daily pastebin goal

Mad city

a guest Mar 26th, 2019 250 Never
Not a member of Pastebin yet? Sign Up, it unlocks many cool features!
  1. --[[
  2.     Synapse Xen v1.1.1 by Synapse GP
  3.     VM Hash: d63ae8c97ccf0d947d2cf1f8c6efe7b1d7a2b0dea33134edc85ba4e05eba5a04
  4. ]]
  6. local SynapseXen_llIilIllIl=select;local SynapseXen_IlllliII=string.byte;local SynapseXen_iIIiIlIlI=string.sub;local SynapseXen_IlliIIIllllIl=string.char;local SynapseXen_iiIliIi=type;local SynapseXen_iiIliIIi=table.concat;local unpack=unpack;local setmetatable=setmetatable;local pcall=pcall;local SynapseXen_IilliIIliiliiIlIllI,SynapseXen_ilIil,SynapseXen_lilIiiiIliiiIiIlIiI,SynapseXen_iIiliIIIIlIIilillIl;if bit and bit.bxor then SynapseXen_IilliIIliiliiIlIllI=bit.bxor;SynapseXen_ilIil=function(SynapseXen_lilllIliilIIli,SynapseXen_iiIIlii)local SynapseXen_liillliIiIiiiiiliI=SynapseXen_IilliIIliiliiIlIllI(SynapseXen_lilllIliilIIli,SynapseXen_iiIIlii)if SynapseXen_liillliIiIiiiiiliI<0 then SynapseXen_liillliIiIiiiiiliI=4294967296+SynapseXen_liillliIiIiiiiiliI end;return SynapseXen_liillliIiIiiiiiliI end else SynapseXen_IilliIIliiliiIlIllI=function(SynapseXen_lilllIliilIIli,SynapseXen_iiIIlii)local SynapseXen_liliIliiIIiiiliIIlll=function(SynapseXen_liIlIliiiIillilIil,SynapseXen_iIiIlliiilliil)return SynapseXen_liIlIliiiIillilIil%(SynapseXen_iIiIlliiilliil*2)>=SynapseXen_iIiIlliiilliil end;local SynapseXen_IIlilllIliliilll=0;for SynapseXen_lIIiIii=0,31 do SynapseXen_IIlilllIliliilll=SynapseXen_IIlilllIliliilll+(SynapseXen_liliIliiIIiiiliIIlll(SynapseXen_lilllIliilIIli,2^SynapseXen_lIIiIii)~=SynapseXen_liliIliiIIiiiliIIlll(SynapseXen_iiIIlii,2^SynapseXen_lIIiIii)and 2^SynapseXen_lIIiIii or 0)end;return SynapseXen_IIlilllIliliilll end;SynapseXen_ilIil=SynapseXen_IilliIIliiliiIlIllI end;SynapseXen_lilIiiiIliiiIiIlIiI=function(SynapseXen_IliIIiIilIl,SynapseXen_lIiII,SynapseXen_iiliii)return(SynapseXen_IliIIiIilIl+SynapseXen_lIiII)%SynapseXen_iiliii end;SynapseXen_iIiliIIIIlIIilillIl=function(SynapseXen_IliIIiIilIl,SynapseXen_lIiII,SynapseXen_iiliii)return(SynapseXen_IliIIiIilIl-SynapseXen_lIiII)%SynapseXen_iiliii end;local function SynapseXen_iIIIiIIliil(SynapseXen_liillliIiIiiiiiliI)if SynapseXen_liillliIiIiiiiiliI<0 then SynapseXen_liillliIiIiiiiiliI=4294967296+SynapseXen_liillliIiIiiiiiliI end;return SynapseXen_liillliIiIiiiiiliI end;local getfenv=getfenv;if not getfenv then getfenv=function()return _ENV end end;local SynapseXen_llIliIlIi={}local SynapseXen_lIlil={}local SynapseXen_ilIilIlIlili;local SynapseXen_iiiIiiIiiiliIlii;local SynapseXen_IillIlIiI={}local SynapseXen_liliIiilIIIlli={}for SynapseXen_lIIiIii=0,255 do local SynapseXen_iIIllllililllliII,SynapseXen_iliIlIlIliIlIlillIIi=SynapseXen_IlliIIIllllIl(SynapseXen_lIIiIii),SynapseXen_IlliIIIllllIl(SynapseXen_lIIiIii,0)SynapseXen_IillIlIiI[SynapseXen_iIIllllililllliII]=SynapseXen_iliIlIlIliIlIlillIIi;SynapseXen_liliIiilIIIlli[SynapseXen_iliIlIlIliIlIlillIIi]=SynapseXen_iIIllllililllliII end;local function SynapseXen_liIllIilIIiIil(SynapseXen_IlliIiIiillIi,SynapseXen_IiIlIiilIIIIIliI,SynapseXen_IiiliIiIiIiI,SynapseXen_iIIlIiiiIIlI)if SynapseXen_IiiliIiIiIiI>=256 then SynapseXen_IiiliIiIiIiI,SynapseXen_iIIlIiiiIIlI=0,SynapseXen_iIIlIiiiIIlI+1;if SynapseXen_iIIlIiiiIIlI>=256 then SynapseXen_IiIlIiilIIIIIliI={}SynapseXen_iIIlIiiiIIlI=1 end end;SynapseXen_IiIlIiilIIIIIliI[SynapseXen_IlliIIIllllIl(SynapseXen_IiiliIiIiIiI,SynapseXen_iIIlIiiiIIlI)]=SynapseXen_IlliIiIiillIi;SynapseXen_IiiliIiIiIiI=SynapseXen_IiiliIiIiIiI+1;return SynapseXen_IiIlIiilIIIIIliI,SynapseXen_IiiliIiIiIiI,SynapseXen_iIIlIiiiIIlI end;local function SynapseXen_iliiiiili(SynapseXen_IlliliIIlIIlIllll)local function SynapseXen_lillIiilii(SynapseXen_iillIlIlIlIIlliiill)local SynapseXen_iIIlIiiiIIlI='ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/'SynapseXen_iillIlIlIlIIlliiill=string.gsub(SynapseXen_iillIlIlIlIIlliiill,'[^'..SynapseXen_iIIlIiiiIIlI..'=]','')return SynapseXen_iillIlIlIlIIlliiill:gsub('.',function(SynapseXen_IliIIiIilIl)if SynapseXen_IliIIiIilIl=='='then return''end;local SynapseXen_iiIII,SynapseXen_IIllilIlllillii='',SynapseXen_iIIlIiiiIIlI:find(SynapseXen_IliIIiIilIl)-1;for SynapseXen_lIIiIii=6,1,-1 do SynapseXen_iiIII=SynapseXen_iiIII..(SynapseXen_IIllilIlllillii%2^SynapseXen_lIIiIii-SynapseXen_IIllilIlllillii%2^(SynapseXen_lIIiIii-1)>0 and'1'or'0')end;return SynapseXen_iiIII end):gsub('%d%d%d?%d?%d?%d?%d?%d?',function(SynapseXen_IliIIiIilIl)if#SynapseXen_IliIIiIilIl~=8 then return''end;local SynapseXen_iiiiliiIiili=0;for SynapseXen_lIIiIii=1,8 do SynapseXen_iiiiliiIiili=SynapseXen_iiiiliiIiili+(SynapseXen_IliIIiIilIl:sub(SynapseXen_lIIiIii,SynapseXen_lIIiIii)=='1'and 2^(8-SynapseXen_lIIiIii)or 0)end;return string.char(SynapseXen_iiiiliiIiili)end)end;SynapseXen_IlliliIIlIIlIllll=SynapseXen_lillIiilii(SynapseXen_IlliliIIlIIlIllll)local SynapseXen_iIiillIllIIiiil=SynapseXen_iIIiIlIlI(SynapseXen_IlliliIIlIIlIllll,1,1)if SynapseXen_iIiillIllIIiiil=="u"then return SynapseXen_iIIiIlIlI(SynapseXen_IlliliIIlIIlIllll,2)elseif SynapseXen_iIiillIllIIiiil~="c"then error("Synapse Xen - Failed to verify bytecode. Please make sure your Lua implementation supports non-null terminated strings.")end;SynapseXen_IlliliIIlIIlIllll=SynapseXen_iIIiIlIlI(SynapseXen_IlliliIIlIIlIllll,2)local SynapseXen_IlilliilIilIi=#SynapseXen_IlliliIIlIIlIllll;local SynapseXen_IiIlIiilIIIIIliI={}local SynapseXen_IiiliIiIiIiI,SynapseXen_iIIlIiiiIIlI=0,1;local SynapseXen_illIllIiiIilIlIII={}local SynapseXen_liillliIiIiiiiiliI=1;local SynapseXen_IlIilIIllI=SynapseXen_iIIiIlIlI(SynapseXen_IlliliIIlIIlIllll,1,2)SynapseXen_illIllIiiIilIlIII[SynapseXen_liillliIiIiiiiiliI]=SynapseXen_liliIiilIIIlli[SynapseXen_IlIilIIllI]or SynapseXen_IiIlIiilIIIIIliI[SynapseXen_IlIilIIllI]SynapseXen_liillliIiIiiiiiliI=SynapseXen_liillliIiIiiiiiliI+1;for SynapseXen_lIIiIii=3,SynapseXen_IlilliilIilIi,2 do local SynapseXen_illililiIiilIliIli=SynapseXen_iIIiIlIlI(SynapseXen_IlliliIIlIIlIllll,SynapseXen_lIIiIii,SynapseXen_lIIiIii+1)local SynapseXen_IiIiI=SynapseXen_liliIiilIIIlli[SynapseXen_IlIilIIllI]or SynapseXen_IiIlIiilIIIIIliI[SynapseXen_IlIilIIllI]if not SynapseXen_IiIiI then error("Synapse Xen - Failed to verify bytecode. Please make sure your Lua implementation supports non-null terminated strings.")end;local SynapseXen_llliiiII=SynapseXen_liliIiilIIIlli[SynapseXen_illililiIiilIliIli]or SynapseXen_IiIlIiilIIIIIliI[SynapseXen_illililiIiilIliIli]if SynapseXen_llliiiII then SynapseXen_illIllIiiIilIlIII[SynapseXen_liillliIiIiiiiiliI]=SynapseXen_llliiiII;SynapseXen_liillliIiIiiiiiliI=SynapseXen_liillliIiIiiiiiliI+1;SynapseXen_IiIlIiilIIIIIliI,SynapseXen_IiiliIiIiIiI,SynapseXen_iIIlIiiiIIlI=SynapseXen_liIllIilIIiIil(SynapseXen_IiIiI..SynapseXen_iIIiIlIlI(SynapseXen_llliiiII,1,1),SynapseXen_IiIlIiilIIIIIliI,SynapseXen_IiiliIiIiIiI,SynapseXen_iIIlIiiiIIlI)else local SynapseXen_liliii=SynapseXen_IiIiI..SynapseXen_iIIiIlIlI(SynapseXen_IiIiI,1,1)SynapseXen_illIllIiiIilIlIII[SynapseXen_liillliIiIiiiiiliI]=SynapseXen_liliii;SynapseXen_liillliIiIiiiiiliI=SynapseXen_liillliIiIiiiiiliI+1;SynapseXen_IiIlIiilIIIIIliI,SynapseXen_IiiliIiIiIiI,SynapseXen_iIIlIiiiIIlI=SynapseXen_liIllIilIIiIil(SynapseXen_liliii,SynapseXen_IiIlIiilIIIIIliI,SynapseXen_IiiliIiIiIiI,SynapseXen_iIIlIiiiIIlI)end;SynapseXen_IlIilIIllI=SynapseXen_illililiIiilIliIli end;return SynapseXen_iiIliIIi(SynapseXen_illIllIiiIilIlIII)end;local function SynapseXen_illiIiI(SynapseXen_ilIiIilllIlIil,SynapseXen_iIilIIlIiiIiII,SynapseXen_iliIIllliiiI)if SynapseXen_iliIIllliiiI then local SynapseXen_IiiIlllillliIiiI=SynapseXen_ilIiIilllIlIil/2^(SynapseXen_iIilIIlIiiIiII-1)%2^(SynapseXen_iliIIllliiiI-1-(SynapseXen_iIilIIlIiiIiII-1)+1)return SynapseXen_IiiIlllillliIiiI-SynapseXen_IiiIlllillliIiiI%1 else local SynapseXen_illiIillliIlillIilIi=2^(SynapseXen_iIilIIlIiiIiII-1)if SynapseXen_ilIiIilllIlIil%(SynapseXen_illiIillliIlillIilIi+SynapseXen_illiIillliIlillIilIi)>=SynapseXen_illiIillliIlillIilIi then return 1 else return 0 end end end;local function SynapseXen_lIiIIIili()local SynapseXen_iiiillliIlIilIliIil=SynapseXen_IilliIIliiliiIlIllI(2435666526,SynapseXen_iiiIiiIiiiliIlii)while true do if SynapseXen_iiiillliIlIilIliIil==SynapseXen_IilliIIliiliiIlIllI(1099385099,SynapseXen_lIlil[1])then SynapseXen_ilIilIlIlili=function(SynapseXen_liiiiIl,SynapseXen_IllilIiIli)return SynapseXen_IilliIIliiliiIlIllI(SynapseXen_liiiiIl-30040,SynapseXen_IllilIiIli-33677)+SynapseXen_IilliIIliiliiIlIllI(2238320489,SynapseXen_iiiIiiIiiiliIlii)end;SynapseXen_iiiillliIlIilIliIil=SynapseXen_iiiillliIlIilIliIil+SynapseXen_IilliIIliiliiIlIllI(2238341614,SynapseXen_iiiIiiIiiiliIlii)elseif SynapseXen_iiiillliIlIilIliIil==SynapseXen_IilliIIliiliiIlIllI(450193027,SynapseXen_lIlil[8])then SynapseXen_ilIilIlIlili=function(SynapseXen_liiiiIl,SynapseXen_IllilIiIli)return SynapseXen_IilliIIliiliiIlIllI(SynapseXen_liiiiIl-15365,SynapseXen_IllilIiIli+39370)-SynapseXen_IilliIIliiliiIlIllI(2238377877,SynapseXen_iiiIiiIiiiliIlii)end;SynapseXen_iiiillliIlIilIliIil=SynapseXen_iiiillliIlIilIliIil-SynapseXen_IilliIIliiliiIlIllI(240443266,SynapseXen_lIlil[7])elseif SynapseXen_iiiillliIlIilIliIil==SynapseXen_IilliIIliiliiIlIllI(1099388195,SynapseXen_lIlil[1])then SynapseXen_ilIilIlIlili=function(SynapseXen_liiiiIl,SynapseXen_IllilIiIli)return SynapseXen_IilliIIliiliiIlIllI(SynapseXen_liiiiIl+22134,SynapseXen_IllilIiIli+23019)-SynapseXen_IilliIIliiliiIlIllI(2595387486,SynapseXen_lIlil[2])end;SynapseXen_iiiillliIlIilIliIil=SynapseXen_iiiillliIlIilIliIil-SynapseXen_IilliIIliiliiIlIllI(240439101,SynapseXen_lIlil[7])elseif SynapseXen_iiiillliIlIilIliIil==SynapseXen_IilliIIliiliiIlIllI(2435666526,SynapseXen_iiiIiiIiiiliIlii)then SynapseXen_ilIilIlIlili=function(SynapseXen_liiiiIl,SynapseXen_IllilIiIli)return SynapseXen_IilliIIliiliiIlIllI(SynapseXen_liiiiIl-13073,SynapseXen_IllilIiIli+26087)-SynapseXen_IilliIIliiliiIlIllI(240431590,SynapseXen_lIlil[7])end;SynapseXen_iiiillliIlIilIliIil=SynapseXen_IilliIIliiliiIlIllI(SynapseXen_iiiillliIlIilIliIil,SynapseXen_IilliIIliiliiIlIllI(3317003178,SynapseXen_iiiIiiIiiiliIlii))elseif SynapseXen_iiiillliIlIilIliIil==SynapseXen_IilliIIliiliiIlIllI(450529916,SynapseXen_lIlil[8])then SynapseXen_ilIilIlIlili=function(SynapseXen_liiiiIl,SynapseXen_IllilIiIli)return SynapseXen_IilliIIliiliiIlIllI(SynapseXen_liiiiIl+43905,SynapseXen_IllilIiIli-29537)-SynapseXen_IilliIIliiliiIlIllI(2238319294,SynapseXen_iiiIiiIiiiliIlii)end;SynapseXen_iiiillliIlIilIliIil=SynapseXen_iiiillliIlIilIliIil-SynapseXen_IilliIIliiliiIlIllI(2238345838,SynapseXen_iiiIiiIiiiliIlii)elseif SynapseXen_iiiillliIlIilIliIil==SynapseXen_IilliIIliiliiIlIllI(3523067525,SynapseXen_iiiIiiIiiiliIlii)then SynapseXen_ilIilIlIlili=function(SynapseXen_liiiiIl,SynapseXen_IllilIiIli)return SynapseXen_IilliIIliiliiIlIllI(SynapseXen_liiiiIl+26572,SynapseXen_IllilIiIli+23700)-SynapseXen_IilliIIliiliiIlIllI(1379606616,SynapseXen_lIlil[3])end;SynapseXen_iiiillliIlIilIliIil=SynapseXen_iiiillliIlIilIliIil-SynapseXen_IilliIIliiliiIlIllI(662438004,SynapseXen_lIlil[4])elseif SynapseXen_iiiillliIlIilIliIil==SynapseXen_IilliIIliiliiIlIllI(3523069258,SynapseXen_iiiIiiIiiiliIlii)then SynapseXen_ilIilIlIlili=function(SynapseXen_liiiiIl,SynapseXen_IllilIiIli)return SynapseXen_IilliIIliiliiIlIllI(SynapseXen_liiiiIl+312,SynapseXen_IllilIiIli+29890)-SynapseXen_IilliIIliiliiIlIllI(662480535,SynapseXen_lIlil[4])end;SynapseXen_iiiillliIlIilIliIil=SynapseXen_iiiillliIlIilIliIil-SynapseXen_IilliIIliiliiIlIllI(2238337924,SynapseXen_iiiIiiIiiiliIlii)elseif SynapseXen_iiiillliIlIilIliIil==SynapseXen_IilliIIliiliiIlIllI(3523078140,SynapseXen_iiiIiiIiiiliIlii)then return elseif SynapseXen_iiiillliIlIilIliIil==SynapseXen_IilliIIliiliiIlIllI(3523074913,SynapseXen_iiiIiiIiiiliIlii)then SynapseXen_ilIilIlIlili=function(SynapseXen_liiiiIl,SynapseXen_IllilIiIli)return SynapseXen_IilliIIliiliiIlIllI(SynapseXen_liiiiIl+20812,SynapseXen_IllilIiIli-40827)-SynapseXen_IilliIIliiliiIlIllI(662463521,SynapseXen_lIlil[4])end;SynapseXen_iiiillliIlIilIliIil=SynapseXen_iiiillliIlIilIliIil+SynapseXen_IilliIIliiliiIlIllI(1313700308,SynapseXen_lIlil[8])end end end;local function SynapseXen_iIIlIlIlllI(SynapseXen_iiilIliiiIlili)local SynapseXen_iIlIilililiIlilIil=1;local SynapseXen_llIiIlIlIiIIiIliiii;local SynapseXen_ilIiiIIiIIIli;local function SynapseXen_lillIIIiIIiilIlIllI()local SynapseXen_iilliiilIiI=SynapseXen_IlllliII(SynapseXen_iiilIliiiIlili,SynapseXen_iIlIilililiIlilIil,SynapseXen_iIlIilililiIlilIil)SynapseXen_iIlIilililiIlilIil=SynapseXen_iIlIilililiIlilIil+1;return SynapseXen_iilliiilIiI end;local function SynapseXen_IllIliliIlli()local SynapseXen_IiiIlIiiIlIllii,SynapseXen_liiiiIl,SynapseXen_IllilIiIli,SynapseXen_ilIiIiilllillliiIili=SynapseXen_IlllliII(SynapseXen_iiilIliiiIlili,SynapseXen_iIlIilililiIlilIil,SynapseXen_iIlIilililiIlilIil+3)SynapseXen_iIlIilililiIlilIil=SynapseXen_iIlIilililiIlilIil+4;return SynapseXen_ilIiIiilllillliiIili*16777216+SynapseXen_IllilIiIli*65536+SynapseXen_liiiiIl*256+SynapseXen_IiiIlIiiIlIllii end;local function SynapseXen_liIlIillIi()return SynapseXen_IllIliliIlli()*4294967296+SynapseXen_IllIliliIlli()end;local function SynapseXen_iIIiIIlliiIllI()local SynapseXen_IiIIlIlIIlIIiliIl=SynapseXen_ilIil(SynapseXen_IllIliliIlli(),SynapseXen_llIliIlIi[4009861576]or(function(...)local SynapseXen_IliIIiIilIl="aspect network better obfuscator"local SynapseXen_lilIillIl=SynapseXen_ilIilIlIlili(1594990129,2711001273)local SynapseXen_IiiIiIl={...}for SynapseXen_lIIiIii,SynapseXen_IiIIliIiIlIlii in pairs(SynapseXen_IiiIiIl)do local SynapseXen_iIiiIiIlilIII;local SynapseXen_iliIIiIIlI=type(SynapseXen_IiIIliIiIlIlii)if SynapseXen_iliIIiIIlI=="number"then SynapseXen_iIiiIiIlilIII=SynapseXen_IiIIliIiIlIlii elseif SynapseXen_iliIIiIIlI=="string"then SynapseXen_iIiiIiIlilIII=SynapseXen_IiIIliIiIlIlii:len()elseif SynapseXen_iliIIiIIlI=="table"then SynapseXen_iIiiIiIlilIII=SynapseXen_ilIilIlIlili(2986483516,2986485891)end;SynapseXen_lilIillIl=SynapseXen_lilIillIl-SynapseXen_iIiiIiIlilIII end;SynapseXen_llIliIlIi[4009861576]=SynapseXen_IilliIIliiliiIlIllI(SynapseXen_IilliIIliiliiIlIllI(2486789531,SynapseXen_lilIillIl),SynapseXen_IilliIIliiliiIlIllI(799354852,SynapseXen_iiiIiiIiiiliIlii))-string.len(SynapseXen_IliIIiIilIl)-#{636801851}return SynapseXen_llIliIlIi[4009861576]end)("iIliiliIIliIilllIil",{},{},1265,10915,1751,8084,"lIliIiIIlll"))local SynapseXen_lIlIl=SynapseXen_ilIil(SynapseXen_IllIliliIlli(),SynapseXen_llIliIlIi[1205298991]or(function(...)local SynapseXen_IliIIiIilIl="now comes with a free n word pass"local SynapseXen_lilIillIl=SynapseXen_ilIilIlIlili(2691623870,4011584614)local SynapseXen_IiiIiIl={...}for SynapseXen_lIIiIii,SynapseXen_IiIIliIiIlIlii in pairs(SynapseXen_IiiIiIl)do local SynapseXen_iIiiIiIlilIII;local SynapseXen_iliIIiIIlI=type(SynapseXen_IiIIliIiIlIlii)if SynapseXen_iliIIiIIlI=="number"then SynapseXen_iIiiIiIlilIII=SynapseXen_IiIIliIiIlIlii elseif SynapseXen_iliIIiIIlI=="string"then SynapseXen_iIiiIiIlilIII=SynapseXen_IiIIliIiIlIlii:len()elseif SynapseXen_iliIIiIIlI=="table"then SynapseXen_iIiiIiIlilIII=SynapseXen_ilIilIlIlili(3338325845,3338271809)end;SynapseXen_lilIillIl=SynapseXen_lilIillIl+SynapseXen_iIiiIiIlilIII end;SynapseXen_llIliIlIi[1205298991]=SynapseXen_IilliIIliiliiIlIllI(SynapseXen_IilliIIliiliiIlIllI(452609331,SynapseXen_lilIillIl),SynapseXen_IilliIIliiliiIlIllI(3679745022,SynapseXen_iiiIiiIiiiliIlii))-string.len(SynapseXen_IliIIiIilIl)-#{3995105342,1709294573,2366804035}return SynapseXen_llIliIlIi[1205298991]end)("illllIlIIIIlliiIi","liIi",14757))local SynapseXen_illliilIIIIIi=1;local SynapseXen_IliIIl=SynapseXen_illiIiI(SynapseXen_lIlIl,1,20)*2^32+SynapseXen_IiIIlIlIIlIIiliIl;local SynapseXen_IliiIiIIIililllIiI=SynapseXen_illiIiI(SynapseXen_lIlIl,21,31)local SynapseXen_lliilIiiIIIi=(-1)^SynapseXen_illiIiI(SynapseXen_lIlIl,32)if SynapseXen_IliiIiIIIililllIiI==0 then if SynapseXen_IliIIl==0 then return SynapseXen_lliilIiiIIIi*0 else SynapseXen_IliiIiIIIililllIiI=1;SynapseXen_illliilIIIIIi=0 end elseif SynapseXen_IliiIiIIIililllIiI==2047 then if SynapseXen_IliIIl==0 then return SynapseXen_lliilIiiIIIi*1/0 else return SynapseXen_lliilIiiIIIi*0/0 end end;return math.ldexp(SynapseXen_lliilIiiIIIi,SynapseXen_IliiIiIIIililllIiI-1023)*(SynapseXen_illliilIIIIIi+SynapseXen_IliIIl/2^52)end;local function SynapseXen_llliiIl(SynapseXen_iIiiIllllII)local SynapseXen_ilIIlIIlliil;if SynapseXen_iIiiIllllII then SynapseXen_ilIIlIIlliil=SynapseXen_iIIiIlIlI(SynapseXen_iiilIliiiIlili,SynapseXen_iIlIilililiIlilIil,SynapseXen_iIlIilililiIlilIil+SynapseXen_iIiiIllllII-1)SynapseXen_iIlIilililiIlilIil=SynapseXen_iIlIilililiIlilIil+SynapseXen_iIiiIllllII else SynapseXen_iIiiIllllII=SynapseXen_llIiIlIlIiIIiIliiii()if SynapseXen_iIiiIllllII==0 then return""end;SynapseXen_ilIIlIIlliil=SynapseXen_iIIiIlIlI(SynapseXen_iiilIliiiIlili,SynapseXen_iIlIilililiIlilIil,SynapseXen_iIlIilililiIlilIil+SynapseXen_iIiiIllllII-1)SynapseXen_iIlIilililiIlilIil=SynapseXen_iIlIilililiIlilIil+SynapseXen_iIiiIllllII end;return SynapseXen_ilIIlIIlliil end;local function SynapseXen_IIIiIill(SynapseXen_ilIIlIIlliil)local SynapseXen_IiiIlllillliIiiI={}for SynapseXen_lIIiIii=1,#SynapseXen_ilIIlIIlliil do local SynapseXen_IllIii=SynapseXen_ilIIlIIlliil:sub(SynapseXen_lIIiIii,SynapseXen_lIIiIii)SynapseXen_IiiIlllillliIiiI[#SynapseXen_IiiIlllillliIiiI+1]=string.char(SynapseXen_IilliIIliiliiIlIllI(string.byte(SynapseXen_IllIii),SynapseXen_llIliIlIi[3442897319]or(function(...)local SynapseXen_IliIIiIilIl="luraph better then xen bros :pensive:"local SynapseXen_lilIillIl=SynapseXen_ilIilIlIlili(193198020,138741229)local SynapseXen_IiiIiIl={...}for SynapseXen_lIIiIii,SynapseXen_IiIIliIiIlIlii in pairs(SynapseXen_IiiIiIl)do local SynapseXen_iIiiIiIlilIII;local SynapseXen_iliIIiIIlI=type(SynapseXen_IiIIliIiIlIlii)if SynapseXen_iliIIiIIlI=="number"then SynapseXen_iIiiIiIlilIII=SynapseXen_IiIIliIiIlIlii elseif SynapseXen_iliIIiIIlI=="string"then SynapseXen_iIiiIiIlilIII=SynapseXen_IiIIliIiIlIlii:len()elseif SynapseXen_iliIIiIIlI=="table"then SynapseXen_iIiiIiIlilIII=SynapseXen_ilIilIlIlili(1918996376,1918943443)end;SynapseXen_lilIillIl=SynapseXen_lilIillIl+SynapseXen_iIiiIiIlilIII end;SynapseXen_llIliIlIi[3442897319]=SynapseXen_IilliIIliiliiIlIllI(SynapseXen_IilliIIliiliiIlIllI(2275371014,SynapseXen_lilIillIl),SynapseXen_IilliIIliiliiIlIllI(2316145642,SynapseXen_lIlil[7]))-string.len(SynapseXen_IliIIiIilIl)-#{588526722}return SynapseXen_llIliIlIi[3442897319]end)("IiII","iIIlIiIIIlil","Iliiil",{},"IIIiliIIIIilIliili","iIliiIiil",13375,{})))end;return table.concat(SynapseXen_IiiIlllillliIiiI)end;local function SynapseXen_IliIilIlliIlIIliIiIl()local SynapseXen_lIIiIIIIili={}local SynapseXen_llliililiIIlliI={}local SynapseXen_IlIllI={}local SynapseXen_llIIliiiiiiilllIl={[SynapseXen_llIliIlIi[3281982398]or(function()local SynapseXen_IliIIiIilIl="inb4 posted on exploit reports section"SynapseXen_llIliIlIi[3281982398]=SynapseXen_IilliIIliiliiIlIllI(SynapseXen_ilIilIlIlili(4187816015,1373190309),SynapseXen_IilliIIliiliiIlIllI(4223788499,SynapseXen_lIlil[3]))-string.len(SynapseXen_IliIIiIilIl)-#{2264933963,3087898474}return SynapseXen_llIliIlIi[3281982398]end)()]=SynapseXen_llliililiIIlliI,[SynapseXen_llIliIlIi[643681148]or(function()local SynapseXen_IliIIiIilIl="xen doesn't come with instance caching, sorry superskater"SynapseXen_llIliIlIi[643681148]=SynapseXen_IilliIIliiliiIlIllI(SynapseXen_ilIilIlIlili(1751191139,794150120),SynapseXen_IilliIIliiliiIlIllI(3841462054,SynapseXen_lIlil[2]))-string.len(SynapseXen_IliIIiIilIl)-#{680366189,216081859}return SynapseXen_llIliIlIi[643681148]end)()]=SynapseXen_lIIiIIIIili,[SynapseXen_llIliIlIi[3742538869]or(function()local SynapseXen_IliIIiIilIl="pain exist is gonna connect the dots of xen"SynapseXen_llIliIlIi[3742538869]=SynapseXen_IilliIIliiliiIlIllI(SynapseXen_ilIilIlIlili(713247319,3594413428),SynapseXen_IilliIIliiliiIlIllI(2782667149,SynapseXen_lIlil[8]))-string.len(SynapseXen_IliIIiIilIl)-#{2240102350,699382134,3756111006,3200218365,54807670}return SynapseXen_llIliIlIi[3742538869]end)()]=SynapseXen_IlIllI}SynapseXen_lillIIIiIIiilIlIllI()SynapseXen_llIIliiiiiiilllIl[376676081]=SynapseXen_IilliIIliiliiIlIllI(SynapseXen_lillIIIiIIiilIlIllI(),SynapseXen_llIliIlIi[3870702091]or(function()local SynapseXen_IliIIiIilIl="SYNAPSE XEN [FE BYPASS] [BETTER THEN LURAPH] [AMAZING] OMG OMG OMG !!!!!!"SynapseXen_llIliIlIi[3870702091]=SynapseXen_IilliIIliiliiIlIllI(SynapseXen_ilIilIlIlili(412999501,2853676784),SynapseXen_IilliIIliiliiIlIllI(1226921876,SynapseXen_lIlil[6]))-string.len(SynapseXen_IliIIiIilIl)-#{49597686,2985765399}return SynapseXen_llIliIlIi[3870702091]end)())SynapseXen_IllIliliIlli()SynapseXen_lillIIIiIIiilIlIllI()SynapseXen_llIIliiiiiiilllIl[1118284126]=SynapseXen_IilliIIliiliiIlIllI(SynapseXen_lillIIIiIIiilIlIllI(),SynapseXen_llIliIlIi[1818314407]or(function(...)local SynapseXen_IliIIiIilIl="hi xen crashes on my axon paste plz help"local SynapseXen_lilIillIl=SynapseXen_ilIilIlIlili(3270722026,3915065877)local SynapseXen_IiiIiIl={...}for SynapseXen_lIIiIii,SynapseXen_IiIIliIiIlIlii in pairs(SynapseXen_IiiIiIl)do local SynapseXen_iIiiIiIlilIII;local SynapseXen_iliIIiIIlI=type(SynapseXen_IiIIliIiIlIlii)if SynapseXen_iliIIiIIlI=="number"then SynapseXen_iIiiIiIlilIII=SynapseXen_IiIIliIiIlIlii elseif SynapseXen_iliIIiIIlI=="string"then SynapseXen_iIiiIiIlilIII=SynapseXen_IiIIliIiIlIlii:len()elseif SynapseXen_iliIIiIIlI=="table"then SynapseXen_iIiiIiIlilIII=SynapseXen_ilIilIlIlili(3592321035,3592325815)end;SynapseXen_lilIillIl=SynapseXen_lilIillIl+SynapseXen_iIiiIiIlilIII end;SynapseXen_llIliIlIi[1818314407]=SynapseXen_IilliIIliiliiIlIllI(SynapseXen_IilliIIliiliiIlIllI(24710195,SynapseXen_lilIillIl),SynapseXen_IilliIIliiliiIlIllI(2028659845,SynapseXen_lIlil[3]))-string.len(SynapseXen_IliIIiIilIl)-#{3071348511}return SynapseXen_llIliIlIi[1818314407]end)("lIilIllIiliIiiiIii","liIIIiil"))SynapseXen_lillIIIiIIiilIlIllI()SynapseXen_lillIIIiIIiilIlIllI()for SynapseXen_iIllli=1,SynapseXen_IilliIIliiliiIlIllI(SynapseXen_ilIiiIIiIIIli(),SynapseXen_llIliIlIi[603181970]or(function(...)local SynapseXen_IliIIiIilIl="can we have an f in chat for ripull"local SynapseXen_lilIillIl=SynapseXen_ilIilIlIlili(3464890966,3497509853)local SynapseXen_IiiIiIl={...}for SynapseXen_lIIiIii,SynapseXen_IiIIliIiIlIlii in pairs(SynapseXen_IiiIiIl)do local SynapseXen_iIiiIiIlilIII;local SynapseXen_iliIIiIIlI=type(SynapseXen_IiIIliIiIlIlii)if SynapseXen_iliIIiIIlI=="number"then SynapseXen_iIiiIiIlilIII=SynapseXen_IiIIliIiIlIlii elseif SynapseXen_iliIIiIIlI=="string"then SynapseXen_iIiiIiIlilIII=SynapseXen_IiIIliIiIlIlii:len()elseif SynapseXen_iliIIiIIlI=="table"then SynapseXen_iIiiIiIlilIII=SynapseXen_ilIilIlIlili(2603839679,2603830270)end;SynapseXen_lilIillIl=SynapseXen_lilIillIl-SynapseXen_iIiiIiIlilIII end;SynapseXen_llIliIlIi[603181970]=SynapseXen_IilliIIliiliiIlIllI(SynapseXen_IilliIIliiliiIlIllI(3035857437,SynapseXen_lilIillIl),SynapseXen_IilliIIliiliiIlIllI(1123815028,SynapseXen_iiiIiiIiiiliIlii))-string.len(SynapseXen_IliIIiIilIl)-#{1929285935,157501908,3958222060,4231691105,3364065287,3504770727}return SynapseXen_llIliIlIi[603181970]end)({},{},8350,9858,6244))do local SynapseXen_iIiiiIliIlIlIll=SynapseXen_IilliIIliiliiIlIllI(SynapseXen_IllIliliIlli(),SynapseXen_llIliIlIi[3905001932]or(function()local SynapseXen_IliIIiIilIl="print(bytecode)"SynapseXen_llIliIlIi[3905001932]=SynapseXen_IilliIIliiliiIlIllI(SynapseXen_ilIilIlIlili(2356704231,2533048077),SynapseXen_IilliIIliiliiIlIllI(318735886,SynapseXen_iiiIiiIiiiliIlii))-string.len(SynapseXen_IliIIiIilIl)-#{1818748642,572074973,3275473865,1920630721,1878140651,1793494763,1106270188,2898972271,3412415026}return SynapseXen_llIliIlIi[3905001932]end)())local SynapseXen_IIiIilillilililiIili=SynapseXen_lillIIIiIIiilIlIllI()SynapseXen_IllIliliIlli()local SynapseXen_iiIliIi=SynapseXen_lillIIIiIIiilIlIllI()SynapseXen_lillIIIiIIiilIlIllI()local SynapseXen_iiiiIllill={[1957859473]=SynapseXen_iIiiiIliIlIlIll,[583017039]=SynapseXen_IIiIilillilililiIili,[806424001]=SynapseXen_illiIiI(SynapseXen_iIiiiIliIlIlIll,1,6),[1425497348]=SynapseXen_illiIiI(SynapseXen_iIiiiIliIlIlIll,7,14)}if SynapseXen_iiIliIi==(SynapseXen_llIliIlIi[425908409]or(function(...)local SynapseXen_IliIIiIilIl="this is so sad, alexa play ripull.mp4"local SynapseXen_lilIillIl=SynapseXen_ilIilIlIlili(3509394740,2793608001)local SynapseXen_IiiIiIl={...}for SynapseXen_lIIiIii,SynapseXen_IiIIliIiIlIlii in pairs(SynapseXen_IiiIiIl)do local SynapseXen_iIiiIiIlilIII;local SynapseXen_iliIIiIIlI=type(SynapseXen_IiIIliIiIlIlii)if SynapseXen_iliIIiIIlI=="number"then SynapseXen_iIiiIiIlilIII=SynapseXen_IiIIliIiIlIlii elseif SynapseXen_iliIIiIIlI=="string"then SynapseXen_iIiiIiIlilIII=SynapseXen_IiIIliIiIlIlii:len()elseif SynapseXen_iliIIiIIlI=="table"then SynapseXen_iIiiIiIlilIII=SynapseXen_ilIilIlIlili(3994602243,3994541647)end;SynapseXen_lilIillIl=SynapseXen_lilIillIl+SynapseXen_iIiiIiIlilIII end;SynapseXen_llIliIlIi[425908409]=SynapseXen_IilliIIliiliiIlIllI(SynapseXen_IilliIIliiliiIlIllI(2008818049,SynapseXen_lilIillIl),SynapseXen_IilliIIliiliiIlIllI(352502139,SynapseXen_lIlil[1]))-string.len(SynapseXen_IliIIiIilIl)-#{2566857522,3060076198,769943476,4230184551,470963405,1905483783,3000181566,3061357229,1718108103}return SynapseXen_llIliIlIi[425908409]end)({},9239))then SynapseXen_iiiiIllill[1713189260]=SynapseXen_illiIiI(SynapseXen_iIiiiIliIlIlIll,24,32)SynapseXen_iiiiIllill[215057416]=SynapseXen_illiIiI(SynapseXen_iIiiiIliIlIlIll,15,23)elseif SynapseXen_iiIliIi==(SynapseXen_llIliIlIi[257256426]or(function(...)local SynapseXen_IliIIiIilIl="skisploit is the superior obfuscator, clearly."local SynapseXen_lilIillIl=SynapseXen_ilIilIlIlili(4039765170,4218250436)local SynapseXen_IiiIiIl={...}for SynapseXen_lIIiIii,SynapseXen_IiIIliIiIlIlii in pairs(SynapseXen_IiiIiIl)do local SynapseXen_iIiiIiIlilIII;local SynapseXen_iliIIiIIlI=type(SynapseXen_IiIIliIiIlIlii)if SynapseXen_iliIIiIIlI=="number"then SynapseXen_iIiiIiIlilIII=SynapseXen_IiIIliIiIlIlii elseif SynapseXen_iliIIiIIlI=="string"then SynapseXen_iIiiIiIlilIII=SynapseXen_IiIIliIiIlIlii:len()elseif SynapseXen_iliIIiIIlI=="table"then SynapseXen_iIiiIiIlilIII=SynapseXen_ilIilIlIlili(784789195,784726613)end;SynapseXen_lilIillIl=SynapseXen_lilIillIl-SynapseXen_iIiiIiIlilIII end;SynapseXen_llIliIlIi[257256426]=SynapseXen_IilliIIliiliiIlIllI(SynapseXen_IilliIIliiliiIlIllI(3920424541,SynapseXen_lilIillIl),SynapseXen_IilliIIliiliiIlIllI(2890045814,SynapseXen_lIlil[8]))-string.len(SynapseXen_IliIIiIilIl)-#{2038484710,673340535,469398993}return SynapseXen_llIliIlIi[257256426]end)({},12599,{},{}))then SynapseXen_iiiiIllill[1782830286]=SynapseXen_illiIiI(SynapseXen_iIiiiIliIlIlIll,15,32)elseif SynapseXen_iiIliIi==(SynapseXen_llIliIlIi[3862003699]or(function()local SynapseXen_IliIIiIilIl="double-header fair! this rationalization has a overenthusiastically anticheat! you will get nonpermissible for exploiting!"SynapseXen_llIliIlIi[3862003699]=SynapseXen_IilliIIliiliiIlIllI(SynapseXen_ilIilIlIlili(528304291,4219075879),SynapseXen_IilliIIliiliiIlIllI(3279589768,SynapseXen_lIlil[4]))-string.len(SynapseXen_IliIIiIilIl)-#{4220308228,1598070108,61773908,1380773219,2307063900}return SynapseXen_llIliIlIi[3862003699]end)())then SynapseXen_iiiiIllill[302231661]=SynapseXen_illiIiI(SynapseXen_iIiiiIliIlIlIll,15,32)-131071 end;SynapseXen_llliililiIIlliI[SynapseXen_iIllli]=SynapseXen_iiiiIllill end;SynapseXen_IllIliliIlli()SynapseXen_lillIIIiIIiilIlIllI()for SynapseXen_iIllli=1,SynapseXen_IilliIIliiliiIlIllI(SynapseXen_ilIiiIIiIIIli(),SynapseXen_llIliIlIi[2138426251]or(function()local SynapseXen_IliIIiIilIl="xen detects custom getfenv"SynapseXen_llIliIlIi[2138426251]=SynapseXen_IilliIIliiliiIlIllI(SynapseXen_ilIilIlIlili(1065451881,2330101327),SynapseXen_IilliIIliiliiIlIllI(3066400838,SynapseXen_iiiIiiIiiiliIlii))-string.len(SynapseXen_IliIIiIilIl)-#{2423875732,1370880816,1282114991}return SynapseXen_llIliIlIi[2138426251]end)())do local SynapseXen_iiIliIi=SynapseXen_lillIIIiIIiilIlIllI()SynapseXen_IllIliliIlli()local SynapseXen_llllIIiIliIilIiIIlIi;if SynapseXen_iiIliIi==(SynapseXen_llIliIlIi[249070187]or(function()local SynapseXen_IliIIiIilIl="xen best rerubi paste"SynapseXen_llIliIlIi[249070187]=SynapseXen_IilliIIliiliiIlIllI(SynapseXen_ilIilIlIlili(205967232,2663146347),SynapseXen_IilliIIliiliiIlIllI(395571419,SynapseXen_iiiIiiIiiiliIlii))-string.len(SynapseXen_IliIIiIilIl)-#{3623147215}return SynapseXen_llIliIlIi[249070187]end)())then SynapseXen_llllIIiIliIilIiIIlIi=SynapseXen_lillIIIiIIiilIlIllI()~=0 elseif SynapseXen_iiIliIi==(SynapseXen_llIliIlIi[203771719]or(function(...)local SynapseXen_IliIIiIilIl="wait for someone on devforum to say they are gonna deobfuscate this"local SynapseXen_lilIillIl=SynapseXen_ilIilIlIlili(1639268121,2821238486)local SynapseXen_IiiIiIl={...}for SynapseXen_lIIiIii,SynapseXen_IiIIliIiIlIlii in pairs(SynapseXen_IiiIiIl)do local SynapseXen_iIiiIiIlilIII;local SynapseXen_iliIIiIIlI=type(SynapseXen_IiIIliIiIlIlii)if SynapseXen_iliIIiIIlI=="number"then SynapseXen_iIiiIiIlilIII=SynapseXen_IiIIliIiIlIlii elseif SynapseXen_iliIIiIIlI=="string"then SynapseXen_iIiiIiIlilIII=SynapseXen_IiIIliIiIlIlii:len()elseif SynapseXen_iliIIiIIlI=="table"then SynapseXen_iIiiIiIlilIII=SynapseXen_ilIilIlIlili(1240308787,1240248437)end;SynapseXen_lilIillIl=SynapseXen_lilIillIl-SynapseXen_iIiiIiIlilIII end;SynapseXen_llIliIlIi[203771719]=SynapseXen_IilliIIliiliiIlIllI(SynapseXen_IilliIIliiliiIlIllI(3773425002,SynapseXen_lilIillIl),SynapseXen_IilliIIliiliiIlIllI(656807493,SynapseXen_lIlil[7]))-string.len(SynapseXen_IliIIiIilIl)-#{1771280871,4286171383,1670136595,2370646072}return SynapseXen_llIliIlIi[203771719]end)({},"IlIIillIliIIl",{},"iliiiIllilIliIiiIi"))then SynapseXen_llllIIiIliIilIiIIlIi=SynapseXen_iIIiIIlliiIllI()elseif SynapseXen_iiIliIi==(SynapseXen_llIliIlIi[1113417222]or(function(...)local SynapseXen_IliIIiIilIl="sponsored by ironbrew, jk xen is better"local SynapseXen_lilIillIl=SynapseXen_ilIilIlIlili(945324120,2918154601)local SynapseXen_IiiIiIl={...}for SynapseXen_lIIiIii,SynapseXen_IiIIliIiIlIlii in pairs(SynapseXen_IiiIiIl)do local SynapseXen_iIiiIiIlilIII;local SynapseXen_iliIIiIIlI=type(SynapseXen_IiIIliIiIlIlii)if SynapseXen_iliIIiIIlI=="number"then SynapseXen_iIiiIiIlilIII=SynapseXen_IiIIliIiIlIlii elseif SynapseXen_iliIIiIIlI=="string"then SynapseXen_iIiiIiIlilIII=SynapseXen_IiIIliIiIlIlii:len()elseif SynapseXen_iliIIiIIlI=="table"then SynapseXen_iIiiIiIlilIII=SynapseXen_ilIilIlIlili(809523008,809527841)end;SynapseXen_lilIillIl=SynapseXen_lilIillIl+SynapseXen_iIiiIiIlilIII end;SynapseXen_llIliIlIi[1113417222]=SynapseXen_IilliIIliiliiIlIllI(SynapseXen_IilliIIliiliiIlIllI(2726479289,SynapseXen_lilIillIl),SynapseXen_IilliIIliiliiIlIllI(2992604649,SynapseXen_iiiIiiIiiiliIlii))-string.len(SynapseXen_IliIIiIilIl)-#{2627314449,3284348228,4281233527,838364285,241831361,1498992489}return SynapseXen_llIliIlIi[1113417222]end)(909,"il","IilillIl",{},{},"lIiiIIIIIiiIIlIi",5613,"lIliIiIlIIilllII",9251,{}))then SynapseXen_llllIIiIliIilIiIIlIi=SynapseXen_iIIiIlIlI(SynapseXen_IIIiIill(SynapseXen_llliiIl()),1,-2)end;SynapseXen_lIIiIIIIili[SynapseXen_iIllli-1]=SynapseXen_llllIIiIliIilIiIIlIi end;SynapseXen_lillIIIiIIiilIlIllI()for SynapseXen_iIllli=1,SynapseXen_IilliIIliiliiIlIllI(SynapseXen_ilIiiIIiIIIli(),SynapseXen_llIliIlIi[1207344196]or(function()local SynapseXen_IliIIiIilIl="yed"SynapseXen_llIliIlIi[1207344196]=SynapseXen_IilliIIliiliiIlIllI(SynapseXen_ilIilIlIlili(3735164298,1067066494),SynapseXen_IilliIIliiliiIlIllI(450193780,SynapseXen_lIlil[6]))-string.len(SynapseXen_IliIIiIilIl)-#{2718196261,3164078334,2823792402,2308632190,1145312442,3399911833}return SynapseXen_llIliIlIi[1207344196]end)())do SynapseXen_IlIllI[SynapseXen_iIllli-1]=SynapseXen_IliIilIlliIlIIliIiIl()end;return SynapseXen_llIIliiiiiiilllIl end;do assert(SynapseXen_llliiIl(4)=="\27Xen","Synapse Xen - Failed to verify bytecode. Please make sure your Lua implementation supports non-null terminated strings.")SynapseXen_ilIiiIIiIIIli=SynapseXen_IllIliliIlli;SynapseXen_llIiIlIlIiIIiIliiii=SynapseXen_IllIliliIlli;local SynapseXen_IIililIiiIiIli=SynapseXen_llliiIl()SynapseXen_lillIIIiIIiilIlIllI()SynapseXen_IllIliliIlli()SynapseXen_iiiIiiIiiiliIlii=SynapseXen_iIIIiIIliil(SynapseXen_ilIiiIIiIIIli())SynapseXen_lillIIIiIIiilIlIllI()SynapseXen_lillIIIiIIiilIlIllI()local SynapseXen_iliIiiliilIiIIIllIii=0;for SynapseXen_lIIiIii=1,#SynapseXen_IIililIiiIiIli do local SynapseXen_IllIii=SynapseXen_IIililIiiIiIli:sub(SynapseXen_lIIiIii,SynapseXen_lIIiIii)SynapseXen_iliIiiliilIiIIIllIii=SynapseXen_iliIiiliilIiIIIllIii+string.byte(SynapseXen_IllIii)end;SynapseXen_iliIiiliilIiIIIllIii=SynapseXen_IilliIIliiliiIlIllI(SynapseXen_iliIiiliilIiIIIllIii,SynapseXen_iiiIiiIiiiliIlii)for SynapseXen_iIllli=1,SynapseXen_lillIIIiIIiilIlIllI()do SynapseXen_lIlil[SynapseXen_iIllli]=SynapseXen_ilIil(SynapseXen_ilIiiIIiIIIli(),SynapseXen_iliIiiliilIiIIIllIii)end;SynapseXen_lIiIIIili()end;return SynapseXen_IliIilIlliIlIIliIiIl()end;local function SynapseXen_IlIIIiIliII(...)return SynapseXen_llIilIllIl('#',...),{...}end;local function SynapseXen_IlIli(SynapseXen_llIIliiiiiiilllIl,SynapseXen_IillilliiilIiIiIiI,SynapseXen_lIiilIiiiiiIiIllii)local SynapseXen_lIIiIIIIili=SynapseXen_llIIliiiiiiilllIl[SynapseXen_llIliIlIi[643681148]or(function()local SynapseXen_IliIIiIilIl="xen doesn't come with instance caching, sorry superskater"SynapseXen_llIliIlIi[643681148]=SynapseXen_IilliIIliiliiIlIllI(SynapseXen_ilIilIlIlili(1751191139,794150120),SynapseXen_IilliIIliiliiIlIllI(3841462054,SynapseXen_lIlil[2]))-string.len(SynapseXen_IliIIiIilIl)-#{680366189,216081859}return SynapseXen_llIliIlIi[643681148]end)()]local SynapseXen_llliililiIIlliI=SynapseXen_llIIliiiiiiilllIl[SynapseXen_llIliIlIi[3281982398]or(function()local SynapseXen_IliIIiIilIl="inb4 posted on exploit reports section"SynapseXen_llIliIlIi[3281982398]=SynapseXen_IilliIIliiliiIlIllI(SynapseXen_ilIilIlIlili(4187816015,1373190309),SynapseXen_IilliIIliiliiIlIllI(4223788499,SynapseXen_lIlil[3]))-string.len(SynapseXen_IliIIiIilIl)-#{2264933963,3087898474}return SynapseXen_llIliIlIi[3281982398]end)()]local SynapseXen_IlIllI=SynapseXen_llIIliiiiiiilllIl[SynapseXen_llIliIlIi[3742538869]or(function()local SynapseXen_IliIIiIilIl="pain exist is gonna connect the dots of xen"SynapseXen_llIliIlIi[3742538869]=SynapseXen_IilliIIliiliiIlIllI(SynapseXen_ilIilIlIlili(713247319,3594413428),SynapseXen_IilliIIliiliiIlIllI(2782667149,SynapseXen_lIlil[8]))-string.len(SynapseXen_IliIIiIilIl)-#{2240102350,699382134,3756111006,3200218365,54807670}return SynapseXen_llIliIlIi[3742538869]end)()]return function(...)local SynapseXen_IliiiIlliil,SynapseXen_iIiIIiil=1,-1;local SynapseXen_iillliIlIililll,SynapseXen_IIIIilIiI={},SynapseXen_llIilIllIl('#',...)-1;local SynapseXen_iilliilI=0;local SynapseXen_lillIilIiil={}local SynapseXen_liilIliIilIll={}local SynapseXen_IliIlIiillIIlliil=setmetatable({},{__index=SynapseXen_lillIilIiil,__newindex=function(SynapseXen_lIlIll,SynapseXen_Illii,SynapseXen_lIiIliiiIIillIilliI)if SynapseXen_Illii>SynapseXen_iIiIIiil then SynapseXen_iIiIIiil=SynapseXen_Illii end;SynapseXen_lillIilIiil[SynapseXen_Illii]=SynapseXen_lIiIliiiIIillIilliI end})local function SynapseXen_IIiililiiliiIll()local SynapseXen_iiiiIllill,SynapseXen_liIliIliiliili;while true do SynapseXen_iiiiIllill=SynapseXen_llliililiIIlliI[SynapseXen_IliiiIlliil]SynapseXen_liIliIliiliili=SynapseXen_iiiiIllill[583017039]SynapseXen_IliiiIlliil=SynapseXen_IliiiIlliil+1;if SynapseXen_liIliIliiliili==112 then SynapseXen_iilliilI=SynapseXen_IliIlIiillIIlliil[SynapseXen_IilliIIliiliiIlIllI(SynapseXen_iiiiIllill[1425497348],41)]elseif SynapseXen_liIliIliiliili==40 then SynapseXen_IliIlIiillIIlliil[SynapseXen_lilIiiiIliiiIiIlIiI(SynapseXen_lilIiiiIliiiIiIlIiI(SynapseXen_iiiiIllill[1425497348],33,256),SynapseXen_iilliilI,256)]=SynapseXen_lIIiIIIIili[SynapseXen_lilIiiiIliiiIiIlIiI(SynapseXen_iiiiIllill[1782830286],191212,262144)]elseif SynapseXen_liIliIliiliili==249 then local SynapseXen_lIliIIiIliiIIlliill=SynapseXen_lilIiiiIliiiIiIlIiI(SynapseXen_iiiiIllill[1713189260],126,512)local SynapseXen_IllIii=SynapseXen_IilliIIliiliiIlIllI(SynapseXen_IilliIIliiliiIlIllI(SynapseXen_iiiiIllill[215057416],120),SynapseXen_iilliilI)local SynapseXen_IlIllI=SynapseXen_IliIlIiillIIlliil;if SynapseXen_lIliIIiIliiIIlliill>255 then SynapseXen_lIliIIiIliiIIlliill=SynapseXen_lIIiIIIIili[SynapseXen_lIliIIiIliiIIlliill-256]else SynapseXen_lIliIIiIliiIIlliill=SynapseXen_IlIllI[SynapseXen_lIliIIiIliiIIlliill]end;if SynapseXen_IllIii>255 then SynapseXen_IllIii=SynapseXen_lIIiIIIIili[SynapseXen_IllIii-256]else SynapseXen_IllIii=SynapseXen_IlIllI[SynapseXen_IllIii]end;SynapseXen_IlIllI[SynapseXen_iIiliIIIIlIIilillIl(SynapseXen_iiiiIllill[1425497348],111,256)]=SynapseXen_lIliIIiIliiIIlliill+SynapseXen_IllIii elseif SynapseXen_liIliIliiliili==61 then local SynapseXen_lliiIIill=SynapseXen_lilIiiiIliiiIiIlIiI(SynapseXen_iiiiIllill[1425497348],67,256)local SynapseXen_IlIllI=SynapseXen_IliIlIiillIIlliil;local SynapseXen_IiiiilIiIlllIl=SynapseXen_IlIllI[SynapseXen_lliiIIill+2]local SynapseXen_illllIlIl=SynapseXen_IlIllI[SynapseXen_lliiIIill]+SynapseXen_IiiiilIiIlllIl;SynapseXen_IlIllI[SynapseXen_lliiIIill]=SynapseXen_illllIlIl;if SynapseXen_IiiiilIiIlllIl>0 then if SynapseXen_illllIlIl<=SynapseXen_IlIllI[SynapseXen_lliiIIill+1]then SynapseXen_IliiiIlliil=SynapseXen_IliiiIlliil+SynapseXen_iiiiIllill[302231661]SynapseXen_IlIllI[SynapseXen_lliiIIill+3]=SynapseXen_illllIlIl end else if SynapseXen_illllIlIl>=SynapseXen_IlIllI[SynapseXen_lliiIIill+1]then SynapseXen_IliiiIlliil=SynapseXen_IliiiIlliil+SynapseXen_iiiiIllill[302231661]SynapseXen_IlIllI[SynapseXen_lliiIIill+3]=SynapseXen_illllIlIl end end elseif SynapseXen_liIliIliiliili==91 then SynapseXen_IliIlIiillIIlliil[SynapseXen_IilliIIliiliiIlIllI(SynapseXen_lilIiiiIliiiIiIlIiI(SynapseXen_iiiiIllill[1425497348],48,256),SynapseXen_iilliilI)]={}elseif SynapseXen_liIliIliiliili==0 then local SynapseXen_lIliIIiIliiIIlliill,SynapseXen_IllIii=SynapseXen_IilliIIliiliiIlIllI(SynapseXen_iiiiIllill[1713189260],30),SynapseXen_iIiliIIIIlIIilillIl(SynapseXen_iiiiIllill[215057416],75,512)local SynapseXen_IlIllI=SynapseXen_IliIlIiillIIlliil;if SynapseXen_lIliIIiIliiIIlliill>255 then SynapseXen_lIliIIiIliiIIlliill=SynapseXen_lIIiIIIIili[SynapseXen_lIliIIiIliiIIlliill-256]else SynapseXen_lIliIIiIliiIIlliill=SynapseXen_IlIllI[SynapseXen_lIliIIiIliiIIlliill]end;if SynapseXen_IllIii>255 then SynapseXen_IllIii=SynapseXen_lIIiIIIIili[SynapseXen_IllIii-256]else SynapseXen_IllIii=SynapseXen_IlIllI[SynapseXen_IllIii]end;SynapseXen_IlIllI[SynapseXen_iIiliIIIIlIIilillIl(SynapseXen_iIiliIIIIlIIilillIl(SynapseXen_iiiiIllill[1425497348],110,256),SynapseXen_iilliilI,256)][SynapseXen_lIliIIiIliiIIlliill]=SynapseXen_IllIii elseif SynapseXen_liIliIliiliili==240 then SynapseXen_IliIlIiillIIlliil[SynapseXen_iIiliIIIIlIIilillIl(SynapseXen_iIiliIIIIlIIilillIl(SynapseXen_iiiiIllill[1425497348],49,256),SynapseXen_iilliilI,256)]=SynapseXen_IilliIIliiliiIlIllI(SynapseXen_iiiiIllill[1713189260],0)~=0;if SynapseXen_IilliIIliiliiIlIllI(SynapseXen_iiiiIllill[215057416],89)~=0 then SynapseXen_IliiiIlliil=SynapseXen_IliiiIlliil+1 end elseif SynapseXen_liIliIliiliili==217 then local SynapseXen_lliiIIill=SynapseXen_iIiliIIIIlIIilillIl(SynapseXen_iiiiIllill[1425497348],109,256)local SynapseXen_IllIii=SynapseXen_iIiliIIIIlIIilillIl(SynapseXen_iiiiIllill[215057416],58,512)local SynapseXen_IlIllI=SynapseXen_IliIlIiillIIlliil;local SynapseXen_llIliiiIlllIiill=SynapseXen_lliiIIill+2;local SynapseXen_iIliillIIli={SynapseXen_IlIllI[SynapseXen_lliiIIill](SynapseXen_IlIllI[SynapseXen_lliiIIill+1],SynapseXen_IlIllI[SynapseXen_lliiIIill+2])}for SynapseXen_iIllli=1,SynapseXen_IllIii do SynapseXen_IliIlIiillIIlliil[SynapseXen_llIliiiIlllIiill+SynapseXen_iIllli]=SynapseXen_iIliillIIli[SynapseXen_iIllli]end;if SynapseXen_IlIllI[SynapseXen_lliiIIill+3]~=nil then SynapseXen_IlIllI[SynapseXen_lliiIIill+2]=SynapseXen_IlIllI[SynapseXen_lliiIIill+3]else SynapseXen_IliiiIlliil=SynapseXen_IliiiIlliil+1 end elseif SynapseXen_liIliIliiliili==45 then local SynapseXen_lliiIIill=SynapseXen_IilliIIliiliiIlIllI(SynapseXen_iiiiIllill[1425497348],66)local SynapseXen_lIliIIiIliiIIlliill=SynapseXen_IilliIIliiliiIlIllI(SynapseXen_iIiliIIIIlIIilillIl(SynapseXen_iiiiIllill[1713189260],62,512),SynapseXen_iilliilI)local SynapseXen_IllIii=SynapseXen_IilliIIliiliiIlIllI(SynapseXen_iiiiIllill[215057416],110)local SynapseXen_IlIllI=SynapseXen_IliIlIiillIIlliil;SynapseXen_lIliIIiIliiIIlliill=SynapseXen_IlIllI[SynapseXen_lIliIIiIliiIIlliill]if SynapseXen_IllIii>255 then SynapseXen_IllIii=SynapseXen_lIIiIIIIili[SynapseXen_IllIii-256]else SynapseXen_IllIii=SynapseXen_IlIllI[SynapseXen_IllIii]end;SynapseXen_IlIllI[SynapseXen_lliiIIill+1]=SynapseXen_lIliIIiIliiIIlliill;SynapseXen_IlIllI[SynapseXen_lliiIIill]=SynapseXen_lIliIIiIliiIIlliill[SynapseXen_IllIii]elseif SynapseXen_liIliIliiliili==4 then local SynapseXen_IlIllI=SynapseXen_IliIlIiillIIlliil;local SynapseXen_lIliIIiIliiIIlliill=SynapseXen_iIiliIIIIlIIilillIl(SynapseXen_iiiiIllill[1713189260],41,512)local SynapseXen_IIIiiilili=SynapseXen_IlIllI[SynapseXen_lIliIIiIliiIIlliill]for SynapseXen_iIllli=SynapseXen_lIliIIiIliiIIlliill+1,SynapseXen_IilliIIliiliiIlIllI(SynapseXen_iIiliIIIIlIIilillIl(SynapseXen_iiiiIllill[215057416],92,512),SynapseXen_iilliilI)do SynapseXen_IIIiiilili=SynapseXen_IIIiiilili..SynapseXen_IlIllI[SynapseXen_iIllli]end;SynapseXen_IliIlIiillIIlliil[SynapseXen_iIiliIIIIlIIilillIl(SynapseXen_iiiiIllill[1425497348],45,256)]=SynapseXen_IIIiiilili elseif SynapseXen_liIliIliiliili==103 then SynapseXen_lIiilIiiiiiIiIllii[SynapseXen_lilIiiiIliiiIiIlIiI(SynapseXen_lilIiiiIliiiIiIlIiI(SynapseXen_iiiiIllill[1713189260],9,512),SynapseXen_iilliilI,512)]=SynapseXen_IliIlIiillIIlliil[SynapseXen_iIiliIIIIlIIilillIl(SynapseXen_iiiiIllill[1425497348],51,256)]elseif SynapseXen_liIliIliiliili==32 then local SynapseXen_lIliIIiIliiIIlliill=SynapseXen_iIiliIIIIlIIilillIl(SynapseXen_iiiiIllill[1713189260],28,512)local SynapseXen_IllIii=SynapseXen_iIiliIIIIlIIilillIl(SynapseXen_IilliIIliiliiIlIllI(SynapseXen_iiiiIllill[215057416],35),SynapseXen_iilliilI,512)local SynapseXen_IlIllI=SynapseXen_IliIlIiillIIlliil;if SynapseXen_lIliIIiIliiIIlliill>255 then SynapseXen_lIliIIiIliiIIlliill=SynapseXen_lIIiIIIIili[SynapseXen_lIliIIiIliiIIlliill-256]else SynapseXen_lIliIIiIliiIIlliill=SynapseXen_IlIllI[SynapseXen_lIliIIiIliiIIlliill]end;if SynapseXen_IllIii>255 then SynapseXen_IllIii=SynapseXen_lIIiIIIIili[SynapseXen_IllIii-256]else SynapseXen_IllIii=SynapseXen_IlIllI[SynapseXen_IllIii]end;SynapseXen_IlIllI[SynapseXen_IilliIIliiliiIlIllI(SynapseXen_iiiiIllill[1425497348],48)]=SynapseXen_lIliIIiIliiIIlliill-SynapseXen_IllIii elseif SynapseXen_liIliIliiliili==133 then local SynapseXen_lIliIIiIliiIIlliill=SynapseXen_iIiliIIIIlIIilillIl(SynapseXen_IilliIIliiliiIlIllI(SynapseXen_iiiiIllill[1713189260],10),SynapseXen_iilliilI,512)local SynapseXen_IllIii=SynapseXen_iIiliIIIIlIIilillIl(SynapseXen_iiiiIllill[215057416],104,512)local SynapseXen_IlIllI=SynapseXen_IliIlIiillIIlliil;if SynapseXen_lIliIIiIliiIIlliill>255 then SynapseXen_lIliIIiIliiIIlliill=SynapseXen_lIIiIIIIili[SynapseXen_lIliIIiIliiIIlliill-256]else SynapseXen_lIliIIiIliiIIlliill=SynapseXen_IlIllI[SynapseXen_lIliIIiIliiIIlliill]end;if SynapseXen_IllIii>255 then SynapseXen_IllIii=SynapseXen_lIIiIIIIili[SynapseXen_IllIii-256]else SynapseXen_IllIii=SynapseXen_IlIllI[SynapseXen_IllIii]end;SynapseXen_IlIllI[SynapseXen_iIiliIIIIlIIilillIl(SynapseXen_iiiiIllill[1425497348],54,256)]=SynapseXen_lIliIIiIliiIIlliill*SynapseXen_IllIii elseif SynapseXen_liIliIliiliili==37 then SynapseXen_IliIlIiillIIlliil[SynapseXen_IilliIIliiliiIlIllI(SynapseXen_iiiiIllill[1425497348],12)]=SynapseXen_IliIlIiillIIlliil[SynapseXen_IilliIIliiliiIlIllI(SynapseXen_iiiiIllill[1713189260],68)]elseif SynapseXen_liIliIliiliili==169 then local SynapseXen_lliiIIill=SynapseXen_iIiliIIIIlIIilillIl(SynapseXen_iiiiIllill[1425497348],121,256)local SynapseXen_lIliIIiIliiIIlliill=SynapseXen_IilliIIliiliiIlIllI(SynapseXen_iIiliIIIIlIIilillIl(SynapseXen_iiiiIllill[1713189260],115,512),SynapseXen_iilliilI)local SynapseXen_IlIllI=SynapseXen_IliIlIiillIIlliil;local SynapseXen_iliiiiiIlIiiliI,SynapseXen_liIlilllliillIiIlliI;local SynapseXen_IliiIlIIllliIliilil;if SynapseXen_lIliIIiIliiIIlliill==1 then return elseif SynapseXen_lIliIIiIliiIIlliill==0 then SynapseXen_IliiIlIIllliIliilil=SynapseXen_iIiIIiil else SynapseXen_IliiIlIIllliIliilil=SynapseXen_lliiIIill+SynapseXen_lIliIIiIliiIIlliill-2 end;SynapseXen_liIlilllliillIiIlliI={}SynapseXen_iliiiiiIlIiiliI=0;for SynapseXen_iIllli=SynapseXen_lliiIIill,SynapseXen_IliiIlIIllliIliilil do SynapseXen_iliiiiiIlIiiliI=SynapseXen_iliiiiiIlIiiliI+1;SynapseXen_liIlilllliillIiIlliI[SynapseXen_iliiiiiIlIiiliI]=SynapseXen_IlIllI[SynapseXen_iIllli]end;return SynapseXen_liIlilllliillIiIlliI,SynapseXen_iliiiiiIlIiiliI elseif SynapseXen_liIliIliiliili==36 then local SynapseXen_lIliIIiIliiIIlliill=SynapseXen_iIiliIIIIlIIilillIl(SynapseXen_IilliIIliiliiIlIllI(SynapseXen_iiiiIllill[1713189260],58),SynapseXen_iilliilI,512)local SynapseXen_IllIii=SynapseXen_IilliIIliiliiIlIllI(SynapseXen_iiiiIllill[215057416],103)local SynapseXen_IlIllI=SynapseXen_IliIlIiillIIlliil;if SynapseXen_lIliIIiIliiIIlliill>255 then SynapseXen_lIliIIiIliiIIlliill=SynapseXen_lIIiIIIIili[SynapseXen_lIliIIiIliiIIlliill-256]else SynapseXen_lIliIIiIliiIIlliill=SynapseXen_IlIllI[SynapseXen_lIliIIiIliiIIlliill]end;if SynapseXen_IllIii>255 then SynapseXen_IllIii=SynapseXen_lIIiIIIIili[SynapseXen_IllIii-256]else SynapseXen_IllIii=SynapseXen_IlIllI[SynapseXen_IllIii]end;SynapseXen_IlIllI[SynapseXen_iIiliIIIIlIIilillIl(SynapseXen_iiiiIllill[1425497348],124,256)]=SynapseXen_lIliIIiIliiIIlliill/SynapseXen_IllIii elseif SynapseXen_liIliIliiliili==89 then local SynapseXen_lliiIIill=SynapseXen_iIiliIIIIlIIilillIl(SynapseXen_iIiliIIIIlIIilillIl(SynapseXen_iiiiIllill[1425497348],8,256),SynapseXen_iilliilI,256)~=0;local SynapseXen_lIliIIiIliiIIlliill=SynapseXen_lilIiiiIliiiIiIlIiI(SynapseXen_iiiiIllill[1713189260],17,512)local SynapseXen_IllIii=SynapseXen_IilliIIliiliiIlIllI(SynapseXen_iiiiIllill[215057416],103)local SynapseXen_IlIllI=SynapseXen_IliIlIiillIIlliil;if SynapseXen_lIliIIiIliiIIlliill>255 then SynapseXen_lIliIIiIliiIIlliill=SynapseXen_lIIiIIIIili[SynapseXen_lIliIIiIliiIIlliill-256]else SynapseXen_lIliIIiIliiIIlliill=SynapseXen_IlIllI[SynapseXen_lIliIIiIliiIIlliill]end;if SynapseXen_IllIii>255 then SynapseXen_IllIii=SynapseXen_lIIiIIIIili[SynapseXen_IllIii-256]else SynapseXen_IllIii=SynapseXen_IlIllI[SynapseXen_IllIii]end;if SynapseXen_lIliIIiIliiIIlliill<=SynapseXen_IllIii~=SynapseXen_lliiIIill then SynapseXen_IliiiIlliil=SynapseXen_IliiiIlliil+1 end elseif SynapseXen_liIliIliiliili==135 then local SynapseXen_lIliIIiIliiIIlliill=SynapseXen_iIiliIIIIlIIilillIl(SynapseXen_iiiiIllill[1713189260],105,512)local SynapseXen_IllIii=SynapseXen_iIiliIIIIlIIilillIl(SynapseXen_iIiliIIIIlIIilillIl(SynapseXen_iiiiIllill[215057416],99,512),SynapseXen_iilliilI,512)local SynapseXen_IlIllI=SynapseXen_IliIlIiillIIlliil;if SynapseXen_lIliIIiIliiIIlliill>255 then SynapseXen_lIliIIiIliiIIlliill=SynapseXen_lIIiIIIIili[SynapseXen_lIliIIiIliiIIlliill-256]else SynapseXen_lIliIIiIliiIIlliill=SynapseXen_IlIllI[SynapseXen_lIliIIiIliiIIlliill]end;if SynapseXen_IllIii>255 then SynapseXen_IllIii=SynapseXen_lIIiIIIIili[SynapseXen_IllIii-256]else SynapseXen_IllIii=SynapseXen_IlIllI[SynapseXen_IllIii]end;SynapseXen_IlIllI[SynapseXen_iIiliIIIIlIIilillIl(SynapseXen_iiiiIllill[1425497348],72,256)]=SynapseXen_lIliIIiIliiIIlliill%SynapseXen_IllIii elseif SynapseXen_liIliIliiliili==231 then SynapseXen_IliIlIiillIIlliil[SynapseXen_iIiliIIIIlIIilillIl(SynapseXen_iiiiIllill[1425497348],59,256)]=not SynapseXen_IliIlIiillIIlliil[SynapseXen_IilliIIliiliiIlIllI(SynapseXen_IilliIIliiliiIlIllI(SynapseXen_iiiiIllill[1713189260],59),SynapseXen_iilliilI)]elseif SynapseXen_liIliIliiliili==24 then local SynapseXen_lliiIIill=SynapseXen_lilIiiiIliiiIiIlIiI(SynapseXen_iiiiIllill[1425497348],54,256)~=0;local SynapseXen_lIliIIiIliiIIlliill=SynapseXen_lilIiiiIliiiIiIlIiI(SynapseXen_lilIiiiIliiiIiIlIiI(SynapseXen_iiiiIllill[1713189260],43,512),SynapseXen_iilliilI,512)local SynapseXen_IllIii=SynapseXen_iIiliIIIIlIIilillIl(SynapseXen_iiiiIllill[215057416],107,512)local SynapseXen_IlIllI=SynapseXen_IliIlIiillIIlliil;if SynapseXen_lIliIIiIliiIIlliill>255 then SynapseXen_lIliIIiIliiIIlliill=SynapseXen_lIIiIIIIili[SynapseXen_lIliIIiIliiIIlliill-256]else SynapseXen_lIliIIiIliiIIlliill=SynapseXen_IlIllI[SynapseXen_lIliIIiIliiIIlliill]end;if SynapseXen_IllIii>255 then SynapseXen_IllIii=SynapseXen_lIIiIIIIili[SynapseXen_IllIii-256]else SynapseXen_IllIii=SynapseXen_IlIllI[SynapseXen_IllIii]end;if SynapseXen_lIliIIiIliiIIlliill==SynapseXen_IllIii~=SynapseXen_lliiIIill then SynapseXen_IliiiIlliil=SynapseXen_IliiiIlliil+1 end elseif SynapseXen_liIliIliiliili==125 then SynapseXen_IliIlIiillIIlliil[SynapseXen_IilliIIliiliiIlIllI(SynapseXen_iiiiIllill[1425497348],56)]=SynapseXen_lIiilIiiiiiIiIllii[SynapseXen_IilliIIliiliiIlIllI(SynapseXen_iiiiIllill[1713189260],33)]elseif SynapseXen_liIliIliiliili==202 then local SynapseXen_lliiIIill=SynapseXen_IilliIIliiliiIlIllI(SynapseXen_iIiliIIIIlIIilillIl(SynapseXen_iiiiIllill[1425497348],34,256),SynapseXen_iilliilI)local SynapseXen_lIliIIiIliiIIlliill=SynapseXen_IilliIIliiliiIlIllI(SynapseXen_iiiiIllill[1713189260],55)local SynapseXen_IlIllI=SynapseXen_IliIlIiillIIlliil;local SynapseXen_IIllliIiiIiiiiIlI,SynapseXen_IIlIIiIilIllIII;local SynapseXen_IliiIlIIllliIliilil;local SynapseXen_illiliIliiIilIlIIi=0;SynapseXen_IIllliIiiIiiiiIlI={}if SynapseXen_lIliIIiIliiIIlliill~=1 then if SynapseXen_lIliIIiIliiIIlliill~=0 then SynapseXen_IliiIlIIllliIliilil=SynapseXen_lliiIIill+SynapseXen_lIliIIiIliiIIlliill-1 else SynapseXen_IliiIlIIllliIliilil=SynapseXen_iIiIIiil end;for SynapseXen_iIllli=SynapseXen_lliiIIill+1,SynapseXen_IliiIlIIllliIliilil do SynapseXen_IIllliIiiIiiiiIlI[#SynapseXen_IIllliIiiIiiiiIlI+1]=SynapseXen_IlIllI[SynapseXen_iIllli]end;SynapseXen_IIlIIiIilIllIII={SynapseXen_IlIllI[SynapseXen_lliiIIill](unpack(SynapseXen_IIllliIiiIiiiiIlI,1,SynapseXen_IliiIlIIllliIliilil-SynapseXen_lliiIIill))}else SynapseXen_IIlIIiIilIllIII={SynapseXen_IlIllI[SynapseXen_lliiIIill]()}end;for SynapseXen_illllIlIl in next,SynapseXen_IIlIIiIilIllIII do if SynapseXen_illllIlIl>SynapseXen_illiliIliiIilIlIIi then SynapseXen_illiliIliiIilIlIIi=SynapseXen_illllIlIl end end;return SynapseXen_IIlIIiIilIllIII,SynapseXen_illiliIliiIilIlIIi elseif SynapseXen_liIliIliiliili==81 then SynapseXen_IliIlIiillIIlliil[SynapseXen_lilIiiiIliiiIiIlIiI(SynapseXen_iiiiIllill[1425497348],82,256)]=SynapseXen_IillilliiilIiIiIiI[SynapseXen_lIIiIIIIili[SynapseXen_iIiliIIIIlIIilillIl(SynapseXen_iiiiIllill[1782830286],102551,262144)]]elseif SynapseXen_liIliIliiliili==95 then local SynapseXen_lliiIIill=SynapseXen_IilliIIliiliiIlIllI(SynapseXen_iiiiIllill[1425497348],2)local SynapseXen_lIliIIiIliiIIlliill=SynapseXen_IilliIIliiliiIlIllI(SynapseXen_iiiiIllill[1713189260],28)local SynapseXen_IlIllI,SynapseXen_lliliillIIIil=SynapseXen_IliIlIiillIIlliil,SynapseXen_iillliIlIililll;SynapseXen_iIiIIiil=SynapseXen_lliiIIill-1;for SynapseXen_iIllli=SynapseXen_lliiIIill,SynapseXen_lliiIIill+(SynapseXen_lIliIIiIliiIIlliill>0 and SynapseXen_lIliIIiIliiIIlliill-1 or SynapseXen_IIIIilIiI)do SynapseXen_IlIllI[SynapseXen_iIllli]=SynapseXen_lliliillIIIil[SynapseXen_iIllli-SynapseXen_lliiIIill]end elseif SynapseXen_liIliIliiliili==211 then local SynapseXen_lliiIIill=SynapseXen_IilliIIliiliiIlIllI(SynapseXen_iIiliIIIIlIIilillIl(SynapseXen_iiiiIllill[1425497348],29,256),SynapseXen_iilliilI)local SynapseXen_IlIllI=SynapseXen_IliIlIiillIIlliil;SynapseXen_IlIllI[SynapseXen_lliiIIill]=assert(tonumber(SynapseXen_IlIllI[SynapseXen_lliiIIill]),'`for` initial value must be a number')SynapseXen_IlIllI[SynapseXen_lliiIIill+1]=assert(tonumber(SynapseXen_IlIllI[SynapseXen_lliiIIill+1]),'`for` limit must be a number')SynapseXen_IlIllI[SynapseXen_lliiIIill+2]=assert(tonumber(SynapseXen_IlIllI[SynapseXen_lliiIIill+2]),'`for` step must be a number')SynapseXen_IlIllI[SynapseXen_lliiIIill]=SynapseXen_IlIllI[SynapseXen_lliiIIill]-SynapseXen_IlIllI[SynapseXen_lliiIIill+2]SynapseXen_IliiiIlliil=SynapseXen_IliiiIlliil+SynapseXen_iiiiIllill[302231661]elseif SynapseXen_liIliIliiliili==216 then local SynapseXen_IlIllI=SynapseXen_IliIlIiillIIlliil;for SynapseXen_iIllli=SynapseXen_iIiliIIIIlIIilillIl(SynapseXen_lilIiiiIliiiIiIlIiI(SynapseXen_iiiiIllill[1425497348],127,256),SynapseXen_iilliilI,256),SynapseXen_lilIiiiIliiiIiIlIiI(SynapseXen_iiiiIllill[1713189260],50,512)do SynapseXen_IlIllI[SynapseXen_iIllli]=nil end elseif SynapseXen_liIliIliiliili==188 then local SynapseXen_lliiIIill=SynapseXen_lilIiiiIliiiIiIlIiI(SynapseXen_iiiiIllill[1425497348],31,256)~=0;local SynapseXen_lIliIIiIliiIIlliill=SynapseXen_iIiliIIIIlIIilillIl(SynapseXen_iiiiIllill[1713189260],34,512)local SynapseXen_IllIii=SynapseXen_IilliIIliiliiIlIllI(SynapseXen_iiiiIllill[215057416],126)local SynapseXen_IlIllI=SynapseXen_IliIlIiillIIlliil;if SynapseXen_lIliIIiIliiIIlliill>255 then SynapseXen_lIliIIiIliiIIlliill=SynapseXen_lIIiIIIIili[SynapseXen_lIliIIiIliiIIlliill-256]else SynapseXen_lIliIIiIliiIIlliill=SynapseXen_IlIllI[SynapseXen_lIliIIiIliiIIlliill]end;if SynapseXen_IllIii>255 then SynapseXen_IllIii=SynapseXen_lIIiIIIIili[SynapseXen_IllIii-256]else SynapseXen_IllIii=SynapseXen_IlIllI[SynapseXen_IllIii]end;if SynapseXen_lIliIIiIliiIIlliill<SynapseXen_IllIii~=SynapseXen_lliiIIill then SynapseXen_IliiiIlliil=SynapseXen_IliiiIlliil+1 end elseif SynapseXen_liIliIliiliili==151 then SynapseXen_IliiiIlliil=SynapseXen_IliiiIlliil+SynapseXen_iiiiIllill[302231661]elseif SynapseXen_liIliIliiliili==234 then if SynapseXen_lilIiiiIliiiIiIlIiI(SynapseXen_iiiiIllill[1782830286],256985,262144)==7537 then SynapseXen_IliIlIiillIIlliil[SynapseXen_IilliIIliiliiIlIllI(SynapseXen_iiiiIllill[1425497348],2)]=SynapseXen_iiiIiiIiiiliIlii else SynapseXen_IliIlIiillIIlliil[SynapseXen_IilliIIliiliiIlIllI(SynapseXen_iiiiIllill[1425497348],2)]=SynapseXen_lIlil[SynapseXen_lilIiiiIliiiIiIlIiI(SynapseXen_iiiiIllill[1782830286],256985,262144)]end elseif SynapseXen_liIliIliiliili==31 then local SynapseXen_IllIii=SynapseXen_IilliIIliiliiIlIllI(SynapseXen_iiiiIllill[215057416],120)local SynapseXen_IlIllI=SynapseXen_IliIlIiillIIlliil;if SynapseXen_IllIii>255 then SynapseXen_IllIii=SynapseXen_lIIiIIIIili[SynapseXen_IllIii-256]else SynapseXen_IllIii=SynapseXen_IlIllI[SynapseXen_IllIii]end;SynapseXen_IlIllI[SynapseXen_IilliIIliiliiIlIllI(SynapseXen_iiiiIllill[1425497348],58)]=SynapseXen_IlIllI[SynapseXen_IilliIIliiliiIlIllI(SynapseXen_iiiiIllill[1713189260],7)][SynapseXen_IllIii]elseif SynapseXen_liIliIliiliili==191 then SynapseXen_IillilliiilIiIiIiI[SynapseXen_lIIiIIIIili[SynapseXen_iIiliIIIIlIIilillIl(SynapseXen_iiiiIllill[1782830286],76446,262144)]]=SynapseXen_IliIlIiillIIlliil[SynapseXen_lilIiiiIliiiIiIlIiI(SynapseXen_IilliIIliiliiIlIllI(SynapseXen_iiiiIllill[1425497348],10),SynapseXen_iilliilI,256)]elseif SynapseXen_liIliIliiliili==54 then local SynapseXen_lIliIIiIliiIIlliill=SynapseXen_IliIlIiillIIlliil[SynapseXen_iIiliIIIIlIIilillIl(SynapseXen_iiiiIllill[1713189260],106,512)]if not not SynapseXen_lIliIIiIliiIIlliill==(SynapseXen_iIiliIIIIlIIilillIl(SynapseXen_iiiiIllill[215057416],53,512)==0)then SynapseXen_IliiiIlliil=SynapseXen_IliiiIlliil+1 else SynapseXen_IliIlIiillIIlliil[SynapseXen_iIiliIIIIlIIilillIl(SynapseXen_iiiiIllill[1425497348],16,256)]=SynapseXen_lIliIIiIliiIIlliill end elseif SynapseXen_liIliIliiliili==251 then local SynapseXen_IlllIIliliIIiiiiIII=SynapseXen_IlIllI[SynapseXen_iIiliIIIIlIIilillIl(SynapseXen_iiiiIllill[1782830286],242296,262144)]local SynapseXen_IlIllI=SynapseXen_IliIlIiillIIlliil;local SynapseXen_lliilIil;local SynapseXen_liillIIIl;if SynapseXen_IlllIIliliIIiiiiIII[376676081]~=0 then SynapseXen_lliilIil={}SynapseXen_liillIIIl=setmetatable({},{__index=function(SynapseXen_lIlIll,SynapseXen_Illii)local SynapseXen_llIliIIlIIllIIIIiiIi=SynapseXen_lliilIil[SynapseXen_Illii]return SynapseXen_llIliIIlIIllIIIIiiIi[1][SynapseXen_llIliIIlIIllIIIIiiIi[2]]end,__newindex=function(SynapseXen_lIlIll,SynapseXen_Illii,SynapseXen_lIiIliiiIIillIilliI)local SynapseXen_llIliIIlIIllIIIIiiIi=SynapseXen_lliilIil[SynapseXen_Illii]SynapseXen_llIliIIlIIllIIIIiiIi[1][SynapseXen_llIliIIlIIllIIIIiiIi[2]]=SynapseXen_lIiIliiiIIillIilliI end})for SynapseXen_iIllli=1,SynapseXen_IlllIIliliIIiiiiIII[376676081]do local SynapseXen_lllli=SynapseXen_llliililiIIlliI[SynapseXen_IliiiIlliil]if SynapseXen_lllli[583017039]==37 then SynapseXen_lliilIil[SynapseXen_iIllli-1]={SynapseXen_IlIllI,SynapseXen_IilliIIliiliiIlIllI(SynapseXen_lllli[1713189260],68)}elseif SynapseXen_lllli[583017039]==125 then SynapseXen_lliilIil[SynapseXen_iIllli-1]={SynapseXen_lIiilIiiiiiIiIllii,SynapseXen_IilliIIliiliiIlIllI(SynapseXen_lllli[1713189260],33)}end;SynapseXen_IliiiIlliil=SynapseXen_IliiiIlliil+1 end;SynapseXen_liilIliIilIll[#SynapseXen_liilIliIilIll+1]=SynapseXen_lliilIil end;SynapseXen_IlIllI[SynapseXen_IilliIIliiliiIlIllI(SynapseXen_iiiiIllill[1425497348],33)]=SynapseXen_IlIli(SynapseXen_IlllIIliliIIiiiiIII,SynapseXen_IillilliiilIiIiIiI,SynapseXen_liillIIIl)elseif SynapseXen_liIliIliiliili==158 then local SynapseXen_lliiIIill=SynapseXen_lilIiiiIliiiIiIlIiI(SynapseXen_lilIiiiIliiiIiIlIiI(SynapseXen_iiiiIllill[1425497348],63,256),SynapseXen_iilliilI,256)local SynapseXen_lIliIIiIliiIIlliill=SynapseXen_lilIiiiIliiiIiIlIiI(SynapseXen_IilliIIliiliiIlIllI(SynapseXen_iiiiIllill[1713189260],41),SynapseXen_iilliilI,512)local SynapseXen_IllIii=SynapseXen_IilliIIliiliiIlIllI(SynapseXen_IilliIIliiliiIlIllI(SynapseXen_iiiiIllill[215057416],85),SynapseXen_iilliilI)local SynapseXen_IlIllI=SynapseXen_IliIlIiillIIlliil;local SynapseXen_IIllliIiiIiiiiIlI,SynapseXen_IIlIIiIilIllIII;local SynapseXen_IliiIlIIllliIliilil,SynapseXen_iliiiiiIlIiiliI;SynapseXen_IIllliIiiIiiiiIlI={}if SynapseXen_lIliIIiIliiIIlliill~=1 then if SynapseXen_lIliIIiIliiIIlliill~=0 then SynapseXen_IliiIlIIllliIliilil=SynapseXen_lliiIIill+SynapseXen_lIliIIiIliiIIlliill-1 else SynapseXen_IliiIlIIllliIliilil=SynapseXen_iIiIIiil end;SynapseXen_iliiiiiIlIiiliI=0;for SynapseXen_iIllli=SynapseXen_lliiIIill+1,SynapseXen_IliiIlIIllliIliilil do SynapseXen_iliiiiiIlIiiliI=SynapseXen_iliiiiiIlIiiliI+1;SynapseXen_IIllliIiiIiiiiIlI[SynapseXen_iliiiiiIlIiiliI]=SynapseXen_IlIllI[SynapseXen_iIllli]end;SynapseXen_IliiIlIIllliIliilil,SynapseXen_IIlIIiIilIllIII=SynapseXen_IlIIIiIliII(SynapseXen_IlIllI[SynapseXen_lliiIIill](unpack(SynapseXen_IIllliIiiIiiiiIlI,1,SynapseXen_IliiIlIIllliIliilil-SynapseXen_lliiIIill)))else SynapseXen_IliiIlIIllliIliilil,SynapseXen_IIlIIiIilIllIII=SynapseXen_IlIIIiIliII(SynapseXen_IlIllI[SynapseXen_lliiIIill]())end;SynapseXen_iIiIIiil=SynapseXen_lliiIIill-1;if SynapseXen_IllIii~=1 then if SynapseXen_IllIii~=0 then SynapseXen_IliiIlIIllliIliilil=SynapseXen_lliiIIill+SynapseXen_IllIii-2 else SynapseXen_IliiIlIIllliIliilil=SynapseXen_IliiIlIIllliIliilil+SynapseXen_lliiIIill-1 end;SynapseXen_iliiiiiIlIiiliI=0;for SynapseXen_iIllli=SynapseXen_lliiIIill,SynapseXen_IliiIlIIllliIliilil do SynapseXen_iliiiiiIlIiiliI=SynapseXen_iliiiiiIlIiiliI+1;SynapseXen_IlIllI[SynapseXen_iIllli]=SynapseXen_IIlIIiIilIllIII[SynapseXen_iliiiiiIlIiiliI]end end elseif SynapseXen_liIliIliiliili==120 then local SynapseXen_lliiIIill=SynapseXen_lilIiiiIliiiIiIlIiI(SynapseXen_iiiiIllill[1425497348],30,256)local SynapseXen_lIliIIiIliiIIlliill=SynapseXen_lilIiiiIliiiIiIlIiI(SynapseXen_lilIiiiIliiiIiIlIiI(SynapseXen_iiiiIllill[1713189260],109,512),SynapseXen_iilliilI,512)local SynapseXen_IllIii=SynapseXen_IilliIIliiliiIlIllI(SynapseXen_iiiiIllill[215057416],127)local SynapseXen_IlIllI=SynapseXen_IliIlIiillIIlliil;if SynapseXen_IllIii==0 then SynapseXen_IliiiIlliil=SynapseXen_IliiiIlliil+1;SynapseXen_IllIii=SynapseXen_llliililiIIlliI[SynapseXen_IliiiIlliil][1957859473]end;local SynapseXen_llIliiiIlllIiill=(SynapseXen_IllIii-1)*50;local SynapseXen_IIIlliIilIiiIii=SynapseXen_IlIllI[SynapseXen_lliiIIill]if SynapseXen_lIliIIiIliiIIlliill==0 then SynapseXen_lIliIIiIliiIIlliill=SynapseXen_iIiIIiil-SynapseXen_lliiIIill end;for SynapseXen_iIllli=1,SynapseXen_lIliIIiIliiIIlliill do SynapseXen_IIIlliIilIiiIii[SynapseXen_llIliiiIlllIiill+SynapseXen_iIllli]=SynapseXen_IlIllI[SynapseXen_lliiIIill+SynapseXen_iIllli]end elseif SynapseXen_liIliIliiliili==206 then if not not SynapseXen_IliIlIiillIIlliil[SynapseXen_lilIiiiIliiiIiIlIiI(SynapseXen_lilIiiiIliiiIiIlIiI(SynapseXen_iiiiIllill[1425497348],51,256),SynapseXen_iilliilI,256)]==(SynapseXen_iIiliIIIIlIIilillIl(SynapseXen_iiiiIllill[215057416],75,512)==0)then SynapseXen_IliiiIlliil=SynapseXen_IliiiIlliil+1 end elseif SynapseXen_liIliIliiliili==196 then SynapseXen_IliIlIiillIIlliil[SynapseXen_lilIiiiIliiiIiIlIiI(SynapseXen_iiiiIllill[1425497348],35,256)]=-SynapseXen_IliIlIiillIIlliil[SynapseXen_lilIiiiIliiiIiIlIiI(SynapseXen_iiiiIllill[1713189260],32,512)]elseif SynapseXen_liIliIliiliili==138 then SynapseXen_IliIlIiillIIlliil[SynapseXen_lilIiiiIliiiIiIlIiI(SynapseXen_iiiiIllill[1425497348],93,256)]=#SynapseXen_IliIlIiillIIlliil[SynapseXen_iIiliIIIIlIIilillIl(SynapseXen_iiiiIllill[1713189260],4,512)]elseif SynapseXen_liIliIliiliili==193 then local SynapseXen_lIliIIiIliiIIlliill=SynapseXen_lilIiiiIliiiIiIlIiI(SynapseXen_iiiiIllill[1713189260],95,512)local SynapseXen_IllIii=SynapseXen_IilliIIliiliiIlIllI(SynapseXen_IilliIIliiliiIlIllI(SynapseXen_iiiiIllill[215057416],33),SynapseXen_iilliilI)local SynapseXen_IlIllI=SynapseXen_IliIlIiillIIlliil;if SynapseXen_lIliIIiIliiIIlliill>255 then SynapseXen_lIliIIiIliiIIlliill=SynapseXen_lIIiIIIIili[SynapseXen_lIliIIiIliiIIlliill-256]else SynapseXen_lIliIIiIliiIIlliill=SynapseXen_IlIllI[SynapseXen_lIliIIiIliiIIlliill]end;if SynapseXen_IllIii>255 then SynapseXen_IllIii=SynapseXen_lIIiIIIIili[SynapseXen_IllIii-256]else SynapseXen_IllIii=SynapseXen_IlIllI[SynapseXen_IllIii]end;SynapseXen_IlIllI[SynapseXen_IilliIIliiliiIlIllI(SynapseXen_iiiiIllill[1425497348],49)]=SynapseXen_lIliIIiIliiIIlliill^SynapseXen_IllIii elseif SynapseXen_liIliIliiliili==67 then local SynapseXen_lliiIIill=SynapseXen_iIiliIIIIlIIilillIl(SynapseXen_iiiiIllill[1425497348],96,256)local SynapseXen_lIlIlIliiIlI={}for SynapseXen_iIllli=1,#SynapseXen_liilIliIilIll do local SynapseXen_lilIIilIillIilI=SynapseXen_liilIliIilIll[SynapseXen_iIllli]for SynapseXen_IIIIli=0,#SynapseXen_lilIIilIillIilI do local SynapseXen_iliIliIIil=SynapseXen_lilIIilIillIilI[SynapseXen_IIIIli]local SynapseXen_IlIllI=SynapseXen_iliIliIIil[1]local SynapseXen_iIlIilililiIlilIil=SynapseXen_iliIliIIil[2]if SynapseXen_IlIllI==SynapseXen_IliIlIiillIIlliil and SynapseXen_iIlIilililiIlilIil>=SynapseXen_lliiIIill then SynapseXen_lIlIlIliiIlI[SynapseXen_iIlIilililiIlilIil]=SynapseXen_IlIllI[SynapseXen_iIlIilililiIlilIil]SynapseXen_iliIliIIil[1]=SynapseXen_lIlIlIliiIlI end end end end end end;local SynapseXen_IIllliIiiIiiiiIlI={...}for SynapseXen_iIllli=0,SynapseXen_IIIIilIiI do if SynapseXen_iIllli>=SynapseXen_llIIliiiiiiilllIl[1118284126]then SynapseXen_iillliIlIililll[SynapseXen_iIllli-SynapseXen_llIIliiiiiiilllIl[1118284126]]=SynapseXen_IIllliIiiIiiiiIlI[SynapseXen_iIllli+1]else SynapseXen_IliIlIiillIIlliil[SynapseXen_iIllli]=SynapseXen_IIllliIiiIiiiiIlI[SynapseXen_iIllli+1]end end;local SynapseXen_lIliIIiIliiIIlliill,SynapseXen_IllIii=SynapseXen_IIiililiiliiIll()if SynapseXen_lIliIIiIliiIIlliill and SynapseXen_IllIii>0 then return unpack(SynapseXen_lIliIIiIliiIIlliill,1,SynapseXen_IllIii)end;return end end;local function SynapseXen_IIiliilIIIl(SynapseXen_IiliIlll,SynapseXen_IillilliiilIiIiIiI)local SynapseXen_Illilli=SynapseXen_iIIlIlIlllI(SynapseXen_IiliIlll)return SynapseXen_IlIli(SynapseXen_Illilli,SynapseXen_IillilliiilIiIiIiI or getfenv(0)),SynapseXen_Illilli end;return SynapseXen_IIiliilIIIl(SynapseXen_iliiiiili("dRtYZW4RAAAAN0NDVlRQRzBPSTlHOEpURgBeKd5tfDZyaoU0fAml2HqQLaDYH+7GUdd8VRaiRU84t/RUzn4//T6LIzEny/Yp1J5EAec+0SokMxdJExWZbdBCZsgoPFn0ZfoTEI1nyChbSNB9+lIrOR6DIKD9wxELa6eHkWcYLKY4Zws10e4WDZeGIms3VHBkP/5rcNL5lmgLK2Xz0Me/E3rgTPpshVkz6VHYS/9S+mlFgQVgzpf0PQ0LMdFuFg2XBd4VTlRVc7yIYfvb+2U9+gCnR2HhGOTntGMLUtGuFg2Xi4WxWlQ3JXbbx796BKMt+hvFmTDpUbZjAF36K4VBBGDOF8ZRQwt90W4WDZcRhL8oVHHF2TDpUZBONyT6WL5EA5meTbhxBQtGhYEFYM62dAMDCzzR7hYNl2Fg3lFUKU83Ga0lSJSEdQtSvkQDmZ6pSEE/C01QTFPIKH3WRhH6DxUkTK8tNZQLYQsT0MxQyCgaetE2+nj+RAOYnncVpFYLQTM6CYwfDRNxDAtlkAxQyCjx3E0v+itVJMyvLWCk7XcLWtACZ8goeJexPfpLEE1nyCh8811Y+gsrOR6DIJDh/ywLaxCNZMgoQo5jAvpbKzkegyD3qY9IC3oQzWTIKEPak2P6RvbuCEz5t/LWLgsRp8eeZxhqOnMDCxTR7hYNl02LugpUERDPUMgo7nrWEvoM0e4WDZdZgmYmVB1Q9FHIKA84WDr6SUXCLelR1rEsdfpKDzYZryX8yJwmC2Y+RwOYnuY/mGQLPtBCZMgoV1XQKPpZEI1lyCjlSsxO+ij27ghM+a8CkX4LBqeHn2cYuT2pUAtq0e4WDZcjuFMlVFMzeomNH8KUa0sLNdHuFg2XqjsXR1RmUM1CyCjLoEQw+nAQdE/IKMLkH0r6RA82Ga8lsVaGPgt4MNeRZ9hZrvpaCx0PNBmsJdYJ4hgLa35HA5mecCKwMwsfp/sAjfDYoXwRCw8V50yuLb5EQBYLYtGuFg2XYlK5RFQbRcNR6VE45z53+grQj1HIKDjEEFL6CZUmTKgtarq3dwsFUM5QyCgtQUIT+n1+xgOYnuuMtUMLIP5Hg5meDZYNbAs+xUAEYM7EzXZBC3DRrhYNly3j5FZUVKf7gI3w3EfjGAsE8NcRYdjbCTsAC2GFgAVgzkScPygLbNGuEg2Xj2aHY1QKkM9RyCiyKddA+mNVJ8ypLXutPHULXrm1cIHqoeSMdPpBEA1lyCj1WNdT+kL27ghM+ejaMQ8LLxBNZcgoJMgwPvo9KzkegyBtthkUCyanR59nGF66lXgLRNHuFg2XbZCOMVRBZb69x798u1w0+jrl8aHHv7L43jH6WRDOUMgoFXSUKfpCPkYDmJ5yldBICz2PNJmqJfjCUnYLEdHuFA2XF+lpYlRip0f8BxgH/11zCwrR7hYNl34uhiZUR5APUcgoCH0DSfoT0a4WDZdPda0QVDTFxi/pUU7P3Aj6Ag82Ga8lo5TLTAspVSfMqS27crkvCxEQzlDIKNcKxjL6GT5GA5ie/AYUQAtyjzSZqiWugkkMCzxV50+uLfRmPTALZ081GaolAjwpOAspPsYCmJ7kzQRZC2bRLhYNl/aULDpUMgWABWDOnfQKFgs30a4WDZfrbyBLVELPNxmoJRjcRGALLBJrGJPZbvpvPAsz0S7o8pceeIMWVEyz/4hh+wd9Zl36ZA82GawlqEyIMwt9DzWZqiVz0z84CzJ+RgOZnhwsjG0LCNXmT6gtd0k9KgsXzzUZqiWdRPMPCy6+xgKYnnHdOn0LA9EuFg2XA4UXBVQm5weKfxgM9K8yCwzRrhYNl7ezj1JUfdEu6fKXvC8oblRikmsYk9loHMpZC17RLujyl4DCWx5UUTTsn1dDG+ohNwsKhVk+6VHE9BlJ+gOz+suMH9/ZOFULf9HuFg2Xc8RXA1RzxZk+6VHE0BIV+idkP35QcDv7fAgLMxAMXsgoDybjLvoGfkSDmJ6yeaM7C1DFWT7pUQgkozz6IvP6S4wfahmQIgtnUExeyCjBIgM6+ke+RIOYnkHMXj0LOQVYPulR2ouUefowM/rLjR+yJOhgCxmQjF/IKA6JxF76e/5Eg5iel+zUCgtVpwft+RjPFsxeC2bRrhYNl1l3+HpUYwUZVulREDNmP/omRVg+6VHnxbJC+hBz+kuNH26UnSsLCqcHSP8YaKTGbgtd0e4WDZf5pecdVH/QTF7IKHXfV136TNGuFg2X/A6zQVQdZD9+a3CA638lCzcPNhmvJd39mTsLNz5Hg5ieWaybFwtvhVg+6VEdd/ZM+g/QwmLIKPlm4An6JRANYsgoug1mHvpqKzkegyAixWIUCxkQTWLIKBeN1Rz6M/buCEz51HZJVAtIp0ecZxgzYxYLC1jR7hYNl/9yHhFUFbP5y4ofRy+OXwsR0a4WDZdNB3g7VC9kP/5qcFVWgFgLXw82Ga8l65T4Gwt5EE9eyChzFd1S+hR+R4OYnnLgeVcLQcVYPulR/oHDVfpT8/lLih+DN8QZCydQz1/IKP9XBU/6C75Hg5ieoHFAFgswBVs+6VGq7+cc+h25tXCB6nUEP3L6QRDNY8goHsqwdfpUKzkegyA9fpdAC2oQDWPIKJPvUCv6FfbuCEz593VqQQtppwedZxiuFoUMCw/R7hYNl/H3+ldUKTP5y4sfdh/Oewtn0e4WDZcHmVoXVG0Qi1PIKPQkQXP6D+Xzqce/gs8mUvoJDzYZryWR9LASC1Onh532GEbhC0QLSdGuFg2XV45aGVQsJTfVx7+2yTx5+n+Qj1/IKFQfLEL6YP5Hg5ieut3yeAtBp8f5HhjEAqwfC3rR7hYNl2HJPjpUA0VbPulRr0JaH/ox0e4WDZffNalOVD1kP35tcJDV/FILbuWw18e/s+ibNPpGDzYZryVrzVB7C3C5tXCB6pTQtyv6ZxCNYMgo9e7Cc/op9u4ITPk7VOs8Cw2nh5pnGG4RiEsLaNHuFg2X2crBLlQiUEtxyCjdX+sQ+nfQz3rIKMdRblH6fnP5S4sfCPTYGwtBp4flEhizXhonCyvRrhYNl2BAshZUFpCLecgo3/MCCvoB0I9fyCh3T20t+hM+RoOYnoFzqk0LQoVbPulRpgs9QfoUs/jLiB+h7AE3CyQQjl/IKA3dpR76fX5Gg5ieTfo4Tgsp0a4WDZc1tgsBVBFkP/5ScEDsNQwLGMVbPulRk6UGJPpr8/hLiB/nPFd2CzdQjl/IKAl9Q0v6F75Gg5ieVLWdcgsoBVo+6VEEY8Ff+lCnx/oAGKxj7iELEdHuFg2XtwMZR1QJM/jLiR+DI2wvC2XR7hYNlwBNEmZUKWQ/flNwr+/rOQtfpXWhx7/tR5Fb+noPNhmvJX2ixEsLN5COX8goolU+MfoK/kaDmJ5RJ8kDCxJFWj7pUTa81Cj6KNHuFg2XlLKBfVQJxU1Q6VGBrjs1+g5kP35TcEx3jAcLKnP4S4kfs2zEHwtS0I5fyCiKWoU2+hU+QYOYnoDOMyELJdGuFg2XIw1QYlRx5Xu6x78hFHFy+iWFWj7pUW6OZF36FbP/y4Yf31mBTgtpp8fiEBh2ADNDC1fR7hYNl+Ca91dULBCJX8go9xtfPfop0a4WDZcZjSwgVD/l8cDHv95qLQb6QA82Ga8lsp0GFAtffkGDmJ70z3d/CzenB+8kGIAamlILF9HuFg2XTYxPXFQ40AtfyCiIVHwB+gSl/tTHvx23cEX6E8VaPulRdZ5pc/okubVwgeqgnL0++jYQDWDIKO/WiRj6Wis5HoMgfoW3RAsLpweaZxhEqt8sC27R7hYNl5qIfERUPwVBJ+lR2QP2ZPomEE9wyCiXzv0x+gjz/0uGH9beylALXtHuFg2XsIOUClRg5TLOx7+AyGlM+nWlvsDHv8LslgH6QVCJX8goYRfmJfoqvkGDmJ4QJIceC1qnh2caGIQlJ0kLJNHuFg2XsbwgFFRJBUU+6VFfH5Mj+i/R7hYNl74es2NUM4XZL+lRfuSGbfoHpfDfx7+R6qIQ+kUPNhmvJcgdd3oLetCCYcgoEpofFPolEM1hyChASiMb+j/27ghM+dpaolILLKfHm2cYnCv7ZQtT0e4WDZcSKiRoVCMz/8uHHwmPFnoLZNGuFg2XIVERR1R9ZXfex795eLci+n0PNhmvJTZJTRALbZCJX8go3D8cPPpq/kGDmJ5LfqBCCwi5dR2I6mZZC1r6ehBNYcgoWsY9HPo19u4ITPmh1rFCC34QjW7IKONIcBv6SfbuCEz5Osu8TQtFp4eYZxiiqx5mC1LR7hYNlyF8ZmFUW0VFPulRZbFwJvpm0e4WDZeUUxVYVHLFQlTpUVDufHT6dSXzuse/cltRPPpxDzYZryUbuL9PCz7QAm7IKLKVpmj6ZRBNbsgoLL3xEPpwKzkegyApct52CyIQjW/IKFDpbAn6ECs5HoMgwkjFNwsLp4eZZxgzLs9LCyDR7hYNl+EjaSNUHWQ/fmRwfk6DaQtnZD9+ZHAIFug3Cx5z/0uHH4HTX1ULNbk1HYjqDkK8fvp1EA1vyCggDH0c+kYrOR6DIJXvuFYLKqcHmWcY69S8FQtJ0e4WDZc/fcJ1VEzQiV/IKEzJGEz6adGuFg2XWYnmKlRdZD/+ZnBSh5dMC1wPNhmvJcXbYm0LKz5Ag5ieTLHAUgsq0a4WDZczcZ47VFVFQ0DpUbC4Phr6VYVFPulR9DbtD/oFs/7LhB9ECdZCCzoQiF/IKHGwzgj6DH5Ag5iekLDmPQsdxUU+6VFzSqQb+hrz/kuEH57v+z8Lc6dHS0AYXIpSSQtJ0e4WDZfuU6QZVExFhSLpUSbtEw36P9DCUMgo+DR1GvpqUEheyCgGrJw/+mK+QIOYnnF/lnULRQVEPulRgrbMUPoMp8d3RxjktkN6CwzRrhYNl09VxEtUKiV2vMe/UsNsefooM/7LhR/+ls5aC0aQSF7IKF3cDTf6UP5Ag5ieyxI4ZwtbRUQ+6VF7kPtA+mjR7hYNlyIH6w5ULpDORsgo/vBiTfoQZX+lx78OpYkd+lhz/kuFH8i1jxMLI7m1cIHqcbFuEfoFEI1syCgDHNgd+nsrOR6DIHLEcTsLLxDNbMgoyFoUFvotKzkegyAoKV0QC3wQDWzIKDxf5Gn6fPbuCEz5waSSEgsxpweGZxiG/wdSC3HRrhYNl0LARyFUF6X2xse/Ba/KGPoC0MhfyCh9zegS+kg+Q4OYnk1DmGULMoVEPulR5xenfvoxs/3Lgh/tiQhcCxEQi1/IKMMBZRX6ZX5Dg5ieJupZKAt3xUQ+6VGRWBF5+lanR+wgGDdfZnsLRdGuFg2XVa6bDFR9xc0p6VExhGNt+ivz/UuCH4mqtzALCdHuFg2X0x1oQFRqZD/+f3DuXydxC0TltqDHv9h8WVb6XVCLX8go73REXPpcvkODmJ6BRepuCwYFRz7pUUmSM0D6ETP9y4MfbmSDEAtIkItfyCjlF1gg+mv+Q4OYnuewVH0LCUVHPulRsp1CU/oEc/1Lgx9vQsAXCyrQi1/IKOmPmFT6cj5Cg5iehUkcAws70IJtyCivQKs1+gwQzW3IKMXRlGT6I/buCEz5yCLDKQttEA1tyCiB2s5R+gn27ghM+R/vdggLe6cHh2cYC87gQAs50e4WDZeFli9bVH6FRz7pUaDCCzX6OdGuFg2XKzR6dlQhZD9+bXDq4po3C2gPNhmvJYsgVEYLMrm1cIHqN+J7JfogEI1qyCibSRwA+mMrOR6DIKvRQFgLKxDNasgou1UocvoV9u4ITPnSCK0VC38QDWrIKN+ksUH6GvbuCEz5iyYuKAtQpweEZxgdn513C0vR7hYNl0vbn1xUUrP8y4AfO1Y6PwsH0a4WDZdftRhAVCXlu9DHv/0f7yr6Qw82Ga8ljhq5LgtVp4d19hiXYLhPC17R7hYNl057fjRUMhCKX8goHgd7Ovob0a4WDZc7/2Z1VAKFhyjpUTIjuGb6Qw82Ga8lJHy6IwtGfkKDmJ77bQYVCyWnR8n5GJbf1xYLc9HuFg2Xv6GlZVRBxUc+6VGjhCd4+kDRrhYNlyf8AFZUZFDMXsgowfGUQforDzYZryXGEFdFC2Tz/EuAH5nRzSgLPrm1cIHqWQW+cvoAEI1ryChOoNx1+jz27ghM+Y+4wTQLAxDNa8gouSY7XPoT9u4ITPkK8/BgC2MQDWvIKMdulkT6Jis5HoMg1V03JQslpweFZxhSTFhpCzPR7hYNl54DWSdUFsUCOelRp+TlPfoZZD9+bHCFT6twC01QSl7IKJPLXz/6ab5Cg5iewAJUSwtuBUY+6VHXfhJ/+mrR7hYNl86/+BxUCYUEX+lREJNKbfpVJXC9x78WUEZy+jYz/MuBH5yAFhALZtGuFg2XKnHsTVRnxdhR6VEbl4YR+hGQSl7IKHYsoEn6A/5Cg5ieu40WEgsCp0edEBhd6Th9C1HR7hYNl5/bWRtUMGQ/fn5wxwajewsNxUUj6VHLsA0E+i5FRj7pUaCryCb6D6eHaf8Y6aElTgsl0a4WDZdQqRZBVAwFR0XpUXW/THH6RnP8S4Ef1NcaBAtx0MpfyChd5KF2+lc+TYOYnunRwHULboVGPulRGDNXNPpup0f/BRj5H0MVCwPR7hYNl3kc6GVUQLPzy54fhvTQBAss0a4WDZeU1r5PVG1kP35QcN6m+joLPA82Ga8led7mawt5p0eZPxh6Bc5SC07R7hYNl7QGGm9UDwVbXOlRGhYKBfo+kPV7yCg2ywMv+mIQtV/IKOJrcGj6an5Ng5ie/gQrJQtBubVwgep3+sx1+koQjWjIKHs/vg36WCs5HoMgDFebDAs6EM1oyCjbatkM+g4rOR6DIFzOMh0LLBANaMgomTtkG/p4KzkegyCjR9gnC0OnB4JnGJ+QLioLetHuFg2X+fevP1RgUPZdyCjhKbJq+gTF2ULpUf351SD6d8VGPulR+tHLc/o1p0fnFRiIEmQCC2fR7hYNlwsWz1JUN/PzS54fuizGPwtR0e4WDZcm5DAGVCoFQVzpUQWZ6136JKVzv8e/OE9ySvo5DzYZryXdjU4eC3e5tXCB6g+90mD6ABCNacgo8yPsL/pdKzkegyDvMpdcCyYQzWnIKKznBjP6dis5HoMgDRRgZwtBEA1pyChMfRwU+jT27ghM+Y+JJyMLB6cHg2cY+YW3fwsg0e4WDZe2nlkgVH5QtV/IKKrtIFf6WNGuFg2XsQC+VVQlZD9+YnCJS25nC1UPNhmvJbLEqE4LS75Ng5iecKeHJgtwubVwgeq+z6Aa+gMQjZbIKOEXXHn6cCs5HoMgalBtXAtIEM2WyCi90OR/+mn27ghM+Y72ZFQLQxANlsgoOovrGvpN9u4ITPnizKgCCwunB4BnGJ90CQALEdHuFg2XskZZI1QLBUE+6VEAKFgu+n7R7hYNlyPqIStUPWQ//n1wEOVeBAtMZD9+Z3A1R8NiC0YPNhmvJanC3iELOzPzy58fv/lOGQtap4dsWhhaKM8OCxDRrhYNl3PSjX9UQpDxfsgoMs7sW/pkkLVfyCgdl99H+iP+TYOYnoOc2lcLW7n1HIjqVw3UB/oVEI2XyCjt83RM+lwrOR6DIBOxXmMLCRDNl8goCr5lVfpJ9u4ITPnAWSglC1UQDZfIKCpgCjL6Q/buCEz5zPRaHQsopweBZxhY4WhFC13R7hYNl8zewH5ULUVBPulRiRSHDfoW0a4WDZf1cTQmVESl96jHv9nqpVD6eQ82Ga8lluSONAsK0IKUyCiihShO+kAQzZTIKGSm6S/6Gys5HoMg7s+zSQt/p8eOZxhIo6MzC1PRrhYNl7n4o3ZUFcVaPelRm7qccPonc/NLnx/WYcloC1m59R2I6uVE2nD6VxBNlMgo8JR4FvpDKzkegyDsHH4oC0unR45nGFYhiXMLV9HuFg2X1zoTfVR+0LVfyChjcX9l+hrR7hYNlwQNSxZUQUWFVulR++LfNPpDpXa+x7+HthxF+lIPNhmvJS+tbCgLWT5Mg5ie8Q9COwsVp0eALRi25f0ZCwnR7hYNl48UJwxUMmQ/fmtwnuGGDwtK0LdbyCilqGsx+jCFQT7pUZhm8mz6V6dH9CUYIKNqRAs00e4WDZeUCFMlVE5QTkDIKB1Nyy36DZCOS8goi1xeUfpos/LLnB/AU34WC3bR7hYNl9l1GUNUMdACZMgoCrNJNvov5bf2x78gGDxp+nEQtF/IKBTwYx76M35Mg5ieOpJCUAseubVwgeoapvZ++g8QzZXIKLChFh76Wys5HoMg2FD5PQsNEA2VyCiyAE03+nUrOR6DINXBHTwLKacHj2cYb4gSJgtN0e4WDZdlRmsRVA7FQT7pUQXvQFb6YtGuFg2XdUZaHFRmkI5wyCgs3sQV+jcPNhmvJeodOgELP/PyS5wfPOjYQgtE0a4WDZd/lx9SVGiQTXPIKEeCFVP6XVC0X8go5CJHSfodvkyDmJ6oMbMrC34FQD7pUVsGx1/6TjPyy50fZ+VmWAs0kHReyCg3wRcW+kn+TIOYno7qQxALINCCksgo5dTkVfpbEM2SyChNf8ws+m0rOR6DIB7Ml1ALdhANksgoAbMgIPooKzkegyDCTsdYCwenB4xnGMkNnFULN9HuFg2XRO9OHVQY5THDx788Isoc+j8QSUHIKJ09mUz6WUVAPulRDaCBCfpVubVwgepW3QM6+loQjZPIKAK/syz6HvbuCEz58c2+fQsnEM2TyCjlm0Jt+kKnh41nGHkAuzULIdHuFg2X5egETFRSc/JLnR8GvV5WC3XR7hYNlwkMBmJUJWV198e/v+y1EvpVxZlL6VFE7/9z+lwPNhmvJU45UUgLKtGuFg2XBIhXBFRChYVS6VGVf/RH+nPQdF7IKPDrCGH6Rz5Pg5ieNgQkMgsYp8f+HRioP19oCzzRrhYNl/owMEBUOkUbKOlRKBCuZvp7hUA+6VGiu68u+g6z8cuaHzOGTW8LKBD3X8gosjfNCPpdfk+DmJ6vzGxyCze59R2I6h6FGjv6AhANk8goeItiYfooKzkegyBBpVE2C3YQTZPIKE9Nviz6dvbuCEz5B/d+ZQstEI2QyCg6KzYN+g+nh41nGOeh1lULatHuFg2X4LSYVlQJxUA+6VFJwbFG+iXRrhYNl7wbWRBUHGU+8Me/FjLpOPoPDzYZryVzRHgSCxvz8UuaH4TgZA4LZqcHdkkYoucmdwsE0e4WDZfiDX9mVEtkP/5tcDWMQlMLahD0aMgobuiAOPpMULdfyCjCLw0H+kW+T4OYnrBdjxILOAVDPulRz68dEfo7p0f9ARgJXjRsC3HR7hYNl+LjGVdUEjPxy5sfy1qGLQtX0e4WDZcSCeAlVERkP/5ocPaVpjcLZeW6ose/ml0rYvpiDzYZryVSd0pNC1WQt1/IKOyqlX76K/5Pg5ie6FN7cAtFp0dmHxgTHtcZC1DRrhYNl1OXzH9UKMWDT+lRpJtNEPoaRUM+6VHvTy9a+iKnBxMdGMk/lVYLCNHuFg2XX9p+Y1QRJTbZx78Yhz13+g3lfKLHvwaXtRT6VXPxS5sfFveTMAtH0LdfyCgYKlI4+n8+ToOYnjXcG24LNoVDPulR/VdvQPozp8eAbBjxC9BMCwDR7hYNl8Vy92hUcLPwy5gf7S5jHQti0e4WDZcTAENOVFtQ9FvIKFCThVT6TGQ/fn9wRs/1HgtBDzYZryXr7WM7C0O5tXCB6n36RGH6PBDNkMgo5QSPOPoK9u4ITPknqAIBCxwQDZDIKCDXpGD6JvbuCEz5URpDbgtUEE2QyCjWWURO+nj27ghM+XmAECULNxCNkcgoCk1cc/pwp4eNZxhBeKRXC2PR7hYNlzTskg9UTGQ//nxwdZ93WwsPZfyvx7/hs2Qx+mkQtl/IKA1WJQX6c35Og5ie0/a6OgsIxUM+6VFWOhI9+irz8EuYH6kE724LU1C2X8gokajEGfpsvk6DmJ52oRFmC3sFQj7pUbjqKkf6Y7k1HIjqbFDKNfojEM2RyCgBX15S+iYrOR6DICZSuxILFBANkcgogkEEIvolKzkegyBl8Ms9CxcQTZHIKJNrAmj6Y6eHjWcY9pAqdQs70e4WDZdpf4gxVG4z8MuZHywTdWgLUdGuFg2XWglZC1ROZD9+bHDEf9gFCw0PNhmvJVcbJ2ILWKdH/AcY+I38aAtD0e4WDZcAhVdlVHqQtl/IKEQ4XV76ONHuFg2XgW0tUVR3pTyvx7+SeZYp+nRkP/5ucBPVPy0LbA82Ga8lLwJregs0/k6DmJ4F3ZN8CxxFQj7pURRz4kf6X3PwS5kfhd7sNQsj0IKeyCgtth0g+lkQzZ7IKOnsQzX6M/buCEz5/6sRIgsrEA2eyChHMTIE+hT27ghM+YJjO3ALeBBNnsgooIZFXfoop4eNZxh6KmZBC3nRrhYNl6m1xD1UTqV6yce/GmRZL/on0HZeyCjSFeRG+gU+SYOYnpmD1kULcIVCPulRc7UtOvoAp0eR9hiz1KsOC0XR7hYNl4mKL3RUMxDObMgoS+5hVfpu5bbZx7863cUG+iWz98uWH7b6XFcLPtGuFg2XMv9mOFQP5fDIx7+Ir5AO+jIQsV/IKG6CmFj6M35Jg5ievgo3NAs9pSlBCwCrfIwHCzHQgp/IKDzrQBf6BBDNn8go53ufKvoAKzkegyAppvF2Cy0QDZ/IKKtmWm36ICs5HoMgI/L/GAswEE2fyCgeguBd+i8rOR6DIN1VIB8LNBCNnMgoMIZXJPpcp4eNZxhNkfo2C1DR7hYNl9nnuT5UAcWCPelRL728cfo30a4WDZd5fCNRVAKFmlrpUW+qckH6Lg82Ga8lLAZWQAt9pwdI/xilkMFOCxPR7hYNl6GpK1FUCPM3TZYfug6uaAsJ0e4WDZfdM2NpVAlkP354cCBd4xoLc9BNfcgoLxHNPPonDzYZryXo10oBC2anhxpAGKuF9AwLJtHuFg2XgJOPYFQIpakJCADKLI5wC1nRrhYNl+2j/A1UfGVwoce/H4s4fPpjDzYZryWCr1d+CwW5tXCB6vghVz/6XxDNnMgoaeGbM/onKzkegyAerh4/C0gQDZzIKCQhV236cCs5HoMgWs/GUQsFEE2cyCiDgF5f+lWnh41nGAwcNUcLFtHuFg2X8Zk8S1QaJVDOCQDXdatBC0PRrhYNl75ophNUF4UHfulRB01LAPoLDzYZryUniVwqCyrlV84JAFqBZiILONCCncgoNgaIPfpmEM2dyCgPlghv+lIrOR6DIEVueBcLbRANncgoujxtCvpiKzkegyBStMJJCwkQTZ3IKGaVUFb6c6eHjWcY3YN/NAtz0a4WDZfVpV06VBBkP35pcN+tdhQLB2VozgkADVB0RwsL0a4WDZdeuE5BVFqlu63Hv8dHtA76c+VVzgkAnzleOgs45alPCwASKB1QC2e5tXCB6rUKqwX6MxCNmsgoQlOTNfoJKzkegyCy5UIFCwYQzZrIKPJsUwv6BqeHjWcYn5ZMAQt/0e4WDZd4itZtVHHlaQUIACdZrkoLZNGuFg2XP8tDTFRBJbTMx7/5eRpE+k4PNhmvJXTb3A4LH+VpTg8ACXunXAtvpwf4UxgWkgh3CyLRrhYNl9pb3GJUFoVNQ+lRpR2gd/pjxUI66VGs3LBX+nvz90uWH4+nWRgLXlDxWsgovvBKHfojpwd6AxhJrAxdCxXR7hYNlzEE4FNUTZAxWsgoYRD3bfou0a4WDZcUMZ5oVDNkP35qcJoUqQ8LFQ82Ga8ldALPGQtV0EKRyCh3pMVA+lynh59nGPnhQw4LTNGuFg2Xkxp3L1RrZD/+f3BaUP8pCzDQcVrIKJoTqwr6Fr5Jg5ue60/PPAsS5amJDwCm2W4mC27lKUwSAHS6jw4LKKcHnFsYBCBBLwsF0a4WDZecRrVmVA+l9dLHv/R2q1T6J8XCOOlRxLhwB/o28/dLlh9LPultC3dQcVvIKGFvemD6YLl1HIjqopkWN/opEA2ayCgzjaxf+mH27ghM+cb55wgLDRBNmsgoQ98sVvoap4eNZxgEd7xUCwrR7hYNl+/m/0tULJBxWsgoHPKcNPps0e4WDZd8mm8YVEZkP/5ocGSCG1kLQWQ/flJwP4aWJgt/DzYZryVP8b8fC0CnRxYAGCCJKgQLCdHuFg2XFnmyLlQKBURF6VFmcdIA+hmlM9XHv4yaYFX6V9CxWMgo/cYBX/o4EHBayCh6SnIL+km+SQObnrjDUXkLYeWpiRIAs9uoNgtbxcI46VFCXfQJ+hnz90uWH7OCIxgLc6dHnEcY75yWUwsk0e4WDZcsrtU5VDpQcVrIKOVVnVr6Z9GuFg2XlRAkD1RAkMpuyCiKdj1d+iwPNhmvJdSTflALYJAxWMgoYT7NQPp20HFayCjFSBEl+lUQcFjIKE1Z7jL6fr5JA5ueGgKMDAs85amJEADIL25FC3y5tXCB6mUQxCv6ExCNm8goOaP6IPpr9u4ITPmpz5BzCzcQzZvIKK9nDhD6faeHjWcY508PNwsN0e4WDZe3K4NnVCslqAIIADCAtGwLX9HuFg2XUdH9T1R0EM9iyCiMZPcv+hnQNnvIKNHoDQr6FA82Ga8lfnKtegsyxUI66VGqbONn+irRrhYNl0jipAhUAhB0Xsgo7/hdPPpg8/dLlh86JEAoCwtQ8VrIKAxkhAz6W9ACm8goVsBSLvpWEE2byCg7OLd4+ib27ghM+bC1TRkLbxCNmMgo5xM4dPpY9u4ITPmyDaswC18QzZjIKDpB1nX6Qis5HoMgPpVQeQsUEA2YyChR/BYK+kWnh41nGGQ82wULPtGuFg2Xx9pbTlRzxRtw6VEM/ewy+jCQMVrIKHwbJAL6edBxWsgoxXm6K/p2vkmDm54q74ViC3ElqIkPANdfonoLL6cH/WkYouCsVQsr0a4WDZcNvAEBVAxkP35qcNlArH0LFSUoTBIAQgj4ZgspubVwgep8ahxb+kAQTZjIKOx50ST6MSs5HoMgeBf8YwsbEI2ZyCig9EU8+iQrOR6DIET0TTELcxDNmcgo5UpvePp2p4eNZxiZkfRaC2nR7hYNlyZDRT1UGeW1pce/yZ87KPp9ZD/+aXB486BUC3/FwjjpUfZNfXr6IqcH7yIYSJXsDAsD0a4WDZf1V4FdVAGl8dPHvwuRown6SvP3S5Yfrrf2QQts0AKZyChX/CEX+nQQTZnIKAMAal76XCs5HoMgo85nYwsNEI2GyChZ+rBO+gGnh41nGCTzykwLZtGuFg2X6eVhPVQGJTfMx79xJQ5F+m5QcVrIKIw9m3j6A7m1cIHqFwhKVPprEM2GyCjS7ihu+mf27ghM+RjvHmQLABANhsgow31OQfpnp4eNZxieu0gvCzjR7hYNl9FKmDNUIWW2xse/DdloVPpiUHSTyCjGb7kR+nGQMVjIKEBB9GL6RNBChsgov6i0XPoEEI2HyCil8JEY+n4rOR6DIHYcVAYLLxDNh8gobPVQSvonp4eNZxiUwsAwC23R7hYNl8h3rUFUc5CMTcgoiHbjXfoeZfWtx7/oTZIK+lnQcVrIKOlrIi36HRBwWMgobiA/XPpZvkkDm55EF9cICxfQAofIKFEN2TL6dhBNh8goMHfMLPor9u4ITPncrz5aCy0QjYTIKPvymSz6ais5HoMg5KoNVQtLEM2EyCiVP9sj+gArOR6DIFSh+hELdBANhMgoiX4Ua/pVp4eNZxgS2ZxlCz7R7hYNl9rWrh1UPCWoiRAAjMhfTwtT0e4WDZfIMjsmVDtkP35ucPlXR1oLFWQ//lFwj6ARFwt6DzYZryWON201C3TFgibpUfDEnhX6CPO3QpYfo9aAOwtF8zdClh9/sm5RCyLRrhYNl5rnElJUWwWHQulRm5gvVfodJagJFgDE4J56C0anx+YYGOktzBgLdtHuFg2Xi43ST1RdJWjLFwDgqUIMCxbR7hYNlzxqxm5UV1DxRsgob8IVOPodJTzwx7+NFEg8+ksPNhmvJamooUcLX8VCOulRqiJGUPpx8/dLlh8nqPVQC0S5NR2I6lNr+xX6MhBNhMgoHhjONPph9u4ITPmaO+U1CxoQjYXIKOZgNUX6TPbuCEz5PMvkIgtJEM2FyCiywVcD+gr27ghM+b4Ni2kLABANhcgokzpHQvoIp4eNZxgMd6g6CzDR7hYNl/FgyGtUfSVy3se/vVUYCfoAxd5z6VEKhscL+l1Q8VrIKNQR8Tv6eJDxWsgoS0G1TPpv0PFayCjfjhF++nK+SYObnod4ylELYLm1cIHqLXQhCvoQEE2FyCg3fkgH+kgrOR6DIMlatxELNxCNgsgooztEQPo09u4ITPkY3vcXCz8QzYLIKO8EWnP6JfbuCEz56gBgVAstEA2CyChVbPkz+junh41nGFjBqQkLPtHuFg2XT/G7JFQgJaiJFADBJ2kFC1PR7hYNl4JayztUFZCMmMgoqnxEJvpXUI1CyCjMxBUl+j0PNhmvJXCoKE4LVdHuFg2X6to1TlQwkM6dyCjPajl3+iJkP/5pcJFIZAALWSUoSBUAGG8ieQt587fEjR/b+iJ3CwLVacG6LeZ/zW8LNrMxiGH74joiZfpJDzYZvCVzy3gNC2YPNpmhJQd0VQkLDg82mawlht4gRAsQDzaZpSVfGeZlCz++iQOYntRYTk0LMbm1cIHqJjd4W/o2EE2CyCjZjYBU+nL27ghM+WZhTiILOhCNg8gofJKvEvoCp4eNZxhe+8tmC0LR7hYNlyplxXFUQmXoSQsAFRyJLgsx0e4WDZcgvSstVFpkP/5kcCS4ukILD4WNdelRKFikR/ohDzYZryU552YwC07RrhYNl0lUuW5UcgVDPelRfc+vB/pAZWgFCAAlL8NNCxanB20hGDcSqnkLPdHuFg2Xzmy/b1QOZWhODwBDKIxjC0XR7hYNl6Mr/kZUSmQ/fmVwiZe+BAsHBRtb6VEc+2VX+jwPNhmvJUeNM3ALbdBCnsgow8EHUPoip0eMZxh8sFdXC0rR7hYNlw/jezdUV8VCOulRAk81Yfpp0a4WDZfpYR1OVFVQNJ7IKLLjpXf6Kw82Ga8lLiovAQsMp0fvJRi2kIxHC2HR7hYNl8kTcGpUYvP3S5YfdojbbAt70e4WDZetOM8IVClkP/5RcBrrklILYgWFYulRk1vzXvpoDzYZryV8cutqC2NQcUfIKGmv+1X6O5BxR8gouGmPOPoLuXUciOpDRKUx+kMQzYPIKNqojX76Sys5HoMgXpRWGws8EA2DyCh2msMI+nb27ghM+aZpfzULEBBNg8goeCwzb/oZp4eNZxhcu0UXCzjRrhYNlzovdERUOpCOdsgo2tKRAvoi0HFHyCgIeJIc+nW+SYObnsi6qE8LdKeHASoYVPyEZAsm0a4WDZfe9zxQVHTFGUzpUQfsBWz6TmWoiQ8AaWOAbAt+Zah2GAAq6GoTCxK59RyI6tJKYR36bBCNgMgoBUPQefo+KzkegyCtI1UOC3sQzYDIKKC0e0b6LSs5HoMgaklLWQt2EA2AyCgscHtG+ngrOR6DIINASDoLOBBNgMgovwqUS/omp4eNZxhyk3EkCzDRrhYNl7WGe2BUM5AIS8goSrQlH/pDZShMEgAgWnc7Cz3FwjjpUeK1jV76WNDChsgocXmse/omp4fKZxjZm7BQCzrR7hYNl9X11glUN0XbRulReZLYfPpckA96yChxbW18+irz90uWH/RdRj4LBlAxRMgobjvGK/oGkHFayCjpmXBc+m7QcUTIKNHNCxz6WRBwWsgoSEO9LfprvkkDm55DFERsCxfR7hYNl6Hf6ShURWQ/flBw8IwkKgs70I1HyCi9bqwd+mBlqIkSAEyBP3MLWsXCOOlRqXQOMfo88/dLlh8Two5fCzZQcVrIKPOl9n/6H5CxRcgoDvAIXfof0IKByChiOa1s+g8QzYHIKI4rs3v6XSs5HoMgZMVWPAsgEA2ByCikXJZo+h6nh41nGPPXCQULWdHuFg2X9caeVlQwZfWox7+rhCwn+mJQ9FnIKIZNrw/6ctBxWsgozz+9a/pk0MKDyChbyu59+gunR4JnGCPtCBALTtHuFg2XdgWrGVQckA9LyCiUdY5p+iIFgCPpUeh3sXn6ARDwRcgoMPXIJvp1vkkDm56ADfgGCzxlqIkQABH8zxELfKXodwsALVJ3bAsep4fIJRi8EkZwCw7R7hYNl6P/IVtUCOV998e/ydSSXPoMZD9+b3AVeKY2C0SlKAIIAFXAvAkLQtBCgcgoqnP8MvpOEI2OyCixZLQs+mz27ghM+cmPlkoLGxDNjsgoR0C0IfpRp4eNZxg04hQPCx7R7hYNl4L2eHVUX8VCOulRDNTrc/oa0a4WDZdEpiInVGZkP/5QcP3mUHcLDw82Ga8lwcWUUgsZ0IKfyCgZzHwe+iqnR4xnGGF823ULcdHuFg2X2mROAlRc8/dLlh/GtBEJC3XRrhYNl6GV9C5UA2Q/fmlwty2AFwtVDzYZryXaSsASCyZQ8VrIKHEBSG/6KqeHcCYYC0cuVQs50e4WDZcL3NsqVGtle8/Hv/9OGRv6QJBIRsgoRRzZbfpNkDFayCjMUCAp+hHQcVrIKJX23Rr6Qb5Jg5ueLxvzYAt1paiJDwDEybkUCyenR5IzGLnVinELb9HuFg2XCe11JFQIpShMEgC3KeBYCzvRrhYNl6Llq2pUbUUZWulRxDyxEvorDzYZryUC8IwiCwu5NRyI6t9lBgf6HxANjsgohdV1TPpN9u4ITPnWTsoqC3wQTY7IKNxphRH6PSs5HoMgEpC7ZAtnEI2PyCiv6Ld++l4rOR6DIOtpZTwLJxDNj8goarX1R/pxp4eNZxiYfhVCC0jRrhYNl7jt5RRUOWQ//mtwnHJEbwtwxcI46VFAlABk+iK5tXCB6mnPJQL6ZhANj8goF6gVUvoZKzkegyAQxSJPCz0QTY/IKDHfg1j6b6eHjWcYa4bBHQti0e4WDZe4WOpGVAnz90uWH9ccmkQLTdHuFg2XhWBFFlRkpT3ex78Fullk+lcFm37pUeR7U0L6Cg82Ga8l9Z8zcQtGUHFayCiNg1hM+jCQsUXIKA+pqHP6ebl1HIjqA5yNK/pKEI2MyCinSfUW+mkrOR6DIDYz0hsLFhDNjMgoR/jsO/opKzkegyAxSCpLC0QQDYzIKF0sFyr6dys5HoMgOXdfbgsnEE2MyCiaytsO+g+nh41nGEDPbEALWdHuFg2XEWUAYVQ+0HFayCilVaQs+nTR7hYNl+WkvDFUMGVxxce/ube7VPoYZD9+fnDbpR0uC1kPNhmvJT4ioTELO9DCj8goa5AxGvohp0eMZxiBP+clC1XR7hYNl2wlqxFUDRBwRcgo+M1IWPo00e4WDZc8Q/BGVDBkP/55cPzLRU0LGmWyqse/yZZjAvpSDzYZryVdGq86C2y+SQObnj8W2GgLGqWoiRAAU2FPewthp4duKBgdyNoFC3LR7hYNl9sG9U9UNOVodwsAgB3JTAs30a4WDZd0kvIYVGZkP35vcInGuxQLAw82Ga8lQ553aAti5WgCCAAS8f93Cw+5NRyI6nKqDir6CBCNjcgoyUEOUvoY9u4ITPk3qdcVCwEQzY3IKBcDMTf6DKeHjWcYPLCyEgsw0a4WDZcpJX1xVBFQ9G7IKNQIJHL6X8VCOulRn4xwdfpo8/dLlh/jzjQvCxNQ8VrIKP4Ghl76T5DxWsgo7m8DNvon0PFayChONStR+nG+SYObnmo07AgLWtGuFg2XYxXidFRxhcIo6VGfQY4f+kPlqIkPAFV23UcLa9DCnMgocxj5Ivpzp0eMZxg1e/YnCzHR7hYNl/H2VRpUUOWoTBgACgT5BAt60a4WDZfOy4gqVHmFQkbpUdjfAmD6Hw82Ga8lv5JoQws75ShMEgCQ8+FECznQwoHIKAkWZXH6LKdHjGcYL3+QVAtV0e4WDZf2iJEDVCjFwjjpUTegSFn6AtGuFg2X5LrLN1Rh0AuFyCjl8L0P+jsPNhmvJV4NJQwLRbm1cIHqeIWUbPpPEA2NyCgi2s1o+gb27ghM+aszsm4LfxBNjcgoCATBN/pD9u4ITPkNiAFOC18QjYrIKJD0Uw76ZCs5HoMgiodeJQs8EM2KyCh9IHlH+jGnh41nGNj0mC0LTdHuFg2XdjXDFVQ78/dLlh9FFQ4AC3PRrhYNl/l1mm5UcpAISMgoEbOcZ/p6DzYZryVr5s4ZCyW5dR2I6kVv7Hn6ORANisgoCwBwQPpJ9u4ITPkzMSNuC2QQTYrIKIx7Iw36ECs5HoMgQNx7Ngs9EI2LyCi1nWtM+kX27ghM+S4PegELLRDNi8gofL9iXvp1p4eNZxgZsdZGCx/RrhYNlzAWugJUHGQ/fm1wnokZOwsFUHFayChZxXMz+kGQ8ULIKLpKbyX6UNACi8gog8KvRfp5EE2LyCgYRe1g+nYrOR6DIBA2sh4LcxCNiMgoxps9ZfoS9u4ITPkv88tJCxQQzYjIKOfdlh76RKeHjWcYOJcadgtA0a4WDZdd8ycvVDZkP35+cKqiZXsLcNBxWsgoU8ViAfpP0AKMyCj/8iw6+lKnR4xnGJg6xxQLedHuFg2Xkh/cK1RIEHBFyCiIZCZ4+nzR7hYNl3pHSmpUdCUy2Me/ZnfVBfp+EHRNyCgfOVck+h0PNhmvJYIxGx8LE75JA5uerd+NLwtA5aiJEACNc2ceC1jFgibpUZfVl2D6b/O3QpYfZMDgYwtJ0AKIyChVw/JW+gIQTYjIKFApOSn6QvbuCEz58D3VbQsEEI2JyChOmYQK+kIrOR6DIInIjEALVRDNicgoMRhRFvpzp4eNZxjLUKNkC2fR7hYNl+TpPkpUVvM3R5YfaVSrewto0e4WDZd06xIoVFUlvM3Hv+jT4g76IFDIUcgolzc2IPpYDzYZryUCYnghCxvQQpHIKAoccAf6OxCNi8gordcXUvoop4eNZxh/7lVvC0vRrhYNl0uhgG5USxBweMgoZxEeIvop5agJFgA4yQ8fCzWnh/cnGCx3/A4LZtHuFg2X/pl9aVRCEPBuyCilqfM9+k6QDGfIKNINVAf6K+XoyRcAXJ8VLwtHxUI66VHk6CF2+kenhwZPGFiQ7lwLeNHuFg2XyvAJR1QOJb7kx79GoMc6+jZkP/5tcMsIE2ILUPP3S5YfqSCuIAtSUPFayCjccat8+k/R7hYNl3Ci3HBUFyU75Me/IpgrZvpLZD/+YnCHv80ECxmQ8VrIKPRevkX6INDxWsgoT3pZN/pFvkmDm559b29ZC0GnR/EJGOMlTGwLTNHuFg2XEsIiYlRR5aiJFABjYyFRC3XRrhYNl9hjWWxUPwXDLOlR/ObiRPoKDzYZryU3UNpLC3fRrhYNl/YlBgRUYKWw0Me/IyZVEPpr5WjOHQBj1n9HC065tRyI6jTBURX6PBANicgotkeDafoZKzkegyDWWgRSCyYQTYnIKFkaqmj6PKeHjWcYKBH/JgsV0a4WDZddEPMBVFWFWHjpUba1pBD6F+UoSBUAcH+8HgsFpweSUBie2sohC27RrhYNl4qVuVRUEGQ/fm1wtlSifwsr5WhOIgDi1gxmCzzQgrbIKHDinAr6ZhDNtsgowZfpS/pvKzkegyB62zpHCyQQDbbIKD9kMQn6WvbuCEz5UTQsWQtpEE22yChYsVkw+hz27ghM+SnqYFgLUhCNt8goyXv9efo7p4eNZxjAarZoCxXR7hYNlyqArE5UViWrdQsAW5zLPQtv0a4WDZfx8XR5VDRkP/5jcCGAbVgLfg82Ga8lK8aePgshubVwgeo/JIgW+jYQzbfIKGa8qU76ais5HoMgjWWJVgssEA23yCgi7mAP+munh41nGOopRloLedHuFg2X5jDYdFQCJWsCCAC7sF0MCyfRrhYNl92pSXxUJ8UZfOlRc2zpZvoBDzYZryXA1MQsC0/FQjrpUdtNyHT6GNGuFg2X8Bj8J1Rq5XLxx78rD1Zc+g/z90uWH8goIX8LG1DxWsgo1ghObfoXkPFayChvGJQW+kjQ8VrIKJFYxWX6Z75Jg5ue64D0Qwsi0IKIyCjLrGMa+kanh/1nGH/NT0YLK9HuFg2XL2ftQlQOhcZr6VF71qxh+m8lv+DHvxsmNiD6TCWriQ8AI55sSgsWp8fhLhjuXiNzC1HR7hYNl/fFrU1UViWrTBgAS5IbUgtv0a4WDZehDscsVH0lchXGv8I50Q76ZA82Ga8lsiL5DQtHJStMEgDJWXUtC3TFwjjpUTZX8336Qrm1cIHqWWkUY/osEE23yCjZmdUc+iQrOR6DIEbqgWMLWRCNtMgouZ8zDfog9u4ITPnjfpM7CwAQzbTIKB0ejwz6ZvbuCEz5qL4ZNws4EA20yCiZ111K+hCnh41nGODp1UQLaNHuFg2XtHoMKFQb8/dLlh9en6RJC0DR7hYNlyLiPnZUdmQ/fmhwIPnaOgtG0ImQyCjdp40T+jYPNhmvJchcETgLf6dHSU8YzQ1VfgtO0a4WDZeFxMgQVB5kP356cJ5/+QsLc1AxQ8go5vM7L/olkHFayCjiRtMy+hnQcUPIKLQFqkT6LBBwWsgo27T2GvpRvkkDm57BIpNiC0bQQrTIKHLQp0b6VRCNtcgoGOe3Gfp9KzkegyCp83ACC0QQzbXIKMqZJEz6YvbuCEz5NSVPeQsjEA21yChV2j42+ib27ghM+div4GkLHRBNtcgoYSBdRvpWp4eNZxgwkM1oCzzRrhYNl1tfpQJUPdC1Wcgomm1DVfoYJauJEgBasPQsC1bFwjjpUYWNCGH6H9HuFg2XvbD4NVQOxUMz6VG0XcZW+hxkP/5ncNUvEyULJfP3S5Yf8fQPFAt00IKyyChdIYt/+j0QzbLIKAEHlhz6Ois5HoMgTPyXfAs5EA2yyCjmuJcC+i6nh41nGLHsaSULaNGuFg2XTY95PVQJpfrUx79RRdA7+hVQcVrIKE5221L6baeHewIYzUgBRAte0e4WDZfHxXtOVCSQsUDIKOZud3H6LtHuFg2Xb1nuKFRDEMy1yCjAE6wc+mNFQHnpUWyxsA76PQ82Ga8lGZa8CwtcuXUciOrTVPd9+hEQTbLIKDWNIhL6dSs5HoMgGNfDHQsIEI2zyCieqk86+i4rOR6DIKCS8j8LSBDNs8gohhI7O/omp4eNZxgPwPZyC0TR7hYNl6neKxlUV9BxWsgoZK9UY/og0a4WDZe1bfg7VGlFGnzpUZJ91Fj6Rg82Ga8lOPehVgtvuTUdiOq4ragC+lEQDbPIKKREvBT6WfbuCEz5wqewHQsZEE2zyCg4+voq+kWnh41nGJ46iSILSNHuFg2XIKb3alQsEHBYyCiK5OZ2+kbRrhYNl1N3wHdUSqU94ce/dql0M/oVDzYZryVNk3keCwW+SQObns5EhWkLSiWriRAAoWNQOwtkxYIm6VF4muYp+kSnh+0aGI1P938LbtHuFg2XEUhYAVQixcAx6VFD4aQD+jdkP/5QcBwmfzoLIvO3QpYfgeUXcwtM0a4WDZepPfZzVGAl/c/Hv+wswBD6JvM3R5Yffrn+HQt10IKwyChFYnQE+ioQzbDIKEQPDln6bCs5HoMgOjcYYQsdEA2wyCj96rMo+nErOR6DIClgjTULQxBNsMgomnYtKPpRp4eNZxjNWMoFCzjR7hYNlwua8xVULyWrCRYAZ/OcLwtZ0a4WDZfMrVQZVDwQMFDIKA677kP6fw82Ga8lmKxLRQszJavyFwDbS9lxC1TQgrHIKJXM91L6KxDNscgoVrYyVvpS9u4ITPkzR9AEC3cQDbHIKJJYg2f6c6eHjWcYvm8FRgsR0a4WDZfFlNoLVD0FgWTpUb/AlGP6YsVCOulRHWSIRfoPubVwgepPLC1t+kAQTbHIKFLUIg/6aSs5HoMgzJYIHQs6EI2+yChgP4w2+kT27ghM+VcpLzELNxDNvsgoeudRDfphKzkegyBYVAUyCwQQDb7IKJuFumT6JaeHjWcY1CD6egsN0e4WDZe3ME1KVH1FQC7pUV7DnBv6YiXzuse/QMJzPvow8/dLlh+UjJxpCxJQ8VrIKPVrKXL6BLm1cIHq1Qv5I/pyEE2+yCgH7251+jYrOR6DIP9GNncLNBCNv8go1YGhEvoEp4eNZxjihoQkCwjR7hYNlyVeCzdUGJDxWsgoh160dPoS0a4WDZdgY3khVE1FBDjpUYwWgWr6Bg82Ga8lD+GLQQtBp4dtJhjRq48sC2bR7hYNl/IMGUJUVtDxWsgoiSFlGPpI0e4WDZf9CuxzVAoQSbbIKI8V7QH6XpBMRcgoX7TCf/oKDzYZryXXnb9ICzG+SYObnjqRKSALPiWriRQAHI5NQgtWJWvOHQBgxwlqC325NRyI6koyBHL6XxDNv8goLi3iAPpy9u4ITPkj5PhVCzIQDb/IKI3uvgj6CaeHjWcYEXBrQQtx0e4WDZcGYtlFVGMlK0gVAFVCrVALMNGuFg2XzLwZWFQ9ZD9+UHCtuHAwCx4PNhmvJQI6PR4LL6fH4hAYtOF5QAsI0e4WDZc6v/0CVEUla04iAIdWtwgLLNGuFg2X8CRPT1RCZD/+Y3AMiOZxC2IPNhmvJfI7xgoLE/O3xIsf0YI5HAtD1WnBui1TiVtPC0yzcYhh+4azkWX6Tw82mawlU5qXAAtmvokDmJ57KFY/C2pl63ILAMzo3EgLENBCv8gouPnuGPocEI28yCgRMSI6+hf27ghM+fUZyVkLYhDNvMgoCqs0DvojKzkegyDsUXI4CzoQDbzIKPGFJT36aaeHjWcYmPHRXAs70e4WDZdmv8hpVCllKwIIAP5I72ILRdGuFg2XCiKmF1ReZD9+aXA/vJlmCzIPNhmvJZG/H0cLDMVCOulRAyduYfoL0EK8yCiZd/NX+mAQjb3IKD7WRh76OCs5HoMgewfLbwtWEM29yCgqQHw/+nIrOR6DIGsxzSwLbBANvcgorLkZcvo3KzkegyDPbQhpCw8QTb3IKJ5Un1T6Z6eHjWcYsThfWwth0e4WDZd488YGVGXz90uWH2UJ7m8LKtGuFg2XnTfQZVRWJXLJx7+bajcD+nkPNhmvJdw+uVILalDxWsgoHWHzKfpmkPFayChrsklV+i3Q8VrIKHzGhzb6Tr5Jg5uegO6wCgst0a4WDZdNRygFVABkP/5/cO2PHUsLZ2WriQ8AKckuKgtqp0eWOxif0FgOC33R7hYNl7g/ozdUK2WrTBgA9/jkXAsI0e4WDZfKG/gJVH9QtUrIKLaeqFb6ZQWGQulRdNX5Bfp7DzYZryVouGsbCy1lK0wSAAqKB3sLR9CCusgozRvfNPp2EM26yCjxQWED+lX27ghM+b9AfUgLRRANusgoHjIEF/pEp4eNZxj0cNEACxrRrhYNl3MzkQRUJ2Q//lFwGdcuYgtbxcI46VF6WzMW+h+5tRyI6ta2gTv6BRBNusgo3eASHPpoKzkegyA1YTcfC1cQjbvIKLzIgxz6SvbuCEz5mVxNYAsqEM27yCiZgz4Q+m8rOR6DILGSZycLOhANu8gov58DM/pdp4eNZxhWX1UyCz3R7hYNl7avfEtUVPP3S5YfMsOpYwtU0a4WDZf8DuQhVEhFhlrpUb6odmb6cg82Ga8lmqDEKgtC0e4WDZekzNIDVGLldN7Hv7/GEx36e1B2nsgor3ibT/pmUHFAyCgt8DtA+hWnRw0yGEDldBELEtGuFg2XG9Q0KFRd5TDTx78Lfd5Z+jmQcVrIKCxr6XT6HdCxQcgogounNfonEHBayCjWvlAd+ka+SQObnuh1lWcLJ7m1cIHq5gvtdPokEE27yCh3vYYP+kH27ghM+SErEjwLZhCNuMgoraqoY/pTp4eNZxgCtN4BCyzRrhYNl3K43CxUWqV9vce/IXKCRvp9ZauJEgCF/JwNCxTFwjjpUZJl3x/6QfP3S5YfSi+Oegsd0EKYyCgiQ7RL+h+nR4xnGOE9hxULbtHuFg2XGc3celQqUHFayCg1lg5g+gTR7hYNlwE2yxJUPoXGculRWi+aVfpk0HVwyChmbbZa+lwPNhmvJaWkyG0LeJCxRcgoEXQebPoO0HFayCj+uysq+lkQ8EHIKBBUNjL6Pb5JA5ueSHnTEAt7ubVwgepOCmEw+n8QzbjIKAmRiXL6d/buCEz59oAvEAshEA24yChK7qkH+lwrOR6DIDAieUsLShBNuMgo7cezW/pV9u4ITPk8h+sOCyEQjbnIKDpEm0b6EaeHjWcYPh97Bgtf0e4WDZdY6dRAVEJkP/5qcKlDslYLSGQ/fmtwBXiBfwtqZauJEABnB88PCxTQwrnIKP7deij6ERANucgok+/9Fvog9u4ITPnwTO5qCw0QTbnIKMS4zw76GSs5HoMgp+LdPQt7EI2myCj9LhQ4+mj27ghM+YoQ6HMLcRDNpsgomGZDN/p5p4eNZxjuLEQZCxDRrhYNl6b5tgBUGIWaO+lRZXq1afpKxYIm6VEgI4hH+hinB9ZpGHsbN1MLUtGuFg2Xjdz/fFRN5fDfx79tHTYl+mjzt0KWH5kfJQALCKeH+1MYuLeCZwt70a4WDZdzW5N4VHUQjXbIKLEjKUX6KvM3WpYf9oeCXwtNubVwgeoWIXpG+nUQDabIKNntaWP6Sys5HoMgHDxgWQsdEE2myCihCKlr+k/27ghM+Yf4rQsLXRCNp8goZTzbLvpvKzkegyDntmBpC3cQzafIKH2ARiv6XaeHjWcYFtszSgt+0e4WDZcV2aRNVBhlqwkWAK6g3xALQNHuFg2XXL9odFRVhRpe6VHhFRF7+i/Fw3HpUV0fOgH6eA82Ga8lGqEpeQtBZevyFwBk+Ek0C27FQjrpUYgQwzD6MvP3S5YftKkEUgt0p4fQKBi2tWxnC3zR7hYNl8cUVz9UNQXDf+lRQTL8ZvothQKU6VGhITRC+kdQ8VrIKJVkZjn6ENACp8golCkRH/pwEE2nyCiVBe1P+horOR6DIPwUuisLRhCNpMgoiVT4XPpHKzkegyADqvQ8CwUQzaTIKBXr4wD6DSs5HoMg3fhTUAspEA2kyCjLKIQc+nKnh41nGK5L7lULStHuFg2XLy/1KFRAkPFayCj+zng++jbR7hYNl+eSSyVUNqU+9Me/toQ3dvpOpb7/x7/nie8++hgPNhmvJcvfTDELYtDxWsgo+Xy5fvosvkmDm54X3TUcC2rR7hYNl+0kkRBUEYWCX+lR4oTHKPpeZD9+eXCJYZsVC21lq4kUAMWqrhELadGuFg2X8ATudVRMpXyqx7/e5IRz+lllK0gVAIMbzysLFfO3RIsfiKr0GAt01enfui0VpPlXC3ezsYlh+6rGAR/6eb6JA5ieE3FwUgtopWtzCwA16OZKCxmnh/FAGE+ctyQLXdGuFg2XG/vyB1RE5bq8x78eluwV+lmlKwIIAIEF0wYLVMVCOulRFc+Xcfpmp4dvKhiuyCwZCwvR7hYNl0f5LEpUd/P3S5YfeCC9NAs70e4WDZdRkoUuVFSFQITpUQIDkED6WGW/xMe/qstYQ/ocDzYZryUyq0EiCymnh1IRGDlbN38LPdGuFg2X1Az+ClQGZD/+ZnDZAnANCyNQ8VrIKLxktxf6J5DxWsgoCrwgRvoPubVwgerF44I5+jcQTaTIKEZ4dGX6TCs5HoMggASdUwsbEI2lyCi4IaVF+h/27ghM+XM6B2gLRRDNpcgofV5sfPoNKzkegyDQutopC2AQDaXIKCd/HkP6Y6eHjWcYLZWsSgt90e4WDZeeHgMoVHKQzGjIKGGJtlX6CAVGLelRFKNnO/pe0PFayCiN85RF+li+SYObnkXs/k4Lf6WriQ8AuB4CRwtO0EKlyChRvnRO+nEQjaLIKIDIW0X6Ois5HoMg1OcwPgt8EM2iyCiGQxlW+mH27ghM+d8vUgELJBANosgo9UkuE/okp4eNZxi5QJE0C1zRrhYNlz0E6ixUceX978e/43BqE/oqpatMGAAyXr9DCymlK0wSAGogV1gLGsXCOOlRreT6f/pU0EKiyCh0pgE6+jEQjaPIKC1winz6BvbuCEz5cGhNBwt6EM2jyCiRH/JM+kUrOR6DIJSkEFgLGRANo8goIzoud/oLKzkegyB8XRxIC28QTaPIKKfwFCL6RqeHjWcYVsdaDQtp0e4WDZfUDC98VAPz90uWH5Iy5V4LMdGuFg2XaOCNU1ReEAxeyCgilLIx+lMPNhmvJYf5PEULJFDxTsgo9Mk1PPod0IKgyCgS+Tx2+jQQzaDIKLPgM3H6cfbuCEz5/SJzAAsMEA2gyCgInUAA+k/27ghM+ePNVVoLBhBNoMgomdesV/pN9u4ITPnIYzVMCxsQjaHIKJh4cGX6IaeHjWcYwNeiKQsk0a4WDZexQ6MIVH1kP/5QcKYwoRwLb5BxWsgoMxsHHvp80DFOyCjvDCh1+ggQcFrIKDri1V36Hb5JA5uexEslVQsz0MKhyCiOoLg1+igQDaHIKJ0vegn6Oys5HoMg4yc2IwtCEE2hyChouAka+lb27ghM+WHO8m4LFRCNrsgo6dQSRvo+KzkegyD2kLMOC3UQza7IKNlPtyv6EaeHjWcYOx07ZQs40e4WDZe+d1h5VBClq4kSAJDmMioLIdGuFg2XPHSjG1Q+EMlMyCgW9mQA+gYPNhmvJRZ7NxYLdKdHVPsYDXwmfAt30e4WDZf2QvcuVGLQNWXIKNoXHHr6JgWad+lROvWjUPovxcI46VHGIARE+hG5tXCB6t/353f6IhANrsgoubKiB/pS9u4ITPkisRE1C3MQTa7IKFcXWTf6Xis5HoMgmjCaYAsoEI2vyChhbd9Q+mOnh41nGDQIViMLJdHuFg2XFwhpJFRF8/dLlh+Pw0QJCxTR7hYNl2jzBw1UStDNs8gowoelOvocZD/+UHDEKLgsCyUPNhmvJXBYp1oLd7m1cIHqf4hQZvpjEM2vyCjbS/1D+mcrOR6DINGBLiULfBANr8goaMFiTfpUKzkegyDFyIdAC1YQTa/IKEh2Ywj6V6eHjWcY4MgmbAso0a4WDZdcxnAHVCFkP/5RcOcGVSYLblBxWsgoF7a9I/oYkLFFyChY9YtU+gnQcVrIKBoVFj76NKfHg1IYNWCZHQs80e4WDZeNfPkhVHkQ8EHIKC1ehVb6W9GuFg2X+avIdVRiEMp0yCjQqi14+j4PNhmvJbvvCg0LU75JA5ueFIGKGgt4p0dcHhhWIgYDC1TRrhYNl1hpXhZUTyV1rce/z1jeZPpNpauJEAB7rLs8CzHRrhYNl6pdWShUZEVEKulRjYs/Q/oYxYIm6VF56fF1+j6nB1ZRGNjergELQtHuFg2XfNuEIlRcpbS5x7+don0l+g9l8B/Gv/wMPEr6afO3QpYfVmO8WgtU8zdalh8d2Yp9C2TR7hYNlwb3DmFUJoXAfelRfTgwX/ouZD/+ZXBGDD0bCzOlqwkWABKoUgcLLaVr8xcAmLT8agtPxUI66VH15wYC+gXz90uWH5HIsiQLcFDxWsgom0hBePprp0fuKxgFccoTCz3R7hYNl09DFDZUPZDxWsgoBB6vZfo30e4WDZfxPodgVDUl8OLHv9EEfBv6MAWZjOlRAr1HLvoLDzYZryVstoguCxnQwqXIKCYqbXn6QqdHjGcYyve6UQt/0e4WDZcPboJsVBbQ8VrIKMKntlL6etHuFg2XIOuCSVQPhY136VGKtnUR+kiF2m7pUTyduFP6Mg82Ga8lLh87QAsdvkmDm56Nngw4CzSlq4kUACgOvxYLXqUrSBUAHEJAVQsdubVwgeo8r/od+j8QjazIKEGjN3/6KSs5HoMgjBmmRQspEM2syCjC46kS+morOR6DILqpYwULexANrMgoEY0Hf/pR9u4ITPly/iZWCz8QTazIKKUsizP6JKeHjWcY9EECBAth0a4WDZcy2PsYVBlkP/5gcAWatnMLJvO3xIgfB0lHLAsd1WnBui3nvFpjCy6z8Ylh+36EsHX6fr6JA5ieDuo+eAt55StwCwAnHMt0C0/lKwIIABctu0QLW8VCOulRkMdUJPoR0IKtyChH9L8A+kIQza3IKHA66FD6KfbuCEz5VJGJZwteEA2tyCgXezAK+hX27ghM+ekYWkkLAhBNrcgoy7fzW/oAp4eNZxhmirNpCxPR7hYNl6Ww9jBUNfP3S5Yf1bSNRQs70a4WDZcqRMwpVHdkP/5icIWQhhMLYQ82Ga8l+t+gRgsX0MKZyChREJQz+hSnR4xnGJqZsnILDNHuFg2XmmH9BlQvUPFayChNGEYM+nrR7hYNl5ipYhtUIdA3o8gowTz7I/pBxUQ86VEuusoQ+m8PNhmvJZlqDTILFbm1HIjqZ6NPHPoWEI2qyCgfX/NT+mArOR6DIOfQeFILdRDNqsgoXsOJFPpkp4eNZxjDGVhICz/RrhYNl490cQpUCaX1oce/zAceMvoskPFayCi4jWZ++h7Q8VrIKDLx5Xv6Ob5Jg5ueoALedQtT5auJDwDbzd5rC37lq0wYAC7Xrw4LGuUrTBIAij9xdgthxcI46VFtBCFl+ki5tXCB6sMwVm/6bxANqsgoW19BJPpW9u4ITPmV25sJCxQQTarIKFbtKlv6fPbuCEz5Gcz2DQtlEI2ryCjxv8BE+j6nh41nGJ7S4n8LDdHuFg2XjcW8Q1RH8/dLlh8e75YkCwPR7hYNl6+qHkhUbhA2f8goroA3I/oFhUFj6VGTf5VF+lcPNhmvJZ7Cq3kLXtCCvsgos2RGKfoep0eMZxgROeoHCznR7hYNl4QlMmpUcFBxQMgoC9ILEPpM0a4WDZfFS5d1VFgFQ3HpUUOjfRv6NA82Ga8lUwt2fwsdubVwgep7Sa9R+gEQzavIKPX83hD6FSs5HoMgpentdAs3EA2ryCi4KDpT+l727ghM+TjWXjoLRxBNq8goHca6dfpzp4eNZxigWpgZC3bR7hYNl1H73SRUapBxWsgoS8DlKfpN0e4WDZf2LFhcVCqF2U7pUeesYGv6PIUYmulRNEcCdfpUDzYZryVlVct7C1PQsU/IKM1nWy76M9GuFg2XS9EtGFRqkEtlyCi4u8Ar+nAQcFrIKBAmvgP6Kr5JA5ueSinZHAsh0e4WDZe9dkZ0VC/QS3DIKPAmLmL6QkVZf+lRiUa2C/pL5auJEgBoMdVjC0DFwjjpUcXj5kP6dtDCnMgo93ApV/oZEA2LyCgNTJYn+gunh41nGJkZ9y4LTtGuFg2XAlgVWFRURU1L6VFJSRYy+hTz90uWHz7GdwwLPFBxWsgo4iAdGvogkLFFyCj7YBsJ+h/QcVrIKH/f60X6TxDwQcgoerywG/oFvkkDm54W6H5vC27R7hYNl11ov1lUA6Xwyce/Ukbqdfp6ZD9+aXDTJ/dqCxrlq4kQAMol9R4LILl1HIjqTLQhWfo0EI2oyChwPm4Q+gT27ghM+WGD1XwLFBDNqMgoMz/YC/oMp4eNZxgP0ug7C13R7hYNlyISFBhULsWCJulRNGuRePoI0e4WDZf9rEUVVDdkP/5mcGnojxULQdC0Xsgo25gZOfprDzYZryVp1EAFCxTzt0KWH2QEyCQLPtCCp8goRy92B/poEM2ayCgF2LM/+iSnh41nGGJIfBULNNHuFg2XqixhY1Q9ELagyCg2edU1+hElNrrHv3mvljv6V/M3WpYfT5wbLAsV0a4WDZfqcRkkVHRkP35kcEVe8xMLOeWrCRYAgBiWEws+p8fwDBjWSX1tC0DR7hYNl+w6X3ZUUeUr8BcAGNvabQs+0a4WDZeWzqhkVCkQSLDIKESaCWH6Mw82Ga8lliTzGgtExUI66VHygcEP+lLRrhYNl8AOYH1UFOWwDMa/ZE80Vfpn8/dLlh8z+kp3CwfQAqjIKI46B3r6WhBNqMgo2A0eefpm9u4ITPkKFopMCz0QjanIKK//oAv6APbuCEz5ur8lHQtEEM2pyCjLSvdX+kwrOR6DIFkuwAALZhANqcgo9T3YUPpGp4eNZxjoj9lxC27R7hYNl97omjZUV1DxWsgoApQVUPo50e4WDZediuhcVAJkP/5icLMr73YLdsWHcOlR9b0sSPpaDzYZryUZ1OYXCw+5NRyI6izq/h76LBBNqcgotaLZQfoM9u4ITPmxGkFECxMQjdbIKC5TbUf6D/buCEz5z4wUBQswEM3WyCilqowy+mT27ghM+XU2kgwLHBAN1sgo7TETW/pOp4eNZxgaPwtECynR7hYNl654QAFUNpDxWsgooyjDIvpn0a4WDZddkscwVB+lesLHv3PbFDf6QA82Ga8loWI5fQt20PFayCg2779v+lW+SYObnh+vKnULMbl1HIjqdTFiaPoNEE3WyCgedecl+iv27ghM+cqUQgoLdBCN18gocpQ+Ivo9KzkegyAQe31/C2IQzdfIKFyoAGn6Bis5HoMgaPPBJAtrEA3XyCgGABct+kCnh41nGI/KtycLKNHuFg2X6wLAMlQe5auJFAD9bMJYC2HRrhYNl7qQuWxUN9DPjcgoq1DJe/ohDzYZryWWzVZVCwPR7hYNl/X5IRZUUWQ/fnhwyzDwHwsv0I5ZyCjjvlg7+gDlK0gVAJGX/XsLfvO3RIgf28U7dgsv1enfui1MWJREC0+zMYlh+1w+Awf6Q76JA5iecMX3NgtAJapxCwDbcR5+CyolKgIIAL1oOnsLS8VCOulRDQRHE/o88/dLlh/MRptOC0dQ8VrIKBnR/iL6VqfH3gQYBa3bWAsG0a4WDZehde8gVG7FQHXpURYXnS/6aJDxWsgouLf9Hvoe0PFayChp51on+i6+SYObnhs/OUILOadHszoY97u+Sgsj0e4WDZdoM7hvVC6l89/Hv8eJiUr6eCW23ce/UOaDY/pjJaqJDwDLrOcXCxS59RyI6ifOeSr6LBBN18goF17BOfpR9u4ITPnR3aImCwkQjdTIKJASnHD6WfbuCEz5Bvt+AgtYEM3UyCix51YM+mWnh41nGJzjEigLddHuFg2Xd7r5XVQIJapMGAAVsw8AC1zR7hYNlxMCuTBUaMVeOOlR5q9oHPoI0AluyCigeWB++kQPNhmvJYpb8V8LV9AC1MgoD92mW/plEE3UyCg2iepx+lb27ghM+UjKI2QLPxCN1cgoLRdYPvpDp4eNZxi2z3ZcC3TRrhYNlxNHRjRUXoVGSOlRaXDCQfoVJSpMEgBDa78tC03FwjjpUTg+5Cv6adGuFg2X4QdULVRlZD/+aHApf8B7C3rz90uWH3UVNFALQtCChsgoTk37d/oHp0eMZxgMR1AyCy/R7hYNl8cllnhUIVDxTsgoXV6/Lfp10e4WDZee3SdxVE/QCZXIKA7gUC76C4XbVOlRv13DZ/orDzYZryXotSR0C0yQcVrIKL3jwCb6ZNAxT8go/SmWGPppEHBayCid2e1T+iG+SQObnqiZbBoLGyWqiRIARFXoOgtO0IKAyCj5TbBc+hQQjdTIKGh6Hxf6eqeHjWcYzYamWwtg0a4WDZeqHuUUVC9Qy0rIKBn5lF76XMXCOOlR7UClDfoP0e4WDZePsUZLVDplvAbGv0U/EEf6PsXNbOlRTQBcbfpy8/dLlh+LGrVmCyJQcVrIKLKi6WX6f9BCq8goAAnMdfpgp4eXZxhP3eQ+CxfRrhYNl7cPFWJUZ2Q//mdweI9nbgtWkLFFyCiWQuhs+hbQcVrIKP6WV3T6KdDC1cgo+/M0RfoZEA3VyChlYS5e+nb27ghM+QtRlXMLTRBN1cgoxr+ddvo4p4eNZxiDu1lNCxfR7hYNl8oevD5UFxDwQcgotVrvGPpe0a4WDZeP3RkiVBTlNwvGv9rULzT6Jw82Ga8l7ez9NAsYvkkDm57ADNJoC1zQgtLIKLaxox76NhDN0sgoLr1mO/pEKzkegyCik+Z+Cy0QDdLIKKeQLUH6CKeHjWcYcqvmbwt30e4WDZfrk8AaVCFkP357cMWZXHULLcWePulR3wnKYPp2JaqJEACDR/F+CxnFgibpUQvNniv6LfO3QpYfF86bMgte0IKeyChfiTYi+ienR4xnGC8Ym34LBNHuFg2XERvwRFRZ8zdalh9Moz8iC0XR7hYNl6VSn2FUW4UBi+lRk2kIQfpoEPCOyCjv8at6+igPNhmvJfKFdTsLLyWqCRYAEKluTgtIJarxFwD3rAB3C0W5dR2I6mwcbyf6RxBN0sgo5yTofPp3KzkegyB1AqhoC3QQjdPIKHhkKzT6PSs5HoMglLn0KAsbEM3TyChm+wxt+junh41nGEf2HioLQNHuFg2X30j2E1QUZfMzxr+4+4BF+nol+8rHv/cK62j6Z8VCOulRpt3lZfoquXUdiOq0rmgV+j8QDdPIKKfRY2D6DPbuCEz5r6kUMws4EE3TyCg6Nwo7+k+nh41nGMc08UoLYtHuFg2XG7i6NlRt8/dLlh+1JAc3C1rRrhYNl5T/UypUB2Q//m9wBnFoGwtQDzYZryWovEYlC2TQwrLIKOqHDRz6RqdHjGcYJdOebgsF0e4WDZdVOVs+VDpQ8VrIKEhGCxT6J9GuFg2XakH4aVRTZD9+UHDFjtdfCw8PNhmvJelcTl8LfJDxWsgovG5LMvo90PFayCjSTR8X+lu+SYObnkCYREELe7k1HYjqc+ClAvpZEI3QyChN2qxQ+gr27ghM+ZLvWwQLPBDN0Mgo30smCfo5KzkegyAdmdZpCz4QDdDIKCCvbV/6GPbuCEz53rJ0QgsBEE3QyCgK4tYO+k+nh41nGDjydVALWtHuFg2X0zCHTlR4JaqJFABwNL0kCxPRrhYNl/XIf2VUd+W90ce/iKQEA/onDzYZryWdNhkOCzrQgtHIKDL9Nij6bBDN0cgo46r4b/o/KzkegyDhQFIPCykQDdHIKCur6WH6Qis5HoMgQmlUdQtkEE3RyChU0pUB+gH27ghM+Xw1WDELWhCN3sgoIlR0Pforp4eNZxjI2Sp0C0fR7hYNl5KK0ExUXaU/Esa/bdCzbfpiUPFpyChQbV1t+jwlKkgVAHlnPg0LSPO3xIkfT7WlVgtu1WnBui095vxzC1mzcYlh+5EjLAf6XL6JA5ieIyyeLgtOZSpxCwC+3zwRC31lKgIIAB5YcE4LH9GuFg2X9fABCVQYEAucyCjcpmwf+kzFQjrpUeABE1r6bPP3S5YfbT3cWAtMUPFayCjX8j1H+kqQ8VrIKNf1Slb6OdDxWsgoFdItA/o7vkmDm54X8KRaCzC5tXCB6s+hyEz6RRDN3sgouTIjf/oz9u4ITPlAcWQyC0YQDd7IKJgdPlP6c/buCEz5ePKTTgscEE3eyCh750Fd+iSnh41nGHGqBVMLYtHuFg2XmYlaSVRAJfLRx79J5h5d+lSFW3vpUfprgT76NGWqiQ8ABWSLPgsh0ILfyCi4AdEI+gEQzd/IKKIA0WP6QCs5HoMgFX1wAQsMEA3fyCihoJsY+jr27ghM+VpcJlYLSxBN38go0IRBAvp+p4eNZxjSN+EBC0vR7hYNl1jGMn5UG2WqTBgAJmVmbQtC0e4WDZddwlJFVCxlMqjHv9oWsn36PkUHiOlRsP/FDvo0DzYZryXMr915C2SnR7UDGH9BywALFtGuFg2XQ6TRXFQuZD/+YXCd2/98CyZlKkwSALXHlXELK8XCOOlR4feBPPp90AKnyCgwbHpP+nKnR4xnGN9TM0ULRtHuFg2XEXRnWlQU8/dLlh943tlFCxHRrhYNl5zYbSJUVGQ/fm9wCCTNYAt9DzYZryW2lOtBC0G5tXCB6jqe+Wb6fBCN3MgoPujsbvoSKzkegyA/sLsjC0oQzdzIKHSGj3L6L/buCEz5bV19RgscEA3cyCi4qLQL+gIrOR6DIGy3Ol0LJxBN3MgoWgCrTvpbp4eNZxiyOOcMC1bR7hYNl0PuZw9UAGW81Me/Gn+qS/p7RUOW6VEgzCp9+n5Q8U7IKBceAlL6aZBxWsgolOg4ePp90ILdyChlB78R+iUQzd3IKPRywgP6A/buCEz5EQZBVAsaEA3dyCh4MNRH+gD27ghM+TxdeDcLXxBN3cgodiqfB/pxp4eNZxggJj4LCx/R7hYNl5gGjCtUKGQ//mVwqYoJOwtXUA1gyChb30w3+h7QsUzIKCgL7EL6RhBwWsgoV3GhR/oKvkkDm54xtQhuC0HQgtrIKON7T3b6axDN2sgo2H/4fvpw9u4ITPnEsx9ACzoQDdrIKBVShVL6dSs5HoMgPBnlHQshEE3ayCgkcx4Z+gj27ghM+cf/LS4LQhCN28goLl2EX/pNp4eNZxgY4mMkCy3RrhYNl6Yy505UHYVeWulRo/MmdforZaqJEgCI+tBPC1TFwjjpUVIEi0P6etCCnMgot6DdMfpZp0f9ZxgE6UI6C0vR7hYNl2uUs11UeWQ/fmRw2OhRFQsSZD/+fXBhLYgkC1zz90uWH8sP5AELR1BxWsgoFUJUH/pN0e4WDZchaz4fVBVkP/5pcFMy8QELCkWAi+lRo/ozD/oykLFFyChxbsop+nTQcVrIKKLz/D76dRDwQcgoL7ctIvoavkkDm55FlF87C1DQQrbIKE6HX0z6ShCNrsgokaLLG/oqp4eNZxjwVM0sC0bRrhYNl3WPswhUeOU9B8a/Q6kdO/pSZaqJEAA+w3RDCx/FgibpUdUhCHP6G/O3QpYfxuDaHQsD8zdalh/rYOpLC12nR49lGMMAHw4LAdHuFg2X6sVlflRfZaoJFgA4AeMpC0XRrhYNl7ZjpEVUECUzBsa/bUE/UPo8DzYZryUhpLoaC0VlKvEXAO62/ygLQ8VCOulRwhccPvpEpwfkSRjQA1tGC1rR7hYNl83wa0BUVwWGj+lRCa9SGvpZ5boMxr/UalpE+ibz90uWH5Tqv1oLL1DxWsgor+vuRvpvkPFayCglXqc/+g7RrhYNl23wDldUO1AMt8gohjkzKfpE0PFayCi8LQ8M+jm+SYObnjq+/lELbdGuFg2XIEeYIFRWELBHyCjIvXtk+htlqokUAHfC1nULS2UqSBUAMBYTXgt187dEiR8w9LcpC3/V6d+6LVmvhmELLrOxtmH713AYVfpDvokDmJ4C2eBCC3SnRwRJGBUv8UILNNGuFg2XiM1+PVRXJXPZx783dYkE+nqlqn4LAOpffn4LVqUqAggAMSY0UQtBxUI66VEV3+Rl+l/z90uWHwwV8hsLZKdHmVkYMDh2NwsE0e4WDZd3pu5yVFlQ8VrIKOiddDn6atGuFg2XgjBIc1R+Jf3Mx7+3e2dj+ngPNhmvJZ6aXUgLZNDCisgoBJOBBfpGp0eMZxgthAoOCxHR7hYNl/GIPjlUE5DxWsgoz1DPePo10e4WDZf7qfgBVFfFmnnpUV+OB3z6epBJQcgoS7KMaPolDzYZryUL999XCw65tXCB6meqvUr6MxDN28go2+DaZfp/KzkegyCkRQZaC0UQDdvIKCEleUj6XKeHjWcYqxYsOwt70e4WDZfVXVkKVFgFmDjpUR1C3gD6RGQ//lFw20Z5UQtE0PFayCh9epcP+h++SYObnv/mJ3ULN9GuFg2XAqwISFQ/0EqCyCizvqkI+lKlqokPAH4pO2YLZqWqTBgA4jMdYgtgpSpMEgB6LY4IC3inR8RCGAEquHALE9GuFg2Xy6ItElRk0IxkyCgINKMz+i/FwjjpUQfKvxL6SfP3S5YfP0rBCgs/0AK6yCg7aYZ++jGnh+dnGFaKYFYLPdGuFg2X25bnCFQfhV5X6VHJhC40+j1Q8U7IKE0ktQX6N9BC28gooS5yavpIEI3YyCgc5sYw+iArOR6DIJbhX0YLCxDN2MgoILxEK/oTKzkegyBjcs0YC3MQDdjIKG/ihGP6aKeHjWcYBcZiVAtC0a4WDZeIahsLVHblNAnGv2CcpUb6G5BxWsgonRztEPoi0DFMyCieWCQy+kYQcFrIKBSbABX6Nb5JA5ueUWj4OAsWpaqJEgDY+kZpC0u5tXCB6opTvEn6RhBN2MgoXMm2Mvok9u4ITPm6qJJaC1EQjdnIKLfOcg76J/buCEz5r+q+YgtxEM3ZyChTwX8e+iinh41nGMRENAQLf9HuFg2XWYyHMFQXZD/+U3BBmlpcCxYFgovpUafKtlz6FMXCOOlR34lPMvoSubVwgepDdVZZ+hgQDdnIKLg8eyz6Yys5HoMgHBP/BAskEE3ZyCjkMcoz+nunh41nGCy9aGcLL9HuFg2XXyrPIVRg8/dLlh/ronpJC1LRrhYNlyIuakBUPhB3ocgoX6+eDfoCDzYZryWbStQzC2NQcVrIKFmiFBT6VLm1HIjq391+ffpoEI3GyCgzAcwd+jL27ghM+WfvuhULfRDNxsgoDNDtWPoiKzkegyCtUDg6C1UQDcbIKGxA7xj6Nys5HoMglqLobAsaEE3GyCjUnTl4+nanh41nGKOua0wLatHuFg2XJCsjdFRnULffyCggwGMK+m/l/djHv3HkvQb6JJCxRcgopTAONvpduTUciOqdJDZX+h0QjcfIKMNhtgj6WSs5HoMgaCZFYAtPEM3HyCh4Z/99+gSnh41nGLYHsRoLRNHuFg2XIt3oRVRSZD9+UnB6w3QOCzYFAL7pUcGrkCL6RNBxWsgok3U4dfpMEPBByChosRZH+hG+SQObnvG3pWULJaWqiRAADWqWRgsW0e4WDZeiVYw2VElkP35QcFniCm8LLKXwpce/8151SvoOxYIm6VFbKaJh+nnzt0KWH2dUjXwLN6fHDTAYtiMqJgs70e4WDZds9ewZVGBQDqXIKGtj6HT6SdBCfMgoP+KoOfpo8zdalh8P3NV/CzSlqgkWAELt9DALeqeHMisYW1jOWws90a4WDZcgw69EVEWFWEvpUX2F1nn6OqWq/hcAhqEXXQskxUI66VHeeVN4+jHz90uWH1Eo9FYLcdACx8gov3AyI/oWEE3HyCgGmhZg+lErOR6DIDz3BzoLDBCNxMgojwV5YvpMKzkegyCmOdZVC1YQzcTIKNrFPxD6Z6eHjWcYkXDYKgsU0e4WDZcePblXVH1Q8VrIKPN2KVj6fdGuFg2XTG4NJlQSEDVuyCi398tl+jwPNhmvJWnWwm0LMbn1HIjqVnAkaPoEEA3EyChQXZkU+icrOR6DIL0MhhwLWBBNxMgot0NuP/p09u4ITPlbFW9kCycQjcXIKIwZRz36Xis5HoMgBCq3aQtoEM3FyCgqVWMu+nOnh41nGFlppVELZNHuFg2X7uYxJFQFkPFayCi6e3kt+l3RrhYNl5HpxRpUZQWHLOlRxwZjYvpfDzYZryV+YBJMC3vQ8VrIKPVrRQv6RL5Jg5ueEYUpDAtm0ELUyCg5IfEo+i6nx+tnGKrDBmkLNdGuFg2Xl8end1Q6ZD9+f3AhIsUvC32lqokUACzCRBcLG9ACxcgouFi+AvoCEE3FyCi70XdX+nkrOR6DIFjDkRMLbxCNwsgoYBbXTvoy9u4ITPnKkdJACwEQzcLIKB9OUhj6aCs5HoMgCyXYAwsKEA3CyCg/GxFq+i+nh41nGK3eIkULPNGuFg2Xdxw/DFREJbIQxr9/3ZFp+h+lKkgVAJLzzRsLVvO3xIYfj0pDNQs61enfui2S6nZ/C3mz8bZh+4/v7Hv6Fr6JA5ieQpzkNAsm5Sp+CwBLkNZtCxLR7hYNl1T8w1pUFxA3TcgoesifDfpoZf8Dxr/R8DxM+lzlKgIIAPP3QSwLWMVCOulRY5upA/oL8/dLlh+S7VtOC0DRrhYNlzbU7CpUXtDJacgoK9cfS/pIUPFayChsQdB1+nPQwsLIKDmgRXH6UqdHjGcY5Z7WMQti0e4WDZdbBBNnVACQ8VrIKMaGQUT6WNHuFg2XIt40cFRVRUec6VGUx4s2+ipkP/5ucBGdPUwLcQ82Ga8lpfPQegtx0ELCyCj1Ht4v+lIQjcPIKKD64SH6XPbuCEz5wWd6cAsvEM3DyChwPRMY+hCnh41nGMtMSRwLENHuFg2XSPA8CFR00PFayCiNXAUQ+iHR7hYNl5OLEi5UM2Q/fntw0gfiIAtBZD9+enADimc1CxoPNhmvJW9gOmALd75Jg5ueR+3RMAsM5aqJDwCrrpwkC3O5tXCB6qW5MWz6VhANw8goPO1AIvpZ9u4ITPmrrsk+C1wQTcPIKKGpeEX6OfbuCEz5a4mGLgt4EI3AyCjdCUQm+hkrOR6DIMxhkwILQRDNwMgoWE/cOvohp4eNZxi+I4JGC1bRrhYNl5gDonhUT2Q//ntwBzaaSAtP5apMGAAOKJInCwLlKkwSALlAPgkLCsXCOOlR3pk9PPpf8/dLlh9GxYwRCze59RyI6lU8WiH6FRANwMgokPqnN/p89u4ITPkIy6ZDC0EQTcDIKHI7hG76Qis5HoMgKfn8UQsrEI3ByCimA4Ev+lYrOR6DIMa4i3ILNRDNwcgoNeGCDfoHp4eNZxjocEM/C3PR7hYNlyq0CmBUP1DxTsgoDGh2Mfpa0e4WDZcA0R4UVFVkP358cDUoAysLHaV9Lsa/QxwLL/ofDzYZryUeEktQCzTQgp3IKNIveSD6ZadHjGcYOumYJwt20e4WDZc5cZlXVBGQcVrIKKCd42H6BdHuFg2XglDGfVR5Bc1J6VHDOo0y+gPFGyDpUV1jTwT6TQ82Ga8l2NXGHwtx0LFNyCgp45Zc+nLQQr/IKEz7QXX6AadHjGcYdFkjSwtI0e4WDZf3O99/VFIQcFrIKB4rbwb6RtGuFg2XB1UCAVRipTUHxr9P4dlR+iYPNhmvJdvcahILT75JA5ue1Od0cgsd5aqJEgDF9gwLC0nFwjjpUdLERi/6e7m1cIHqymyFXfp8EA3ByCgA0nIl+jn27ghM+fQdNHYLZhBNwcgodq+bDPotKzkegyBjLTZWC0cQjc7IKFT/jTX6OaeHjWcYizp4QAs80e4WDZdtFToqVE5FjWXpUdmKP2n6WMUbIelRhn2vZfpV8/dLlh8iyzFwCxCnR8v9GM+OIBALf9HuFg2X93bcM1RXUHFayCheeftm+mPR7hYNl/ZBTRFUZuW0rce/POYOQvpVBcWd6VEow3NC+mAPNhmvJT/d7RQLeJCxRcgoF/90XPoRpwfrRBhxDQ9SCxnRrhYNl5YryEVUWJB1pcgoMH6ecPo50HFayCgPJsUs+hgQ8EHIKMdyH2b6Vb5JA5ueSxXOJAsk5aqJEAABilo0CzKnh04OGKDMQmQLWtHuFg2XY/e4C1RMZD9+anCPbj9sCyVFBFrpUaqhsAX6H8WCJulRkeSof/op0MLOyChL/GYc+m8QDc7IKMIN9AT6X/buCEz5Ed3UdgtfEE3OyCj69Kkn+jErOR6DIO5B7nELVxCNz8go+vYmBvpMp4eNZxiX4mwPCxfR7hYNl3RHJiBUVvO3QpYfLVLLUgsb0a4WDZdnMA9xVBFQ8dTIKL/6tj76bQ82Ga8lgMRaMgsPp4d4HBgPv5FxC2jR7hYNl0Ap81RUSPM3WpYfXo+iDAs20e4WDZcpn+ULVDNFx7TpUXX5kRn6HGQ/fn5wkfBTPAsBDzYZryVGUws1C025dR2I6gNkvCH6BhDNz8gopxUpLvpz9u4ITPnfZCMyC1wQDc/IKF/7ryz6F6eHjWcYDdSkSgt00e4WDZexX5osVBblqgkWAJUHF1MLatHuFg2XXUr2LVRuEDF6yCirpF9q+i+lfSHGv2EaJj36dQ82Ga8lk7QnbgsO0ELPyCin8NgK+l8QjczIKCGItST6O/buCEz53arDSwtTEM3MyCgKpuIy+nKnh41nGLTtIlsLH9GuFg2XgNoVIVQFpTHax7/e0Y55+mrlKv4XABVZ/2ILS8VCOulRSDYYO/pV8/dLlh+D+IdiC1mnx5FOGHY4vR0LYNHuFg2XaNaSG1R2UPFayCi+nXtj+iHR7hYNl09IEwVUK2Q/fmpwf+dRMgsNEPWkyCjthPdD+j8PNhmvJdf9414LE5DxWsgoOGh6e/pO0PFayCiqdcBO+na+SYObnh2V7RALWeWqiRQAFofrZAtX0e4WDZdoKx8ZVA2F247pUUhmCHX6TdBJWsgo6JnWcPpD5SpIFQC/HIELCx/zt0SGH9oqE3QLZ9VpwbotWyE0EwsUszG2YfsXmLVw+iq+iQOYnnjo6UMLLiWVfwsA2/7fVwsqJRUCCAD+GwpOCwfFQjrpUexuaUD6TdDCq8goNyMRW/php8eGZxjqodsmC2bRrhYNl05vQW9UFAWCdelRSIeAfPpE8/dLlh9o77tECwhQ8VrIKNcK2HT6RdHuFg2Xu+SRR1QORRu+6VFM6HsB+hYQcdnIKHiZqTD6QZDxWsgo4WaQH/oT0ALMyCiTZBUZ+lwQTczIKAwYGyz6SvbuCEz5XfuTIgtREI3NyChObsIK+iArOR6DIGnJ5x4LZhDNzcgoE3uIC/pdp4eNZxi1DoAXC0vRrhYNl1SUgDJUE2Xzvse/6cV7JvoK0PFayCiGA/lT+ne+SYObnm8gniILL9DCpMgoc6bAIvoKp0eMZxjNF4wfCyrR7hYNl8f7lWJUNSWViQ8AQFG1LAtB0a4WDZcD3pl5VAwQNWDIKIi7QGj6LQ82Ga8ls/nkNAt+JZVMGAAMias1C1zQAs3IKAxDsUP6HRBNzcgoAZSQCfpbKzkegyCapGglC14QjcrIKF7mbH36F/buCEz5H6xTLgt8EM3KyCiHioBb+m6nh41nGAFwqG8LJtHuFg2X8tHfbVQoJRVMEgBXH5VwC2nRrhYNl55IujlUIaV9Msa/ZcPzKvp3DzYZryXti7xuC1TFwjjpUd3q2XP6XfP3S5YfnD8QbQt/0a4WDZcjqdl0VGqFBC3pUW7TPxb6M1DxTsgoIzyWXfpKkHFayChyGOBG+jbQMU3IKG6GnW36RtGuFg2XPRhaClRERdlL6VGK2dEM+gcQcFrIKCMxjnz6Zr5JA5ueFD9oWgs+JZWJEgDuWBNSC1PFwjjpUZJ0UR76P6fHYhgYzQ+hPAtL0a4WDZeH69tEVBMQcJLIKFIDaDH6S/P3S5Yfq1syLws00a4WDZdMYBdoVEhFWFHpUSqSAXH6flBxWsgoB/3jIvpE0ALKyCgrRC1m+icQTcrIKPjmoxD6JfbuCEz5hiU4Xws3EI3LyCgCxsQ6+imnh41nGH6P+F4LddHuFg2XmX4KFVQjkLFFyCj17CN7+gjR7hYNl5xlcXpUNYVZKulRiqcYC/oZULZHyCj7vwVh+jQPNhmvJcLPqC0LStGuFg2XpnQOb1RJZbXtx7/f+7cY+nrQcVrIKELA1wb6ONHuFg2X93SVXlRCELfZyCiAQq1T+g7FGW7pUZp06mT6OBDwQcgoAaD7f/oyvkkDm54sR9ctCywllYkQAIN6SXQLZsWCJulRFakZBfoSubVwgep4wpls+k8QzcvIKE+yxH76DvbuCEz5/DfbUAsmEA3LyCiyiUU6+jIrOR6DIJf8Iz0LVxBNy8go1fEPHfptp4eNZxjN/GAWCxvR7hYNl7K1hzhURhCMs8go8XTQDPpkhcOj6VHD9f0w+gHzt0KWHxvVUksLHPM3WpYfcjFeIQsGpwd18Rgo3To+C0LR7hYNl74HmAhURyWVCRYAjXWHBwte0a4WDZcOJUUlVHpkP35ocPeQ4S8LGg82Ga8l/b4TXgsfJZX/FwDqWAJLCwrQwq3IKIO7BSr6YKcHmmcYbA2hfgsr0e4WDZeEd/kEVHxkP/5icOM1rHELd9BCpMgox2cjIvpkxUI66VEIX0p6+mbz90uWHy1zuh8LD1DxWsgoych9NfoDkPFayCie8GVH+k+nR/EyGCJGci4LeNHuFg2XZtQHUFQOZD9+bHAtrAYeC3KFx1TpUQYuMSv6XtDxWsgois0tMvoivkmDm54DMgc+C3u5dR2I6rcDbD36GRCNyMgo0oLae/oCKzkegyCDdlE6C1AQzcjIKHYhPQP6H/buCEz536PhFwslEA3IyCj8IKIU+kenh41nGJogfCALJNHuFg2X2PFUTVQgpXrgx78+TNM++hUFwqvpUaU4DEX6LCWViRQAaRmKUwsOJRVIFQDvtstwC1Lzt8SHH+l1bToLG9Xp37otKWAyQgsLs3G2Yfteo6sA+ia+iQOYnl2CDEoLT9GuFg2XnH/6OFQmBRkn6VGV2Q8n+mFlFX8LAJvoH2sLHWUVAggA+dGgVQtkxUI66VG7WP5/+ifQQsjIKDYD3Tf6CRCNycgoczrUY/oIKzkegyAAj79tC3kQzcnIKPhGUSX6CvbuCEz57fDCHwscEA3JyCjAt3ld+hH27ghM+VvZ5icLLxBNycgosAF+KPopp4eNZxi3tO1HCx7R7hYNl0OJkg5Ud/P3S5YfWWDKHgtx0a4WDZcsXxdbVEVlMfXHv+yrPg76eQ82Ga8l21AMfQts0e4WDZeCIW01VCFQtdTIKJcKsj/6YJANzcgoCb6nLPorUPFayCixFHhW+meQ8VrIKAbDt276Mbm1cIHq53wKLvpIEI32yCijjalm+nYrOR6DIGtJoAYLLRDN9sgovI2scfonp4eNZximm8t+C3fR7hYNl7ikgjhUQdDxWsgo1JNxVfo30a4WDZcZViZWVAhkP/5kcI6MJQkLRg82Ga8lawU3LgsevkmDm57x/I96C3NllYkPAN8w3nwLONDCnMgoZQI3Vfp+pwfNZxhh5ihdC33RrhYNlzRduWRUfAXHlelRHdeeWPpBZZVMGABRwpY6CxZlFUwSALPtfHALRsXCOOlRNr+YEPoo8/dLlh8bIN5qCy1QsUrIKMFNz1P6ZpBxWsgo8A/+evoF0PFKyCi3ptEz+nMQcFrIKN1vAkz6CL5JA5ueLwMtCgsj0AL2yCj0n3Qi+hAQTfbIKOxMRjn6UPbuCEz5GdAONws6EI33yCiNrWlL+i0rOR6DIBB90CALCBDN98goAqsIUPp0KzkegyApB+BCCwIQDffIKKgWWh/6d6eHjWcY8qA6Bws/0e4WDZeqeZxGVA9llYkSAKtMI3gLYNHuFg2Xk3mAW1QAhd4v6VEzEYlK+hOlMAHGv3fT93j6dw82Ga8l0VQrBQth0EL3yChdfUwy+lQQjfTIKEhb+XL6QPbuCEz55AzYWQtIEM30yChsYroH+mqnh41nGJIXQF8LNtHuFg2XR/3gelRixcI46VHTY/IH+mLR7hYNl8Ui3V1UX0XGO+lRZEDFI/p4BRha6VFtTLll+jwPNhmvJUwdYWwLDNHuFg2Xjin8QVR60I7ayCh7Zcgr+kJkP/5ucG4BmTQLOPP3S5Yf3lLWBQsjp8eRThgGxhxBC1PR7hYNl0o9gShUP1BxWsgo0t4EVvp70e4WDZf804wBVAKFGYrpUenhpij6VmX89ce/85LHb/odDzYZryWVlOJfCxCQsUXIKPyt+hT6FdAC9Mgo10dwWPp4EE30yCjdFHQi+msrOR6DIP90JXALABCN9cgoXIEREvpIKzkegyDZJjp1CyUQzfXIKJoZlBL6eKeHjWcYkkUFFQsX0e4WDZetWuwTVE7QcVrIKGELYWT6PNGuFg2XLo5LdVQnhcFM6VHQ72o6+kgPNhmvJRnlhwwLYhAwSsgogEq8XfohvkkDm545P9hPCw7RrhYNl2MeiExUTxDKecgoHy/9LPoxZZWJEADuqVZlCxbQAtLIKHGsoWn6OxDNhcgobACBFvoap4eNZxi1pf4yC0DR7hYNl2dejUFUXyWyBca/DxL7SfowZD9+enA/TuRoCwjFgibpUYkWDW36EKeHEEwY31/oQgsh0e4WDZdQN6I4VCPzt0KWH0aX6BoLbdHuFg2XwC/MWlQPEPXEyCiO0Gts+kBFAjjpUTaogw36Tg82Ga8lG3OgMAsD8zdalh8VhVN8CyXQwsTIKIiKb3j6YKdHjGcYb1lREwt+0e4WDZcpbCQuVFhllQkWALZMRDgLSdHuFg2XKFcdCVQ0EPeKyCgcv7Rl+lpFAXLpUdkYwn76Ww82Ga8lq2yAeQtUZRX/FwC+zaU0Cz7QAvXIKAEy/Ev6KxBN9cgoSqO7FvoJ9u4ITPnTbN8WC3cQjfLIKCkWxTv6WSs5HoMgN3s5TwtWEM3yyCjxtxIN+mT27ghM+ZagAxALPhAN8sgouhRSY/okp4eNZxihmig4CwjR7hYNly53k3VUbsVCOulRJF28Yvpq0a4WDZca+b1oVG6QNsTIKJBAqRr6Zg82Ga8lW9EDCAsA8/dLlh8UBPEQCxDRrhYNl0XtjkZUONACR8go+cLMGfpxUPFayCh5vTA3+lCnh2sCGPWoIA8Lb9HuFg2XrajsSVQb5bMfxr9+6a5C+lSlPcLHv6+TDQn6YZDxWsgoSfO3PPokubVwgern2aMk+icQTfLIKERBc3f6Wis5HoMgTSXHIwtxEI3zyCizAkRf+kanh41nGMYYO1wLYdGuFg2Xd9/HQlQnZD/+fXDWVo1uCzDQ8VrIKBtImm/6O75Jg5ueb4v9SAs+0MLzyCg1ueIP+lQQDfPIKARSv0r6HvbuCEz5c7EvBwsSEE3zyCjbHP4U+kgrOR6DIBGQKz4LWRCN8MgoYy3qK/oO9u4ITPlJvZNhCwYQzfDIKMyYHzL6dqeHjWcY4UKdQQtg0e4WDZd8mJMIVDZllYkUAFLrtGwLVdGuFg2XnytoWVRTZD9+U3Bp5G0VC1UPNhmvJQzNBQ4LZ9HuFg2XS5yrAFQZEHWIyCjc9xgs+gbQysXIKDZROAv6SmUVSBUABu3vUQto87dEhx8l8NFZCwbV6d+6Lb2eJCALZLOxt2H7LjalRfpavokDmJ7bozwzCwXRrhYNl3mJIhpUTdCCT8goviPHf/o7pRV8CwBnfsR1C3i5NRyI6igNAW/6DhAN8Mgo7KMqM/oS9u4ITPlEfwhSCzoQTfDIKP1d/nr6dvbuCEz5/b7sCAsxEI3xyCgrm34E+i0rOR6DIDQLREgLJBDN8cgoWj/HLfokp4eNZxhJL04DCxfR7hYNl9hl+zRUSaUVAggAQA5GHAs70e4WDZdt4opAVCMFmZXpUdt6qHD6ESWzwce/fRXqIfpUDzYZryWjgp05C0fRrhYNl7G4DlZUUmV298e/WBN4cfoIxUI66VF6S00q+h3z90uWHykJxlMLeFDxWsgo0qlHePoX0IKiyCitC1Nt+mIQzcHIKIN3XH36bqeHjWcY4j1wYAsX0a4WDZeZcpMSVA5l8MDHvyKMnFf6dZDxWsgo/mhmSvpo0e4WDZfAJuEGVCtlc+LHvzBKL1z6MwUFpOlRg+RfTvoP0PFayCiJXwci+kC+SYObnl/q0RgLJtACxcgoRMNhPfpBEE2AyChQHEtb+jKnh41nGMF3STwLQNGuFg2X8+uPelQQZD/+ZnAjdzNRCwqllYkPAF/q+x4LHaWVTBgAciN7XAs5pRVMEgDclPc9C1HQws7IKIuBNEP6WBANm8go6/pJf/oTp4eNZxj/02d8C0TR7hYNlyLjUn1UbQUFLulRsxlIS/pFJTXrx7+p+QYs+nbFwjjpUWdMzk76RNDCnMgoRxeBVvo4p0eMZxjKAmJ+C0bR7hYNl/nmcCVUPPP3S5Yfaq1/Ewsu0e4WDZdSM5pbVFJkP35+cHmAzxMLR6W7G8a/CJL1I/o/DzYZryUtpYdJC2lQsUvIKNQre0/6ItCCrMgo62u1dfp8EA2pyCjyYlFM+kmnh41nGNMW4UALBdGuFg2X2ymSKlR4ZD9+eHC4j+BDC22QcVrIKANBDWf6dtDxS8gosc0GFPoD0ALxyCgHwspB+gwQTfHIKDChRDT6ZvbuCEz543VlHwsWEI3+yCgJfQIU+gGnh41nGEhrQD4LFdHuFg2XdJwqfVQsRYOZ6VGWKLt/+jXl8PzHv2/nfiD6PRBwWsgo94MDJPpivkkDm548mAZ2CwmllYkSAMbe6gALUsXCOOlRuMHud/oNuTUciOo/gTt3+nkQzf7IKPfjxhv6LPbuCEz573RIeAslEA3+yCgnog1H+mSnh41nGI3dfj4LD9HuFg2XrLs4BVQX8/dLlh9WD1wLC2LR7hYNly44tElUOYWaRulRJWm5DvpzBcLU6VGIYF8++jcPNhmvJUzzF0wLFFBxWsgouBiMBfp1kLFFyChdYm5Y+gbR7hYNlzRvvElUBGQ//mNwcxvBAAsKBQGe6VF8wgQD+m/QcVrIKL+QBBX6J9BC/sgoC9Gjb/omEI3/yCioMVt6+mf27ghM+UQbhgkLGBDN/8goOPwLTvoYp4eNZxgfckVuC2/RrhYNl6CaKzBUCVBxrsgoRiNWMvpBEDBKyChzM3oY+jy+SQObnlWqkXoLDdAC/8goDiDPE/pAEE3/yCg5lCZB+mMrOR6DIMOojnMLJhCN/MgozjoVVPpyp4eNZxgJSwNcC0LR7hYNly9kEWRUM6WViRAAuxzbDAsV0e4WDZfRrv0BVGSFBtXpUdWBBHP6I2W2MMa/i+T9PvonDzYZryVzwGBqCyWnh2g8GFnIK2kLM9HuFg2XBlXXJVQVxYIm6VHuOAJF+k7R7hYNl9U52FNUCOVxL8a/7qFkbPpEUAncyCjgDyoQ+nYPNhmvJWIhzVsLVPO3QpYfcIXfZQsM8zdalh+jC7wyC1O5tXCB6g6laRP6FxDN/MgoAGZ9PPoLKzkegyCiuEY0CzoQDfzIKKQsAGP6GvbuCEz5Dvl+BwtOEE38yCg/r1ZO+nWnh41nGHydr30LU9HuFg2XmkKjIlRtpZUJFgDMNItXCw3RrhYNlxNlRz1UXcVCKelRedeWYfoFDzYZryX+3UEeC1OnB4FlGNYqylULH9GuFg2XdxOZI1QWBcAm6VHYWM85+i2lFfwXADpwdn4LZsVCOulRI3itcPpr8/dLlh865NATC1JQ8VrIKH1JYWn6Xbn1HYjq1x15f/prEI39yCizorAy+iorOR6DIHDBckcLBRDN/cgo344KOvp3p4eNZxjt+2NGCzzRrhYNl9N8XVNUbQVZX+lRy17CfPpYkPFayCjesT1P+lS5tXCB6sZJK3L6DhAN/cgocSUqefpo9u4ITPmcBBM2CxQQTf3IKFE76Rb6TKeHjWcYjMe/YAtZ0e4WDZdfvYlPVGfQ8VrIKIg3YwT6EtGuFg2X0zyGP1RPEPaCyCgSJ48E+noPNhmvJeef7Q0LUb5Jg5ueuDYtKws3pZWJFADfvrA9CxinB2ArGAt+lxkLXtGuFg2X186ZWVRm5fomxr954HxD+kulFUgVAGy87TALJfO3xIQfBblBFwsb1enfui2DeRB5CwWz8bdh+5GXyln6AL6JA5ieSpQ7Jwtr5dV9CwDsymtUC2anB3oDGPxQs0kLbdHuFg2X205ONlRS5VUFCAC6uvByCzPR7hYNl/6xTH1UA2X/Oca/wIlNafoCBdtm6VHKJ4tK+n0PNhmvJX/7sCkLO9GuFg2X3mWVUFRg0AtiyCgK20NP+lflVU4PAAUfrzoLMMVCOulR3u6oCPoU8/dLlh9pIeEoCynRrhYNl1aLlVBUaMXbaulRrmBjGfo5UHFHyCgE7uN1+gSQcUfIKJsHAVP6ItBxR8go6JOGffpEvkmDm57zbXBtC1DllYkPAOeCG2ILR+WVdhgA2H2Fawsl0MK1yCilcnlp+j+nh5NnGEQepWILLtHuFg2XvoByW1QZpbDgx79sSh5y+j6FG4XpUZ1Z9TT6eeUVTBIAXRVCMQtP0ALeyCj1EIEw+iQQjcjIKH3k4V36NKeHjWcYMcLCRAsM0e4WDZctv50BVAqQ9KjIKA3BjBr6Q2Q/fmlwOAnLDQtlxcI46VFKu4Qv+ifQQoDIKB+/xH/6ZadHjGcY4hyXTQsA0e4WDZfG0KR+VAfz90uWHy9OF2wLFdGuFg2XBqSpRlRIRQRs6VFCASgy+noPNhmvJReUGU4LNtDC3cgoLqd1dvpbEA3xyCi6IwYF+nynh41nGEwhx1ILA9HuFg2X9l48clRZxcSC6VHefsBm+jhkP/54cBMZSgsLVVBxS8goWnTGRfphkHFayCgP7BwL+ibQcUTIKATgAjL6fRBwWsgoOz7jfvozvkkDm57cpjEaCw3QgvrIKMrRcXD6NBDN+sgoG3NlevopKzkegyAReodjCxsQDfrIKDkQn136FSs5HoMgMzC+AgtKEE36yCjtpag++kqnh41nGPAh5xMLP9HuFg2X7RBLPlQQ5ZWJEgDKMX0SCyzR7hYNl+dYkTVUJsWYo+lRQxlOfvoVZD9+UHCGcT51CykPNhmvJSgzGUILCrm1cIHq2oXoCfogEI37yCidJdgW+jT27ghM+abplXsLGhDN+8gofn5tHPppKzkegyA1oOhqC1AQDfvIKAY3dAL6KaeHjWcYSMXaHwtW0a4WDZduz557VFEQyb/IKEsMzDX6QcXCOOlR9aKwFvp68/dLlh/JkkFNC0tQcVrIKBAt3Wf6IZCxRcgoY5njavpS0HFayCj4bxN++nMQsEjIKAaZwQ76W75JA5uefF0uPwtR0a4WDZexOklnVFglPDDGvzIZkxH6PeWViRAAPrkufgtNJdR3CwCnsLNOCyTQQvvIKFQbkS76KhCN+Mgo1q5JVPpt9u4ITPkQKH0OC2kQzfjIKKi2Rwz6Xis5HoMgCBDoKgssEA34yCgY1EBf+jQrOR6DIO/kmhILRxBN+MgorAatPfo9p4eNZxj3OKQ4C3XR7hYNl7Cc40lUKCWUDggAPlthHAso0e4WDZfeW6RaVA+Fg1TpUTr3ahH6MUVD0+lRwHgbQvpHDzYZryW4pi1FCz7FQjrpUcPmilP6Z9GuFg2XHM5MclRyJTLSx78zvzZM+iLz90uWHyvuoHcLelDxWsgo3liUEvoBkDFayCijC3lG+h+nxy4lGFy3wkgLYtGuFg2XTR0kfFQKhQS86VFIBn8++h/QcVrIKO/Z6xr6U75Jg5ueOnF5BAsIJZSJDwBuXRMECyXRrhYNl3h/0gdUBYVFWulRLNHcT/pEJRRMEgD8xEZcC13FwjjpUZcF/Sb6RfP3S5YfRPKiGQtsUHFayCh9kglZ+neQsUXIKKUk8UH6INBxWsgobJkae/oa0ELYyCir+lxG+j4QTcfIKNBLMmP6SKeHjWcYtxtcYgt90e4WDZe8//9fVHjl/MrHv4GRXxP6BlBJ9cgohUXbcvoiEHBFyCi9ClYs+nG+SQObngO0BzoLS9AC1sgovrTBY/pMp0eMZxjGSKpqC0bR7hYNl5GU41JUMiWUiRAA3avkHQs10e4WDZd0Fc5aVAFkP/5ncLjknwULXOWyKsa/R40jCfoEDzYZryUURv9ICx7QAofIKKRI3ST6f6dHjGcYrzU4DQtG0e4WDZe/yDUlVDtllHoLAJRtgkMLCtHuFg2XfmTOJVRXkHHPyCiGbmYx+lUFgpPpUbuWR2r6BA82Ga8lPsevGAso0ALFyCjHNl8y+g2nR4xnGC0NqhMLddHuFg2X6dNzNVQ0ZdQOCABcDAlICxPRrhYNl0AclCBULZB3YsgoL2xKbfpgDzYZryWJn353CwO5tXCB6tKuU2/6DhCN+cgoa0Z7PfpUKzkegyAKTkZ9CywQzfnIKK5AYGT6dPbuCEz5dAntJQsnEA35yCg81+sI+l+nh41nGHr2mSALe9HuFg2Xnn90AVRIhR616VHg5SlL+lVkP/5pcGlyw2gLXcVCOulRypX8Kfp70EKNyCg0Tg5x+lOnR4xnGK4V7WgLcNHuFg2XpCz2N1R58/dLlh/cjGwlC3fR7hYNl5lvsE5UYmQ//mlwrFs1EwsikAqJyCg/5hFo+iIPNhmvJRHyUBgLFVDxWsgo3SCTB/ps0EL5yCg3O6pD+j4QjebIKNW2+Wf6ays5HoMgmAiXbAtVEM3myCj6RxgU+kynh41nGOmMDRILWNHuFg2XU+mWYlQXxV6l6VGlbyV4+hnl8B/Gv2Cdp1n6dJDxWsgo6ueYHfpp0ALmyCg+Ro1r+g0QTebIKBelYHT6ais5HoMgCn6aTgsuEI3nyChbaRZZ+ianh41nGOTxwEwLftHuFg2XPxlsE1Re0PFayChPgccv+jXR7hYNl6+FYU5UfJC0a8gomi3rGfpr5fDqx78nFkMT+gUPNhmvJaZd5WYLE75Jg5ueNcISXAtrZZSJDwA+nKhnC0zQwufIKDcQ3hT6NxAN58go3ht0avp5KzkegyDyk4JIC3MQTefIKH1QJgX6LvbuCEz5j/Q/Kgt6EI3kyChpUPh3+ln27ghM+dWtvW8LORDN5Mgo3MrMEvpGp4eNZxh0lLwICxXR7hYNl57zHjlUM2WUTBgAkCe0KAst0a4WDZfzP/RIVHsFQTnpUR0J/n/6bg82Ga8lrsvTYAsY0e4WDZeFghkDVFjQMXjIKKWBCDH6COU0K8a/SHsBA/oBZRRMEgCy/5kZCyG5tXCB6tgv3jv6UxAN5MgoNDHtNfof9u4ITPm59o5ZCwEQTeTIKIO2HAv6U/buCEz5fixyBAtAEI3lyCgTvOZ7+ln27ghM+SBPXnILIBDN5cgo4vqyCvpGp4eNZxgoLEwyCzTRrhYNl2y8PCRUZ6UyLsa/AmpmbvpuxcI46VHVG055+lrz90uWH7s4JxMLbFBxWsgoYI84K/pSkPFCyChcW29J+m/QAuXIKGio/lX6bhBN5cgoOqfnH/px9u4ITPkJjWYKCzUQjeLIKJ5Ru1/6GfbuCEz5+E7JWQsnEM3iyCi+hx0i+nWnh41nGD/GSHcLP9HuFg2XYnccclQHxdia6VHMfg8m+mJkP357cAa8ak0LatBxWsgoKFmpVvpOubVwgeqh3Wxd+jEQDeLIKGJVVTP6TfbuCEz5GrEmWgtbEE3iyCga3EkM+mwrOR6DIAngPFYLOBCN48goUU16CvoVp4eNZxiAYexqCw3R7hYNlwDI2TlUARBwRcgovBM6FvpV0e4WDZfD7a5mVBjQzEnIKJMHh1r6fJB0msgoN0qGRfp5DzYZryXgYnB3Czq+SQObnhjpYmgLDGWUiRAAwwOpRgtIpwcQTxiggbcEC17R7hYNl/BxWRhUB8WCJulRJjanEPpt0a4WDZcUtrs9VD1kP35rcGgWIVsLBA82Ga8lrwJkDQts87dClh8c2AFRC2nzN0eWH/RJkGoLYdDC48gos50mVPpkEA3jyChzlDhN+iT27ghM+QPOPkwLdxBN48gof1TvA/o+9u4ITPknHSp0C2AQjeDIKITjb2z6OaeHjWcY1qO0VQsf0a4WDZef5wpzVABQjl/IKGZwLSb6DWWUCRYAPPdCNAsr0MLgyCh07xV9+mMQDeDIKCVyK336S/buCEz5lY2RQwtYEE3gyCj1HEp6+mL27ghM+bBKOgsLbRCN4cgoKSz8K/pcKzkegyDIiMsOCxUQzeHIKO1+FGb6BKeHjWcY00fcPgsh0a4WDZec34B8VAxQD0zIKJrE4Vr6WmXU/RcAhWYjEwswxUI66VH5lYEB+gOnBxtdGHrijGcLO9HuFg2XRplCEVQN8/dLlh9oasVGC0PRrhYNl6UX4DRUPoXNq+lRZXXDZPpwDzYZryXwXB5nCwFQ8VrIKIytMGH6c5DxWsgosWu1ffoh0PFayCgZwdAy+ga+SYObnjKtcjQLEGWUiRQA3fktKwtAZVTOHQCLFdc5C25lFEgVAP+3WEELBGVUTiIAzFL8EAsn0ALhyCicb8dQ+iIQTeHIKE53e1D6TCs5HoMgibhmSgs/EI3uyCjvqmtx+j8rOR6DIJfTHlELfhDN7sgoXMLOJvpoKzkegyCwI4MnC08QDe7IKKCI0zD6daeHjWcYEb36HAs90e4WDZcUG7ZAVAml1HoLAEaNAg8LOdHuFg2XDaV9J1QMkEiDyCiXr8V7+nGQDYTIKJE5lFj6Jw82Ga8lZGxeAQsipdQOCADcStZLC0KnRx3iGOdSiDILDdHuFg2XIKYfblRBkDSyyCiRSAwg+hqlOiXGv2eN6Tb6IcVCOulRqZXaAfo+uTUciOoJFG9Q+jQQTe7IKAYux1/6Sys5HoMgfoSJaAtbEI3vyCgwHUoP+kSnh41nGIwQ91ELA9GuFg2XsIyQQ1QH0AjkyCj+cIgY+hfz90uWH0DkSXsLQ1DxWsgow2UtUfpY0MLvyCiUIDtn+kkQDe/IKKIutj36Lis5HoMg9/w0MgtkEE3vyCiOM+81+horOR6DIOnMxGELbhCN7MgofHaAVfoCKzkegyB7dKIGCx8QzezIKFsJYAf6UKeHjWcY78jkaAty0e4WDZcbSMYsVC8lsBTGv0tp6wj6fdCO88goeh8lGPo9kPFayCgbu1lQ+kjQ8VrIKPI17n76Kr5Jg5ueYqjMdAtWpZSJDwDWB7JGC1yllEwYANHh/UgLXbk1HIjq0TImOvo3EA3syCgJouoA+iH27ghM+U58kAILexBN7MgoLvMLFvpOKzkegyDouYR5CyAQje3IKADgyW76T6eHjWcYoUEqfQsk0e4WDZdtqmEAVEgFWVLpUbPJji76CAUZzelREbknF/ohpRRMEgB0YQZQC2nFwjjpUctO1zH6ANGuFg2X00x0XlRqZD9+YnDFyWFlCwvz90uWH+xhYSULC1AxQ8gospQlKPp5kHFayCiqk9E5+iinR/LzGNyULmULT9HuFg2XkRp3T1RH0HFDyCh5rydw+jHRrhYNl62VvhlUOkVZlelR1vjFA/p3DzYZryXlNUpOCwHQgqHIKB1T30r6WhDNg8gosvRkKvosp4eNZxjKSR0oCz7R7hYNl1OO9kRUJ8XDg+lRM2HxDfpQxUPR6VGY2AYG+gAQcFrIKEa/LEP6GL5JA5ueiGQVFgsKpZSJEgBDGPooC27FwjjpUfTrTHj6ddDCzsgoZgdWFfpUp0eMZxglMA0/CzDR7hYNl9GZr3hUZ/P3S5Yf/whqGAtl0e4WDZc7R6QHVBVQcVHIKP90Kmb6OgVHw+lR1uJXMvpdDzYZryUaFUwfCwpQcVrIKLyfw2D6eJCxQMgooW/7YvpqpwdpORjEoGs0CxLR7hYNl6BQuRpUFNBxWsgoXwl7SfpP0a4WDZeP/RYEVFdkP/59cEW1ORsLDg82Ga8l2NaVEQsV0IKuyCjdsmV/+linR4xnGKQY3GsLdtHuFg2Xy0ClG1R5EHBYyCgtWvYz+kDRrhYNl15GtiVUX6U0AMa/rr32H/p4DzYZryX7TwtqC0u+SQObnnam8E0LZaWUiRAA+/4YeQsLxYIm6VECvx8q+jDRrhYNl9uQcAtUDpC0SMgoJBD8QPoD87dClh8uP8Y5CyrQwu3IKBW/ZGf6KRAN7cgoTg80Y/pAKzkegyD+6Z5KC3gQTe3IKIGb4AP6UKeHjWcYGv2+OgtZ0e4WDZcjFGZxVCjzN0eWHwkYCm8LZ9GuFg2XvxPFRFQihcRm6VH2/k5E+lUPNhmvJRLRP3ILItCC58go5X/tKvp9p0eMZxjO6j0BCx7R7hYNl2ecqV5UD6WUCRYA63e7ZAth0e4WDZd+Z+kJVHFFjZbpUdh05hf6aGQ//mFwIISZPAtxDzYZryUnbSASCwrQQv3IKJ0tnl36ZadHjGcYEQV/FAsn0e4WDZdYU5p0VBmllPIXAIUrIxELdNGuFg2XWX6EdFRQBdqr6VGp81sc+kIPNhmvJZaWeWsLabl1HIjqqaf4SfprEI3qyCiSp98Q+hf27ghM+V7gJn8LaRDN6sgovx1DKPpFp4eNZxgz0f1hCzrR7hYNl2GYDRRUIsVCOulRKBXnRvpJ0e4WDZcB6Y5BVAgFGcXpUarNUmz6fRC1u8goWAYeVfo6DzYZryUXBYtEC1/RrhYNl6OszkBUS+V3+se/bQ6kLfoR8/dLlh86tXVsCwynR/oDGLfspykLDtHuFg2X6LV3c1QhUPFayCjqld11+iDR7hYNl5RkJSdULJAM1MgobfjcV/ol0LXyyCgnAGpy+igPNhmvJeAzMmILGNAC6sgojwcRA/pZEE3qyCgAFSAT+lL27ghM+Sy+U1ILRxCN68gom1/sMvprKzkegyCF39ljCx4QzevIKClFw236MaeHjWcYDlm8JAtq0e4WDZfMsd8qVEWQ8VrIKPrO42n6bdHuFg2XGilWfVQbUEhFyCiGt18b+lPQ92jIKIOKU0f6cg82Ga8lFNmrLAsm0PFayChIjHsi+hW+SYObnrZ7zDALR9HuFg2XWzcPC1QskI7byCg+jh1Y+itkP/5jcKQeL1wLZ6WUiRQAsQ7yNwtb0e4WDZdj7l4/VCRltcTHv5VC1ln6PRBw7sgosQ+jKvpUpVTOHQA/5xY0C0TQAuvIKEmw5Xv6PBBN68gonGRYAfoSKzkegyC91y07CwQQjejIKLZl/ir6RvbuCEz52dE2fQsvEM3oyCghOmAS+iCnh41nGEULZSULLNHuFg2XYK4GJVQdZD/+UXB/jg47CxxkP/54cMuE0xMLQKUUSBUAOEYMWQt4pVROIgDRYokOC0Pzt8SCHy912w0LDtXp37ota0UVLgtYszG3Yfv4OKpB+l0PNpmlJUvS3SgLcr6JA5ieuIQcPgtn5RR6CwCGW18qC2a5tXCB6v1t/hP6HhAN6MgoNU8TDPoG9u4ITPnREcsBCxEQTejIKN2pvS76LKeHjWcY3a26VAsX0e4WDZfOHi42VBPllA4IADHM7H8LPNHuFg2XAlS+AlQOBYKB6VH3dMFA+nNQSoHIKDp7p2v6Aw82Ga8lTYDjLQs90e4WDZde/zMEVCwl8qPHv+2G4Fb6UmQ/fmBwWn8HBQsfxUI66VFHU7IG+h/z90uWH08k0GILPdCC6cgo1lavAfo+EM3pyCgFH5cJ+hwrOR6DIF5phRALDRAN6cgo0bsuP/pH9u4ITPl5MwpKC2EQTenIKO8bCm/6dqeHjWcYGIYiWAsa0e4WDZdW4nVYVAVQ8VrIKAKB1Fr6GtGuFg2XyRv9MVRKhYat6VFlnFB8+icPNhmvJdwoKzgLVpDxWsgoyweJGvpf0PFayCgU5Dgv+i++SYObnpJWZAwLD+WUiQ8Ay6XsJQs15ZRMGABZQTU0C3inhxU2GDHloBELQNHuFg2XjpapMlRm5RRMEgC/7YR9CzPR7hYNl8td7jNUJOV2pse/eZ8TOfpLpff9x7/efolO+g0PNhmvJb2sulQLPKfHmkAY1tQlegt/0e4WDZfSe89EVGvFwjjpUZaNpG36F9HuFg2XPlccQVRakLfsyCha3MwG+jNkP/5ScIt/yAELMQ82Ga8ltDWBXgsP8/dLlh+6GTw7CzrRrhYNl/PD/TtUOYVAJelRLM6gQvpfUPFOyCgzJCQJ+hfQgtLIKNbsv1L6dKdHjGcYbY1OHQt+0e4WDZdQDREXVFiQcVrIKBnpLW76bNGuFg2XUFThB1QNZD/+fXChb3sKC3MPNhmvJcyFCTULDNHuFg2XNTFKSlQ6EHDnyCjmdnRH+hxkP35rcOvTpDcLN9CxScgooeonOvp/ubVwgeogTaRk+kwQjRbLKHklhlT6I/buCEz5M/HKaAt+EM0WyyibUvsP+hT27ghM+ashvUoLdRANFssoVln3Mvpi9u4ITPkeD94sC1AQTRbLKKxKkE76bqeHjWcY5Ku/AAto0a4WDZco5T9sVBoltgnGv4b3Siv6dBBwWsgoXt3TJvprvkkDm55h2/VaCy7llIkSADtVpnALAafH/ggYi6B8cgsm0e4WDZcDh7wnVFHFwjjpUbkwWV36U9GuFg2XNmfDD1RRZD9+YHAhm28qC3MPNhmvJUOgfm8LcPP3S5Yfsr82XAtzp0f+NxhH9m1CCxXR7hYNlzQNJkBUUmQ//mBwfkvoXwt55XTWx78Eg31r+lhQcVrIKEHcpBv6Trm1cIHqxTHzSvofEI0XyygxUzJU+nD27ghM+WLDYSULaRDNF8soOyH5SPo6KzkegyDMw3wNCw4QDRfLKODGGyL6JKeHjWcYy8qcTQth0e4WDZfCiEsFVFklPQ3Gv0VgpED6fVBxTsgo2jE/RPoNkLFFyCiCJVR5+nzQcVrIKFkKZD76OBDwQcgoUHEvMvoRvkkDm571wT0rCwjR7hYNl55zjU5UdpD348goPXNyFvoZpTzLx7/GaZcK+ljllIkQAH/b/QYLPcWCJulR7E4Qf/of87dClh9KKbcrC0GnR+URGHfvKCoLNdHuFg2XRQyOYlRO8zdalh8DJi1RCx3RrhYNlwZThUdUX5C2dcgojkMZTfoGDzYZryV0CT45C27llAkWABB4hhQLDuUU+hcAoeh9VQtO0EIXyyg7Filh+hwQjRTLKDh01z36E/buCEz5WpTkPQtAEM0Uyyh3vsdr+hb27ghM+RvpmHcLCBANFMso3nHpGfp0p4eNZxiScAhaC0fRrhYNlxIei1pUIGQ/fmhwtTTAUQsCxUI66VG5q3Rj+kTz90uWH9EIpxkLcLm1HIjqnuTUZvoUEE0UyyiFbCxK+kz27ghM+YLLdzsLSBCNFcsoDeKFPfoop4eNZxiRfjAFC3zRrhYNlz2QbANUOGQ/fmBw6PmiXAtiUPFayCh0DeVh+hiQ8VrIKHewaAP6adDxWsgota9hSfpLvkmDm549epJWC0jllIkUAMWoAwQLUuUUSBUAkFAXBQsFubUciOpswMEr+hgQzRXLKE/wRRz6ESs5HoMgVpWSKgsREA0VyyjdExc1+nCnh41nGPBjWzULKdHuFg2XUJeDSVRx87dEgh+oRvAECyPR7hYNlzz2MllUT2W3Hsa/rlE0A/od0HfeyCivwUVx+iEPNhmvJbR+3GoLd9Xp37otI9ECPws5s3G3YfuRPIl/+nm+iQOYnp8HyXoLTacHwkkYwiymGQse0e4WDZforT4QVHflNaDHv0KwBkf6NZBPZ8gos9R+HPolJZd7CwDpXSYMC3O59R2I6l+T/VH6chBNFcso86ooA/pr9u4ITPltooQtCzgQjRLLKCOOg076EaeHjWcYpJbQZAsl0e4WDZe+PaJyVAcllw4IABYElEULZtGuFg2XaT+NYVRjBQW56VE8TL0a+jQPNhmvJbhZU1kLYtGuFg2XdU4LElQwBRk66VGsKYoW+mfFQjrpUXlCSlf6F9DCEssoo29WGfpSEA0SyyhF478q+k8rOR6DIKVUCAcLNBBNEsso+jwGQ/oPp4eNZxjItVtLC3/R7hYNl88GoB5Uf/P3S5YfR3UmSgsG0e4WDZcdgTVrVG1kP35ucMg34xQLVBA378goFpcvW/oSDzYZryXDinhYCylQ8VrIKAIszBX6Y9CCE8soVbQgG/poEM0Tyyh4XdxL+in27ghM+RSlkGELIRANE8soRDWPW/obKzkegyAzSGgUCxYQTRPLKEaA+R76fCs5HoMgqTniZgsVEI0Qyyi4MdIe+j6nh41nGF+iX0QLNdHuFg2X1KlOG1RikPFayCj+l65E+hvR7hYNl28z8GlUUuW6Jsa/719Xd/okxdt46VEhj/sb+kEPNhmvJfGnFQwLRdDxWsgoUkrWPvpvvkmDm57i/108C0fQwv/IKMGR8TP6HqdHjGcYkuEmaAsZ0e4WDZcPuQcuVColl4kPAHotnSMLAtHuFg2X1KvBalQzZD9+bnDzYLlnC24lO0bGv/nlBAf6fw82Ga8lik8cNgsc0e4WDZcIq+BNVCLQic7IKHekRQ76M2U9rse/dnkJH/p/JZdMGACL+Hd+C3nQQoHIKOscQjL6PRBNoMgoVT0jBfoZp4eNZxj6w80PC0/R7hYNlwSDX1dUL2Q//mpwXGL7PwsfZD/+UXDMvsxhCwAlF0wSACAdeFYLKsXCOOlR4+zzB/px0AKzyCgwr8M++kGnB45nGF+s0TALNdHuFg2XihfnalQIZD9+a3DZSB8dCxxQCpHIKN9Yfwv6b/P3S5YfCEopdwscUPFOyCjgfHxh+giQcVrIKFpY/if6NNDCpMgoHTAoIPpup0eMZxgzoypnC3DR7hYNl/2rGSVUCdAxScgo6dbucvob0e4WDZfrJJFcVDjl9/rHv4K84C76Z0VGKOlRbShYHfo1DzYZryVCexhGCyIQcFrIKO73iBr6Hb5JA5ueJqCndAtd0IKwyCjBr7tO+kinR4JnGG/NVA4LKdGuFg2XaS1NIFRoxUBa6VH8M3QO+iAll4kSABgJNVgLO8XCOOlRDeK6Tfo38/dLlh9+D9x3Cy3QwhDLKPHYCWD6ZxANEMsoDD/IQ/oXKzkegyCEFPhLCzUQTRDLKDAmA0/6FaeHjWcYk2ZuWQsy0e4WDZeOhJpZVDVkP35icHl/fn8LVWQ/fn9wS5RsKQtUUHFayCiTbdAB+kSQsUXIKGQQSxT6StBxWsgo3oWoZfpX0IIRyygpL5Zg+j0QzRHLKGMVTlD6PPbuCEz5omw1ewtSEA0RyyiaTy5D+iH27ghM+fcfx2oLdxBNEcsooG5Ob/pvp4eNZxiJbeBVC17R7hYNl7uJJV9UAxDwQcgocM87Ufo/0e4WDZcrVhQOVDlkP35ocHgGCm8LW5DLmsgoS1csUPpqDzYZryXzFc5oCzi+SQObniAg3HYLAyWXiRAA8K81OQsJxYIm6VFtob0i+izzt0KWH00DwEcLCPM3WpYfXvH2BgsGJZcJFgCylApHCw+5tXCB6u6h5Dn6fBCNHssoEQRAUvo3KzkegyCN9Z1HC2EQzR7LKBhcpkb6Dys5HoMg2aS0fwtKEA0eyyiE9xV1+n6nh41nGHrJDHMLVNGuFg2X04XSPFQspX/yx7+XvKVo+gQll/sXAA1wN20LZcVCOulRmwD/U/pC8/dLlh9cAspbCz9Q8VrIKHdXVWj6YZDxWsgoQ2kaVfpC0PFayCjzmy8o+k2+SYObnlxplFcLWNCC/MgoJbklPPpCp0eMZxin76gFCxHR7hYNlwNYDWdUNyWXiRQAXMJRFAtu0e4WDZeXBrIjVFlkP/5vcL58KjkLK2Q//lFwU5DjDgs6DzYZryWnf2UWC04lF0gVAKytInALG6dHng0YSVm0HwsC0e4WDZelBy0ZVGFkP/5icFn9KzsLd9CIlcgoVgGTIPoT87fEgx+zB45PC2bV6d+6LZoQqAwLBLOxtGH7RURfZ/oyvokDmJ4z0ExzCxy5tXCB6pVmekL6MBBNHssoJ48UT/orKzkegyDF0U1FCzEQjR/LKOO0VHD6fvbuCEz5HKxDQgt6EM0fyyhMzisJ+i+nh41nGG83UTALLdGuFg2XLlfvSlQHkMj9yChzjTZS+gxlF3sLAF/+0S0LVdDCpsgoYwqUP/pbp0eMZxgi1OQGCw7R7hYNlyFRJHFUVGWXDggAmZ+YZwsu0e4WDZfTzMFhVB+Qta7IKHTx33H6BkUAh+lRXBauOPpyDzYZryWfKRt4C2XQAh/LKHaT6376RRBNH8sovgcXVvpuKzkegyA6xfsRCxoQjRzLKOI10R76QKeHjWcYl4hibgtw0e4WDZffBLpiVCHFQjrpUYnHWRv6BdHuFg2XhJMWMlRaZD/+YXDSTlwECx5Qt6bIKBjbwFz6Zw82Ga8l3SMXKgtA8/dLlh854vY5C3HQgu7IKLB15kn6QqdHjGcYzMULHQsi0e4WDZds2d8IVAJQ8VrIKG8FIXf6PdHuFg2Xop2kNVRl5X3Gx78usy4I+g1leyDGv7C6szb6Pw82Ga8lBCpIQwslubVwgepEoT88+kYQzRzLKCsQuB/6ACs5HoMg1BZIcQtFEA0cyygb3K4S+lwrOR6DIBpSTm0LFxBNHMsou+CfAvoa9u4ITPm+z80VCxAQjR3LKMpjUjv6PaeHjWcYGJgQCwtk0e4WDZdOzk4kVE9FxaHpUTivU336e2Q/fmJwDFmMNwtskPFayCgZ4KJ5+iTQ8VrIKM6iKWz6Nb5Jg5uexhZffQskZZeJDwAmx+AjC0Rll0wYAPC2wFoLN9AC7sgoKu4pK/pjpwf+Zxg55kEhCznRrhYNlzyfAwBUBGQ/fmVwJDWdLwtAZRdMEgBidJA1C3HRrhYNlwO+j39UXAUAK+lR2rz0J/okxcI46VG8azMq+krz90uWHwp7HgILUVCxdsgoEuxNG/pz0MIdyygl5uAn+kAQDR3LKJ1I7A76Mys5HoMgfou9BgtMEE0dyyhZvKBZ+lynh41nGBfs1F4LSNHuFg2Xd6hqc1Q9kHFayCh2fuQ/+l7R7hYNlwash2VUV2Q/fn5w2bavHAtRJT3Kx79xssdk+iAPNhmvJdZ+EiALPNHuFg2XAvthRlRFRcH+6VHUK6Ns+h2F3qbpUWy7An36R9DxdsgoRoygC/ozEHBayChYBcki+lG+SQObnl+ocSkLZ7m1cIHqlV+rD/pqEI0ayyiWObJU+m327ghM+SPr2DILMxDNGssoLlp7KvpS9u4ITPnV1gJiC20QDRrLKFXBKX76QaeHjWcYklGXHAtJ0e4WDZdqV2s/VFKFWK/pUUJfjS36MCV2xse/kLYgbfp7ZZeJEgAz94VTC2vFwjjpUdw263n6SPP3S5YfffrhRgtpUHFayCgg401P+hLQAtXIKNJXOlH6K6dHjGcYYMydJQsh0e4WDZfqo24UVFiQsUXIKG4qlk76etHuFg2XAKgBA1QuUMh5yChTNqEe+jFkP/5gcJddt3ULTQ82Ga8ldRV5WgtZ0EK7yCjoLc5H+iqnR4xnGH++jwALM9HuFg2X80fLB1Q50HFayChpoZQF+nLR7hYNl5Kn12RULoXBk+lRs0miE/okZD/+U3BthfFwCwsPNhmvJWnF2iYLSdDC+8gojR1lZPoYp4eWZxg5+YcBCzbR7hYNl0nWi0dUXAXakOlR0M1ALfpD0HF7yChnCB17+kQQ8EHIKCXifU/6fr5JA5ueQCMDEgs8ZZeJEAC01mMFCwa5tRyI6mTk6xD6IBBNGssodismAfob9u4ITPntvAZpCxsQjRvLKAnVngr6GCs5HoMgA0oeJgszEM0byyjBopo8+mb27ghM+dzzGUULKhANG8soTmq5Cfp3p4eNZxiJMRgIC1XR7hYNlzWUr0xUXcWCJulRkTTIS/ok0a4WDZcPgqwRVGtkP/5TcEnssn0LPA82Ga8lLoAyOAtD0IKcyCj6H6Np+ganx+xnGISIIWALKNHuFg2XX53yKFQNZf3ax79XgVoT+lCFzZbpUcK0lwr6CvO3QpYfyLI7YAtI8zdalh8paHINC2lllwkWAGahMRALFGUX+xcAQNQcIAtHxUI66VElIMF++lDRrhYNl2D9BjtUWJCNWsgoxjaCdvo88/dLlh+XcFxvCydQ8VrIKNeUbTr6bJDxWsgodVwGD/oW0PFayCgZVDse+iy+SYObnlvay2MLR2WXiRQAtzV2Lgsfp4cG9BgWmFdTCxPRrhYNl3eSJT1UNyUyVMa/XEP1Fvo5ZRdIFQAFE6xsC33QQhvLKNMTI3X6BBCNGMsoPLgzUPpiKzkegyCmiPcTC30QzRjLKKbi+Ur6NvbuCEz5VorzPQtnEA0Yyyjk4gMI+hGnh41nGFICeBALI9HuFg2XLTJvOVQBpTzhx79y6/5S+ialusfHv3RKOEH6dPO3RIMf7DCxbAsz1enfui2n6JpkC0Wz8bRh+89t+Dr6cb6JA5ielx27QAsMpdd4CwCCCwMKC0ellw4IAFgA2DkLAdBCGMsoVweOa/p5EI0ZyyjPSIFH+mv27ghM+RH+iVcLWBDNGcsosTHLWPoRp4eNZxjokRVLC2fR7hYNlxqIXm5UfMVCOulR4BGQP/od0e4WDZeYDqwOVC9ls9XHv87NX1r6O1B2SsgoH4iuZPpwDzYZryXveEJ4C3jz90uWH5Z7ehALQVDxWsgoiuitH/oK0MIQyyg7I2En+iIQjRDLKMmu3jz6PqeHjWcYzkKHLAt20e4WDZchPI0tVAZldfnHv0X+2iX6F2X9Uca/EeP7W/pOkPFayCj/6Kop+nrQ8VrIKE2VzE36L75Jg5ueSq5yKQsFpZeJDwA8GItFC2ill0wYAIRhTgYLHacHt0AY44FhYgsQ0a4WDZd1Bu4xVE4QTX/IKHMkZWL6SaUXTBIADMFJCQtz0AIZyyitDtxo+gYQTRnLKNu2ZUv6TfbuCEz5keCyMAs1EI0GyyhK4Y1U+gwrOR6DIPrCKTsLdxDNBssowGHZTvo5KzkegyDUMTJ3C3cQDQbLKCOJ3lP6DKeHjWcYZ8JFEgtp0e4WDZcP55AiVEglMc7Hv4gksU76C2Q//mlwP1uuews3xcI46VFU4wYE+gmnB0T0GEZ2iEALK9GuFg2X7Qe+DFReBUek6VFPuXoU+mTz90uWH9vnLX0LMlDxTsgoYGlFLvpVkHFayCjs2/UC+lzQcXbIKBQHOEr6F7k1HYjqFdk9W/odEE0GyygpaNZJ+k4rOR6DIAXpWhkLTRCNB8so4Au5JvpqKzkegyA+KAI9CyUQzQfLKLSdzDv6eKeHjWcY7JzpJgtA0e4WDZf8D7kkVF0QcFrIKBN6mQr6E9HuFg2X5dUtSVQnxU146VFAw1h1+ihQcbDIKJh7q3/6XA82Ga8lCPEDYwtqvkkDm54cgeo7C0S5tRyI6iktRUn6fhANB8soG18OCfo19u4ITPllmYsfCwoQTQfLKHnlOG36MfbuCEz5SOijQQstEI0Eyyi/tB4e+janh41nGKXZvGILVdHuFg2XKNX7blRmpZeJEgD+RKgiCxvRrhYNlzkbKT1UPGQ//lNwxLm3DQtQDzYZryWrkxpLC2/FwjjpUeBZSBP6ItDCBMsohZiSIvoyEA0Eyygrr10d+m0rOR6DINt8CGsLLhBNBMsob3dLEfphp4eNZxgwvpEhCz7R7hYNl1Ns2xxUBSXzVsa/lOoVWfocZD/+a3ACHZpTC3Pz90uWH/PVvRsLXLm1cIHqV2TNdfoSEI0FyyhlIYBE+h8rOR6DILoOlDkLGBDNBcsoSZsMOvpHKzkegyBhjp0tC38QDQXLKFCuCTf6eCs5HoMguecPMwsaEE0FyyjBOIci+nynh41nGMPyEmgLOtGuFg2XmUpKFFRUZD/+Z3B/cJlCC29QcVrIKFlzhSX6AJCxRcgovMwfNPow0e4WDZcr0PhJVBxkP/5TcMBKw0ILIGQ//ntwXMjAaAsa0HFayCgx1SU1+m7QgsrIKHxePHn6ABDN7sgoo+p6XvoCp4eNZxh35hl5CwTRrhYNl5jsFDNUIxB3FcsoCbH2APoREPBByCh79e0q+im+SQObniDFxwsLAqWXiRAAUdJ1YwtcxYIm6VHfHjE0+hnQQhzLKJ7Lxl76R6dHjGcYOBxeGgsG0e4WDZfDd9dsVEPzt0KWH5drh2sLCdGuFg2X7m7eTlQdEPRjyCjzcGcE+gwPNhmvJWDTzhYLHNCCAsso06w7Q/pEEM0CyyjJPcgg+iErOR6DILiiFR4LZRANAssozwlxQfoPKzkegyDOc20hCx4QTQLLKEvEk276Eys5HoMgXkDXVQsKEI0DyygvY1wk+kenh41nGJlnNTkLZtGuFg2XtuqzbFRPZD/+bXDt1987C23zN1qWH7vqxFMLcqWXCRYA//YTFAsapdf4FwCZ9GMXC2/FQjrpUSIBqDX6FdHuFg2XNVB2H1R0pTsAxr9RCO16+g6Qy9HIKFeP9GX6RvP3S5YfQ5IOYgtBUPFayCiAum8++k+nhwZYGOsinlcLT9HuFg2XvgHOJVR7kPFayCi3Kq8X+lnRrhYNlyyr421UYGQ//n5wO4MTZQsHDzYZryXE+StkCx7Qgu7IKBSaBCD6R6dHjGcY1jKDYAtV0e4WDZcJ9idxVC3Q8VrIKP/Shw36A9HuFg2X+Z3DTVRRhUeF6VFl2Rta+gtkP35QcCFfRX8Leg82Ga8lVY/cGAtHvkmDm545AfskC13QgqvIKNptE2X6d6cHkWcYBzPOJwsd0a4WDZe1eBN4VGylPf/Hv+ZdHEj6WKWXiRQAwkRKWws7pRdIFQDrU9wsCzbRrhYNl9F8lgpULQWYPOlRdZGHMfoB87fEgB8pkjlUCzPV6d+6LeC3By4LELMxtGH7UO6yVfo0vokDmJ5UNVI0CzunRwnhGFPuRQELBdHuFg2XsBfndFQa0HfwyCi+DV18+h1QCo7IKMdQMUD6JuVXeAsAzdmcOwsH0e4WDZf1AKkiVGxkP357cGNQW3YLAmQ/fmRwCL8JTwtz5VcFCABI7zQNCxnlV04PAIyJhFILUsVCOulRtE95VvoW8/dLlh/xjDBHCyxQcUfIKB5XMlr6fdGuFg2X5AUcJlRlRUW66VHHnUQZ+hSQcUfIKISQzgf6MNDCA8so8SkJQ/psEA0DyygXcGQc+nL27ghM+SXP9XcLLhBNA8soG3DFW/o9p4eNZxgaxtR6CwbR7hYNl8Q/L3tUA9BxR8goXZFCC/pE0a4WDZdmfPEKVFHlNCPGv4oRxmT6Og82Ga8l4VJuAws8vkmDm55nOrthC2Hll4kPACvHoGQLatGuFg2XN4ymPlRIZD/+Y3ALwuE/C37ll3YYAMSMPXcLW9CCAMsovrdSDfonEM0Ayyjic8N/+nH27ghM+Y1wxykLCRANAMsoksv1Zfpc9u4ITPnZfLB7C18QTQDLKBMIQD36FKeHjWcYAfasVwtQ0e4WDZeiRMgbVETlF0wSALa17SALFdGuFg2X8RUHc1RUZD/+bHA3rUYAC14PNhmvJS9s6RALS8XCOOlRfm8YT/php4cEVBj7VBMICzLR7hYNl1XTlTNUL/P3S5YfsIImbgtd0e4WDZdUJbNGVB+FWtTpUadG8nj6U+U/xce/hwRBA/oZDzYZryVphu8aCwHQwqjIKOyK6Wv6BxBNo8goBu+wPvokp4eNZxgNbm1/C03RrhYNlzaDIwpUFFAOScgoSSWGTvp6UHFLyCjnGskn+irQAtXIKHVlXQv6IxCN8MgozuTdWvoup4eNZxiOrlsWCzTRrhYNl5DnvCJUSBBx+MgoQt+TAfozkHFayCgmjDcp+kzRrhYNl9onBnFUX2Q/fmNwHrLgTQs30PF3yCimCkJX+kcQcFrIKAAQ60D6B75JA5uevtmLegtxubVwgep3JFNo+ngQjQHLKOBCMiD6bPbuCEz5VKyzSwsBEM0ByyiDLRVX+nMrOR6DIOHgj2MLORANAcsooeN1B/pDKzkegyA/jwNSCyMQTQHLKEZP0kT6SqeHjWcYeXaOPQtO0e4WDZe9UrB2VFLll4kSAOZotn8LONGuFg2X6CXBXlRy5bD3x796gDsz+h8PNhmvJdWwRn8LUtCCDssoNmsqPfoGEM0OyyivZ485+iArOR6DICSI2i8LGRANDsso6LitOvpi9u4ITPn3Qj0OCykQTQ7LKCut7mj6IKeHjWcYT5J5cQsN0e4WDZeF5E9QVHCl90rGv7Ca+0T6LWQ//mdwH4TbDQsqxcI46VGlcipz+gzQgg/LKCGpTwr6chDND8soqijQEPoo9u4ITPnhZAZyCzAQDQ/LKD/VjBn6LaeHjWcYX0NsOQss0e4WDZe0W6oCVATls6HHv+dzfDb6XEWBV+lR9fOLf/pn8/dLlh+pmOUTCzjQAorIKAuPBGn6YhCN3sgo2X1FPPoTp4eNZxja/a9lC1XR7hYNl0U052BUcRBNGcso/+C5Z/puJbMpxr8E1kMt+gVQcVrIKJDWshH6VZCxRcgoo078Xvow0HFayCiNXFh8+kcQMHfIKNV2eA/6B75JA5ueyjKaJwsK5ZeJEABnFANJC2Al1ncLAFSnR3ALPCWWDAgAUn8hHgts0e4WDZc8jHBXVHMlPDfGv4o8kHD6XWQ//nxwZG5gGQtVxUI66VEe2ylB+hDz90uWH/zLeVALdlDxWsgoH2ecDPo60ALwyCjj3kNH+gCnR4xnGPJ9j0gLKtHuFg2XJ/yuAFQzkDFayCgVe3Ia+i3RrhYNl5Yd8iVUBmQ//m5wpH6PYAs4DzYZryVMzbRXCwzQcVrIKMnEyBD6Xr5Jg5ueOFE/GQtb0EIPyyhw5JIj+igQjQzLKGX4wjf6dCs5HoMghtxYGgt0EM0MyyjcuBR++k+nh41nGAgLlWwLPNHuFg2XjWvuE1ROpbTUx79jVfFf+gUFwZ7pUZabpjr6VCWWiQ8AF5ZrQAsnJRZMEgAD3NRBCx7FwjjpUaR0m1/6PPP3S5YfceBWIgtwUHFayCh/CJlG+lGQsUXIKK6K2BL6ONACqMgoQokZBvoNp8f1ZxjCx69EC2LRrhYNl827qHdUdGQ//lFw6zjiUgtj0HFayCiNuCgD+lKnR7k7GJgf5GULVNHuFg2X+ibTLFQxBQNF6VHpvuFG+l4ld63Hv3upoxn6VxBwRcgoI/0fJvpavkkDm56pVaJ9CwPQAgzLKJaNykv6aRBNDMsoElnLHPp79u4ITPlomF98C2YQjQ3LKOPBjwb6R/buCEz5sAXDLQtIEM0Nyyj+THlh+kWnh41nGDP2W0kLX9GuFg2XQYKKd1QxZD/+U3DPhWtWC2sllokQAEYGATMLVrm1HYjqVQ1kUfptEA0NyygSF3lB+m327ghM+ZUNSHELLhBNDcsoeB7vdfpE9u4ITPnOwOtWC24QjQrLKJI8Pyv6OPbuCEz5oPWkOgsCEM0KyygfvV9B+lunh41nGPZMvkULfNHuFg2XhSYfeFRsZRZ5CwDnAiZdCzvRrhYNlwPLJCVUHBAMfsgoRlnEcvpnDzYZryV9ht1nC2fQAgrLKM6urWb6aBBNCssoKVZyAfo69u4ITPksOasnCyYQjQvLKBT6wzH6Xis5HoMgC3fyJwsvEM0LyygSD9wJ+k2nh41nGJTo0nALQtHuFg2XTM1HcFQ/ZdYMCAA+ZrodCynR7hYNl/J3KAtURmQ//mlwMwMLHgscxUaA6VGNeKZr+lkPNhmvJe5vU3MLRsVCOulR49PKefoV8/dLlh9g+l5ICyTRrhYNl3bc0npUCmQ/fmdwdXGERgsOUPFayCiRAHFd+m65NR2I6l3WSG36cBANC8soDxKBEPoTKzkegyDDhy1RC2MQTQvLKJnCUTP6FvbuCEz5E5CocgsqEI0IyyhISU17+hr27ghM+SRdrUsLZhDNCMsoiRYwf/pJp4eNZxh1Qd1bCyHR7hYNl2P7a0lUSkVE5+lRaGuYfPonZD/+ZXC/9llHC2CQ8VrIKPqq5iz6HNACCMso0s3nFfoDEE0IyyjdRmE0+n/27ghM+QAveQcLYhCNCcso8BEAZfoBKzkegyDLAr9RCy0QzQnLKLTvyxj6d/buCEz5l+w8dQs6EA0JyygDhvRo+lWnh41nGJVWPmcLSdGuFg2XH4uTS1RfJbvGx7+/hcFJ+mLQ8VrIKMCDXiX6Mb5Jg5ueuBJlLgsl0EIJyyh+JAxF+hMQjTbLKG5xFHL6RSs5HoMgJN83KQsvEM02yyjHywxn+jT27ghM+RonMU0LLxANNssoxOIoYvpzp4eNZxgQV6giCxjR7hYNl3TetDVUSmWWiQ8ADu9dFAtS0a4WDZfPZ6swVGRkP/5ncIolNiwLDg82Ga8lLeByYQsn0a4WDZfpGE1AVH5kP35hcKTZNhULTWWWTBgAcJGTUgszp0eYXxgAWQVeCwPR7hYNlyuoNFFUYmUWTBIANKROHQtR0a4WDZcGf4YPVAxkP35lcDax8AMLaQ82Ga8laDUoEAtA0e4WDZcr58BtVDkFh6rpUSZs83L6dCV1ZMa/zpKJJvoyxcI46VEKBWEp+n/z90uWH3gZ5E0LU9BCNssoJB2wAPpJEI03yyjIOdt4+jb27ghM+TK6ljELShDNN8so9U1wBfor9u4ITPmn038aCxkQDTfLKCLfRGL6GaeHjWcY14zoUQtf0e4WDZcELdohVEBQcVrIKGHco3v6Y9HuFg2Xqe2LOlQIkE+cyCj51BZO+kel+zDGv90KgFT6aw82Ga8l8QW5IAsokPFCyChWsIg0+kynBw9lGBJ6nlcLYtHuFg2XccJvJFRS0HFayCjSq8Fl+grR7hYNl8akVQJUB4WGJelR45WMafpmRYJo6VFevV8g+kQPNhmvJfhNkQYLWNDC2sgowW6VTvp2EM3xyCjhnB9e+lSnh41nGFMTHmcLE9HuFg2XYVRVUlRm5fHPx78nLv02+kVFgrXpUWYrI0X6RRBwRcgolyhABfo5vkkDm56Uxzx1Cw1llokQAHAx2RULCcWCJulRm6QPFvo587dClh8wWHFTCzfQQjfLKNpBzHT6DxCNNMso/LXJM/pHKzkegyAUfM1cCxoQzTTLKH/xs1b6FPbuCEz5haleQwt1EA00yygpBcsB+nWnh41nGKS2AHkLXdGuFg2XpAyyDVRMhQ166VGuLE5B+iDzN0eWHyFDyHkLcdBCNMso86CYK/peEI01yyj6TMEN+iArOR6DINkybgULSRDNNcsoJA47EvpcKzkegyBiO+NQCxcQDTXLKHmF3i76TfbuCEz5woZvBQsWEE01yyhB7x8C+k6nh41nGGDPayALH9GuFg2XN88CN1Q3UEkGyyjrGZUP+iJllgkWAKH0QwILT6eHDxAYLsG8QwsQ0e4WDZcYQRlAVBdQzMfIKJ6DV3/6SWQ/fmJwgU3cRwt1ZVb4FwBPc4o/C2LFQjrpUZljUQz6FfP3S5YfyBmfAQsTUPFayCiO/stB+hPRrhYNlydJJwhUelANF8soLDQERPoskPFayCgbPr9G+jTQ8VrIKERvxm/6Yr5Jg5uegOpzWws+0MLGyCg0sRcs+iGnx+pnGNKVtWkLQdHuFg2XvFTAYVQJpbXwx7+pL4lc+j4QccTIKEwkfVz6dWWWiRQA8GsiCQt6ubVwgeoBgitd+gcQjTLLKKz1WE/6OfbuCEz5NyS0DQsjEM0yyyicBloK+mz27ghM+VccIE0LDBANMssoXeMXXvojp4eNZxjvs8svCxXR7hYNl2uKEV5UVtA2NcsotinGCPoPRYZR6VFLw0Mg+l1lVs4dAFIDNTwLQLm1cIHqp/89HfomEE0yyyi+qaEL+n0rOR6DIMyUWwALAhCNM8so5u11OfpD9u4ITPk0rBI3C0wQzTPLKBxjbwr6DaeHjWcY3WkFHQs80e4WDZeqcNBcVA1kP/5icGtJ2CYLTJAJocgo00X7V/pvZRZIFQAsutJxCx9lVk4iAGRnUkMLRqVWeQsAHJIJEgtMpdYMCADvV3ErCwbFQjrpUXK7dTX6TfP3S5Yf/TwgVQsrUPFayCj+HF0++hyQ8VrIKN+KT2r6KNDxWsgoKpzlLfoPvkmDm55tCPgiCwfRrhYNl8rjqjJUCRA0S8goqlLJVfoRpZaJDwAPnQEZCyKllkwYAC7EXngLIdHuFg2Xnh1KeVR7ZD/+Z3AgClhoC1NkP/54cNWuyAULTKUWTBIA7fKRTgt+0AIzyyhamx9j+kUQTTPLKCebq2v6M/buCEz5TildVwszEI0wyygtee0N+mmnh41nGEfBR3cLX9HuFg2X1ws4T1QAxcI46VHFHidS+jPRrhYNlwhcUl9UFuU0Qca/nsl6KfpQDzYZryUFNag8C2jz90uWH6pfckkLMVAxQ8gomPhCLfpv0MLKyCiBYv1T+gmnR4xnGMGDJA0LOdHuFg2Xn8b0ZFQBkHFayChyyJUl+nHRrhYNl/nhNE5UbIXH1elRklfHRfpoDzYZryXLW1MkC27QwjLLKA9cLjD6f6dHjGcYim7Pewts0e4WDZfQI2gaVDnQcUPIKEF//lL6eNHuFg2XAMJzT1RFEHQLyyh61Tsc+lFkP/5ocKEnVioLNQ82Ga8lfbU5EAtmp4dDJRin7Y80CzHR7hYNl34bGhhUe5CN0sgomQsCYPpNZD/+bXDFyOIlC1QQcFrIKNQU0QT6db5JA5ueYiN7OQtduTUdiOr8sgky+mUQzTDLKComIm76dis5HoMgrPaFcgs6EA0wyyhmZEEg+j2nh41nGOljRmwLXdGuFg2XfF46F1RzZD/+aHDBh9QcC1ullokSACi1YjoLR9BCMMsodbSrHfoTEI0xyygcJPlW+nArOR6DIP58QWELZxDNMcso5k+9N/oU9u4ITPmVbG5QCygQDTHLKLiO9g76YqeHjWcYfs7AWQsn0e4WDZdiYjJnVCTFwjjpUdiNdQD6ddHuFg2XPHwWRlRpZD/+ZHC2eT5XCyVkP/5jcPvA+F4Lbw82Ga8l+YkXFQtT8/dLlh+OvDV6C1dQcVrIKJK6Qhr6JNBCMcsoYwwEX/oEEI0+yyj9/CMT+l4rOR6DIMg6WjYLcRDNPssobVH/HvpJ9u4ITPlcXHt8C0oQDT7LKFGRHC76WSs5HoMgX2dbJgtKEE0+yyiUoIsr+j2nh41nGELPQ2MLRNHuFg2XEIY8dlRyBY3S6VGFudxy+ielsPbHvwy3xhX6UJCxQMgoKGqFcPp40HFayCj7TX00+mfR7hYNlxlQJVtUDhAJAMso8QSDbfpg0M2yyCjxgwd6+isQcFjIKEK7dkn6Cr5JA5ue7KyDTwt7pZaJEACERG9xC3XRrhYNl9lccAVUNwWaFOhRiEnGePp7xYIm6VF3T307+n3QAoDIKCWaFn/6FKdHjGcYwFdIRAtX0e4WDZd4SPFvVDXzt0KWHyJ/5GALJ9GuFg2XmhrrMVQ3ZD/+e3BEIV5uC0IPNhmvJbx6mW0LPtACn8go4bfdPPo3EA3qyCg1+Rhu+m6nh41nGInszVwLTdGuFg2XtGPQX1R6xQDA6VHEc5QA+iDzN0eWH48NFm4LZ9HuFg2XF6ANU1QABQPG6VFcU1pt+juQNuzIKFKYzC76GqWWCRYA6IRLFQtz0IKjyCjJGCN5+h+nR4xnGAfU3CILA9HuFg2XyhwbHlQ3pZbyFwCPy7d/C1LRrhYNl9p9u3lUEmQ//mlwIpVzHAsNDzYZryXcbggOCzPFQjrpUaSk+Tj6TfP3S5YfUkseSQsK0a4WDZc3nvceVG1FBLzpUVsulh36BFDxWsgoMR5ZFPojkPFayCjswWdp+gjQ8VrIKNo3q2L6YL5Jg5ue/7YdOgt2pZaJFAA2kqQIC1SlVs4dALWjDy0LetCCP8soDm/9RPodEM0/yyieUf0U+morOR6DIE/aU1ALJRANP8soDnvITfoN9u4ITPkPUfkAC24QTT/LKAtVRgT6YKeHjWcYzXaZWQsf0e4WDZfmhGtHVB+lFkgVAKoph3ILJNGuFg2XE44Je1QnZXxgxr+9qYhV+nQPNhmvJdWdNgsLf7m1cIHqsL4/GvoVEI08yygk9R5V+h8rOR6DIJbCcRgLAxDNPMsohP5gCfpIp4eNZxiZ4BhgCxPRrhYNl51NUW5UG5Dxv8goleWYOPpepVZOIgAfeAM6C3nzt8SeH8qNNCALENXp37otLXpoAwsls3G0YfuIGEgf+ggPNpmhJQHstS4LQr6JA5iesdATGQsa0IKlyCjye74D+mQQTaHIKOVmU1n6BaeHjWcY5vjxJAtQ0e4WDZcGXhcSVBWQS/DIKOi5MVD6OqW8e8a/ZcrkT/ou5ZZmCwCIJ890C33llgwIAIXkLWULPNCC18gop6jUAPpGEA0CyyjNlW0x+iunh41nGJM2K2cLE9GuFg2Xw81xalQBkE/qyChF7hkH+kXFQjrpUWDTWHH6ZfP3S5Yf600GYAsR0EIfyyj5zRVn+hIQzcHIKEelJAb6fqeHjWcYS1y3fwsl0a4WDZdCOcNuVFqFAPnpUVHTm276HlDxWsgow0qUCfoiufUciOrRGHsO+n8QDTzLKEcUDyr6cfbuCEz5sxyGGwsFEE08yyihVpxA+mOnh41nGAWQpQcLaNHuFg2Xor5+EVRtkPFayChCZC4z+m/RrhYNl45+vXlUWMXebelRYDmnfvpfDzYZryUfTuNeCyynh2siGD6dqDULPtHuFg2XWlJyU1Q90PFayCjPX2so+nbRrhYNl4QczH1UP0XZS+lRn3tsTfomDzYZryVD129XCxO+SYObnlqRKyILROWWiQ8AID5fBQtqubVwgeofmwZX+hUQjT3LKM5IrSn6a/buCEz5DAzQJAt8EM09yyj/9R8K+n727ghM+RPiswALGBANPcsofcPpSvoPp4eNZxiiM3QrCxbRrhYNl5J/sFtUDiV9b8a//d0xP/pc5ZZMGAAsXUFtC1DQQj3LKHAFCSz6bBCNOsso5Cg5Sfok9u4ITPnX5BgICwAQzTrLKAboqxX6YSs5HoMgKGo6EQt+EA06yyg5YyhL+m6nh41nGODmhGoLDtGuFg2XXxw3AVRpUI3vyCiWShE2+nPlFkwSAEzv2gcLOMXCOOlR5T1MNPpV0EI6yyidR/48+g8QjTvLKEs8zSv6bfbuCEz5sv6HFAs2EM07yyggcMxK+kinh41nGLKLJlQLRdHuFg2X+97/VlQ18/dLlh+IcO0+C2rR7hYNl6w8PExUBCV0o8e/Le1aY/okZTKcxr8/AkJn+igPNhmvJWUiMW0LAtGuFg2XeU2oTVRbZXY/xr9qUE4l+hxQMXTIKGVlThX6ctBCkMgoVvXLWPpLEE35yCgeYA5V+jSnh41nGAenwhsLV9HuFg2X+aJeL1Q5hUVn6VGe4AF5+hpkP/5ocJolGGwLXpBxWsgoMTBcFvpI0HF0yCg/yf8p+gUQcFrIKB5J7Rf6Nb5JA5ueDZjZTwsW5ZaJEgAjl/UcCzHQAjvLKO2OFBD6YxBNO8souLB4UfoL9u4ITPlmo9VnCzoQjTjLKKJh8kH6T6eHjWcYz5SqSAt30e4WDZd2lJghVFjFwjjpUf+hxm/6CNHuFg2X0OEzcFQi0AmNyCgsso0Z+mdlsA/Gv48NSzv6Eg82Ga8lRUvcCwtJ8/dLlh8kwhc4CwhQcVrIKHwlmxL6JNDCOMso4cONWPpHEA04yyhFUg9E+nArOR6DIP6S00wLfhBNOMsonxSJVfon9u4ITPn10q07C3EQjTnLKHv5DWP6EKeHjWcYPJwsbwt00e4WDZclGKx3VClkP35ncM1qdVELdKX3xce/tFksPfo+kLFFyCjRMOFY+iHQcVrIKHk/shX6ddBCwMgogdumG/pnp0eMZxhGXkJbCwrR7hYNl23TViVURhDwQcgoaEWTK/pI0a4WDZe7wrl4VEPQzvDIKJr24mH6eg82Ga8lok7BCwtYvkkDm56nQAcrCyKnByNtGL6vxAILSNGuFg2X2la2TFR+kHaCyChLO2s/+gnllokQAKeUvngLRtBCNMsovqrxGvpiEI0SyyjCgsV3+kOnh41nGGC6UEsLVNHuFg2Xwh6oS1Q2UArsyCi27A8y+k4Q9m3IKDvnclT6ZMWCJulRSJt+I/pL0MIAyyg3A0IC+nSnR4dnGCkT0EULGtHuFg2XE/yzF1QrEIrVyCji8QoT+n2Qi+/IKBXxbx36ePO3QpYfTRE2SQsa8zdalh8VvEk7CxDllgkWAJRI5VQLFtDCOcsoC9kINvoSEA05yyiA0i9v+hQrOR6DIIApZm8LQhBNOcsomR4UT/pn9u4ITPlC4qp9CyQQjSbLKA81pHf6KqeHjWcYvEggSAs90e4WDZfX6h0EVEbQTWPIKJ7/WH/6N2Q//n5wJMjrRQtX5ZbmFwAVdgA5CyXFQjrpUUn3a3H6TNCCFssoMDNSM/odEA2tyCh4GjtF+n6nh41nGOFepHoLMNGuFg2Xk/1CGVQ65Xd5xr/d2wxi+hvz90uWH+NkkhgLQbl1HYjqVFm1dfoOEM0myyjfFstb+j8rOR6DIP8SwCULXhANJssolXpnHPpzKzkegyBaEzw0C2gQTSbLKPaZWzX6YPbuCEz5463GdAsDEI0nyyguv/sa+gOnh41nGFGdx0oLfdHuFg2XJEDhXVQQBcSV6VHa8Boh+iJltjfGvwMGk2H6UVDxWsgoZq1wffpQ0ALmyChWdhRt+kynR4xnGIAL6goLPNHuFg2XSvbjSFQskPFayCjQq5Mk+kLR7hYNl3y7bFBUcKWz98e/fVjIW/oGEMu1yChCEiIy+loPNhmvJd5j8QgLfdDxWsgo4ziiGPpLvkmDm54ULhpoC2TllokUACQ8GgoLd7m1HIjqZTwAFvoVEM0nyyj6Gy1w+mUrOR6DIFf2TD0LBxANJ8soPQ7RIPpT9u4ITPkQXAYtCwkQTSfLKPCNJUL6VaeHjWcYmccCcQtP0e4WDZd/55xoVHflFkgVAG8pNh8LCNGuFg2XkTS2O1QyRQX/6VH/QKcy+ioPNhmvJTr07ScLRNGuFg2XEBHhSlQCZD9+UnC6lr4HCyPzt0SeH2BNrwkLFtVpwbotYDPWaQsYs7G1Yftt+BhG+nW+iQOYnkqqrjYLddDCF8soyF+CTPpjpweaZxjoG6VvCxzR7hYNl4LdYCFUfZDKw8goekG5Q/pRhUfx6VHc/i9E+lwlUWYLAIpw5mkLOSWRDAgAyhxIFQsh0MIRyygH6gEs+l8QzaPIKIUFOyn6V6eHjWcYZiHpRAtr0a4WDZegvJ5tVCtFQ13pUXqnKBr6OsVCOulRkdMjAPp98/dLlh+xhbRJCxZQ8VrIKAmCBCD6KdCCJMsoAOZzD/p7EM0kyyib6QkZ+nP27ghM+c43CisLOxANJMsozWvEGPofp4eNZxii5DMRCzXR7hYNlyjggmZUVpDxWsgoqBFCAPpu0e4WDZd1lxEZVE7FQ+/pUcbP7Q36aGQ//mhwhQhZagsKDzYZryXKbURvC27Q8VrIKIrymjD6Sr5Jg5ueBJ6+BwsgJZGJDwBFlrFJCzUlkUwYAPRtjRwLIyURTBIAuWJUMwstxcI46VEKIekx+hrz90uWH9RNIU0LbtBCJMsoXeYuIPoiEI0lyyh9aQt2+nD27ghM+ZE67EYLChDNJcsoXZVRRvoP9u4ITPmZOkEFCxcQDSXLKM75eCv6K/buCEz54lZDIQsxEE0lyyjmUa1v+mGnh41nGP1gUiwLFdHuFg2X1axhOlQgZD/+anAeweNKC07ldxTGv9bugGv6ClAxdMgoaVWqcfpjkHFayCgYhXcC+m3Q8XXIKNv1SQL6ORBwWsgoHDAXJPplvkkDm55njyohCyrQwhHLKGTgVi76a6dHk2cYlUKOcgt50e4WDZdwUjlDVGUlsjPGvxDpQSj6IZA33cgo71SpRfpwJZGJEgCDWk51Cx3FwjjpUa/WDBT6aqeH5RsY7mkYNAtS0a4WDZf6drsAVBxkP/5QcGY3KGALLPP3S5Yfw/uDIwtSp4f8ChgYoYc2C2vRrhYNl+2o+35UY8VN++lRYY2+B/pYUHFayCj30gAN+kunB3XxGF07h3MLRdHuFg2X1zqyClR2kLFFyChrLEcD+gPR7hYNlweXjG5UMtAP08golqKlUvpVhQR66VGBfp54+ikPNhmvJSMFdggLe9HuFg2X+Ij0FFRTEPHlyCiMZ2dP+hcQMCXLKN6+VTn6MNBxWsgoN5G5OPoIEPBByCgF9o8F+nS+SQObntDeJQcLXLm1HIjqvp5dNfoGEI0iyyg/Ybd6+l8rOR6DIPDNT10LTxDNIssowVZPFPp5KzkegyAr95h8Cy8QDSLLKDCRIhP6HaeHjWcYuTSoZwsw0e4WDZcT8qxjVE4lkYkQAGyJZEkLCtGuFg2XwGeiM1R50LVxyCgnh5lJ+jsPNhmvJQn901YLK9CCjsgoyZQQFPpwEI2iyCiyrY0f+lynh41nGDChEhMLa9HuFg2XXdYwQFQVUDa4yCh+nXNv+iZFArvpUVFzak76Z8WCJulRj/XnN/py87dClh+SgwN4CynzN1qWH6VARBULDiWRCRYAIMXHfgtlp8c9Ehgy+LJACzHR7hYNlznv3y9UCcUD3+lRq3pjTPpqZD9+bXCseqg+C3olUeYXAGRBR0ELDdGuFg2X8sytElR6RQDy6VGKv/Ev+k/FQjrpUVHBsEv6bfP3S5Yfzc7QLws3UPFayChXgcpm+hGQ8VrIKMO3XG/6fdDxWsgo4bz/LfpAvkmDm56M5OVhC3slkYkUAJsqNBYLVtHuFg2XUGLRElQKELF7yCi3I6xk+jsFAhDoUaofXzz6cSURSBUAWCdzagti0MKRyCg0elZA+hanB5BnGIzrjBALKNHuFg2XmLzRLFRFRYOG6VFNUIFU+mJkP/5QcF8LUhQLVPO3xJ8f6RrVNwto1WnBui0qizMnCwqz8bVh+zQzb3n6Xb6JA5ieQ2HOJwttZdFnCwASQwp2C0PR7hYNl0tQ9ANUb2Q/fm1wc4IfJwtQELARyyhxRmlU+mhlkQwIANGt6WcLNtBCIssou1aJKPpXEI0jyyhImtc9+j727ghM+VsaHmULaRDNI8soTurCLPoZKzkegyD9BNImCz4QDSPLKE4DTWT6KaeHjWcYMK/YKAtL0e4WDZcJUVYsVA3FQjrpUbb8EET6LdGuFg2XxrFML1QHZTWBxr+JMvMQ+gYPNhmvJUlDMhMLTvP3S5YfH79iewsn0e4WDZdRNyheVFFkP359cD7EaG8LQKVynca/sekLVPpEUPFayChpGIxd+h25tXCB6lDMtDn6PBBNI8soFh9cFvp59u4ITPl/mTgDCz0QjSDLKME0J176YCs5HoMgHksTNwtpEM0gyyjrAVwJ+kynh41nGIRJgBoLONHuFg2Xx0HhQlQZkPFayChVZmwM+ibRrhYNl/WL2zhUYMVNjelRHanxJfohDzYZryUc5XpEC2/RrhYNlzf+IUNUPgWay+lRYwJsC/pb0PFayCjcw98p+ma+SYObnoJnSWoLH9ACiMgoHtlaTPoLEI3KyCiFzQwS+m+nh41nGBcMVncLStGuFg2XQd2kKlRxRUe/6VF+DsAp+jBlkYkPAH2Is08LKWWRTBgAhRhaRQsv0MLTyCgg5ZkM+iUQTYfIKJylPQ76VaeHjWcYKyKjMwst0e4WDZfn8s0LVH1Q9E3IKInLqnf6F2Q/fnpw3P0peAsnZRFMEgBaXy42C0XQAiDLKBJPMzL6AhBNIMsoPedGNvpQ9u4ITPmLqC9/C2kQjSHLKGt4yH/6D/buCEz58OglJgtTEM0hyygtSxci+kErOR6DIG/y5nsLRxANIcsoE1xCNvp1p4eNZxih+g5SCxrR7hYNl1JnxylUE8XCOOlRlwZqMfpl0e4WDZdOXWZNVFNkP/55cFFaHzMLPFDJvMgoi5HVE/pODzYZryX/bpETC3rQQojIKDJwh3f6UKdHjGcYyj+SFAtl0e4WDZc+EXo/VCfz90uWHzGghXoLf9GuFg2XroqJKlRb5XMWxr8p9XYv+n0PNhmvJeuXz38LO1AxdMgozCHkM/px0EIhyyiQJ5kx+kQQjS7LKMRRR0f6Ais5HoMgj07jRQtdEM0uyyjrN3N9+iL27ghM+TCnyhMLTBANLssoiNQcNfpip4eNZxhQdDEdC0LR7hYNl+3r4lVUMJBxWsgo+5+ye/os0e4WDZeEY6hbVFHl8FjGv2aHGS36FtDP8sgoZhq0B/oPDzYZryV7gZ96C1LQcXXIKDMnOHD6ThBwWsgoeJtrZPo0vkkDm56a6aZlCxJlkYkSABY1ACALQdBCLsso8iUwC/pPEI0vyyiC2YkH+hH27ghM+cQ1NzQLGhDNL8so7TSoUvpyKzkegyBJiKVRC3IQDS/LKB4IIHL6GCs5HoMgi0UxYgtoEE0vyygfr74F+n6nh41nGCk2owELU9HuFg2XX25lX1RhxcI46VGU091E+hvRrhYNl9ys6zxUOAWbnelRYCjmB/pzDzYZryXGJDBtCy/RrhYNlz8z4D1UX5A39cgo8OMVZ/oi8/dLlh9EW2JCC1xQcVrIKBc1Njf6BpCxRcgoo3NtKfpq0IIsyyjXLtR3+kEQzSzLKGWpU3/6OvbuCEz5rDrRRAsUEA0syyhNd+Uc+mL27ghM+Tn7enALCBBNLMsoJh1nSPplp4eNZxhJ+nAyCxHRrhYNlwod8zJUPuV1+ce/wStKfPpw0HFayChsHUoS+k+5NR2I6sOcJQn6QRCNLcsocf/uLPoj9u4ITPnSPWY0C3EQzS3LKMJfpwv6T/buCEz5krTAVQsGEA0tyyiN+uww+n/27ghM+WA0ElULFhBNLcsodwTwW/odp4eNZxgSmpRiCwrR7hYNl+0pUVZUJ8WY3+lRC1tcG/olBULP6VGQErwC+mUQ8EHIKH9O5mb6V75JA5uedHxFLQtVZZGJEAATLNFvCwTFgibpUTdJv1/6R9CCGMsoOARjdPpaEA0xyygVPoFh+janh41nGNs/mhQLW9GuFg2XgthsBlRSZD9+Z3Dxdk8JC03zt0KWHxK9uwwLavM3WpYfAf0nVwtJpwfe4xgUv9kQCxvR7hYNl9Ox8jVUFVC08cgoileDW/pyUAmKyChql7wZ+mplkQkWAB6s6zMLY9ACi8goahVEPvpHp0eMZxjHenQ8C1zR7hYNlxeVqURUNmXR5xcA7JKKXwtR0e4WDZdah2gmVGlkP/59cEGJrgoLeoWetulROh17NfolDzYZryU470EJCwbQQv3IKL7knQP6A6dHjGcYOF+lHgtN0e4WDZep+a0YVBjFQjrpUTYw8w36HdHuFg2XtoAaR1QRhUWo6VHSe0Af+loQ9kjIKBwSxyj6bQ82Ga8lVdxrLQsKpwfp5xhbwDkmC33RrhYNl3Lxj3hUTAXGgOlRV2WEH/op8/dLlh8JlDgOC1K5tRyI6l8l/236OxCNKssoTaPqQ/pt9u4ITPlrBqc+CxUQzSrLKL6B+WX6EKeHjWcYv/7UCwtU0e4WDZfDiaFuVBZQ8VrIKAror0v6ZtHuFg2XXuwNS1QlkMn/yCgDouA5+h6l9W3Gv1F9VxX6Mg82Ga8lSrYzFwsEkPFayCjPOK8o+jjQ8VrIKHiqWDz6AL5Jg5ueiwezVAs3ZZGJFAAnDIwsCzxlEUgVAJxUF2cLWfO3RJ8fw2w2dQtL1enfui1efdNfC12zMbVh+5pEflT6IL6JA5ieZ7jpXgsx0a4WDZe8W9crVA5kP/5qcF0/5U4LU6VRZwsA8VDefgsX0II0yyjr1F0++kAQjejIKK9rtzL6UqeHjWcYnsvlEgsA0e4WDZcpXaMUVFtkP/5ucIqOpzsLadC2s8goVzmWEvoLpZEMCAC7ywoxCz7QghrLKKHvOUH6LqdHjGcYEahKZAtP0e4WDZf5SNBtVBTFQjrpUdkpFyH6f9HuFg2XAYxFBlRt5XZgxr/n6FxR+hkFAOrpUYwD+j/6ZA82Ga8l4FsBBwsIubVwgepyFes1+lQQDSrLKLJbCjr6JSs5HoMgX/dCQgsUEE0qyyh9Wf4E+lkrOR6DIPi1lSkLZhCNK8soGq3/RPoZp4eNZxjZiyIQC3bR7hYNlytO0kpUSfP3S5YfRu6Ebwsg0a4WDZfnmfNvVH1kP357cIcfHyoLfw82Ga8liysPZgtp0AIPyyjeGwd2+j6nR4xnGPoq2zkLRdHuFg2XCdtXAVR5UPFayCjWpaZA+jDR7hYNl4yAXlRUMgUCfelRHbtDM/o9ZD9+U3D2mvdQCwsPNhmvJcBCw3sLLJDxWsgoFWNFKfoKubVwgeowx8Ml+gcQzSvLKGXS/k/6B/buCEz5zUHDbwsPEA0ryyiwFtMi+gf27ghM+br5yykLHxBNK8so31k2dPoJ9u4ITPkpz6peCzYQjSjLKL2YwG76UKeHjWcY4UgzLwsD0e4WDZeVJbdaVD/Q8VrIKC1tf1j6MNGuFg2XYwXQJVQUhZ4t6VHKD3hF+l0PNhmvJbHxYEMLDb5Jg5ue+rKEeAtj0MI5yyiGOyAl+kMQzRHLKBQ8TlT6H6eHjWcYBPvHWQte0e4WDZcM/+AZVG5kP/5ncHbFtE4LKsWaIOlRI/A+Ivp5pZGJDwDi6chPCyGlkUwYAIEPQzwLStDCKMsor9AyVPp8EA0oyyhP3AVP+gD27ghM+RkenVwLdxBNKMsoe3nwUfppKzkegyCt8vMxC3UQjSnLKFyYiWH6O6eHjWcYt4nIQQsS0a4WDZeA7T9MVBVkP35QcPvnWw8LRqURTBIAvkn2eQswxcI46VGhgB81+j7z90uWHzhYl1wLELm1HIjqNItJNvpAEM0pyyikKhY1+jD27ghM+YZirR0LXxANKcsoeOg3YPoEp4eNZxg3NENYC3rR7hYNl1AbEglURoUY6ulRzvwFPvp35fXUx78yaRcH+i1QMXTIKFqBW3H6arm1HIjq/sy3bfpkEE0pyyhu9St9+l4rOR6DIKX4/SwLPBCNVssoR176XfoM9u4ITPkXWBtqCwkQzVbLKNLWmSf6C/buCEz5NUPRFQsVEA1WyyinD00g+j6nh41nGIGFg0oLHNHuFg2XASjiQlQhkHFayCjlratL+lLRrhYNl1wMixVUXaW018e/dFo1Y/pHDzYZryV+OmwJCwXQQlbLKMNAwVf6FxCNV8soPAkAP/pM9u4ITPmu3Y4/C0oQzVfLKH5CR1H6eCs5HoMggxXfEgtXEA1XyyjfzW4T+ngrOR6DIIV7glILERBNV8soAtXsdPpWp4eNZxj/DaZcC0zRrhYNl74ItmRUc9Dxa8goKnovJvp/0PFyyCjDHDQt+mrQglTLKN7ARWr6TxDNVMsow31JH/oa9u4ITPnT+XlOCx8QDVTLKOoVM3v6ZSs5HoMgKjXKMgtYEE1UyyjNcbY0+lKnh41nGDdusUoLWtHuFg2XydLJS1RLEHBayCizfuxD+ifRrhYNl9q7GyxUckVbm+lRtonBCPpKDzYZryUoJPFOCzq+SQObno/w/l0LP6WRiRIAi6WjAAsWxcI46VEENYti+hXz90uWH4Tpk18LWFBxWsgo8ihwavpUkLFFyCj/n4hi+m/QcVrIKDXX4Cr6NhDwQcgoNVgYKvpyvkkDm57pBK5cCy2lkYkQANGFFUYLetHuFg2XJz5/XFQi5TE5xr/NAtUL+gGQzUzIKPawIAH6GcWCJulRatvxL/p+87dClh+Wb+9SCzrQwoXIKOaHJWL6IBANn8gohL32APpkp4eNZxjcFs08Cw/RrhYNl1mcPh9UZGQ//lNw3YUxAwsd8zdalh8TEaN4C1zQglXLKG7pBmj6dhDNVcso89VCePpc9u4ITPkHF8YgCw0QDVXLKGhlon36OSs5HoMgw2X0FQtbEE1Vyyg05+wD+lT27ghM+ci/9l0LOxCNUssoipgvM/p+p4eNZxi/JSoVC0nRrhYNl/UEnGVUYSUzZca/vKXGBfovpZEJFgC4b/NxC0Kl0eQXAH0+sG4LRsVCOulRNSSuefoa0MJSyyhFN75T+ncQDVLLKCCNgCr6KCs5HoMg2W+oAQsAEE1Syygy2W46+hWnh41nGBjClwkLJNHuFg2XegNJeFQi8/dLlh8jV9IACxnR7hYNl1NMnSRUB6X0TMa/pWxWHPosxVk76VEKwNwG+gEPNhmvJfHFRVwLINACpMgodhm+T/o5p0eMZxjUT6A3CxfR7hYNl762OVZUOFDxWsgo3walBPo10e4WDZdJmHJtVFpkP/58cGsfwxMLYkWNbelR9bBgZfoeDzYZryWY6Y4wC1uQ8VrIKGIz/VL6XdDxWsgovFQaAfodvkmDm55mSzF1C3Cnx5FOGAcXM1ELQ9HuFg2X1dVMYFRrpZGJFACJKkELC2rRrhYNl4Hf7iVUQkVEKelRWJcwP/p4DzYZryXHM10+CzOlEUgVAD2sBygLcPO3xJwfMuE4cQtq1WnBui3uKkUqCwKzcbVh+1aFlxD6U76JA5ie5EGLNwsd0MIPyyheeL0O+h2nR4xnGGXWbzQLBtHuFg2XlSeHVlRB5RFkCwDl5lNZCynRrhYNlzKUKQBUPgVBm+lRc0NEK/pfDzYZryVSVIJoC3TlkQwIAEUONzcLatCCU8soCUjnLPoZEM1TyyhMqg4Q+iv27ghM+UwoiBsLGxANU8so6DeiJPoyKzkegyDR8yZ2Cz8QTVPLKPnU2mn6aKeHjWcYLbMyMwt+0e4WDZf/hlsNVCHFQjrpUawJoTj6M9HuFg2XzvRdNFRCJTW2xr/7R4Y3+gRkP/5/cPU2VhQLZA82Ga8lTz0LaQsV0e4WDZcVp0B4VABQdWrIKPhkBAj6SGQ//nxwc81ICAt88/dLlh94fe0yC0BQ8VrIKJYeX1X6dtBC4Mgo/o2LQ/oMEE0iyyiKGwgC+nOnh41nGIqzMHkLAtGuFg2XcrhHEFQWZXcBxr9+4WdX+nCQ8VrIKMAuMnb6AdDCgMgonTL3MPoJp0eMZxg5xPAmCzTR7hYNl9ntJkBUdNDxWsgoYlC9Mvoo0e4WDZdfcXEFVCtFmcjpUcQ2CEL6BWQ/fnxwDT0YIwskDzYZryWSoxMqCy2+SYObnl/6ejcLbeWRiQ8ALCrrNQtz0IIryyiFz3Qp+hanR4xnGB2FC14LLNHuFg2Xp7eaMVRA5ZFMGADXNklJCzXRrhYNl9LFinRUfUXaz+lRikdEDfp4DzYZryWphpkfC3bRrhYNl41HE09UfiXxbca/HhqFIfpT5RFMEgCxEI08Cz7FwjjpUS5CRA36LdDCEssoomtecfoYEE0gyygLl29K+nynh41nGC1XTFALVNGuFg2XSCpEWFRiBYZI6VFjZUhf+mrz90uWHxQVkDoLA1AxdMgokNbgV/oa0ELDyCg5q6Er+noQDR3LKHrJRAP6f6eHjWcYC+1zKwt90a4WDZfxA4ozVAfQNuTIKLk5Hh76SZBxWsgoOOwiZvos0LFzyCgvdoRV+isQcFrIKFz7Kwz6ZL5JA5uevcWZMAt35ZGJEgBu3uxlC3zQglDLKFo+LSX6RRDNUMso0KS5Yfo19u4ITPllCa1wC3QQDVDLKNdP6lz6ESs5HoMgznFKHgsjEE1Qyyj66P89+hz27ghM+W8qCh8LNBCNUcsoZ4m1Uvomp4eNZxjXgiRQCz3RrhYNl4psvBJUD2Q/fn1w4FDAeQtpxcI46VEB0wp6+gDz90uWH2+8KBYLJNDCUcsonX8Uf/osEA1Ryyibp2pW+nsrOR6DIFJFpzkLQhBNUcsotS8UHfpb9u4ITPlFSj51C2UQjV7LKIzjDRn6TaeHjWcY4IOADgs20e4WDZdqhqQgVCFQcVrIKF4olGn6e9HuFg2Xu094C1RJEHSRyCieESMN+iDFhhDoUYnlBln6ZQ82Ga8lNivtEwtzkLFFyCgMZP5k+lbQcVrIKNIpagL6OxDwQcgoYKXXS/pgvkkDm56QUiYfC0zRrhYNl2vBm3VUMGQ/fnpwP3uJOwsj5ZGJEAAn91tpC3u59RyI6s9IhH/6QxDNXssop3RpP/ps9u4ITPk1rq8NCwIQDV7LKIv/3i76Wys5HoMggeUQbwtYEE1eyygWqet/+n6nh41nGJoOf3ULTNHuFg2Xggn8FlRexYIm6VHN1YBT+nDR7hYNlx+MSWdURmV8mca/cODWXfpGkM3eyCgLMkxZ+jkPNhmvJXaN5xkLONCC08go6mfPLvpBEM3FyCiV6idB+nCnh41nGNZlDGYLRtGuFg2XFwa/EVQQZD/+YHDjKgZKC0nzt0KWH5pCc2ELbPM3WpYfZbu+VwsR0e4WDZfGQltEVAkF2KbpUQCNJmf6KtCIU8sozcPBO/pM5ZEJFgDfN0NrC1K5tXCB6sPkkTX6FxCNX8sosr7hXPpKKzkegyBYLso7CyIQzV/LKAzEUx36OCs5HoMghZwHagsFEA1fyygayQ5T+lWnh41nGHJgX1MLbNHuFg2X89XQGlR+0IpNyCjzCR5y+jlQNLrIKKvPMG36ZeUR5BcA2B2YAgtNxUI66VHAhcR8+mfz90uWH5uCPRkLVVDxWsgoOsARAvpU0e4WDZcxMLZfVC/FhxjoUZMZz336TGUw08e/MWUITfpckPFayCjXsGAM+inRrhYNlzczYBNUG4XapulRjj+2Cvpu0PFayCgx5/ly+hG+SYObnoamx18LW+WRiRQA3sUBGQsC5RFIFQBmAl8+C1fzt0ScH5DNNG4LaNXp37otE7AhOAsCs7GyYfvx/7Zf+ga+iQOYnvzr708LaNGuFg2XT3OfGlR1JTDLx7+juk8x+mYlkGULAO0z3SALSKcHWV0Ya1vxWAs60e4WDZeyfQkIVAaQSm3IKPKrWwj6d2Q/flNwGbmLYAtxJVAFCABgwG5rC1a5tXCB6qL7tC76fhBNX8soKnw3cvpxKzkegyDuH2VtCyEQjVzLKPaAbk76FqeHjWcY4CYsFwsq0a4WDZdbb5xmVHdQjA7LKPDH6nb6eyVQTg8A5r1IbQtGxUI66VEZclcM+iPz90uWHzZ+JA8LHdACMcso9G0vavokEA2myCgC3vJN+iqnh41nGNpDbTgLJNGuFg2Xoi2RU1QShYVJ6VFP/v55+kdQcUfIKLsf43b6fdDCXMsoB9nofPphEA1cyyj6jKFT+mErOR6DIFhY2hMLXhBNXMsoXv7/evp59u4ITPnn9gInCxoQjV3LKDHeEk/6dis5HoMgwxfmYQthEM1dyyiQXBBE+gynh41nGFtNxhgLQdHuFg2XQ5DAalQ8kHFHyCg3Zuhh+k3RrhYNl2Zzb2xUChB1Zcgoud9tMPpHDzYZryW3Osw4C0jQAl3LKMmsmE36OxBNXcsoCdrjHPpP9u4ITPmox78zC2kQjVrLKMC9dXr6FaeHjWcY/APXJwsL0a4WDZdWOBwzVC1FggzoUSqU+yj6FdBxR8goccTrdvpPvkmDm55KXGRVC1e5NR2I6k5IkUj6VhDNWssodCW8YPpH9u4ITPlAbSx6CzgQDVrLKMVvhlz6Ois5HoMg64I/GwsvEE1ayyhQWxN1+kmnh41nGHxi6DALTNGuFg2XszLqJVQyRUWm6VEZ7Nwr+mslkIkPAEAIiX0Lf9CCW8so4IR6Qvp4EM1byyjhBh1n+i727ghM+b7ouWQLDBANW8so7eJIDvo99u4ITPlmkpQTC0wQTVvLKJVAlFb6HKeHjWcY22TZNAtY0a4WDZfJ0y5/VGFkP/5QcHR43GcLBiWQdhgAGVlPQQtk0IJYyygQt15z+nkQzVjLKE0DNU76S/buCEz56J1UIAteEA1Yyyg0GQpb+mcrOR6DIPvRtgcLdhBNWMsoOfnRafoLp4eNZxhpgzlSC1bR7hYNl5kMPhVUUCUQTBIAVXi9bwsy0a4WDZcoWEZiVG0lNsbHvx8AUSr6Hw82Ga8lxWa+JgtP0e4WDZdqk9RYVFgQN2jIKPlmihT6WEUbiulRdWjrTPpDxcI46VEA6IpK+iXQQlzLKHPXNyr6GacH42cYSgDPCwtJ0a4WDZc9jjwqVBwltr3Hv2/FUw76BvP3S5YfdbjJMQsnUDFzyCiauWg1+h3QQsTIKKqHZ2L6SxDNgcgoUmRzSvpep4eNZximQXdDCy/RrhYNlylDNHJUNSU2qce/uRNSJPpTkHFayCjd9vg5+lPQcXPIKLdnrlL6f9DCvMgoVVY4cvpHEE0nyygu0ehJ+gKnh41nGKGTFhoLQ9GuFg2XtEsJLFREZD/+ZnBxvCxhCzgQcFrIKKWkZ0r6TL5JA5uehijjJQtT0ALzyCiu/L8j+lsQDeTIKCHjjjv6A6eHjWcYlSr+aQsJ0a4WDZdbep5sVA1kP/5TcEIP8w0LNSWQiRIAltK7FAsd0IIpyygJNMRR+hSnB5xnGH5s8gALVtGuFg2XZhpGX1Q3xUc+6VGrTl92+ivFwjjpUcvG1yn6RqcHBCIYaN9dPAsu0a4WDZc1UzANVHHFBKjpUfwS93D6HfP3S5YfPvACagsRUHFayChGGzsU+nfQglnLKID0Kwn6HhDNWcsoqbkIEvpIKzkegyBh2mcYCzYQDVnLKEqo+Wn6SPbuCEz564aQEgtkEE1ZyygRG/s5+hSnh41nGGEyG24LfNHuFg2XvSb6cVQXZbPZx7+EDJtD+golfMfHv75XtFn6EpCxRcgoiQfRVfp60HFayChplNUp+l3Qws/IKCnIoR/6DKfH4GcYE8bZdQt40e4WDZcX9cYYVE7l80jGv3v2oSP6fGQ//nxwx4usIQsdELBwyCjvVrAU+jO+SQObngB4uQILOCWQiRAAjz/ZPQsoZdB3CwAehd1NCy3QguHIKAsGfRj6RRCNGssoCoBqDPoop4eNZxgbgddACxDRrhYNlxQ4sH9UWcUBQ+lRIwI/WvpfZdAKCABumsQ3CwHFQjrpUefjdSH6Drm1HYjqi1OxdPo0EI1Gyyj+o7Ao+gsrOR6DIIAXFUELcRDNRssojGopMPpDp4eNZxggefFACz3R7hYNl1meVHJUUPP3S5YfQvGJZws+0a4WDZcLoo0UVAqQSULIKPFiEk36MQ82Ga8lHfKyRAsoUPFayCiElVhi+mTR7hYNl4jh71BUd2Q//n5wiK7ESwtkZD/+ZXCtk6N4Cz+QMVrIKI9phXT6RNACRssopoK1RPogEE1Gyyg9A/97+gb27ghM+Yj4iz4LThCNR8soWFzvD/oyp4eNZxhRJUJnC1zR7hYNl3uERX1UVGQ//mhwD95SBAtOZD/+bnDtFgg2C3DQcVrIKMAZbCn6QL5Jg5ue5lYiRQtP0EItyyjM6gQS+gYQTdLIKOyx9zz6eaeHjWcYa8P9KwsQ0a4WDZeNdr5jVDFkP/5hcDT8BkALXGWQiQ8A2UgCeQtx0MJHyyinsUZP+nwQDUfLKFV7y3j6Uis5HoMg/kenVAthEE1Hyygh4jAA+kb27ghM+dWvC3sLGxCNRMsomvUaSvpo9u4ITPkFlBwrCw0QzUTLKCpfPmD6AqeHjWcY9Ps8QQtb0e4WDZdQoXc7VDdlEEwSAD6l9HkLJdGuFg2X8b2FMlQ+ZD/+f3DQNQpjCwIPNhmvJZM6XFoLLtAC1MgoW6lMavpep0eMZxidmAZyCwvR7hYNl7xfNWNUDMXCOOlRLDlqBfoH0e4WDZe3Bh5WVGOlMFjGv+DtiRv6SAVEOulRSnvCQPp+DzYZryUfRjhUC3enxxIAGOeJTDwLVNGuFg2XYDf3TVQexQXO6VEnt+Ev+mHz90uWHyeVLnALZNBCzsgoH7u5IPpBEI29yCgnyR13+iqnh41nGHES4UkLOtGuFg2Xy4BIb1RRUImzyCiwuNMG+lFQcVrIKMXYNVz6HNDC9cgogTX+KPo/p0eMZxjK6UUFCx7R7hYNl4VxPQhUWJCxRcgow1joK/pd0a4WDZfJiglAVHMF2jnpUfe67Xb6ew82Ga8lei0JUQs70AJEyyg9eQEC+g4QTUTLKHcA9DT6PCs5HoMgDiuKfgsIEI1FyygTNlVu+g327ghM+cINV2oLIRDNRcso7UwVFfpbp4eNZxg6+wo+CxvR7hYNl4TfbHRUSdBxWsgozG1oQfpu0a4WDZf/+2kiVDeFRmjpUSvnAU76fQ82Ga8lm342Twsv0e4WDZc1pxgWVFdkP/5QcE++zzULEqU2p8a/wfhpJPotEHBFyCifV2RK+nu+SQObnpIQ/FgLDrm1cIHq9P57OPpgEA1FyyivD8gc+kr27ghM+dvUOlMLUxBNRcsohq4yLvobKzkegyD1HrNUC2MQjULLKAMx1An6LPbuCEz5RFZHGgsQEM1CyygevBpp+nanh41nGAcN0zELB9GuFg2XetTqWFQZ0A0xyygYuoNt+gRlkIkQAM9OVz8LBdCCxMgopHrtJfomEM0tyyj508RS+lunh41nGFEcKWkLPNHuFg2XhfV+V1QZZD/+ZXCM6mgCCy9QjELIKJGPJGP6E6WQYgsACs4FLQt2p4ec+hiEpsIbC07RrhYNl/+yfQlUMmQ//mJwOT6PKAtrpRAKCABtiDklC2nFQjrpUWQPSD36JfP3S5YfZT2MKQsu0IJEyyhDM6t7+kKnR4xnGDMk3iILP9HuFg2XFLfXIFQzUPFayCiRZGMh+hbR7hYNlzIc4CRULEUNw+lRg3LcAPpShZtd6VEcBEIy+hcPNhmvJR+n4wsLcJDxWsgo2otvKvpq0AJCyyirOiMt+lUQTULLKAXfNUn6O/buCEz5E5ktbAsKEI1Dyyj2GNsP+jr27ghM+dTdL1wLUxDNQ8somb6sYPo8p4eNZxgBtrJpCy3R7hYNlyr/ITJUOtDxWsgoM5otQfoV0e4WDZcLMG52VEJkP35QcPnS1w4LL9A1DcsoksdOcvoWDzYZryXDurpRC2++SYObnv9C7E0LNtACQ8soocJUAPoQEE1DyyjXOvBf+jQrOR6DIPSk0D4LUhCNQMsoZrlkePpUKzkegyCrbPhkC0AQzUDLKPN+Rlb6GCs5HoMgpyvILwtlEA1AyygRBY1X+k2nh41nGA4KNTYLaNGuFg2Xc1mNQlRTZD9+fHDMcmIgC3elkIkPAEq3rFYLdqWQTBgAt6wZegtnpRBMEgA9+b9bC33FwjjpUWfIGWP6M/P3S5YfTXt9aQt8UHFayCj42zU8+li5dR2I6rowmDr6SxBNQMsoADKTc/orKzkegyDgpNx9CxcQjUHLKIAm2DT6XfbuCEz59GMCVgsAEM1ByyiKXsQ++l327ghM+Ud6/RILKBANQcsomafaV/okp4eNZxhT++5fC2nR7hYNl5s99SxUepDxQsgoPM6WFvoJ0a4WDZdwNQg6VGml9RLGv/H+lzr6Vw82Ga8l70nwdgt6pwdsJxgC5QlxCzHR7hYNl+SB9VZUWdBxWsgoQimGXPpW0e4WDZf+klIrVAxkP/58cLfFTFoLCmU0nMa/ey1WavorDzYZryUbbMceC0LQQkHLKIfPRCH6VRCNTssoFmsUOPocKzkegyCka6xUCzIQzU7LKGbm4CX6PqeHjWcYT94iUwt/0a4WDZdpxLVPVEFkP/5ncLEJS0ILMRBwRcgoqbtyEfoKvkkDm57+E2NxCybQAk7LKOQoEiD6OhBNTssovGz0bPok9u4ITPkcG8UpC2UQjU/LKI4BLAH6PPbuCEz5QXyafQtLEM1PyygiCiJK+lWnh41nGOq6MX8LAdHuFg2XSESFW1RURZs96FGdv8hn+mRQjMDIKCAGAzH6HqWQiRAAZFN6AgtE0AJPyygARchU+jIQTU/LKLi0w176VvbuCEz5hbjlCQsaEI1MyygISpsU+nn27ghM+U5Yn3oLTxDNTMsoH+PWGPpDKzkegyC7vXgLC2QQDUzLKE+0b1X6faeHjWcYLf8sLAtS0e4WDZdZgDsbVBhFWXTpUbttODX6WhAKuMgoau6IdPp9xYIm6VH818MA+k7zt0KWH0vnY2YLbvM3R5Yf9+HBSQstpZAJFgCpunhZC1PQwv3IKHSSOyT6WxBNoMgoGLZmZfo6p4eNZxgzHFhFC1LRrhYNlxYpQ1tUZiV9z8e/hdx7J/oDpZDlFwBSOylRC3rFQjrpURYh3jz6O/P3S5YfQJnxdQt2UPFayCjf+MJ++mq5tXCB6vkb6Tf6XhBNTMsosfz0Avpp9u4ITPk38uQOC3oQjU3LKAr+1T36YaeHjWcYARc8Vgs70a4WDZdiFjk0VCaldM7Hv3EPBjD6TZDxWsgoQ0pYdvpF0PFayCgvtWQf+i++SYObnui6MX8LGqWQiRQAZ+LQNwtZ0a4WDZdjYKh3VDSlcMXHv5FoGXH6MaVQzh0AchfvCAt6pRBIFQADuY9AC0W5tXCB6izUWVj6bxDNTcsooWNVb/pfKzkegyCIhHN1C3sQDU3LKEOaPVD6OqeHjWcYutYPTQtq0e4WDZc8gr98VGTQSEPIKBwViXz6H2Q/fn1wfe1VMgsApVBOIgBne8xTCwPl0GILAPG6+AMLd+UQCggAGL4sHAtGp4d8BBhdGLt3C2PR7hYNl5vezjJUXsVCOulRQRxvZvpO0e4WDZe6pct4VF0FmALoUcnawHH6QxBPKMsomyHGIPoRDzYZryXqdkBjC0TQQk3LKOSJLTf6UBCNSssoQzPPV/p6KzkegyDmsWZ1C2UQzUrLKA4edGL6FKeHjWcYy7EaHgtT0e4WDZfxvd5cVFfz90uWH/yOVgILcNGuFg2XemeZXVQFZD/+e3BELj92C0kPNhmvJZymBSkLEVDxWsgopvu7d/oLkPFayChZQlMs+hbQQpvIKMIh8hT6AadHjGcYbN6KQQtv0e4WDZcS6fV4VDnQ8VrIKPkfPEP6a9HuFg2XFGdoPFRtpf+bxr8aZctJ+gJF2dnpUUJQFyz6CQ82Ga8lBSPTAQs3vkmDm55ohvljC2PlkIkPAAwTzkULX+WQTBgA+YqiAQsO0IJTyyg78fFL+ggQjTvLKNmn5X/6bKeHjWcYj+ZeTQtX0e4WDZewCwRoVFFlsBvGv7YGBk36KyV0p8a/I6yQJPpA5RBMEgB96gRmC3PFwjjpUZtSgyP6cvP3S5Yf+Q2FGwtkUDFDyCjZgJIQ+nGQcVrIKFAblxv6FLk1HYjqeBRVJvpaEA1KyyipQ/FY+m0rOR6DIBLBgkcLcRBNSssoTKnyLfoU9u4ITPm9i55FC00QjUvLKKWwTxX6BqeHjWcY0CgDNgs40a4WDZeLH6tvVAzFzbbpUdiGwmv6a9BxQ8goH1d7A/pr0IIfyyhp5I0g+h6nR4xnGMfgV14La9HuFg2XM8T8IlQOEHBayCh1OpsT+nHR7hYNl1gTu0dUYBAKL8so77xtTvoQ5f8Nxr+Mfthy+jcPNhmvJa8XVmILJb5JA5ueNAPHEwtg5ZCJEgBxfO0PC3a59R2I6umdYSP6OBDNS8soXF8iZvpXKzkegyAAR40rC18QDUvLKApvbj36aqeHjWcYHTc4AwsP0a4WDZeJvTZ5VCRQtK3IKAIE5G36MMXCOOlRcr80dPoI0AJByyjH+Vh8+m0QjeTIKGC7QEr6OaeHjWcYFt9LXgs80a4WDZf8xsBMVGRFw4jpUaBH5X76BfP3S5YfWAmqEwt+UHFayCiUmolW+kqQsUDIKACfdnj6C9BxWsgoBGbeW/oNEHBYyCj1gbJH+mi+SQObnqMa6DcLB9GuFg2XnBGtP1RDZfYMxr8fHPNQ+ijlkIkQAKL43W0LOMWCJulRHxGeZ/op0e4WDZfUK18iVELQC23IKOyN+kL6WhAKW8sogtPbKPom87dClh+bq+AVC1bzN0eWHw4T0RcLZuWQCRYAZGXJawsB0EJLyyjxX1hY+iYQjUjLKEBZ2Ev6PvbuCEz5wgUaFAs4EM1IyyjDzNAW+m2nh41nGF446EgLYNHuFg2Xe3nQaFQM5ZDyFwDUf2JQC3XRrhYNl3DZCS5UBoWFFOhRyBkuaPo1DzYZryXpgP5OCxTFQjrpUfOrK336VfP3S5Yf+VStYgtRUPFayCiETdk7+nzQAqDIKL9+miH6UqdHjGcYQXTAdQsF0e4WDZfrUY11VGGQ8VrIKKJSOnz6NtGuFg2XQ9nBLlQZJfDTx79ZCKJ3+hIPNhmvJVyU3RQLNdBCKsso0dqiIfp6EA07yygt5r5g+kGnh41nGJ8JhVkLNtGuFg2XY/2oCVQzUAiFyCi2PgZ4+g/Q8VrIKL8snm76Yr5Jg5uec6OGFwtXpwdwDxhV9iwECwPR7hYNlzhx00NUeuWQiRQAFUbBAgsX0a4WDZccZicXVERkP35gcGop1XcLQw82Ga8lHE34agsH0AIgyyjItPYP+hkQTc/IKE/nfEb6FKeHjWcYbFEkDwtV0a4WDZecsHYgVBllfirGv5ZEqnL6A+VQzh0A5kJ/dAsg0e4WDZecfM93VAVFG/TpUfkf1XL6bWQ//lBwIkhgWgtm5RBIFQC88nMWCxPlUE4iACW6pkkLJPO3RJofBYJiMgsr1enfui0x2lhVC32z8bJh+3FClw/6fQ82Gbwlq630HQtdvokDmJ4ISjMCCxwlE2ILAK4/4VYLUbm1cIHqudHSJvpvEA1IyyifKyBt+mP27ghM+WgA9n8LGBBNSMsoeR0GQvp9p4eNZxhlAdJkCwHR7hYNl/bzmg5UIiXTCggAZ1a0Agt90e4WDZdryMYkVCmFgJ3pUcb9CWr6EeX+2se/JiZiLfpXDzYZryW9Yfw9C2vR7hYNl3SFcGdUGhCIAsso1LOEP/oSZD/+UXDRTj5GCyPFQjrpUXa/7Xv6FfP3S5Yfee7vAAtXUPFayCh/iPJJ+iXQQvrIKEn1PF76AhANkMgoMEDdAPp3p4eNZxgDIrBmC33RrhYNl1xmClFUTGQ//mBwQAvsPwsxkPFayChwrgwd+jLQ8VrIKO7eaXr6Eb5Jg5uei+N6WAt00IKEyCggly5z+nEQDbDIKCSnhm/6fqeHjWcY/4vlEws70a4WDZd0cGUIVFJkP/57cNz8oyMLbSWTiQ8Aq0yKUgseJZNMGADadrYBC0/QQl3LKFvPGQD6N6cH7WcYiiANWQtc0a4WDZfIiXQfVCGQtwvLKBy6TCj6ciUTTBIA+uR+KgsvxcI46VHqYt0G+nHQggvLKOGcTCv6NqdHjGcYeJbIfQsN0e4WDZcnPZwXVDTz90uWHxkhukoLB9GuFg2XjhhDIlQPRYSq6VF2zg9o+koPNhmvJeECCBILIlDxTsgonLmZevoukHFayCiVmpNT+njQsXHIKJMKISv6MhBwWsgo+gxMSvpwvkkDm57W9D4xC2Ylk4kSAJwQTFkLHdHuFg2XljlxclQ25b1cxr9C+X1M+gBkP35icA9ehUYLP8XCOOlRfRMcePoh8/dLlh+2jE0QC1LR7hYNlz1QglRUFhD2tsgoK6dTVvoeZD/+Y3C69xZUC3pQcVrIKCg5HS36cJCxRcgo46/0TvoO0EICyyilxL5K+nynR4xnGL3kLScLedHuFg2Xv8s+H1Qx0HFayChUxJUE+lTR7hYNl+7QrSdUOiU9r8a/bczYBPoXZD/+YHAQct8zC3kPNhmvJdtR50ELFBDwQcgo1RKlOvohvkkDm55fTWZJCyglk4kQAJn+3FILcMWCJulR/D5VEvoo87dClh87CRBaCz3R7hYNl4WWbCJUDEUHtelRzVUiXvpPUA0byyhhgG5D+kHzN1qWHzKAExcLSyWTCRYAwlLkUgt10IJJyyh0YIUP+lIQzUnLKAxlHWH6FPbuCEz56RM6OwsjEA1Jyygn3T16+lWnh41nGMPidE0LPNGuFg2XHgiZYlRcRQD16VFdb0pc+kAlE+IXAOxX7j8LC7m1HYjqjNbHJvomEE1JyyjZDzc7+lorOR6DIBl/fGoLfhCNdssoZ1eqH/piKzkegyDEEFIPC3cQzXbLKJO/gXb6V6eHjWcY9WJSdwtD0e4WDZcx5qwAVGjQSLTIKPzSFCf6TFBPIcsodHuBBPpnxUI66VG1gslA+jTz90uWH0/iBW0LL6cHGF8YonfedQs80e4WDZeoJ9daVB1Q8VrIKEcYglr6RtHuFg2X/NmkMFQeZfeCxr9MSsoP+jiF25LpUV76SBr6cA82Ga8lUPIAEAt40a4WDZdn/CILVBAQi5HIKDhBGTP6fpDxWsgoAqZ0BfpD0AIbyyiIPvYs+iKnR4xnGGhGOl4LCdHuFg2XqQMVPFR50PFayChwrkU1+hDRrhYNl16gjjtUWOXzPsa/sM5sSvpyDzYZryVa1645Cwu+SYObnjf4w2QLLbn1HIjqqLIKJPoCEA12yygRk6EH+kkrOR6DIP2gAUcLWBBNdssoaeQqSPo/p4eNZxgkAX8pCxDR7hYNl5Z9plhULiWTiRQA89kkQQtz0a4WDZf9OMg0VEHFm03pUZfwKi/6KQ82Ga8l9cFuAgtTJRNIFQA0T45eC1Hzt8SbH7cbOWELYNVpwbotqGbMEAsgszGyYfucmYNi+je+iQOYnkpgy20LKNGuFg2XLe+vNlQEhZoh6FGw6n0T+l1lk2MLAHrTmGwLMGXTCggAoiZYdws8xUI66VHx95F8+lTz90uWHwjKHVoLH1DxWsgoHOYtYPor0IJ3yyihGksh+gYQzXfLKA+/3U76R/buCEz5uaREIwsIEA13yyhbT/1C+hCnh41nGGdNYwkLEdHuFg2XR5olT1RSxUU86FFOHCMh+ieQNQLLKAOVczj6JpDxWsgo++vrdfoQ0PFayCiv005R+gG+SYObnnswnlkLVGWTiQ8AZAVVGwtjZZNMGADWIUUHCwRlE0wSAF6id0oLcsXCOOlRblHgLPot8/dLlh8n/3d5Cz+5NRyI6kpa/HD6NRBNd8sobmVFP/oKKzkegyDpgcRRCxoQjXTLKNzHeBT6ZfbuCEz5D2sjZQsmEM10yyiMlct6+gKnh41nGKN4SQ4LGdHuFg2X5OyZD1RQUPFOyChTFcED+lbR7hYNl/PMml5USWQ//mVwvj7RTQte5fG9x7+EsyhS+kwPNhmvJfe4HWsLa9AC/sgoN4lrQPofp0eMZxhQYyU+C1DR7hYNl4s8XGNUW5BxWsgo3y+2F/oP0e4WDZf1F+RhVGsFh4TpUZKty2f6LmQ/fnpwGt6aVAtbDzYZryX3r/R7C2zQMXHIKKnbOhz6MxBwWsgoFQWsWfoZvkkDm55lTmxVC23QAnTLKOZCcXT6ehBNdMso7TA1b/pWKzkegyARPE1PCy8QjXXLKAf+nHH6EqeHjWcYMoRJYwty0e4WDZdU7zsfVGZlk4kSAFdlZ1oLddHuFg2XS/cIJ1QV5bEHxr+nJBdD+h8FAJDpUcmLmWr6fg82Ga8lREnUNwsjubVwgeoOZnto+lUQzXXLKNO5lwH6Ays5HoMgPKK7TQthEA11yyi6w5RC+h4rOR6DIOh6J3MLUhBNdcsooam7FfpSKzkegyAHMsgqC0MQjXLLKCzY0WD6DKeHjWcYUAguDAtn0a4WDZd5XxoeVE9kP35jcGRgZwgLdcXCOOlRY/3dDvpt8/dLlh8VmLEACwZQcVrIKMiBF0X6B5CxRcgooKoTcPo60HFayCjxvWsu+lYQ8EHIKFd3uDX6UL5JA5uerii1EQsZ0MJByyit/xVV+ksQjdbIKLYKDGL6D6eHjWcYLPeXTwtE0a4WDZeGakp/VE0Q9ZnIKEHg4FD6B2WTiRAA5iB3SgtjxYIm6VHIiUo0+ja5tXCB6ttIIhP6AhDNcssoqLt3YPpo9u4ITPnpp4EbC3MQDXLLKDgryUb6Eys5HoMgcjfQAgtHEE1yyyjiQ5kc+jsrOR6DIJs56i4LOBCNc8soS7GsI/o+p4eNZxhEUSYdC1rRrhYNl+WrPzJUR2Q//lNwXYOYNwtA87dClh81eOIFCw7QQrrIKOJlHwD6RKdHjGcYm10PdgtB0e4WDZf2cx0dVHnzN1qWHyM8PjwLYtGuFg2X6+/TUlQ5JfBGxr8Pazkn+isPNhmvJZp3YnYLTbm1cIHqsJIGNfoeEM1zyygZ3cRS+kH27ghM+Rg1+0gLGxANc8soevRSc/oUKzkegyBbZmEVC0YQTXPLKMzOdin6EaeHjWcYd0tiagtw0e4WDZfSdtQwVG1kP/5ucD4e0H4LUqV3C8a/qJDIfPpSZZMJFgBThv1nC1fQQnXLKE9AEn36BadHjGcYpPF7dgsJ0e4WDZcPCcgKVDplk+MXABpaomgLddHuFg2X71uSEVR35bVHxr/C/n5I+k9QSFHLKL1kOSX6Ew82Ga8lwPJ+dAt20EKsyCisZmd3+mqnR4xnGKEy2xoLa9HuFg2XElq6LlQvxUI66VF/rkMY+gvR7hYNl+Gvxg5UTGX1E8a/PuguMfplJfAtxr/F6to6+lQPNhmvJWok+C4LJPP3S5YfzQSeZQtd0ELkyChySoEh+k0QTXLLKG2oAEv6P6eHjWcYdbw9EAs40e4WDZcLU38rVCBkP35hcJlH7DQLMWQ//mVwIWuASQsaUPFayCi7xP1K+h2Q8VrIKCzHh3j6CNDxWsgoaEZYW/oRvkmDm57rYW43C3tlk4kUAGmNqygLTdCCcMsobf/KbPprEM1wyyg3jOB6+j4rOR6DIJP8ZgkLAhANcMso0UVkOvo9KzkegyDN1/NICyQQTXDLKFTB7Gn6R/buCEz5sNYqcgsmEI1xyyjdQBsr+jinh41nGDv2nloLYtHuFg2XsGV+QFQOZD9+f3B5cqR6C2ZlO1XGv/CenUH6c2UTSBUA700JAQsU87dEmx/QbkVtCzLVacG6LZB3IXkLHbNxsmH7IoGqbPppvokDmJ7LHfU0C1OlE2MLAL4v62ALX6XTCggAx2xzRAtR0ILpyCgWE1Yv+igQzcfIKPLvvWX6d6eHjWcYxvqWaAsl0e4WDZcAxOowVAPFRpXpUf5+/Sr6UeXz38a/FvSYXfojxUI66VG850w3+lXQwnHLKOdngTv6GhANccsowhPdUvoGKzkegyCiSMApCwYQTXHLKHWotz36daeHjWcYTLWPFQsI0e4WDZdkJvdDVCvz90uWH5GauzcLANGuFg2XvZujElQehV706VHVk91F+ksPNhmvJeUAoHMLCVDxWsgo4Q/IMvoX0a4WDZdbNNooVAKFmDboUSPhIX76HJDxWsgoi2YEQ/p90PFayCiQEwlp+hu+SYObnrrBjVQLVdAC3cgotV6/ZfoXp0eMZxhOzxwuCxrR7hYNl3OwIgFUWqWTiQ8AOHjiNQs90e4WDZebHcUTVDmFHqrpUaJ5GhP6XWV8Kca/P4PcM/o8DzYZryXbtF5tCzClk0wYAHVvwXALDNGuFg2Xw2/hC1QSJX1vxr/V16Qv+i6lE0wSABIviCILI9GuFg2XvzQ5cVRQpfVOxr9fQvAH+g3FwjjpUSD77EP6QPP3S5Yfc1ZXDAt60II8yyhFzq8z+m4Qzf/IKKUyKEb6IKeHjWcY0LoxUgt30a4WDZcIYggdVGtkP/5icMoHlhULNlCxfsgojxJddfp4kHFayCggvbkE+kunR8v9GJZF9E4LQdHuFg2Xp5okL1QS0PF+yChG0+IM+lzR7hYNl3X7pA9UQtC3sMgoAMc3Jvo3xYIW6FEcE9J0+goPNhmvJfB/qCkLMRBwWsgo3MnoUvoovkkDm576D5V5C1Olk4kSAJ9Sni0LGdCCxMgorZHQKfpFp0eMZxjFNod2C0zR7hYNlxB/al5UeMXCOOlRegrKb/og0e4WDZdJbIp8VHlQTrDIKAGlzTj6KYUN5elRBXTzHvolDzYZryVWBRgBC0bz90uWH3deGF4LMbm1cIHqc5IwM/owEI1+yyieTmRq+nH27ghM+Y7A4kcLDhDNfssoRUWPK/pHp4eNZxgcZxlOC2vR7hYNl729GxhUbIVbm+lRz+WIPPohEAxxyygvFDRL+mtQcVrIKLtCiSH6CZCxRcgo8kDrSvpi0AJ+yyiZrf0z+hMQTX7LKJKcbGz6bis5HoMgXOHiRQssEI1/yygiAsd++ksrOR6DICMqfGsLAxDNf8soMGD+L/oMp4eNZxihII1KC0jR7hYNl24lgSBUfdBxWsgo7+CsLvo40a4WDZchO999VGclcknGvzQXbiH6Fg82Ga8lTCHmKgsD0AJ/yyhsKsEI+g8QTX/LKDv8/Tz6Fys5HoMgE7SBXgszEI18yyicHVYE+ncrOR6DILOJknsLexDNfMso3CCHffofKzkegyDSErRDC3sQDXzLKEKfXyv6G6eHjWcYXonMDwtg0e4WDZeD8kVcVEpQ9M/IKFGc8zv6C2Q/fmxwD2hjIgt0EPBByChANSoB+k2+SQObnqKs+zwLaKWTiRAAxA5TCwtiuXUciOr5JrlA+h0QTXzLKJAp/Wj6aPbuCEz53+gGZgs2EI19yyi56LJv+mf27ghM+cWWmmwLOBDNfcso/AFzf/o4p4eNZxiCddgQC07R7hYNl6cgiUpUAQVNt+lRZ5DJOfozBdlm6VHMcS4N+mLFgibpUeYhJ1j6QPO3QpYf5W9iOgtg0AJ9yyinceRH+n0QTX3LKIl7Nm36SCs5HoMgExX4FQsQEI16yyjQOU92+hv27ghM+auskmwLGBDNessoUPk3O/pg9u4ITPkFHlA2C1sQDXrLKHNSlRX6daeHjWcY3/J+Kwso0e4WDZelY9hzVCTzN1qWH4ZF3UoLA9HuFg2XBEnYelRTUAt0yyijg+8p+n8lsYvGv47g7BP6CQ82Ga8l4L/MWwsopZMJFgDHc9AKC3+lE+MXAErb8mILCLm1cIHq8hywIPpoEE16yyg5ghJJ+icrOR6DILyirFELWxCNe8so3wniQfpkp4eNZxgU+IVLC3jRrhYNlwcHZBNUatAIkcgo0r/jSvpexUI66VEpU3sd+hinx4VWGKlsLjcLL9HuFg2XIrkiTVQW8/dLlh9ClLgVC0TR7hYNl+AiOAJUGWQ//mpwTdSVHgsWpfXXxr+PYt58+mwPNhmvJQ4sjj8LQ7m1cIHqP4DKDfo7EM17yyhh+j59+i327ghM+UZnbzoLLBANe8soRR8ELPoEKzkegyDRLntWCxgQTXvLKPOkMmL6ZqeHjWcYfP9UOAsC0e4WDZewYGNAVD9Q8VrIKJWXEjX6NdGuFg2X3LNvbFRDZD/+ZHCRQndxC1oPNhmvJQ5RmzILTJDxWsgohbuucvpc0IJ4yygaWr5m+i8QzXjLKHy8lwj6O/buCEz5F/HwXgtVEA14yyj/6Ykk+gf27ghM+TwBc2oLVxBNeMsomFAYbfoc9u4ITPnopDokC3AQjXnLKAexE2z6MqeHjWcYhiGEWQs10e4WDZceHBs0VC7Q8VrIKJp6tAv6f9GuFg2XIbMLWVRe0M0RyygVJu9g+kcPNhmvJe1+9H8Le75Jg5ue3rp1Ugsy0IJzyygRnt4I+jAQTc7IKLcSOjv6XaeHjWcYXXvgRQt80a4WDZeZpbl7VBqFxlvpUeYeGDn6DKWTiRQAeUU7Qgsw0a4WDZdMxicYVGhkP/5RcA/of1ILGKUTSBUAdy8IEQt787fEmB+LPqFXCz7V6d+6LegBTQELfbOxs2H7Gv6JGPpDvokDmJ5BKPJQC2e5NR2I6kW7l1b6KRDNecso+767WvoXKzkegyAmWIlVCygQDXnLKMU/IzX6N/buCEz51nkLTws8EE15yyjd3sBh+kYrOR6DIFMC/CoLbxCNZsso+WQjN/o+p4eNZxg9igF8CyfR7hYNl08fuGxUWuXTYAsACpV1Zwtw0a4WDZeVs30MVEjl/trGv7lekzb6BA82Ga8l7/03JAsT0IJZyyjoWqwx+gunB+5nGA/iDxgLd9HuFg2XKZzWDFReZD/+bHCY9cglC1JldzrGv8SKFED6IeXTCggAuHUrNwsZ0MJmyygSxZh7+mAQDWbLKPLObRn6FvbuCEz5IsdWNgtKEE1myyjYM5dQ+mcrOR6DIAXTdgcLQhCNZ8sorB2AAfpxKzkegyBsNwNXC3UQzWfLKLhpq3/6ZqeHjWcYQm0cHQsR0e4WDZctBMJgVFHFQjrpUZWveAT6IdHuFg2XhEnNBVRDZD/+a3Bgjm4kC2pF2CnoUVREmzn6TA82Ga8lkQrqSQtlp8fmGBgBTZ9+C1rR7hYNl4bYOnBUU/P3S5YfrrBfXwsG0e4WDZdmmyRXVHZkP35hcPO4gBILa0VF2OlR6RTKM/o8DzYZryXbr2QMC2/QAmfLKHvY3An6JhBNZ8sojoR7IPoWKzkegyDgEhRfCz8QjWTLKIAXAzX6Lis5HoMg0bcAQQtmEM1kyyhg6BEV+lorOR6DIFvY4FoLVRANZMsoP+mScfpMp4eNZxilCvsQCwTR7hYNl9AzBB5UIlDxWsgoH935Q/on0a4WDZdU1+gAVAMFhUboUdEBmhb6eA82Ga8lhrXgDgsmkPFayCjyhWN/+nTQ8VrIKHv6XR36SL5Jg5ueCg3jFAsW5ZOJDwA0q9E5C325tXCB6lSexkn6IhBNZMso2HIobfoK9u4ITPm2yAAwC1AQjWXLKG0WPhn6Cis5HoMg+p4bPgsFEM1lyyjPmuYr+gH27ghM+bVS6QQLRhANZcsoGgUCW/ovp4eNZxi9i0UeC2nR7hYNl6dTGStUYuWTTBgA4FoDJgsc0e4WDZfY50IAVGZkP355cCXv4jALDgXbIulR68XMLvpMDzYZryXYa6VIC0zQAsbIKCP7bUX6RBANEcsoDqDtG/p0p4eNZxjrBU4CC27RrhYNl0Y7MhdUE9CP4cgoFypycvpz5RNMEgAAOQMOC3bFwjjpURcRukX6EfP3S5Yfvlv9TAsNUHF+yCiY3rYh+jjQQmXLKFPvwhn6bRCNYssoSmTpKfoqKzkegyAVxaBrC1cQzWLLKEsBf1f6LaeHjWcY03J7IgsG0e4WDZfAdkNZVCHFQDPpUTg7oiH6TZCLVcsoWgaSQfpxkHFayChdraA/+mfRrhYNlxWwd2VUEMWYd+lRyA4eRPps0LF/yCiEKz0Y+goQcFrIKPSSf3f6N75JA5ueDVCYVAsvubVwgepkw+tW+m4QDWLLKJTAMhn6I/buCEz5mgesbAt1EE1iyygQ1Hgy+lorOR6DIA6U+SILGhCNY8soiPqFWPpEp4eNZxjIi5EcC1XR7hYNlyY9wUtUEGQ/fm1wKVeaOgtQ0M+DyCjDoOhR+kHlk4kSAMZeHzULVLm1HYjq8qvqUfplEM1jyyhMtQMo+hArOR6DIHZi2XQLLBANY8soLGixVfofp4eNZxgIvXEzCzTR7hYNlxnSnQJUKMXCOOlRcwY1Vvoz0a4WDZfxlcVtVDXlPtfHv+ja8TT6Kw82Ga8l+X6JGgtm8/dLlh+TEj9OCyVQcVrIKKjgOQ/6INBCY8so2DlHdPpuEI1gyyj6FwQh+ggrOR6DIKlmzU8LJhDNYMso59alZfoTp4eNZxj4ljJ6CwLRrhYNl5XizBxUM2Q/fn5wdtRjewtbkLFFyCg18vsA+gXQAmDLKPtvBQX6AxBNYMsoHe4KZ/ok9u4ITPnOqxlCC3QQjWHLKJ41+H76F/buCEz5zk50IgsEEM1hyyisbOIb+iYrOR6DIP1mdyYLThANYcso4ldCBvosp4eNZxjlnwNWCwfRrhYNlx7flhxUBcVeVuhROIL5C/pN0HFayCjNP7RP+gzRrhYNl4J2bE5Ub6W8Pca/k3T6LfpTEPBByCi2AfcW+jm+SQObnoYYeDoLWdCC58goV/TQKvoVp0eMZxg3vtVhC0rR7hYNlxkUGT5UauWTiRAAX4amXgt/0a4WDZcWnfhvVAlFWSbpUfX3jmX6Sw82Ga8ltN7ICgs/0e4WDZcZAyBtVCuQsXLIKAwBKHz6cCU8mca/IKDxXfp0xYIm6VGFDzc/+nu5tXCB6qW3gXn6NxBNYcsoya3DM/paKzkegyCbNgdWC1MQjW7LKKgLakb6K6eHjWcYJVcGAQto0a4WDZelUUZKVEJl+63Hv9/FSnv6EfO3QpYfW3JubAs78zdalh+hla1uC2vlkwkWAL78nCgLHOXT4BcAqvLvFQsC0AIvyyhyKR9o+gQQTVHLKPSS/QH6DqeHjWcY6GTmAQsC0e4WDZd3rKJXVCZkP35/cMq13lsLRmQ/fmxwv9zsGQsvxUI66VF1jYwb+irz90uWHzN3AxcLY9DCbsso7vy+FPoLEA1uyyj0rXg5+kQrOR6DIPpnAAgLfBBNbsso2KrIAPpIKzkegyDQVj9EC1sQjW/LKAn0fz/6QKeHjWcYOKNYAQty0a4WDZeaVINLVCKQdILIKMlvI2X6dlDxWsgoHyU4T/ovkPFayCiB6UZY+kfQ8VrIKOTeLFH6RL5Jg5ueotuKUwta0MJvyygYQ8UM+gMQDW/LKKij0Sj6S/buCEz5bJTcdQtBEE1vyyiyu3ck+gorOR6DIG1vflYLHRCNbMsojHc7Y/pRp4eNZxgeW/J6C2vRrhYNl3iY3ANUOcVY6+lRAQOjSvom5ZOJFAAkGoxCCxblE0gVAKQlmCULafO3RJgfknLUegt31WnBui0ZIppKCySz8bNh+4VKRlv6Z76JA5ieIq6NCwtNJZJhCwCuY2Y6C3XQwmzLKFk5QHH6LRANbMso+rslcPp8KzkegyCkujgfC3gQTWzLKMpM2mX6faeHjWcYdRI1HAt20a4WDZdXxDUcVC6FhjToUXdyRz/6EyXSCggAbZmcewtkxUI66VEB0kEr+h7QgrXIKMfZgXz6KqdHjGcYVuPRAQs80e4WDZekaH00VCPz90uWH+UXGgkLMdHuFg2X4xHzAFRQUPHkyCgwuKlm+jyFQ+fpUdtPS3/6CA82Ga8lfFajYgtu0IJtyyhTpORf+k0QzW3LKGRuDnv6Bys5HoMgA3q6GgtREA1tyyjlNlVA+kQrOR6DINrLwHoLLxBNbcsorr30TPpMKzkegyBDgCI4CzYQjWrLKHr/YCn6d6eHjWcYuDqjPAtt0e4WDZdcRhhRVA9Q8VrIKCPNSHP6NNHuFg2XDHFteVRMJXJixr96CMBz+m2QygHLKPAQv3f6FA82Ga8lIjnmFgtf0AKQyChdVTR3+hOnR4xnGPJD1ksLUdHuFg2XyO0ZNFQukPFayChajPVo+iTRrhYNl9c6mQNUKuX7hsa/TiSoavo8DzYZryV3MdRBCwXQ8VrIKGMDplb6PL5Jg5ueqTBFeQtKuTUciOoK/H0n+m8QzWrLKD9073/6EvbuCEz57AjMNwtTEA1qyyju+dd6+iunh41nGGAQmlMLLtHuFg2XnW9CE1QsUA3NyCg8zzFa+isFwHvpUa/vFS76GyWSiQ8ADCvkNws5JZJMGAAxlIQAC2YlEkwSADWigQILesXCOOlRa8NMDvoY0IL6yChwvqBp+ianR4xnGCvkwCQLNtHuFg2XjwrXclR08/dLlh+E9+R1CzfR7hYNlwzZi3RULdDIIssoO1V9bfonxYPh6VE877Jf+mUPNhmvJSFshVsLeNCCNMsodbFOVvoIp0eMZxifB/taCzrR7hYNl0zq/BBUVlAxf8goXSpfUPo/0a4WDZfVyr8OVCZQSMzIKC29gE36HQ82Ga8lkKs6PAsSufUdiOqw39VH+iwQTWrLKP+kGmH6Zys5HoMgI5hwKAsREI1ryyjXaXku+kSnh41nGLxdYjgLX9GuFg2X93ueOFRckMuVyCg/l104+iyQcVrIKGOQ3D36BtBCwsgoIXlrO/pSEI3kyCh+3B1e+genh41nGGkjrRALedGuFg2X2t/QH1RTZT+Sxr+D9mYH+hLQcX/IKGQiKFb6ZdGuFg2XykezJ1RMEHQ8yyily4cm+lgQcFrIKCgdxnr6Yr5JA5ueWq+RZQtA0MJryyi3K2RG+ngQDWvLKKZmsjz6Sis5HoMgGIwiSgsREE1ryyi/J35Q+nv27ghM+eec0wELNBCNaMsoSzNSHvojp4eNZxhMrnEBCwjR7hYNl/dPSmtUeiWSiRIARN7kPgs00e4WDZdiOJwBVE7F2VjoUbY04Qz6DUWHmelR7ZwkYPoVDzYZryXFmRw7C0klkm5IAIWfsRwLbNDCaMso6LsJOfpfEA1oyyi6iXth+lYrOR6DINaQOEcLfRBNaMsoQPMyQPpDp4eNZxicxQ4WCxPRrhYNlygSxj1UfsUBi+lR+fQiKfokxcI46VGlDQdS+lLz90uWH5rAnnQLMlBxWsgoL/cAZPofkLFFyCh+8dZg+ivQcVrIKH1e/Rn6RhDwQcgo30SmYPoXvkkDm571C+ozCzklkokQAN6+AhgLJ8WCJulRMhYkD/oB0e4WDZegKjh1VGRlu7PGvynEX0L6IpC1Cssorbk/U/pI87dClh9VWVxcCwS5tXCB6py49Uf6KBCNacsoTsuwZPorKzkegyAm+4t2CwIQzWnLKP7NESX6aCs5HoMgzew4OwsNEA1pyyii4+Ag+ginh41nGCvNBWULfdHuFg2XxypqC1QN8zdalh+44L5FCxvR7hYNlx3VdHVUL2Uxica/wkMnSfoH0MwEyyh3XkEr+m4PNhmvJVUWuQQLPCWSCRYAoi6LCQtEJZLhFwCemwdiCy/FQjrpUWz5a3/6LPP3S5Yf4t42VgtfubVwgepQ45RX+jgQTWnLKGtvF0f6bvbuCEz5shToTwtdEI2WyyhkHkty+kunh41nGHZE630LCtHuFg2Xx95RBlQGBYBi6VGR+hUc+ngQt+LIKLLg0lj6NVDxWsgo+HxYXPo40MKWyygvRMJS+iwQDZbLKNEaOTv6QPbuCEz5KtTEfAt1EE2Wyyhom04m+jmnh41nGHywTXkLYNGuFg2XTzlyBlQLJTzJxr9m8AwO+nSQ8VrIKKqCUjL6BdDxWsgoRyCSJfpSvkmDm57CESpGC1bRrhYNly5lH0tUF2Q//mVwDoaQPQt9JZKJFACFfSMJCyAlEkgVAGskimgLftHuFg2X2k+UIFQR5f3fx7/MCBNs+iyFAELoUfsyl1P6R/O3xJkfHWOlWQsp1WnBui3KfWckCxazMbNh+7HqCzz6Ub6JA5ieVxGnSAsWubUciOpDtX9k+hIQjZfLKLj9/UT6cvbuCEz5pOR8fAsREM2Xyyj6MUhU+hb27ghM+cEGf1ILBhANl8soODH0bvoFKzkegyCd2hhtCzsQTZfLKNMu8G76PaeHjWcYG3nDNwtc0a4WDZewo0oNVCjls9vGv+FgTRn6Z2XSbgsAsdsYdAtZ0IKUyyjdCbI3+kYQzZTLKDfZ0xr6CPbuCEz5xbb9YAsOEA2Uyyg5gY0W+nQrOR6DIKEiIg4LNRBNlMsoGbonM/orp4eNZxgCD7k4CxbR7hYNl8ekOiRUVmVSBQgAtS/WKQsJ0a4WDZfXAPs+VGUF2C/pUWon9T36Tg82Ga8lAt8aWgseZVJODwAs+8U6C2bQgpXLKJRz6l76XxDNlcsonwP4Q/og9u4ITPkVA7l8C3wQDZXLKDReBh76a6eHjWcYwP3vOgs10a4WDZc6yQR3VEtkP358cDsPszULQ8VCOulRjvOrb/p68/dLlh9eJm13CzenBwEsGLka8wcLQ9GuFg2XFP/IBFQhkEkAyyj3pdI3+jZQ8VrIKAIKWn76D9BCkcgoDKjYKPoOp0eMZxhBuZMbC2nR7hYNl8JXvmxUfJAxWsgofV3WTfp60a4WDZcCwPkvVDbQT97IKNNm7zD6bQ82Ga8lIf5fOAs20HFayCj07WoN+k2+SYObniZ4kVsLbtACyMgovrisX/peEI1VyyidejBU+nunh41nGHWgLXYLQ9HuFg2XnMOaVlQiZD/+aHCSc5cWC3dkP35ucJ9wHGILPWWSiQ8A+/krKAsN0ILpyCiczRwi+m2nR4xnGFNk01MLD9HuFg2Xy2PhT1RRZRJMEgAcVuVIC3rRrhYNl9J71X1UO+V90Me/KBOhE/o5DzYZryXyXx1JCwnQQpXLKETbn3/6URCNkssot/QTNvo3KzkegyANi7BFC0kQzZLLKPdo7Fb6IKeHjWcYalw5Owst0e4WDZc3pxEYVFfFwjjpUUVcDxP6StHuFg2XWdexZVRWZD/+bHBy1vsXC3KlN9rHv0vnYg76Iw82Ga8lZX2OSwtL8/dLlh9lSahiC33QgkjLKCmOYn36CqdHjGcYy6CxJQtk0e4WDZeR2lRgVBhQcVvIKIQav2f6PdHuFg2XsQDLelRMZD/+a3BXKnsiC0Ul8AbGv8kjM0H6Kg82Ga8lUuX3dwte0MJAyyjxeHI2+gGnR/NnGKPPFTILJtGuFg2XT2+1d1R4ZD9+aXCZgTY+C36QcVrIKPWmCRX6J9BxfMgot/GeI/oh0IISyyj9Kroq+iWnB+5nGPddMz4LNNGuFg2XmSPPblQ40M3pyCj0fiI6+jsQcFrIKEQOiiP6cb5JA5ueDNnaPwsi0EK8yCjaX7lF+lsQDR7LKOpX4Fz6RqeHjWcYzycoKAsg0e4WDZczIVwVVG1kP/54cE5qWXoLL0UB5elR+AsebfpJZZKJEgBwAvsYCzzFwjjpUR1o7gX6BfP3S5YfrhgVTAsnUHFayCh6k+dP+jmnx8n+GLzA9nQLRtHuFg2XMGNWElRVkDFYyChIiqUO+m3RrhYNl/jiUFZUCMWCd+lRjOR0cPo8DzYZryWnPGY7C0TQcVrIKPFAEkL6D9BCbcsoGYqhYPocEE3OyChEs1Ub+ninh41nGCbcGVYLdNGuFg2XoxXqEVQ2ZTEGxr83WfYm+nsQcFjIKA/Pbjj6dL5JA5uewQaUGwsyZZKJEAAttYEyCzTQwsbIKBbYT2/6fKdHjGcYDZsTIgsG0e4WDZc56awtVH+l0m4LANm1qkgLB9HuFg2XvemQN1Q6kLUgyyjO7UBK+gxQNx/LKGOO73z6PQ82Ga8lt18MdAsopRIICAB2Io8HCwm5NR2I6lfVq1v6aRANkssots/WafpU9u4ITPmuwFVRC1sQTZLLKBiOJCf6Pis5HoMgx/14HwsXEI2TyyiaVs8c+horOR6DIGQaWFILIxDNk8soUVFBVvo7p4eNZxh2HENNCz/R7hYNl1yvYyJUO2U/gsa/czzFYfphZD9+ZnBsoAlUCxPFQjrpUdYjb0D6G/P3S5YfX+g2KgsF0IKnyChi8Eo5+mmnR4xnGOYuOwcLD9HuFg2XGdgCbVQSUPFayCjQ7tVW+knR7hYNl0IsH0tUG4VYOelRwLDEKvpGBUF+6VE4p6df+m4PNhmvJRQL0V8LMZAxWsgoptvSavod0HFayChE7ONn+ia+SYObnmLJVzYLQbm1cIHqSlmDcPo0EA2TyygzEkMG+kwrOR6DIE+gwycLehBNk8soanEwFfpWp4eNZxhE56UTCzXR7hYNl+3UODFUIWQ/fn9wlFFxBQs2xcF66VGspdMP+g2lkokPAJ63EC0LQKdH2GwY/y/5TAsM0a4WDZdQvF9wVDIFxHbpUXgahxT6W6USTBIAZ2SeWwtyxcI46VEpdoYB+iLQwqjIKFyl4Cj6IhBNOcsoOOn5M/oDp4eNZxiMMflOC3fRrhYNlyqKrHhUUpDJecgoTfuECfog8/dLlh+uiUdqC1xQcVrIKOwxFzT6dNGuFg2XuOWUB1R1BVj76VHTCGsV+j2QMVjIKK5Vf2n6KdBxWsgomzvIIfpdubVwgepmomxw+icQjZDLKP6eeFn6KSs5HoMgf+kQUQs+EM2QyygHejkg+iqnh41nGG2yqnALNNHuFg2X8N3NeFRyEHBYyChXqUIt+nDR7hYNl/kBfgFULWQ//lFwnGHaUgsNBU0E6FEmkJw9+j0PNhmvJc1NggMLDL5JA5uet2YFVgtw0a4WDZcOfOJYVHtkP35TcMJpcyoLH6WSiRAAyMhURgsdpwdkVRiCP1UJC1fR7hYNl4qDpQBUSwWZNuhRaieFMvoMZXbQx79iekwq+iXFgibpURJhySb6OtACB8soXyBBMvpfEM1lyyjWDg8w+jWnh41nGMW8s2MLQdHuFg2XNzS5R1QWhURF6FGVw85z+meFDSTpUXKy+Wr6W/O3QpYfnGDrawtk8zdClh+/RElaC2SlkgkWACaVkVELadHuFg2XWJ97UFRVEM1EyCgOoAcU+gDlNNrHv853LmT6UqXS7hcAnMuZKwsg0EIEyyi6Lh1y+mIQDSzLKAj2Lj76daeHjWcYKkEnAwst0e4WDZfvpc1mVAOl8ibGv+bqFwv6JMUHkulRg+dHXPogxUI66VGD2MMM+hfR7hYNl4qqqjNUEwXNTulRU5FrK/peZD/+eHDlndAyCy3z90uWH8gkE2wLHFDxWsgoD87LcPpOkPFayCgzWNE6+kG59R2I6sx2H1X6URANkMsoTOApJvox9u4ITPnmQtN6C10QTZDLKPSyvgn6QvbuCEz57FA3TwtlEI2Ryyg80rFY+n727ghM+RwM0GQLPRDNkcsovKgadfpop4eNZxhvRVdZCzXR7hYNl4nEzQdUMGU81ca/MjE9XPo4ZXu7x78zYAIi+gDQ8VrIKMqTk1X6Bb5Jg5ueMMQPIAt+pZKJFADCM7w0C1WnR78ZGHfIYXELb9GuFg2Xa7xJOlRB5XyGxr+q1B9Y+hWlEkgVAH8vQV0LWfO3xJYfMFCtKQt/1WnBui0zNe4WC0mzcbNh+3qrVkj6Tg82GbwlQM/gOgssDzaZoSVkb415C3UPNpmsJRhIUjgLAw82maUlxA3fQgs7vokDmJ7UtqFGCwnRrhYNl3k/DmVUHBCNXssoIfYZL/olxYI96VF2Z65b+nXVKeu6LZDoHj0LC5DxfcgoeDAoDvp5vkkDmJ431Sl0C2jVqeu6LYvyaUQLIpBxfcgoUJKaZfpfJTR6hVtRIT8LC3/QgoLIKHhhGwz6CBANscgozHf2GfoSp4eNZxh295ZwC1PR7hYNl1AvlEVUKGQ/fmBw6IxDDAsqJf/Ixr+uktpF+jGlnWxMAMLNBxMLNqXd7BcA1sMdKQswufUdiOoDkc1c+jsQDZHLKHlZl2b6N/buCEz5LYgnfgs0EE2RyygyUvpB+gunh41nGNBDtzsLT9HuFg2Xojf1WVRRpV3sTQDQ701oC1bRrhYNl5mkew9UWJBMbcgoprJTePpDDzYZryXvuucuCz2+iYObnmcz9m8LUsWCPelRZNyaK/pb1Snrui1qsiBgCzKQ8X3IKLG5vmj6Er5JA5iefkW3RQtc1anrui2jp0hmCz3Qgp7LKLuT1D/6FBDNnssom6omRvopKzkegyCn/9F4C1MQDZ7LKJ3NWQH6V/buCEz5kze6RgsOEE2eyygZeaZW+iGnh41nGLUb7nkLc9HuFg2XncGNQFQ1kHF9yCit6H0b+mzR7hYNlyOt1ThUT6Xw/ce/IfF2B/pr0IJYyyjP3WZA+goPNhmvJWskUxALCyU0eoVbWZtrVwtLpZ1tTADkT+xLCy+l3e0XAIcXpUULXqVd7E0AcI69aAscvomDm57z4xkSC1QzsbBh+yqJchD6ZdBCGssoTu8WYPokEM3QyChc6gNC+lenh41nGHr1MncLYdGuFg2XdQkKfFQKZD/+e3ASh0hhC2zl+8bHv2r0RHL6M7m1cIHqnHKndvpYEI2fyyiKIykk+hYrOR6DIAY4VDYLVBDNn8sohAOmU/o8p4eNZxgWbVkZC23R7hYNlzI4R3xUNhBxWsgo/QeEC/oW0e4WDZc+A/VIVHcFw37oUfEy0zj6XWQ/fmlwrtOLYQtsDzYZryX4zzclCzXQQkbLKGm02gz6FKdHjGcYbCumDQsv0e4WDZdMof1zVF/lO8bHv/4EEw76BtGuFg2Xni8YKlRqBUBk6VG63Q9Z+hgPNhmvJUuELTkLbNCCxcgomE+POvpSEI0Jyyh01tVl+j2nh41nGPgKmwALVNGuFg2XAaZ1TFRyJTZdxr/nplko+gvFglnpURBb80v6YLm1cIHqYxVnGPoEEA2fyygQ6DZR+gMrOR6DIBon7woLBRBNn8sol5DcDfpAKzkegyBd7epLCw8QjZzLKG9m+Aj6Bis5HoMgplumYAt0EM2cyygpl/Yt+hOnh41nGFgZWUMLEdHuFg2XvB31XFRyUDF4yChfvLdd+lzR7hYNl162Xj1UZlA1C8soxTbud/okxUMp6FEoqLFr+lAPNhmvJZMvOWkLGr5Jg5ieISfbawsBhUoEYM4CMwxkCxPRbhkNl8qvo0ZUCcWCPelRWCESNfom0IJGyyh2eQFg+lOnR4xnGL5e+woLeNHuFg2XY4j0IFQq83dhlh8mliZJC1/RrhYNl1iLz1xUC8VDVulR2VVyJvo5DzYZryX/jEwvCxfR7hYNlyjRCS9UWRCMdcgocPiVAvo8JXvfx78gTb1G+mrzt2KWHxJDlgsLZvP3YpYfIZlGGgs90EL0yChzbb9X+jEQjebIKF8uGST6B6eHjWcY8HZIIgtM0a4WDZeMjvctVCNkP35ScFRC/l0LHPM3YpYfKx5VMQsJp0ckUhjpubBnC2XRrhYNlxoFITtUEmQ//mBwNaCNHQsY83dilh9WYUZHC18FTTrpURyNXCr6LzP345cfEYHoagtU0ALGyChea51S+goQjWbLKA30GRH6CqeHjWcYXrQ5QwtK0e4WDZe0cv0aVHnlNhrGv08D0Tj6TWQ/fm1w0Hl1IAtvRQ1Y6VG4y4EG+kGFTVjpUZG1OD36Dz5Ig5ieFD4IXgsC0PFayCj//2Zb+hK5tXCB6hnxrWX6JRANnMsofoiWcfod9u4ITPnLgjABCzMQTZzLKH8R9Uz6cys5HoMgFNmSHws6EI2dyyiFILES+ienh41nGDpezUYLT9HuFg2Xib6zNFQXEPBayCgce9w7+iPRrhYNl0vhxWBUE2Q//mtw3vDHAQs4DzYZryX8fQxRCxn+SYObnktbDUULS+XSCVQAj/BBDAtbxUJY6VGyVDRb+jc2HeNU+XOdqQELJ9DCncsoP+1sVPpYEA2dyyjCJipv+i0rOR6DIBtoLhkLdBBNncsoGqUhCfoPKzkegyAjXpp9CycQjZrLKPdllVn6fqeHjWcYl5A8Owt40e4WDZfcSnEoVDflO8bHv7WtIQ36JdGuFg2XEqH8U1Q6ZXzyxr/j3qwh+kcPNhmvJY84vxALLdGu/fKX39EfVFRXaKoXt6kIyAVYCzVKoLcncXkUzYYEG+T0FwgAAAAWFAUXFB8HAATskyVoFAAAACEjPiU+IjwwIjk0Iy49PjA1NDUABCYg6zgIAAAAFhQFAxQfBwAEl1PHagcAAABxFRQTBBYABPSSflMEAAAAAgQTAK6VBmxu+n5zwP4EtksEv+8WYAsAAABxBQMQEhQTEBIaAAQHo0IHBQAAABcYHxUABDoeVX4HAAAAcT0YHxRRAARjqtVHBwAAAHFLVBVaSwAEjcGDGgoAAABxPRgfFFFUFVoABMa9hVEHAAAAFhwQBRIZAASNdNQVCQAAADgfAgUQHxIUAAT3tvNZBAAAAB8UBgAEJ3mXXgoAAAAiEgMUFB82BBgABEY40FIGAAAANwMQHBQABDV4hl4LAAAAJRQJBTMEBQUeHwAEr2GDTAoAAAAlFAkFPRATFB0ABCcRcSMFAAAAPxAcFAAEWTsBVQgAAAA8EBVRNiQ4AARBhpZOBwAAACEQAxQfBQAEdyV/NQUAAAAWEBwUAAQUpHBjCAAAADIeAxQ2BBgABAXGRkcKAAAANQMQFhYQEx0UACUK7jwGAQTxv3QMCwAAAD4BFB9RNwMQHBQABBUfokcHAAAAMBIFGAcUAATIFKlBEQAAADMQEhoWAx4EHxUyHh0eA0IABKJJUVkHAAAAMh4dHgNCAK5p6FpB+n5zwP4ERjSusAgBHKcvOcioUVM0rlJ+01P6fnPA/gS2CwQ6g4hnEAAAADMeAxUUAyIYCxQhGAkUHQAEm4BdDAkAAAAhHgIYBRgeHwAEy1XfDwYAAAAkNRgcQwCuCtJvcdVHjn/F5Fo0ro8lUUUdy2YgZeAkNAT/PHVQBQAAACIYCxQArqdmCyX6fnPA/kTuS65GRAU6+n5zwP4EjUsEdcUpVwUAAAA3Hh8FAASuCt8FBQAAADQfBBwABAARYCcHAAAANh4FGRAcAASv9iYMBQAAACUUCQUABOAV3x8FAAAAPgEUHwAEHCEnUAsAAAAlFAkFMh4dHgNCAATBuCMyCQAAACUUCQUiGAsUAK6Xgcs2+n5zwP4EmksE0pjpThEAAAA8HgQCFDMEBQUeH0A1HgYfAASZmU8BCAAAABIeHx8UEgUABHsHTXkEAAAAJSECAK5ZZoILBmxIpOoRAzQEoBXdERcAAAAzEBIaFgMeBB8VJQMQHwIBEAMUHxIIAK7wZLZS6X5zgM03VTSuR1emImSVtb4+Tj40rqO+dWKwr2kgZOAkNK7Y77QE+n5zwP5E3kuuIFqkcfp+c8D+dMtLBI1limQEAAAAJR4BAK4D0wlH+n5zwP4E9EsEgOfJJgkAAAAlIQJRPxAcFACu99ptHvp+c8D+JN5LBGRZ8S0LAAAANh4FGRAcMx4dFQAE0TX6PAsAAAAlFAkFIhIQHRQVAASzodQrDAAAACUUCQUmAxABARQVAAQ6Q7BGCgAAADIdHgIUUSUhAgCuizr9aYFCXIBl61w0rvLzdglqyIcfRs0ktK4sYRRK+n5zwP4EiEsEHKcnbQIAAAApAAS3En8NDgAAADIDGBwYHxAdUTMQAhQArjY7EQ7HMRC/E5LbtK4I+3cnPmWBP7v8BDSu4Mxrafp+c8D+hPNLBON1130PAAAANh4FGRAcIhQcGBMeHRUABJN7t0gIAAAAMh4fHxQSBQAEdxQfDgwAAAAhHh0YEhRRMxACFACuZa1JV28BWYATktu0riWwZydwy0EAd5VyNATtzBU2CgAAADkUAx5RMxACFACuLwdRWmi7c8DLFmY0BH6d1hAFAAAAMxAfGgCu9Xu/coFb3N+Hu2M0BAmwAVgHAAAAMhACGB8eAK7t4A1I2BgDgENobTQEV6J+EAgAAAA7FAYUHQMIAK6yaPZB1fBZAP6JVjQESh7SFAoAAAA/GBYZBRIdBBMArlMpt2kA7JV/XGdVNAQnl2ktCAAAADAYAwEeAwUArjLiumzbGWAANE5QNARuy6xTBwAAADYQAxAWFACucdfqaxmIiH8Tktu0rqOTAV4PmnpgDDVfNK7GXDsT+n5zwP4E/0sEfuq7OAoAAAA2BB9RIgUeAxQArkmx7VeUrmmgwfA3tK4u22VqxnN3gGiTWjQE+1RSYAYAAAAlIQJRQwCupdIuWYZjSN8tU380rpDmKWb6fnPA/oTcSwTPxKwoDAAAACUhAlFRQ1E/EBwUAARqILdsDAAAADIdHgIUUSUhAlFDAAS18cFhCwAAADMQHxpRJxAEHQUAruGG0HO0Lua/O49zNARFzDtrDQAAADIQAhgfHlEnEAQdBQCuUGsKZNbUwx/K3WA0BL9IcSgRAAAAOxQGFB0DCFEqOB8CGBUULACuDO/eVHDg58AQktu0rrPb7ln6QaIfO2NeNAQsqlZUEwAAAD8YFhkFEh0EE1EqOB8CGBUULACuckJrLVySeODO7lc0BPupPEoIAAAAIhIDGAEFAgCuoJh0Lm24sd+aDm00rtPLuGz6fnPA/oTZSwQCSvMVDQAAACISAxgBBQJRPxAcFAAEAV+uKw4AAAAyHR4CFFEiEgMYAQUCAARaqe9VCAAAADcQAxxRKSEAruNU7HTIEL7/EJLbtK5c/1UbbIN3oUYAdDQEiNq5BA0AAAAwGBwTHgVRV1E0IiEArkEcK1UtS0rA9eplNASeyr8fEwAAADweHxQIUTcQAxxRKjcYCRQVLACuBcqqHEO/p39H3Wg0BOrEbAANAAAANhQFUTAdHVEyEAMCAK5IR9I51+kygErmUjQExGMmIg4AAAA1FB0UBRRRHRACFAMCAARkZ3ZJEgAAADMIARACAlEwHwUYXDIZFBAFAK4acDBWV8Clv4GRXzQEZYsbRQUAAAA8HhUCAK5JyslwVyq0n2lzbjSuSDm5I8RC3B8PBCc0rmlY93b6fnPA/uTZSwR/3ThODAAAAFE8HhUCUVE/EBwUAARc5utPCwAAADIdHgIUUTweFQIABGBCpDEEAAAAPCFEAK4TfR8ku6ohQAuidzQEQIr9EAcAAAAhGAIFHh0AricpMWR12DaA0YdlNASnFNJcCAAAADgfFzAcHB4ArgY3dCyrl50/FZLbtK7zH4UZfw9JgJu9XzQEPS/zPwgAAAAiGR4FFgQfAK6gTcgPkF0AgA6S27Su+uwSWY7XE4CQRGg0BMCfTz8GAAAAMxAFHh8ArnMhcAkAT1/AHpLbtK7RPnY9Iv2zP21hUjQEz8dIcQsAAAAiFB0UEgUQEx0UACXDEkh9AAR9iw0NCgAAADIdHgIUUTAdHQCu7wf+AZO0Q2DQRQM0BEqGeXULAAAANhQFIhQDBxgSFAAEn1X8RAsAAAAiBRADBRQDNgQYAAQd+HRUCAAAACIUBTIeAxQABE/K/hARAAAAIhQfFT8eBRgXGBIQBRgeHwAEMfrsCAYAAAAlGAUdFAAEZVYMUAgAAAAyAxQVGAUCAATLLFVhEwAAADwQFRRREwhROBIeHwtSQ0BGRwAEmT/+OQkAAAA1BAMQBRgeHwCugWgVSfp+c8D+BJJLBOwDlBoFAAAAOB8XHgAEpNhAUioAAAAhAxQCAlETCAEQAgJRMB8FGFwyGRQQBVETFBceAxRRBAIYHxZRJSFWIgAEp2PDDwcAAAALGBYLEBYABGkRJWkIAAAAEh4EHwUUAwAE5HCdMAUAAAAGEBgFAK4I6nM2YOfqWWedDzQEe8wDfAgAAAAhHRAIFAMCAARDsoheDAAAAD0eEhAdIR0QCBQDAARziRQ7CgAAACEdEAgUAzYEGAAE7szTcQ0AAAAyAx4CAhkQGAM2JDgABMHUsBoKAAAAMgMeAgIZEBgDAAQygL5xDAAAADgcEBYUMh4dHgNCAAQ8QBoYCAAAABcDHhw5IicArlXI4W6Bat2HH34iNK6UujRr+n5T2QuCVUquBO03Ffp+c8B+VXdLrv589w/6fnOomwgZSq4K3ZdD+n7zF/+fc0quKSUdQfp+c8B+qHRLrtUlYjD6fnPAfjh3S67yJLBk+n5zwP7CFUuulJ8tWPp+cyAcnnNKrlZd6Fj6fpNp60xdSq7o/w04+n5zwP4DCEuuWsLLbvp+s6rnTF1Krv2yPy76fnPA/mcGS67KAvsx+n5zwP42EEuuYeXDefp+M5Oq3GhKrg0c7T76fnPwJewCSq4vSLco+n5zwP6BB0uurSYTVPp+c8B+RXZLrnRdqC/6fnPuFOwCSq6O6TIq+n5zwP7ddEuuJqy8E/p+c8D+JwdLrhoz4BH6fpN0talWSq5OR0RH+n5zwP6kBUuulssvMPp+U63S/lRKrjY8oyb6fnPA/m52S64WfHUo+n6zpTAMa0quuLXbCPp+81XFdnBKrvdUbA36fnPA/iAMS66NjO1e+n7zZ7Z2cEquXD40Nvp+c8D+NXVLrtVFdAv6fnPA/nYeS667tlxy+n7zRKCXZUquvIc/EPp+cx1cwn1Krg5GX136fnPA/mwaS65JjRpW+n5zwP4MBUuuiD1Aafp+syFeT2FKrkrdxnv6fnPA/qMFS64yffV4+n5zSBGsGkquW3l0DPp+c8D+PwxLrqIHOCD6fnPA/pgNS67EGZwJ+n5zwP5gFkuujkNlZPp+cwnuPVNKrldkZkL6fnMq/otsSq5Ne1h5+n5zwP7pBEuuvmO1V/p+c8D+aCNLrg5PWXr6fnM8+ItsSq7nvV0C+n5zwP4cE0uuPud4BPp+c8D+xDxLrhrnPwL6fnPA/k8DS642lpsf+n7Tya6pVkquREFdEvp+c8D+Qg9LrkGmwB36fnPA/hoOS65Mdwhr+n5zwP55CkuupJaLR/p+cwqojF5KrhaUXQT6fnPA/u8DS647lQFd+n5zwP4cF0uuRnPwI/p+c8D+AgVLrm0hCGX6fvNiB1Z+Sq7HQFRp+n5zwP6oAEuu9GAiG/p+c8D+2CpLrnFvQTj6fnPA/gwwS67e0PUi+n7zIrSpVkquZZjCBfp+c8D+BDNLrjhh+SH6fnPA/oIXS66BF3RN+n5zwP4idUuuLEmxRfp+0xStqVZKrp46jF76fnPA/jAkS67ubOBQ+n5zwP5GBkuugHXgW/p+c8D+GBhLrtmngxD6fvPnoFJVSq7CPiZD+n7zFpq9VEqu/MrBL/p+c8D+ihNLrlKtnkf6fnOtJpUHSq7SVXAP+n5zwP7Ewkuuys+WIPp+8+p6cFlKrpdoVy/6fnPAfuN0S67CznlP+n5zwP6vBUuuAMzrTfp+89e5qVZKrtdnelj6fpNo6s9VSq4n7Uks+n5zwP6+F0uuL74XJvp+c8D+yw1LrnrOYgT6frNSynBjSq7dbSwL+n5zwP61DEuuV/ZRP/p+k1yvqVZKrhj91iP6fnPA/iMHS66Tn7Nt+n5zwP4E+0uubz9UB/p+E/Z8cFlKrhfxs0j6fnPAfmV3S674sQFZ+n5zwP5qCkuuDfgYefp+c8D+rhhLrkLKT0X6fnM7wt5aSq7du74W+n5zwP6aEkuuazyhD/p+c8D+AhJLrmYYUnH6fnPaGYpiSq4wmPZn+n4TwjAVXkqu5UimZvp+c8D+RMBLrimrol76fnPA/sIYS64fA20g+n5zSV+NeUquzGPkK/p+075J8ldKrpIaBBL6fnPA/kQES65wFM0b+n5zwP76G0uu+FB9Mfp+c8D+nCJLrr1xmCj6fnNyTPJXSq5AP7xx+n5zwP5YAEuuc1d1XPp+c8D+BNdLrkd2m2L6fjOqtalWSq7u+CFW+n5zwvZKH0queiGYW/p+c8D+jg5LrtrG9Cb6fnPA/sQtS65+KwZV+n7TEL/NUkquecaHDfp+c8D+fDRLrkWnBFb6fpM8s6lWSq6WuY0M+n5zwP40NEuuoFMKPfp+c3fsunVKrsSiCnX6fnPA/vR2S673oN4z+n6zQqypVkquAWPJF/p+03uOxFtKrg2icEb6fnPA/mw9S64fZCJ++n5zwH5tdEuu7XfAX/p+c8D+OhdLrr0JXT76frOH+rtaSq6HSdgV+n5zwP4FAUuu9bred/p+c8D+vCFLrnJ9x2L6fjPMqjFcSq6W3TNL+n5TvPS4W0qu5YJnLPp+c8B+sHdLrpGOICD6frP7elVsSq7rlExW+n5zwP4PdEuuob15J/p+c/wQc35KruSG8Dn6fnN8WgUdSq5tvbRQ+n5zwP6XCEuuo8sML/p+E515xF1KrjRoByL6frPNoNBXSq5FTXZG+n5zwP62C0uut9h8EPp+c8D+Gw5LrjZtmnT6fnPAfst2S668XMpb+n4zTKTQV0qunC5wGfp+c8D+nBhLruOe3GL6fnPA/lEAS67QhjtB+n5zwP6YAEuupaaRF/p+E5jcklNKrvQdvCv6fnPA/jwVS649Kr8h+n5zwP7YBEuueob7A/p+c8D+BAlLrpQxkWv6frOOralWSq78Iktv+n5zwP4aEkuuRwIxCvp+00ixqVZKrsrollL6fnPA/hYTS66hdUd8+n5zwP5RAkuuOfcXNPp+8zsEJ2hKruTl3E76fnPA/ggLS64cCTIY+n5zwP6oKUuu/55KIvp+c8D+ZhxLrt7rI0z6fnOG9n5WSq7UEKdT+n4z6HLvWkqu6cr0Bfp+c8B+YHRLrgKWnjn6fnOvspYESq5K9NBF+n5TUCVfXUquqmGIJvp+c8D+JD9Lro7UDTD6ftM0JV9dSq6253pC+n5zwP4fD0uuAmTVf/p+c8D+QBFLrtljHjT6fnPAfhh2S671PwRt+n4zIP+Ub0quEW5RBPp+c8D+hDpLrtX6el76frMUs6lWSq4RP/0z+n5zwP5UGEuuUGwXRvp+c8D+GQNLrul6jSz6fnPA/kQ8S66ONXAA+n7zDQO5dUquOkQUWPp+c8D+UB1LrmQ0WX76fhOTckZXSq4pA5Rj+n5zwP6TCUuuT93mPPp+c8D+ggNLrkjRLkj6fnPA/mgYS67J66AS+n7Tw62pVkquSR8ZdPp+c8D+pMZLrns043P6fnPA/hALS67dSzZ3+n5zwP6vCEuumbroW/p+8xYmTnBKrp6ANiL6fhNs+eheSq7GpYlN+n5zwP4MB0uuSR8FWvp+c8D+wg9LrmfGYXP6frMPv5JbSq7/oBNr+n7TujyJXkquUbSCOPp+c8D+AAxLrqQswgz6fnPA/qgZS65VfONV+n4TAD2JXkqucDzPcvp+c8D+Oh1Lrs4NiAr6fvMnpR1ySq401/s6+n4zpT+OUkqucmj5Ffp+c8D+9DZLrvHM53L6fnPA/n4US65Vys4y+n5zwH4Qd0uuGZ/Afvp+M044jlJKrqJCvBf6fnPA/lgJS64aup13+n4zm7SpVkquR+q6NPp+c8D+HwtLrmgYqn/6fnPA/gTJS66/NhYN+n5zwH7AdEuu6+NNO/p+81KxqVZKrvaVGUT6fhOIfaxaSq7hbQkm+n5zwP5KDEuuE0DXe/p+c8D+7C1Lrv6yA1z6fnPA/t8MS65/sYNQ+n4zZKTdZEqu8gWeNPp+M9Lm+WtKrq/BY2X6fnPA/uQqS66WGvUD+n5zYMI/bEquCyUGQfp+c8D+RwRLrp+r2xH6fnPA/uAJS66GYbtF+n7zQAa5dUqubKiaTvp+c8D+HD1LrhCnn0r6fnNc460aSq7wU9cN+n7zmCz1bUqu70HxdPp+c8D+owZLrrlE0CX6fnPA/p8KS65xnbxA+n5zyDn1bUqu9p7wAfp+M3zjmWpKrr+5zkv6fnPA/sgfS64xzrhR+n7Ts1i8WUquu8IZXvp+c8D+Hh9Lrt8vSFP6fnPA/l10S64bbQUi+n5zwP7iFEuuWV50Rfp+My2ZSVlKrsjbGkL6fnPA/jJ2S65zZ3EL+n4z+bSpVkqu1DjFMPp+c8B+rnZLrjU+Jj76frNDCopiSq6mjnIw+n7ztAusYUqurjEDG/p+c8D+eB5LrgI1Xj/6fnPA/ssAS64SHDl0+n4zEAysYUquHhUgavp+c49cQm1Krq7WmiD6fnPA/tMAS66n6hxe+n5zwP5WAkuu5TeAJ/p+c8D+FwpLrjXfLV76fnNAbkJtSq5pE14X+n5zhab5bEqugO+PGvp+c8D+vQRLrl+u5AP6fnOUJ51uSq70al4n+n5zwP6cC0uuv2HuUfp+c8D+7AJLrmUXyTH6fnPA/pcKS64uYqx4+n5zbncUA0qurXVAdfp+c8D+qXZLrgXAXkf6frMlbgtjSq7hJUgo+n5zwP65CkuuZXb3JPp+c8D+FhxLripdzwn6fnPA/qYPS67o/etx+n6zcGgqY0quqRzhNvp+82A8p1xKrlFLyjL6fnPA/tkJS66pXtsz+n5zwP4E7UuujWhdO/p+c8D+YgJLri8hNF36fnPXzntpSq4WZtFw+n5zwP6kDUuuxgAEBPp+c8D+nQZLrrrhYjb6fnPA/uYOS6421+gZ+n7TCbepVkquDEoSRfp+8z+g/WlKrh7N2AP6fnPA/hB1S656gz0n+n5zwP6UDkuu74uCU/p+c8D+WwxLrl3zAib6frN5tv1pSq6cdn1S+n5zwP64G0uuc0WCUfp+c8D+jAhLrk2TemT6fnPA/t4US65i0AQq+n6zhBsXYUquSGm6L/p+cweBKAVKrgoKcU36fnPA/qB3S66DZaJH+n5zwP59BUuuCIpeKfp+Mz6xz2NKrnWvYGf6fnPeODAdSq5gC+pH+n5zwP5oDEuuPWNaKvp+c8D+iQlLrvxgKwz6fnPA/mR2S656GH8h+n5znIQwHUqu7ApZKfp+cyRH01NKrqvoM1D6fnPA/qgiS67CG7x6+n5zwP4ZDkuukUEpY/p+c8D+ghhLrm/CzQv6fjPDGpJhSq4L4VY0+n7zP05LbEquvZCGPvp+c8B+OnVLrgQVImT6fnPAfmh1S66x6ZMM+n5zwH44dUuuab1dQPp+M7hZS2xKrpGswi76fnPA/p4ES65+tWZD+n5zwP6kEkuukIRLbfp+c5CxqVZKrh83fCP6fnPA/j4aS657/con+n5zwP5MOEuuMjx1ffp+09J9fFdKrnOlfVX6fnPA/qTVS65B4QsA+n5zwP7qFEuueucgAPp+c8D+/CJLrs/Va376fnPnstB6Sq4IJMYL+n4TlxIPX0qukusuJvp+c8D+awNLrjowviP6fnPA/gTLS663LORi+n4z/xEPX0quflVDfvp+c8D+bQJLrhwNPXX6fvMSO8BmSq4fU148+n5zwP6eCkuuZZhJKvp+c8D+KhlLrqGSgg36fpMMralWSq7bm2lL+n5zwH7ZdEuuSFPxa/p+c8D+bD9LrlAFAxH6fnM1t6lWSq4zwAhR+n5zwP51dEuunE1ST/p+c8XaunVKrtn1qlr6fvMY4a5WSq4O+S5m+n5zwP7EDkuuc7ssH/p+c8D+QQhLrnoI6WH6fnPA/gUAS66uCgt4+n5zOd2uVkqubqLmcvp+c8D+tC1LrjL7+xT6fnPA/hwbS65Y3uBB+n5zwP4sD0uu64zpRfp+8xYJimJKrgqIJBH6fnPA/pwoS6685rc1+n5zwP7hDUuu4xqeZvp+c8D+KhJLrrfkbkL6fnOp/Lp1Sq7r0vQp+n5zwP5wE0uuCGjXH/p+c8D+1hBLrtVN6Sv6fvNTo1JVSq4CCuMR+n7zLtqsUkquHyreR/p+c8D+0hVLrsN7OSr6fnPLEI4OSq4si78N+n5zCmVvFUqucvS4Ffp+c8D+RNVLrlofKgP6fnM+Ym8VSq5xuHUs+n7TEeQHUUquC+/XF/p+c8B+2HZLrhLs5WT6fnPTx652Sq5StZAW+n5zwP6VAkuu6434d/p+c8D+ohJLrlj4PBT6fvPeFyV2Sq5jgp9W+n5zwP7Qd0uu1U0qQfp+swekl2VKriBqbFT6fnPA/qAYS65Bp78d+n5zwP4AJ0uuSvVdcvp+c8B+snRLrvQ2+R36fnMSia0aSq5FQdFI+n4TlXUCXkqubAScQfp+c8D+sQ1Lrr+ASF76fnPAflV3S674nJRz+n5zwH4Cd0uuktYACPp+E/fhklhKrgtFOg36fnPA/ggNS66d2m9p+n5zwP6Cd0uur0XlSfp+cxJg63ZKrqZeRWD6fnPEbj9vSq4wqJkS+n5zwP70Okuu+0UsLfp+c8D+KgZLrps6pRf6fnPobT9vSq5lKM4y+n5zwP54GUuuNIBpEvp+c8D+qQVLrl0wcgr6fnPA/owLS67LRJlh+n6z57NSXEqu2ZGGOfp+cylPBldKrikpEyT6fnPA/lsMS66Miclm+n5zwP4kJUuuBzVJQ/p+M8AMMF1KripZmTn6frOHyJBtSq5/1oBX+n5zwP4RdUuunUC5Ofp+c8D+cw5LrmjMVAf6fnPA/gcAS65nHAN9+n7zeZ2Dd0quXFV6Yfp+c8D+DDlLroIU7nr6fvOzUTZySq7aAr8A+n6TiDCVUkqu9FtBa/p+c8B+QXZLrhY/vwT6fnPA/oQuS67pHbg8+n4zX6pFUUquez/4F/p+c8D+9HZLrpglQHT6fnPA/mF0S67DrXUk+n7TIPRcWkqupZEjYfp+c8D+vgRLrptjO176fvMvtalWSq4VzaBN+n5zwP5PBUuuCW1OHvp+c8D+xNdLro1T3T/6fnPA/gMNS664Nv8c+n7znObMbEqujrBPJPp+c8B+6HdLrsKu00v6fvOpMVVoSq6zwOQi+n5zWk0Ue0quQRDcGfp+c8D+zhhLrg+pq2r6fnPA/scIS653sUBN+n5zRmIUe0qu7IzCY/p+c8D+YAlLrrcNj2X6fnPA/hENS677x8oJ+n5zwP62Gkuulz0Gdfp+U7qmUlVKrvy7owf6fpNU4AVTSq73QFkw+n5zwP4oJUuutB32Nvp+c8D+TCBLrkPAFC/6fnPA/pQzS67J3V9k+n5z6ETuD0quxWpQcfp+M0/bO1RKrs/D4gf6fnPA/gV0S65XtPNW+n7zz9Q7VEqukICRdvp+c8D+OA9LrjWBhib6fnPA/k4DS66IMEwS+n5zwH4wdEuuw9ewaPp+c+2PblRKrrrpo176fnPA/v4RS66QH4Zb+n5zwP7kxkuuRorhVfp+c8D+5wdLroAGNBX6ftMwp1JVSq4CFWUj+n5zwP7HAEuuonpYDvp+c8D+JwtLro7uRTH6fvP56lt+Sq7BzDYs+n5TgnKzVUqutnf4E/p+c8D+xMNLrtAkOBv6fnPA/p4eS66b1TVk+n5zJHSzVUqu1FLKSfp+c8D+JhZLrnmE+R76fnMirZdlSq5nqsVt+n6TcxkKV0quzBWcNPp+c8D+kC1Lrlww3R/6fhNzSeVQSq5YI6kc+n5zx4GgB0qu8GrCL/p+c8D+4BpLrm/It336fnPA/ugmS67LBl8V+n5zsINmK0qu3jr0dvp+s0Vn+WhKrlweO3b6fnPA/qASS64Zgxt9+n5zwP4+d0uu8txeDPp+M05h+WhKrsYhAmH6flPbIEVdSq5VZStF+n5zwP5EAUuu+c8VQPp+U8MfRV1Krt8m02/6fnPA/sw+S67Mn1hW+n5zwP7EGUuuvRitdvp+M2PZJFpKrnjsvCf6fnPA/l4JS65Y0lYZ+n5zwP7uEEuuMAazCvp+s+f4419KrsrYnjv6fhOdcf5YSq4HxS9t+n5zwP4sEkuuIqFeR/p+c8D+vgpLrvqF+kP6fnPA/oT4S66PondV+n6zeW/+WEqudZzbKfp+c8D+9MxLrkoSalX6fpPQsKlWSq4pH0k0+n4zrPMEYEquOfuTXfp+c8D+JNRLruHFDWH6fnPA/okNS64rl2ts+n5zwP4MCkuuW2sjTPp+M2sB+2NKrt/KK236frNMNd9bSq7KOxsQ+n5zwP46EkuuYTOadvp+0xAy31tKrvlUtDz6fjPfSH5pSq5ykwVo+n5zwP7eDkuu/5BKOvp+c8D+whBLrqAVz0b6fnPQU35pSq7FuM4o+n4T3rt1XkquvCntfPp+c8D+WBlLruScvHH6fnPA/ioHS65dy2ho+n5zwP7IJUuudpxqXvp+s0y7dV5KrlStgkn6fnPA/lwWS6655DE0+n6ToTBZVkqurK85Xvp+sx6bwl9KrqiqQk76fnPA/rQAS66ux3JB+n5zwP7YJ0uu9CzeVfp+c8D+6Q5LrvheSx36fvODlcJfSq5XOHtz+n5zwP6cAUuuQwPfSvp+c8D+sQlLrqRMFz/6fnPA/r8PS66uq1pj+n5zUw2KYkquYOWVAPp+c1n4E1JKrql0PW36fnPA/uwjS65hquJb+n5z5WCMf0quyIAxR/p+c8D+ECxLrnvO5gX6frMPE4piSq4ltk0o+n5zqrHRaEquoecVYfp+c8D+ZMpLrqU/YBn6fhMCXAhWSq57WC0V+n6TDZAdVEqu7uuvEPp+c8D+BPZLrpZxO0D6fpMJkB1USq7mVtZz+n5zwP5uA0uuiykQNfp+c8D+NMVLrpece0n6fpN/talWSq7m0R4z+n5zwP5iAUuuWQxTbvp+cwCjIc9Krr6HYjz6fnPA/hgNS67X1u1g+n4zaq+pVkqukhmIcPp+c5qacHpKrnPcxQ36fnPA/sw+S67lO+JJ+n5zwP4RD0uuqvnGBPp+c4OocHpKrqsE9Gj6fnPA/tIeS66l2Hd6+n5zwP4sP0uu1r1FIfp+c84xhVRKrsjsoUv6ftOHCM9fSq6iZycH+n5zwP50IkuuelfWcvp+c8D+ohhLrkXOtQf6fnPA/hwuS67pZsJD+n5zgArPX0qu017wePp+c8D+tQtLrhhoRAH6fnPA/i4DS647fhQu+n5zg9oCY0quG5DALPp+86HPrHdKrgFOBHb6fnPA/rUJS65P4HZP+n4TuN5+WkquEekiDPp+c5jcYVFKrjYQGXP6fnPA/hN0S64lR+hA+n4zEuNhUUquoAKBAPp+87NsNmdKrhtC1xv6fnPA/jIMS64/XVxY+n5zwP5oCEuu4nI7U/p+c8D+bClLroiwuk36fvO3azZnSq6+O0cJ+n5zwH4Sdkuu0o1bQPp+c8D+Xw9LriGGKSn6fnPA/ognS64RDscE+n4zJfFNZEquyPVTDvp+c5jNjHhKrpogi2f6fnPA/rIdS6451+hg+n5zwP4DAkuugGGNEvp+86+YN1lKrrDpVlr6fnPA/jYMS64xcFEx+n5zwP4mGkuuyW94Gfp+kwqxqVZKrrXrznv6fjOGKNFsSq7+b0kE+n5zwP65BEuuu9FqYfp+c8D+vwdLrvLC6yX6fnOHam1pSq6y4UQ6+n7zHF1aY0qug04mIfp+c8D+fwpLriaQP276fnPA/mEKS65gcaoR+n5zwP5MFkuukfFqUfp+M17UEm5KrhqNvxf6fvOQ3AJYSq5+Cfc++n5zwP7qH0uuq9jBRfp+c8D+3BdLrnCZTwj6fnPAfhF0S66VTndT+n6zzuUCWEqulvGnY/p+c8D+BwlLrkgjMGL6frPGlIJYSq6Hd0lJ+n7zo6zJYEquso8FIPp+c8D+jQBLrvIWB3D6fnPA/qQgS65Xmu5x+n5zwP4EFEuupd6Fcfp+s8hiA19KrseGizH6fnPA/qglS64jVDkb+n5zwP70wEuu55wwcfp+cz84wV5KrgMw6mD6ftMie+5RSq6nZngi+n5zwP5JdUuukVlgAvp+E89/7lFKrrJhgmT6fnPA/lUNS66qrSog+n7z/OG6dUqur4/ZYvp+M0fO+lBKrlP9Ymb6fnPA/o4FS65nfu0m+n5zwH5JdkuuCQ7DfPp+UyXQ+lBKrlIgSBP6frNqYNBhSq5LYjV6+n5zwP6bDEuuUXAtS/p+c8B+eHVLrlUXuCr6ftNoATBTSq5ETS1N+n5zwP6IBkuuc2WjBvp+M5iuqVZKrhy0Wl/6fnMzvw9SSq70sZct+n5zwP7VAUuu3+uxRvp+c8D+wAVLrlGB0AH6fhOxvw9SSq5uI/s1+n5zwP6EJEuuPzJQSvp+c8D+hARLria1mXr6fnPA/mwcS66x7Nkg+n5zI09FfEque79PMfp+c8D+YhtLrjEErCr6fnPA/tcAS65S/VoF+n7zo72Makqusl+fF/p+88Qj0WlKrs3Rh3L6fnPA/iMCS6690k9q+n5zwP5kIUuu2dViP/p+81YVrVJKriOR8if6fnPA/oQsS67uZENK+n5zQEQtVEqu2hsQafp+c8D+9AdLrtM0OnD6fnPBYxQDSq7ukgFF+n5zwP7MBkuuC3vMF/p+c614cFlKrvL0xR76fnNOjTB7Sq50Lr0J+n5zwP4UMkuutcN/cfp+c42MMHtKruFhkW76fpMycuNSSq7Gj1wx+n5zwP6wAUuuF4sJGPp+c8D+0XZLrqHK/kj6fnPA/q0ES64deQd1+n5zn3fjUkquSexBWfp+8xvcllNKrkWBehj6fnPA/gwPS67zC3g3+n6zqeerYUquQiocfPp+c5p7D1RKrj8qYhn6fnPA/gELS67WYqwQ+n5zwP6ZDEuuY+hWRPp+M45yD1RKrsby0yr6fnPA/sELS652Bbsv+n5zwP6kLEuutDA+Zfp+c7yAjSZKrqhq4Cb6fnPA/ooCS67celBm+n5zwP7pd0uu9nmeAfp+88xDVmBKrhWaEFH6fvPICFddSq6BXdY5+n5zwH4rdkuuWLDPGvp+0zwPV11Krv0vOkv6fnPA/qoSS66FK9tz+n5zwH6BdUuuqaudPPp+c8D+agdLrjA4YD36fpN6/RRWSq4uj1Vr+n4zeqPoVUquXf3xL/p+c8D+bDRLrnZUHWL6ftOwo+hVSq6B4n06+n5zwP5YFEuuVrorCPp+c8D+cgRLrmfq1m76frMpFp9fSq4qv5RA+n5zwP7kGEuugIPaI/p+c8D+zB5LrikoMlX6fnPA/iEPS65vHz8T+n5z4jUUA0quqJOeBPp+M8fPfldKriinRjL6fnPA/gALS66F6pox+n5zwP7iCEuuk3PSK/p+MxbK01JKrjHTDVj6fnNvFtYDSq7sgjES+n5zwP5YBkuuXvHiTfp+c8sH1gNKrm81gxv6fjPqY5JSSq6OpyVZ+n5zwP58M0uu52+jWfp+c8D+BIFLrnXtC3v6fnPA/gh1S65cnh59+n5zDZycVUqueF+IGvp+c8D+QBBLribr0QP6fnPA/gcAS64ryllJ+n5zTCqsGkquERixXvp+c8D+DAlLrhUBLhb6fnPA/qwqS67cWrVN+n5z4ysUA0qu8tDmT/p+E4CmY11Krl0TsFb6fnPA/roIS67kMVcj+n5zx9EAaUquQGSBPfp+c8D+UBpLrm3fa1v6fnPA/oT6S65xkp4L+n5zwP7/BUuu7+mxCfp+czMAGltKruzuTyn6fjPQ6lxcSq7OLF02+n5zwP6qCUuucSn6fPp+c8D+9DxLruxv8HP6fnPA/uoaS67XP4sq+n5zUp+AXkquq6MXUPp+c9Ot22JKruNkfCD6fnPA/q4NS66cyqFV+n7zPafbYkquB+Z7HPp+k+xD8FZKrgydn2D6fnPA/p0CS65/w5l0+n5zwP5qBEuuV5C1NPp+s8088FZKrmIGzFX6fnPA/r90S67jxgJ5+n5zwP50MEuuldqkJ/p+c8D+indLrvm+7Ez6fjP4sKlWSq6O+rYv+n7z63jGXUqu94O1Gvp+c8B+YnRLrsE7+mL6fnPA/rIOS666SlRC+n4zqmgda0qu0fA2bvp+c9hGADZKruWdaRX6fnPA/lgnS65QaUte+n6zrCHqX0quVRgkcfp+c3hSJTdKrkSiein6fnPA/vgLS65S6ahY+n6z7o6yX0quTWTfcvp+s++RqW9Kro2y81P6fnPA/sAlS67LFIJ++n5zwP7wGUuuiu3nb/p+c0qbaGtKrmcvHUf6fnPA/jQFS666x9pW+n5zwP5NCUuuFFj8Jfp+c8D+t3RLrqSJICL6fnO4ti1/Sq5F5L0u+n5ztJapbkquHVbUW/p+c8D+BQ9LruzH6FD6fnPAfmV3S66CxZIn+n7zw5ipbkqut2eaLvp+c8D+GgRLrjzMiwn6fnPA/jh1S66SiI9a+n5zwP4FC0uuwNN8J/p+05z2I1pKrnB5DH76fjPxpMRjSq4ZTjIj+n5zwP7fCUuuqwbAVPp+c8D+xNZLrrqH+yn6fnPA/j4TS66y+mFA+n4TP9j4Xkqu+JOyVPp+8wOVYF9Krl32QSj6fnPA/vYWS65kVMMJ+n5zwP4UKkuuVTegc/p+k1SVYF9KrkngyyL6fnMvhJkISq6ro3F4+n5zwP76dEuutkdKSfp+c8D+pDBLrh35ehv6fnN/XZkISq4HUeYT+n6TA6S9X0qufcMRWPp+c8D+xClLrhwR1gv6fnPA/kweS66ozXVK+n7z4yhvcUquhFbiUfp+c6c8k3tKrl0/OF36fnPA/vwJS65VsohM+n5zwP5GC0uu0LUfV/p+c8D+9QJLrnz4kyz6ftM+y+5YSq6lbYIZ+n5zwP5oFUuuxfu+Hfp+c8D+uwtLrkM4uQ76fvP4JcprSq6+fKsz+n5zwP5nAUuunuJESvp+c8D+cQ9LrneE0Ev6fnPooKx6Sq4M9wN8+n5zEXl1V0quDDUkCPp+c8B+03ZLrj8cG2z6fpPGcnVXSq6Fb25Z+n5zwP6XDEuuJ8LEZ/p+UyzimVtKrhEdukb6fhMoRk1cSq50JF0X+n5zwP7aEkuuNxsZO/p+c8D+xAVLrqoRZBz6fvPSRE1cSq6JGn9/+n4z0CCWb0quoO5GGPp+c8D+9w5LrlXQLB76fnPA/tAIS64wvLEr+n5zwP7mAEuuZ8C+dPp+cwayeBxKrjS2R3z6fhMl3EFeSq4eT1Ek+n5zwP4kB0uuDiRpXvp+c8D+NAVLrl0Qslz6fhPn3UFeSq6HkKUG+n5zwP6WBEuuPpPXGvp+U/bFv1pKrqCSwgP6fnPA/mAjS67QthJF+n4zuqVSVUqu2fccXfp+c8D+zCVLrjIRuFz6fnPA/pJ2S67ejFMs+n5zOWvzckquPdYGDvp+s6ZhP2xKru8dXVD6fnPA/koeS670gHhR+n5zwP5sJ0uudOCvCfp+0zexL1pKruYKATf6fjO3FJteSq53T0Ib+n5zwP7IBEuu9H22DPp+sxASm15KrlqxbQr6fnMAMj7jSq7lcXFc+n5zwP7cFEuuV12/Dfp+cwDZOeNKrkkCfGv6fvNWAMF6Sq4JxLA2+n5zwP4fd0uuJjQDH/p+c8D+mQlLro6FhWH6fpPWPPNUSq4L3MBU+n5zcNm3xkqukiyJfPp+c8D+7AZLrkao+Bz6fnPA/hMLS65x/3Fv+n7zs/F3bUquHrP2Svp+c8D+KAFLruRnmzn6fnPA/jYZS64Ibws/+n5zwP6hBUuuJfbWIPp+c0DTl1tKrmj1YGL6fnPA/gQhS65HQkww+n5zwP4qF0uuhh4xdfp+cwhPFANKrrbXVT/6frN0GsxtSq7lJwcy+n5zwP4jCUuuN+wFLfp+874SzG1KrmBPbS/6fnNAQqn5Sq7X8Q1I+n5zwP7IA0uuPEDxNvp+c8D+2hJLrjI9Byv6fnPA/oAaS64NC2MP+n7zIehjWEqup+IaLfp+c8D+TglLrurrvVn6fnPA/hYcS64h/1x2+n5zXnwUA0quf6PkRfp+MwZpi19KrsM6aTH6fnPA/rgHS67DBmNl+n5zwP7GEkuuEss8ZPp+03Fmi19KrqxwkAv6fnPA/gguS677Hr8T+n5zwP5jB0uuSkpAT/p+MxqyqVZKrhBj/2b6fvMJAy53Sq7rs8sQ+n5zwP4uBUuuFIugbfp+c8D+6QxLrujvZT/6fnPA/modS67Oiix7+n7zOfMvd0que7TkMfp+8z+TplRKrqtmTh76fnPA/ow6S65Z6slm+n5zwP5fDEuuXregVfp+sxiOplRKrrtEJhL6fvNGNGRmSq5OqRwj+n5zwP4sFkuu1R1Ibfp+c8D+0w1LrhfgL236fnPAfnx1S66GKPxt+n7zGUVkZkqurT4sIfp+c1hybFFKru3BfhT6fnPA/gwHS64vM6t3+n5zwP7gHkuukSc7afp+c8DlX3tKrryRsF/6fnPA/pwtS675YQBb+n5zwP7bCEuuDoBjFPp+c8D+QwZLrhodzlb6flMEibxYSq4XxXRA+n5zwH4Ld0uu/LhNJ/p+c9AvFANKrn5R6HH6fnPAfgV2S66kmccH+n5zwP6EJkuu6dxjXvp+EwK3qVZKrhOJpDb6fnPA/pB0S66CbY9r+n5zwP4+dEuurvgOCvp+c8D+0g5LrgvouWb6fnNVpKlWSq449wou+n5Tm1kUW0quDVBMK/p+c8D+YhFLrtqrllH6fnPA/kACS65XkmF7+n4zjuZEaUquXI6AH/p+c8D+JQ1LrnKTkAf6frOB5C5rSq7N5+9/+n5zwP5sLkuuFp3aNvp+c8D+ywpLrrs3IXv6fnPA/pJ3S6616B4R+n5zEhYUA0qufQdEYfp+szSqm1pKrt2IUGH6fnPA/hUJS653+OAY+n5zwP7SHkuuvmFGbPp+c8D+oQxLrtHE0j/6fvMa5C9sSq7SC45s+n7TFxHmWEqum9ZgCPp+c8D+TgRLrtJkuCT6fnPA/jgIS67WeOoc+n4TmRDmWEquk9O3bfp+k8zBslhKroCjAXv6fnPA/oF1S67v3t8r+n5zwH4odUuuAb2+OPp+c8D+GCBLrjzK3Dr6fvPzN3piSq72RTEQ+n7zCL9RYkqu0+5WUPp+c8D+kAhLrhjSUkb6fvPjxFFiSq5pnn1N+n5zRmIlYUquKvFkc/p+c8D+hwRLrpHXgFP6fnPA/pYOS66X3aln+n4zwmUlYUqu1nw6e/p+c3z1hwZKrrC+kUv6fnPA/vkPS66vXGwr+n5zwH5KdUuuFbIRdfp+c8B+f3RLrsjN+0H6fnPMC00uSq49NJkb+n5zRHo2YUquLpaacvp+c8D+JhNLrlGwqwH6fnPA/od0S657Lu4M+n4z4XU2YUquYUu7d/p+c8D+IHdLrnuKYDL6fnPA/s4bS64AWo9k+n7z+6NSVUquRHnhSfp+c8B+43RLrpB4HzP6fnPA/oF2S648lH11+n5zxIK8CEquoMyTJ/p+c8D+EwhLrj1XBzv6fnNeq59nSq6tjBUy+n7zhcA8akqu0Y05G/p+c8D+bA5Lrk4GA1b6fnPA/kTVS65BJOwR+n5zwP7wDUuurPSkTvp+c5XPPGpKrholVxz6fvMdzpRSSq6KRLhr+n5zwP6mDEuuSRgrAvp+sxfI0lVKrguTjXL6fnPA/m8PS66e4bkW+n5zwP6aHUuuYUwwa/p+Exep0VBKroifKU/6fnMY9iIFSq5ZwT1B+n5zwP7LDUuuZElyMvp+c8D++QJLruurdUP6frOSvXFUSq4qYKAn+n7zLijxc0quHQt1Kfp+c8D+gCRLrqaKCWb6fnPA/lsAS64tyr4V+n7zzzDxc0qux5t0bfp+kzIKi1ZKrqivNHf6fnPA/sMPS64I99Z9+n5zwP7KHEuuldf0UPp+85RX5FdKrmxAxhX6fnPAfiJ3S66BtAwj+n5zovUtf0quW0r8D/p+0+/Y4VlKrjGI/HX6fnPA/nQdS64FGaFI+n5ztaTQfUqu7oRQR/p+MzDXJ2tKrrxD3W76fnPA/iF2S66sUb0H+n5zwP5Uw0uuubGzGvp+c8B+ZnRLrjMiwyj6fjOk1SdrSq7beksL+n7TYYcDVUquvBFoG/p+c8D+OQZLrlljK1j6fnPA/qoBS65C0X19+n6zT4QDVUquVrm9Vfp+c8D+4w5LriqIlSz6fnPA/twvS66WmTov+n5zwP4AKkuuJBi0P/p+c3bsnxpKrsyZ5nL6flPyqWhZSq68Om5P+n5zwP5kN0uun1LfBPp+c8D+eAVLrs1Jagf6flMnp2hZSq7IEIIy+n7T3iT5UEquIW2wS/p+c8D+OwZLrv0BSUX6fnPA/g93S66P3upu+n5zwP4jAkuu1vnuPPp+U4nJe1dKridubCD6fnPAfiN2S67p7RVN+n5zwP7YJ0uuD8q+X/p+c8D+WQdLrtgwHzr6fnP/sZdlSq6Up9JD+n5TepGfWUqupJU+NPp+c8D+2h5Lrju2REr6fnPKeTUHSq7ixTxA+n5zLbrRCkquv2/fbvp+c8D+5DJLrlGqqD76fnPA/q0NS67onFom+n6zhY3Ob0quhSsXI/p+M6KotWRKrlqT2jr6fnPAfsR3S65PT7AD+n5zwP6wHkuu8o/8Dvp+c8D+vB1LrqiafFD6fnMASd5nSq5VfWYm+n5zwP4SCUuufkbyNfp+c5SgZ2pKrqg3Chf6fnPA/o8AS66RSEpr+n7zO3Y5XEqu544iKvp+868qM2FKrsZRt1P6fnPA/uIMS658AnQ5+n5zdjMzYUquljCEZvp+c8B+iXZLrqODwC36fnPA/lAJS67cFU4E+n4zaWcLYUquTLxoLvp+c8B+o3dLrvaEFUz6fvPgFgh+Sq6f9lsO+n5TAF9IVEquuKOKcPp+c8D+lhRLrjndS0T6fjMpXEhUSq40hrMw+n5zwP4JCEuudTq2Wfp+E8isqVZKrhiLYQr6fnNkvmsrSq6V1XBO+n5zwP4UE0uuwmOnOvp+c++UB2hKrqnn9Dr6fnPA/gTqS65a8aNu+n5zwP4EAEuuRtN4R/p+U9JxL1tKrhd8KWf6fnPA/nATS64ereYN+n6Tt6dSVUquYAtBPfp+E0+OkFRKrpZJ3mb6fnPA/uArS67Y3ext+n5zxGUNKEqurvzfCPp+c8D+shxLrp/snBz6fnPA/mAcS65yBgw4+n4z5BKKYkqubeu9S/p+8ysOJ2VKrqzC4nX6fnPA/jIXS64kr+02+n6zBBAnZUquc5MbDPp+c8D+pC9LrqMmvhX6fnPA/kAUS65Vyj4u+n5zwP6uDUuu/pWgA/p+EycMMFRKru9qzBL6fnPA/nIDS65gHLVM+n5zwP4AAUuubeuhE/p+c8D+0CJLrniZOnn6fnNdI113Sq41rV4M+n5zwP6ENUuuuJGEP/p+c8B+gXZLrljZ1QX6fpMzy3xRSq5EMS9++n7zLbpJa0quQ8/gMfp+c8D+qghLrgbMVH76fnPA/pZ0S64XzVx6+n5zwP7cMEuusxandfp+c7c6K3JKrg/xYEn6frNMNYxUSq5CCHkw+n5zwP4EPkuuuXk/Nfp+s+w1jFRKri8sVVT6fnPA/pQyS67/socV+n7zUHf6VUqu+ovCN/p+Mwxme1xKrjdzeW76fnPA/tkFS66Qu+Av+n5zwP7cCUuuc5tjXfp+05Vse1xKroaD4Wz6frPqWFZfSq4vCNls+n5zwP4sFUuuoySHS/p+c8D+lhpLrugzpF36fnPA/pwmS64ElyMR+n4TSNODUkquaQ9CTPp+c8D+EglLrt7QqmL6fnPA/jAdS65JwjJW+n4TKF90UEquekduV/p+09NK5VpKrkUQb2T6fnPA/ggeS66Wto0u+n5zwP52dUuu37t0Avp+c8D+DQxLrnekFVb6fvNwROVaSq4oIJV3+n5zwP5IGEuuNbm7Afp+sx47pmBKrlV4BSf6fnPA/uIfS64wTrpB+n5zwP60xkuuJURFYvp+swOxqVZKro5B9Af6frM+I6NvSq6/olNh+n5zwP5gEUuu2Xu3D/p+c8B+fXZLrh08YAv6fnPA/mECS66PfYlo+n4zgRCjb0quwBCQc/p+c8D+7QRLrvrlOBP6fnPA/l4US66P+ztT+n5zwP4eGkuuMP6SB/p+c4QZrBpKrrRxfhb6fnNNhEoOSq59lo0h+n5zwH7Ud0uuJfxlIfp+c8D+UB1LrngHWVT6fnPA/lsDS65rs0Qn+n5z5YVKDkquxA5efvp+c9kQwntKror6PCb6fnPA/jIdS65o5+ol+n5zwH73dEuuMBTcX/p+c8D+bBhLrsnGGkj6fnN+MsJ7Sq6QZZYb+n5zwP6qD0uuMBY7e/p+c8D+dwZLrk6CQnP6fnPA/vYBS655CCsj+n4TrKypVkqu+278J/p+8190cnVKrsiHclr6fnPA/godS67Bu+UZ+n7zGs70eUqugRbPS/p+c8D+tgZLrtRaMnP6fnPAfqd2S66XTEtz+n5zZ7elX0quGejjOPp+c8D+lAtLroTAgzP6fvMA8y1/Sq7as08t+n5zhuSSCEquzmTNU/p+c8D+XCtLrtRHfVX6fpNssJBbSq6pMYVm+n5zn5wve0qu0BiNTvp+c8D+LDhLrpofrE36fnPA/nwdS65pR4Fh+n5zwP4LCUuuoIpPBPp+81VhCn5KruIT91f6fnPA/sgnS67uTWtK+n4zp+4VWUqudJvnPfp+c8lp3HpKrjkRr0T6fnPA/lQOS64qXyxM+n5zwP6YKkuuzCulNPp+cxIBLgZKrlVLCDb6fvOJ44R3Sq7NCBYQ+n5zwP44CUuuKwNJB/p+c8D+9wBLrhqtFgT6frNTnr9aSq7tqdgv+n7zuUZdcEquwDiqUfp+c8D+lBVLrgSl3yH6fnMkMAhTSq6Lsepe+n7ztXKRYEquoOgjJvp+c8D+CAZLrvQtCmf6fnPA/gSGS64/v7EU+n5zwP70BUuuRpooPvp+87J9kWBKrt0Mu2f6fnPA/oB3S65UtO0w+n4zrnQeZEquzsGjTvp+c8D+JQZLrj/6wCf6fvO9DZ9VSq4liwYg+n5z5mpQBkqu967wX/p+c8D+tM5LrhYWr076fnPA/voZS64vsfpi+n5zWlxQBkquouI9dPp+cxz6KFVKrlaXmE36fnPA/pgrS66jv9t++n5zJBCUI0quwYG/QPp+c8D+Pw5LrvT10C/6fnPA/twXS67v2pBY+n6T4bSpVkqu/p9pRPp+c8D+ChBLrpCJjFv6fnMyjfVqSq7msiNw+n6zJ6eOVkquoRcrUfp+c8D+Ow5Lrrx6Uz36frOz+9FcSq4VcZMu+n5zwP4/dUuuTqn+Vvp+c8D+9ghLri5DV3P6fnPAfoR3S65zPGok+n5zwIknBEqu9LLPCfp+k+qbql1KrlYThkT6fnPA/s4RS666rRtv+n5zwP5QKkuuqqJyQ/p+kwSbql1KrlivOWf6frPHnuRWSq6AG6QR+n5zwH6Cd0uuTgJlTvp+00Yj7lBKri58qS36fvMa0c9SSq7fGXNu+n5zwH7KdEuuanLTUfp+k+bVz1JKrop+ZBD6fnPA/soSS668EvFl+n5zwP4OEEuuFZOTMPp+c8D+ohZLrtHIqzX6frO2UNxkSq6jGTYw+n5zwP5fAEuuycJkKvp+0zLe8l1Krnzs9l36fnPAfn93S64i+/91+n6TJ7epVkqu+q0xafp+c8D+rDpLrilJZ0D6fnPA/lF0S67+s29o+n5zwP5wAkuuKUk6Efp+kwDA/VRKrmmBiUb6fnPA/h8MS64lt0VU+n4TV3lwWUqu/c5HV/p+E/xw/VZKrsKYQA36fnPA/l4ZS65zG1NG+n5zwP6gIUuupP7Gbvp+k8Nz/VZKrv7Q+FT6fnPA/pYeS644s7Yp+n7TfbKpVkquKU4eZvp+c8D+UQxLrvfwKWf6fnPA/koGS66uyWN0+n5zwP7KF0uu4XeDDPp+8xW5qVZKrtoO1ET6fnPA/gt1S67o5jpj+n5zwP6iGEuuat3qMPp+U+CvqVZKrk0Mfhz6fjOY2e9lSq69ZnVn+n5zwH4xdkuur5VWUfp+c8D+ywVLrlTg2CX6frOJ5O9lSh8vQkkAEAFWD+xuHzNyE1sImW2FWTPpUb/A4CX6P2iql7ep2FTGJgtfaKoXt6nydZM4C20F+u8yO2URzYYEymmVeAUAAAAuND8nAH0OQkkAGgCs0ypsWTNLX1UImW1QjVPIKC+rsFj6RJDNU8goQCS1a/opq7kegiANSY1xCySQDVPIKPa513D6THZpCE/5XuV5eQtBvSfPuIdllIoOCxfRrhYNl9VojhpUSEUZMOlRZaPRAPpX5D/+UXC7P9k0C2Q/OoGdfdiLankLIIJvC5bKYWXZLgsuaKqX0qn4JFpKCy1oqhftqaP1XHkLQWzviFBMYBHNhq77VD5l+n5z4BQX2Uqu1eYUFvp+c8D+6AZLrqA4UzD6fnPA/lwzS64nUHwN+n5zwP6E1ksGDkJJAEYF+G8+R0szA3ZCCJltOTUciOolfxIB+m+QDVPIKMgGCTX6cnZpCE/5eW9MLQsdkE1TyCiN4Qgq+lWruR6CIDCRYRgLc5CNUMgoZcbDd/omq7kegiDZtvxlCwe9p8y4h72KjmALKrl1HYjqSJ7EMPoqEA1QyCiuQWJ6+j4rOR6DIO6X3S8LMKcHymcYxyuHUwsk0e4WDZe+3bxnVGPkP/5RcI+nJRELAdGuFg2XqILVEVRUEKtQyCjeKEIB+jUPNhmvJfyGZlQLPj86gZ19pYeVYwsJ5YNFAgDrU2lrCzs/OgGdfa0M5gALLOWDRQIAqvaBAwsjPzqBnH15PhIpC13lg0UCAKneelQLPj86AZx9+y8YMAso5YNFAgBpxe0sC1toqpfgqWI+dhULHG39SVFFbBHNhgTpUVRGCAAAACcYAhgTHRQAJcAF+VABru3FPhz6fnPA/nwhS67h8W8Q+n5zwP7GHUuuyog1C/p+c8D+3CFLru9w50n6fnPA/gTXS66BBr4M+n5zwP6iB0uuT536KPp+M7Szl2VKRA5CSQBEAL/GN3JCM1EnUgiZbT86gZ19PEXtIwtW0AJTyChsUXU/+nQQTVPIKFwimCn6TSs5HoMgX1WoOgsMp0fNZxjrOgcHC3bR7hYNlz02HlBUKGQ/flBwjs5MMwtoZXexx7/UfiBU+jalqUUCAMhN3T4LZGiqF7ep2mbbYwsP+QNTeBJhEc2GBDbUZW0IAAAAJxgCGBMdFAAlCmL5WgCuDnaxMPp+s2Se9ltKrr2b/jb6fnPAfkx2S65ncLgf+n4TsEilWkpaDkJJAF8BczkEZWozEWwxCJlthVkz6VEFz8II+gTQQl7IKM/UA1b6GxCNX8go8p6YIPpz9u4ITPmnMl4DCwqnh8lnGJbM4TkLSdHuFg2X9JnGJVRABdg+6VEs4Fdi+hYl9r/Hv7DKaCT6VLP6yIwfA85tDQsFufUciOrR3rUN+l4QDV/IKO2wnkL6Lys5HoMgV8NQEQtpEE1fyChh73tk+kQrOR6DIJ6GmXILLqdHyWcYBPwgYAst0e4WDZd3AQMiVAuzOsiMH7G5QT4LO9GuFg2Xif+JKlRjZXa+x78Eqhx++hoPNhmvJdauRB4LcbN6yIwfMzR9YAsEs7rJjB9jN3E+C0jFmTHpUUI6n0f6GtGuFg2X4ZVZTlQgRZk86VG2pU97+gXzOkmMHzfk4FELX1BMUMgoPVohXfozkIxRyChW60cq+lnQzFHIKCpjknP6bL5Eg5uefK81NwtcpamCAAD0l44AC1XQwlzIKKhNQyr6DBANXMgoXsnuJ/oa9u4ITPnyARACCyYQTVzIKNeiEGz6QPbuCEz5dXS9VgtyEI1dyChmCOxm+hwrOR6DIA7HRX4LPaeH92cYmCWRcAtI0e4WDZcg4uQhVEmF2T7pUX+T0nX6UtGuFg2XqLTjMlRaBdgx6VHg7kJb+kIPNhmvJayYfy4LCxBMUcgoAyGvEfpQfoSDmJ4jst9vCxGFWTPpUQJEx2P6QadHyfkYZzHLcAsL0e4WDZeaULJaVDGz+siMH7HtuyALLdGuFg2XdaSXGFQnUIxRyCiEVlM0+joPNhmvJWrG7y4LX7M6yIwfz3nneAtA0AJdyCg6utM0+mwQTV3IKG9ML2n6KvbuCEz5TNaaSgttEI1ayCgQ4plm+i727ghM+Z8jRyILT6eH9GcYnQp7MQtl0e4WDZddDqZrVHazesiMH9CysRQLG9HuFg2XPQMXUVRFZfe+x7+BlqkO+iXFWTHpUQ3kkCv6cg82Ga8lD8L2Ygs+s7rJjB+WHuonC3S5tXCB6oWkPDH6TRANWsgovjbiHfp49u4ITPm6+oMrC3unB/RnGHAFSEkLbdHuFg2XLX5UVlQlxZkx6VEQQZpn+kTRrhYNl0sbAkdUdoXZPOlRNFc+W/pCDzYZryVMOAtpCwq5tXCB6kgzOAD6OhCNW8go2oTTQfoh9u4ITPk+D0cTCxkQzVvIKBftQWn6afbuCEz5MnPGUAtTp8f1Zxi7YDQVC0HR7hYNl5wWqAlUKvM6SYwfTTgCAwtW0a4WDZf8wSQ8VBiFGD3pUfPTdhD6KQ82Ga8lyZFLJAs1ubVwgeqtRHcc+n0QTVvIKFxLkyD6b/buCEz5RtSsMwsMp0f1ZxiRZx5+CxjR7hYNl+x31UlUaaW1pse/1jLoCfpYRdk+6VFrtKU++mxQjF7IKA3KlzL6D5DMXsgoM8KSOvoE0a4WDZc710gPVEHQAlDIKPpxDCv6ddAMXsgoKPOFWPoUvkSDm567MWgbCz3R7hYNl/Mi8UFUcGQ/fm1whBtBOgtChZ4w6VHDUvsx+j+lqYIAAE0yl2YLSmiqF7ep5l6FHgtDj48cASNBEc2GBOZsX2UFAAAAFhAcFAAEGkUeXQgAAAAhHRAIFAMCAAT627BrDAAAAD0eEhAdIR0QCBQDAAQyuoI4CgAAADIZEAMQEgUUAwAEwjL+CREAAAA5BBwQHx4YFSMeHgUhEAMFAARkoxUsBwAAADI3AxAcFAAEQRz4NwQAAAAfFAYArqMYlDEnckQgva4WS65QsKtrSWuZX2gXj0uuSr0UFlfBVsBBHMBLBFe9lyMFAAAABhAYBQCuYviXLPp+c8D+BEY0rmtOLV7l+5iRRgIWS65i3qALi0N5F130jkuuEYhzGgxWL088McBLrpvalmL6frNdCjpmSq52s5sK+n5zwP7vAUuu6+kCJ/p+c2OlzwJKrlHHZSX6fnPA/lIdS65GHB8M+n5zwP5zDUuuvTg5VPp+k2qrUlVKrvH3Y3b6fpPLjjpUSq4JhTJK+n5zwP4cBEuuq9NLDfp+c8B+kXZLrnudAl76fnPA/ooNS65XMVcH+n7zwo06VEquk2ojN/p+c7Pc7HJKrtVZmUr6fnPA/sQ0S66qy3xx+n5zwP6Yd0uuk6YVdPp+c/vL7HJKrhwcaE76fnPA/ssIS66s/69u+n7T4KypVkquCzpwDvp+c8D+Sw5Lrm4d7Rb6fnPA/k0AS66qiHYf+n6z2aqpVkquIJIqMvp+c8D+FABLrjLbA1b6fvM8Hl5USnIOQkkAawHET3AsXDNpUWwImW3QAlHIKKll3Cv6TRBNUcgoIiOpDfpkKzkegyBhdFomCyQQjV7IKLJXAAT6Pys5HoMg+nSCdwsep4fIZxhIc/10C0/R7hYNl/R0+25UEoVZM+lRTwhlXvpa0e4WDZdrAacCVHRkP/5ScGvCXm0LQGQ//lJwvAmWdwtHDzYZryWqvec0Cx7QAl7IKP0wQEf6bBBNXsgo8PVIaPoMKzkegyCu+xEYCzsQjV/IKIx39Xj6L/buCEz5pR9lagskp4fJZxhgH1YeC0DRrhYNl1l6WVBUI6U3vce/MvbIEPols/rIjB/4c3xtCzSnx0n/GCGn5VYLUNGuFg2XwsZyGVRHhZg86VG1E3sw+h+zOsiMH+LSnncLGLN6yIwflCbPaAs3s7rJjB9oUB1vCynFmTHpUUYiB1r6ZNBCX8go5RhTGPpvEI1cyCgsxxAd+jr27ghM+f5akjwLd6eH9mcYs17iJws70a4WDZeCi4wlVEVl97rHv2FMB2X6SvM6SYwfsKCVdAse0a4WDZddoiYKVF/QDV/IKJ5CKWT6R1BMUMgo/9iaUvpD0a4WDZcL+sZwVGQQjVHIKJX3tAT6f5CMUcgoAkKvO/pJ0MxRyCiGLPQU+gC+RIObnlabvVILQbn1HIjqCLmFQPpAEA1cyCinqb9K+jorOR6DIDbkvScLYKcH9mcYAXL1BQtW0e4WDZfnrStpVHZkP/5tcH/tPgwLGmW2use/G3GhKvpUpamCAAAEZXliC2Zoqhe3qV4xqSoLWbT44g0JfBHNhgRU1FRTBQAAABYQHBQABOOWfCcIAAAAIR0QCBQDAgAEH/MhVwwAAAA9HhIQHSEdEAgUAwAEvGSSFgoAAAAyGRADEBIFFAMABG/KaHMRAAAAOQQcEB8eGBUjHh4FIRADBQAE2FeZMwcAAAAyNwMQHBQABDVtzGoEAAAAHxQGAK6VR1Edn7p2YC8POMuuptyAfvMELSBWN/xLrhw3iHPedesAQw8Ry67CK3li+n6TNV8VWUquFv7ZJ/p+c8D+vgdLrrgXOGn6fnPA/rw0S67oKhVk+n6zs2EVWUquz7DUBPp+c3riIF9Krtv4XiT6fnPA/usPS65e/3R/+n5zwP4gAEuuzEVvOvp+E5G7FlJKrv0mlnb6fnNori56Sq7OjE4p+n7TUdS4WUquPFarWfp+c8D+/w5LrhZrkA36fjO13hVWSq6dC3Ve+n5zwP6+EUuuT72LXPp+cwZlS3dKNw5CSQBVAfFPGDowMx1VZwiZbVDNXMgog/JgHvo7kA1cyCjoZyVy+kmruR6CIESMIm4LGZBNXMgoZmCGafo0q7kegiB0kL1GC3S9Z8i4h1ioC3YLaKcHTeEY4foXWAt10e4WDZft75UTVGTkP/5RcFnctzELRtHuFg2XG6xDT1Q+EIdTyChPa9Fm+nBF2T/pUbCgtGL6ZA82Ga8lGgiDLwtFhVkz6VFFiwdJ+nqz+siMH7CUXF8LHbM6yIwf5geBeQs60e4WDZcDLQsAVCmQRlPIKJlEJ1X6JqWMvse/LZa0Nfofs3rIjB+jnvJ1C2uzusmMH3SY2DoLS6dHTNMYV7WxcwsC0e4WDZd15EIzVHHFmTHpUTRweDX6aNHuFg2XYs31SFRS0MdRyCigKR8k+nNkP/5ScI7uWGELXw82Ga8lA2yXbgsu8zpJjB8mxPRYCw2QBFHIKOU0DBr6KNBEUcgo35YBUPpuK/kYgyA6sNBUCynQhF7IKHaEo3r6O/auDkz5aP2YaAsu0MReyCgxMnwg+mwr+RiDIDtZsC4LEqfHSFMYjqeZUAtj0e4WDZe100EDVBsQRlDIKDk2iHz6YNGuFg2XcIdRMVQ+0ERQyCgK+UsQ+mAPNhmvJW1ooDELDLl1HIjq1ZpyefoF0EReyCj849ZY+iAr+RiDIE+ZgDoLJ9CEX8goxALbTfoo9q4OTPnUpZwFC02nh0lTGMr3yRsLS9GuFg2XOAp3dlRKZUy8x78pFs4H+ndQhlHIKGgubgj6BpDGUcgooWJVSPpcfh4FbJ5nhyAkCxK5tR2I6jBi8iL6fdAEX8gos9rpW/pTK/kYgyC30J4xC3jQRF/IKJJ0P1z6Wyv5GIMg/CkSGAtvp0dJUxgpwk89C0jRrhYNlygxuS9UdMUZP+lR0PEEY/pH5ZeCAAA+XH90C3loqpfIqT0m6x4LBsxbcgwDfRHNhgSnJa5HBQAAABYQHBQABNdlWTcIAAAAIR0QCBQDAgAEo6YSJQwAAAA9HhIQHSEdEAgUAwAE4EwCMgoAAAAyGRADEBIFFAMABOfvdFgRAAAAOQQcEB8eGBUjHh4FIRADBQAEyHjqOQcAAAAyNwMQHBQABOGtDTYEAAAAHxQGAK5kftMJLd0D/fRbLcuu0ZPgFwxWL0888eRLrgzEcFXu0DQhhAYvS66mLGto+n5zVEozUkqu1XJiZ/p+c8B+5HRLrvebAmP6fnPA/lAUS67fEvZa+n5zwP7TAEuu5qP1RPp+M+ZQM1JKrifecmf6fnPA/lF0S67wbGF1+n5zwP5gHEuurkQpVfp+c5znzhxKrpcl5Ev6fnPA/sIMS644TQwq+n5zwP5kI0uuoVGCNfp+M5B+UVVKrl1X/iv6fjPPClBXSq60q5gO+n5zwP7ED0uuDA4yLvp+c8B+cXRLrjG4zBr6fnPA/kTvSxMOQkkAFAGZr7RAETNOPXcImW25tXCB6lbIkx36BRANUcgoPzbtH/o29u4ITPncdJAkCy2nB8tnGNaDnH8LINHuFg2XyvtUIlQlhVkz6VGYqz4O+lfR7hYNlxz+3mdUX8UZMelRUr5WSPoR5Texx7/x3g4I+gIPNhmvJRd+DA0LBNCCXsgojuHBSfo6EM1eyCiTDmZi+k327ghM+UrOrxsLKBANXsgolpjgdvoX9u4ITPkNYFVFCyUQTV7IKEf+WHX6dys5HoMguCUHSQsYp0fIZxhQZNdKC2HRrhYNl7hlFUNUJIXZMOlRCi9lIPo5s/rIjB8Z6cR1CzSzOsiMH80pjykLBLN6yIwfCaZDJwtUs7rJjB+XrbkmC06nh83mGN75dVILAdGuFg2X5j1TDFQ95Texx79QoOwE+krFmTHpUZScgnP6YvM6SYwfoL03IwtSp0fI4Rgr3YIaC3vRrhYNl+17GjdUaJAMXsgoIG7nWvp8UExQyChyrCkw+hbQwl/IKOPm4w76TxANX8goNWsCFfpmKzkegyCehJZOC2OnB8lnGN2rXmILU9HuFg2Xfp5VDlQUkIxRyCisbxkR+l3R7hYNl0Y0PyZUR2Q/fm1wjAwHAgsoBRk/6VHQmr9E+kMPNhmvJQseNRkLN9DMUcgorL/tcvp+vkSDm55UqakkC2elqYIAAAHpjD4LcGiqF7epP4pACgsktk1dAg1wEc2GBF8IBVoFAAAAFhAcFAAE9InCLAgAAAAhHRAIFAMCAAQL9l9UDAAAAD0eEhAdIR0QCBQDAARuWt8QCgAAADIZEAMQEgUUAwAE3mMvRREAAAA5BBwQHx4YFSMeHgUhEAMFAARj9QZXBwAAADI3AxAcFAAEUdNVOQQAAAAfFAYAri3i42sPgYxfEpQzS67kIN0yvH5zwFLnjkuuX8YHKSWBjB915c1LrtMoklv6fnPA/rd0S67c61cx+n7zM6ypVkquAkhpPPp+8zPFr2FKroYxrV76fnPA/vx0S64wv9FR+n5zwP61BUuuilFbRfp+c8D+zQBLrqknKyz6flMZQ9haSq6iWeZS+n6zXKK7XUquLK7Iefp+c8D+eg1Lrt0hkg76fnPtp7tdSiMOQkkAFwHNgZdjeDMjEG8ImW1QDV/IKN8OCSv6LZBNX8gory4FKPpddmkIT/lH7QpZCz29Z8u4h71mN1ELALm1cIHqrmLQOvpkEM1cyCgKdnwJ+hX27ghM+aofbQILK6fH9mcYvoYybwtY0e4WDZemmQQRVHDkP/5RcMIA1lsLQdHuFg2XNffeQVRFRRgx6VFDdhoW+nklXrHHvx/if0T6Nw82Ga8lJMbMKgtzp4fKsxiapbZpC0LRrhYNlyYIK0lUW+Vdsce/f85obfo0hVkz6VGE5v0r+gyz+siMH36z3kMLVLm1cIHqF9n8T/odUBVRyCgehSBg+jv2Lh9M+djO3CMLbVBVUcgogNveO/oWK3kGgyD4OXlQC05QlV7IKB6bXx/6Sit5BoMg8BkBBgtzp4dINhgZguscC2HR7hYNl3WwvE5UZYUYMelRfr/7FvouUBRRyCi2mGsZ+iGzOsiMH2hx/BILXbN6yIwf8f5AFwt3EBVeyCiR3Ssb+i1QVV7IKFgL9yf6TfYuH0z5ozACfwtip0dINhgkBf0UCzzR7hYNl5R+MCBUPmQ/flJwsU51YQsGRZg+6VH1qB8i+iizusmMH/a7Uj0LLcWZMelRo/bgZvpc8zpJjB+6kGtUCx6nh8nPGNk6/jwLVdHuFg2XFvGyPlQLZV+/x7+9C9dl+kaQ1F7IKBHeQ3X6FZBUUMgoWA2GO/ou0JRRyCjff8wK+gKnR0jNGIWkMCQLLNGuFg2X5/tOUlQOEFRQyCh4QtRu+gIQ11HIKGBmxk/6PP6sFEuekJbONQtJZYGCAACNqzlTC15oqpflqWxpawALSBzu7EJucxHNhgRB24BxBQAAABYQHBQABGcEt2sIAAAAIR0QCBQDAgAEB8bPOgwAAAA9HhIQHSEdEAgUAwAESEL4NgoAAAAyGRADEBIFFAMABCqqAAkRAAAAOQQcEB8eGBUjHh4FIRADBQAECvVVeAcAAAAyNwMQHBQABAvT0joEAAAAHxQGAK6M/2pFM4GM39TLLUuuwxErb8F+c2DUuY5Lrvb0bhwlgYwf82wzS664VwJo+n5zwP48P0uuMeEQOPp+c8D+lQlLrhwLr236fnPA/rQ9S67d6PF/+n5z4Lquf0quP+aMAPp+01JhfVxKridi5HH6fnPA/mgMS66cj0Az+n6zsgDwaEqudwTBXvp+k5nLeFJKrjmvPGL6fpOBz7RWSq4B6BN2+n5zwP7EHUuu4qBQVvp+c8D+xOxLrlDjUS/6fnPA/qQwS67VUeA++n4zYbCpVkpkDkJJAAwBy97+F2kzcwJ3CJltUM1fyCh4ftRf+guQDV/IKAevhx36BHZpCE/5XrvnBgsjvSfLuIfwCM9PC3Onh0v5GJY91FMLedHuFg2Xeq/aK1RxEI1RyChb/OMM+h6ltb3Hv4JNZVL6GuQ//lFwL4W1FwtOhVkz6VGyrdw1+kmz+siMH2VJVWELK6eHStAY9GSqIQtm0e4WDZcaBtlMVBizOsiMH/H3LkILLNGuFg2X5aWOVlQqxZ4w6VFeywFx+g8PNhmvJYq+wkcLQrN6yIwfS5NWDwsR0BpRyCixqHpK+jQQRVHIKL5Px2b6XPbuAEz5Tt29MAt+p0fLVxgFUmxfC2XRrhYNl7//YTZUBCUOv8e/h6RsSfoQs7rJjB9SBHtsC0nFmTHpUY9DiHT6SfM6SYwfo8U/Mwspp0dM0RgR6TEhCzTR7hYNlwFIcmlUN6UPv8e/O1srN/puZD/+UnASSVthCyJQRFDIKH+w7Rz6KZCEUcgosdSxCPoc0MRRyChdL3Yp+kq+XItrnpczfw8LQdDaXsgoF9YiUPpjEAVeyCgTV/Zn+ln27gBM+ctioxgLYhBFXsgo+5AxTPo89u4ATPm9rbAvC0enR8hXGEndnk4LMdHuFg2XP65bQFQMpZGCAAD5NTI2CyfRrhYNlxG8+VtUHmQ//lFwBOSxIQtbDzYZryX+/98nCxNoqhfHqZ8k4XwLd8ZeDHsNcBHNhgRDW3phBQAAABYQHBQABPiNUjYIAAAAIR0QCBQDAgAEto9bXAwAAAA9HhIQHSEdEAgUAwAE+tHAGQoAAAAyGRADEBIFFAMABLzKZFsRAAAAOQQcEB8eGBUjHh4FIRADBQAEQXVsfwcAAAAyNwMQHBQABNfo/AAEAAAAHxQGAK7Q/mcr8KnQsMNu68uuQMuAeZwYFaaY4o5Lrjw+3xDJTUDzzSUxS67k4Eph+n6zszMDWUquyr/KWfp+c8D+ThRLrpxxCxH6fnOe8bNgSq5uq0Q++n4z+jeCX0quewoFaPp+c8D+/Q9LrnVH1Sz6fnPA/gANS67NU8QH+n6TGTGCX0quOk8tb/p+E5E3slpKrkNcPSD6fnPA/k0CS66Pbagv+n5zwP4E6UtiDkJJABABE47ncmAzQAt/CJlthVkz6VFBS04o+jSz+siMH4QFMxkLPbM6yIwfs+DHZgtws3rIjB8Rp2heCwqnR8zhGF/icgELFdGuFg2X1XBBYFQVJTe/x79DQZls+k+zusmMH6zytTALFMWZMelRTDlqE/ol8zpJjB+BsnVGCwJQTFDIKId4CA36Y9HuFg2XV+0ac1R7EMxQyChaU0EL+g1kP/5ScO65rVcLS5CMUcgo0d4oK/pR0AJRyCjk/2pD+nsQTVHIKEZgGVn6UPbuCEz5ACoeVwtMEI1eyChM+TQS+jwrOR6DIIhdFyoLcaeHyGcYuBhiewsG0e4WDZcPydE8VFLQzFHIKJ/Wk0z6cdHuFg2X9w2UAlRR5Xa+x7/ievJ++k0ldr7Hv6VymHz6TQ82Ga8lyY57Ggs+vkSDm56yzFl+C0S5NR2I6mtOREH6HhANXsgoltvbMfpZKzkegyDzhl0YCxOnB8hnGAn9tF8LL9HuFg2XHgN0UlRkpamCAAB8e9Y8CxzR7hYNlwY+FHhUZGQ//lBwI7a+AgtXZD9+UnA0mjt7C1UPNhmvJY7jzAYLBmiqF7ephm+bJgsg6eF2Lhl0Ec2GBG7HHwsFAAAAFhAcFAAEs8WiBggAAAAhHRAIFAMCAARUdnFMDAAAAD0eEhAdIR0QCBQDAAQh5n9dCgAAADIZEAMQEgUUAwAEqzzfVBEAAAA5BBwQHx4YFSMeHgUhEAMFAASNadZ1BwAAADI3AxAcFAAEor/uYAQAAAAfFAYArtrqoBp1vIboogAiS67PuKhRyU1A8823jkuuVRc9Esd0pGOOOYpLrqheWQv6fpOl8/FdSq5QrAx0+n5zwP4YB0uuusCHCvp+c8D+2HdLrjlSA1H6fhPS9fFdSq4PGeJY+n5zwP72Gkuu3mJdaPp+cyQHrBpKJg5CSQAMAVkEsn9nMzRlbgiZbTn1HIjqNLb2WPoakA1RyCiMQupK+iWruR6CICH8WFILRZBNUcgo3pGrN/p3q7kegiAlo0UeCyCQjV7IKBFrsW/6GHZpCE/54EP0TQsRvafKuIeFP5NGCwK5tXCB6mH2G1v6XBANXsgox2LoA/oi9u4ITPnxAu5KC2UQTV7IKPDmvlj6Dis5HoMgQdx+TAsqEI1fyChu+VN8+h4rOR6DIA5KYmALGaeHyWcYheFCIQtG0e4WDZfC3m5kVCXkP/5RcH4PrC0LMdGuFg2XlaOVElQvhVg/6VFsbX0j+hsPNhmvJftY9WILWoVZM+lRL3T3c/prs/rIjB8/QVsEC3KzOsiMH1kODwMLR6cHStsYWSPKIQsk0e4WDZegn7oxVCNlA77Hv25R1GP6EmQ//lNwRE8PGwtzs3rIjB9ZThtCCzynx8rZGGj5ElkLKNGuFg2X24LxSFQZZD9+UnDenxwXCwSzusmMHwaHDH8LKKeHTdsYgyEANAso0a4WDZfBsQ5kVBQFWTPpUVJzn2/6K8WZMelRJCwgOfpo8zpJjB+mN0A/C3AQWFDIKIGy33H6bVCYUcgok8hWCvpapwdK2xiiOSknCzXR7hYNl1VdpXxUPGQ//lNw4zkKaAt+kNlRyChE3OVi+lGQ2FHIKPQlEwr6On4QD3CesPJ7bwtWpwfK2BiYbTpWC3vR7hYNl3zAt1JUSeWdggAABC8NQwtv0e4WDZcUb/1rVFtkP/5tcPCeGD4LWpCeU8goDaYYY/oMDzYZryV8DqQ0CwVoqpfcqaQ+9GkLe0Q0iFMqdhHNhgQB3T8BBQAAABYQHBQABIRdZlQIAAAAIR0QCBQDAgAEJ3DhMQwAAAA9HhIQHSEdEAgUAwAEmt2sfgoAAAAyGRADEBIFFAMABIR69wARAAAAOQQcEB8eGBUjHh4FIRADBQAEPOHEEwcAAAAyNwMQHBQABNmzlhwEAAAAHxQGAK6e1/1aXg5OyilxFsuuvY92HIFq3Ycfvo1LrksQ3gAMVi9PPPAjy64ZYRFG+n5zwH5RdEuuq65ZYvp+c8D+0g5LrrSovh76fnPA/nYYS67GMYIp+n5zwP4E1kuuyguAJfp+c8D+NA9LrngIQhn6fnPA/o4XS67HIZRV+n5zwP7OEEuu3nLDPfp+8yewqVZKFQ5CSQB1AQoFty0CMwEuHAiZbVBNX8go3XxNHPpMkI1cyCiR+xNS+m92aQhP+cO5egcLYr2nyLiHFzg6FAtnuTUciOqSPh5++l8QDVzIKPqiTDn6Gys5HoMgs/p7JAtXpwf2ZxjBPmV6Cz7R7hYNl/OTIi1UaGQ//lNw0RoAUwtrZD9+UnDHolIVC1vkP/5RcPyWfjsLOadHTbcYExlOZwsb0a4WDZd47lcwVCzFHjHpUQ3TDWb6XoVZM+lRKhaUfPp+s/rIjB/E265SCwK5dRyI6r1gX2L6NNAqUcgoquWwQfos9q4QTPnbHYNTCzrQalHIKDPYo2z6XvauEEz5GHA7ZAs+0KpeyCjLjjVw+gor+QaDIMQNxnQLfqeHSDcYHDReQwtW0a4WDZfmW2RIVEVkP35QcCHtaC8LFrM6yIwf6yGgGQtAp8fKzRj1Ym0RCxjR7hYNl2QfiQhUbNAqUcgoKzvGMfpoxRkx6VE310IB+iCzesiMH5P0M2MLOqeHzbAYZ7lmSAsh0e4WDZc/Ly51VEbFWTPpUZX5QX36AGQ//lBwijmMFAsYs7rJjB+Vhnt+CzaQKl7IKCuAg3f6fNBqXsgoe+VgSfpc9q4QTPk/+JsmCzLQql/IKKmX0mj6Dyv5BoMghOicFQs2p4dJNxjs521PCzzR7hYNl4mJTmlUIcWZMelRnR2eIvop0e4WDZf9WzYkVGcQVVDIKO4qkgj6BMWZP+lRnd99XfpEDzYZryVhqcJbCzWnx0qzGDa9A0ILU9HuFg2XimLYCFR9kGpTyCgbhlJZ+kjQqlPIKBp0GzH6FvM6SYwfYJwcGAtjEFRQyChsDAtJ+hSnx0myGM6hHE8LK9HuFg2Xf7t8RVR/ENVTyCim1DZ/+nHF3j/pUaQRgAr6LFCUUcgo/+UHa/oMp0dMthi0xT44C1PRrhYNl5KguyNUVJDqXsgolLwsXPotkNRRyCjKiRUQ+nl+LBtInlQMFFkLM+WBggAApU/FIAsTaKqX5Kk/5d8aC1Mk+ngpa3wRzYYEQM0mNgUAAAAWEBwUAAQvpZtNCAAAACEdEAgUAwIABGz00AUMAAAAPR4SEB0hHRAIFAMABIOvrDgKAAAAMhkQAxASBRQDAARuHPojEQAAADkEHBAfHhgVIx4eBSEQAwUABJFTQAYHAAAAMjcDEBwUAAS4x8VYBAAAAB8UBgCur7O4Dbh+c4Dq6dpLrpG8FlocgYy/N4iOS64O35B4t35zYMXRyMuuna7tIfp+c8D+anZLrnFMHQn6fnPA/lcKS648l2MF+n5zwP7pBUuuwlu0a/p+MwQNG2RKrkxknjn6fvO6jkpnSq5UHXsv+n5zwP5KDkuu39q3Svp+c8D+cgVLrp28szX6fvNwj0pnSgTS+PkaBwAAADg4HR04GACubwd7Nfp+879ZynZKrlrVSFn6fnPA/hYOS67m6kMF+n5zwP4E6kuuv4bUa/p+c8D+BMxLrq2k+QP6frOrML1RSgYOQkkAHgGkKfoJFTN0O3wImW25tR2I6q+XxRD6chANUcgoWOT7VfoTKzkegyCatqI7CzwQTVHIKKGXdib6MvbuCEz5KuRVaAsxEI1eyChhk5d6+hYrOR6DIKPe93kLY6eHyGcY0CA0CwsG0a4WDZd2g310VG1kP/5ScO6lxnkLcYVZM+lRvEnpSPpls/rIjB/mQGk4C3OzOsiMH2JMhRILMLN6yIwfbx7HYQsBs7rJjB/kAAEyCwXFmTHpUewpRnz6Q/M6SYwfZpmYGQseUExQyChfR8tn+i/RrhYNlxhoITNUceW2v8e/KKURMPp8kIxRyCizhQQJ+hjQzFHIKHLYXU36aL5Eg5ueDXTjOgtD0AJeyChCDEwL+ggQTV7IKNyDxXj6fys5HoMgNv69KQscEI1fyChCXN8b+gIrOR6DIHUzknILK6eHyWcY4ECwOQth0e4WDZeIZuMAVAqlqYIAAAROHVsLJNHuFg2XmDVaAFRikI1TyCg2SLg1+jcFWDHpUXxTanz6Ww82Ga8lJZbQewtbaKoXt6lA1dZTCwJpC049fXYRzYYEnaxFaAUAAAAWEBwUAARZpYwwCAAAACEdEAgUAwIABC9QzhcMAAAAPR4SEB0hHRAIFAMABDe6bU8KAAAAMhkQAxASBRQDAASnfho5EQAAADkEHBAfHhgVIx4eBSEQAwUABOpjP08HAAAAMjcDEBwUAAQY1pYlBAAAAB8UBgCuNXWOWV9+c2BQSC/LruLLEQn9fnNgW/PyS66ej00y235z4LJlM0uuipwAXPp+c8B+f3ZLrtqwq1/6fnPA/pwiS65FaUAn+n5zwP4IIUuubrHCFvp+M0uF8FZKrukLCSz6frNi74NeSq5S2DE8+n5zwP68GEuu9esjdvp+c8D+KXVLrnR2I1H6fnMs9INeSnEOQkkAJQDTqZwhZDMYakoImW1QDVPIKHg+QzP6A5BNU8go+pTbRvovdmkIT/kUE2gMCx2QjVDIKAWc3Cv6J6u5HoIgqG1MXwsekM1QyChaO5Aa+kJ2aQhP+d4eyxMLar3nzLiH/HLjKAsxp4dK4Bgn/ihlCwHR7hYNlwB8jRtUTuQ//lFw36yWBgtW0e4WDZeVZDcQVGUQ61DIKFuTUy/6P4WeMelRAwg8ZfoCDzYZryVbIWsRCxc/OoGdfUMEcFsLA2WDRQIAjjaKGAstaKqX4am/eyocCzXwzmMIdWMRzYYEIWImTQgAAAAnGAIYEx0UACX+O6xrAK6Z83AG+n6TGqDUVEqueT3FNPp+c8D+onZLrjJDXwD6fnPA/mYSS64au20I+n5zwP7kxEuuE3YyfPp+c8D+ROhLag5CSQAoAU1l4QsoMz9AFQiZbTm1HIjqBNENIPpIkE1cyCjRyPVJ+mSruR6CIBynNl0Lc5CNXcgo6/IzYfoAdmkIT/lAVclMCziQzV3IKDk9KSn6Fau5HoIgJzNQRwtDvefJuIeNzK8WCym5tR2I6rddw2b6ThBNXcgoh5o0c/op9u4ITPkMlYFvCzSnR/dnGAFA4S8LR9HuFg2XZW/RUVRV5D/+UXB7qckHC2nR7hYNl44VUEVUFxCHX8gotqJaWfpaZY28x78upvdR+lcPNhmvJT8zYjsLO4VZM+lRvG2UTvpIs/rIjB+i1PM+C0KzOsiMHwTcLycLdadHze8Y4QxdAAsz0e4WDZdftkddVB5kP/5RcAoQDzkLRWQ/flBwhqmCZQtAs3rIjB+8W6NBCz25tXCB6vBoCzX6FlAHUcgosz2nUPprK3kYgyDPgfYYCwJQR1HIKMRyXhL6Byt5GIMgIphqawt3UIdeyCgTxEs7+jUreRiDICjlzl4LTqeHSFIYh5fYQwtv0a4WDZeodgAIVFuljL7Hv9Hp5lr6HbO6yYwfRzYkDwsw0a4WDZepVxACVHqFnjHpUcxpCzT6fMWZMelRAPxTavoyufUciOofRJ4c+kJQB17IKHSC8gP6BCt5GIMgoqiUVQsbpwdIUhhj8mclCzvR7hYNlw0qLAdUT/M6SYwfLSsSIgtM0e4WDZc4bHk2VDdQBlDIKLP+D1f6L2Q/flBwZcu/OQtKDzYZryX2zrNUCw6QRlDIKDtoHFv6SRCHX8goipoKPfoJUMdfyChsPKFl+iP2Lg1M+RwkpS4LBFAHX8go1u8iFPpWK3kYgyCK8Jk3CxynB0lSGHAaBhgLX9HuFg2X0w7ralQoZD/+bXB8RMxzCzbF3jzpUT6o/F/6Q9CGUcgogu9NKfoIpwdN6xhZoVBoCzjR7hYNl2P0lDlUDhABUcgoghJyZ/pX5Yu8x7/9BKpZ+lIQwVHIKC46tkD6af6eBm+e67yqJwtbEIdcyChmB8BX+lNQx1zIKL79swX6evYuDUz547ImHwsxp8d2Uhg2JOxsCyHR7hYNl9luoSdUMGWXggAAXugiGAsF0a4WDZfbPDQ0VFZF2DDpUdtyf0z6Lg82Ga8lltCkOwsDaKqXyanAE89qCxH35ENlU3kRzYYESaNBYQUAAAAWEBwUAATL/MYECAAAACEdEAgUAwIABJKVRlAMAAAAPR4SEB0hHRAIFAMABOap9FYKAAAAMhkQAxASBRQDAAR+ykU8EQAAADkEHBAfHhgVIx4eBSEQAwUABIRv61YHAAAAMjcDEBwUAARBYKcqBAAAAB8UBgCuQK2DQeWlQSAywjFLrvH9ehVN4XDA+gZitK69QlpOALHp34H5y0uuATntdPp+c8B+9nRLrunyQzz6fnPA/mYCS667+8EH+n5zwP5AIEuuWA/fF/p+8zAXbl9KrhwC+CL6fnPAfh51S67+S7V5+n7zyKhSVUqu4CFdF/p+06Mb0lpKrp3cHy76fnPA/pIZS66eeFFW+n5zwP43CkuuXmI3CPp+cxD0ohtKrv7JcmD6fjObFlJSSq5sr1U3+n5zwP58JEuuYbUgIPp+cy8WUlJKriO/GjT6fnPA/t0BS66qVXha+n5zwP4/CEuubKl6EPp+c8D+kApLrrxBOgv6fnPA/gTXS64kBkYr+n5zwP4ACUuu/3H6Fvp+88rSLX9KPQ5CSQB+AcqKNBZ2MwRxdAiZbYVZM+lR8wDtAPops/rIjB/8CDJIC3Wnh03mGLK0ABYLdtHuFg2XmMEdZlQbszrIjB+gpchJCxDRrhYNl/FJ8HdUT+U2sce/g2OgNPoLDzYZryWXhO9BC2uzesiMHyM3rzwLO7O6yYwfmYIMXQtyp4dL4hjd8+spC2TR7hYNl2/WKxxUfMWZMelREiHLK/pL0e4WDZccWmF/VCpkP/5TcGS6AFgLT2Q/flBwN664XgtFDzYZryW4IwoDCybzOkmMHykBCyILT7m1HIjq4xgrT/o4EA1RyCjsw1BA+hErOR6DIGUIVXoLG6cHy2cYwA9YVgsj0a4WDZe4C4hiVEGF2DDpUTjemVb6H1BMUMgoZ+0KVfpR0IJeyCjoYsFB+lsQzV7IKPW/cRn6EvbuCEz5VGjeRwscEA1eyCh8jKQN+kv27ghM+RDgy0kLShBNXsgoxdINd/o7KzkegyCXOX9DC3mnR8hnGAZO1DELMtHuFg2Xo0krTFQOkIxRyCiT+2Bp+nLRrhYNl967sxxUBOX3vMe/lfXTevpLDzYZryX+XEB4Cw7QzFHIKKk3Tg76eL5Eg5ueg0j0GQtq0a4WDZePTxd1VF9kP/5TcNlNflULBqWpggAAyUUoDgsDaKoXt6ll8FMsC3DRSjZeBXURzYYEl1xAQgUAAAAWEBwUAAQjZHUDCAAAACEdEAgUAwIABGn7vG4MAAAAPR4SEB0hHRAIFAMABAI9AXYKAAAAMhkQAxASBRQDAAS1YroaEQAAADkEHBAfHhgVIx4eBSEQAwUABA6CwD4HAAAAMjcDEBwUAATYgVZYBAAAAB8UBgCu0RJ5XHW8huii9S9Lrt50uXHwqdCww46PS64hcl0wFi/L3ntxNkuubPIZdfp+c8D+3BlLrtstDkj6frONtHJXSq7TDXk2+n5zlp6fA0qu41EAY/p+c8D+zBVLruyy5zT6fnPA/isPS64/B5s9+n5zwP5iDUuusds7YPp+c8OWnwNKTg5CSQAZAecvyDkNMxUxFwiZbTm1cIHqDvtFX/pVkM1cyCgQgoYX+maruR6CIP3tGT0La73nyLiHFnErLgsFubVwgeqJmENb+jAQTVzIKPOznGP6L/buCEz5u1c+GQsVEI1dyCiTuNIE+jArOR6DIPDafzkLNaeH92cY1yTVMQsG0e4WDZdh1pZpVHXkP/5RcLQhCS0LKdHuFg2X9ft9clRRZD9+bXCJPo1QCyNQ31DIKI59Jl76Vw82Ga8l6hpuJAt3p8fKwhil4zktC1HR7hYNl1sAdw9UIIVZM+lRpeAzA/pY0a4WDZfbkzwbVHDlRrHHv8gDjkP6Kg82Ga8l41nWGQsX0B1RyCjfWdxS+jMQXFHIKDFbqRv6KPbuB0z5HiNpWwsdEJxeyCiuOmJg+gQrORGDIAhdI1wLDqeHyEEY25UqSAtp0e4WDZelFS8oVG6z+siMH4c8mHMLa9HuFg2XnHgpG1QKpcW/x7+jK7An+gRFmT7pUaFK5wv6aw82Ga8lR1uQAgtHszrIjB/kX/IFC2S5tXCB6sQJVi36YBAcXsgouSKDGvpB9u4HTPnimlZDCz8QXF7IKLGYlVv6FfbuB0z5AukxVgs/EJxfyCh8PdQ1+igrORGDIB/eA0gLQKeHyUEYy2Cjdgsg0e4WDZe3aKgbVB+zesiMHwpiiQkLJdGuFg2XA/CZeFQUpcS+x78IDRJl+i8PNhmvJQ/jmFULOLO6yYwfTJ3WAgsV0a4WDZevfdELVGflRrzHv7C3pTD6VMWZMelRHEc/Ivp3p0fLwxiofk1wC3/R7hYNl5lWhWlUG1AfXsgoZD/LSvoJZD9+U3DIb0QOCxLzOkmMHytWRhgLNFBfUMgo0xfINfpyp4dKwhi4kbpCC2fR7hYNl0Ocmg1Ua5CfUcgofIUoUPpj0a4WDZfL/QA+VGAQn17IKOXCb2v6GA82Ga8lVoTDewtquTUciOob5nlr+goQHF/IKCZwOTz6RfbuB0z5tdt+CQtvEFxfyChOMaIO+mH27gdM+W1QHAYLUKdHyUEYeHY1UAt30e4WDZf9SuA2VADQ31HIKPnJTFT6ANHuFg2XGYhYF1RlZD/+UnBLS3V8CzClxrzHv7cm2Hn6Yg82Ga8lNwIVdgsbvleMfZ6RwP0HCyClnoIAAC/m4hYLTWiqF9WpkP0dFgtBT63vC1d+Ec2GBPgkyQMFAAAAFhAcFAAEa3KifggAAAAhHRAIFAMCAATBrZYvDAAAAD0eEhAdIR0QCBQDAARyOERACgAAADIZEAMQEgUUAwAEQhjhTBEAAAA5BBwQHx4YFSMeHgUhEAMFAATqM0dIBwAAADI3AxAcFAAEjOBfCQQAAAAfFAYArtTYHymynwnUUCPyy647Iq4lFi/L3ntvikuustUSVPCp0LDDdj9LrqWQsWz6fvOUK8R9Sq7NIxZy+n5zwP4gKUuuCcD3Fvp+c8D+RB5Lrsbkgxb6fnPpLcR9Sq4MXqE0+n5zwP64BkuuorCQT/p+c8D+3BpLru+HKw/6fnPA/vISS64qJJI9+n4THK6pVkqu6d/8SPp+c8D+/3dLriOPtAX6fnPA/h4eS64BHSUc+n4z7waKYkqu18oBS/p+c8D+h3ZLrnW9CnH6fnPA/gTpS64f5K4I+n5zwH74dEuuugRyFPp+c8D+JCtLrlwJkCD6fpPcrKlWSj0OQkkAaQEnl0NYQTNLRG8ImW1QzVzIKJvAtET6eJANXMgohJJNc/o4dmkIT/kYJwFRCxSQTVzIKF7BjTP6T6u5HoIgNlNbXAtTvWfIuIdElxMLCyXR7hYNl1ZxGXZUA9BNXsgowaaxBPpxRVk86VGYdq5r+kfkP/5RcNjdAT4LWIVZM+lRL//sePoGp0fMxxha+Y07CzjR7hYNl/a0lw1UJrP6yIwfuDPSKwss0e4WDZeeuEcKVCAFWDPpUaxB3FD6ZCWHvse/IpF7CPooDzYZryUyY2EtCx6zOsiMH0FSNiMLfLN6yIwfiYmPfgt70BJRyCjMYgQK+nkQXVHIKOw7WSn6SCs5DoMgkzPuPwtLEJ1eyCjIcpUS+hD27hhM+Zti3hsLTKeHyEcYdpCAfQsQ0a4WDZeu7XIDVHOlRr7HvyNyRUv6PrO6yYwfwmb0PAs60BJeyCibI6Yq+ioQXV7IKM5dNmj6Bys5DoMgkJvJRAs8EJ1fyCjLMHkC+iYrOQ6DIOO/SR0LTaeHyUcYN3udVgtm0a4WDZeJiUNOVG+lhrzHvwKswkj6QsWZMelRmXaHTvp/8zpJjB8/4uFcC3JQXFDIKIwm2Xj6QpCcUcgo2lZSFPob0NxRyChLrHIQ+j2+VJN7ngVJsCILP7l1HYjqBmnGYPoVEB1fyCgurTld+m727hhM+Sn5gGELaBBdX8go32G9UfpU9u4YTPmZmOwSCwKnR8lHGCrwITULbdHuFg2XvnlWRlQZpZmCAACNrPstC0TRrhYNlxir1TlUNWVGvMe/9xVCfvoODzYZryWYtS5IC0BoqhfXqZH0gyQLTC/Al2FKfRHNhgTXEa1BBQAAABYQHBQABBXbU2gIAAAAIR0QCBQDAgAEnAbHFQwAAAA9HhIQHSEdEAgUAwAEZlDXTAoAAAAyGRADEBIFFAMABCwGynYRAAAAOQQcEB8eGBUjHh4FIRADBQAEdIIHBwcAAAAyNwMQHBQABLUwehkEAAAAHxQGAK65UI5CBHA2QaCoIkuuiNcTRnGg2kAF2tdLruyZ2Qdqvmy+ALDqy67VpGBw+n5zO3C+W0qudLq1Z/p+c8D+7CNLrqtNuwT6fnPA/pQKS66sb5Nl+n4zx/1uV0quPo+NHfp+M94u0l9Kru5/THT6fnPA/uEIS67XTvIv+n5zwP52CUuuRca/S/p+kw2ApFVKrkqD30n6fnPA/jgRS64NILNv+n5zwP70IkuuEtVnLPp+M9Sol2VKrogzxV/6frO3FDpcSq74m1YU+n5zwP4cFEuuFjZXT/p+c8D+1CpLrk9iiWH6fnPA/sTtS1oOQkkAPwCsqXoUdzMgcEgImW0/OoGdfYCu9RALDbk1HIjqOOFKF/onEA1TyCjJhmlp+j4rOR6DIDJIFUYLCxBNU8gotm0aLvpT9u4ITPkFKcgDC1MQjVDIKKESIib6VPbuCEz5o/AfUgswp4fKZxhLpq4YC3DR7hYNl6k14lNUEKWpRQIASy7EWAsC0e4WDZchoORxVB1kP/5RcE7e52ELU4VZM+lRhdBvRvprDzYZryWodfkbC0doqhe3qQmH/wQLSr904SUWYhHNhgRV9mpfCAAAACcYAhgTHRQAJeG5ZVoArnJscG36fnPA/kUAS66nZ5A++n5zwH6jdEuudAgkNPp+c8B+bHZLrndanTX6fjPmBopiSmkOQkkAPwGUFcUbGzMoDGUImW05tRyI6laJNG76epBNXMgorHFpD/opdmkIT/nZXNEmCyOQjV3IKM/02SP6D3ZpCE/5GgMoGAsOkM1dyChxYGsb+nmruR6CILYpG0ULFb3nybiH8VQ/eAtapwdL4Bh+NARwC2bRrhYNl3MKtU5UOGQ//m1wvKYeLQsP5D/+UXCXhS91C3eFWTPpUahhdkP6WsWZMOlRpgeEPPoe1aRNoS3BsMQmCxnQRFPIKM9ln2b6VSfjgI3w0ZYudQtV/hwEa57GtchlC0u+nARpnmp85FsLcr5chGiediK2IAthhZkw6VFxMfgm+haVJMyhLWtlxX4LUKeHyOwYcFn6Pgtz0e4WDZfwPXV5VB6QxFDIKIUFXj36D9GuFg2Xn+e9T1Q1UARRyCgdhElN+m8PNhmvJVBxpl8LXr6chGuekTSNBQsXlaTMoS3AYHNmC0y5tXCB6uqRTmf6BVAFXsgoofrLaPp/9i4PTPlMzfEnC0VQRV7IKIcHTgT6byt5FoMg5ZGjLwssp0dIVhiw3eJ+C33RrhYNl/DL3EVUbZDEXsgoU9H9EfoWkERQyCivRG8Q+iQlD3qFW1HdvzgLTyWQQwYAsgCpYAsdEMVfyCis1eZg+hdQBV/IKI0qREn6MSt5FoMgc42cCAsFUEVfyCjwVHx1+gYreRaDIMvhJUYLRKdHSVYYflKcCwtU0a4WDZeMW955VCEFWT/pUbrOhC36fyUQQwcA7fXnKAt5uTUdiOqSxqVv+glQxVzIKOIuFG/6ECt5FoMg2M4yEAtRp8d2Vhg8W1VvC1/R7hYNl/XXq11USCWQQAQAjJqQTgth0a4WDZeYXe9eVBYQB1zIKIIdCmz6SQ82Ga8l8EOuJAtRvlwEa55fxuE1C3ZoqpfFqW3B6DwLfoMOfHoofxHNhgTJXGZmCwAAAB0eEBUCBQMYHxYABDCcrToFAAAAFhAcFAAEwS5YcggAAAA5BQUBNhQFAASvx9lxIgAAABkFBQECS15eARACBRQTGB9fEh4cXgMQBl4GGhoIG0c/SAAEbsGpcwsAAAA2FAUiFAMHGBIUAAR+uZpwCwAAACIFEAMFFAM2BBgABKUOSWkIAAAAIhQFMh4DFAAEMNDPEBEAAAAiFB8VPx4FGBcYEhAFGB4fAARwzG17BgAAACUYBR0UAATB0ko/CAAAADwQFVE2JDgABPvM3F8FAAAAJRQJBQAENiYsVwgAAAA0HxATHRQVAAT7F7guCQAAADUEAxAFGB4fAK68DhVQ+n5zwP4EkkuuYDV8B/p+c8D+9whLri3Eenf6fnPA/gQaS65l4xdC+n5zmu8mUEquUSbbKPp+83vrpWVKrpMV2Sf6fnPA/iQYS64AwaMs+n5zwP6Hdkuu/js4OPp+E7P8sFhKrphv7mT6fnPA/isHS67n40Vl+n5zuAqsGkquS4WrdPp+c8D+qhVLrr3m+Gf6fnPA/kAOS66AEFww+n5zwP7EKUuu49O0fPp+c8D+xOpLXA5CSQBJAUNnYzI8M3APZAiZbTl1HIjqiHM5RvoqkE1cyCinMoVV+l92aQhP+YyTe30LbJCNXcgodh4RbfpfdmkIT/lcysA9C2W9p8m4h9eKpB8LN6cHSfoYTPfdFAsa0a4WDZczNZlUVElkP35tcDECZz4LNOQ//lFwHJsNFAtW0e4WDZeDTdhNVHAFmDHpUTHtdwH6VaVYsce/damsffoJhVkz6VHusE1D+nPFmTDpUVU24Qz6R9WkTbItLWUKSQsCubVwgepmIABv+kjQE17IKHKkfmj6JfauGUz5uAL3MQsY0FNeyCjYT5xE+jz2rhlM+Rz3xzoLTdCTX8gooXF3evp/9q4ZTPkQWaFFCz2nh0lFGHHvGlMLFdHuFg2XsJ4bKFQSUF1TyCjuq1YL+n3R7hYNlwaufihUGSUYvce/dH4oQfpVZD/+UHD1fPMoCwAPNhmvJSeOxGELc6fqgI3wxPTJKAt5fpUSRp71Tq5SC3Y+FRJEnpRAvxwLHD7Vkkeez98TSAtMhZkw6VGejksy+i6VJMyyLVG+qRcLJhDdUMgoa1vQb/pXPhWSRp5ODSgcCwCVpMyyLbkNK3YLApATX8goOF/GD/pA0FNfyCiA8cU2+i32rhlM+epGyksLetCTXMgoIna7O/pLK/kPgyCY2z9aC1XQ01zIKMrbAgf6Eiv5D4MgoCe2fAsxp8d2RRho/kQ2C1HR7hYNl9qL+RNUQdCTU8gov+xlevoDkJNRyChCiWVi+igQXVDIKEWlg3X6BqUxeoVb0E5GYwt5pZtDBgD1WB17C2TR7hYNl5NgJg5UUYWZMelR25rEffpABVgw6VFy5mtf+ialG0MHACYbV3ALIaWbQAQAGsHUPAt7PtUSRp7x8WAtC1hoqpfWqSky8zoLUZ8lpkJzfhHNhgRDwa9FCwAAAB0eEBUCBQMYHxYABFjeYx8FAAAAFhAcFAAE/Gg5MggAAAA5BQUBNhQFAAT3NdBlIgAAABkFBQECS15eARACBRQTGB9fEh4cXgMQBl4EBkMhQxcTKAAEOHcYcAsAAAA2FAUiFAMHGBIUAAQuvs4eCwAAACIFEAMFFAM2BBgABKOOUEMIAAAAIhQFMh4DFAAEDU+LWhEAAAAiFB8VPx4FGBcYEhAFGB4fAAQOJV4GBgAAACUYBR0UAARjRGJyCAAAADwQFVE2JDgABBea7R8FAAAAJRQJBQAEXwcLZwoAAAA9HhAVGB8WX18ABBp/kUoJAAAANQQDEAUYHh8ArhyfXTD6fnPA/gSSS66uhHVK+n5zwP7GAUuu1zieUvp+c8D+uAdLrhfG/H76fnPA/nAlS67VP8JW+n5T0qqpVkqum0jtPPp+04PscVBKrhBICwn6fnPA/hoIS65g3U5X+n5zwH4VdkuuI2+eRvp+c8D+QgxLrtPJezP6frPfGRxtSq4FzhVW+n5zwP4/AkuuMm2CQfp+c8D+GhxLrqGUlRT6fnPA/mTWSxQOQkkAGAFPzDsUITNIEDQNmW1QjZ/IKDgyFWb6ApDNn8goIJG4QPpDdmkIT/kWpfJGCxWQDZ/IKBO/4HT6b3ZpCE/55QTkDQsjkE2fyCiYRwY6+m12aQhP+YS/sgYLCZCNnMgorOodV/oMvSePuIeWnJgwC1qnBwBvGM9pl1kLZNHuFg2Xyk6+FFQ55D/+UXAyirEbC3/R7hYNl4QU6GtUXGQ//lFwxchNJAtb5UT8x78L4qEK+ioPNhmvJb6CT0YLZIVZM+lRN62MKfoPlWRNsC0n1fUAC0jRrhYNl/sNpW9UBtDeUMgowZOrC/ppUB5TyCjBgOFh+k1+Vg18nipDJ3sLNJXkTbAtiyeYDAtGUJ5QyCiBDmNP+jjlNnqFW/Spdz0LB2XewgAA/s1SaAs50a4WDZcIUzpIVGRFmTHpURKj+3v6LGVewgEAgLPRZgtBZd7DBgDzW/pXC2p+lo1/njha/3ALGYUZPulRWcC1ZPpjEJ5eyCgPyelc+lV+Vo18ntf0fEMLd0VTBGDOoD5WCAsP0S5HDJcCFNIcVCq5NR2I6lglF0/6bxDfRsgoknFPAvpHKzkQgyBkmnM+C2cQH0bIKJQqeXL6JSs5EIMgdYzADAtspwfwQxijOAseCwLR7hYNlw9WEkJUDIVZM+lRLRVSHPpE0e4WDZcnBTgTVFRFGTHpUeaNPGH6LdDfRsgoQriYLvogDzYZryXgSLB4C0iz+suMH9zl32gLF9HuFg2XgsgrV1Q3ZD/+bXDtMvUCC1dlBLjHv8sa4C/6LrM6y4wfIqbjags+s3rLjB/c7WFqC1jQnEfIKEYzVWL6NBDfR8goRLoGbvp/9u4GTPlrFC5PCzKnx/FDGKp9Dl4LBNGuFg2X2KNSe1RhZD/+U3DHimwhC1CzusyMHzXKJzkLfsWZPOlRIhJHZPoz8zpMjB9eG9MtC26nh8veGB3QbHsLLtHuFg2X1H03d1Q5hRk96VG2wkhe+iYQ3ljIKB0wcBD6O1BeX8go07mAIvo0p4dz3RiOVDc8C2/RrhYNl8OBCBhUA2VEp8e/rIF0IvpDkJ5cyCgX1ZJi+l6nh/HqGDjGdGYLYtHuFg2Xj7rPXlR8xdk86VH2C85C+nNlBL/Hv2wAMU36B9DeXMgojNc7dvoHvlaNf57yffZ9CwTQXEfIKBTlnHP6fBCfRMgoUeWUAPp89u4GTPmAdeBCCzwQ30TIKH0OG2H6KPbuBkz5yDeKVgtHp8f+QxjDisVuCxPRrhYNl2C1AxBUKdBeWMgoUJawSPoLpZ+CCgCwFsFJCx2FGT7pUdrXni36dRCeXsgoYRcCHPoFfpaNfJ7p92VNC0uFWTPpUXeKBBD6f7P6y4wfwI9sawsDp4f13xjfzJpsC1fRrhYNl4NgjzBUCYUePulReWRkPfoeszrLjB8osD9BC0DQXETIKKJSDm/6GxCfRcgo8JrkQPpmKzkQgyBceuRiCzoQ30XIKN/S2gf6H/buBkz5QUhBcwtKp8f/QxiukxBsCxnR7hYNl7HHFytUQbN6y4wfuDZVPQtY0e4WDZchl3lZVAilhabHvxIvXmj6bQWYMelRv2SfLvo0DzYZryWk1gpsC0OzusyMH2TCulALXcWZPOlRGpnuO/p/8zpMjB+xIawWC2XQXEXIKIXNblb6cRCfQsgoRDjyZ/oIKzkQgyBCGaEcCy0Q30LIKGXfwlz6R/buBkz5/sZDEgthEB9CyCibNAd++i4rORCDIBYAi1gLRacH/EMYYPNHEwtR0e4WDZchWFdYVCtQXl/IKJU+3Rn6V9GuFg2X/yneL1Q0ZD/+UXBMRMI1C1MPNhmvJSaTkhELOpCeXMgoAkruL/p9p8d/4RgibZIVCwXR7hYNlwLWGn5UCAUYIulRUyKNCPoNRRg66VEKu410+nrQ3lzIKETrqTH6Ir5WjX+eRXvgJAsP0e4WDZfQfdF7VBIlRKPHv5l1inb6BiVFuse//aizb/oApZ+CCgDhnD1cCyfQnEPIKBH7PzD6fhDfQ8goiZZUBfoQ9u4GTPnlg3plCz6nx/1DGKOfjzULIdHuFg2XtP0gPFQUpQOhx79EC+x2+mJFWCXpUQas2X36X4UZPulRMTu/MfoNp0fw6xhA0t1jC3XR7hYNl5KRnyVUShCeXsgo20Z6UPoZ0e4WDZfzgCYgVDXFWTrpURO9OAb6CmXEpse/e4UpXPodDzYZryVHsgs+Cy9+lo18npAp0WMLEYVZM+lRyBgIXvoIpwdK3xhtsRxNCxbR7hYNlyj1439UbbP6y4wffowIIwtJ0a4WDZf73kNYVFLFWTvpUflTDD76HQ82Ga8lAR6tKwtCuXUciOqolLMR+hwQX0PIKJyzaGD6aSs5EIMgjrSHIgt6EJ9AyChHH9Na+hH27gZM+eKNiFYLFxDfQMgoOdXDXvpP9u4GTPmvo5wKC1unx/pDGOiYh2ILF9HuFg2XXPPMY1QMszrLjB8lPJwwC2XR7hYNl89KUwRUdBCeXsgoeYFJEvob0J5DyCgjRicN+nYPNhmvJbmXe1ILW7N6y4wfe6Jzcgt9s7rMjB+4TQ5bCwLQXEDIKNoQEQr6QxCfQcgoPWmcePo/9u4GTPmUh009C1QQ30HIKO8I1Qz6afbuBkz5BMNMNgtMEB9ByChh52Iy+jUrORCDILtB5DcLMKcH+0MYkdGoYgtH0a4WDZcFa1RnVEBlRbzHvwki6G76McWZPOlRaEmgbPpFpwd00xjezDE+CxzR7hYNl3HJIQpURfM6TIwfKvRXXAsr0e4WDZcM7bMnVH8FmCLpUe54Eh/6WJBfXMgopgsXPPpbDzYZryXTVoVFC0ZQXl/IKMEcjmL6IpCeXMgo3dyLWvoP0N5cyChHN+9/+ka+Vo1/nvRlfy8LN6WfggoAYU+LQgtchRk+6VGA4jJj+lwQnl7IKG6L7xP6Cn6WjXyenSJvdAsy0a4WDZdrD90OVCnFHiPpUfyxSRb6RIVZM+lRh9iBBfpb0JxOyCggcZw1+ncQ307IKM6DNHj6YCs5EIMgvrftQQs3p8f4QxhwhG8tC1nR7hYNl2dM4HlUXNCeRcgopzbIavobhVg+6VG86U9l+kSz+suMH6ud3mULX7M6y4wfetxYMQslpwd4whgUj2EWCwbRrhYNl4MOOlpULWQ//m1w36weYgt/s3rLjB8gzP8XCx25tXCB6gZvoAr6bRCfT8goAk3mSfoS9u4GTPnYJ5BFCwGnh/lDGMIlZ0ELBtHuFg2XNu0sbVRis7rMjB+U9wsXCx/RrhYNl5zfDAVUeIVeMelRAMlhCvpoDzYZryUC3XFiCwfFmTzpUf+BEXL6ePM6TIwffqdNJQsvUF5fyChGiipM+i+QnlzIKHtdbXj6cLm1cIHqvYzOLfp/EB9PyCjV/JwB+gf27gZM+VRL3RULeBBfT8goQOXlSPok9u4GTPlawpwsC0AQn0zIKPE9uQ/6Z/buBkz5DkB6Fgtpp4fmQxiFrVhaC17R7hYNl3cfXldUA9DeXMgoEq+bSPoS0e4WDZdy0pggVB5FmD7pUW22/nv6cWQ//m1wA8NdSwtaDzYZryWDuWwNCx++Vo1/nlK0yHcLWqWfggoAtcbeIAsahRk+6VE0dOMZ+lQQnl7IKESuhlP6Qn6WjXyelBQaBQtlhVkz6VFVmbJM+h6z+suMH6agI1YLYLM6y4wfOXKlSwtJp0f6/xh8hjJZC3rR7hYNl4s6rnBUCLN6y4wfoArXHQtG0a4WDZd39oVYVEilQ67Hv7G5mWb6Zg82Ga8ley0LUAsPs7rMjB+roiIDCxDRrhYNlxYObzxUOmQ//m1wyI5JawspxZk86VGapw4t+lHzOkyMH79shx8LdafH5u8YgwasTQtB0a4WDZdhTewVVBjQ317IKL/Dfln6cVAeXMgorB+cNvoqkF5cyCjstSs8+kDQnl3IKEboeVL6Mr5WjX+emcMbGAtQubVwgeq590dq+gQQX0zIKFoJ+QH6MSs5EIMgn2I2AgtYEJ9NyCiMKhc0+jP27gZM+W/64AQLQ6eH50MY/ikjPwt00e4WDZcGDvEoVBGln4IKAH8gDDMLLdGuFg2XFNwmM1R5hZki6VHMKHQq+mQPNhmvJcdbNi0LL9HuFg2X+DiyclQFZD/+U3BqCzZtC2ZkP/5tcJixPxILPIUZPulR/FDyKfoPEB5RyCj2STU9+lF+lo18niXvMngLa4VZM+lRVCGfUPpmp8d32RjsxxwnC3vRrhYNl6QGqk9UR2Q//lNwJi/xQAsZs/rLjB+0Ha08C1KzOsuMH92271gLZLN6y4wfVPUMSQsks7rMjB9K3zl3Cw/RrhYNl69yPA1UWJBeW8goFviOB/ozxZk86VHxBEUj+junR3rsGDD6GxILfNHuFg2XvdndQ1QbpYS5x7/YQ8NF+ndkP/5ScE8c0wkLdfM6TIwfETKiBgtu0BxNyCiucph8+jwQX03IKPJeLEH6TCs5EIMgdAfxBQs3EJ9KyChRAhsq+mIrORCDIKP9OCMLExDfSsgoswRzcvog9u4GTPnmctQsCwinx+RDGMj9eh0LbdHuFg2XnNoZRVQaUN5dyCgJbGsC+mTR7hYNl7KJkElURNBfR8gobKiuSPoVEN9ayChvYV9U+ioPNhmvJbToHDgLM5BeXMgodjPBAfpJp8dK2hjpfBMQC0fRrhYNl0ifcktUaqXDvce/O+8aaPoM0B5dyChyQKRj+iq+Vo1/nhjfLAkLVtBcSsgo/9yZLvokEJ9LyCgsmbgQ+g8rORCDIJ3QtEgLcRDfS8gor2xgT/o7KzkQgyC5cTN+C1inx+VDGAiWqTILbtHuFg2Xra/NclQiZUSmx7+DHnMk+jjlRLzHvzu4TnT6K6WfggoAb2MxeAtb0a4WDZftMA9/VHZFmCPpUQd+LmH6WoUZPulRpkU8A/oqEF5dyChWyCpV+kF+lo18nkS6ZyALEbm1cIHqwNHKCfoaEF9LyChYi6cR+iz27gZM+aaN5jULJBCfSMgoKr+IM/o4KzkQgyBle8JMC2Knh+JDGKZ7h1sLfNHuFg2XaCXINVQppYS+x795KIQW+iHQH07IKE9SplT6KYVZM+lRJPB4Rvov0e4WDZdw3MAXVDcQ3lDIKPu2dzL6LtDfQMgoHigBV/o4s/rLjB+QyHBDCzanh/bdGLz8uAwLHdGuFg2XOspTHFQN0B5OyCj5dfMa+myzOsuMH+VfiU4LGLm1cIHqhiZXXfpGEB9IyCjEOTts+n8rORCDIC5bzgQLOxBfSMgoiZfyXvoVKzkQgyB2o4F/CwIQn0nIKMZFV0D6Nys5EIMgqBaHQwtip4fjQxhmsFhWCyvRrhYNlxl0b3tUcIUePOlRq4yqefpRs3rLjB81CflnC2OzusyMH93qWVULfafHfNIYiXqAYQt80a4WDZdOaQAsVC9lBKDHv6QEjUb6TsWZPOlRfULOYfpJ8zpMjB/qoeNaC35QnlrIKIOkvUP6DpDeWsgoGJ4VPfpGpwf14xi1efUqC1zRrhYNl/mV/FhUHeVFoce/gxyiLvpU0B5ayCgJLCN4+gu+Vo1/nmFDJnMLKrm1HIjqgB1dR/pwEB9JyChXlAgS+ir27gZM+fF7HXMLfBBfScgoocw/MPp59u4GTPnTsRhxC26nR+NDGN9gAR4LB9GuFg2X4+iUD1QvZD/+bXDsj8NOCzGln4IKAPk1fyALd9GuFg2XTNrdXFRFhV4g6VEY1mke+kiFGT7pUWBSxG76NBBeWsgoq2uuRfodfpaNfJ5CDt94C0q5tRyI6tqu4TT6ABDfdsgozO9IBfpVKzkQgyC+IbUJCwEQH3bIKP2Pr2f6Vis5EIMg3t4GPAs3pwfgQxjYoOJVC17R7hYNlwCGC05USYVZM+lRygMbHfpO0e4WDZfcs/UoVCNkP/5ScFuhlkwLKWQ//lNwfZJjTgt9DzYZryWueTQ0CwCz+suMHwxy0S4LLbM6y4wfCKwnDAt/s3rLjB9gh7UBC125tXCB6uwkoWT6VRCfd8goZq3OA/plKzkQgyBOrPFEC3AQ33fIKCIuhmn6SPbuBkz5T9Q9fgsOp8fhQxgNWjZIC3jRrhYNl2JRa3VUadAeQ8goI4h0Ifp+s7rMjB8FPjB3C1TFmTzpUf72CSv6IPM6TIwfgquCCwsip0f50BgRYehQC0/R7hYNl01UbnxUN2Q//m1wh8FxTAsEBZkq6VEkvP8m+ltQnlvIKCU7R3X6aJDeW8gog6NdVPpe0Fx3yCj4jN1S+gAQn3TIKNs4Z1r6aCs5EIMgDJ34BAssEN90yCgGUsBk+mD27gZM+VevxCQLPqfH7kMY4FHgYAtV0e4WDZffmsQHVEvQHlvIKOp6V1/6MNGuFg2XVUG6NlQ3pcSux7+5Ky5U+mEPNhmvJXaJDVILQb5WjX+ecxi2BAs0pZ+CCgCHkf9oCw2nh0jCGBa1ACQLZdGuFg2XinYwIVQiEF5QyCiPxt4Y+l+FGT7pUYXBUiT6FhCeXsgoG/ciFvohfpaNfJ4vu0AkCw6FWTPpUbHvhk/6fqfHeeYYMIC9Owsq0a4WDZesOOd9VBLQH0HIKHMQ6G76JrP6y4wfuSftLwsBszrLjB/TcSUlC3azesuMHw1hECULPbO6zIwfjEFJFAtzxZk86VFvIGkM+hDzOkyMH+AOjnsLJrl1HYjqog6ef/p3EF90yCgW2KcI+n/27gZM+aMKlT8LAqdH7kMYF9mRJQsB0e4WDZfva2AxVHBQXlvIKH/+EDX6PtHuFg2X0sLoC1Qo5QXVx7+YLyFo+lUlBarHv/g0eiX6Jw82Ga8lOwQORAtykJ5YyCidOh5F+kLQ3ljIKPzBUl36Ir5WjX+ekc/jPwsqp8fn7xjf0GJ9C1vRrhYNlzurdUtUMZAeX8goDoeLCvoFpZ+CCgDuUaIlC32FGT7pUTiP9A76V9HuFg2Xu5G5dVQ8RVgz6VGwHyhr+ntkP35tcFPo5WwLbRCeXsgo6bpadfo/fpaNfJ5tzSxMC2anh2TwGFB77WoLfNHuFg2XQux9VVQ+hVkz6VFiuatN+mXR7hYNl9RL2kxUCWQ/flNwLLNCYQs9EB5MyChZ8WUa+mUPNhmvJRBB0z8LFaeHzfMYiqzuBAtK0a4WDZfduas1VABkP35TcFNsRGYLL7P6y4wfLciEGAsOufUciOpCFDMZ+hAQ33XIKCswE2D6afbuBkz5cT8oPAtIEB91yCi0blgF+lcrORCDIMSv6UwLHhBfdcgouxuWVvpY9u4GTPkWvWw/CwCnR+9DGHG+wQULDNHuFg2XxxmBY1QlZD/+bXA2W2A4CxwlhL7HvzganRz6UbM6y4wfAktoPQsPs3rLjB99LjN8C1WnB3fRGLgOp3YLItHuFg2XffEaOFR1s7rMjB8DyNhYCxzR7hYNl4qPeU5UXGQ/fm1wUKm1YwtFUN5QyCh4T2le+mQPNhmvJduB8CgLBMWZPOlRJUn3A/oJubUciOov9G9w+nwQ33LIKDHTTg/6Zis5EIMgJRXOVQsEEB9yyCjyb5BE+ij27gZM+f1+shwLQKcH7EMYPfx1dwt80e4WDZc022txVEfzOkyMHzqo6lILUNGuFg2X65ZAbVRmpcS6x78/OtFR+mIPNhmvJcWdPB8LV1BeW8goocVcRfo6kJ5YyChP6GsK+mLQ3ljIKPxpxBz6QL5WjX+eHtyPLgt/ubVwgerlQ4J8+jMQn3PIKPBQWxj6Eis5EIMgE/cqYQtBp4ftQxiez4UACxXRrhYNl084HwBUcmVFvse//UkDXvoPpZ+CCgAno3RYCxiFGT7pUbt54CT6UhCeXsgorqp4a/ocfpaNfJ7KUEByCw6FWTPpUQxd93b6QqdHStYYnMiQMgsh0e4WDZckhq5qVBhkP35TcBKe0zYLVRCeUcgo5+CBXPpzs/rLjB9AL7BnCwOzOsuMHyeyInoLHdAcc8gorGJPRPpDEF9zyCgn3dZj+l4rORCDIOoxbWYLEadH7UMYvr24TwtX0e4WDZetuRtmVF+zesuMH8ZqwQQLD9GuFg2Xd+pNf1QtpcSix78HLF8V+jgPNhmvJYOMD3cLALk1HYjqoHRWTvogEN9wyCjCyFEI+jn27gZM+b6PbQELdxAfcMgoKXADKPpI9u4GTPk8SWQKCysQX3DIKF+Ewzj6DCs5EIMgO0aCCgtap0fqQxgPsUUVCzvR7hYNl8S+t1NUYbO6zIwfSoRwbgsM0a4WDZdnTrA1VGBkP/5RcF0Ecj4LHg82Ga8lMNaZXAtS0NxxyCibKXEc+loQH3HIKBh8Xxn6CSs5EIMgZwGwPwskpwfrQxhuUTZ8C2fR7hYNl+Y1ozVUWcWZPOlRbJAXFfoK0e4WDZclFApCVGzQnFHIKL10tjb6HYXeKulRsHdOB/okDzYZryVFrTcfC1nzOkyMH4h+HFULKlBeW8gofomOevpEubVwgepr5Z1Z+jMQn37IKJECtEn6ais5EIMgQpv2SgttEN9+yCikFfNh+mkrORCDINbdMl0LLqfH6EMY85K3WgtN0e4WDZdrFB4vVACQ33bIKMegxmv6FGQ//lFw7QijEAsjkB5YyCiQaWYk+jvQXH7IKI258yX6SRCff8gossFeH/oBKzkQgyAKUQhWCxcQ33/IKC4YP1n6GvbuBkz5In7EfwsDEB9/yChPhdV9+nH27gZM+RfCS2ALVacH6UMYdhTgLwsL0a4WDZd5V6laVBHQXE/IKFSqEhz6R9DeWMgogILKd/orvlaNf57O0E8tCxOln4IKAKWN9hELaadHbP4Y+4zRbgsG0e4WDZfHens4VApkP35TcGRWn0gLMWQ//lFwv2FRBgs/hRk+6VHx5k4e+hCnx/TbGH2UlxQLR9HuFg2XsXVIFFQzxRk76VGTzIkU+kdlBL3HvzYfkWn6WRCeXsgolQamMPpofpaNfJ56Yt1sC1rQnHzIKOM6BlH6YBDffMgo2tK8Ofp+9u4GTPlQVmYHC1wQH3zIKGiWvUP6evbuBkz5UT/lGwsLEF98yCgM1stv+mwrORCDIAQg7ygLUqdHlkMYBm60YQt00e4WDZd6ILg6VEyFWTPpUYz8Z2v6IdGuFg2XqPTNNlQfZD9+UHC6FiJ3CxIPNhmvJQEVnX0LaKcHbB8YkYRQMwsw0a4WDZfb0zBCVFMQX3DIKKqB6GL6KLP6y4wfr+2vfAsUpwdu1xhy7WE1C1jRrhYNlxawFFFUSSXE1se/lCc9KvopszrLjB8s2kh7CyS5tXCB6vqVg3T6CBDffcgo0sglWPon9u4GTPk+zkYKC0Gnx5dDGM++DmYLdNGuFg2XfUYjH1RkEB9wyCgaOJZ9+kuzesuMHylEMyMLMbO6zIwf1N7qaAsn0e4WDZc4aSABVB5kP35tcNqTOykLE+UEqse/n/IAOPpIxZk86VHHt+co+kanh0jYGC8Ty28LFNHuFg2XZgJ1HVQJ8zpMjB8bS94jC3DRrhYNl9ff9CFUQYXZJ+lRVXf8JfoSDzYZryUvqfMqC27QXH3IKMfvkTr6VRCfesgo0+2VXvpx9u4GTPnalvhJC00Q33rIKFkjUTT6fvbuBkz54iBiKwsxp8eUQxgAEJ1xCwPR7hYNl2Kmg29UKqWF1Me/8m7BSPoLkF5GyCh5tYkA+mdQXljIKNYtHGz6LNBcesgoQ6PfX/oREJ97yCihYQI4+nYrORCDIFTaPSQLXKeHlUMY6di/UAsu0e4WDZdSH39CVDuQnlnIKKOZmyX6ENGuFg2XilKbBlR6xVkv6VF4KnNs+isPNhmvJWqs8z8LN6cHTd0Y46m9SQtq0e4WDZchsh8UVCrQ3lnIKC1ccRv6PtGuFg2X2buBIlQZhVlW6VFsQsIZ+nkPNhmvJV3ZFCgLFr5WjX+ewP0YQQs+p0fK3xhbppQmC37R7hYNl2wYew5UKaWfggoAjz7NHQto0e4WDZeCzV9NVG0FGSLpUezW0nz6BoUeOulRLmP1O/pvDzYZryUUQ3wLC2GFGT7pUS6fN336dKcHFgwYXWucPQsd0e4WDZfr4L9LVEiF2TrpUYvv1B36AVBfd8goXw7zF/o1EF5ayCiV7+B1+nl+lo18nopGplMLCtGuFg2XlJMGQ1RWhVgk6VHQJDgG+iyFWTPpUSCH2nr6Z7m1cIHqm8ntafoHEB97yCi4ChVs+kMrORCDIHiKgw0LVxBfe8gogB4+avpcKzkQgyDba5ttCw4Qn3jIKBfSfW76LCs5EIMgZPM2MwtBp4eSQxh+cWocCyTR7hYNl+dJMjxUCmWFpMe/lXGBSvp4xd4/6VFb7pQg+iSz+suMH0/a7WYLWacHff0YbrReMwsk0e4WDZflpMcUVEKzOsuMH0UtKSoLJdHuFg2XWwDMf1QPZD/+bXDfFJR0CySFmVzpUW3WLHf6dQ82Ga8lhXjeCAt6s3rLjB9zG+0PC3S5tXCB6vSqrV76QRAfeMgoMn8SFPoJKzkQgyDlm+5GC0kQX3jIKMQ3GEb6EvbuBkz5KFgxbgsep0eSQxi92b4aC3vRrhYNlztbvGFUAmQ/fm1wYc2cRgtFs7rMjB+Lj8wgCxO5dRyI6gbS1A/6aRDfecgoFRy+QvonKzkQgyDEu2QyC0enx5NDGJmMTw4LXtHuFg2XTKtuN1QO5YTEx79hRTpK+ialRLHHv6lG8Bv6QcWZPOlR/he3evpW8zpMjB9WiX8ZC19QnlvIKBs81BD6XZDeW8goiQ4gEvppp4dk8Bih22VeCwLR7hYNl7KrklRUC9AeW8goi9kiC/oE0a4WDZchO/stVHFFGF3pUfW5rV36Mg82Ga8lyKWwVAt1vlaNf57iEpRqCya5dRyI6tsDfDH6NxBfecgovUriDvpM9u4GTPnQ9Id7C2gQn2bIKB2EbxL6Nys5EIMgWeUESAtHp4eQQxi9jUcCC1jR7hYNl1/Z3ABUC6WfggoAf8ktaQtn0a4WDZcz0jI0VENkP35ScMFR5gALJg82Ga8lcJufCgtAhRk+6VHybudS+ianRxLqGAjfljwLCtHuFg2XmQDLMFRFEJ9MyCgXsj4x+hhkP35ScGGWPFILJhCeXsgoG1I1V/pTfpaNfJ7JTcskC2KnB3zjGByda1ALRNHuFg2XFGSOYVQphVkz6VHnABFX+ifR7hYNl9CUgzpUDaXE08e/IsupCfoyhZgg6VGfNVsD+iIPNhmvJYr4uAgLdrP6y4wf6/XyfQsQpwd6/xh5xvF0C0TR7hYNl/EISBxUcbM6y4wfXCFMZAto0a4WDZeW58EPVHFQXk7IKJFfXTf6TA82Ga8loBntBQsvs3rLjB+chQd1C1yzusyMH6MiwAELLcWZPOlRzbupZvoG8zpMjB9rSOMWC29QXlvIKJDSJ2L6VtAcZsgoGUxDT/pjEF9myCgbDbIF+kX27gZM+cOXyRwLCqdHkEMY/Ee8BgsO0e4WDZe48M48VDqlBLHHv1aHIRr6QWQ//lBw9GcmMQsSkJ5YyCisaoc3+jPQ3ljIKKnX/336Z75WjX+e5o25NAtw0NxnyCjMTppy+goQH2fIKEr2TCH6CvbuBkz5FwpHGAstpweRQxgpQm0wC1bR7hYNl7x13DtUARCedsgoAox7X/oOZUSjx7+SnNIu+h6ln4IKAMd5/HQLOIUZPulR1FSUa/oeEJ5eyCgUUKVL+gV+lo18njkvtGoLKYVZM+lRIqoYEPpLs/rLjB/B4M4VCzOzOsuMH1r3CCsLbrN6y4wfFPuFdQszs7rMjB/P+OEICy7FmTzpUdDO/Tr6ctCcZMgolVRUZPpFEN9kyCg7lRhC+nv27gZM+SfVUS0LbxAfZMgoEjj8WfowKzkQgyBSWWhSCzqnB55DGKZRZFsLC9HuFg2XrIpvElQT0NxGyChyEvkd+n5kP35tcASX8EcLX/M6TIwfMGVXHAsv0e4WDZelvWkFVElkP/5TcOq7EHoLVpAfZsgo90vEdPpkUF5byCh5dHEC+kGnB0nVGMjUx2ALCNHuFg2XQS/1eFQwkJ5YyChkyj1T+jzRrhYNl4HOrjlUL+XEpce/L+jJdvpwDzYZryX2bGFxC1y5tXCB6kc1XCv6OhCfZcgoLzewVvpV9u4GTPlP6qhvCwkQ32XIKLLTVSH6Fys5EIMg9oPRUAt2EB9lyCjvODRr+ikrORCDIPYtjxILC6cHn0MYDCigbAsa0a4WDZchKglLVGtQHlHIKGqUWgb6SNDeWMgodrfdbPoYvlaNf55Vo6ZPC0mnBxMpGGWZAkILKtHuFg2XvCOoOFRVpZ+CCgBbdnRZC27R7hYNlxEF2wdUV8UZI+lRlCjrbfpABVkr6VFF6wQE+ksPNhmvJRqH0XILJIUZPulRA9CWZvpqEJ5eyCgG2CtD+mp+lo18nskn0XALadCcYsgo2GyDHfpPEN9iyCjmygUe+kf27gZM+dOOKFALHhAfYsgomWnZZPoK9u4GTPkI4BpqCyinB5xDGK1seG8LE9GuFg2XxROfalQMxRks6VEVSB4T+kSFWTPpUePOQFH6S9HuFg2XITxxPlRiZD/+U3DCCAZvCxPlhKbHv646qjv6UrP6y4wf/8KXBwshp4eSHRgwDwEoCybR7hYNl+QKQgVUG8XZRelRaFGkBfoCRdle6VGIZIgn+mWzOsuMH7JGLSwLcqfHlhQY5I3JDAtx0e4WDZf4RH4FVDqzesuMHx0VPQkLfNHuFg2XiEJgbVRFRZlF6VFd1IhQ+nFkP/5TcMPyhGALZQ82Ga8lW5LREQshubVwgep0ipoZ+ncQn2PIKNqFGiz6Dis5EIMgMb7gegsJp4edQxhQkbUTC0vR7hYNlyFZCUBULpCfT8goBSnbdvo+hR5W6VFkAq8F+k6zusyMHyDy7CILbdAcY8gobER6a/oEEF9jyCjyPNJg+iArORCDIKEDEDgLYBCfYMgo7rowRvoDKzkQgyAi8H1ZC3IQ32DIKNXTWCb6dis5EIMgjRgFAgsWp8eaQxi/LvdAC0LR7hYNl1a9RxRUY2Q//lNwnrDkAQsOxd456VGgbzdW+hnFmTzpUS4e32r6IqcH4BQYFjztXgtB0e4WDZd6rv0wVFZkP35ScB8VvUMLSpCfQ8goZPU6d/oe8zpMjB/s8mwiC2O5NR2I6uP9hwX6WxBfYMgog8b/BPpx9u4GTPncOq1pCzkQn2HIKDEdTDH6KCs5EIMgZzKYNAsIEN9hyCikgnFj+h0rORCDIG7FckkLKafHm0MYkD61bQs00e4WDZeSXHgqVCKFGSvpUVj0tkz6FGQ//m1wkgfvFgtSUF5byCg2GQAa+j6QHljIKJc+jkH6dtHuFg2XzRg8L1RvZD/+UnDc6BtACw9kP/5ScJQb4XoLB9DeWMgotWLjU/oevlaNf57Mgg0RC2WnR/r/GDdFLz0LItHuFg2XiJHXeVRIpZ+CCgAWXNtcCy3R7hYNl5YP2mRUYtBcfcgok23xPvpBkJ5wyCh56t53+gcPNhmvJRaZHGkLD4UZPulRop4EIPpVp8eU5xg5qQ1SCw3RrhYNl5hVc0xUMwWZJ+lRKKKlQfpGEJ5eyCgV2ccv+nJ+lo18nl+qJAoLQYVZM+lRAZ8laPols/rLjB+jkeMNC1uzOsuMH/jYgUkLKrN6y4wfplVmGAsIpwfL3BgT2Hx3CwfR7hYNl3WkUihUBEUZVelRwRzqN/poBVgu6VHX8i1t+jezusyMHybffX8LALm1cIHqPmnffvonEF9hyCgwSkIG+jErORCDIEtW/G4LJRCfbsgoCY2GNfpG9u4GTPnJZS9SC12nh5hDGDjRqyMLdtHuFg2Xk8wpc1QGxZk86VESQ18++hrRrhYNl8BI0EVUP6VD08e/U982VPpjDzYZryVvJwZ4C02nx5s+GGGAI28LYNHuFg2XwB+UF1QY8zpMjB/xGr4sC03R7hYNl1JdvVVUYxDff8gonAhSRvoJEN9PyCihmhJH+i8PNhmvJeR9D3QLYlAeWcgouu+qO/o30BxuyCgt55o2+mgQX27IKFi/Vib6Ays5EIMgQqSgWAs6p0eYQxj3+bdkCwDR7hYNl1XqXBRUIWQ/fm1w1MPTRQschdlc6VEP1ygj+i2QXlnIKOvIrmP6HNGuFg2XvxYACFQxkF5YyChjwo44+iXQnkbIKEjRdhn6Vr5WjX+ePEESeQtnpZ+CCgBOi35wC26FGT7pUbt+Oxf6GacHaBsYzTCMLwtD0e4WDZeALNkSVFsQXlrIKHEyQ1/6DtGuFg2X8OqnCFRs0F94yCjZYb08+nQPNhmvJSo8bnQLNH6WjXye7tMAfAsWpwcbORhk/SAECwvR7hYNl37eBghUOIVZM+lRuV5RQPoY0a4WDZf9MBEmVCqlRc/HvyeEwSf6Qg82Ga8lNqXjKQsWpwceGxix3KMdC2DR7hYNlzf0AG9UPmQ/flNwCGXHEgtpZcW4x7+TT50j+kqz+suMH9fbUVELUKcHbwEYkM2QDgtp0e4WDZcjyLg9VBSzOsuMH8o1QyULd9HuFg2XG1ysX1QT0JxYyCimTGI9+gRkP35ScFqoiCkLAg82Ga8lLnFdUgtts3rLjB84DKVfCzfQ3G/IKEfRYy76fhAfb8goUabac/oE9u4GTPmGraYbC1AQX2/IKEI2CTL6SSs5EIMgFb4RcQsop0eZQximtSJ9C37R7hYNlxDS+GFUCrO6zIwfgGKtEAsx0e4WDZdDN2RFVDOFmUTpUVBTw3z6HoUeOulRmZoIe/orDzYZryUXsiNzCy7RrhYNl5CA/EpUFIXeIulRbajcBPolxZk86VEWy5hs+hrzOkyMH2wHvw0LAVCeW8goaMgFX/pbkN5byCj6ooc7+iTQHlvIKFZ88Vb6TL5WjX+eIQtONQs9pZ+CCgAZst03C3TQ3GzIKDJ+YSP6fBAfbMgoZWloevph9u4GTPmVDUcxCzIQX2zIKM+tlnP6ePbuBkz56YZcPQsfp0eGQxgKzfpwC0HR7hYNl/eNtDxUAgVYRelRweSwC/pF0J5+yCiQ0+Y5+geFGT7pUf+OvUv6DBCeXsgo6fOIXPpWfpaNfJ7paswaC3unB+AvGM/EDB8LBtHuFg2X7iT7TlRrxd5E6VHvNENa+nhlxaTHv5o53n36PoVZM+lRCERCZvoGubVwgeo/pHwI+nYQ323IKIqoHTT6afbuBkz565Y6YwtREB9tyCgW5wgy+nT27gZM+ZqXhl0LbqcHh0MY0QZIEAsd0e4WDZd/rlUeVDmz+suMH/nTFxkLEdGuFg2XJrSHElQuJQXdx78jBzly+isPNhmvJTkVDhgLTbM6y4wfi1jrYQt+s3rLjB8UCo1CCyqzusyMH85f5GMLB6dHeBYYJMIQHgtE0e4WDZfX8lIhVDJkP35TcA3SQlsLNpCefsgolgoJevoVxZk86VHX6zYR+lDzOkyMHxly6iMLeVBeW8goRbpgWvpokJ5YyCj2B6h4+izRrhYNl/nal2tUAeXEq8e/GueYaPoV0N5YyCjM1cxS+ki+Vo1/nmb7bWYLT9CcasgoCbaTTPo6EN9qyCg9fGNu+jsrORCDIBeWgBQLNafHhEMYmKfVJgs40e4WDZfgwxhuVCqln4IKAN4RNFYLGdHuFg2XIug6TVReZD/+UnBE4D1CC2iFHk7pUY3p+D76Aw82Ga8lHvxlAAtC0FxqyCgDkD4K+ngQn2vIKHdWE1H6L/buBkz5qdaKVAs1EN9ryCihrPAS+kErORCDIOCQv0ELTRAfa8goPS7lNPpV9u4GTPn12/hdC1GnB4VDGNNZmmULINHuFg2XQoDfR1Q+ZQSux78HYMQA+ltF2TzpUUt6rin6a4UZPulRb6enC/ow0JxoyCgIDhAS+l8Q32jIKMynA1/6DSs5EIMgODJOPwsAEB9oyCg8RwBX+k4rORCDINxQQEgLJKcHgkMYe6d2RQtU0a4WDZfT3LppVD5lBKzHv/Tuvmb6XhCeXsgoTnSkIvplfpaNfJ4PjiJ3CyCnRxAbGM60cXULANHuFg2XSOQmO1R7ZD9+U3AfnX94CyGFWS3pUbwxMyD6AIVZM+lR1H0OA/ok0a4WDZf3F1UYVB9QXkXIKGT00Gz6IbP6y4wfSue5HQt1szrLjB/PIKlWCwWzesuMH1/FsgELQbO6zIwfx+fqdgtlxZk86VFNJCoN+jmnx+gYGN0TJwwLEdHuFg2X7sG5NlQJ8zpMjB8DVgBYCyHR7hYNl5lW/ThUQ6XD3Me/GMXlc/pr0N9byChqIpg6+hEPNhmvJXBjYSQLY1BeW8go5kb+FPodkJ5YyChfA1Ng+lbRrhYNlx1660tUI4VeVulRLVEVDPom0N5YyCjQJUpn+ki+Vo1/nqGf3yALcafH+ysYq6wqCAsd0e4WDZeh6iFkVDUlBNHHvxStQin6D+XE18e/Z3ifc/oBpZ+CCgDsGHZvC2e5tXCB6pN/D2v6FhCfacgokU45KPph9u4GTPmc2sZrC1QQ32nIKMF3UCv6AfbuBkz501xxZgsMp8eDQxiAK6FQC3PR7hYNl7SBdHBUZIUZPulRZFjmYPog0a4WDZcuvP8ZVGnQ3mPIKKQheS36ZQ82Ga8lzRk1KgtuEJ5eyCi1WWZo+mZ+lo18nuHlxRkLG9BcacgoqN+3X/o9EJ+WyCh+ZTdC+iv27gZM+ev4ph0LIhDflsgoFWLwc/otKzkQgyAicXUyC0mnx4BDGBZUjS4LatHuFg2XCUW1N1Q3hVkz6VHf8u96+mXR7hYNl8EAQGJUFMXZOulRgzQbIfoUkJ5HyCj+Kb0s+n8PNhmvJebZAlULCbP6y4wfVMKGdQsJ0e4WDZfSTx9UVAmQ307IKLRDyzz6fdBfUcgor96GLvpBszrLjB9mBVhHC0+zesuMHwNuw3QLbdHuFg2XU3wfP1Q7JUTNx78Lfcxu+i1lBNPHv7ZDUn/6QrO6zIwfhmO4MQsXxZk86VEJ8ZZx+i/zOkyMH52/+DELddBclsgoW7b2avpEEJ+XyCiXY8gL+lMrORCDIHzBKEULBKeHgUMY54AObwtf0e4WDZfmuPloVDlQXlvIKJLhijX6E9GuFg2XJqKpTlRqBZk/6VGvpTJx+jUPNhmvJUvs3hoLbKcHlkkYb4l1Iwtn0a4WDZd8ldZCVA1QnnTIKKvH0yb6JpAeWMgonqyfJfpz0N5YyCgnw5UV+mq+Vo1/nnKyO04LPaWfggoA6naHFwtGhRk+6VEjtPhX+l4Qnl7IKFW5mB76eH6WjXyeo7c+cQta0a4WDZcUl8x8VELQXEHIKM6u7GD6FIVZM+lRDSxaBPoGp0f+5xha19QFC1vR7hYNl2CXLl9UFLP6y4wfoPJDUQt80e4WDZceoaF8VASF2UjpUemjvAv6SuWF0se/p4gIM/pdDzYZryUjDm4dC2SzOsuMH22DWi4LUdAcl8go2xtIb/oEEF+XyCg9F4gR+iv27gZM+aCGkSELbxCflMgoBtG8O/pwKzkQgyAPOchLC3inh45DGEOeL0QLQNHuFg2Xb2TLb1RgRVkm6VGEZs0G+i2FniTpUd/hQQn6ILN6y4wfe3ALIQtKs7rMjB+bYxQUCwDRrhYNlw2fAhlUURBeS8goXavgQPoSxZk86VET8Zc6+g3zOkyMHwepNysLQVCeW8gowl8bW/oMkN5byCg2KzIs+irQHJTIKIcKMlP6XBBflMgoF413A/pY9u4GTPko+HRkCxYQn5XIKNsmWh/6bis5EIMgQhgpSQtYp4ePQxhbbxo4CzzR7hYNlxWRMxVUKsWZWulRxkNxQ/oFUB9ryCiQxhhU+nzQHlvIKEar3EP6Y75WjX+e5WLRPQtupZ+CCgAsUMVrCz+5dR2I6gzBlmr6DxAflcgoglueNPou9u4GTPlwxzFFCwoQX5XIKAfYjR36N/buBkz5cRIgFAtEEJ+SyCiEWMkN+ir27gZM+RFkXyoLMKeHjEMYuVBYPAsK0e4WDZfhjS4rVCWlBbzHv5JZezf6QCWE2se/eDXXGfoEhRk+6VFP8FR9+g8Qnl7IKBLGSEr6Jn6WjXyeVEolbQtehVkz6VGb8HlI+kiz+suMH65tFW0LZKdH+/kYZ29fcAtD0e4WDZeV/ktuVFWzOsuMH0EvAGILcdHuFg2XeF+TKVQ+EN5nyCjP4gw7+gCFWXbpUQZRLyj6UA82Ga8lWej3HAsY0a4WDZdtM9JaVCPQ30fIKId0SED6ObN6y4wfz0CjOAsYp8fk8Bh0UCg3CyvR7hYNl/E8vyVUZrO6zIwf6xS0EQsk0e4WDZcaAbpjVB/FHiPpUdXdZB36P4WZSulRxRFfb/pLDzYZryUsJs9XCynFmTzpUYc3STr6ZvM6TIwfpiMTQgtm0BySyCh1tmwo+jkQX5LIKDndu3v6ePbuBkz5ZwFbBQsZEJ+TyCjf9mFc+i0rORCDINzH3nILMRDfk8goGt4zS/pJp4eNQxj6JTIeCw/R7hYNl7YbvQ9UVFBeW8goDBBmLfpF0a4WDZe83SEeVAilBL3HvwLet0P6PQ82Ga8lk16dDQsKp0eDSRhDEjohC3vR7hYNlzRb4hBUXJCeWMgoDNd/ePpz0e4WDZdPZX9eVHRkP/5ScK2ApmELWdAeY8goGg8DEfp+DzYZryX5SMYcCz7Q3ljIKI9qAib6DL5WjX+eR4KjCQtkuXUdiOpv4+gx+jIQH5PIKM3X91P6U/buBkz5ixfhIAtgEF+TyCg1mgI8+gMrORCDIPbn1HsLdRCfkMgop2tcSPo5p4eNQxjJfzQjC2vR7hYNl6DPOSxUcWQ/flBwNleiVwsJ0Jx5yChKbbMI+n+ln4IKAAkchjQLf6eHax4Y68MAUwtW0e4WDZdSJcVnVESFGT7pUfEbB376ENHuFg2Xgv7MN1RvpYTKx7/imP8e+hGlxLvHvycDo376Xw82Ga8lhqBPCwtb0a4WDZfC0W82VE1F2VbpUb6NGFv6MBCeXsgo5QBtIPp1fpaNfJ5eCOh3C2mFWTPpUWJ+9yv6J7P6y4wf8pYnNgslubVwger7QpJS+isQ35DIKMOPqWb6HPbuBkz5KQd2AwsJEB+QyCjLBSgw+jIrORCDIPMTOV8LfRBfkMgogRI0bPpcp4eNQxjHyk1iCyvR7hYNly7gbktUDLM6y4wfM5tHVgs20e4WDZcPmyk7VEQFWEvpUfmR5F/6UBDfdsgo52HkOvoKDzYZryVezkguC1izesuMH99ahV8LP6eHESoYKM85Bwtp0e4WDZeudegqVD+zusyMH0x4rg4LWNHuFg2XHsZePlQM0N6WyChOmXAI+gKQX0PIKCBigg76dA82Ga8lYrbhLgtYxZk86VG/cip8+jnzOkyMH+zHDGELf6dH4DMYsqk/Tgt10a4WDZctGNUpVGtkP35QcAaW8BILdVBeW8goZkewbPpxkJ5YyCigSupF+gHQ3ljIKGezjXD6XL5WjX+eE0BYbgsrpZ+CCgCiyysqC3CFGT7pUcA8jSv6dRCeXsgoDm4vUvosfpaNfJ4AkFxNCwrQnJHIKPzKsmz6PxDfkcgolyVKBPpT9u4GTPk+oOEnC0YQH5HIKDkNSRX6B6eHjUMYLNarVAsB0e4WDZfbtFQpVC+FWTPpUR1P5gn6atGuFg2XgAttFVQcJYSrx7+r/NdW+jUPNhmvJXX7OlMLHLm1cIHqt/RNEvo8EF+RyCjLNc0b+iz27gZM+VxKBhQLYxCfnsgoAxHGSvo9p4eNQxjdV/ssCwbRrhYNl/Z/KGdUNGQ//lFwcfWwMQtEs/rLjB/NpKgIC2rRrhYNl+Ij42ZUPwVYO+lRxduxTfomszrLjB8dxrNcCz6zesuMH+IjEC0Lb7O6zIwfIF7zMgs/xZk86VE8v2kh+kDRrhYNl53WeFtUD+WFxce/loSYHvoc8zpMjB8v1A1ZCzDQ3J7IKLiWx3f6MBAfnsgoMMFGI/pYKzkQgyBnxuI/C0QQX57IKGWtcXv6V6eHjUMYfqVgWgtN0e4WDZfr82MaVHRQXlvIKHpTin36RdHuFg2XSEaBYVQqUF9EyCjLYSk1+hdkP35TcOQdo2cLLA82Ga8l1979PwtTkB5YyCgtqJIP+izQ3ljIKDEoNXn6VL5WjX+eipTIQQsKp4dpGhim/YJiCx3R7hYNl+dsIWhUSqWfggoAFyS2WwsB0e4WDZeJh2JMVFjlRcHHvwFgekf6DmQ//lFw2r4kfwsJDzYZryWX2wYrCwXR7hYNl8WnLWRUXwWYIelRmkudVPo+EN9CyCiso5JB+luFGT7pUUOagF76MKcHeeAYRlVXWgsG0a4WDZd/Vjc1VCwQX07IKDMMrXD6JBCeXsgowFZ9IPp2fpaNfJ4Sd+xeC2rRbrrzl+235gJUcGiqF9upTTvKdAs8xnfQZVBxEM2GBHyY2hgFAAAAFhAcFAAEFEmEfAsAAAA2FAUiFAMHGBIUAARQqVl5CwAAACIFEAMFFAM2BBgABGmg6AgIAAAAIhQFMh4DFAAETIoxYxEAAAAiFB8VPx4FGBcYEhAFGB4fAAQt3WcmBgAAACUYBR0UAASOuKsYCAAAADwQFVE2JDgABJaOoF4FAAAAJRQJBQAE4Za7AQgAAAA0HxATHRQVAASuUZc6CQAAADUEAxAFGB4fAK6s/5Fv+n5zwP4EkksE+Wh0MAUAAAAGEBgFAK6qqi5Y+n5zwP4ERjQEpYbSOggAAAAhHRAIFAMCAASIr1YTDAAAAD0eEhAdIR0QCBQDAAQoBhtmCgAAADIZEAMQEgUUAwAEM5ZDLBEAAAA5BBwQHx4YFSMeHgUhEAMFAARXEbYxBwAAADI3AxAcFAAEhEsjQwQAAAAfFAYArrpfWWHNfnOgmYwWS64TtRYV235z4Aoej0uuYMJqLxCBjP8jwcNLrjL+WBCm8bE11gwxS65DmFooFi/L3nvvBzSuH08bOBsEZ265ochLrhaV/1BCYPYrr/AwS66LDdUv+n5zwP6syEuuqEsrFPp+c8D+BKpLrmHXGwblpUEgMsIxS66oXlk6TeFwwPoGYrSu21GcEACx6d+B+ctLrhKjRyf6fnPA/gSIS65sx015J3JEIL2uFkuuQmOHBElrmV9oF49LrhAJiCVXwVbAQRzAS66XWg5F5fuYkUYCFkuuEOVTYotDeRdd9I5Lrtr5l1UMVi9PPDHAS64CYptNi0N5F130jUuuGXjvMwRwNkGgqCJLrp5UHG5xoNpABdrXS67ox5ZWar5svgCw6suu1sqPKnW8huii9S9LroW6FTbwqdCww46PS66Z73U0Fi/L3ntxNkuuxu0IcPp+c8D+8BtLrkAgTB76fnPA/psES65t8Bkk+n5zZC2sGkquqsOiV/p+07I82ldKrsSxyxz6fnPA/hZ1S6675mlE+n4T7h4EXUqu9ikUQ/p+E7enalZKri65wnn6fnPA/gUKS64MGHcE+n5zwP7+dEuuRTP/Ovp+U/rGd1dKrhvWb2n6fnN4ZstaSq7iSits+n5zwP72EUuuDRH/UPp+c8D+wB5LrklRzVD6flMFZstaSq429TES+n5zmayUdEquoc+Sdvp+c8D+anVLruZsgAT6fnPA/p4MS641t4RY+n5zwP60zEuuODhiR/p+86K1lHRKrtP/+in6fvOp7MpdSq6aXEpI+n5zwP68JEuujKEmN/p+82mxNlFKrmhHp1P6fnPA/oQCS66VfUoV+n5zwP7QA0uu8FRITvp+c8D+23dLrhghxwP6fnPd2rp1Sq5YnKtW+n6TlTaaUEquVK8aZPp+c8D+NwpLrmvTMw/6fnPA/qAkS64bCz1z+n5zwP66AkuuKu1/Pvp+c5ZbCwxKror32gT6frPAjm9uSq6sQ0Na+n5zwP5UzUuuqajkc/p+87j6FmZKJVhhEkgArtZ0szL6fnPA/pEMS64eHbsL+n4TWa+pVkqu/YeIPPp+c8D+shpLrpwlUGn6fnPA/nQKS67sd+91+n5zwP6+GEuu5CeITfp+s0urqVZKruPphC36fnOrBM1sSq5gr9Z0+n5zwP41AEuu/C+ISfp+c8B+gHdLrvQyGDz6frMhsalWSq60D+NY+n5zy765ZkquA9RUEfp+c8D+lwVLrpGoygT6fnPA/pYRS67MbGk7+n5zwP7UKEuud6hcPfp+c+HEuWZKrrjnm2n6fjM2e5ZhSq6yEBJ++n5zwP42BEuunZItY/p+c8D+Jg9LrrK6Ggz6fvN3NolWSq7+kits+n5zwP5QA0uuOkziOPp+c8B+RHVLrtfYpEr6frPm13ZqSq7Ycs8O+n5zwP6wHUuuum5aCfp+c8D+BA1LrqyQBBn6fnPA/kYOS65iSr5t+n6zAyLtXkquoXr5Xvp+c8D+thdLrsPljmr6fnPA/sIHS67wDDoR+n7zCP6qWUquGkZ/fPp+c8D+zD9LrpHelGT6fnPA/igIS642B+gR+n5zTHMUA0quY2gaXfp+c8D+aCZLrvHvugj6fnPA/lYMS65fgH5f+n5zeLJyVEqug7LXavp+syZtRVpKrujk90f6fnPA/iAiS66YkTRv+n5zwP6E/UuuS8ByUfp+84xtRVpKru7Xclz6fnPA/iAjS663csUa+n5z8K2XZUquK/JPQvp+c8D+WCBLrmwXHwr6fnPA/i4JS66gSjJZ+n5zwP4yAEuuO0Vldfp+84sNRWVKrhRNcnL6fnPAfiZ0S67H8+BR+n5zwP4gDEuuiEKxKPp+cxBaFANKrvMq11H6fnPA/lMCS65jI6EJ+n7zVe4be0qud9xtQPp+cxrN2W1KruxkrSH6fnPA/oAYS676iChO+n7zyc7ZbUquqxW5B/p+c8D+8hxLrh4VMA/6fnPA/swTS67+mw5o+n5zwH7yd0uuRarrfPp+c3oBrBpKrkMZLjP6frNJLT1YSq7wlEtQ+n5zwP6oBkuuii0xCPp+M7QvPVhKrkKtjm76fnPA/mYBS64fBPZC+n5zwP5MFEuucKKcY/p+E61iL1dKruHpCE36fnNwdqVbSq5iVINX+n5zwP7fDkuufgj7Rvp+c8D+ZwJLrp9rOjT6fnPA/moaS66fuA98+n6z9C7sYEqubOzqW/p+84snKWVKrvP1hFL6fnPA/ooDS67QAqQh+n5zwH54dEuuGn/dDvp+c8D+yCtLrlLSuhH6fvPQGCllSq7D4qcv+n5zwP5iGEuuRyBmUfp+c/ICE1RKrg5aknb6flNehJhYSq5rwYVA+n5zwP6OC0uuNyidNfp+c8D+/QxLrn4p9RP6ftOp6wFRSq6XQ5Im+n7zTUlVd0qum1bdG/p+c8D+bBRLrhk4SDb6fvMzTFV3Sq7QurcY+n5zwH71dEuujemYB/p+c8B+E3RLrqNpETz6fnPA/hQaS66leedC+n4zvNwdbEquO36/Q/p+c8D+4gNLrrhSYVX6fnPA/pF3S67S2op5+n5TrkCPWEquYORvd/p+c8D+jgZLrj0I7G36fjNX0N1uSq6ly8kU+n5zwP5UMEuuqPzoHvp+c8D+NB5LrsGSQUn6fnMt8rp1Sq6rKuRt+n4zHId3VUqul27PV/p+c8D+HgpLrrpPs176fvPKeTNjSq6KLRY9+n5zRRDDCEquPvauAfp+c8B+CXZLrr08ai76flMHtvleSq514Tc++n5TsnIwVkquJzvRVfp+c8D+83RLrhtWxkz6fnPA/u4US67/NFJ/+n5T2E2gUEqukiD9Z/p+c8D+vw5Lrl1dkDH6fnPA/gT7S66akvIP+n5zwP5UG0uuN6aAHvp+c/+qmXFKrmP1Ujb6frNpqPZlSq4Pu50Y+n5zwP4lBUuuk9qIJ/p+c8D+EhdLrg6CTkf6fvN6TSdfSq7F7zgf+n5zwP5kOUuuWVG5Kfp+c4AV5gRKru7WU2z6fvPpnmRwSq4pdUY4+n5zwP7MLEuuT0k+Kvp+c8D+3ClLruO4A1z6fnPA/hYHS64+gPcQ+n5zZPPqZEquvdqbFPp+c8D+xMNLrkOKOwP6fnPA/tgiS67mGNle+n5zwP4sH0uuzd2EAvp+kztrClpKrgsIe2T6fnPA/vAES6617Zhk+n5zwP4HDUuuKzfaDPp+04ixqVZKrnGC9G/6frO9SsRsSq6QP3lI+n5zwP5QF0uuF7jDQfp+04QyhVdKrq+xlnn6fnPwIYA6Sq5UCt8X+n5zwP6EHkuu4ZNvA/p+c8D+RC5Lrvkx7jP6fnNw7oE6Sq7A7Ipl+n5zc+9nakquIWJaaPp+c8D+1BRLrnMbDEb6fnPA/noUS6794YFp+n5T1JDnUkqu0IVlGfp+c8D+9nRLrvrImx/6fnPA/oAIS65GDIEK+n6zE6ipVkquC+f0Mvp+k27Sr1FKrgTYPiX6fnPA/kTAS65VXQ4f+n4TQtKvUUquwx/tYPp+82FV819Krs0J50/6fnPA/tkNS64vhp0m+n5zwP56H0uu39uQdfp+c8D+2AlLrk6rL3X6fvO9uydzSq7Su+1c+n5zidYmAkqugrWdNfp+c8D+rh5LrkglkS36fnPA/nARS67Xlq8C+n6zgmRoYkquTK0eLPp+c8D+zDhLroAbE236fnPA/q8GS656si4r+n4zF66pVkqujsheX/p+M0Fy3VBKrlpdTFP6fnPA/uQcS64PTkto+n5zwP6k2UuuSke5Gvp+089w3VBKrmfpIlv6fhM4PMZVSq7r2ptB+n5zwP6pC0uuCVN5R/p+s4JBxlVKrh/uvFz6fpPDWnZdSq6zQ7w8+n5zwP6WHEuuu7C+APp+c8D+IQZLrrJGGST6fvP88cpaSq4VUGAT+n5zNF9wEUquBAOuOfp+c8D+enZLrjfvXkH6fnPA/gTPS657u0cm+n5zMKWBd0quK5PETvp+c8D+BwtLrn/D2BD6fnPA/gw0S67p72c8+n5zwP5cKkuu+HN2Bvp+c8Ay1iVKrrHzpmH6fnOEF1cASq4+svxd+n5zwP4IGEuukbvKP/p+c8D+sChLrgm+lyH6fnNdDlcASq4+/pMU+n5zwP5ZAUuuhmf7Pfp+c8D+uBpLrktbSRf6fvOJXUpiSq4i18R6+n5zwP64JEuuvYOLa/p+c8D+vgRLrpUCJgz6fhNFsqlWSq5njAVM+n6zSGkKa0qufXMvFfp+c8D+BB5LrpTmUFf6frNIZAprSq54FttG+n5zwP7YFkuuRjpcOvp+cz4JAQVKrpOZ+wj6fnMWOe17Sq4Yvr9y+n5zwP52A0uu7pM2Afp+c91D7XtKroU+rH76fnNAN3LbSq6S33hE+n5zwP7MFEuuWjHlSPp+c8D+nwdLrgGUe2v6fnPA/jgiS67k6YFI+n5zwP6E6ktiDkJJAGABG8PNKxMzOzMcCJltubVwgepXAKY2+mYQDV/IKMlhuBz6Ris5HoMgVDmoJQsLEE1fyCg7ADJN+h/27ghM+VGftDELUxCNXMgow9+9XPpDKzkegyDIA9dGC1unh/ZnGIrrllALcNGuFg2XPT2Pa1RMRZg96VGcOYVM+n+FWTPpUaRVYzj6M7P6yIwfPf+NTQsSp8fL4hhWEO93Cz3R7hYNl69fK3ZUFbM6yIwf76F4XQtB0e4WDZciO8ZoVCpkP/5RcG+CZlsLRuX2v8e/ZoPlNPolDzYZryWeKk0vC06nx8v9GECtqDELO9HuFg2XCjoqbVRpxV4z6VHHHgtB+i3QAl7IKMJe7iH6ALN6yIwfki0OAgsPp0dL4RhZ/up3C3HRrhYNl8oxn3RUX2Q//lJwffy3Rgs8s7rJjB9yZm17CwOVZEysLRkjSxkLCn6Eg5ielpZYTgtop8fL4BgfyEAVCzfR7hYNlw1rG0JUcAUZP+lRrhTxavoxZD9+UnCsC3NoC3+FWTPpUeVLCCf6K7P6yIwfrYxpQQsc0AJcyCjdsh8b+hEQTVzIKLOOJxL6Tis5HoMgmt58cgsgp0f2Zxg2Jj5wC3fR7hYNlwsVgztUZoUZMelRAMqPHfprpbe7x781HcpM+gmzOsmMH+40BmQLHrN6yYwfmLSGSwsxs7rJjB8lvQEMCySVZEysLfk1jwALSX6Eg5ieiiYuJgs1hVkz6VGIIUwn+lCVJE+sLW0vjkILb6cHy/gYyUUsGAsC0a4WDZfQeIVoVExkP/5QcKjVMTALV1DMUcgoILDlQ/o1fkQDmJ5qgWkqCyyVpE+sLVokoRALeadHS+IYmbZNGgtX0a4WDZer4ZMsVC6QDVHIKOFtJxr6VlBMUcgoGzOBI/ph5QB6hVtoeflNC0nRrhYNlyQ0XDRUdRBNUMgoJ05IH/ocZahABAC1OhgcC1FlKEAFAGgk6GoLXGWoQQoAhqevJwshfoSDm56zi4BdCwBoqhe3qRd5I18LOSgiGH5QfRHNhgTxaas7BQAAABYQHBQABBhc0nQKAAAAJh4DGgIBEBIUAAQEKNtFDQAAADsUBhQdAwgiBR4DFAAEZINkLggAAAA7FAYdFAMIAATn8Gt0BwAAAD0QAhQDAgAENBcVHwgAAAA1FAIFAx4IAAQXXCYhBwAAADgWHx4DFAAELVXFEg0AAAAmHgMdFT4TGxQSBQIABDWXcwoLAAAANhQFIhQDBxgSFAAEQ16GKQsAAAAiBRADBRQDNgQYAATe1P0cCAAAACIUBTIeAxQABGT5incRAAAAIhQfFT8eBRgXGBIQBRgeHwAESJRLGwYAAAAlGAUdFAAEFPYNUQgAAAA8EBVRNiQ4AARbmz4tBQAAACUUCQUABOPyXWEGAAAANR4fFFAABAI39SEJAAAANQQDEAUYHh8Arm6sjk76fnPA/gSSS66wEM9N+n5zwP6wAEuuXK1Ec/p+c8D+fXRLruakWC36fnPA/oQbS67JlokT+n6zomB2bEquZ4bfO/p+c3Q7alZKrsyzV3L6fnPA/voPS64hjblK+n5zy0P8dkpNDkJJAAQBNRTkbhszGXcBCplthVkz6VF0ETxz+jCnB835GO6WOEkLGtHuFg2XAteuLlQbUMxTyCgE9pQf+lWQjV/IKPAcRxX6VBDMU8go+viCDPoSfoSDmJ5x3JFyCzSF2TDpUQMrXXP6Qbl1HIjqcbGhVvp0EA1cyCjPmCJ8+l727ghM+anMlBALaxBNXMgozHTTCvoj9u4ITPko0yEoCzinR/ZnGDd0g1MLY9HuFg2XB/y2JlQas3rIjB/hR0IyC3fR7hYNl2dWdXBUMUVYMelRacPBKfpGxV4z6VFZ/RJS+jYPNhmvJVjEj34LRqfHSPgY/kBgAgt50a4WDZfA84c4VB9kP/5RcOyr1SALAbO6yYwf9alNSQs9s/rJjB8dYlxXCwyzOsmMH2xEIC4LesUZMelRdEOZH/o70a4WDZf0kVBnVAcQzVHIKDCWtyX6JfO6SowfWe5wcgt1UMxRyChNoNFH+juQDFHIKGusei76etHuFg2XeyfYIVQVpfW8x79CUb8h+kCFGT7pUQxkzgr6LNBMUcgo5/pVb/ogvkSDm55vsO51CzalqYIBAMv9+VsLF9GuFg2XxcsAM1RrZTe+x78ghsAC+iaFWTPpUbsrpW/6FdGuFg2XJZRODFQaZD9+UnDp3DJsCzcQzFPIKHQ1cFf6NH6Eg5iesG1QSgsihdkw6VE4WEgh+iyzesiMHzhGCkQLCLO6yYwfED43fgtGs/rJjB+QV+JKCz3R7hYNl4QWUn1UC2Q/flBw3J2VXwsIZD/+bXBLKPkyCyqzOsmMH7cB9hwLDdGuFg2X/e52BFRppbW8x783BKpf+lDFGTHpUSmGslT6OtGuFg2Xwt7hIlRLEE1QyCiV1RYG+jLzukqMH5xrmy8LFKeHS+IYsB7BDgtp0e4WDZecSgk+VGxQzFHIKBtvoHb6aNHuFg2XY+QUC1RCZD/+UHCmNhxcC20lNrvHv2B84jf6FQ82Ga8lHHFVTAt1ubVwgepGIFdu+ncQzV3IKCxGN0f6Z/buCEz5lL/CYgthEA1dyCiw/XR9+l727ghM+Xe5ZTMLbacH92cYLFAnVQt60a4WDZdQ61tNVGfl97zHv7W5jgn6eJAMUcgoc+28AvpMubVwgeqg1doW+jYQjVrIKHbZ0i76E/buCEz5PuFSTQtyEM1ayCgNXrwR+kr27ghM+R9B6h8LWhANWsgo5pDdMfoX9u4ITPmiDJ0xC0qnB/RnGCtYwwMLX9HuFg2XHT+3S1Qr0ExRyCgkxGwE+h7R7hYNl9j4Uk9UTmX3vce/Uq+aFvowZD/+U3CPxZU2C1APNhmvJbGsxhcLfL5Eg5ueQQdkGwsjpamCAQC7qFY5C2OFWTPpUfT/XWr6axDMU8go7uaofvoVfoSDmJ4o+plGC1uF2TDpUQZ5ESr6VKfH9PQYhQCMVQsY0e4WDZeDLWVBVCOzesiMH3aEWywLHNGuFg2Xz59TPFQLRZg/6VE9THR2+m4PNhmvJba5ghsLXrO6yYwfw3f5cwtjuTUciOrKjM58+kgQjVvIKDv7NyD6fvbuCEz57tHAXAt9EM1byChN9OBa+hUrOR6DIHgu1S4LfBANW8goi/a5IPpOKzkegyCgAf4sC0WnB/VnGLlgfUsLbtHuFg2XYrirGFRwhZkw6VF3C2wB+i8l97vHv3x2Qkn6NrP6yYwfds/mDAtzszrJjB/dhCwECxrQgljIKFv+xBP6DBDNWMgodX70BfotKzkegyDZMVgIC1sQDVjIKPqCvG/6BvbuCEz58Wnybgs2EE1YyChTy0p1+kj27ghM+dm2P34LLKdH8mcY37CueQtA0e4WDZdiW7RpVEXFGTHpUd9nqgL6XtGuFg2XQbYLb1R2RZk76VHKp4M/+ggPNhmvJWOAalULKtDCWcgowCmlXPpEEA1ZyCj0/6sa+kYrOR6DIDAJqDsLLRBNWcgoRUseevpC9u4ITPm4RHVpC06nR/NnGOUUXw8LAdHuFg2XtiO3c1RF87pKjB8sE2teCybR7hYNl/Or6VZUFaU2vce/R8b1ePpQ0EJfyCh6/3Zy+lQPNhmvJRZuLjYLCdGuFg2XmhMVTVRHJXexx78I6Ytw+iVQzFHIKGtXgCv6HZAMUcgoYvxBTfp90ExRyCgXTuNX+l2+RIObnsJJoH4LK9DCRsgoj4nDa/ooEA1GyCgXBXJ6+kj27ghM+b/eME4LPBBNRsgoOfFhQ/orKzkegyBGWNkwC2inR/BnGDy0nlELPdGuFg2XIdvIf1RIZD/+bXD23Y0fCyqlqYIBAFr0PQ8LBYVZM+lR5gNVOPoIEMxTyCi36u0N+hF+hIOYnjIK8HgLdNDCR8goSsF1PPpUEA1HyCjWbLQW+kwrOR6DIL5T2QALEacH8WcY5RGkKQsW0a4WDZdEOdRGVDLldqXHv4zuyjr6LYXZMOlRWU3xGvows3rIjB+drysCCzazusmMH0vkMhELCtGuFg2XCrEwWFRkZfa5x79FQ/J1+jOz+smMH2y7LyYLY9CCRMgoepa/ffojEM1EyCh4z4Ju+lL27ghM+ZEqNyULdqfH/mcYdj+yHQta0e4WDZfxQf0vVAazOsmMH7Zf0wsLetHuFg2XwoVWJVR3ZD/+UHABDboqCx/QDFrIKIDpiD76Ow82Ga8lkqthdgtMxRkx6VGZT7IN+nGnR03yGAAILw8LXtGuFg2XakLiAlQBRdkm6VHwb912+gPzukqMH5hFcTkLFLm1cIHqZ84kfvoJEE1EyChL+fUt+jMrOR6DIMw5aE4LXadH/mcYmYEbIwtW0a4WDZetyvNwVFDQQkfIKImpGBX6YFDMUcgo3R3/ffoUubUdiOqRRdkk+ggQzUXIKCCHFRH6GfbuCEz5VQDhXws4EA1FyCi0Ll8m+jr27ghM+Z5Y9DwLWacH/2cYrMlQVQsM0a4WDZcJn/ITVA9kP35tcKYZ808LI5AMUcgolYWyf/oauTUciOpUTbAg+hsQjULIKAIlNgj6AvbuCEz5vDAVTAtxEM1CyCgl59Eo+k327ghM+ZqFH3wLZ6fH/GcYT/R/Sgsm0a4WDZeZSOU3VC1F2STpUUhgknP6etBMUcgogQm4Ofp6vkSDm57jb9NwC1ylqYIBAArdcSMLANHuFg2XScOobVRDZba6x796ZCtM+lRkP35ScOOJYF4LQoVZM+lRqw3FSfoTEMxTyCgunNsG+k1+hIOYnie+kVALeqeHfvEYSw75Pwti0a4WDZftNGAMVCJlt6XHv9hUCzz6H4XZMOlRM9wmcfoSs3rIjB87JNY8Cz6zusmMH/iP/m8LFrP6yYwfsIBMIQsouXUdiOoLuJsY+hkQTULIKOR2OVb6VfbuCEz5qcN6MgsiEI1DyCgLhe12+iArOR6DIKmMTC4LRBDNQ8goIj6INvp39u4ITPlOqEQTC2anx/1nGKFSPQMLaNHuFg2XfZfeYFR8ZD9+U3CtqYtVCz1kP35QcK3lD20LEbM6yYwfI3k4bgsXxRkx6VH8Z7Y++lHzukqMH2PQvWsLELm1cIHqhnelQ/ovEE1DyCgmuqdT+jX27ghM+VGvdzMLNhCNQMgobWmeKfow9u4ITPlOivA8CzGnh/pnGHfTKhsLLdHuFg2XZ8LLA1QfBVg66VFBQb0z+kdkP35tcNFknWsLRFDMUcgooKwrDPoKubUciOpoTaEP+lMQDUDIKIpjxl36c/buCEz5G0dLQQtkEE1AyCgF8Dc7+gcrOR6DINR3ISsLPhCNQcgo1fR6FvphKzkegyCaCBA3C2anh/tnGAs6j1wLf9HuFg2XuyDocFQBUAxcyChpUdlD+l1ldqXHvz9c+Tz6UpAMUcgoGfoELPovuXUciOq3ia9h+icQDUHIKL8+YDn6TfbuCEz5HFHLXQsmEE1ByCi7AfUr+nn27ghM+VVuN0ULYRCNTsgome/xAPpvKzkegyC2ZD1RC2Cnh/hnGJUsCXQLT9HuFg2XKsTgelQi0ExRyCjfpEkF+n7R7hYNl4dKLxtUOmQ//lFwjtyzdgsdZbenx7+tIjVD+jQPNhmvJU456FYLar5Eg5uetALhAAsupamCAQBHupVNCzyFWTPpUbql2yf6LhDMU8goEql0EfoZfoSDmJ7KQMAqC22nB3LzGJDURykLBNHuFg2XnA6yElQchdkw6VFeOuAb+lXR7hYNl3FYaGVUbJCNRsgosV8LLvoQ5Xe5x7/bnSoN+nQPNhmvJfIvS2ILGrN6yIwfDpGITQst0AJOyCiaDQUU+icQTU7IKPXnEzH6Gys5HoMgR2YWCgspEI1PyCjK5X9P+kErOR6DICoRG3kLFhDNT8golf+YE/pEKzkegyD4MelHCyKnx/lnGEreDk8LWtHuFg2X/e6WJFQMs7rJjB8vb0N5CwDR7hYNl1prl2tUfmQ//lFwZfAyHgsgEM1RyCjqIQk4+lYPNhmvJSgdaQYLRrP6yYwfhfw+XQsMszrJjB+PiLRMCzO5NR2I6muGRm/6ehBNT8goz/2MGvppKzkegyChmm9oCw4QjUzIKMkA1mP6fys5HoMg8HI5NQtRp4fmZxjLz2MjCwXRrhYNlyhPSEJUIVCNTMgoYDDhJPoLxRkx6VEUu1VB+jLQAkzIKKQy60/6VRBNTMgoT6kqIfpM9u4ITPnHFCRCCxUQjU3IKI9uaQn6ECs5HoMgeKLlYwszp4fnZxgbt+0iCwjRrhYNl9RqTGRUbCV3pMe/Qy2DSfpg87pKjB+yUdxUC01QzFHIKH5bHgj6ZZAMUcgoXA8WcvoV0AJNyChQXB4p+nkQTU3IKDPZVkv6GvbuCEz5xZlMWwsYp0fnZxioPopeCxbR7hYNl/SPiTFUe9BMUcgo2+QtBfoq0e4WDZdtrnM8VHdkP/5QcHn4/BELIlBMWsgo0BD8N/oFDzYZryWO225gC1i+RIObnu7Z6yoLMKWpggEAMUkDXQsshVkz6VFsPNps+janx/4IGEdXJTwLYdHuFg2XoC5pTFRXEMxTyCjmqkED+lzR7hYNl3/kjkBUOtBNTsgoiHY4LPonEAxGyCi3a6EB+icPNhmvJUMKCDoLcH6Eg5ieexu3MQtN0MJKyCj+FSIC+icQDUrIKABhzgP6OfbuCEz5q4FIMAtSpwfkZxhTZXROCzLR7hYNl5D7zBVUAmQ/flBwnrjHBAsZkExEyCinmNlq+niF2TDpUbElTxz6H7N6yIwfrIeWLQsk0IJLyCiSFGVc+nwQzUvIKPZyWkr6Wis5HoMg3WvHdwspEA1LyCgpJAtq+gIrOR6DIC4/JUsLaqcH5WcYytWsIAsQ0e4WDZeCTzBLVG8F2T/pUQIldyb6XWX3r8e/2UQILvo1s7rJjB8VzG4oCzOz+smMHwceXwYLadGuFg2XCIxiE1QZZD9+UHBvKEtBCwCzOsmMH0luV1cLJsUZMelRZidMT/oz87pKjB+7FIkLC2JQzFHIKAHJHHr6FZAMUcgoIu55FPo10IJIyCjrjccC+icQzUjIKHk0HTD6WvbuCEz5AT6nTwstEA1IyCheOAAH+mQrOR6DIGc64RELBRBNSMgoNbK1N/oVKzkegyDcqXBzCw2nR+JnGJ+860oLZ9GuFg2XCOCqdlR6ZD/+UnAM3EUeC3LQTFHIKETBUGn6ML5Eg5uehUMmGQt3pamCAQCpT7dRC0PRrhYNl/jGATNUF+W3rse/UambXvo+hVkz6VEg9ysW+jXRrhYNl7fqFVtUcSV21se/IUsCW/oGEMxTyChhdAEF+k1+hIOYnj+cgGMLWNDCScgoXKf/YvovEA1JyCgI5PkH+jv27ghM+fj2pUgLQqcH42cYw2s2MwtC0e4WDZdvuFhoVCSF2TDpUY/f3Gv6f9GuFg2XIzQdd1QiZD9+U3DpDLNLC1IPNhmvJYRmig4LONHuFg2XY1MICVQMZD9+bXBTzPh6C29QzE7IKPX9swX6U7N6yIwfTURYbwsBufUdiOoM9SE6+gEQjXbIKHl0DTL6RCs5HoMgdQgvYgsoEM12yCgrEe4W+kX27ghM+XuNZQ8LOqfH4GcYf3CFKAtd0e4WDZe3y8UuVA+zusmMH8aiLRALcNHuFg2XrxGIL1Q6ZD/+U3ChNkhSCxZQTFvIKC4LsD76OQ82Ga8l6knAJQsIs/rJjB9LNM13C0yzOsmMH6XVpkQLV8UZMelRZr5rXfpz0e4WDZfM5l4pVDSQjVPIKLOobkz6RmQ//lBweZn9Bwsx87pKjB9S8y4QCyO5NR2I6m6PKUL6QhBNdsgoawrAaPox9u4ITPnPK68SCxEQjXfIKOTIwin6MfbuCEz5EqbrCQt5p4fhZxixjBV8CwrR7hYNl49clz9US1DMUcgolO1zAfpY0a4WDZe0ZzhDVAGlN73Hvx4JPVz6KQ82Ga8lg+3GTAsV0e4WDZda4VRkVD/ldq7Hv+qSdWj6GxDMU8got/XeEPp0kAxRyCjQrfAQ+mjQTFHIKKsnmgf6Xr5Eg5ue2muWYAsL0AJ3yCj+gRl4+g8QTXfIKB3RvS36DfbuCEz5ngVSJgsUEI10yCjZSPde+kYrOR6DIIVcZEILS6eH7mcYFeAnWwtT0e4WDZeO3Eg0VF1kP35tcD7SyTILc2Q//lFwYRyFAwsGpamCAQCbD/xUC2bRrhYNlxyp/VZULBDMX8goNEeMXvophVkz6VHnT8ZI+ne59RyI6q86lgD6NRANdMgoMGI6IPoh9u4ITPmTatZxCx2nB+5nGEwBnSkLM9GuFg2XiGpXU1RyZfapx7+nlxwr+jUQzFPIKAC+zlr6R36Eg5ie4RlcSgsGp4d4HBhYqXpTCxnR7hYNl03EiGRUFYXZMOlRznc8Z/oy0a4WDZdu3n1BVB3FHj3pUUArg2T6AA82Ga8lcHr4CQt5s3rIjB/y0cU0C0uzusmMH93G2jALBNGuFg2XdNitRFQvBRgw6VHV3rQT+imz+smMHxvCZyYLIKdHZh4Y0thfWQs+0a4WDZfzT5spVABkP35TcLyPlgoLQLM6yYwfR6h3SAtNp0fnFRjZFw4sCw3R7hYNl7V2fxxUUMUZMelRN+DPWPpF0e4WDZe6oYZEVDNlNqbHv6Nf7Q/6TeV2vse/yDn9c/oCDzYZryUvM2A9C3HR7hYNlzaIKBNUL9BCUcgojQ8Of/oH0A1CyCikGDJB+ibzukqMH+NmFnELK9HuFg2XxRA9NFQgZbajx78cB71f+jKl9anHvyHFvj/6JlDMUcgot/Gha/pm0IJ1yCi2a1oo+gAQzXXIKJnF5FT6FvbuCEz59zmvVAt8p8fvZxiOZDtdC2PR7hYNlzYY/3JUa5AMUcgoWsknQPoR0a4WDZeJzjofVEaQzVjIKNn2fjX6Iw82Ga8l5cogYwto0ExRyCg5Vd4q+nm+RIObnoDrZgELA7m1cIHqF9qKf/oiEE11yCgkdqpc+gD27ghM+TsPzVgLe6dH72cYx9gbcQsl0e4WDZcf5K4FVB6lqYIBAIQc50cLKdGuFg2XhtNKJVRzUA1GyCi1Lvkt+iYPNhmvJcveaRwLFoVZM+lRecGmUvob0e4WDZfjWYkUVFXQQkrIKDdjRmb6X4WeLelRS8FrDPpuEMxTyChl8mBr+jx+hIOYnl3g2E8LV9GuFg2XpJGje1RxxRkm6VFAkWBl+iWF2TDpUZoRNgH6MrN6yIwfE9gXOgtUp8d89RgzSyEkC2HR7hYNl0UZ0XJUTRBNSMgofTm+ZfoiZD/+UnCzrT1JC3azusmMHxLMxCALQrP6yYwfFp+QdQs8szrJjB9E4dxLCxTQwnLIKHFoEif6ZhANcsgovsOEbvopKzkegyB9GMM7C3wQTXLIKLnG+3P6ais5HoMgEJs+EAs0p0fsZxiWVP1VCy7R7hYNlzcpYSJUVcUZMelRoVHFQ/p/0e4WDZd8PAZyVHtkP/5ScOMMhmwLSKW3rMe/k+IYcvpxDzYZryU6BFAoC0fzukqMH4nBBnALRNDCc8go+O6zFvoWEA1zyCgapWhN+ikrOR6DIDmaokYLExBNc8gozSObC/pmKzkegyBbX9ZKC3+nR+1nGFWKxzYLV9HuFg2XZjEYd1Q9pXXRx78460tg+jlQjHbIKAg8XVH6PVDMUcgoq44rd/o3kAxRyChG5cF/+nPQTFHIKAWaTzL6IL5Eg5ueRWw8UAt6pamCAQAK2fxPCwOnR8n5GN5EiyILNtHuFg2Xxcn1PVQnhVkz6VGGHb85+nfRrhYNl4DqBGZUXZBNTMgo9Pg2HfpnDzYZryU9BUZuC0LQwnDIKEC7myL6OxANcMgoXPUnC/pE9u4ITPkc+zZJCxqnB+pnGGqzBQQLL9GuFg2Xn0HWZ1Q40I1zyChYrq0f+moQzFPIKPTnNFD6OH6Eg5iecm9hRAsjhdkw6VGeOwdk+iyVJE6sLV3d4VgLTFDMXsgoZCFZQ/oHfkQDmJ5UJXRECxSVpE6sLXv5JEELD1BMXsgoAxWxHfp/5QB6hVsZFFpXCwKnx/8DGDC0ShwLatGuFg2XkHSiT1Q0xZ5S6VEwn+sU+kRlqEEKAJ9jF2gLbbm1cIHqg0uPV/o1EI1xyCjbBm12+iD27ghM+cxy5BsLaaeH62cYuM9ZFgtT0a4WDZcpZe9WVAHQjVrIKFFUPjP6QmUoQQsAdrWdeQtwuXUciOoPdD4O+iIQDXHIKMI4Tn/6GvbuCEz5r5ntdgt2EE1xyCjllIUD+jn27ghM+e/05HwLBBCNfsgoL/rMV/plKzkegyA/gUwcCzWnh+hnGNsVxRoLG9GuFg2X6ceTI1QAEI1JyChcMl07+nZlqE4IAPYSE1ULI36Eg5ueF9nCVQsiaKoXt6mU/PtrC1qSEXV+beoRzYYEDdizOAUAAAAGEBgFAK6WXnEc+n5zwP4ERjQEURk6TAUAAAAWEBwUAASVv8kUCAAAACEdEAgUAwIABKxECQkMAAAAPR4SEB0hHRAIFAMABLYZtisKAAAAMhkQAxASBRQDAASMdv5bEQAAADkEHBAfHhgVIx4eBSEQAwUABEZPjC0HAAAAMjcDEBwUAATB+zU1BAAAAB8UBgCuUFMwes1+c6CZjBZLrpKMck3bfnPgCh6PS66OT75xEIGM/yPBw0sEv3YfagsAAAA2FAUiFAMHGBIUAASejfsdCwAAACIFEAMFFAM2BBgABGJtwTgIAAAAIhQFMh4DFAAEFMHfcREAAAAiFB8VPx4FGBcYEhAFGB4fAASR0AhJBgAAACUYBR0UAARPK7U2CAAAADwQFVE2JDgABC+Op00FAAAAJRQJBQAE+wvpYB4AAAAzCAEQAgIUFV9RNB8bHghRBAIYHxZRPBAVUTYkOAAEfinJOAkAAAA1BAMQBRgeHwCuubE+O/p+c8D+BJJLroPuq136fnPA/tgmS64hCz0z+n5zwP5UCEuuKCIzB/p+8xfcunVKrn2FOwP6fnPA/vUNS66Dh4Eb+n5zwP6aGkuuA/kCa/p+E01tR1FKrjJMU0z6fnPA/ggJS64f4spc+n5zwP7RCkuuSk+/Lvp+c8D+ZwBLrsqDbRz6fjNPpqlWSq59AuR3+n5zwH7fdEuuw9ruFfp+c8D+jQlLrtjl3wD6fnPA/tAWS65ZlnNg+n4zQ1BzaEqudSxTOPp+c5BbPHFKrpo6A0P6fnPA/kAcS67QAiZc+n5zwP7idEuuiGeWcPp+c8D+OhNLri9Ncln6fvM0SDxxSq6Uxjht+n5zqqQSHUqurrd6Zvp+c8D+hhpLrph0Yyn6fnPA/vQIS66dvI4y+n5zCIUSHUquzeKeSfp+87EYD2BKrjq5Qgz6fnPA/oQOS65YhRc3+n5zwP6kOkuuqA16avp+c4SrES9KrgIY42P6frMnhe1aSq4RhnpZ+n5zwP6XD0uuRdFGNfp+M9LxymFKrraH2Az6fnNgOnglSq6XBYwd+n5zwP7pD0uuo5DNNPp+c5TSeSVKrlMmdX36fnPA/uwIS64ScMU++n6zW12xYUquMA79GPp+c8D+jBdLrm2dlg36fnPAfpN3S64vv80F+n4z6ysDWUquM5I0EPp+c8D+kQNLroh9+3D6fnPA/jEOS64TAzlh+n5zMnWcHEquoRlrWPp+c8D+BB9LrgYEcUv6fnPA/n12S67ICAUx+n5zwP5Ew0uuEE3aefp+c79DtwhKrvybMFT6fnPA/gAIS67Gpxsd+n5zwP46HUuuCNdNWPp+s7ro8VRKrp+UjDn6fnPA/uoWS673lQUG+n5zwP6UdkuufiiPWvp+c8D+bAZLrqYmEV36fhOnd7pUSq7MvnYH+n5zwP5jDkuu6WKQS/p+c8D+VAxLrgr6w1T6fnPA/kUDS67reUg0+n5zj966dUquhE6uAPp+87bvK35Krlo/lD36fnPAfkZ0S65CzPh2+n5zwP4fdEuuKgJqZPp+c8D+/gdLrlvriAD6fnPcGip+Sq4vNHBo+n5zwP4MFkuuDlxQA/p+c8D+XAVLrgR+eHn6ftN86PZWSq4U/JQP+n5zxpB5EEqu5vxXWvp+c8D+WwRLrh9KIWH6fnPA/gcNS66Ev2oD+n5T+lcTX0quRyauIfp+0w2d2lNKrkUeVh/6fnPA/oR3S64tnWw1+n7T7ZbaU0quoUNYVvp+0xHkZVZKrlXVYWD6fnPA/q4DS66mz3Zo+n5zr1pADUqugcP/C/p+891Hg1ZKrg2eDw76fnPA/nYNS66RcPJd+n5zwP64DEuu1bOJAfp+86bgj2lKrryVxE/6fjMET69aSq49HRI4+n5zwP7SB0uukt37Gfp+c8D+BPlLrqA2LBL6fnPAfih1S65jg1Yq+n7zVf3rc0quGvB0U/p+czT0/VxKrsaot1r6fnPA/hADS64PYccv+n7zVvP9XEquy0YVFvp+c8D+pHZLrrktPWn6fnPAfjJ0S65JLLEo+n7TeXpwWUquJ/Z8Cvp+c8D+3AtLrqy/Thj6fnPA/gsPS64SXgJQ+n5zZHqtGkqu7PLUDvp+c2UBcllKrgiQyiv6fnPA/ighS64tknJw+n5zwP7wG0uu487IePp+cypzgF9KrpO9GlX6fnPAfkt0S64BhvhR+n7TUVOqV0qutAxwIfp+E7m7l1VKripQgh/6fnPA/mwRS67cUQ9z+n6TL7iXVUquQuiwGfp+c8D+wHRLrsGwnzb6frM3rKlWSq5adjYa+n4zoHEsYEquyfiYUPp+c8D+eghLrt3kNgT6fnPA/oIaS65QUa98+n5z8HosYEquJe//Hvp+U+kEBlpKrmifkD/6fnPA/o4ES679W7RG+n5zwP7/BkuuWQlWVvp+81z5k1BKrq6aJH/6fnPcZrlcSq6dqc9t+n5zwP5oGUuuBa/mPvp+M8/wRVdKrpgkbkr6fnPA/qEPS666tFxu+n5z6bykeEquzLAZPvp+c8D+9BJLrvNr2y/6fnPA/jIMS64+1cAe+n5zwP5Wd0uuBJvNX/p+845DGmhKRA5CSQB3ADqTuVoXMwdlWwiZbT86gZ19tVCDRws0palFAgB4PQR4CxNoqhe3qXng9DgLCyCnGWAwZhHNhgRgywJFCAAAACcYAhgTHRQAJVD1SgAAWw5CSQAQAVH32wJWMzN3QQiZbYVZM+lRUY6sKfphp0fM5hjN7CY0CxnR7hYNl3S0MmJUT2X2vse/b2tcYfoCJTW/x78XHq86+iWz+siMH8OwNzMLQbM6yIwfDpo/Wwt7s3rIjB8HVfc+Cx+nR8rjGMEXLxMLa9HuFg2XJ5SzPFRI87rJjB+ssfsmCyzR7hYNl4R7vw1USuW3v8e/jvMKH/o9ZD9+UnCk4+N5C0oPNhmvJdwu0BILLTP6SYwfonT/LAtIkAxQyChGi7Us+k3QTFDIKBSON076eBAPUMgoUkMKY/ptEDwWDdOmijcDVHdVJ0+vLd3ZOlMLdT5Gg5iehdaHWAsTZauCBgDMOcJYCx4IROjyPYOrAlVUSWiqF7epSKBTQQs8R/XwfBduEc2GBMIvzRkFAAAAFhAcFAAEugMAawgAAAAhHRAIFAMCAAT5pRlQDAAAAD0eEhAdIR0QCBQDAASF41J9CQAAADMQEhoBEBIaAATHVD1UBAAAADwhRAAEA87KaQwAAAAjGBcdFCISAxgBBQCubjEfevp+c8D+BEY0rmlQpST6fnPA/gSSSwRBYApWBgAAADIdHh8UAAQnPDkXBwAAACEQAxQfBQBvDkJJAAwB/dw/eGozFA5sCJlthVkz6VFip/Ms+ka5NRyI6k49ZDz6JRANUcgoCC/3Z/pFKzkegyAlMt10CzGnB8tnGEXU0VMLetHuFg2X/OSZcVQAs/rIjB+HuIpoCzDR7hYNlwCPzwhUVkVZMOlRe64IMfoVZD/+b3CS4XIuC0EPNhmvJXu4E30LULM6yIwfJ25/JAt5ubVwgeosCL5z+l4QjV7IKI2siiH6PCs5HoMgb7GoBgtLp4fIZxjbsXUbC23RrhYNlwhPiglURmQ//m9wh+7jHAt7s3rIjB/ux7l/C1fzusmMH5kOti8LVLk1HIjqlNEidvofEA1eyChAD4Ep+lorOR6DIAbpMHgLeRBNXsgo4ZcaPPol9u4ITPknrWkOCxinR8hnGNjLrFsLYtHuFg2X3L2EPFRTM/pJjB8dg/4QC1zRrhYNl/EjuyFUQyX1vce/+NWTMfoJDzYZryXL2pMjCzinR8v9GDegZCoLB9HuFg2XzzqUXlQDkAxQyCgUbwl3+iHRrhYNlzRfKBNUDRDNXsgor2H4VvpZDzYZryVmKJxlC1nRrhYNl/a1kktUXmQ//mxwTptjJwtK0ExQyChIjA4B+nqnB03hGFuidyILe9HuFg2Xj/CXLVRuEA9QyChYkCVw+jjRrhYNl4HcRTFUNtAPUcgozezxNfpADzYZryU+6l1ZCzwQPBYN0ypBCyZUJlUnT68tns0aMQs9PkaDmJ4btKd0CyFlq4IGAEwtn3sLdAhE6PI9PQSCAlQaaKoXt6lSs9USCwBII5tBAnURzYYEln1RfQUAAAAWEBwUAASzhMBiCAAAACEdEAgUAwIABOeopAcMAAAAPR4SEB0hHRAIFAMABPQe9zIJAAAAMxASGgEQEhoABIVhqzQHAAAAIRgCBR4dAATmHW9XDQAAACEYAgUeHSISAxgBBQCutzsWQvp+c8D+BEY0rh1BYTf6fnPA/gSSSwRwUu1mBgAAADIdHh8UAATEQAcoBwAAACEQAxQfBQCu4KNDC/p+c8D+LCRLrsBzTzz6fnPMFYpiSq6759kX+n5zwP5aGEuu8i4MJvp+cxfN61RKrh1uiVL6fnPAfuN0S67qfrZA+n5zwP45C0uuz1uoa/p+c8oUimJKUg5CSQA0AcBhYxozMz8o7AiZbTm1cIHq0XhLDvppkM1ZyCgiBOIF+k6ruR6CIODtrAwLd5ANWcgoF1P3B/podmkIT/k4xOQsCyy9J/W4h9hb4m0LO6fH8/IYzVeFTgsu0e4WDZfZzfoCVAzkP/5RcFjM7gELetGuFg2XDACqblQ/ZD/+aXDajBMJCzIPNhmvJVtAWDgLCYVZM+lRWv6SVfohxZkw6VFShctB+i5QalzIKNFFgkD6TJCqXcgoiME3J/pOK7kGgyD9bgY+Czqnh/c0GBUwWXkLSdHuFg2XY13JLlQI8zpIjB/XTWk1Cz/RrhYNl1n/9V5UP6VcvMe/p99eXvoPDzYZryXii/cpC2rRrhYNl1AWBARUEqVcsce/9o2taPpG83pIjB85ymkyCx+5tXCB6iFWtET6f5AqXcgosN6VH/pc9m4QTPmxbwcxC3yQal3IKGLaGXn6avZuEEz5SwvlNQtZkKpayCjjoDQo+mD2bhBM+aZHQgULHqeH9DQYSB8wfQsU0e4WDZctF1U1VDnzukmMH8oyYF0LedHuFg2XYHYVRVQuRVkz6VECyG1g+klkP35pcJ25pFMLKA82Ga8ljiOwXwtq1WTM3y36GdQdCy8+rJtJnn1lKkYLetHuNw2XjMvwGVQH1adM2S0wiDAKCz7RrhYNl3k6gRpUHaXduse/Nv+PGPoyEFdQyCjGaqgP+ko+7xtJnjSlywkLBQWoBWDOLLkbFwt90a4aDZfsIpMKVArVp0zZLWKBpW0LbxCXUcgoeSCzXPovPu8bSZ6HqsloCzkFqAVgzicnz1oLFdFuHA2XOn95H1RV1adM2S3uJaMICwinB3fKGCIxihwLDtHuFg2Xm6MATVQGENdRyCgl+vQS+i3R7hYNl+ZimUZUfWQ//mxwV/XMFAs/ZD9+b3AqBO15CxgPNhmvJbtf0yALKj7vG0meaByEaQt6BagFYM5Zqi0lC1rRrh4Nl555pzJUVdWnTNkt3bLvHQtU0a4WDZdL3Bd9VC5kP/5RcDEtEFMLFhAXUcgo972OEfpgPu8bSZ7Y/IMsC3QFqAVgzoaopR4LRNHuEA2XnCpuFFQQ1adM2S2Q1wQWCwGnx8jMGKXsk30LA9GuFg2XkaXhclRpBdo66VFOTjs3+gwQV1HIKAMZLXb6Lj7vG0megNOodQtEBagFYM5Kz3YOCz3R7hINl6EmuU9UYNWnTNktOlyNcAtEubVwgepHMisj+jKQKlrIKArnlGr6Ryu5BoMgaKBEEQsepwf0NBhukBEzC3zRrhYNl216TRxUZWQ/flBwzSZrUQsgEJdeyCgCT2sg+jU+7xtJngec1QMLEAVoBGDOiFLMFAto0a4DDZd4+ex8VCG5tXCB6rmCtWf6SZCqW8goGrqUHvoRK7kGgyAv/IheC06Q6lvIKM1ulTj6DvZuEEz5LmdpCAtTp8f1NBjgYfoQC0zR7hYNl2El6ANUWcVYM+lRTFyDIfph0a4WDZdDfnYlVE5FmTrpUalNB3D6Xg82Ga8lJVeYUAt2FWdM2S1aBvJMC1F+r5tJnnjYODsLVdGuBw2X2DopDlRAFWbO2y3PvZlAC32nx8nPGOctLCkLZ9HuFg2Xj0dhY1RPUBZeyCg01Cxd+lnR7hYNl2tjPhRUWWQ//mxwvh9LaQtCZD/+bHB/8ixmCyQPNhmvJX5cq3MLSH7uG0mehHjrVAsFRWsEYM5aTm8cC0bR7hgNl0sZuxNUIgUaP+lRKXxRa/pGzzWZqSWs4DB4Cx5+7ptJnp9r61ALcEVaP+lRe/J1fPpNufUciOoe2xJW+giQalvIKJkXWkD6eCu5BoMgixUHTgsKkKpYyCigD2oq+in2bhBM+T901GgLNJDqWMgoYn2WfPpHK7kGgyCrqVxNC0ynx/I0GOKb5WQLLdGuFg2X2JikeFQsZd+7x79mhSED+gRz+EyJH2T7aXwLNrM/zIkf7lZmOQtHp8fLsxieRK8sCx7R7hYNl7NYXRJUYpBWX8gonRdQb/pF0e4WDZfVLR5+VGxQVlDIKPRGTV36RmQ/flBwVVg2AwtgDzYZryVdNmcCC26nh/bIGIenaVYLaNHuFg2XRS1NHlQrZD9+aHC+9mAcC2cF2zDpUQeAEUr6SwVFPOlRROXdVPofp0fKsBgD+7VhC0rR7hYNl0fVdiVUJDP/zYcfbhvHbQt40e4WDZfLStVQVCCQVVHIKPj/TE/6eMUaOOlRRcx7S/ovDzYZryWdOV14C0e+LptInvdRKToLI0VaP+lRFV7ANvoQuTUdiOrm23Jq+gaQaljIKHry9kj6BPZuEEz5VsneKgsKp0fyNBiK8r1VCxrR7hYNly+c7WVUUHP4TIkfvHaiGQtR0e4WDZdlvW99VGBQFl7IKJpJgUn6c4VaM+lR/ZvaAPokDzYZryUoBM8fC1mnR/bIGPAXfX4LZdHuFg2XbtIpdlRjsz/MiR/fyEoRCwnR7hYNl1YVhiJUJmQ/flJwj5CTcAtWZD/+bHD3vEhxC3gPNhmvJVlk0DALOZAWXMgoiBqIYfpOBUU86VHfPi1W+l0z/82HH6MXDCALGr4um0ieAt8FTwtTkqgZk9nXjE0SC3/Rrvjyl+j2bAZUfVKpGZPZxRxpewtq0W7L8pcRnSZmVAVoqhfmqaLc/kYLFaiWvwNdSBHNhgQSMtURBQAAAB8UCQUABPm9YAUFAAAAFhAcFAAEArozEAgAAAAhHRAIFAMCAATJB9BlDAAAAD0eEhAdIR0QCBQDAAQrCgNzCQAAADMQEhoBEBIaAAQlbVAhDwAAADYUBTUUAhIUHxUQHwUCAATmoRxoDwAAADcYHxU3GAMCBTIZGB0VAASvMfwuDQAAACEYAgUeHSISAxgBBQAEqCqdKQwAAAAjGBcdFCISAxgBBQAEiud5Dw4AAAAiGR4FFgQfIhIDGAEFAAR9L69fDAAAACUQCxQDIhIDGAEFAATOGtAgDgAAADYDFB8QFRQiEgMYAQUABCYwBSEMAAAAIR4GFAMiEgMYAQUABGGHsEMEAAAAOAIwAASlMyx/DAAAAD0eEhAdIhIDGAEFAATG8AB7CAAAABYUBQIUHwcABHnoCx0GAAAAFRQTBBYABAR0ciMLAAAAAhQFBAEHEB0EFAAEAR9ZBAcAAAAjFB0eEBUABB7m+gQFAAAAMBwcHgAERn1UCgUAAAAcEAUZAAS6t+YqBQAAABkEFhQABBaRxFIFAAAAMh0YAQCuGHRMdvp+E90DhVRKrsjzuVz6fnPAfmF3S65mXdMT+n5zBAaFVEquaz8lDvp+c8D+FXZLrj+Xvjf6fnPAfq93S67JI5tA+n5zwP4+EEuuSn5va/p+89mmqVZKrgPYdA/6fnPA/iANS66koYRb+n7zTvqbc0quRcUSdfp+c8D+thlLroxialP6fnPA/noES67yA+on+n4TW7CpVkquj1wnXPp+c8B+fXRLrtGeTD76fnPA/s4GS64VN11w+n5zwP7AJ0uuzB1lavp+U2FkRVJKrn2qu376fnPA/j8AS64jfLcy+n5zjL2tGkquU60JIPp+c8D+jgdLro41+Sn6fnPAfk93S65NpdMC+n5zwP5E60sgDkJJAGUBUjtyXDcza2tjCJltOTUciOrLKRho+iOQDV/IKFL8ahH6fqu5HoIghoQRUwtmvSfLuIfiLJwyCxnQglzIKAEUFgn6XxDNXMgoui0rE/ow9u4ITPnlDWFuCz4QDVzIKIcPBQD6BCs5HoMgiFW9KwtNpwf2Zxhvg8YbCyPRrhYNl/VRtDxULEUYPulRN1YNOfoF5D/+UXD6aUNSC2qnx83NGCyC7QALT9GuFg2XQEUeVlR3UNZQyCgTImE3+laFWTPpUc5MI0z6VbP6yIwff1RXAwtr0a4WDZdSpRlKVHZkP35vcAbeWAALQLM6yIwfrS+LKQskuTUdiOoUI0dn+gsQF1HIKMN8kGv6Ais5CIMgbZ+oMQtrEFdRyCjGlc4C+hz27h5M+ZGG3zkLDqdHyzMY9RHyGwtI0e4WDZdVWnEuVDuzesiMH2YSf2oLC9GuFg2Xj0aBLFRoJV2xx78r+ABm+mIPNhmvJagAyUMLEfO6yYwfsorOJws8ufUdiOrYvTpk+hgQ117IKN5X1jr6FPbuHkz5hugQOgs1p8fIMxiT70FNC1rR7hYNl2ineXlUGJCRXsgoTo5nRfotpZu9x7+/9wwa+k8z+kmMH4UwojgLFZAWUMgoA1YiTfo60FReyCgdkT09+igQl1/IKBGYejr6Ays5CIMgKR0EJwtHp4fJMxj+XGkBCz7R7hYNlyzOzElUF9BWUMgobpH6WvpG0e4WDZc/WJxgVFUQkVHIKFTmZmP6LiXcv8e/o7MeHvoYDzYZryVSMfUwC24QEVDIKHi48mH6BBAqFg3TJX6VQVRBVSdPwy3xyxxPCxY+aJVMnhnqAXYLPGWBggYAD5DAcQtcCETo8j0OhCQwVFBoqhfrqRXriBULCTRru1R/fBHNhgSi60MCBQAAABYQHBQABGTkrWAIAAAAIR0QCBQDAgAEPXnncQwAAAA9HhIQHSEdEAgUAwAEx3vocgkAAAAzEBIaARASGgAEJEOzEggAAAAiGR4FFgQfAAQCy8R7DgAAACIZHgUWBB8iEgMYAQUArp9yomv6fnPA/gRGNK4hxq81+n5zwP4EkksEZWjQfwYAAAAyHR4fFAAE1LiZMgcAAAAhEAMUHwUArs2gsjf6fnPA/q8PS66LZxlw+n5zwP4HC0uu2/5wSvp+c0bjrRpKrq7+Omv6fnPA/pYSS67bRMsx+n5zS/HPdEqufyflH/p+80CKSHVKrqjHLGT6fnPA/mw6S65fYHBe+n5zeoxIdUquyOsnWPp+c8D+5D5LrlhLzTj6fnPA/sTWS640NvRm+n7zEIwkYUqu8H9Tefp+c8D+nB5LroINcDT6fnPA/ggkS67hu+EQ+n7TbaAbWEpRDkJJAEQBc42LTG0zZwpoCJlthVkz6VF/A1cx+laz+siMH467kgALZLM6yIwfbg2OLAs9ubVwgerIj9Um+j4QDVHIKH+y/lv6ZvbuCEz5JdPNGAsLEE1RyCi6r1ZB+hwrOR6DIHrAb14LBadHy2cYWi42cgsG0a4WDZc1CcwqVBBFmTDpUYc3smz6N7N6yIwfnnCGMQsb0e4WDZcjoFAYVAgFmDHpUeLWPSz6YZCPUMgoy4n8IPpN87rJjB+PPTkvC36nx8rgGL0gQk4LddHuFg2XVbVCAVRgM/pJjB/9q4ZvC2bRrhYNl0DxrD5UdGQ//lJwtpcPeQsmDzYZryXgrXECC3GQDFDIKDN4/x/6W6dHzOcYNtD8NwsX0e4WDZdm+3EyVEzQTFDIKGwBjFL6RtHuFg2X5nZpQlRXEA9QyCi2Wmkd+nqFmz7pUTqLZyX6ZA82Ga8l2W/RSwsjEA9QyChc+DIR+kUQ/BUN078rEB1UDlUnT68t5q/0NgsaPkaDmJ5Gl6M9C0u5tRyI6shdQBv6fRDNXsgokNZhFvoLKzkegyAgoNhHCzYQDV7IKNjELxf6RvbuCEz51dymNAs/EE1eyCiop+57+j327ghM+Xqb81ALFKdHyGcY9sGTLgtU0e4WDZfvEWV7VGlkP/5tcJ17AzwLd+V2vse/cXtLWPoHZauCBgC6GV07CwoIhOryPQV/fRpUG2iqF7epQH0nYwszX+YPCXR1Ec2GBGxOBTsFAAAAFhAcFAAEkpeeBQgAAAAhHRAIFAMCAATq5modDAAAAD0eEhAdIR0QCBQDAASj9lpsCQAAADMQEhoBEBIaAAScnKx8BgAAADMQBR4fAATg38Y0DAAAADwUFB0UIhIDGAEFAK7emKE1+n5zwP4ERjSu8MGkRvp+c8D+BJJLBPFbLX4GAAAAMh0eHxQABE7j9wsHAAAAIRADFB8FAK78g/4/+n5zwP5xCkuuTDXXVvp+c8D+9AlLrvSbl0X6fvNxLLphSq7uGNtl+n5zwP7E0kuuCPS1aPp+c8D+KwhLrudNjw76fnPA/ooTS65CBqpS+n5zAEFtLkp8DkJJABcFYhEXSBIzTV5HCJltPzqBnX1dv49GC3PRrhYNlz0hPBRUQtDNU8goRMZ/C/pxpalFAgCdUMksC1M/OgGdfYz/72MLPdACU8goGM5CQPoEEE1TyCgWEFB2+h/27ghM+dakmGQLFxCNUMgoFeLMefofKzkegyD/T8A0C2unh8pnGE+YCzALN9HuFg2XJUZ0AVRBpalFAgDLAIJVCyLR7hYNlx4x7gtUSGQ//lNwYWFFZgsc5fa+x7/81PhA+mEPNhmvJQLgQ20LJz86gZx9jCfbVgt50AJQyChfe3Bo+nIQTVDIKJrSISr6VSs5HoMgVAtkUQs4p0fKZxhvhA5cCxnR7hYNl9zNVAVUYaWpRQIA8eNlcgtu0e4WDZdrYRFuVGVkP35ScF8ubx0LKGQ//lNwMz3oXQtiDzYZryW0zFEuCw8/OgGcffsX4nELUqWpRQIA/wDMbAtpaKoXt6lYj3tlC2T1tARtR20RzYYEDWqJfAgAAAAnGAIYEx0UACWOTIdeAK7cQ0MX+n5zDE1lHEquiN0OT/p+c8D+DAVLrnsT/Ej6fnPA/qAYS65TDJRr+n5z+EVlHEqugMQzL/p+s0KrRFhKrgEEVAf6fnPA/mAWS67jrjV1+n7zvKpEWEpfDkJJABkBWMtdd1syaDxtCJltEI1QyCi7Cy50+i9QzVDIKD8eNh36WjYpiEz5Y4UHAQt+UA1QyCgYRTkY+gNr+Z6DICRXiAoLeKcHSmYYG7xgRwsH0e4WDZe5+qAVVAXFWTPpUZkozkD6b9HuFg2X9wMAbVRLkA1QyCi5OSIU+hwF2DDpUU2BzSb6Sg82Ga8laQZXIwsl8/pIjB8YVX0CCzanB03hGF4qGxYLM9HuFg2Xre5iflRJBVgz6VFbAfQ2+jTR7hYNlxnIwglUFlCNU8goQ/WdePo5pXe+x78ZcUVI+goPNhmvJZIv/WsLSadHzOYY9SRQZAta0e4WDZe47LoMVFald7HHv2BXmwH6ZKX2vse/x8mSGfoBMzrIjR9Khmc0C28QjVHIKD7WoSz6K1DNUcgow5XkRvpLNimITPltUUoVCypQDVHIKOgxbwz6d2v5noMgvJLWVwtKpwdLZhgYXHloC2TR7hYNl6hVcAVUQUVYM+lRfmT7QfoS0a4WDZdtuF99VH4QjFPIKNHnDg36Bw82Ga8lBwF6Jwtic3pIjR9t6KtfC0p6eg2IhT5nezgLTP7Eg5iee8RVPQtNvkSDmZ4DqCAkCx6nx83mGLdNdxwLFNHuFg2XtVoif1QOBVgz6VFq2Hcc+gvRrhYNlzAGj21UPtACUcgof1xtAfpODzYZryXHPx4tC1DR7hYNl8uMOTJUINACUcgoJmjeYPp/xRkw6VGQskNV+kszesiNHzATJBQLbnnVjpIkXtMRZwsaqKqXt6kaP5h0Cy1oqxe3qV3bS0gLSerKCEx8aBHNhgRwXNgSBQAAABwQBRkABFjYMEkFAAAAEBIeAgAEDJbHbAQAAAASHgIABC2jNz8DAAAAARgArth2WVP6frPZ5bhUSq5xyco5+n5zwP4gGUuuLSCGLvp+c8D+fQxLrqZYBVT6fpN857hUSq5hCY1l+n6zzyYLYUquXkPTdvp+c8B+indLrhHQ9iT6fnPA/sQJS657Frw2+n5zJyYLYUolDkJJAA=="),getfenv())()
RAW Paste Data
We use cookies for various purposes including analytics. By continuing to use Pastebin, you agree to our use of cookies as described in the Cookies Policy. OK, I Understand