daily pastebin goal
63%
SHARE
TWEET

Untitled

DJAlguein Nov 8th, 2018 97 Never
Not a member of Pastebin yet? Sign Up, it unlocks many cool features!
  1. local DJGUI_lIlIIII='2d2d155b9f200a7abdbab6ea9f6744ee3803b2ae59f4a3003bb5337cebd711e94c23f24c9256fc88d834d4f9bc1922d344f0429d2c07420d9d5e638ace7679243e72c4240df0cb0a4e08eec372c0a97f6b80a73cfd'local DJGUI_lllIIIII='2f68d5891579ec1d703c445c7eba121e8a5a7c2af628414098a27f932a10c79bd23fbce86502903e7ec3bdee727137d00595146e00de9a3461a8e60d'local DJGUI_IllI=244;local DJGUI_lIlIlIIlII=61;local DJGUI_llIIIIIIlIIlllIlI=4584865;local DJGUI_lIIIlIIllIIlIIIIIIllI=2985;local DJGUI_IlllIIIllIIIllIIlIIII=function()local DJGUI_IIlIIllIIIlIIlIIl='745648ba86abd5d8e477bfb1121543389948d20597a728b47732309257464275e065ea187b97496afd3ae4cab6c967f6cd1c3c4205345c075f5219c7b31c7413094c5bd236407de16a27096cedb5cf7cb0de3e1f0654ef16'local DJGUI_lllllllIlIllllI='4366407b0e3318e5983c908e525acdb5de85f44ed99ccf91df586c11c917c0343fa3d042c76f0cf1e8c834b58508340e6a52eaa8a483d6462ddd58847893743a1f1b318f8ee1'local DJGUI_IIllIIlIIlIlllIllIlI='6d561c57eb79da69c362f381e3cd6040a2f41fe898872d18c0a967d77d882b9f4be0ffd43b592b1dfb1c91fb3eae68e4706f1b4e1b8651e0'local DJGUI_IlllIIIIIIlI='706f5baddb6fbbd58549bd31bac92e41d8f2d1b07c868423aaa3cd160c5877c1c86fa7587343910d71d3523574a6ba711ac2cc2388c7a5eba04b625d22377e0bd3b1f2f9e69781c34b5ae4e6d2c8c61a99dec059ec8c8ece'local DJGUI_lIIlllIIllIllllll='7a417d459163fa21af671e59771b4a433ee7fb5cdfbdb84b025b9f23d187f71dfa2653c4e542771a9e65faf34cd0c8839e7b119ec4d105c40f47b15487e1149f90d25061cead89fa1f2c1c5e1a9b89d6b015df734ca51abfe785042e79803e0dede7'local DJGUI_IIIlIIlII='584eccad7b4cb3732835c345b32fa7bdca61c8665de97ba9908712d15560ec7cfd6f2bc35e1493f83523864c13f01e477522ac9b09f27622c9ac1207a16417e29e4307'local DJGUI_lIllIlllllIIlI='654d98f51b1e439656bc22191c40a74e649c63f7055ba3f89a361ed8c48e4fc104526b0d32377a1f819980b1d3f4e8665fa26d0c2847ffad70c8092e8a27401f14ad1bd494e9ecde5af87052f738dc5e6387c19b671ccfebbbfb54b0ac2060'local DJGUI_lllIlIllI='7046e8330a53e870506d930f763aecb0576d77d569b9fc4543916078554d10bc91e1442dee3c23f1626c898de65133ec593ab716d63e414e17c307ba7f7ba59d0540fafcb6a16767e0372a25dc0f635d47b73db7'local DJGUI_IlIIIlllIllIIIlI='4f511c9f4029dec7999f944c87e740268dad2db233780ec58b92176f8f90a7bf99539973342a7113fbe354d536547acbb97fac6351eb75471359edd2f30c9b464f1fd9'local DJGUI_lllIIlIII='4d51f1410b3e89438c4a30e38356cc675c66d4a4d4d1b93fc183a2b22364c08e1f0a62db2cc6e3245221874a8128e3a9d32e2372de3f3e822d64d41c45c39ee6886d373cb103c9b1438066f49132b8ebb182c134fa8e4f5533aa7b7c89e853e6ff259214'local DJGUI_lllllIllI={OxzkDFEEx,CgJzEg,jSlVrAxBnmojUTNPaEpE,XKuomspkWfLXBWVRl,JhyAOhCnxJWgNyK,fqFbTUdK,TwrnGmPuJTyOkAhjGOiAE,tDeQtJcCAz,zWHuI,dFkDhUVZoYfjvZWVcuShOjwPA}end;local DJGUI_lIlllIllIlI='4142f118fd7fa82e208dfed835aea0d02cdb39a6a8a050c42fae13b10022541419a38a86432383af2c4d6eba23bd61e9bc204ebbd6fab2d5c4015feea332c1e3'local DJGUI_llIlIIlIIllIlIll=function()local DJGUI_lIllll='6d73b2d16060d3fafc746c04da9a5cab675a0fda508e90376f166c77aec0e8bd7626c611d1ee74fb31f77c84643d748d58f49caadeb7a56f10bec8bf55ef26a18286ff0f9e6af475571d140c4fac98a0517fb3e3caf8'local DJGUI_IIIlIlIIlllI='785762fea852a553dd27c7faef9b8dccfa3fe442e70dff25b1c411e559c9c41d2fab934e171c21529864c9d0ecb40fa7dfa0'local DJGUI_IlIIlllIIlIlIlllll='536151f5cb571c5fec823606603fe9a64e6eb37580776d18be2d5bc10b479d7d8600b69395e5d232903d421f6d77726514cf880eb7460f01a4'local DJGUI_IlIlllIlIllIllIlII='4e6bcd5c0af78ca8f4d51acbb94edbc450f961e8b90adc8cbb644c86f90ca9b74778cf70ccbb92'local DJGUI_IIIlIIllIIllIllI='754902ccd8e31d825ada02a717e9b55fb7f72de1ff2af0798d46070a515ff523dbbf6b3ba5a3'local DJGUI_lIIlIIlllI='6a615b721399d7b77e64619a896859a69168c4c406e1e3cda76b4a042da1e5a70ca68c812fb84e0b562ead1ac35ceb4248c9e9193027ecf0a7480c4c209d35723123bd821537546fc5509d627cccb09a2427b6d1386eba2d9c96b100c17a8df208'local DJGUI_IIllIlllIIllIIllI={kLlBCJBqYkxAjBhuKpH,ModNjRkUXqBVdVy,EFPHnOEboAnzSmzaRn,FwTytCrChsEBrCSEi,wFmCuGJzDj,KKzPjVKUaDskZqOyhSsWf}end;local DJGUI_IIlIlIlI=function()local DJGUI_lIIlII='7952519b1531bdfc64455998479ff676788bc085a8d5d3eb8fe5adf679545881af469d1de90c1b4fa3e2a28f21c775ef5d509c062d6debfccfe71c40fb215f4a037013a49ddfb09a541ada2826ff1efb65ac3e58468c8e271216'local DJGUI_llIIIlIIIIIIlllIlIIlI='6b5562ba894b7325ecf90ad51fb0ebd9284eee6ced80c32f5e718cf00e92b8'local DJGUI_lIIIIlIIIIIllIIIIl='536c26267f72aab4264636631d6cf8f0d1871f413f4d6bced3adaf2de79f50c6f4aa9f9aaee3672714575b945e6105555cb2214dab5080479adac18eedcc93c4f2'local DJGUI_IIIllIIIlllIllllI='6e41dfb1c9a6f837ba456d233c7e1cf96f6b3278d3969916ff4da215712f086f9a015cb3bd36d905079290fd2c7bfa0a116a0ad2e4306ea11e28d5bab9bd8181fa04a0fcac4759a9bfce8e3172ebdff5652b7dd6310b440950aba7474e9f'local DJGUI_IIllllIl='6f4bc345dea61265e4e98ff0a2f898d06c8b2698847846857305c943c642730cd2b74692c013455e56d30805a8aee80d4e9ec710adfd69b87a2ed713d754c29822758bfc9b872484d45bd39cf919'local DJGUI_IIllIIlllIl='64458677ebb0062220d13909150514fe82cd21a79378c5c0e1cdd734c0c2ebfeb81fc096311274a4725046f588e4d8b0885e0b792a1ee2869bc3'local DJGUI_IllIIllIlllIlI='50416b21b167073061de14aaa8898128182abf99b89336f9e0066ff63866c4798f46d217ed10831a716f7d43f57a7b918133e800d2b772cc61e34bef4b2733b00e1399877bcfa21f1b9637683011898e7fbc9f45d616342b626f53204a43e3'local DJGUI_lllI='4166df26264bf22e0cb1bc572b98a3f9828135d462995c61b959ec6a9b153c081ab5fb3ce26fa52db70fdf8154dcf0cd8923e0db56c09d9f73e5f21d96825ff3b68f2bbd7bcba0a6841c4b2f5fa6fc81a5c8acd843da8293c59a'local DJGUI_IIIIIllIIlllIIlllIlI={tZHMacUgSVAwrFmDwxJyHq,RyIcUQCgDVuuhVc,DakDWffDVtgYQwO,HqQAYwr,UbhCchyBpBqRVAuFClQeX,wYtXjFmS,ljwquAbLeCWtMjBFBN,kQyOjcWmVXkPjUplJOMpaSJb}end;local DJGUI_lIllIII=function()local DJGUI_IllIIIllIIlll='485a97065342b1ae7d7e87318159c0de7ec176c44fbbccb9262af406420b4a5f2eb7ee0a3ec770697b9bc20b0f70901b5c91217813386eab8ca6f8616bd175521054454b8d14081e533ca3ff543a887e3868e586c05955'local DJGUI_lIlIlIlIIllllIlIlllI='68587e6520d5084ec643e1d2051e3725568490b2ab4ae6e17cd32992e9193d73dc3ec79806d7b9a6b62fd8bad2737fcfb11b01a4e4b3e7b6ade1ca65f640ee552eb427c719a56ac34e0a06ba4a6d4a21'local DJGUI_lIllllIIlIlIII={BvEfjArnhNrHtsNMSNL,OcDfwTcJfQAGw}end;local DJGUI_IlllIllllllllIIllIIlI='6e753f2601e1'local DJGUI_lIlIlIlIlllIIlIIlII=function()local DJGUI_Ill='4545f11d97185580001521c4e289c94129169cd53166e8537b94de00f7ea640f243575e7b6e95a475d58ad7e7f4b3e38974488dcffeaf37e2e6f1c5de6d4245e78a96103ca790ce2457468a910dac6d3'local DJGUI_llIlllIlIllIIlI={pgKwQEpOpwPChLrRMc}end;local DJGUI_llllIlIllIIlIIl='756ce7c8e5e8be'local DJGUI_IlIIIIIlII=function()local DJGUI_IIllIlll='775ab2698c93bd5f0fdca850cb7f830da3af3c960e7b62eaa3b15886f997ff11ad9415cfff55ec66092824a63adc6786dade47d75ccbfe2648f073360beac8b904f11ac5f8d8b95630cce26fc10025a9c5270f7b259172a84821724ea9ac'local DJGUI_Illlll='4367755c187897f1d19f1a5a47b08ecafb0cddcffdcc2d55ebdfcab4c03688a1107c86fbec805bbb2adb14003bd3a98a35708825c52118e2ab6c3bdcb12c85e416db1ef9fb59020d2fcf21d5fa5608e6d0ee208f0f3703'local DJGUI_llIlIIIIIIl='64736c26cb48661b6fed6f1cfb6bcb6ff3f03b56d033b82bf78f5ff48648b07275071feddfd0ff2b70579671f6dac137b645ca6e5976311ae3e9e9a54e3cb28eb947d5573619228748d3362fdeaa7e'local DJGUI_IllIIIlIllIIIllI='4a5336805f3a70b582a62544f05f4545abd1146f9bdbb4673efa9b3e8814499629bb343c1575c39b055262f1b2aa'local DJGUI_IlIIIlIllll={naSZdtOOZhFrycBQlWZ,vwTcNbYU,nMuVkAcRLsnR,HLjxQsEFdAmSxeLAYsgnJ}end;local DJGUI_IIlll='6c65ccc8f658'local DJGUI_lIllIIllIIlllIIlIII=function()local DJGUI_lIlIllIIllIl='516dbc698f5e71311dedfbc895eff228c68ea7246c3e2bacd81fc687db679d99d68e4c11e8c354f239b61e8e050ae333645eae25728d10cab8210d85923029c63eeb5a7b2eeae4175bfa7b43619958f8b575'local DJGUI_lllIl='6f5262926572a4aa61a597a6cf61a900d5f835e8c72413220f80de8a61865b1d301cabff126ce59f05dbb4300b919eff7f7075ddbddbee7065a2653771a0218404ccc1cf55337d202de9'local DJGUI_IlIlllIllIIIlIl='74436bb1ed0b9e775fa37502cbf5a20710d4dc45763e9fe66e555633490ecf3747e65c544300ea98d7c663c211b941c91a52'local DJGUI_llII='4961020fccea5b8207b0128959be0e7892864239cf9346950b180867f0ab3e30c9b15a9e7ba9b728fb86079268a5c0715526567affcbfe6cd166902c5124eeda5d9f2e0f329bf038309074300c261c89b5914b4caae959042efa5c'local DJGUI_IIlIlIIl={ajeVBJLwavSN,yIqRcWY,tRdQmSrTwrMMzQeiTByDmYzE,xUSfPh}end;local DJGUI_IlIllIIIlIllll='4572369bb79a26'local DJGUI_IlIlIIIlIlllIIIIllll=function()local DJGUI_IlIlIII='4c41f8ba804d3e5e027822462b23cd5f2add8f6360e82641464753c5586040e9'local DJGUI_llllIIIIIIllll='65563fb1190d64f6fe17593c1a8928fb1221a8807b1d04e8a446e54f9a54216cd587b3d6f36a2234568caa9b62bcd938d33455b0edd6a932ff18d5bfa1f44bd0c35628870d9321f7200b579ebbb2'local DJGUI_IlIlIl='7447639f45aefa59faefa589cb88935f809f3c588315c10b3b5b8d9b907018cbeabae808baa4990a7b1fc99445c4d20346b9eb97d15199fe5e96d0c958c08e1de01e87639232'local DJGUI_llIlIlll='59622e3c315b21a82a1c8603b3bed0faf80e9747e36268fb1b2085497fa710ab63'local DJGUI_IlIIlII='454e0121767c328399f08fa4d24bb8087c16fbe5540ab5c4953688fc4ee1b98650544f25813bdeaa4d5c41e8f6'local DJGUI_lllIlIllIllIIlII='4a688e573de3b63ff59b99656c2dde6e3a305fdf384c4a9d9ecfbc2b90f063210014c40f2b6001'local DJGUI_IlllIIlIlIlllllIIIIll='4478028067f6899e5fe3b71f44dcb519b2b77b00cbee3aa4ca983ffea881a0efd50e455fbc6e43496235ab765db99441dd258c055376d84724'local DJGUI_lllIIlIllIIlIllllIIlI='78481da8b6b02b9694484fb7d735f6e7168e82641239aff480a4292033e381145f8926055a8736698d5289774256a30c767de78d'local DJGUI_lIIIIIlIIllI='43705bfe052e597bc6ca4c08dd68941cdc4d1d8c6381075d574590ece762d8711b1fc1ec4d4b'local DJGUI_llIIIllllIllIIlllllll='4f4a744a63e0849ffb15744cb055a211ddb7dd4c31c00ec493372d76d45007e9b876ec562322998ef2a442dc449ef0b11945536b0ad048142fe367f2f23fc956cf52e0db11c9408886e02179a450bf2a29de5d0dc60a9626316efbf304ea62'local DJGUI_lIIIII={YJwnwwMSRSqBjZhw,uUZutvykiDqEsTKyTLUCOBjtT,aVvNzMEkyTSkmH,mbEZcTtpPDcFSjcaBHuBgBB,TvMFbJGDhudSzAjqTCx,wWfzDCmkTJfR,BwXPvPsZCvOpi,ItjWObKSmhDqBcS,DzCSdv,SBpzZuVjHyCcDHLbZsq}end;local DJGUI_IIIIIIIIIIIIllII='556e01d15ed9fed8e7ab1872b56e4b8df1d680e63d73025b3d19391dbf74880cc9b193e6'local DJGUI_IIII='4f6e74f511cf6223e72f5a51e6313504b1f6ca66f6f69d21e944'local DJGUI_IIIlIlI='4c75bbd4fc265093b55c811391942cafd8db9758e398'local DJGUI_IlIl='546813bf0fb1f22dca7dafc718006b1b5a64a41d1fe3b3a89f6b8c7c'local DJGUI_IlllIIlIlI=function()local DJGUI_IIIlllI='7745750625d7235d385585b17ed30892fb6fc751138e5e10617bbaa1a530f98dc46c2ed469c6fa8115add172813b756a34'local DJGUI_lIllI={VuGOgb}end;local DJGUI_lllIllIlIlllIlllllIII;local DJGUI_IlIIl;local DJGUI_lIlIlIlIlllIII;local DJGUI_llIIlIll;local DJGUI_IIlllIlIIlIllIIII;local DJGUI_IlIIlIIIlIlIl;local DJGUI_lIlIlIIlIllII;local DJGUI_IIIIllIllI;local DJGUI_llllIlIlI;local DJGUI_lllIllIIl;local DJGUI_IIIIlIllll=setmetatable;local DJGUI_lllll=coroutine;local DJGUI_IlllII=DJGUI_lllll.create;local DJGUI_lIIIIIlll=DJGUI_lllll.resume;local DJGUI_IlIlI=string;local DJGUI_llIIIIIlIlIIl=DJGUI_IlIlI.char;local DJGUI_lIlIlIlIlIIIlIllI=DJGUI_IlIlI.sub;local DJGUI_IIlIllllIIlIlllll=DJGUI_IlIlI.len;local DJGUI_IllIlIllIIIllI=getfenv;local DJGUI_IIllIl=tostring;local DJGUI_IllIIIlIlIlIl=tonumber;local DJGUI_lIIlllI;local DJGUI_IllIIllllIIIlllIl;local DJGUI_IlllIlIlllIIIllIIIll;local DJGUI_lIIIlIlIlIIllII;local DJGUI_IlIIlIlll;local DJGUI_IlllllIIlIIIlIIllII=select;local DJGUI_lllIlIlllI;local DJGUI_lIllIIlIlIlIllllll;local DJGUI_lIIIlIlIllIlIlII;local DJGUI_llIIllIll;local DJGUI_lIlIlllIlIIlllIIll;local DJGUI_IlIlIIIl;local DJGUI_llIIIllIIlIIIIIlI;local DJGUI_IlIlllIIll=function()local DJGUI_lIllIIIIllIlIlIlllIl='746ca11db969b591700e08ca00acced37c156238caec963a21f29565d862eb4e6ef6ae4571a8f144b34763ca0cb444805a580dfb1f14e522e16b'local DJGUI_lIllIIIIIlIlIllIIlII='41558e26335bccc18b687a40ded70b7a840b4bffeba0928f8f4152228963e4f62c69374f77edb8f7a6d900202e713204d9cd6a4bf5736ef3f7885c54d6'local DJGUI_IlllIIII='59634006316c6b0e4669e1975db065a98e929096c54e77d49f49dbf960d50f'local DJGUI_IIIIllIIllIII='785801bf56a16145188b55a4d4343abf6e7dc4ff59a18b28ff717d7df8f5060462ddced91d174058bec5f5255b3c1c758c71b19b1917ea5cd5f632358279d0c3884fdaf84265d5bdd3a80770d5f95b3ca1c5b04b9e80b96417089dc98f'local DJGUI_IllIlIllIIIIllIlllIII={SxxDNy,KQaVFlRoUTeSsaDZeyLyiiK,nAnAiNvLJpnJ,JKOkThrJLWhyeBmWw}end;DJGUI_lllIllIIl=function(DJGUI_IlIlIIllllIlIIlllI)local DJGUI_lIIlI,DJGUI_IIllIlIIIIIlIl=DJGUI_llIIIIIIlIIlllIlI,16384 +DJGUI_lIIIlIIllIIlIIIIIIllI;return(DJGUI_IlIlIIllllIlIIlllI:gsub('%x%x',function(DJGUI_lIIllllIlllIlIlII)local DJGUI_llIlIIIllllllIllIIIl=DJGUI_lIIlI%274877906944;local DJGUI_lIIlIlIlIlllIIIIllII=(DJGUI_lIIlI-DJGUI_llIlIIIllllllIllIIIl)/274877906944;local DJGUI_IIIlllIIIIllIllIlllI=DJGUI_lIIlIlIlIlllIIIIllII%128;DJGUI_lIIllllIlllIlIlII=DJGUI_IllIIIlIlIlIl(DJGUI_lIIllllIlllIlIlII,16)local DJGUI_lIlllIlIIlIllllIlll=(DJGUI_lIIllllIlllIlIlII+ (DJGUI_lIIlIlIlIlllIIIIllII-DJGUI_IIIlllIIIIllIllIlllI)/128)* (2 *DJGUI_IIIlllIIIIllIllIlllI+1)%256;DJGUI_lIIlI=DJGUI_llIlIIIllllllIllIIIl*DJGUI_IIllIlIIIIIlIl+DJGUI_lIIlIlIlIlllIIIIllII+DJGUI_lIIllllIlllIlIlII+DJGUI_lIlllIlIIlIllllIlll;return string.char(DJGUI_lIlllIlIIlIllllIlll)end))end;local DJGUI_llIIII={}local DJGUI_IllIlIIlIIlllIIlIIl={}local DJGUI_IIIIIlIII={}local DJGUI_IlIlIllIllllIlIllIII={}for i=65,90 do DJGUI_llIIII[DJGUI_lllIllIIl(DJGUI_IlllIllllllllIIllIIlI)..i]=i end;for i=97,122 do DJGUI_IllIlIIlIIlllIIlIIl[DJGUI_lllIllIIl(DJGUI_IlllIllllllllIIllIIlI)..i]=i end;local DJGUI_lIlllllllIllIll=function()local DJGUI_IlIIIIlIIlII='724fbbd1eecbf261eca820095c25fae1b09d0c407183810e92816c64d3eab85519620046186383a2c4f26c4d4ce3dd4666edaff4a37d7ff77dcd6edd256897e9d7bdb31c3f5c96c1bc2b7ee5464fa4130d'local DJGUI_IIIIlIlIIlllIIllI='55763745e8984fbc545d110dfa0a57bf799418fd1af4df7b51e922374d7888324de42f63dc'local DJGUI_llllIIlllll='49762e65d61e8bf687a8b0f52e76dc48376cc7717d5cb92dad75285cbe30567c9876132b6774145d2bd9f27c3e84aa41e928d2173f341aa1d7d66c5df26d65156089cb196517911756a77b50dd69b8621af05b3b2c2b01'local DJGUI_lIlIIIIlllllllIll='74635221df50a8d6bebbcd8d6ff6406a6d226d51ef4a6159a6afd7e4c6b4ca115c2f2bb85c217be0c8ab0bcaaf5fb1606a7ba49a2e69247dafc39a7a37ff9bcc5b1e2a0c4dc02e7dc6f1779b18e3ef43fd40fcf0f0b56743d0be'local DJGUI_Ill='6965cd777bd149be789e6053e577ab792c2d63f9aea5a79a9a0017eae7ce1059c7381a3ac8840fa2ca509c708e17a0c16e1dfb614de288724eb728055daa6010721de64380a7875f0cdadedf66'local DJGUI_IIlIlllIIIIIllllI='4a6240bfac84bc8e2ddb8ff6866dd18393ac55dde433d9060672c7b288a20e483a051feb4a2ce307d71b'local DJGUI_llIlll='5863aa41ba469ea585cea221d61b27d8922fdd56bdae937695b7a01979239b2af47fe1e3daf8c3d7338c0624db26c25b7c7f45f4a5ad047a72a4806c8493698824'local DJGUI_lllIllIIlIllIIlI='6a72e80677f1fb7d9e05373e596d8b7eb32b4eb0fccb6d90027197a1b0f535116dc379faaf04fff602bf494151e1a18d48'local DJGUI_lIllI='4f41a04ea7199ebec04ba210ef09ac9e853f2474557afec857854e2bcc3f5b4b17aca16d30206d3260108ff40386c481e90578789ff93498b5c4f4831276b9d00748f32c705098ab2e5a209a0bd83704f12734'local DJGUI_lIIlIlIllIIllIlIlIl='6c44363326aeb515e131df738acc7d61fdceed28d4cd5e4dc560cfaac92912e9c3ffaf8a544b'local DJGUI_IllIllIlIlI={NobSfFDwKFcNqzlZD,hDhClUGBWyTTfohl,WMvdXNaEzHc,AxGcLDlXlIhz,HKirTp,CeeNoAcGbVKOdzEbGrQ,tdEWPv,tMrYEGusoZVjCqWr,gSHHpIkAzeLuFSudOa,OYtMtSXOqSEgtBWsKvEdrkMbn}end;local DJGUI_IlIIlllIlll=function(DJGUI_IIIIIIlIll,DJGUI_IIlIlIlIll)DJGUI_IIIIIlIII[DJGUI_lllIllIIl(DJGUI_llllIlIllIIlIIl)..DJGUI_llIIIIIlIlIIl(DJGUI_IIlIlIlIll)]=DJGUI_llIIIIIlIlIIl(DJGUI_IIlIlIlIll)end;local DJGUI_llllI=function(DJGUI_lIIlllIlIIII,DJGUI_IIlIlIIllII)DJGUI_IlIlIllIllllIlIllIII[DJGUI_lllIllIIl(DJGUI_IIlll)..DJGUI_llIIIIIlIlIIl(DJGUI_IIlIlIIllII)]=DJGUI_llIIIIIlIlIIl(DJGUI_IIlIlIIllII)end;table.foreach(DJGUI_llIIII,DJGUI_IlIIlllIlll)table.foreach(DJGUI_IllIlIIlIIlllIIlIIl,DJGUI_llllI)local DJGUI_IllIlIlIllIlIl=function()local DJGUI_IIIIlIlIllll='5570b3d1ca81308288d23cf3396a4452833bb0d3ca797d896fc997eac857b3fe1e168fbeedbbfc74e8ab27c3030591d58e66973377a5bfbe91d7145eca37d473120fa1c10d3645e85611ca354f213efee6166b'local DJGUI_llllIIIlIIlIl='4373403cdb45d110c577f1ebeba0de5b51b0b794af12c1aadfce6470778a7d56d59a94316bbcc9040b679a52b6e73e356281ac4d6b8d16aa2385af089ff84f18535c3ee11b059ca4'local DJGUI_llIIIIllIIlIlllIIIII={EhBnVnIdQNfZeYlGkTnpFbK,UYowIRfXcrXyK}end;local DJGUI_IIIIIllI=DJGUI_IIIIIlIII.uletterA..DJGUI_IIIIIlIII.uletterB..DJGUI_IIIIIlIII.uletterC;local DJGUI_lIIIIlllIIIlllIllII=DJGUI_IIIIIlIII.uletterA..DJGUI_IIIIIlIII.uletterB..DJGUI_IlIlIllIllllIlIllIII.letterx;local DJGUI_IlIIIlIlIIIIIlllIIIll=DJGUI_IIIIIlIII.uletterA..DJGUI_IlIlIllIllllIlIllIII.letters..DJGUI_IIIIIlIII.uletterB..DJGUI_IlIlIllIllllIlIllIII.letterx;local DJGUI_llllIIlllIllIIII=DJGUI_IIIIIlIII.uletterM..DJGUI_IIIIIlIII.uletterO..DJGUI_IIIIIlIII.uletterV..DJGUI_IIIIIlIII.uletterE;local DJGUI_llIllllII=DJGUI_IIIIIlIII.uletterL..DJGUI_IIIIIlIII.uletterO..DJGUI_IIIIIlIII.uletterA..DJGUI_IIIIIlIII.uletterD..DJGUI_IIIIIlIII.uletterK;local DJGUI_lIlllIllIIIlIll=DJGUI_IIIIIlIII.uletterL..DJGUI_IIIIIlIII.uletterO..DJGUI_IIIIIlIII.uletterA..DJGUI_IIIIIlIII.uletterD..DJGUI_IIIIIlIII.uletterB..DJGUI_IIIIIlIII.uletterO..DJGUI_IIIIIlIII.uletterO..DJGUI_IIIIIlIII.uletterL;local DJGUI_III=DJGUI_IIIIIlIII.uletterL..DJGUI_IIIIIlIII.uletterO..DJGUI_IIIIIlIII.uletterA..DJGUI_IIIIIlIII.uletterD..DJGUI_IIIIIlIII.uletterN..DJGUI_IIIIIlIII.uletterI..DJGUI_IIIIIlIII.uletterL;local DJGUI_IlIIllIIlIlIIlIllllI=DJGUI_IIIIIlIII.uletterG..DJGUI_IIIIIlIII.uletterE..DJGUI_IIIIIlIII.uletterT..DJGUI_IIIIIlIII.uletterU..DJGUI_IIIIIlIII.uletterP..DJGUI_IIIIIlIII.uletterV..DJGUI_IIIIIlIII.uletterA..DJGUI_IIIIIlIII.uletterL;local DJGUI_IIllll=DJGUI_IIIIIlIII.uletterG..DJGUI_IIIIIlIII.uletterE..DJGUI_IIIIIlIII.uletterT..DJGUI_IIIIIlIII.uletterG..DJGUI_IIIIIlIII.uletterL..DJGUI_IIIIIlIII.uletterO..DJGUI_IIIIIlIII.uletterB..DJGUI_IIIIIlIII.uletterA..DJGUI_IIIIIlIII.uletterL;local DJGUI_IlIllllIIIIlIIIllll=DJGUI_IIIIIlIII.uletterG..DJGUI_IIIIIlIII.uletterE..DJGUI_IIIIIlIII.uletterT..DJGUI_IIIIIlIII.uletterT..DJGUI_IIIIIlIII.uletterA..DJGUI_IIIIIlIII.uletterB..DJGUI_IIIIIlIII.uletterL..DJGUI_IIIIIlIII.uletterE;local DJGUI_IllIlllllIIIIIIl=DJGUI_IIIIIlIII.uletterS..DJGUI_IIIIIlIII.uletterE..DJGUI_IIIIIlIII.uletterT..DJGUI_IIIIIlIII.uletterG..DJGUI_IIIIIlIII.uletterL..DJGUI_IIIIIlIII.uletterO..DJGUI_IIIIIlIII.uletterB..DJGUI_IIIIIlIII.uletterA..DJGUI_IIIIIlIII.uletterL;local DJGUI_llIIl=DJGUI_IIIIIlIII.uletterS..DJGUI_IIIIIlIII.uletterE..DJGUI_IIIIIlIII.uletterT..DJGUI_IIIIIlIII.uletterU..DJGUI_IIIIIlIII.uletterP..DJGUI_IIIIIlIII.uletterV..DJGUI_IIIIIlIII.uletterA..DJGUI_IIIIIlIII.uletterL;local DJGUI_IlIllIlIlIllIIlIl=DJGUI_IIIIIlIII.uletterS..DJGUI_IIIIIlIII.uletterE..DJGUI_IIIIIlIII.uletterT..DJGUI_IIIIIlIII.uletterT..DJGUI_IIIIIlIII.uletterA..DJGUI_IIIIIlIII.uletterB..DJGUI_IIIIIlIII.uletterL..DJGUI_IIIIIlIII.uletterE;local DJGUI_lIlllIlIlIIllIIlllIllIlll=DJGUI_IIIIIlIII.uletterN..DJGUI_IIIIIlIII.uletterE..DJGUI_IIIIIlIII.uletterW..DJGUI_IIIIIlIII.uletterT..DJGUI_IIIIIlIII.uletterA..DJGUI_IIIIIlIII.uletterB..DJGUI_IIIIIlIII.uletterL..DJGUI_IIIIIlIII.uletterE;local DJGUI_IIIlIllIIllIlI=DJGUI_IIIIIlIII.uletterS..DJGUI_IIIIIlIII.uletterE..DJGUI_IIIIIlIII.uletterL..DJGUI_IIIIIlIII.uletterF;local DJGUI_IIIllIlllII=DJGUI_IIIIIlIII.uletterA..DJGUI_IIIIIlIII.uletterD..DJGUI_IIIIIlIII.uletterD;local DJGUI_lIlIIllIIlIIlIIllII=DJGUI_IIIIIlIII.uletterS..DJGUI_IIIIIlIII.uletterU..DJGUI_IIIIIlIII.uletterB;local DJGUI_IIIlll=DJGUI_IIIIIlIII.uletterM..DJGUI_IIIIIlIII.uletterU..DJGUI_IIIIIlIII.uletterL;local DJGUI_llIllIllII=DJGUI_IIIIIlIII.uletterD..DJGUI_IIIIIlIII.uletterI..DJGUI_IIIIIlIII.uletterV;local DJGUI_lIIIIlIIllllIlIIl=DJGUI_IIIIIlIII.uletterM..DJGUI_IIIIIlIII.uletterO..DJGUI_IIIIIlIII.uletterD;local DJGUI_llIllIIllIIlllllI=DJGUI_IIIIIlIII.uletterP..DJGUI_IIIIIlIII.uletterO..DJGUI_IIIIIlIII.uletterW;local DJGUI_IIlIIIIlIIllIl=DJGUI_IIIIIlIII.uletterU..DJGUI_IIIIIlIII.uletterN..DJGUI_IIIIIlIII.uletterM;local DJGUI_IIIIll=DJGUI_IIIIIlIII.uletterN..DJGUI_IIIIIlIII.uletterO..DJGUI_IIIIIlIII.uletterT;local DJGUI_IlIIlIIIIlllIII=DJGUI_IIIIIlIII.uletterL..DJGUI_IIIIIlIII.uletterE..DJGUI_IIIIIlIII.uletterN;local DJGUI_IIIIIIIIlIIIlII=DJGUI_IIIIIlIII.uletterC..DJGUI_IIIIIlIII.uletterO..DJGUI_IIIIIlIII.uletterN..DJGUI_IIIIIlIII.uletterC..DJGUI_IIIIIlIII.uletterA..DJGUI_IIIIIlIII.uletterT;local DJGUI_llIIlIIIllIlIIlIlIIIIlllIIl=DJGUI_IIIIIlIII.uletterJ..DJGUI_IIIIIlIII.uletterM..DJGUI_IIIIIlIII.uletterP;local DJGUI_IIlIIllIIlll=DJGUI_IIIIIlIII.uletterE..DJGUI_IIIIIlIII.uletterQ;local DJGUI_llllIlllIllllII=DJGUI_IIIIIlIII.uletterL..DJGUI_IIIIIlIII.uletterT;local DJGUI_lIIIIIIIIlIIIIlllll=DJGUI_IIIIIlIII.uletterL..DJGUI_IIIIIlIII.uletterE;local DJGUI_IlllIllIIlllI=DJGUI_IIIIIlIII.uletterT..DJGUI_IIIIIlIII.uletterE..DJGUI_IIIIIlIII.uletterS..DJGUI_IIIIIlIII.uletterT;local DJGUI_IlIlIIlIIllIllIII=DJGUI_IIIIIlIII.uletterT..DJGUI_IIIIIlIII.uletterE..DJGUI_IIIIIlIII.uletterS..DJGUI_IIIIIlIII.uletterT..DJGUI_IIIIIlIII.uletterS..DJGUI_IIIIIlIII.uletterE..DJGUI_IIIIIlIII.uletterT;local DJGUI_lIIll=DJGUI_IIIIIlIII.uletterC..DJGUI_IIIIIlIII.uletterA..DJGUI_IIIIIlIII.uletterL..DJGUI_IIIIIlIII.uletterL;local DJGUI_IllII=DJGUI_IIIIIlIII.uletterT..DJGUI_IIIIIlIII.uletterA..DJGUI_IIIIIlIII.uletterI..DJGUI_IIIIIlIII.uletterL..DJGUI_IIIIIlIII.uletterC..DJGUI_IIIIIlIII.uletterA..DJGUI_IIIIIlIII.uletterL..DJGUI_IIIIIlIII.uletterL;local DJGUI_lIIIl=DJGUI_IIIIIlIII.uletterR..DJGUI_IIIIIlIII.uletterE..DJGUI_IIIIIlIII.uletterT..DJGUI_IIIIIlIII.uletterU..DJGUI_IIIIIlIII.uletterR..DJGUI_IIIIIlIII.uletterN;local DJGUI_IlIlIlIlIllIllII=DJGUI_IIIIIlIII.uletterF..DJGUI_IIIIIlIII.uletterO..DJGUI_IIIIIlIII.uletterR..DJGUI_IIIIIlIII.uletterL..DJGUI_IIIIIlIII.uletterO..DJGUI_IIIIIlIII.uletterO..DJGUI_IIIIIlIII.uletterP;local DJGUI_lIllllllIllllIIII=DJGUI_IIIIIlIII.uletterF..DJGUI_IIIIIlIII.uletterO..DJGUI_IIIIIlIII.uletterR..DJGUI_IIIIIlIII.uletterP..DJGUI_IIIIIlIII.uletterR..DJGUI_IIIIIlIII.uletterE..DJGUI_IIIIIlIII.uletterP;local DJGUI_IIIlIIIIIIIIIIllIll=DJGUI_IIIIIlIII.uletterT..DJGUI_IIIIIlIII.uletterF..DJGUI_IIIIIlIII.uletterO..DJGUI_IIIIIlIII.uletterR..DJGUI_IIIIIlIII.uletterL..DJGUI_IIIIIlIII.uletterO..DJGUI_IIIIIlIII.uletterO..DJGUI_IIIIIlIII.uletterP;local DJGUI_llIIlII=DJGUI_IIIIIlIII.uletterS..DJGUI_IIIIIlIII.uletterE..DJGUI_IIIIIlIII.uletterT..DJGUI_IIIIIlIII.uletterL..DJGUI_IIIIIlIII.uletterI..DJGUI_IIIIIlIII.uletterS..DJGUI_IIIIIlIII.uletterT;local DJGUI_IlIlIlIIIIlIlI=DJGUI_IIIIIlIII.uletterC..DJGUI_IIIIIlIII.uletterL..DJGUI_IIIIIlIII.uletterO..DJGUI_IIIIIlIII.uletterS..DJGUI_IIIIIlIII.uletterE;local DJGUI_lIlllIIIIIlllIlll=DJGUI_IIIIIlIII.uletterC..DJGUI_IIIIIlIII.uletterL..DJGUI_IIIIIlIII.uletterO..DJGUI_IIIIIlIII.uletterS..DJGUI_IIIIIlIII.uletterU..DJGUI_IIIIIlIII.uletterR..DJGUI_IIIIIlIII.uletterE;local DJGUI_lIlIIIIlI=DJGUI_IIIIIlIII.uletterV..DJGUI_IIIIIlIII.uletterA..DJGUI_IIIIIlIII.uletterR..DJGUI_IIIIIlIII.uletterA..DJGUI_IIIIIlIII.uletterR..DJGUI_IIIIIlIII.uletterG;local DJGUI_IIIlllIl={DJGUI_IIIIIllI,DJGUI_lIIIIlllIIIlllIllII,DJGUI_IIIIIllI,DJGUI_IIIIIllI,DJGUI_IIIIIllI,DJGUI_lIIIIlllIIIlllIllII,DJGUI_IIIIIllI,DJGUI_lIIIIlllIIIlllIllII,DJGUI_IIIIIllI,DJGUI_IIIIIllI,DJGUI_IIIIIllI,DJGUI_IIIIIllI,DJGUI_IIIIIllI,DJGUI_IIIIIllI,DJGUI_IIIIIllI,DJGUI_IIIIIllI,DJGUI_IIIIIllI,DJGUI_IIIIIllI,DJGUI_IIIIIllI,DJGUI_IIIIIllI,DJGUI_IIIIIllI,DJGUI_IIIIIllI,DJGUI_IlIIIlIlIIIIIlllIIIll,DJGUI_IIIIIllI,DJGUI_IIIIIllI,DJGUI_IIIIIllI,DJGUI_IIIIIllI,DJGUI_IIIIIllI,DJGUI_IIIIIllI,DJGUI_IIIIIllI,DJGUI_IIIIIllI,DJGUI_IlIIIlIlIIIIIlllIIIll,DJGUI_IlIIIlIlIIIIIlllIIIll,DJGUI_IIIIIllI,DJGUI_IIIIIllI,DJGUI_IIIIIllI,DJGUI_lIIIIlllIIIlllIllII,DJGUI_IIIIIllI}local DJGUI_IIlllllllIIlIIllI={DJGUI_llllIIlllIllIIII,DJGUI_llIllllII,DJGUI_lIlllIllIIIlIll,DJGUI_III,DJGUI_IlIIllIIlIlIIlIllllI,DJGUI_IIllll,DJGUI_IlIllllIIIIlIIIllll,DJGUI_IllIlllllIIIIIIl,DJGUI_llIIl,DJGUI_IlIllIlIlIllIIlIl,DJGUI_lIlllIlIlIIllIIlllIllIlll,DJGUI_IIIlIllIIllIlI,DJGUI_IIIllIlllII,DJGUI_lIlIIllIIlIIlIIllII,DJGUI_IIIlll,DJGUI_llIllIllII,DJGUI_lIIIIlIIllllIlIIl,DJGUI_llIllIIllIIlllllI,DJGUI_IIlIIIIlIIllIl,DJGUI_IIIIll,DJGUI_IlIIlIIIIlllIII,DJGUI_IIIIIIIIlIIIlII,DJGUI_llIIlIIIllIlIIlIlIIIIlllIIl,DJGUI_IIlIIllIIlll,DJGUI_llllIlllIllllII,DJGUI_lIIIIIIIIlIIIIlllll,DJGUI_IlllIllIIlllI,DJGUI_IlIlIIlIIllIllIII,DJGUI_lIIll,DJGUI_IllII,DJGUI_lIIIl,DJGUI_IlIlIlIlIllIllII,DJGUI_lIllllllIllllIIII,DJGUI_IIIlIIIIIIIIIIllIll,DJGUI_llIIlII,DJGUI_IlIlIlIIIIlIlI,DJGUI_lIlllIIIIIlllIlll,DJGUI_lIlIIIIlI}local DJGUI_IIIllll=function()local DJGUI_IlIIlllIIll='725a970f5c785a85b5cabd6a86dcfd0fa402c6166991c8d6d11fdc7cd968b8c553b3984d7018599cee51f995f9c970921b408a6ac8fb8ba1c45c6992cee05bbe2cee5f240a092408cc21a66a01a370ff1dd83b82c14bc041bc59ffcd'local DJGUI_IIllllllIIlIlI='5974f1de3b22c796cbb796464d7b54373be7b281327c6ee7092a15b923a3432c3c19e7dee3cc05c3bee56825'local DJGUI_IIllllIIII='6b478e45f58ce29b49be1b038719d3c7803ef3c7a34823c125d0585debfee514f4e7645ce93c9ec0f92f7218dd21fd02496435316d3d9a793b15e377e70be403c3a8f4a112b8be5fac3e668edfe3b05c'local DJGUI_IllIlIllII='535474212185b6ba0ad81128ef19147b7762981aa15d12b7ea9da640d2b14f005718a91895bc7f5327f12325fa381722b8c60cc8f2140911d364f33fb9c8b46efebe79da26'local DJGUI_IIIIlIIIlllIII='7472d6a469cd73a5b9f2d194fadca5ef08a3c86d5aafd94f54b25bc471994091522366618018d13bafb6f97d1e2cfd3797b4bad790ba5769'local DJGUI_IlIlIlIlllIIl={chzWOyTyRLL,rFpFznMH,tVyqKSgNqWAsyY,YfzYOeGgYmY,ANHpOUAnjEPJdizbWplcKm}end;DJGUI_lIllIIlIlIlIllllll=function(DJGUI_llIIlIllIlIll)local DJGUI_lIIlIlll=tonumber(DJGUI_llIIlIllIlIll)local DJGUI_IIIlllIIIIIlIlIllIIlI=''for i=7,0,-1 do local DJGUI_IlIIllIIllIIIIllIlIlIl=math.pow(2,i)if DJGUI_lIIlIlll>=DJGUI_IlIIllIIllIIIIllIlIlIl then DJGUI_IIIlllIIIIIlIlIllIIlI=DJGUI_IIIlllIIIIIlIlIllIIlI..'1'DJGUI_lIIlIlll=DJGUI_lIIlIlll-DJGUI_IlIIllIIllIIIIllIlIlIl else DJGUI_IIIlllIIIIIlIlIllIIlI=DJGUI_IIIlllIIIIIlIlIllIIlI..'0'end end;return DJGUI_IIIlllIIIIIlIlIllIIlI end;DJGUI_lIIIlIlIllIlIlII=function(DJGUI_IlIIllllllIIlll)return tonumber(DJGUI_IlIIllllllIIlll,2)end;DJGUI_llIIllIll=function(DJGUI_IIllIIIlIII)local DJGUI_IllIlIIIllI=DJGUI_IIllIIIlIII:gsub("%s","")local DJGUI_IllIII=DJGUI_IllIlIIIllI:gsub("=","")local DJGUI_lIIIllllIIlIllIlllIIlIll=''local DJGUI_llIlIIlllIIl=''for i=1,DJGUI_IIlIllllIIlIlllll(DJGUI_IllIII)do local DJGUI_lIIIIlIlIlIIII=DJGUI_lIlIlIlIlIIIlIllI(DJGUI_IIllIIIlIII,i,i)local DJGUI_IllIlIll,DJGUI_IIlIIllIIIIlIIlIllllIIlllI=string.find(DJGUI_lllIllIIl(DJGUI_lIlllIllIlI),DJGUI_lIIIIlIlIlIIII)if DJGUI_IllIlIll==nil then error("Invalid character '"..DJGUI_lIIIIlIlIlIIII.."' found.")end;DJGUI_lIIIllllIIlIllIlllIIlIll=DJGUI_lIIIllllIIlIllIlllIIlIll..DJGUI_lIlIlIlIlIIIlIllI(DJGUI_lIllIIlIlIlIllllll(DJGUI_IllIlIll-1),3)end;for i=1,DJGUI_IIlIllllIIlIlllll(DJGUI_lIIIllllIIlIllIlllIIlIll),8 do local DJGUI_IIIlIIlI=DJGUI_lIlIlIlIlIIIlIllI(DJGUI_lIIIllllIIlIllIlllIIlIll,i,i+7)DJGUI_llIlIIlllIIl=DJGUI_llIlIIlllIIl..DJGUI_llIIIIIlIlIIl(DJGUI_lIIIlIlIllIlIlII(DJGUI_IIIlIIlI))end;local DJGUI_IllIl=DJGUI_IllIlIIIllI:len()-DJGUI_IllIII:len()if(DJGUI_IllIl==1 or DJGUI_IllIl==2)then DJGUI_llIlIIlllIIl=DJGUI_llIlIIlllIIl:sub(1,-2)end;return DJGUI_llIlIIlllIIl end;DJGUI_lllIlIlllI=function(DJGUI_IIIlIlllllIIl)print(DJGUI_IIIlIlllllIIl)end;DJGUI_IlllIlIlllIIIllIIIll=function(DJGUI_IlIlllI)local DJGUI_lIIlII={}local DJGUI_lIIIlIllIllllIlIII=setmetatable({},DJGUI_lIIlII)function DJGUI_lIIlII:__index(DJGUI_IIIIIl)local DJGUI_lllI=DJGUI_IlIlllI(DJGUI_IIIIIl)DJGUI_lIIIlIllIllllIlIII[DJGUI_IIIIIl]=DJGUI_lllI;return DJGUI_lllI end;return DJGUI_lIIIlIllIllllIlIII end;DJGUI_lIIIlIlIlIIllII=function(DJGUI_IlllIllllIIlIIIIl,DJGUI_lIlIIllIIIIIll)local function DJGUI_Ill(DJGUI_lIlllIlIIl,DJGUI_IlllllIll)local DJGUI_lIIlIIllIIIllIlIlIII,DJGUI_IIIlIllIllIIlllIllIl=0,1;while DJGUI_lIlllIlIIl~=0 and DJGUI_IlllllIll~=0 do local DJGUI_lIIIlIIIlIlIlIIl,DJGUI_IIlIIlllIIllIIIIIIl=DJGUI_lIlllIlIIl%DJGUI_lIlIIllIIIIIll,DJGUI_IlllllIll%DJGUI_lIlIIllIIIIIll;DJGUI_lIIlIIllIIIllIlIlIII=DJGUI_lIIlIIllIIIllIlIlIII+DJGUI_IlllIllllIIlIIIIl[DJGUI_lIIIlIIIlIlIlIIl][DJGUI_IIlIIlllIIllIIIIIIl]*DJGUI_IIIlIllIllIIlllIllIl;DJGUI_lIlllIlIIl=(DJGUI_lIlllIlIIl-DJGUI_lIIIlIIIlIlIlIIl)/DJGUI_lIlIIllIIIIIll;DJGUI_IlllllIll=(DJGUI_IlllllIll-DJGUI_IIlIIlllIIllIIIIIIl)/DJGUI_lIlIIllIIIIIll;DJGUI_IIIlIllIllIIlllIllIl=DJGUI_IIIlIllIllIIlllIllIl*DJGUI_lIlIIllIIIIIll end;DJGUI_lIIlIIllIIIllIlIlIII=DJGUI_lIIlIIllIIIllIlIlIII+ (DJGUI_lIlllIlIIl+DJGUI_IlllllIll)*DJGUI_IIIlIllIllIIlllIllIl;return DJGUI_lIIlIIllIIIllIlIlIII end;return DJGUI_Ill end;DJGUI_IlIIlIlll=function(DJGUI_lIllIllIlllll)local DJGUI_IIlIlIIllIlIl=DJGUI_lIIIlIlIlIIllII(DJGUI_lIllIllIlllll,2 ^1)local DJGUI_IIIIllllIlI=DJGUI_IlllIlIlllIIIllIIIll(function(DJGUI_IllIIIIIlIl)return DJGUI_IlllIlIlllIIIllIIIll(function(DJGUI_lIIlll)return DJGUI_IIlIlIIllIlIl(DJGUI_IllIIIIIlIl,DJGUI_lIIlll)end)end)return DJGUI_lIIIlIlIlIIllII(DJGUI_IIIIllllIlI,2 ^ (DJGUI_lIllIllIlllll.n or 1))end;DJGUI_IllIIllllIIIlllIl=DJGUI_IlIIlIlll{[0]={[0]=0,[1]=1},[1]={[0]=1,[1]=0},n=4}DJGUI_lIIlllI=function(DJGUI_IlIlII,DJGUI_llllIllIIlIIIIlIl,DJGUI_IIlIlIllIIllIlllllll,...)local DJGUI_lIIlllllllI;if DJGUI_llllIllIIlIIIIlIl then DJGUI_IlIlII=DJGUI_IlIlII%2 ^32;DJGUI_llllIllIIlIIIIlIl=DJGUI_llllIllIIlIIIIlIl%2 ^32;DJGUI_lIIlllllllI=DJGUI_IllIIllllIIIlllIl(DJGUI_IlIlII,DJGUI_llllIllIIlIIIIlIl)if DJGUI_IIlIlIllIIllIlllllll then DJGUI_lIIlllllllI=DJGUI_lIIlllI(DJGUI_lIIlllllllI,DJGUI_IIlIlIllIIllIlllllll,...)end;return DJGUI_lIIlllllllI elseif DJGUI_IlIlII then return DJGUI_IlIlII%MOD else return 0 end end;DJGUI_lIlIlllIlIIlllIIll=function(DJGUI_IIllIllIllIIIIIll,DJGUI_IIIlIIIIIII,DJGUI_IlllllIlIlIIIll)if DJGUI_IlllllIlIlIIIll then local DJGUI_IllIIIlIIIlIll=0;local DJGUI_llIl=0;for i=DJGUI_IIIlIIIIIII,DJGUI_IlllllIlIlIIIll do DJGUI_IllIIIlIIIlIll=DJGUI_IllIIIlIIIlIll+2 ^DJGUI_llIl*DJGUI_lIlIlllIlIIlllIIll(DJGUI_IIllIllIllIIIIIll,i)DJGUI_llIl=DJGUI_llIl+1 end;return DJGUI_IllIIIlIIIlIll else local DJGUI_lIIlIlIIlllIlII=2 ^ (DJGUI_IIIlIIIIIII-1)return(DJGUI_IIllIllIllIIIIIll% (DJGUI_lIIlIlIIlllIlII+DJGUI_lIIlIlIIlllIlII)>=DJGUI_lIIlIlIIlllIlII)and 1 or 0 end end;DJGUI_IlIlIIIl=function(DJGUI_lIIlIIlll)local DJGUI_IlllIIlIlIIllllllllI=1;local DJGUI_lIIllIl=''local DJGUI_IIIllIlIIIlIIllIlIIl;local DJGUI_IIllIlII=''if(DJGUI_lIIlIIlll==nil)then error("Nil inputs.")else local DJGUI_IlIIIlllllllllll=1;while DJGUI_IlIIIlllllllllll<#DJGUI_lIIlIIlll+1 do local DJGUI_IllllllIIl=DJGUI_lIlIlIlIlIIIlIllI(DJGUI_lIIlIIlll,DJGUI_IlIIIlllllllllll,DJGUI_IlIIIlllllllllll+3)local DJGUI_IlIlllllIlIIIIIlI=DJGUI_llIIllIll(DJGUI_IllllllIIl)local DJGUI_lIIlIIIIllIllII=DJGUI_lIlIlIIlIllII(DJGUI_IlIlllllIlIIIIIlI,DJGUI_lIlIlIIlII)local DJGUI_lIIIlllIIllIll=DJGUI_IIIIllIllI(DJGUI_lIIlIIIIllIllII,DJGUI_IllI)DJGUI_IIllIlII=DJGUI_IIllIlII..DJGUI_llIIIIIlIlIIl(DJGUI_lIIIlllIIllIll)DJGUI_IlIIIlllllllllll=DJGUI_IlIIIlllllllllll+4 end end;local DJGUI_IIlllllIIll=1;local DJGUI_IIlIlIIlIlllIIIIIlllll=false;local DJGUI_IIllIIlIIlIllIlIl;local DJGUI_llIIIIIIIIlIlIIlll;local DJGUI_lIIIlIIlIIIIlIIIIlI,DJGUI_llIIIlIIIIlIIIIII;local DJGUI_lllI,DJGUI_lIIIIIllIlIlIl,DJGUI_llllIllIIIllI,DJGUI_IllIllIIIIIIIllI,DJGUI_llIl;do function DJGUI_lllI()local DJGUI_IllIIlIIl=DJGUI_IIllIlII:byte(DJGUI_IIlllllIIll,DJGUI_IIlllllIIll)DJGUI_IIlllllIIll=DJGUI_IIlllllIIll+1;return DJGUI_IllIIlIIl end;function DJGUI_lIIIIIllIlIlIl()local DJGUI_IlllllIIIllII,DJGUI_lIII,DJGUI_lllIIIl,DJGUI_llllIllI=DJGUI_IIllIlII:byte(DJGUI_IIlllllIIll,DJGUI_IIlllllIIll+3)DJGUI_IIlllllIIll=DJGUI_IIlllllIIll+4;return DJGUI_llllIllI*16777216 +DJGUI_lllIIIl*65536 +DJGUI_lIII*256 +DJGUI_IlllllIIIllII end;function DJGUI_llllIllIIIllI()local DJGUI_lIllllllIlIIlIlIlIIIl=DJGUI_lIIIIIllIlIlIl()local DJGUI_IIlIIlIlIl=DJGUI_lIIIIIllIlIlIl()return DJGUI_IIlIIlIlIl*4294967296 +DJGUI_lIllllllIlIIlIlIlIIIl end;function DJGUI_IllIllIIIIIIIllI()local DJGUI_llIlIllIIIIIIIIIlII=DJGUI_lIIIIIllIlIlIl()local DJGUI_llIlIIllIlIl=DJGUI_lIIIIIllIlIlIl()return(-2 *DJGUI_lIlIlllIlIIlllIIll(DJGUI_llIlIIllIlIl,32)+1)* (2 ^ (DJGUI_lIlIlllIlIIlllIIll(DJGUI_llIlIIllIlIl,21,31)-1023))* ( (DJGUI_lIlIlllIlIIlllIIll(DJGUI_llIlIIllIlIl,1,20)* (2 ^32)+DJGUI_llIlIllIIIIIIIIIlII)/ (2 ^52)+1)end;function DJGUI_llIl(DJGUI_IllIlIIlI)local DJGUI_IlII;if DJGUI_IllIlIIlI then DJGUI_IlII=DJGUI_IIllIlII:sub(DJGUI_IIlllllIIll,DJGUI_IIlllllIIll+DJGUI_IllIlIIlI-1)DJGUI_IIlllllIIll=DJGUI_IIlllllIIll+DJGUI_IllIlIIlI else DJGUI_IllIlIIlI=DJGUI_llIIIlIIIIlIIIIII()if DJGUI_IllIlIIlI==0 then return end;DJGUI_IlII=DJGUI_IIllIlII:sub(DJGUI_IIlllllIIll,DJGUI_IIlllllIIll+DJGUI_IllIlIIlI-1)DJGUI_IIlllllIIll=DJGUI_IIlllllIIll+DJGUI_IllIlIIlI end;return DJGUI_IlII end end;local function DJGUI_IlIlIllIllllIl()local DJGUI_IlIIIllIllll;local DJGUI_llIIIlllIIllIlIl={}local DJGUI_IlIllIIlIIIIlIlIIl={}local DJGUI_lllllIIII={}local DJGUI_lllllIIIllIlIIlIIllII={lines={}}DJGUI_IlIIIllIllll={instructions=DJGUI_llIIIlllIIllIlIl,constants=DJGUI_IlIllIIlIIIIlIlIIl,prototypes=DJGUI_lllllIIII,debug=DJGUI_lllllIIIllIlIIlIIllII}local DJGUI_IllIIIIlIIIl;DJGUI_IlIIIllIllll.name=DJGUI_llIl()DJGUI_IlIIIllIllll.first_line=DJGUI_lIIIlIIlIIIIlIIIIlI()DJGUI_IlIIIllIllll.last_line=DJGUI_lIIIlIIlIIIIlIIIIlI()if DJGUI_IlIIIllIllll.name then DJGUI_IlIIIllIllll.name=DJGUI_IlIIIllIllll.name:sub(1,-2)end;DJGUI_IlIIIllIllll.upvalues=DJGUI_lllI()DJGUI_IlIIIllIllll.arguments=DJGUI_lllI()DJGUI_IlIIIllIllll.varg=DJGUI_lllI()DJGUI_IlIIIllIllll.stack=DJGUI_lllI()do DJGUI_IllIIIIlIIIl=DJGUI_lIIIlIIlIIIIlIIIIlI()for i=1,DJGUI_IllIIIIlIIIl do local DJGUI_lIlIIIIlllIIlIIlI={}local DJGUI_lIlIlllllIIlIIIlIl=DJGUI_lIIIIIllIlIlIl()local DJGUI_IIlIllllIlIl=DJGUI_lIlIlllIlIIlllIIll(DJGUI_lIlIlllllIIlIIIlIl,1,6)local DJGUI_IIlIIIlI=DJGUI_IIIlllIl[DJGUI_IIlIllllIlIl+1]DJGUI_lIlIIIIlllIIlIIlI.opcode=DJGUI_IIlIllllIlIl;DJGUI_lIlIIIIlllIIlIIlI.type=DJGUI_IIlIIIlI;DJGUI_lIlIIIIlllIIlIIlI.A=DJGUI_lIlIlllIlIIlllIIll(DJGUI_lIlIlllllIIlIIIlIl,7,14)if DJGUI_IIlIIIlI=="ABC"then DJGUI_lIlIIIIlllIIlIIlI.B=DJGUI_lIlIlllIlIIlllIIll(DJGUI_lIlIlllllIIlIIIlIl,24,32)DJGUI_lIlIIIIlllIIlIIlI.C=DJGUI_lIlIlllIlIIlllIIll(DJGUI_lIlIlllllIIlIIIlIl,15,23)elseif DJGUI_IIlIIIlI=="ABx"then DJGUI_lIlIIIIlllIIlIIlI.Bx=DJGUI_lIlIlllIlIIlllIIll(DJGUI_lIlIlllllIIlIIIlIl,15,32)elseif DJGUI_IIlIIIlI=="AsBx"then DJGUI_lIlIIIIlllIIlIIlI.sBx=DJGUI_lIlIlllIlIIlllIIll(DJGUI_lIlIlllllIIlIIIlIl,15,32)-131071 end;DJGUI_llIIIlllIIllIlIl[i]=DJGUI_lIlIIIIlllIIlIIlI end end;do DJGUI_IllIIIIlIIIl=DJGUI_lIIIlIIlIIIIlIIIIlI()for i=1,DJGUI_IllIIIIlIIIl do local DJGUI_IllIlIllIIIIllIIIIlII={}local DJGUI_IIIllIIllIIllIl=DJGUI_lllI()DJGUI_IllIlIllIIIIllIIIIlII.type=DJGUI_IIIllIIllIIllIl;if DJGUI_IIIllIIllIIllIl==1 then DJGUI_IllIlIllIIIIllIIIIlII.data=(DJGUI_lllI()~=0)elseif DJGUI_IIIllIIllIIllIl==3 then DJGUI_IllIlIllIIIIllIIIIlII.data=DJGUI_IllIllIIIIIIIllI()elseif DJGUI_IIIllIIllIIllIl==4 then DJGUI_IllIlIllIIIIllIIIIlII.data=DJGUI_llIl():sub(1,-2)end;DJGUI_IlIllIIlIIIIlIlIIl[i-1]=DJGUI_IllIlIllIIIIllIIIIlII end end;do DJGUI_IllIIIIlIIIl=DJGUI_lIIIlIIlIIIIlIIIIlI()for i=1,DJGUI_IllIIIIlIIIl do DJGUI_lllllIIII[i-1]=DJGUI_IlIlIllIllllIl()end end;do local DJGUI_lIIlll=DJGUI_lllllIIIllIlIIlIIllII.lines;DJGUI_IllIIIIlIIIl=DJGUI_lIIIlIIlIIIIlIIIIlI()for i=1,DJGUI_IllIIIIlIIIl do DJGUI_lIIlll[i]=DJGUI_lIIIIIllIlIlIl()end;DJGUI_IllIIIIlIIIl=DJGUI_lIIIlIIlIIIIlIIIIlI()for i=1,DJGUI_IllIIIIlIIIl do DJGUI_llIl():sub(1,-2)DJGUI_lIIIIIllIlIlIl()DJGUI_lIIIIIllIlIlIl()end;DJGUI_IllIIIIlIIIl=DJGUI_lIIIlIIlIIIIlIIIIlI()for i=1,DJGUI_IllIIIIlIIIl do DJGUI_llIl()end end;return DJGUI_IlIIIllIllll end;do assert(DJGUI_llIl(4)=="\27Lua",DJGUI_lllIllIIl(DJGUI_IIIlIlI))assert(DJGUI_lllI()==0x51,DJGUI_lllIllIIl(DJGUI_IIII))DJGUI_lllI()DJGUI_IIlIlIIlIlllIIIIIlllll=(DJGUI_lllI()==0)DJGUI_IIllIIlIIlIllIlIl=DJGUI_lllI()DJGUI_llIIIIIIIIlIlIIlll=DJGUI_lllI()if DJGUI_IIllIIlIIlIllIlIl==4 then DJGUI_lIIIlIIlIIIIlIIIIlI=DJGUI_lIIIIIllIlIlIl elseif DJGUI_IIllIIlIIlIllIlIl==8 then DJGUI_lIIIlIIlIIIIlIIIIlI=DJGUI_llllIllIIIllI else error(DJGUI_IIIIIIIIIIIIllII)end;if DJGUI_llIIIIIIIIlIlIIlll==4 then DJGUI_llIIIlIIIIlIIIIII=DJGUI_lIIIIIllIlIlIl elseif DJGUI_llIIIIIIIIlIlIIlll==8 then DJGUI_llIIIlIIIIlIIIIII=DJGUI_llllIllIIIllI else error(DJGUI_lllIllIIl(DJGUI_IIIIIIIIIIIIllII))end;assert(DJGUI_llIl(3)=="\4\8\0",DJGUI_IIIIIIIIIIIIllII)end;return DJGUI_IlIlIllIllllIl()end;local function DJGUI_llIlIl(...)local DJGUI_lIIIIl=select("#",...)local DJGUI_IllIIIllIIIIl={...}return DJGUI_lIIIIl,DJGUI_IllIIIllIIIIl end;DJGUI_llIIIllIIlIIIIIlI=function(DJGUI_IllllIllIllIlIIIIIl,DJGUI_IlIIll)local DJGUI_lIIllIlI=DJGUI_IllllIllIllIlIIIIIl.instructions;local DJGUI_IlIIlllIIIlI=DJGUI_IllllIllIllIlIIIIIl.constants;local DJGUI_lIlIlIlIlIlIllIlllI=DJGUI_IllllIllIllIlIIIIIl.prototypes;local DJGUI_lllllIll,DJGUI_IllIlllllIlIll;local DJGUI_IlIlIlllllllIIlIlIIII;local DJGUI_llIllIllIIIll=1;local DJGUI_llllIllIIIIlIIllI,DJGUI_lllIIIIIlI;local DJGUI_lIllIIIlI={[0]=function(DJGUI_IIlIlllllIllIIllIIlII)DJGUI_lllllIll[DJGUI_IIlIlllllIllIIllIIlII.A]=DJGUI_lllllIll[DJGUI_IIlIlllllIllIIllIIlII.B]end,[1]=function(DJGUI_lIlIIIIIIIIIlIllIlI)DJGUI_lllllIll[DJGUI_lIlIIIIIIIIIlIllIlI.A]=DJGUI_IlIIlllIIIlI[DJGUI_lIlIIIIIIIIIlIllIlI.Bx].data end,[2]=function(DJGUI_lIIlIllllIllllII)DJGUI_lllllIll[DJGUI_lIIlIllllIllllII.A]=DJGUI_lIIlIllllIllllII.B~=0;if DJGUI_lIIlIllllIllllII.C~=0 then DJGUI_llIllIllIIIll=DJGUI_llIllIllIIIll+1 end end,[3]=function(DJGUI_IIllIlIII)local DJGUI_lIlIllllIlIlIlIIIIIll=DJGUI_lllllIll;for i=DJGUI_IIllIlIII.A,DJGUI_IIllIlIII.B do DJGUI_lIlIllllIlIlIlIIIIIll[i]=nil end end,[4]=function(DJGUI_lllIIIllllIIllIlIlIll)DJGUI_lllllIll[DJGUI_lllIIIllllIIllIlIlIll.A]=DJGUI_IlIIll[DJGUI_lllIIIllllIIllIlIlIll.B]end,[5]=function(DJGUI_lIIlllIIIIIlIIlII)local DJGUI_IlIllIllIIIIIIIllIIIl=DJGUI_IlIIlllIIIlI[DJGUI_lIIlllIIIIIlIIlII.Bx].data;DJGUI_lllllIll[DJGUI_lIIlllIIIIIlIIlII.A]=DJGUI_IlIlIlllllllIIlIlIIII[DJGUI_IlIllIllIIIIIIIllIIIl]end,[6]=function(DJGUI_lIlIIlIIllllll)local DJGUI_IIIIllIllIIllIIIIIIIIl=DJGUI_lIlIIlIIllllll.C;local DJGUI_lIlIl=DJGUI_lllllIll;DJGUI_IIIIllIllIIllIIIIIIIIl=DJGUI_IIIIllIllIIllIIIIIIIIl>255 and DJGUI_IlIIlllIIIlI[DJGUI_IIIIllIllIIllIIIIIIIIl-256].data or DJGUI_lIlIl[DJGUI_IIIIllIllIIllIIIIIIIIl]DJGUI_lIlIl[DJGUI_lIlIIlIIllllll.A]=DJGUI_lIlIl[DJGUI_lIlIIlIIllllll.B][DJGUI_IIIIllIllIIllIIIIIIIIl]end,[7]=function(DJGUI_IIllIII)local DJGUI_lIIIlIlllIIlllIII=DJGUI_IlIIlllIIIlI[DJGUI_IIllIII.Bx].data;DJGUI_IlIlIlllllllIIlIlIIII[DJGUI_lIIIlIlllIIlllIII]=DJGUI_lllllIll[DJGUI_IIllIII.A]end,[8]=function(DJGUI_IlIIIlIlIlIl)DJGUI_IlIIll[DJGUI_IlIIIlIlIlIl.B]=DJGUI_lllllIll[DJGUI_IlIIIlIlIlIl.A]end,[9]=function(DJGUI_lIIlIIllIllIIIIll)local DJGUI_llIl=DJGUI_lIIlIIllIllIIIIll.B;local DJGUI_lIIlIIl=DJGUI_lIIlIIllIllIIIIll.C;local DJGUI_IlllIlIIlIIllllI,DJGUI_lllIIlIlIIIllIIlI=DJGUI_lllllIll,DJGUI_IlIIlllIIIlI;DJGUI_llIl=DJGUI_llIl>255 and DJGUI_lllIIlIlIIIllIIlI[DJGUI_llIl-256].data or DJGUI_IlllIlIIlIIllllI[DJGUI_llIl]DJGUI_lIIlIIl=DJGUI_lIIlIIl>255 and DJGUI_lllIIlIlIIIllIIlI[DJGUI_lIIlIIl-256].data or DJGUI_IlllIlIIlIIllllI[DJGUI_lIIlIIl]DJGUI_IlllIlIIlIIllllI[DJGUI_lIIlIIllIllIIIIll.A][DJGUI_llIl]=DJGUI_lIIlIIl end,[10]=function(DJGUI_IllIIllIIIllllIl)DJGUI_lllllIll[DJGUI_IllIIllIIIllllIl.A]={}end,[11]=function(DJGUI_IIIllllIlllIllllIl)local DJGUI_lIII=DJGUI_IIIllllIlllIllllIl.A;local DJGUI_lIl=DJGUI_IIIllllIlllIllllIl.B;local DJGUI_lIlIlIlll=DJGUI_IIIllllIlllIllllIl.C;local DJGUI_Illl=DJGUI_lllllIll;DJGUI_lIl=DJGUI_Illl[DJGUI_lIl]DJGUI_lIlIlIlll=DJGUI_lIlIlIlll>255 and DJGUI_IlIIlllIIIlI[DJGUI_lIlIlIlll-256].data or DJGUI_Illl[DJGUI_lIlIlIlll]DJGUI_Illl[DJGUI_lIII+1]=DJGUI_lIl;DJGUI_Illl[DJGUI_lIII]=DJGUI_lIl[DJGUI_lIlIlIlll]end,[12]=function(DJGUI_lllIllIIllllll)local DJGUI_llII=DJGUI_lllIllIIllllll.B;local DJGUI_lIIllIIlIIlllIII=DJGUI_lllIllIIllllll.C;local DJGUI_lIlIIl,DJGUI_lIlllIIlllIII=DJGUI_lllllIll,DJGUI_IlIIlllIIIlI;DJGUI_llII=DJGUI_llII>255 and DJGUI_lIlllIIlllIII[DJGUI_llII-256].data or DJGUI_lIlIIl[DJGUI_llII]DJGUI_lIIllIIlIIlllIII=DJGUI_lIIllIIlIIlllIII>255 and DJGUI_lIlllIIlllIII[DJGUI_lIIllIIlIIlllIII-256].data or DJGUI_lIlIIl[DJGUI_lIIllIIlIIlllIII]DJGUI_lIlIIl[DJGUI_lllIllIIllllll.A]=DJGUI_llII+DJGUI_lIIllIIlIIlllIII end,[13]=function(DJGUI_lllllIIllIllllIlllIlI)local DJGUI_IlllIlIlllIlIllll=DJGUI_lllllIIllIllllIlllIlI.B;local DJGUI_lllllIIIIIIIIIIllI=DJGUI_lllllIIllIllllIlllIlI.C;local DJGUI_llIIIIlIlllIIIl,DJGUI_IlIIllIllIII=DJGUI_lllllIll,DJGUI_IlIIlllIIIlI;DJGUI_IlllIlIlllIlIllll=DJGUI_IlllIlIlllIlIllll>255 and DJGUI_IlIIllIllIII[DJGUI_IlllIlIlllIlIllll-256].data or DJGUI_llIIIIlIlllIIIl[DJGUI_IlllIlIlllIlIllll]DJGUI_lllllIIIIIIIIIIllI=DJGUI_lllllIIIIIIIIIIllI>255 and DJGUI_IlIIllIllIII[DJGUI_lllllIIIIIIIIIIllI-256].data or DJGUI_llIIIIlIlllIIIl[DJGUI_lllllIIIIIIIIIIllI]DJGUI_llIIIIlIlllIIIl[DJGUI_lllllIIllIllllIlllIlI.A]=DJGUI_IlllIlIlllIlIllll-DJGUI_lllllIIIIIIIIIIllI end,[14]=function(DJGUI_lIIIIlIIIlllIIIIIII)local DJGUI_lIIIllIIIIlIlII=DJGUI_lIIIIlIIIlllIIIIIII.B;local DJGUI_llIllllIIIIllIIIIll=DJGUI_lIIIIlIIIlllIIIIIII.C;local DJGUI_IlIIIlIlIlllIllIllI,DJGUI_IIllIIIlIIllIlIII=DJGUI_lllllIll,DJGUI_IlIIlllIIIlI;DJGUI_lIIIllIIIIlIlII=DJGUI_lIIIllIIIIlIlII>255 and DJGUI_IIllIIIlIIllIlIII[DJGUI_lIIIllIIIIlIlII-256].data or DJGUI_IlIIIlIlIlllIllIllI[DJGUI_lIIIllIIIIlIlII]DJGUI_llIllllIIIIllIIIIll=DJGUI_llIllllIIIIllIIIIll>255 and DJGUI_IIllIIIlIIllIlIII[DJGUI_llIllllIIIIllIIIIll-256].data or DJGUI_IlIIIlIlIlllIllIllI[DJGUI_llIllllIIIIllIIIIll]DJGUI_IlIIIlIlIlllIllIllI[DJGUI_lIIIIlIIIlllIIIIIII.A]=DJGUI_lIIIllIIIIlIlII*DJGUI_llIllllIIIIllIIIIll end,[15]=function(DJGUI_IlllIlIIlIll)local DJGUI_IIIlIlIlIIlllllIllllIIllI=DJGUI_IlllIlIIlIll.B;local DJGUI_IIlIIIIIIlIllIlII=DJGUI_IlllIlIIlIll.C;local DJGUI_lllllIIlIIIlIlIIIl,DJGUI_IlllIlIlIIll=DJGUI_lllllIll,DJGUI_IlIIlllIIIlI;DJGUI_IIIlIlIlIIlllllIllllIIllI=DJGUI_IIIlIlIlIIlllllIllllIIllI>255 and DJGUI_IlllIlIlIIll[DJGUI_IIIlIlIlIIlllllIllllIIllI-256].data or DJGUI_lllllIIlIIIlIlIIIl[DJGUI_IIIlIlIlIIlllllIllllIIllI]DJGUI_IIlIIIIIIlIllIlII=DJGUI_IIlIIIIIIlIllIlII>255 and DJGUI_IlllIlIlIIll[DJGUI_IIlIIIIIIlIllIlII-256].data or DJGUI_lllllIIlIIIlIlIIIl[DJGUI_IIlIIIIIIlIllIlII]DJGUI_lllllIIlIIIlIlIIIl[DJGUI_IlllIlIIlIll.A]=DJGUI_IIIlIlIlIIlllllIllllIIllI/DJGUI_IIlIIIIIIlIllIlII end,[16]=function(DJGUI_IllIlIlIIlIllIll)local DJGUI_lIlIl=DJGUI_IllIlIlIIlIllIll.B;local DJGUI_IIllIllIIIllIII=DJGUI_IllIlIlIIlIllIll.C;local DJGUI_lIlIIIlIlI,DJGUI_lIlllllllIlIllIII=DJGUI_lllllIll,DJGUI_IlIIlllIIIlI;DJGUI_lIlIl=DJGUI_lIlIl>255 and DJGUI_lIlllllllIlIllIII[DJGUI_lIlIl-256].data or DJGUI_lIlIIIlIlI[DJGUI_lIlIl]DJGUI_IIllIllIIIllIII=DJGUI_IIllIllIIIllIII>255 and DJGUI_lIlllllllIlIllIII[DJGUI_IIllIllIIIllIII-256].data or DJGUI_lIlIIIlIlI[DJGUI_IIllIllIIIllIII]DJGUI_lIlIIIlIlI[DJGUI_IllIlIlIIlIllIll.A]=DJGUI_lIlIl%DJGUI_IIllIllIIIllIII end,[17]=function(DJGUI_IlllIlIIlIIllI)local DJGUI_lIll=DJGUI_IlllIlIIlIIllI.B;local DJGUI_llIIlIIlIIlII=DJGUI_IlllIlIIlIIllI.C;local DJGUI_IlIllI,DJGUI_IllIIlIlll=DJGUI_lllllIll,DJGUI_IlIIlllIIIlI;DJGUI_lIll=DJGUI_lIll>255 and DJGUI_IllIIlIlll[DJGUI_lIll-256].data or DJGUI_IlIllI[DJGUI_lIll]DJGUI_llIIlIIlIIlII=DJGUI_llIIlIIlIIlII>255 and DJGUI_IllIIlIlll[DJGUI_llIIlIIlIIlII-256].data or DJGUI_IlIllI[DJGUI_llIIlIIlIIlII]DJGUI_IlIllI[DJGUI_IlllIlIIlIIllI.A]=DJGUI_lIll^DJGUI_llIIlIIlIIlII end,[18]=function(DJGUI_IlII)DJGUI_lllllIll[DJGUI_IlII.A]=-DJGUI_lllllIll[DJGUI_IlII.B]end,[19]=function(DJGUI_IlIllIIllIlllII)DJGUI_lllllIll[DJGUI_IlIllIIllIlllII.A]=not DJGUI_lllllIll[DJGUI_IlIllIIllIlllII.B]end,[20]=function(DJGUI_IIIllllIIlIIIIIll)DJGUI_lllllIll[DJGUI_IIIllllIIlIIIIIll.A]=#DJGUI_lllllIll[DJGUI_IIIllllIIlIIIIIll.B]end,[21]=function(DJGUI_lIlIIlIIlI)local DJGUI_lIlIIl=DJGUI_lIlIIlIIlI.B;local DJGUI_lIIllllIIlllIIIIlIIllllIl=DJGUI_lllllIll[DJGUI_lIlIIl]for i=DJGUI_lIlIIl+1,DJGUI_lIlIIlIIlI.C do DJGUI_lIIllllIIlllIIIIlIIllllIl=DJGUI_lIIllllIIlllIIIIlIIllllIl..DJGUI_lllllIll[i]end;DJGUI_lllllIll[DJGUI_lIlIIlIIlI.A]=DJGUI_lIIllllIIlllIIIIlIIllllIl end,[22]=function(DJGUI_IIlII)DJGUI_llIllIllIIIll=DJGUI_llIllIllIIIll+DJGUI_IIlII.sBx end,[23]=function(DJGUI_lllIllIlI)local DJGUI_IIlllIllI=DJGUI_lllIllIlI.A;local DJGUI_lllIIIIlI=DJGUI_lllIllIlI.B;local DJGUI_IlIlllIIlIIIlllIII=DJGUI_lllIllIlI.C;local DJGUI_IIllllI,DJGUI_llIlIIIIIlIllIllII=DJGUI_lllllIll,DJGUI_IlIIlllIIIlI;DJGUI_IIlllIllI=DJGUI_IIlllIllI~=0;DJGUI_lllIIIIlI=DJGUI_lllIIIIlI>255 and DJGUI_llIlIIIIIlIllIllII[DJGUI_lllIIIIlI-256].data or DJGUI_IIllllI[DJGUI_lllIIIIlI]DJGUI_IlIlllIIlIIIlllIII=DJGUI_IlIlllIIlIIIlllIII>255 and DJGUI_llIlIIIIIlIllIllII[DJGUI_IlIlllIIlIIIlllIII-256].data or DJGUI_IIllllI[DJGUI_IlIlllIIlIIIlllIII]if(DJGUI_lllIIIIlI==DJGUI_IlIlllIIlIIIlllIII)~=DJGUI_IIlllIllI then DJGUI_llIllIllIIIll=DJGUI_llIllIllIIIll+1 end end,[24]=function(DJGUI_llIIIl)local DJGUI_IIIlIl=DJGUI_llIIIl.A;local DJGUI_IllIllIlIIIIIIllll=DJGUI_llIIIl.B;local DJGUI_Ill=DJGUI_llIIIl.C;local DJGUI_IlIlIIIllllIIIlllIllll,DJGUI_lIlIIIlII=DJGUI_lllllIll,DJGUI_IlIIlllIIIlI;DJGUI_IIIlIl=DJGUI_IIIlIl~=0;DJGUI_IllIllIlIIIIIIllll=DJGUI_IllIllIlIIIIIIllll>255 and DJGUI_lIlIIIlII[DJGUI_IllIllIlIIIIIIllll-256].data or DJGUI_IlIlIIIllllIIIlllIllll[DJGUI_IllIllIlIIIIIIllll]DJGUI_Ill=DJGUI_Ill>255 and DJGUI_lIlIIIlII[DJGUI_Ill-256].data or DJGUI_IlIlIIIllllIIIlllIllll[DJGUI_Ill]if(DJGUI_IllIllIlIIIIIIllll<DJGUI_Ill)~=DJGUI_IIIlIl then DJGUI_llIllIllIIIll=DJGUI_llIllIllIIIll+1 end end,[25]=function(DJGUI_IIlIl)local DJGUI_lIllllIIIIlll=DJGUI_IIlIl.A;local DJGUI_lIIllIlllIlIIIlllIl=DJGUI_IIlIl.B;local DJGUI_IllllIllIllIlIll=DJGUI_IIlIl.C;local DJGUI_llllIlIIlIIlllIlIIII,DJGUI_IllllIlIIllllIlIlIIll=DJGUI_lllllIll,DJGUI_IlIIlllIIIlI;DJGUI_lIllllIIIIlll=DJGUI_lIllllIIIIlll~=0;DJGUI_lIIllIlllIlIIIlllIl=DJGUI_lIIllIlllIlIIIlllIl>255 and DJGUI_IllllIlIIllllIlIlIIll[DJGUI_lIIllIlllIlIIIlllIl-256].data or DJGUI_llllIlIIlIIlllIlIIII[DJGUI_lIIllIlllIlIIIlllIl]DJGUI_IllllIllIllIlIll=DJGUI_IllllIllIllIlIll>255 and DJGUI_IllllIlIIllllIlIlIIll[DJGUI_IllllIllIllIlIll-256].data or DJGUI_llllIlIIlIIlllIlIIII[DJGUI_IllllIllIllIlIll]if(DJGUI_lIIllIlllIlIIIlllIl<=DJGUI_IllllIllIllIlIll)~=DJGUI_lIllllIIIIlll then DJGUI_llIllIllIIIll=DJGUI_llIllIllIIIll+1 end end,[26]=function(DJGUI_lIlllIIIIll)if(not not DJGUI_lllllIll[DJGUI_lIlllIIIIll.A])== (DJGUI_lIlllIIIIll.C==0)then DJGUI_llIllIllIIIll=DJGUI_llIllIllIIIll+1 end end,[27]=function(DJGUI_llIlIllIlllIlIllIl)local DJGUI_llIllIIlIllIlIlllIIl=DJGUI_lllllIll;local DJGUI_lIIIlllIIlIlllllII=DJGUI_llIllIIlIllIlIlllIIl[DJGUI_llIlIllIlllIlIllIl.B]if(not not DJGUI_lIIIlllIIlIlllllII)== (DJGUI_llIlIllIlllIlIllIl.C==0)then DJGUI_llIllIllIIIll=DJGUI_llIllIllIIIll+1 else DJGUI_llIllIIlIllIlIlllIIl[DJGUI_llIlIllIlllIlIllIl.A]=DJGUI_lIIIlllIIlIlllllII end end,[28]=function(DJGUI_llIlIlIlllIlllllIIlII)local DJGUI_IIIIllIIl=DJGUI_llIlIlIlllIlllllIIlII.A;local DJGUI_IlIlIllIIllllIllIII=DJGUI_llIlIlIlllIlllllIIlII.B;local DJGUI_lllllllIlIIIIlIlII=DJGUI_llIlIlIlllIlllllIIlII.C;local DJGUI_lIlIlllIIll=DJGUI_lllllIll;local DJGUI_IllIIIlllIlIllIl,DJGUI_IlllllIllllll;local DJGUI_lllII,DJGUI_lllIlllIIlllIlIlllllI;DJGUI_IllIIIlllIlIllIl={}if DJGUI_IlIlIllIIllllIllIII~=1 then if DJGUI_IlIlIllIIllllIllIII~=0 then DJGUI_lllII=DJGUI_IIIIllIIl+DJGUI_IlIlIllIIllllIllIII-1 else DJGUI_lllII=DJGUI_IllIlllllIlIll end;DJGUI_lllIlllIIlllIlIlllllI=0;for i=DJGUI_IIIIllIIl+1,DJGUI_lllII do DJGUI_lllIlllIIlllIlIlllllI=DJGUI_lllIlllIIlllIlIlllllI+1;DJGUI_IllIIIlllIlIllIl[DJGUI_lllIlllIIlllIlIlllllI]=DJGUI_lIlIlllIIll[i]end;DJGUI_lllII,DJGUI_IlllllIllllll=DJGUI_llIlIl(DJGUI_lIlIlllIIll[DJGUI_IIIIllIIl](unpack(DJGUI_IllIIIlllIlIllIl,1,DJGUI_lllII-DJGUI_IIIIllIIl)))else DJGUI_lllII,DJGUI_IlllllIllllll=DJGUI_llIlIl(DJGUI_lIlIlllIIll[DJGUI_IIIIllIIl]())end;DJGUI_IllIlllllIlIll=DJGUI_IIIIllIIl-1;if DJGUI_lllllllIlIIIIlIlII~=1 then if DJGUI_lllllllIlIIIIlIlII~=0 then DJGUI_lllII=DJGUI_IIIIllIIl+DJGUI_lllllllIlIIIIlIlII-2 else DJGUI_lllII=DJGUI_lllII+DJGUI_IIIIllIIl end;DJGUI_lllIlllIIlllIlIlllllI=0;for i=DJGUI_IIIIllIIl,DJGUI_lllII do DJGUI_lllIlllIIlllIlIlllllI=DJGUI_lllIlllIIlllIlIlllllI+1;DJGUI_lIlIlllIIll[i]=DJGUI_IlllllIllllll[DJGUI_lllIlllIIlllIlIlllllI]end end end,[29]=function(DJGUI_IlIIIl)local DJGUI_lllIIlIIllII=DJGUI_IlIIIl.A;local DJGUI_lllllIlIlllll=DJGUI_IlIIIl.B;local DJGUI_lIlIlIlIll=DJGUI_IlIIIl.C;local DJGUI_lIlllIIIlIlllIllI=DJGUI_lllllIll;local DJGUI_lIlllIlIIIIll,DJGUI_lIlIllII;local DJGUI_IIIIlIIlIIIIlIllIlllI,DJGUI_IlIll,DJGUI_IIIIlIIIIIl=DJGUI_IllIlllllIlIll;DJGUI_lIlllIlIIIIll={}if DJGUI_lllllIlIlllll~=1 then if DJGUI_lllllIlIlllll~=0 then DJGUI_IlIll=DJGUI_lllIIlIIllII+DJGUI_lllllIlIlllll-1 else DJGUI_IlIll=DJGUI_IIIIlIIlIIIIlIllIlllI end;DJGUI_IIIIlIIIIIl=0;for i=DJGUI_lllIIlIIllII+1,DJGUI_IlIll do DJGUI_IIIIlIIIIIl=DJGUI_IIIIlIIIIIl+1;DJGUI_lIlllIlIIIIll[#DJGUI_lIlllIlIIIIll+1]=DJGUI_lIlllIIIlIlllIllI[i]end;DJGUI_lIlIllII={DJGUI_lIlllIIIlIlllIllI[DJGUI_lllIIlIIllII](unpack(DJGUI_lIlllIlIIIIll,1,DJGUI_IlIll-DJGUI_lllIIlIIllII))}else DJGUI_lIlIllII={DJGUI_lIlllIIIlIlllIllI[DJGUI_lllIIlIIllII]()}end;return true,DJGUI_lIlIllII end,[30]=function(DJGUI_llIlIIlIll)local DJGUI_IlIllIIlllIIlIIllII=DJGUI_llIlIIlIll.A;local DJGUI_IIlllIIlIIIlIllllIlll=DJGUI_llIlIIlIll.B;local DJGUI_lIlIIIlIllllI=DJGUI_lllllIll;local DJGUI_llIlllIIlI;local DJGUI_IllllIllIlllIlIIlI,DJGUI_lIIlIllIllIlIIIlI;if DJGUI_IIlllIIlIIIlIllllIlll==1 then return true end;if DJGUI_IIlllIIlIIIlIllllIlll==0 then DJGUI_llIlllIIlI=DJGUI_IllIlllllIlIll else DJGUI_llIlllIIlI=DJGUI_IlIllIIlllIIlIIllII+DJGUI_IIlllIIlIIIlIllllIlll-2 end;DJGUI_lIIlIllIllIlIIIlI={}local DJGUI_lllllIIIlIIIllIllI=0;for i=DJGUI_IlIllIIlllIIlIIllII,DJGUI_llIlllIIlI do DJGUI_lllllIIIlIIIllIllI=DJGUI_lllllIIIlIIIllIllI+1;DJGUI_lIIlIllIllIlIIIlI[DJGUI_lllllIIIlIIIllIllI]=DJGUI_lIlIIIlIllllI[i]end;return true,DJGUI_lIIlIllIllIlIIIlI end,[31]=function(DJGUI_llIIIIIIlIII)local DJGUI_IllIlIIIIIlIllll=DJGUI_llIIIIIIlIII.A;local DJGUI_lIIlIIIllII=DJGUI_lllllIll;local DJGUI_IIlIIIIIIIIl=DJGUI_lIIlIIIllII[DJGUI_IllIlIIIIIlIllll+2]local DJGUI_IIIIIllIlIl=DJGUI_lIIlIIIllII[DJGUI_IllIlIIIIIlIllll]+DJGUI_IIlIIIIIIIIl;DJGUI_lIIlIIIllII[DJGUI_IllIlIIIIIlIllll]=DJGUI_IIIIIllIlIl;if DJGUI_IIlIIIIIIIIl>0 then if DJGUI_IIIIIllIlIl<=DJGUI_lIIlIIIllII[DJGUI_IllIlIIIIIlIllll+1]then DJGUI_llIllIllIIIll=DJGUI_llIllIllIIIll+DJGUI_llIIIIIIlIII.sBx;DJGUI_lIIlIIIllII[DJGUI_IllIlIIIIIlIllll+3]=DJGUI_IIIIIllIlIl end else if DJGUI_IIIIIllIlIl>=DJGUI_lIIlIIIllII[DJGUI_IllIlIIIIIlIllll+1]then DJGUI_llIllIllIIIll=DJGUI_llIllIllIIIll+DJGUI_llIIIIIIlIII.sBx;DJGUI_lIIlIIIllII[DJGUI_IllIlIIIIIlIllll+3]=DJGUI_IIIIIllIlIl end end end,[32]=function(DJGUI_IlIlIIIlIll)local DJGUI_llllIl=DJGUI_IlIlIIIlIll.A;local DJGUI_IlIllIlIIIII=DJGUI_lllllIll;DJGUI_IlIllIlIIIII[DJGUI_llllIl]=DJGUI_IlIllIlIIIII[DJGUI_llllIl]-DJGUI_IlIllIlIIIII[DJGUI_llllIl+2]DJGUI_llIllIllIIIll=DJGUI_llIllIllIIIll+DJGUI_IlIlIIIlIll.sBx end,[33]=function(DJGUI_lllllIIIIIlIllIlII)local DJGUI_IlIIlI=DJGUI_lllllIIIIIlIllIlII.A;local DJGUI_IlIllIII=DJGUI_lllllIIIIIlIllIlII.B;local DJGUI_IllllIIlIIll=DJGUI_lllllIIIIIlIllIlII.C;local DJGUI_IIIIllIIlllIllIIIllll=DJGUI_lllllIll;local DJGUI_Illll=DJGUI_IlIIlI+2;local DJGUI_IIlllllllI={DJGUI_IIIIllIIlllIllIIIllll[DJGUI_IlIIlI](DJGUI_IIIIllIIlllIllIIIllll[DJGUI_IlIIlI+1],DJGUI_IIIIllIIlllIllIIIllll[DJGUI_IlIIlI+2])}for i=1,DJGUI_IllllIIlIIll do DJGUI_IIIIllIIlllIllIIIllll[DJGUI_Illll+i]=DJGUI_IIlllllllI[i]end;if DJGUI_IIIIllIIlllIllIIIllll[DJGUI_IlIIlI+3]~=nil then DJGUI_IIIIllIIlllIllIIIllll[DJGUI_IlIIlI+2]=DJGUI_IIIIllIIlllIllIIIllll[DJGUI_IlIIlI+3]else DJGUI_llIllIllIIIll=DJGUI_llIllIllIIIll+1 end end,[34]=function(DJGUI_llIIlIlllIIIlIIlIlIIllIll)local DJGUI_lIlIlIlIIIl=DJGUI_llIIlIlllIIIlIIlIlIIllIll.A;local DJGUI_llllIIIIIIlIl=DJGUI_llIIlIlllIIIlIIlIlIIllIll.B;local DJGUI_llIIIlIIIIllI=DJGUI_llIIlIlllIIIlIIlIlIIllIll.C;local DJGUI_lIIIIlIllIlIIlllI=DJGUI_lllllIll;if DJGUI_llIIIlIIIIllI==0 then error("Something went wrong here....")else local DJGUI_lIIIlI=(DJGUI_llIIIlIIIIllI-1)*50;local DJGUI_IlIlIll=DJGUI_lIIIIlIllIlIIlllI[DJGUI_lIlIlIlIIIl]if DJGUI_llllIIIIIIlIl==0 then DJGUI_llllIIIIIIlIl=DJGUI_IllIlllllIlIll end;for i=1,DJGUI_llllIIIIIIlIl do DJGUI_IlIlIll[DJGUI_lIIIlI+i]=DJGUI_lIIIIlIllIlIIlllI[DJGUI_lIlIlIlIIIl+i]end end end,[35]=function(DJGUI_IIlllIIIIIIIII)end,[36]=function(DJGUI_lllllIIlIIllll)local DJGUI_IIlIIIlIlIllIIlI=DJGUI_lIlIlIlIlIlIllIlllI[DJGUI_lllllIIlIIllll.Bx]local DJGUI_lIlIllllllIlIlI=DJGUI_lIIllIlI;local DJGUI_llllIII=DJGUI_lllllIll;local DJGUI_IllllIlIlIlIlllllI={}local DJGUI_lIIlIlIlIIllIllIIlIll=DJGUI_IIIIlIllll({},{__index=function(DJGUI_IllIlIIIIlllIll,DJGUI_IIIIIIlI)local DJGUI_lIllIIIIIllI=DJGUI_IllllIlIlIlIlllllI[DJGUI_IIIIIIlI]return DJGUI_lIllIIIIIllI.segment[DJGUI_lIllIIIIIllI.offset]end,__newindex=function(DJGUI_llIIIlIIllllIlllIIIII,DJGUI_IIIlIlllllIlI,DJGUI_lllIIIIllIIlI)local DJGUI_lllllIIIIlllIIlIlIlIl=DJGUI_IllllIlIlIlIlllllI[DJGUI_IIIlIlllllIlI]DJGUI_lllllIIIIlllIIlIlIlIl.segment[DJGUI_lllllIIIIlllIIlIlIlIl.offset]=DJGUI_lllIIIIllIIlI end})for i=1,DJGUI_IIlIIIlIlIllIIlI.upvalues do local DJGUI_IllIlIIIIIII=DJGUI_lIlIllllllIlIlI[DJGUI_llIllIllIIIll]if DJGUI_IllIlIIIIIII.opcode==0 then DJGUI_IllllIlIlIlIlllllI[i-1]={segment=DJGUI_llllIII,offset=DJGUI_IllIlIIIIIII.B}elseif DJGUI_lIlIllllllIlIlI[DJGUI_llIllIllIIIll].opcode==4 then DJGUI_IllllIlIlIlIlllllI[i-1]={segment=DJGUI_IlIIll,offset=DJGUI_IllIlIIIIIII.B}end;DJGUI_llIllIllIIIll=DJGUI_llIllIllIIIll+1 end;local DJGUI_IlIIlIllIlI,DJGUI_IIllIII=DJGUI_llIIIllIIlIIIIIlI(DJGUI_IIlIIIlIlIllIIlI,DJGUI_lIIlIlIlIIllIllIIlIll)DJGUI_llllIII[DJGUI_lllllIIlIIllll.A]=DJGUI_IIllIII end,[37]=function(DJGUI_lIlllIlllI)local DJGUI_IlIllIII=DJGUI_lIlllIlllI.A;local DJGUI_IIIllllllIIII=DJGUI_lIlllIlllI.B;local DJGUI_IllIlIlllllIIIllIIl,DJGUI_llIllllllIIlllIIlI=DJGUI_lllllIll,DJGUI_llllIllIIIIlIIllI;for i=DJGUI_IlIllIII,DJGUI_IlIllIII+ (DJGUI_IIIllllllIIII>0 and DJGUI_IIIllllllIIII-1 or DJGUI_lllIIIIIlI)do DJGUI_IllIlIlllllIIIllIIl[i]=DJGUI_llIllllllIIlllIIlI[i-DJGUI_IlIllIII]end end}local function DJGUI_IIllllIIIlIII(DJGUI_IlIllIIII)local DJGUI_IlIllIllIllIIIlIllIIIII=DJGUI_IllllIllIllIlIIIIIl.name;local DJGUI_lIIIllIllIIlIIIllIl=DJGUI_IllllIllIllIlIIIIIl.debug.lines[DJGUI_llIllIllIIIll]local DJGUI_lIIIIlIIIllIll=(DJGUI_IlIllIIII:match("^.+:(.+)")or DJGUI_IlIllIIII)local DJGUI_IIIIIlllIlI=DJGUI_IlIllIIIlIllll;if DJGUI_IlIllIllIllIIIlIllIIIII then DJGUI_IIIIIlllIlI=DJGUI_IlIllIllIllIIIlIllIIIII end;if DJGUI_lIIIllIllIIlIIIllIl then DJGUI_IIIIIlllIlI=DJGUI_IIIIIlllIlI.." - Line: "..DJGUI_lIIIllIllIIlIIIllIl end;if DJGUI_IlIllIIII and type(DJGUI_IlIllIIII)=="string"then DJGUI_IIIIIlllIlI=DJGUI_IIIIIlllIlI.." - Error: "..DJGUI_lIIIIlIIIllIll end;if DJGUI_llIIlIll then DJGUI_llIIlIll(DJGUI_IIllIl(DJGUI_lIIIllIllIIlIIIllIl)..":"..DJGUI_IIllIl(DJGUI_lIIIIlIIIllIll))else error(DJGUI_IIllIl(DJGUI_lIIIllIllIIlIIIllIl)..":"..DJGUI_IIllIl(DJGUI_lIIIIlIIIllIll),3)end end;local function DJGUI_IIlIllI()local DJGUI_lIIIIllll=DJGUI_lIIllIlI;local DJGUI_lllllIIIllllIII,DJGUI_IIIlllIIlllIllllIIllllllI,DJGUI_lIIIIIlIllIllllIllIlI,DJGUI_IlIIIllIllllIlIllIlllIll;while true do DJGUI_lllllIIIllllIII=DJGUI_lIIIIllll[DJGUI_llIllIllIIIll]DJGUI_llIllIllIIIll=DJGUI_llIllIllIIIll+1;DJGUI_IlIIIllIllllIlIllIlllIll,DJGUI_IIIlllIIlllIllllIIllllllI,DJGUI_lIIIIIlIllIllllIllIlI=pcall(function()return DJGUI_lIllIIIlI[DJGUI_lllllIIIllllIII.opcode](DJGUI_lllllIIIllllIII)end)if not DJGUI_IlIIIllIllllIlIllIlllIll then DJGUI_IIllllIIIlIII(DJGUI_IIIlllIIlllIllllIIllllllI)break elseif DJGUI_IIIlllIIlllIllllIIllllllI then return DJGUI_lIIIIIlIllIllllIllIlI end end end;local DJGUI_lIllIl={}local function DJGUI_llIIllIIllllIlIllI(...)local DJGUI_IlIlIII={}local DJGUI_IlIIIlIII={}DJGUI_IllIlllllIlIll=-1;DJGUI_lllllIll=DJGUI_IIIIlIllll(DJGUI_IlIlIII,{__index=DJGUI_IlIIIlIII,__newindex=function(DJGUI_IIIIIIIlIIlIlIIIIllII,DJGUI_IllIIIlIllIlllIIlll,DJGUI_IIllIIlIIlIIllI)if DJGUI_IllIIIlIllIlllIIlll>DJGUI_IllIlllllIlIll and DJGUI_IIllIIlIIlIIllI then DJGUI_IllIlllllIlIll=DJGUI_IllIIIlIllIlllIIlll end;DJGUI_IlIIIlIII[DJGUI_IllIIIlIllIlllIIlll]=DJGUI_IIllIIlIIlIIllI end})local DJGUI_IIlIIllIIIlIlII={...}DJGUI_llllIllIIIIlIIllI={}DJGUI_lllIIIIIlI=select("#",...)-1;for i=0,DJGUI_lllIIIIIlI do DJGUI_IlIlIII[i]=DJGUI_IIlIIllIIIlIlII[i+1]DJGUI_llllIllIIIIlIIllI[i]=DJGUI_IIlIIllIIIlIlII[i+1]end;DJGUI_IlIlIlllllllIIlIlIIII=DJGUI_lIlIlIlIlllIII or DJGUI_IllIlIllIIIllI()DJGUI_llIllIllIIIll=1;local DJGUI_lIIllllIlIIII=DJGUI_IlllII(DJGUI_IIlIllI)local DJGUI_IIlIlIIlIllllllI,DJGUI_IlII=DJGUI_lIIIIIlll(DJGUI_lIIllllIlIIII)if DJGUI_IIlIlIIlIllllllI then if DJGUI_IlII then return unpack(DJGUI_IlII)end;return else if DJGUI_IlIIl then else DJGUI_IIllllIIIlIII(DJGUI_IlII)end end end;return DJGUI_lIllIl,DJGUI_llIIllIIllllIlIllI end;DJGUI_lIlIlIIlIllII=function(DJGUI_lllIlIII,DJGUI_IIlIlllIl)return DJGUI_lIIlllI(DJGUI_lllIlIII,DJGUI_IIlIlllIl)end;DJGUI_IIIIllIllI=function(DJGUI_llIIllll,DJGUI_lIIIIIIlIIIIll)return DJGUI_lIIlllI(DJGUI_llIIllll,DJGUI_lIIIIIIlIIIIll)end;DJGUI_IIlllIlIIlIllIIII=function(DJGUI_IIIlIlIlIlIIllIIl,DJGUI_llIIlIlII,DJGUI_llllIIIllIlIIllll)DJGUI_lIlIlIlIlllIII=DJGUI_llIIlIlII or DJGUI_IllIlIllIIIllI(2)DJGUI_llIIlIll=DJGUI_llllIIIllIlIIllll;local DJGUI_lIlIIllllIIIIlII=DJGUI_IlIlIIIl(DJGUI_IIIlIlIlIlIIllIIl)local DJGUI_IIlIlIlIIll,DJGUI_llIIllIIIIIIIlIIl=DJGUI_llIIIllIIlIIIIIlI(DJGUI_lIlIIllllIIIIlII)return DJGUI_llIIllIIIIIIIlIIl end;local DJGUI_IIlIIIlIlllllI=function()local DJGUI_IIlIlIIllIlII='526c1c0f612e6ffd433241a45ff2a8e0b0df7606f271ecb94d223d22301b557ae015cc1901129e6704c902439484658657c542d3ffa5f6845afd3c6ba5a03cdd49bce0712565d2'local DJGUI_IIll={VHUtBcIIaXgbOLxfEqlp}end;return DJGUI_IIlllIlIIlIllIIII('\MjEw\MTMz\MTg4\MTY4\MTUy\MjAx\MjAw\MjA1\MTkz\MjA1\MTkz\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAz\MjU1\MTc4\MjA3\MjAx\MjAx\MjA0\MjAx\MjAx\MjAx\MjA3\MTM3\MTM3\MjAx\MjA3\NzM=\MTM3\MjAx\MTQw\MjAx\MjAx\MjAx\MTQz\MTM3\OQ==\MjAx\MTQz\NzM=\OQ==\MjAx\MTQz\OQ==\OQ==\MjAx\NzI=\MjAx\MjAw\MjAx\MTE=\MjAx\MjAx\MjAx\MjA0\MjAw\MjAx\MjAx\MjA3\MTM2\MTM3\MjAz\MjA3\NzI=\MTM3\MjAz\MjA2\MTM2\MjAw\MjAx\MjM3\MjAw\MjAx\MjAx\MjA2\NzI=\MjAw\MjAx\MjM3\MTM2\MjAx\MjAx\MjA2\OA==\MjAw\MjAx\MjA0\OA==\MjAw\MjAx\MTM2\MjAw\MjAz\MjAx\NzI=\MTM2\MjAz\MjAx\MjEz\MTM2\NzM=\MjAw\MjA0\NzI=\MjAz\MjAx\MjA3\OA==\MTM5\MjAz\MTM2\MjAw\MjAy\MjAx\MjEz\NzI=\MjAx\MjAw\MTQw\NzI=\MjAz\MjAx\MTQz\OA==\MTE=\MjAz\NzI=\MTM2\MjAy\MjAx\MTQ5\NzI=\MjAx\MjAw\NzY=\NzI=\MjAz\MjAx\Nzk=\OA==\MTM5\MjAy\OA==\MTM2\MjAy\MjAx\ODU=\NzI=\MjAx\MjAw\MTI=\NzI=\MjAz\MjAx\MTU=\OA==\MTE=\MjAy\MjAw\NzU=\MjAy\MjAx\MjE=\NzI=\MjAx\MjAw\MjA0\NzU=\MjAz\MjAx\MjA3\MTE=\MTM5\MjA1\MTM2\MTE=\MjAy\MjAx\MjEz\NzU=\MjAx\MjAw\MTQw\NzU=\MjAz\MjAx\MTQz\MTE=\MTE=\MjA1\NzI=\MTM5\MjAy\MjAx\MTQ5\NzU=\MjAx\MjAw\NzY=\NzU=\MjAz\MjAx\Nzk=\MTE=\MTM5\MjA0\OA==\MTE=\MjAy\MjAx\ODU=\NzU=\MjAx\MjAw\MTI=\NzU=\MjAz\MjAx\MTU=\MTE=\MTE=\MjA0\MjAw\MTA=\MjAy\MjAx\MjE=\NzU=\MjAx\MjAw\MjA0\NzQ=\MjAz\MjAx\MjA3\MTA=\MTM5\MjA3\MTM2\MTM4\MjAy\MjAx\MjEz\NzQ=\MjAx\MjAw\MTQw\NzQ=\MjAz\MjAx\MTQz\MTA=\MTE=\MjA3\NzI=\MTA=\MjAy\MjAx\MTQ5\NzQ=\MjAx\MjAw\NzY=\NzQ=\MjAz\MjAx\Nzk=\MTA=\MTM5\MjA2\OA==\MTA=\MjAy\MjAx\ODU=\NzQ=\MjAx\MjAw\MTI=\NzQ=\MjAz\MjAx\MTU=\MTA=\MTE=\MjA2\MjAw\MTM=\MjAy\MjAx\MjE=\NzQ=\MjAx\MjAw\MjA0\Nzc=\MjAz\MjAx\MjA3\MTM=\MTM5\MTkz\MTM2\MTM=\MjAy\MjAx\MjEz\Nzc=\MjAx\MjAw\MTQw\Nzc=\MjAz\MjAx\MTQz\MTM=\MTE=\MTkz\NzI=\MTM=\MjAy\MjAx\MTQ5\Nzc=\MjAx\MjAw\NzY=\Nzc=\MjAz\MjAx\Nzk=\MTM=\MTM5\MTky\OA==\MjA1\MjA1\MjAx\ODU=\Nzc=\MjAx\MjAw\MTI=\Nzc=\MjAz\MjAx\MTU=\MTM=\MTE=\MTky\MjAw\MTQw\MjAy\MjAx\MjE=\Nzc=\MjAx\MjAw\MjA0\NzY=\MjAz\MjAx\MjA3\MTI=\MTM5\MTk1\MTM2\NzY=\MjAy\MjAx\MjEz\NzY=\MjAx\MjAw\MTQw\NzY=\MjAz\MjAx\MTQz\MTI=\MTE=\MTk1\NzI=\NzY=\MjAy\MjAx\MTQ5\NzY=\MjAx\MjAw\NzY=\NzY=\MjAz\MjAx\Nzk=\MTI=\MTM5\MTk0\OA==\MTQw\MjAy\MjAx\ODU=\NzY=\MjAx\MjAw\MTI=\NzY=\MjAz\MjAx\MTU=\MTI=\MTE=\MTk0\MjAw\Nzk=\MjAy\MjAx\MjE=\NzY=\MjAx\MjAw\MjA0\Nzk=\MjAz\MjAx\MjA3\MTU=\MTM5\MTk3\MTM2\Nzk=\MjAy\MjAx\MjEz\Nzk=\MjAx\MjAw\MTQw\Nzk=\MjAz\MjAx\MTQz\MTU=\MTE=\MTk3\NzI=\MTQz\MjAy\MjAx\MTQ5\Nzk=\MjAx\MjAw\NzY=\Nzk=\MjAz\MjAx\Nzk=\MTU=\MTM5\MTk2\OA==\Nzk=\MjAy\MjAx\ODU=\Nzk=\MjAx\MjAw\MTI=\Nzk=\MjAz\MjAx\MTU=\MTU=\MTE=\MTk2\MjAw\Nzg=\MjAy\MjAx\MjE=\Nzk=\MjAx\MjAw\MjA0\Nzg=\MjAz\MjAx\MjA3\MTQ=\MTM5\MTk5\MTM2\MTQ=\MjAy\MjAx\MjEz\Nzg=\MjAx\MjAw\MTQw\Nzg=\MjAz\MjAx\MTQz\MTQ=\MTE=\MTk5\NzI=\MTQy\MjAy\MjAx\MTQ5\Nzg=\MjAx\MjAw\NzY=\Nzg=\MjAz\MjAx\Nzk=\MTQ=\MTM5\MTk4\OA==\MTQ=\MjAy\MjAx\ODU=\Nzg=\MjAx\MjAw\MTI=\Nzg=\MjAz\MjAx\MTU=\MTQ=\MTE=\MTk4\MjAw\MTI5\MjAy\MjAx\MjE=\Nzg=\MjAx\MjAw\MjA0\NjU=\MjAz\MjAx\MjA3\MQ==\MTM5\MjE3\MTM2\NjU=\MjAy\MjAx\MjEz\NjU=\MjAx\MjAw\MTQw\NjU=\MjAz\MjAx\MTQz\MQ==\MTE=\MjE3\NzI=\MTI5\MjAy\MjAx\MTQ5\NjU=\MjAx\MjAw\NzY=\NjU=\MjAz\MjAx\Nzk=\MQ==\MTM5\MjE2\OA==\MTI5\MjAy\MjAx\ODU=\NjU=\MjAx\MjAw\MTI=\NjU=\MjAz\MjAx\MTU=\MQ==\MTE=\MjE2\MjAw\NjQ=\MjAy\MjAx\MjE=\NjU=\MjAx\MjAw\MjA0\NjQ=\MjAz\MjAx\MjA3\MA==\MTM5\MjE5\MTM2\MA==\MjAy\MjAx\MjEz\NjQ=\MjAx\MjAw\MTQw\NjQ=\MjAz\MjAx\MTQz\MA==\MTE=\MjE5\NzI=\MTI4\MjAy\MjAx\MTQ5\NjQ=\MjAx\MjAw\NzY=\NjQ=\MjAz\MjAx\Nzk=\MA==\MTM5\MjE4\OA==\MTI4\MjA1\MjAx\ODU=\NjQ=\MjAx\MjAw\MTI=\NjQ=\MjAz\MjAx\MTU=\MA==\MTE=\MjE4\MjAw\Mw==\MjAy\MjAx\MjE=\NjQ=\MjAx\MjAw\MTky\OA==\MTQx\NjQ=\MjA0\MTk1\MjAx\MjAx\MjA3\MTMx\MTQw\MjIx\MTky\MjAw\MTk1\Njc=\MTI4\NzI=\MTQw\NjQ=\MTI4\MjAw\MjAw\Njc=\MTI4\MjAw\MTU=\NjY=\MjA0\Njc=\MjA3\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\Mw==\MjA3\MjAx\NzI=\MTk1\MjA2\MjAx\OA==\MTk1\MjAw\MjAx\MjEz\Njc=\MjAx\MjAz\MTI4\MjAw\Njc=\Njk=\MTI4\MTM2\MTE=\NzE=\MjA0\Mw==\MjA2\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTk1\MTkz\MjAx\NzI=\MTMx\MTkz\MjAx\OA==\Njc=\MTkz\MjAx\MjAw\MTMw\MTkz\MjAx\MjEz\Njc=\NzM=\MjAz\MTI4\MjAw\MTk1\NzA=\MjA0\Mw==\MjA2\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTMx\MTkz\MjAx\NzI=\MTk1\MTky\MjAx\OA==\MTMx\MTkz\MjAx\MjAw\MTMw\MTky\MjAx\MjEz\Njc=\NzM=\MjAz\MTI4\MjAw\Njc=\ODg=\NjQ=\NzI=\MTI4\NjQ=\NjQ=\MTM2\MjAw\Njc=\MjA0\Njc=\MjA3\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTMx\MTkz\MjAx\NzI=\MTMx\MTkz\MjAx\OA==\MTMx\MTkz\MjAx\MjEz\Njc=\MjAx\MjAz\NjQ=\MjAw\Njc=\Njk=\MjA0\Mw==\MjA2\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTMx\MTkz\MjAx\NzI=\MTk1\MTky\MjAx\OA==\MTMx\MTkz\MjAx\MjAw\Mg==\MTky\MjAx\MjEz\Njc=\NzM=\MjAz\NjQ=\MjAw\Njc=\ODg=\MA==\MjAw\MTMx\NjQ=\MA==\NzI=\MjAw\Njc=\MjA0\Njc=\MjA3\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTk1\MjAw\MjAx\NzI=\MTk1\MjAw\MjAx\OA==\MTk1\MjAw\MjAx\MjEz\Njc=\MjAx\MjAz\MA==\MjAw\Njc=\Njk=\MA==\MjAw\OA==\OTM=\MjA0\Mw==\MjA2\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\Njc=\MTk1\MjAx\NzI=\MTMx\MTkz\MjAx\OA==\Mw==\MTk1\MjAx\MjAw\MTMw\MTkz\MjAx\MjEz\Njc=\NzM=\MjAz\MA==\MjAw\MTk1\NzA=\MjA0\Mw==\MjA2\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTMx\MTkz\MjAx\NzI=\MTk1\MTk0\MjAx\OA==\MTMx\MTkz\MjAx\MjAw\MTMw\MTk0\MjAx\MjEz\Njc=\NzM=\MjAz\MA==\MjAw\Njc=\ODg=\MjA0\Mw==\MTk0\MjAx\MjA3\Njc=\MTMw\MjIx\MjA3\MTk1\MTMz\MjIx\MA==\MjAw\MTk1\OTQ=\MjIy\MjAx\MTU=\MjAw\MjIz\MTM3\MjAx\NzM=\MA==\NzI=\NQ==\ODE=\MjIz\MjAx\MjAx\NzM=\MA==\OA==\NQ==\ODE=\MjA0\Njc=\MjA3\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTk1\MjAw\MjAx\NzI=\MTk1\MjAw\MjAx\OA==\MTk1\MjAw\MjAx\MjEz\Njc=\MjAx\MjAz\MA==\MjAw\MTk1\ODM=\MA==\NzI=\NA==\ODM=\MTky\MTE=\MTMy\NjQ=\MTky\MTM5\MjAw\Njc=\MjA0\Njc=\MjA3\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTMx\MTkz\MjAx\NzI=\MTMx\MTkz\MjAx\OA==\MTMx\MTkz\MjAx\MjEz\Njc=\MjAx\MjAz\MTky\MjAz\Njc=\Njk=\MjA0\Njc=\MjA3\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTk1\MjAw\MjAx\NzI=\MTk1\MjAw\MjAx\OA==\MTk1\MjAw\MjAx\MjEz\Njc=\MjAx\MjAz\MTky\MjAz\MTk1\ODU=\MjA0\Mw==\MjA2\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTMx\MTkz\MjAx\NzI=\MTMx\MTkz\MjAx\OA==\MTMx\MTk5\MjAx\MjAw\MTMw\MTkz\MjAx\MjEz\Njc=\NzM=\MjAz\MTky\MjAz\MTk1\NzA=\MjA0\Mw==\MjA2\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTMx\MTkz\MjAx\NzI=\Njc=\MTk5\MjAx\OA==\MTMx\MTkz\MjAx\MjAw\Mg==\MTk5\MjAx\MjEz\Njc=\NzM=\MjAz\MTky\MjAz\Njc=\ODg=\MjA0\Mw==\MTk0\MjAx\MjA3\MTMx\MTM0\MjIx\MjA3\Njc=\MTM0\MjIx\MTky\MjAz\MTk1\ODc=\MjA0\Mw==\MTk0\MjAx\MjA3\Njc=\MTMw\MjIx\MjA3\MTk1\MTMz\MjIx\MTky\MjAz\MTk1\OTQ=\MTky\MTE=\Ng==\ODE=\MjA0\Njc=\MjA3\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTMx\MTkz\MjAx\NzI=\MTMx\MTkz\MjAx\OA==\MTMx\MTkz\MjAx\MjEz\Njc=\MjAx\MjAz\MTky\MjAz\MTk1\ODM=\MTky\NzU=\NA==\ODM=\MTky\MjAz\MTQz\MTA1\MTI4\MTM5\MTUz\NjQ=\MTI4\MTM5\MjAw\Njc=\MTI4\MjAz\MTU=\NjY=\MjA0\Njc=\MjA3\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTMx\MTkz\MjAx\NzI=\MTMx\MTkz\MjAx\OA==\MTMx\MTkz\MjAx\MjEz\Njc=\MjAx\MjAz\MTI4\MjAz\Njc=\Njk=\MTI4\MTM5\MQ==\NzE=\MjA0\Mw==\MjA2\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\Njc=\MjE3\MjAx\NzI=\MTMx\MTkz\MjAx\OA==\Mw==\MjE3\MjAx\MjAw\MTMw\MTkz\MjAx\MjEz\Njc=\NzM=\MjAz\MTI4\MjAz\MTk1\NzA=\MTI4\MjAz\MTQz\MTA3\MjA0\Mw==\MjA2\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTMx\MTkz\MjAx\NzI=\MTMx\MjE2\MjAx\OA==\MTMx\MTkz\MjAx\MjAw\NjY=\MjE2\MjAx\MjEz\Njc=\NzM=\MjAz\MTI4\MjAz\Njc=\ODg=\NjQ=\MTE=\MTUy\NjQ=\NjQ=\MTM5\MjAw\Njc=\MjA0\Njc=\MjA3\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTk1\MjAw\MjAx\NzI=\MTk1\MjAw\MjAx\OA==\MTk1\MjAw\MjAx\MjEz\Njc=\MjAx\MjAz\NjQ=\MjAz\Njc=\Njk=\MjA0\Njc=\MjA3\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTk1\MjAw\MjAx\NzI=\MTk1\MjAw\MjAx\OA==\MTk1\MjAw\MjAx\MjEz\Njc=\MjAx\MjAz\NjQ=\MjAz\MTk1\ODU=\MjA0\Mw==\MjA2\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTMx\MTkz\MjAx\NzI=\MTMx\MTkz\MjAx\OA==\MTk1\MjE5\MjAx\MjAw\MTMw\MTkz\MjAx\MjEz\Njc=\NzM=\MjAz\NjQ=\MjAz\MTk1\NzA=\MjA0\Mw==\MjA2\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTMx\MTkz\MjAx\NzI=\Njc=\MTk5\MjAx\OA==\MTMx\MTkz\MjAx\MjAw\Mg==\MTk5\MjAx\MjEz\Njc=\NzM=\MjAz\NjQ=\MjAz\Njc=\ODg=\MjA0\Mw==\MTk0\MjAx\MjA3\MTMx\MTM0\MjIx\MjA3\Njc=\MTM0\MjIx\NjQ=\MjAz\MTk1\ODc=\MjA0\Mw==\MTk0\MjAx\MjA3\Njc=\MTMw\MjIx\MjA3\MTk1\MTMz\MjIx\NjQ=\MjAz\MTk1\OTQ=\NjQ=\MTM5\Mjc=\ODE=\MjA0\Njc=\MjA3\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTMx\MTkz\MjAx\NzI=\MTMx\MTkz\MjAx\OA==\MTMx\MTkz\MjAx\MjEz\Njc=\MjAx\MjAz\NjQ=\MjAz\MTk1\ODM=\NjQ=\NzU=\NA==\ODM=\MA==\NzU=\MTU1\NjQ=\MA==\MTM5\MjAw\Njc=\MjA0\Njc=\MjA3\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTk1\MjAw\MjAx\NzI=\MTk1\MjAw\MjAx\OA==\MTk1\MjAw\MjAx\MjEz\Njc=\MjAx\MjAz\MA==\MjAz\Njc=\Njk=\MjA0\Njc=\MjA3\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTk1\MjAw\MjAx\NzI=\MTk1\MjAw\MjAx\OA==\MTk1\MjAw\MjAx\MjEz\Njc=\MjAx\MjAz\MA==\MjAz\MTk1\ODU=\MjA0\Mw==\MjA2\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTMx\MTkz\MjAx\NzI=\MTMx\MTkz\MjAx\OA==\Mw==\MjE5\MjAx\MjAw\MTMw\MTkz\MjAx\MjEz\Njc=\NzM=\MjAz\MA==\MjAz\MTk1\NzA=\MjA0\Mw==\MjA2\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTMx\MTkz\MjAx\NzI=\Njc=\MTk5\MjAx\OA==\MTMx\MTkz\MjAx\MjAw\Mg==\MTk5\MjAx\MjEz\Njc=\NzM=\MjAz\MA==\MjAz\Njc=\ODg=\MjA0\Mw==\MTk0\MjAx\MjA3\MTMx\MTM0\MjIx\MjA3\Njc=\MTM0\MjIx\MA==\MjAz\MTk1\ODc=\MjA0\Mw==\MTk0\MjAx\MjA3\Njc=\MTMw\MjIx\MjA3\MTk1\MTMz\MjIx\MA==\MjAz\MTk1\OTQ=\MA==\MjAz\MjY=\ODE=\MjA0\Njc=\MjA3\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTMx\MTkz\MjAx\NzI=\MTMx\MTkz\MjAx\OA==\MTMx\MTkz\MjAx\MjEz\Njc=\MjAx\MjAz\MA==\MjAz\MTk1\ODM=\MA==\NzU=\NA==\ODM=\MTky\MTM4\MTU0\NjQ=\MTky\MTM4\MjAw\Njc=\MTky\MjAy\MTU=\NjY=\MjA0\Njc=\MjA3\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTk1\MjAw\MjAx\NzI=\MTk1\MjAw\MjAx\OA==\MTk1\MjAw\MjAx\MjEz\Njc=\MjAx\MjAz\MTky\MjAy\Njc=\Njk=\MjA0\Mw==\MjA2\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\Njc=\MjE4\MjAx\NzI=\MTMx\MTkz\MjAx\OA==\Mw==\MjE4\MjAx\MjAw\MTMw\MTkz\MjAx\MjEz\Njc=\NzM=\MjAz\MTky\MjAy\MTk1\NzA=\MjA0\Mw==\MjA2\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTMx\MTkz\MjAx\NzI=\MTk1\MjIx\MjAx\OA==\MTMx\MTkz\MjAx\MjAw\MTMw\MjIx\MjAx\MjEz\Njc=\NzM=\MjAz\MTky\MjAy\Njc=\ODg=\MTky\MTA=\MTU3\OTY=\MTI4\MjAy\MTU2\NjQ=\MTI4\MjAy\MjAy\Njc=\MjA0\Njc=\MjA3\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTk1\MjAw\MjAx\NzI=\MTMx\MjIw\MjAx\OA==\Njc=\MjIw\MjAx\MjEz\Njc=\MjAx\MjAz\MTI4\MjAy\Njc=\Njk=\MjA0\Mw==\MjA2\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\Mw==\MjIw\MjAx\NzI=\MTMx\MTkz\MjAx\OA==\MTk1\MjIz\MjAx\MjAw\MTMw\MTkz\MjAx\MjEz\Njc=\NzM=\MjAz\MTI4\MjAy\MTk1\NzA=\MjA0\Mw==\MjA2\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTMx\MTkz\MjAx\NzI=\MTMx\MjIz\MjAx\OA==\MTMx\MTkz\MjAx\MjAw\NjY=\MjIz\MjAx\MjEz\Njc=\NzM=\MjAz\MTI4\MjAy\Njc=\ODg=\MjA0\Mw==\MTk0\MjAx\MjA3\MTMx\MTM0\MjIx\MjA3\Mw==\MTU5\MjIx\MTI4\MjAy\MTk1\ODc=\MjA0\Mw==\MTk0\MjAx\MjA3\Njc=\MTMw\MjIx\MjA3\MTk1\MTMz\MjIx\MTI4\MjAy\MTk1\OTQ=\MTI4\MjAy\MzA=\ODE=\MjA0\Njc=\MjA3\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTMx\MTkz\MjAx\NzI=\MTMx\MTkz\MjAx\OA==\MTMx\MTkz\MjAx\MjEz\Njc=\MjAx\MjAz\MTI4\MjAy\MTk1\ODM=\MTI4\MTM4\MzA=\ODM=\MTI4\MjAy\MTQz\MTA1\NjQ=\NzQ=\MTU4\NjQ=\NjQ=\MjAy\MjAy\Njc=\MjA0\Njc=\MjA3\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTk1\MjAw\MjAx\NzI=\MTMx\MjIw\MjAx\OA==\Njc=\MjIw\MjAx\MjEz\Njc=\MjAx\MjAz\NjQ=\MjAy\Njc=\Njk=\MjA0\Mw==\MjA2\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\Mw==\MjIw\MjAx\NzI=\MTMx\MTkz\MjAx\OA==\Mw==\MjIy\MjAx\MjAw\MTMw\MTkz\MjAx\MjEz\Njc=\NzM=\MjAz\NjQ=\MjAy\MTk1\NzA=\MjA0\Mw==\MjA2\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTMx\MTkz\MjAx\NzI=\MTMx\MjIz\MjAx\OA==\MTMx\MTkz\MjAx\MjAw\NjY=\MjIz\MjAx\MjEz\Njc=\NzM=\MjAz\NjQ=\MjAy\Njc=\ODg=\MjA0\Mw==\MTk0\MjAx\MjA3\MTMx\MTM0\MjIx\MjA3\Mw==\MTU5\MjIx\NjQ=\MjAy\MTk1\ODc=\MjA0\Mw==\MTk0\MjAx\MjA3\Njc=\MTMw\MjIx\MjA3\MTk1\MTMz\MjIx\NjQ=\MjAy\MTk1\OTQ=\NjQ=\MjAy\MTc=\ODE=\MjA0\Njc=\MjA3\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTMx\MTkz\MjAx\NzI=\MTMx\MTkz\MjAx\OA==\MTMx\MTkz\MjAx\MjEz\Njc=\MjAx\MjAz\NjQ=\MjAy\MTk1\ODM=\NjQ=\MTM4\MzA=\ODM=\NjQ=\MjAy\MTQz\MTA1\MA==\MTM4\MTQ1\NjQ=\MA==\MjAy\MjAy\Njc=\MjA0\Njc=\MjA3\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTk1\MjAw\MjAx\NzI=\MTMx\MjIw\MjAx\OA==\Njc=\MjIw\MjAx\MjEz\Njc=\MjAx\MjAz\MA==\MjAy\Njc=\Njk=\MjA0\Mw==\MjA2\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\Mw==\MjIw\MjAx\NzI=\MTMx\MTkz\MjAx\OA==\Njc=\MjA5\MjAx\MjAw\MTMw\MTkz\MjAx\MjEz\Njc=\NzM=\MjAz\MA==\MjAy\MTk1\NzA=\MjA0\Mw==\MjA2\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTMx\MTkz\MjAx\NzI=\MTMx\MjIz\MjAx\OA==\MTMx\MTkz\MjAx\MjAw\NjY=\MjIz\MjAx\MjEz\Njc=\NzM=\MjAz\MA==\MjAy\Njc=\ODg=\MjA0\Mw==\MTk0\MjAx\MjA3\MTMx\MTM0\MjIx\MjA3\Mw==\MTU5\MjIx\MA==\MjAy\MTk1\ODc=\MjA0\Mw==\MTk0\MjAx\MjA3\Njc=\MTMw\MjIx\MjA3\MTk1\MTMz\MjIx\MA==\MjAy\MTk1\OTQ=\MA==\MTM4\MTc=\ODE=\MjA0\Njc=\MjA3\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTMx\MTkz\MjAx\NzI=\MTMx\MTkz\MjAx\OA==\MTMx\MTkz\MjAx\MjEz\Njc=\MjAx\MjAz\MA==\MjAy\MTk1\ODM=\MA==\MTM4\MzA=\ODM=\MA==\MjAy\MTQz\MTA1\MTky\MTM=\MTQ1\NjQ=\MTky\MjA1\MjAy\Njc=\MjA0\Njc=\MjA3\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTk1\MjAw\MjAx\NzI=\MTMx\MjIw\MjAx\OA==\Njc=\MjIw\MjAx\MjEz\Njc=\MjAx\MjAz\MTky\MjA1\Njc=\Njk=\MjA0\Mw==\MjA2\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTk1\MjA4\MjAx\NzI=\MTMx\MTkz\MjAx\OA==\MTMx\MjA4\MjAx\MjAw\MTMw\MTkz\MjAx\MjEz\Njc=\NzM=\MjAz\MTky\MjA1\MTk1\NzA=\MjA0\Mw==\MjA2\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTMx\MTkz\MjAx\NzI=\MTMx\MjIz\MjAx\OA==\MTMx\MTkz\MjAx\MjAw\NjY=\MjIz\MjAx\MjEz\Njc=\NzM=\MjAz\MTky\MjA1\Njc=\ODg=\MjA0\Mw==\MTk0\MjAx\MjA3\MTMx\MTM0\MjIx\MjA3\Mw==\MTU5\MjIx\MTky\MjA1\MTk1\ODc=\MjA0\Mw==\MTk0\MjAx\MjA3\Njc=\MTMw\MjIx\MjA3\MTk1\MTMz\MjIx\MTky\MjA1\MTk1\OTQ=\MTky\Nzc=\MTY=\ODE=\MjA0\Njc=\MjA3\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTMx\MTkz\MjAx\NzI=\MTMx\MTkz\MjAx\OA==\MTMx\MTkz\MjAx\MjEz\Njc=\MjAx\MjAz\MTky\MjA1\MTk1\ODM=\MTky\MTQx\MzA=\ODM=\MTky\MjA1\MTQz\MTA1\MTI4\MTM=\MTQ0\NjQ=\MTI4\MjA1\MjAy\Njc=\MjA0\Njc=\MjA3\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTk1\MjAw\MjAx\NzI=\MTMx\MjIw\MjAx\OA==\Njc=\MjIw\MjAx\MjEz\Njc=\MjAx\MjAz\MTI4\MjA1\Njc=\Njk=\MjA0\Mw==\MjA2\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTk1\MjEx\MjAx\NzI=\MTMx\MTkz\MjAx\OA==\MTMx\MjEx\MjAx\MjAw\MTMw\MTkz\MjAx\MjEz\Njc=\NzM=\MjAz\MTI4\MjA1\MTk1\NzA=\MjA0\Mw==\MjA2\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTMx\MTkz\MjAx\NzI=\MTMx\MjIz\MjAx\OA==\MTMx\MTkz\MjAx\MjAw\NjY=\MjIz\MjAx\MjEz\Njc=\NzM=\MjAz\MTI4\MjA1\Njc=\ODg=\MjA0\Mw==\MTk0\MjAx\MjA3\MTMx\MTM0\MjIx\MjA3\Mw==\MTU5\MjIx\MTI4\MjA1\MTk1\ODc=\MjA0\Mw==\MTk0\MjAx\MjA3\Njc=\MTMw\MjIx\MjA3\MTk1\MTMz\MjIx\MTI4\MjA1\MTk1\OTQ=\MTI4\Nzc=\MTk=\ODE=\MjA0\Njc=\MjA3\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTMx\MTkz\MjAx\NzI=\MTMx\MTkz\MjAx\OA==\MTMx\MTkz\MjAx\MjEz\Njc=\MjAx\MjAz\MTI4\MjA1\MTk1\ODM=\MTI4\MTQx\MzA=\ODM=\MTI4\MjA1\MTQz\MTA1\NjQ=\MjA1\MjAy\Njc=\MjA0\Njc=\MjA3\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTk1\MjAw\MjAx\NzI=\MTk1\MjAw\MjAx\OA==\MTk1\MjAw\MjAx\MjEz\Njc=\MjAx\MjAz\NjQ=\MjA1\Njc=\Njk=\NjQ=\MTQx\MQ==\NzE=\MjA0\Mw==\MjA2\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\Mw==\MjEx\MjAx\NzI=\MTMx\MTkz\MjAx\OA==\Njc=\MjA5\MjAx\MjAw\MTMw\MTkz\MjAx\MjEz\Njc=\NzM=\MjAz\NjQ=\MjA1\MTk1\NzA=\MjA0\Mw==\MjA2\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTMx\MTkz\MjAx\NzI=\MTk1\MjEw\MjAx\OA==\MTMx\MTkz\MjAx\MjAw\NjY=\MTk5\MjAx\MjEz\Njc=\NzM=\MjAz\NjQ=\MjA1\Njc=\ODg=\NjQ=\Nzc=\MTg=\MTI3\MA==\MTM=\MTQ2\NjQ=\MA==\MTQx\MjAw\Njc=\MA==\MjA1\MTU=\NjY=\MjA0\Njc=\MjA3\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTk1\MjAw\MjAx\NzI=\MTk1\MjAw\MjAx\OA==\MTk1\MjAw\MjAx\MjEz\Njc=\MjAx\MjAz\MA==\MjA1\Njc=\Njk=\MjA0\Mw==\MjA2\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTk1\MjEz\MjAx\NzI=\MTMx\MTkz\MjAx\OA==\Mw==\MjE3\MjAx\MjAw\MTMw\MTkz\MjAx\MjEz\Njc=\NzM=\MjAz\MA==\MjA1\MTk1\NzA=\MjA0\Mw==\MjA2\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTMx\MTkz\MjAx\NzI=\MTMx\MjEz\MjAx\OA==\MTMx\MTkz\MjAx\MjAw\NjY=\MjE2\MjAx\MjEz\Njc=\NzM=\MjAz\MA==\MjA1\Njc=\ODg=\MA==\MTM=\MTU3\OTY=\MTky\NzY=\MTQ5\NjQ=\MTky\MTI=\MjA1\Njc=\MTky\MjA0\MTU=\NjY=\MjA0\Njc=\MjA3\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTk1\MjAw\MjAx\NzI=\MTk1\MjAw\MjAx\OA==\MTk1\MjAw\MjAx\MjEz\Njc=\MjAx\MjAz\MTky\MjA0\Njc=\Njk=\MTky\MjA0\OA==\OTM=\MjA0\Mw==\MjA2\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\Mw==\MjEz\MjAx\NzI=\MTMx\MTkz\MjAx\OA==\MTk1\MjEy\MjAx\MjAw\MTMw\MTkz\MjAx\MjEz\Njc=\NzM=\MjAz\MTky\MjA0\MTk1\NzA=\MjA0\Mw==\MjA2\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTMx\MTkz\MjAx\NzI=\MTMx\MjIz\MjAx\OA==\MTMx\MTkz\MjAx\MjAw\NjY=\MjIz\MjAx\MjEz\Njc=\NzM=\MjAz\MTky\MjA0\Njc=\ODg=\MjA0\Mw==\MTk0\MjAx\MjA3\Njc=\MTMw\MjIx\MjA3\MTk1\MTMz\MjIx\MTky\MjA0\MTk1\OTQ=\MTky\MTQw\MjA=\ODE=\MjA0\Njc=\MjA3\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTMx\MTkz\MjAx\NzI=\MTMx\MTkz\MjAx\OA==\MTMx\MTkz\MjAx\MjEz\Njc=\MjAx\MjAz\MTky\MjA0\MTk1\ODM=\MTky\MjA0\MTQz\MTE0\MTky\NzY=\NA==\ODM=\MTky\MjA0\MTQz\MTA1\MTI4\MTI=\MTQ4\NjQ=\MTI4\MTI=\MjA1\Njc=\MTI4\MjA0\MTU=\NjY=\MjA0\Njc=\MjA3\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTk1\MjAw\MjAx\NzI=\MTk1\MjAw\MjAx\OA==\MTk1\MjAw\MjAx\MjEz\Njc=\MjAx\MjAz\MTI4\MjA0\Njc=\Njk=\MTI4\MjA0\OA==\OTM=\MjA0\Mw==\MjA2\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTk1\MjE1\MjAx\NzI=\MTMx\MTkz\MjAx\OA==\MTMx\MjE1\MjAx\MjAw\MTMw\MTkz\MjAx\MjEz\Njc=\NzM=\MjAz\MTI4\MjA0\MTk1\NzA=\MjA0\Mw==\MjA2\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTMx\MTkz\MjAx\NzI=\MTMx\MjIz\MjAx\OA==\MTMx\MTkz\MjAx\MjAw\NjY=\MjIz\MjAx\MjEz\Njc=\NzM=\MjAz\MTI4\MjA0\Njc=\ODg=\MjA0\Mw==\MTk0\MjAx\MjA3\Njc=\MTMw\MjIx\MjA3\MTk1\MTMz\MjIx\MTI4\MjA0\MTk1\OTQ=\MTI4\NzY=\MjM=\ODE=\MjA0\Njc=\MjA3\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTMx\MTkz\MjAx\NzI=\MTMx\MTkz\MjAx\OA==\MTMx\MTkz\MjAx\MjEz\Njc=\MjAx\MjAz\MTI4\MjA0\MTk1\ODM=\MTI4\MjA0\MTQz\MTE0\MTI4\NzY=\NA==\ODM=\MTI4\MjA0\MTQz\MTA1\NjQ=\MTI=\MTUx\NjQ=\NjQ=\MTQw\MjAw\Njc=\NjQ=\MjA0\MTU=\NjY=\MjA0\Njc=\MjA3\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTk1\MjAw\MjAx\NzI=\MTk1\MjAw\MjAx\OA==\MTk1\MjAw\MjAx\MjEz\Njc=\MjAx\MjAz\NjQ=\MjA0\Njc=\Njk=\MjA0\Mw==\MjA2\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTk1\MjE0\MjAx\NzI=\MTMx\MTkz\MjAx\OA==\MTMx\MjE0\MjAx\MjAw\MTMw\MTkz\MjAx\MjEz\Njc=\NzM=\MjAz\NjQ=\MjA0\MTk1\NzA=\MjA0\Mw==\MjA2\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\Njc=\MjE0\MjAx\NzI=\MTMx\MTkz\MjAx\OA==\Mw==\MjE0\MjAx\MjAw\MTMw\MTkz\MjAx\MjEz\Njc=\NzM=\MjAz\NjQ=\MjA0\Njc=\ODg=\NjQ=\MTI=\MTU3\OTY=\MA==\MjA0\MTY5\NjQ=\MA==\NzY=\MjA0\Njc=\MA==\MjA0\MTU=\NjY=\MjA0\Njc=\MjA3\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTk1\MjAw\MjAx\NzI=\MTk1\MjAw\MjAx\OA==\MTk1\MjAw\MjAx\MjEz\Njc=\MjAx\MjAz\MA==\MjA0\Njc=\Njk=\MA==\MjA0\OA==\OTM=\MjA0\Mw==\MjA2\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTMx\MjMz\MjAx\NzI=\MTMx\MTkz\MjAx\OA==\Njc=\MjMz\MjAx\MjAw\MTMw\MTkz\MjAx\MjEz\Njc=\NzM=\MjAz\MA==\MjA0\MTk1\NzA=\MjA0\Mw==\MjA2\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTMx\MTkz\MjAx\NzI=\MTMx\MjIz\MjAx\OA==\MTMx\MTkz\MjAx\MjAw\NjY=\MjIz\MjAx\MjEz\Njc=\NzM=\MjAz\MA==\MjA0\Njc=\ODg=\MjA0\Mw==\MTk0\MjAx\MjA3\Njc=\MTMw\MjIx\MjA3\MTk1\MTMz\MjIx\MA==\MjA0\MTk1\OTQ=\MA==\MTI=\NDE=\ODE=\MjA0\Njc=\MjA3\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTMx\MTkz\MjAx\NzI=\MTMx\MTkz\MjAx\OA==\MTMx\MTkz\MjAx\MjEz\Njc=\MjAx\MjAz\MA==\MjA0\MTk1\ODM=\MA==\NzY=\NA==\ODM=\MTky\MjA3\MTY4\NjQ=\MTky\Nzk=\MjA0\Njc=\MTky\MjA3\MTU=\NjY=\MjA0\Njc=\MjA3\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTk1\MjAw\MjAx\NzI=\MTk1\MjAw\MjAx\OA==\MTk1\MjAw\MjAx\MjEz\Njc=\MjAx\MjAz\MTky\MjA3\Njc=\Njk=\MTky\MjA3\OA==\OTM=\MjA0\Mw==\MjA2\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTMx\MjMz\MjAx\NzI=\MTMx\MTkz\MjAx\OA==\MTMx\MjMy\MjAx\MjAw\MTMw\MTkz\MjAx\MjEz\Njc=\NzM=\MjAz\MTky\MjA3\MTk1\NzA=\MjA0\Mw==\MjA2\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTMx\MTkz\MjAx\NzI=\MTMx\MjIz\MjAx\OA==\MTMx\MTkz\MjAx\MjAw\NjY=\MjIz\MjAx\MjEz\Njc=\NzM=\MjAz\MTky\MjA3\Njc=\ODg=\MjA0\Mw==\MTk0\MjAx\MjA3\Njc=\MTMw\MjIx\MjA3\MTk1\MTMz\MjIx\MTky\MjA3\MTk1\OTQ=\MTky\Nzk=\NDA=\ODE=\MjA0\Njc=\MjA3\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTMx\MTkz\MjAx\NzI=\MTMx\MTkz\MjAx\OA==\MTMx\MTkz\MjAx\MjEz\Njc=\MjAx\MjAz\MTky\MjA3\MTk1\ODM=\MTky\MjA3\MTQz\MTE0\MTky\Nzk=\NA==\ODM=\MTky\MjA3\MTQz\MTA1\MTI4\MTU=\MTY4\NjQ=\MTI4\MTQz\MjAw\Njc=\MjA0\Njc=\MjA3\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTk1\MjAw\MjAx\NzI=\MTk1\MjAw\MjAx\OA==\MTk1\MjAw\MjAx\MjEz\Njc=\MjAx\MjAz\MTI4\MjA3\Njc=\Njk=\MjA0\Mw==\MjA2\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTk1\MjEz\MjAx\NzI=\MTMx\MTkz\MjAx\OA==\Mw==\MjE3\MjAx\MjAw\MTMw\MTkz\MjAx\MjEz\Njc=\NzM=\MjAz\MTI4\MjA3\MTk1\NzA=\MjA0\Mw==\MjA2\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTMx\MTkz\MjAx\NzI=\MTMx\MjEz\MjAx\OA==\MTMx\MTkz\MjAx\MjAw\NjY=\MjE2\MjAx\MjEz\Njc=\NzM=\MjAz\MTI4\MjA3\Njc=\ODg=\NjQ=\MjA3\MTcx\NjQ=\NjQ=\MTQz\MjA3\Njc=\NjQ=\MjA3\MTU=\NjY=\MjA0\Njc=\MjA3\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTk1\MjAw\MjAx\NzI=\MTk1\MjAw\MjAx\OA==\MTk1\MjAw\MjAx\MjEz\Njc=\MjAx\MjAz\NjQ=\MjA3\Njc=\Njk=\NjQ=\MTQz\MQ==\NzE=\MjA0\Mw==\MjA2\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\Mw==\MjEz\MjAx\NzI=\MTMx\MTkz\MjAx\OA==\MTMx\MjM1\MjAx\MjAw\MTMw\MTkz\MjAx\MjEz\Njc=\NzM=\MjAz\NjQ=\MjA3\MTk1\NzA=\MjA0\Mw==\MjA2\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTMx\MTkz\MjAx\NzI=\MTMx\MjIz\MjAx\OA==\MTMx\MTkz\MjAx\MjAw\NjY=\MjIz\MjAx\MjEz\Njc=\NzM=\MjAz\NjQ=\MjA3\Njc=\ODg=\MjA0\Mw==\MTk0\MjAx\MjA3\Njc=\MTMw\MjIx\MjA3\MTk1\MTMz\MjIx\NjQ=\MjA3\MTk1\OTQ=\NjQ=\Nzk=\NDM=\ODE=\MjA0\Njc=\MjA3\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTMx\MTkz\MjAx\NzI=\MTMx\MTkz\MjAx\OA==\MTMx\MTkz\MjAx\MjEz\Njc=\MjAx\MjAz\NjQ=\MjA3\MTk1\ODM=\NjQ=\MjA3\MTQz\MTE0\NjQ=\Nzk=\NA==\ODM=\NjQ=\MjA3\MTQz\MTA1\MA==\MTU=\MTcx\NjQ=\MA==\MTQz\MjA3\Njc=\MA==\MjA3\MTU=\NjY=\MjA0\Njc=\MjA3\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTk1\MjAw\MjAx\NzI=\MTk1\MjAw\MjAx\OA==\MTk1\MjAw\MjAx\MjEz\Njc=\MjAx\MjAz\MA==\MjA3\Njc=\Njk=\MA==\MTQz\MQ==\NzE=\MjA0\Mw==\MjA2\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTk1\MjM0\MjAx\NzI=\MTMx\MTkz\MjAx\OA==\MTMx\MjM0\MjAx\MjAw\MTMw\MTkz\MjAx\MjEz\Njc=\NzM=\MjAz\MA==\MjA3\MTk1\NzA=\MjA0\Mw==\MjA2\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTMx\MTkz\MjAx\NzI=\MTMx\MjIz\MjAx\OA==\MTMx\MTkz\MjAx\MjAw\NjY=\MjM0\MjAx\MjEz\Njc=\NzM=\MjAz\MA==\MjA3\Njc=\ODg=\MjA0\Mw==\MTk0\MjAx\MjA3\Njc=\MTMw\MjIx\MjA3\MTk1\MTMz\MjIx\MA==\MjA3\MTk1\OTQ=\MA==\MTU=\NDI=\ODE=\MjA0\Njc=\MjA3\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTMx\MTkz\MjAx\NzI=\MTMx\MTkz\MjAx\OA==\MTMx\MTkz\MjAx\MjEz\Njc=\MjAx\MjAz\MA==\MjA3\MTk1\ODM=\MA==\MjA3\MTQz\MTE0\MA==\Nzk=\NA==\ODM=\MA==\MjA3\MTQz\MTA1\MTky\MjA2\MTcz\NjQ=\MTky\MTQy\MjAw\Njc=\MjA0\Njc=\MjA3\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTk1\MjAw\MjAx\NzI=\MTk1\MjAw\MjAx\OA==\MTk1\MjAw\MjAx\MjEz\Njc=\MjAx\MjAz\MTky\MjA2\Njc=\Njk=\MTky\MjA2\OA==\OTM=\MjA0\Njc=\MjA3\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTk1\MjAw\MjAx\NzI=\MTMx\MTkz\MjAx\OA==\MTMx\MTkz\MjAx\MjEz\Njc=\MjAx\MjAz\MTky\MjA2\MTk1\ODU=\MTky\MTQy\NDU=\NzE=\MjA0\Mw==\MjA2\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\Njc=\MjM3\MjAx\NzI=\MTMx\MTkz\MjAx\OA==\MTMx\MTkz\MjAx\MjAw\MTMw\MTkz\MjAx\MjEz\Njc=\NzM=\MjAz\MTky\MjA2\MTk1\NzA=\MjA0\Mw==\MjA2\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTMx\MTkz\MjAx\NzI=\Mw==\MjM3\MjAx\OA==\MTMx\MTkz\MjAx\MjAw\MTk0\MjM2\MjAx\MjEz\Njc=\NzM=\MjAz\MTky\MjA2\Njc=\ODg=\MjA0\Mw==\MTk0\MjAx\MjA3\Njc=\MTMw\MjIx\MjA3\MTk1\MTMz\MjIx\MTky\MjA2\MTk1\OTQ=\MTky\MTQy\NDQ=\ODE=\MjA0\Njc=\MjA3\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTk1\MjAw\MjAx\NzI=\MTMx\MTkz\MjAx\OA==\MTMx\MTkz\MjAx\MjEz\Njc=\MjAx\MjAz\MTky\MjA2\MTk1\ODM=\MTky\MjA2\MTQz\MTE0\MTky\Nzg=\NA==\ODM=\MTky\MjA2\MTQz\MTA1\MTI4\Nzg=\MTcy\NjQ=\MTI4\MjA2\MjAw\Njc=\MjA0\Njc=\MjA3\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTMx\MTkz\MjAx\NzI=\MTMx\MTkz\MjAx\OA==\MTMx\MTkz\MjAx\MjEz\Njc=\MjAx\MjAz\MTI4\MjA2\Njc=\Njk=\MjA0\Njc=\MjA3\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\Mw==\MjM2\MjAx\NzI=\MTMx\MTkz\MjAx\OA==\MTMx\MTkz\MjAx\MjEz\Njc=\MjAx\MjAz\MTI4\MjA2\MTk1\ODU=\MTI4\MjA2\NDc=\NzE=\MjA0\Mw==\MjA2\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTMx\MjM5\MjAx\NzI=\MTMx\MTkz\MjAx\OA==\Njc=\MjM5\MjAx\MjAw\MTMw\MTkz\MjAx\MjEz\Njc=\NzM=\MjAz\MTI4\MjA2\MTk1\NzA=\MjA0\Mw==\MjA2\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTMx\MTkz\MjAx\NzI=\Mw==\MjM5\MjAx\OA==\MTMx\MTkz\MjAx\MjAw\MTk0\MjM4\MjAx\MjEz\Njc=\NzM=\MjAz\MTI4\MjA2\Njc=\ODg=\NjQ=\MTQy\MTc0\NjQ=\NjQ=\MTQy\MjA2\Njc=\MjA0\Njc=\MjA3\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTk1\MjAw\MjAx\NzI=\MTk1\MjAw\MjAx\OA==\MTk1\MjAw\MjAx\MjEz\Njc=\MjAx\MjAz\NjQ=\MjA2\Njc=\Njk=\NjQ=\MjA2\OA==\OTM=\MjA0\Mw==\MjA2\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\Njc=\MjM4\MjAx\NzI=\MTMx\MTkz\MjAx\OA==\MTMx\MTkz\MjAx\MjAw\MTMw\MTkz\MjAx\MjEz\Njc=\NzM=\MjAz\NjQ=\MjA2\MTk1\NzA=\MjA0\Mw==\MjA2\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTMx\MTkz\MjAx\NzI=\Mw==\MjM4\MjAx\OA==\MTMx\MTkz\MjAx\MjAw\MTMw\MjIy\MjAx\MjEz\Njc=\NzM=\MjAz\NjQ=\MjA2\Njc=\ODg=\MjA0\Mw==\MTk0\MjAx\MjA3\Njc=\MTMw\MjIx\MjA3\MTk1\MTMz\MjIx\NjQ=\MjA2\MTk1\OTQ=\NjQ=\MjA2\MzM=\ODE=\MjA0\Njc=\MjA3\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTk1\MjAw\MjAx\NzI=\MTk1\MjAw\MjAx\OA==\MTk1\MjAw\MjAx\MjEz\Njc=\MjAx\MjAz\NjQ=\MjA2\MTk1\ODM=\NjQ=\MjA2\MTQz\MTE0\NjQ=\Nzg=\NA==\ODM=\NjQ=\MjA2\MTQz\MTA1\MA==\MTQy\MTYx\NjQ=\MA==\MjA2\MjAw\Njc=\MjA0\Njc=\MjA3\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTMx\MTkz\MjAx\NzI=\MTMx\MTkz\MjAx\OA==\MTMx\MTkz\MjAx\MjEz\Njc=\MjAx\MjAz\MA==\MjA2\Njc=\Njk=\MjA0\Njc=\MjA3\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\Njc=\MjI1\MjAx\NzI=\Mw==\MjI1\MjAx\OA==\MTk1\MjI0\MjAx\MjEz\Njc=\MjAx\MjAz\MA==\MjA2\MTk1\ODU=\MA==\MTQy\MjQ=\NzE=\MjA0\Mw==\MjA2\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTMx\MjI0\MjAx\NzI=\MTMx\MTkz\MjAx\OA==\MTMx\MTkz\MjAx\MjAw\MTMw\MTkz\MjAx\MjEz\Njc=\NzM=\MjAz\MA==\MjA2\MTk1\NzA=\MjA0\Mw==\MjA2\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTMx\MTkz\MjAx\NzI=\Mw==\MjM5\MjAx\OA==\MTMx\MTkz\MjAx\MjAw\Mg==\MjM5\MjAx\MjEz\Njc=\NzM=\MjAz\MA==\MjA2\Njc=\ODg=\MTky\MQ==\MjA2\Njc=\MjA0\Njc=\MjA3\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTk1\MjAw\MjAx\NzI=\MTk1\MjAw\MjAx\OA==\MTk1\MjAw\MjAx\MjEz\Njc=\MjAx\MjAz\MTky\MTkz\Njc=\Njk=\MTky\MTkz\OA==\OTM=\MjA0\Mw==\MjA2\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\Njc=\MjI0\MjAx\NzI=\MTMx\MTkz\MjAx\OA==\MTMx\MTkz\MjAx\MjAw\MTMw\MTkz\MjAx\MjEz\Njc=\NzM=\MjAz\MTky\MTkz\MTk1\NzA=\MjA0\Mw==\MjA2\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTMx\MTkz\MjAx\NzI=\Mw==\MjI0\MjAx\OA==\MTMx\MTkz\MjAx\MjAw\Mg==\MjM5\MjAx\MjEz\Njc=\NzM=\MjAz\MTky\MTkz\Njc=\ODg=\MjA0\Mw==\MTk0\MjAx\MjA3\Njc=\MTMw\MjIx\MjA3\MTk1\MTYz\MjIx\MTky\MTkz\MTk1\OTQ=\MTky\MTI5\MzU=\ODE=\MjA0\Njc=\MjA3\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTk1\MjAw\MjAx\NzI=\MTk1\MjAw\MjAx\OA==\MTk1\MjAw\MjAx\MjEz\Njc=\MjAx\MjAz\MTky\MTkz\MTk1\ODM=\MTky\MTkz\MTQz\MTE0\MTky\NjU=\NA==\ODM=\MTky\MTkz\MTQz\MTA1\MTI4\NjU=\MTYz\NjQ=\MTI4\MTkz\MjAw\Njc=\MTI4\MTkz\MTU=\NjY=\MjA0\Njc=\MjA3\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTk1\MjAw\MjAx\NzI=\MTk1\MjAw\MjAx\OA==\MTk1\MjAw\MjAx\MjEz\Njc=\MjAx\MjAz\MTI4\MTkz\Njc=\Njk=\MTI4\MTI5\MQ==\NzE=\MjA0\Mw==\MjA2\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\Mw==\MjI3\MjAx\NzI=\MTMx\MTkz\MjAx\OA==\MTk1\MjI2\MjAx\MjAw\MTMw\MTkz\MjAx\MjEz\Njc=\NzM=\MjAz\MTI4\MTkz\MTk1\NzA=\MjA0\Mw==\MjA2\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTMx\MTkz\MjAx\NzI=\MTMx\MjI2\MjAx\OA==\MTMx\MTkz\MjAx\MjAw\NjY=\MjI2\MjAx\MjEz\Njc=\NzM=\MjAz\MTI4\MTkz\Njc=\ODg=\MjA0\Mw==\MTk0\MjAx\MjA3\Mw==\MTYy\MjIx\MjA3\MTk1\MTY1\MjIx\MTI4\MTkz\MTk1\ODc=\MTI4\MQ==\MTU3\OTY=\NjQ=\MTI5\MTY1\NjQ=\NjQ=\MTI5\MTkz\Njc=\NjQ=\MTkz\MTU=\NjY=\MjA0\Njc=\MjA3\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTk1\MjAw\MjAx\NzI=\MTk1\MjAw\MjAx\OA==\MTk1\MjAw\MjAx\MjEz\Njc=\MjAx\MjAz\NjQ=\MTkz\Njc=\Njk=\NjQ=\MTI5\MQ==\NzE=\MjA0\Mw==\MjA2\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\Njc=\MjI5\MjAx\NzI=\MTMx\MTkz\MjAx\OA==\Mw==\MjI5\MjAx\MjAw\MTMw\MTkz\MjAx\MjEz\Njc=\NzM=\MjAz\NjQ=\MTkz\MTk1\NzA=\MjA0\Mw==\MjA2\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTMx\MTkz\MjAx\NzI=\MTMx\MjI2\MjAx\OA==\MTMx\MTkz\MjAx\MjAw\MTk0\MjI4\MjAx\MjEz\Njc=\NzM=\MjAz\NjQ=\MTkz\Njc=\ODg=\MjA0\Mw==\MTk0\MjAx\MjA3\Mw==\MTYy\MjIx\MjA3\MTk1\MTY1\MjIx\NjQ=\MTkz\MTk1\ODc=\MA==\MTI5\MTY0\NjQ=\MA==\MTI5\MTkz\Njc=\MA==\MTkz\MTU=\NjY=\MjA0\Njc=\MjA3\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\Njc=\MjI4\MjAx\NzI=\Njc=\MjI4\MjAx\OA==\Njc=\MjI4\MjAx\MjEz\Njc=\MjAx\MjAz\MA==\MTkz\Njc=\Njk=\MA==\MTkz\OA==\OTM=\MA==\MTI5\MQ==\NzE=\MjA0\Mw==\MjA2\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\Mw==\MjI4\MjAx\NzI=\MTMx\MTkz\MjAx\OA==\MTk1\MjMx\MjAx\MjAw\MTMw\MTkz\MjAx\MjEz\Njc=\NzM=\MjAz\MA==\MTkz\MTk1\NzA=\MjA0\Mw==\MjA2\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTMx\MTkz\MjAx\NzI=\MTMx\MjIz\MjAx\OA==\MTMx\MTkz\MjAx\MjAw\NjY=\MjIz\MjAx\MjEz\Njc=\NzM=\MjAz\MA==\MTkz\Njc=\ODg=\MjA0\Mw==\MTk0\MjAx\MjA3\Njc=\MTMw\MjIx\MjA3\MTk1\MTMz\MjIx\MA==\MTkz\MTk1\OTQ=\MA==\MTI5\Mzk=\ODE=\MjA0\Njc=\MjA3\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTk1\MjAw\MjAx\NzI=\MTk1\MjAw\MjAx\OA==\MTk1\MjAw\MjAx\MjEz\Njc=\MjAx\MjAz\MA==\MTkz\MTk1\ODM=\MA==\MTkz\MTQz\MTE0\MA==\NjU=\NA==\ODM=\MA==\MTkz\MTQz\MTA1\MTky\NjQ=\MTY3\NjQ=\MTky\MTI4\MTkz\Njc=\MjA0\Njc=\MjA3\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\Mw==\MjMx\MjAx\NzI=\Mw==\MjMx\MjAx\OA==\MTMx\MTkz\MjAx\MjEz\Njc=\MjAx\MjAz\MTky\MTky\Njc=\Njk=\MTky\MTky\Mzg=\OTM=\MjA0\Njc=\MjA3\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTMx\MTkz\MjAx\NzI=\MTk1\MjAw\MjAx\OA==\MTMx\MTkz\MjAx\MjEz\Njc=\MjAx\MjAz\MTky\MTky\MTk1\ODU=\MTky\MTI4\MQ==\NzE=\MjA0\Mw==\MjA2\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTMx\MjMw\MjAx\NzI=\MTMx\MTkz\MjAx\OA==\Njc=\MjMw\MjAx\MjAw\MTMw\MTkz\MjAx\MjEz\Njc=\NzM=\MjAz\MTky\MTky\MTk1\NzA=\MjA0\Mw==\MjA2\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTMx\MTkz\MjAx\NzI=\MTMx\MjIz\MjAx\OA==\MTMx\MTkz\MjAx\MjAw\NjY=\MjIz\MjAx\MjEz\Njc=\NzM=\MjAz\MTky\MTky\Njc=\ODg=\MjA0\Mw==\MTk0\MjAx\MjA3\Njc=\MTMw\MjIx\MjA3\MTk1\MTMz\MjIx\MTky\MTky\MTk1\OTQ=\MTky\MA==\Mzg=\ODE=\MjA0\Njc=\MjA3\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTk1\MjAw\MjAx\NzI=\MTk1\MjAw\MjAx\OA==\MTk1\MjAw\MjAx\MjEz\Njc=\MjAx\MjAz\MTky\MTky\MTk1\ODM=\MTky\MTky\MTQz\MTE0\MTky\NjQ=\NA==\ODM=\MTky\MTky\MTQz\MTA1\MTI4\MTky\MTg1\NjQ=\MTI4\MTI4\MTkz\Njc=\MTI4\MTky\MTU=\NjY=\MjA0\Njc=\MjA3\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTk1\MjAw\MjAx\NzI=\MTk1\MjAw\MjAx\OA==\MTk1\MjAw\MjAx\MjEz\Njc=\MjAx\MjAz\MTI4\MTky\Njc=\Njk=\MTI4\MTI4\MQ==\NzE=\MjA0\Mw==\MjA2\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTMx\MjQ5\MjAx\NzI=\MTMx\MTkz\MjAx\OA==\Njc=\MjQ5\MjAx\MjAw\MTMw\MTkz\MjAx\MjEz\Njc=\NzM=\MjAz\MTI4\MTky\MTk1\NzA=\MjA0\Mw==\MjA2\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTMx\MTkz\MjAx\NzI=\Mw==\MjQ5\MjAx\OA==\MTMx\MTkz\MjAx\MjAw\MTk0\MjQ4\MjAx\MjEz\Njc=\NzM=\MjAz\MTI4\MTky\Njc=\ODg=\NjQ=\MTI4\MTg0\NjQ=\NjQ=\MTI4\MTkz\Njc=\MjA0\Njc=\MjA3\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTk1\MjAw\MjAx\NzI=\MTk1\MjAw\MjAx\OA==\MTk1\MjAw\MjAx\MjEz\Njc=\MjAx\MjAz\NjQ=\MTky\Njc=\Njk=\NjQ=\MTky\OA==\OTM=\MjA0\Mw==\MjA2\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTMx\MjMw\MjAx\NzI=\MTMx\MTkz\MjAx\OA==\Njc=\MjQ4\MjAx\MjAw\MTMw\MTkz\MjAx\MjEz\Njc=\NzM=\MjAz\NjQ=\MTky\MTk1\NzA=\MjA0\Mw==\MjA2\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTMx\MTkz\MjAx\NzI=\MTMx\MjIz\MjAx\OA==\MTMx\MTkz\MjAx\MjAw\NjY=\MjIz\MjAx\MjEz\Njc=\NzM=\MjAz\NjQ=\MTky\Njc=\ODg=\MjA0\Mw==\MTk0\MjAx\MjA3\Njc=\MTMw\MjIx\MjA3\MTk1\MTMz\MjIx\NjQ=\MTky\MTk1\OTQ=\NjQ=\MA==\NTY=\ODE=\MjA0\Njc=\MjA3\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTk1\MjAw\MjAx\NzI=\MTk1\MjAw\MjAx\OA==\MTk1\MjAw\MjAx\MjEz\Njc=\MjAx\MjAz\NjQ=\MTky\MTk1\ODM=\NjQ=\MTky\MTQz\MTE0\NjQ=\NjQ=\NA==\ODM=\NjQ=\MTky\MTQz\MTA1\MA==\MTky\MTg3\NjQ=\MA==\MTI4\MTkz\Njc=\MjA0\Njc=\MjA3\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTMx\MTkz\MjAx\NzI=\MTMx\MjUx\MjAx\OA==\Njc=\MjUx\MjAx\MjEz\Njc=\MjAx\MjAz\MA==\MTky\Njc=\Njk=\MA==\MTI4\MQ==\OTM=\MjA0\Mw==\MjA2\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\Mw==\MjUx\MjAx\NzI=\MTMx\MTkz\MjAx\OA==\MTk1\MjUw\MjAx\MjAw\MTMw\MTkz\MjAx\MjEz\Njc=\NzM=\MjAz\MA==\MTky\MTk1\NzA=\MjA0\Mw==\MjA2\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTMx\MTkz\MjAx\NzI=\MTMx\MjIz\MjAx\OA==\MTMx\MTkz\MjAx\MjAw\NjY=\MjIz\MjAx\MjEz\Njc=\NzM=\MjAz\MA==\MTky\Njc=\ODg=\MjA0\Mw==\MTk0\MjAx\MjA3\Njc=\MTMw\MjIx\MjA3\MTk1\MTMz\MjIx\MA==\MTky\MTk1\OTQ=\MA==\MTI4\NTg=\ODE=\MjA0\Njc=\MjA3\MjAx\MjA3\Mw==\MTM5\MjIx\MTM2\MTk1\MjAw\MjAx\NzI=\MTk1\MjAw\MjAx\OA==\MTk1\MjAw\MjAx\MjEz\Njc=\MjAx\MjAz\MA==\MTky\MTk1\ODM=\MA==\MTky\MTQz\MTE0\MA==\NjQ=\NA==\ODM=\MA==\MTky\MTQz\MTA1\MA==\MTky\MTU=\NjY=\MTI4\MjAw\MTQz\NDY=\MTI4\MTkz\MTQz\NDY=\MTk0\Mw==\NTg=\MTk4\NzY=\Mw==\MjA2\MjAx\Nzk=\Mw==\MTM5\MjIw\OA==\MTk1\MjUz\MjAx\MjAw\MTMw\MjUz\MjAx\MTM2\MTk0\MjUz\MjAx\NzI=\MTMw\MjUz\MjAx\ODU=\Njc=\NzM=\MjAz\OA==\Njc=\MjUz\MjAx\MjAw\Mg==\MjUz\MjAx\MTM2\MTMw\MjAz\MjAx\MjEz\MTMx\MjAx\MjAy\MjA0\MTk1\MjUy\MjAx\MTM2\MTMx\MjUy\MjAx\MjEz\MTMx\MjAx\MjAw\MTk0\Mw==\NTg=\MjAz\NzY=\Mw==\MjA2\MjAx\Nzk=\Mw==\MTM5\MjIw\OA==\Njc=\MjUy\MjAx\MjAw\MTMw\MTkz\MjAx\MTM2\Mg==\MjUy\MjAx\NzI=\MTMw\MTkz\MjAx\ODU=\Njc=\NzM=\MjAz\OA==\Njc=\MjUz\MjAx\MjAw\MTk0\MjU1\MjAx\MTM2\MTMw\MjE2\MjAx\MjEz\MTMx\MjAx\MjAy\MA==\MTQ=\MTU3\OTY=\MjA0\Mw==\MjAw\MjAx\MTM2\MTMx\MjU1\MjAx\NzI=\MTMx\MjAz\MjAx\MjEz\MTMx\NzM=\MjAw\MTI4\MQ==\MTU3\OTY=\MTky\MjAw\MTQz\MzY=\MjA3\Mw==\MTkx\MTk5\MTk0\MTk1\MTkw\MjIx\MTA5\Njc=\MjAx\MjAx\MjAx\MjAx\NzM=\MjAz\MjEz\MTMx\NzM=\MjAw\MjA3\Mw==\MTkx\MTk4\MTk0\MTk1\MTkw\MjIx\MTA5\Mw==\MjAx\MjAx\MjAx\MjAx\NzM=\MjAz\MjEz\MTMx\NzM=\MjAw\MjA3\Mw==\MTkx\MjA0\MTk0\MTk1\MTkw\MjIx\MTA5\MTk1\MjAw\MjAx\MjAx\MjAx\MjAx\MjA0\MjAx\MjAx\NzM=\MjA0\MjAx\MjAx\MjAx\MjA1\MjAx\MjAx\NzM=\MTk3\MjAx\MjAx\NzM=\MTky\MjAx\MjAx\MjAx\MTk0\MjAx\MjAx\MjAx\MjA3\MjEz\MTMx\NzM=\MjAw\MjA3\Mw==\MTkx\MjA1\MTk0\MTk1\MTkw\MjIx\MTA5\MTMx\MjAw\MjAx\MjAx\MjAx\MjAx\MjA0\MjAx\MjAx\NzM=\MjA0\MjAx\MjAx\MjAx\MjA1\MjAx\MjAx\NzM=\MTk3\MjAx\MjAx\NzM=\MTky\MjAx\MjAx\MjAx\MjA3\MjAx\MjAx\MjAx\MTk0\MjEz\MTMx\NzM=\MjAw\MjA3\Mw==\NjM=\MjA0\MTk0\MTk1\MTkw\MjIx\MTA5\Njc=\MjAw\MjAx\MjAx\MjAx\MjAx\MjA0\MjAx\MjAx\NzM=\MjA0\MjAx\MjAx\MjAx\MjA1\MjAx\MjAx\NzM=\MTk3\MjAx\MjAx\MjAx\MjA3\MjAx\MjAx\MjAx\MTk0\MjAx\MjAx\NzM=\MTky\MjEz\MTMx\NzM=\MjAw\MjA3\Mw==\MTkx\MTkz\MTk0\MTk1\MTkw\MjIx\MTA5\Mw==\MjAw\MjAx\MjAx\MjAx\NzM=\MjAw\MjEz\MTMx\NzM=\MjAw\MjA3\Mw==\NjM=\MTkz\MTk0\MTk1\MTkw\MjIx\MTA5\MTk1\MjAz\MjAx\MjEz\MTMx\NzM=\MjAw\MjA3\Mw==\NjM=\MjA3\MTk0\MTk1\MTkw\MjIx\MTA5\MTMx\MjAz\MjAx\MjEz\MTMx\NzM=\MjAw\MjA3\Mw==\MTkx\MTky\MTk0\MTk1\MTkw\MjIx\MTA5\Njc=\MjAz\MjAx\MjAx\MjAx\NzM=\MjE3\MjAx\MjAx\MjAx\MjE5\MjAx\MjAx\MjAx\MjE4\MjEz\MTMx\NzM=\MjAw\MjA3\Mw==\MTkx\MjE5\MTk0\MTk1\MTkw\MjIx\MTA5\Mw==\MjAz\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\NzM=\MjAw\MjAx\MjAx\NzM=\MjE3\MjEz\MTMx\NzM=\MjAw\MjA3\Mw==\NjM=\MjA2\MTk0\MTk1\MTkw\MjIx\MTA5\MTk1\MjAy\MjAx\MjEz\MTMx\NzM=\MjAw\MjA3\Mw==\MTkx\MjA2\MTk0\MTk1\MTkw\MjIx\MTA5\MTMx\MjAy\MjAx\MjAx\MjAx\NzM=\MjAw\MjEz\MTMx\NzM=\MjAw\MjAw\MTMx\MjU0\MjAx\MTQz\Mw==\NjM=\MjE4\MTMw\MTk1\NjI=\MjIx\NDU=\Njc=\MjAy\MjAx\MjAx\MjAx\MjAx\MjE4\MjAx\MjAx\NzM=\MjAw\MjAx\MjAx\NzM=\MjE3\MTQ5\MTMx\NzM=\MjAw\MTQw\MTk1\MjUy\MjAx\NzI=\Njc=\MjU0\MjAx\MTQ5\MTMx\MjAx\MjAw\MTM2\Mw==\MjU0\MjAx\NzY=\MTk1\MjUy\MjAx\OA==\Njc=\MjU0\MjAx\ODU=\MTMx\MjAx\MjAw\NzI=\MTk1\MjAw\MjAx\OA==\MTk1\MjQx\MjAx\MjAw\MTk0\MjAw\MjAx\MTU3\MTk0\NzM=\MjIw\NzI=\MTk0\MjAw\MjAx\MjMz\MTMw\MjAz\NzM=\MjA0\MTMz\MjQx\MjAx\MjA3\Njk=\MTc3\MjA5\MTM3\MTk3\NzM=\MjIw\NzI=\MTk3\MjAw\MjAx\OQ==\MTk3\NzM=\MjIy\MjEz\Njk=\MjAx\MjAz\MA==\MjAw\Njk=\ODE=\MjA0\MTk3\MjUy\MjAx\MTM2\NQ==\MjQx\MjAx\MjEz\MTMz\MjAx\MjAw\MjE0\MTk0\NTI=\MTgy\MjA0\MTk0\MjUy\MjAx\MTM2\NjY=\MjU0\MjAx\MjEz\MTMw\MjAx\MjAw\MjAw\MTk0\MjQw\MjAx\MTM2\MTMw\MjQw\MjAx\NzI=\MTk0\MjAw\MjAx\Mjk=\MTk0\NzM=\MjIz\MjAw\MTk3\MjAw\MjAx\MTA1\MTMw\MjAz\NzM=\NzY=\MTMz\MjQx\MjAx\Nzk=\Njk=\MTc3\MjA4\OQ==\MTk3\NzM=\MjIz\MjAw\MTk2\MjAw\MjAx\MTM3\MTk2\NzM=\MjA5\ODU=\Njk=\MjAx\MjAz\MA==\NzI=\Njk=\ODE=\NzY=\MTk3\MjUy\MjAx\OA==\NQ==\MjQx\MjAx\ODU=\MTMz\MjAx\MjAw\ODY=\MTk0\NTI=\MTgy\MjIz\NzM=\NjE=\MTgy\MjE1\MjAx\NzM=\MjAx\NDc=\MjAx\MjAx\MjAx\MjA1\MjA0\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTc0\MTY4\MTY0\MTcy\MjAx\MjA1\MTkz\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTUz\MTY1\MTY4\MTc2\MTcy\MTg3\MTg2\MjAx\MjA1\MTk3\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTMz\MTY2\MTcw\MTY4\MTY1\MTUz\MTY1\MTY4\MTc2\MTcy\MTg3\MjAx\MjA1\MjA2\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTU2\MTg2\MTcy\MTg3\MTI4\MTcz\MjAx\MjAy\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\NTc=\MjQ2\MjA1\MjAy\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTY0\MTcy\MjAx\MjA1\MjA2\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTg3\MTcy\MTY0\MTc0\MTg4\MTYw\MjAx\MjA1\MjA2\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTYw\MTY3\MTc1\MTY2\MTg3\MTY0\MjAx\MjA1\MjE4\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTQx\MTMx\MjMz\MTI4\MTY3\MTYw\MTg5\MTYw\MTY4\MTY1\MTYw\MTc5\MTYw\MTY3\MTc0\MjMx\MjMx\MjMx\MjAx\MjAy\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTkz\MTM3\MjA1\MTky\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTI4\MTY3\MTg2\MTg5\MTY4\MTY3\MTcw\MTcy\MjAx\MjA1\MjA1\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTY3\MTcy\MTkw\MjAx\MjA1\MTk1\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTU0\MTcw\MTg3\MTcy\MTcy\MTY3\MTQy\MTg4\MTYw\MjAx\MjA1\MjA3\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTQz\MTg3\MTY4\MTY0\MTcy\MjAx\MjA1\MTk1\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTU3\MTcy\MTc3\MTg5\MTMz\MTY4\MTcx\MTcy\MTY1\MjAx\MjA1\MTk0\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTU3\MTcy\MTc3\MTg5\MTM5\MTg4\MTg5\MTg5\MTY2\MTY3\MjAx\MjA1\MTk3\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTI4\MTY0\MTY4\MTc0\MTcy\MTM5\MTg4\MTg5\MTg5\MTY2\MTY3\MjAx\MjA1\MTkz\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTU3\MTcy\MTc3\MTg5\MTM5\MTY2\MTc3\MjAx\MjA1\MjA0\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTM1\MTY4\MTY0\MTcy\MjAx\MjA1\MTkz\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTQw\MTY4\MTg2\MTc2\MTQy\MTU2\MTI4\MjAx\MjA1\MjA2\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTUz\MTY4\MTg3\MTcy\MTY3\MTg5\MjAx\MjA1\MTkz\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTM4\MTY2\MTg3\MTcy\MTQy\MTg4\MTYw\MjAx\MjA1\MjA3\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTY0\MTY4\MTYw\MTY3\MjUx\MjAx\MjA1\MjA2\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTM2\MTcw\MTg5\MTYw\MTkx\MTcy\MjAx\MjAw\MjAw\MjA1\MjE2\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTM5\MTY4\MTcw\MTYy\MTc0\MTg3\MTY2\MTg4\MTY3\MTcz\MTM4\MTY2\MTY1\MTY2\MTg3\MjUw\MjAx\MjA1\MjA2\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTM4\MTY2\MTY1\MTY2\MTg3\MjUw\MjAx\MjAy\MTEw\MjQ1\MTE1\MjE2\MjIz\MjIw\MTI=\MjQ2\MjAy\MTYy\MTEz\MQ==\MjQ0\MTQ4\MTQ4\MzY=\MjQ2\MjA1\MjE3\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTM5\MTY2\MTg3\MTcz\MTcy\MTg3\MTU0\MTYw\MTc5\MTcy\MTUz\MTYw\MTc3\MTcy\MTY1\MjAx\MjA1\MTky\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTUz\MTY2\MTg2\MTYw\MTg5\MTYw\MTY2\MTY3\MjAx\MjA1\MjA3\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTU2\MTQx\MTYw\MTY0\MjUx\MjAx\MjAy\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\OQ==\MjAy\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAy\MzY=\NzM=\MjUx\MTY5\MTA4\Mzg=\Mjg=\MjQ2\MjA1\MjA0\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTU0\MTYw\MTc5\MTcy\MjAx\MjAy\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTc2\MTM3\MjAy\MjAx\MjAx\MjAx\MjAx\MjAx\MTA1\MTg4\MTM3\MjA1\MTkz\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTg5\MTY2\MTg1\MTY3\MTY4\MTY0\MTcy\MjAx\MjAy\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjQ4\MTM3\MjA1\MTky\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTQy\MTU2\MTI4\MTU3\MTYw\MTg5\MTY1\MTcy\MjAx\MjA1\MjIy\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTM5\MTY4\MTcw\MTYy\MTc0\MTg3\MTY2\MTg4\MTY3\MTcz\MTU3\MTg3\MTY4\MTY3\MTg2\MTg1\MTY4\MTg3\MTcy\MTY3\MTcw\MTc2\MjAx\MjAy\MjEy\MTQz\MTcz\NTQ=\MTk3\OTM=\Nw==\MjQ2\MjAy\MTU3\MjAy\Mjc=\MTA1\OTU=\OTU=\MTU=\MTE4\MjAy\MjAx\MjAx\MjAx\MjAx\MjAx\MTM3\MTYw\MTM3\MjAy\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjU0\MTM3\MjA1\MjA0\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTQz\MTY2\MTY3\MTg5\MjAx\MjA1\MjA0\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTQw\MTY3\MTg4\MTY0\MjAx\MjA1\MTk0\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTU0\MTY2\MTg4\MTg3\MTcw\MTcy\MTU0\MTY4\MTY3\MTg2\MjAx\MjA1\MjA0\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTU3\MTcy\MTc3\MTg5\MjAx\MjA1\MjIy\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTQx\MTMx\MjMz\MTQy\MTU2\MTI4\MjMz\MTkx\MjUx\MjMz\MjI4\MjMz\MTM2\MTg4\MTg5\MTYx\MTY2\MTg3\MTYw\MTg2\MTcy\MTcz\MjAx\MjA1\MTk1\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTQx\MTMx\MjMz\MTQy\MTU2\MTI4\MjMz\MTkx\MjUx\MjAx\MjA1\MTk0\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTU3\MTcy\MTc3\MTg5\MTM4\MTY2\MTY1\MTY2\MTg3\MjUw\MjAx\MjA1\MTky\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTU3\MTcy\MTc3\MTg5\MTU0\MTYw\MTc5\MTcy\MjAx\MjAy\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjI5\MTM3\MjA1\MTk0\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTY0\MTY4\MTYw\MTY3\MTcx\MTg4\MTg5\MTg5\MTY2\MTY3\MjAx\MjA1\MTk2\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTM5\MTY2\MTg3\MTcz\MTcy\MTg3\MTM4\MTY2\MTY1\MTY2\MTg3\MjUw\MjAx\MjAy\MTQ3\MTA0\MjE=\MTgy\MTYz\ODE=\MTAw\MjQ2\MjAy\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTU3\MTM3\MjAy\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjQ0\MTM3\MjA1\MjA3\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTU0\MTg5\MTc2\MTY1\MTcy\MjAx\MjA1\MTk3\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTM5\MTg4\MTg5\MTg5\MTY2\MTY3\MTU0\MTg5\MTc2\MTY1\MTcy\MjAx\MjA1\MjE5\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTU1\MTY2\MTcx\MTY1\MTY2\MTc3\MTU1\MTY2\MTg4\MTY3\MTcz\MTM5\MTg4\MTg5\MTg5\MTY2\MTY3\MjAx\MjA1\MTk0\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTQz\MTQw\MjMz\MTU0\MTcw\MTg3\MTYw\MTg1\MTg5\MTg2\MjAx\MjA1\MTk3\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTU3\MTcy\MTc3\MTg5\MTU4\MTg3\MTY4\MTg1\MTg1\MTcy\MTcz\MjAx\MjA1\MjA1\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTcx\MTY4\MTg3\MjAx\MjAy\MTM4\Nzg=\NjY=\ODY=\MTg1\MjQ0\Mw==\MjQ2\MjAy\NQ==\NDc=\MjMx\MjMz\NjE=\MjM4\OTY=\MjQ2\MjA1\MTk0\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTU0\MTcy\MTY1\MTcy\MTcw\MTg5\MTY4\MTcx\MTY1\MTcy\MjAx\MjAy\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjE3\MTM3\MjAy\MjAx\MjAx\MjAx\MjAx\MjAx\ODk=\MTg5\MTM3\MjA1\MTkz\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTQy\MTU2\MTI4\MTY0\MTcy\MTY3\MTg4\MjAx\MjAy\MjM0\Njc=\Nzg=\NTQ=\Njg=\MjMz\MTE=\MjQ2\MjA1\MjA3\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTQy\MTU2\MTI4\MTg2\MjMx\MjAx\MjA1\MTkz\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTcw\MTg3\MTcy\MTcz\MTYw\MTg5\MTg2\MjAx\MjAy\NzU=\MTI5\MjIy\MTgy\MjAw\MTg=\NQ==\MjQ2\MjA1\MTkz\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTM4\MTg3\MTcy\MTcz\MTYw\MTg5\MTg2\MjAx\MjA1\MTky\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTQy\MTU2\MTI4\MTc1\MTg3\MTY4\MTY0\MTcy\MjAx\MjAy\MjMy\MTE3\MjIw\MTM3\MjUw\MjUw\Mg==\MjQ2\MjAy\Mjg=\MTQ3\MTM2\MTY5\ODE=\MjEy\MTAx\MjQ2\MjAy\MjAx\MjAx\MjAx\MjAx\MjAx\MTIx\MTg2\MTM3\MjAy\MjAx\MjAx\MjAx\MjAx\MjAx\MTg1\MTg5\MTM3\MjA1\MTkz\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTU5\MTYw\MTg2\MTYw\MTcx\MTY1\MTcy\MjAx\MjAw\MjAx\MjA1\MjA3\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTMz\MTM0\MTQz\MTMw\MjUx\MjAx\MjAy\MTQz\MTQ4\MTYy\Mzg=\MTU0\MTU2\Mjg=\MjQ2\MjAy\ODM=\MTc4\MTI5\NDk=\MjM=\MjI=\MjI=\MjQ2\MjAy\MjUx\MTE=\NTk=\MjE0\Nzk=\MTY4\OTc=\MjQ2\MjAy\MjIw\MjEz\MzY=\MjI=\NA==\MTE4\MTAw\MjQ2\MjAy\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTYw\MTM3\MjAy\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTI4\MTM3\MjA1\MjEx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTU1\MTY2\MTcx\MTY1\MTY2\MTc3\MTU1\MTY2\MTg4\MTY3\MTcz\MTQx\MTg3\MTY2\MTg1\MTcz\MTY2\MTkw\MTY3\MTM5\MTg4\MTg5\MTg5\MTY2\MTY3\MjAx\MjA1\MjA2\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTMz\MTM0\MTU3\MTQz\MTMw\MjUx\MjAx\MjAy\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjQ3\MTM3\MjA1\MjA3\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTQz\MTQw\MTQy\MTU2\MTI4\MjAx\MjAy\MTU3\MTcz\MjEz\MjQ2\MjMx\OTA=\NQ==\MjQ2\MjA1\MjA2\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTQz\MTQw\MjMz\MTQy\MTU2\MTI4\MjAx\MjA1\MTk3\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTU0\MTYx\MTY4\MTg5\MTg5\MTcy\MTg3\MTkx\MTY4\MTg2\MTg5\MjAx\MjAy\NDI=\MjE0\MjEw\MjMz\MTM0\MTk2\MTY=\MjQ2\MjA1\MTky\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTM5\MTY4\MTcw\MTYy\MTcz\MTY2\MTY2\MTg3\MjAx\MjAy\NzQ=\MTk3\MjUw\MjMz\MTE1\MTA0\OTg=\MjQ2\MjAy\Nzk=\Mjg=\NTk=\MjI=\ODk=\MjAw\NDM=\MjQ2\MjA1\MjIy\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTM2\MTcz\MTY2\MTg1\MTg5\MjMz\MjM5\MjMz\MTU1\MTY4\MTYw\MTg2\MTcy\MjMz\MTM5\MTY4\MTcw\MTYy\MTcz\MTY2\MTY2\MTg3\MjAx\MjA1\MTk1\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTg3\MTcy\MTY0\MTY2\MTg5\MTcy\MTg2\MTg1\MTc2\MjAx\MjAy\MTQ2\NDY=\MjE5\MjMz\MTA1\MjAw\OTk=\MjQ2\MjAy\MTcw\MTMz\MjQw\NDE=\MTY1\MTcw\NDY=\MjQ2\MjA1\MTk1\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTU1\MTcy\MTY0\MTY2\MTg5\MTcy\MTU0\MTg1\MTc2\MjAx\MjAy\MjE4\OTU=\NQ==\MjQ2\MTc0\MTg2\NDc=\MjQ2\MjAy\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTU2\MTM3\MjA1\MjA3\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTI4\MTY0\MTY4\MTc0\MTcy\MjAx\MjA1\MjA5\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTg3\MTcx\MTc3\MTY4\MTg2\MTg2\MTcy\MTg5\MTYw\MTcz\MjQz\MjMw\MjMw\MjUx\MjUy\MjUw\MjQ5\MjUy\MjQ4\MjU0\MjUz\MjU1\MjU1\MjAx\MjA1\MTk2\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTcw\MTg3\MTcy\MTcz\MTYw\MTg5\MTg2\MTc1\MTg3\MTY4\MTY0\MTcy\MjAx\MjAy\MTc2\NTY=\MzM=\OQ==\MjE1\NzY=\Mg==\MjQ2\MjAy\MjAx\MjAx\MjAx\MjAx\MjAx\MTA1\MTg2\MTM3\MjA1\MjA3\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTcy\MTc3\MTg5\MTg3\MTY4\MjAx\MjAy\MTU1\MA==\MTIz\OQ==\MTU3\MjQ1\MTQ=\MjQ2\MjAy\MA==\MjMx\MjUy\MjE0\NDY=\MjE0\ODY=\MjQ2\MjA1\MjEy\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTM4\MTg3\MTcy\MTY4\MTg5\MTcy\MTcz\MjMz\MTM5\MTc2\MjQz\MjMz\MTQx\MjMx\MTMx\MjMz\MTM2\MTY1\MTc0\MTg4\MTcy\MTYw\MTY3\MjM0\MjQ4\MjUw\MjUw\MjU0\MjAx\MjA1\MTk0\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTU3\MTcy\MTc3\MTg5\MTU0\MTcw\MTY4\MTY1\MTcy\MTcz\MjAx\MjA1\MTkz\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTkw\MTYx\MTY2\MTY0\MTY4\MTcz\MTcy\MjAx\MjAy\Mzk=\MjI2\MjA2\MTY4\MTk0\MTk2\MQ==\MjQ2\MjAy\MTE0\MTEw\MjIw\MjMz\MTI3\MTc1\NQ==\MjQ2\MjA1\MjUx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTU3\MTYx\MTY4\MTY3\MTYy\MTg2\MjMz\MTg5\MTY2\MjMz\MTY4\MTY1\MTY1\MjMz\MTg5\MTYx\MTY2\MTg2\MTcy\MjMz\MTg2\MTcw\MTg3\MTYw\MTg1\MTg5\MTg2\MjMz\MTYw\MTY3\MTcw\MTY1\MTg4\MTcz\MTcy\MTcz\MjMz\MTYw\MTY3\MjMz\MTg5\MTYx\MTYw\MTg2\MjMz\MTQy\MTU2\MTI4\MjMx\MjAx\MjA1\MTk1\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTc1\MTcy\MTg2\MTcw\MTg3\MTYw\MTg1\MTg5\MTg2\MjAx\MjAy\MTU3\MTcy\OTU=\MjQ2\MTk1\MzA=\Mg==\MjQ2\MjAy\MTUy\MjI4\Mw==\MjQ2\MTU=\MTA3\OTk=\MjQ2\MjAy\Mjg=\ODg=\MjUy\NzM=\MjQ0\MTk1\MzI=\MjQ2\MjAy\MTEx\Mzc=\NDE=\ODY=\MjY=\MTU2\Mzk=\MjQ2\MjA1\MTk0\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTcw\MTY2\MTY0\MTYw\MTY3\MTc0\MTg2\MTY2\MTY2\MTY3\MjAx\MjAy\MjI1\NjA=\MTQ1\MjQ2\MTA4\NDc=\MTU=\MjQ2\MjAy\NjI=\MjUz\MTYy\MTgy\OA==\NDg=\MTYx\MTE4\MjA1\MTk5\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTQz\MTQw\MjMz\MTU0\MTcw\MTg3\MTYw\MTg1\MTg5\MTg2\MjMz\MjQz\MjI0\MjAx\MjA1\MTky\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTY0\MTY2\MTg3\MTcy\MTYw\MTY3\MTc1\MTY2\MjAx\MjAy\MjA0\MTA1\Mg==\NzM=\MjM2\MTYz\MTQ=\MjQ2\MjA1\MTM3\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTQ0\MTY4\MTYx\MTY2\MTY2\MjMy\MjMz\MTU3\MTYx\MTYw\MTg2\MjMz\MTYw\MTg2\MjMz\MTY4\MTY1\MTY0\MTY2\MTg2\MTg5\MjMz\MTY2\MTg4\MTg5\MjMx\MjMz\MTU4\MTYw\MTY1\MTY1\MjMz\MTcx\MTcy\MjMz\MTcw\MTY2\MTY0\MTYw\MTY3\MTc0\MjMz\MTYw\MTY3\MjMz\MTg5\MTYx\MTcy\MjMz\MTY3\MTcy\MTc3\MTg5\MjMz\MTc1\MTcy\MTkw\MjMz\MTcz\MTY4\MTc2\MTg2\MjMx\MjAx\MjA1\MTk1\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTcw\MTYx\MTY4\MTY3\MTc0\MTcy\MTY1\MTY2\MTc0\MjAx\MjA1\MjA3\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTg5\MTYw\MTg5\MTY1\MTcy\MjAx\MjAy\MTgw\MTk5\MjU=\MjE0\MjE2\MjE2\MTIw\MjQ2\MjA1\MTk0\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTM4\MTYx\MTY4\MTY3\MTc0\MTcy\MTY1\MTY2\MTc0\MjQz\MjAx\MjA1\MjA1\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTY1\MTY2\MTc0\MjAx\MjAy\MjI4\MTA=\MTA2\NzM=\NDg=\MjY=\MTU=\MjQ2\MjAy\NDc=\NTA=\MTI4\MTgy\MTEx\MjE4\NA==\MjQ2\MjAy\MjAx\MjAx\MjAx\MjAx\MjAx\NzM=\MTYw\MTM3\MjA1\NjU=\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjQ4\MjMx\MjMz\MTI5\MTY4\MTY1\MTY1\MTY2\MjMy\MjMz\MTI5\MTcy\MTg3\MTcy\MjM4\MTg2\MjMz\MTkw\MTYx\MTY4\MTg5\MjMz\MTYx\MTY4\MTg2\MjMz\MTcw\MTYx\MTY4\MTY3\MTc0\MTcy\MTcz\MjMz\MTYw\MTY3\MjMz\MTkx\MjUx\MjQz\MjMz\MTM2\MTcz\MTcz\MTcy\MTcz\MjMz\MTY0\MTY2\MTg3\MTcy\MjMz\MTg2\MTcw\MTg3\MTYw\MTg1\MTg5\MTg2\MjI5\MjMz\MTY4\MTY3\MTcz\MjMz\MTY4\MjMz\MTY1\MTY2\MTc0\MTYw\MTY3\MjMz\MTg1\MTY4\MTY3\MTcy\MTY1\MjMx\MjMz\MjUx\MjMx\MjMz\MTI4\MTY0\MTg1\MTg3\MTY2\MTkx\MTcy\MTcz\MjMz\MTU0\MTcy\MTcw\MTg4\MTg3\MTYw\MTg5\MTc2\MjMx\MjMz\MjUw\MjMx\MjMz\MTI4\MTY0\MTg1\MTg3\MTY2\MTkx\MTcy\MTcz\MjMz\MTM2\MTY3\MTYw\MTY0\MTg2\MjMx\MjMz\MjUz\MjMx\MjMz\MTI4\MTY0\MTg1\MTg3\MTY2\MTkx\MTcy\MTcz\MjMz\MTU2\MTI4\MjAx\MjA1\MTk3\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTcw\MTY1\MTY2\MTg2\MTcy\MTcx\MTg4\MTg5\MTg5\MTY2\MTY3\MjAx\MjAy\MjAx\MjAx\MjAx\MjAx\MjAx\OQ==\MTQ1\MTM3\MjAy\MTM=\MTIy\MjI3\NDE=\MTA2\MTg1\MzQ=\MjQ2\MjAy\MjAx\MjAx\MjAx\MjAx\MjAx\NzM=\MTUy\MTM3\MjAy\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjQ5\MTM3\MjA1\MjA2\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTM4\MTY1\MTY2\MTg2\MTcy\MjMx\MjAx\MjA1\MTk0\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTM0\MTg1\MTcy\MTY3\MTcx\MTg4\MTcz\MTcz\MTY2\MTY3\MjAx\MjAy\ODk=\MzA=\NzQ=\MTI4\NTY=\NTY=\NDA=\MjQ2\MjAy\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjMz\MTM3\MjAy\MjQ2\MjIz\MTEy\MjI=\MTU2\MjQz\MjA=\MjQ2\MjAy\MTM3\Mzc=\MjE0\MjMz\MTY1\NQ==\MzY=\MjQ2\MjAy\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTQ0\MTM3\MjAy\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTM2\MTM3\MjA1\MTk0\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTY2\MTg1\MTcy\MTY3\MTcx\MTg4\MTg5\MTg5\MTY2\MTY3\MjAx\MjAy\MTkx\MjQ5\MTk3\ODY=\MTQy\NDA=\Mw==\MjQ2\MjAy\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTMy\MTM3\MjA1\MjA0\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTM0\MTg1\MTcy\MTY3\MjAx\MjA1\MjA3\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTYw\MTY3\MTg5\MTg3\MTY2\MjAx\MjAy\MTI0\OA==\NjQ=\MzM=\MzA=\MzE=\NDc=\MjQ2\MjAy\MzE=\MTUx\NTE=\MTMy\MjIy\MjA5\NjU=\MjQ2\MjAy\ODA=\MjI1\MTM5\MzU=\MTkx\MTkx\NDc=\MjQ2\MjAy\MjM=\MTY2\MTA1\NTQ=\ODY=\NTM=\MjE=\MjQ2\MjAy\NzY=\NTc=\MjE1\MTM3\NDA=\MTc5\Nzc=\MTE4\MjAy\MjAx\MjAx\MjAx\MjAx\MjAx\MTM3\MTQ0\MTM3\MjA1\MTk1\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTM2\MTg3\MTYw\MTY4\MTY1\MTM5\MTY2\MTY1\MTcz\MjAx\MjA1\MjAy\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTQx\MTMx\MjAx\MjA1\MTk0\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTMz\MTY2\MTc0\MTYw\MTY3\MTQz\MTg3\MTY4\MTY0\MTcy\MjAx\MjAy\NTM=\MTA0\MjEy\MTY5\MTc4\MjAx\NDQ=\MjQ2\MjAy\MTg3\MTQx\MjAy\MjMz\MTk1\ODk=\MzY=\MjQ2\MjAy\MjAx\MjAx\MjAx\MjAx\MjAx\MTg1\MTg3\MTM3\MjAy\MjAx\MjAx\MjAx\MjAx\MjAx\MjQ5\MTc5\MTM3\MjA1\MTk0\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTQz\MTg3\MTY4\MTY0\MTcy\MTU0\MTg5\MTc2\MTY1\MTcy\MjAx\MjA1\MTk3\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTU1\MTY2\MTcx\MTY1\MTY2\MTc3\MTU1\MTY2\MTg4\MTY3\MTcz\MjAx\MjA1\MTkz\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTg5\MTY2\MTg1\MTcx\MTY4\MTg3\MTg3\MjAx\MjAy\MTk3\MTM3\MTIz\ODY=\MjIz\ODM=\ODc=\MTE4\MjAy\NDM=\OTg=\OTc=\MjAx\NDM=\MTY3\OTI=\MTE4\MjAy\MjAx\MjAx\MjAx\MjAx\MjAx\NzM=\MTI4\MTM3\MjA1\MTk1\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTYw\MTY3\MTc1\MTY2\MTg1\MTY4\MTY3\MTcy\MTY1\MjAx\MjAy\MzI=\ODM=\MA==\MjU0\MTg=\MjE=\MjE=\MjQ2\MjAy\MjMz\NTM=\MTUx\MjE0\OTk=\MTcz\MTM=\MjQ2\MjAy\Njk=\MTU0\MTUx\MjQ2\NzY=\MTA3\MTE=\MjQ2\MjA1\MjMy\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTMz\MTY2\MTc0\MTYw\MTY3\MjQz\MjMz\MTUz\MTY1\MTcy\MTY4\MTg2\MTcy\MjMz\MTcw\MTYx\MTY2\MTY2\MTg2\MTcy\MjMz\MTY4\MTY3\MjMz\MTY2\MTg1\MTg5\MTYw\MTY2\MTY3\MjMx\MjMx\MjAx\MjA1\MTky\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTU1\MTM5\MTQ1\MTMz\MTY2\MTc0\MTYw\MTY3\MjAx\MjAy\MTQ4\MTUy\MTMx\MTkz\MTU5\MTU2\NDQ=\MjQ2\MjAy\MzY=\NTQ=\NTQ=\MTE4\NQ==\NQ==\Mzc=\MjQ2\MjAy\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjM3\OQ==\MjAy\MjU=\MjUz\MjMy\NDE=\MjM1\Njg=\MjY=\MjQ2\MjA1\MjIy\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTMz\MTY2\MTc0\MjMz\MTYw\MTY3\MjMz\MTkw\MTYw\MTg5\MTYx\MjMz\MTU1\MTcx\MTY1\MTc3\MjMz\MTU2\MTg2\MTcy\MTg3\MjMx\MjAx\MjA1\MTky\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTg2\MTcy\MTg1\MTcy\MTg3\MTY4\MTg5\MTcy\MjAx\MjAy\MjM2\MTY=\OQ==\MTY5\MjUx\MTYz\ODY=\MTE4\MjAy\MTE2\MjUy\MjQ3\MjAx\ODM=\NzU=\MjA=\MjQ2\MjAy\MjAx\MjAx\MjAx\MjAx\MjAx\NzM=\MTg3\MTM3\MjAy\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjM5\MTM3\MjA1\MTk1\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTkw\MTYx\MTYw\MTg5\MTcy\MTY1\MTYw\MTg2\MTg5\MjAx\MjAy\MTU5\MTMx\MjM=\MjE0\MTM3\MTgw\NDA=\MjQ2\MjA1\MTk4\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTU4\MTYx\MTYw\MTg5\MTcy\MTMz\MTYw\MTg2\MTg5\MjMz\MTM4\MTY2\MTcz\MTcy\MjAx\MjA1\MTk2\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTM2\MTg4\MTg5\MTYx\MTcy\MTY3\MTg5\MTYw\MTcw\MTY4\MTg5\MTcy\MjAx\MjAy\MjAx\MjAx\MjAx\MjAx\MjAx\NDE=\MTY2\MTM3\MjAy\MjAx\MjAx\MjAx\MjAx\MjAx\MTM3\MTY2\MTM3\MjAy\MTg3\MTY1\MTgy\MTUw\MTk1\Mzc=\OQ==\MjQ2\MjAy\MTI5\MTc4\MTk1\MjMz\MTgy\MjE3\NDY=\MjQ2\MjA1\MTk5\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTM2\MTg4\MTg5\MTYx\MTcy\MTY3\MTg5\MTYw\MTcw\MTY4\MTg5\MTcy\MjMx\MjAx\MjA1\MTk1\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTQx\MTg3\MTY4\MTc0\MTc0\MTY4\MTcx\MTY1\MTcy\MjAx\MjA1\MTk5\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTU3\MTkw\MTcy\MTcy\MTY3\MTUz\MTY2\MTg2\MTYw\MTg5\MTYw\MTY2\MTY3\MjAx\MjAy\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\NDE=\MjQ2\MjAy\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTI4\OQ==\MjA1\MjA1\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTM0\MTg4\MTg5\MjAx\MjA1\MTkz\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTQw\MTY1\MTY4\MTg2\MTg5\MTYw\MTcw\MjAx\MjA1\MjA0\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTkw\MTY4\MTYw\MTg5\MjAx\MjAy\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjIx\MTM3\MjAy\MjUx\OQ==\MTU3\MjE0\Nzg=\MTE=\MTQ=\MjQ2\MjAy\MzQ=\MjA3\MTI4\MjMz\MzA=\NDc=\MzA=\MjQ2\MjA1\MjA0\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTUy\MTg4\MTY4\MTcz\MjAx\MjA1\MTk2\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTI4\MTY3\MTYw\MTg5\MTYw\MTY4\MTY1\MTYw\MTc5\MTcy\MTcz\MjMx\MjAx\MjA1\MTk2\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTU1\MTcy\MTg2\MTcy\MTg5\MTM0\MTY3\MTU0\MTg1\MTY4\MTkw\MTY3\MjAx\MjA1\MjE5\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTMy\MTY2\MTg4\MTg2\MTcy\MTM5\MTg4\MTg5\MTg5\MTY2\MTY3\MjQ4\MTM4\MTY1\MTYw\MTcw\MTYy\MjAx\MjA1\MTkz\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTM4\MTY2\MTY3\MTY3\MTcy\MTcw\MTg5\MjAx\MjA1\MjIz\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTQx\MjMx\MTMx\MjMz\MTQy\MTU2\MTI4\MjMz\MTkx\MjUx\MjMz\MTM5\MTQw\MTU3\MTM2\MjMz\MjI4\MjMz\MTU4\MTI4\MTUz\MjAx\MjAy\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjM3\MTM3\MjA1\MjUw\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTMy\MTY4\MTcz\MTcy\MjMz\MTcx\MTc2\MjMz\MTQx\MjMx\MTMx\MjMz\MTM2\MTY1\MTc0\MTg4\MTcy\MTYw\MTY3\MjM0\MjQ4\MjUw\MjUw\MjU0\MjMz\MjI4\MjMz\MTU0\MTg4\MTc0\MTc0\MTcy\MTg2\MTg5\MjMz\MTg2\MTY2\MTY0\MTcy\MjMz\MTg4\MTg1\MTcz\MTY4\MTg5\MTcy\MTg2\MjMz\MjQz\MjI0\MjAx\MjA1\MjI4\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTU4\MTcy\MTY1\MTg1\MjI5\MjMz\MTM2\MTcz\MTY2\MTg1\MTg5\MjMz\MTY4\MTY3\MTcz\MjMz\MTg3\MTY4\MTYw\MTg2\MTcy\MjMz\MTYw\MTg2\MjMz\MTg1\MTY4\MTg5\MTcw\MTYx\MTcy\MTcz\MjMz\MTc0\MTY2\MTcz\MTcz\MTY4\MTY0\MjMz\MTYw\MTg5\MjMx\MjMx\MjAx\MjA1\MjA2\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTg2\MTg5\MTg3\MTYw\MTY3\MTc0\MjAx\MjA1\MjA1\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTg2\MTg4\MTcx\MjAx\MjAy\ODM=\ODA=\ODA=\ODA=\ODA=\ODA=\MA==\MjQ2\MjAy\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTM3\MjA1\MjA2\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTQx\MTMx\MjMz\MTQy\MTU2\MTI4\MjAx\MTk4\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTk0\MjAx\MjAx\MjAx\MjE2\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjA2\MTk4\MjAx\MjAx\MjAx\MjA0\MjAx\MjAx\MjAx\MTQw\MTM3\MjAx\MjAx\MTQz\NzM=\OQ==\MjAx\MTMw\OQ==\OQ==\MjAx\MTQ5\MjAx\MjAx\MjAw\MjEz\MjAx\MjAw\MjAx\MjIz\MjAx\MjAw\NzM=\MTQz\MjAw\MTM2\MjAz\MjIy\MTM3\OA==\MjAz\MjIz\MTM3\MjAx\NzM=\MTMw\NzI=\MTM2\MjAz\MTQ5\MTM2\MjAx\MjAw\MjMy\NzM=\MjAx\MjAx\MjIz\MjAx\NTU=\MTgy\MjE1\MjAx\NzM=\MjAx\MjA2\MjAx\MjAx\MjAx\MjA1\MjA3\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTg1\MTY4\MTYw\MTg3\MTg2\MjAx\MjA1\MjAy\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTY0\MTcy\MjAx\MjA1\MTk1\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTUz\MTY1\MTY4\MTc2\MTcy\MTg3\MTQy\MTg4\MTYw\MjAx\MjA1\MTk3\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTQy\MTcy\MTg5\MTM4\MTYx\MTYw\MTY1\MTcz\MTg3\MTcy\MTY3\MjAx\MjA1\MjA0\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTM1\MTY4\MTY0\MTcy\MjAx\MjA1\MTky\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTMy\MTY2\MTcz\MTcy\MTg2\MTYx\MTY2\MTkw\MjAx\MjA1\MjA2\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTg3\MTcy\MTY0\MTY2\MTkx\MTcy\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjE5\MjAx\MjAx\MjAx\MjM4\MjAx\MjAx\MjAx\MjAx\MjAz\MjAx\MTk1\MTU5\MjAx\MjAx\MjAx\NzY=\MjAx\MjAx\MjAx\ODU=\MTM3\NzM=\MjAx\NzY=\MTM3\MjAx\MjAx\Nzk=\NzM=\MTM3\MjAw\OA==\OQ==\MjAx\MjAx\ODU=\NzM=\MjAx\MjAw\MTI=\MTM3\MjAw\MjAx\MTU=\NzM=\OA==\MjAw\NjQ=\OQ==\MjAx\NzU=\NjQ=\MjAx\MTE=\NzQ=\MTI=\MTM3\MjAx\MjAx\MTU=\NzM=\OQ==\MjAw\MjAw\MTM2\MjAz\MjAx\MTM3\MjAw\MjAx\MjAw\MjE=\NzM=\NzM=\MjAw\MjA0\OA==\MjAz\MjAx\MjA3\NzI=\MTM3\MjAz\MTM2\MjAw\MjAy\MjAx\NzI=\MjAw\MjAy\MjAx\OA==\MjAw\MjAy\MjAx\MjEz\NzI=\MjAx\MjAz\MA==\MjAx\MjAw\NzY=\MjA0\NzI=\MjAy\MjAx\MjA3\NzI=\MTM3\MjAz\MTM2\OA==\MjAy\MjAx\NzI=\MjAw\MjA1\MjAx\OA==\MTM2\MjA1\MjAx\MjAw\MjAz\MjA1\MjAx\MjEz\NzI=\NzM=\MjAz\MA==\MjAx\NzI=\Nzk=\MjA0\NzI=\MjAy\MjAx\MjA3\NzI=\MTM3\MjAz\MTM2\OA==\MjA1\MjAx\NzI=\MjAw\MjA1\MjAx\OA==\MjAw\MjA0\MjAx\MjAw\MjAz\MjA1\MjAx\MjEz\NzI=\NzM=\MjAz\MA==\MjAx\MjAw\NjQ=\MA==\MjAx\MTM=\Njc=\MjA0\MTM2\MjAx\MjAx\MjA3\NzI=\MTM3\MjAz\MTM2\NzI=\MjA0\MjAx\NzM=\MjAw\MjAx\MjAw\MjEz\NzI=\NzM=\MjAw\MTQw\NzI=\MjAy\MjAx\MTQz\NzI=\OQ==\MjAz\NzI=\OA==\MjA0\MjAx\OA==\MjAw\MjA1\MjAx\MjAw\MjAz\MjA3\MjAx\MTM2\MjAz\MjA1\MjAx\MTQ5\NzI=\NzM=\MjAz\MTky\MTM2\NzI=\Nzk=\MTQw\OA==\MjAz\MjAx\MTQz\NzI=\OQ==\MjAz\NzI=\MjAw\MjA1\MjAx\OA==\MjAw\MjA1\MjAx\MjAw\MjAz\MjA1\MjAx\MTQ5\NzI=\MjAx\MjAz\MTky\MTM2\MjAw\NzY=\MTQw\NzI=\MjAy\MjAx\MTQz\NzI=\OQ==\MjAz\NzI=\MTM2\MjA3\MjAx\OA==\MjAw\MjA1\MjAx\MjAw\NzU=\MjA3\MjAx\MTM2\MjAz\MjA1\MjAx\MTQ5\NzI=\NzM=\MjAz\MTky\MTM2\MjAw\NjQ=\MTQw\OA==\MjAz\MjAx\MTQz\NzI=\OQ==\MjAz\NzI=\MjAw\MjAy\MjAx\OA==\MjAw\MjAy\MjAx\MjAw\MjAz\MjAy\MjAx\MTQ5\NzI=\MjAx\MjAz\MTky\MTM2\NzI=\Njg=\MTky\MTM2\MTQy\NzE=\MTky\MjAw\MjAx\NzA=\MTQw\OA==\MjA2\MjAx\MTQz\MjAw\MQ==\MjAz\NzY=\OA==\MjA2\MjAx\Nzk=\MTM2\MTI5\MjAy\NDU=\MjAw\MjAx\MjAx\MjAx\MjAx\NzM=\MjAx\MjAx\MjAx\MjAx\MjAw\ODU=\MjAw\MjAx\MjAw\MTQ5\MTM2\MjAx\MjAx\MjE1\MjAx\NzM=\MjAx\MjM1\MjAx\MjAx\MjAx\MjA1\MjA2\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTg3\MTcy\MTY0\MTc0\MTg4\MTYw\MjAx\MjA1\MTky\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTI4\MTY3\MTg2\MTg5\MTY4\MTY3\MTcw\MTcy\MjAx\MjA1\MjA1\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTY3\MTcy\MTkw\MjAx\MjA1\MTk1\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTU0\MTcw\MTg3\MTcy\MTcy\MTY3\MTQy\MTg4\MTYw\MjAx\MjA1\MjA2\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTUz\MTY4\MTg3\MTcy\MTY3\MTg5\MjAx\MjA1\MjAy\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTY0\MTcy\MjAx\MjA1\MTk1\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTUz\MTY1\MTY4\MTc2\MTcy\MTg3\MTQy\MTg4\MTYw\MjAx\MjA1\MjA0\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTM1\MTY4\MTY0\MTcy\MjAx\MjA1\MTky\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTMy\MTY2\MTcz\MTcy\MTg2\MTYx\MTY2\MTkw\MjAx\MjA1\MjA3\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTQz\MTg3\MTY4\MTY0\MTcy\MjAx\MjA1\MjE2\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTM5\MTY4\MTcw\MTYy\MTc0\MTg3\MTY2\MTg4\MTY3\MTcz\MTM4\MTY2\MTY1\MTY2\MTg3\MjUw\MjAx\MjA1\MjA2\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTM4\MTY2\MTY1\MTY2\MTg3\MjUw\MjAx\MjAy\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\NTc=\MjQ2\MjA1\MjA0\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTU0\MTYw\MTc5\MTcy\MjAx\MjA1\MjA3\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTU2\MTQx\MTYw\MTY0\MjUx\MjAx\MjAy\MjIx\MTAz\MTQy\NDA=\MTc5\MjIx\Mzk=\MjQ2\MjAy\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAy\ODM=\ODA=\ODA=\ODA=\ODA=\ODA=\MTEy\MjQ2\MjA1\MTky\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTUz\MTY2\MTg2\MTYw\MTg5\MTYw\MTY2\MTY3\MjAx\MjAy\MTEz\MjE1\NzY=\MzQ=\MTUy\MTEz\ODc=\MjQ2\MjAy\NjY=\MTY1\NDY=\NTA=\OTY=\NTY=\MTA3\MjQ2\MjA1\MjE3\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTM5\MTY2\MTg3\MTcz\MTcy\MTg3\MTU0\MTYw\MTc5\MTcy\MTUz\MTYw\MTc3\MTcy\MTY1\MjAx\MjA1\MTk1\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTU3\MTcy\MTc3\MTg5\MTMz\MTY4\MTcx\MTcy\MTY1\MjAx\MjAy\MTg0\MjQ0\MTk1\MzA=\MTA2\MTg1\MzY=\MjQ2\MjAy\MTk1\MzA=\MTA2\MTg1\MjQ0\MTk1\MTI2\MjQ2\MjAy\MTc4\MjIx\MTAz\MTQy\NDA=\MTc5\MTA5\MjQ2\MjAy\MjEw\MjMw\MjA=\MjM3\MjA3\NzI=\MTA4\MjQ2\MjA1\MTk0\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTU3\MTcy\MTc3\MTg5\MTM4\MTY2\MTY1\MTY2\MTg3\MjUw\MjAx\MjA1\MTky\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTQz\MTY2\MTY3\MTg5\MTU0\MTYw\MTc5\MTcy\MjAx\MjA1\MjA2\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTU0\MTYw\MTc5\MTcy\MjQ4\MjUz\MjAx\MjA1\MjA0\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTU3\MTcy\MTc3\MTg5\MjAx\MjA1\MTk1\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTcw\MTY2\MTg3\MTY2\MTg4\MTg5\MTYw\MTY3\MTcy\MjAx\MjA1\MjA2\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTg3\MTcy\MTg2\MTg4\MTY0\MTcy\MjAx\MjA1\MjA2\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTcw\MTg3\MTcy\MTY4\MTg5\MTcy\MjAx\MjAw\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjM0\MjAx\MjAx\MjAx\MjM5\MjAx\MjAx\MjAx\MjAz\MjAx\MjAx\MjAz\MjA2\MjAx\MjAx\MjAx\MjA0\MjAx\MjAx\MjAx\MTQx\MjAx\MjAx\MjAx\MjEz\MTM3\MjAx\MjAw\MjA1\MjAx\NzM=\MjAx\MTk0\MTM3\MTM3\MjAx\MjEz\MTM3\MjAx\MjAw\MjE1\MjAx\NzM=\MjAx\MjAz\MjAx\MjAx\MjAx\MjA1\MjA0\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTkw\MTY4\MTYw\MTg5\MjAx\MjA1\MjA2\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTg3\MTcy\MTY0\MTY2\MTkx\MTcy\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\Mzk=\MjAw\MjAx\MjAx\NTc=\MjAw\MjAx\MjAx\MjAw\MjAx\MjAx\MjA2\MTk5\MjAx\MjAx\MjAx\MjA1\MjAx\MjAx\MjAx\MTk0\MjAx\MTM3\MjAx\NzY=\MTM3\MjAx\MjAx\Nzk=\NzM=\MTM3\MjAw\OA==\OQ==\MjAx\MjAx\MjAw\MjAw\MjAw\MjAx\MTM2\MTM2\MjAw\MjAx\NzI=\MjAw\MjAw\MjAx\ODU=\NzM=\NzM=\MjAz\OA==\NzM=\MjAw\MjAx\MjAw\OA==\MjAw\MjAx\MTM2\MjAw\MjAz\MjAx\MjEz\MTM3\MjAx\MjAy\MjE1\MjAx\NzM=\MjAx\MTky\MjAx\MjAx\MjAx\MjA1\MTk5\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTU3\MTkw\MTcy\MTcy\MTY3\MTUz\MTY2\MTg2\MTYw\MTg5\MTYw\MTY2\MTY3\MjAx\MjA1\MjA3\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTU2\MTQx\MTYw\MTY0\MjUx\MjAx\MjA1\MjA1\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTY3\MTcy\MTkw\MjAx\MjAy\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\NDE=\MTE4\MjAy\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAy\MjQ=\MjI4\MTc4\MjI=\NDc=\MjIy\MzE=\MjQ2\MjA1\MjAy\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTI4\MTY3\MjAx\MjA1\MjA0\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTM5\MTY4\MTcw\MTYy\MjAx\MjAy\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTM3\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\NTk=\MjAw\MjAx\MjAx\NjE=\MjAw\MjAx\MjAx\MjAw\MjAx\MjAx\MjA2\MTk5\MjAx\MjAx\MjAx\MjA1\MjAx\MjAx\MjAx\MTk0\MjAx\MTM3\MjAx\NzY=\MTM3\MjAx\MjAx\Nzk=\NzM=\MTM3\MjAw\OA==\OQ==\MjAx\MjAx\MjAw\MjAw\MjAw\MjAx\MTM2\MTM2\MjAw\MjAx\NzI=\MjAw\MjAw\MjAx\ODU=\NzM=\NzM=\MjAz\OA==\NzM=\MjAw\MjAx\MjAw\OA==\MjAw\MjAx\MTM2\MjAw\MjAz\MjAx\MjEz\MTM3\MjAx\MjAy\MjE1\MjAx\NzM=\MjAx\MTky\MjAx\MjAx\MjAx\MjA1\MTk5\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTU3\MTkw\MTcy\MTcy\MTY3\MTUz\MTY2\MTg2\MTYw\MTg5\MTYw\MTY2\MTY3\MjAx\MjA1\MjA3\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTU2\MTQx\MTYw\MTY0\MjUx\MjAx\MjA1\MjA1\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTY3\MTcy\MTkw\MjAx\MjAy\MjUx\OQ==\MTU3\MjE0\Nzg=\MTE=\MTQ=\MjQ2\MjAy\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAy\MzQ=\MjA3\MTI4\MjMz\MzA=\NDc=\MzA=\MjQ2\MjA1\MjAy\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTI4\MTY3\MjAx\MjA1\MjA2\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTM5\MTY2\MTg4\MTY3\MTcw\MTcy\MjAx\MjAy\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTkz\MTM3\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\NjM=\MjAw\MjAx\MjAx\NTU=\MjAw\MjAx\MjAx\MjA2\MjAx\MjAx\MjAz\MjA5\MjAx\MjAx\MjAx\MjA1\MjAx\MjAx\MjAx\MTQw\MTM3\MjAx\MjAx\MTQz\NzM=\OQ==\MjAx\MTQz\OQ==\OQ==\MjAx\MTky\MTM3\MjAx\NzM=\MjA1\MjAx\NzM=\MjAx\MTQw\MTM3\MjAx\MjAx\MTQz\NzM=\OQ==\MjAx\MTQz\MjAx\OA==\MjAx\MTky\MTM3\MjAx\NzM=\MjA1\MjAx\MjAx\MjAw\MTQw\MTM3\MjAx\MjAx\MTQz\NzM=\OQ==\MjAx\MTQz\MjAx\OA==\MjAx\MTky\MTM3\MjAx\NzM=\MjA1\MjAx\NzM=\MjAw\MTky\NzM=\OA==\NzU=\MjA1\MjAx\MjAx\MjAz\MTky\NzM=\OA==\NzU=\MjA1\MjAx\NzM=\MjAz\MTky\NzM=\OA==\NzU=\MjA1\MjAx\MjAx\MjAy\MTky\OQ==\OA==\NzU=\MjE1\MjAx\NzM=\MjAx\MTkz\MjAx\MjAx\MjAx\MjA1\MjA3\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTU0\MTg5\MTc2\MTY1\MTcy\MjAx\MjA1\MjA0\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTQw\MTY3\MTg4\MTY0\MjAx\MjA1\MTk3\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTM5\MTg4\MTg5\MTg5\MTY2\MTY3\MTU0\MTg5\MTc2\MTY1\MTcy\MjAx\MjA1\MjA4\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTU1\MTY2\MTcx\MTY1\MTY2\MTc3\MTU1\MTY2\MTg4\MTY3\MTcz\MTQx\MTcy\MTc1\MTY4\MTg4\MTY1\MTg5\MTM5\MTg4\MTg5\MTg5\MTY2\MTY3\MjAx\MjA1\MjE5\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTU1\MTY2\MTcx\MTY1\MTY2\MTc3\MTU1\MTY2\MTg4\MTY3\MTcz\MTM5\MTg4\MTg5\MTg5\MTY2\MTY3\MjAx\MjA1\MTkz\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTU5\MTYw\MTg2\MTYw\MTcx\MTY1\MTcy\MjAx\MjAw\MjAx\MjAw\MjAw\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAz\MjAx\MjAx\MTkz\MjAz\MjAx\MjAx\MjA2\MjAx\MjAx\MjAz\MjA5\MjAx\MjAx\MjAx\MjA1\MjAx\MjAx\MjAx\MTQw\MTM3\MjAx\MjAx\MTQz\NzM=\OQ==\MjAx\MTQz\OQ==\OQ==\MjAx\MTky\MTM3\MjAx\NzM=\MjA1\MjAx\NzM=\MjAx\MTQw\MTM3\MjAx\MjAx\MTQz\NzM=\OQ==\MjAx\MTQz\OQ==\OQ==\MjAx\MTky\MTM3\MjAx\NzM=\MjA1\MjAx\MjAx\MjAw\MTQw\MTM3\MjAx\MjAx\MTQz\NzM=\OQ==\MjAx\MTQz\MjAx\OA==\MjAx\MTky\MTM3\MjAx\NzM=\MjA1\MjAx\NzM=\MjAw\MTky\NzM=\OA==\NzU=\MjA1\MjAx\MjAx\MjAz\MTky\NzM=\OA==\NzU=\MjA1\MjAx\NzM=\MjAz\MTky\NzM=\OA==\NzU=\MjA1\MjAx\MjAx\MjAy\MTky\OQ==\OA==\NzU=\MjE1\MjAx\NzM=\MjAx\MTkz\MjAx\MjAx\MjAx\MjA1\MjA3\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTU0\MTg5\MTc2\MTY1\MTcy\MjAx\MjA1\MjA0\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTQw\MTY3\MTg4\MTY0\MjAx\MjA1\MTk3\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTM5\MTg4\MTg5\MTg5\MTY2\MTY3\MTU0\MTg5\MTc2\MTY1\MTcy\MjAx\MjA1\MjE5\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTU1\MTY2\MTcx\MTY1\MTY2\MTc3\MTU1\MTY2\MTg4\MTY3\MTcz\MTM5\MTg4\MTg5\MTg5\MTY2\MTY3\MjAx\MjA1\MjA4\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTU1\MTY2\MTcx\MTY1\MTY2\MTc3\MTU1\MTY2\MTg4\MTY3\MTcz\MTQx\MTcy\MTc1\MTY4\MTg4\MTY1\MTg5\MTM5\MTg4\MTg5\MTg5\MTY2\MTY3\MjAx\MjA1\MTkz\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTU5\MTYw\MTg2\MTYw\MTcx\MTY1\MTcy\MjAx\MjAw\MjAx\MjAw\MjAw\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTk1\MjAz\MjAx\MjAx\MjE5\MjAz\MjAx\MjAx\MjA2\MjAx\MjAx\MjAz\MjA5\MjAx\MjAx\MjAx\MjA1\MjAx\MjAx\MjAx\MTQw\MTM3\MjAx\MjAx\MTQz\NzM=\OQ==\MjAx\MTQz\OQ==\OQ==\MjAx\MTky\MTM3\MjAx\NzM=\MjA1\MjAx\NzM=\MjAx\MTQw\MTM3\MjAx\MjAx\MTQz\NzM=\OQ==\MjAx\MTQz\MjAx\OA==\MjAx\MTky\MTM3\MjAx\NzM=\MjA1\MjAx\MjAx\MjAw\MTQw\MTM3\MjAx\MjAx\MTQz\NzM=\OQ==\MjAx\MTQz\OQ==\OQ==\MjAx\MTky\MTM3\MjAx\NzM=\MjA1\MjAx\NzM=\MjAw\MTky\NzM=\OA==\NzU=\MjA1\MjAx\MjAx\MjAz\MTky\NzM=\OA==\NzU=\MjA1\MjAx\NzM=\MjAz\MTky\NzM=\OA==\NzU=\MjA1\MjAx\MjAx\MjAy\MTky\OQ==\OA==\NzU=\MjE1\MjAx\NzM=\MjAx\MTkz\MjAx\MjAx\MjAx\MjA1\MjA3\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTU0\MTg5\MTc2\MTY1\MTcy\MjAx\MjA1\MjA0\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTQw\MTY3\MTg4\MTY0\MjAx\MjA1\MTk3\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTM5\MTg4\MTg5\MTg5\MTY2\MTY3\MTU0\MTg5\MTc2\MTY1\MTcy\MjAx\MjA1\MjE5\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTU1\MTY2\MTcx\MTY1\MTY2\MTc3\MTU1\MTY2\MTg4\MTY3\MTcz\MTM5\MTg4\MTg5\MTg5\MTY2\MTY3\MjAx\MjA1\MjA4\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTU1\MTY2\MTcx\MTY1\MTY2\MTc3\MTU1\MTY2\MTg4\MTY3\MTcz\MTQx\MTcy\MTc1\MTY4\MTg4\MTY1\MTg5\MTM5\MTg4\MTg5\MTg5\MTY2\MTY3\MjAx\MjA1\MTkz\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTU5\MTYw\MTg2\MTYw\MTcx\MTY1\MTcy\MjAx\MjAw\MjAx\MjAw\MjAw\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjIx\MjAz\MjAx\MjAx\MjE1\MjAz\MjAx\MjAx\MjAw\MjAx\MjAx\MjA0\MjEy\MjAx\MjAx\MjAx\MjA1\MjAx\MjAx\MjAx\MjIy\MjAx\MTM3\MjAx\MjIz\MjAx\MjAy\NzM=\MjA0\MTM3\MjAx\MjAx\MjA3\NzM=\MTM3\MjAx\MTM2\OQ==\MjAx\MjAx\NzY=\MjAx\MjAw\MjAx\Nzk=\MTM3\MTM2\MjAw\MjEz\NzM=\NzM=\MjAw\MTky\OQ==\MTM2\NzQ=\MTQw\MjAx\MjAz\MjAx\NzI=\MTM3\MjAz\MjAx\MTQ5\MTM3\MjAx\MjAw\MTMw\NzM=\MTM5\MjAx\MTQ5\MTM3\MjAx\MjAw\MjIz\OQ==\MjAz\NzM=\MjA0\OQ==\MjAz\MjAx\MTQw\MjAx\MjAw\MjAx\MTMw\MjAx\MTA=\MjAx\OA==\MTM3\MjAy\MjAx\MjAz\MjAw\NzM=\MjAx\MTQ5\MjAx\MjAx\MjAz\MjEz\NzM=\MjAx\MjAx\MjEz\MTM3\NzM=\MjAx\MjA0\NzM=\MjAy\MjAx\MTM2\OQ==\MjAy\MjAx\NzI=\MjAx\MjA1\MjAx\MjEz\MTM3\NzM=\MjAw\MjE1\MjAx\NzM=\MjAx\MjE2\MjAx\MjAx\MjAx\MjAw\MjAx\MjA1\MTky\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTI4\MTY3\MTg2\MTg5\MTY4\MTY3\MTcw\MTcy\MjAx\MjA1\MjA1\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTY3\MTcy\MTkw\MjAx\MjA1\MTkz\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTMy\MTcy\MTg2\MTg2\MTY4\MTc0\MTcy\MjAx\MjA1\MjA0\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTc0\MTY4\MTY0\MTcy\MjAx\MjA1\MTk1\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTU4\MTY2\MTg3\MTYy\MTg2\MTg1\MTY4\MTcw\MTcy\MjAx\MjA1\MjA0\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTU3\MTcy\MTc3\MTg5\MjAx\MjA1\MTcx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTI5\MTY2\MTY1\MTcz\MjMz\MTg4\MTg1\MjMz\MTcx\MTg4\MTcz\MjI5\MjMz\MTc2\MTY2\MTg4\MjMz\MTY3\MTcy\MTcy\MTcz\MjMz\MTg5\MTY2\MjMz\MTcx\MTcy\MjMz\MTY1\MTY2\MTc0\MTc0\MTcy\MTcz\MjMz\MTYw\MTY3\MjMz\MTg5\MTY2\MjMz\MTg4\MTg2\MTcy\MjMz\MTg5\MTYx\MTYw\MTg2\MjMz\MTM4\MTMy\MTQx\MjMx\MjMz\MTU3\MTg3\MTc2\MjMz\MTg2\MTY2\MTY0\MTcy\MjMz\MTY2\MTg5\MTYx\MTcy\MTg3\MTg2\MjMz\MTYw\MTc1\MjMz\MTc2\MTY2\MTg4\MjMz\MTcz\MTY2\MjMz\MTY3\MTY2\MTg5\MjMz\MTYx\MTY4\MTkx\MTcy\MjMz\MTY4\MTcw\MTcw\MTcy\MTg2\MTg2\MjMy\MjAx\MjA1\MjA0\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTkw\MTY4\MTYw\MTg5\MjAx\MjAy\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjE3\MTM3\MjA1\MjA2\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTU1\MTcy\MTY0\MTY2\MTkx\MTcy\MjAx\MjA1\MTk0\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTY1\MTY2\MTY4\MTcz\MTg2\MTg5\MTg3\MTYw\MTY3\MTc0\MjAx\MjA1\MTkz\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTI5\MTg5\MTg5\MTg1\MTQy\MTcy\MTg5\MjAx\MjA1\MjM1\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTYx\MTg5\MTg5\MTg1\MTg2\MjQz\MjMw\MjMw\MTg1\MTY4\MTg2\MTg5\MTcy\MTcx\MTYw\MTY3\MjMx\MTcw\MTY2\MTY0\MjMw\MTg3\MTY4\MTkw\MjMw\MTMw\MTkx\MjU1\MTcw\MTcz\MTY3\MTM2\MTU4\MjAx\MjA1\MjA2\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTYw\MTY3\MTc1\MTY2\MTg3\MTY0\MjAx\MjA1\MjE3\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTM5\MTY4\MTcw\MTYy\MTcz\MTY2\MTY2\MTg3\MjMz\MTU1\MTY4\MTY3\MjMz\MjQz\MTQx\MjAx\MjAy\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTkz\MTM3\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjMz\MjAz\MjAx\MjAx\MjM0\MjAz\MjAx\MjAx\MjAx\MjAx\MjAx\MjA0\MTk2\MjAx\MjAx\MjAx\MjA0\MjAx\MjAx\MjAx\MTQw\MTM3\MjAx\MjAx\MTMw\NzM=\OQ==\MjAx\OA==\OQ==\MjAx\MjAx\MjAz\MjAw\NzM=\MjAx\MTQ5\MjAx\MjAx\MjAz\MjEz\NzM=\MjAx\MjAx\MjEz\MTM3\NzM=\MjAx\MjA0\MjAx\MjAw\MjAx\MTM2\MTM3\MjAw\MjAx\NzI=\NzM=\MjAw\MjAx\MjEz\MTM3\NzM=\MjAw\MjE1\MjAx\NzM=\MjAx\MjA2\MjAx\MjAx\MjAx\MjA1\MTk0\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTY1\MTY2\MTY4\MTcz\MTg2\MTg5\MTg3\MTYw\MTY3\MTc0\MjAx\MjA1\MjA0\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTc0\MTY4\MTY0\MTcy\MjAx\MjA1\MTkz\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTI5\MTg5\MTg5\MTg1\MTQy\MTcy\MTg5\MjAx\MjA1\MjI0\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTYx\MTg5\MTg5\MTg1\MTg2\MjQz\MjMw\MjMw\MTY0\MTg3\MTg2\MTg1\MTc2\MTkx\MjUx\MTg2\MTY2\MTg4\MTg3\MTcw\MTcy\MjMx\MjQ5\MjQ5\MjQ5\MTkw\MTcy\MTcx\MTYx\MTY2\MTg2\MTg5\MTY4\MTg1\MTg1\MjMx\MTcw\MTY2\MTY0\MjMw\MjAx\MjA1\MjA2\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTYw\MTY3\MTc1\MTY2\MTg3\MTY0\MjAx\MjA1\MjE2\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTMy\MTg3\MjMx\MTU0\MTg1\MTc2\MjMz\MTkx\MjUx\MjMz\MTU1\MTY4\MTY3\MjMz\MjQz\MjI0\MjAx\MjAy\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTkz\MTM3\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjM2\MjAz\MjAx\MjAx\MjI1\MjAz\MjAx\MjAx\MjAx\MjAx\MjAx\MjA0\MTk2\MjAx\MjAx\MjAx\MjA0\MjAx\MjAx\MjAx\MTQw\MTM3\MjAx\MjAx\MTMw\NzM=\OQ==\MjAx\OA==\OQ==\MjAx\MjAx\MjAz\MjAw\NzM=\MjAx\MTQ5\MjAx\MjAx\MjAz\MjEz\NzM=\MjAx\MjAx\MjEz\MTM3\NzM=\MjAx\MjA0\MjAx\MjAw\MjAx\MTM2\MTM3\MjAw\MjAx\NzI=\NzM=\MjAw\MjAx\MjEz\MTM3\NzM=\MjAw\MjE1\MjAx\NzM=\MjAx\MjA2\MjAx\MjAx\MjAx\MjA1\MTk0\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTY1\MTY2\MTY4\MTcz\MTg2\MTg5\MTg3\MTYw\MTY3\MTc0\MjAx\MjA1\MjA0\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTc0\MTY4\MTY0\MTcy\MjAx\MjA1\MTkz\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTI5\MTg5\MTg5\MTg1\MTQy\MTcy\MTg5\MjAx\MjA1\MjM1\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTYx\MTg5\MTg5\MTg1\MTg2\MjQz\MjMw\MjMw\MTg1\MTY4\MTg2\MTg5\MTcy\MTcx\MTYw\MTY3\MjMx\MTcw\MTY2\MTY0\MjMw\MTg3\MTY4\MTkw\MjMw\MTkx\MTY0\MTMz\MTU1\MTcx\MjU1\MTg1\MTQw\MjAx\MjA1\MjA2\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTYw\MTY3\MTc1\MTY2\MTg3\MTY0\MjAx\MjA1\MTM4\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTMz\MTY2\MTY1\MjI5\MjMz\MTI4\MjMz\MTc0\MTg4\MTcy\MTg2\MTg2\MjMz\MTYw\MTc1\MjMz\MTc2\MTY2\MTg4\MjMz\MTkw\MTY4\MTY3\MTY3\MTY4\MjMz\MTg4\MTg2\MTcy\MjMz\MTY0\MTc2\MjMz\MTQy\MTU2\MTI4\MjMz\MTc1\MTY2\MTg3\MjMz\MTY4\MjMz\MTcx\MTY4\MTcz\MjMz\MTU1\MTUz\MTQy\MjMz\MTc0\MTY4\MTY0\MTcy\MjMz\MTg5\MTYx\MTY4\MTg5\MTg2\MjMz\MTc1\MTYw\MTY3\MTcy\MjAx\MjAy\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTkz\MTM3\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjI3\MjAz\MjAx\MjAx\MjQ4\MjAz\MjAx\MjAx\MjAy\MjAx\MjAx\MjA2\MjQ5\MjAx\MjAx\MjAx\MjA1\MjAx\MjAx\MjAx\MTky\MTM3\MTM3\NzM=\MjA1\MjAx\MjAx\MjAx\MTk0\NzM=\MTM3\MjAx\NzY=\OQ==\MjAx\MjAx\Nzk=\MjAx\MTM2\MjAw\OA==\MTM3\MjAw\MjAx\MjAw\NzI=\MjAw\MjAx\MTM2\OA==\MjAw\MjAx\NzI=\NzI=\MjAw\MjAx\ODU=\NzM=\NzM=\MjAz\OA==\MjAx\MjAz\MjAx\MjAw\MTM2\MjAz\MjAx\MTM2\NzI=\MjAz\MjAx\MjEz\MTM3\MjAx\MjAy\MjA0\OQ==\MjAz\MjAx\MTM2\MjAx\MjAy\MjAx\MjEz\MTM3\MjAx\MjAw\MjA1\MjAx\NzM=\MjAx\MTk0\NzM=\MTM3\MjAx\NzY=\OQ==\MjAx\MjAx\Nzk=\MjAx\MTM2\MjAw\OA==\MTM3\MjAy\MjAx\MjAw\NzI=\MjAw\MjAx\MTM2\NzI=\MjAy\MjAx\NzI=\NzI=\MjAw\MjAx\ODU=\NzM=\NzM=\MjAz\OA==\OQ==\MjAy\MjAx\MjAw\MjAw\MjA1\MjAx\MTM2\NzI=\MjAz\MjAx\MjEz\MTM3\MjAx\MjAy\MjA0\OQ==\MjAz\MjAx\MTM2\MjAx\MjAy\MjAx\MjEz\MTM3\MjAx\MjAw\MjA1\MjAx\MjAx\MjAw\MTk0\NzM=\MTM3\MjAx\NzY=\OQ==\MjAx\MjAx\Nzk=\MjAx\MTM2\MjAw\OA==\MTM3\MjA1\MjAx\MjAw\NzI=\MjAw\MjAx\MTM2\NzI=\MjA1\MjAx\NzI=\NzI=\MjAw\MjAx\ODU=\NzM=\NzM=\MjAz\OA==\OQ==\MjAy\MjAx\MjAw\MjAw\MjA1\MjAx\MTM2\NzI=\MjAz\MjAx\MjEz\MTM3\MjAx\MjAy\MjE1\MjAx\NzM=\MjAx\MjE4\MjAx\MjAx\MjAx\MjA1\MTkz\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTU5\MTYw\MTg2\MTYw\MTcx\MTY1\MTcy\MjAx\MjAw\MjAw\MjA1\MTk5\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTU3\MTkw\MTcy\MTcy\MTY3\MTUz\MTY2\MTg2\MTYw\MTg5\MTYw\MTY2\MTY3\MjAx\MjA1\MjA3\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTU2\MTQx\MTYw\MTY0\MjUx\MjAx\MjA1\MjA1\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTY3\MTcy\MTkw\MjAx\MjAy\Mzk=\MTgx\MjQ2\MjUy\MTUx\MTE1\NDQ=\MjQ2\MjAy\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAy\MjA3\NzI=\OTI=\MTM4\NjY=\MTY1\MTQ=\MjQ2\MjA1\MjA1\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTM0\MTg4\MTg5\MjAx\MjA1\MjA2\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTM5\MTY2\MTg4\MTY3\MTcw\MTcy\MjAx\MjAy\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjIx\MTM3\MjA1\MjA0\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTkw\MTY4\MTYw\MTg5\MjAx\MjAy\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTM3\MjAy\OTA=\MjA5\MjA1\MTU5\MTk5\MjI4\MTE=\MjQ2\MjAy\NzY=\MzQ=\MTUy\MTEz\MjE1\NzY=\MjY=\MjQ2\MjA1\MjAy\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTI4\MTY3\MjAx\MjA1\MTkz\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTQw\MTY1\MTY4\MTg2\MTg5\MTYw\MTcw\MjAx\MjAy\MjI2\Nzg=\MjIz\MTY=\Nw==\NjI=\MTA=\MjQ2\MjAy\MjEw\MjMw\MjA=\MjM3\MjA3\NzI=\NDA=\MjQ2\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjUw\MjAz\MjAx\MjAx\MTM3\MjAz\MjAx\MjAx\MjAy\MjAx\MjAx\MjA2\MjUw\MjAx\MjAx\MjAx\MjA1\MjAx\MjAx\MjAx\MTQw\MjAx\MjAx\MjAx\MTQz\MTM3\OQ==\MjAx\MTQz\NzM=\OQ==\MjAx\MTU4\MTM3\MjAx\MjAx\MjIz\MjAx\MjAw\NzM=\MjA0\MjAx\MjAx\MjAx\MjA3\MTM3\MTM3\MjAx\MjA3\OQ==\MTM3\MjAx\MjEx\MjAx\MjAx\MjAx\MjIz\OQ==\MjA3\NzM=\MjAz\MjAx\NzM=\MjAx\MTkz\MjAx\NzM=\MjAx\MjA0\MjAx\MjAw\MjAx\MTM2\MTM3\MjAw\MjAx\NzI=\NzM=\MjAw\MjAx\MjEz\MTM3\NzM=\MjAw\MjA0\OQ==\MjAw\MjAx\MTM2\NzM=\MjAw\MjAx\MjEz\MTM3\MjAx\MjAw\MjA1\MjAx\MjAx\MjAw\MTk0\MjAx\MTM5\MjAx\NzY=\MTM3\MjAz\MjAx\Nzk=\NzM=\MTM5\MjAw\OA==\OQ==\MjAz\MjAx\MjAw\MjAw\MjAy\MjAx\MTM2\MTM2\MjAy\MjAx\NzI=\MjAw\MjAy\MjAx\ODU=\NzM=\NzM=\MjAz\OA==\NzM=\MjAy\MjAx\MjAw\OA==\MjAy\MjAx\MTM2\MjAw\MjA1\MjAx\MjEz\MTM3\MjAx\MjAy\MjA0\OQ==\MjAw\MjAx\MTM2\MjAx\MjA1\MjAx\MjEz\MTM3\MjAx\MjAw\MjA1\MjAx\MjAx\MjAw\MTky\NzM=\MTM=\NjU=\MjIz\NzM=\MjAz\NzM=\MjA0\MjAx\MjAw\MjAx\MTM2\OQ==\MjA1\MjAx\NzI=\NzM=\MjAw\MjAx\MjEz\MTM3\NzM=\MjAw\MjA0\OQ==\MjAw\MjAx\MTM2\NzM=\MjAw\MjAx\MjEz\MTM3\MjAx\MjAw\MjA0\MjAx\MjAw\MjAx\MTM2\MjAx\MjA0\MjAx\NzI=\NzM=\MjAw\MjAx\MjEz\MTM3\NzM=\MjAw\MjE1\MjAx\NzM=\MjAx\MjIw\MjAx\MjAx\MjAx\MjA1\MjA0\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTc0\MTY4\MTY0\MTcy\MjAx\MjA1\MTkz\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTUz\MTY1\MTY4\MTc2\MTcy\MTg3\MTg2\MjAx\MjA1\MTky\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTY4\MTY1\MTcx\MTYw\MTcy\MjUw\MjU1\MjQx\MjAx\MjA1\MTk1\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTY4\MTY1\MTcx\MTYw\MTcy\MjUw\MjU1\MjQx\MjUx\MjAx\MjA1\MjA2\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTYw\MTY3\MTc1\MTY2\MTg3\MTY0\MjAx\MjA1\MjQx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTU4\MTY2\MTY2\MTg1\MjMy\MjMz\MTQ0\MTY2\MTg4\MjMz\MTYx\MTY4\MTkx\MTcy\MjMz\MTg2\MTg4\MTcw\MTcw\MTcy\MTg2\MTg2\MTc1\MTg4\MTY1\MTY1\MTc2\MjMz\MTY1\MTY2\MTc0\MTc0\MTcy\MTcz\MjMz\MTYw\MTY3\MjMz\MTkw\MTYw\MTg5\MTYx\MjMz\MTc2\MTY2\MTg4\MTg3\MjMz\MTU2\MTU0\MTQw\MTU1\MTI4\MTQx\MjMx\MjAx\MjAy\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTkz\MTM3\MjA1\MjA0\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTkw\MTY4\MTYw\MTg5\MjAx\MjA1\MTk5\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTU3\MTkw\MTcy\MTcy\MTY3\MTUz\MTY2\MTg2\MTYw\MTg5\MTYw\MTY2\MTY3\MjAx\MjA1\MjA3\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTU2\MTQx\MTYw\MTY0\MjUx\MjAx\MjA1\MjA1\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTY3\MTcy\MTkw\MjAx\MjAy\NTM=\MTA0\MjEy\MTY5\MTc4\MjAx\NDQ=\MjQ2\MjAy\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAy\MTg3\MTQx\MjAy\MjMz\MTk1\ODk=\MzY=\MjQ2\MjA1\MjA1\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTM0\MTg4\MTg5\MjAx\MjA1\MjA0\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTM5\MTY4\MTcw\MTYy\MjAx\MjAy\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjIx\MTM3\MjA1\MTkz\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTU5\MTYw\MTg2\MTYw\MTcx\MTY1\MTcy\MjAx\MjAw\MjAx\MjA1\MTc1\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTQ0\MTY2\MTg4\MTg3\MjMz\MTU2\MTU0\MTQw\MTU1\MTI4\MTQx\MjMz\MTI4\MTg2\MjMz\MTY3\MTY2\MTg5\MjMz\MTkw\MTYx\MTYw\MTg5\MTcy\MTY1\MTYw\MTg2\MTg5\MTcy\MTcz\MjMx\MjMz\MTMy\MTY4\MTYy\MTcy\MjMz\MTg2\MTg4\MTg3\MTcy\MjMz\MTc2\MTY2\MTg4\MjMz\MTY4\MTg3\MTcy\MjMz\MTg4\MTg2\MTYw\MTY3\MTc0\MjMz\MTY4\MTY3\MjMz\MTY4\MTcw\MTcw\MjMz\MTg5\MTYx\MTY4\MTg5\MjMz\MTYx\MTY4\MTg2\MjMz\MTcx\MTcy\MTcy\MTY3\MjMz\MTkw\MTYx\MTYw\MTg5\MTcy\MTY1\MTYw\MTg2\MTg5\MTcy\MTcz\MjI5\MjMz\MTY3\MTY2\MTg5\MjMz\MTY4\MTY3\MjMz\MTY4\MTY1\MTg5\MjMx\MjAx\MjA1\MjI5\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTMy\MTY4\MTc2\MTcx\MTcy\MjMz\MTYw\MTc1\MjMz\MTc2\MTY2\MTg4\MjMz\MTg5\MTg3\MTc2\MjMz\MTY1\MTY2\MTc0\MTc0\MTYw\MTY3\MTc0\MjMz\MTYw\MTY3\MjMz\MTkw\MTYw\MTg5\MTYx\MjMz\MTc2\MTY2\MTg4\MTg3\MjMz\MTU4\MTMz\MjMz\MjQz\MjI0\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTM5\MjAz\MjAx\MjAx\MTQw\MjAz\MjAx\MjAx\MjAx\MjAx\MjAx\MjA0\MTk2\MjAx\MjAx\MjAx\MjA0\MjAx\MjAx\MjAx\MTM2\MTM3\MjAx\MjAx\NzI=\NzM=\MjAx\MjAx\MjEz\MTM3\NzM=\MjAw\MjA0\OQ==\MjAx\MjAx\MTQw\MjAx\MjAw\MjAx\MTMw\MTM3\OA==\MjAx\OA==\NzM=\MjAw\MjAx\MjAz\MjAw\NzM=\MjAx\MTQ5\MjAx\MjAx\MjAz\MjEz\NzM=\MjAx\MjAx\MjEz\MTM3\NzM=\MjAx\MjE1\MjAx\NzM=\MjAx\MjA2\MjAx\MjAx\MjAx\MjA1\MjA2\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTYw\MTY3\MTc1\MTY2\MTg3\MTY0\MjAx\MjA1\MjMz\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTU0\MTYx\MTY4\MTg5\MTg5\MTcy\MTg3\MTkx\MTY4\MTg2\MTg5\MjMz\MTY1\MTY2\MTY4\MTcz\MTYw\MTY3\MTc0\MjMx\MjMz\MjI1\MTQz\MTQw\MjMz\MTM2\MTQx\MTMy\MTI4\MTM1\MjI0\MjAx\MjAy\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTkz\MTM3\MjA1\MTk0\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTY1\MTY2\MTY4\MTcz\MTg2\MTg5\MTg3\MTYw\MTY3\MTc0\MjAx\MjA1\MjA0\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTc0\MTY4\MTY0\MTcy\MjAx\MjA1\MTkz\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTI5\MTg5\MTg5\MTg1\MTQy\MTcy\MTg5\MjAx\MjA1\MjM1\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTYx\MTg5\MTg5\MTg1\MTg2\MjQz\MjMw\MjMw\MTg1\MTY4\MTg2\MTg5\MTcy\MTcx\MTYw\MTY3\MjMx\MTcw\MTY2\MTY0\MjMw\MTg3\MTY4\MTkw\MjMw\MTkw\MTc3\MTcy\MTUy\MTQw\MjUy\MTMz\MTcx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTQz\MjAz\MjAx\MjAx\MTM0\MjAz\MjAx\MjAx\MjAw\MjAx\MjAx\MjA0\MjA4\MjAx\MjAx\MjAx\MjA1\MjAx\MjAx\MjAx\MjIy\MjAx\MTM3\MjAx\MjIz\MjAx\MjAy\NzM=\MjA0\MTM3\MjAx\MjAx\MjA3\NzM=\MTM3\MjAx\MTM2\OQ==\MjAx\MjAx\NzY=\MjAx\MjAw\MjAx\Nzk=\MTM3\MTM2\MjAw\MjEz\NzM=\NzM=\MjAw\MTky\OQ==\MTM2\NzQ=\MTQw\MjAx\MjAz\MjAx\NzI=\MTM3\MjAz\MjAx\MTQ5\MTM3\MjAx\MjAw\MTMw\NzM=\MTM5\MjAx\MTQ5\MTM3\MjAx\MjAw\MjIz\OQ==\MjAw\NzM=\MjA0\OQ==\MjAz\MjAx\MTQw\MjAx\MjAw\MjAx\MTMw\MjAx\MTA=\MjAx\OA==\MTM3\MjAy\MjAx\MjAz\MjAw\NzM=\MjAx\MTQ5\MjAx\MjAx\MjAz\MjEz\NzM=\MjAx\MjAx\MjEz\MTM3\NzM=\MjAx\MjE1\MjAx\NzM=\MjAx\MTk5\MjAx\MjAx\MjAx\MjAw\MjAx\MjA1\MTky\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTI4\MTY3\MTg2\MTg5\MTY4\MTY3\MTcw\MTcy\MjAx\MjA1\MjA1\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTY3\MTcy\MTkw\MjAx\MjA1\MTkz\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTMy\MTcy\MTg2\MTg2\MTY4\MTc0\MTcy\MjAx\MjA1\MjA0\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTc0\MTY4\MTY0\MTcy\MjAx\MjA1\MTk1\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTU4\MTY2\MTg3\MTYy\MTg2\MTg1\MTY4\MTcw\MTcy\MjAx\MjA1\MjA0\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTU3\MTcy\MTc3\MTg5\MjAx\MjA1\MTcx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTI5\MTY2\MTY1\MTcz\MjMz\MTg4\MTg1\MjMz\MTcx\MTg4\MTcz\MjI5\MjMz\MTc2\MTY2\MTg4\MjMz\MTY3\MTcy\MTcy\MTcz\MjMz\MTg5\MTY2\MjMz\MTcx\MTcy\MjMz\MTY1\MTY2\MTc0\MTc0\MTcy\MTcz\MjMz\MTYw\MTY3\MjMz\MTg5\MTY2\MjMz\MTg4\MTg2\MTcy\MjMz\MTg5\MTYx\MTYw\MTg2\MjMz\MTM4\MTMy\MTQx\MjMx\MjMz\MTU3\MTg3\MTc2\MjMz\MTg2\MTY2\MTY0\MTcy\MjMz\MTY2\MTg5\MTYx\MTcy\MTg3\MTg2\MjMz\MTYw\MTc1\MjMz\MTc2\MTY2\MTg4\MjMz\MTcz\MTY2\MjMz\MTY3\MTY2\MTg5\MjMz\MTYx\MTY4\MTkx\MTcy\MjMz\MTY4\MTcw\MTcw\MTcy\MTg2\MTg2\MjMy\MjAx\MjA1\MjA0\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTkw\MTY4\MTYw\MTg5\MjAx\MjAy\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjE3\MTM3\MjA1\MjA2\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTU1\MTcy\MTY0\MTY2\MTkx\MTcy\MjAx\MjA1\MTk0\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTY1\MTY2\MTY4\MTcz\MTg2\MTg5\MTg3\MTYw\MTY3\MTc0\MjAx\MjA1\MTkz\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTI5\MTg5\MTg5\MTg1\MTQy\MTcy\MTg5\MjAx\MjA1\MjM1\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTYx\MTg5\MTg5\MTg1\MTg2\MjQz\MjMw\MjMw\MTg1\MTY4\MTg2\MTg5\MTcy\MTcx\MTYw\MTY3\MjMx\MTcw\MTY2\MTY0\MjMw\MTg3\MTY4\MTkw\MjMw\MTU2\MTY0\MTYx\MTY4\MTQw\MTkx\MTU3\MTU3\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTU0\MjAz\MjAx\MjAx\MTcw\MjAz\MjAx\MjAx\MjAy\MjAx\MjAx\MTky\MjQw\MjAx\MjAx\MjAx\MjA1\MjAx\MjAx\MjAx\MjA3\MjAx\MTM3\MjAx\MjIy\MTM3\MTM3\MjAx\MjIz\MjAx\MTk1\NzM=\MjAz\MjAx\NzM=\MjAx\MTkz\MjAx\NzM=\MjAx\MjA0\NzM=\MjAx\MjAx\MTM2\OQ==\MjAx\MjAx\NzI=\MjAx\MjAw\MjAx\MjEz\MTM3\NzM=\MjAw\MjA0\MTM3\MjAw\MjAx\MTM2\MjAx\MjAw\MjAx\MjEz\MTM3\MjAx\MjAw\MjA1\MjAx\MjAx\MjAw\MTk0\NzM=\MTM2\MjAx\NzY=\OQ==\MjAw\MjAx\Nzk=\MjAx\MTM5\MjAw\OA==\MTM3\MjAz\MjAx\MjAw\NzI=\MjAz\MjAx\MTM2\OA==\MjAz\MjAx\NzI=\NzI=\MjAz\MjAx\ODU=\NzM=\NzM=\MjAz\OA==\MjAx\MjAy\MjAx\MjAw\MTM2\MjAy\MjAx\MTM2\MjAw\MjAw\MjAx\MjEz\MTM3\MjAx\MjAy\MjA0\MTM3\MjAw\MjAx\MTM2\MjAx\MjAw\MjAx\MjEz\MTM3\MjAx\MjAw\MjAw\MTM3\MjAz\MjAx\MTM2\NzM=\MjAy\MjAx\NzI=\MTM3\MjAz\MjAx\MjMz\MTM3\MjAz\NzM=\MjA1\MjAw\MjAx\MjAw\MTQw\MjAw\MjA1\MjAx\MTQz\MjAw\MTE=\MjAz\NzA=\NzI=\MTA=\MjAw\OA==\MTM2\MjAz\MjAx\MjAw\MTM5\MjAz\MjAx\MTQ5\NzI=\MjAx\MjAz\MTky\MTM2\NzI=\Nzg=\MjA1\MjAw\MjAx\MjAw\MTky\NzI=\MTM=\NjU=\MjE0\MjAx\NTI=\MTgy\MjIz\NzM=\MjAz\NzM=\MjA0\NzM=\MjAx\MjAx\MTM2\OQ==\MjA1\MjAx\NzI=\MjAx\MjAw\MjAx\MjEz\MTM3\NzM=\MjAw\MjA0\MTM3\MjAw\MjAx\MTM2\MjAx\MjAw\MjAx\MjEz\MTM3\MjAx\MjAw\MjA0\NzM=\MjAx\MjAx\MTM2\MjAx\MjA0\MjAx\NzI=\MTM3\MjA0\MjAx\MjEz\MTM3\NzM=\MjAw\MjE1\MjAx\NzM=\MjAx\MjIz\MjAx\MjAx\MjAx\MjA1\MjA0\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTU3\MTcy\MTc3\MTg5\MjAx\MjA1\MjA1\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTY4\MTkw\MTcz\MjAx\MjA1\MjA2\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTYw\MTY3\MTc1\MTY2\MTg3\MTY0\MjAx\MjA1\MjM3\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTU0\MTg4\MTcw\MTcw\MTcy\MTg2\MTg2\MTc1\MTg4\MTY1\MTY1\MTc2\MjMz\MTY1\MTY2\MTc0\MTc0\MTcy\MTcz\MjMz\MTYw\MTY3\MjMz\MTg4\MTg2\MTYw\MTY3\MTc0\MjMz\MTU4\MTMz\MjMz\MTI4\MTQx\MjMx\MjAx\MjAy\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjIx\MTM3\MjA1\MjA0\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTkw\MTY4\MTYw\MTg5\MjAx\MjA1\MTk5\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTU3\MTkw\MTcy\MTcy\MTY3\MTUz\MTY2\MTg2\MTYw\MTg5\MTYw\MTY2\MTY3\MjAx\MjA1\MjA3\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTU2\MTQx\MTYw\MTY0\MjUx\MjAx\MjA1\MjA1\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTY3\MTcy\MTkw\MjAx\MjAy\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\NTc=\MjQ2\MjAy\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAy\MTg3\MTQx\MjAy\MjMz\MTk1\ODk=\MzY=\MjQ2\MjA1\MjA1\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTM0\MTg4\MTg5\MjAx\MjA1\MjA0\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTM5\MTY4\MTcw\MTYy\MjAx\MjAy\MjAx\MjAx\MjAx\MjAx\MjAx\NDE=\MTY2\MTM3\MjA1\MjE2\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTM5\MTY4\MTcw\MTYy\MTc0\MTg3\MTY2\MTg4\MTY3\MTcz\MTM4\MTY2\MTY1\MTY2\MTg3\MjUw\MjAx\MjA1\MjA2\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTM4\MTY2\MTY1\MTY2\MTg3\MjUw\MjAx\MjA1\MTkz\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTU5\MTYw\MTg2\MTYw\MTcx\MTY1\MTcy\MjAx\MjAw\MjAx\MjA1\MjA4\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTQ0\MTY2\MTg4\MTg3\MjMz\MTU4\MTMz\MjMz\MTM4\MTY2\MTcz\MTcy\MjMz\MTYw\MTg2\MjMz\MTYw\MTY3\MTkx\MTY4\MTY1\MTYw\MTcz\MjMx\MjAx\MjA1\MTk1\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTU3\MTg3\MTc2\MjMz\MTY4\MTc0\MTY4\MTYw\MTY3\MjAx\MjAy\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MTM3\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx\MjAx',DJGUI_IllIlIllIIIllI())()
RAW Paste Data
We use cookies for various purposes including analytics. By continuing to use Pastebin, you agree to our use of cookies as described in the Cookies Policy. OK, I Understand
 
Top