SHARE
TWEET

ARAScript 12+

XanZScript Feb 20th, 2020 (edited) 633 Never
Not a member of Pastebin yet? Sign Up, it unlocks many cool features!
  1. --[[
  2. ARAScript v1.0.5
  3. by Aanki#3852
  4.  12 caserows
  5. Discord Invite : 8HNkBB9
  6. ]]
  7. local ARAScript_lIIIllIllllllllIIlI=string.byte;local ARAScript_lllIIlIIIIIII=string.char;local ARAScript_lIlIlIIlllIIlIIl=string.sub;local ARAScript_IllIlIlIIlIlI=table.concat;local ARAScript_llIlIIIllIll=table.insert;local ARAScript_IIIllIIlIllIllIII=math.ldexp;local ARAScript_IIlIllIIlIllIlIllll=getfenv or function()return _ENV end;local ARAScript_IIIlIlIIIIllIlIllIlIIlII=setmetatable;local ARAScript_llIIlIlIIIIIIIlII=select;local ARAScript_IIIlIIlIlIlllllIllllII=unpack or table.unpack;local ARAScript_lIlIlIIIIIl=tonumber;local function ARAScript_IIlIlIIlIlI(ARAScript_lIIIllIllllllllIIlI)local ARAScript_lIllllIlIlllIII,ARAScript_IlllIlIIIllIlI,ARAScript_IIlIIIllllIIIllllIIl="","",{}local ARAScript_lIIIllllIlllllIllIlI=256;local ARAScript_IIIlIIlIlIlllllIllllII={}for ARAScript_lIIIllIIIlIIllIllIllIIlI=0,ARAScript_lIIIllllIlllllIllIlI-1 do ARAScript_IIIlIIlIlIlllllIllllII[ARAScript_lIIIllIIIlIIllIllIllIIlI]=ARAScript_lllIIlIIIIIII(ARAScript_lIIIllIIIlIIllIllIllIIlI)end;local ARAScript_lIIIllIIIlIIllIllIllIIlI=1;local function ARAScript_IlIIIIlllIIllllIlI()local ARAScript_lIllllIlIlllIII=ARAScript_lIlIlIIIIIl(ARAScript_lIlIlIIlllIIlIIl(ARAScript_lIIIllIllllllllIIlI,ARAScript_lIIIllIIIlIIllIllIllIIlI,ARAScript_lIIIllIIIlIIllIllIllIIlI),36)ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI+1;local ARAScript_IlllIlIIIllIlI=ARAScript_lIlIlIIIIIl(ARAScript_lIlIlIIlllIIlIIl(ARAScript_lIIIllIllllllllIIlI,ARAScript_lIIIllIIIlIIllIllIllIIlI,ARAScript_lIIIllIIIlIIllIllIllIIlI+ARAScript_lIllllIlIlllIII-1),36)ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI+ARAScript_lIllllIlIlllIII;return ARAScript_IlllIlIIIllIlI end;ARAScript_lIllllIlIlllIII=ARAScript_lllIIlIIIIIII(ARAScript_IlIIIIlllIIllllIlI())ARAScript_IIlIIIllllIIIllllIIl[1]=ARAScript_lIllllIlIlllIII;while ARAScript_lIIIllIIIlIIllIllIllIIlI<#ARAScript_lIIIllIllllllllIIlI do local ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IlIIIIlllIIllllIlI()if ARAScript_IIIlIIlIlIlllllIllllII[ARAScript_lIIIllIIIlIIllIllIllIIlI]then ARAScript_IlllIlIIIllIlI=ARAScript_IIIlIIlIlIlllllIllllII[ARAScript_lIIIllIIIlIIllIllIllIIlI]else ARAScript_IlllIlIIIllIlI=ARAScript_lIllllIlIlllIII..ARAScript_lIlIlIIlllIIlIIl(ARAScript_lIllllIlIlllIII,1,1)end;ARAScript_IIIlIIlIlIlllllIllllII[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_lIllllIlIlllIII..ARAScript_lIlIlIIlllIIlIIl(ARAScript_IlllIlIIIllIlI,1,1)ARAScript_IIlIIIllllIIIllllIIl[#ARAScript_IIlIIIllllIIIllllIIl+1],ARAScript_lIllllIlIlllIII,ARAScript_lIIIllllIlllllIllIlI=ARAScript_IlllIlIIIllIlI,ARAScript_IlllIlIIIllIlI,ARAScript_lIIIllllIlllllIllIlI+1 end;return table.concat(ARAScript_IIlIIIllllIIIllllIIl)end;local ARAScript_IlIIIIlllIIllllIlI=ARAScript_IIlIlIIlIlI('22C26727526525Z27526724R24W24S24R24T25224X25426526327925425A24Y25626526027924724R24R24V24825624R26525M27925327U24V24S26D26O26O25A24V25226P25228B25524M26P24W24T27I26227926M26P26N26P26I26526527923K24826525X27923V24W25425424Z25624925A24T24Y26426728Y27924Z24W25A25727D27F27H26527228228428628824V25A27D25625927G26P25824W24Y26O24T25A24O26O25424B26H23X24424N25226H27J27924124W24D24Z26525W2792AJ25A25825024Z25229U25726526628N26526127928E25A25224T24S29D27527X24R23W25624T24P25225827P27R27523Z24Z25A24M2BC2B62AM27524324W25825A24Z2BK2BM2BC2AF2752442BF25026525V2AN2BL2AQ2AS2AU26P28T27927C2C027A25227O2CG25725A24R27P29B27527226T27Z26P29O27V29Q26O25825724X26P2572AT29Z24T2CL24V24V29Y2A026O25624Y25925625728924P2CM29824S26O26J26P24V29L27929C28M27524R25224R29526525F2C72AP2AR2AT24R27326Q27323W25827F24V2E624A24N25625824R24Q2CN2AV2DU26729Z29F24T2652EN26E2EU2EU2AZ27925524W24W2CN2ER27K2DV25624N27Z2EN24524W2592462AV2B027525A2EK25328J2CG24X27N27P25R27923X24024D24324023R27323X2BC24W24Z24Z26P2932652CP26724Q24T2AK26M2CV28528726O24O2GG26P24T2FB29F24N2DA2A127M27O2DM26K26M2GT26E26L26L26F26J26K2A22FZ2G126Q2G42FF26725525225624Z29I26525I27923U24S2BC27326V2592C82E427D2732BV2BC24R26U2E72732CG2412FN2EX27527324623Z2HU2ES2792DJ24Z24Q27P25H27924T2H22G22932HP2EK24W25529824Y27324V2922542BO26525Y2792DW2GQ24R27N24V2HZ26729J27G27I2H62EZ2992CM26525J27926Y25726Q2JC2JE25723V26Y26N26L25726D2JJ2JL2JN2JK25723P2CG2BN2982I527524Y24W24X24R2532G52792CL24M2CG2FJ2G82K42JY27G2KB2J12EH2KE24S24M24X27Q2IC25624U2I927D2C52GC23K2ID2KO2562KQ2G623U2G926524K2GC2CX2D324S2D52D72D929Z2A128A2522GF29V2FJ24W2502DM26H26G26E26H2LM26E26N26H26F26H26K26L26J26G26J2LR26O26L23T24224C24625126H2AI23S2HA26G24L25724326Q23T24S26L24S24524L26M24P23K26K23U24D2LR23T2FS26Q25824Q26M26Q25126G24T24425625225326F24325725624026L26N23Q2AB23Z2MR23T24P24625025A23X24O23U24Q2J024227Y2FJ2AV2F426723Z24023W23V2KL27524725629H2IR2C627524C2K02CN2K126Q23V24M24V2FO27928A24V2AS2BU2DW2K026O25124S2K02CG24D24W2572K72BQ26727T27V2BB2BD2BF27P28Z27524523W24024124A24X29Z2N92O22EO2OB2562K12J02DD2DF2HC2EN24V29K27Z2782O92OB27G2I92AL27923T2B42EJ2BV2HG2BZ2EN2FD2952AV2BI2PI24X24X2EH27Z2IT2O92532982AP2F227727924024P2BC2532O52AV2G623V25A27I2NW23V2F627Z2P726724E23X24E2EA2EC2E62AW2I62CG24O2B324R2DS27925N24F2B72EO29T27Y2F02OH2KK2R32GP24Y25A23K2BU2HH2RL27N24W24Q2K124W2RQ2RH27525J2RK2PU2KF2G12HL2PY2SA2HH2G128B24X2C42R32SG24Z24V2G82OL2BH2792SM2BV2AK2FP2752R828E2EE2EG2EI2EK2DG2PH2Q524T2I42L22752832CW2GE2L52L72OK2GN28928B2LE2592LG2LI26O2LK26F26E26J26F26K2LW2LY26N26E26G26H26H26J26L2DC24726J25123W24E24324526E26I2M526I26F24X26N26M24X24T23Z23V24A25824D24925924P24N26N25824V26F2AH26K24E24024O24724925724126M25924N25823X23T25824M26J25426G25526K23W26H24M24L24Z2LM24T24U26Q24W2472462L12L32TD2D428J2L82TH2LC2TK2TM2LJ26G26K2TU26I2JK26G26F26N26G2WG26L2LK26I26O23R24V24424B25425124X24724L23W2492UR2MX23T24E23K26M25425323Y24S24B24U25124A26H23Q2562552PF2442NO24Y24T25824A23Y29123Z24Q25723K2GV24R25925124P24824R24724V23Z26L23R2452M223X26G23Y26N26526V2GC2GE2H824X2DX28H2BE24V26O2L62R92DM2YE2YG23K2AS25926P2I825A2KE2QE24O26526N27924E25A2SJ25226W24S2FX2IE26P24824827324E2II29729927324J27324B2W02D62HU26F24724125024D24D26E2ZI26525S27924C2QJ27H2562912932952N32K72NW2PD24Q24Y2PH31072OA2PG2QH2672BB24Y2BF2G02OT2SA24C2CM25625428J2K72SA2ZE27B2ZG310C2SA2BB27U2J32B62QB24C2ID2D324R2B62H62BB2EI2FK2ZY2752PD25A2HL2562ZD2ZF2IL2KR2O92RN2732912732402RQ2J92ZZ311Q23X24W24O2Z726V2OV27C2F22E92FJ24V26U26525C27926K26N26N26Y2E92OH2DG27331242HO31232F029U2T723W3128312A2NW2BB2G12JX26731002O52PT2ZZ2QS2AQ25924W24N2PZ2SX312J257312L312P2QG279312W24Z312L2I827P2OZ313H2732XO24T2SQ2IS313G2HA313I23Z27G2C425K313T2G12ZD314126V2AH2E62FY2DH2482G0257312A311B2AS2N92ER311F312Z311Y31202ZD2JZ2S22RG2S621B2682KE2RU24N2S626726V2RK2H624S24Q2552H831382R32732RX311K2GJ31212PH2R02F7313631382O8314I2HH27327B2732S42PK31392672OL2AP2562FJ2HB2BZ25T279311H311J26O2ZL24S311I2DZ25L27924927G2YG2732432522592A324T24M273311631312FK315W313A2EH2522BV311R31012LI26525E2ZZ2ID2CM28J315L2552Z82GJ2G12G3254311L27B2IK299265316L26731612L72I124X2BE2CN312Y243311I2HA26526K316V316J2T72IJ2E92EB2SZ2HU2Z22Z427026K26F26I26L2HJ2GZ2WE26E2WE26F26G26M26H2WB2TU26J2TY312A26T290316R2Z7315K2E826N318F270318226J26M2HJ2LK318V26M26F26L318B26L2GV26I26M26I2TR2HT2PH2ZP2ZR2ZT26E2652732K52RO2G82522S12Z72E82RU2N9315J2QS2732CL24T24X319O2J326525G319F27B319H319J27324F27324P26K2992522G1319I2D12QE27Z31652752N927B2702TZ26M318331A32TE2W131741S2AX26725P26R27931AR31AS2752AX28U2I031AY2672AX29B25P27529B2NW27927K31AW31AV26731B92S628U31B631B32672EN31BI28U2H62Z029C26727R27825P23Z31BQ310H25P2AM29B31B0267319E26729B31C531AX31BK2672R32792B031BC31B72672H627931C131C131BQ2AX2AX31BM267315G31CH31BQ27531CN2OZ26722K31CK27925P26Q31C426725U2DS22F31BQ29B31CM31BV29B317B26724G31BE31CR2752IB31C031C826324C27924L31BJ31BU26727831CP25Q31DQ31DU2B026124I31DU29N31AW31DK27931E031BE31DL27524O31DO31BV27831C1311R31DU2782ZY31BI28Z2SW2DS27828Z28U31C327827831DT31EO31DU31B631EH26725O2S631EL31DO27527825N27931ES27828127927831AZ31AS31BV2IT31F32I023N2672IT2IT316531EV313Z2RH2AM2SA2792IT2AM31BH27528Z2JA31CS2752AM2HE2RH315G2B031BP2C62IB319X31G42672E1316U27931D331B231DP315W31EC254267315W315W319E2SW31D3312C315W2SW2C625D31D22DS31GD31BQ31BP31D327126727026731GY26726Z26726Y26731GR26729N31GW31GU31CD31GJ31CQ31BI2ZY26W31CY31BV2FP31EC2AX2FP2FP31EG31FX31EJ2792FP31B631EN27531HQ26731ER31HZ31H9314W31C731DT26U2S631BI2S62ZY31HS2SW315W31H02ZY31BP315W318I26S27531D531D3315W31HP22831CO26726X31GU25P31GT31D331D031B131GU31D32CU31BI315W26O31F42752ZY2IT2Z031C32FP2IT2GB31C331DT2IT26L31C231FX2IT317O31C331EX2IT26J31JK26731F32IT26I31GV31JT31BQ25R31IR2C631AU31D331DP31D326H31CB22E31GU25A31BJ27531E22FG31E931GU31K72I02JA31D331D326G31CF25331GU25931BJ2AX31KE26731KR31D831GU26F2DS31CW317B27K26N316U315W26E26726D31H3275315W26C26726B2DS314H2AX31BP2ZY26926726831I431HG26A26731HS31LR31DF31C331IC31LT31BI31DT24E31IB31I131BQ31LV31LT24D27531CW31DT27631H931IR31DT31DL2BQ31CW31B631BC31DD31EX31CP31D531B631EX31IQ31M224B31C724F31LT31DT28U31K031HG31MT311F319E31D328U31AR22631BD31CS31EA26724A31CY31D02IT2492DS319E31EB31BJ26131B629B2E131FA31KU31NM31FB31D131EC31H031C631LS28M2482S629B28M31FT31DE31EC31KD31DE31LS2B031HU31O42B031HY31DE27K31I231OC2P031JS27K27K24631CF23U31CF31BD31AR31NX31CE27923Y31DE31CC31C727K31O331OF31O631LO2DS27K31OA31OH31DE31OE31OI26724531P527K24431PB26724331PE24231AS31D028M2412DS2RG31OV31FX31BR2672402S628M28M27R2SW27K31PI28M31BI27K31BV31PQ28M31OT2RH31OX31F031OU27931BP27K23X310I31OW31ON27526N24H31DE23V26731OM25P24X31QB31QJ31O423T31ET31O931QC31O423S31QW31QS31LA31DE23R31R131P331QY31DE23Q31R631QI31R327K31BS31OL31DE31CL31KC31OQ31KC31AS25631C831FE31JS31PV26731F727528M31FA31BI2B031RP31C331DW26731FK27527R31FM31EK31C82RH2B031NH31BI27R31FW31C727831G031M731FH31CB31H3313Z2IT2IB23P31R32IT31GA2DS2R331CM31FY31LU31SW2AM31GM31FU267312C2AM2SW2IT31GT31CA2R328U31BP28Z31H031H231TB31H531H731MB31SJ29N2P731PD28Z31HF2OZ31O12C623O31CY27531N231J731J131LX31J831P131GC31LT31OB31KL31M231C331U42YB31J426731I827931DD314H2K531IS2C62ZY31MX2AM31H02C631QK2672AM31IK31IM31C931UO31BJ31MX2IT31IU28Z31IW31US31IZ31JS28Z28Z31J331SW31J631J02C631G331JS31D32B031JF31LB31ON31JJ31M42B031JN31I32B031JR31JG31ON31JW27928Z31MV31TI2IT31AU31UY31BV28Z31KI31CF31K928Z21N31RL31KU31W431KX31VZ31F42JA31V326731KN26131W226731W731BA31E631WH31BJ31KU21M31KG28Z31KZ27931CW2OZ31L3316U2AM31L731FG31BP2AM31LD31LF279315G31LI2752C631LL31LN2SW2AM31LQ2C631BI2C631OY2C631UH31C7315W31M031G131HG31OB31XI26731M631CV31HG31MA31MX315W31DL2PU31CW2ZY31MI31I4310H26731D531UI31UU31IR315W31MR311F23K31IS31GG31LO2AM31MT31CP31EM31QA28Z31RZ31T128Z31RT31US31RW31SW31YN31UT2AM31S331IS31S631U131CA31MT2AM31TV25P22531IS31SE31BI31D331SH279317B31VA31HG31SO31R3315W31SS27931LH31C731HN31TW31I031T031LT312C31I031HG31GT311F31Y031CQ26N24T31LT31TD31R32ZY31H631H831IE31HB31LT31ZK31RL31HV31HH27531DT31TS31PQ31HX31TW31EU31TY31JY31O831AX31F331EN2JA320K31ER31LL320K2YB27931DT31DT31B62SW2FP31H031DT31BP2FP31UQ320A2FP31MP315W31IU31EG31ZV26731V131M42ZY31V531I431V731JS31DT2AM31JB31FX2AM31VE31EW31UT31VH27531F32AM31VK31RS31UT31VN27531652AM31VQ31TZ316531MW31Y926731AU31EG31BV2ZY31W026131KP2ZY26R26631RI31KU322K31KT31WK26M322L31NQ322F31WA31LT2ZY31WE31K92ZY322R31E1322Q322S31KU26L322S31DP2ZY31WR31SI31EJ31WV31I431L723M31R32FP31X22DS31M931BJ31BP31DT31X931LO2FP31LQ320Z320E31SX31M231DT31LS31EX31XM323K321T31OB320Y31XR31SI31EX31XV31IR31EX31DL31GD31CW31F331Y228131DB31D531F328131MP31EX31MR31FE31KN31DT31EX31MW31I331MT323L31U231QA31J931TT31I431OY31I031B531FX23L2S631MO2S62FP324731LG31CQ31BQ31Y131M324S31I42ZY31YD320X31RL31BI31B625B325831AX324331I431KB325M31KV320J31AX25831JS320K257324131N3321M31I431RN25P229321T2552S6324Q31M331HT2673266321W26731GI2RH31B6320P31JS31EX2FP326G322031KP2RH31EX28131OB31F331DT25231C731652512DS27431F3322831JS28131B6326Z31BI313Z2502S6281313Z31OB31S3327A2S726724Z2S631652JA31OB313Z327931C72HE24Y2S6313Z2HE31EN31L9320R267327A31D02IB31QR27931MT2JA2IB327Z2672HE313Z24W31PJ267319X24V31NB31G926724U31CH31JJ316U31CJ328N2HE316U2AX27331L92HE2JA328F31CZ328H315P328K2E13200276328P31D1279328S267328U31C2328X267328Z328G328I32942J1328O329C31DE329A328C329N328V329F329H3291329J31CS31D02E1314O29C32982EN328M329Q329D328W329Q329U31D0329W328G2E124Q329M316U31CG329B32A6329F281329032AA26724P329K31E83297329N2QB320831GT31CE31BP31GT31JR314U32AY26724M26731DN32B22L224J2DS2HE31GT328V2752HE32AL31C7319X31DY31PQ2E131QL32AS316U31FP312C32AW323M27531GT31DD23W32BA26732BC31JS2HE31F3329027532AB31BI2E122N31CB31OM316U2IT31RI26731RK31B931QF328T31BJ31C32HE31EX327J329222M2S62HE319X31OB2IB32CM31C72E122L2S62IB2E131OB319X32CV31BI316U31CW2RH319X328Q329E328L32D424732BY26722J2S62E131GT31OB316U319X32C331T226722I324Z319E22H2S6316U319E32BD329N2IB32DO312C32DR31PQ319E22G32DV31JK329S329N2E1329031PT32E232DS31Y532E732DX31JS316U2HE32E132DQ32EF31K92RH32DW32CJ27532EK26732EM32E331C7319E22D2DS328N32ER328V27832EU32EW32EF27432EQ32E82S631BC2R331T92OZ24D2EK27B24X26L24B31202KK2QB23T2QF28J26L2YW25632AR314V313S31E728J2LI29S2BG26531GW24C2G82ID2K1310P27O2A32J024C2492A32CJ2NW2RE2DX314V314Q32FY31XR32FI2K026L23U24V2IB2792E12S631C32DS31SV31BQ31OY28U28U325331D12NW31Q2329O2DS28U31Q931BI31NZ31TW31C62B031C331C632AU31CE32H031F1324Z2AX31Y432HA320B32GX2S631UY31MA32H231D631C731B8324Z31P82RH32HB31BQ32HD31S831JS32HG32I831D132HK31D131HF31HF27531FG2762NW2GP2P62792B92P32BE32G32QB2BX2BN2B5315O2BS2BU2BW2BL32IT32GN31002QK2EI2BZ2SA2QP2QR2QT2KE2QW2QY2902R12J02BS2O62AV2R32R52R7317U2ED2HV31AW24P2RD2RF26721X21Y32JV32JV22U314R31C128W2RL3104294296311N31W026Q32K832K932KA32KB32KC32KD32KE32KF32KF312Y2PR27G27Z314H2Z82552ID24S253317T2R9314V32II27924B2DK32GN246317G2PK27B316F32J1311Q31072BP32IM27Y310031A825732G8312Y310P2HH2B62R3315727B315M2KK2NW23K2502562K7310H29F2LH2732J62HV2H62B22B4325G314P314R2NW2HX2CJ31GW27332LQ24M26V24S2HT2EZ2S22AV2SA315L2EK316Z2HV2EN2HP2ID2HV32KM315724S32MC32ME2S124X32MH27932KE2RZ314M2S3311V2SL313B3136312526432IF2672RK323L2FY2OL2BF310Q25723W32L32QX2SR2752FY2JZ2CN2B632J62RQ32LG27P315G32L024P2LH25632IO2BZ2H62S232G22C4317B311U2PK2J3316H2RN26R32GY2DS25R2S931F432O82QE2572CC31GW32FH24M32OA32NU32OD2PH32OO32NU2RL31672ID32O12ER2EN32NU2HV32MI313624Q2X324R2CU2S6314X2QN27532OO2J332OS2NW27331072J032OO32PJ2OZ32PI32LR313D32P628332PC2SB2SN313X312Y23W25027G32LI2ZZ2BL24S24S2522H82T4323L316H32Q332Q532Q7313C24S32PZ24X2B631EJ2SM25825332LC2FM27O2582BL265323L32QK32QM2HB2I72I932QQ2YV2EN23T2BV2PY2QB2982542L632QR3110313U32PY2KD31RP2SM2HP27U2DD32JN2K031562BL2HV31H627523U2FM311J315J24W27332RF314432RU24C32QB32Q62H9313C32RC32QH312A31SH313H32OA313W2SJ2732AT319Q2AT31632DG2CC2SL313U2SO313Q2DZ2R32FY2J232J42AV32Q932SP27E2BF2EL32RV32QG32QI2SS313U32QL32QN2FN32KP32QS32T12G132T332QW32R32BC2KW2PH32R624S32T631AE32PU32RG2CN24Y32RJ319T32KP2I432RO31QO32RR29532RT32RV313U2HJ2AH2Z832SQ32SX32S432MD319W31402AS27H313O2SP32TV32SD2L532SG32OL32PT2SM2SD27P2SA24231A826Q23W2OH2582ZX31F432UM24Z32UO32UQ32SY32Q026532QJ32T232QV2D02FN310K2AK32QT32V232LC32QX2DD31A832TF28K24S32V626532RE32TY2CM32TM32TO27332V62HV31H032RP32TU311K315K32RW32U032UU32UW2EH2E932SZ32S632U732OA2AJ2I932SC2Z732UE311J32UG2QB2ST312X310H313H32U432G4313T311227H24S24A2QQ2PL31RP23W314A2HP31412482ID316G2E832SA2C4323L313N2SU32SE316232WB25C31B025P31R531B231J032HR31CN2G632I3326D31Q831JS2DS28M32OE27532HH2S627R32XN31DU31BP32HN2IT31IA31RL32XS31O132H432KU32H332XK31BA32Y431RU32Y631ON32XS32XR31EY31C72AX31CA31MA2DS32I631CU31B231B431U031F931NQ31X731CY328J2AX31HD32HR32HM31XU32Y82ZY31CG32EI322P31J731N431N6328G31I331CS31OV324V32YG324Z32H532HR32Y131BD326331BI2AX325A31CN32ZJ31CE32ZL31DE32ZN28M32ZN31PP31JS31S131O127832XG32XO31DU31OB31S127K31S031ON31F333032B0281330631S232ZT31ON31YZ31P431O127R31AW31C327R27R31O12IT32ZX31PR2IT31OB330J31DE330I31PR330531S431PR3308330W31SD31JS330R31YZ330K32I532HN317B31F5329Q31BI31SN32YC27832XW2752IT323L31EV319X31FN31DU2RH31WC31CU330P31QA31SR32HU31RC31FQ31BQ2AM32CG32CJ31YF28U32DW2JA315W31D331GT31DX31HG31OT2AX27831KU332831E52FQ331Y31KS329N31NJ31SJ31PG31NN31WK332K31NQ331G2DS31LD31YK31PQ2AM312C331M31US331O31CX331A31M2332W31AW31BI31SZ2S631XG324Z31D329N2RH315W31FP31YO32YW31SJ32ZG331F328L332W32IC331P331W2DS327M328V315W31P8332131HG3324322T32YW2732JA31LW2HE261325Y315W333P31LT31KU3345273315W31C632AG31B62IT31RN332L279334F332O333127531JR28Z32H731SW32VR31ST332X2DS331P32H0332P332W2G6333432Y82C6334O31GU333A31XK333X31VF315W31ZB31WC31DB334U31C7334W31C728Z31H22RH335C33303317333I2IT31H62FF2IT32DH322M31WK335R332D31LB323731FC333X2JA31FI31TH26X32C82IT1K31BJ31IU31KU336631KX2IT3317336031SJ335O317O2IT23531BJ31B831WK336J31AR31CW310H31BH31NE28Z335L31US28Z2HE31T5329N32HV31US336U31WC31H6336Y31HK337031TN31TW31WC31TQ31I5332W333731C331WC31I8337F31US318I337I28Z31IL31XF322B2S631D332HQ31IS32YT31US31GE31T1331H31SW31V1337O336U31XQ31ZB2AM2AM31YJ332Z31T1315G334Z32P9334R333H31US337Y31UT336U3385331932YP321L279338J3387326331B926V335X31SJ331H31MR28Z32XU334Z338I31UT3359334S331U3263331U337W3371337931US336X333I316U337732XY333E337B320W334R337E333E337H333E321S31WC31JJ337O31AU2RH337R333631GU332W339731VS324Z321Y324Z2C6338231IS2HE31Z926731JR331K31Z3338D31WM2DS338S336B335Z31SJ335N31CF336H26721A336K335V33AM31KC336P31HH336S3356336V329Q336Y339D335F33AV337331LO2IT337633B0330H339G31C72C6339I31VR31IS31OB337G31V2337J33BG337M33B9337P339T31SJ31XN337U31SU33B0338G2AM338032YP33A42C6338431UT338P31YL31IS332T267322633BC338E339Z33C3339031FZ33BK338M31SY33C231T1338Q33AE338T335E25P338W31R331C72AM33CA329Q33BC28Z332Y3395333I339Y33B1339A33B3336Z33B6339931YK337O33BB338932XI33BF337L267339O31US339Q32YP339S31JX337S2C633BP31BD31EV33BS267317O31PQ33A331TW338331C731D333A92DS338J31HD31YK31KT33CI33AG331H31PM31W9331K2SA337O31KN332W28Z31CP335C339633C1337233CZ33AY31US31EV33B733AW339H331S339K33AW339M33AW31KZ33DA33DE31IS33DG31U133DI339W334R33CX32Z931UT33E832YP31L733AA33CF31US32ZG335Y336D33AI31L831IT336426724X322S336831WK33FK33AG330H3272336129B31C333613302335M31JY33FU31SJ330Y33FF31LD33FZ2IT31LF33G426731YZ331P31CJ336131VF321T26E322S2IT31KU33GF32Z1275251338T33C82752GB2AM31BX32YP31LQ33F933C032H0337831J0337A33BK330N33EC33D831US33FW33AW330V33AW33G131WC33G3333E33G631SW28Z31YZ31FS331531IS32GW31JX32YJ33BD31HG31B923Y322S333Y31M22FP31GT25P31I8323O322V31DT2FP31MT33HX31M231LN32XO31B62C6242322S32HB31WK33IA336O33CF31BH27K31D331LL32Z62C6316U31K431TU31LM320C31IS31HK33IO31IS3240337O33EM31XQ31O1315W33D631YE32XI31XQ33ES31XQ31M631C331XQ33EW315W33DG31HI2R42S6315W31UE32YP33972C6338G31D331WK31U933IK31JX31IO2DS333733E1329A33GN334K32912AM31MR31J733E033AP24U33CJ33JY31D028Z31NA31J7335J33FD322V336131NE26X2Z02IT24P33FL33AP33KK33GK26722V33K633FQ33FF33FT33FX33H6336133H8336133G1336133HC33FF31NX33G733G932H1334T33BN31XU31EX22K33GG33AP33LC33KO22Z33JX324V33GQ33L9337O32DE33GV33AC33GX339F33EN33H133EP33H4334N33BI33FY333E33HA31US33L231WC33L433HF33G833DX33L7337O33HL31U133HN3337333R2DS21W33HS2JA33I132DF33I431DT31OK31KJ33HU32NB31AS33HY31P931CB33I826722033IB33AP33MX33IF315G33IH31GU33MN31LO33IM31IV33IP31PA33IL26733IT33BK31PD33DQ33LR33IZ335533J233DR31XP31IS33J631IS33J832YP2C633JB33BL31C72ZY33NF2DS33JH339V33JK33JY33IP31PG31PQ315W33N531U133JS31X431CX31B922S33LI328K2AM31PI33K233OB31WK33OD33E3328K28Z31PM33KB332Z33KD33MO336131PT33KH31SJ1V33KL31KU33OY33KO2662RB31DP32CC31F432B433FS31JS33FV33PA31SJ33KY33G033PC2IT33L2336131BV33L533L832Y3331U310H316L31EX1Y33LD31KU33PS31W8334K33DB31UT33GS31IS31Q733M7338633LP33D233GZ33FB33LT337D33LV330S333E33H831WC33M028Z33M231US33PK33M533HH33M832YP33MA33IP33MC31BQ33ME27921N33MH33MP33HW33MS31QF33MO33MJ33I333MS32BW33I731IS21R33MY31KU33R833N131HH33II26733R033N6329N33IU31D333R533RH33ND337O31QN33NG33IY33HO31U933NK31XO31JS33J533RW33NP33RY33NS335533JD31TZ33RP33NY320933JT33DL32YP33JM31QO324Z315W33RG33O8333F33JU32H931BE33P431VY33K731UT31QV33OI338Q31WK26333SL338U33ON26731R033OQ33FC31SJ33FE336131R533OW31FI2RB33FM31FQ2RB31KU25H2RB31XT310H31LI31J62IT316U31RA33EL33D333HJ33BA33LU33BE31US33ES31WC31SP33EV33BK33EY33IP33F033DK33F333A0267320G33Q531B92JA33OM329X31US32IH31B1335C31KU33U727531N532XC2S62NW32KI2PS2HD313G32N6313E32RV2IX2CN315631012IQ2JM2CD27532K132N52562DG32N727D2QB25P3345333332HW31NY32KU32YL32H032YL32Z633JV32FC32Z432H933UL32KK26531S6313H32UJ33UR310Q33UU2Z333UW26D33UY26732K12SF313U32UJ33V633V8324Z33PN2DS330N31B231D732YD329931LO33VH2RH31AW31BC33UK2PQ33UM32S732SK32UB311K27D33VS32QL33VU2DG33VW32K028X32SJ2SH33WN33W3332G31PQ33W627933W833AO33VE33WC2SW33WE32GZ33VJ33WI27932KJ2PL33VO32SK313X33VR33UT33WR310233UX33WV32UH33XI2SJ33X032CD31C733X331OR33VI33WA32ZH33X831B231BF32Z433WH31CH33WJ33VM32TJ313H32X433WP33XL33UV33WT33VX32K132WD313U2SU33XT325L33VA2RH33X533VD33WB2G633X933SJ33XB33UI33VK2NW2RU2K2312Y25532LU2ER33XP2R32S0314N32LM33E831NA33XU31C331RI31CJ31CJ33XB33XW33YM33AO33VG33YU33Y431P233Y633XE33UM32TJ315C2XT313731A432TC33VT33XN33WU28V33WW27932LK2RP2PK33YL33V933L733YO33VC32ID33YR33IR33XA33ZN33BC27633Y72PL31RT32K332TV33YC311K33XM33VV33YG3402275340M32K529932N9315O32LM2J3315732JR32GK32JU32JW21Y32JY26531IA315733UR31A8313I341029L310H316132UF26P31GB31AS31R033XU31CN33ZG33WC33WF340C33Y033YS33Y232HO33WC33ZD33AD31IU31BJ2AM2AX28M31KU342333AP31IP27531KW2S631PA31RI33KO31NP31DP33VF31C233UF2AX2B0336331BJ2HE342433AP342P31NQ2AX33V631YK333D31BJ338E341O31MA337S31FA33WE3429342H325L31D028U31CA32EI339533UH31RL31BC');local ARAScript_lIIIllIIIlIIllIllIllIIlI=bit32 or require('bit');local ARAScript_IIlIIIllllIIIllllIIl=ARAScript_lIIIllIIIlIIllIllIllIIlI and ARAScript_lIIIllIIIlIIllIllIllIIlI.bxor or function(ARAScript_lIIIllIIIlIIllIllIllIIlI,ARAScript_IlllIlIIIllIlI)local ARAScript_lIllllIlIlllIII,ARAScript_IIlIIIllllIIIllllIIl=1,0 while ARAScript_lIIIllIIIlIIllIllIllIIlI>0 and ARAScript_IlllIlIIIllIlI>0 do local ARAScript_lIIIllllIlllllIllIlI,ARAScript_lIlIlIIlllIIlIIl=ARAScript_lIIIllIIIlIIllIllIllIIlI%2,ARAScript_IlllIlIIIllIlI%2 if ARAScript_lIIIllllIlllllIllIlI~=ARAScript_lIlIlIIlllIIlIIl then ARAScript_IIlIIIllllIIIllllIIl=ARAScript_IIlIIIllllIIIllllIIl+ARAScript_lIllllIlIlllIII end ARAScript_lIIIllIIIlIIllIllIllIIlI,ARAScript_IlllIlIIIllIlI,ARAScript_lIllllIlIlllIII=(ARAScript_lIIIllIIIlIIllIllIllIIlI-ARAScript_lIIIllllIlllllIllIlI)/2,(ARAScript_IlllIlIIIllIlI-ARAScript_lIlIlIIlllIIlIIl)/2,ARAScript_lIllllIlIlllIII*2 end if ARAScript_lIIIllIIIlIIllIllIllIIlI<ARAScript_IlllIlIIIllIlI then ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IlllIlIIIllIlI end while ARAScript_lIIIllIIIlIIllIllIllIIlI>0 do local ARAScript_IlllIlIIIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI%2 if ARAScript_IlllIlIIIllIlI>0 then ARAScript_IIlIIIllllIIIllllIIl=ARAScript_IIlIIIllllIIIllllIIl+ARAScript_lIllllIlIlllIII end ARAScript_lIIIllIIIlIIllIllIllIIlI,ARAScript_lIllllIlIlllIII=(ARAScript_lIIIllIIIlIIllIllIllIIlI-ARAScript_IlllIlIIIllIlI)/2,ARAScript_lIllllIlIlllIII*2 end return ARAScript_IIlIIIllllIIIllllIIl end local function ARAScript_IlllIlIIIllIlI(ARAScript_lIllllIlIlllIII,ARAScript_lIIIllIIIlIIllIllIllIIlI,ARAScript_IlllIlIIIllIlI)if ARAScript_IlllIlIIIllIlI then local ARAScript_lIIIllIIIlIIllIllIllIIlI=(ARAScript_lIllllIlIlllIII/2^(ARAScript_lIIIllIIIlIIllIllIllIIlI-1))%2^((ARAScript_IlllIlIIIllIlI-1)-(ARAScript_lIIIllIIIlIIllIllIllIIlI-1)+1);return ARAScript_lIIIllIIIlIIllIllIllIIlI-ARAScript_lIIIllIIIlIIllIllIllIIlI%1;else local ARAScript_lIIIllIIIlIIllIllIllIIlI=2^(ARAScript_lIIIllIIIlIIllIllIllIIlI-1);return(ARAScript_lIllllIlIlllIII%(ARAScript_lIIIllIIIlIIllIllIllIIlI+ARAScript_lIIIllIIIlIIllIllIllIIlI)>=ARAScript_lIIIllIIIlIIllIllIllIIlI)and 1 or 0;end;end;local ARAScript_lIIIllIIIlIIllIllIllIIlI=1;local function ARAScript_lIllllIlIlllIII()local ARAScript_lIllllIlIlllIII,ARAScript_IlllIlIIIllIlI,ARAScript_lIlIlIIlllIIlIIl,ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIllllllllIIlI(ARAScript_IlIIIIlllIIllllIlI,ARAScript_lIIIllIIIlIIllIllIllIIlI,ARAScript_lIIIllIIIlIIllIllIllIIlI+3);ARAScript_lIllllIlIlllIII=ARAScript_IIlIIIllllIIIllllIIl(ARAScript_lIllllIlIlllIII,223)ARAScript_IlllIlIIIllIlI=ARAScript_IIlIIIllllIIIllllIIl(ARAScript_IlllIlIIIllIlI,223)ARAScript_lIlIlIIlllIIlIIl=ARAScript_IIlIIIllllIIIllllIIl(ARAScript_lIlIlIIlllIIlIIl,223)ARAScript_lIIIllllIlllllIllIlI=ARAScript_IIlIIIllllIIIllllIIl(ARAScript_lIIIllllIlllllIllIlI,223)ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI+4;return(ARAScript_lIIIllllIlllllIllIlI*16777216)+(ARAScript_lIlIlIIlllIIlIIl*65536)+(ARAScript_IlllIlIIIllIlI*256)+ARAScript_lIllllIlIlllIII;end;local function ARAScript_lIlIlIIIIIl()local ARAScript_lIllllIlIlllIII=ARAScript_IIlIIIllllIIIllllIIl(ARAScript_lIIIllIllllllllIIlI(ARAScript_IlIIIIlllIIllllIlI,ARAScript_lIIIllIIIlIIllIllIllIIlI,ARAScript_lIIIllIIIlIIllIllIllIIlI),223);ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI+1;return ARAScript_lIllllIlIlllIII;end;local function ARAScript_lIIIllllIlllllIllIlI()local ARAScript_IlllIlIIIllIlI,ARAScript_lIllllIlIlllIII=ARAScript_lIIIllIllllllllIIlI(ARAScript_IlIIIIlllIIllllIlI,ARAScript_lIIIllIIIlIIllIllIllIIlI,ARAScript_lIIIllIIIlIIllIllIllIIlI+2);ARAScript_IlllIlIIIllIlI=ARAScript_IIlIIIllllIIIllllIIl(ARAScript_IlllIlIIIllIlI,223)ARAScript_lIllllIlIlllIII=ARAScript_IIlIIIllllIIIllllIIl(ARAScript_lIllllIlIlllIII,223)ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI+2;return(ARAScript_lIllllIlIlllIII*256)+ARAScript_IlllIlIIIllIlI;end;local function ARAScript_llIIIIlIIlIIIIlIllllI()local ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_lIllllIlIlllIII();local ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII();local ARAScript_lIlIlIIlllIIlIIl=1;local ARAScript_IIlIIIllllIIIllllIIl=(ARAScript_IlllIlIIIllIlI(ARAScript_lIllllIlIlllIII,1,20)*(2^32))+ARAScript_lIIIllIIIlIIllIllIllIIlI;local ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IlllIlIIIllIlI(ARAScript_lIllllIlIlllIII,21,31);local ARAScript_lIllllIlIlllIII=((-1)^ARAScript_IlllIlIIIllIlI(ARAScript_lIllllIlIlllIII,32));if(ARAScript_lIIIllIIIlIIllIllIllIIlI==0)then if(ARAScript_IIlIIIllllIIIllllIIl==0)then return ARAScript_lIllllIlIlllIII*0;else ARAScript_lIIIllIIIlIIllIllIllIIlI=1;ARAScript_lIlIlIIlllIIlIIl=0;end;elseif(ARAScript_lIIIllIIIlIIllIllIllIIlI==2047)then return(ARAScript_IIlIIIllllIIIllllIIl==0)and(ARAScript_lIllllIlIlllIII*(1/0))or(ARAScript_lIllllIlIlllIII*(0/0));end;return ARAScript_IIIllIIlIllIllIII(ARAScript_lIllllIlIlllIII,ARAScript_lIIIllIIIlIIllIllIllIIlI-1023)*(ARAScript_lIlIlIIlllIIlIIl+(ARAScript_IIlIIIllllIIIllllIIl/(2^52)));end;local ARAScript_IIIllIIlIllIllIII=ARAScript_lIllllIlIlllIII;local function ARAScript_IIlIlIIlIlI(ARAScript_lIllllIlIlllIII)local ARAScript_IlllIlIIIllIlI;if(not ARAScript_lIllllIlIlllIII)then ARAScript_lIllllIlIlllIII=ARAScript_IIIllIIlIllIllIII();if(ARAScript_lIllllIlIlllIII==0)then return'';end;end;ARAScript_IlllIlIIIllIlI=ARAScript_lIlIlIIlllIIlIIl(ARAScript_IlIIIIlllIIllllIlI,ARAScript_lIIIllIIIlIIllIllIllIIlI,ARAScript_lIIIllIIIlIIllIllIllIIlI+ARAScript_lIllllIlIlllIII-1);ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI+ARAScript_lIllllIlIlllIII;local ARAScript_lIllllIlIlllIII={}for ARAScript_lIIIllIIIlIIllIllIllIIlI=1,#ARAScript_IlllIlIIIllIlI do ARAScript_lIllllIlIlllIII[ARAScript_lIIIllIIIlIIllIllIllIIlI]=ARAScript_lllIIlIIIIIII(ARAScript_IIlIIIllllIIIllllIIl(ARAScript_lIIIllIllllllllIIlI(ARAScript_lIlIlIIlllIIlIIl(ARAScript_IlllIlIIIllIlI,ARAScript_lIIIllIIIlIIllIllIllIIlI,ARAScript_lIIIllIIIlIIllIllIllIIlI)),223))end return ARAScript_IllIlIlIIlIlI(ARAScript_lIllllIlIlllIII);end;local ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_lIllllIlIlllIII;local function ARAScript_lIIllllIIlllllllllIIlllIl(...)return{...},ARAScript_llIIlIlIIIIIIIlII('#',...)end local function ARAScript_llIllIIIl()local ARAScript_lllIIlIIIIIII={};local ARAScript_lIIIllIllllllllIIlI={};local ARAScript_lIIIllIIIlIIllIllIllIIlI={};local ARAScript_IlIIIIlllIIllllIlI={ARAScript_lllIIlIIIIIII,ARAScript_lIIIllIllllllllIIlI,nil,ARAScript_lIIIllIIIlIIllIllIllIIlI};local ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_lIllllIlIlllIII()local ARAScript_lIlIlIIlllIIlIIl={}for ARAScript_IlllIlIIIllIlI=1,ARAScript_lIIIllIIIlIIllIllIllIIlI do local ARAScript_lIllllIlIlllIII=ARAScript_lIlIlIIIIIl();local ARAScript_lIIIllIIIlIIllIllIllIIlI;if(ARAScript_lIllllIlIlllIII==3)then ARAScript_lIIIllIIIlIIllIllIllIIlI=(ARAScript_lIlIlIIIIIl()~=0);elseif(ARAScript_lIllllIlIlllIII==0)then ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_llIIIIlIIlIIIIlIllllI();elseif(ARAScript_lIllllIlIlllIII==2)then ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIlIIlIlI();end;ARAScript_lIlIlIIlllIIlIIl[ARAScript_IlllIlIIIllIlI]=ARAScript_lIIIllIIIlIIllIllIllIIlI;end;for ARAScript_lIIIllIllllllllIIlI=1,ARAScript_lIllllIlIlllIII()do local ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_lIlIlIIIIIl();if(ARAScript_IlllIlIIIllIlI(ARAScript_lIIIllIIIlIIllIllIllIIlI,1,1)==0)then local ARAScript_IIlIIIllllIIIllllIIl=ARAScript_IlllIlIIIllIlI(ARAScript_lIIIllIIIlIIllIllIllIIlI,2,3);local ARAScript_IIIlIIlIlIlllllIllllII=ARAScript_IlllIlIIIllIlI(ARAScript_lIIIllIIIlIIllIllIllIIlI,4,6);local ARAScript_lIIIllIIIlIIllIllIllIIlI={ARAScript_lIIIllllIlllllIllIlI(),ARAScript_lIIIllllIlllllIllIlI(),nil,nil};if(ARAScript_IIlIIIllllIIIllllIIl==0)then ARAScript_lIIIllIIIlIIllIllIllIIlI[#("qHX")]=ARAScript_lIIIllllIlllllIllIlI();ARAScript_lIIIllIIIlIIllIllIllIIlI[#("5FZA")]=ARAScript_lIIIllllIlllllIllIlI();elseif(ARAScript_IIlIIIllllIIIllllIIl==1)then ARAScript_lIIIllIIIlIIllIllIllIIlI[#("LvA")]=ARAScript_lIllllIlIlllIII();elseif(ARAScript_IIlIIIllllIIIllllIIl==2)then ARAScript_lIIIllIIIlIIllIllIllIIlI[#("80a")]=ARAScript_lIllllIlIlllIII()-(2^16)elseif(ARAScript_IIlIIIllllIIIllllIIl==3)then ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ejs")]=ARAScript_lIllllIlIlllIII()-(2^16)ARAScript_lIIIllIIIlIIllIllIllIIlI[#("6duL")]=ARAScript_lIIIllllIlllllIllIlI();end;if(ARAScript_IlllIlIIIllIlI(ARAScript_IIIlIIlIlIlllllIllllII,1,1)==1)then ARAScript_lIIIllIIIlIIllIllIllIIlI[#("bh")]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ep")]]end if(ARAScript_IlllIlIIIllIlI(ARAScript_IIIlIIlIlIlllllIllllII,2,2)==1)then ARAScript_lIIIllIIIlIIllIllIllIIlI[#("739")]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("HBz")]]end if(ARAScript_IlllIlIIIllIlI(ARAScript_IIIlIIlIlIlllllIllllII,3,3)==1)then ARAScript_lIIIllIIIlIIllIllIllIIlI[#("SLTe")]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Omm0")]]end ARAScript_lllIIlIIIIIII[ARAScript_lIIIllIllllllllIIlI]=ARAScript_lIIIllIIIlIIllIllIllIIlI;end end;ARAScript_IlIIIIlllIIllllIlI[3]=ARAScript_lIlIlIIIIIl();for ARAScript_lIIIllIIIlIIllIllIllIIlI=1,ARAScript_lIllllIlIlllIII()do ARAScript_lIIIllIllllllllIIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI-1]=ARAScript_llIllIIIl();end;return ARAScript_IlIIIIlllIIllllIlI;end;local function ARAScript_IllIlIlIIlIlI(ARAScript_lIIIllIIIlIIllIllIllIIlI,ARAScript_IIlIlIIlIlI,ARAScript_lIlIlIIlllIIlIIl)local ARAScript_IlllIlIIIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[1];local ARAScript_lIllllIlIlllIII=ARAScript_lIIIllIIIlIIllIllIllIIlI[2];local ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[3];return function(...)local ARAScript_IIlIIIllllIIIllllIIl=ARAScript_IlllIlIIIllIlI;local ARAScript_IIIllIIlIllIllIII=ARAScript_lIllllIlIlllIII;local ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI;local ARAScript_lIlIlIIIIIl=ARAScript_lIIllllIIlllllllllIIlllIl local ARAScript_lIllllIlIlllIII=1;local ARAScript_lIIIllIllllllllIIlI=-1;local ARAScript_llIllIIIl={};local ARAScript_lllIIlIIIIIII={...};local ARAScript_IlIIIIlllIIllllIlI=ARAScript_llIIlIlIIIIIIIlII('#',...)-1;local ARAScript_llIIlIlIIIIIIIlII={};local ARAScript_IlllIlIIIllIlI={};for ARAScript_lIIIllIIIlIIllIllIllIIlI=0,ARAScript_IlIIIIlllIIllllIlI do if(ARAScript_lIIIllIIIlIIllIllIllIIlI>=ARAScript_lIIIllllIlllllIllIlI)then ARAScript_llIllIIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI-ARAScript_lIIIllllIlllllIllIlI]=ARAScript_lllIIlIIIIIII[ARAScript_lIIIllIIIlIIllIllIllIIlI+1];else ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI]=ARAScript_lllIIlIIIIIII[ARAScript_lIIIllIIIlIIllIllIllIIlI+1];end;end;local ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IlIIIIlllIIllllIlI-ARAScript_lIIIllllIlllllIllIlI+1 local ARAScript_lIIIllIIIlIIllIllIllIIlI;local ARAScript_lIIIllllIlllllIllIlI;while true do ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("a")];if ARAScript_lIIIllllIlllllIllIlI<=#("rXGPP4d0jqktYguHjBNZxKcZQirmhjSQeMJ0rHx6EnHYz9GbPHq68H5SUQ8GM0TaJFpmHFpN")then if ARAScript_lIIIllllIlllllIllIlI<=#("QuidnBRNpIK3VRHQ1fLJ0tNFGp4TsEkrO2s")then if ARAScript_lIIIllllIlllllIllIlI<=#("XOHpq2xsihYXSHQzO")then if ARAScript_lIIIllllIlllllIllIlI<=#("nvRNH8G8")then if ARAScript_lIIIllllIlllllIllIlI<=#("Wys")then if ARAScript_lIIIllllIlllllIllIlI<=#("2")then if ARAScript_lIIIllllIlllllIllIlI>#("")then local ARAScript_lIIIllIllllllllIIlI;local ARAScript_lIIIllllIlllllIllIlI;local ARAScript_lIlIlIIlllIIlIIl;ARAScript_lIlIlIIlllIIlIIl=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("pX")];ARAScript_lIIIllllIlllllIllIlI=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("jhJ")]];ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl+1]=ARAScript_lIIIllllIlllllIllIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl]=ARAScript_lIIIllllIlllllIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("etgW")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("WU")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("9br")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIlIlIIlllIIlIIl=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("hf")]ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl]=ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIlIlIIlllIIlIIl+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("3Fg")]))ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ND")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("jxf")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Nteh")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("36")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("5KF")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("xYYE")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("FU")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Nbq")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Y9")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("LHz")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("trW")];ARAScript_lIIIllIllllllllIIlI=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]for ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_lIIIllllIlllllIllIlI+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("6kRl")]do ARAScript_lIIIllIllllllllIIlI=ARAScript_lIIIllIllllllllIIlI..ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI];end;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("59")]]=ARAScript_lIIIllIllllllllIIlI;ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("fF")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("iI1")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("uOvU")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("pn")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("X78")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("j1j8")];else ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#{{942607;124559;117949;784006};{698534;716108;454506;102850};}]]=#ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("JKi")]];end;elseif ARAScript_lIIIllllIlllllIllIlI==#("3m")then local ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Xy")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI]()else if(ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("PR")]]~=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("sy11")]])then ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;else ARAScript_lIllllIlIlllIII=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("dBR")];end;end;elseif ARAScript_lIIIllllIlllllIllIlI<=#("vr77u")then if ARAScript_lIIIllllIlllllIllIlI==#("zBha")then local ARAScript_IIlIlIIlIlI;local ARAScript_lllIIlIIIIIII;local ARAScript_IllIlIlIIlIlI,ARAScript_llIIlIlIIIIIIIlII;local ARAScript_IlIIIIlllIIllllIlI;local ARAScript_lIIIllllIlllllIllIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("cb")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("XzI")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Tx")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("66L")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Lzdu")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("DX")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("1z1")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("8H")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("NKg")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("M9nA")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("TqS")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("mq")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Tu")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("FMY")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("CQ")];ARAScript_IlIIIIlllIIllllIlI=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("LI3")]];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1]=ARAScript_IlIIIIlllIIllllIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_IlIIIIlllIIllllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("4Wpg")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("n1")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("2Rg")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("rL")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIIIllllIlllllIllIlI+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ZX4")]))ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Yf")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("UZ3")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("DFb4")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("jZ")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("7TN")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("A7vj")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("qV")];ARAScript_IlIIIIlllIIllllIlI=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("gHt")]];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1]=ARAScript_IlIIIIlllIIllllIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_IlIIIIlllIIllllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("WkfS")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("am")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("EIZ")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("qM")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Sgf")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Kq")]ARAScript_IllIlIlIIlIlI,ARAScript_llIIlIlIIIIIIIlII=ARAScript_lIlIlIIIIIl(ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1]))ARAScript_lIIIllIllllllllIIlI=ARAScript_llIIlIlIIIIIIIlII+ARAScript_lIIIllllIlllllIllIlI-1 ARAScript_lllIIlIIIIIII=0;for ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_lIIIllllIlllllIllIlI,ARAScript_lIIIllIllllllllIIlI do ARAScript_lllIIlIIIIIII=ARAScript_lllIIlIIIIIII+1;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI]=ARAScript_IllIlIlIIlIlI[ARAScript_lllIIlIIIIIII];end;ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("T0")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIIIllllIlllllIllIlI+1,ARAScript_lIIIllIllllllllIIlI))ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ne")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("LJv")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Am")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("dIp")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("QZ")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("sRM")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlIIIIlllIIllllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Qk1")];ARAScript_IIlIlIIlIlI=ARAScript_IlllIlIIIllIlI[ARAScript_IlIIIIlllIIllllIlI]for ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IlIIIIlllIIllllIlI+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("966J")]do ARAScript_IIlIlIIlIlI=ARAScript_IIlIlIIlIlI..ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI];end;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("8B")]]=ARAScript_IIlIlIIlIlI;ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("GP")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1])ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIllllIlIlllIII=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("yGO")];else local ARAScript_lllIIlIIIIIII;local ARAScript_IIlIlIIlIlI;local ARAScript_llIIlIlIIIIIIIlII,ARAScript_IllIlIlIIlIlI;local ARAScript_IlIIIIlllIIllllIlI;local ARAScript_lIIIllllIlllllIllIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("oZ")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("9A2")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("v5")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("o4J")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("IhxW")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("qT")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("2tD")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("uA6e")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("lk")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("STu")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("IN")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("EFi")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("xMdI")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("lJ")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("DEf")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Xx7i")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("JL")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("4Er")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("FT")];ARAScript_IlIIIIlllIIllllIlI=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Q5z")]];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1]=ARAScript_IlIIIIlllIIllllIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_IlIIIIlllIIllllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Nc3y")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("bK")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Ctm")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Zc")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIIIllllIlllllIllIlI+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Rqj")]))ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("0V")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("84r")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("C4GI")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("9v")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("o2h")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("8ZRT")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("9y")];ARAScript_IlIIIIlllIIllllIlI=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ZQB")]];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1]=ARAScript_IlIIIIlllIIllllIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_IlIIIIlllIIllllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("vioL")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("s6")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("yos")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("5n")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("tDj")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("6i")]ARAScript_llIIlIlIIIIIIIlII,ARAScript_IllIlIlIIlIlI=ARAScript_lIlIlIIIIIl(ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1]))ARAScript_lIIIllIllllllllIIlI=ARAScript_IllIlIlIIlIlI+ARAScript_lIIIllllIlllllIllIlI-1 ARAScript_IIlIlIIlIlI=0;for ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_lIIIllllIlllllIllIlI,ARAScript_lIIIllIllllllllIIlI do ARAScript_IIlIlIIlIlI=ARAScript_IIlIlIIlIlI+1;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI]=ARAScript_llIIlIlIIIIIIIlII[ARAScript_IIlIlIIlIlI];end;ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("JW")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIIIllllIlllllIllIlI+1,ARAScript_lIIIllIllllllllIIlI))ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("b6")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("MpO")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("QU")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("5qr")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("et")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("HjD")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("IC")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("v9A")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("9brC")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlIIIIlllIIllllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("mgk")];ARAScript_lllIIlIIIIIII=ARAScript_IlllIlIIIllIlI[ARAScript_IlIIIIlllIIllllIlI]for ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IlIIIIlllIIllllIlI+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("khIV")]do ARAScript_lllIIlIIIIIII=ARAScript_lllIIlIIIIIII..ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI];end;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("xv")]]=ARAScript_lllIIlIIIIIII;ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("gJ")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1])ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("im")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("vuE")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("0q")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("EGY")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("QJ")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1])ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Kf")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("aR1")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Up")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("hyH")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("2Y")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("qud")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("N8Ye")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("2s")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("LTB")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlIIIIlllIIllllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("moG")];ARAScript_lllIIlIIIIIII=ARAScript_IlllIlIIIllIlI[ARAScript_IlIIIIlllIIllllIlI]for ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IlIIIIlllIIllllIlI+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Go8j")]do ARAScript_lllIIlIIIIIII=ARAScript_lllIIlIIIIIII..ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI];end;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("v4")]]=ARAScript_lllIIlIIIIIII;ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("IU")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1])ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIllllIlIlllIII=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("YUs")];end;elseif ARAScript_lIIIllllIlllllIllIlI<=#("YVNKO6")then local ARAScript_IlIIIIlllIIllllIlI;local ARAScript_lllIIlIIIIIII;local ARAScript_lIIIllllIlllllIllIlI;local ARAScript_lIlIlIIIIIl;local ARAScript_lIIIllIllllllllIIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("OI")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("rhz")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("NZ")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("WPC")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("5B")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Dey")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllIllllllllIIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("soe")];ARAScript_lIlIlIIIIIl=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIllllllllIIlI]for ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_lIIIllIllllllllIIlI+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("B4zy")]do ARAScript_lIlIlIIIIIl=ARAScript_lIlIlIIIIIl..ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI];end;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Rk")]]=ARAScript_lIlIlIIIIIl;ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Ba")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1])ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("KE")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("DRr")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("4X")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("dnB")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("BE")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("4YW")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Ko")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("aAy")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("PW")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("yN6")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("hs")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("8p7")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("jb")];ARAScript_lIIIllIllllllllIIlI=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("2OF")]];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1]=ARAScript_lIIIllIllllllllIIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_lIIIllIllllllllIIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("H5tP")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("N7")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("vLx")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("2Z")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIIIllllIlllllIllIlI+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("jI5")]))ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Ql")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("DBk")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("PhxU")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("jC")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("RWx")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("MVCY")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("BW")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("2mz")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("uvUD")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ZO")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("QhC")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("9bMa")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("rm")];ARAScript_lIIIllIllllllllIIlI=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("sf9")]];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1]=ARAScript_lIIIllIllllllllIIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_lIIIllIllllllllIIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("hkeS")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ud")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1])ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("sp")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("UQ9")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("rK")];ARAScript_lIIIllIllllllllIIlI=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("S3q")]];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1]=ARAScript_lIIIllIllllllllIIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_lIIIllIllllllllIIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("fN3S")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("jq")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("BYg")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("j6")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIIIllllIlllllIllIlI+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("EqX")]))ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("8c")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("D2r")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("pY3k")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("yV")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("28T")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("FMeK")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("3A")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("pD0")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("VWkR")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("7n")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("jSQ")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ek5u")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("1r")];ARAScript_lIIIllIllllllllIIlI=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("JTy")]];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1]=ARAScript_lIIIllIllllllllIIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_lIIIllIllllllllIIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Gstr")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("J1")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1])ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("6s")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("CVv")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("PJ")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("GeH")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("EcOW")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("jy")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("g6I")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllIllllllllIIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("uFl")];ARAScript_lIlIlIIIIIl=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIllllllllIIlI]for ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_lIIIllIllllllllIIlI+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("81TV")]do ARAScript_lIlIlIIIIIl=ARAScript_lIlIlIIIIIl..ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI];end;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Va")]]=ARAScript_lIlIlIIIIIl;ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("tr")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("YXu")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("30")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("6tj")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("94")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ddj")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllIllllllllIIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ic3")];ARAScript_lIlIlIIIIIl=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIllllllllIIlI]for ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_lIIIllIllllllllIIlI+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("HDJd")]do ARAScript_lIlIlIIIIIl=ARAScript_lIlIlIIIIIl..ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI];end;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("VB")]]=ARAScript_lIlIlIIIIIl;ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Yv")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1])ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("PA")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("3aF")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("nL")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("GEQ")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("jm")]ARAScript_lllIIlIIIIIII={ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1])};ARAScript_IlIIIIlllIIllllIlI=0;for ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_lIIIllllIlllllIllIlI,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("x7c2")]do ARAScript_IlIIIIlllIIllllIlI=ARAScript_IlIIIIlllIIllllIlI+1;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI]=ARAScript_lllIIlIIIIIII[ARAScript_IlIIIIlllIIllllIlI];end ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIllllIlIlllIII=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("BQJ")];elseif ARAScript_lIIIllllIlllllIllIlI>#("jhJUsJK")then local ARAScript_lIIIllllIlllllIllIlI;local ARAScript_lIlIlIIlllIIlIIl;ARAScript_lIlIlIIlllIIlIIl=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Mt")];ARAScript_lIIIllllIlllllIllIlI=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("4B3")]];ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl+1]=ARAScript_lIIIllllIlllllIllIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl]=ARAScript_lIIIllllIlllllIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("u9yk")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("yn")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Gpp")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Ri")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("yMZ")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIlIlIIlllIIlIIl=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("MN")]ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIlIlIIlllIIlIIl+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("MgU")]))ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];do return end;else local ARAScript_lIIIllllIlllllIllIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("k8")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("5Z4")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("cK")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("cWG")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("yl")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("aF3")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("q0")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIIIllllIlllllIllIlI+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("gHt")]))ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("IF")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("U0v")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("uH")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("kFm")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("5SJ7")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];do return end;end;elseif ARAScript_lIIIllllIlllllIllIlI<=#("Z25yyOE0sWqy")then if ARAScript_lIIIllllIlllllIllIlI<=#("qhHy7I7MPP")then if ARAScript_lIIIllllIlllllIllIlI>#("C0Te9M9zx")then local ARAScript_lIIIllllIlllllIllIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Wk")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Xix")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("lq")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1])ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("hL")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("lvf")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("de")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Un2")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("om")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1])ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIllllIlIlllIII=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("VGp")];else local ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("gF")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIIIllIIIlIIllIllIllIIlI+1,ARAScript_lIIIllIllllllllIIlI))end;elseif ARAScript_lIIIllllIlllllIllIlI==#("HHGUNit4uYy")then local ARAScript_IlIIIIlllIIllllIlI;local ARAScript_IIlIlIIlIlI,ARAScript_IllIlIlIIlIlI;local ARAScript_lllIIlIIIIIII;local ARAScript_lIIIllllIlllllIllIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("0k")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("4JN")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("CV")];ARAScript_lllIIlIIIIIII=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("v5P")]];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1]=ARAScript_lllIIlIIIIIII;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_lllIIlIIIIIII[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("6FLS")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Xv")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("sIy")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("q0")]]=(ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Uhr")]~=0);ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("zx")]ARAScript_IIlIlIIlIlI,ARAScript_IllIlIlIIlIlI=ARAScript_lIlIlIIIIIl(ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIIIllllIlllllIllIlI+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Nbq")])))ARAScript_lIIIllIllllllllIIlI=ARAScript_IllIlIlIIlIlI+ARAScript_lIIIllllIlllllIllIlI-1 ARAScript_IlIIIIlllIIllllIlI=0;for ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_lIIIllllIlllllIllIlI,ARAScript_lIIIllIllllllllIIlI do ARAScript_IlIIIIlllIIllllIlI=ARAScript_IlIIIIlllIIllllIlI+1;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI]=ARAScript_IIlIlIIlIlI[ARAScript_IlIIIIlllIIllllIlI];end;ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("9Z")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIIIllllIlllllIllIlI+1,ARAScript_lIIIllIllllllllIIlI))ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("09")]]();ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("54")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Aoh")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("pt")]]=#ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("zEK")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ORG")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Ib")]];else local ARAScript_lIIIllllIlllllIllIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("FC")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("LnR")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("HE")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("2kH")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("zt")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("DF8")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ey")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIIIllllIlllllIllIlI+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("7tP")]))ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("c1")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("6D9")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("9P")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("pvS")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("C8sk")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];do return end;end;elseif ARAScript_lIIIllllIlllllIllIlI<=#("i29cvuaNskmQ5H")then if ARAScript_lIIIllllIlllllIllIlI==#("z1QW1b6ULaOtA")then local ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Rp")]local ARAScript_IIlIIIllllIIIllllIIl,ARAScript_lIllllIlIlllIII=ARAScript_lIlIlIIIIIl(ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI](ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI+1]))ARAScript_lIIIllIllllllllIIlI=ARAScript_lIllllIlIlllIII+ARAScript_lIIIllIIIlIIllIllIllIIlI-1 local ARAScript_lIllllIlIlllIII=0;for ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI,ARAScript_lIIIllIllllllllIIlI do ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI]=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];end;else ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("pp")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("B8M")]]+ARAScript_lIIIllIIIlIIllIllIllIIlI[#("3czE")];end;elseif ARAScript_lIIIllllIlllllIllIlI<=#("Rt113S0f7qOzUgx")then local ARAScript_lIllllIlIlllIII=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("V4")]local ARAScript_IIlIIIllllIIIllllIIl,ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_lIlIlIIIIIl(ARAScript_IlllIlIIIllIlI[ARAScript_lIllllIlIlllIII](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIllllIlIlllIII+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("uWn")])))ARAScript_lIIIllIllllllllIIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI+ARAScript_lIllllIlIlllIII-1 local ARAScript_lIIIllIIIlIIllIllIllIIlI=0;for ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII,ARAScript_lIIIllIllllllllIIlI do ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI+1;ARAScript_IlllIlIIIllIlI[ARAScript_lIllllIlIlllIII]=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI];end;elseif ARAScript_lIIIllllIlllllIllIlI==#("ZYgn5dPbHHliybRb")then ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("cm")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("cjk")]]+ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ML1V")];else ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("4o")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ARI")]][ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("JqBP")]]];end;elseif ARAScript_lIIIllllIlllllIllIlI<=#("8M0vZbYdt4AiDq0yrl0nlSNPZu")then if ARAScript_lIIIllllIlllllIllIlI<=#("HSR5JNXVFG79WrjMjo3dq")then if ARAScript_lIIIllllIlllllIllIlI<=#("VgZ1XAq8kGFPrvM81FP")then if ARAScript_lIIIllllIlllllIllIlI>#("u1tld6bgEB6qfl6LfS")then ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ZV")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("FyB")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("EOD2")]];else local ARAScript_IIlIIIllllIIIllllIIl=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("R2")];local ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("qsWo")];local ARAScript_lIlIlIIlllIIlIIl=ARAScript_IIlIIIllllIIIllllIIl+2 local ARAScript_IIlIIIllllIIIllllIIl={ARAScript_IlllIlIIIllIlI[ARAScript_IIlIIIllllIIIllllIIl](ARAScript_IlllIlIIIllIlI[ARAScript_IIlIIIllllIIIllllIIl+1],ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl])};for ARAScript_lIIIllIIIlIIllIllIllIIlI=1,ARAScript_lIIIllllIlllllIllIlI do ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl+ARAScript_lIIIllIIIlIIllIllIllIIlI]=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI];end;local ARAScript_IIlIIIllllIIIllllIIl=ARAScript_IIlIIIllllIIIllllIIl[1]if ARAScript_IIlIIIllllIIIllllIIl then ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl]=ARAScript_IIlIIIllllIIIllllIIl ARAScript_lIllllIlIlllIII=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("qFR")];else ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;end;end;elseif ARAScript_lIIIllllIlllllIllIlI>#("yFHuCEh9Y9lyyzVa3WNX")then local ARAScript_lIIIllllIlllllIllIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("oK")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Y86")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("cW")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("SW8")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("V2")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Gcj")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("np")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIIIllllIlllllIllIlI+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("IPI")]))ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("z0")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("rxK")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ro")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("jil")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("c11i")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];do return end;else ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("FV")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("5Ho")];end;elseif ARAScript_lIIIllllIlllllIllIlI<=#("yjFUJoJgAb2iPraYG2S67nh")then if ARAScript_lIIIllllIlllllIllIlI==#("dJ1ulcYC499vcL2pI3y7so")then do return end;else ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("fv")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("4Xz")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#{"Kiriot love sex";"Retard gonna sey they are gonna deobfuscate this";{167628;432913;294567;567760};"Arilis ate a panda once kiriot is sad and aztup too";}];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#{{409655;988556;158394;33469};"1 + 1 = 111";}]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("rIe")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("rL4k")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Kn")]]={};ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#{"Kiriot love sex";"Kiriot is a panda !";}]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("0d3")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("0D")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("l5a")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("t0XK")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("0n")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("HO4")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Qd6J")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("49")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("0VN")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("YFAR")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("nZ")]]={};ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("WF")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("435")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Lqkm")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("JI")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("WRp")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("UTTP")];end;elseif ARAScript_lIIIllllIlllllIllIlI<=#("hVmy4513kcmRaxo5xmAoPrPV")then ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("mm")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Hhu")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("4zS6")]];elseif ARAScript_lIIIllllIlllllIllIlI>#("9DydZj8Y0UJ8P4HcgYt0312t8")then local ARAScript_lIllllIlIlllIII=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("si")]local ARAScript_lIlIlIIlllIIlIIl={ARAScript_IlllIlIIIllIlI[ARAScript_lIllllIlIlllIII](ARAScript_IlllIlIIIllIlI[ARAScript_lIllllIlIlllIII+1])};local ARAScript_IIlIIIllllIIIllllIIl=0;for ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_lIllllIlIlllIII,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("3UsL")]do ARAScript_IIlIIIllllIIIllllIIl=ARAScript_IIlIIIllllIIIllllIIl+1;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_IIlIIIllllIIIllllIIl];end else ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("NnM")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Ad")]];end;elseif ARAScript_lIIIllllIlllllIllIlI<=#("V39dZgBC4DEZv2n2kNP6Sr3mJDu5bi")then if ARAScript_lIIIllllIlllllIllIlI<=#("dfYzfYW4DImadIqDBMbQoPbsD9XE")then if ARAScript_lIIIllllIlllllIllIlI>#("VFAV2ATIEhdySmyFrZOra4taCvz")then local ARAScript_lIIIllIllllllllIIlI;local ARAScript_lIIIllllIlllllIllIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Cl")]]=ARAScript_IIlIlIIlIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Kl0")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("61")];ARAScript_lIIIllIllllllllIIlI=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("EtM")]];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1]=ARAScript_lIIIllIllllllllIIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_lIIIllIllllllllIIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("BFmp")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("3J")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("iYT")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("gB")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Nzb")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("85rR")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("SL")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("kFb")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("I2")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("NAJ")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("jm")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIIIllllIlllllIllIlI+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("XSU")]))ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Vb")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("LrU")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Kj")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("c3p")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("3ok0")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("PI")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("5zA")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("bASl")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("BA")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIIIllllIlllllIllIlI+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("qRG")]))ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("1D")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("78I")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("xq")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("glI")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("83")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1])ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("aD")]]=ARAScript_IIlIlIIlIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("lny")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#{"youtube.com/watch?v=pjJ2w1FX_Wg";"spoodercraft says bim bam boom";}];ARAScript_lIIIllIllllllllIIlI=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("MQB")]];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1]=ARAScript_lIIIllIllllllllIIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_lIIIllIllllllllIIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("KghL")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("uU")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("KIN")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Rq")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("dAn")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("qu9S")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("7Q")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("jxn")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("9x")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("fBh")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("3n")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIIIllllIlllllIllIlI+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("3Kl")]))ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("eQ")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("kM7")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("10")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("UNg")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("dmZH")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("8k")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Gfc")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("fd5M")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Kk")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIIIllllIlllllIllIlI+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("7Oa")]))ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];do return end;else if(ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("SV")]]<=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ZCbx")]])then ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;else ARAScript_lIllllIlIlllIII=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("dQ5")];end;end;elseif ARAScript_lIIIllllIlllllIllIlI>#("F5fbrIRdWolhI57E7rGDOYkjjmv1l")then local ARAScript_lIIIllllIlllllIllIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Je")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("UY8")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Eu")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("7Wc")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Qo2Y")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("cT")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("fCr")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("r4")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("EML")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Echd")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Ox")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Kng")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("tyLl")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("of")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("szn")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("O5Kk")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("55")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("u9Y")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("RzOy")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("fO")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Bz2")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("7Ffk")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Dv")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("POe")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ifVG")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Ph")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIIIllllIlllllIllIlI+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("OoC")]))else local ARAScript_lIIIllIllllllllIIlI;local ARAScript_lIIIllllIlllllIllIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Io")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("KvT")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("cDl2")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("LB")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("XaV")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("bfV7")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("dz")]]={};ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ob")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("cci")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("RDTs")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("1J")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("KFo")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("411i")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("vt")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("L3z")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Ru")];ARAScript_lIIIllIllllllllIIlI=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("7Kt")]];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1]=ARAScript_lIIIllIllllllllIIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_lIIIllIllllllllIIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("qLFV")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("OX")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Kex")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("WE")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIIIllllIlllllIllIlI+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Hot")]))ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("9b")];ARAScript_lIIIllIllllllllIIlI=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Vh0")]];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1]=ARAScript_lIIIllIllllllllIIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_lIIIllIllllllllIIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("866x")]];end;elseif ARAScript_lIIIllllIlllllIllIlI<=#("tGbPdIbcgkFuScOGUf7ZdjZ6AQU51fl0")then if ARAScript_lIIIllllIlllllIllIlI==#("x5Pg21zC4lv7sfhGNDq4vvjRepxXgka")then local ARAScript_lIIIllllIlllllIllIlI;local ARAScript_lIlIlIIlllIIlIIl;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("my")]]={};ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("dT")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Qiq")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("nNeX")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIlIlIIlllIIlIIl=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("1c")]ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIlIlIIlllIIlIIl+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("nCz")]))ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIlIlIIlllIIlIIl=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Mk")];ARAScript_lIIIllllIlllllIllIlI=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("qcN")]];ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl+1]=ARAScript_lIIIllllIlllllIllIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl]=ARAScript_lIIIllllIlllllIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("lTRh")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("VR")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ATV")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("0n")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ZEa")];else local ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Sg")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI](ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI+1])end;elseif ARAScript_lIIIllllIlllllIllIlI<=#("ODvh8z1nIxj7D8gLMAnM46GaV8bNFMvTl")then local ARAScript_lIIIllllIlllllIllIlI;local ARAScript_lIlIlIIlllIIlIIl;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("W7")]]={};ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("a4")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("cbF")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("MNQo")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("fZ")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("N5Z")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("FWXY")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("2e")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("TWd")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("qnNi")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIlIlIIlllIIlIIl=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("5b")]ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIlIlIIlllIIlIIl+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("PrQ")]))ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIlIlIIlllIIlIIl=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("vY")];ARAScript_lIIIllllIlllllIllIlI=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("MeU")]];ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl+1]=ARAScript_lIIIllllIlllllIllIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl]=ARAScript_lIIIllllIlllllIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("C7Aa")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("qE")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("k5B")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("1f")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("CnA")];elseif ARAScript_lIIIllllIlllllIllIlI==#("t0UaHoLdv8mmngiWkQ7ydR6uxaxoS6aBWf")then local ARAScript_lIIIllIllllllllIIlI;local ARAScript_lIIIllllIlllllIllIlI;ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("y2")];ARAScript_lIIIllIllllllllIIlI=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("EJH")]];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1]=ARAScript_lIIIllIllllllllIIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_lIIIllIllllllllIIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("fjzG")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#{{902811;322531;877072;209315};{590203;969831;969498;541752};}]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("hZ4")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("vr")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIIIllllIlllllIllIlI+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("OIR")]))ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("6B")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("MLP")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Yd")];ARAScript_lIIIllIllllllllIIlI=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("8kE")]];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1]=ARAScript_lIIIllIllllllllIIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_lIIIllIllllllllIIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ey5b")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("nW")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("dsh")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("aT")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIIIllllIlllllIllIlI+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("UEZ")]))ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#{"Kiriot is a panda !";{149618;883407;390157;561073};}]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#{"Retard gonna sey they are gonna deobfuscate this";{485147;118044;987218;306768};"Kiriot is a panda !";}]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("kkU5")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("qE")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Fbu")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("O4pA")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("oC")];ARAScript_lIIIllIllllllllIIlI=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("pWt")]];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1]=ARAScript_lIIIllIllllllllIIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_lIIIllIllllllllIIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("mjhJ")]];else if(ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("U5")]]<=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("aa6R")]])then ARAScript_lIllllIlIlllIII=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("xbX")];else ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;end;end;elseif ARAScript_lIIIllllIlllllIllIlI<=#("q0M29b0LHYIV5ETBPWXtN4ANH1vvA8WAhC26IY7xmgzGYoCV9FvO9")then if ARAScript_lIIIllllIlllllIllIlI<=#("bxA9uiPFkJbiOEMX21YAgGF3ZsALv4MhBvAFGJDZSS5Z")then if ARAScript_lIIIllllIlllllIllIlI<=#("QL7imNF0KPG1HkcSdjq64Srdgqsy9RzKPziRCDi")then if ARAScript_lIIIllllIlllllIllIlI<=#("hr1Q4O8zBgPIP3L8s3b5tg02q5mibuqLa9ZM0")then if ARAScript_lIIIllllIlllllIllIlI==#("jDs462c05WYkyIBm7aB8A9C0yf0dHQe8hSUJ")then local ARAScript_IIlIIIllllIIIllllIIl=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("OM")];local ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ntRc")];local ARAScript_lIlIlIIlllIIlIIl=ARAScript_IIlIIIllllIIIllllIIl+2 local ARAScript_IIlIIIllllIIIllllIIl={ARAScript_IlllIlIIIllIlI[ARAScript_IIlIIIllllIIIllllIIl](ARAScript_IlllIlIIIllIlI[ARAScript_IIlIIIllllIIIllllIIl+1],ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl])};for ARAScript_lIIIllIIIlIIllIllIllIIlI=1,ARAScript_lIIIllllIlllllIllIlI do ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl+ARAScript_lIIIllIIIlIIllIllIllIIlI]=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI];end;local ARAScript_IIlIIIllllIIIllllIIl=ARAScript_IIlIIIllllIIIllllIIl[1]if ARAScript_IIlIIIllllIIIllllIIl then ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl]=ARAScript_IIlIIIllllIIIllllIIl ARAScript_lIllllIlIlllIII=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("xB3")];else ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;end;else local ARAScript_lIIIllllIlllllIllIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("uj")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("q6I")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("QG")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("TsU")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("D8")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("BVH")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("mH")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIIIllllIlllllIllIlI+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("aYc")]))ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ac")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("qsY")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("d0")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("pFo")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Cnkt")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];do return end;end;elseif ARAScript_lIIIllllIlllllIllIlI==#("Ak7ZA9Au16SjYbYk1ljbDG0c8tpSZcQY2KH0Ej")then ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ce")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("1PU")]][ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("g0VN")]]];else if(ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("BP")]]==ARAScript_lIIIllIIIlIIllIllIllIIlI[#("gERx")])then ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;else ARAScript_lIllllIlIlllIII=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Fdy")];end;end;elseif ARAScript_lIIIllllIlllllIllIlI<=#("9bGHji4TOqXpHKIk3t50fUSFYq3rnE7RSkk969R4e")then if ARAScript_lIIIllllIlllllIllIlI==#("LCcXjntAOHIt4psaS3oMFjsfHvAIn3MaVFiqDagQ")then local ARAScript_lIIIllIllllllllIIlI;local ARAScript_lIIIllllIlllllIllIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("0h")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Kp0")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ISaM")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("rl")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("AaQ")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("6bZv")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Jk")]]={};ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Y3")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("rjS")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("eCom")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("vt")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("oQZ")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("1ERY")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("t1")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("8gX")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ed")];ARAScript_lIIIllIllllllllIIlI=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Nst")]];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1]=ARAScript_lIIIllIllllllllIIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_lIIIllIllllllllIIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("AT5i")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Pn")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("SvA")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("4R")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIIIllllIlllllIllIlI+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ISP")]))ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("FL")];ARAScript_lIIIllIllllllllIIlI=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ynd")]];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1]=ARAScript_lIIIllIllllllllIIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_lIIIllIllllllllIIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("xyE7")]];else ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("7zr")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("93")]];end;elseif ARAScript_lIIIllllIlllllIllIlI<=#("Y0Aizp4Q6rYPCfCi6pYYWmU4HIAhcISWJPRs26ifF1")then ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("BZ")]]=(ARAScript_lIIIllIIIlIIllIllIllIIlI[#("MMs")]~=0);elseif ARAScript_lIIIllllIlllllIllIlI>#("MYvtAQiHVs2lMfGM10XOyJbgXyip9hSs45iflo9B3b7")then local ARAScript_IlIIIIlllIIllllIlI;local ARAScript_IllIlIlIIlIlI,ARAScript_IIlIlIIlIlI;local ARAScript_lllIIlIIIIIII;local ARAScript_lIIIllllIlllllIllIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("7k")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("WV7")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("eO")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Zlc")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("tm")];ARAScript_lllIIlIIIIIII=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ptQ")]];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1]=ARAScript_lllIIlIIIIIII;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_lllIIlIIIIIII[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("GsKn")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("fS")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("5e6")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("iT")]]=(ARAScript_lIIIllIIIlIIllIllIllIIlI[#("LLO")]~=0);ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("jv")]ARAScript_IllIlIlIIlIlI,ARAScript_IIlIlIIlIlI=ARAScript_lIlIlIIIIIl(ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIIIllllIlllllIllIlI+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Fug")])))ARAScript_lIIIllIllllllllIIlI=ARAScript_IIlIlIIlIlI+ARAScript_lIIIllllIlllllIllIlI-1 ARAScript_IlIIIIlllIIllllIlI=0;for ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_lIIIllllIlllllIllIlI,ARAScript_lIIIllIllllllllIIlI do ARAScript_IlIIIIlllIIllllIlI=ARAScript_IlIIIIlllIIllllIlI+1;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI]=ARAScript_IllIlIlIIlIlI[ARAScript_IlIIIIlllIIllllIlI];end;ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Fl")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIIIllllIlllllIllIlI+1,ARAScript_lIIIllIllllllllIIlI))ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Ay")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("NeL")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Be")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ZHC")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("2Y")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("9n8")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Gsel")];else local ARAScript_IIlIIIllllIIIllllIIl=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("h5")];local ARAScript_lIllllIlIlllIII=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("zoo")]];ARAScript_IlllIlIIIllIlI[ARAScript_IIlIIIllllIIIllllIIl+1]=ARAScript_lIllllIlIlllIII;ARAScript_IlllIlIIIllIlI[ARAScript_IIlIIIllllIIIllllIIl]=ARAScript_lIllllIlIlllIII[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ByYA")]];end;elseif ARAScript_lIIIllllIlllllIllIlI<=#("REfmxurpSn2cWoGbH3INKJqR7AAN0xUxMIAss62OZDKRcft7")then if ARAScript_lIIIllllIlllllIllIlI<=#("83aDt3hnyo65OzuDGAoZnSLa3Xh9KP2gC52DU3sOrf4R6T")then if ARAScript_lIIIllllIlllllIllIlI==#("donHPeiEpsaKGViNTxZDTG2TMhKHhX3dkNdUvhmbtBMkT")then ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Zx")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Qqi")];else local ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("e9")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIIIllIIIlIIllIllIllIIlI+1,ARAScript_lIIIllIllllllllIIlI))end;elseif ARAScript_lIIIllllIlllllIllIlI==#("X2jClugpCIxE5IFLxDz6z3SyrLjXis3R9rtRxPMJ75kGx1m")then local ARAScript_lllIIlIIIIIII;local ARAScript_IIlIlIIlIlI,ARAScript_IllIlIlIIlIlI;local ARAScript_IlIIIIlllIIllllIlI;local ARAScript_lIIIllllIlllllIllIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Ku")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("HWZ")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("PLJQ")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("pZ")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("CnP")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Iv")];ARAScript_IlIIIIlllIIllllIlI=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("8UL")]];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1]=ARAScript_IlIIIIlllIIllllIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_IlIIIIlllIIllllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("NX3c")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("u0")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("O5I")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("45")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIIIllllIlllllIllIlI+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("KDJ")]))ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("FH")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("2Qr")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("YW1u")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("sO")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("f9P")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("II2s")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("YB")];ARAScript_IlIIIIlllIIllllIlI=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("vr3")]];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1]=ARAScript_IlIIIIlllIIllllIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_IlIIIIlllIIllllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("V1b4")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("j7")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("mcE")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ct")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("pSh")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Ge")]ARAScript_IIlIlIIlIlI,ARAScript_IllIlIlIIlIlI=ARAScript_lIlIlIIIIIl(ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1]))ARAScript_lIIIllIllllllllIIlI=ARAScript_IllIlIlIIlIlI+ARAScript_lIIIllllIlllllIllIlI-1 ARAScript_lllIIlIIIIIII=0;for ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_lIIIllllIlllllIllIlI,ARAScript_lIIIllIllllllllIIlI do ARAScript_lllIIlIIIIIII=ARAScript_lllIIlIIIIIII+1;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI]=ARAScript_IIlIlIIlIlI[ARAScript_lllIIlIIIIIII];end;ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("k5")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIIIllllIlllllIllIlI+1,ARAScript_lIIIllIllllllllIIlI))ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("1j")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("2Bc")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("F3")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("MHs")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("RI")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1])ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIllllIlIlllIII=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("RFX")];else if(ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Cn")]]~=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("IzGM")])then ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;else ARAScript_lIllllIlIlllIII=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("SAl")];end;end;elseif ARAScript_lIIIllllIlllllIllIlI<=#("HTejWX44kWkKksgiOQFNnXoR0Z9ESmbAzEqAoU4lxAHLFcyOYc")then if ARAScript_lIIIllllIlllllIllIlI>#("RxKCTExt7YBl8VVlRcR44VspXqOmYBuQQutdYcI61B7y6nI0U")then ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("1t")]]=ARAScript_IllIlIlIIlIlI(ARAScript_IIIllIIlIllIllIII[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("FgY")]],nil,ARAScript_lIlIlIIlllIIlIIl);else local ARAScript_IlIIIIlllIIllllIlI;local ARAScript_lllIIlIIIIIII;local ARAScript_lIIIllllIlllllIllIlI;local ARAScript_lIlIlIIIIIl;local ARAScript_lIIIllIllllllllIIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("4W")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ItO")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("0V")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("1xp")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllIllllllllIIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("CRE")];ARAScript_lIlIlIIIIIl=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIllllllllIIlI]for ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_lIIIllIllllllllIIlI+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("b4G7")]do ARAScript_lIlIlIIIIIl=ARAScript_lIlIlIIIIIl..ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI];end;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Ng")]]=ARAScript_lIlIlIIIIIl;ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("mF")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1])ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("GY")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("u70")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("lT")];ARAScript_lIIIllIllllllllIIlI=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Nbf")]];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1]=ARAScript_lIIIllIllllllllIIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_lIIIllIllllllllIIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("VYYm")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("WN")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("QmP")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("nY")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIIIllllIlllllIllIlI+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("EQG")]))ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("1g")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("1Mv")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("TAHk")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("AS")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("4Pd")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("UBTQ")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Xl")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Wvy")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("2GGa")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("HM")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("qRa")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("XKOn")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("at")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("b52")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("nqqj")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("6o")];ARAScript_lIIIllIllllllllIIlI=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("KVn")]];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1]=ARAScript_lIIIllIllllllllIIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_lIIIllIllllllllIIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("3p4T")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Rr")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1])ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Ql")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("bpW")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("mq")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("PXl")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ae")]ARAScript_lllIIlIIIIIII={ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1])};ARAScript_IlIIIIlllIIllllIlI=0;for ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_lIIIllllIlllllIllIlI,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("TUQ1")]do ARAScript_IlIIIIlllIIllllIlI=ARAScript_IlIIIIlllIIllllIlI+1;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI]=ARAScript_lllIIlIIIIIII[ARAScript_IlIIIIlllIIllllIlI];end ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIllllIlIlllIII=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("1EU")];end;elseif ARAScript_lIIIllllIlllllIllIlI<=#("RMgh75etOC0kGHEUGOBSxOEVcEY5tJSYD6TTKIxy8FyffQ5B3mR")then if(ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("CR")]]<=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("vu0B")]])then ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;else ARAScript_lIllllIlIlllIII=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("vu8")];end;elseif ARAScript_lIIIllllIlllllIllIlI==#("zbFdhveEhi9eTcSJXUk8qcT1qzPxJybh1XzBCQMnD3q0Fsvd7vNj")then local ARAScript_lIIIllllIlllllIllIlI;local ARAScript_IIIlIIlIlIlllllIllllII;local ARAScript_lIIIllIllllllllIIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("L8")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("4rO")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("bn")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("N0r")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllIllllllllIIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("lP0")];ARAScript_IIIlIIlIlIlllllIllllII=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIllllllllIIlI]for ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_lIIIllIllllllllIIlI+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("hQZ9")]do ARAScript_IIIlIIlIlIlllllIllllII=ARAScript_IIIlIIlIlIlllllIllllII..ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI];end;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("hA")]]=ARAScript_IIIlIIlIlIlllllIllllII;ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("b8")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1])ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Ck")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("XWl")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ZZ")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#{"Kiriot love sex";{667458;97313;248484;711938};"1 + 1 = 111";}]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("tG")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("2R3")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("xl")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("jmy")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("jm")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("7kO")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("pX")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("7m0")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("tf")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("g6Z")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("GzGH")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllIllllllllIIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("7Xk")];ARAScript_IIIlIIlIlIlllllIllllII=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIllllllllIIlI]for ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_lIIIllIllllllllIIlI+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("kkKa")]do ARAScript_IIIlIIlIlIlllllIllllII=ARAScript_IIIlIIlIlIlllllIllllII..ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI];end;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("uz")]]=ARAScript_IIIlIIlIlIlllllIllllII;ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("G5")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1])ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("PK")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("7Ny")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("dO")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("rNB")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("GV")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1])ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ek")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("mtX")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("qh")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("zPh")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Cjyj")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];if(ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Co")]]<=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("EH97")]])then ARAScript_lIllllIlIlllIII=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("CEb")];else ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;end;else ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("T1")]]={};end;elseif ARAScript_lIIIllllIlllllIllIlI<=#("TOvsNWTQS5Uh2m5Nrghi6GxW2x7cMzmU1fijchZ32HU8GSMfAAQoGafmqKApZR")then if ARAScript_lIIIllllIlllllIllIlI<=#("tS9pXeWLkropzVzpkU1MlT7o1952DRJdlDBpHDZbOZF7rUQC2tpG8f3KV")then if ARAScript_lIIIllllIlllllIllIlI<=#("zXi4hDSke6ujTR5Z7vna7gtEaiBdfgJ0FWeb2USbogQUgTLJLihIxVX")then if ARAScript_lIIIllllIlllllIllIlI==#("EP38cPe8xFP7N37nOlV0AJyqI2D78bET8VIn0T9JbRxMeO5Rl43k97")then local ARAScript_lIIIllIllllllllIIlI;local ARAScript_lIIIllllIlllllIllIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("72")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("bjM")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("i0Ou")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("mR")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("639")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("DUmG")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("sh")]]={};ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("dt")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("c6Q")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("IBqi")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("zP")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("H3c")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("FUy4")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Os")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("YsF")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("TN")];ARAScript_lIIIllIllllllllIIlI=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("UjD")]];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1]=ARAScript_lIIIllIllllllllIIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_lIIIllIllllllllIIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("JjQP")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("vk")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("zN3")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("2d")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIIIllllIlllllIllIlI+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ZzT")]))ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("T3")];ARAScript_lIIIllIllllllllIIlI=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Vj8")]];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1]=ARAScript_lIIIllIllllllllIIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_lIIIllIllllllllIIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("m6Q1")]];else local ARAScript_IlIIIIlllIIllllIlI;local ARAScript_IIlIlIIlIlI,ARAScript_IllIlIlIIlIlI;local ARAScript_lllIIlIIIIIII;local ARAScript_lIIIllllIlllllIllIlI;ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("IW")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIIIllllIlllllIllIlI+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("aXi")]))ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("9R")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("O9B")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("LQ2e")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("p0")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1])ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("sn")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("NSR")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("sa")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("NKM")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("u2")];ARAScript_lllIIlIIIIIII=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("9Sq")]];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1]=ARAScript_lllIIlIIIIIII;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_lllIIlIIIIIII[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("QUkC")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("pX")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("R8l")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("p9")]]=(ARAScript_lIIIllIIIlIIllIllIllIIlI[#("aJM")]~=0);ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("JL")]ARAScript_IIlIlIIlIlI,ARAScript_IllIlIlIIlIlI=ARAScript_lIlIlIIIIIl(ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIIIllllIlllllIllIlI+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("mmt")])))ARAScript_lIIIllIllllllllIIlI=ARAScript_IllIlIlIIlIlI+ARAScript_lIIIllllIlllllIllIlI-1 ARAScript_IlIIIIlllIIllllIlI=0;for ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_lIIIllllIlllllIllIlI,ARAScript_lIIIllIllllllllIIlI do ARAScript_IlIIIIlllIIllllIlI=ARAScript_IlIIIIlllIIllllIlI+1;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI]=ARAScript_IIlIlIIlIlI[ARAScript_IlIIIIlllIIllllIlI];end;ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("au")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIIIllllIlllllIllIlI+1,ARAScript_lIIIllIllllllllIIlI))end;elseif ARAScript_lIIIllllIlllllIllIlI==#("4rNBjmhaub581vTx4mmYTmVm47VVehsUb3N6ns0v3RbLjPduCH98XiiS")then local ARAScript_lIIIllllIlllllIllIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("6K")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("4oH")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("MG")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("jhQ")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("B7d5")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Zz")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Tla")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("oz")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("6yY")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("a2oP")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("LA")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("XLE")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Uifz")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Yc")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("3hg")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("8j9g")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("WH")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("M0y")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Gdvr")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("FD")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("yXe")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("2Jlq")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("os")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ytL")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("UJ5J")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ZA")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIIIllllIlllllIllIlI+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("dL8")]))else if(ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ao")]]==ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("LgV9")]])then ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;else ARAScript_lIllllIlIlllIII=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("bHi")];end;end;elseif ARAScript_lIIIllllIlllllIllIlI<=#("AGmBx5nSk78SWjLv04ckkdo3AsHiu72U5BXWN5HVY28RfNQxyM6ogHuxqtb")then if ARAScript_lIIIllllIlllllIllIlI==#("zeynfoXvvZT5yrxreHXXNjVSaONzfBFt4ExTFVM1ZtbJ3b1ZjdrUGnBotP")then local ARAScript_IIlIIIllllIIIllllIIl=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("rx")];local ARAScript_lIllllIlIlllIII=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("8Ex")]];ARAScript_IlllIlIIIllIlI[ARAScript_IIlIIIllllIIIllllIIl+1]=ARAScript_lIllllIlIlllIII;ARAScript_IlllIlIIIllIlI[ARAScript_IIlIIIllllIIIllllIIl]=ARAScript_lIllllIlIlllIII[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("tSbW")]];else local ARAScript_lIlIlIIIIIl;local ARAScript_IlIIIIlllIIllllIlI;local ARAScript_lIIIllllIlllllIllIlI;local ARAScript_IIIlIIlIlIlllllIllllII;local ARAScript_lIIIllIllllllllIIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("zR")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Ux0")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("sF")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("TqD")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllIllllllllIIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("iFy")];ARAScript_IIIlIIlIlIlllllIllllII=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIllllllllIIlI]for ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_lIIIllIllllllllIIlI+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("CLDT")]do ARAScript_IIIlIIlIlIlllllIllllII=ARAScript_IIIlIIlIlIlllllIllllII..ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI];end;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Fb")]]=ARAScript_IIIlIIlIlIlllllIllllII;ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("EO")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1])ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ZV")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("TLv")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Io")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("hLs")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("EB")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("XAk")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#{"1 + 1 = 111";"Kiriot love sex";}]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("MMb")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Ua")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("9Md")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("1n")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("DWu")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllIllllllllIIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("7DR")];ARAScript_IIIlIIlIlIlllllIllllII=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIllllllllIIlI]for ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_lIIIllIllllllllIIlI+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("GUeK")]do ARAScript_IIIlIIlIlIlllllIllllII=ARAScript_IIIlIIlIlIlllllIllllII..ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI];end;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("6s")]]=ARAScript_IIIlIIlIlIlllllIllllII;ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Vz")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1])ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("OD")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("0Yp")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Ra")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("nOi")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("QV")]ARAScript_IlIIIIlllIIllllIlI={ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1])};ARAScript_lIlIlIIIIIl=0;for ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_lIIIllllIlllllIllIlI,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("xMVB")]do ARAScript_lIlIlIIIIIl=ARAScript_lIlIlIIIIIl+1;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI]=ARAScript_IlIIIIlllIIllllIlI[ARAScript_lIlIlIIIIIl];end ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIllllIlIlllIII=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("kmx")];end;elseif ARAScript_lIIIllllIlllllIllIlI<=#("CLzq4tza35NXt567silY8XXocjVYQdhzZIkpBdgpFa74Gp7YJphfi0oOXknV")then local ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("n9")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIIIllIIIlIIllIllIllIIlI+1,ARAScript_lIIIllIllllllllIIlI))elseif ARAScript_lIIIllllIlllllIllIlI>#("Lu0Xo7VURHpb6t703SWm7oB6bq8tGCp0vR3Qghrsle1S1dlHqY4DBILv34V78")then local ARAScript_lIIIllIllllllllIIlI;local ARAScript_IIIlIIlIlIlllllIllllII;local ARAScript_lIlIlIIlllIIlIIl;local ARAScript_lIIIllllIlllllIllIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("IC")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("kVY")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("CQ8Z")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("lP8")];ARAScript_lIlIlIIlllIIlIIl=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]for ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_lIIIllllIlllllIllIlI+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("lnGr")]do ARAScript_lIlIlIIlllIIlIIl=ARAScript_lIlIlIIlllIIlIIl..ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI];end;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("SY")]]=ARAScript_lIlIlIIlllIIlIIl;ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Hp")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#{"Wally is cute";"1 + 1 = 111";{855333;780782;279480;955586};}]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("2z93")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("rJ")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Cp1")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("YcJY")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IIIlIIlIlIlllllIllllII=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("EN")];ARAScript_lIIIllIllllllllIIlI=ARAScript_IlllIlIIIllIlI[ARAScript_IIIlIIlIlIlllllIllllII];for ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIIlIIlIlIlllllIllllII+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("qu8")]do ARAScript_llIlIIIllIll(ARAScript_lIIIllIllllllllIIlI,ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI])end;else local ARAScript_lllIIlIIIIIII;local ARAScript_IIlIlIIlIlI;local ARAScript_IllIlIlIIlIlI,ARAScript_llIIlIlIIIIIIIlII;local ARAScript_IlIIIIlllIIllllIlI;local ARAScript_lIIIllllIlllllIllIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("oH")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("4lV")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Ge")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("jN8")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("qfDy")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("m3")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ELl")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("VW")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("oQ8")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("9EuT")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("79Y")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("PD")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("IG")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("FK3")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ut")];ARAScript_IlIIIIlllIIllllIlI=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("aTf")]];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1]=ARAScript_IlIIIIlllIIllllIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_IlIIIIlllIIllllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("8utm")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("jo")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Xlk")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("in")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIIIllllIlllllIllIlI+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("oTD")]))ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ax")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("aZk")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("OUlC")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Hn")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("RaN")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("oel8")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("PB")];ARAScript_IlIIIIlllIIllllIlI=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("6ar")]];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1]=ARAScript_IlIIIIlllIIllllIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_IlIIIIlllIIllllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("hVkb")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("tS")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("rk9")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("su")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("HQj")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("o6")]ARAScript_IllIlIlIIlIlI,ARAScript_llIIlIlIIIIIIIlII=ARAScript_lIlIlIIIIIl(ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1]))ARAScript_lIIIllIllllllllIIlI=ARAScript_llIIlIlIIIIIIIlII+ARAScript_lIIIllllIlllllIllIlI-1 ARAScript_IIlIlIIlIlI=0;for ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_lIIIllllIlllllIllIlI,ARAScript_lIIIllIllllllllIIlI do ARAScript_IIlIlIIlIlI=ARAScript_IIlIlIIlIlI+1;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI]=ARAScript_IllIlIlIIlIlI[ARAScript_IIlIlIIlIlI];end;ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("E2")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIIIllllIlllllIllIlI+1,ARAScript_lIIIllIllllllllIIlI))ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("TU")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("sb8")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Fi")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Hal")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("bf")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("AvH")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlIIIIlllIIllllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("n9R")];ARAScript_lllIIlIIIIIII=ARAScript_IlllIlIIIllIlI[ARAScript_IlIIIIlllIIllllIlI]for ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IlIIIIlllIIllllIlI+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ud7z")]do ARAScript_lllIIlIIIIIII=ARAScript_lllIIlIIIIIII..ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI];end;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("0x")]]=ARAScript_lllIIlIIIIIII;ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ml")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1])ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIllllIlIlllIII=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ZpK")];end;elseif ARAScript_lIIIllllIlllllIllIlI<=#("npqAQoAqTVAEa3xSe8fCcRHXzXgIWlvttU0MBCy6g9fic7IS8l0X2HzHSEb3i2FIAfj")then if ARAScript_lIIIllllIlllllIllIlI<=#("cVqMKivdMzUBozJLvJCXus47BFYnFHT7XrPn4nmTlv4tTKOTt3m0Ox4T1tlfuhIe")then if ARAScript_lIIIllllIlllllIllIlI>#("XO6UvRhvSL9zLn10e4Mu3tAx5xKbhzdX0O65R97leE5V5uqfuoqn6TWEnJY9gfo")then local ARAScript_lIllllIlIlllIII=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("1n")]ARAScript_IlllIlIIIllIlI[ARAScript_lIllllIlIlllIII]=ARAScript_IlllIlIIIllIlI[ARAScript_lIllllIlIlllIII](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIllllIlIlllIII+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("7pX")]))else local ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("d9")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI](ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI+1])end;elseif ARAScript_lIIIllllIlllllIllIlI<=#("IlJ6r5je6AqzyPCKgFR2h01g2DShk8e8oMnTWuYAfmqGDxfJho2MzxlSuDdZmc37u")then local ARAScript_lIIIllllIlllllIllIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("xn")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("BtQ")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ec")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("m4s")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("vnKH")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("n4")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("KiQ")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("CO")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("0Tc")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("S2XH")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("vr")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Zun")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("IeXh")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("1c")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("DXJ")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("e0hH")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("eO")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("D1B")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("m4Ey")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("5E")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("fPx")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ostR")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ef")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("n8a")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("5y5Q")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("cy")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIIIllllIlllllIllIlI+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("tJf")]))elseif ARAScript_lIIIllllIlllllIllIlI>#("jVBTYWRrX5JuNGxja6fDK2AGytq9mcstklmuhyAg5hKqi9ZHCdb712Rru5uFFSeUNp")then ARAScript_lIllllIlIlllIII=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("c95")];else ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("EA")]]=(ARAScript_lIIIllIIIlIIllIllIllIIlI[#("sSr")]~=0);end;elseif ARAScript_lIIIllllIlllllIllIlI<=#("CsbcMG9IDsjxzEUHjauCsE59ld5MncZO3ZynAbAB2to9lJ6aUk5TrX17yc0IKxtBDFDJg")then if ARAScript_lIIIllllIlllllIllIlI==#("ghL3K8p5XMh51cggvg8AZyk10FaXGRgx3odXiyn2SCpnBPGqtxjvLRQT6Tce8CAgGVbN")then local ARAScript_IIlIlIIlIlI;local ARAScript_llIIlIlIIIIIIIlII,ARAScript_IllIlIlIIlIlI;local ARAScript_lIIIllllIlllllIllIlI;local ARAScript_lllIIlIIIIIII;local ARAScript_IlIIIIlllIIllllIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Wv")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("n3O")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("oA")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("bmH")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("tX")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Vyj")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("AjOg")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlIIIIlllIIllllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("DbD")];ARAScript_lllIIlIIIIIII=ARAScript_IlllIlIIIllIlI[ARAScript_IlIIIIlllIIllllIlI]for ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IlIIIIlllIIllllIlI+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("xqOm")]do ARAScript_lllIIlIIIIIII=ARAScript_lllIIlIIIIIII..ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI];end;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ay")]]=ARAScript_lllIIlIIIIIII;ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("F0")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1])ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("49")]]={};ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("C8")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("WNU")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("PB")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("TYx")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("c7dh")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Ca")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("pRI")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("E5AL")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("0k")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("2E9")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("K7")];ARAScript_IlIIIIlllIIllllIlI=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Jve")]];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1]=ARAScript_IlIIIIlllIIllllIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_IlIIIIlllIIllllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("CUmv")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("DK")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("bUb")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("gN")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIIIllllIlllllIllIlI+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("CxC")]))ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("9V")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("zUd")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("zJgh")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("l5")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Gas")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("kjhS")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("NJ")];ARAScript_IlIIIIlllIIllllIlI=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("8Ax")]];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1]=ARAScript_IlIIIIlllIIllllIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_IlIIIIlllIIllllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("4la7")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("oh")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Hyx")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Hb")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("PcV")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Gg")]ARAScript_llIIlIlIIIIIIIlII,ARAScript_IllIlIlIIlIlI=ARAScript_lIlIlIIIIIl(ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1]))ARAScript_lIIIllIllllllllIIlI=ARAScript_IllIlIlIIlIlI+ARAScript_lIIIllllIlllllIllIlI-1 ARAScript_IIlIlIIlIlI=0;for ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_lIIIllllIlllllIllIlI,ARAScript_lIIIllIllllllllIIlI do ARAScript_IIlIlIIlIlI=ARAScript_IIlIlIIlIlI+1;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI]=ARAScript_llIIlIlIIIIIIIlII[ARAScript_IIlIlIIlIlI];end;ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("WW")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIIIllllIlllllIllIlI+1,ARAScript_lIIIllIllllllllIIlI))ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("jD")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("zzW")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("OA")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("7q3")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Fc")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("MTA")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("8X")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("xB1")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("5pq5")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ID")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("NH7")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlIIIIlllIIllllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("kuW")];ARAScript_lllIIlIIIIIII=ARAScript_IlllIlIIIllIlI[ARAScript_IlIIIIlllIIllllIlI]for ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IlIIIIlllIIllllIlI+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("rplT")]do ARAScript_lllIIlIIIIIII=ARAScript_lllIIlIIIIIII..ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI];end;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("GE")]]=ARAScript_lllIIlIIIIIII;ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("OZ")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1])ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIllllIlIlllIII=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("8PP")];else local ARAScript_lIIIllllIlllllIllIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("RM")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("yQv")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ic")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("LkH")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("97tx")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("W6")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("86d")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("bu")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1])ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("n0")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("hrd")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("nH")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("9ac")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Qh")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("G1R")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Q7sb")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];do return end;end;elseif ARAScript_lIIIllllIlllllIllIlI<=#("s773gSxi7Bl9TEiHUVmIu0zvj3pciSQO2sazlDF9tL9r1ep8qJW9ZeODIMUmCu9pVIhBDT")then local ARAScript_lllIIlIIIIIII;local ARAScript_IIlIlIIlIlI;local ARAScript_llIIlIlIIIIIIIlII,ARAScript_IllIlIlIIlIlI;local ARAScript_IlIIIIlllIIllllIlI;local ARAScript_lIIIllllIlllllIllIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("8p")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("e4g")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("b8")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("NMi")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("XkGv")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("na")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("LoO")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("2ZvN")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("zh")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("xaV")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("8C")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("31H")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("r4Ck")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("JF")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("DST")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("mDqm")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ES")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("rHk")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#{{343669;981069;671958;917727};{589843;8148;707930;171828};}];ARAScript_IlIIIIlllIIllllIlI=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("NJi")]];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1]=ARAScript_IlIIIIlllIIllllIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_IlIIIIlllIIllllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ixym")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Gt")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("9ov")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("5s")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIIIllllIlllllIllIlI+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("eDx")]))ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("a8")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("YWO")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("m0VT")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("4T")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Oh2")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("739W")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Th")];ARAScript_IlIIIIlllIIllllIlI=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("o0m")]];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1]=ARAScript_IlIIIIlllIIllllIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_IlIIIIlllIIllllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("VT5O")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("xJ")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("uaO")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("0M")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("kmW")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("3p")]ARAScript_llIIlIlIIIIIIIlII,ARAScript_IllIlIlIIlIlI=ARAScript_lIlIlIIIIIl(ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1]))ARAScript_lIIIllIllllllllIIlI=ARAScript_IllIlIlIIlIlI+ARAScript_lIIIllllIlllllIllIlI-1 ARAScript_IIlIlIIlIlI=0;for ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_lIIIllllIlllllIllIlI,ARAScript_lIIIllIllllllllIIlI do ARAScript_IIlIlIIlIlI=ARAScript_IIlIlIIlIlI+1;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI]=ARAScript_llIIlIlIIIIIIIlII[ARAScript_IIlIlIIlIlI];end;ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("CO")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIIIllllIlllllIllIlI+1,ARAScript_lIIIllIllllllllIIlI))ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("hl")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("BjO")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Ak")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("gh6")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("1F")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Pdg")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("6s")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Ek3")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("C4JQ")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlIIIIlllIIllllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("d0p")];ARAScript_lllIIlIIIIIII=ARAScript_IlllIlIIIllIlI[ARAScript_IlIIIIlllIIllllIlI]for ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IlIIIIlllIIllllIlI+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("fFj8")]do ARAScript_lllIIlIIIIIII=ARAScript_lllIIlIIIIIII..ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI];end;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Qz")]]=ARAScript_lllIIlIIIIIII;ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("od")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1])ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("E0")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("PmT")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("th")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("xEl")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("k7")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1])ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("pN")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("K9G")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("nD")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Rr4")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("42")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("hMW")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("nQgn")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("rF")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("lTs")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlIIIIlllIIllllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("TWj")];ARAScript_lllIIlIIIIIII=ARAScript_IlllIlIIIllIlI[ARAScript_IlIIIIlllIIllllIlI]for ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IlIIIIlllIIllllIlI+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("BXtE")]do ARAScript_lllIIlIIIIIII=ARAScript_lllIIlIIIIIII..ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI];end;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("e1")]]=ARAScript_lllIIlIIIIIII;ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("zA")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1])ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIllllIlIlllIII=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("h6s")];elseif ARAScript_lIIIllllIlllllIllIlI>#("qqnoT1hEeOrVJ5QYXOI0JTrH8LUHt7ZFHnFTM04LBhPJkKAteTtW52WH8QphgKkhZWnvA6m")then local ARAScript_lIIIllllIlllllIllIlI;local ARAScript_lIlIlIIlllIIlIIl;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("nk")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("7NB")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIlIlIIlllIIlIIl=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("dO")]ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl]=ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIlIlIIlllIIlIIl+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("A1Q")]))ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIlIlIIlllIIlIIl=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("P8")];ARAScript_lIIIllllIlllllIllIlI=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("57J")]];ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl+1]=ARAScript_lIIIllllIlllllIllIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl]=ARAScript_lIIIllllIlllllIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("beMZ")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("OY")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("IoT")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("qo")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("qoK")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIlIlIIlllIIlIIl=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("6M")]ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIlIlIIlllIIlIIl+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("eT7")]))ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIlIlIIlllIIlIIl=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("KT")];ARAScript_lIIIllllIlllllIllIlI=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("3Id")]];ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl+1]=ARAScript_lIIIllllIlllllIllIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl]=ARAScript_lIIIllllIlllllIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("z4QH")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("dV")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("tc1")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("x7")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Ql4")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIlIlIIlllIIlIIl=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("kz")]ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIlIlIIlllIIlIIl+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("1Pn")]))else ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("V4")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("6jL")]];end;elseif ARAScript_lIIIllllIlllllIllIlI<=#("T6ACdTvzlBCLOcJPB7U5KWF17IUyvd3iGvd8DuDpt16QhKDWnJ5Clrx6CIEG88chHter8KlgEFLS0ZTye7kXiB6o8gH507qvYYiYFlYNyZ7RQ")then if ARAScript_lIIIllllIlllllIllIlI<=#("gMYgCaXp9fyZs1cppHno4bQ523jIztDoJua4gTGqJJZcAQ26KhJBDBUe63oI1p0QMiq80ijGb7QulNGlan8rUcVhK6")then if ARAScript_lIIIllllIlllllIllIlI<=#("nF7ztTjArz4fC7czGUA2sycIOrI5Kxiz4j6bdIxMcnnXghGtRNpxjdQZCzVckn04pFkrbbv8yY0fjpCGV")then if ARAScript_lIIIllllIlllllIllIlI<=#("o6hVo1EgJOWuCYxtHL7osQrr9vmKQm7pq693WFqsY4CRlcxbSZT1JG5JP0W2P3BxRHdFZDIctOAy")then if ARAScript_lIIIllllIlllllIllIlI<=#("Lf69k11EgRVaBo5SzO4Ef9O91mprRH4fHudUZ2EbK3K0sFynMt59G4hLC7i8MJXJWPDflk3Hk2")then if ARAScript_lIIIllllIlllllIllIlI>#("mAYQvYbPxM5KNnDs1TFzagaeOcscBByZNa4lNrXkL4A71eZ2S1bXPD3gzTctF8n6nf6MsrPK6")then ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("37")]]();else if(ARAScript_lIIIllIIIlIIllIllIllIIlI[#("hl")]<ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("DHN5")]])then ARAScript_lIllllIlIlllIII=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("kNN")];else ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;end;end;elseif ARAScript_lIIIllllIlllllIllIlI==#("YfQdnJmBuJzLkjgYW4pDPNRETVhnJBmC1tPYAvGDheOOHN4XGEFVtDPlzmtCC913x6U0FszByXv")then local ARAScript_lIIIllIllllllllIIlI;local ARAScript_lIIIllllIlllllIllIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("2J")]]={};ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("1q")]]={};ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Sa")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("c73")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("uh")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("x2p")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("UZ")];ARAScript_lIIIllIllllllllIIlI=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("QFv")]];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1]=ARAScript_lIIIllIllllllllIIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_lIIIllIllllllllIIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("nXSK")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Ak")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Xfs")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("RQ")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIIIllllIlllllIllIlI+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("f5a")]))ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("OE")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("uQu")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("SRW8")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Y3")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("atF")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("rWWT")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("xy")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("hSV")];else ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("AZ")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("5JI")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("7zCK")];end;elseif ARAScript_lIIIllllIlllllIllIlI<=#("9c6g0uRe5BhyOEznbdbimUqL3drmfexHgelxqmLgrX76Zvma4lztVnyoVvnXcF81dKqKrc6ZD40AWu")then if ARAScript_lIIIllllIlllllIllIlI>#("I1rs4PcV3Q7L59YdXYf2oeMT2oK11x8CBJQ5VmemaYy3uBb0O1dLQCHDpIAQfl4GSFkvs3rKT32AQ")then local ARAScript_IIlIlIIlIlI;local ARAScript_IllIlIlIIlIlI,ARAScript_llIIlIlIIIIIIIlII;local ARAScript_lIIIllllIlllllIllIlI;local ARAScript_lllIIlIIIIIII;local ARAScript_IlIIIIlllIIllllIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("4S")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("j8q")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("vl")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("5Rx")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("BP")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("txD")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlIIIIlllIIllllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("0Tj")];ARAScript_lllIIlIIIIIII=ARAScript_IlllIlIIIllIlI[ARAScript_IlIIIIlllIIllllIlI]for ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IlIIIIlllIIllllIlI+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ysTK")]do ARAScript_lllIIlIIIIIII=ARAScript_lllIIlIIIIIII..ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI];end;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("r0")]]=ARAScript_lllIIlIIIIIII;ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Ub")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1])ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("aE")]]={};ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("yA")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Mqj")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("qn")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Ms2")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("kZMv")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("4c")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("xug")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Qcl2")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ku")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Ue6")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("85")];ARAScript_IlIIIIlllIIllllIlI=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("H5T")]];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1]=ARAScript_IlIIIIlllIIllllIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_IlIIIIlllIIllllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("OfUR")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Y0")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("OmB")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#{"youtube.com/watch?v=pjJ2w1FX_Wg";{40190;462465;460045;443631};}]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIIIllllIlllllIllIlI+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("s8q")]))ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("4p")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("1Oe")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("usOp")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Uv")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("JFO")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Ni6u")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("rd")];ARAScript_IlIIIIlllIIllllIlI=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("AlU")]];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1]=ARAScript_IlIIIIlllIIllllIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_IlIIIIlllIIllllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("dfdQ")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Zx")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("goB")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Fb")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("LzM")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("5N")]ARAScript_IllIlIlIIlIlI,ARAScript_llIIlIlIIIIIIIlII=ARAScript_lIlIlIIIIIl(ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1]))ARAScript_lIIIllIllllllllIIlI=ARAScript_llIIlIlIIIIIIIlII+ARAScript_lIIIllllIlllllIllIlI-1 ARAScript_IIlIlIIlIlI=0;for ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_lIIIllllIlllllIllIlI,ARAScript_lIIIllIllllllllIIlI do ARAScript_IIlIlIIlIlI=ARAScript_IIlIlIIlIlI+1;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI]=ARAScript_IllIlIlIIlIlI[ARAScript_IIlIlIIlIlI];end;ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("eC")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIIIllllIlllllIllIlI+1,ARAScript_lIIIllIllllllllIIlI))ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("hq")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Ant")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("us")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("acL")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("96")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ZGd")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlIIIIlllIIllllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("bnk")];ARAScript_lllIIlIIIIIII=ARAScript_IlllIlIIIllIlI[ARAScript_IlIIIIlllIIllllIlI]for ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IlIIIIlllIIllllIlI+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("5dhv")]do ARAScript_lllIIlIIIIIII=ARAScript_lllIIlIIIIIII..ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI];end;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("8D")]]=ARAScript_lllIIlIIIIIII;ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("XE")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1])else local ARAScript_lIIIllllIlllllIllIlI;local ARAScript_lIlIlIIlllIIlIIl;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("EH")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("pSz")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("2eBP")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("CN")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("BrZ")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("oL35")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Fu")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("l1a")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("2PUn")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("SE")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("W0c")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("fPEV")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("33")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("vbn")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("b2rQ")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("MD")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ujy")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("K9F5")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIlIlIIlllIIlIIl=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ZW")];ARAScript_lIIIllllIlllllIllIlI=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("4oZ")]];ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl+1]=ARAScript_lIIIllllIlllllIllIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl]=ARAScript_lIIIllllIlllllIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("K7yf")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIlIlIIlllIIlIIl=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("QA")]ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl]=ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl](ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl+1])ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Ss")]]=#ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("hgZ")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];if(ARAScript_lIIIllIIIlIIllIllIllIIlI[#("R0")]<ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("p18v")]])then ARAScript_lIllllIlIlllIII=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("dRu")];else ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;end;end;elseif ARAScript_lIIIllllIlllllIllIlI<=#("yBmUm9txW9cmQnWzgZ42k0qQHVJD2XJhXGj8Dv85muTktgneYuWcGYJIkHnCA0F9A4AjdY5V18PZhfx")then local ARAScript_lIIIllllIlllllIllIlI;local ARAScript_lIlIlIIlllIIlIIl;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ES")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ayY")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("oC")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("z7T")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIlIlIIlllIIlIIl=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("NN")]ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIlIlIIlllIIlIIl+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("bkN")]))ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIlIlIIlllIIlIIl=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("jM")];ARAScript_lIIIllllIlllllIllIlI=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Ekr")]];ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl+1]=ARAScript_lIIIllllIlllllIllIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl]=ARAScript_lIIIllllIlllllIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("bpbW")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("xM")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("9Iz")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("cf")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#{"Kiriot is a panda !";{659412;100444;29121;321132};"Kiriot is a panda !";}];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIlIlIIlllIIlIIl=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("8x")]ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIlIlIIlllIIlIIl+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("C5o")]))ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIlIlIIlllIIlIIl=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Y7")];ARAScript_lIIIllllIlllllIllIlI=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("chx")]];ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl+1]=ARAScript_lIIIllllIlllllIllIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl]=ARAScript_lIIIllllIlllllIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("zvZV")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("kX")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Fj3")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ZT")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("mfn")];elseif ARAScript_lIIIllllIlllllIllIlI>#("HFPHaGM87MY5iGFv0TVzQdb9zblHiTBekW45k883sBmB99NuDt9yu7UEDPh9ueZnkTVvLKl2U1go0K9z")then local ARAScript_lIIIllIllllllllIIlI;local ARAScript_lIIIllllIlllllIllIlI;ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("1Y")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIIIllllIlllllIllIlI+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("AoF")]))ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("dn")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("LZA")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("uO")];ARAScript_lIIIllIllllllllIIlI=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ZY3")]];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1]=ARAScript_lIIIllIllllllllIIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_lIIIllIllllllllIIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("qKxU")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("g9")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("snJ")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("XQ")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIIIllllIlllllIllIlI+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("dNQ")]))ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("dt")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("SPg")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("aWUB")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("mQ")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("XJE")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("of7c")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("eS")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("qsY")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("4qOU")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("4Q")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("tbR")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("nRil")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("0e")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("yKK")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("W1G2")]];else ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("8X")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Gro")]];end;elseif ARAScript_lIIIllllIlllllIllIlI<=#("1dZUdUncBCF09JnM9qqorU3igND0FN3PSLDa9Eh8IskhQbUs2N1tTkfhkRNBqxIYJZhzfmMGirR9JVCe2k81V")then if ARAScript_lIIIllllIlllllIllIlI<=#("6IFv0s0RSlUvJ04vmQbvkBEgIzpJIgyQc93K3TvtPCKFonmMkG7s0AyFdzYCdriLXetJ7tDDtRQT182umNy")then if ARAScript_lIIIllllIlllllIllIlI==#("ifZNLyGF54qys8Sj3NO1dE9jTPOfGEpA3gDRoR8KX8IzBsA2qSBJ9H8OgQ36TB8CP1EmGa5mPedf6KTBpV")then local ARAScript_lIIIllllIlllllIllIlI;local ARAScript_lIlIlIIlllIIlIIl;ARAScript_lIlIlIIlllIIlIIl=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Er")]ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIlIlIIlllIIlIIl+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("o1V")]))ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIlIlIIlllIIlIIl=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Bs")];ARAScript_lIIIllllIlllllIllIlI=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("KW5")]];ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl+1]=ARAScript_lIIIllllIlllllIllIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl]=ARAScript_lIIIllllIlllllIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ojUd")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("eR")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("zVO")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIlIlIIlllIIlIIl=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("L1")]ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl]=ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIlIlIIlllIIlIIl+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("iK6")]))ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIlIlIIlllIIlIIl=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("jb")];ARAScript_lIIIllllIlllllIllIlI=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ufQ")]];ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl+1]=ARAScript_lIIIllllIlllllIllIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl]=ARAScript_lIIIllllIlllllIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("9LOG")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Hh")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("a8l")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIlIlIIlllIIlIIl=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("uM")]ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl]=ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIlIlIIlllIIlIIl+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("HFT")]))ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIlIlIIlllIIlIIl=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("hX")];ARAScript_lIIIllllIlllllIllIlI=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("cd6")]];ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl+1]=ARAScript_lIIIllllIlllllIllIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl]=ARAScript_lIIIllllIlllllIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("DhHc")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("cj")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("A2P")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIlIlIIlllIIlIIl=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("bF")]ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl]=ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIlIlIIlllIIlIIl+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("YmT")]))else ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Xi")]]();end;elseif ARAScript_lIIIllllIlllllIllIlI>#("YcQAxhYLJXb0xafUJYnxpXo44D3SH7DR8Mjz8BgeRAvzNoRf00jMbyJaYVG4ogdLuu1U0RViSiP0BZrPVY1R")then local ARAScript_lIIIllIllllllllIIlI=ARAScript_IIIllIIlIllIllIII[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("xoG")]];local ARAScript_IIIlIIlIlIlllllIllllII;local ARAScript_lIIIllllIlllllIllIlI={};ARAScript_IIIlIIlIlIlllllIllllII=ARAScript_IIIlIlIIIIllIlIllIlIIlII({},{__index=function(ARAScript_lIllllIlIlllIII,ARAScript_lIIIllIIIlIIllIllIllIIlI)local ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_lIIIllllIlllllIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI];return ARAScript_lIIIllIIIlIIllIllIllIIlI[1][ARAScript_lIIIllIIIlIIllIllIllIIlI[2]];end,__newindex=function(ARAScript_IlllIlIIIllIlI,ARAScript_lIIIllIIIlIIllIllIllIIlI,ARAScript_lIllllIlIlllIII)local ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_lIIIllllIlllllIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI]ARAScript_lIIIllIIIlIIllIllIllIIlI[1][ARAScript_lIIIllIIIlIIllIllIllIIlI[2]]=ARAScript_lIllllIlIlllIII;end;});for ARAScript_lIlIlIIlllIIlIIl=1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("6r9X")]do ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;local ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];if ARAScript_lIIIllIIIlIIllIllIllIIlI[#("V")]==71 then ARAScript_lIIIllllIlllllIllIlI[ARAScript_lIlIlIIlllIIlIIl-1]={ARAScript_IlllIlIIIllIlI,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("x65")]};else ARAScript_lIIIllllIlllllIllIlI[ARAScript_lIlIlIIlllIIlIIl-1]={ARAScript_IIlIlIIlIlI,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("NIr")]};end;ARAScript_llIIlIlIIIIIIIlII[#ARAScript_llIIlIlIIIIIIIlII+1]=ARAScript_lIIIllllIlllllIllIlI;end;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("7s")]]=ARAScript_IllIlIlIIlIlI(ARAScript_lIIIllIllllllllIIlI,ARAScript_IIIlIIlIlIlllllIllllII,ARAScript_lIlIlIIlllIIlIIl);else local ARAScript_lIIIllIllllllllIIlI;local ARAScript_lIIIllllIlllllIllIlI;ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("xM")];ARAScript_lIIIllIllllllllIIlI=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("LSn")]];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1]=ARAScript_lIIIllIllllllllIIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_lIIIllIllllllllIIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("hRfg")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("zi")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("PEU")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("UD")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIIIllllIlllllIllIlI+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("cCH")]))ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("eU")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Ynu")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("JBlk")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Ds")];ARAScript_lIIIllIllllllllIIlI=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("5an")]];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1]=ARAScript_lIIIllIllllllllIIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_lIIIllIllllllllIIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("iq1L")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("kO")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("vlj")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("0v")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIIIllllIlllllIllIlI+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("DN4")]))ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Rz")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("J60")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("0c")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("WG0")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("fu4z")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("2Y")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]()end;elseif ARAScript_lIIIllllIlllllIllIlI<=#("1PKciKn4m0LvUerx6ojea42STK9E0jBoxXEPrSRgInFseERV9sYJSMX6W1sJLTedzv86LMfoIcGWzKOo3oEIu1H")then if ARAScript_lIIIllllIlllllIllIlI>#("aH3AziFYjC3SGUjxnJbPfaImneQxoHSIYn6eTP0zHSN7Q5TiehtVZ2P99RmuCiKNUv4rXfNJTMhyxLHruHshm6")then local ARAScript_lIIIllllIlllllIllIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("mm")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Ozq")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("3k")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("COC")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("D5")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("SkV")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("dy")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIIIllllIlllllIllIlI+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("MP2")]))ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("o7")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("tje")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("3J")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ICX")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("tNiq")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("NN")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("JkH")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("9g")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#{"Retard gonna sey they are gonna deobfuscate this";{840957;872578;479514;767015};"youtube.com/watch?v=pjJ2w1FX_Wg";}]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("gjg0")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];if(ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("3P")]]~=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("F2Sa")])then ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;else ARAScript_lIllllIlIlllIII=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("yMM")];end;else local ARAScript_lIllllIlIlllIII=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("2I")];local ARAScript_IIlIIIllllIIIllllIIl=ARAScript_IlllIlIIIllIlI[ARAScript_lIllllIlIlllIII];for ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_lIllllIlIlllIII+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("U3Q")]do ARAScript_llIlIIIllIll(ARAScript_IIlIIIllllIIIllllIIl,ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI])end;end;elseif ARAScript_lIIIllllIlllllIllIlI<=#("6J6ecCG7ziamubCv8EVcnUqMzk494ZCAXN7T0aLgnPSpxylq2ltNC4FlruQ2HGcKQLARdTF73OZJcbpb8OgTGZ82")then local ARAScript_lIlIlIIIIIl;local ARAScript_lIIIllIllllllllIIlI;local ARAScript_lIIIllllIlllllIllIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#{{74840;677894;927004;138246};{178057;432506;817007;592855};}]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Tod")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("i2")];ARAScript_lIIIllIllllllllIIlI=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("2V8")]];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1]=ARAScript_lIIIllIllllllllIIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_lIIIllIllllllllIIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("HeOz")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("6J")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("dnk")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("CS")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIIIllllIlllllIllIlI+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("BBj")]))ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("SX")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("MnV")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("JzDS")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("kD")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("gvs")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("mp67")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("T7")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("MDW")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("LxKY")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("9o")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("dv2")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("FJY4")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("om")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("DxQ")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("AuuH")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Wa")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("zGj")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("qI13")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("qK")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("lNc")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("xp")];ARAScript_lIIIllIllllllllIIlI=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("151")]];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1]=ARAScript_lIIIllIllllllllIIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_lIIIllIllllllllIIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("bRGv")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Pg")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("DA4")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("26")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIIIllllIlllllIllIlI+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("izL")]))ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("el")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("5xP")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("4jB6")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Vq")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("990")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("1njL")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("7S")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("uUj")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("hr4C")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Wj")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("UZX")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("7pT0")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("MY")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("e8g")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ne5z")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("E3")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("s4Y")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Ck")]]=ARAScript_IIlIlIIlIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("MYH")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Mk")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Cvr")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllIllllllllIIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Vsz")];ARAScript_lIlIlIIIIIl=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIllllllllIIlI]for ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_lIIIllIllllllllIIlI+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("PydA")]do ARAScript_lIlIlIIIIIl=ARAScript_lIlIlIIIIIl..ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI];end;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("uv")]]=ARAScript_lIlIlIIIIIl;ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("EG")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("0UX")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("31ny")]];elseif ARAScript_lIIIllllIlllllIllIlI==#("WBGuSKRMiJW7FnjQvUXf6jqeP42ztd1MHJqs9Nkdh63CEdDB7cjekXlNjBPYRsreSjA561RSKT89pYLLBCCr4WBUy")then ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("x1")]]=ARAScript_IIlIlIIlIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Xvd")]];else if(ARAScript_lIIIllIIIlIIllIllIllIIlI[#("E5")]<ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ui16")]])then ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;else ARAScript_lIllllIlIlllIII=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("WXm")];end;end;elseif ARAScript_lIIIllllIlllllIllIlI<=#("iI7vxYPYTtOIEfvBFCZlxu0exo1ak5TQHsTiUnxjuBfq738v6Dr94mqXR38h7POXL8akxmQqeP05pKhEqGeSOUVtc6C1opmQXrQ")then if ARAScript_lIIIllllIlllllIllIlI<=#("2X8TWa4ovuHhWF1BL5j1nRiBVZbZDki84iMDHu6OZG8SAteUzVf2iYVlPI868fWlmJnO2y4q9FbRSBaBUqBRfpZfxBX8v9")then if ARAScript_lIIIllllIlllllIllIlI<=#("UUWF0gB2a1Z2NWdDoHIlROeg6ThqCL54a0r765jutzB0pymss7JBXX7fPQJh8jAA642XFgHtxm2snn0JHZ7EbEhm2lsq")then if ARAScript_lIIIllllIlllllIllIlI==#("cxj8a4vFAYmBoeL4P2BZ9Lil6yCXQ4sXq7u0TtmtFegaVcWAGrnt1BxBn7cNCIZFFzkrTUlvPhu5EiB3LcqyR96ZK3M")then local ARAScript_lIllllIlIlllIII=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("qE")]ARAScript_IlllIlIIIllIlI[ARAScript_lIllllIlIlllIII]=ARAScript_IlllIlIIIllIlI[ARAScript_lIllllIlIlllIII](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIllllIlIlllIII+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("MYC")]))else local ARAScript_lIlIlIIlllIIlIIl;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("WY")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("rhe")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("mlTF")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("sE")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("J8X")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("XU")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Dmp")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIlIlIIlllIIlIIl=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("1l")]ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl]=ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIlIlIIlllIIlIIl+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Cfs")]))ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("AA")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("BWp")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("CC")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("k4Q")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("XA")]]={};ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("WE")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("0Q4")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("9OAP")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("0A")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("M3b")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("W7PS")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Jh")]]={};end;elseif ARAScript_lIIIllllIlllllIllIlI==#("rK16oMFv1FQWf1PUgB6fGibArBYGDvSZhBeepyQ2NfcgvFrZulTj7HoiICPYX92GW1OPXKFSUdDBg5dXi8lqNI2Ll5GXT")then ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Ln")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("3iW")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("0nb3")]];else local ARAScript_lIllllIlIlllIII=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("TP")]ARAScript_IlllIlIIIllIlI[ARAScript_lIllllIlIlllIII](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIllllIlIlllIII+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("nyC")]))end;elseif ARAScript_lIIIllllIlllllIllIlI<=#("fNmGtF0NcURaz3eXcNz1PYYL3n8dE1dR818ZoKLI6G6BKMj9Gy32z1nqZLNfHXikQ9bH4oJCc05i1xbre9Hf8kshNR9N7Fbi")then if ARAScript_lIIIllllIlllllIllIlI>#("WUKKMerYB0I5fADKubHqdlFQ43mo6FHZXVfMBRC5pqIuVlIrHdMEE1tKp3QS1c26tShtt0iOJMbWOk5Sv4S22cu6CFxIbUd")then local ARAScript_IIlIlIIlIlI;local ARAScript_IllIlIlIIlIlI,ARAScript_llIIlIlIIIIIIIlII;local ARAScript_lIIIllllIlllllIllIlI;local ARAScript_lllIIlIIIIIII;local ARAScript_IlIIIIlllIIllllIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("pt")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("6MT")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("RI")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("geQ")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("gM")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("FVm")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("DkTy")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlIIIIlllIIllllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Ji8")];ARAScript_lllIIlIIIIIII=ARAScript_IlllIlIIIllIlI[ARAScript_IlIIIIlllIIllllIlI]for ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IlIIIIlllIIllllIlI+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("qeGY")]do ARAScript_lllIIlIIIIIII=ARAScript_lllIIlIIIIIII..ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI];end;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("i6")]]=ARAScript_lllIIlIIIIIII;ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("oc")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1])ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("bD")]]={};ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("aa")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Chk")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("gD")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("d9J")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ZyXj")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("in")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("kMf")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("cuBm")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Hp")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("sOn")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("YQ")];ARAScript_IlIIIIlllIIllllIlI=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("tyx")]];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1]=ARAScript_IlIIIIlllIIllllIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_IlIIIIlllIIllllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("a7y0")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Al")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("kf1")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("vg")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIIIllllIlllllIllIlI+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("9ot")]))ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("tP")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Rle")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("6lFl")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("2R")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("jzl")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("gg7M")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("1t")];ARAScript_IlIIIIlllIIllllIlI=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("nJX")]];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1]=ARAScript_IlIIIIlllIIllllIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_IlIIIIlllIIllllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("cCvv")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("AK")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("djA")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("vT")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("8xx")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("cj")]ARAScript_IllIlIlIIlIlI,ARAScript_llIIlIlIIIIIIIlII=ARAScript_lIlIlIIIIIl(ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1]))ARAScript_lIIIllIllllllllIIlI=ARAScript_llIIlIlIIIIIIIlII+ARAScript_lIIIllllIlllllIllIlI-1 ARAScript_IIlIlIIlIlI=0;for ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_lIIIllllIlllllIllIlI,ARAScript_lIIIllIllllllllIIlI do ARAScript_IIlIlIIlIlI=ARAScript_IIlIlIIlIlI+1;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI]=ARAScript_IllIlIlIIlIlI[ARAScript_IIlIlIIlIlI];end;ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("MI")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIIIllllIlllllIllIlI+1,ARAScript_lIIIllIllllllllIIlI))ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("8J")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("IjG")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("vu")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("WAm")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("QZ")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("qy3")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("uQ")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("PS2")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("5hMX")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("lQ")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Huj")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlIIIIlllIIllllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ChZ")];ARAScript_lllIIlIIIIIII=ARAScript_IlllIlIIIllIlI[ARAScript_IlIIIIlllIIllllIlI]for ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IlIIIIlllIIllllIlI+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ykGr")]do ARAScript_lllIIlIIIIIII=ARAScript_lllIIlIIIIIII..ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI];end;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Co")]]=ARAScript_lllIIlIIIIIII;ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Lq")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1])ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIllllIlIlllIII=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("KzG")];else local ARAScript_lIIIllllIlllllIllIlI;ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Hg")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIIIllllIlllllIllIlI+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("PxX")]))ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("nD")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("1Ds")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("FXY0")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("gx")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1])ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("rT")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Q49")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Hu")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("lZZ")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("FW35")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#{"youtube.com/watch?v=pjJ2w1FX_Wg";"youtube.com/watch?v=pjJ2w1FX_Wg";}]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]()ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ml")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Q8r")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("of")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("qB7")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("eJta")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("xj")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("mDy")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("tL")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("tVK")]];end;elseif ARAScript_lIIIllllIlllllIllIlI<=#("zMaddo8R5852ZI6e87x6u9dqxl2ZEKMZJYxbj2Pg6a73hDh3IrJexg2zITQ2ximuvfsak54grp9tckj4e8qlbICC68DBlXUXY")then local ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ea")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI](ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI+1])elseif ARAScript_lIIIllllIlllllIllIlI==#("HbjgTNyDWggJxyKVXz2bsYN1emCE4FGlFzNhU7oNXJVvuxMf0B9v5WtTyscHl3IrL4d7UCb0jonUcrGSKvOEFjqTf4UC5SC3aE")then ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("BC")]]=ARAScript_IIlIlIIlIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("4lR")]];else if(ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Qi")]]==ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("SAk5")]])then ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;else ARAScript_lIllllIlIlllIII=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Kq8")];end;end;elseif ARAScript_lIIIllllIlllllIllIlI<=#("BsOuyzjmRIJQfWu6ZpeWBOu20SK4CWuUIIfz6apev7KlGnOPLVMN5SsW8WFQZoU4nZiIR5aYa9AEejvNe4tQkRYZosBkGKogmQ7Rfg7P")then if ARAScript_lIIIllllIlllllIllIlI<=#("XN5rYSYA2L55eTHasszFZsBVtrylPH87O4xd2IAKMUO8tkh6BQXXJk5Fmk8HtNUuN7qjxDhV2Y2fOCBijCV8UkyE911SJ3p99tuv3")then if ARAScript_lIIIllllIlllllIllIlI==#("J7Jb5Vs01UUZy21VKDKXkGMAl9I3ftgeol2XASpNliah7UFyhoT2WfXdvj05mzVHNQKmaev1n6MbGFCCEjV1LoriyYCq2tAWyDEq")then local ARAScript_IIlIIIllllIIIllllIIl=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Avt")];local ARAScript_lIllllIlIlllIII=ARAScript_IlllIlIIIllIlI[ARAScript_IIlIIIllllIIIllllIIl]for ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("K9fr")]do ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII..ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI];end;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("tK")]]=ARAScript_lIllllIlIlllIII;else local ARAScript_lIIIllllIlllllIllIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Yd")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("vBT")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("YO")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("s9e")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("3vKe")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("o6")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]()ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Az")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("gkU")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("zs")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("zjA")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("VQnb")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("W1")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("f3m")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("5W")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("tMY")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("hn")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIIIllllIlllllIllIlI+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("h4o")]))ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("qg")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ag4")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("OZ")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("gus")];end;elseif ARAScript_lIIIllllIlllllIllIlI<=#("syd22P0EWI1RyCcO46yzBZlNf93G0NcalslWS8TKCPMqKJE2xhEHf2SEmAX2VtNiG0Gfpq55nY7Vn5cGFbiTjG5sKSKrk0YhcDUTdy")then if ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("F2")]]then ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;else ARAScript_lIllllIlIlllIII=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("TVh")];end;elseif ARAScript_lIIIllllIlllllIllIlI==#("glJtq56pryryTk48a5mGIROUyaZTUktChAcHLmOxNCs43De6iFUX02dAIY6qgnGgeZqtiyyYr02fzT1552KpAGLovN8WpxqA5l0dmVY")then ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("bA")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Q8p")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("trht")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("7I")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("CDF")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("pJAi")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Rf")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("1Jg")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("vXMb")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("mO")]]={};ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("mc")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("izs")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("8aK3")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("A3")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("MTF")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("GRHR")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Iz")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("UPM")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("jlY2")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("RR")]]={};ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("nI")]]={};ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("CK")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("pYh")];else if not ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("u4")]]then ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;else ARAScript_lIllllIlIlllIII=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("0NP")];end;end;elseif ARAScript_lIIIllllIlllllIllIlI<=#("g6Ga97aY6bunNqRInb7GzLI4JCkm3XTkeZiDaLoyMjZobdXPFrZkXrvFzLCHXX5jskjXhnINWJ3pVs2GPGSM8IyWEOezjRLYoQ6149HrTl")then if ARAScript_lIIIllllIlllllIllIlI>#("nzfTgS52rfslUWxtEiiEe8fbfvaMQ9B2Wjjyy48RnZtT5FmfHQciKStpseOVRtlsPAALM95KkCqoOvgKj5ea6rrdZ4etqna3ObeFfLDHU")then local ARAScript_lIIIllllIlllllIllIlI;local ARAScript_lIlIlIIlllIIlIIl;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Cx")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("V2o")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("yvrS")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("aZ")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("veH")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Br0m")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Yn")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("AYI")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("bJ6B")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("g5")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("9yX")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("fUJc")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("gd")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("bJk")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("UftD")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Vo")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("qTK")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("MVB3")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIlIlIIlllIIlIIl=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("g7")];ARAScript_lIIIllllIlllllIllIlI=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("vpD")]];ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl+1]=ARAScript_lIIIllllIlllllIllIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl]=ARAScript_lIIIllllIlllllIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("dUIR")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIlIlIIlllIIlIIl=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Zt")]ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl]=ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl](ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl+1])ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("lU")]]=#ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("uBL")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];if(ARAScript_lIIIllIIIlIIllIllIllIIlI[#("7p")]<ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("aF3K")]])then ARAScript_lIllllIlIlllIII=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("4WV")];else ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;end;else if(ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("I1")]]~=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("QjyV")])then ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;else ARAScript_lIllllIlIlllIII=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("k7x")];end;end;elseif ARAScript_lIIIllllIlllllIllIlI<=#("8iCeL77dLVolvxivVR5Ls7CxLNrMFIDIpEsjMUthvmMoOCPRxTZVMjjbReD7PvIdsR61d8UayYogumTi7LoVSR6furCHqxC9OI67GYNy9Yy")then local ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("gV")]local ARAScript_IIlIIIllllIIIllllIIl,ARAScript_lIllllIlIlllIII=ARAScript_lIlIlIIIIIl(ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI](ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI+1]))ARAScript_lIIIllIllllllllIIlI=ARAScript_lIllllIlIlllIII+ARAScript_lIIIllIIIlIIllIllIllIIlI-1 local ARAScript_lIllllIlIlllIII=0;for ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI,ARAScript_lIIIllIllllllllIIlI do ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI]=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];end;elseif ARAScript_lIIIllllIlllllIllIlI>#("4dQFvu9dhXuLU0HWHmUbvoCXqVNj81V4tilrM7l6xz21numQq00XevCPL3nKRZepbBrMPpjKaXP6vKJ6J73hb8Z7RGQTTLpHtNZWdLabRqWr")then ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("pA")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("lZ8")]];else local ARAScript_lIIIllllIlllllIllIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("8U")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("hlb")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("hL")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("aAc")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("qg")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("CPd")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("EQ")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIIIllllIlllllIllIlI+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("sn9")]))ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("lo")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("M3u")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("bN")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("mtG")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("6Vf4")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];do return end;end;elseif ARAScript_lIIIllllIlllllIllIlI<=#("FtbtrbU66odLt4jKB0zHhMTVW2862BUlHqmlOzCKFLyzWkUQ1BpAxUK2LqHzcXeGE1edS75czZbHot8LiseBluZWQtLy1cISG154gR74GnaITcNqr5qUTNticrxyvHk")then if ARAScript_lIIIllllIlllllIllIlI<=#("qtaxzdFCuk58uqdNRug5VX83IW2ZtJI8cNqzcp1nBZAISvYWnTRbBoLEuhZNlPhVN75R9OLBD2F6yBll8gLL2HHYbXd4AobWRO5VBhWJhpJJUPf46OOfdH")then if ARAScript_lIIIllllIlllllIllIlI<=#("fAgPmLQan0SoTFAU0tbDM78dxSj8WK6SkVZutCK8BouSbAvAG3YWcdqhCdrEBSoN4ae8PfByUcbxNpb6vUD2WkPgFR3qkfHTaSYbvyUADAb9b3Fmb")then if ARAScript_lIIIllllIlllllIllIlI<=#("iRpv0Uu7D8mjnOFrx5CaL89cAxiQfMmQpZ70EP1dQy4VntlxETHKVaTjRm6DMP21WG4zRPYSdyundnYglVlvfM5ofXiqTyCaGd9SzXQY5YGxQGg")then if ARAScript_lIIIllllIlllllIllIlI>#("zZr0DHVjKPs3HH8Q5tR9ngRyfyAqfJJJRP23fMI9s0hTEWqz00BvYgori3UegFdbgUm2OfKtVSRy984tgbBphmUKALVm1D2XXgNUJzUUqhKgA1")then local ARAScript_lIIIllllIlllllIllIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("jY")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("NIH")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("r1")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("lNX")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("kI")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("VN3")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Ya")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIIIllllIlllllIllIlI+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("nLN")]))ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("zF")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ytV")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("0h")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("TS6")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ANWW")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];do return end;else ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("tR")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("7q5")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("74")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("E9T")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("rbZ6")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("GD")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("PYp")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("jv")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("28f")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("P06N")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("We")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("1Nr")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Mg")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("tY2")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("rbo8")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("9R")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("qAL")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("l6")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("IrE")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("K09B")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("SC")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("LKg")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#{"Wally is cute";{615266;983244;432870;305465};}]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("SF6")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("KRJ4")];end;elseif ARAScript_lIIIllllIlllllIllIlI>#("k9B8eeY439MDduyCs03K2ukUSrQ89NOkIrLmBFXT9lTU75QA3QrqGqAZZQqXyZ4qvC4WUkaXcjLRMAXWLqftvyOq1WyVoavkrDzFb4QTQEnxQTnz")then local ARAScript_lIllllIlIlllIII=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Hv")]ARAScript_IlllIlIIIllIlI[ARAScript_lIllllIlIlllIII](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIllllIlIlllIII+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("3gG")]))else local ARAScript_lIIIllllIlllllIllIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("US")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("vjb")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("tl")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1])ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("CW")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("o6x")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Aa")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#{"spoodercraft says bim bam boom";"Kiriot is a panda !";"Retard gonna sey they are gonna deobfuscate this";}]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("0QHJ")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];if not ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Bc")]]then ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;else ARAScript_lIllllIlIlllIII=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("y4b")];end;end;elseif ARAScript_lIIIllllIlllllIllIlI<=#("EmgUL47YO47XoJcYBziasVQLvO1jrKhI82UXoAQICRx9S6B4lIpueyKTGGy7dYGdWAYxZoJaTKJLyR2Am77TuXDKrarTcTFOktmshee79oLFZ9vYN7U")then if ARAScript_lIIIllllIlllllIllIlI>#("0XS96neZ6089f5BeEKsi2aUfl8VsPDfe8zXyLnv3apaiqMA3JqucPMn0cMX7DVjEU3bQhcEqnziM9LZKJ1UyicAxk7u8BzBogHzyKTVGXdYpDM1BXm")then local ARAScript_lIIIllIllllllllIIlI;local ARAScript_lIIIllllIlllllIllIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("kX")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("y0o")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("B8V9")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("m1")]]=(ARAScript_lIIIllIIIlIIllIllIllIIlI[#("uu2")]~=0);ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("th")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("1jg")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Qo")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIIIllllIlllllIllIlI+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("QFW")]))ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Ht")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("sDP")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("8Q7U")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("xN")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("zlP")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Gb")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("4yD")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("0mVQ")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("lr")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("78I")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("4Hgh")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("RH")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1])ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("FV")];ARAScript_lIIIllIllllllllIIlI=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("E2y")]];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1]=ARAScript_lIIIllIllllllllIIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_lIIIllIllllllllIIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("JOuy")]];else local ARAScript_lIIIllIllllllllIIlI;local ARAScript_lIIIllllIlllllIllIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("0r")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("2he")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#{"Retard gonna sey they are gonna deobfuscate this";"spoodercraft says bim bam boom";{244362;342705;504395;800923};"1 + 1 = 111";}];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ka")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("rTJ")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("9txE")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Xu")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("0aA")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("sqoX")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("RB")]]={};ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("kN")]]={};ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("B5")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("FAZ")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("9c")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("p4P")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("m4")];ARAScript_lIIIllIllllllllIIlI=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("kND")]];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1]=ARAScript_lIIIllIllllllllIIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_lIIIllIllllllllIIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("43oE")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("J9")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("2Iv")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("DF")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIIIllllIlllllIllIlI+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Ls2")]))end;elseif ARAScript_lIIIllllIlllllIllIlI<=#("LaWvRDPGkRF0Z83GCmB9ZgoKeoj3Jg4knaZntlR45nLYsn9rKgzovnJFWlqDsV7dXuMZiPlqGGdMFAr0p2tCSPYaCtCi4nMkqHb7Mji45hS0j69x4BnB")then local ARAScript_lIIIllIllllllllIIlI;local ARAScript_lIIIllllIlllllIllIlI;local ARAScript_IIIlIIlIlIlllllIllllII;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("FZ")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("gSu")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Y0")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("yPZ")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IIIlIIlIlIlllllIllllII=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("NKV")];ARAScript_lIIIllllIlllllIllIlI=ARAScript_IlllIlIIIllIlI[ARAScript_IIIlIIlIlIlllllIllllII]for ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIIlIIlIlIlllllIllllII+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("y63P")]do ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllllIlllllIllIlI..ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI];end;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("cx")]]=ARAScript_lIIIllllIlllllIllIlI;ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("hK")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("7HZ")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("tJAZ")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("GY")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("iOI")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Wb")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("mm3")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllIllllllllIIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("8q")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIllllllllIIlI](ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIllllllllIIlI+1])ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("DG")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Phh")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("JO")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("yQE")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("XNx3")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("zL")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("hNY")]];elseif ARAScript_lIIIllllIlllllIllIlI>#("FvhGMyZndvr43v8ytofTzHK781FtfoEakSVk3CaWtR2WA5pLb8KmiSc7WkHV2FiY2rUkKXF1osASPYHdL4sgOq1DPYzT4p4YId3ileanES80sur8NEj8l")then local ARAScript_lIlIlIIIIIl;local ARAScript_lllIIlIIIIIII;local ARAScript_lIIIllllIlllllIllIlI;local ARAScript_IlIIIIlllIIllllIlI;local ARAScript_lIIIllIllllllllIIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Vt")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("fOG")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("kl")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("faJ")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllIllllllllIIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("2J9")];ARAScript_IlIIIIlllIIllllIlI=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIllllllllIIlI]for ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_lIIIllIllllllllIIlI+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("GV1W")]do ARAScript_IlIIIIlllIIllllIlI=ARAScript_IlIIIIlllIIllllIlI..ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI];end;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("nv")]]=ARAScript_IlIIIIlllIIllllIlI;ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("9z")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1])ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("j2")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("SYU")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("fQ")];ARAScript_lIIIllIllllllllIIlI=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("UtK")]];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1]=ARAScript_lIIIllIllllllllIIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_lIIIllIllllllllIIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("G0rc")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("AX")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("YfG")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("1F")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIIIllllIlllllIllIlI+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Heq")]))ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Rc")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("gmW")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Ortt")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Np")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ScC")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("QA1Z")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("KN")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("h8D")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("OKpk")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("qv")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Nsx")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("B4I3")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Du")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("hXc")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Q3vm")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("9I")];ARAScript_lIIIllIllllllllIIlI=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("6HY")]];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1]=ARAScript_lIIIllIllllllllIIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_lIIIllIllllllllIIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ibCH")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("28")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1])ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("dt")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("c48")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("pD")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ipd")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("q9")]ARAScript_lllIIlIIIIIII={ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1])};ARAScript_lIlIlIIIIIl=0;for ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_lIIIllllIlllllIllIlI,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("HO0S")]do ARAScript_lIlIlIIIIIl=ARAScript_lIlIlIIIIIl+1;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI]=ARAScript_lllIIlIIIIIII[ARAScript_lIlIlIIIIIl];end ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIllllIlIlllIII=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("TND")];else if(ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("d4")]]<=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("cog8")]])then ARAScript_lIllllIlIlllIII=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("XPM")];else ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;end;end;elseif ARAScript_lIIIllllIlllllIllIlI<=#("kLArGWzV69yLjM4z2G3fN6sbjuGBfBf6NH2rS4JoYSV9CSkQdoMOegynrzhkp8QG3C8NTNQ86Oq5ktKCkZx1ZB1GiP9tWy90cpf9UI6BIORB0Dd8YPaALZRDLC")then if ARAScript_lIIIllllIlllllIllIlI<=#("eNxlIPA35oKSM36skTAPQLbFhyJpnINyrd2XlDiVBKhTn6yHOGGTlXXDL1dkgkPyMmBJaigSLOngErqk9bLRb4mEqzmuz8Pp4UhbGZGFAYhHJQ9sK3leK8vS")then if ARAScript_lIIIllllIlllllIllIlI==#("6rM6VsN88mTkpPjGfqmWP5Kz3VGWLQ6yAbJI4JPFFILEqiunbJERi6tbSmdaX0yrpuVngMLHMSqhtfiVArVclopESH0RGORPktn5yghz77fBPmSMerKGevf")then ARAScript_lIllllIlIlllIII=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("xpZ")];else local ARAScript_lllIIlIIIIIII;local ARAScript_IIlIlIIlIlI;local ARAScript_llIIlIlIIIIIIIlII,ARAScript_IllIlIlIIlIlI;local ARAScript_IlIIIIlllIIllllIlI;local ARAScript_lIIIllllIlllllIllIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("KE")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("0yr")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("rK")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("TAi")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("yVIj")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Kz")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("cSa")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("X2")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("z7r")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("5FRh")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("eDv")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("lM")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("DA")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("4CE")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("s9")];ARAScript_IlIIIIlllIIllllIlI=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("0Ss")]];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1]=ARAScript_IlIIIIlllIIllllIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_IlIIIIlllIIllllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Mrzl")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("xO")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("kxm")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Qy")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIIIllllIlllllIllIlI+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Sb7")]))ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("pt")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("MDq")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("U6ha")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("7m")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ht8")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("O7uW")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("C2")];ARAScript_IlIIIIlllIIllllIlI=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("M3p")]];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1]=ARAScript_IlIIIIlllIIllllIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_IlIIIIlllIIllllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("9TI2")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ER")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("yYL")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Kr")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("371")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("fp")]ARAScript_llIIlIlIIIIIIIlII,ARAScript_IllIlIlIIlIlI=ARAScript_lIlIlIIIIIl(ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1]))ARAScript_lIIIllIllllllllIIlI=ARAScript_IllIlIlIIlIlI+ARAScript_lIIIllllIlllllIllIlI-1 ARAScript_IIlIlIIlIlI=0;for ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_lIIIllllIlllllIllIlI,ARAScript_lIIIllIllllllllIIlI do ARAScript_IIlIlIIlIlI=ARAScript_IIlIlIIlIlI+1;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI]=ARAScript_llIIlIlIIIIIIIlII[ARAScript_IIlIlIIlIlI];end;ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("hd")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIIIllllIlllllIllIlI+1,ARAScript_lIIIllIllllllllIIlI))ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("LY")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("3qP")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("IV")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("hQJ")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("rm")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Ft2")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlIIIIlllIIllllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("aNl")];ARAScript_lllIIlIIIIIII=ARAScript_IlllIlIIIllIlI[ARAScript_IlIIIIlllIIllllIlI]for ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IlIIIIlllIIllllIlI+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("lYJ8")]do ARAScript_lllIIlIIIIIII=ARAScript_lllIIlIIIIIII..ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI];end;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("AM")]]=ARAScript_lllIIlIIIIIII;ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("su")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1])ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIllllIlIlllIII=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("mOU")];end;elseif ARAScript_lIIIllllIlllllIllIlI==#("fqGKW4a8aL6a1myskveojYYFYnMndlKZnm0gLINc6gAeqRU14qvTq11qDbVJrX4YahWPxqSMSbrcyTngDVtW01IxuJNKXeUjlMej5fFNJTaoJZ2UXOfHEi8iJ")then local ARAScript_lIIIllllIlllllIllIlI;local ARAScript_lIlIlIIlllIIlIIl;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("hZ")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("DCy")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("4vlp")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("dU")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("DCe")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Outa")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("F8")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("VsX")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ppPB")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("rS")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("kIV")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ggfr")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("7q")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("XpK")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ABV8")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("rI")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("UsG")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("m6YG")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIlIlIIlllIIlIIl=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("6O")];ARAScript_lIIIllllIlllllIllIlI=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("b2Z")]];ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl+1]=ARAScript_lIIIllllIlllllIllIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl]=ARAScript_lIIIllllIlllllIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("YSAS")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIlIlIIlllIIlIIl=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("dA")]ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl]=ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl](ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl+1])ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Hk")]]=#ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("M9S")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];if(ARAScript_lIIIllIIIlIIllIllIllIIlI[#("be")]<ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("yU2O")]])then ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;else ARAScript_lIllllIlIlllIII=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("nq6")];end;else local ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Vq")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI](ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI+1])end;elseif ARAScript_lIIIllllIlllllIllIlI<=#("tXOhZOqi0WPelxqQmg1sYGR3Xi8nQdN5KFWR9B4v7A8feSCSqX52rpLXgVuQPdDXjUFQLJRWmFvyILYeRq72hUNt48KnfnR47k5umVgRgjQX4npG6q9zgKPAglWM")then if ARAScript_lIIIllllIlllllIllIlI==#("DQ8YBAyPE16jpW8e0zQTerZorXxFGnb8FSNDR9DX10Dzdo1YRuqWf34l1UGOd2ipZ7PIiGx0531oYAld6JYk7p2LXCM7EZU9RnJfJsQl7A1mbQxBJCRFe8sKedU")then ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("E8")]]=ARAScript_IllIlIlIIlIlI(ARAScript_IIIllIIlIllIllIII[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("3TI")]],nil,ARAScript_lIlIlIIlllIIlIIl);else if(ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Wd")]<ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("tNuv")]])then ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;else ARAScript_lIllllIlIlllIII=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Lm4")];end;end;elseif ARAScript_lIIIllllIlllllIllIlI<=#("3Axfi2HL0fEN2NmHyQKhekybip5T59bGJ8rIdVdiiWKD8dMBVVlzEMMSbv737YQ1e8e4uPDNMB9sK5deOE8jXMb6vJGSYkltfTz99RgfsJXcNtigr2pD0HeC6hIWj")then if(ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("hg")]]~=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Tehu")]])then ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;else ARAScript_lIllllIlIlllIII=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Hhm")];end;elseif ARAScript_lIIIllllIlllllIllIlI==#("ZBoPm1Gdf6y30nZ8tcBzA55SEJO7d1it5HUvY7gqKoWsf6Q0M7XGuVu3GHkOmJanXd8tDEkx5kYliMNH3XufeN9jm10rXDdboJFc8xyhWBLk6jU34NUzn4jkdYhMO3")then ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("1q")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("10Y")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("eSrS")];else ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("nu")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("dr0")]];end;elseif ARAScript_lIIIllllIlllllIllIlI<=#("CgX7KhKJHAmsNbYmch6yjSPXtzu8koVE31iejmjWten8bLGioLeFRGATBaNkWMyrPTAW3Ud07kdeEQWS3lTKkqWxBzNjJ89SR6trlUpFHnHHCvpVo5rK2Xgz6cuEg4r9kvyIxEHj")then if ARAScript_lIIIllllIlllllIllIlI<=#("oc6To4fj25NRAZ3Z4uizWyN6Ixg8RyUzhOOVjQRhoto9OrVGESCiyUk0Aak2YhCEkoJWliPoObjCjNrpMLE96MayDYujFZth1UZzT9tvcmFvLSQWS4qnNDIIolsyXGTYScK")then if ARAScript_lIIIllllIlllllIllIlI<=#("Y3HNqi6ThOXUhJBLJfEylqkIQ6JGDQOJip7ZyN7FHYBKyIpnfioMIlnIS86tJAqBaoM1LLn5i91y0KjiQuBtBba6cAgzRN6gI9Kj5zNE5tEJu0RhZYOo8698nQZlEYoFd")then if ARAScript_lIIIllllIlllllIllIlI>#("Z0a9mrS7zhICMlS9K29RhMaL6pJC9he9GJa1gZLvGbI2BVeODFovGvNn0Ad7Tq7rcI6ck12UrNlgeijkk48E2SEj6XbRVONpdqZ2YcDLNFe2jGjRp2WYrDzteWfy0k8N")then ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Ch")]]=#ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("6f4")]];else if(ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("3x")]]==ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ELnr")])then ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;else ARAScript_lIllllIlIlllIII=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("NsU")];end;end;elseif ARAScript_lIIIllllIlllllIllIlI>#("6cYsrxiCy1yOLaANtC31Z7K1FYb6fVDGB2nEvz8GNx4MbQDWPUGTfVk8C6YEumvMz2mTW6r5DyoDd8ZYuoquoTAPRpbzKFkBarnjDUaTDLpSHS5Eh9if5bxPCHcG53u8mX")then ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Ke")]]={};else local ARAScript_lIIIllIllllllllIIlI=ARAScript_IIIllIIlIllIllIII[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("KHH")]];local ARAScript_IIIlIIlIlIlllllIllllII;local ARAScript_lIIIllllIlllllIllIlI={};ARAScript_IIIlIIlIlIlllllIllllII=ARAScript_IIIlIlIIIIllIlIllIlIIlII({},{__index=function(ARAScript_lIllllIlIlllIII,ARAScript_lIIIllIIIlIIllIllIllIIlI)local ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_lIIIllllIlllllIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI];return ARAScript_lIIIllIIIlIIllIllIllIIlI[1][ARAScript_lIIIllIIIlIIllIllIllIIlI[2]];end,__newindex=function(ARAScript_IlllIlIIIllIlI,ARAScript_lIIIllIIIlIIllIllIllIIlI,ARAScript_lIllllIlIlllIII)local ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_lIIIllllIlllllIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI]ARAScript_lIIIllIIIlIIllIllIllIIlI[1][ARAScript_lIIIllIIIlIIllIllIllIIlI[2]]=ARAScript_lIllllIlIlllIII;end;});for ARAScript_lIlIlIIlllIIlIIl=1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("RHYP")]do ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;local ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];if ARAScript_lIIIllIIIlIIllIllIllIIlI[#("U")]==71 then ARAScript_lIIIllllIlllllIllIlI[ARAScript_lIlIlIIlllIIlIIl-1]={ARAScript_IlllIlIIIllIlI,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("MtC")]};else ARAScript_lIIIllllIlllllIllIlI[ARAScript_lIlIlIIlllIIlIIl-1]={ARAScript_IIlIlIIlIlI,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("S40")]};end;ARAScript_llIIlIlIIIIIIIlII[#ARAScript_llIIlIlIIIIIIIlII+1]=ARAScript_lIIIllllIlllllIllIlI;end;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("nH")]]=ARAScript_IllIlIlIIlIlI(ARAScript_lIIIllIllllllllIIlI,ARAScript_IIIlIIlIlIlllllIllllII,ARAScript_lIlIlIIlllIIlIIl);end;elseif ARAScript_lIIIllllIlllllIllIlI<=#("VVQuLoI2OESi8uIrKveF94IS6REYKpqFTpjSBPI1yiTlTzelxLVNhsD0n8z3UUsymnzSlZ05Xng0lv8HNsB8FNxBXsFDpPhOZv8FavaIVZ04lMP192pBsu2K0752uxQigDbZy")then if ARAScript_lIIIllllIlllllIllIlI>#("Gqs3mQXDokOOExzQuEEzPcBhnzjRXTL0DGv8iAhmWyTUoQ2sUAhHv8YE0kQYGgPGKXk8bAI5xqNqtQ3HG06xLdEFR2i7UsQQSnkBG4ru2mkevHjkrisPjs4GsQriqLkdK6Jg")then if not ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("eE")]]then ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;else ARAScript_lIllllIlIlllIII=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ytW")];end;else local ARAScript_lIlIlIIIIIl;local ARAScript_lllIIlIIIIIII;local ARAScript_lIIIllllIlllllIllIlI;local ARAScript_IlIIIIlllIIllllIlI;local ARAScript_lIIIllIllllllllIIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("NH")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Py4")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("TE")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("kVm")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllIllllllllIIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("AXF")];ARAScript_IlIIIIlllIIllllIlI=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIllllllllIIlI]for ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_lIIIllIllllllllIIlI+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("H06e")]do ARAScript_IlIIIIlllIIllllIlI=ARAScript_IlIIIIlllIIllllIlI..ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI];end;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("7G")]]=ARAScript_IlIIIIlllIIllllIlI;ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("9Z")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1])ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Ql")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Y7c")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("zs")];ARAScript_lIIIllIllllllllIIlI=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("DiM")]];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1]=ARAScript_lIIIllIllllllllIIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_lIIIllIllllllllIIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("voBn")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("TJ")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Ks0")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("a1")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIIIllllIlllllIllIlI+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("yVo")]))ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("r3")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("BtV")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Wfzc")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("aI")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ta4")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("iZDa")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Uc")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("z8L")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("fBRP")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("5n")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("uLD")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("XHLE")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("LF")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ZPo")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("WZPU")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("NF")];ARAScript_lIIIllIllllllllIIlI=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("1Jd")]];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1]=ARAScript_lIIIllIllllllllIIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_lIIIllIllllllllIIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("3hdk")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("K3")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1])ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("h4")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("RWt")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("pZ")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Hxy")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIIIllllIlllllIllIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Uu")]ARAScript_lllIIlIIIIIII={ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI](ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllllIlllllIllIlI+1])};ARAScript_lIlIlIIIIIl=0;for ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_lIIIllllIlllllIllIlI,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("0rdW")]do ARAScript_lIlIlIIIIIl=ARAScript_lIlIlIIIIIl+1;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI]=ARAScript_lllIIlIIIIIII[ARAScript_lIlIlIIIIIl];end ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIllllIlIlllIII=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("HdF")];end;elseif ARAScript_lIIIllllIlllllIllIlI<=#("CaMJMFz3AijS8QLaaGAsPhZMidrbhEA8dPZiRgHXFN3IhAs5KcKAjX0uk9BInyV5TlPs0Dt49MYcorESVvCe49ZqYF7RP9Kh17Y6V9egTPBH9Yf3FSX15RbUvyEvGMo9cQkqDH")then if(ARAScript_lIIIllIIIlIIllIllIllIIlI[#("7N")]<ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ylld")]])then ARAScript_lIllllIlIlllIII=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("b2E")];else ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;end;elseif ARAScript_lIIIllllIlllllIllIlI>#("VruvpIrrazel7mSlj6eKyFSLgACEsNZA7VbKLuVlefE7CArXuEbtz6JpKUp0gY8yJOomkiLZk3GrbUiQiOiYMFbalVa0f5fphfyXleMm3liFBrnZLJSCPkVeNnbziUTpYqk5vuE")then local ARAScript_lIllllIlIlllIII=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("HC")];local ARAScript_IIlIIIllllIIIllllIIl=ARAScript_IlllIlIIIllIlI[ARAScript_lIllllIlIlllIII];for ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_lIllllIlIlllIII+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("cX2")]do ARAScript_llIlIIIllIll(ARAScript_IIlIIIllllIIIllllIIl,ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI])end;else local ARAScript_lIllllIlIlllIII=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("A6")]local ARAScript_IIlIIIllllIIIllllIIl,ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_lIlIlIIIIIl(ARAScript_IlllIlIIIllIlI[ARAScript_lIllllIlIlllIII](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIllllIlIlllIII+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("IXP")])))ARAScript_lIIIllIllllllllIIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI+ARAScript_lIllllIlIlllIII-1 local ARAScript_lIIIllIIIlIIllIllIllIIlI=0;for ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII,ARAScript_lIIIllIllllllllIIlI do ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI+1;ARAScript_IlllIlIIIllIlI[ARAScript_lIllllIlIlllIII]=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI];end;end;elseif ARAScript_lIIIllllIlllllIllIlI<=#("c65AvGK3HkoHnNL6utk8dmeiD3RkhsDqeOASovThNh17GmbkPnLckG9Z2X7CZAWoS8CJn2S8Lcu5vgMq1GF4RAfJPK0CzqrmvNoHVC6WGNChkdEVkQKs52Is324OcpKuVhKT2fGAKSye8")then if ARAScript_lIIIllllIlllllIllIlI<=#("zLgerSQ9rEe6O2IsTpchxcEV3fkkSmEEt6EtI881OV0fO5BN1q8ib1KvgulmHFqfaLMSynVVrlDMmzg7OHsCnuCDvhnmXWtjEUfctToOGn00y7jSnnI9lZ1PjjvqaJ7G1thCseO4sP")then if ARAScript_lIIIllllIlllllIllIlI==#("9FMey8F8Jnt7O3A3jy8O7pu8e0SzjKORH31kHe7rFKyrHvDJ3kEHtb8UjN9IqgY9KNBUbpvfARix1dCTxiG9ggyF5hb3ezbyWzS44TINYygN2L2glqlhLZ3Do5Z3oDbbPVLDuIYOL")then if ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("7p")]]then ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;else ARAScript_lIllllIlIlllIII=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("0bS")];end;else local ARAScript_IIlIIIllllIIIllllIIl=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("GFq")];local ARAScript_lIllllIlIlllIII=ARAScript_IlllIlIIIllIlI[ARAScript_IIlIIIllllIIIllllIIl]for ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("1dXA")]do ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII..ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI];end;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("5V")]]=ARAScript_lIllllIlIlllIII;end;elseif ARAScript_lIIIllllIlllllIllIlI<=#("kSaVNtp4SXm4X6FpP93Ozvxe7hazVOCIGSOlCEsFNtUnYV7O7f2ZU6EZu5YFs0jeuOyertXlQybeMjqljxCQVNYKoZ0HPYlWkP2jy3vNrRjv5zmlPMu6zDtS0Y0DEqG2mo46rgYqaYz")then local ARAScript_lIIIllllIlllllIllIlI;local ARAScript_lIlIlIIlllIIlIIl;ARAScript_lIlIlIIlllIIlIIl=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("AX")]ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl]=ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIlIlIIlllIIlIIl+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("pG5")]))ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIlIlIIlllIIlIIl=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("8g")];ARAScript_lIIIllllIlllllIllIlI=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("RIS")]];ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl+1]=ARAScript_lIIIllllIlllllIllIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl]=ARAScript_lIIIllllIlllllIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("girl")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("vA")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Kks")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIlIlIIlllIIlIIl=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("vj")]ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl]=ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIlIlIIlllIIlIIl+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("gvX")]))ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIlIlIIlllIIlIIl=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("aV")];ARAScript_lIIIllllIlllllIllIlI=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("kBR")]];ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl+1]=ARAScript_lIIIllllIlllllIllIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl]=ARAScript_lIIIllllIlllllIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ZO71")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("sa")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("QJR")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIlIlIIlllIIlIIl=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("R8")]ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl]=ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIlIlIIlllIIlIIl+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("gtG")]))ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIlIlIIlllIIlIIl=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("dd")];ARAScript_lIIIllllIlllllIllIlI=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("OP4")]];ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl+1]=ARAScript_lIIIllllIlllllIllIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl]=ARAScript_lIIIllllIlllllIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("7BPN")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("qn")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("WM1")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIlIlIIlllIIlIIl=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("OM")]ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl]=ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIlIlIIlllIIlIIl+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("76g")]))elseif ARAScript_lIIIllllIlllllIllIlI>#("EDO0NP1dDpyRvjtKc3jakqjQEq4JYd5Kdooyja0ZADA60mKhWnohPy3ms7vvUsoztYOg56AcduLR1m0rQXWKZY4PvbelOEegoaMbJEl0YleuXmvfheQ7HOKG38V41oyJpED1LYSmL5WN")then local ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Wl")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIIIllIIIlIIllIllIllIIlI+1,ARAScript_lIIIllIllllllllIIlI))else local ARAScript_lIllllIlIlllIII=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("50")]local ARAScript_lIlIlIIlllIIlIIl={ARAScript_IlllIlIIIllIlI[ARAScript_lIllllIlIlllIII](ARAScript_IlllIlIIIllIlI[ARAScript_lIllllIlIlllIII+1])};local ARAScript_IIlIIIllllIIIllllIIl=0;for ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_lIllllIlIlllIII,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("aWr1")]do ARAScript_IIlIIIllllIIIllllIIl=ARAScript_IIlIIIllllIIIllllIIl+1;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_IIlIIIllllIIIllllIIl];end end;elseif ARAScript_lIIIllllIlllllIllIlI<=#("K2iQ8dKYgKKAfiLSr9JYFesTEFtvDxL26WtfMn2kXVj42BFQhEs6mZoGKAlEUouU8SEtYFfdgzaT4y0daOo8dOPgIYGmczBJBA5k6l1Mzo0YZFLlJhDf9vQucxVa83bS7BsFCQgZWMKZY1r")then if ARAScript_lIIIllllIlllllIllIlI>#("muN45uJeTLiKA1OFmh0ymfT3bNsyV1GlfSXOphWM1oV1IHA57fMQa30gLU2rcks2e6FRd9pfvnG8u2vFnxAQp0kl2QcFoEKQ53WLcS280GuXx2WTzydPVNNoWsYx7U01N0dCfUDGFC0TFx")then ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("AW")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("f05")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Yx5z")]];else local ARAScript_lIIIllllIlllllIllIlI;local ARAScript_lIlIlIIlllIIlIIl;ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ZL")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Ey2")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIlIlIIlllIIlIIl=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Ql")]ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl]=ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIlIlIIlllIIlIIl+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("oVI")]))ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIlIlIIlllIIlIIl=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Lz")];ARAScript_lIIIllllIlllllIllIlI=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Xml")]];ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl+1]=ARAScript_lIIIllllIlllllIllIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl]=ARAScript_lIIIllllIlllllIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("LuIC")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("oP")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ZaB")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIlIlIIlllIIlIIl=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("eo")]ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl]=ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIlIlIIlllIIlIIl+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("bmy")]))ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIlIlIIlllIIlIIl=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("xv")];ARAScript_lIIIllllIlllllIllIlI=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("qqF")]];ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl+1]=ARAScript_lIIIllllIlllllIllIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl]=ARAScript_lIIIllllIlllllIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Tcom")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("VR")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Fr9")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIlIlIIlllIIlIIl=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("HR")]ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl]=ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl](ARAScript_IIIlIIlIlIlllllIllllII(ARAScript_IlllIlIIIllIlI,ARAScript_lIlIlIIlllIIlIIl+1,ARAScript_lIIIllIIIlIIllIllIllIIlI[#("um8")]))ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_lIlIlIIlllIIlIIl=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("uK")];ARAScript_lIIIllllIlllllIllIlI=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("NtA")]];ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl+1]=ARAScript_lIIIllllIlllllIllIlI;ARAScript_IlllIlIIIllIlI[ARAScript_lIlIlIIlllIIlIIl]=ARAScript_lIIIllllIlllllIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("U02Y")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("0f")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Ccq")];end;elseif ARAScript_lIIIllllIlllllIllIlI<=#("a4sg1B55rpHYT3GagPEjHYuOO5IksX3UzDYDON9BS4VlI6TM8BTdbnrlJPD52UNFvXzpfdvDPcCNdjfSl6l1dZSlkM39kdI7qqZVHDG5eqz8VPiAJVU6JVBHfmfEjxsLFEvXuukTBqWXBTAG")then local ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("R2")]ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI]()elseif ARAScript_lIIIllllIlllllIllIlI>#("EBztMzFZsQtybVS7XErtvfoKbFs9NfvWJaQ63r2f07bP0uzFd0OoimhzlZsgfGlntHYafWdFMlDydJUQgY5XBgOx2rUe8V9uVYusGyzrWiN7TUuNeNarKzWn3CiYc9H0miMooCjTzObrERNi6")then ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("D2")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("g0o")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("yy")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("AkQ")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("VP")]]={};ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("xz")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("GTD")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("mtmM")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("yR")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("C9h")]]=ARAScript_lIIIllIIIlIIllIllIllIIlI[#("6HIS")];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("vJ")]]={};ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("sO")]]=ARAScript_lIlIlIIlllIIlIIl[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("2y8")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("vs")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("WuU")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("fV6a")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("zv")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("ovd")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("Tn2Q")]];ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;ARAScript_lIIIllIIIlIIllIllIllIIlI=ARAScript_IIlIIIllllIIIllllIIl[ARAScript_lIllllIlIlllIII];ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("tV")]][ARAScript_lIIIllIIIlIIllIllIllIIlI[#("KS5")]]=ARAScript_IlllIlIIIllIlI[ARAScript_lIIIllIIIlIIllIllIllIIlI[#("EgGv")]];else do return end;end;ARAScript_lIllllIlIlllIII=ARAScript_lIllllIlIlllIII+1;end;end;end;return ARAScript_IllIlIlIIlIlI(ARAScript_llIllIIIl(),{},ARAScript_IIlIllIIlIllIlIllll())();
RAW Paste Data
We use cookies for various purposes including analytics. By continuing to use Pastebin, you agree to our use of cookies as described in the Cookies Policy. OK, I Understand
Top