Ledger Nano X - The secure hardware wallet
SHARE
TWEET

Untitled

a guest Mar 30th, 2020 92 Never
Not a member of Pastebin yet? Sign Up, it unlocks many cool features!
  1. ocal ReeTHub_lllIlIIIIllIIIlIlIlIIllll=string.byte;local ReeTHub_IllIllIIIll=string.char;local ReeTHub_IIlIlIIlIIlllllllI=string.sub;local ReeTHub_IllllIIIIIlIIIIlII=table.concat;local ReeTHub_IllllIllIIIlIIl=table.insert;local ReeTHub_llIllIIIllIIIIlIlIl=math.ldexp;local ReeTHub_lIllIIIIIIllllll=getfenv or function()return _ENV end;local ReeTHub_llIllIII=setmetatable;local ReeTHub_IIIIIIIIIllII=select;local ReeTHub_IlIIllIIlIlllIIllII=unpack or table.unpack;local ReeTHub_lIIIlllIlllIlII=tonumber;local function ReeTHub_lIIIIIlIlIlIIIIIllI(ReeTHub_lllIlIIIIllIIIlIlIlIIllll)local ReeTHub_IIIlIllIlllllI,ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl="","",{}local ReeTHub_IlIIllIIlIlllIIllII=256;local ReeTHub_IIIIIllIIllIllI={}for ReeTHub_IllllIllIIIlIIl=0,ReeTHub_IlIIllIIlIlllIIllII-1 do ReeTHub_IIIIIllIIllIllI[ReeTHub_IllllIllIIIlIIl]=ReeTHub_IllIllIIIll(ReeTHub_IllllIllIIIlIIl)end;local ReeTHub_IllllIllIIIlIIl=1;local function ReeTHub_lllllllIIIIIIlllIIl()local ReeTHub_IIIlIllIlllllI=ReeTHub_lIIIlllIlllIlII(ReeTHub_IIlIlIIlIIlllllllI(ReeTHub_lllIlIIIIllIIIlIlIlIIllll,ReeTHub_IllllIllIIIlIIl,ReeTHub_IllllIllIIIlIIl),36)ReeTHub_IllllIllIIIlIIl=ReeTHub_IllllIllIIIlIIl+1;local ReeTHub_llIlIlllIlIIIlI=ReeTHub_lIIIlllIlllIlII(ReeTHub_IIlIlIIlIIlllllllI(ReeTHub_lllIlIIIIllIIIlIlIlIIllll,ReeTHub_IllllIllIIIlIIl,ReeTHub_IllllIllIIIlIIl+ReeTHub_IIIlIllIlllllI-1),36)ReeTHub_IllllIllIIIlIIl=ReeTHub_IllllIllIIIlIIl+ReeTHub_IIIlIllIlllllI;return ReeTHub_llIlIlllIlIIIlI end;ReeTHub_IIIlIllIlllllI=ReeTHub_IllIllIIIll(ReeTHub_lllllllIIIIIIlllIIl())ReeTHub_IIIllIIllIlIlIllllIl[1]=ReeTHub_IIIlIllIlllllI;while ReeTHub_IllllIllIIIlIIl<#ReeTHub_lllIlIIIIllIIIlIlIlIIllll do local ReeTHub_IllllIllIIIlIIl=ReeTHub_lllllllIIIIIIlllIIl()if ReeTHub_IIIIIllIIllIllI[ReeTHub_IllllIllIIIlIIl]then ReeTHub_llIlIlllIlIIIlI=ReeTHub_IIIIIllIIllIllI[ReeTHub_IllllIllIIIlIIl]else ReeTHub_llIlIlllIlIIIlI=ReeTHub_IIIlIllIlllllI..ReeTHub_IIlIlIIlIIlllllllI(ReeTHub_IIIlIllIlllllI,1,1)end;ReeTHub_IIIIIllIIllIllI[ReeTHub_IlIIllIIlIlllIIllII]=ReeTHub_IIIlIllIlllllI..ReeTHub_IIlIlIIlIIlllllllI(ReeTHub_llIlIlllIlIIIlI,1,1)ReeTHub_IIIllIIllIlIlIllllIl[#ReeTHub_IIIllIIllIlIlIllllIl+1],ReeTHub_IIIlIllIlllllI,ReeTHub_IlIIllIIlIlllIIllII=ReeTHub_llIlIlllIlIIIlI,ReeTHub_llIlIlllIlIIIlI,ReeTHub_IlIIllIIlIlllIIllII+1 end;return table.concat(ReeTHub_IIIllIIllIlIlIllllIl)end;local ReeTHub_lIIIlllIlllIlII=ReeTHub_lIIIIIlIlIlIIIIIllI('25X23Q27523R23Y27523Q25R26G26T26Q26F26G26D26B23R23P27926G26B26P23R23Z27925X26D26S26B26B26G25D26R26N23R23N27925C26S26F26J27I23W27925U26B27226Q25G26R26Q26Q26H26G27P28A28C26Q25M26F26C26B26I23R23K27925Y26F27U26G26Q23R23M27926928627I23V27R26B26S26O29A25X28I28526927I23S27926427B26A28C25G26B26M26F26O26N26H26S29227925F26G26R26J23R23L27R26N26C26I26N26G26929X27525K2962AC23Q25N26F2A923R24627925G26F26D26L26926S26H26R26G26A25H26H26I29V25128U2792AY2B026S2B22A42752682AT26J25W25D25G2792BH25D25I2BH275162BJ23R2402AN2AP2AR2AT2AV26A25U28527C26U28Y27W26D27323Q21Q2481323125Z21Q21425523R23T2AN29V29N26S25X26N27026B25Y26N27228S2BL2BH27728W26H26T26N26Q29U28K28227525V25E26N26J25023Q24U1A25G1P152552242CD2932752CK2CM2CS26U26Y2BK2BL23A2722DP2BH1626A2DT2BH24I2DX2792462BK21T1X22C22H22T25722W2552CS23Q25B2E027525A25I2AG25C28J2912892DJ2AU26S27H25X27F26T2AG28B28D23R2CT2EN23Q2EW26Q2B52B12CU2752F22DK26B2EC24Q2EF25I25Z2BK23H23U23K26E1322E21F2EB2CS25T2EI27Q27525O2AJ26I26C27U26F26L23Q26C24I22O2491O22V2272EB22126H22026X2FL2FN2EC24W2BK25U25K25J1P25E1T21W2CD2782752AI26A24M25H2CY2C42CS24S2BK1X1Y26P21L2GN2GP27525W25I26X25C25K2DG2B327525J2D626C26H26Q23Q1W23C21621L2HC2DG23Q23D22B21O2551Y23Q22F2CD29J27528F26C2A726B24M27Y26J24M2CK26J23Q25X24Q23B2612HY2I02HT1422B25524J22K22A2CD2442AN26I26F29N24M25U26M2AT26P2A92692IB2D62CS22U26H2EF23Q23A2EB21O1N26D23D23F26M2HS2BL22E2702JA24X2EI27K27526726B26T2EC25G2EF162JX23R23U2CG26S2CI2F42B72EC2592JA25F2JY25O2BK26X25W2D81123P26M21L2A32B428Y28I28J23R2F025W27V25U25225324M25Q26R26C2EC24Y2EI23X28M28D25T28526U26U26B26A23O23R23R2I22F128N26625J2A826926G2872902AG25M26B2682912FS23Q26D29V2AU2CZ27M2AG26P2L921B23O2752442D827627924M2CS2M72IT23Q2EY2JR2ME23Q2MF2MB2EY2752MD2MH2MR2MM2ML23Q2DI2CT2MU2MT2M72MO23Q2MQ2M72N423Q2MG27K2D22BH2N52MT27K2N12MQ27K27K2MT29328V2BL2NH2MU2MG2932NE2752932932MT2822N92792NT2NN2752822NQ23Q2NV2NZ23Q28V2NK2BH2822N52MG28V2O22O72O52A42NW27528V2OB2752A42O22A42A42MT2782O82792OQ2O52782O22782782MT27Q2OI23Q2P02O527Q2O227Q27Q2MT2892OT2752PA2O52892O22892892MT2L52P32PK2O52L52O22L52L52MT2K22PD23Q2PT2O52K22O22K22K22MT2982P32Q32O52982O22982982MT29J2MW2792QC2O529J2O229J29J2MT2CF2P32QM2O52CF2GR2N22752CF2CF27Q2AM2OU23Q2CF2MG2CF2L52MP2QV2R123Q2892MQ2QW23Q2K22QZ2752892CF2522MB29829J2QZ2EY2B92N62R72RF2RB2R82472RQ23Q2AM2MG2RW2RV2RZ2MG2IT2452CS2R22MU2RN2R82RI2MB24223Q24323Q2RJ2MR2BQ2412RW2CF24F2MC2R72CF2MF2M72AM2SK2M825M23Q2RV2SU2RW2IT24C2792MG2S52SZ2792CF2S52SS2MB24E2R82R323Q2SN2R62SA2O52ST2T32752RV24A2TL2RQ2SZ2T423Q24B2S623Q2T92RX2MB24D2R82QZ2M72ON2SL2TY2TH2RC2S12752AM2482TP2RV2492TP2IT2MQ2BH2S72TA2MU2RC2SH2M72SJ2U52TG2QU2TI2MT2AM24N2UD23Q2TR2M82UZ2TP2T52TV2TX2U223Q2TC2S72R82US2RT2SQ2RW2TK2V12SX23Q24K2UG2V22VH2S524L2V52S82752M72U02VA2R42SO2TI24I2UT2RC24J2U62M72VZ2SB2MU24G23Q24H2U52RS2SP2VI2MG2VG2S02VM2T02WI2T72RQ2UL2M724U2R82UO23Q24V23Q24S2U627K2U42TE2WC2TI2U92TY24T2UY2X42VH2IT2X62UJ2WM2WW2TI2SH27K2UQ2TE2VC2WD2UV2WI2MG2SY2VL24Q2V32WK2R72V627527K2V92UR2VX2RC2XK2V02VI24R2VL2Y12VO2VQ2UL27K2VU2U52R52W02R82VZ2VD23Q2W22QZ27K2W52SG25323Q27K2W824O2N625S2U12XY2RU2VF2XL2TM2YY2TQ2TV2IT2Y82D92WQ2XU2WS2WU2U62932WY2RR2YV2CF2X22UB2UY2UF2X72UT2XA2Z32ZA2XD2NR23Q2XG2R72XI2UU2YX24P2UY2Y12IT2SH2RW2V42BL2T82VR2MV2V82TD2ZT2ZE2TJ2Z02RV2YN2ZK2Y523Q2VP31042TW31062932YA2TE2YC2YG2YF2WD2YI2ZQ2YL2SH2932W82WA2WZ310B2ZG310D2Z02IT2T62R72ZN2QZ2932WP2W62932WT2WV2QZ2822ZC2YU2U72YW2WF23Q2X92XM311O2VL2X92WL31192O02ZP2O32ZR2V22XH310B2Y02ZY2VL2MA31022XR2R82XT311Y2XW3121311L2VE311N2Y12RV2Y3310G2XQ310J2XA312A282310O2R7310Q2WD310S2TI310U311Y310W311W2W82512WB31122YX312H2XL2MM2T62XP2UK2U6282311C2SG311W2WT24Y2U628V311J2CF2X02U82YX2UC2VH2UE2VL2UI311U310628V2UN2OJ311Z2SK312D2YD312F2UA23Q2ZX313Q311523Q24Z2XQ31173129313V31082VV2TF312231342UY310F2WJ310H312M2WL312A28V312Q2R8312S2VY31422YH313I23Q312Y2O623Q310Z3132312E2WE314431352ZZ3128313A2QZ28V313D2SH28V311F2U62OP2MR311131553113311P2YZ315O2RQ311T311831062A4313X23Q2A42ZS2VB314I312G31242ZK24W314B2Y7315I314F2XX315531233147312J314M312L31672QZ2A4314S2VW3155312U2W1316831502A42W824X3154314W311331582Y42Z2315U2Z52W62A4313G2U62782WY26G311K2N22YL2ZF313O2ZI313S316Z2UL278315W278315Z2SM3161314431462WH315925A3166310K312A278312C310A316B314J3147314L2S32Z02Y6317U3106278316K2PX310B316N2R8312W27831502783153315L316V3180317Q316Y310K311V2P43171313E318Q315H2QZ27Q313K2U6318K311N315Q2RV315Q2X8317G2U627Q315W27Q317L314H317Z31623147315925B317T312N310627Q317X3160319C31572UY316E3183314N316H2PE23Q3189314U2RC318C2CF312W27Q315027Q2W8258316U2YG316W3163316F318O319J318R2SH27Q31742QZ289318X313M311M3144313P2WH2ZJ2WJ313T2MD315B26I2R9311X289319A2ZU2XZ2ZW31AA3183259319H314P3106289319L317M319N2TY313531822V1319S31862UL289319W318B314W312W2893150289318I2ZD315M318L311Q3159314C315B2RG31AE31C0318U2752L531AK313331902X5311S31952QZ2L5315W2L531AZ317N31BD31B32V125631B62XS31062L531BA319B314W316C2WH319Q31BG316G31BI2U62L531BL316M31BN31CZ314Z2Z6318A2W825731A72WD31A9319E318N2ZM31CO31C1318A31AH2752K231C631BU311N31AO311Q31AQ3183313T315T2UL2K2315W2K231CG319C2TA317P2442UX2XN2ZK31CL2VN315A310L31DV316931412YG31CT311Q31BF2Z131E8314O31CN31EB31D1314W319Z314X2QZ2K231502K231BS317931A831BV2YZ31BX31CB31DK31DH2K231C323Q2982RP318J31EX311N2542UY31FC2ZK31FE31DF2UL298315W2982SD2EB2SH29831DZ31CS31EY2VI31592DT2TS31BY31EA2U629831CQ31B02R831EF2YZ25J31DE2TS2BG31CY2QZ2982YA2SH29J29825H2U629J2A429831F931DB2YX25E2UY31GP2ZK25F31F123Q29J2RC31GM2X12YX25D2UY25Q2VL25R31GU29J25C31D629J31FQ31EE31FS31E52WJ25O31CM314D2UL29J31G131CH2WG2442YR2RV31G6312K31E82VK31GA27529J31EN310R314W25P31GI31D52W629J2W82SW2443178313L2MC2TO313N31FB31FD2VL31FG313U31HJ31DH29J2WT25N318S29J25K23Q25L2YB310B25Y2N22FA2RC25Z2RX26931GV23Q31IV2CF23K2Y32CF2MN2752652792M72M8314A2AM25W2VX2AM2AM2742792RV31J82BH2AM2N52E12MR2EY31J62TY2EY31JX31JA2NX2T3314A2RV31JH2TH2RV2RV31JL2V12RF31JM2MY2BH2RV31JY31JV2RV2N02MR23Q31JB2ZQ31JE2RQ31K42UT2IT2IT31K8310L2RV2BL2ZN31JD2V131KF2Y32IT2ND31KJ31KL315131KN2S531KP2MQ2S52S531KT2SD2RZ2792TX31KY310L31L0310L2NP31L42792O8244314A2SD31L92752SD2SD31KT2SF2S52BL2SD31JR31LU31JT2O62Y32SD2O131LN2752QT31LQ2SE23Q31LT31MD2SF31KT2BQ2SD2BL2SF31M231MD31LK2SF2OD31M9318Q31KN2BQ31MF2BQ2BQ31KT2SK2SF2BL2BQ31MN2BQ31LK2BQ2U42MO31L52F031MC2SK31MF2SK2SK31KT2TC2BQ2BL2SK31MN2SK31LK2SK2OX31MS31NB314A2TC31MF2TC2TC31KT2SN314C2TC31MN2TC31LK2TC2P731MS2K231KN2SN31MF2SN2SN31KT2T22TC2BL2SN31MN2SN31LK2SN2PH31O731K123Q2T231MF2T22T231KT2U02US2792T231MN2T231LK2T22PQ31MS2LH31MC2U031MF2U02U031KT2TO2T22BL2U031MN2U031LK2U02Q031MS2BH31MC2TO31MF2TO2TO31KT2TU2U02BL2TO31MN2TO31JY2R82MB2QG31LO2792F627A27C27E27G27I2MJ27M27O2YC25M26H26D26F26I27S26S26N26U2912O828X28Z2912RF25N2AU26T26B28F28H28J25325E26H26P28K2RP2AY26G27M26D26Q2YC2442MJ2O22NA2RW2MI2MK2EC2VS2MU2MQ2N129331RO2MR28231RR31JU2ML317S2MJ279313131RJ2MO31JO2N131KJ315X31Q52MW2952872KR27925D26B26Q25X29A29T27H2KM27525Y2IV27329A2EU31QF31QH31QJ31SM26F31SO29W2LW31SU31SW27Y2802LW31QL27V27X27Z31SK23Q25E2JU26Q2AT27331NB31IN31Q22ZL31JC2RW2M731RY31RH2M731DT310731TP31RT2CS28V31TP2RP31TJ31S431TH2BL2O831Q627B27D27F31SJ31QC27N2HF2IE27T31QN31QP28W2C12LQ31KV2AH31QW31QY28G28I26G25325H2A82AQ31T831R831RA26Q31O82N631RF2VX31RH2MG31RJ2BL31LI2MK31TO31TH31RQ31J931TS31M42O72Y331UY31N931RL31S02YO31KJ31S32MX27531NJ2MH31QQ31UF31QT2BR2AQ2AS2AU2AW2K62B22O831VX31T82BB26H2BD2BF2CS2DV2JA2DZ2EC2E22AG31S928831SC31SE31SG29B26N31SJ31UW25U26P31T531WH31SI27I31VZ2FY26Q27I2LW31WM31T527B26826H27J27L27N23Q26831X631X722O2DH29Y2A02A22YC25F26F2CX2AA29E27326I27I2N925H2L031WJ2CE29Y31XG2J32D527U31RB2D031X227525L28G31RL2EC2J82EI2MW31SZ25T2BH31GT2CS31TP2EY31TP2MT31V22UT31JY2932MG2M72N92N731L62RW2ZB2CS2EY2NY2OT31PL31YT2LW31PL23M2LW2XP2EY31I82792QT24M31LZ27927Q31YL31AW2EC2N531TP2YC2MU2BH2N32MU31Z32Z731UW2NF31VI31GL2ZQ31P6311W31JO2MQ2O42AM31ZV311Y2X2313W2VX2OF2UH313Y28V2S52MG2A431MK2BH2QT2VH27Q320A27927K2PF31K02MB2MG2822MJ31ZY28231YK313Y320A320831MD2VH278320F311W2P5311A2MU2P32NY31RR31VM2MX31KI31Z02792YT2MO2ID31YC2602BL31YE2MK31V131VI2TH31YJ31TK23Q320S2Z731N131YQ321N31YS31072M72OT321A2MR3218275321X31Z431MA2MC31Z8319U31ZB2F031V331RN2CS31ZG31V431ZJ31KI31YO31ZN2Z727K31ZQ310731ZS311Y31ZU311W28231ZX322P31563151322O315128V3204322W310L320T320X31MT2TP320E2CS320H31ZH31KM315K311W320N322S320Q315131YN2OM31YP2MG31762CS282320Z2ZQ31YM2CS321331TH31VN2MS31VJ31Q531RL31U12QT31U331Q931U631X327O2O831QL31UC31U931QR27W29131UH31QV26R31QX31QZ31UM31UO31UQ26L31US28J31UU31RD31UY2TH31V02MB31TM323831ZD322A31S531V831M431VA31KF31RW321J2BH31VH31L331Q131S5324X31Q52F02B02IW27D31QM2AA31WC2AF2RP25Q28H26U31SD2912UX27526M325L26T25824P24P2C027D26B26C2A924O2LY26J24P28526P24P25S25C26B25M25324Z25B2732LW24431HR31S5321I31KY31RU31VI31YO2QF2ZQ31TY321Y31Y3324U31J9321F323X31Q5323Z31Q831U531QB324331U9324631QO324831VQ23R324C31UJ324G31R131UP31WJ324K31R7324M26B31RB31UW31RE323W324Q31TJ321I324T31V4322931V63259326N32502MR31VC325331Q031L52BL3255323V31TZ2N131VN327831QS2AL31VS2BT31VV2AX2AZ2F531VZ328H2B731W12BC2BE31G92DU2DW2EC31W92CS31WB31S82AF2F0325N31WP31WJ27I31WL31WN27W329031SJ31WS26B26F31WU28L2F7329426G31WZ31X131U726P31X531X731X631X92AG29Z2A123R31XE31XT31XI26Q31XK31XM2B431XP26D31XR27531XF31XH26931XV327K2CZ2KQ2MJ31Y12HL326U2BH31Y52AG31Y831YA2EC31YD31TI31RM327R2VX321L31ZB323G31VI31LP2ZQ31TW2MB31YU2BH31YW2MV31YY321Y31Z1315K317832232MP322523Q31ZA31RM322831TN32AL318A31TJ31ZI31RM322F31ZM2VX2NG31F6321R322M282322V31ZW2UT2O4320032572MQ32032UT2OF3207323H3232320C2RW32352NL32B9324U2MW31ZL311Y323C311Y320P2RW28V321O31S6321Q323J321S2BL323M310M3211323Q324W3288321632B2321931KJ321C2BL24M321E2MX31YF31RI3253326N323E2M732CI27K32CK2ZQ323231YT2MU321W31M4321Z23Q322132B5323331Z72BL32BA2MU32BC31TJ327V2BH322C32CZ32BI323A31VI322H31VI322J32BO2TP32BQ2VX32BS320O322T32012TH32BY32BX315132C131S632C331KW319U3232323731LI32CA2RW320M32E6311Y323E28V32AR2A432AT318Q32AV311Y323N321U311Y2BL323R31S5323T2EY31KI3257326S313Y276327031U431QA31XZ23Q31QD327531UB327731VP328B327B324E31UK31R031UN327F31UR327I31R932A7324O327O32BE31YG325332BG31RL31ZE31V731YI31RS32G731RV23O31RX2CS328531S232FZ3259276325B26H325D31TC2J3325H31SA325J325L325N23R325P23Q325R26Q26U325T325V325X31WU326026G326231W3326526F326726J25T24Y25S26T26L25Q25Q326H326J2N1326L32AO2MR27K326P32CR326S32DE31Y3327T31Q031VL31TT326Z2793240327232FG32FI324532FK31UD31SL327932FO324F31UL327E324J324L32FW327L2T3324P32G032D4327S326U32G5327W31V932G9322W31VD323W31VF2EC32GE2R73287279328932FM324A328C2I32BS31VU2BV31W0328J2B62B827931W231W4328P27931W7328S2JA328V294328X31WF31SF31SH32912K128A329E329631WR2B431WT31WV32JS31WY26G31X032I231X4329L329M31XA32A231XC329R31XS32A431XJ31XL281329Y326032A031JO32A331XU26N31XW32A828K32AA31Y232AD27932AF31Y731SN2YT32JC32AJ321T32D332AN321K326T32AQ2TP27K32EW31YR326X32AX2792X431YJ2LW32LD2N632DL31Z632B832DP2M732DR32DX31ZF31RH32BH31KC32CB27K32E032BM322K29332BP32BW322S322R32CE32E932M0322Z322Y32C02RW32092CS32C42MG32C62BH32EL2BH32EN320L32D5323D32CG32CM32M9320U2RW320W323L318Q2UL2NY321232CS32IZ32CU31YX27925V32CX32AJ32D1323W32L1324S32HM32DE31ZB32D932MP2NO32MN323W32LB2D332DH2LW32N231Z332LI322432DO321M32LN31KC32LP32G32TH2N532LT2RD32BL31ZP32E32VH32E52TH32E7322S32BV322V32EC3205323032C232MB32EI32C832EK32C832EM323W32MJ32CD2O432ES32F232MO32EW323K32CN32MT2ZO323P32F332MX3215323W32F831VK2EC323Y32HZ327132FF329I32FJ31QM32FL31UE32FN279324D32IA32FR324I327G32IE324N32IH32FZ32N732HN31RK32G432OX31TQ32IP326N2OK32GC328432PO32GF32IY323931SB275325C26A325E32GN328W32GP279325K32GX32GS32GU32GW32GY325U325W31XG32H23261326332H7326726U25A25N26C25Q26B26J25Y32HI32FZ32HL32L331RJ32HP32OW32HR310732HT321T32R432P232HY27532I032P6327432I432P932I631J332I832PD327C32IB32FS32ID32FV31UU327M32II32PN31YH32NU31V532G72ZQ327X32IQ328031VE31JZ32IV32PY32IX325832CT27632J12LQ2RF2AO31VT2BU31VW328K31VY2B432SH328M31W3328O31W6328R2CS328T2BL32JK27531WD32Q223Q328Z32JP31WK32JZ329532SZ32JV27525H32JX329C2F1329E329G32K3329J32K5268329N2MW329P31XD32KB2J332KD329X32T5329Z32A123Q32KK2AA32A631XX32A927932AB32KS32KT2J932AG31SN26632AI31YC32L0321H32N832R0310732L52VH32L72TP32L92MX32NH32NY32LE27931YZ32B332NM31Z532NO2BH32LL31ZC32RW32NT31RM32LR32NW2RW32LU32NZ32E232NE32LZ32BR311Y32M232BU32MM32O8315132M732EE32MO32EH31PN32EJ323632OH32MH32OJ323B32EQ32CF2OC32MN320T32DB318Q323232CO32MU32CQ32OW327V32S82MB32172LW31Y9321B32AJ31IZ32D232U832PO32UA32D732VQ321P32UF32NF32AW32DF2BH317S32UK2EG32CV27532W432LH32UP32B732NP322732PQ32DT27932DV32UX31ZK32UZ32NY2TH32LW32O132EO32M532O532M332O7320232VB32BZ32VD323132OD32VG32OF32VI320I32Q132X632OL32ER32MM32EU323I322332EY32VV32OU32OO31K032VZ32MY32OZ328632582BH32P332RB32P5324227532I327R32I5328A32J232I932FQ324H32FT327H32SJ32IF31RC32PL31TH32RT32G232UW32WV32RX32PS324Z32S03252324T32IW32F932HW32CA32GJ32GL325F2AB32Q827I32GQ32QC31SE32GT27932QF32GZ32QI325Y32H332H53264326624P26724X26F25C25J25X25026J32QX31TH32QZ32IQ32HO2Z7326Q310732R4330032LQ2MX32R832HX32FC32P432FE32Y732FH31U832RF324732SA324B32RK32FP327D32RN32PI32RP32A732RR32PM32W932RU32YQ324V32XY32RY32PT31J932S132IT32S332GD32S532YZ32FZ32J032PB32J232SC32J532SF328G32JA31U931W02RP32JD32SN2BL32JH32SQ32JJ31Y632JL31SA328Y31WG32T332JR329D31WO331S3298329A32JY331U27W32TB329I329K329L32TG31XB329Q329S32KC329V32KE31XN32TP32KJ329T32A532KM32A731XY32KQ32AC32TZ32KU28W32U332U532DW326X32YO32CD32AP31RM32AR32UE2VH32UG32NG32WI32UL32NJ333432N027531Z232WQ32B62N232LK32NQ32YR32UV326V322E32DY32V032X332O032V332E432X732V632BT31ZZ32V932XB322X32XD320632VE32XG323432WG31VI32XK32R532DY32EP32O432XO32VP32CI2A432VS32MR32OS32F032MV32CR330V311Z32Y0333723Q32WP23Q32CY31ZI32W732N6330R32MK32DH321M32NC32VS29332DD32F12OT32WK32WN23Q335332DI32WP322232DM333D32WU330U32BE32WY2VX32UY322G32V132BN333N32O2333P322Q333R28232XA32EB32XC32ED333X32XF2BL32MC32VH32C7334332MI32VM334732VO313Y32XQ32OQ31S6334E32CP32OV32VK334I32F632X0331433072MH32FD3241327332Y8330D32YA32RG32YC31UG330I32PF32YG32RO32YJ32PK2M832RS334T32IL32R6334I324Y31JY327Y32GA32PW3254331332P132G632GI27932Q432Q6325G32Z631T832QB325M32ZA31GR32GV325S32QH26T273325Y26J24R28C26H26A324E32ZI24P26T32I526T24P2A72IW31SE2J031R42J324P25G2IV29N2IZ2J12J324O26I26R26F24J25025032ZU326K32W132N9326O32ZZ32HQ321T330332RV31M4326X2EC2QT31U232Y6336M330C31QE27931QG31QI31QK32YB2N126C336R2912MW2AI2AK32YE330K32PH32FU336X32A72RF24426N330Q322932L23304335D3214311Y32RZ33A2330Y32D42MW33A0337731S6326N2P0337931RZ337B32GG2N131KY2LF279339G2RP25S26N2CX2I631LP26732QY326W32IQ31LI32HV31KA32F832HW2BL298330832Y5330A339732FI31SR339C3276291339F339H2AG339K28K2N133972JT2EU33AL33AN2A631XL2N02MW26P2AJ2HL22322233BU33BU23E2552LE31PV2N62RP31RG327Q32U9339Y32UU31TH33A833C932YV321I33A633C832IQ33CA33AA32D431F832WH2752SH2EY27Q289321I2RP33CM32C833CP2MB31RD31RM31UW334K33A527933CS27Q322K2RO33D12MB33D3321T2EC');local ReeTHub_IllllIllIIIlIIl=bit32 or require('bit');local ReeTHub_IIIIIllIIllIllI=ReeTHub_IllllIllIIIlIIl and ReeTHub_IllllIllIIIlIIl.bxor or function(ReeTHub_IllllIllIIIlIIl,ReeTHub_IIIlIllIlllllI)local ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIIIllIIllIllI=1,0 while ReeTHub_IllllIllIIIlIIl>0 and ReeTHub_IIIlIllIlllllI>0 do local ReeTHub_IIlIlIIlIIlllllllI,ReeTHub_IlIIllIIlIlllIIllII=ReeTHub_IllllIllIIIlIIl%2,ReeTHub_IIIlIllIlllllI%2 if ReeTHub_IIlIlIIlIIlllllllI~=ReeTHub_IlIIllIIlIlllIIllII then ReeTHub_IIIIIllIIllIllI=ReeTHub_IIIIIllIIllIllI+ReeTHub_llIlIlllIlIIIlI end ReeTHub_IllllIllIIIlIIl,ReeTHub_IIIlIllIlllllI,ReeTHub_llIlIlllIlIIIlI=(ReeTHub_IllllIllIIIlIIl-ReeTHub_IIlIlIIlIIlllllllI)/2,(ReeTHub_IIIlIllIlllllI-ReeTHub_IlIIllIIlIlllIIllII)/2,ReeTHub_llIlIlllIlIIIlI*2 end if ReeTHub_IllllIllIIIlIIl<ReeTHub_IIIlIllIlllllI then ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIlIllIlllllI end while ReeTHub_IllllIllIIIlIIl>0 do local ReeTHub_IIIlIllIlllllI=ReeTHub_IllllIllIIIlIIl%2 if ReeTHub_IIIlIllIlllllI>0 then ReeTHub_IIIIIllIIllIllI=ReeTHub_IIIIIllIIllIllI+ReeTHub_llIlIlllIlIIIlI end ReeTHub_IllllIllIIIlIIl,ReeTHub_llIlIlllIlIIIlI=(ReeTHub_IllllIllIIIlIIl-ReeTHub_IIIlIllIlllllI)/2,ReeTHub_llIlIlllIlIIIlI*2 end return ReeTHub_IIIIIllIIllIllI end local function ReeTHub_llIlIlllIlIIIlI(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IllllIllIIIlIIl,ReeTHub_IIIlIllIlllllI)if ReeTHub_IIIlIllIlllllI then local ReeTHub_IllllIllIIIlIIl=(ReeTHub_llIlIlllIlIIIlI/2^(ReeTHub_IllllIllIIIlIIl-1))%2^((ReeTHub_IIIlIllIlllllI-1)-(ReeTHub_IllllIllIIIlIIl-1)+1);return ReeTHub_IllllIllIIIlIIl-ReeTHub_IllllIllIIIlIIl%1;else local ReeTHub_IllllIllIIIlIIl=2^(ReeTHub_IllllIllIIIlIIl-1);return(ReeTHub_llIlIlllIlIIIlI%(ReeTHub_IllllIllIIIlIIl+ReeTHub_IllllIllIIIlIIl)>=ReeTHub_IllllIllIIIlIIl)and 1 or 0;end;end;local ReeTHub_IllllIllIIIlIIl=1;local function ReeTHub_IIIlIllIlllllI()local ReeTHub_IlIIllIIlIlllIIllII,ReeTHub_IIlIlIIlIIlllllllI,ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIlIllIlllllI=ReeTHub_lllIlIIIIllIIIlIlIlIIllll(ReeTHub_lIIIlllIlllIlII,ReeTHub_IllllIllIIIlIIl,ReeTHub_IllllIllIIIlIIl+3);ReeTHub_IlIIllIIlIlllIIllII=ReeTHub_IIIIIllIIllIllI(ReeTHub_IlIIllIIlIlllIIllII,134)ReeTHub_IIlIlIIlIIlllllllI=ReeTHub_IIIIIllIIllIllI(ReeTHub_IIlIlIIlIIlllllllI,134)ReeTHub_llIlIlllIlIIIlI=ReeTHub_IIIIIllIIllIllI(ReeTHub_llIlIlllIlIIIlI,134)ReeTHub_IIIlIllIlllllI=ReeTHub_IIIIIllIIllIllI(ReeTHub_IIIlIllIlllllI,134)ReeTHub_IllllIllIIIlIIl=ReeTHub_IllllIllIIIlIIl+4;return(ReeTHub_IIIlIllIlllllI*16777216)+(ReeTHub_llIlIlllIlIIIlI*65536)+(ReeTHub_IIlIlIIlIIlllllllI*256)+ReeTHub_IlIIllIIlIlllIIllII;end;local function ReeTHub_lllllllIIIIIIlllIIl()local ReeTHub_IIIlIllIlllllI=ReeTHub_IIIIIllIIllIllI(ReeTHub_lllIlIIIIllIIIlIlIlIIllll(ReeTHub_lIIIlllIlllIlII,ReeTHub_IllllIllIIIlIIl,ReeTHub_IllllIllIIIlIIl),134);ReeTHub_IllllIllIIIlIIl=ReeTHub_IllllIllIIIlIIl+1;return ReeTHub_IIIlIllIlllllI;end;local function ReeTHub_IIIllIIllIlIlIllllIl()local ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIlIllIlllllI=ReeTHub_lllIlIIIIllIIIlIlIlIIllll(ReeTHub_lIIIlllIlllIlII,ReeTHub_IllllIllIIIlIIl,ReeTHub_IllllIllIIIlIIl+2);ReeTHub_llIlIlllIlIIIlI=ReeTHub_IIIIIllIIllIllI(ReeTHub_llIlIlllIlIIIlI,134)ReeTHub_IIIlIllIlllllI=ReeTHub_IIIIIllIIllIllI(ReeTHub_IIIlIllIlllllI,134)ReeTHub_IllllIllIIIlIIl=ReeTHub_IllllIllIIIlIIl+2;return(ReeTHub_IIIlIllIlllllI*256)+ReeTHub_llIlIlllIlIIIlI;end;local function ReeTHub_lllIIIIlIllIIIIII()local ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIlIllIlllllI();local ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI();local ReeTHub_IIlIlIIlIIlllllllI=1;local ReeTHub_IIIIIllIIllIllI=(ReeTHub_llIlIlllIlIIIlI(ReeTHub_IIIlIllIlllllI,1,20)*(2^32))+ReeTHub_IllllIllIIIlIIl;local ReeTHub_IllllIllIIIlIIl=ReeTHub_llIlIlllIlIIIlI(ReeTHub_IIIlIllIlllllI,21,31);local ReeTHub_IIIlIllIlllllI=((-1)^ReeTHub_llIlIlllIlIIIlI(ReeTHub_IIIlIllIlllllI,32));if(ReeTHub_IllllIllIIIlIIl==0)then if(ReeTHub_IIIIIllIIllIllI==0)then return ReeTHub_IIIlIllIlllllI*0;else ReeTHub_IllllIllIIIlIIl=1;ReeTHub_IIlIlIIlIIlllllllI=0;end;elseif(ReeTHub_IllllIllIIIlIIl==2047)then return(ReeTHub_IIIIIllIIllIllI==0)and(ReeTHub_IIIlIllIlllllI*(1/0))or(ReeTHub_IIIlIllIlllllI*(0/0));end;return ReeTHub_llIllIIIllIIIIlIlIl(ReeTHub_IIIlIllIlllllI,ReeTHub_IllllIllIIIlIIl-1023)*(ReeTHub_IIlIlIIlIIlllllllI+(ReeTHub_IIIIIllIIllIllI/(2^52)));end;local ReeTHub_lIIIIIlIlIlIIIIIllI=ReeTHub_IIIlIllIlllllI;local function ReeTHub_llIllIIIllIIIIlIlIl(ReeTHub_IIIlIllIlllllI)local ReeTHub_llIlIlllIlIIIlI;if(not ReeTHub_IIIlIllIlllllI)then ReeTHub_IIIlIllIlllllI=ReeTHub_lIIIIIlIlIlIIIIIllI();if(ReeTHub_IIIlIllIlllllI==0)then return'';end;end;ReeTHub_llIlIlllIlIIIlI=ReeTHub_IIlIlIIlIIlllllllI(ReeTHub_lIIIlllIlllIlII,ReeTHub_IllllIllIIIlIIl,ReeTHub_IllllIllIIIlIIl+ReeTHub_IIIlIllIlllllI-1);ReeTHub_IllllIllIIIlIIl=ReeTHub_IllllIllIIIlIIl+ReeTHub_IIIlIllIlllllI;local ReeTHub_IIIlIllIlllllI={}for ReeTHub_IllllIllIIIlIIl=1,#ReeTHub_llIlIlllIlIIIlI do ReeTHub_IIIlIllIlllllI[ReeTHub_IllllIllIIIlIIl]=ReeTHub_IllIllIIIll(ReeTHub_IIIIIllIIllIllI(ReeTHub_lllIlIIIIllIIIlIlIlIIllll(ReeTHub_IIlIlIIlIIlllllllI(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IllllIllIIIlIIl,ReeTHub_IllllIllIIIlIIl)),134))end return ReeTHub_IllllIIIIIlIIIIlII(ReeTHub_IIIlIllIlllllI);end;local ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIlIllIlllllI;local function ReeTHub_lIllIIIll(...)return{...},ReeTHub_IIIIIIIIIllII('#',...)end local function ReeTHub_lIIIIIlIlIlIIIIIllI()local ReeTHub_lIIIlllIlllIlII={};local ReeTHub_IllIllIIIll={};local ReeTHub_IllllIllIIIlIIl={};local ReeTHub_lllIlIIIIllIIIlIlIlIIllll={ReeTHub_lIIIlllIlllIlII,ReeTHub_IllIllIIIll,nil,ReeTHub_IllllIllIIIlIIl};local ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIlIllIlllllI()local ReeTHub_IIIIIllIIllIllI={}for ReeTHub_llIlIlllIlIIIlI=1,ReeTHub_IllllIllIIIlIIl do local ReeTHub_IIIlIllIlllllI=ReeTHub_lllllllIIIIIIlllIIl();local ReeTHub_IllllIllIIIlIIl;if(ReeTHub_IIIlIllIlllllI==2)then ReeTHub_IllllIllIIIlIIl=(ReeTHub_lllllllIIIIIIlllIIl()~=0);elseif(ReeTHub_IIIlIllIlllllI==0)then ReeTHub_IllllIllIIIlIIl=ReeTHub_lllIIIIlIllIIIIII();elseif(ReeTHub_IIIlIllIlllllI==1)then ReeTHub_IllllIllIIIlIIl=ReeTHub_llIllIIIllIIIIlIlIl();end;ReeTHub_IIIIIllIIllIllI[ReeTHub_llIlIlllIlIIIlI]=ReeTHub_IllllIllIIIlIIl;end;for ReeTHub_lllIlIIIIllIIIlIlIlIIllll=1,ReeTHub_IIIlIllIlllllI()do local ReeTHub_IllllIllIIIlIIl=ReeTHub_lllllllIIIIIIlllIIl();if(ReeTHub_llIlIlllIlIIIlI(ReeTHub_IllllIllIIIlIIl,1,1)==0)then local ReeTHub_IIlIlIIlIIlllllllI=ReeTHub_llIlIlllIlIIIlI(ReeTHub_IllllIllIIIlIIl,2,3);local ReeTHub_IlIIllIIlIlllIIllII=ReeTHub_llIlIlllIlIIIlI(ReeTHub_IllllIllIIIlIIl,4,6);local ReeTHub_IllllIllIIIlIIl={ReeTHub_IIIllIIllIlIlIllllIl(),ReeTHub_IIIllIIllIlIlIllllIl(),nil,nil};if(ReeTHub_IIlIlIIlIIlllllllI==0)then ReeTHub_IllllIllIIIlIIl[#("eiE")]=ReeTHub_IIIllIIllIlIlIllllIl();ReeTHub_IllllIllIIIlIIl[#("mLmG")]=ReeTHub_IIIllIIllIlIlIllllIl();elseif(ReeTHub_IIlIlIIlIIlllllllI==1)then ReeTHub_IllllIllIIIlIIl[#("Il0")]=ReeTHub_IIIlIllIlllllI();elseif(ReeTHub_IIlIlIIlIIlllllllI==2)then ReeTHub_IllllIllIIIlIIl[#("l00")]=ReeTHub_IIIlIllIlllllI()-(2^16)elseif(ReeTHub_IIlIlIIlIIlllllllI==3)then ReeTHub_IllllIllIIIlIIl[#("0za")]=ReeTHub_IIIlIllIlllllI()-(2^16)ReeTHub_IllllIllIIIlIIl[#("RYXg")]=ReeTHub_IIIllIIllIlIlIllllIl();end;if(ReeTHub_llIlIlllIlIIIlI(ReeTHub_IlIIllIIlIlllIIllII,1,1)==1)then ReeTHub_IllllIllIIIlIIl[#("Y9")]=ReeTHub_IIIIIllIIllIllI[ReeTHub_IllllIllIIIlIIl[#("pj")]]end if(ReeTHub_llIlIlllIlIIIlI(ReeTHub_IlIIllIIlIlllIIllII,2,2)==1)then ReeTHub_IllllIllIIIlIIl[#("Bn5")]=ReeTHub_IIIIIllIIllIllI[ReeTHub_IllllIllIIIlIIl[#("5D6")]]end if(ReeTHub_llIlIlllIlIIIlI(ReeTHub_IlIIllIIlIlllIIllII,3,3)==1)then ReeTHub_IllllIllIIIlIIl[#("H1vO")]=ReeTHub_IIIIIllIIllIllI[ReeTHub_IllllIllIIIlIIl[#("XQel")]]end ReeTHub_lIIIlllIlllIlII[ReeTHub_lllIlIIIIllIIIlIlIlIIllll]=ReeTHub_IllllIllIIIlIIl;end end;ReeTHub_lllIlIIIIllIIIlIlIlIIllll[3]=ReeTHub_lllllllIIIIIIlllIIl();for ReeTHub_IllllIllIIIlIIl=1,ReeTHub_IIIlIllIlllllI()do ReeTHub_IllIllIIIll[ReeTHub_IllllIllIIIlIIl-1]=ReeTHub_lIIIIIlIlIlIIIIIllI();end;return ReeTHub_lllIlIIIIllIIIlIlIlIIllll;end;local function ReeTHub_IllIllIIIll(ReeTHub_IllllIllIIIlIIl,ReeTHub_lllIlIIIIllIIIlIlIlIIllll,ReeTHub_IIlIlIIlIIlllllllI)local ReeTHub_llIlIlllIlIIIlI=ReeTHub_IllllIllIIIlIIl[1];local ReeTHub_IIIlIllIlllllI=ReeTHub_IllllIllIIIlIIl[2];local ReeTHub_IllllIllIIIlIIl=ReeTHub_IllllIllIIIlIIl[3];return function(...)local ReeTHub_IIIIIllIIllIllI=ReeTHub_llIlIlllIlIIIlI;local ReeTHub_IllllIIIIIlIIIIlII=ReeTHub_IIIlIllIlllllI;local ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl;local ReeTHub_lIIIlllIlllIlII=ReeTHub_lIllIIIll local ReeTHub_IIIlIllIlllllI=1;local ReeTHub_lllllllIIIIIIlllIIl=-1;local ReeTHub_lIllIIIIIIllllll={};local ReeTHub_llIllIIIllIIIIlIlIl={...};local ReeTHub_lIIIIIlIlIlIIIIIllI=ReeTHub_IIIIIIIIIllII('#',...)-1;local ReeTHub_IIIIIIIIIllII={};local ReeTHub_llIlIlllIlIIIlI={};for ReeTHub_IllllIllIIIlIIl=0,ReeTHub_lIIIIIlIlIlIIIIIllI do if(ReeTHub_IllllIllIIIlIIl>=ReeTHub_IIIllIIllIlIlIllllIl)then ReeTHub_lIllIIIIIIllllll[ReeTHub_IllllIllIIIlIIl-ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIllIIIllIIIIlIlIl[ReeTHub_IllllIllIIIlIIl+1];else ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl]=ReeTHub_llIllIIIllIIIIlIlIl[ReeTHub_IllllIllIIIlIIl+1];end;end;local ReeTHub_IllllIllIIIlIIl=ReeTHub_lIIIIIlIlIlIIIIIllI-ReeTHub_IIIllIIllIlIlIllllIl+1 local ReeTHub_IllllIllIIIlIIl;local ReeTHub_IIIllIIllIlIlIllllIl;while true do ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("A")];if ReeTHub_IIIllIIllIlIlIllllIl<=#("Z8F1y5PrClb1rKzAqjCbZXYVGRDPIuBrMMBvL4Dpm6md7hjy9XAzQb0")then if ReeTHub_IIIllIIllIlIlIllllIl<=#("kUuQD9ThVUpPidZvQlY2LUXyIeQ")then if ReeTHub_IIIllIIllIlIlIllllIl<=#("5bMLWAk0KXXnn")then if ReeTHub_IIIllIIllIlIlIllllIl<=#("sn2Eo6")then if ReeTHub_IIIllIIllIlIlIllllIl<=#("dT")then if ReeTHub_IIIllIIllIlIlIllllIl<=#("")then ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Pk")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("rlY")]];elseif ReeTHub_IIIllIIllIlIlIllllIl==#("8")then local ReeTHub_IIIllIIllIlIlIllllIl;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("bL")]]=ReeTHub_lllIlIIIIllIIIlIlIlIIllll[ReeTHub_IllllIllIIIlIIl[#("ZoT")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("T1")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("8JF")]][ReeTHub_IllllIllIIIlIIl[#("7XfF")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("GC")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("VEV")]][ReeTHub_IllllIllIIIlIIl[#("o6Kb")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Sd")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("opM")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("HA")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("ky0")]][ReeTHub_IllllIllIIIlIIl[#("R457")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("fl")]]=ReeTHub_IllllIllIIIlIIl[#("1Xo")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("C7")]]=ReeTHub_IllllIllIIIlIIl[#("fmO")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("jK")]]=ReeTHub_IllllIllIIIlIIl[#("lmD")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("VV")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("xSn")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];if(ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("rz")]]~=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("xV7g")]])then ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;else ReeTHub_IIIlIllIlllllI=ReeTHub_IllllIllIIIlIIl[#("hoL")];end;else ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("u0")]]=ReeTHub_IllllIllIIIlIIl[#("3LT")];end;elseif ReeTHub_IIIllIIllIlIlIllllIl<=#("A67i")then if ReeTHub_IIIllIIllIlIlIllllIl==#("t8m")then local ReeTHub_lllllllIIIIIIlllIIl;local ReeTHub_IIIllIIllIlIlIllllIl;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Ns")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("Dy4")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("X7")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("1Mg")]][ReeTHub_IllllIllIIIlIIl[#("mE0t")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("E4")]]=ReeTHub_IllllIllIIIlIIl[#("vgp")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Vt")]]=ReeTHub_lllIlIIIIllIIIlIlIlIIllll[ReeTHub_IllllIllIIIlIIl[#("9PF")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("vq")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("54n")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("3j")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("bzk")]][ReeTHub_IllllIllIIIlIIl[#("mU8F")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Gm")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("bOn")]][ReeTHub_IllllIllIIIlIIl[#("vKcY")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("k1")];ReeTHub_lllllllIIIIIIlllIIl=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("WIY")]];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl+1]=ReeTHub_lllllllIIIIIIlllIIl;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_lllllllIIIIIIlllIIl[ReeTHub_IllllIllIIIlIIl[#("zFRg")]];else local ReeTHub_lllllllIIIIIIlllIIl;local ReeTHub_IIIllIIllIlIlIllllIl;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("e7")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("dsL")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#{"Arilis ate a panda once kiriot is sad and aztup too";"Wally is cute";}]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("s7U")]][ReeTHub_IllllIllIIIlIIl[#("VoWX")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("lx")]]=ReeTHub_IllllIllIIIlIIl[#("gKb")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("24")]]=ReeTHub_lllIlIIIIllIIIlIlIlIIllll[ReeTHub_IllllIllIIIlIIl[#("Cl8")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#{"youtube.com/watch?v=pjJ2w1FX_Wg";"Kiriot is a panda !";}]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("T0x")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("u7")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("xk5")]][ReeTHub_IllllIllIIIlIIl[#("N6zj")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("uz")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("myO")]][ReeTHub_IllllIllIIIlIIl[#("cS7X")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("bA")];ReeTHub_lllllllIIIIIIlllIIl=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("yjg")]];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl+1]=ReeTHub_lllllllIIIIIIlllIIl;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_lllllllIIIIIIlllIIl[ReeTHub_IllllIllIIIlIIl[#("E7W1")]];end;elseif ReeTHub_IIIllIIllIlIlIllllIl==#("hO3T2")then ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("oz")]]=ReeTHub_IllIllIIIll(ReeTHub_IllllIIIIIlIIIIlII[ReeTHub_IllllIllIIIlIIl[#("r98")]],nil,ReeTHub_IIlIlIIlIIlllllllI);else ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("GZ")]]={};end;elseif ReeTHub_IIIllIIllIlIlIllllIl<=#("W3zLPHBJF")then if ReeTHub_IIIllIIllIlIlIllllIl<=#("ZUY2rhy")then local ReeTHub_IIIllIIllIlIlIllllIl;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("NC")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("eWD")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("3T")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("jOC")]][ReeTHub_IllllIllIIIlIIl[#("E7fE")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("5X")]]=ReeTHub_IllllIllIIIlIIl[#("y4e")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("5J")]]=ReeTHub_lllIlIIIIllIIIlIlIlIIllll[ReeTHub_IllllIllIIIlIIl[#("QWn")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("HD")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("kZ3")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Dv")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("yHG")]][ReeTHub_IllllIllIIIlIIl[#("h1gy")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Vk")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("tIm")]][ReeTHub_IllllIllIIIlIIl[#("2d1U")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("j0")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("En8")]][ReeTHub_IllllIllIIIlIIl[#("8Sd6")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Wc")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("nry")]][ReeTHub_IllllIllIIIlIIl[#("quZs")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("xAZ")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("MC")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("ZP")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("TEQ")]][ReeTHub_IllllIllIIIlIIl[#("NMpK")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Ip")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("sYG")]][ReeTHub_IllllIllIIIlIIl[#("CT04")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("PO")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("6jM")]][ReeTHub_IllllIllIIIlIIl[#("XjrY")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("nA")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("gfs")]][ReeTHub_IllllIllIIIlIIl[#("WZbd")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("qHO")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("vz")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("tF")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("CF7")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("hW")]][ReeTHub_IllllIllIIIlIIl[#("6MM")]]=ReeTHub_IllllIllIIIlIIl[#("81nk")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("xV")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("yqK")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("zD")]][ReeTHub_IllllIllIIIlIIl[#("9jj")]]=ReeTHub_IllllIllIIIlIIl[#("V30Z")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("ah")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("1oM")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Bt")]]=ReeTHub_IllllIllIIIlIIl[#("bKa")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("2g")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl+1])ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("z8")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("MGv")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("4Y")]][ReeTHub_IllllIllIIIlIIl[#("80Q")]]=ReeTHub_IllllIllIIIlIIl[#("iiW9")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("rH")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("Wnr")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("eX")]][ReeTHub_IllllIllIIIlIIl[#("HHv")]]=ReeTHub_IllllIllIIIlIIl[#("GLGs")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];do return end;elseif ReeTHub_IIIllIIllIlIlIllllIl==#("9U3NOz4p")then local ReeTHub_lllIlIIIIllIIIlIlIlIIllll;local ReeTHub_IllllIIIIIlIIIIlII,ReeTHub_IIIIIIIIIllII;local ReeTHub_IllIllIIIll;local ReeTHub_IIIllIIllIlIlIllllIl;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("MC")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("mhn")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("ME")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("J1D")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("VD")];ReeTHub_IllIllIIIll=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("5AQ")]];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl+1]=ReeTHub_IllIllIIIll;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_IllIllIIIll[ReeTHub_IllllIllIIIlIIl[#("in61")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("2j")]]=ReeTHub_IllllIllIIIlIIl[#("4iK")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("0P")]]=(ReeTHub_IllllIllIIIlIIl[#("ENI")]~=0);ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("3W")]ReeTHub_IllllIIIIIlIIIIlII,ReeTHub_IIIIIIIIIllII=ReeTHub_lIIIlllIlllIlII(ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("pEB")])))ReeTHub_lllllllIIIIIIlllIIl=ReeTHub_IIIIIIIIIllII+ReeTHub_IIIllIIllIlIlIllllIl-1 ReeTHub_lllIlIIIIllIIIlIlIlIIllll=0;for ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIllIIllIlIlIllllIl,ReeTHub_lllllllIIIIIIlllIIl do ReeTHub_lllIlIIIIllIIIlIlIlIIllll=ReeTHub_lllIlIIIIllIIIlIlIlIIllll+1;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl]=ReeTHub_IllllIIIIIlIIIIlII[ReeTHub_lllIlIIIIllIIIlIlIlIIllll];end;ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#{{939836;288158;591645;537082};"spoodercraft says bim bam boom";}]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_lllllllIIIIIIlllIIl))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("54")]]();ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];do return end;else ReeTHub_IIIlIllIlllllI=ReeTHub_IllllIllIIIlIIl[#("LU9")];end;elseif ReeTHub_IIIllIIllIlIlIllllIl<=#("JgnKGd8qZfM")then if ReeTHub_IIIllIIllIlIlIllllIl>#("39yCeJKjuC")then local ReeTHub_IIIlIllIlllllI=ReeTHub_IllllIllIIIlIIl[#("Sn")]local ReeTHub_IIIIIllIIllIllI,ReeTHub_IllllIllIIIlIIl=ReeTHub_lIIIlllIlllIlII(ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIlIllIlllllI](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIlIllIlllllI+1,ReeTHub_IllllIllIIIlIIl[#("25x")])))ReeTHub_lllllllIIIIIIlllIIl=ReeTHub_IllllIllIIIlIIl+ReeTHub_IIIlIllIlllllI-1 local ReeTHub_IllllIllIIIlIIl=0;for ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI,ReeTHub_lllllllIIIIIIlllIIl do ReeTHub_IllllIllIIIlIIl=ReeTHub_IllllIllIIIlIIl+1;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIlIllIlllllI]=ReeTHub_IIIIIllIIllIllI[ReeTHub_IllllIllIIIlIIl];end;else local ReeTHub_IlIIllIIlIlllIIllII;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("ve")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("25s")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("4u")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("xuV")]][ReeTHub_IllllIllIIIlIIl[#("YAoQ")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("ky")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("dAm")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IlIIllIIlIlllIIllII=ReeTHub_IllllIllIIIlIIl[#("iZ")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IlIIllIIlIlllIIllII]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IlIIllIIlIlllIIllII](ReeTHub_llIlIlllIlIIIlI[ReeTHub_IlIIllIIlIlllIIllII+1])ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Rg")]]();end;elseif ReeTHub_IIIllIIllIlIlIllllIl==#("qfThfjo9RAO2")then local ReeTHub_lllllllIIIIIIlllIIl;local ReeTHub_IIIllIIllIlIlIllllIl;ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("9G")];ReeTHub_lllllllIIIIIIlllIIl=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("kN5")]];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl+1]=ReeTHub_lllllllIIIIIIlllIIl;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_lllllllIIIIIIlllIIl[ReeTHub_IllllIllIIIlIIl[#("CtW9")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Be")]]=ReeTHub_IllllIllIIIlIIl[#("NAU")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("lz")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("85B")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("Op")];ReeTHub_lllllllIIIIIIlllIIl=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("QQd")]];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl+1]=ReeTHub_lllllllIIIIIIlllIIl;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_lllllllIIIIIIlllIIl[ReeTHub_IllllIllIIIlIIl[#("Wzet")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("jQ")]]=ReeTHub_lllIlIIIIllIIIlIlIlIIllll[ReeTHub_IllllIllIIIlIIl[#("1Qd")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("b3")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("cvj")]][ReeTHub_IllllIllIIIlIIl[#("I2b8")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("RA")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("0QF")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Q7")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("1Xx")]][ReeTHub_IllllIllIIIlIIl[#("OxsE")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("hQ")]]=ReeTHub_IllllIllIIIlIIl[#("q2x")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("0U")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("Zvi")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("qh")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("lDv")]][ReeTHub_IllllIllIIIlIIl[#("ksTA")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("O6")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("EJn")]][ReeTHub_IllllIllIIIlIIl[#("V4vu")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Rr")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("q53")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Yk")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("vnG")]][ReeTHub_IllllIllIIIlIIl[#("vPkK")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Eq")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("E5X")]][ReeTHub_IllllIllIIIlIIl[#("YxWD")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("vb")]]=ReeTHub_IllllIllIIIlIIl[#("5Lb")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("hg")]]=(ReeTHub_IllllIllIIIlIIl[#("ILC")]~=0);ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("J9")]]=ReeTHub_IllllIllIIIlIIl[#("sga")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("pt")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("ILX")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("as")]]={};ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("2u")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("9mG")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Wx")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("CX2")]][ReeTHub_IllllIllIIIlIIl[#("hHl8")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("6F")]]=ReeTHub_IllllIllIIIlIIl[#("4aE")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("ju")]]=ReeTHub_IllllIllIIIlIIl[#("xIE")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("g2")]]=ReeTHub_IllllIllIIIlIIl[#("JkH")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("Tl")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("Bjz")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("UW")]][ReeTHub_IllllIllIIIlIIl[#("hAz")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("ql7h")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("JS")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("4yY")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("cR")];ReeTHub_lllllllIIIIIIlllIIl=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("A6Z")]];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl+1]=ReeTHub_lllllllIIIIIIlllIIl;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_lllllllIIIIIIlllIIl[ReeTHub_IllllIllIIIlIIl[#("CgV6")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("Qz")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl+1])ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIlIllIlllllI=ReeTHub_IllllIllIIIlIIl[#("AGG")];else local ReeTHub_IllllIllIIIlIIl=ReeTHub_IllllIllIIIlIIl[#("ZR")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IllllIllIIIlIIl+1,ReeTHub_lllllllIIIIIIlllIIl))end;elseif ReeTHub_IIIllIIllIlIlIllllIl<=#("rEtQ0LDcWFgVGlKZtfIh")then if ReeTHub_IIIllIIllIlIlIllllIl<=#{{521746;524357;905335;784513};"spoodercraft says bim bam boom";{700687;748219;285202;1237};{240392;519251;537888;102640};{817249;303374;263109;566819};"1 + 1 = 111";"Retard gonna sey they are gonna deobfuscate this";"1 + 1 = 111";{68862;522186;529789;470923};{999827;952596;538432;251873};"Wally is cute";"1 + 1 = 111";{556154;163848;798707;494254};"Wally is cute";"youtube.com/watch?v=pjJ2w1FX_Wg";"Wally is cute";}then if ReeTHub_IIIllIIllIlIlIllllIl<=#("tT97FLMxK8Okxu")then ReeTHub_IIIlIllIlllllI=ReeTHub_IllllIllIIIlIIl[#("Tfr")];elseif ReeTHub_IIIllIIllIlIlIllllIl>#{"Arilis ate a panda once kiriot is sad and aztup too";"Kiriot love sex";"Kiriot is a panda !";{92509;36929;693562;675121};"youtube.com/watch?v=pjJ2w1FX_Wg";{253538;430528;787975;651843};{714640;695232;483127;566160};"spoodercraft says bim bam boom";{452419;291791;4705;649105};{726194;512724;530448;474414};{472757;817962;749069;845330};"Retard gonna sey they are gonna deobfuscate this";{125616;226013;603169;153399};"Retard gonna sey they are gonna deobfuscate this";"Retard gonna sey they are gonna deobfuscate this";}then local ReeTHub_lllIlIIIIllIIIlIlIlIIllll;local ReeTHub_IIIIIIIIIllII,ReeTHub_IllllIIIIIlIIIIlII;local ReeTHub_IllIllIIIll;local ReeTHub_IIIllIIllIlIlIllllIl;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("U6")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("hAB")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("aS")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("Mg6")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("6z")];ReeTHub_IllIllIIIll=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("emi")]];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl+1]=ReeTHub_IllIllIIIll;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_IllIllIIIll[ReeTHub_IllllIllIIIlIIl[#("iLvY")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("78")]]=ReeTHub_IllllIllIIIlIIl[#("XNj")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("tD")]]=(ReeTHub_IllllIllIIIlIIl[#("zRb")]~=0);ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("CH")]ReeTHub_IIIIIIIIIllII,ReeTHub_IllllIIIIIlIIIIlII=ReeTHub_lIIIlllIlllIlII(ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("lTN")])))ReeTHub_lllllllIIIIIIlllIIl=ReeTHub_IllllIIIIIlIIIIlII+ReeTHub_IIIllIIllIlIlIllllIl-1 ReeTHub_lllIlIIIIllIIIlIlIlIIllll=0;for ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIllIIllIlIlIllllIl,ReeTHub_lllllllIIIIIIlllIIl do ReeTHub_lllIlIIIIllIIIlIlIlIIllll=ReeTHub_lllIlIIIIllIIIlIlIlIIllll+1;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl]=ReeTHub_IIIIIIIIIllII[ReeTHub_lllIlIIIIllIIIlIlIlIIllll];end;ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("2p")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_lllllllIIIIIIlllIIl))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Us")]]();ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];do return end;else do return end;end;elseif ReeTHub_IIIllIIllIlIlIllllIl<=#("aKBVYiiD3jJsj65IJh")then if ReeTHub_IIIllIIllIlIlIllllIl==#("H0KSivphbN8TS77OK")then ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("aU")]]={};else local ReeTHub_IllllIllIIIlIIl=ReeTHub_IllllIllIIIlIIl[#("9q")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl](ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl+1])end;elseif ReeTHub_IIIllIIllIlIlIllllIl==#("JsLo1gxlPu4asdVrekA")then local ReeTHub_lllllllIIIIIIlllIIl;local ReeTHub_IIIllIIllIlIlIllllIl;ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#{"1 + 1 = 111";"Kiriot is a panda !";}];ReeTHub_lllllllIIIIIIlllIIl=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("SmE")]];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl+1]=ReeTHub_lllllllIIIIIIlllIIl;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_lllllllIIIIIIlllIIl[ReeTHub_IllllIllIIIlIIl[#("1dU2")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Nv")]]=ReeTHub_IllllIllIIIlIIl[#("Oz2")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("AS")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("11V")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("WX")];ReeTHub_lllllllIIIIIIlllIIl=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("8NJ")]];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl+1]=ReeTHub_lllllllIIIIIIlllIIl;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_lllllllIIIIIIlllIIl[ReeTHub_IllllIllIIIlIIl[#("3SBF")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("iM")]]=ReeTHub_lllIlIIIIllIIIlIlIlIIllll[ReeTHub_IllllIllIIIlIIl[#("BBQ")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("1T")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("X9E")]][ReeTHub_IllllIllIIIlIIl[#("rKZ4")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("an")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("vFT")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("F7")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("dVv")]][ReeTHub_IllllIllIIIlIIl[#("NhUu")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Ca")]]=ReeTHub_IllllIllIIIlIIl[#("Wac")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("l9")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("M3T")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("o7")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("uX8")]][ReeTHub_IllllIllIIIlIIl[#("J7ni")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("AZ")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("1Cc")]][ReeTHub_IllllIllIIIlIIl[#("o4nF")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("iQ")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("inf")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#{"Wally is cute";{915675;54235;128206;764193};}]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("cAN")]][ReeTHub_IllllIllIIIlIIl[#("ma7T")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Of")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("SSR")]][ReeTHub_IllllIllIIIlIIl[#("eXsa")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("jM")]]=ReeTHub_IllllIllIIIlIIl[#("Q0r")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("3j")]]=(ReeTHub_IllllIllIIIlIIl[#{"youtube.com/watch?v=pjJ2w1FX_Wg";"Kiriot love sex";{644557;830551;31856;282768};}]~=0);ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("B9")]]=ReeTHub_IllllIllIIIlIIl[#("Lil")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("oM")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("Sb2")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("ml")]]={};ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("so")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("bI4")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("GH")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("C73")]][ReeTHub_IllllIllIIIlIIl[#("IVDl")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("oS")]]=ReeTHub_IllllIllIIIlIIl[#("QLv")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("eT")]]=ReeTHub_IllllIllIIIlIIl[#("yuS")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("iZ")]]=ReeTHub_IllllIllIIIlIIl[#("mJ9")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("d1")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("F1B")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("8r")]][ReeTHub_IllllIllIIIlIIl[#("Hek")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("1q0s")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("6s")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("cId")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("6Y")];ReeTHub_lllllllIIIIIIlllIIl=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("HMR")]];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl+1]=ReeTHub_lllllllIIIIIIlllIIl;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_lllllllIIIIIIlllIIl[ReeTHub_IllllIllIIIlIIl[#("b1b4")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("fl")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl+1])else local ReeTHub_lllllllIIIIIIlllIIl;local ReeTHub_IIIllIIllIlIlIllllIl;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("t5")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("XXS")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("V2")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("6CA")]][ReeTHub_IllllIllIIIlIIl[#("4ZL2")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("fi")]]=ReeTHub_IllllIllIIIlIIl[#("aJK")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("M5")]]=ReeTHub_lllIlIIIIllIIIlIlIlIIllll[ReeTHub_IllllIllIIIlIIl[#("Bqu")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("4Y")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("bzG")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("8r")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("hAx")]][ReeTHub_IllllIllIIIlIIl[#("9E6j")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("0k")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("W4X")]][ReeTHub_IllllIllIIIlIIl[#("rNgm")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("Dn")];ReeTHub_lllllllIIIIIIlllIIl=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("HuZ")]];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl+1]=ReeTHub_lllllllIIIIIIlllIIl;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_lllllllIIIIIIlllIIl[ReeTHub_IllllIllIIIlIIl[#("0YUi")]];end;elseif ReeTHub_IIIllIIllIlIlIllllIl<=#("rzIbhZ4B0ulsuM9ZVs8Ev7R")then if ReeTHub_IIIllIIllIlIlIllllIl<=#("mau58B2XoSOkUKhcl6uti")then ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("6x")]]=(ReeTHub_IllllIllIIIlIIl[#("NIh")]~=0);elseif ReeTHub_IIIllIIllIlIlIllllIl>#("QQd6GWl6GuSNYgE8CACzdM")then if(ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("2J")]]==ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("YFcp")]])then ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;else ReeTHub_IIIlIllIlllllI=ReeTHub_IllllIllIIIlIIl[#("1qI")];end;else do return end;end;elseif ReeTHub_IIIllIIllIlIlIllllIl<=#("Zekl6rzMxXKuO2c4gLrmsChWa")then if ReeTHub_IIIllIIllIlIlIllllIl>#("nE42UIdRo1uKoPhSv0nVZgAF")then local ReeTHub_IIIllIIllIlIlIllllIl;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("2j")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("CHE")]][ReeTHub_IllllIllIIIlIIl[#("8d5c")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("KV")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("F4I")]][ReeTHub_IllllIllIIIlIIl[#("v8dI")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Jy")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("m59")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("z7")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("gHc")]][ReeTHub_IllllIllIIIlIIl[#("olAr")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("tx")]]=ReeTHub_IllllIllIIIlIIl[#("Au5")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Gb")]]=ReeTHub_IllllIllIIIlIIl[#("Prx")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("B8")]]=ReeTHub_IllllIllIIIlIIl[#("TYN")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("Yo")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("j5q")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];if(ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("C0")]]==ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("dYsD")]])then ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;else ReeTHub_IIIlIllIlllllI=ReeTHub_IllllIllIIIlIIl[#("1DS")];end;else local ReeTHub_IllllIllIIIlIIl=ReeTHub_IllllIllIIIlIIl[#("KY")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl](ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl+1])end;elseif ReeTHub_IIIllIIllIlIlIllllIl==#("XWAQx7zlye4REccr7NlJHvNeKg")then local ReeTHub_IlIIllIIlIlllIIllII;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("1n")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("6z1")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("ZU")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("va5")]][ReeTHub_IllllIllIIIlIIl[#("okOU")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("vu")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("vRQ")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IlIIllIIlIlllIIllII=ReeTHub_IllllIllIIIlIIl[#("Nz")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IlIIllIIlIlllIIllII]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IlIIllIIlIlllIIllII](ReeTHub_llIlIlllIlIIIlI[ReeTHub_IlIIllIIlIlllIIllII+1])ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("mC")]]();else local ReeTHub_IIIlIllIlllllI=ReeTHub_IllllIllIIIlIIl[#("cj")];local ReeTHub_IIIIIllIIllIllI=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("FU9")]];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIlIllIlllllI+1]=ReeTHub_IIIIIllIIllIllI;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIlIllIlllllI]=ReeTHub_IIIIIllIIllIllI[ReeTHub_IllllIllIIIlIIl[#("mh3I")]];end;elseif ReeTHub_IIIllIIllIlIlIllllIl<=#("JoTgezH6WNb136z1Kmb1XlE2Eo6YBivfqR06P70r7")then if ReeTHub_IIIllIIllIlIlIllllIl<=#("pP6VrNhFc2JpExV0N0DSGOr5LmgDlNvT3R")then if ReeTHub_IIIllIIllIlIlIllllIl<=#("Z6S6sQ6fDHamDkYuaZoKLyakfHPsAG")then if ReeTHub_IIIllIIllIlIlIllllIl<=#("vWB6453jcJJYyK9Nrxrv3PguB5I0")then local ReeTHub_IIIllIIllIlIlIllllIl;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("HB")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("vFx")]][ReeTHub_IllllIllIIIlIIl[#("AXuT")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("BB")]]=ReeTHub_IllllIllIIIlIIl[#("jXo")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("me")]]=ReeTHub_IllllIllIIIlIIl[#("rPN")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Gh")]]=ReeTHub_IllllIllIIIlIIl[#("Oor")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("f8")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("ZCA")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("CH")]][ReeTHub_IllllIllIIIlIIl[#("DdQ")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("6J3Z")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("jE")]][ReeTHub_IllllIllIIIlIIl[#("vUu")]]=ReeTHub_IllllIllIIIlIIl[#("sJIz")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Lj")]][ReeTHub_IllllIllIIIlIIl[#("iHy")]]=ReeTHub_IllllIllIIIlIIl[#("PyC6")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("CY")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("5Vz")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("ML")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("gJB")]][ReeTHub_IllllIllIIIlIIl[#("alJO")]];elseif ReeTHub_IIIllIIllIlIlIllllIl==#("aNP7RPAco4AgPmacJNKg3y5hj6RQf")then local ReeTHub_lllllllIIIIIIlllIIl;local ReeTHub_IIIllIIllIlIlIllllIl;ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("Xz")];ReeTHub_lllllllIIIIIIlllIIl=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("jkK")]];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl+1]=ReeTHub_lllllllIIIIIIlllIIl;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_lllllllIIIIIIlllIIl[ReeTHub_IllllIllIIIlIIl[#("XzkC")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("0c")]]=ReeTHub_IllllIllIIIlIIl[#("yP8")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("jB")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#{"Kiriot love sex";{828337;445327;703959;352361};"Kiriot is a panda !";}]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("9N")];ReeTHub_lllllllIIIIIIlllIIl=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("t8c")]];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl+1]=ReeTHub_lllllllIIIIIIlllIIl;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_lllllllIIIIIIlllIIl[ReeTHub_IllllIllIIIlIIl[#("ofFm")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("10")]]=ReeTHub_lllIlIIIIllIIIlIlIlIIllll[ReeTHub_IllllIllIIIlIIl[#("ZSX")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("hH")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("DmJ")]][ReeTHub_IllllIllIIIlIIl[#("C0RH")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("uV")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("rou")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("E2")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("06H")]][ReeTHub_IllllIllIIIlIIl[#("E4Dg")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("o6")]]=ReeTHub_IllllIllIIIlIIl[#("bq1")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("O9")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("E9r")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("aK")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("VnN")]][ReeTHub_IllllIllIIIlIIl[#("PMpB")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("hT")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("pte")]][ReeTHub_IllllIllIIIlIIl[#("ZP7p")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("oo")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("ShG")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("lr")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("VbQ")]][ReeTHub_IllllIllIIIlIIl[#("nnRZ")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("6k")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("MZz")]][ReeTHub_IllllIllIIIlIIl[#("HzCS")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("7T")]]=ReeTHub_IllllIllIIIlIIl[#("tfp")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Fu")]]=(ReeTHub_IllllIllIIIlIIl[#("Gab")]~=0);ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("iq")]]=ReeTHub_IllllIllIIIlIIl[#("hUX")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("1t")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("BfO")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("bL")]]={};ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#{"1 + 1 = 111";"youtube.com/watch?v=pjJ2w1FX_Wg";}]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("KDF")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("j8")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("jyk")]][ReeTHub_IllllIllIIIlIIl[#("neva")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("mT")]]=ReeTHub_IllllIllIIIlIIl[#("AiF")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("E2")]]=ReeTHub_IllllIllIIIlIIl[#("L4R")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Fj")]]=ReeTHub_IllllIllIIIlIIl[#("Liy")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("ZH")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("8jK")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Xr")]][ReeTHub_IllllIllIIIlIIl[#("scZ")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("YR5P")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("7i")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("tQ7")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("x2")];ReeTHub_lllllllIIIIIIlllIIl=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("yBy")]];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl+1]=ReeTHub_lllllllIIIIIIlllIIl;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_lllllllIIIIIIlllIIl[ReeTHub_IllllIllIIIlIIl[#("gSDv")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("Mq")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl+1])ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIlIllIlllllI=ReeTHub_IllllIllIIIlIIl[#("uB9")];else local ReeTHub_IIIlIllIlllllI=ReeTHub_IllllIllIIIlIIl[#("lm")]local ReeTHub_IIIIIllIIllIllI,ReeTHub_IllllIllIIIlIIl=ReeTHub_lIIIlllIlllIlII(ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIlIllIlllllI](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIlIllIlllllI+1,ReeTHub_IllllIllIIIlIIl[#("4Hd")])))ReeTHub_lllllllIIIIIIlllIIl=ReeTHub_IllllIllIIIlIIl+ReeTHub_IIIlIllIlllllI-1 local ReeTHub_IllllIllIIIlIIl=0;for ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI,ReeTHub_lllllllIIIIIIlllIIl do ReeTHub_IllllIllIIIlIIl=ReeTHub_IllllIllIIIlIIl+1;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIlIllIlllllI]=ReeTHub_IIIIIllIIllIllI[ReeTHub_IllllIllIIIlIIl];end;end;elseif ReeTHub_IIIllIIllIlIlIllllIl<=#("9xdyb630R5JLcD2poDfs2s8U3NRHXU8U")then if ReeTHub_IIIllIIllIlIlIllllIl>#("U5cdrkeiS5OHsvDp4RnKXNQzsFzpvd6")then local ReeTHub_IIIlIllIlllllI=ReeTHub_IllllIllIIIlIIl[#("Zf")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIlIllIlllllI]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIlIllIlllllI](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIlIllIlllllI+1,ReeTHub_IllllIllIIIlIIl[#("FbC")]))else ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("djo")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("OX")]];end;elseif ReeTHub_IIIllIIllIlIlIllllIl==#("ZPsI0l7rbjjytnKqnr2dUjigoNVXVYWP8")then local ReeTHub_IIIllIIllIlIlIllllIl;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("YU")]]=ReeTHub_IllllIllIIIlIIl[#("S7q")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("mb")]]=ReeTHub_IllllIllIIIlIIl[#("3oP")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("7N")]]=ReeTHub_IllllIllIIIlIIl[#("Imz")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("yc")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("l0N")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Yo")]][ReeTHub_IllllIllIIIlIIl[#("HIs")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("kiTG")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("3i")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("iCV")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("XW")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("gmU")]][ReeTHub_IllllIllIIIlIIl[#("Kip1")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#{"Arilis ate a panda once kiriot is sad and aztup too";"Retard gonna sey they are gonna deobfuscate this";}]]=ReeTHub_IllllIllIIIlIIl[#("KM5")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Rr")]]=ReeTHub_IllllIllIIIlIIl[#("CO6")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("PQ")]]=ReeTHub_IllllIllIIIlIIl[#("j7p")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Rk")]]=ReeTHub_IllllIllIIIlIIl[#{{852834;405737;315742;820054};{713642;336445;589595;267858};"Kiriot love sex";}];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("H8")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("iul")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("mV")]][ReeTHub_IllllIllIIIlIIl[#("zrR")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("nj1J")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("mz")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("0ej")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("mo")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("l0t")]][ReeTHub_IllllIllIIIlIIl[#("fDV8")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("My")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("EyH")]][ReeTHub_IllllIllIIIlIIl[#("LqpJ")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("t5")]][ReeTHub_IllllIllIIIlIIl[#("ror")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("hTrC")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("y1")]][ReeTHub_IllllIllIIIlIIl[#("3ma")]]=ReeTHub_IllllIllIIIlIIl[#("FVvJ")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("ff")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("smy")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("IF")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("des")]][ReeTHub_IllllIllIIIlIIl[#("zP5A")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Vs")]]=ReeTHub_IllllIllIIIlIIl[#("bf2")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("dR")]]=ReeTHub_IllllIllIIIlIIl[#("5At")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("dr")]]=ReeTHub_IllllIllIIIlIIl[#("FQn")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("VR")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("OJM")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("qK")]][ReeTHub_IllllIllIIIlIIl[#("vBA")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("fYEZ")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("2G")]][ReeTHub_IllllIllIIIlIIl[#("dOW")]]=ReeTHub_IllllIllIIIlIIl[#("PZx6")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("nf")]][ReeTHub_IllllIllIIIlIIl[#("rhm")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("N6Eq")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Su")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("R3m")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("hs")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("HIP")]][ReeTHub_IllllIllIIIlIIl[#("43ky")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("RC")]]=ReeTHub_IllllIllIIIlIIl[#("Gnb")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("yO")]]=ReeTHub_IllllIllIIIlIIl[#("44c")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("yC")]]=ReeTHub_IllllIllIIIlIIl[#("8Q4")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#{"Kiriot is a panda !";"1 + 1 = 111";}]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("Ka4")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("xJ")]][ReeTHub_IllllIllIIIlIIl[#("PzS")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("11YM")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#{"Arilis ate a panda once kiriot is sad and aztup too";"youtube.com/watch?v=pjJ2w1FX_Wg";}]][ReeTHub_IllllIllIIIlIIl[#("sQb")]]=ReeTHub_IllllIllIIIlIIl[#("DXsX")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Jh")]][ReeTHub_IllllIllIIIlIIl[#("nQQ")]]=ReeTHub_IllllIllIIIlIIl[#("BHvB")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Pm")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("DgX")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Xu")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#{{322838;49204;938073;242633};"Wally is cute";{911372;7360;331202;762004};}]][ReeTHub_IllllIllIIIlIIl[#("WWA5")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("0d")]]=ReeTHub_IllllIllIIIlIIl[#("AH9")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("m6")]]=ReeTHub_IllllIllIIIlIIl[#("LJn")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Iv")]]=ReeTHub_IllllIllIIIlIIl[#("mDd")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("xy")]]=ReeTHub_IllllIllIIIlIIl[#("8KD")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("i3")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("Zrf")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("pL")]][ReeTHub_IllllIllIIIlIIl[#("lnP")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("svuT")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Y0")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("oBU")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("X9")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("3Y0")]][ReeTHub_IllllIllIIIlIIl[#("Iqf4")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("GJ")]]=ReeTHub_IllllIllIIIlIIl[#("hXm")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("cc")]]=ReeTHub_IllllIllIIIlIIl[#("AKW")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("tK")]]=ReeTHub_IllllIllIIIlIIl[#("DAK")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("0I")]]=ReeTHub_IllllIllIIIlIIl[#("N9M")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("ie")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("OOq")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("iZ")]][ReeTHub_IllllIllIIIlIIl[#("hc5")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("GEIp")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("qv")]][ReeTHub_IllllIllIIIlIIl[#("2U3")]]=ReeTHub_IllllIllIIIlIIl[#("na2j")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("kA")]][ReeTHub_IllllIllIIIlIIl[#("YvS")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("1GJN")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("iz")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("MQJ")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("m8")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("xuS")]][ReeTHub_IllllIllIIIlIIl[#("gLcr")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("3c")]]=ReeTHub_IllllIllIIIlIIl[#("Gvx")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("lR")]]=ReeTHub_IllllIllIIIlIIl[#("N4L")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("nF")]]=ReeTHub_IllllIllIIIlIIl[#("Z2n")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("Ld")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("Hpp")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Ur")]][ReeTHub_IllllIllIIIlIIl[#("1bp")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("hDp4")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Uh")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("QM6")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("jQ")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Rli")]][ReeTHub_IllllIllIIIlIIl[#("FGe9")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("tH")]]=ReeTHub_IllllIllIIIlIIl[#("BAF")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Lv")]]=ReeTHub_IllllIllIIIlIIl[#("6bf")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("53")]]=ReeTHub_IllllIllIIIlIIl[#("QjI")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("Mg")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("iOu")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Z6")]][ReeTHub_IllllIllIIIlIIl[#("hE1")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("lSz4")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("t6")]][ReeTHub_IllllIllIIIlIIl[#("BEu")]]=ReeTHub_IllllIllIIIlIIl[#("69gV")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("05")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("fdJ")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("2P")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Ape")]][ReeTHub_IllllIllIIIlIIl[#("W4pU")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("yB")]]=ReeTHub_IllllIllIIIlIIl[#("VOZ")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("3z")]]=ReeTHub_IllllIllIIIlIIl[#("x4r")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("fc")]]=ReeTHub_IllllIllIIIlIIl[#("kDz")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("CJ")]]=ReeTHub_IllllIllIIIlIIl[#("DrG")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("BL")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("qa9")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("or")]][ReeTHub_IllllIllIIIlIIl[#("uXG")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("WXSB")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Q8")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("fin")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("m4")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Dkx")]][ReeTHub_IllllIllIIIlIIl[#("7nXb")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("0B")]]=ReeTHub_IllllIllIIIlIIl[#("fgm")];else local ReeTHub_IIIlIllIlllllI=ReeTHub_IllllIllIIIlIIl[#("it")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIlIllIlllllI](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIlIllIlllllI+1,ReeTHub_IllllIllIIIlIIl[#("Z6J")]))end;elseif ReeTHub_IIIllIIllIlIlIllllIl<=#("ROd5ATU5JNEsff4hbek3mQGlsmBkHmxEzMG6n")then if ReeTHub_IIIllIIllIlIlIllllIl<=#("2jsZLFN6IP2OXSFeFbh1MmrJzvq93DJ74Tm")then local ReeTHub_lllllllIIIIIIlllIIl;local ReeTHub_IIIllIIllIlIlIllllIl;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("RB")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("lvl")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("un")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("eN3")]][ReeTHub_IllllIllIIIlIIl[#("coNy")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("ac")]]=ReeTHub_IllllIllIIIlIIl[#("HHN")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("vH")]]=ReeTHub_lllIlIIIIllIIIlIlIlIIllll[ReeTHub_IllllIllIIIlIIl[#("p1g")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("ry")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("i2s")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("92")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Rzc")]][ReeTHub_IllllIllIIIlIIl[#("R52c")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("cL")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("g7M")]][ReeTHub_IllllIllIIIlIIl[#("jhOY")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("Tm")];ReeTHub_lllllllIIIIIIlllIIl=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("ebm")]];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl+1]=ReeTHub_lllllllIIIIIIlllIIl;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_lllllllIIIIIIlllIIl[ReeTHub_IllllIllIIIlIIl[#("gFrG")]];elseif ReeTHub_IIIllIIllIlIlIllllIl==#("KyebIxPVr2AP9tgFZvQP2UAooNceg5UeFEEh")then local ReeTHub_IIIllIIllIlIlIllllIl;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("vl")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("CWa")]][ReeTHub_IllllIllIIIlIIl[#{"Wally is cute";"Wally is cute";"youtube.com/watch?v=pjJ2w1FX_Wg";"Kiriot is a panda !";}]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Xd")]]=ReeTHub_IllllIllIIIlIIl[#("LJ1")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("g6")]]=ReeTHub_IllllIllIIIlIIl[#("pAv")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("IV")]]=ReeTHub_IllllIllIIIlIIl[#("H7k")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("Og")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("9ox")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Bo")]][ReeTHub_IllllIllIIIlIIl[#("NuG")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("SYOE")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("gt")]][ReeTHub_IllllIllIIIlIIl[#("tm0")]]=ReeTHub_IllllIllIIIlIIl[#("84xj")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("24")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("bIT")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("70")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("ts7")]][ReeTHub_IllllIllIIIlIIl[#("RxSK")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Yg")]]=ReeTHub_IllllIllIIIlIIl[#("0iy")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("h8")]]=ReeTHub_IllllIllIIIlIIl[#("a08")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("l8")]]=ReeTHub_IllllIllIIIlIIl[#("cfC")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("yn")]]=ReeTHub_IllllIllIIIlIIl[#("Xxv")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("Ho")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("PpR")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("vT")]][ReeTHub_IllllIllIIIlIIl[#("pnP")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("0bmV")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("pv")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("TUC")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("9L")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Q0N")]][ReeTHub_IllllIllIIIlIIl[#("Oi3f")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("yN")]]=ReeTHub_IllllIllIIIlIIl[#("9Rz")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("nE")]]=ReeTHub_IllllIllIIIlIIl[#("1X6")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("aZ")]]=ReeTHub_IllllIllIIIlIIl[#("voU")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("As")]]=ReeTHub_IllllIllIIIlIIl[#("URu")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("9B")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("l30")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("3D")]][ReeTHub_IllllIllIIIlIIl[#("L0n")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("D5r4")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("uc")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("E90")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("qJ")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("yqL")]][ReeTHub_IllllIllIIIlIIl[#("0Tts")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("2H")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Dnj")]][ReeTHub_IllllIllIIIlIIl[#("3rz3")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("3S")]][ReeTHub_IllllIllIIIlIIl[#("8F9")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("oUFd")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("WZ")]][ReeTHub_IllllIllIIIlIIl[#("t4V")]]=ReeTHub_IllllIllIIIlIIl[#("UWSD")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("xT")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("EBO")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("x7")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("AYG")]][ReeTHub_IllllIllIIIlIIl[#("l9T1")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Vy")]]=ReeTHub_IllllIllIIIlIIl[#("aJN")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Wg")]]=ReeTHub_IllllIllIIIlIIl[#("DWy")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Ux")]]=ReeTHub_IllllIllIIIlIIl[#("7Qz")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("Zx")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("NIU")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("PO")]][ReeTHub_IllllIllIIIlIIl[#("IoP")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("K5Ie")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("uh")]][ReeTHub_IllllIllIIIlIIl[#("38U")]]=ReeTHub_IllllIllIIIlIIl[#("cNCM")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Xv")]][ReeTHub_IllllIllIIIlIIl[#("eli")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("8czg")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("gg")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("uY0")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#{"Arilis ate a panda once kiriot is sad and aztup too";"Retard gonna sey they are gonna deobfuscate this";}]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("VXl")]][ReeTHub_IllllIllIIIlIIl[#("JNtV")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("tM")]]=ReeTHub_IllllIllIIIlIIl[#("K9M")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("CH")]]=ReeTHub_IllllIllIIIlIIl[#("hh4")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("MJ")]]=ReeTHub_IllllIllIIIlIIl[#("GRy")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("NE")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("RhE")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("hh")]][ReeTHub_IllllIllIIIlIIl[#("iZ3")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("3O0C")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("2e")]][ReeTHub_IllllIllIIIlIIl[#("Z6e")]]=ReeTHub_IllllIllIIIlIIl[#("QnZO")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Lh")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("OuH")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("7c")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("0Yt")]][ReeTHub_IllllIllIIIlIIl[#("09D2")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("qJ")]]=ReeTHub_IllllIllIIIlIIl[#("vZ6")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("IP")]]=ReeTHub_IllllIllIIIlIIl[#("MDJ")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("rd")]]=ReeTHub_IllllIllIIIlIIl[#("egk")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("EA")]]=ReeTHub_IllllIllIIIlIIl[#("Ylv")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("Ly")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("uPB")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("zc")]][ReeTHub_IllllIllIIIlIIl[#("3je")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("8Utl")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("3R")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("5uI")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("MP")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("KVW")]][ReeTHub_IllllIllIIIlIIl[#("Mr2i")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Wo")]]=ReeTHub_IllllIllIIIlIIl[#("xIK")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Vh")]]=ReeTHub_IllllIllIIIlIIl[#("k5I")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("rx")]]=ReeTHub_IllllIllIIIlIIl[#("ph7")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("fk")]]=ReeTHub_IllllIllIIIlIIl[#("WRE")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("3d")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("9sX")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("yv")]][ReeTHub_IllllIllIIIlIIl[#("xy6")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("RxLr")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("9O")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("UsN")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Ar")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("4Xm")]][ReeTHub_IllllIllIIIlIIl[#("JQ8N")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Fm")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("tDa")]][ReeTHub_IllllIllIIIlIIl[#("6efA")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("fd")]][ReeTHub_IllllIllIIIlIIl[#("LEc")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("ZYYq")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("8P")]][ReeTHub_IllllIllIIIlIIl[#("gVQ")]]=ReeTHub_IllllIllIIIlIIl[#("8KHn")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("zW")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("mx1")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("pG")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("1fX")]][ReeTHub_IllllIllIIIlIIl[#("YsiX")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("6l")]]=ReeTHub_IllllIllIIIlIIl[#("7Lt")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("kF")]]=ReeTHub_IllllIllIIIlIIl[#("Lzg")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("2F")]]=ReeTHub_IllllIllIIIlIIl[#("sqW")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("kG")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("5Py")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("mN")]][ReeTHub_IllllIllIIIlIIl[#("Qn0")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("MVSW")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Gx")]][ReeTHub_IllllIllIIIlIIl[#("qye")]]=ReeTHub_IllllIllIIIlIIl[#("sMH6")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("vp")]][ReeTHub_IllllIllIIIlIIl[#("Sk9")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("kbZv")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Dl")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("BzA")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("nh")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("95u")]][ReeTHub_IllllIllIIIlIIl[#("3O3j")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("eF")]]=ReeTHub_IllllIllIIIlIIl[#("jbP")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Ei")]]=ReeTHub_IllllIllIIIlIIl[#("xkh")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Fc")]]=ReeTHub_IllllIllIIIlIIl[#("9m1")];else local ReeTHub_IlIIllIIlIlllIIllII;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Op")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("8JI")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("EN")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("pra")]][ReeTHub_IllllIllIIIlIIl[#("YELd")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("f4")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("HRq")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IlIIllIIlIlllIIllII=ReeTHub_IllllIllIIIlIIl[#("aW")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IlIIllIIlIlllIIllII]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IlIIllIIlIlllIIllII](ReeTHub_llIlIlllIlIIIlI[ReeTHub_IlIIllIIlIlllIIllII+1])ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("12")]]();end;elseif ReeTHub_IIIllIIllIlIlIllllIl<=#("gtpHHrG6LaJvdhIcHi07ZW4tLOvivjF09ITcAhu")then if ReeTHub_IIIllIIllIlIlIllllIl==#("3sONDSdXlb8vOkhtz6625xKBGTxGzGMzXzdGir")then ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("D3")]]=(ReeTHub_IllllIllIIIlIIl[#("zSC")]~=0);else local ReeTHub_IIIllIIllIlIlIllllIl;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("9E")]]=ReeTHub_lllIlIIIIllIIIlIlIlIIllll[ReeTHub_IllllIllIIIlIIl[#("07D")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("U6")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("tPi")]][ReeTHub_IllllIllIIIlIIl[#("g0yf")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("RX")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("IOh")]][ReeTHub_IllllIllIIIlIIl[#("pHlc")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("RQ")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#{"Kiriot is a panda !";"Wally is cute";"Retard gonna sey they are gonna deobfuscate this";}]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("GR")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("tDA")]][ReeTHub_IllllIllIIIlIIl[#("kxtC")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("J1")]]=ReeTHub_IllllIllIIIlIIl[#("0WJ")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#{"Wally is cute";{724349;813068;826770;119652};}]]=ReeTHub_IllllIllIIIlIIl[#("4Vl")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("ox")]]=ReeTHub_IllllIllIIIlIIl[#("VoY")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("Vn")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("Sn9")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];if(ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Dn")]]~=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("mq1E")]])then ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;else ReeTHub_IIIlIllIlllllI=ReeTHub_IllllIllIIIlIIl[#("U0m")];end;end;elseif ReeTHub_IIIllIIllIlIlIllllIl>#("2LJ7uljlZBzNElDGHTmgTvHyQzJIogLlgeeqxApp")then local ReeTHub_lllllllIIIIIIlllIIl;local ReeTHub_IIIllIIllIlIlIllllIl;ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("2b")];ReeTHub_lllllllIIIIIIlllIIl=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("A3f")]];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl+1]=ReeTHub_lllllllIIIIIIlllIIl;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_lllllllIIIIIIlllIIl[ReeTHub_IllllIllIIIlIIl[#("6Ukq")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("KF")]]=ReeTHub_IllllIllIIIlIIl[#("j4s")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("C3")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("eVg")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("AW")];ReeTHub_lllllllIIIIIIlllIIl=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("sJd")]];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl+1]=ReeTHub_lllllllIIIIIIlllIIl;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_lllllllIIIIIIlllIIl[ReeTHub_IllllIllIIIlIIl[#("kA8O")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Ry")]]=ReeTHub_lllIlIIIIllIIIlIlIlIIllll[ReeTHub_IllllIllIIIlIIl[#("zVf")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("kE")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("ER3")]][ReeTHub_IllllIllIIIlIIl[#("hjOf")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Dr")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("ZDy")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("ss")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("oMV")]][ReeTHub_IllllIllIIIlIIl[#("DnBd")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("MV")]]=ReeTHub_IllllIllIIIlIIl[#("pgC")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#{"Arilis ate a panda once kiriot is sad and aztup too";{689934;800471;188900;971366};}]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("R7I")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("bo")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("C3y")]][ReeTHub_IllllIllIIIlIIl[#("N0XB")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("yZ")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("h1v")]][ReeTHub_IllllIllIIIlIIl[#("GuCC")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("i6")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("k5N")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("ah")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("VOZ")]][ReeTHub_IllllIllIIIlIIl[#("HNhi")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("XV")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("aVW")]][ReeTHub_IllllIllIIIlIIl[#("vPhX")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("YI")]]=ReeTHub_IllllIllIIIlIIl[#("Hpc")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("cK")]]=(ReeTHub_IllllIllIIIlIIl[#("9OR")]~=0);ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("q9")]]=ReeTHub_IllllIllIIIlIIl[#("ggx")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("LK")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("mfg")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("m7")]]={};ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("DT")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("s3m")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Ly")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("ho3")]][ReeTHub_IllllIllIIIlIIl[#("0IHo")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("os")]]=ReeTHub_IllllIllIIIlIIl[#("9WS")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Jb")]]=ReeTHub_IllllIllIIIlIIl[#("rT6")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("2C")]]=ReeTHub_IllllIllIIIlIIl[#("k2D")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("dF")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("059")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("6Y")]][ReeTHub_IllllIllIIIlIIl[#("kjc")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("aSoK")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("hQ")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("IkW")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("8U")];ReeTHub_lllllllIIIIIIlllIIl=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("HoA")]];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl+1]=ReeTHub_lllllllIIIIIIlllIIl;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_lllllllIIIIIIlllIIl[ReeTHub_IllllIllIIIlIIl[#("80X7")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("PX")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl+1])ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIlIllIlllllI=ReeTHub_IllllIllIIIlIIl[#{"youtube.com/watch?v=pjJ2w1FX_Wg";{3717;534675;139835;433538};"youtube.com/watch?v=pjJ2w1FX_Wg";}];else local ReeTHub_IIIlIllIlllllI=ReeTHub_IllllIllIIIlIIl[#("66")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIlIllIlllllI]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIlIllIlllllI](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIlIllIlllllI+1,ReeTHub_IllllIllIIIlIIl[#("xTD")]))end;elseif ReeTHub_IIIllIIllIlIlIllllIl<=#("HIea2int2HX6khHdkq5ML7SZnGzhljgD7UlXCyYqvnvKXo57")then if ReeTHub_IIIllIIllIlIlIllllIl<=#("mmjuNWKZpWvTgiTAt8B6TLWDPpxLic8KCK867it8L8mM")then if ReeTHub_IIIllIIllIlIlIllllIl<=#("HpfNjDpFbYMAQPxz9RmXWrGjWDlPDuVzkbhaq78JSf")then local ReeTHub_IlIIllIIlIlllIIllII;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("CI")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("6e4")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("el")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("jCq")]][ReeTHub_IllllIllIIIlIIl[#("g7UE")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("IJ")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("N4T")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IlIIllIIlIlllIIllII=ReeTHub_IllllIllIIIlIIl[#("AE")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IlIIllIIlIlllIIllII]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IlIIllIIlIlllIIllII](ReeTHub_llIlIlllIlIIIlI[ReeTHub_IlIIllIIlIlllIIllII+1])ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("ly")]]();elseif ReeTHub_IIIllIIllIlIlIllllIl==#("WxHqD6JMq9YPpT60QrLcRcmpPIxibSOfR1UWpmSS3SE")then local ReeTHub_IIIllIIllIlIlIllllIl;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("UI")]]=ReeTHub_lllIlIIIIllIIIlIlIlIIllll[ReeTHub_IllllIllIIIlIIl[#("3TX")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("lq")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("lZV")]][ReeTHub_IllllIllIIIlIIl[#("07GR")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Hv")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("acf")]][ReeTHub_IllllIllIIIlIIl[#("EcFu")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("FN")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("t0x")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("sK")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("tk0")]][ReeTHub_IllllIllIIIlIIl[#("XgOu")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("tM")]]=ReeTHub_IllllIllIIIlIIl[#("CWH")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("JB")]]=ReeTHub_IllllIllIIIlIIl[#("pP4")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("W8")]]=ReeTHub_IllllIllIIIlIIl[#{{552168;227105;335506;498496};"spoodercraft says bim bam boom";{455375;258399;837872;670848};}];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("ky")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("Gbm")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];if(ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("8R")]]~=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("esJN")]])then ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;else ReeTHub_IIIlIllIlllllI=ReeTHub_IllllIllIIIlIIl[#("aLg")];end;else local ReeTHub_IIIllIIllIlIlIllllIl;ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("0X")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("7Pm")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("R4")]][ReeTHub_IllllIllIIIlIIl[#("91c")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Yg1n")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("jV")]][ReeTHub_IllllIllIIIlIIl[#("f3b")]]=ReeTHub_IllllIllIIIlIIl[#("R0j2")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("05")]][ReeTHub_IllllIllIIIlIIl[#("dL5")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("z5Na")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("uJ")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("lRS")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Up")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("4P3")]][ReeTHub_IllllIllIIIlIIl[#("2b07")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Tf")]]=ReeTHub_IllllIllIIIlIIl[#("aDH")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("EM")]]=ReeTHub_IllllIllIIIlIIl[#("NGx")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("O8")]]=ReeTHub_IllllIllIIIlIIl[#("dsj")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("Vb")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("JOf")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("3I")]][ReeTHub_IllllIllIIIlIIl[#("MLb")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("8m3f")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("1O")]][ReeTHub_IllllIllIIIlIIl[#("BJJ")]]=ReeTHub_IllllIllIIIlIIl[#("2lCq")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("qL")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("gfO")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("pj")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("2KN")]][ReeTHub_IllllIllIIIlIIl[#("XzgS")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("AT")]]=ReeTHub_IllllIllIIIlIIl[#("VP2")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("RB")]]=ReeTHub_IllllIllIIIlIIl[#("uUQ")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("UA")]]=ReeTHub_IllllIllIIIlIIl[#("Gsz")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("po")]]=ReeTHub_IllllIllIIIlIIl[#("ChI")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("tx")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("Lu4")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("zd")]][ReeTHub_IllllIllIIIlIIl[#("O2h")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("UfsT")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Qy")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("3Ml")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("W7")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("2e0")]][ReeTHub_IllllIllIIIlIIl[#("O2NR")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("ID")]]=ReeTHub_IllllIllIIIlIIl[#("Q1c")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("TD")]]=ReeTHub_IllllIllIIIlIIl[#("VJc")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("tE")]]=ReeTHub_IllllIllIIIlIIl[#("5CF")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("ad")]]=ReeTHub_IllllIllIIIlIIl[#("jYD")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("B6")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("IgR")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("jb")]][ReeTHub_IllllIllIIIlIIl[#("PtO")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("2DND")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("VN")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("HBN")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("dI")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("JhR")]][ReeTHub_IllllIllIIIlIIl[#("cDLs")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("O1")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("C5e")]][ReeTHub_IllllIllIIIlIIl[#("LmWW")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("TJ")]][ReeTHub_IllllIllIIIlIIl[#("fNW")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Fy2Q")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("hN")]][ReeTHub_IllllIllIIIlIIl[#("rcy")]]=ReeTHub_IllllIllIIIlIIl[#("aY5c")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("ij")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("y9r")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Fa")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("jn9")]][ReeTHub_IllllIllIIIlIIl[#("XSgy")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("D5")]]=ReeTHub_IllllIllIIIlIIl[#("xsY")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Pt")]]=ReeTHub_IllllIllIIIlIIl[#("mjx")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("s8")]]=ReeTHub_IllllIllIIIlIIl[#("5ts")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("zH")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("VcQ")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("jb")]][ReeTHub_IllllIllIIIlIIl[#("T32")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("fJl9")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("dF")]][ReeTHub_IllllIllIIIlIIl[#("uOp")]]=ReeTHub_IllllIllIIIlIIl[#("zJ9E")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Ne")]][ReeTHub_IllllIllIIIlIIl[#("5DF")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("uXX4")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("gL")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("jIJ")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("k3")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("i5e")]][ReeTHub_IllllIllIIIlIIl[#("HtHO")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("gs")]]=ReeTHub_IllllIllIIIlIIl[#("hRx")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("JO")]]=ReeTHub_IllllIllIIIlIIl[#("pBh")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Nr")]]=ReeTHub_IllllIllIIIlIIl[#("TKA")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("Iy")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("sdx")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("8v")]][ReeTHub_IllllIllIIIlIIl[#("ueB")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("p971")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Bt")]][ReeTHub_IllllIllIIIlIIl[#("clB")]]=ReeTHub_IllllIllIIIlIIl[#("dILu")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("z7")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("PZl")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("De")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("U8P")]][ReeTHub_IllllIllIIIlIIl[#("uvnN")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("c2")]]=ReeTHub_IllllIllIIIlIIl[#("7Gg")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("ux")]]=ReeTHub_IllllIllIIIlIIl[#("G7P")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("0F")]]=ReeTHub_IllllIllIIIlIIl[#("Hr3")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("3m")]]=ReeTHub_IllllIllIIIlIIl[#("cjp")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("t0")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("ksa")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("vG")]][ReeTHub_IllllIllIIIlIIl[#("Evg")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("bbXn")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("MG")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("qMq")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("SO")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("pTn")]][ReeTHub_IllllIllIIIlIIl[#("5zzH")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("TP")]]=ReeTHub_IllllIllIIIlIIl[#("5Kx")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("2V")]]=ReeTHub_IllllIllIIIlIIl[#("6uU")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("YO")]]=ReeTHub_IllllIllIIIlIIl[#("zIl")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("iH")]]=ReeTHub_IllllIllIIIlIIl[#("rfS")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("es")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("Kfm")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("xR")]][ReeTHub_IllllIllIIIlIIl[#("7Lv")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("mbbP")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Xf")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("AkV")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("nh")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("RoO")]][ReeTHub_IllllIllIIIlIIl[#("ElCr")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("jd")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("ehA")]][ReeTHub_IllllIllIIIlIIl[#("gMu3")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("20")]][ReeTHub_IllllIllIIIlIIl[#("WDj")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("18OE")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Hu")]][ReeTHub_IllllIllIIIlIIl[#("JNP")]]=ReeTHub_IllllIllIIIlIIl[#("9Jkm")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("nM")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("kvO")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("d8")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("4U0")]][ReeTHub_IllllIllIIIlIIl[#("GGt8")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Ff")]]=ReeTHub_IllllIllIIIlIIl[#("HVY")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Dl")]]=ReeTHub_IllllIllIIIlIIl[#("nVx")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("fq")]]=ReeTHub_IllllIllIIIlIIl[#("J0Q")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("Yp")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("4yR")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("n4")]][ReeTHub_IllllIllIIIlIIl[#("QpU")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("0KBx")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("KG")]][ReeTHub_IllllIllIIIlIIl[#("5v2")]]=ReeTHub_IllllIllIIIlIIl[#("cH5T")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("XT")]][ReeTHub_IllllIllIIIlIIl[#("6AB")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("i35m")]];end;elseif ReeTHub_IIIllIIllIlIlIllllIl<=#("xv2rthrqhdTTjqM5KBKJuS8y8kLEK2i8JY3sPeY4Ay8Nhb")then if ReeTHub_IIIllIIllIlIlIllllIl>#("8KWhDi4dOxFsjGXQo4VjvysqFNQi7Uup7IM4XUQ0OVp5k")then local ReeTHub_IIIllIIllIlIlIllllIl;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("E5")]]=ReeTHub_IllllIllIIIlIIl[#("GL8")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("OL")]]=ReeTHub_IllllIllIIIlIIl[#("yDq")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("J1")]]=ReeTHub_IllllIllIIIlIIl[#("sfo")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("ms")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("fyq")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("jr")]][ReeTHub_IllllIllIIIlIIl[#("6Fc")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("zR3S")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("KV")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("ODE")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("kd")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("aTo")]][ReeTHub_IllllIllIIIlIIl[#("7U5S")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("ne")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("3Dy")]][ReeTHub_IllllIllIIIlIIl[#("N0Yt")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Ut")]][ReeTHub_IllllIllIIIlIIl[#("usp")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("71Dh")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("PN")]][ReeTHub_IllllIllIIIlIIl[#("1UV")]]=ReeTHub_IllllIllIIIlIIl[#("Gl7a")];else local ReeTHub_lllllllIIIIIIlllIIl=ReeTHub_IllllIIIIIlIIIIlII[ReeTHub_IllllIllIIIlIIl[#("hz1")]];local ReeTHub_IIIllIIllIlIlIllllIl;local ReeTHub_IlIIllIIlIlllIIllII={};ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_llIllIII({},{__index=function(ReeTHub_IIIlIllIlllllI,ReeTHub_IllllIllIIIlIIl)local ReeTHub_IllllIllIIIlIIl=ReeTHub_IlIIllIIlIlllIIllII[ReeTHub_IllllIllIIIlIIl];return ReeTHub_IllllIllIIIlIIl[1][ReeTHub_IllllIllIIIlIIl[2]];end,__newindex=function(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IllllIllIIIlIIl,ReeTHub_IIIlIllIlllllI)local ReeTHub_IllllIllIIIlIIl=ReeTHub_IlIIllIIlIlllIIllII[ReeTHub_IllllIllIIIlIIl]ReeTHub_IllllIllIIIlIIl[1][ReeTHub_IllllIllIIIlIIl[2]]=ReeTHub_IIIlIllIlllllI;end;});for ReeTHub_IIlIlIIlIIlllllllI=1,ReeTHub_IllllIllIIIlIIl[#("ud56")]do ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;local ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];if ReeTHub_IllllIllIIIlIIl[#("B")]==91 then ReeTHub_IlIIllIIlIlllIIllII[ReeTHub_IIlIlIIlIIlllllllI-1]={ReeTHub_llIlIlllIlIIIlI,ReeTHub_IllllIllIIIlIIl[#("bTc")]};else ReeTHub_IlIIllIIlIlllIIllII[ReeTHub_IIlIlIIlIIlllllllI-1]={ReeTHub_lllIlIIIIllIIIlIlIlIIllll,ReeTHub_IllllIllIIIlIIl[#("ejy")]};end;ReeTHub_IIIIIIIIIllII[#ReeTHub_IIIIIIIIIllII+1]=ReeTHub_IlIIllIIlIlllIIllII;end;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#{"1 + 1 = 111";"Kiriot is a panda !";}]]=ReeTHub_IllIllIIIll(ReeTHub_lllllllIIIIIIlllIIl,ReeTHub_IIIllIIllIlIlIllllIl,ReeTHub_IIlIlIIlIIlllllllI);end;elseif ReeTHub_IIIllIIllIlIlIllllIl==#("OyMRTTx1pKrGNZCWg3couM333Eo5GLixgT8rGpbM3grcMrh")then local ReeTHub_IlIIllIIlIlllIIllII;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("bb")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("yPA")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("VY")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("gt5")]][ReeTHub_IllllIllIIIlIIl[#("fN8L")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("hH")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("ofA")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IlIIllIIlIlllIIllII=ReeTHub_IllllIllIIIlIIl[#("IL")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IlIIllIIlIlllIIllII]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IlIIllIIlIlllIIllII](ReeTHub_llIlIlllIlIIIlI[ReeTHub_IlIIllIIlIlllIIllII+1])ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("fd")]]();else local ReeTHub_IlIIllIIlIlllIIllII;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("I9")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("RAQ")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("MM")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("is1")]][ReeTHub_IllllIllIIIlIIl[#("YMMk")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("5p")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("TLO")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IlIIllIIlIlllIIllII=ReeTHub_IllllIllIIIlIIl[#("m4")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IlIIllIIlIlllIIllII]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IlIIllIIlIlllIIllII](ReeTHub_llIlIlllIlIIIlI[ReeTHub_IlIIllIIlIlllIIllII+1])ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("V3")]]();end;elseif ReeTHub_IIIllIIllIlIlIllllIl<=#("y2Ov35CcETYpEBuPC4z41kq02Auot1qLvzIO6WDkq6XXCViDVNL")then if ReeTHub_IIIllIIllIlIlIllllIl<=#("2n8mLYEELmTNCm3e3RSPBnN4xDygq2DQqJShAuchr9Kenkuo1")then ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Jc")]][ReeTHub_IllllIllIIIlIIl[#("L2O")]]=ReeTHub_IllllIllIIIlIIl[#("gPS0")];elseif ReeTHub_IIIllIIllIlIlIllllIl==#("Jd45qOLe0iAymSUcv3EWOJPKxCOJRmijomsAVureHvF4S4W1uk")then local ReeTHub_IIIllIIllIlIlIllllIl;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Di")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("RRf")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("0Y")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("f5B")]][ReeTHub_IllllIllIIIlIIl[#("lSMO")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("vd")]]=ReeTHub_IllllIllIIIlIIl[#("3m1")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("xQ")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl+1])ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("PP")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("Ygl")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Yh")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("8b3")]][ReeTHub_IllllIllIIIlIIl[#("rBYM")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("vI")]]=ReeTHub_IllllIllIIIlIIl[#("dpz")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("Kf")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl+1])ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("tJ")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("slT")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("sv")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("ajC")]][ReeTHub_IllllIllIIIlIIl[#("nT3o")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("l8")]]=ReeTHub_IllllIllIIIlIIl[#("QO7")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("3M")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl+1])ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("vS")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("aRU")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Yp")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("9a2")]][ReeTHub_IllllIllIIIlIIl[#("4Z8c")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("iJ")]]=ReeTHub_IllllIllIIIlIIl[#("Bty")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("xI")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl+1])ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("b7")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("AMq")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Kn")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("8cn")]][ReeTHub_IllllIllIIIlIIl[#("92nx")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("y3")]]=ReeTHub_IllllIllIIIlIIl[#("ssA")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("EG")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl+1])ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("cc")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("mPO")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("2k")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("UN2")]][ReeTHub_IllllIllIIIlIIl[#("ups4")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("5V")]]=ReeTHub_IllllIllIIIlIIl[#("iOb")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("vC")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl+1])ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("DH")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("rhM")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("gB")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("yCv")]][ReeTHub_IllllIllIIIlIIl[#("1DhV")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("n7")]]=ReeTHub_IllllIllIIIlIIl[#("Xgv")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("Or")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl+1])ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("1M")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("32p")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("dG")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("BHo")]][ReeTHub_IllllIllIIIlIIl[#("NCry")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("02")]]=ReeTHub_IllllIllIIIlIIl[#("q1J")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("5V")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl+1])ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("0p")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("xil")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("0B")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("BoE")]][ReeTHub_IllllIllIIIlIIl[#("PZvG")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("mP")]]=ReeTHub_IllllIllIIIlIIl[#("L8s")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("yg")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl+1])ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("lq")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("Bkd")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Iq")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("7Bf")]][ReeTHub_IllllIllIIIlIIl[#("fTxR")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("ny")]]=ReeTHub_IllllIllIIIlIIl[#{"Kiriot is a panda !";"Kiriot is a panda !";{599846;986567;895914;309350};}];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("ub")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl+1])ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("81")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("yoT")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("tF")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Atb")]][ReeTHub_IllllIllIIIlIIl[#("qQPA")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("mI")]]=ReeTHub_IllllIllIIIlIIl[#("JrQ")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("fq")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl+1])ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("hy")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("pII")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("pC")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("NLX")]][ReeTHub_IllllIllIIIlIIl[#("tFox")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("2E")]]=ReeTHub_IllllIllIIIlIIl[#("Kym")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("e2")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl+1])ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("qs")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("DyU")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("OR")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("VCb")]][ReeTHub_IllllIllIIIlIIl[#("ch3i")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("CG")]]=ReeTHub_IllllIllIIIlIIl[#{"Kiriot is a panda !";"Kiriot is a panda !";"Kiriot love sex";}];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("Z2")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl+1])ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("G3")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("F1u")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("5l")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("71r")]][ReeTHub_IllllIllIIIlIIl[#("UMh7")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("4g")]]=ReeTHub_IllllIllIIIlIIl[#("FYL")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("rA")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl+1])ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("c8")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("2HE")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("iC")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("D6s")]][ReeTHub_IllllIllIIIlIIl[#("DILO")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("d4")]]=ReeTHub_IllllIllIIIlIIl[#("cDi")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("ac")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl+1])ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("8I")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("KkQ")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("zO")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#{"Kiriot is a panda !";"youtube.com/watch?v=pjJ2w1FX_Wg";{129111;116240;884918;963315};}]][ReeTHub_IllllIllIIIlIIl[#("kHSP")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("6s")]][ReeTHub_IllllIllIIIlIIl[#("ivd")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("L2LM")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("5T")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("pF6")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("C6")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("gdV")]][ReeTHub_IllllIllIIIlIIl[#("kYRG")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("7j")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Xu8")]][ReeTHub_IllllIllIIIlIIl[#("hm5j")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("o9")]][ReeTHub_IllllIllIIIlIIl[#("8tO")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("H6mr")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("SL")]][ReeTHub_IllllIllIIIlIIl[#("aAj")]]=ReeTHub_IllllIllIIIlIIl[#("ELz1")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Bs")]][ReeTHub_IllllIllIIIlIIl[#("TsS")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("SfbO")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("RV")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("ll2")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("LG")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("1Oq")]][ReeTHub_IllllIllIIIlIIl[#("XXKk")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("87")]]=ReeTHub_IllllIllIIIlIIl[#("DSC")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("QG")]]=ReeTHub_IllllIllIIIlIIl[#("aL3")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("ou")]]=ReeTHub_IllllIllIIIlIIl[#("SEo")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#{"Kiriot love sex";"1 + 1 = 111";}]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("mCh")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("yR")]][ReeTHub_IllllIllIIIlIIl[#("6L6")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("jGr6")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("pf")]][ReeTHub_IllllIllIIIlIIl[#("mbc")]]=ReeTHub_IllllIllIIIlIIl[#("64Ma")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("nW")]][ReeTHub_IllllIllIIIlIIl[#("XjG")]]=ReeTHub_IllllIllIIIlIIl[#("pNBr")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("sp")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("l0X")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("j7")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("dCU")]][ReeTHub_IllllIllIIIlIIl[#("ntAQ")]];else local ReeTHub_IIIlIllIlllllI=ReeTHub_IllllIllIIIlIIl[#("Sp")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIlIllIlllllI](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIlIllIlllllI+1,ReeTHub_IllllIllIIIlIIl[#("1Qv")]))end;elseif ReeTHub_IIIllIIllIlIlIllllIl<=#("CUfzaztIZacyNaqi9AtqbLAosdV2DQWnGyQzjYsaBWDdE814BVWCa")then if ReeTHub_IIIllIIllIlIlIllllIl>#("X1t0g6NCfjnY1ot19lhtZoixUum1CR3unMLZesRvy9RsZQgMKJWK")then local ReeTHub_IlIIllIIlIlllIIllII;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Hu")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("Hkt")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("SE")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("dDL")]][ReeTHub_IllllIllIIIlIIl[#("9DUV")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Pr")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("d58")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IlIIllIIlIlllIIllII=ReeTHub_IllllIllIIIlIIl[#("s9")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IlIIllIIlIlllIIllII]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IlIIllIIlIlllIIllII](ReeTHub_llIlIlllIlIIIlI[ReeTHub_IlIIllIIlIlllIIllII+1])ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Xv")]]();else local ReeTHub_lllllllIIIIIIlllIIl;local ReeTHub_IIIllIIllIlIlIllllIl;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Cc")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("SJt")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("IB")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("QGk")]][ReeTHub_IllllIllIIIlIIl[#("fWcB")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("nx")]]=ReeTHub_IllllIllIIIlIIl[#("f8X")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("WQ")]]=ReeTHub_lllIlIIIIllIIIlIlIlIIllll[ReeTHub_IllllIllIIIlIIl[#("Qgl")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("PG")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("R2e")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("hH")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("oHl")]][ReeTHub_IllllIllIIIlIIl[#("uNUH")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("JZ")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("RX2")]][ReeTHub_IllllIllIIIlIIl[#("aPqn")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("cQ")];ReeTHub_lllllllIIIIIIlllIIl=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("JV2")]];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl+1]=ReeTHub_lllllllIIIIIIlllIIl;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_lllllllIIIIIIlllIIl[ReeTHub_IllllIllIIIlIIl[#("J9zi")]];end;elseif ReeTHub_IIIllIIllIlIlIllllIl==#("ReJS7fVUW9zp3KpOFWRFV50IZHeoKr24t9HIcghm6MLard6f18eXff")then local ReeTHub_lllllllIIIIIIlllIIl;local ReeTHub_IIIllIIllIlIlIllllIl;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("GK")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("1GB")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("f4")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("isK")]][ReeTHub_IllllIllIIIlIIl[#("fOTA")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("AG")]]=ReeTHub_IllllIllIIIlIIl[#("GFt")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("ES")]]=ReeTHub_lllIlIIIIllIIIlIlIlIIllll[ReeTHub_IllllIllIIIlIIl[#("yDJ")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("Tj")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("q0d")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("2t")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("0Tb")]][ReeTHub_IllllIllIIIlIIl[#("Dx3C")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("E5")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("xrV")]][ReeTHub_IllllIllIIIlIIl[#("QWGC")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("sa")];ReeTHub_lllllllIIIIIIlllIIl=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("NZs")]];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl+1]=ReeTHub_lllllllIIIIIIlllIIl;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_lllllllIIIIIIlllIIl[ReeTHub_IllllIllIIIlIIl[#("j1lZ")]];else local ReeTHub_IlIIllIIlIlllIIllII;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("gl")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("gH9")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("In")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("PRL")]][ReeTHub_IllllIllIIIlIIl[#("M24f")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Sz")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("rSU")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IlIIllIIlIlllIIllII=ReeTHub_IllllIllIIIlIIl[#("zb")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IlIIllIIlIlllIIllII]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IlIIllIIlIlllIIllII](ReeTHub_llIlIlllIlIIIlI[ReeTHub_IlIIllIIlIlllIIllII+1])ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("0i")]]();ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];do return end;end;elseif ReeTHub_IIIllIIllIlIlIllllIl<=#("Vna3BbGjFhF63cRLyPEIju0pWL9yLmfZnAWtbnRkACg2XgccjyRhLHAAyUgZciJscPSDqyJk8tiSo7DPI6o")then if ReeTHub_IIIllIIllIlIlIllllIl<=#("F7nRav5rg1iq2Y0hyJWWZHjrzSlBrCrg4vXeCbD4Crdhk1ZBhvq9jCy8Y6rrjF9PKcxGa")then if ReeTHub_IIIllIIllIlIlIllllIl<=#("Qxg2tHDbgI2Vs6kr6C8YqFUkU6ryIhEsAxP43ri0FWZUzzldFrf4ImEkN5hxpf")then if ReeTHub_IIIllIIllIlIlIllllIl<=#("9dKv6qqzPthsFQ9VvVn3pcKVn2Er7jVLAr0RZcpWn2BLB39FNkWMbln6EY")then if ReeTHub_IIIllIIllIlIlIllllIl<=#("dX8CGJG3mZr5tFBPyM8ut38OXxiKnd3na3l9pB4c4aWPuoDgKG0uFEYk")then ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("7v")]]=ReeTHub_IllIllIIIll(ReeTHub_IllllIIIIIlIIIIlII[ReeTHub_IllllIllIIIlIIl[#("nNO")]],nil,ReeTHub_IIlIlIIlIIlllllllI);elseif ReeTHub_IIIllIIllIlIlIllllIl>#("uPiB6Pi6e4AtCA6R6AtgtsI4baRmISGeal4WVM8vNTqtdXig3OJeFeEbg")then local ReeTHub_lllllllIIIIIIlllIIl;local ReeTHub_IIIllIIllIlIlIllllIl;ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("Wl")];ReeTHub_lllllllIIIIIIlllIIl=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("n4d")]];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl+1]=ReeTHub_lllllllIIIIIIlllIIl;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_lllllllIIIIIIlllIIl[ReeTHub_IllllIllIIIlIIl[#("JdmO")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Nz")]]=ReeTHub_IllllIllIIIlIIl[#("SQA")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("rR")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("Eph")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("YJ")];ReeTHub_lllllllIIIIIIlllIIl=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("IRT")]];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl+1]=ReeTHub_lllllllIIIIIIlllIIl;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_lllllllIIIIIIlllIIl[ReeTHub_IllllIllIIIlIIl[#("aeMk")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("zn")]]=ReeTHub_lllIlIIIIllIIIlIlIlIIllll[ReeTHub_IllllIllIIIlIIl[#("m9C")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("d9")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Dzr")]][ReeTHub_IllllIllIIIlIIl[#("BcNK")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("t2")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("oO3")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("zW")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("9r7")]][ReeTHub_IllllIllIIIlIIl[#("8Ur4")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("It")]]=ReeTHub_IllllIllIIIlIIl[#("NHP")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("6b")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("WKM")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("FG")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("h1Q")]][ReeTHub_IllllIllIIIlIIl[#("oiYp")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("NG")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("KU1")]][ReeTHub_IllllIllIIIlIIl[#("RYJV")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("6D")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("9dI")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("fq")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("lXV")]][ReeTHub_IllllIllIIIlIIl[#("mTOl")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("93")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("NED")]][ReeTHub_IllllIllIIIlIIl[#("Ajos")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("La")]]=ReeTHub_IllllIllIIIlIIl[#("Xrj")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("rX")]]=(ReeTHub_IllllIllIIIlIIl[#("syn")]~=0);ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("TN")]]=ReeTHub_IllllIllIIIlIIl[#("ba3")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("2y")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("ycT")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Gf")]]={};ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("ou")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("T29")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("us")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Xri")]][ReeTHub_IllllIllIIIlIIl[#("Mjvd")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("lV")]]=ReeTHub_IllllIllIIIlIIl[#("TUJ")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Vh")]]=ReeTHub_IllllIllIIIlIIl[#("V0f")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("6n")]]=ReeTHub_IllllIllIIIlIIl[#("gIM")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("UA")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("SDg")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("D6")]][ReeTHub_IllllIllIIIlIIl[#("G0K")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("hoLh")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("tP")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("j6Z")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("cV")];ReeTHub_lllllllIIIIIIlllIIl=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("dkg")]];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl+1]=ReeTHub_lllllllIIIIIIlllIIl;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_lllllllIIIIIIlllIIl[ReeTHub_IllllIllIIIlIIl[#("1KaJ")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("eV")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl+1])else local ReeTHub_lllllllIIIIIIlllIIl;local ReeTHub_IIIllIIllIlIlIllllIl;ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("AA")];ReeTHub_lllllllIIIIIIlllIIl=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("E8p")]];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl+1]=ReeTHub_lllllllIIIIIIlllIIl;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_lllllllIIIIIIlllIIl[ReeTHub_IllllIllIIIlIIl[#("Ao7X")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("R1")]]=ReeTHub_IllllIllIIIlIIl[#("inD")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("2O")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("Zyp")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("WA")];ReeTHub_lllllllIIIIIIlllIIl=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("5LF")]];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl+1]=ReeTHub_lllllllIIIIIIlllIIl;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_lllllllIIIIIIlllIIl[ReeTHub_IllllIllIIIlIIl[#("lF1k")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("gH")]]=ReeTHub_lllIlIIIIllIIIlIlIlIIllll[ReeTHub_IllllIllIIIlIIl[#("A33")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("MW")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("VY8")]][ReeTHub_IllllIllIIIlIIl[#("RzBr")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("2h")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("SjW")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Hc")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("4AX")]][ReeTHub_IllllIllIIIlIIl[#("YF9r")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("W4")]]=ReeTHub_IllllIllIIIlIIl[#("UuY")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("As")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("rgR")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("kh")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("aIx")]][ReeTHub_IllllIllIIIlIIl[#("fXUS")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Kv")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Kyd")]][ReeTHub_IllllIllIIIlIIl[#("DmCv")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("jp")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("B9T")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Q2")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("q08")]][ReeTHub_IllllIllIIIlIIl[#("MTfm")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("rQ")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("9sX")]][ReeTHub_IllllIllIIIlIIl[#("kmC1")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("dn")]]=ReeTHub_IllllIllIIIlIIl[#("CQO")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("JA")]]=(ReeTHub_IllllIllIIIlIIl[#("LPC")]~=0);ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Dl")]]=ReeTHub_IllllIllIIIlIIl[#("XvI")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("j2")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("mzp")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("o5")]]={};ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("qC")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("B0y")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("cM")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("gnv")]][ReeTHub_IllllIllIIIlIIl[#("gsk2")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("oG")]]=ReeTHub_IllllIllIIIlIIl[#("RNt")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("8D")]]=ReeTHub_IllllIllIIIlIIl[#("vij")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("dm")]]=ReeTHub_IllllIllIIIlIIl[#("sRc")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("mo")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("47I")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("LS")]][ReeTHub_IllllIllIIIlIIl[#("6DV")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("TXtZ")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("G0")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("Bz6")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("IR")];ReeTHub_lllllllIIIIIIlllIIl=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("LWo")]];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl+1]=ReeTHub_lllllllIIIIIIlllIIl;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_lllllllIIIIIIlllIIl[ReeTHub_IllllIllIIIlIIl[#("xLSO")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("xA")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl+1])end;elseif ReeTHub_IIIllIIllIlIlIllllIl<=#("z676yvzuspFk5uC8DKcn1n1Ls4jCK6R2PHmcyRu45TF2LTTnMHL392ylevNE")then if ReeTHub_IIIllIIllIlIlIllllIl>#("6UvIMGyizKVphsiT99Kl6ZcuY3Wjb8ce0S98iu8nufm70O2KoCexcspgSbU")then local ReeTHub_lllllllIIIIIIlllIIl;local ReeTHub_IIIllIIllIlIlIllllIl;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("t4")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("4E2")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("AA")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("tSS")]][ReeTHub_IllllIllIIIlIIl[#("NEoc")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Bo")]]=ReeTHub_IllllIllIIIlIIl[#("vIn")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("oZ")]]=ReeTHub_lllIlIIIIllIIIlIlIlIIllll[ReeTHub_IllllIllIIIlIIl[#("mJa")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("7L")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("x4r")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("CA")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("rDx")]][ReeTHub_IllllIllIIIlIIl[#("9cFd")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("y7")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("CqF")]][ReeTHub_IllllIllIIIlIIl[#("8soA")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("bO")];ReeTHub_lllllllIIIIIIlllIIl=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("QCr")]];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl+1]=ReeTHub_lllllllIIIIIIlllIIl;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_lllllllIIIIIIlllIIl[ReeTHub_IllllIllIIIlIIl[#("Mdh1")]];else local ReeTHub_lllllllIIIIIIlllIIl=ReeTHub_IllllIIIIIlIIIIlII[ReeTHub_IllllIllIIIlIIl[#("39e")]];local ReeTHub_IIIllIIllIlIlIllllIl;local ReeTHub_IlIIllIIlIlllIIllII={};ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_llIllIII({},{__index=function(ReeTHub_IIIlIllIlllllI,ReeTHub_IllllIllIIIlIIl)local ReeTHub_IllllIllIIIlIIl=ReeTHub_IlIIllIIlIlllIIllII[ReeTHub_IllllIllIIIlIIl];return ReeTHub_IllllIllIIIlIIl[1][ReeTHub_IllllIllIIIlIIl[2]];end,__newindex=function(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IllllIllIIIlIIl,ReeTHub_IIIlIllIlllllI)local ReeTHub_IllllIllIIIlIIl=ReeTHub_IlIIllIIlIlllIIllII[ReeTHub_IllllIllIIIlIIl]ReeTHub_IllllIllIIIlIIl[1][ReeTHub_IllllIllIIIlIIl[2]]=ReeTHub_IIIlIllIlllllI;end;});for ReeTHub_IIlIlIIlIIlllllllI=1,ReeTHub_IllllIllIIIlIIl[#("WN22")]do ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;local ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];if ReeTHub_IllllIllIIIlIIl[#("W")]==91 then ReeTHub_IlIIllIIlIlllIIllII[ReeTHub_IIlIlIIlIIlllllllI-1]={ReeTHub_llIlIlllIlIIIlI,ReeTHub_IllllIllIIIlIIl[#("YXa")]};else ReeTHub_IlIIllIIlIlllIIllII[ReeTHub_IIlIlIIlIIlllllllI-1]={ReeTHub_lllIlIIIIllIIIlIlIlIIllll,ReeTHub_IllllIllIIIlIIl[#("oLI")]};end;ReeTHub_IIIIIIIIIllII[#ReeTHub_IIIIIIIIIllII+1]=ReeTHub_IlIIllIIlIlllIIllII;end;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("qU")]]=ReeTHub_IllIllIIIll(ReeTHub_lllllllIIIIIIlllIIl,ReeTHub_IIIllIIllIlIlIllllIl,ReeTHub_IIlIlIIlIIlllllllI);end;elseif ReeTHub_IIIllIIllIlIlIllllIl==#("TngBIRzzsjLOax00MfFjal4J3PbIC2qhLpEg8WAjoDre1BvQCAEMGKSHtHI2P")then ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("BF")]]=(not ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("og1")]]);else local ReeTHub_lllIlIIIIllIIIlIlIlIIllll;local ReeTHub_IllllIIIIIlIIIIlII,ReeTHub_IIIIIIIIIllII;local ReeTHub_IllIllIIIll;local ReeTHub_IIIllIIllIlIlIllllIl;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("x1")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("zBF")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("SO")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("EV1")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("lO")];ReeTHub_IllIllIIIll=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("gpW")]];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl+1]=ReeTHub_IllIllIIIll;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_IllIllIIIll[ReeTHub_IllllIllIIIlIIl[#("P3NV")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("YV")]]=ReeTHub_IllllIllIIIlIIl[#("mBq")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("sv")]]=(ReeTHub_IllllIllIIIlIIl[#("qNU")]~=0);ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("7J")]ReeTHub_IllllIIIIIlIIIIlII,ReeTHub_IIIIIIIIIllII=ReeTHub_lIIIlllIlllIlII(ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("EkR")])))ReeTHub_lllllllIIIIIIlllIIl=ReeTHub_IIIIIIIIIllII+ReeTHub_IIIllIIllIlIlIllllIl-1 ReeTHub_lllIlIIIIllIIIlIlIlIIllll=0;for ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIllIIllIlIlIllllIl,ReeTHub_lllllllIIIIIIlllIIl do ReeTHub_lllIlIIIIllIIIlIlIlIIllll=ReeTHub_lllIlIIIIllIIIlIlIlIIllll+1;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl]=ReeTHub_IllllIIIIIlIIIIlII[ReeTHub_lllIlIIIIllIIIlIlIlIIllll];end;ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("7f")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_lllllllIIIIIIlllIIl))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("59")]]();ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];do return end;end;elseif ReeTHub_IIIllIIllIlIlIllllIl<=#("6B3DcV2U10Pv4I4ZSCtvfcyOLaH7XBnIEyG0kyyKYSIO7kPkNEZfIsV4cp2bo47AM")then if ReeTHub_IIIllIIllIlIlIllllIl<=#("1HbdOueTHyEURBvvutMi9lMMY5Gvv3VhbZsijJZFbYVyArJBQ2KOYEhQ4ApTYSy")then ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Ys")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("4fo")]];elseif ReeTHub_IIIllIIllIlIlIllllIl==#("MvT1inlVEghlAolHveQDshtIRNnUtfQsBhVdJSsDQZjRv6pQnSyUc4uFckjF9CCz")then local ReeTHub_IllllIllIIIlIIl=ReeTHub_IllllIllIIIlIIl[#("hi")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IllllIllIIIlIIl+1,ReeTHub_lllllllIIIIIIlllIIl))else local ReeTHub_lllIlIIIIllIIIlIlIlIIllll;local ReeTHub_IIIIIIIIIllII,ReeTHub_IllllIIIIIlIIIIlII;local ReeTHub_IllIllIIIll;local ReeTHub_IIIllIIllIlIlIllllIl;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Za")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("48y")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("i1")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("AN2")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("Mo")];ReeTHub_IllIllIIIll=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("6Lg")]];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl+1]=ReeTHub_IllIllIIIll;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_IllIllIIIll[ReeTHub_IllllIllIIIlIIl[#("baBs")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("yp")]]=ReeTHub_IllllIllIIIlIIl[#("hOT")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("lJ")]]=(ReeTHub_IllllIllIIIlIIl[#("b89")]~=0);ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("PT")]ReeTHub_IIIIIIIIIllII,ReeTHub_IllllIIIIIlIIIIlII=ReeTHub_lIIIlllIlllIlII(ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("tOi")])))ReeTHub_lllllllIIIIIIlllIIl=ReeTHub_IllllIIIIIlIIIIlII+ReeTHub_IIIllIIllIlIlIllllIl-1 ReeTHub_lllIlIIIIllIIIlIlIlIIllll=0;for ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIllIIllIlIlIllllIl,ReeTHub_lllllllIIIIIIlllIIl do ReeTHub_lllIlIIIIllIIIlIlIlIIllll=ReeTHub_lllIlIIIIllIIIlIlIlIIllll+1;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl]=ReeTHub_IIIIIIIIIllII[ReeTHub_lllIlIIIIllIIIlIlIlIIllll];end;ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("ts")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_lllllllIIIIIIlllIIl))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("vE")]]();ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];do return end;end;elseif ReeTHub_IIIllIIllIlIlIllllIl<=#("YUsDh8OVmWE8MlVxHHLR6qHWpbyIXEoxUqIl7nfUU8Zh1HA9ziC50RFHnGmgLf8TIgn")then if ReeTHub_IIIllIIllIlIlIllllIl>#("NJAtB177Bz5TLyjPbtGdVa8Ba9jOagJUtevZTiE9THgYLEGm6tSoKjKML8sCSs7tZk")then ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("NC")]]();else local ReeTHub_IllllIllIIIlIIl=ReeTHub_IllllIllIIIlIIl[#("N4")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl](ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl+1])end;elseif ReeTHub_IIIllIIllIlIlIllllIl==#("Gbu52ZHtn4kZHD6SQzujjEUoUZcrAKW8Be9kLyZAd0vSAjV8VLq5FbpbrflcWp3OilzD")then if(ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("se")]]==ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Q7A2")]])then ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;else ReeTHub_IIIlIllIlllllI=ReeTHub_IllllIllIIIlIIl[#("xOz")];end;else local ReeTHub_IIIllIIllIlIlIllllIl;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("h8")]]=ReeTHub_lllIlIIIIllIIIlIlIlIIllll[ReeTHub_IllllIllIIIlIIl[#("U5W")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("oj")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("GkH")]][ReeTHub_IllllIllIIIlIIl[#("dXgs")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("5v")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("1BN")]][ReeTHub_IllllIllIIIlIIl[#("AI4S")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("sJ")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("Jb7")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("GT")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("HMf")]][ReeTHub_IllllIllIIIlIIl[#("sD10")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("qj")]]=ReeTHub_IllllIllIIIlIIl[#("ChI")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("9X")]]=ReeTHub_IllllIllIIIlIIl[#("gCx")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("EE")]]=ReeTHub_IllllIllIIIlIIl[#("0X8")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("vG")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("oOF")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];if(ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("f9")]]~=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("9Mxa")]])then ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;else ReeTHub_IIIlIllIlllllI=ReeTHub_IllllIllIIIlIIl[#("YTM")];end;end;elseif ReeTHub_IIIllIIllIlIlIllllIl<=#("WgsK5gthbYLedGZs1EAY72GlWNY6SJoUsG9E8vK554qrL8STdurS9OG3LgXrrxADK0VIHvuG3F2d")then if ReeTHub_IIIllIIllIlIlIllllIl<=#("nLX5f2yrGVO9f21IrNJEXSUmklR9VYFWCrxF9xmEbkdfhICED7M1tJYG1LU3lyGSp2IXFxI5")then if ReeTHub_IIIllIIllIlIlIllllIl<=#("eDNOPfMUnGYmNC2E1OzMssOOvZp9O8gzQBpgk1lGij71SFNAQtNSjthVZ9sZZMgoAzGmmV")then local ReeTHub_IllllIllIIIlIIl=ReeTHub_IllllIllIIIlIIl[#("Le")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl](ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl+1])elseif ReeTHub_IIIllIIllIlIlIllllIl>#("9D3DjvW50mZttvypxsErlJvQHcTCs8An4bOpp07AcdCNarW3bij3SDgBgn6gMtM1WLzrRha")then if(ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("pe")]]~=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("fATs")]])then ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;else ReeTHub_IIIlIllIlllllI=ReeTHub_IllllIllIIIlIIl[#("hKS")];end;else local ReeTHub_IlIIllIIlIlllIIllII;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("BA")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("vzo")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Xz")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("RDe")]][ReeTHub_IllllIllIIIlIIl[#("726k")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("1d")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("JJW")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IlIIllIIlIlllIIllII=ReeTHub_IllllIllIIIlIIl[#("Jg")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IlIIllIIlIlllIIllII]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IlIIllIIlIlllIIllII](ReeTHub_llIlIlllIlIIIlI[ReeTHub_IlIIllIIlIlllIIllII+1])ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Bx")]]();end;elseif ReeTHub_IIIllIIllIlIlIllllIl<=#("veohhSPoqZAkZHGC4njc31XTBK0A3Fl3iNINn9syIS0X4Ccpe7yE87NFrGRH2pvWOGbm82n54V")then if ReeTHub_IIIllIIllIlIlIllllIl>#("laaZ8ILu5gS5ladvRrWGsxejyB0qmTCKmEBEqRS9q4AP5L0m5GGNhpkZ50BIStimPhSRJJfaK")then ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Xt")]][ReeTHub_IllllIllIIIlIIl[#("x1r")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("OOpA")]];else local ReeTHub_lllllllIIIIIIlllIIl;local ReeTHub_IIIllIIllIlIlIllllIl;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("QO")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("Xpr")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("o2")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("C1v")]][ReeTHub_IllllIllIIIlIIl[#("8GKa")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("e0")]]=ReeTHub_IllllIllIIIlIIl[#("G50")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("8R")]]=ReeTHub_lllIlIIIIllIIIlIlIlIIllll[ReeTHub_IllllIllIIIlIIl[#("9hS")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("Oq")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("z8K")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("0Z")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("meK")]][ReeTHub_IllllIllIIIlIIl[#("h95W")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("9m")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Som")]][ReeTHub_IllllIllIIIlIIl[#("JjKk")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("1M")];ReeTHub_lllllllIIIIIIlllIIl=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("22P")]];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl+1]=ReeTHub_lllllllIIIIIIlllIIl;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_lllllllIIIIIIlllIIl[ReeTHub_IllllIllIIIlIIl[#("eKzI")]];end;elseif ReeTHub_IIIllIIllIlIlIllllIl==#("oz6AnWLOvQmZC7sLIApkr7VmaY3iNvBGduaW2GNO7d8D90PUz8aPUAFrNTAz3Da9oRVg6HScXMm")then local ReeTHub_lllIlIIIIllIIIlIlIlIIllll;local ReeTHub_IllllIIIIIlIIIIlII,ReeTHub_IIIIIIIIIllII;local ReeTHub_IllIllIIIll;local ReeTHub_IIIllIIllIlIlIllllIl;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("LX")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("BHk")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("SO")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("rOh")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("KY")];ReeTHub_IllIllIIIll=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("dtX")]];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl+1]=ReeTHub_IllIllIIIll;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_IllIllIIIll[ReeTHub_IllllIllIIIlIIl[#("OeXV")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("4K")]]=ReeTHub_IllllIllIIIlIIl[#("MqU")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("fm")]]=(ReeTHub_IllllIllIIIlIIl[#("04n")]~=0);ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("6S")]ReeTHub_IllllIIIIIlIIIIlII,ReeTHub_IIIIIIIIIllII=ReeTHub_lIIIlllIlllIlII(ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("qL2")])))ReeTHub_lllllllIIIIIIlllIIl=ReeTHub_IIIIIIIIIllII+ReeTHub_IIIllIIllIlIlIllllIl-1 ReeTHub_lllIlIIIIllIIIlIlIlIIllll=0;for ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIllIIllIlIlIllllIl,ReeTHub_lllllllIIIIIIlllIIl do ReeTHub_lllIlIIIIllIIIlIlIlIIllll=ReeTHub_lllIlIIIIllIIIlIlIlIIllll+1;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl]=ReeTHub_IllllIIIIIlIIIIlII[ReeTHub_lllIlIIIIllIIIlIlIlIIllll];end;ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("M3")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_lllllllIIIIIIlllIIl))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("A4")]]();ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];do return end;else local ReeTHub_IIIllIIllIlIlIllllIl;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("cK")]]=ReeTHub_IllllIllIIIlIIl[#("Q5v")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("bX")]]=ReeTHub_IllllIllIIIlIIl[#("PQc")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("2Y")]]=ReeTHub_IllllIllIIIlIIl[#("q3x")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("dN")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("71K")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("nv")]][ReeTHub_IllllIllIIIlIIl[#("0gN")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("IMTq")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Tz")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("qYV")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("TT")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("EVZ")]][ReeTHub_IllllIllIIIlIIl[#("PmCg")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("oV")]]=ReeTHub_IllllIllIIIlIIl[#("OpR")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("mc")]]=ReeTHub_IllllIllIIIlIIl[#("PBk")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("0p")]]=ReeTHub_IllllIllIIIlIIl[#("r3Y")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("fl")]]=ReeTHub_IllllIllIIIlIIl[#("qjE")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("JP")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("3rD")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("fJ")]][ReeTHub_IllllIllIIIlIIl[#("uCJ")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Ebxz")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Oc")]][ReeTHub_IllllIllIIIlIIl[#("78C")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("gF71")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("zb")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("j4U")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("BT")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("0f9")]][ReeTHub_IllllIllIIIlIIl[#("YrV5")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("x2")]]=ReeTHub_IllllIllIIIlIIl[#("lHX")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("CR")]]=ReeTHub_IllllIllIIIlIIl[#("QmE")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("jX")]]=ReeTHub_IllllIllIIIlIIl[#("spN")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("5Z")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("tbI")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Nb")]][ReeTHub_IllllIllIIIlIIl[#("r0N")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("doRe")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("s8")]][ReeTHub_IllllIllIIIlIIl[#("RH2")]]=ReeTHub_IllllIllIIIlIIl[#("4SYf")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("nO")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("9sm")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("hO")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("j3H")]][ReeTHub_IllllIllIIIlIIl[#("FpOC")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("2e")]]=ReeTHub_IllllIllIIIlIIl[#("jDI")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("50")]]=ReeTHub_IllllIllIIIlIIl[#("F6s")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("dV")]]=ReeTHub_IllllIllIIIlIIl[#("8M1")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("hD")]]=ReeTHub_IllllIllIIIlIIl[#("vtI")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("oN")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("xJM")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("QA")]][ReeTHub_IllllIllIIIlIIl[#("DXt")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("vRDb")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("ok")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("OgI")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("qa")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("9gX")]][ReeTHub_IllllIllIIIlIIl[#("cn9v")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("lf")]]=ReeTHub_IllllIllIIIlIIl[#("TB8")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("hn")]]=ReeTHub_IllllIllIIIlIIl[#("EkR")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Qp")]]=ReeTHub_IllllIllIIIlIIl[#("IEn")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("PJ")]]=ReeTHub_IllllIllIIIlIIl[#("Qku")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("En")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("Vea")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("g1")]][ReeTHub_IllllIllIIIlIIl[#("rHS")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("ih6W")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("AG")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("j3S")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("ld")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("z4i")]][ReeTHub_IllllIllIIIlIIl[#("p0X4")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("7H")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("ZC8")]][ReeTHub_IllllIllIIIlIIl[#("AFyb")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Z3")]][ReeTHub_IllllIllIIIlIIl[#("vRO")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Vnqu")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("eM")]][ReeTHub_IllllIllIIIlIIl[#("1pC")]]=ReeTHub_IllllIllIIIlIIl[#("10Ge")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("QU")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("Ko7")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Q5")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("V2N")]][ReeTHub_IllllIllIIIlIIl[#("gYTk")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("pC")]]=ReeTHub_IllllIllIIIlIIl[#("gmg")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("iJ")]]=ReeTHub_IllllIllIIIlIIl[#("TLR")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("2m")]]=ReeTHub_IllllIllIIIlIIl[#("Cs6")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("4h")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("vup")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Q0")]][ReeTHub_IllllIllIIIlIIl[#("lBt")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("0puZ")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Ca")]][ReeTHub_IllllIllIIIlIIl[#("BYT")]]=ReeTHub_IllllIllIIIlIIl[#("XWb9")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Rk")]][ReeTHub_IllllIllIIIlIIl[#("fUX")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("ODUk")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Z0")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("6oM")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("VL")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("rnW")]][ReeTHub_IllllIllIIIlIIl[#("0tCX")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("JX")]]=ReeTHub_IllllIllIIIlIIl[#("uXl")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("mA")]]=ReeTHub_IllllIllIIIlIIl[#("adU")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Gj")]]=ReeTHub_IllllIllIIIlIIl[#("tYN")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("uc")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("8Tr")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("rf")]][ReeTHub_IllllIllIIIlIIl[#("JJE")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Z6OP")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("c4")]][ReeTHub_IllllIllIIIlIIl[#("Eff")]]=ReeTHub_IllllIllIIIlIIl[#("sL2i")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("ky")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("YWO")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Jo")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("QAv")]][ReeTHub_IllllIllIIIlIIl[#("ChML")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("T8")]]=ReeTHub_IllllIllIIIlIIl[#("JO3")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("1B")]]=ReeTHub_IllllIllIIIlIIl[#("oJd")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("1y")]]=ReeTHub_IllllIllIIIlIIl[#("dkS")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("gs")]]=ReeTHub_IllllIllIIIlIIl[#("hJ5")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("SS")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("7r7")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("xj")]][ReeTHub_IllllIllIIIlIIl[#("UEi")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("kjIe")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Ah")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("Rm5")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("HA")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("zH2")]][ReeTHub_IllllIllIIIlIIl[#("9lrH")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("vW")]]=ReeTHub_IllllIllIIIlIIl[#("DFP")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("LK")]]=ReeTHub_IllllIllIIIlIIl[#("Z2f")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("l9")]]=ReeTHub_IllllIllIIIlIIl[#("Gho")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("UE")]]=ReeTHub_IllllIllIIIlIIl[#("xY1")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("jP")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("0Bp")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("ED")]][ReeTHub_IllllIllIIIlIIl[#("CNy")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("yfuR")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Gl")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("GOS")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("6u")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("N07")]][ReeTHub_IllllIllIIIlIIl[#("Xx6k")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("dY")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("sZZ")]][ReeTHub_IllllIllIIIlIIl[#("3LQC")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("ei")]][ReeTHub_IllllIllIIIlIIl[#("3Ly")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("l33a")]];end;elseif ReeTHub_IIIllIIllIlIlIllllIl<=#("8snkiiTOvWVN0TiignUFd8nreJY2p81imqsuGpqVTxOC5hqnyJ5J1Sk9e5fKu1zx4NBJAYN179VQuWv")then if ReeTHub_IIIllIIllIlIlIllllIl<=#("sKEQcsqEgspKjRB17qHrRRYJ6eM17EOsKiqUyTtMv7DgJdSpJ3TeodpLV4U8QAHMP7aaAQEo655Uo")then local ReeTHub_lllIlIIIIllIIIlIlIlIIllll;local ReeTHub_IIIllIIllIlIlIllllIl;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Wl")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("l8m")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("RG")];ReeTHub_lllIlIIIIllIIIlIlIlIIllll=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("oY3")]];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl+1]=ReeTHub_lllIlIIIIllIIIlIlIlIIllll;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_lllIlIIIIllIIIlIlIlIIllll[ReeTHub_IllllIllIIIlIIl[#("H0jT")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Pq")]]=ReeTHub_IllllIllIIIlIIl[#("vQx")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("W4")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("rDB")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Z8")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("hKZ")]][ReeTHub_IllllIllIIIlIIl[#("QVyv")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("pm")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("kdv")]][ReeTHub_IllllIllIIIlIIl[#("OPhM")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("76")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("kRa")]][ReeTHub_IllllIllIIIlIIl[#("mpkv")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("rb")];ReeTHub_lllIlIIIIllIIIlIlIlIIllll=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("8ox")]];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl+1]=ReeTHub_lllIlIIIIllIIIlIlIlIIllll;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_lllIlIIIIllIIIlIlIlIIllll[ReeTHub_IllllIllIIIlIIl[#("flCg")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("sz")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl+1])ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];do return end;elseif ReeTHub_IIIllIIllIlIlIllllIl>#("a3xvsdVKdG3Q9D9v56A0CLcRZ3AEithGxd40MtgD1e3EgURbpL99tzqz0PGAOqCUyys5JiTL068xSI")then local ReeTHub_lllllllIIIIIIlllIIl;local ReeTHub_IIIllIIllIlIlIllllIl;ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("UH")];ReeTHub_lllllllIIIIIIlllIIl=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("djn")]];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl+1]=ReeTHub_lllllllIIIIIIlllIIl;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_lllllllIIIIIIlllIIl[ReeTHub_IllllIllIIIlIIl[#("JEfB")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("8g")]]=ReeTHub_IllllIllIIIlIIl[#("AV0")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("C7")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("VYQ")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("2D")];ReeTHub_lllllllIIIIIIlllIIl=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("D9o")]];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl+1]=ReeTHub_lllllllIIIIIIlllIIl;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_lllllllIIIIIIlllIIl[ReeTHub_IllllIllIIIlIIl[#("fsqk")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("fZ")]]=ReeTHub_lllIlIIIIllIIIlIlIlIIllll[ReeTHub_IllllIllIIIlIIl[#("z9E")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("2T")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Wm4")]][ReeTHub_IllllIllIIIlIIl[#("I6MF")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Dg")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("MIC")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("7Y")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Xv4")]][ReeTHub_IllllIllIIIlIIl[#("b8Kj")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Th")]]=ReeTHub_IllllIllIIIlIIl[#{"Kiriot is a panda !";"1 + 1 = 111";{249876;155084;70747;267791};}];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("DE")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("o6A")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("uy")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("ThA")]][ReeTHub_IllllIllIIIlIIl[#("nDeD")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#{"Wally is cute";{405004;807651;695221;752098};}]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("yzm")]][ReeTHub_IllllIllIIIlIIl[#("5SHY")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("bX")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("Dli")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Cy")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("VcE")]][ReeTHub_IllllIllIIIlIIl[#("vzdk")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("6y")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("pg2")]][ReeTHub_IllllIllIIIlIIl[#("mP6g")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("v2")]]=ReeTHub_IllllIllIIIlIIl[#("ss3")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("DA")]]=(ReeTHub_IllllIllIIIlIIl[#("4KO")]~=0);ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("70")]]=ReeTHub_IllllIllIIIlIIl[#("ehL")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("gW")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("JhK")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("kp")]]={};ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("P9")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("WJU")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("hH")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("uqe")]][ReeTHub_IllllIllIIIlIIl[#("uz7g")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("c3")]]=ReeTHub_IllllIllIIIlIIl[#("m4u")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("B1")]]=ReeTHub_IllllIllIIIlIIl[#("Ne2")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Da")]]=ReeTHub_IllllIllIIIlIIl[#("eId")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("va")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("obB")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("2x")]][ReeTHub_IllllIllIIIlIIl[#("VZg")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("pOQo")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("e9")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("KRA")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("2y")];ReeTHub_lllllllIIIIIIlllIIl=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("C0d")]];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl+1]=ReeTHub_lllllllIIIIIIlllIIl;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_lllllllIIIIIIlllIIl[ReeTHub_IllllIllIIIlIIl[#("gLrq")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("Xf")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl+1])else local ReeTHub_IIIllIIllIlIlIllllIl;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("b0")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("xPH")]][ReeTHub_IllllIllIIIlIIl[#("fAN8")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("YW")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("nql")]][ReeTHub_IllllIllIIIlIIl[#("xVD3")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("HY")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("oxT")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Ot")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("oCy")]][ReeTHub_IllllIllIIIlIIl[#("j3C1")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("nb")]]=ReeTHub_IllllIllIIIlIIl[#("djz")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("vE")]]=ReeTHub_IllllIllIIIlIIl[#("h6C")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("KV")]]=ReeTHub_IllllIllIIIlIIl[#("kTb")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("ss")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("FRZ")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];if(ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("UL")]]==ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("vbDo")]])then ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;else ReeTHub_IIIlIllIlllllI=ReeTHub_IllllIllIIIlIIl[#("blW")];end;end;elseif ReeTHub_IIIllIIllIlIlIllllIl<=#("fmyoHuim8XFa7XRZLNjgTBVCh1yixA3RreBmpb4AokuieiWXihxTJC0PB6hP6aZI3XS2xEKKTT2IfMy9f")then if ReeTHub_IIIllIIllIlIlIllllIl==#("apdki0nWWs4oDovXpqA3BOHWaZKrJZIiKx9KESP2OLSqQEqNmrxhJmjvTqktp5m6VVPgoVtHLHoZ6pgG")then local ReeTHub_lllllllIIIIIIlllIIl;local ReeTHub_IIIllIIllIlIlIllllIl;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("zp")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("bbm")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Ho")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("ZBJ")]][ReeTHub_IllllIllIIIlIIl[#("ZG7a")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("VA")]]=ReeTHub_IllllIllIIIlIIl[#("ghg")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("yP")]]=ReeTHub_lllIlIIIIllIIIlIlIlIIllll[ReeTHub_IllllIllIIIlIIl[#("tzL")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("tY")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("BrJ")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Kn")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("mb1")]][ReeTHub_IllllIllIIIlIIl[#("rcrO")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("q0")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("oQF")]][ReeTHub_IllllIllIIIlIIl[#("UgW0")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("FG")];ReeTHub_lllllllIIIIIIlllIIl=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("I67")]];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl+1]=ReeTHub_lllllllIIIIIIlllIIl;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_lllllllIIIIIIlllIIl[ReeTHub_IllllIllIIIlIIl[#("Wc8W")]];else local ReeTHub_IIIllIIllIlIlIllllIl;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Tn")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Q89")]][ReeTHub_IllllIllIIIlIIl[#("J5e6")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("xT")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("7B5")]][ReeTHub_IllllIllIIIlIIl[#("xlZt")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Qd")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("xdz")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Ai")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("N3m")]][ReeTHub_IllllIllIIIlIIl[#("eicV")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Rg")]]=ReeTHub_IllllIllIIIlIIl[#("gHu")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("kC")]]=ReeTHub_IllllIllIIIlIIl[#("Mvm")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("I8")]]=ReeTHub_IllllIllIIIlIIl[#("jST")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("Lq")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("6b0")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];if(ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("JS")]]~=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("KCNX")]])then ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;else ReeTHub_IIIlIllIlllllI=ReeTHub_IllllIllIIIlIIl[#("jdC")];end;end;elseif ReeTHub_IIIllIIllIlIlIllllIl==#("6fqCAJymO1mIvMSzVG4ZjzC80Gc7tzDkOVt05Fvmr4K4g8p4GBkUlQzIOsM3HA3oyb4Ls2DqjSIpYH11qh")then ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("YE")]]();else local ReeTHub_lllllllIIIIIIlllIIl;local ReeTHub_IIIllIIllIlIlIllllIl;ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("a3")];ReeTHub_lllllllIIIIIIlllIIl=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("zJu")]];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl+1]=ReeTHub_lllllllIIIIIIlllIIl;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_lllllllIIIIIIlllIIl[ReeTHub_IllllIllIIIlIIl[#("uEZS")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("pY")]]=ReeTHub_IllllIllIIIlIIl[#("v3c")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("Dz")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("MZ1")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("DS")];ReeTHub_lllllllIIIIIIlllIIl=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("DzB")]];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl+1]=ReeTHub_lllllllIIIIIIlllIIl;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_lllllllIIIIIIlllIIl[ReeTHub_IllllIllIIIlIIl[#("cgLt")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("c4")]]=ReeTHub_lllIlIIIIllIIIlIlIlIIllll[ReeTHub_IllllIllIIIlIIl[#("LoB")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("O2")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("V91")]][ReeTHub_IllllIllIIIlIIl[#("tdRR")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("9f")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("RWU")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("x6")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("np3")]][ReeTHub_IllllIllIIIlIIl[#("3CaS")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("ei")]]=ReeTHub_IllllIllIIIlIIl[#("C1R")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("yY")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("lux")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("C1")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("sey")]][ReeTHub_IllllIllIIIlIIl[#("fn8Z")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Cz")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("0yQ")]][ReeTHub_IllllIllIIIlIIl[#{"Retard gonna sey they are gonna deobfuscate this";{191081;245609;533079;981136};{504503;293249;600966;886262};"Kiriot love sex";}]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("YC")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("LZI")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("cS")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("NhK")]][ReeTHub_IllllIllIIIlIIl[#("uAkU")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("5f")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Sgs")]][ReeTHub_IllllIllIIIlIIl[#("fgvH")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("nI")]]=ReeTHub_IllllIllIIIlIIl[#("jR5")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("q5")]]=(ReeTHub_IllllIllIIIlIIl[#("5s3")]~=0);ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("7Z")]]=ReeTHub_IllllIllIIIlIIl[#("S3Z")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("uO")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("1Rb")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("mk")]]={};ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("ee")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("LGy")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Pb")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("gmV")]][ReeTHub_IllllIllIIIlIIl[#("pLFl")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("bL")]]=ReeTHub_IllllIllIIIlIIl[#("R85")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("BZ")]]=ReeTHub_IllllIllIIIlIIl[#("qrZ")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Z6")]]=ReeTHub_IllllIllIIIlIIl[#("bXK")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("vB")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("jbz")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("q0")]][ReeTHub_IllllIllIIIlIIl[#("FdZ")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("aCvZ")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("Kh")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("aqd")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("kF")];ReeTHub_lllllllIIIIIIlllIIl=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("f3X")]];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl+1]=ReeTHub_lllllllIIIIIIlllIIl;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_lllllllIIIIIIlllIIl[ReeTHub_IllllIllIIIlIIl[#("hB48")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("lg")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl+1])end;elseif ReeTHub_IIIllIIllIlIlIllllIl<=#("2oS88vVmN2CP1auGeePMO83KEijUgBUNA9aaPd6oHP0zScQoDbWXMFW4uiFZlbglhYp2au0bhAe9iF1BC5qfP7b4mfQHIgcGJ")then if ReeTHub_IIIllIIllIlIlIllllIl<=#("q3XYnikVPlBWWZqdyqUaHkXvP4OtDbxJBEo8OORi44rZEAt1pFTWVIgfgBisE1rOY1vrKsAUKMgN372oLXd8sLY3yj")then if ReeTHub_IIIllIIllIlIlIllllIl<=#("mFyOdMObMecq7e9liBEmiJ4SRYsuncC4BBmpl8cao6pjJHg3szQC47TNKQ7pssXJMh0G2U9kyD7ltUikSAbYxa")then if ReeTHub_IIIllIIllIlIlIllllIl<=#("DSJPGbXR6iQHBQKbJAFdB9Ht0HWI3q9lMhxYseEiLVbdOmSEhyDz16JDlpZ9opYPjE4ssWTE5xDQ8EPNYsAG")then local ReeTHub_lllllllIIIIIIlllIIl;local ReeTHub_IIIllIIllIlIlIllllIl;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("rM")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("S9D")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("M8")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("6IP")]][ReeTHub_IllllIllIIIlIIl[#("hF9L")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Dp")]]=ReeTHub_IllllIllIIIlIIl[#("xIu")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Al")]]=ReeTHub_lllIlIIIIllIIIlIlIlIIllll[ReeTHub_IllllIllIIIlIIl[#("eTo")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("2Z")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("hAH")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Ai")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("g0Y")]][ReeTHub_IllllIllIIIlIIl[#("8fpv")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("99")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("xdx")]][ReeTHub_IllllIllIIIlIIl[#("436F")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("e5")];ReeTHub_lllllllIIIIIIlllIIl=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("49o")]];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl+1]=ReeTHub_lllllllIIIIIIlllIIl;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_lllllllIIIIIIlllIIl[ReeTHub_IllllIllIIIlIIl[#("WfEC")]];elseif ReeTHub_IIIllIIllIlIlIllllIl>#("LuQJ3NcpE4u7v4jrzkvP8DFE3FSKlk60s1IjoUzjQoCChTNJFuzhe00iZlQz4Cds8FPFvadPVm8Uacvk2ie1W")then local ReeTHub_IIIllIIllIlIlIllllIl;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("fF")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("ENy")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("RF")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("tNP")]][ReeTHub_IllllIllIIIlIIl[#("FSWt")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("YZ")]]=ReeTHub_IllllIllIIIlIIl[#("xCk")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Tj")]]=ReeTHub_IllllIllIIIlIIl[#("SzN")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("jm")]]=ReeTHub_IllllIllIIIlIIl[#("c9Y")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("U3")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("xnf")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Y0")]][ReeTHub_IllllIllIIIlIIl[#("lAK")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#{"Wally is cute";"Arilis ate a panda once kiriot is sad and aztup too";"Wally is cute";"Arilis ate a panda once kiriot is sad and aztup too";}]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("MS")]][ReeTHub_IllllIllIIIlIIl[#("koc")]]=ReeTHub_IllllIllIIIlIIl[#("3FlX")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("YV")]][ReeTHub_IllllIllIIIlIIl[#("s86")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("KhVU")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("im")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("vnU")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Jm")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("V5n")]][ReeTHub_IllllIllIIIlIIl[#("kujy")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("6G")]]=ReeTHub_IllllIllIIIlIIl[#("Q1t")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("QV")]]=ReeTHub_IllllIllIIIlIIl[#("Bfy")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("HL")]]=ReeTHub_IllllIllIIIlIIl[#("lKa")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("Ei")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("HG0")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("1p")]][ReeTHub_IllllIllIIIlIIl[#("dWB")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("gF0a")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("5p")]][ReeTHub_IllllIllIIIlIIl[#("zWN")]]=ReeTHub_IllllIllIIIlIIl[#("b7CB")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("bq")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("Dk5")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("QE")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("ps4")]][ReeTHub_IllllIllIIIlIIl[#("ATQF")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("P3")]]=ReeTHub_IllllIllIIIlIIl[#("aAl")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("kQ")]]=ReeTHub_IllllIllIIIlIIl[#("fLC")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("xk")]]=ReeTHub_IllllIllIIIlIIl[#("0hm")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Im")]]=ReeTHub_IllllIllIIIlIIl[#("7Q4")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("Ed")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("xZC")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Aq")]][ReeTHub_IllllIllIIIlIIl[#("Ffq")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("q3GF")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("ri")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("nKG")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("M6")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("jJQ")]][ReeTHub_IllllIllIIIlIIl[#("zSjA")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Bn")]]=ReeTHub_IllllIllIIIlIIl[#("PKp")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("bI")]]=ReeTHub_IllllIllIIIlIIl[#("tGY")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Lq")]]=ReeTHub_IllllIllIIIlIIl[#("uur")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Rb")]]=ReeTHub_IllllIllIIIlIIl[#("K4X")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("cx")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("pfC")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Th")]][ReeTHub_IllllIllIIIlIIl[#("165")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("PuUk")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Tt")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("jsg")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("pB")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("fl5")]][ReeTHub_IllllIllIIIlIIl[#("jIzT")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("7L")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Ctd")]][ReeTHub_IllllIllIIIlIIl[#("Q1l4")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("0y")]][ReeTHub_IllllIllIIIlIIl[#("AXG")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("6cVu")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("md")]][ReeTHub_IllllIllIIIlIIl[#("b9N")]]=ReeTHub_IllllIllIIIlIIl[#("1Bph")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("nU")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("X9s")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Qu")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("WTa")]][ReeTHub_IllllIllIIIlIIl[#("rZOE")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("b7")]]=ReeTHub_IllllIllIIIlIIl[#("hpa")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("NX")]]=ReeTHub_IllllIllIIIlIIl[#("Ou8")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("qy")]]=ReeTHub_IllllIllIIIlIIl[#("zrv")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("tI")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("AbZ")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("L3")]][ReeTHub_IllllIllIIIlIIl[#("0zx")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("zvBV")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Cl")]][ReeTHub_IllllIllIIIlIIl[#("JKy")]]=ReeTHub_IllllIllIIIlIIl[#("Qnrd")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Vd")]][ReeTHub_IllllIllIIIlIIl[#("sWh")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("1t6F")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("4V")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("9XT")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("SF")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("l0i")]][ReeTHub_IllllIllIIIlIIl[#("ASLQ")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("4Y")]]=ReeTHub_IllllIllIIIlIIl[#("suU")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Dc")]]=ReeTHub_IllllIllIIIlIIl[#("ZED")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("vR")]]=ReeTHub_IllllIllIIIlIIl[#("OEU")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("gM")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("kcD")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("iR")]][ReeTHub_IllllIllIIIlIIl[#("xHG")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("x6YV")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("hG")]][ReeTHub_IllllIllIIIlIIl[#("1jA")]]=ReeTHub_IllllIllIIIlIIl[#("nfMk")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("tL")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("mZc")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("uV")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("I97")]][ReeTHub_IllllIllIIIlIIl[#("t35H")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("P5")]]=ReeTHub_IllllIllIIIlIIl[#("2N7")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Qg")]]=ReeTHub_IllllIllIIIlIIl[#("PqO")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("e5")]]=ReeTHub_IllllIllIIIlIIl[#("hOn")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("ev")]]=ReeTHub_IllllIllIIIlIIl[#("bv8")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("q1")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("uva")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("pp")]][ReeTHub_IllllIllIIIlIIl[#("tLu")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("uBBU")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("qv")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("422")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("jM")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("C1l")]][ReeTHub_IllllIllIIIlIIl[#("SVSb")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("TX")]]=ReeTHub_IllllIllIIIlIIl[#("Gk3")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("cy")]]=ReeTHub_IllllIllIIIlIIl[#("f7S")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("YK")]]=ReeTHub_IllllIllIIIlIIl[#("3CA")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("eX")]]=ReeTHub_IllllIllIIIlIIl[#("5L0")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("FP")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("0fq")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("jb")]][ReeTHub_IllllIllIIIlIIl[#("9tp")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("HEVk")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("ue")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("sXL")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("O0")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("zOM")]][ReeTHub_IllllIllIIIlIIl[#("Kn8G")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("te")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("DKs")]][ReeTHub_IllllIllIIIlIIl[#("CHQy")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("8d")]][ReeTHub_IllllIllIIIlIIl[#("CA1")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("LLg7")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("9G")]][ReeTHub_IllllIllIIIlIIl[#("O5U")]]=ReeTHub_IllllIllIIIlIIl[#("7zA3")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("57")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("kgo")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("7b")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("cbj")]][ReeTHub_IllllIllIIIlIIl[#("9q0I")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("zp")]]=ReeTHub_IllllIllIIIlIIl[#("K9O")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Gl")]]=ReeTHub_IllllIllIIIlIIl[#("5Np")];else if(ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("yU")]]~=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("MoX7")]])then ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;else ReeTHub_IIIlIllIlllllI=ReeTHub_IllllIllIIIlIIl[#("v5Q")];end;end;elseif ReeTHub_IIIllIIllIlIlIllllIl<=#("VCbAtcdaookiEMdhnFrUv12fhWZGHWxmHjTmD6QaLV7UJ2JUgU5KKbD4K5sImIDC18Mt20PqYqiK3hHpmfAX1XNF")then if ReeTHub_IIIllIIllIlIlIllllIl==#("ZNINiXcrG2Lpp1pfOWs32aCzduhiQLevhNdngNPEfsyo597njSmatMZZljKXQ4M4YpiNYb8agYXJMmDdx387ydb")then ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Kg")]]=ReeTHub_IllllIllIIIlIIl[#("ZkV")];else local ReeTHub_lllllllIIIIIIlllIIl;local ReeTHub_IIIllIIllIlIlIllllIl;ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("2Y")];ReeTHub_lllllllIIIIIIlllIIl=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("r8A")]];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl+1]=ReeTHub_lllllllIIIIIIlllIIl;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_lllllllIIIIIIlllIIl[ReeTHub_IllllIllIIIlIIl[#("TtCL")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("ae")]]=ReeTHub_IllllIllIIIlIIl[#("o3I")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("KS")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("Jxg")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("IZ")];ReeTHub_lllllllIIIIIIlllIIl=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("JrV")]];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl+1]=ReeTHub_lllllllIIIIIIlllIIl;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_lllllllIIIIIIlllIIl[ReeTHub_IllllIllIIIlIIl[#("g5zS")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Of")]]=ReeTHub_lllIlIIIIllIIIlIlIlIIllll[ReeTHub_IllllIllIIIlIIl[#("EpP")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("ZK")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("5g6")]][ReeTHub_IllllIllIIIlIIl[#("XUdY")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("sm")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("kIb")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("j5")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("oFd")]][ReeTHub_IllllIllIIIlIIl[#("hPUc")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Ki")]]=ReeTHub_IllllIllIIIlIIl[#("v2b")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("K6")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("LTh")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Vz")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("CKN")]][ReeTHub_IllllIllIIIlIIl[#("he1I")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("eg")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("GeT")]][ReeTHub_IllllIllIIIlIIl[#("syBq")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("V4")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("ksW")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("vx")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("FrB")]][ReeTHub_IllllIllIIIlIIl[#("mTSI")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("m1")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("cLp")]][ReeTHub_IllllIllIIIlIIl[#("rjGB")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("o2")]]=ReeTHub_IllllIllIIIlIIl[#("1ZZ")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#{{791097;625495;815802;352733};"youtube.com/watch?v=pjJ2w1FX_Wg";}]]=(ReeTHub_IllllIllIIIlIIl[#("sfZ")]~=0);ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("2r")]]=ReeTHub_IllllIllIIIlIIl[#("pSW")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("tT")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("h8a")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("TA")]]={};ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("r9")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("Dxs")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("aX")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#{{165933;248797;590313;265209};{675024;965206;13550;103093};"youtube.com/watch?v=pjJ2w1FX_Wg";}]][ReeTHub_IllllIllIIIlIIl[#("caRV")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("JJ")]]=ReeTHub_IllllIllIIIlIIl[#("TEG")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Ke")]]=ReeTHub_IllllIllIIIlIIl[#("CZa")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Z6")]]=ReeTHub_IllllIllIIIlIIl[#("ECZ")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("R6")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("UJp")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("yu")]][ReeTHub_IllllIllIIIlIIl[#("odY")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("onba")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("IX")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("HbC")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("j3")];ReeTHub_lllllllIIIIIIlllIIl=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("rfS")]];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl+1]=ReeTHub_lllllllIIIIIIlllIIl;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_lllllllIIIIIIlllIIl[ReeTHub_IllllIllIIIlIIl[#("6EUg")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("dV")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl+1])ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIlIllIlllllI=ReeTHub_IllllIllIIIlIIl[#("ri1")];end;elseif ReeTHub_IIIllIIllIlIlIllllIl>#("Xnc7d2YlQEBQ0uAiTm4GYpm8RGBW5OGVnNZK9b7oaM3iWWmcE0oljGRIbepHBbpc7QCnGZiSoPFmxdl4szsfAtLS6")then local ReeTHub_lllllllIIIIIIlllIIl;local ReeTHub_IIIllIIllIlIlIllllIl;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Yc")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("q3u")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("7d")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("KVo")]][ReeTHub_IllllIllIIIlIIl[#("OD39")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Hm")]]=ReeTHub_IllllIllIIIlIIl[#("RVp")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("9Q")]]=ReeTHub_lllIlIIIIllIIIlIlIlIIllll[ReeTHub_IllllIllIIIlIIl[#("izL")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("im")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("h11")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Fc")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("ifz")]][ReeTHub_IllllIllIIIlIIl[#("SFiG")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("eM")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("c9W")]][ReeTHub_IllllIllIIIlIIl[#("ebFM")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("Zu")];ReeTHub_lllllllIIIIIIlllIIl=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("huT")]];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl+1]=ReeTHub_lllllllIIIIIIlllIIl;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_lllllllIIIIIIlllIIl[ReeTHub_IllllIllIIIlIIl[#("8jsk")]];else ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("QT")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("K5v")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("y1")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("nB1")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("tF")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("YyV")]][ReeTHub_IllllIllIIIlIIl[#("hygT")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("LW")]]=(not ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("VWy")]]);ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("l2")]][ReeTHub_IllllIllIIIlIIl[#("FYI")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("evAi")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];do return end;end;elseif ReeTHub_IIIllIIllIlIlIllllIl<=#("J5VAX9v0lgt9GORG6EaEl82vncSkMNeUqoqm6Z2G0G2eKs2Py3ygSDgLdAmUqloIcKTryFJhMFNPfXV4kdWSp7bYiQjHM")then if ReeTHub_IIIllIIllIlIlIllllIl<=#("oPrtc9KLr3upFmZBFpOrJnAGreI5jRubFEp8yVVWuKV3yaCZ8Rk43uIapWc7BPBKJsUb61dTF179DGhrMT6CGAhk5pT")then ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Ck")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("rfV")]];elseif ReeTHub_IIIllIIllIlIlIllllIl==#("TXuQilufpB2hOCAcyJITOUvRS9dikKfRiCaSGr1qlccl1ZXeafXxR978CO7ihl4Pvl9mBSGfSqHMSj03l9heXT9iEbp2")then local ReeTHub_IlIIllIIlIlllIIllII;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("9y")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("EOW")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("6A")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("82s")]][ReeTHub_IllllIllIIIlIIl[#("T9M0")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("4O")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("c4f")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IlIIllIIlIlllIIllII=ReeTHub_IllllIllIIIlIIl[#("W8")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IlIIllIIlIlllIIllII]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IlIIllIIlIlllIIllII](ReeTHub_llIlIlllIlIIIlI[ReeTHub_IlIIllIIlIlllIIllII+1])ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("K8")]]();else ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("zq")]]=(not ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("dUR")]]);end;elseif ReeTHub_IIIllIIllIlIlIllllIl<=#("Sj9hxZQZLNsKROBDuqrXe7ieZ2Nl0SACNWahHEvukdLvYEgeJQjU8foUa5sEmE92m174Os5147MbvXpuWIMkJPDIHpgMl1h")then if ReeTHub_IIIllIIllIlIlIllllIl>#("eTi7HlAqVsZbDnznP7SO2YtIyzyzmsPdZ67NOsXKivAqZCet027oiDYpALJiYbdCNWmHqVJxjhGGycS6teItvB4vhRndTP")then ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("kj")]][ReeTHub_IllllIllIIIlIIl[#("ax6")]]=ReeTHub_IllllIllIIIlIIl[#("YpGn")];else local ReeTHub_IIIllIIllIlIlIllllIl;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("kQ")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("uO5")]][ReeTHub_IllllIllIIIlIIl[#("H1kZ")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("GH")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("M31")]][ReeTHub_IllllIllIIIlIIl[#("mSAV")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Ct")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("Wsd")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("CN")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("jkv")]][ReeTHub_IllllIllIIIlIIl[#("XkKs")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("dZ")]]=ReeTHub_IllllIllIIIlIIl[#("PqF")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("BU")]]=ReeTHub_IllllIllIIIlIIl[#("ezT")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("MD")]]=ReeTHub_IllllIllIIIlIIl[#("QkZ")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("dI")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("h2A")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];if(ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Pa")]]==ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("qvkM")]])then ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;else ReeTHub_IIIlIllIlllllI=ReeTHub_IllllIllIIIlIIl[#("j90")];end;end;elseif ReeTHub_IIIllIIllIlIlIllllIl==#("hr8OdpIcfsLea6r1x3NYTDUgl10zKIGNEuzoAzORWbDaVx3A0Z1kg1cOI1ClAiDHX7KQIdB8o6bSaTuZ8BJURuGNrVQI6CrN")then local ReeTHub_IIIllIIllIlIlIllllIl;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("uW")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("SG7")]][ReeTHub_IllllIllIIIlIIl[#("xeap")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Jq")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("aaK")]][ReeTHub_IllllIllIIIlIIl[#("eAPd")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("xZ")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("0Ld")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("DA")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("ygb")]][ReeTHub_IllllIllIIIlIIl[#("TNf9")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("jD")]]=ReeTHub_IllllIllIIIlIIl[#("2aR")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Pt")]]=ReeTHub_IllllIllIIIlIIl[#("5eK")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("RH")]]=ReeTHub_IllllIllIIIlIIl[#("egl")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("U7")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("2ju")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];if(ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("aJ")]]~=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("qmr9")]])then ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;else ReeTHub_IIIlIllIlllllI=ReeTHub_IllllIllIIIlIIl[#("tG2")];end;else local ReeTHub_IIIIIllIIllIllI=ReeTHub_IllllIllIIIlIIl[#("ig")];local ReeTHub_IIIlIllIlllllI=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("tA6")]];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIIIllIIllIllI+1]=ReeTHub_IIIlIllIlllllI;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIIIllIIllIllI]=ReeTHub_IIIlIllIlllllI[ReeTHub_IllllIllIIIlIIl[#("v6P9")]];end;elseif ReeTHub_IIIllIIllIlIlIllllIl<=#("5mXWn1Wy25kZuOYHNn9JT0DB7yXx3bWOyjeGIdUJXvYzvX7g2btoseZeUvY0eAF1jGCkJs8JEAWxcdfkAQF1RIvtu9Vmo3Ex16p0uWHJ")then if ReeTHub_IIIllIIllIlIlIllllIl<=#("UV2rDcRqOAy4OkLjh0KHVuK6zGfXoZNj5X6XEc27e6KDgDmWOQn67crAk62763bZXo90nYQf7NCZUg06stiJMRl2FHMIk5ak5VQ1")then if ReeTHub_IIIllIIllIlIlIllllIl<=#("xI0ah8uKCPeg5PMUCmgcguQlh5cMq48A8D5VsIES1sd2ICopyBDIKYyb2P2m5TtIQOhCT1C3TykYrYNQQWn0CAZjf43NQqWi8F")then local ReeTHub_IlIIllIIlIlllIIllII;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("O0")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("Y8a")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Ng")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("g6x")]][ReeTHub_IllllIllIIIlIIl[#("IAsp")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("J3")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("0Rc")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IlIIllIIlIlllIIllII=ReeTHub_IllllIllIIIlIIl[#("AQ")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IlIIllIIlIlllIIllII]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IlIIllIIlIlllIIllII](ReeTHub_llIlIlllIlIIIlI[ReeTHub_IlIIllIIlIlllIIllII+1])ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("n7")]]();elseif ReeTHub_IIIllIIllIlIlIllllIl>#("4tWHH8JZlNJTeblHiFDgpY7xY7YnCMcZXMTx3pQ12LOGGkZLEUNNGz5fvATJkuxKLU6CsZN3ZMnPkC0OimUS8ztyRNaEHgRInd5")then local ReeTHub_IlIIllIIlIlllIIllII;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("BC")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("s45")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("2y")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("5Ga")]][ReeTHub_IllllIllIIIlIIl[#("Df4f")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("l8")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("YP1")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IlIIllIIlIlllIIllII=ReeTHub_IllllIllIIIlIIl[#("OK")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IlIIllIIlIlllIIllII]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IlIIllIIlIlllIIllII](ReeTHub_llIlIlllIlIIIlI[ReeTHub_IlIIllIIlIlllIIllII+1])ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("eI")]]();else local ReeTHub_lllllllIIIIIIlllIIl;local ReeTHub_IIIllIIllIlIlIllllIl;ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("un")];ReeTHub_lllllllIIIIIIlllIIl=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("p3J")]];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl+1]=ReeTHub_lllllllIIIIIIlllIIl;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_lllllllIIIIIIlllIIl[ReeTHub_IllllIllIIIlIIl[#("C05M")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("LY")]]=ReeTHub_IllllIllIIIlIIl[#("o2A")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("vH")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("eNh")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("Xg")];ReeTHub_lllllllIIIIIIlllIIl=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("dFu")]];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl+1]=ReeTHub_lllllllIIIIIIlllIIl;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_lllllllIIIIIIlllIIl[ReeTHub_IllllIllIIIlIIl[#("Wdvt")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("9q")]]=ReeTHub_lllIlIIIIllIIIlIlIlIIllll[ReeTHub_IllllIllIIIlIIl[#("Tle")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("jH")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("gm1")]][ReeTHub_IllllIllIIIlIIl[#("kfKb")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("mJ")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("Kon")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#{"Arilis ate a panda once kiriot is sad and aztup too";"Kiriot is a panda !";}]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Acq")]][ReeTHub_IllllIllIIIlIIl[#("dekC")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("3D")]]=ReeTHub_IllllIllIIIlIIl[#("htZ")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("c9")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("yFV")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("SE")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("qKe")]][ReeTHub_IllllIllIIIlIIl[#("BAbX")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Of")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("X9K")]][ReeTHub_IllllIllIIIlIIl[#("PhzW")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("rN")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("k3k")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Ue")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("LQK")]][ReeTHub_IllllIllIIIlIIl[#("NT9m")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Nf")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("bir")]][ReeTHub_IllllIllIIIlIIl[#("ArQt")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Yl")]]=ReeTHub_IllllIllIIIlIIl[#("OMc")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("OE")]]=(ReeTHub_IllllIllIIIlIIl[#("v8Z")]~=0);ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Y2")]]=ReeTHub_IllllIllIIIlIIl[#("QgT")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("LO")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("Af4")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("9R")]]={};ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("St")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("hkM")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Ze")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("PYN")]][ReeTHub_IllllIllIIIlIIl[#("sKuJ")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("ev")]]=ReeTHub_IllllIllIIIlIIl[#("1OI")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("y2")]]=ReeTHub_IllllIllIIIlIIl[#("TVl")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("1D")]]=ReeTHub_IllllIllIIIlIIl[#("nVt")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("kd")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("Ict")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Bf")]][ReeTHub_IllllIllIIIlIIl[#("kZT")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("CZr7")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("jz")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("j6l")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("D3")];ReeTHub_lllllllIIIIIIlllIIl=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Vd6")]];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl+1]=ReeTHub_lllllllIIIIIIlllIIl;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_lllllllIIIIIIlllIIl[ReeTHub_IllllIllIIIlIIl[#("y4Cr")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("xc")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl+1])ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIlIllIlllllI=ReeTHub_IllllIllIIIlIIl[#("GRu")];end;elseif ReeTHub_IIIllIIllIlIlIllllIl<=#("oxsOhUY3lp54JfB7KPLmBJVPYjxS4QBgHezV4gLoKAmBSg4BQT7JCSuPMOZ7xg9FZYyFQPdEdxMbvt6Ro5ckS1PYUTipqN2EARL4TA")then if ReeTHub_IIIllIIllIlIlIllllIl==#("aQDGfgstsRiTBdYX7jKU6GXnBFiLPSb8ZjbFovJRBA0Ii4BAM4OVjPZF3peL8SPKQj3qctIMK2sGPofHdS8UeqYjuGL9q8TTVq28a")then ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Er")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("9Gk")]][ReeTHub_IllllIllIIIlIIl[#("cZh6")]];else local ReeTHub_IIIllIIllIlIlIllllIl;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Xb")]]=ReeTHub_lllIlIIIIllIIIlIlIlIIllll[ReeTHub_IllllIllIIIlIIl[#("Byb")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("yX")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("4Fa")]][ReeTHub_IllllIllIIIlIIl[#("POJv")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("PT")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Wp9")]][ReeTHub_IllllIllIIIlIIl[#("Cfym")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Hp")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("1XA")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("j6")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("eJx")]][ReeTHub_IllllIllIIIlIIl[#("Vz1d")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("EA")]]=ReeTHub_IllllIllIIIlIIl[#("CcQ")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("XI")]]=ReeTHub_IllllIllIIIlIIl[#("ZvS")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("eJ")]]=ReeTHub_IllllIllIIIlIIl[#("BEP")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("bx")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("2My")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];if(ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("aR")]]==ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("0fDG")]])then ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;else ReeTHub_IIIlIllIlllllI=ReeTHub_IllllIllIIIlIIl[#("YYi")];end;end;elseif ReeTHub_IIIllIIllIlIlIllllIl>#("ysvblrvt0OkIHpT4FzuU6GSJuLiKVyvgG4uQzceHXbQ6ZSCD90VDNqm1LXRKiWICsdcN5dGDuY650VTMjQL4M2DpRDeLvFzbDoOVQYH")then local ReeTHub_IlIIllIIlIlllIIllII;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("U3")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("6IT")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("7e")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("e29")]][ReeTHub_IllllIllIIIlIIl[#("ZZCJ")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("UX")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("rGV")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IlIIllIIlIlllIIllII=ReeTHub_IllllIllIIIlIIl[#("kW")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IlIIllIIlIlllIIllII]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IlIIllIIlIlllIIllII](ReeTHub_llIlIlllIlIIIlI[ReeTHub_IlIIllIIlIlllIIllII+1])ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("BM")]]();else ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("4s")]][ReeTHub_IllllIllIIIlIIl[#("jpp")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("TqSZ")]];end;elseif ReeTHub_IIIllIIllIlIlIllllIl<=#("usiZuqb0deADkNZAKW5D94gZz4DLg76uiPKtTO5BCoHre60ZAnl33e6AmsAAYATghftGdGQ61FaUxZVDdOl2WcCdSjgAnFMcFBj9MuV3Hpc")then if ReeTHub_IIIllIIllIlIlIllllIl<=#("eldyH7xkn1ufNpY4zqSx27p6PW0T2ruGad9GfT2piCZOgdvvH1FqHPGg6hSVgOr5GYfKqrYPyCoAiMZLBFmbXe8uH2K8bhjFk3ir8Wfoc")then local ReeTHub_lllllllIIIIIIlllIIl;local ReeTHub_IIIllIIllIlIlIllllIl;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("m3")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("Svf")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("0R")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("WEn")]][ReeTHub_IllllIllIIIlIIl[#("LjTs")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("tT")]]=ReeTHub_IllllIllIIIlIIl[#("L8l")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Zx")]]=ReeTHub_lllIlIIIIllIIIlIlIlIIllll[ReeTHub_IllllIllIIIlIIl[#("ANa")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("ZP")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("AR8")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("HX")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("skL")]][ReeTHub_IllllIllIIIlIIl[#("Pb8V")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("am")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("v9o")]][ReeTHub_IllllIllIIIlIIl[#("vCee")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("8T")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Tn1")]][ReeTHub_IllllIllIIIlIIl[#("9cyY")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("uN")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("x9e")]][ReeTHub_IllllIllIIIlIIl[#("6xLS")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("TK2")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("qN")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Wg")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("tC4")]][ReeTHub_IllllIllIIIlIIl[#("ZlaV")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("nY")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#{"Arilis ate a panda once kiriot is sad and aztup too";{966629;61838;701886;393546};"Kiriot is a panda !";}]][ReeTHub_IllllIllIIIlIIl[#("lyJA")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("R3")];ReeTHub_lllllllIIIIIIlllIIl=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("FEb")]];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl+1]=ReeTHub_lllllllIIIIIIlllIIl;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_lllllllIIIIIIlllIIl[ReeTHub_IllllIllIIIlIIl[#("LPJu")]];elseif ReeTHub_IIIllIIllIlIlIllllIl==#("3eBf7trgtMBqhCZVcySZOpsUpoEHNPz787k34C5pR4YId3VRDnTSHmlOWQZT0UEPmErkq50KDCiTCVRvEWeA5RBVVGhnMmz6BiuJMLAHxi")then ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("qvf")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("1N")]];else ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("74")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Vin")]][ReeTHub_IllllIllIIIlIIl[#("ZgRR")]];end;elseif ReeTHub_IIIllIIllIlIlIllllIl<=#("eeDma9EoeQdTGdGAVYM8qdlrsBhU2xHcWCvRrtgoi7uqxzZGfkOTUk8b3k4K1TvRia7dRZhCRy0tS443LMOSSYsMEuXhAGxzLOixCWYqdmcvu")then if ReeTHub_IIIllIIllIlIlIllllIl>#("s9pa8oeO8uSuJxbabkaBTeVIBZYyOFW6qZbY1zHht6PYOgmBpdl1v45nnRJiBRaDJWeUumiNN3gWA74tNxhLt4Lx3XLjZyRM6lp2cDfc4InC")then ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Yu")]]=ReeTHub_lllIlIIIIllIIIlIlIlIIllll[ReeTHub_IllllIllIIIlIIl[#("psI")]];else local ReeTHub_IIIllIIllIlIlIllllIl;ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("t4")]][ReeTHub_IllllIllIIIlIIl[#("gI2")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("yVxg")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("W3")]][ReeTHub_IllllIllIIIlIIl[#("IIH")]]=ReeTHub_IllllIllIIIlIIl[#("Q24r")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("en")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("ZHK")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("8G")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("pFp")]][ReeTHub_IllllIllIIIlIIl[#("nJah")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("6d")]]=ReeTHub_IllllIllIIIlIIl[#("QKA")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Hd")]]=ReeTHub_IllllIllIIIlIIl[#("mzx")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("yL")]]=ReeTHub_IllllIllIIIlIIl[#("4HS")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("nZ")]]=ReeTHub_IllllIllIIIlIIl[#("vfl")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("ji")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("3I9")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Hb")]][ReeTHub_IllllIllIIIlIIl[#("23f")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("DanS")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("nG")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("7kN")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("P6")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Vnr")]][ReeTHub_IllllIllIIIlIIl[#("73OX")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("g9")]]=ReeTHub_IllllIllIIIlIIl[#("2Mg")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("7j")]]=ReeTHub_IllllIllIIIlIIl[#("3tj")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("OT")]]=ReeTHub_IllllIllIIIlIIl[#("l1F")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("h5")]]=ReeTHub_IllllIllIIIlIIl[#("07E")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("oB")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("uJ8")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("jB")]][ReeTHub_IllllIllIIIlIIl[#("FhT")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("tEd8")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("qf")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("EDr")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("6M")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("VNp")]][ReeTHub_IllllIllIIIlIIl[#("0Q40")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("GH")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("oCR")]][ReeTHub_IllllIllIIIlIIl[#("dZ4j")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("uU")]][ReeTHub_IllllIllIIIlIIl[#("9Gh")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("sEqK")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Wq")]][ReeTHub_IllllIllIIIlIIl[#("yr7")]]=ReeTHub_IllllIllIIIlIIl[#("cPBA")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("xA")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("zeg")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("cB")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("R4y")]][ReeTHub_IllllIllIIIlIIl[#("Y29d")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("pK")]]=ReeTHub_IllllIllIIIlIIl[#("pKV")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#{"youtube.com/watch?v=pjJ2w1FX_Wg";{771956;737745;772539;466085};}]]=ReeTHub_IllllIllIIIlIIl[#("3tl")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("ar")]]=ReeTHub_IllllIllIIIlIIl[#("bh6")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("7d")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("LYW")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Jz")]][ReeTHub_IllllIllIIIlIIl[#("qUT")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("FgJp")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Ok")]][ReeTHub_IllllIllIIIlIIl[#("Bzt")]]=ReeTHub_IllllIllIIIlIIl[#("mZ5K")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("CB")]][ReeTHub_IllllIllIIIlIIl[#("kSy")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("IOju")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("zs")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("xsu")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("yu")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("oeA")]][ReeTHub_IllllIllIIIlIIl[#("Ngdu")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("C2")]]=ReeTHub_IllllIllIIIlIIl[#("Q60")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Yh")]]=ReeTHub_IllllIllIIIlIIl[#("uSI")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("qb")]]=ReeTHub_IllllIllIIIlIIl[#("vAz")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("7A")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("rST")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("HG")]][ReeTHub_IllllIllIIIlIIl[#("lJU")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("DNeU")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("My")]][ReeTHub_IllllIllIIIlIIl[#("pIK")]]=ReeTHub_IllllIllIIIlIIl[#("OdNL")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("4m")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("5Wd")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("pS")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Xfs")]][ReeTHub_IllllIllIIIlIIl[#("7R15")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("QK")]]=ReeTHub_IllllIllIIIlIIl[#("zgS")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Z0")]]=ReeTHub_IllllIllIIIlIIl[#("3cF")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("hi")]]=ReeTHub_IllllIllIIIlIIl[#("0d1")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("KJ")]]=ReeTHub_IllllIllIIIlIIl[#("sYh")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("Ji")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("KyP")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("fr")]][ReeTHub_IllllIllIIIlIIl[#("tJA")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("7pO2")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("vR")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("vPU")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("X5")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("OZD")]][ReeTHub_IllllIllIIIlIIl[#("DIQK")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("yX")]]=ReeTHub_IllllIllIIIlIIl[#("g2l")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("rD")]]=ReeTHub_IllllIllIIIlIIl[#("9zd")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Vl")]]=ReeTHub_IllllIllIIIlIIl[#("eba")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Wi")]]=ReeTHub_IllllIllIIIlIIl[#("RZ2")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("9C")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("PAj")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("p0")]][ReeTHub_IllllIllIIIlIIl[#("AMn")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("zFfK")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("36")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("RK8")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Yc")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("r6e")]][ReeTHub_IllllIllIIIlIIl[#("RZOR")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("UZ")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("LLO")]][ReeTHub_IllllIllIIIlIIl[#("1bZC")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("G4")]][ReeTHub_IllllIllIIIlIIl[#("M6O")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("jluQ")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("E2")]][ReeTHub_IllllIllIIIlIIl[#("tHM")]]=ReeTHub_IllllIllIIIlIIl[#("1Wnc")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("eC")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("IoB")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("vZ")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("XN3")]][ReeTHub_IllllIllIIIlIIl[#("yDlj")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("JZ")]]=ReeTHub_IllllIllIIIlIIl[#("Qd0")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("qW")]]=ReeTHub_IllllIllIIIlIIl[#("OvE")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Af")]]=ReeTHub_IllllIllIIIlIIl[#("AZ0")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("lf")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("68L")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("D4")]][ReeTHub_IllllIllIIIlIIl[#("kBF")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("46Ep")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("8J")]][ReeTHub_IllllIllIIIlIIl[#("V8f")]]=ReeTHub_IllllIllIIIlIIl[#("i7c1")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("QI")]][ReeTHub_IllllIllIIIlIIl[#("a6q")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("icjE")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("np")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("iCB")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("hs")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("c0v")]][ReeTHub_IllllIllIIIlIIl[#("5Bmn")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("14")]]=ReeTHub_IllllIllIIIlIIl[#("VjX")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("h4")]]=ReeTHub_IllllIllIIIlIIl[#("CoV")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Nt")]]=ReeTHub_IllllIllIIIlIIl[#("QEu")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_IIIllIIllIlIlIllllIl=ReeTHub_IllllIllIIIlIIl[#("KI")]ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IIIllIIllIlIlIllllIl](ReeTHub_IlIIllIIlIlllIIllII(ReeTHub_llIlIlllIlIIIlI,ReeTHub_IIIllIIllIlIlIllllIl+1,ReeTHub_IllllIllIIIlIIl[#("Ovu")]))ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("ot")]][ReeTHub_IllllIllIIIlIIl[#("ilE")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("qnaI")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("et")]][ReeTHub_IllllIllIIIlIIl[#("87E")]]=ReeTHub_IllllIllIIIlIIl[#("MqdR")];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("lb")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#("fbq")]];ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;ReeTHub_IllllIllIIIlIIl=ReeTHub_IIIIIllIIllIllI[ReeTHub_IIIlIllIlllllI];ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("Qg")]]=ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("zle")]][ReeTHub_IllllIllIIIlIIl[#("oNEZ")]];end;elseif ReeTHub_IIIllIIllIlIlIllllIl==#("jYpXpGdJzjOkR0HM8XolE0nSbrkqfQVQiJU9uxK2NdHcLRvMIA6V8ptsLIV8uXETy7chgIrMnxJBtkgu5JSQUaS2pByWLMH0JYPOPnGaitHMR3")then ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("sP")]]=ReeTHub_IIlIlIIlIIlllllllI[ReeTHub_IllllIllIIIlIIl[#{"Retard gonna sey they are gonna deobfuscate this";{428843;246257;737804;519538};"Kiriot love sex";}]];else ReeTHub_llIlIlllIlIIIlI[ReeTHub_IllllIllIIIlIIl[#("bv")]]=ReeTHub_lllIlIIIIllIIIlIlIlIIllll[ReeTHub_IllllIllIIIlIIl[#("Oop")]];end;ReeTHub_IIIlIllIlllllI=ReeTHub_IIIlIllIlllllI+1;end;end;end;return ReeTHub_IllIllIIIll(ReeTHub_lIIIIIlIlIlIIIIIllI(),{},ReeTHub_lIllIIIIIIllllll())();
RAW Paste Data
We use cookies for various purposes including analytics. By continuing to use Pastebin, you agree to our use of cookies as described in the Cookies Policy. OK, I Understand
Top