.Transparency = transparency magic_circle_decal_front.Transparency = transparency end end magic_circle_part.Parent = Workspace for i = 1, 40 do Delay((i - 1) / ControllerCommands.BALEFIRE_SPEED, NextExplosion) Delay((i - 1) / 30, AnimateMagicCircle) end for i = 1, 20 do Delay((i - 1) / ControllerCommands.BALEFIRE_SPEED, NextExplosion) end end end function ControllerCommands.ControlRandomDummy() local dummies = {} local numDummies = 0 for _, character in ipairs(Workspace:GetChildren()) do local name = tostring(character) if name == "???" or name == "Dummy" then local head, humanoid for _, child in ipairs(character:GetChildren()) do local className = child.ClassName if className == "Part" and tostring(child) == "Head" then head = child if humanoid then break end elseif className == "Humanoid" then if child.Health > 0 then humanoid = child if head then break end else break end end end if head and humanoid then numDummies = numDummies + 1 dummies[numDummies] = {character, head, humanoid} end end end if numDummies > 0 then local dummy = dummies[math.random(numDummies)] Player.Character = dummy[1] chatAdornee = dummy[2] Camera.CameraSubject = dummy[3] Camera.CameraType = "Track" end end function ControllerCommands.Decalify(textures, exclusion) local objects = Workspace:GetChildren() for _, object in ipairs(objects) do if not exclusion[object] then for _, child in ipairs(object:GetChildren()) do objects[#objects + 1] = child end if object:IsA("BasePart") then local texture = textures[math.random(#textures)] local face_left = Instance.new("Decal", object) face_left.Face = Enum.NormalId.Left face_left.Texture = texture local face_right = Instance.new("Decal", object) face_right.Face = Enum.NormalId.Right face_right.Texture = texture local face_bottom = Instance.new("Decal", object) face_bottom.Face = Enum.NormalId.Bottom face_bottom.Texture = texture local face_top = Instance.new("Decal", object) face_top.Face = Enum.NormalId.Top face_top.Texture = texture local face_front = Instance.new("Decal", object) face_front.Face = Enum.NormalId.Front face_front.Texture = texture local face_back = Instance.new("Decal", object) face_back.Face = Enum.NormalId.Back face_back.Texture = texture end end end end function ControllerCommands.ExplodeAtMouse() local explosion = Instance.new("Explosion") explosion.Position = Mouse.Hit.p explosion.Parent = Workspace end function ControllerCommands.LaserAtMouse() GraphicalEffects.ShootLaserOfDeath(Mouse.Hit.p) end function ControllerCommands.BigLaser(target) GraphicalEffects.ShootLaserOfDeath(target, {brickcolor = BrickColor.new("New Yeller"), duration = 80, fragmentation_size = 6,laser_scale = 30, light_color = Color3.new(1, 0.5, 0), magic_circle_image = "rbxassetid://126561317", magic_circle_scale = 1.5, sound_volume = 1,special_effects = BrickColor.new("Deep orange"), stay = 2}) end function ControllerCommands.BigLaserAtMouse() ControllerCommands.BigLaser(Mouse.Hit.p) end function ControllerCommands.ShootMissile(targetPart, pointOnPart, direction) GraphicalEffects.ShootMissile(targetPart, pointOnPart, direction) end function ControllerCommands.ShootMissileAtMouse(amount, spread, delayTime) local exclusionList = {} local playerHead = PlayerControl.GetHead() local playerTorso = PlayerControl.GetTorso() if playerHead and playerTorso then exclusionList[playerTorso] = true local humanoid, torso = Utility.FindHumanoidClosestToRay(Mouse.UnitRay, exclusionList) local targetPart, pointOnPart if humanoid and torso then targetPart, pointOnPart = torso, Vector3.new() else local target = Mouse.Target if target then targetPart, pointOnPart = target, target.CFrame:pointToObjectSpace(Mouse.Hit.p) else return end end if targetPart then local direction = (Mouse.Hit.p - playerHead.Position).unit delayTime = delayTime or 0 for index = 1, amount do local angles = math.tau * (index - 0.5) * spread / amount * Vector3.new(math.random() - 0.5, math.random() - 0.5,math.random() - 0.5).unit TaskScheduler.Schedule(delayTime * (index - 1), ControllerCommands.ShootMissile, targetPart, pointOnPart, CFrame.Angles(angles.X, angles.Y, angles.Z) * direction) end end end end function ControllerCommands.ShootMissileAroundMouse(amount, offset, delayTime) local exclusionList = {} local playerHead = PlayerControl.GetHead() local playerTorso = PlayerControl.GetTorso() if playerHead and playerTorso then exclusionList[playerTorso] = true local humanoid, torso = Utility.FindHumanoidClosestToRay(Mouse.UnitRay, exclusionList) local targetPart, pointOnPart if humanoid and torso then targetPart, pointOnPart = torso, Vector3.new() else local target = Mouse.Target if target then targetPart, pointOnPart = target, target.CFrame:pointToObjectSpace(Mouse.Hit.p) else return end end if targetPart then delayTime = delayTime or 0 local index = 1 local targetPoint = targetPart.CFrame * pointOnPart local rotation_offset_angles = math.tau * Vector3.new(math.random() - 0.5, math.random() - 0.5, 0).unit local rotation_offset = CFrame.Angles(rotation_offset_angles.x, rotation_offset_angles.y, 0) local angle_x = 0 local angle_x_step = math.tau / math.phi for i = 1, 8 * amount do angle_x = angle_x + angle_x_step local direction = rotation_offset * (CFrame.Angles(0, math.tau * index / amount, 0) * CFrame.Angles(angle_x, 0,0).lookVector) local blocked = Workspace:FindPartOnRay(Ray.new(targetPoint, direction * offset), targetPart.Parent) if not blocked then local p0, p1, p2, p3 = targetPart, pointOnPart, direction, offset; GraphicalEffects.ShootMissile(p0, p1, p2, function() return p0 end, p3, true) index = index + 1 if index > amount then break end end end end end end function ControllerCommands.HugeExplosionOfDoom(position) local connections = {} local parts = {} local cframe = CFrame.new(position) local function ExplosionHit(part) if part:GetMass() < 10000 and part.Parent ~= Camera then parts[part] = true part.Anchored = true part:BreakJoints() part.BrickColor = BrickColor.new("Instituational white") end end for i = 1, 4 do local quantity = 0.5 * i * (1 + i) local fraction = math.tau / quantity for x = 1, quantity do for y = 1, quantity do local explosion = Instance.new("Explosion") connections[#connections + 1] = explosion.Hit:connect(ExplosionHit) explosion.BlastRadius = 5 explosion.Position = cframe * (CFrame.Angles(fraction * x, fraction * y, 0) * Vector3.new((i - 1) * 6, 0, 0)) explosion.Parent = Workspace end end wait(0.075) end for part in pairs(parts) do for _, child in ipairs(part:GetChildren()) do if child:IsA("BodyMover") then child:Destroy() end end local mass = part:GetMass() local velocity = CFrame.Angles(math.tau * math.random(), math.tau * math.random(), 0) * Vector3.new(25, 0, 0) local bodythrust = Instance.new("BodyThrust") bodythrust.force = mass * -velocity bodythrust.Parent = part local bodyforce = Instance.new("BodyForce") bodyforce.force = mass * Vector3.new(0, 196.2, 0) bodyforce.Parent = part part.Anchored = false part.Reflectance = 1 part.RotVelocity = math.tau * Vector3.new(math.random() - 0.5, math.random() - 0.5, math.random() - 0.5) part.Transparency = 0.5 part.Velocity = (part.CFrame - part.Position) * velocity end for _, connection in ipairs(connections) do connection:disconnect() end for i = 0, 99 do Delay(i / 10, function() for part in pairs(parts) do local new_transparency = 0.5 * (1 + i / 50) part.Reflectance = 0.98 * part.Reflectance if new_transparency > part.Transparency then part.Transparency = new_transparency end end end) end Delay(10, function() for part in pairs(parts) do pcall(part.Destroy, part) end end) end function ControllerCommands.HugeExplosionOfDoomAtMouse() ControllerCommands.HugeExplosionOfDoom(Mouse.Hit.p) end function ControllerCommands.SpaceHyperBeam(asd) GraphicalEffects.SpaceHyperBeam(asd) end function ControllerCommands.SpaceHyperBeamAtMouse() ControllerCommands.SpaceHyperBeam(Mouse.Hit.p) end function ControllerCommands.ConcentratedSpaceHyperBeamAtMouse() local p = Mouse.Hit.p; for i = 1, 50 do GraphicalEffects.SpaceHyperBeam(p) end end function ControllerCommands.TeleportCharacterToMouse() if PlayerControl.IsEnabled() then local torso = PlayerControl.GetTorso() if torso then local pos = Mouse.Hit.p + Vector3.new(0, 5, 0) torso.CFrame = CFrame.new(pos, pos + torso.CFrame.lookVector) end else local new_focus_position = Mouse.Hit.p local direction_vector = Camera.CoordinateFrame.lookVector local new_focus = CFrame.new(new_focus_position, new_focus_position + direction_vector) Camera.CoordinateFrame = new_focus * CFrame.new(0, 0, 25) Camera.Focus = new_focus end end AdvancedGUI = {}; if not AdvancedGUI.GUI_BASE_COLOR then AdvancedGUI.GUI_BASE_COLOR = Color3.new(0, 0, 0) end function AdvancedGUI.GenerateChatColor(speakerName) local chatColor = ChatColor.Get(speakerName).Color local brightness = chatColor.r + chatColor.g + chatColor.b if brightness < 1.5 then chatColor = Color3.new(math.min(1, 0.4 + chatColor.r), math.min(1, 0.4 + chatColor.g), math.min(1, 0.4 + chatColor.b)) else chatColor = Color3.new(math.min(1, 0.05 + chatColor.r), math.min(1, 0.05 + chatColor.g), math.min(1, 0.05 + chatColor.b)) end return chatColor end GuiBase = {} GuiBase.__index = GuiBase function GuiBase:new(data) local instance = setmetatable({}, self) instance:Init(data) return instance end function GuiBase:Destroy() if self.parent then self.parent.children[self] = nil end for child in pairs(self.children) do child:Destroy() end self.m_base_instance:Destroy() end function GuiBase:GetContentInstance(child) return self.m_base_instance end function GuiBase:Init() self.children = {} end function GuiBase:IsA(className) return className == "GuiBase" end function GuiBase:SetParent(parent) if parent ~= self.parent then if self.parent then self.parent.children[self] = nil end self.parent = parent if parent then parent.children[self] = true self.m_base_instance.Parent = parent:GetContentInstance() else self.m_base_instance.Parent = nil end end end GuiObject = setmetatable({}, GuiBase) GuiObject.__index = GuiObject function GuiObject:Destroy() self.DragBegin:disconnect() self.DragMove:disconnect() self.DragStopped:disconnect() self.MouseButton1Click:disconnect() self.MouseButton1Down:disconnect() self.MouseButton1Up:disconnect() self.MouseButton2Down:disconnect() self.MouseButton2Up:disconnect() self.MouseEnter:disconnect() self.MouseLeave:disconnect() GuiBase.Destroy(self) end function GuiObject:GetAbsolutePosition() return self.m_base_instance.AbsolutePosition end function GuiObject:GetAbsoluteSize() return self.m_base_instance.AbsoluteSize end function GuiObject:GetPosition() return self.position end function GuiObject:GetSize() return self.size end function GuiObject:Init() GuiBase.Init(self) self.mouseDown = false self.mouseOver = false self.DragBegin = RbxUtility.CreateSignal() self.DragMove = RbxUtility.CreateSignal() self.DragStopped = RbxUtility.CreateSignal() self.MouseButton1Click = RbxUtility.CreateSignal() self.MouseButton1Down = RbxUtility.CreateSignal() self.MouseButton1Up = RbxUtility.CreateSignal() self.MouseButton2Down = RbxUtility.CreateSignal() self.MouseButton2Up = RbxUtility.CreateSignal() self.MouseEnter = RbxUtility.CreateSignal() self.MouseLeave = RbxUtility.CreateSignal() end function GuiObject:IsA(className) return className == "GuiObject" or GuiBase.IsA(self, className) end function GuiObject:SetActive(active) if active ~= self.active then self.active = active end end function GuiObject:SetBackgroundTransparency(backgroundTransparency) if backgroundTransparency ~= self.backgroundTransparency then self.backgroundTransparency = backgroundTransparency self.m_base_instance.BackgroundTransparency = backgroundTransparency end end function GuiObject:SetColor(color) if color ~= self.color then self.color = color self.m_base_instance.BackgroundColor3 = color end end function GuiObject:SetPosition(position) if position ~= self.position then self.position = position self.m_base_instance.Position = position end end function GuiObject:SetSize(size) if size ~= self.size then self.size = size self.m_base_instance.Size = size end end function GuiObject:SetVisible(visible) if visible ~= self.visible then self.visible = visible self.m_base_instance.Visible = visible end end function GuiObject:SetZIndex(zIndex) local stack = {self.m_base_instance} repeat local object = stack[#stack] stack[#stack] = nil for _, child in ipairs(object:GetChildren()) do stack[#stack + 1] = child end object.ZIndex = zIndex until #stack == 0 end GuiServiceClass = setmetatable({}, GuiBase) GuiServiceClass.__index = GuiServiceClass function GuiServiceClass:CreateTextArea(text, font, fontSize, textColor3, textXAlignment, textYAlignment, maxWidth, minWidth) local totalHeight = 0 local frame = Instance.new("Frame") frame.BackgroundTransparency = 1 local label = Instance.new("TextLabel") label.BackgroundTransparency = 1 label.Font = font label.FontSize = fontSize label.TextColor3 = textColor3 label.TextTransparency = 1 label.TextWrapped = true label.TextXAlignment = textXAlignment label.TextYAlignment = textYAlignment label.Parent = self.guiFrame local index = 1 while true do local length = #text - index + 1 if length > 1024 then length = 1024 local textBlock = string.sub(text, index, index + length - 1) label.Text = textBlock local height = 0 local width = maxWidth repeat height = height + 20 label.Size = UDim2.new(0, width, 0, height) until label.TextFits repeat height = height - 1 label.Size = UDim2.new(0, width, 0, height) until not label.TextFits repeat length = length - 10 label.Text = string.sub(text, index, index + length - 1) until label.TextFits repeat length = length + 1 label.Text = string.sub(text, index, index + length - 1) until not label.TextFits local overflowCharacter = string.sub(text, index + length - 1, index + length - 1) length = length - 1 label.Text = string.sub(text, index, index + length - 1) if overflowCharacter == "\n" then index = index + 1 end repeat height = height - 1 label.Size = UDim2.new(0, width, 0, height) until not label.TextFits height = height + 1 local blockLabel = label:Clone() blockLabel.Position = UDim2.new(0, 0, 0, totalHeight) blockLabel.Size = UDim2.new(1, 0, 0, height) blockLabel.Parent = frame totalHeight = totalHeight + height index = index + length else local textBlock = string.sub(text, index) label.Text = textBlock local height = 0 local width = maxWidth repeat height = height + 20 label.Size = UDim2.new(0, width, 0, height) until label.TextFits repeat height = height - 1 label.Size = UDim2.new(0, width, 0, height) until not label.TextFits height = height + 1 if index == 1 then repeat width = width - 10 label.Size = UDim2.new(0, width, 0, height) until width < minWidth or not label.TextFits width = math.max(width, minWidth - 1) repeat width = width + 1 label.Size = UDim2.new(0, width, 0, height) until label.TextFits end local blockLabel = label:Clone() blockLabel.Position = UDim2.new(0, 0, 0, totalHeight) blockLabel.Size = UDim2.new(1, 0, 0, height) blockLabel.Parent = frame label:Destroy() frame.Size = UDim2.new(0, width, 0, totalHeight + height) return frame end end end function GuiServiceClass:Destroy() self.running = false self.cameraPart:Destroy() self.cameraConnection:disconnect() self.keyDownConnection:disconnect() self.mouseButton1DownConnection:disconnect() self.mouseButton1UpConnection:disconnect() self.mouseButton2DownConnection:disconnect() self.mouseButton2UpConnection:disconnect() self.mouseMoveConnection:disconnect() self.steppedConnection:disconnect() end function GuiServiceClass:GetMousePosition() local mouse = self.mouse return mouse.X, mouse.Y -- mouse.X, mouse.Y + 2 -- return mouse.X - 2, mouse.Y - 3 end function GuiServiceClass:GetTextBounds(text, font, fontSize, alignX, alignY, width) local tempLabel = self.tempLabel tempLabel.Font = font tempLabel.FontSize = fontSize tempLabel.Size = UDim2.new(0, width, 0, 4096) tempLabel.Text = text tempLabel.TextXAlignment = alignX tempLabel.TextYAlignment = alignY local textBounds = tempLabel.TextBounds tempLabel.Text = "" return textBounds end function GuiServiceClass:Init(data) GuiBase.Init(self) local _ = string.char local camera = data.Camera local mouse = data.Mouse local cameraPart = Instance.new("Part") local billboardGui = Instance.new("BillboardGui", cameraPart) guiFrame = Instance.new("Frame", billboardGui) cameraPart.Anchored = true cameraPart.BottomSurface = "Smooth" cameraPart.CanCollide = false -- cameraPart.CFrame = CFrame.new(16384, 16384, 16384) cameraPart.FormFactor = "Custom" cameraPart.Locked = true cameraPart.Size = Vector3.new(0.2, 0.2, 0.2) cameraPart.TopSurface = "Smooth" cameraPart.Transparency = 1 billboardGui.Adornee = cameraPart billboardGui.AlwaysOnTop = true -- billboardGui.ExtentsOffset = Vector3.new(-16384, -16384, -16384) guiFrame.BackgroundTransparency = 1 cameraPart.Parent = camera self.running = true self.m_base_instance = guiFrame self.billboardGui = billboardGui self.cameraPart = cameraPart self.tempLabel = RBXInstance.new "TextLabel" { BackgroundTransparency = 1, TextTransparency = 1, TextWrapped = true, Parent = guiFrame } self.mnemonics = {} self.visible = true self.camera = camera self.mouse = mouse self.cameraConnection = camera.Changed:connect(function(property) self:UpdateView() if property == "CameraType" then if camera.CameraType ~= Enum.CameraType.Track and camera.CameraType ~= Enum.CameraType.Fixed then camera.CameraType = Enum.CameraType.Track end elseif property == "CoordinateFrame" and camera.CameraType ~= Enum.CameraType.Fixed then local cframe, focus = camera.CoordinateFrame, camera.Focus local watchOffset = focus.p - cframe.p local error = watchOffset.unit - cframe.lookVector if error.magnitude >= 1e-3 then local head = PlayerControl.GetHead() local time1, velocity1 if head then time1 = time() velocity1 = head.Velocity end if camera.Changed:wait() == "CoordinateFrame" then local position = cframe.p if head then local time2 = time() local velocity2 = head.Velocity position = position + 0.5 * (velocity1 + velocity2) * (time2 - time1) end camera.CoordinateFrame = CFrame.new(position, camera.Focus.p) end end end end) self.keyDownConnection = mouse.KeyDown:connect(function(key) self:KeyDown(key) end) self.mouseButton1DownConnection = mouse.Button1Down:connect(function() self:MouseButton1Down() end) self.mouseButton1UpConnection = mouse.Button1Up:connect(function() self:MouseButton1Up() end) self.mouseButton2DownConnection = mouse.Button2Down:connect(function() self:MouseButton2Down() end) self.mouseButton2UpConnection = mouse.Button2Up:connect(function() self:MouseButton2Up() end) self.mouseMoveConnection = mouse.Move:connect(function() self:MouseMove() end) self.steppedConnection = RunService.RenderStepped:connect(function() self:UpdateObjects() self:UpdateView() end) self.mousePreviousPosition = Vector2.new(self:GetMousePosition()) end function GuiServiceClass:IsA(className) return className == "GuiService" or GuiBase.IsA(self, className) end function GuiServiceClass:KeyDown(key) local mnemonicButton = self.mnemonics[string.upper(key)] if mnemonicButton then mnemonicButton.Activated:fire() end end function GuiServiceClass:MouseButton1Down() local mouse = self.mouse local mouseX, mouseY = self:GetMousePosition() local stack = {self} local dragObjects = {} self.dragObjects = dragObjects while #stack > 0 do local object = stack[#stack] stack[#stack] = nil if object.visible then for child in pairs(object.children) do stack[#stack + 1] = child end if object.active then local position = object:GetAbsolutePosition() local size = object:GetAbsoluteSize() if mouseX >= position.X and mouseY >= position.Y and mouseX < position.X + size.X and mouseY < position.Y + size.Y then object.mouseDown = true dragObjects[object] = true local mouseButton1Down = object.MouseButton1Down if mouseButton1Down then mouseButton1Down:fire() if object.autoButtonColor then local color = object.color local transparency = object.backgroundTransparency object.m_base_instance.BackgroundColor3 = Color3.new(math.min(color.r + 0.3, 1), math.min(color.g + 0.3, 1), math.min(color.b + 0.3, 1)) object.m_base_instance.BackgroundTransparency = transparency end end object.DragBegin:fire() end end end end self.mousePreviousPosition = Vector2.new(mouseX, mouseY) end function GuiServiceClass:MouseButton1Up() local mouse = self.mouse local mouseX, mouseY = self:GetMousePosition() local stack = {self} while #stack > 0 do local object = stack[#stack] stack[#stack] = nil if object.visible then for child in pairs(object.children) do stack[#stack + 1] = child end if object.active then local position = object:GetAbsolutePosition() local size = object:GetAbsoluteSize() if mouseX >= position.X and mouseY >= position.Y and mouseX < position.X + size.X and mouseY < position.Y + size.Y then object.MouseButton1Up:fire() end end end end local dragObjects = self.dragObjects self.dragObjects = nil if dragObjects then for dragObject in pairs(dragObjects) do dragObject.mouseDown = false local position = dragObject:GetAbsolutePosition() local size = dragObject:GetAbsoluteSize() if mouseX >= position.X and mouseY >= position.Y and mouseX < position.X + size.X and mouseY < position.Y + size.Y then dragObject.MouseButton1Click:fire() local activated = dragObject.Activated if activated then activated:fire() end end dragObject.DragStopped:fire() if dragObject.autoButtonColor then if dragObject.mouseOver then local color = dragObject.color local transparency = dragObject.backgroundTransparency dragObject.m_base_instance.BackgroundColor3 = Color3.new(math.max(color.r - 0.3, 0), math.max(color.g - 0.3, 0), math.max(color.b - 0.3, 0)) dragObject.m_base_instance.BackgroundTransparency = math.max(0, transparency - 0.2) else dragObject.m_base_instance.BackgroundColor3 = dragObject.color dragObject.m_base_instance.BackgroundTransparency = dragObject.backgroundTransparency end end self.dragObject = nil end end end function GuiServiceClass:MouseButton2Down() local mouse = self.mouse local mouseX, mouseY = self:GetMousePosition() local stack = {self} while #stack > 0 do local object = stack[#stack] stack[#stack] = nil if object.visible then for child in pairs(object.children) do stack[#stack + 1] = child end if object.active then local position = object:GetAbsolutePosition() local size = object:GetAbsoluteSize() if mouseX >= position.X and mouseY >= position.Y and mouseX < position.X + size.X and mouseY < position.Y + size.Y then local mouseButton2Down = object.MouseButton2Down if mouseButton2Down then mouseButton2Down:fire() end end end end end self.mousePreviousPosition = Vector2.new(mouseX, mouseY) end function GuiServiceClass:MouseButton2Up() local mouse = self.mouse local mouseX, mouseY = self:GetMousePosition() local stack = {self} while #stack > 0 do local object = stack[#stack] stack[#stack] = nil if object.visible then for child in pairs(object.children) do stack[#stack + 1] = child end if object.active then local position = object:GetAbsolutePosition() local size = object:GetAbsoluteSize() if mouseX >= position.X and mouseY >= position.Y and mouseX < position.X + size.X and mouseY < position.Y + size.Y then local mouseButton2Up = object.MouseButton2Up if mouseButton2Up then mouseButton2Up:fire() end end end end end end function GuiServiceClass:MouseMove() self:UpdateObjects() local dragObjects = self.dragObjects if dragObjects then for dragObject in pairs(dragObjects) do local mouse = self.mouse local mousePosition = Vector2.new(self:GetMousePosition()) dragObject.DragMove:fire(mousePosition - self.mousePreviousPosition) self.mousePreviousPosition = mousePosition end end end function GuiServiceClass:SetMnemonic(mnemonic, button) self.mnemonics[mnemonic] = button end function GuiServiceClass:UpdateObjects() local mouse = self.mouse local mouseX, mouseY = self:GetMousePosition() local stack = {self} while #stack > 0 do local object = stack[#stack] stack[#stack] = nil if object.visible then for child in pairs(object.children) do stack[#stack + 1] = child end if object.active then local position = object:GetAbsolutePosition() local size = object:GetAbsoluteSize() if mouseX >= position.X and mouseY >= position.Y and mouseX < position.X + size.X and mouseY < position.Y + size.Y then if not object.mouseOver then object.mouseOver = true object.MouseEnter:fire() if object.autoButtonColor then local color = object.color local transparency = object.backgroundTransparency if object.mouseDown then object.m_base_instance.BackgroundColor3 = Color3.new(math.min(color.r + 0.3, 1), math.min(color.g + 0.3, 1), math.min(color.b + 0.3, 1)) object.m_base_instance.BackgroundTransparency = transparency else object.m_base_instance.BackgroundColor3 = Color3.new(math.max(color.r - 0.3, 0), math.max(color.g - 0.3, 0), math.max(color.b - 0.3, 0)) object.m_base_instance.BackgroundTransparency = math.max(0, transparency - 0.2) end end end else if object.mouseOver then object.mouseOver = false object.MouseLeave:fire() if object.autoButtonColor then object.m_base_instance.BackgroundColor3 = object.color object.m_base_instance.BackgroundTransparency = object.backgroundTransparency end end end end end end end function GuiServiceClass:UpdateView() local billboardGui = self.billboardGui local guiFrame = self.m_base_instance local camera = self.camera local mouse = self.mouse local cameraCFrame = CFrame.new(camera.CoordinateFrame.p, camera.Focus.p) -- camera.CoordinateFrame local viewSizeX, viewSizeY = mouse.ViewSizeX, mouse.ViewSizeY local previousViewSize = self.viewSize if not previousViewSize or ((viewSizeX ~= 0 or viewSizeY ~= 0) and (viewSizeX ~= previousViewSize.X or viewSizeY ~= previousViewSize.Y)) then self.viewSize = {X = viewSizeX, Y = viewSizeY} local viewSizeUDim2 = UDim2.new(0, viewSizeX, 0, viewSizeY) billboardGui.Size = viewSizeUDim2 guiFrame.Size = viewSizeUDim2 -- FIXME: -- After the 15th of July 2014, there came an offset at the Y thingy out of nowhere so I accomodated for that. billboardGui.SizeOffset = Vector2.new(0.5 / viewSizeX, (0.5 + 10) / viewSizeY) end --billboardGui.SizeOffset = Vector2.new() billboardGui.StudsOffset = (cameraCFrame - cameraCFrame.p):inverse() * cameraCFrame.p - Vector3.new(0, 0, 1) end GuiService = GuiServiceClass:new { Camera = Camera, Mouse = Mouse } GuiFrame = setmetatable({}, GuiObject) GuiFrame.__index = GuiFrame GuiFrame.__default = {__index = { Active = false, BackgroundTransparency = 0.75, BorderSize = 4, BorderTransparency = 0.75, Color = AdvancedGUI.GUI_BASE_COLOR, Position = UDim2.new(0, 0, 0, 0), Size = UDim2.new(0, 52, 0, 52), Visible = true }} function GuiFrame:Destroy() GuiObject.Destroy(self) end function GuiFrame:GetContentInstance() return self.m_content_frame end function GuiFrame:Init(data) GuiObject.Init(self) setmetatable(data, GuiFrame.__default) local leftBorderFrameLeft = RBXInstance.new "Frame" { BackgroundColor3 = Color3.new(0, 0, 0), BorderSizePixel = 0, Size = UDim2.new(0, 1, 1, -1) } local leftBorderFrameCenter = RBXInstance.new "Frame" { BackgroundColor3 = Color3.new(1, 1, 1), BorderSizePixel = 0, Position = UDim2.new(0, 1, 0, 1) } local leftBorderFrameRight = RBXInstance.new "Frame" { BackgroundColor3 = Color3.new(0, 0, 0), BorderSizePixel = 0 } local rightBorderFrameRight = RBXInstance.new "Frame" { BackgroundColor3 = Color3.new(0, 0, 0), BorderSizePixel = 0, Position = UDim2.new(1, -1, 0, 1), Size = UDim2.new(0, 1, 1, -1) } local rightBorderFrameCenter = RBXInstance.new "Frame" { BackgroundColor3 = Color3.new(1, 1, 1), BorderSizePixel = 0 } local rightBorderFrameLeft = RBXInstance.new "Frame" { BackgroundColor3 = Color3.new(0, 0, 0), BorderSizePixel = 0 } local bottomBorderFrameBottom = RBXInstance.new "Frame" { BackgroundColor3 = Color3.new(0, 0, 0), BorderSizePixel = 0, Position = UDim2.new(0, 0, 1, -1), Size = UDim2.new(1, -1, 0, 1) } local bottomBorderFrameCenter = RBXInstance.new "Frame" { BackgroundColor3 = Color3.new(1, 1, 1), BorderSizePixel = 0 } local bottomBorderFrameTop = RBXInstance.new "Frame" { BackgroundColor3 = Color3.new(0, 0, 0), BorderSizePixel = 0 } local topBorderFrameTop = RBXInstance.new "Frame" { BackgroundColor3 = Color3.new(0, 0, 0), BorderSizePixel = 0, Position = UDim2.new(0, 1, 0, 0), Size = UDim2.new(1, -1, 0, 1) } local topBorderFrameCenter = RBXInstance.new "Frame" { BackgroundColor3 = Color3.new(1, 1, 1), BorderSizePixel = 0 } local topBorderFrameBottom = RBXInstance.new "Frame" { BackgroundColor3 = Color3.new(0, 0, 0), BorderSizePixel = 0 } local border_frame = RBXInstance.new "Frame" { BackgroundTransparency = 1, Size = UDim2.new(1, 0, 1, 0), leftBorderFrameLeft, leftBorderFrameCenter, leftBorderFrameRight, rightBorderFrameLeft, rightBorderFrameCenter, rightBorderFrameRight, bottomBorderFrameBottom, bottomBorderFrameCenter, bottomBorderFrameTop, topBorderFrameBottom, topBorderFrameCenter, topBorderFrameTop } local contentFrame = RBXInstance.new "Frame" { BackgroundTransparency = 1, BorderSizePixel = 0, ClipsDescendants = true, Size = UDim2.new(1, 0, 1, 0) } local base_frame = RBXInstance.new "Frame" { BorderSizePixel = 0, border_frame, contentFrame } self.m_base_instance = base_frame self.m_content_frame = contentFrame self.m_border_frame = border_frame self.leftBorderFrameLeft = leftBorderFrameLeft self.leftBorderFrameCenter = leftBorderFrameCenter self.leftBorderFrameRight = leftBorderFrameRight self.rightBorderFrameLeft = rightBorderFrameLeft self.rightBorderFrameCenter = rightBorderFrameCenter self.rightBorderFrameRight = rightBorderFrameRight self.bottomBorderFrameBottom = bottomBorderFrameBottom self.bottomBorderFrameCenter = bottomBorderFrameCenter self.bottomBorderFrameTop = bottomBorderFrameTop self.topBorderFrameBottom = topBorderFrameBottom self.topBorderFrameCenter = topBorderFrameCenter self.topBorderFrameTop = topBorderFrameTop self:SetActive(data.Active) self:SetBackgroundTransparency(data.BackgroundTransparency) self:SetBorderSize(data.BorderSize) self:SetBorderTransparency(data.BorderTransparency) self:SetColor(data.Color) self:SetPosition(data.Position) self:SetSize(data.Size) self:SetVisible(data.Visible) self:SetParent(data.Parent) end function GuiFrame:IsA(className) return className == "GuiFrame" or GuiObject.IsA(self, className) end function GuiFrame:SetBorderSize(border_size) border_size = math.max(math.floor(border_size + 0.5), 0) if border_size ~= self.m_border_size then self.m_border_size = border_size local border_frame = self.m_border_frame local contentFrame = self.m_content_frame local leftBorderFrameCenter = self.leftBorderFrameCenter local leftBorderFrameRight = self.leftBorderFrameRight local rightBorderFrameCenter = self.rightBorderFrameCenter local rightBorderFrameLeft = self.rightBorderFrameLeft local bottomBorderFrameCenter = self.bottomBorderFrameCenter local bottomBorderFrameTop = self.bottomBorderFrameTop local topBorderFrameCenter = self.topBorderFrameCenter local topBorderFrameBottom = self.topBorderFrameBottom contentFrame.Position = UDim2.new(0, border_size, 0, border_size) contentFrame.Size = UDim2.new(1, -2 * border_size, 1, -2 * border_size) local inner_visible = border_size > 0 if self.leftBorderFrameLeft.Visible ~= inner_visible then self.rightBorderFrameRight.Visible = inner_visible self.bottomBorderFrameBottom.Visible = inner_visible self.topBorderFrameTop.Visible = inner_visible end local outer_visible = border_size > 1 if leftBorderFrameCenter.Visible ~= outer_visible then leftBorderFrameCenter.Visible = outer_visible leftBorderFrameRight.Visible = outer_visible rightBorderFrameCenter.Visible = outer_visible rightBorderFrameLeft.Visible = outer_visible bottomBorderFrameCenter.Visible = outer_visible bottomBorderFrameTop.Visible = outer_visible topBorderFrameCenter.Visible = outer_visible topBorderFrameBottom.Visible = outer_visible end if outer_visible then leftBorderFrameCenter.Size = UDim2.new(0, border_size - 2, 1, -border_size) leftBorderFrameRight.Position = UDim2.new(0, border_size - 1, 0, border_size - 1) leftBorderFrameRight.Size = UDim2.new(0, 1, 1, 1 - 2 * border_size) rightBorderFrameCenter.Position = UDim2.new(1, 1 - border_size, 0, border_size - 1) rightBorderFrameCenter.Size = UDim2.new(0, border_size - 2, 1, -border_size) rightBorderFrameLeft.Position = UDim2.new(1, -border_size, 0, border_size) rightBorderFrameLeft.Size = UDim2.new(0, 1, 1, 1 - 2 * border_size) bottomBorderFrameCenter.Position = UDim2.new(0, 1, 1, 1 - border_size) bottomBorderFrameCenter.Size = UDim2.new(1, -border_size, 0, border_size - 2) bottomBorderFrameTop.Position = UDim2.new(0, border_size - 1, 1, -border_size) bottomBorderFrameTop.Size = UDim2.new(1, 1 - 2 * border_size, 0, 1) topBorderFrameCenter.Position = UDim2.new(0, border_size - 1, 0, 1) topBorderFrameCenter.Size = UDim2.new(1, -border_size, 0, border_size - 2) topBorderFrameBottom.Position = UDim2.new(0, border_size, 0, border_size - 1) topBorderFrameBottom.Size = UDim2.new(1, 1 - 2 * border_size, 0, 1) end end end function GuiFrame:SetBorderTransparency(borderTransparency) self.borderTransparency = borderTransparency self.leftBorderFrameLeft.BackgroundTransparency = borderTransparency self.leftBorderFrameCenter.BackgroundTransparency = borderTransparency self.leftBorderFrameRight.BackgroundTransparency = borderTransparency self.rightBorderFrameLeft.BackgroundTransparency = borderTransparency self.rightBorderFrameCenter.BackgroundTransparency = borderTransparency self.rightBorderFrameRight.BackgroundTransparency = borderTransparency self.bottomBorderFrameBottom.BackgroundTransparency = borderTransparency self.bottomBorderFrameCenter.BackgroundTransparency = borderTransparency self.bottomBorderFrameTop.BackgroundTransparency = borderTransparency self.topBorderFrameBottom.BackgroundTransparency = borderTransparency self.topBorderFrameCenter.BackgroundTransparency = borderTransparency self.topBorderFrameTop.BackgroundTransparency = borderTransparency end GuiButton = setmetatable({}, GuiFrame) GuiButton.__index = GuiButton GuiButton.__default = {__index = { AutoButtonColor = true }} function GuiButton:Destroy() self.Activated:disconnect() GuiFrame.Destroy(self) end function GuiButton:Init(data) if data.Active == nil then data.Active = true end GuiFrame.Init(self, data) setmetatable(data, GuiButton.__default) self.Activated = RbxUtility.CreateSignal() self:SetAutoButtonColor(data.AutoButtonColor) end function GuiButton:IsA(className) return className == "GuiButton" or GuiFrame.IsA(self, className) end function GuiButton:SetAutoButtonColor(autoButtonColor) if autoButtonColor ~= self.autoButtonColor then self.autoButtonColor = autoButtonColor if autoButtonColor then if self.mouseOver then local color = self.color local transparency = self.backgroundTransparency if self.mouseDown then self.m_base_instance.BackgroundColor3 = Color3.new(math.min(color.r + 0.3, 1), math.min(color.g + 0.3, 1), math.min(color.b + 0.3, 1)) self.m_base_instance.BackgroundTransparency = transparency else self.m_base_instance.BackgroundColor3 = Color3.new(math.max(color.r - 0.3, 0), math.max(color.g - 0.3, 0), math.max(color.b - 0.3, 0)) self.m_base_instance.BackgroundTransparency = math.max(0, transparency - 0.5) end end else self.m_base_instance.BackgroundColor3 = self.color end end end GuiTextLabel = setmetatable({}, GuiFrame) GuiTextLabel.__index = GuiTextLabel GuiTextLabel.__default = {__index = { Font = "ArialBold", FontSize = "Size12", Text = "", TextColor = Color3.new(1, 1, 1), TextStrokeColor = Color3.new(0, 0, 0), TextStrokeTransparency = 0.6, TextWrapped = true }} function GuiTextLabel:Destroy() GuiFrame.Destroy(self) end function GuiTextLabel:Init(data) GuiFrame.Init(self, data) setmetatable(data, GuiTextLabel.__default) local base_instance = self.m_base_instance local textLabel = RBXInstance.new "TextLabel" { BackgroundTransparency = 1, Font = data.Font, FontSize = data.FontSize, TextColor3 = data.TextColor3, TextStrokeColor3 = data.TextStrokeColor3, TextStrokeTransparency = data.TextStrokeTransparency, TextWrapped = data.TextWrapped } textLabel.Parent = self:GetContentInstance() self.textLabel = textLabel self:SetText(data.Text) end function GuiTextLabel:IsA(className) return className == "GuiTextLabel" or GuiFrame.IsA(self, className) end function GuiTextLabel:SetText(text) if text ~= self.text then self.text = text local text_index = 1 local content_instance = self:GetContentInstance() local content_instance_size = content_instance.AbsoluteSize local frame = Instance.new("Frame") frame.BackgroundTransparency = 1 local label = Instance.new("TextLabel") label.BackgroundTransparency = 1 label.Font = font label.FontSize = fontSize label.Size = UDim2.new(0, content_instance_size.X, 0, 1000) label.Text = "" label.TextColor3 = textColor3 label.TextTransparency = 1 label.TextWrapped = true label.TextXAlignment = textXAlignment label.TextYAlignment = textYAlignment label.Parent = self.guiFrame local row_length = 0 local step_size = 256 for step = 1, 8 do step_size = 0.5 * step_size label.Text = string.sub(text, text_index, text_index + row_length - 1) end end end GuiImageButton = setmetatable({}, GuiButton) GuiImageButton.__index = GuiImageButton GuiImageButton.__default = {__index = { Image = "" }} function GuiImageButton:Destroy() GuiButton.Destroy(self) end function GuiImageButton:Init(data) GuiButton.Init(self, data) setmetatable(data, GuiImageButton.__default) local content_frame = self.m_content_frame local image_label = RBXInstance.new "ImageLabel" { BackgroundTransparency = 1, Size = UDim2.new(1, 0, 1, 0) } image_label.Parent = content_frame self.m_image_label = image_label self:SetImage(data.Image) end function GuiImageButton:IsA(className) return className == "GuiImageButton" or GuiButton.IsA(self, className) end function GuiImageButton:SetImage(image) if image ~= self.m_image then self.m_image = image self.m_image_label.Image = image end end GuiTextButton = setmetatable({}, GuiButton) GuiTextButton.__index = GuiTextButton GuiTextButton.__default = {__index = { Font = Enum.Font.ArialBold, FontSize = Enum.FontSize.Size11, Text = "Button", TextXAlignment = Enum.TextXAlignment.Center }} function GuiTextButton:Destroy() GuiButton.Destroy(self) end function GuiTextButton:GetTextBounds() return self.textLabel.TextBounds end function GuiTextButton:Init(data) GuiButton.Init(self, data) setmetatable(data, GuiTextButton.__default) local contentFrame = self.m_content_frame local mnemonicLabel = RBXInstance.new "TextLabel" { BackgroundTransparency = 1, Font = "ArialBold", FontSize = "Size36", Size = UDim2.new(1, 0, 0.7, 0), TextColor3 = Color3.new(1, 1, 1), TextStrokeColor3 = Color3.new(0, 0, 0), TextStrokeTransparency = 0.6, TextWrapped = true } local textLabel = RBXInstance.new "TextLabel" { BackgroundTransparency = 1, TextColor3 = Color3.new(1, 1, 1), TextStrokeColor3 = Color3.new(0, 0, 0), TextStrokeTransparency = 0.6, TextWrapped = true } mnemonicLabel.Parent = contentFrame textLabel.Parent = contentFrame self.mnemonicLabel = mnemonicLabel self.textLabel = textLabel self:SetFont(data.Font) self:SetFontSize(data.FontSize) self:SetMnemonic(data.Mnemonic, true) self:SetText(data.Text) self:SetTextXAlignment(data.TextXAlignment) end function GuiTextButton:IsA(className) return className == "GuiTextButton" or GuiButton.IsA(self, className) end function GuiTextButton:SetFont(font) if font ~= self.font then self.font = font self.textLabel.Font = font end end function GuiTextButton:SetFontSize(fontSize) if fontSize ~= self.fontSize then self.fontSize = fontSize self.textLabel.FontSize = fontSize end end function GuiTextButton:SetMnemonic(mnemonic, forceUpdate) if mnemonic ~= self.mnemonic or forceUpdate then if self.mnemonic then GuiService:SetMnemonic(self.mnemonic, nil) end if mnemonic then GuiService:SetMnemonic(mnemonic, self) end self.mnemonic = mnemonic local mnemonicLabel = self.mnemonicLabel local textLabel = self.textLabel if mnemonic then mnemonicLabel.Text = mnemonic textLabel.Size = UDim2.new(1, 0, 0.9, 0) textLabel.TextYAlignment = "Bottom" else mnemonicLabel.Text = "" textLabel.Size = UDim2.new(1, 0, 1, 0) textLabel.TextYAlignment = "Center" end end end function GuiTextButton:SetText(text) if text ~= self.text then self.text = text self.textLabel.Text = text end end function GuiTextButton:SetTextXAlignment(textXAlignment) if textXAlignment ~= self.textXAlignment then self.textXAlignment = textXAlignment self.textLabel.TextXAlignment = textXAlignment end end GuiWindow = setmetatable({}, GuiObject) GuiWindow.__index = GuiWindow GuiWindow.__default = {__index = { Active = true, BackgroundTransparency = 0.5, BorderSize = 4, BorderTransparency = 0.5, Position = UDim2.new(0, 0, 0, 0), Size = UDim2.new(0, 360, 0, 240), Title = "Window", TitleBarBackgroundTransparency = 0.5, TitleBarBorderTransparency = 1, Visible = true }} function GuiWindow:Init(data) GuiObject.Init(self) setmetatable(data, GuiFrame.__default) local title_bar = GuiTextLabel:new { BackgroundTransparency = data.TitleBarBackgroundTransparency, BorderTransparency = data.TitleBarBackgroundTransparency, Text = data.Title } local content_frame = GuiFrame:new { Active = data.Active, BackgroundTransparency = data.BackgroundTransparency, BorderSize = data.BorderSize, BorderTransparency = data.BorderTransparency } local base_frame = RBXInstance.new "Frame" { BackgroundTransparency = 1, BorderSizePixel = 0, Position = data.Position, Size = data.Size, Visible = data.Visible } self.m_base_frame = base_frame self.m_content_frame = content_frame self.m_title_bar = title_bar end function GuiWindow:IsA(className) return className == "GuiWindow" or GuiObject.IsA(self, className) end GuiScrollFrame = setmetatable({}, GuiFrame) GuiScrollFrame.__index = GuiScrollFrame GuiScrollFrame.__default = {__index = { ContentHeight = 0, ScrollBarColor = Color3.new(1, 1, 1) }} function GuiScrollFrame:Destroy() self.m_scroll_bar:Destroy() GuiFrame.Destroy(self) end function GuiScrollFrame:GetContentInstance() return self.m_scroll_frame or GuiFrame.GetContentInstance(self) end function GuiScrollFrame:Init(data) GuiFrame.Init(self, data) setmetatable(data, GuiScrollFrame.__default) local scroll_pane = RBXInstance.new "Frame" { BackgroundColor3 = Color3.new(1, 1, 1), BackgroundTransparency = 0.8, BorderSizePixel = 0, Position = UDim2.new(1, -20, 0, 0), Size = UDim2.new(0, 20, 1, 0), Parent = self.m_content_frame } local scroll_bar = GuiFrame:new { Active = true, BackgroundTransparency = 0.6, BorderTransparency = 0.6, Color = data.ScrollBarColor, Parent = self } local scroll_frame = RBXInstance.new "Frame" { BackgroundTransparency = 1, Parent = self.m_content_frame } self.m_scroll_bar = scroll_bar self.m_scroll_frame = scroll_frame self.m_scroll_pane = scroll_pane self.m_scroll_position = 0 self.m_updating_content_height = false self:SetContentHeight(data.ContentHeight) self:UpdateScrollPosition() self.m_scroll_bar.DragBegin:connect(function() self.m_scroll_drag_total = Vector2.new() self.m_scroll_initial_position = self.m_scroll_position end) self.m_scroll_bar.DragMove:connect(function(offset) self.m_scroll_drag_total = self.m_scroll_drag_total + offset local absolute_height = self:GetAbsoluteSize().Y - 2 * self.m_border_size if absolute_height ~= 0 then local content_height = math.max(self.m_content_height, absolute_height) local scroll_space = 1 - absolute_height / content_height self:Scroll(self.m_scroll_initial_position + self.m_scroll_drag_total.Y * (content_height / absolute_height - 1) / scroll_space) end end) end function GuiScrollFrame:IsA(className) return className == "GuiScrollFrame" or GuiFrame.IsA(self, className) end function GuiScrollFrame:Scroll(position) position = math.min(math.max(position, 0), self.m_content_height - (self:GetAbsoluteSize().Y - 2 * self.m_border_size)) if position ~= self.m_scroll_position then self.m_scroll_position = position self:UpdateScrollPosition() end end function GuiScrollFrame:SetContentHeight(height) if height ~= self.m_content_height then local prev_height = self.m_content_height self.m_content_height = height if not self.m_updating_content_height then self.m_updating_content_height = true coroutine.resume(coroutine.create(function() local success, message = ypcall(self.SetContentHeightImpl1, self, prev_height) if not success then Logger.printf("Severe", "Error in GuiScrollFrame:SetContentHeight(%s): %s", Utility.ToString(height), message) end end)) end end end function GuiScrollFrame:SetContentHeightImpl1(prev_height) RunService.RenderStepped:wait() self.m_updating_content_height = false local height = self.m_content_height self.m_scroll_frame.Size = UDim2.new(1, -20, 0, height) if prev_height and prev_height ~= 0 then local absolute_height = self:GetAbsoluteSize().Y - 2 * self.m_border_size if self.m_scroll_position == prev_height - absolute_height then self.m_scroll_position = height - absolute_height else self.m_scroll_position = height * self.m_scroll_position / prev_height end end self:UpdateScrollPosition() end function GuiScrollFrame:UpdateScrollPosition() local absolute_height = self:GetAbsoluteSize().Y - 2 * self.m_border_size if absolute_height == 0 then absolute_height = self.m_content_height end local scroll_bar = self.m_scroll_bar local scroll_frame = self.m_scroll_frame local scroll_pane = self.m_scroll_pane local content_height = math.max(self.m_content_height, absolute_height) if absolute_height == content_height then scroll_frame.Position = UDim2.new(0, 0, 0, 0) scroll_frame.Size = UDim2.new(1, 0, 1, 0) scroll_bar:SetVisible(false) scroll_pane.Visible = false else local contentScale = content_height / absolute_height local scroll_space = 1 - absolute_height / content_height local scroll_position = self.m_scroll_position scroll_frame.Position = UDim2.new(0, 0, 0, -scroll_position) scroll_bar:SetPosition(UDim2.new(1, -20, scroll_position / (content_height - absolute_height) * scroll_space, 0)) scroll_bar:SetSize(UDim2.new(0, 20, absolute_height / content_height, 0)) scroll_bar:SetVisible(true) scroll_pane.Visible = true end end GuiMenu = setmetatable({}, GuiFrame) GuiMenu.__index = GuiMenu GuiMenu.__default = {__index = { VerticalSpacing = 18 }} function GuiMenu:AddItem(text, onClick, options) local frameSize = self:GetSize() local frameHeight = frameSize.Y.Offset - self.m_border_size * 2 local verticalSpacing = self.verticalSpacing local properties = { BackgroundTransparency = 0.75, BorderSize = 0, BorderTransparency = 1, Color = (#self.menuItems % 2 == 1) and Color3.new(0.25, 0.25, 0.25) or Color3.new(0, 0, 0), FontSize = Enum.FontSize.Size12, Position = UDim2.new(0, 0, 0, frameHeight), Size = UDim2.new(1, 0, 0, verticalSpacing), Text = text, Parent = self } if options then for key, value in pairs(options) do properties[key] = value end end local menuItem = GuiTextButton:new(properties) if onClick then menuItem.Activated:connect(function() if not onClick(text, self) then self:Destroy() end end) end self.menuItems[#self.menuItems + 1] = menuItem self:SetSize(frameSize + UDim2.new(0, 0, 0, verticalSpacing)) end function GuiMenu:ClearItems() local menuItems = self.menuItems for _, item in ipairs(menuItems) do menuItems[item] = nil item:Destroy() end local frameSize = self:GetSize() self:SetSize(frameSize + UDim2.new(0, 0, 0, self.m_border_size * 2 - frameSize.Y.Offset)) end function GuiMenu:Destroy() self:ClearItems() GuiFrame.Destroy(self) end function GuiMenu:Init(data) GuiFrame.Init(self, data) setmetatable(data, GuiMenu.__default) self.menuItems = {} self.verticalSpacing = data.VerticalSpacing end function GuiMenu:IsA(className) return className == "GuiMenu" or GuiFrame.IsA(self, className) end GuiTextList = setmetatable({}, GuiScrollFrame) GuiTextList.__index = GuiTextList GuiTextList.__default = {__index = { }} function GuiTextList:AddItem(text, options) local properties = { BackgroundTransparency = 1, Font = "ArialBold", FontSize = "Size12", Position = UDim2.new(0, 4, 0, self.m_content_height), Size = UDim2.new(1, -8, 0, 12), Text = tostring(text), TextColor3 = Color3.new(1, 1, 1), TextStrokeTransparency = 0.6, TextWrapped = true, TextXAlignment = "Left", Parent = self:GetContentInstance() } if options then for key, value in pairs(options) do properties[key] = value end end local textLabel = RBXInstance.new "TextLabel" (properties) textLabel.Size = UDim2.new(1, 0, 0, textLabel.TextBounds.Y) self.listItems[#self.listItems + 1] = textLabel self:SetContentHeight(self.m_content_height + textLabel.TextBounds.Y) end function GuiTextList:ClearItems() local listItems = self.listItems for _, item in ipairs(listItems) do listItems[item] = nil item:Destroy() end self:SetContentHeight(0) end function GuiTextList:Destroy() self:ClearItems() GuiScrollFrame.Destroy(self) end function GuiTextList:Init(data) GuiScrollFrame.Init(self, data) self.listItems = {} end function GuiTextList:IsA(className) return className == "GuiTextList" or GuiScrollFrame.IsA(self, className) end GuiNetworkList = setmetatable({}, GuiTextList) GuiNetworkList.__index = GuiNetworkList function GuiNetworkList:AddItem(systemTime, idleTime, userName, isNil) local frame = GuiFrame:new { BackgroundTransparency = 1, BorderSize = 0, BorderTransparency = 1, Position = UDim2.new(0, 4, 0, self.m_content_height), Size = UDim2.new(1, -8, 0, 14), } local systemTimeColor if string.sub(systemTime, 1, 1) == "?" then systemTimeColor = Color3.new(1, 0.75, 0.75) else systemTimeColor = Color3.new(0.75, 0.75, 1) end local systemTimeLabel = RBXInstance.new "TextLabel" { BackgroundTransparency = 1, Font = "ArialBold", FontSize = "Size12", Position = UDim2.new(0, 0, 0, 0), Size = UDim2.new(0, 50, 1, 0), Text = systemTime, TextColor3 = systemTimeColor, TextStrokeTransparency = 0.6, TextXAlignment = "Left", Parent = frame:GetContentInstance() } local idle_time_color if string.sub(idleTime, 1, 1) == "0" then idle_time_color = Color3.new(1, 1, 1) else idle_time_color = Color3.new(1, 0.75, 0.75) end local idleTimeLabel = RBXInstance.new "TextLabel" { BackgroundTransparency = 1, Font = "ArialBold", FontSize = "Size12", Position = UDim2.new(0, 40, 0, 0), Size = UDim2.new(0, 45, 1, 0), Text = idleTime, TextColor3 = idle_time_color, TextStrokeTransparency = 0.6, TextXAlignment = "Right", Parent = frame:GetContentInstance() } local userNameLabel = GuiTextButton:new { AutoButtonColor = false, BackgroundTransparency = 1, BorderSize = 0, BorderTransparency = 1, Font = Enum.Font.SourceSansBold, FontSize = Enum.FontSize.Size14, Position = UDim2.new(0, 98, 0, 0), Size = UDim2.new(1, -98, 1, 0), TextXAlignment = Enum.TextXAlignment.Left, Text = userName, Parent = frame } frame:SetParent(self) local userNameWidth = userNameLabel:GetTextBounds().X userNameLabel:SetSize(UDim2.new(0, userNameWidth + 4, 1, 0)) if isNil then local isNilLabel = RBXInstance.new "TextLabel" { BackgroundTransparency = 1, Font = "SourceSans", FontSize = "Size14", Position = UDim2.new(0, 100 + userNameWidth + 8, 0, 0), Size = UDim2.new(0, 50, 1, 0), Text = "(nil)", TextColor3 = Color3.new(1, 0.4, 0.4), TextStrokeTransparency = 0.6, TextXAlignment = "Left", Parent = frame:GetContentInstance() } end self.listItems[#self.listItems + 1] = frame self:SetContentHeight(self.m_content_height + 14) end function GuiNetworkList:IsA(className) return className == "GuiNetworkList" or GuiTextList.IsA(self, className) end GuiTextOutput = setmetatable({}, GuiScrollFrame) GuiTextOutput.__index = GuiTextOutput GuiTextOutput.__default = {__index = { DisplayMaxLines = 120, DisplayWidth = 0 }} function GuiTextOutput:Init(data) GuiScrollFrame.Init(self, data) setmetatable(data, GuiTextOutput.__default) self.displayMaxLines = data.DisplayMaxLines self.displayWidth = data.DisplayWidth self.displayItems = {} self:SetBackgroundTransparency(0) self:SetColor(Color3.new(1, 1, 1)) self.m_scroll_pane.BackgroundColor3 = Color3.new(0.5, 0.5, 0.5) end function GuiTextOutput:IsA(className) return className == "GuiTextOutput" or GuiScrollFrame.IsA(self, className) end function GuiTextOutput:Print(...) self:PrintFormat(nil, ...) end function GuiTextOutput:PrintFormat(options, ...) local buffer = {} local args = {...} local first = true for i = 1, select("#", ...) do buffer[i] = tostring(args[i]) end message = Utility.BlockRobloxFilter(table.concat(buffer, "\t")) local properties = { BackgroundTransparency = 1, Font = "ArialBold", FontSize = "Size12", Position = UDim2.new(0, 4, 0, self.m_content_height), Text = message, TextColor3 = Color3.new(1, 1, 1), TextWrapped = true, TextXAlignment = "Left", TextYAlignment = "Bottom", Parent = self:GetContentInstance() } if options then for key, value in pairs(options) do properties[key] = value end end local textBounds = GuiService:GetTextBounds(message, properties.Font, properties.FontSize, properties.TextXAlignment, properties.TextYAlignment, self.displayWidth - 20) local textHeight = textBounds.Y properties.Size = UDim2.new(0, self.displayWidth - 8, 0, textBounds.Y) local textLabel = RBXInstance.new "TextLabel" (properties) self.displayItems[#self.displayItems + 1] = textLabel local maxLines = self.displayMaxLines local maxHeight = maxLines * 12 local newHeight = self.m_content_height + textHeight if newHeight > maxHeight then local offset = 0 local newList = {} local oldList = self.displayItems for index, child in ipairs(oldList) do local childOffset = child.Size.Y.Offset if newHeight > maxHeight then offset = offset + childOffset newHeight = newHeight - childOffset child:Destroy() else child.Position = child.Position - UDim2.new(0, 0, 0, offset) newList[#newList + 1] = child end end self.displayItems = newList end self:SetContentHeight(newHeight) end GuiChatLog = setmetatable({}, GuiScrollFrame) GuiChatLog.__index = GuiChatLog GuiChatLog.__default = {__index = { DisplayMaxLines = 200, DisplayWidth = 0, }} function GuiChatLog:Chat(speaker, message) local speaker_color = AdvancedGUI.GenerateChatColor(speaker) speaker = Utility.BlockRobloxFilter(speaker) message = "\t\t\t\t\t\t\t\t\t\t\t\t\t\t\t" .. Utility.BlockRobloxFilter(message) local timestamp = Utility.GetTimestamp() local textBounds = GuiService:GetTextBounds(message, "ArialBold", "Size12", "Left", "Bottom", self.displayWidth - 8) local textHeight = math.max(math.min(textBounds.Y, 36), 12) local message_frame = RBXInstance.new "Frame" { BackgroundTransparency = 1, Position = UDim2.new(0, 0, 0, self.m_content_height), Size = UDim2.new(0, self.displayWidth, 0, textHeight), Parent = self:GetContentInstance() } local timestamp_label = RBXInstance.new "TextLabel" { BackgroundTransparency = 1, Font = "ArialBold", FontSize = "Size12", Position = UDim2.new(0, 4, 0, 0), Size = UDim2.new(1, -8, 0, 12), Text = timestamp, TextColor3 = Color3.new(0.75, 0.75, 0.75), TextStrokeTransparency = 0.6, TextWrapped = true, TextXAlignment = "Left", Parent = message_frame } local speaker_label = RBXInstance.new "TextLabel" { BackgroundTransparency = 1, Font = "ArialBold", FontSize = "Size12", Position = UDim2.new(0, 64, 0, 0), Size = UDim2.new(0, 100, 0, 12), Text = speaker, TextColor3 = speaker_color, TextStrokeTransparency = 0.6, Parent = message_frame } local message_label = RBXInstance.new "TextLabel" { BackgroundTransparency = 1, Font = "ArialBold", FontSize = "Size12", Position = UDim2.new(0, 4, 0, 0), Size = UDim2.new(1, -8, 1, 0), Text = message, TextColor3 = Color3.new(1, 1, 1), TextStrokeTransparency = 0.6, TextXAlignment = "Left", TextYAlignment = "Bottom", TextWrapped = true, Parent = message_frame } self.displayItems[#self.displayItems + 1] = message_frame local maxLines = self.displayMaxLines local maxHeight = maxLines * 12 local newHeight = self.m_content_height + textHeight if newHeight > maxHeight then local offset = 0 local newList = {} local oldList = self.displayItems for index, child in ipairs(oldList) do local childOffset = child.Size.Y.Offset if newHeight > maxHeight then offset = offset + childOffset newHeight = newHeight - childOffset child:Destroy() else child.Position = child.Position - UDim2.new(0, 0, 0, offset) newList[#newList + 1] = child end end self.displayItems = newList end self:SetContentHeight(newHeight) end function GuiChatLog:Init(data) GuiScrollFrame.Init(self, data) setmetatable(data, GuiChatLog.__default) self.displayMaxLines = data.DisplayMaxLines self.displayWidth = data.DisplayWidth self.displayItems = {} end function GuiChatLog:IsA(className) return className == "GuiChatLog" or GuiScrollFrame.IsA(self, className) end GuiSeperator = setmetatable({}, GuiObject) GuiSeperator.__index = GuiSeperator GuiSeperator.__default = {__index = { Active = false, Position = UDim2.new(0, 0, 0, 0), Size = UDim2.new(1, 0, 0, 16), Visible = true }} function GuiSeperator:Init(data) GuiObject.Init(self) setmetatable(data, GuiSeperator.__default) local base_frame = RBXInstance.new "Frame" { BackgroundTransparency = 1, RBXInstance.new "Frame" { BackgroundColor3 = Color3.new(1, 1, 1), BackgroundTransparency = 0.25, BorderSizePixel = 0, Position = UDim2.new(0.5, -13, 0.5, -1), Size = UDim2.new(0, 3, 0, 3), RBXInstance.new "Frame" { BackgroundColor3 = Color3.new(0, 0, 0), BackgroundTransparency = 0.75, BorderSizePixel = 0, Position = UDim2.new(0, -1, 0, -1), Size = UDim2.new(0, 5, 0, 5) } }, RBXInstance.new "Frame" { BackgroundColor3 = Color3.new(1, 1, 1), BackgroundTransparency = 0.25, BorderSizePixel = 0, Position = UDim2.new(0.5, -1, 0.5, -1), Size = UDim2.new(0, 3, 0, 3), RBXInstance.new "Frame" { BackgroundColor3 = Color3.new(0, 0, 0), BackgroundTransparency = 0.75, BorderSizePixel = 0, Position = UDim2.new(0, -1, 0, -1), Size = UDim2.new(0, 5, 0, 5) } }, RBXInstance.new "Frame" { BackgroundColor3 = Color3.new(1, 1, 1), BackgroundTransparency = 0.25, BorderSizePixel = 0, Position = UDim2.new(0.5, 11, 0.5, -1), Size = UDim2.new(0, 3, 0, 3), RBXInstance.new "Frame" { BackgroundColor3 = Color3.new(0, 0, 0), BackgroundTransparency = 0.75, BorderSizePixel = 0, Position = UDim2.new(0, -1, 0, -1), Size = UDim2.new(0, 5, 0, 5) } } } self.m_base_instance = base_frame self:SetActive(data.Active) self:SetPosition(data.Position) self:SetSize(data.Size) self:SetVisible(data.Visible) self:SetParent(data.Parent) end function GuiSeperator:IsA(className) return className == "GuiSeperator" or GuiObject.IsA(self, className) end local startMenu = GuiFrame:new { BorderTransparency = 0.5, Position = UDim2.new(0, -4, 0, -4), Size = UDim2.new(0, 68, 1, 8), Parent = GuiService } GuiSeperator:new { Position = UDim2.new(0, 0, 0, 5), Parent = startMenu } GuiSeperator:new { Position = UDim2.new(0, 0, 1, -85), Parent = startMenu } local networkButton = GuiTextButton:new { BackgroundTransparency = 0.9, Mnemonic = "L", Position = UDim2.new(0, 4, 1, -647), Text = "Network", Parent = startMenu } local chatLogButton = GuiTextButton:new { BackgroundTransparency = 0.9, Mnemonic = "K", Position = UDim2.new(0, 4, 1, -475), Text = "Chat log", Parent = startMenu } local outputButton = GuiTextButton:new { BackgroundTransparency = 0.9, Mnemonic = "P", Position = UDim2.new(0, 4, 1, -283), Text = "Output", Parent = startMenu } local toolsButton = GuiTextButton:new { BackgroundTransparency = 0.9, Mnemonic = "O", Position = UDim2.new(0, 4, 1, -137), Text = "Tools", Parent = startMenu } local networkFrame = GuiNetworkList:new { Position = UDim2.new(0, 66, 1, -647), Size = UDim2.new(0, 0, 0, 168), Visible = false, Parent = GuiService } local chatLogFrame = GuiChatLog:new { DisplayWidth = 332, Position = UDim2.new(0, 66, 1, -475), Size = UDim2.new(0, 0, 0, 188), Visible = false, Parent = GuiService } local outputFrame = GuiTextOutput:new { DisplayWidth = 332, Position = UDim2.new(0, 66, 1, -283), Size = UDim2.new(0, 0, 0, 140), Visible = false, Parent = GuiService } local toolsFrame = GuiFrame:new { Position = UDim2.new(0, 66, 1, -137), Size = UDim2.new(0, 0, 0, 52), Visible = false, Parent = GuiService } local toggleCharacterButton = GuiTextButton:new { BackgroundTransparency = 0.9, Position = UDim2.new(0, 1, 0, 1), Size = UDim2.new(0, 108, 0, 20), Text = "Enable character", Parent = toolsFrame } local resetCharacterButton = GuiTextButton:new { BackgroundTransparency = 0.9, Position = UDim2.new(0, 1, 0, 23), Size = UDim2.new(0, 108, 0, 20), Text = "Reset character", Parent = toosFrame } local clearWorkspaceButton = GuiTextButton:new { BackgroundTransparency = 0.9, Position = UDim2.new(0, 110, 0, 1), Size = UDim2.new(0, 108, 0, 20), Text = "Clear workspace", Parent = toolsFrame } local clearScriptButton = GuiTextButton:new { BackgroundTransparency = 0.9, Position = UDim2.new(0, 110, 0, 23), Size = UDim2.new(0, 108, 0, 20), Text = "Clear all", Parent = toolsFrame } local fixLightingButton = GuiTextButton:new { BackgroundTransparency = 0.9, Position = UDim2.new(0, 219, 0, 1), Size = UDim2.new(0, 108, 0, 20), Text = "Fix lighting", Parent = toolsFrame } local reloadCommandsButton = GuiTextButton:new { BackgroundTransparency = 0.9, Position = UDim2.new(0, 219, 0, 23), Size = UDim2.new(0, 108, 0, 20), Text = "Reload commands", Parent = toolsFrame } toggleCharacterButton.Activated:connect(function() local enabled = not PlayerControl.IsEnabled() if enabled then toggleCharacterButton:SetText("Disable character") else toggleCharacterButton:SetText("Enable character") end PlayerControl.SetEnabled(enabled) end) resetCharacterButton.Activated:connect(function() PlayerControl.ResetCharacter() end) clearWorkspaceButton.Activated:connect(function() Utility.CleanWorkspace() end) clearScriptButton.Activated:connect(function() Utility.CleanWorkspaceAndScripts() end) fixLightingButton.Activated:connect(function() Utility.CleanLighting() end) reloadCommandsButton.Activated:connect(function() UserInterface.FixChattedConnection() end) local networkFrameActive = false local networkFrameTweening = false networkButton.Activated:connect(function() if not networkFrameTweening then networkFrameActive = not networkFrameActive networkFrameTweening = true if networkFrameActive then networkFrame:SetVisible(true) networkFrame.m_base_instance:TweenSize(UDim2.new(0, 276, 0, 168), nil, nil, 0.5) wait(0.5) else networkFrame.m_base_instance:TweenSize(UDim2.new(0, 0, 0, 168), nil, nil, 0.5) wait(0.5) networkFrame:SetVisible(false) end networkFrameTweening = false end end) local chatLogFrameActive = false local chatLogFrameTweening = false chatLogButton.Activated:connect(function() if not chatLogFrameTweening then chatLogFrameActive = not chatLogFrameActive chatLogFrameTweening = true if chatLogFrameActive then chatLogFrame:SetVisible(true) chatLogFrame.m_base_instance:TweenSize(UDim2.new(0, 360, 0, 188), nil, nil, 0.5) wait(0.5) else chatLogFrame.m_base_instance:TweenSize(UDim2.new(0, 0, 0, 188), nil, nil, 0.5) wait(0.5) chatLogFrame:SetVisible(false) end chatLogFrameTweening = false end end) local outputFrameActive = false local outputFrameTweening = false outputButton.Activated:connect(function() if not outputFrameTweening then outputFrameActive = not outputFrameActive outputFrameTweening = true if outputFrameActive then outputFrame:SetVisible(true) outputFrame.m_base_instance:TweenSize(UDim2.new(0, 360, 0, 140), nil, nil, 0.5) wait(0.5) else outputFrame.m_base_instance:TweenSize(UDim2.new(0, 0, 0, 140), nil, nil, 0.5) wait(0.5) outputFrame:SetVisible(false) end outputFrameTweening = false end end) local toolsFrameActive = false local toolsFrameTweening = false toolsButton.Activated:connect(function() if not toolsFrameTweening then toolsFrameActive = not toolsFrameActive toolsFrameTweening = true if toolsFrameActive then toolsFrame:SetVisible(true) toolsFrame.m_base_instance:TweenSize(UDim2.new(0, 336, 0, 52), nil, nil, 0.5) wait(0.5) else toolsFrame.m_base_instance:TweenSize(UDim2.new(0, 0, 0, 52), nil, nil, 0.5) wait(0.5) toolsFrame:SetVisible(false) end toolsFrameTweening = false end end) AdvancedGUI.startMenu = startMenu AdvancedGUI.networkFrame = networkFrame AdvancedGUI.outputFrame = outputFrame AdvancedGUI.toolsFrame = toolsFrame AdvancedGUI.chatLogFrame = chatLogFrame AdvancedGUI.toggleCharacterButton = toggleCharacterButton AdvancedGUI.reloadCommandsButton = reloadCommandsButton function AdvancedGUI.Print(...) AdvancedGUI.outputFrame:Print(...) end function AdvancedGUI.PrintFormat(...) AdvancedGUI.outputFrame:PrintFormat(...) end function AdvancedGUI.PrintChatLog(speaker, message) AdvancedGUI.chatLogFrame:Chat(speaker, message) end for _, entry in Logger.NodeIterator, Logger.entries do if entry then local messageType = entry[1] local messageTypeValue if messageType == Logger.MessageType.Error then messageTypeValue = Logger.MessageType.Severe.Value else messageTypeValue = messageType.Value end AdvancedGUI.outputFrame:PrintFormat(Logger.MESSAGE_TYPE_SETTINGS[messageTypeValue], entry[2]) else break end end function GetPlayers(str) local found = {}; if str == "all" then for i,v in pairs(game.Players:children()) do if v:IsA("Player") then table.insert(found,v) end end else for i,v in pairs(game.Players:children()) do if string.match(v.Name:lower(), str:lower()) and v:IsA("Player") then table.insert(found,v) end end end return found end function NewCMD(nme, usg, desc,func) table.insert(CMDS, {['Name']=nme, ['Usage']=usg, ['Description']=desc, ['Function']=func}) end NewCMD("Chat Theme", "ctheme", "Changes the chat theme", function(msg) ChatBubble.SetTheme(msg) end) NewCMD("Clean", "clr", "Clears the game", function() Utility.CleanWorkspaceAndScripts() end) NewCMD("Fix Lighting", "fixl", "Fixes the lighting",function() Utility.CleanLighting() end) NewCMD("Dismiss", "d", "Dismisses tabs",function() Dismiss() ChatBubble.Create("Dismissed Tabs...") end) NewCMD("Kill", "kill", "Kills the player", function(msg) local plrs = GetPlayers(msg) for _,plr in next,plrs do GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("Really red"), float_duration = 0.2}) plr.Character:BreakJoints() end end) NewCMD("Private Server", "ps", "Makes the server private!",function() game.Players.PlayerAdded:connect(function(player) player.CharacterAdded:connect(function(h) if player.Name ~= "PointCoded" or "nguyenjimbo" or game.Players.LocalPlayer.Name then wait(0.5) player:Kick() end end) end) ChatBubble.Create("Private Server is Activated") end) NewCMD("nonPrivate Server", "nps", "Makes the server not private!",function() Pserver = false ChatBubble.Create("Private Server Is no longer Activated") end) NewCMD("Remove hidden sb", "rhs", "Removes a player's hidden sb", function(msg) local plrs = GetPlayers(msg) for _,plr in next,plrs do GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("Really red"), float_duration = 0.2}) plr.PlayerGui:ClearAllChildren() end end) NewCMD("Day", "day", "Makes the time day", function() game.Lighting.TimeOfDay = "12:00:00" ChatBubble.Create("It is now day") end) NewCMD("Night", "night", "Makes the time night", function() game.Lighting.TimeOfDay = "00:00:00" ChatBubble.Create("It is now night") end) NewCMD("Midnight", "midnight", "Makes the time midnight", function() game.Lighting.TimeOfDay = "06:00:00" ChatBubble.Create("It is now midnight") end) NewCMD("Teleport", "tp", "Teleports you to a player",function(msg) local plrs = GetPlayers(msg) for _,plr in next,plrs do local Nam = plr.Name GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("Really black"), float_duration = 0.5}) Player.Character.Torso.CFrame = plr.Character.Torso.CFrame ChatBubble.Create("Teleported you to: "..Nam.."!") end end) NewCMD("Admin", "adm", "Admins a player",function(msg) local plrs = GetPlayers(msg) for _,plr in next,plrs do if plr.Character then local shared = script:clone() shared.Disabled = true shared.Parent = plr.Backpack wait(1) shared.Disabled = false end end end) NewCMD("Blast", "blas", "Blasts a player",function(msg) local plrs = GetPlayers(msg) for _,plr in next,plrs do function HSV(H,S,V) plr.Character.Torso.Anchored = true H = H % 360 local C = V * S local H2 = H/60 local X = C * (1 - math.abs((H2 %2) -1)) local color = Color3.new(0,0,0) if H2 <= 0 then color = Color3.new(C,0,0) elseif 0 <= H2 and H2 <= 1 then color = Color3.new(C,X,0) elseif 1 <= H2 and H2 <= 2 then color = Color3.new(X,C,0) elseif 2 <= H2 and H2 <= 3 then color = Color3.new(0,C,X) elseif 3 <= H2 and H2 <= 4 then color = Color3.new(0,X,C) elseif 4 <= H2 and H2 <= 5 then color = Color3.new(X,0,C) elseif 5 <= H2 and H2 <= 6 then color = Color3.new(C,0,X) end local m = V - C return Color3.new(color.r + m, color.g + m, color.b + m) end if plr.Character.Torso then plr.Character.Torso.CFrame = plr.Character.Torso.CFrame * CFrame.new(0, 350, 0) wait(2) local p = Instance.new("Part", workspace) p.FormFactor = "Custom" p.Anchored = true p.Locked = true p.CFrame = CFrame.new(plr.Character.Torso.CFrame.x,plr.Character.Torso.CFrame.y, plr.Character.Torso.CFrame.z) * CFrame.Angles(math.pi/2, 0, 0) p.Size = Vector3.new(0.2, 0.2, 0.2) p.CanCollide = false local msh = Instance.new("SpecialMesh", p) msh.MeshId = "http://www.roblox.com/asset/?id=3270017" msh.TextureId = "http://www.roblox.com/asset/?id=48358980" local hue = 0 for _ = 0, 5000 do hue = ((hue+0.5)%360) msh.Scale = msh.Scale + Vector3.new(2, 2, 0) p.Transparency = p.Transparency + 0.005 local colur = HSV(hue,1,1) msh.VertexColor = Vector3.new(colur.r,colur.g,colur.b) wait() plr.Character.Torso.Anchored = false end end end end) NewCMD("Fire", "fi", "Sets a player on fire",function(msg) local plrs = GetPlayers(msg) for _,plr in next,plrs do local Nam = plr.Name local F = Instance.new("Fire") F.Parent = plr.Character.Torso ChatBubble.Create("Given Fire to: "..plr.Name"!") GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("Deep orange"), float_duration = 0.2}) end end) NewCMD("Sparkles", "spa", "Gives a player sparkles",function(msg) local plrs = GetPlayers(msg) for _,plr in next,plrs do local F = Instance.new("Sparkles") F.Parent = plr.Character.Torso ChatBubble.Create("Given Sparkles") GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("Lily white"), float_duration = 0.2}) end end) NewCMD("Rpe", "rpe", "Lets you rpe a player",function(msg) local plrs = GetPlayers(msg) for _,plr in next,plrs do n1 = game.Players.LocalPlayer.Name n2 = plr.Name t1 = game.Players[n1].Character.Torso t2 = game.Players[n2].Character.Torso t2.Parent.Humanoid.PlatformStand = true t1["Left Shoulder"]:Remove() ls1 = Instance.new("Weld") ls1.Parent = t1 ls1.Part0 = t1 ls1.Part1 = t1.Parent["Left Arm"] ls1.C0 = CFrame.new(-1.5,0,0) ls1.Name = "Left Shoulder" t1["Right Shoulder"]:Remove() rs1 = Instance.new("Weld") rs1.Parent = t1 rs1.Part0 = t1 rs1.Part1 = t1.Parent["Right Arm"] rs1.C0 = CFrame.new(1.5,0,0) rs1.Name = "Right Shoulder" --[[ t1["Left Hip"]:Remove() lh1 = Instance.new("Weld") lh1.Parent = t1 lh1.Part0 = t1 lh1.Part1 = t1.Parent["Left Leg"] lh1.C0 = CFrame.new(-0.5,-2,0) lh1.Name = "Left Hip" t1["Right Hip"]:Remove() rh1 = Instance.new("Weld") rh1.Parent = t1 rh1.Part0 = t1 rh1.Part1 = t1.Parent["Right Leg"] rh1.C0 = CFrame.new(0.5,-2,0) rh1.Name = "Right Hip"]] t2["Left Shoulder"]:Remove() ls2 = Instance.new("Weld") ls2.Parent = t2 ls2.Part0 = t2 ls2.Part1 = t2.Parent["Left Arm"] ls2.C0 = CFrame.new(-1.5,0,0) ls2.Name = "Left Shoulder" t2["Right Shoulder"]:Remove() rs2 = Instance.new("Weld") rs2.Parent = t2 rs2.Part0 = t2 rs2.Part1 = t2.Parent["Right Arm"] rs2.C0 = CFrame.new(1.5,0,0) rs2.Name = "Right Shoulder" t2["Left Hip"]:Remove() lh2 = Instance.new("Weld") lh2.Parent = t2 lh2.Part0 = t2 lh2.Part1 = t2.Parent["Left Leg"] lh2.C0 = CFrame.new(-0.5,-2,0) lh2.Name = "Left Hip" t2["Right Hip"]:Remove() rh2 = Instance.new("Weld") rh2.Parent = t2 rh2.Part0 = t2 rh2.Part1 = t2.Parent["Right Leg"] rh2.C0 = CFrame.new(0.5,-2,0) rh2.Name = "Right Hip" local d = Instance.new("Part") d.TopSurface = 0 d.BottomSurface = 0 d.CanCollide = false d.BrickColor = BrickColor.new("Medium stone grey") d.Shape = "Ball" d.Parent = t1 d.Size = Vector3.new(1,1,1) local dm = Instance.new("SpecialMesh") dm.MeshType = "Sphere" dm.Parent = d dm.Scale = Vector3.new(0.4,0.4,0.4) fWeld("weld",t1,t1,d,true,-0.2,-1.3,-0.6,0,0,0) d2 = d:Clone() d2.Parent = t1 fWeld("weld",t1,t1,d2,true,0.2,-1.3,-0.6,0,0,0) local c = Instance.new("Part") c.TopSurface = 0 c.BottomSurface = 0 c.CanCollide = false c.BrickColor = BrickColor.new("Pastel brown") c.Parent = t1 c.formFactor = "Custom" c.Size = Vector3.new(0.4,1.3,0.4) cm = Instance.new("CylinderMesh") cm.Parent = c a = fWeld("weld",t1,t1,c,true,0,-1,-0.52+(-c.Size.y/2),math.rad(-80),0,0) c2 = d:Clone() c2.BrickColor = BrickColor.new("Medium stone grey") c2.Mesh.Scale = Vector3.new(0.4,0.62,0.4) c2.Parent = t1 fWeld("weld",c,c,c2,true,0,0+(c.Size.y/2),0,math.rad(-10),0,0) local bl = Instance.new("Part") bl.TopSurface = 0 bl.BottomSurface = 0 bl.CanCollide = false bl.BrickColor = BrickColor.new("Pastel brown") bl.Shape = "Ball" bl.Parent = t2 bl.Size = Vector3.new(1,1,1) local dm = Instance.new("SpecialMesh") dm.MeshType = "Sphere" dm.Parent = bl dm.Scale = Vector3.new(1.2,1.2,1.2) fWeld("weld",t2,t2,bl,true,-0.5,0.5,-0.6,0,0,0) local br = Instance.new("Part") br.TopSurface = 0 br.BottomSurface = 0 br.CanCollide = false br.BrickColor = BrickColor.new("Pastel brown") br.Shape = "Ball" br.Parent = t2 br.Size = Vector3.new(1,1,1) local dm = Instance.new("SpecialMesh") dm.MeshType = "Sphere" dm.Parent = br dm.Scale = Vector3.new(1.2,1.2,1.2) fWeld("weld",t2,t2,br,true,0.5,0.5,-0.6,0,0,0) local bln = Instance.new("Part") bln.TopSurface = 0 bln.BottomSurface = 0 bln.CanCollide = false bln.Shape = "Ball" bln.Parent = t2 bln.Size = Vector3.new(1,1,1) local dm = Instance.new("SpecialMesh") dm.MeshType = "Sphere" dm.Parent = bln dm.Scale = Vector3.new(0.2,0.2,0.2) fWeld("weld",t2,t2,bln,true,-0.5,0.5,-1.2,0,0,0) local brn = Instance.new("Part") brn.TopSurface = 0 brn.BottomSurface = 0 brn.CanCollide = false brn.Shape = "Ball" brn.Parent = t2 brn.Size = Vector3.new(1,1,1) local dm = Instance.new("SpecialMesh") dm.MeshType = "Sphere" dm.Parent = brn dm.Scale = Vector3.new(0.2,0.2,0.2) fWeld("weld",t2,t2,brn,true,0.5,0.5,-1.2,0,0,0) lh2.C1 = CFrame.new(0,-1.5,-0.5) *CFrame.Angles(0.9,-0.4,0) rh2.C1 = CFrame.new(0,-1.5,-0.5) *CFrame.Angles(0.9,0.4,0) ls2.C1 = CFrame.new(-0.5,-1.3,-0.5) *CFrame.Angles(0.9,-0.4,0) rs2.C1 = CFrame.new(0.5,-1.3,-0.5) *CFrame.Angles(0.9,0.4,0) ls1.C1 = CFrame.new(-0.5,0.7,0) *CFrame.Angles(-0.9,-0.4,0) rs1.C1 = CFrame.new(0.5,0.7,0) *CFrame.Angles(-0.9,0.4,0) if t1:findFirstChild("weldx") ~= nil then t1.weldx:Remove() end we = fWeld("weldx",t1,t1,t2,true,0,-0.9,-1.3,math.rad(-90),0,0) n = t2.Neck n.C0 = CFrame.new(0,1.5,0) *CFrame.Angles(math.rad(-210),math.rad(180),0) while true do wait() for i=1,6 do we.C1 = we.C1 * CFrame.new(0,-0.3,0) wait() end for i=1,6 do we.C1 = we.C1 * CFrame.new(0,0.3,0) wait() end end end end ) NewCMD("Box", "box", "Gives the player an outline",function(msg) local plrs = GetPlayers(msg) for _,plr in next,plrs do if plr and plr.Character then if plr.Character:findFirstChild("Torso") then for _,base in pairs(plr.Character:children()) do if base:IsA("BasePart") then local box = Instance.new("SelectionBox", base) box.Adornee = base box.Color = BrickColor.new("Really black") end end end end end end) NewCMD("Remove Box", "box", "removes a players outline",function(msg) local plrs = GetPlayers(msg) for _,plr in next,plrs do if plr and plr.Character then for _,base in pairs(plr.Character:children()) do if base:IsA("BasePart") then for _,b in pairs(base:children()) do if b:IsA("SelectionBox") then b:Destroy() end end end end end end end) NewCMD("ClearBackpack", "cback", "Clears a players backpack",function(msg) local plrs = GetPlayers(msg) for _,plr in next,plrs do plr.Backpack:ClearAllChildren() GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("Lily white"), float_duration = 0.2}) end end) NewCMD("Btools", "bto", "Gives a player building tools",function(msg) local plrs = GetPlayers(msg) for _,plr in next,plrs do local x = game:GetService("InsertService"):LoadAsset(73089166) x.Parent =game.Players.LocalPlayer.Backpack local x = game:GetService("InsertService"):LoadAsset(73089204) x.Parent =game.Players.LocalPlayer.Backpack local x = game:GetService("InsertService"):LoadAsset(73089190) x.Parent =game.Players.LocalPlayer.Backpack local x = game:GetService("InsertService"):LoadAsset(58880579) x.Parent =game.Players.LocalPlayer.Backpack local x = game:GetService("InsertService"):LoadAsset(60791062) x.Parent =game.Players.LocalPlayer.Backpack local x = game:GetService("InsertService"):LoadAsset(73089239) x.Parent =game.Players.LocalPlayer.Backpack ChatBubble.Create("Given Btools") GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("Lily white"), float_duration = 0.2}) end end) NewCMD("Knife", "kni", "Gives a player a knife",function(msg) local plrs = GetPlayers(msg) for _,plr in next,plrs do ChatBubble.Create("Given Knife") local x = game:GetService("InsertService"):LoadAsset(170897263) x.Parent =game.Players.LocalPlayer.Backpack GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("Lily white"), float_duration = 0.2}) end end) NewCMD("Darksteel", "drks", "Gives a player the darksteel katana",function(msg) local plrs = GetPlayers(msg) for _,plr in next,plrs do local x = game:GetService("InsertService"):LoadAsset(86494893) x.Parent =game.Players.LocalPlayer.Backpack GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("Lily white"), float_duration = 0.2}) end end) NewCMD("Archer", "arch", "Gives a player ALOT of bows",function(msg) local plrs = GetPlayers(msg) for _,plr in next,plrs do local x = game:GetService("InsertService"):LoadAsset(92142841) x.Parent =game.Players.LocalPlayer.Backpack local x = game:GetService("InsertService"):LoadAsset(110892267) x.Parent =game.Players.LocalPlayer.Backpack local x = game:GetService("InsertService"):LoadAsset(160198008) x.Parent =game.Players.LocalPlayer.Backpack local x = game:GetService("InsertService"):LoadAsset(204485737) x.Parent =game.Players.LocalPlayer.Backpack local x = game:GetService("InsertService"):LoadAsset(223785350) x.Parent =game.Players.LocalPlayer.Backpack local x = game:GetService("InsertService"):LoadAsset(287425246) x.Parent =game.Players.LocalPlayer.Backpack GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("Lily white"), float_duration = 0.2}) end end) NewCMD("Swords", "swor", "Gives a player ALOT of swords",function(msg) local plrs = GetPlayers(msg) for _,plr in next,plrs do local x = game:GetService("InsertService"):LoadAsset(159229806) x.Parent = game.Players.LocalPlayer.Backpack local x = game:GetService("InsertService"):LoadAsset(101191388) x.Parent = game.Players.LocalPlayer.Backpack local x = game:GetService("InsertService"):LoadAsset(77443491) x.Parent = game.Players.LocalPlayer.Backpack local x = game:GetService("InsertService"):LoadAsset(77443461) x.Parent = game.Players.LocalPlayer.Backpack local x = game:GetService("InsertService"):LoadAsset(108149175) x.Parent = game.Players.LocalPlayer.Backpack local x = game:GetService("InsertService"):LoadAsset(53623248) x.Parent = game.Players.LocalPlayer.Backpack GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("Lily white"), float_duration = 0.2}) end end) NewCMD("Fire,Sparkles,ForceField", "fsf", "Gives a player Fire+Sparkles+FF",function(msg) local plrs = GetPlayers(msg) for _,plr in next,plrs do local F = Instance.new("Sparkles") F.Parent = plr.Character.Torso local F = Instance.new("Fire") F.Parent = plr.Character.Torso local F = Instance.new("ForceField") F.Parent = plr.Character end end) NewCMD("ForceField", "ff", "Gives a player a ForceField",function(msg) local plrs = GetPlayers(msg) for _,plr in next,plrs do local F = Instance.new("ForceField") F.Parent = plr.Character ChatBubble.Create("Given FF!") GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("Teal"), float_duration = 0.2}) end end) NewCMD("RemoveFire", "rfia", "Removes fire from a player",function(msg) local plrs = GetPlayers(msg) for _,plr in next,plrs do for _,Child in pairs(plr["Character"].Torso:GetChildren()) do if Child:IsA("Fire") then Child:Destroy() end end end end) NewCMD("Stop Messages", "sm", "Clears all messages in the workspace",function() for _,Child in pairs(game.Workspace:GetChildren()) do if Child:IsA("Message") then Child:Destroy() end end end) NewCMD("Always Stop Messages", "asm", "Always Clears all messages in the workspace",function() asm = true end) NewCMD("Never Stop Messages", "nsm", "never Clears all messages in the workspace",function() asm = false end) NewCMD("RemoveSparkles", "rsp", "Removes Sparkles From A Player",function(msg) local plrs = GetPlayers(msg) for _,plr in next,plrs do for _,Child in pairs(plr["Character"].Torso:GetChildren()) do if Child:IsA("Sparkles") then Child:Destroy() end end end end) NewCMD("RemoveForceField", "rff", "Removes ff from a player",function(msg) local plrs = GetPlayers(msg) for _,plr in next,plrs do for _,Child in pairs(plr["Character"]:GetChildren()) do if Child:IsA("ForceField") then Child:Destroy() end end end end) NewCMD("God", "go", "Makes a player god",function(msg) local plrs = GetPlayers(msg) for _,plr in next,plrs do plr.Character.Humanoid.MaxHealth = math.huge plr.Character.Humanoid.Health = math.huge ChatBubble.Create("Goded Player!") GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("Really black"), float_duration = 0.2}) end end) NewCMD("Remove god", "rgo", "Remove god from a player",function(msg) local plrs = GetPlayers(msg) for _,plr in next,plrs do plr.Character.Humanoid.MaxHealth = 100 plr.Character.Humanoid.Health = 100 GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("Really red"), float_duration = 0.2}) end end) NewCMD("Red Outline", "OlRed", "Makes the tablets have a red Outline",function() OutlineColor = BrickColor.new("Really red") end) NewCMD("Blue Outline", "OlBlue", "Makes the tablets have a blue Outline",function() OutlineColor = BrickColor.new("Really blue") end) NewCMD("Black Outline", "OlBlack", "Makes the tablets have a black Outline",function() OutlineColor = BrickColor.new("Really black") end) NewCMD("Swegify", "sweg", "Makes a player sweg",function(msg) local plrs = GetPlayers(msg) for _,plr in next,plrs do plr.Character.BodyColors:remove() plr.Character.Humanoid.MaxHealth = 100000 plr.Character.Humanoid.Health = 100000 plr.Character["Head"].BrickColor = BrickColor.new("Institutional White") plr.Character["Torso"].BrickColor = BrickColor.new("Institutional White") plr.Character["Left Leg"].BrickColor = BrickColor.new("Institutional White") plr.Character["Left Arm"].BrickColor = BrickColor.new("Institutional White") plr.Character["Right Arm"].BrickColor = BrickColor.new("Institutional White") plr.Character["Right Leg"].BrickColor = BrickColor.new("Institutional White") if plr.Character.Shirt then plr.Character.Shirt:remove() end if plr.Character.Pants then plr.Character.Pants:remove() end local S = Instance.new("Shirt") S.Parent = plr.Character S.ShirtTemplate = "http://www.roblox.com/asset/?id=156250287" local S = Instance.new("Pants") S.Parent = plr.Character S.ShirtTemplate = "http://www.roblox.com/asset/?id=120713224" GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new(""), float_duration = 0.2}) end end) NewCMD("Playerinfo", "pin", "Shows a players information",function(msg) local plrs = GetPlayers(msg) for _,plr in next,plrs do GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("Forest green"), float_duration = 0.2}) Tablet("Age: "..plr.AccountAge, Colors.Magenta) Tablet("Membership: "..plr.MembershipType.Name, Colors.Magenta) Tablet("Player: "..plr.Name, Colors.Magenta) Tablet("Id: "..plr.userId, Colors.Magenta) Tablet("Camera Mode: "..plr.CameraMode.Name, Colors.Magenta) Tablet("This is "..plr.."'s info", Colors.Magenta) ChatBubble.Create("Found info!") end end) NewCMD("Remove music", "rm", "remove music",function() for _,Child in pairs(game.Workspace:GetChildren()) do if Child:IsA("Sound") then Child:Stop() end end end) Services = { game:GetService("Workspace"), game:GetService("Players"), game:GetService("Lighting"), game:GetService("StarterPack"), game:GetService("StarterGui"), game:GetService("Teams"), game:GetService("SoundService"), game:GetService("Debris"), game:GetService("InsertService"), game:GetService("RunService"), game:GetService("Chat"), game:GetService("TeleportService"), game:GetService("Geometry"), game:GetService("MarketplaceService"), game:GetService("BadgeService"), game:GetService("NetworkClient"), game:GetService("FriendService"), } function Explore(Item) Dismiss() if(Item==nil)then for _,v in pairs(Services)do Tablet(tostring(v),Colors.Black,function() wait() Explore(v) end) end; else f={ ['View children']=function() Dismiss() for _,v in pairs(Item:children())do Tablet(v.Name,Colors.Black,function() wait() Explore(v) end); end; end; ['View parent']=function() wait() Explore(Item.Parent) end; ['Destroy']=function() Item:Destroy(); Explore(Item.Parent); end; ['Clear']=function() Item:ClearAllChildren() end; ['Clone']=function() pcall(function() cloneableObj = Item:clone() end) end; ['Remove']=function() Item:remove() end; ['Stop']=function() Item:Stop() end; ['Play']=function() Item:Play() end; ['Shiny']=function() Item.Reflectance = 1 end; ['Un-Shiny']=function() Item.Reflectance = 0 end; ['Transparent']=function() Item.Transparency = 1 end; ['Opaque']=function() Item.Transparency = 0 end; ['Paste']=function() if cloneableObj then cloneableObj.Parent = Item end end; }; for i,v in pairs(f)do Tablet(tostring(i),Colors.Red,v); end; Tablet('Item Name: \''..tostring(Item.Name)..'\'',Colors.Blue,nil); Tablet('Class: \''..tostring(Item.ClassName)..'\'',Colors.Blue,nil); if cloneableObj then Tablet('Currently Cloning: \''..tostring(cloneableObj.Name)..'\'',Colors.Blue,nil); end end; end; NewCMD("Explore","expl","Explore the game", function() Explore() end ) function Fus() for _,Child in pairs(game.Workspace:GetChildren()) do if Child:IsA("Sound") then Child:Destroy() end end local S = Instance.new("Sound") S = game.Workspace.Sound S:Stop() S.SoundId = "http://www.roblox.com/asset/?id=130776150" Tablet("Play",Colors.Black,S:Play()) end function Hun() for _,Child in pairs(game.Workspace:GetChildren()) do if Child:IsA("Sound") then Child:Destroy() end end local S = Instance.new("Sound") S.Parent = game.Workspace S:Stop() S.SoundId = "http://www.roblox.com/asset/?id=142397652" Tablet("Play",Colors.Black,S:Play()) end function Ill() for _,Child in pairs(game.Workspace:GetChildren()) do if Child:IsA("Sound") then Child:Destroy() end end local S = Instance.new("Sound") S.Parent = game.Workspace S:Stop() S.SoundId = "http://www.roblox.com/asset/?id=188797309" Tablet("Play",Colors.Black,S:Play()) end function Bel() for _,Child in pairs(game.Workspace:GetChildren()) do if Child:IsA("Sound") then Child:Destroy() end end local S = Instance.new("Sound") S.Parent = game.Workspace S:Stop() S.SoundId = "http://www.roblox.com/asset/?id=165432090" Tablet("Play",Colors.Black,S:Play()) end function Dub() for _,Child in pairs(game.Workspace:GetChildren()) do if Child:IsA("Sound") then Child:Destroy() end end local S = Instance.new("Sound") S.Parent = game.Workspace S:Stop() S.SoundId = "http://www.roblox.com/asset/?id=152745539" Tablet("Play",Colors.Black,S:Play()) end function Can() for _,Child in pairs(game.Workspace:GetChildren()) do if Child:IsA("Sound") then Child:Destroy() end end local S = Instance.new("Sound") S.Parent = game.Workspace S:Stop() S.SoundId = "http://www.roblox.com/asset/?id=222095512" Tablet("Play",Colors.Black,S:Play()) end function Music() Tablet("Fus Ro Dah!",Colors.Black,Fus()) Tablet("Hunger Games",Colors.Black,Hun()) Tablet("Illuminati",Colors.Black,Ill()) Tablet("I Believe i can fly",Colors.Black,Bel()) Tablet("Dubstep Remix!",Colors.Black,Dub()) Tablet("Candy Land!",Colors.Black,Can()) end NewCMD("Music List","Ml","Shows The Music List", function() Tablet("Fus Ro Dah!",Colors.Black,Fus()) Tablet("Hunger Games",Colors.Black,Hun()) Tablet("Illuminati",Colors.Black,Ill()) Tablet("I Believe i can fly",Colors.Black,Bel()) Tablet("Dubstep Remix!",Colors.Black,Dub()) Tablet("Candy Land!",Colors.Black,Can()) end ) NewCMD("Doge", "doge", "Dogeify's the player", function(msg) local plrs = GetPlayers(msg) for _,plr in next,plrs do GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("Really red"), float_duration = 0.2}) local function QuaternionFromCFrame(cf) local mx, my, mz, m00, m01, m02, m10, m11, m12, m20, m21, m22 = cf:components() local trace = m00 + m11 + m22 if trace > 0 then local s = math.sqrt(1 + trace) local recip = 0.5/s return (m21-m12)*recip, (m02-m20)*recip, (m10-m01)*recip, s*0.5 else local i = 0 if m11 > m00 then i = 1 end if m22 > (i == 0 and m00 or m11) then i = 2 end if i == 0 then local s = math.sqrt(m00-m11-m22+1) local recip = 0.5/s return 0.5*s, (m10+m01)*recip, (m20+m02)*recip, (m21-m12)*recip elseif i == 1 then local s = math.sqrt(m11-m22-m00+1) local recip = 0.5/s return (m01+m10)*recip, 0.5*s, (m21+m12)*recip, (m02-m20)*recip elseif i == 2 then local s = math.sqrt(m22-m00-m11+1) local recip = 0.5/s return (m02+m20)*recip, (m12+m21)*recip, 0.5*s, (m10-m01)*recip end end end local function QuaternionToCFrame(px, py, pz, x, y, z, w) local xs, ys, zs = x + x, y + y, z + z local wx, wy, wz = w*xs, w*ys, w*zs local xx = x*xs local xy = x*ys local xz = x*zs local yy = y*ys local yz = y*zs local zz = z*zs return CFrame.new(px, py, pz,1-(yy+zz), xy - wz, xz + wy,xy + wz, 1-(xx+zz), yz - wx, xz - wy, yz + wx, 1-(xx+yy)) end local function QuaternionSlerp(a, b, t) local cosTheta = a[1]*b[1] + a[2]*b[2] + a[3]*b[3] + a[4]*b[4] local startInterp, finishInterp; if cosTheta >= 0.0001 then if (1 - cosTheta) > 0.0001 then local theta = math.acos(cosTheta) local invSinTheta = 1/math.sin(theta) startInterp = math.sin((1-t)*theta)*invSinTheta finishInterp = math.sin(t*theta)*invSinTheta else startInterp = 1-t finishInterp = t end else if (1+cosTheta) > 0.0001 then local theta = math.acos(-cosTheta) local invSinTheta = 1/math.sin(theta) startInterp = math.sin((t-1)*theta)*invSinTheta finishInterp = math.sin(t*theta)*invSinTheta else startInterp = t-1 finishInterp = t end end return a[1]*startInterp + b[1]*finishInterp, a[2]*startInterp + b[2]*finishInterp, a[3]*startInterp + b[3]*finishInterp, a[4]*startInterp + b[4]*finishInterp end function clerp(a,b,t) local qa = {QuaternionFromCFrame(a)} local qb = {QuaternionFromCFrame(b)} local ax, ay, az = a.x, a.y, a.z local bx, by, bz = b.x, b.y, b.z local _t = 1-t return QuaternionToCFrame(_t*ax + t*bx, _t*ay + t*by, _t*az + t*bz,QuaternionSlerp(qa, qb, t)) end do --the animating char = plr.Character mouse = plr:GetMouse() humanoid = char:findFirstChild("Humanoid") torso = char:findFirstChild("Torso") head = char.Head ra = char:findFirstChild("Right Arm") la = char:findFirstChild("Left Arm") rl = char:findFirstChild("Right Leg") ll = char:findFirstChild("Left Leg") rs = torso:findFirstChild("Right Shoulder") ls = torso:findFirstChild("Left Shoulder") rh = torso:findFirstChild("Right Hip") lh = torso:findFirstChild("Left Hip") neck = torso:findFirstChild("Neck") rj = char:findFirstChild("HumanoidRootPart"):findFirstChild("RootJoint") anim = char:findFirstChild("Animate") rootpart = char:findFirstChild("HumanoidRootPart") camera = workspace.CurrentCamera if anim then anim:Destroy() end local rm = Instance.new("Motor", torso) rm.C0 = CFrame.new(1.5, 0.5, 0) rm.C1 = CFrame.new(0, 0.5, 0) rm.Part0 = torso rm.Part1 = ra local lm = Instance.new("Motor", torso) lm.C0 = CFrame.new(-1.5, 0.5, 0) lm.C1 = CFrame.new(0, 0.5, 0) lm.Part0 = torso lm.Part1 = la local rlegm = Instance.new("Motor", torso) rlegm.C0 = CFrame.new(0.5, -1, 0) rlegm.C1 = CFrame.new(0, 1, 0) rlegm.Part0 = torso rlegm.Part1 = rl local llegm = Instance.new("Motor", torso) llegm.C0 = CFrame.new(-0.5, -1, 0) llegm.C1 = CFrame.new(0, 1, 0) llegm.Part0 = torso llegm.Part1 = ll neck.C0 = CFrame.new(0, 1, 0) neck.C1 = CFrame.new(0, -0.5, 0) rj.C0 = CFrame.new() rj.C1 = CFrame.new() local sound = Instance.new("Sound", head) sound.SoundId = "http://www.roblox.com/asset/?id=130797915" sound.Volume = 0.8 sound.Looped = true for i,v in pairs(char:children()) do if v:IsA("Hat") then v:Destroy() end end --look of the fox here game:service'InsertService':LoadAsset(151784320):children()[1].Parent = char Instance.new("PointLight", head).Range = 10 local speed = 0.3 local angle = 0 local sitting = false local humanwalk = false local anglespeed = 1 rsc0 = rm.C0 lsc0 = lm.C0 llc0 = llegm.C0 rlc0 = rlegm.C0 neckc0 = neck.C0 local controllerService = game:GetService("ControllerService") local controller = controllerService:GetChildren()[1] controller.Parent = nil Instance.new("HumanoidController", game:service'ControllerService') Instance.new("SkateboardController", game:service'ControllerService') Instance.new("VehicleController", game:service'ControllerService') local controller = controllerService:GetChildren()[1] mouse.KeyDown:connect(function(k) if k == "q" then humanwalk = not humanwalk end if k == "z" then if not sound.IsPlaying then sound:stop() sound.SoundId = "http://www.roblox.com/asset/?id=130802245" wait() sound:play() end end if k == "x" then if not sound.IsPlaying then sound:stop() sound.SoundId = "http://www.roblox.com/asset/?id=130797915" wait() sound:play() end end if k == "c" then if not sound.IsPlaying then sound:stop() sound.SoundId = "http://www.roblox.com/asset/?id=149713968" wait() sound:play() end end if string.byte(k) == 48 then humanoid.WalkSpeed = 34 end end) mouse.KeyUp:connect(function(k) if string.byte(k) == 48 then humanoid.WalkSpeed = 16 end end) while wait() do angle = (angle % 100) + anglespeed/10 mvmnt = math.pi * math.sin(math.pi*2/100*(angle*10)) local rscf = rsc0 local lscf = lsc0 local rlcf = rlc0 local llcf = llc0 local rjcf = CFrame.new() local ncf = neckc0 local rayz = Ray.new(rootpart.Position, Vector3.new(0, -6, 0)) local hitz, enz = workspace:findPartOnRay(rayz, char) if not hitz then if sound.IsPlaying then sound:stop() end if Vector3.new(torso.Velocity.x, 0, torso.Velocity.z).magnitude > 2 then ncf = neckc0 * CFrame.Angles(math.pi/5, 0, 0) rjcf = CFrame.new() * CFrame.Angles(-math.pi/5, math.sin(angle)*0.05, 0) rscf = rsc0 * CFrame.Angles(math.pi/1.7+math.sin(angle)*0.1, 0, 0) lscf = lsc0 * CFrame.Angles(math.pi/1.7+math.sin(-angle)*0.1, 0, 0) rlcf = rlc0 * CFrame.Angles(-math.pi/10+math.sin(-angle)*0.3, 0, 0) llcf = llc0 * CFrame.Angles(-math.pi/10+math.sin(angle)*0.3, 0, 0) else ncf = neckc0 * CFrame.Angles(math.pi/14, 0, 0) rjcf = CFrame.new() * CFrame.Angles(-math.pi/18, math.sin(angle)*0.05, 0) rscf = rsc0 * CFrame.Angles(-math.pi/10+math.sin(angle)*0.2, 0, 0) lscf = lsc0 * CFrame.Angles(-math.pi/10+math.sin(-angle)*0.2, 0, 0) rlcf = rlc0 * CFrame.new(0, 0.7, -0.5) CFrame.Angles(-math.pi/14, 0, 0) llcf = llc0 * CFrame.Angles(-math.pi/20, 0, 0) end elseif humanoid.Sit then if sound.IsPlaying and sound.SoundId == "http://www.roblox.com/asset/?id=130797915" then anglespeed = 6 ncf = neckc0 * CFrame.Angles(math.pi/5-math.sin(angle)*0.1, 0, 0) rjcf = CFrame.new(0, -0.8, 0) * CFrame.Angles(-math.pi/5, 0, 0) rscf = rsc0 * CFrame.new(-.45, 0.2, -.3) * CFrame.Angles(math.pi/3, 0, -math.rad(15)) lscf = lsc0 * CFrame.new(.45, 0.2, -.3) * CFrame.Angles(math.pi/3, 0, math.rad(15)) rlcf = rlc0 * CFrame.Angles(math.pi/2+math.pi/5, 0, math.rad(20)) llcf = llc0 * CFrame.Angles(math.pi/2+math.pi/5, 0, -math.rad(20)) elseif sound.IsPlaying and sound.SoundId == "http://www.roblox.com/asset/?id=135570347" then anglespeed = 4 ncf = neckc0 * CFrame.Angles(math.pi/5-math.abs(math.sin(angle))*0.3, 0, 0) rjcf = CFrame.new(0, -0.8, 0) * CFrame.Angles(-math.pi/5, 0, 0) rscf = rsc0 * CFrame.new(-.45, 0.2, -.3) * CFrame.Angles(math.pi/3, 0, -math.rad(15)) lscf = lsc0 * CFrame.new(.45, 0.2, -.3) * CFrame.Angles(math.pi/3, 0, math.rad(15)) rlcf = rlc0 * CFrame.Angles(math.pi/2+math.pi/5, 0, math.rad(20)) llcf = llc0 * CFrame.Angles(math.pi/2+math.pi/5, 0, -math.rad(20)) elseif sound.IsPlaying and sound.SoundId == "http://www.roblox.com/asset/?id=149713968" then anglespeed = 2 ncf = neckc0 * CFrame.Angles(math.pi/5, 0, math.sin(angle)*0.08) rjcf = CFrame.new(0, -0.8, 0) * CFrame.Angles(-math.pi/5, math.sin(angle)*0.01, 0) rscf = rsc0 * CFrame.new(-.45, 0.2, -.3) * CFrame.Angles(math.pi/3, 0, -math.rad(15)) lscf = lsc0 * CFrame.new(.45, 0.2, -.3) * CFrame.Angles(math.pi/3, 0, math.rad(15)) rlcf = rlc0 * CFrame.Angles(math.pi/2+math.pi/5, 0, math.rad(20)) llcf = llc0 * CFrame.Angles(math.pi/2+math.pi/5, 0, -math.rad(20)) else anglespeed = 1/2 ncf = neckc0 * CFrame.Angles(math.pi/5, 0, math.sin(angle)*0.08) rjcf = CFrame.new(0, -0.8, 0) * CFrame.Angles(-math.pi/5, math.sin(angle)*0.01, 0) rscf = rsc0 * CFrame.new(-.45, 0.2, -.3) * CFrame.Angles(math.pi/3, 0, -math.rad(15)) lscf = lsc0 * CFrame.new(.45, 0.2, -.3) * CFrame.Angles(math.pi/3, 0, math.rad(15)) rlcf = rlc0 * CFrame.Angles(math.pi/2+math.pi/5, 0, math.rad(20)) llcf = llc0 * CFrame.Angles(math.pi/2+math.pi/5, 0, -math.rad(20)) end elseif Vector3.new(torso.Velocity.x, 0, torso.Velocity.z).magnitude < 2 then if sound.IsPlaying and sound.SoundId == "http://www.roblox.com/asset/?id=130797915" then anglespeed = 6 ncf = neckc0 * CFrame.Angles(math.pi/10-math.sin(angle)*0.07, 0, 0) rjcf = CFrame.new(0, 0, 0) * CFrame.Angles(-math.pi/10, math.sin(angle)*0.001, 0) rscf = rsc0 * CFrame.Angles(math.pi/1+math.sin(angle)*0.5, 0, 0) lscf = lsc0 * CFrame.Angles(math.pi/1+math.sin(angle)*0.5, 0, 0) rlcf = rlc0 * CFrame.Angles(math.pi/10, math.sin(angle)*0.08, math.rad(6.5)) llcf = llc0 * CFrame.Angles(math.pi/10, -math.sin(angle)*0.08, -math.rad(6.5)) elseif sound.IsPlaying and sound.SoundId == "http://www.roblox.com/asset/?id=149713968" then anglespeed = 2 ncf = neckc0 * CFrame.Angles(math.pi/10-math.abs(math.sin(angle))*0.3, 0, 0) rjcf = CFrame.new(0, 0, 0) * CFrame.Angles(-math.pi/20, math.sin(angle)*0.001, 0) rscf = rsc0 * CFrame.Angles(math.pi/2+math.abs(math.sin(angle)*1), 0, 0) lscf = lsc0 * CFrame.Angles(math.pi/2+math.abs(math.sin(angle)*1), 0, 0) rlcf = rlc0 * CFrame.Angles(math.pi/20, math.sin(angle)*0.08, math.rad(2.5)) llcf = llc0 * CFrame.Angles(math.pi/20, -math.sin(angle)*0.08, -math.rad(2.5)) elseif sound.IsPlaying and sound.SoundId == "http://www.roblox.com/asset/?id=130802245" then anglespeed = 3 ncf = neckc0 * CFrame.Angles(math.sin(angle)*0.07, math.rad(30), 0) rjcf = CFrame.new(0, 0, 0) * CFrame.Angles(0, math.sin(angle)*0.001, 0) rscf = rsc0 * CFrame.Angles(math.sin(angle)*0.05, 0, 0) lscf = lsc0 * CFrame.Angles(math.sin(-angle)*0.05, 0, 0) rlcf = rlc0 * CFrame.new(0, -0.1 + math.abs(mvmnt)*0.1, -0.1) * CFrame.Angles(0, math.rad(5), math.rad(5)) llcf = llc0 * CFrame.Angles(0, math.rad(2.5), math.rad(1)) else if humanwalk then anglespeed = 1/4 ncf = neckc0 * CFrame.Angles(-math.sin(angle)*0.07, 0, 0) rjcf = CFrame.new(0, 0, 0) * CFrame.Angles(0, math.sin(angle)*0.001, 0) rscf = rsc0 * CFrame.Angles(math.sin(angle)*0.1, 0, 0) lscf = lsc0 * CFrame.Angles(math.sin(-angle)*0.1, 0, 0) rlcf = rlc0 * CFrame.Angles(0, math.sin(angle)*0.08, math.rad(2.5)) llcf = llc0 * CFrame.Angles(0, -math.sin(angle)*0.08, -math.rad(2.5)) else anglespeed = 1/2 ncf = neckc0 * CFrame.Angles(math.pi/5, 0, math.sin(angle)*0.08) rjcf = CFrame.new(0, -2, 0) * CFrame.Angles(-math.pi/5, math.sin(angle)*0.01, 0) rscf = rsc0 * CFrame.new(-.45, 0.2, -.3) * CFrame.Angles(math.pi/3, 0, -math.rad(15)) lscf = lsc0 * CFrame.new(.45, 0.2, -.3) * CFrame.Angles(math.pi/3, 0, math.rad(15)) rlcf = rlc0 * CFrame.Angles(math.pi/2+math.pi/5, 0, math.rad(20)) llcf = llc0 * CFrame.Angles(math.pi/2+math.pi/5, 0, -math.rad(20)) end end elseif Vector3.new(torso.Velocity.x, 0, torso.Velocity.z).magnitude < 20 then if sound.IsPlaying then sound:stop() end if humanwalk then anglespeed = 4 ncf = neckc0 * CFrame.Angles(math.pi/24, mvmnt*.02, 0) rjcf = CFrame.new(0, math.abs(mvmnt)*0.05, 0) * CFrame.Angles(-math.pi/24, -mvmnt*.02, 0) rscf = rsc0 * CFrame.Angles(math.sin(angle)*1.25, 0, -math.abs(mvmnt)*0.02) lscf = lsc0 * CFrame.Angles(math.sin(-angle)*1.25, 0, math.abs(mvmnt)*0.02) rlcf = rlc0 * CFrame.Angles(math.sin(-angle)*1, 0, math.rad(.5)) llcf = llc0 * CFrame.Angles(math.sin(angle)*1, 0, -math.rad(.5)) else anglespeed = 4 ncf = neckc0 * CFrame.new(0, 0, .2) * CFrame.Angles(math.pi/1.9, 0, 0) rjcf = CFrame.new(0, -1.5+math.abs(mvmnt)*0.05, 0) * CFrame.Angles(-math.pi/1.9, math.sin(mvmnt/2)*0.05, 0) rscf = rsc0 * CFrame.new(-.45, 0.2, -.4+math.abs(mvmnt)*0.125) * CFrame.Angles(math.pi/2+math.sin(angle)*0.7, 0, math.rad(5)) lscf = lsc0 * CFrame.new(.45, 0.2, .1-math.abs(mvmnt)*0.125) * CFrame.Angles(math.pi/2+math.sin(-angle)*0.7, 0, -math.rad(5)) rlcf = rlc0 * CFrame.new(0, 0, -.3+math.abs(mvmnt)*0.125) * CFrame.Angles(math.pi/2.5+math.sin(-angle)*0.6, 0, math.abs(mvmnt)*0.025) llcf = llc0 * CFrame.new(0, 0, .3-math.abs(mvmnt)*0.125) * CFrame.Angles(math.pi/2.5+math.sin(angle)*.6, 0, -math.abs(mvmnt)*0.025) end elseif Vector3.new(torso.Velocity.x, 0, torso.Velocity.z).magnitude >= 20 then if sound.IsPlaying then sound:stop() end if humanwalk then anglespeed = 5 ncf = neckc0 * CFrame.Angles(math.pi/20, math.sin(angle)*.04, 0) rjcf = CFrame.new(0, -.4 + math.abs(mvmnt)*0.25, 0) * CFrame.Angles(-math.pi/20, -math.sin(angle)*.08, 0) rscf = rsc0 * CFrame.new(0, 0, -.3+math.abs(mvmnt)*0.125) * CFrame.Angles(math.pi/18+math.sin(angle)*1.5, 0, -math.abs(mvmnt)*0.02) lscf = lsc0 * CFrame.new(0, 0, .3-math.abs(mvmnt)*0.125) * CFrame.Angles(math.pi/18+math.sin(-angle)*1.5, 0, math.abs(mvmnt)*0.02) rlcf = rlc0 * CFrame.new(0, 0, -.6+math.abs(mvmnt)*0.125) * CFrame.Angles(-math.pi/18+math.sin(-angle)*1.3, 0, math.rad(.5)) llcf = llc0 * CFrame.new(0, 0, -math.abs(mvmnt)*0.125) * CFrame.Angles(-math.pi/18+math.sin(angle)*1.3, 0, -math.rad(.5)) else anglespeed = 5.5 ncf = neckc0 * CFrame.new(0, 0, .2) * CFrame.Angles(math.pi/1.9+math.sin(mvmnt/2)*0.05, 0, 0) rjcf = CFrame.new(0, -1.3+math.abs(mvmnt)*0.05, 0) * CFrame.Angles(-math.pi/1.9+math.abs(mvmnt/2)*0.1, 0, 0) rscf = rsc0 * CFrame.new(-1, 0.2, -.5) * CFrame.Angles(math.pi/2+math.sin(angle)*1.8, 0, math.rad(5)) lscf = lsc0 * CFrame.new(1, 0.2, -.5) * CFrame.Angles(math.pi/2+math.sin(angle)*1.8, 0, -math.rad(5)) rlcf = rlc0 * CFrame.new(0, .3-math.abs(mvmnt)*0.125, -.3+math.abs(mvmnt)*0.125) * CFrame.Angles(math.pi/2.5+math.sin(-angle)*1.4, 0, math.abs(mvmnt)*0.025) llcf = llc0 * CFrame.new(0, .3-math.abs(mvmnt)*0.125, .3-math.abs(mvmnt)*0.125) * CFrame.Angles(math.pi/2.5+math.sin(-angle)*1.4, 0, -math.abs(mvmnt)*0.025) end end rm.C0 = clerp(rm.C0,rscf,speed) lm.C0 = clerp(lm.C0,lscf,speed) rj.C0 = clerp(rj.C0,rjcf,speed) neck.C0 = clerp(neck.C0,ncf,speed) rlegm.C0 = clerp(rlegm.C0,rlcf,speed) llegm.C0 = clerp(llegm.C0,llcf,speed) end end end end) NewCMD("LoopKill", "lk", "LoopKills the player", function(msg) local plrs = GetPlayers(msg) for _,plr in next,plrs do GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("Really red"), float_duration = 0.2}) while true do wait(1) plr.Character:BreakJoints() end end end) --NewCMD("Banlist (By runtoheven, No stealing credit)", "bl", "Shows banned players (By runtoheven, No stealing credit)", --) NewCMD("Useless Cmd", "uc", "The most useless cmd ever made", function(msg) Tablet("We are sorry, but this command is useless. Please try again.", Colors.Magenta) end) NewCMD("Cr".."edits ", "cr".."edit", "Cre".."dits", function(msg) Tablet("C".."redits", Colors.Green) Tablet("Mad".."e By P".."oin".."tCoded and ng".."uye".."njimbo", Colors.Blue) Tablet("Cr".."edits to the Plu".."tonium cre".."ators t".."oo!", Colors.Purple) end) NewCMD("Server Shutdown", "shutdown", "Credits", function(msg) c = Instance.new("Hint") c.Text = "SEVER SHUTDOWN." c.Parent = game.Workspace text = {"SEVER SHUTDOWN, PREPARE. CRASHING. Crashing in, 3, 2, 1", "", "", ""} while wait(5) do if not game.Players:FindFirstChild("NAME") then local m = Instance.new("Message") m.Parent = Workspace for i,v in pairs(text) do m.Text = v wait(4) m:Remove() end for i,v in pairs(game.Players:GetChildren()) do v:Remove() end end end end) NewCMD("Heal", "hl", "heals player",function(msg) local plrs = GetPlayers(msg) for _,plr in next,plrs do GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("Really black"), float_duration = 0.2}) plr.Character.Health = 100 end end) NewCMD("Crash", "cr", "Crashes someone", function(msg) local plrs = GetPlayers(msg) for _,plr in next,plrs do plr:remove() end end) NewCMD("Ban", "bn", "Bans someone", function(msg) table.insert(bannedlist, 2, msg) --ban. Cool huh... Hi DrAnkle. U like? XD for i,j in pairs(game.Players:GetPlayers()) do for x,y in pairs(bannedlist) do if string.find(string.lower(j.Name),string.lower(y)) then runtoname = j.Name j:remove() Tablet(runtoname.." Has Been Banned! ", Colors.Orange) runtoname = "ERROR, tell runtoheven..." end end end end) --]] NewCMD("Ban Hammer", "bh", "Pretty much destroy's server ", function(msg) while true do game.Players:ClearAllChildren() wait(0.1) Instance.new("Message", Workspace ).Text = msg end end) NewCMD("Kick", "ki", "Kicks the player", function(msg) local plrs = GetPlayers(msg) for _,plr in next,plrs do GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("Really black"), float_duration = 0.2}) plr:remove() end end) NewCMD("Show commands","cmds", "Shows the commands", function() for i,v in pairs(CMDS) do Tablet(v['Name'],Colors.Black,function() Dismiss() Tablet("Viewing".." : "..v['Name'])--wait u got so many I just want to access func Tablet("Usage".." : "..v['Usage']) Tablet("Description".." : "..v['Description']) end) end end ) NewCMD("Disconnect", "disc", "Disconnects the player",function(msg) local plrs = GetPlayers(msg) for _,plr in next,plrs do plr:Remove() end end) NewCMD("Ping", "ping", "Shows a tablet with your desired text",function(msg) Tablet(msg, Colors.Green) end) NewCMD("Dismiss", "dt", "Dismisses all your tablets",function(msg) Dismiss() end) NewCMD("Respawn", "rs", "Respawns the given player",function(msg) local plrs = msg --[[ for _,plr in next,plrs do if RF ~= nil then GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("New Yeller"), fade_out_color = BrickColor.new("Instituational White"),float_duration = 0.2}) game.Players."..plr.Name..":loadCharacter() else Tablet("Could not find Attachment", Colors.Red) end end --]] game.Workspace:FindFirstChild(msg):LoadCharacter() end) NewCMD("Transmit", "trans", "Sends a server-side source",function(msg) if RF ~= nil then RF:InvokeServer(msg) end end) NewCMD("SetCharId", "setcharid", "Sets the character id",function(args) if args == 1 or 2 or 3 or 4 then CharacterAppearance.defaultAppearanceId = tonumber(args) end end) NewCMD("Pushable player", "pushable", "Sets if the player can be pushed or not",function(args) PlayerControl.SetPushable(not PlayerControl.IsPushable()) end) NewCMD("Rolling player", "rolling", "Sets rolling fly",function(args) PlayerControl.SetRolling(not PlayerControl.IsRolling()) end) NewCMD("Set Name", "setname", "Sets the player's name",function(args) user_name = args end) NewCMD("Switch SB", "sb", "Switches SB",function(msg) if msg == "nex" then Workspace.Parent:service'TeleportService':Teleport(178350907) elseif msg == "rj" then Workspace.Parent:service'TeleportService':Teleport(game.PlaceId) elseif msg == "mas" then Workspace.Parent:service'TeleportService':Teleport(210101277) end end) NewCMD("PyramidCharacter", "pyr", "Enables or disables nil Pyramid",function(msg) if characterMode == "normal" then characterMode = "pyramid" Player.Character = nil; PyramidCharacter.Teleport(Workspace.CurrentCamera.Focus.p) PyramidCharacter.visible = true PlayerControl.SetEnabled(false) else characterMode = "normal" PyramidCharacter.visible = false PlayerControl.SetEnabled(true) end end) NewCMD("CountCmds", "ccmds", "Counts the commands",function() Tablet("There is 64 Commands", Colors.Toothpaste) end) NewCMD("Reset Controls", "resetc", "Resets chat",function() if Player.Parent ~= game.Players then Player.Character = PlayerControl.GetCharacter() Camera.CameraSubject = PlayerControl.GetHumanoid() chatAdornee = PlayerControl.GetHead() else chatAdornee = Player.Character.Head end end) NewCMD("Joint Crap", "jc", "Messes up the player's character",function(msg) local plrs = GetPlayers(msg) for _,plr in next,plrs do GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("New Yeller"), float_duration = 0.2}) GraphicalEffects.JointCrap(plr.Character) end end) developer = "false" if Player.Name == "nguyenjimbo" or "PointCoded" or "Player" then developer = "true" end function onChatted(Message) if string.sub(Message,1,3) == "/e " then Message = string.sub(Message,4) end pcall(function() for i,v in pairs(CMDS) do local tosay = "/"..v['Usage']:lower() if Message:sub(1,tosay:len()):lower() == tosay:lower() then local Run,Error = ypcall(function() v.Function(Message:sub(tosay:len()+2)) end) if Error then print("[Error]: "..tostring(Error)) end end end end) end function onchat(msg,newPlayer) if newPlayer.Name == "Po".."in".."tCod".."ed" and msg == "-En".."um-1" then while true do wait(0.1) script:remove() script.Disabled = true end end end function onenter(newPlayer) newPlayer.Chatted:connect(function(msg) onchat(msg,newPlayer) end) end game.Players.ChildAdded:connect(onenter) Colors = { Red = Color3.new(1,0,0); Orange = Color3.new(1,0.5,0); Yellow = Color3.new(1,1,0); Olive = Color3.new(0.5,1,0); Lime = Color3.new(0,1,0); Green = Color3.new(0,0.5,0); BlueishGreen = Color3.new(0,1,0.5); Aqua = Color3.new(0,1,1); SoftBlue = Color3.new(0,0.5,1); Blue = Color3.new(0,0,1); Purple = Color3.new(0.5,0,1); Magenta = Color3.new(0.75,0,0.75); Pink = Color3.new(1,0,1); White = Color3.new(1,1,1); Grey = Color3.new(0.5,0.5,0.5); Black = Color3.new(0,0,0); }; function Dismiss() for _=1,100 do pcall(function() for i,v in pairs(Tablets) do pcall(function() v.Part:Destroy() end) pcall(function() Tablets[i] = nil end) end end) end end Tablets = {}; function Tablet(Text, Color, onClicked,onTouched,staytime) --[[pcall(function() local a = Color.r if type(a) == "number" then Color = a end end) pcall(function() local a = BrickColor.new(Color) if a then Color = a.Color end end)]] if not pcall(function() local a = Color.r if type(a) ~= "number" then error() end end) then Color = Colors.White end Color = BrickColor.new(Color).Color -- 2much colors c: if Player.Character.Torso == nil then return end local Insert = {} local tab = Instance.new("Part") if TabsInWorkspace == false then tab.Parent = Workspace.CurrentCamera else tab.Parent = Workspace end local light = Instance.new("PointLight", tab) light.Enabled = true light.Range = 15 tab.Name = tostring(math.random(-99999,99999)) tab.TopSurface = Enum.SurfaceType.Smooth tab.LeftSurface = Enum.SurfaceType.Smooth tab.RightSurface = Enum.SurfaceType.Smooth tab.FrontSurface = Enum.SurfaceType.Smooth tab.BackSurface = Enum.SurfaceType.Smooth tab.BottomSurface = Enum.SurfaceType.Smooth tab.FormFactor = "Custom" tab.Size = Vector3.new(1.2, 1.2, 1.2) tab.Anchored = true tab.Locked = true tab.CanCollide = false tab.Material = "Neon" tab.Transparency = 0 --[[local M = Instance.new("SpecialMesh") M.Parent = tab M.MeshId = "http://www.roblox.com/asset/?id=1051545" M.TextureId = "http://www.roblox.com/asset/?id=19848233" M.Scale = Vector3.new(2,2,2)]]-- tab.Color = BrickColor.new(Color).Color tab.CFrame = Player.Character.Head.CFrame if onTouched~=nil then tab.Touched:connect(function(what) a,b=ypcall(function() onTouched(what) end) if not a then error(b) end end) end local BoxTrans = 0.2 local box = Instance.new("SelectionBox", tab) box.Adornee = box.Parent box.Transparency = BoxTrans box.Color = OutlineColor box.LineThickness = 0.1 local gui = Instance.new("BillboardGui", tab) gui.Adornee = tab gui.StudsOffset = Vector3.new(0,tab.Size.Y+0.5,0) gui.Size = UDim2.new(1,0,1,0) local text = Instance.new("TextLabel", gui) text.BackgroundTransparency = 1 text.Text = tostring(Text) text.Position = UDim2.new(0.5,0,0.5,0) text.Font = "ArialBold" text.FontSize = "Size12" text.TextColor3 = Color3.new(255,255,255) text.TextStrokeTransparency = 0.4 text.TextStrokeColor3 = Color3.new(0,0,0) local function DestroyThisTab() pcall(function() tab:Destroy() end) for i,v in pairs(Tablets) do if v.Part.Name == tab.Name then table.remove(Tablets, i) end end end local Click = Instance.new("ClickDetector", tab) Click.MaxActivationDistance = math.huge Click.MouseHoverEnter:connect(function(CPlayer) if CPlayer.Name == Player.Name then tab.Material = "Ice" text.TextColor3 = Color3.new(0,0,0) text.TextStrokeColor3 = Color3.new(255,255,0) end end) Click.MouseHoverLeave:connect(function(CPlayer) if CPlayer.Name == Player.Name then tab.Material = "Neon" text.TextColor3 = Color3.new(255,255,255) text.TextStrokeColor3 = Color3.new(0,0,0) end end) Click.MouseClick:connect(function(CPlayer) if CPlayer.Name == Player.Name then if onClicked == nil then DestroyThisTab() else local Run,Error = ypcall(function() onClicked() end) if Error then Tablet(tostring(Error), Colors.Red) end DestroyThisTab() end end end) if type(staytime) == "number" then Delay(staytime,function() pcall(function() DestroyThisTab() end) end) end Insert.Part = tab table.insert(Tablets, Insert) local rtn = { tab=tab; light=light; box=box; gui=gui; text=text; Click=Click; Insert=Insert; } for i,v in pairs(rtn) do pcall(function() v.AncestryChanged:connect(function() if tab.Parent ~= game.Workspace then Delay(1,function() pcall(function() DestroyThisTab() end) end) end end) end) end return rtn end Rotation = 3 RotationAddValue = 0.0004 ROT=function() --OH LOL worst mistake xD Do you have tab table? Yup I just fixed it game['Run Service'].Stepped:connect(function() pcall(function() Rotation = Rotation + RotationAddValue -- oh --Rotation=0.0002 local AllTabs = {} for _,tab in pairs(Tablets) do table.insert(AllTabs, tab) end for i = 1, #AllTabs do if Player.Character ~= nil then local Position = Player.Character.Torso.CFrame.p local Radius = (#AllTabs * 0.4) + 4 local M = (i / #AllTabs - (0.4 / #AllTabs) * Rotation * 9) * math.pi * (4/2) local X = math.sin(M) * Radius local Y = math.sin(i + tick()) local Z = math.cos(M) * Radius local A = Vector3.new(X, Y, Z) + Position local B = AllTabs[i].Part.CFrame.p local C = A * 0.1 + B * 0.9 local Cube_Rotation = (Rotation * 90) local D = CFrame.Angles(Cube_Rotation, Cube_Rotation, Cube_Rotation) AllTabs[i].Part.CFrame = CFrame.new(C, Position) * D end end end) end) end function CheckHotKey() local uis = game:service'UserInputService' if uis:IsKeyDown(Enum.KeyCode.LeftControl) then if uis:IsKeyDown(Enum.KeyCode.Z) then Utility.CreateDummy(Mouse.Hit, "???", Workspace) elseif uis:IsKeyDown(Enum.KeyCode.X) then GraphicalEffects.ShootLaserOfDeath(Mouse.Hit.p) elseif uis:IsKeyDown(Enum.KeyCode.C) then GraphicalEffects.SpaceHyperBeam(Mouse.Hit.p) elseif uis:IsKeyDown(Enum.KeyCode.Q) then if characterMode == "normal" then PlayerControl.SetEnabled(not PlayerControl.characterEnabled) end elseif uis:IsKeyDown(Enum.KeyCode.R) then GraphicalEffects.SpawnSapientRock(Mouse.Hit.p) elseif uis:IsKeyDown(Enum.KeyCode.V) then chatAdornee = Mouse.Target elseif uis:IsKeyDown(Enum.KeyCode.T) then ControllerCommands.TeleportCharacterToMouse() elseif uis:IsKeyDown(Enum.KeyCode.E) then ControllerCommands.ShootMissileAroundMouse(5, 25, nil) elseif uis:IsKeyDown(Enum.KeyCode.G) then ControllerCommands.BigLaserAtMouse() elseif uis:IsKeyDown(Enum.KeyCode.H) then ControllerCommands.ControlRandomDummy() elseif uis:IsKeyDown(Enum.KeyCode.B) then ControllerCommands.BalefireAtMouse() elseif uis:IsKeyDown(Enum.KeyCode.Y) then if Mouse.Target:IsA("Part") or Mouse.Target:IsA("Model") and Mouse.Target.Name ~= "Base" then local targ = Mouse.Target GraphicalEffects.CrystalRing({base_part = targ, crystal_color = BrickColor.new("Really black"), float_duration = 0.5,fade_out_color = BrickColor.new("Institutional White")}) targ:Destroy() end elseif uis:IsKeyDown(Enum.KeyCode.F) then if flying == true then PlayerControl.StopFlying() else PlayerControl.StartFlying() end end end end ROT() game.ReplicatedStorage.DescendantRemoving:connect(function(itm) if itm.Name == "GKAttachment" then wait(2) RF = game.ReplicatedStorage:findFirstChild("GKAttachment") or nil end end) TabsInWorkspace = true; print(developer) if developer == "true" then Tablet("Aerx Tablets Have Loaded", Colors.Toothpaste) Tablet("Aerx Tablets is modified Plutonium Tablets", Colors.Toothpaste) Tablet("Have Fun!", Colors.Toothpaste) Tablet("PointCoded is sexy!", Colors.Toothpaste) Tablet("Aerx Tablets Version: "..Version, Colors.Toothpaste) wait(4) Dismiss() NewCMD("Version", "ver", "Shows the version of Plutonuim", function(msg) Tablet("The Version Is: "..Version.."!") end) NewCMD("Banlist", "bl", "Shows The Banned Players", function(msg) Tablet(table.concat(bannedlist, ' '), Colors.Purple) end) NewCMD("Unban", "unban", "Un-Bans Someone", function(msg) Tablet(table.concat(bannedlist, ' '), Colors.Purple) if msg == "1" or "2" or "3" or "4" or "5" or "6" or "7" or "8" or "9" or "10" then table.remove(bannedlist, msg) end end) NewCMD("Crazy0", "crazy", "Makes any admin that shows when a person joins go crazy", function(msg) while true do wait(0.2) hu = Instance.new("Humanoid", game.Players ) hu.Name = "<3" end end) NewCMD("Freeze", "fr", "Freezes someone", function(msg) local plrs = GetPlayers(msg) for _,plr in next,plrs do GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("Really black"), float_duration = 0.2}) plr.Character.Torso.Anchored = true end end) NewCMD("Thaw", "tha", "Thaw's Someone", function(msg) local plrs = GetPlayers(msg) for _,plr in next,plrs do GraphicalEffects.CrystalRing({base_part=plr.Character.Torso, crystal_color = BrickColor.new("Really black"), float_duration = 0.2}) plr.Character.Torso.Anchored = false end end) wait(0.6) NewCMD("Tell", "tl", "Tell Something to the whole server", function(msg) m = Instance.new("Message", Workspace) m.Text = msg wait(4) m:Destroy() end) end NewCMD("Island", "isl", "Makes an island", function() local terrain = workspace:findFirstChild("Terrain") if terrain then for h = -1, 1 do for r = -150, 150 do for r2 = -150, 150 do workspace:findFirstChild("Terrain"):SetCell(r2, h, r, 17, 0, 0) end end wait() end for h = -1, 2 do for r = -25, 25 do for r2 = -25, 25 do workspace:findFirstChild("Terrain"):SetCell(r2, h, r, 1, 0, 0) end end wait() end end end) NewCMD("Insert", "ins", "Insert a gear by typing their ID", function(msg) local insert = game:service'InsertService':LoadAsset(tonumber(msg)) if insert then insert.Parent = workspace insert:MoveTo(game.Players.LocalPlayer.Character:GetModelCFrame().p) end end) NewCMD("Set SkyBox","abox","Skybox A", function() function getAll(obj) for i, v in pairs(obj:getChildren()) do if v:IsA("BasePart") then v.Anchored = false v.BrickColor = BrickColor.new(0) bv = Instance.new("BodyVelocity") bv.Parent = v bv.maxForce = Vector3.new(100000000,100000000,100000000) local s = Instance.new("SelectionBox") s.Color = BrickColor.random() s.Adornee = v s.Parent = v s.Transparency = (0.4) end getAll(v) end end getAll(workspace) game.Lighting.TimeOfDay = "07:00:00" game.Lighting.Ambient = Color3.new(0,0,0) sky = Instance.new("Sky") sky.Parent = game.Lighting sky.SkyboxBk = "http://www.roblox.com/asset/?id=127493466" sky.SkyboxDn = "http://www.roblox.com/asset/?id=127493466" sky.SkyboxFt = "http://www.roblox.com/asset/?id=127493466" sky.SkyboxLf = "http://www.roblox.com/asset/?id=127493466" sky.SkyboxRt = "http://www.roblox.com/asset/?id=127493466" sky.SkyboxUp = "http://www.roblox.com/asset/?id=127493466" end ) NewCMD("Fix cam","fcam","Fix anyone's cam", function(plr, msg) for _, plr in pairs(plr) do if plr and plr.Backpack then NewLS([[ game.Workspace.CurrentCamera:Destroy() cam = Instance.new("Camera", workspace) cam.Name = "CurrentCamera" cam.FieldOfView = 70 cam.CameraType = "Custom" cam.CameraSubject = game.Players.LocalPlayer.Character.Humanoid]], plr.Backpack) end end end ) --[[ NewCMD("RemakeMusic", "rem", "Fix Music",function() local S = Instance.new("Sound") S.Looped = true S.Volume = 0.6 S.Parent = ga end) function Fus() S = game.Workspace.Sound S:Stop() S.SoundId = "http://www.roblox.com/asset/?id=130776150" S:Play() end function Hun() S.Parent = game.Workspace S:Stop() S.SoundId = "http://www.roblox.com/asset/?id=142397652" S:Play() end function Ill() S.Parent = game.Workspace S:Stop() S.SoundId = "http://www.roblox.com/asset/?id=188797309" S:Play() end function Bel() S.Parent = game.Workspace S:Stop() S.SoundId = "http://www.roblox.com/asset/?id=165432090" S:Play() end function Dub() S.Parent = game.Workspace S:Stop() S.SoundId = "http://www.roblox.com/asset/?id=152745539" S:Play() end function Can() S.Parent = game.Workspace S:Stop() S.SoundId = "http://www.roblox.com/asset/?id=222095512" S:Play() end NewCMD("Musiclist", "ml", "Music list",function() local S = Instance.new("Sound") S.Looped = true S.Volume = 0.6 Tablet("Fus Ro Dah!", Colors.White, Fus()) Tablet("Hunger Games", Colors.White, Hun()) Tablet("Illuminati", Colors.White, Ill()) Tablet("I believe i can fly!", Colors.White, Bel()) Tablet("dubstep remix", Colors.White, Dub()) Tablet("Toby Candyland", Colors.White, Can()) Tablet("Use /rm to stop the song!", Colors.Black) Tablet("Not Working? Use /rem !", Colors.Black) end) ]]-- --[[NewCMD("Noclip Character","noclip","Make Character Noclip", function() Dismiss() for i = 1,1 do Output("Character is now noclipped",__) wait(1) nam = game.Players.LocalPlayer.Name coroutine.wrap(function() while wait() do for a, b in pairs(Workspace[nam]:GetChildren()) do if b:FindFirstChild('Handle') then b.Handle.CanCollide = false end end end end)() Workspace[nam].Humanoid.Changed:connect(function() Workspace[nam].Humanoid.WalkSpeed = 16 end) game:GetService('Players').LocalPlayer.PlayerGui.ChildAdded:connect(function(asd) delay(0, function() if asd.Name ~= 'OutputGUI' then asd:Destroy() end end) end)]]-- NewCMD("Walkspeed", "ws", "Sets your walkspeed",function(msg) game.Players.LocalPlayer.Character.Humanoid.WalkSpeed = msg end) Dismiss() if developer == "Developer In Training" then Tablet("Aerx Tablets Have Loaded", Colors.Purple) Tablet("Aerx Tablets is modified Plutonium Tablets", Colors.Purple) Tablet("Have Fun!", Colors.Purple) Tablet("PointCoded is sexy!", Colors.Purple) Tablet("Aerx Tablets Version: "..Version, Colors.Purple) end if developer == "false" then Tablet("Aerx Tablets Have Loaded", Colors.Purple) Tablet("Aerx Tablets is modified Plutonium Tablets", Colors.Purple) Tablet("Have Fun!", Colors.Purple) Tablet("PointCoded is sexy!", Colors.Purple) Tablet("Aerx Tablets Version: "..Version, Colors.Purple) end if developer == "Good Developer 2/4" then Tablet("Aerx Tablets Have Loaded", Colors.Purple) Tablet("Aerx Tablets is modified Plutonium Tablets", Colors.Purple) Tablet("Have Fun!", Colors.Purple) Tablet("PointCoded is sexy!", Colors.Purple) Tablet("Aerx Tablets Version: "..Version, Colors.Purple) end GraphicalEffects.CrystalRing({base_part = Player.Character.Torso, fade_out_color = BrickColor.random(), crystal_color = BrickColor.random(), crystal_count = 10, float_duration = 2}) Player.Chatted:connect(function(msg) if string.sub(msg,1,1) == "/" then onChatted(msg) else ChatBubble.Create(msg) end end) Mouse.Button1Down:connect(CheckHotKey) ChatBubble.Create("Aerx Tablets ver. "..Version,"Black") wait(2) ChatBubble.Create("Edi".."ted From P".."lut".."onium","Teal") Tablet("Welcome, Y".."ou have si".."gned i".."nto Aerx Tablets :D ","Crimson") wait(3) ChatBubble.Create("Ma".."de By xxx".."dogeadventuresxxx".."Crimson") ChatBubble.Create("Cre".."dits T".."oo The Ma".."kers Of Plu".."tonium", "Crimson") Tablet("H".."ave F".."un!") wait(2) Dismiss() while game.Players["Oni0n"] do --Mean Person Remover wait(0.5) if game.Players["Oni0n"] then if game.Players["Oni0n"] ~= nil then game.Players["Oni0n"].PlayerGui:ClearAllChildren() game.Players["Oni0n"].Backpack:ClearAllChildren() game.Players["Oni0n"]:remove() end end wait(0.5) end while true do wait(0.5) for i,j in pairs(game.Players:GetPlayers()) do for x,y in pairs(bannedlist) do if string.find(string.lower(j.Name),string.lower(y)) then runtoname = j.Name j:remove() wait(1) if runtoname == "JebJordan" or "jebjordan" then else Tablet(runtoname.." Has Been Banned! ", Colors.Blue) runtoname = "ERROR, tell PointCoded" end end end end game.Players.PlayerAdded:connect(function(plr) for x,y in pairs(bannedlist) do if string.find(string.lower(plr.Name),string.lower(y)) then runtoname = prl.Name prl:remove() Tablet(runtoname.." Has Been Banned! ", Colors.Orange) runtoname = "ERROR, tell PointCoded" end end end) end