UsernameRTX

Deprecated Vehicle Simulator Auto-farm

Apr 27th, 2020 (edited)
23,644
Never
Not a member of Pastebin yet? Sign Up, it unlocks many cool features!
  1. --[[
  2. IronBrew:tm: obfuscation; Version 2.7.2
  3. ]]
  4. return(function(Ninoo_IIlIlIIl,Ninoo_lIIIIIlIllIlllllIlIlIl,Ninoo_lllIlllIlllllIIIlIIlI)local Ninoo_lIlIllIllIIlI=string.char;local Ninoo_IIIIIlIlI=string.sub;local Ninoo_lIIlIlll=table.concat;local Ninoo_IlllIIIIll=math.ldexp;local Ninoo_llIlIlIIlIlIIIIlIIIIIIII=getfenv or function()return _ENV end;local Ninoo_IlIIllIll=select;local Ninoo_IIlllIllIllIlI=unpack or table.unpack;local Ninoo_IllIIlIIIIlI=tonumber;local Ninoo_lIllIllIlIIlIIlII='\20\56\56\56\58\60\56\56\56\95\89\85\93\58\50\56\56\56\127\93\76\107\93\74\78\81\91\93\58\49\56\56\56\111\87\74\83\75\72\89\91\93\58\63\56\56\56\104\84\89\65\93\74\75\58\51\56\56\56\116\87\91\89\84\104\84\89\65\93\74\58\41\56\56\56\106\93\72\84\81\91\89\76\93\92\107\76\87\74\89\95\93\58\43\56\56\56\110\81\74\76\77\89\84\113\86\72\77\76\117\89\86\89\95\93\74\58\50\56\56\56\84\87\89\92\75\76\74\81\86\95\58\50\56\56\56\127\93\76\119\90\82\93\91\76\75\58\47\56\56\56\74\90\64\89\75\75\93\76\81\92\2\23\23\12\9\11\11\14\14\15\10\14\13\56\56\56\56\56\56\56\200\7\58\62\56\56\56\107\87\77\74\91\93\58\40\56\56\56\116\81\90\74\89\74\65\24\90\65\24\79\89\84\84\65\58\52\56\56\56\123\74\93\89\76\93\111\81\86\92\87\79\58\41\56\56\56\110\93\80\81\91\84\93\24\107\81\85\77\84\89\76\87\74\58\54\56\56\56\126\81\86\92\104\84\89\65\93\74\75\123\89\74\58\60\56\56\56\85\93\76\89\58\55\56\56\56\95\93\76\74\89\79\85\93\76\89\76\89\90\84\93\58\58\56\56\56\86\91\58\50\56\56\56\103\103\86\89\85\93\91\89\84\84\58\54\56\56\56\85\89\83\93\103\79\74\81\76\93\89\90\84\93\58\51\56\56\56\86\93\79\91\91\84\87\75\77\74\93\58\62\56\56\56\122\77\76\76\87\86\58\48\56\56\56\121\77\76\87\94\89\74\85\58\50\56\56\56\121\77\76\87\94\89\74\85\24\10\58\50\56\56\56\121\77\76\87\94\89\74\85\24\11\58\50\56\56\56\121\77\76\87\94\89\74\85\24\12\58\63\56\56\56\95\93\76\94\93\86\78\58\62\56\56\56\108\87\95\95\84\93\58\54\56\56\56\113\86\91\74\93\89\75\93\24\107\72\93\93\92\58\60\56\56\56\94\84\89\95\58\58\56\56\56\81\75\58\48\56\56\56\84\87\91\89\76\81\87\86\58\52\56\56\56\106\93\92\93\93\85\24\123\87\92\93\75\58\62\56\56\56\123\74\89\76\93\75\58\57\56\56\56\91\58\61\56\56\56\75\72\89\79\86\58\48\56\56\56\126\74\93\93\24\12\8\115\58\54\56\56\56\121\86\91\80\87\74\24\110\93\80\81\91\84\93\58\58\56\56\56\89\78\58\51\56\56\56\125\84\93\91\76\74\81\91\122\87\64\58\58\56\56\56\93\90\58\41\56\56\56\106\93\72\89\81\74\125\84\93\91\76\74\81\91\122\87\64\58\59\56\56\56\74\93\90\189\56\56\56\42\42\56\56\56\57\56\56\56\24\56\56\56\56\56\56\58\56\42\56\56\58\56\59\56\56\56\56\56\56\56\56\58\56\58\56\42\56\56\57\56\57\56\56\56\24\56\56\57\56\57\56\58\56\42\56\56\59\56\60\56\56\56\56\56\56\57\56\59\56\58\56\24\56\56\58\56\57\56\61\56\42\56\56\59\56\57\56\56\56\24\46\56\59\56\59\56\58\56\42\108\56\61\56\62\56\56\56\56\56\56\59\56\61\56\58\56\42\56\56\60\56\57\56\56\56\24\56\56\60\56\60\56\58\56\42\56\56\62\56\63\56\56\56\56\56\56\60\56\62\56\58\56\42\56\56\61\56\48\56\56\56\42\56\56\62\56\57\56\56\56\24\56\56\62\56\62\56\49\56\42\56\56\48\56\50\56\56\56\56\90\56\62\56\48\56\58\56\24\40\56\62\56\62\56\51\56\24\56\56\62\56\62\56\52\56\56\56\56\61\56\58\56\58\56\42\56\56\62\56\53\56\56\56\56\56\56\61\56\58\56\58\56\24\56\56\62\56\61\56\54\56\42\56\56\48\56\55\56\56\56\56\56\56\62\56\48\56\58\56\56\56\56\63\56\63\56\56\56\62\99\56\48\56\56\56\57\56\58\56\56\9\56\56\56\58\56\56\56\56\9\56\56\56\63\56\56\56\42\122\56\48\56\40\56\56\56\42\56\56\48\56\42\56\56\56\42\56\56\49\56\57\56\56\56\56\56\56\48\56\58\56\58\56\42\56\56\48\56\41\56\56\56\42\56\56\48\56\41\56\56\56\24\56\56\48\56\48\56\44\56\42\56\56\48\56\43\56\56\56\42\56\56\48\56\45\56\56\56\42\56\56\49\56\41\56\56\56\56\37\56\48\56\58\56\57\56\42\44\56\48\56\41\56\56\56\42\44\56\49\56\46\56\56\56\58\8\56\50\56\57\56\56\56\56\27\56\49\56\58\56\58\56\40\19\56\48\56\44\56\49\56\24\46\56\48\56\62\56\47\56\42\12\56\50\56\32\56\56\56\62\99\56\51\56\58\56\57\56\59\56\56\9\56\56\56\63\56\56\56\56\9\56\56\56\56\56\56\56\56\9\56\56\56\60\56\56\56\56\90\56\48\56\51\56\58\56\24\46\56\49\56\62\56\47\56\42\12\56\51\56\33\56\56\56\62\99\56\52\56\59\56\57\56\59\56\56\9\56\56\56\63\56\56\56\56\9\56\56\56\56\56\56\56\56\9\56\56\56\60\56\56\56\56\90\56\49\56\52\56\58\56\24\46\56\50\56\62\56\47\56\42\12\56\52\56\34\56\56\56\62\99\56\53\56\60\56\57\56\59\56\56\9\56\56\56\63\56\56\56\56\9\56\56\56\56\56\56\56\56\9\56\56\56\60\56\56\56\56\90\56\50\56\53\56\58\56\24\46\56\51\56\62\56\47\56\42\12\56\53\56\35\56\56\56\62\99\56\54\56\61\56\57\56\59\56\56\9\56\56\56\63\56\56\56\56\9\56\56\56\56\56\56\56\56\9\56\56\56\60\56\56\56\56\41\56\51\56\54\56\58\56\42\56\56\52\56\36\56\56\56\56\56\56\52\56\57\56\58\56\24\56\56\53\56\62\56\37\56\42\56\56\55\56\38\56\56\56\56\56\56\40\56\56\56\58\56\8\56\56\40\56\39\56\24\56\40\56\56\40\56\25\56\52\56\62\99\56\41\56\62\56\57\56\57\56\56\9\56\56\56\63\56\56\56\56\90\56\53\56\41\56\58\56\24\46\56\54\56\62\56\47\56\42\12\56\40\56\26\56\56\56\62\99\56\41\56\63\56\57\56\57\56\56\9\56\56\56\59\56\56\56\56\127\56\54\56\41\56\58\56\24\56\56\55\56\62\56\37\56\42\56\56\41\56\27\56\56\56\56\56\56\42\56\56\56\57\56\8\56\56\42\56\39\56\28\56\56\56\56\55\56\42\56\58\56\42\56\56\40\56\29\56\56\56\62\99\56\41\56\48\56\57\56\59\56\56\9\56\56\56\62\56\56\56\56\9\56\56\56\56\56\56\56\56\9\56\56\56\58\56\56\56\56\37\56\40\56\58\56\57\56\24\46\56\40\56\62\56\47\56\42\12\56\42\56\30\56\56\56\62\99\56\43\56\49\56\57\56\57\56\56\9\56\56\56\59\56\56\56\56\93\56\40\56\43\56\58\56\24\56\56\41\56\62\56\37\56\42\56\56\43\56\31\56\56\56\56\56\56\44\56\56\56\58\56\8\56\56\44\56\39\56\16\56\40\56\56\44\56\25\56\52\56\62\99\56\45\56\50\56\57\56\57\56\56\9\56\56\56\63\56\56\56\56\93\56\41\56\45\56\58\56\24\56\56\42\56\62\56\37\56\42\56\56\44\56\17\56\56\56\56\56\56\45\56\56\56\58\56\8\56\56\45\56\39\56\18\56\40\56\56\45\56\25\56\52\56\62\99\56\46\56\51\56\57\56\57\56\56\9\56\56\56\56\56\56\56\56\93\56\42\56\46\56\58\56\24\56\56\43\56\62\56\37\56\42\56\56\45\56\19\56\56\56\56\56\56\46\56\56\56\58\56\8\56\56\46\56\39\56\20\56\40\56\56\46\56\25\56\52\56\58\8\56\47\56\52\56\56\56\56\90\56\43\56\47\56\58\56\56\24\56\56\56\57\56\56\56\56\53\56\56\56\48\56\56\56\58\61\56\56\56\72\89\81\74\75\58\49\56\56\56\79\87\74\83\75\72\89\91\93\58\48\56\56\56\110\93\80\81\91\84\93\75\58\51\56\56\56\127\93\76\123\80\81\84\92\74\93\86\58\54\56\56\56\126\81\86\92\126\81\74\75\76\123\80\81\84\92\58\61\56\56\56\87\79\86\93\74\58\61\56\56\56\110\89\84\77\93\58\60\56\56\56\118\89\85\93\46\56\56\56\42\123\56\56\56\57\56\56\56\42\56\56\57\56\58\56\56\56\24\56\56\57\56\57\56\59\56\24\56\56\57\56\57\56\60\56\56\56\56\57\56\58\56\56\56\56\56\56\56\56\56\56\58\56\60\56\56\56\56\43\56\57\56\24\46\56\61\56\60\56\61\56\42\12\56\63\56\62\56\56\56\56\90\56\61\56\63\56\58\56\62\62\56\62\56\53\56\57\56\61\56\60\36\56\56\56\53\56\57\56\24\102\56\62\56\61\56\63\56\56\47\56\63\56\56\56\56\56\24\102\56\63\56\63\56\48\56\62\33\56\62\56\43\56\57\56\63\56\60\36\56\56\56\43\56\57\56\56\85\56\60\56\57\56\56\56\56\18\56\60\56\58\56\56\56\62\121\56\56\56\63\56\57\56\58\56\60\36\56\56\56\63\56\57\56\56\24\56\56\56\57\56\56\56\56\56\56\56\56\46\56\56\56\50\56\56\56\50\56\56\56\50\56\56\56\50\56\56\56\50\56\56\56\50\56\56\56\50\56\56\56\51\56\56\56\51\56\56\56\51\56\56\56\52\56\56\56\52\56\56\56\52\56\56\56\53\56\56\56\53\56\56\56\53\56\56\56\53\56\56\56\54\56\56\56\55\56\56\56\50\56\56\56\40\56\56\56\42\56\56\56\63\56\56\56\58\60\56\56\56\89\74\95\75\58\48\56\56\56\76\87\75\76\74\81\86\95\58\58\56\56\56\84\85\58\36\56\56\56\127\121\106\93\72\87\74\76\116\87\95\125\74\74\87\74\75\106\93\85\87\76\93\125\78\93\86\76\58\41\56\56\56\95\93\76\86\89\85\93\91\89\84\84\85\93\76\80\87\92\58\50\56\56\56\126\81\74\93\107\93\74\78\93\74\58\58\56\56\56\86\91\33\56\56\56\56\45\56\58\56\56\56\56\56\56\124\56\59\56\56\56\56\56\56\91\56\58\56\56\56\57\56\42\89\56\58\56\57\56\56\56\42\44\56\58\56\58\56\56\56\56\101\56\59\56\56\56\56\56\56\27\56\58\56\58\56\58\56\30\4\56\58\56\54\56\57\56\59\56\60\36\56\56\56\54\56\57\56\42\44\56\58\56\58\56\56\56\56\101\56\59\56\56\56\56\56\56\27\56\58\56\58\56\58\56\30\48\56\58\56\43\56\57\56\60\56\60\36\56\56\56\43\56\57\56\42\44\56\58\56\61\56\56\56\56\35\56\58\56\57\56\58\56\30\48\56\58\56\43\56\57\56\62\56\60\36\56\56\56\43\56\57\56\56\24\56\56\56\57\56\56\56\42\44\56\58\56\63\56\56\56\56\120\56\59\56\56\56\56\56\56\56\56\60\56\56\56\56\56\56\56\56\58\56\56\56\56\56\56\56\56\58\56\56\56\56\56\56\56\56\56\56\57\56\56\56\57\56\56\56\56\33\56\56\56\47\56\56\56\47\56\56\56\47\56\56\56\47\56\56\56\32\56\56\56\32\56\56\56\32\56\56\56\32\56\56\56\32\56\56\56\32\56\56\56\32\56\56\56\32\56\56\56\32\56\56\56\32\56\56\56\32\56\56\56\32\56\56\56\32\56\56\56\32\56\56\56\33\56\56\56\35\56\56\56\35\56\56\56\35\56\56\56\35\56\56\56\35\56\56\56\36\56\56\56\39\56\56\56\58\54\56\56\56\126\81\86\92\104\84\89\65\93\74\75\123\89\74\58\48\56\56\56\112\89\86\92\84\81\86\95\58\48\56\56\56\117\89\64\107\72\93\93\92\58\61\56\56\56\110\89\84\77\93\56\56\56\56\56\56\56\177\120\58\62\56\56\56\108\87\74\73\77\93\56\56\56\56\56\56\176\219\120\58\63\56\56\56\127\74\89\78\81\76\65\56\56\56\56\56\56\120\183\120\58\61\56\56\56\72\74\81\86\76\58\42\56\56\56\121\77\76\87\94\89\74\85\24\121\91\76\81\78\89\76\93\92\58\60\56\56\56\79\89\81\76\56\56\56\56\56\56\56\60\120\58\44\56\56\56\107\93\76\104\74\81\85\89\74\65\104\89\74\76\123\126\74\89\85\93\58\62\56\56\56\123\126\74\89\85\93\58\59\56\56\56\86\93\79\56\102\189\172\167\44\86\155\248\56\86\168\156\199\120\116\117\120\56\48\1\215\199\155\71\177\120\56\6\125\62\152\214\199\215\135\56\138\1\28\56\130\106\72\135\56\134\31\20\216\54\52\116\7\56\62\230\250\39\167\16\116\7\56\98\73\211\167\251\201\115\135\56\205\29\27\184\198\199\215\7\56\232\78\11\120\205\105\72\135\56\6\125\62\152\214\199\215\7\56\33\52\233\167\86\54\116\7\58\52\56\56\56\107\93\86\92\115\93\65\125\78\93\86\76\58\57\56\56\56\111\58\60\56\56\56\95\89\85\93\8\56\56\56\42\11\56\56\56\57\56\56\56\56\56\56\56\56\57\56\58\56\56\56\56\56\56\56\56\56\56\56\56\56\56\56\56\56\56\56\24\56\56\56\56\56\56\58\56\24\56\56\56\56\56\56\59\56\8\56\56\56\56\60\56\61\56\56\56\56\56\56\56\56\56\56\24\56\56\56\56\56\56\58\56\24\56\56\56\56\56\56\62\56\8\56\56\56\56\60\56\63\56\56\56\56\56\56\57\56\56\56\8\56\56\56\56\48\56\49\56\42\56\56\56\56\50\56\56\56\42\56\56\57\56\51\56\56\56\56\56\56\56\56\58\56\57\56\42\44\56\56\56\52\56\56\56\42\12\56\57\56\53\56\56\56\56\27\56\56\56\58\56\58\56\62\98\56\56\56\23\56\57\56\56\56\60\36\56\56\56\23\56\57\56\56\47\56\56\56\56\56\56\56\24\94\56\56\56\56\56\54\56\42\56\56\58\56\55\56\56\56\24\56\56\58\56\58\56\40\56\42\56\56\59\56\41\56\56\56\42\56\56\60\56\42\56\56\56\42\56\56\61\56\43\56\56\56\42\56\56\62\56\44\56\56\56\42\56\56\63\56\45\56\56\56\42\56\56\48\56\46\56\56\56\42\56\56\49\56\47\56\56\56\42\56\56\50\56\32\56\56\56\42\56\56\51\56\33\56\56\56\42\56\56\52\56\34\56\56\56\42\56\56\53\56\35\56\56\56\42\56\56\54\56\36\56\56\56\56\56\56\58\56\54\56\56\56\56\56\56\56\56\56\56\57\56\56\56\56\56\56\58\56\56\56\24\56\56\56\56\56\56\37\56\56\56\56\58\56\57\56\56\56\42\56\56\59\56\38\56\56\56\56\56\56\60\56\56\56\56\56\42\56\56\61\56\39\56\56\56\56\56\56\56\56\61\56\57\56\60\56\56\56\56\40\56\57\56\56\24\56\56\56\57\56\56\56\56\56\56\56\56\8\56\56\56\38\56\56\56\38\56\56\56\38\56\56\56\39\56\56\56\39\56\56\56\39\56\56\56\39\56\56\56\24\56\56\56\24\56\56\56\24\56\56\56\24\56\56\56\25\56\56\56\25\56\56\56\26\56\56\56\26\56\56\56\26\56\56\56\27\56\56\56\27\56\56\56\27\56\56\56\27\56\56\56\27\56\56\56\28\56\56\56\28\56\56\56\28\56\56\56\28\56\56\56\28\56\56\56\28\56\56\56\28\56\56\56\28\56\56\56\28\56\56\56\28\56\56\56\28\56\56\56\28\56\56\56\28\56\56\56\28\56\56\56\28\56\56\56\28\56\56\56\28\56\56\56\28\56\56\56\29\56\56\56\29\56\56\56\29\56\56\56\29\56\56\56\29\56\56\56\29\56\56\56\29\56\56\56\29\56\56\56\31\56\56\56\39\56\56\56\58\54\56\56\56\126\81\86\92\104\84\89\65\93\74\75\123\89\74\58\48\56\56\56\112\89\86\92\84\81\86\95\58\48\56\56\56\117\89\64\107\72\93\93\92\58\61\56\56\56\110\89\84\77\93\56\56\56\56\56\56\56\177\120\58\62\56\56\56\108\87\74\73\77\93\56\56\56\56\56\56\176\219\120\58\63\56\56\56\127\74\89\78\81\76\65\56\56\56\56\56\56\120\183\120\58\61\56\56\56\72\74\81\86\76\58\44\56\56\56\121\77\76\87\94\89\74\85\24\10\24\121\91\76\81\78\89\76\93\92\58\60\56\56\56\79\89\81\76\56\56\56\56\56\56\56\60\120\58\44\56\56\56\107\93\76\104\74\81\85\89\74\65\104\89\74\76\123\126\74\89\85\93\58\62\56\56\56\123\126\74\89\85\93\58\59\56\56\56\86\93\79\56\56\56\56\56\152\28\156\248\56\101\103\13\216\5\100\117\120\56\169\213\68\7\141\179\153\248\56\140\67\135\135\147\199\215\7\56\68\251\202\103\55\114\186\135\56\153\43\45\120\191\18\112\135\56\218\171\36\216\53\17\127\7\56\179\141\196\103\77\21\84\135\56\135\123\30\24\203\199\215\7\56\54\129\25\184\100\115\186\135\56\123\79\10\56\152\199\215\135\56\179\76\166\71\214\39\84\135\58\52\56\56\56\107\93\86\92\115\93\65\125\78\93\86\76\58\57\56\56\56\111\58\60\56\56\56\95\89\85\93\8\56\56\56\42\11\56\56\56\57\56\56\56\56\56\56\56\56\57\56\58\56\56\56\56\56\56\56\56\56\56\56\56\56\56\56\56\56\56\56\24\56\56\56\56\56\56\58\56\24\56\56\56\56\56\56\59\56\8\56\56\56\56\60\56\61\56\56\56\56\56\56\56\56\56\56\24\56\56\56\56\56\56\58\56\24\56\56\56\56\56\56\62\56\8\56\56\56\56\60\56\63\56\56\56\56\56\56\57\56\56\56\8\56\56\56\56\48\56\49\56\42\56\56\56\56\50\56\56\56\42\56\56\57\56\51\56\56\56\56\56\56\56\56\58\56\57\56\42\44\56\56\56\52\56\56\56\42\12\56\57\56\53\56\56\56\56\27\56\56\56\58\56\58\56\62\98\56\56\56\23\56\57\56\56\56\60\36\56\56\56\23\56\57\56\56\47\56\56\56\56\56\56\56\24\94\56\56\56\56\56\54\56\42\56\56\58\56\55\56\56\56\24\56\56\58\56\58\56\40\56\42\56\56\59\56\41\56\56\56\42\56\56\60\56\42\56\56\56\42\56\56\61\56\43\56\56\56\42\56\56\62\56\44\56\56\56\42\56\56\63\56\45\56\56\56\42\56\56\48\56\46\56\56\56\42\56\56\49\56\47\56\56\56\42\56\56\50\56\32\56\56\56\42\56\56\51\56\33\56\56\56\42\56\56\52\56\34\56\56\56\42\56\56\53\56\35\56\56\56\42\56\56\54\56\36\56\56\56\56\56\56\58\56\54\56\56\56\56\56\56\56\56\56\56\57\56\56\56\56\56\56\58\56\56\56\24\56\56\56\56\56\56\37\56\56\56\56\58\56\57\56\56\56\42\56\56\59\56\38\56\56\56\56\56\56\60\56\56\56\56\56\42\56\56\61\56\39\56\56\56\56\56\56\56\56\61\56\57\56\60\56\56\56\56\40\56\57\56\56\24\56\56\56\57\56\56\56\56\56\56\56\56\8\56\56\56\17\56\56\56\17\56\56\56\17\56\56\56\18\56\56\56\18\56\56\56\18\56\56\56\18\56\56\56\19\56\56\56\19\56\56\56\19\56\56\56\19\56\56\56\20\56\56\56\20\56\56\56\21\56\56\56\21\56\56\56\21\56\56\56\22\56\56\56\22\56\56\56\22\56\56\56\22\56\56\56\22\56\56\56\23\56\56\56\23\56\56\56\23\56\56\56\23\56\56\56\23\56\56\56\23\56\56\56\23\56\56\56\23\56\56\56\23\56\56\56\23\56\56\56\23\56\56\56\23\56\56\56\23\56\56\56\23\56\56\56\23\56\56\56\23\56\56\56\23\56\56\56\23\56\56\56\8\56\56\56\8\56\56\56\8\56\56\56\8\56\56\56\8\56\56\56\8\56\56\56\8\56\56\56\8\56\56\56\10\56\56\56\39\56\56\56\58\54\56\56\56\126\81\86\92\104\84\89\65\93\74\75\123\89\74\58\48\56\56\56\112\89\86\92\84\81\86\95\58\48\56\56\56\117\89\64\107\72\93\93\92\58\61\56\56\56\110\89\84\77\93\56\56\56\56\56\56\56\177\120\58\62\56\56\56\108\87\74\73\77\93\56\56\56\56\56\56\176\219\120\58\63\56\56\56\127\74\89\78\81\76\65\56\56\56\56\56\56\120\183\120\58\61\56\56\56\72\74\81\86\76\58\44\56\56\56\121\77\76\87\94\89\74\85\24\11\24\121\91\76\81\78\89\76\93\92\58\60\56\56\56\79\89\81\76\56\56\56\56\56\56\56\60\120\58\44\56\56\56\107\93\76\104\74\81\85\89\74\65\104\89\74\76\123\126\74\89\85\93\58\62\56\56\56\123\126\74\89\85\93\58\59\56\56\56\86\93\79\56\198\200\203\231\59\115\81\120\56\2\199\35\24\5\88\116\120\56\33\147\245\199\243\197\180\120\56\200\229\253\71\146\199\215\135\56\31\61\220\39\23\65\186\7\56\114\231\147\103\2\46\2\135\56\21\74\191\167\96\56\5\135\56\242\235\225\103\6\8\76\135\56\74\85\193\103\222\199\215\7\56\4\61\196\199\32\64\186\7\56\197\229\224\7\169\199\215\7\56\111\35\111\216\15\12\76\7\58\52\56\56\56\107\93\86\92\115\93\65\125\78\93\86\76\58\57\56\56\56\111\58\60\56\56\56\95\89\85\93\8\56\56\56\42\11\56\56\56\57\56\56\56\56\56\56\56\56\57\56\58\56\56\56\56\56\56\56\56\56\56\56\56\56\56\56\56\56\56\56\24\56\56\56\56\56\56\58\56\24\56\56\56\56\56\56\59\56\8\56\56\56\56\60\56\61\56\56\56\56\56\56\56\56\56\56\24\56\56\56\56\56\56\58\56\24\56\56\56\56\56\56\62\56\8\56\56\56\56\60\56\63\56\56\56\56\56\56\57\56\56\56\8\56\56\56\56\48\56\49\56\42\56\56\56\56\50\56\56\56\42\56\56\57\56\51\56\56\56\56\56\56\56\56\58\56\57\56\42\44\56\56\56\52\56\56\56\42\12\56\57\56\53\56\56\56\56\27\56\56\56\58\56\58\56\62\98\56\56\56\23\56\57\56\56\56\60\36\56\56\56\23\56\57\56\56\47\56\56\56\56\56\56\56\24\94\56\56\56\56\56\54\56\42\56\56\58\56\55\56\56\56\24\56\56\58\56\58\56\40\56\42\56\56\59\56\41\56\56\56\42\56\56\60\56\42\56\56\56\42\56\56\61\56\43\56\56\56\42\56\56\62\56\44\56\56\56\42\56\56\63\56\45\56\56\56\42\56\56\48\56\46\56\56\56\42\56\56\49\56\47\56\56\56\42\56\56\50\56\32\56\56\56\42\56\56\51\56\33\56\56\56\42\56\56\52\56\34\56\56\56\42\56\56\53\56\35\56\56\56\42\56\56\54\56\36\56\56\56\56\56\56\58\56\54\56\56\56\56\56\56\56\56\56\56\57\56\56\56\56\56\56\58\56\56\56\24\56\56\56\56\56\56\37\56\56\56\56\58\56\57\56\56\56\42\56\56\59\56\38\56\56\56\56\56\56\60\56\56\56\56\56\42\56\56\61\56\39\56\56\56\56\56\56\56\56\61\56\57\56\60\56\56\56\56\40\56\57\56\56\24\56\56\56\57\56\56\56\56\56\56\56\56\8\56\56\56\12\56\56\56\12\56\56\56\12\56\56\56\13\56\56\56\13\56\56\56\13\56\56\56\13\56\56\56\14\56\56\56\14\56\56\56\14\56\56\56\14\56\56\56\15\56\56\56\15\56\56\56\0\56\56\56\0\56\56\56\0\56\56\56\1\56\56\56\1\56\56\56\1\56\56\56\1\56\56\56\1\56\56\56\2\56\56\56\2\56\56\56\2\56\56\56\2\56\56\56\2\56\56\56\2\56\56\56\2\56\56\56\2\56\56\56\2\56\56\56\2\56\56\56\2\56\56\56\2\56\56\56\2\56\56\56\2\56\56\56\2\56\56\56\2\56\56\56\2\56\56\56\2\56\56\56\3\56\56\56\3\56\56\56\3\56\56\56\3\56\56\56\3\56\56\56\3\56\56\56\3\56\56\56\3\56\56\56\5\56\56\56\39\56\56\56\58\54\56\56\56\126\81\86\92\104\84\89\65\93\74\75\123\89\74\58\48\56\56\56\112\89\86\92\84\81\86\95\58\48\56\56\56\117\89\64\107\72\93\93\92\58\61\56\56\56\110\89\84\77\93\56\56\56\56\56\56\56\177\120\58\62\56\56\56\108\87\74\73\77\93\56\56\56\56\56\56\176\219\120\58\63\56\56\56\127\74\89\78\81\76\65\56\56\56\56\56\56\120\183\120\58\61\56\56\56\72\74\81\86\76\58\44\56\56\56\121\77\76\87\94\89\74\85\24\12\24\121\91\76\81\78\89\76\93\92\58\60\56\56\56\79\89\81\76\56\56\56\56\56\56\56\60\120\58\44\56\56\56\107\93\76\104\74\81\85\89\74\65\104\89\74\76\123\126\74\89\85\93\58\62\56\56\56\123\126\74\89\85\93\58\59\56\56\56\86\93\79\56\96\23\232\199\4\78\105\120\56\210\242\52\248\147\88\116\120\56\207\244\170\56\205\120\153\248\56\137\87\241\167\231\199\215\7\56\130\59\211\231\2\162\78\135\56\116\187\201\135\236\104\124\7\56\155\62\14\248\189\2\125\135\56\11\217\50\56\118\149\76\135\56\95\171\36\216\220\199\215\7\56\147\252\58\184\231\174\78\135\56\122\54\254\103\253\199\215\135\56\42\178\116\248\192\136\76\135\58\52\56\56\56\107\93\86\92\115\93\65\125\78\93\86\76\58\57\56\56\56\111\58\60\56\56\56\95\89\85\93\8\56\56\56\42\11\56\56\56\57\56\56\56\56\56\56\56\56\57\56\58\56\56\56\56\56\56\56\56\56\56\56\56\56\56\56\56\56\56\56\24\56\56\56\56\56\56\58\56\24\56\56\56\56\56\56\59\56\8\56\56\56\56\60\56\61\56\56\56\56\56\56\56\56\56\56\24\56\56\56\56\56\56\58\56\24\56\56\56\56\56\56\62\56\8\56\56\56\56\60\56\63\56\56\56\56\56\56\57\56\56\56\8\56\56\56\56\48\56\49\56\42\56\56\56\56\50\56\56\56\42\56\56\57\56\51\56\56\56\56\56\56\56\56\58\56\57\56\42\44\56\56\56\52\56\56\56\42\12\56\57\56\53\56\56\56\56\27\56\56\56\58\56\58\56\62\98\56\56\56\23\56\57\56\56\56\60\36\56\56\56\23\56\57\56\56\47\56\56\56\56\56\56\56\24\94\56\56\56\56\56\54\56\42\56\56\58\56\55\56\56\56\24\56\56\58\56\58\56\40\56\42\56\56\59\56\41\56\56\56\42\56\56\60\56\42\56\56\56\42\56\56\61\56\43\56\56\56\42\56\56\62\56\44\56\56\56\42\56\56\63\56\45\56\56\56\42\56\56\48\56\46\56\56\56\42\56\56\49\56\47\56\56\56\42\56\56\50\56\32\56\56\56\42\56\56\51\56\33\56\56\56\42\56\56\52\56\34\56\56\56\42\56\56\53\56\35\56\56\56\42\56\56\54\56\36\56\56\56\56\56\56\58\56\54\56\56\56\56\56\56\56\56\56\56\57\56\56\56\56\56\56\58\56\56\56\24\56\56\56\56\56\56\37\56\56\56\56\58\56\57\56\56\56\42\56\56\59\56\38\56\56\56\56\56\56\60\56\56\56\56\56\42\56\56\61\56\39\56\56\56\56\56\56\56\56\61\56\57\56\60\56\56\56\56\40\56\57\56\56\24\56\56\56\57\56\56\56\56\56\56\56\56\8\56\56\56\7\56\56\56\7\56\56\56\7\56\56\56\120\56\56\56\120\56\56\56\120\56\56\56\120\56\56\56\121\56\56\56\121\56\56\56\121\56\56\56\121\56\56\56\122\56\56\56\122\56\56\56\123\56\56\56\123\56\56\56\123\56\56\56\124\56\56\56\124\56\56\56\124\56\56\56\124\56\56\56\124\56\56\56\125\56\56\56\125\56\56\56\125\56\56\56\125\56\56\56\125\56\56\56\125\56\56\56\125\56\56\56\125\56\56\56\125\56\56\56\125\56\56\56\125\56\56\56\125\56\56\56\125\56\56\56\125\56\56\56\125\56\56\56\125\56\56\56\125\56\56\56\125\56\56\56\126\56\56\56\126\56\56\56\126\56\56\56\126\56\56\56\126\56\56\56\126\56\56\56\126\56\56\56\126\56\56\56\112\56\56\56\50\56\56\56\58\58\56\56\56\81\75\58\54\56\56\56\126\81\86\92\104\84\89\65\93\74\75\123\89\74\58\48\56\56\56\112\89\86\92\84\81\86\95\58\48\56\56\56\117\89\64\107\72\93\93\92\58\61\56\56\56\110\89\84\77\93\56\56\56\56\56\56\120\183\120\58\61\56\56\56\72\74\81\86\76\58\32\56\56\56\107\72\93\93\92\24\113\86\91\74\93\89\75\93\92\24\108\87\24\9\20\8\8\8\56\56\56\56\56\56\56\177\120\58\46\56\56\56\107\72\93\93\92\24\124\93\91\74\93\89\75\93\92\24\108\87\24\0\8\8\33\56\56\56\42\44\56\56\56\57\56\56\56\62\98\56\56\56\54\56\57\56\56\56\60\36\56\56\56\54\56\57\56\42\44\56\56\56\58\56\56\56\56\14\56\56\56\57\56\58\56\56\56\56\56\56\56\56\56\56\56\56\56\56\56\56\56\56\56\24\56\56\56\56\56\56\59\56\24\56\56\56\56\56\56\60\56\8\56\56\56\56\61\56\62\56\42\56\56\56\56\63\56\56\56\42\56\56\57\56\48\56\56\56\56\56\56\56\56\58\56\57\56\60\56\56\56\56\32\56\57\56\42\44\56\56\56\58\56\56\56\56\50\56\56\56\57\56\58\56\56\56\56\56\56\56\56\56\56\56\56\56\56\56\56\56\56\56\24\56\56\56\56\56\56\59\56\24\56\56\56\56\56\56\60\56\8\56\56\56\56\61\56\49\56\42\56\56\56\56\63\56\56\56\42\56\56\57\56\50\56\56\56\56\56\56\56\56\58\56\57\56\56\24\56\56\56\57\56\56\56\56\56\56\56\56\33\56\56\56\115\56\56\56\115\56\56\56\115\56\56\56\116\56\56\56\116\56\56\56\116\56\56\56\117\56\56\56\117\56\56\56\117\56\56\56\117\56\56\56\118\56\56\56\118\56\56\56\118\56\56\56\118\56\56\56\104\56\56\56\104\56\56\56\104\56\56\56\105\56\56\56\105\56\56\56\105\56\56\56\105\56\56\56\106\56\56\56\106\56\56\56\106\56\56\56\108\56\56\56\40\56\56\56\58\50\56\56\56\104\84\89\65\93\74\92\89\76\89\58\52\56\56\56\76\79\81\76\76\93\74\103\91\87\92\93\58\52\56\56\56\113\86\78\87\83\93\107\93\74\78\93\74\58\48\56\56\56\9\85\81\84\94\89\78\75\58\49\56\56\56\107\77\90\75\91\74\81\90\93\58\62\56\56\56\117\89\76\74\81\64\58\50\56\56\56\9\8\8\85\110\81\75\81\76\75\58\51\56\56\56\91\81\86\91\87\92\93\85\89\65\87\58\48\56\56\56\9\13\8\85\81\84\84\66\58\49\56\56\56\13\8\85\13\94\81\78\93\75\58\62\56\56\56\11\97\93\89\74\75\58\49\56\56\56\15\13\85\110\81\75\81\76\75\58\49\56\56\56\126\74\93\93\124\74\87\86\93\58\60\56\56\56\113\4\11\109\58\61\56\56\56\72\74\81\86\76\58\54\56\56\56\123\87\92\93\75\24\106\93\92\93\93\85\93\92\126\56\56\56\56\16\56\56\56\56\56\56\56\24\56\56\56\56\56\56\57\56\24\56\56\56\56\56\56\58\56\24\56\56\56\56\56\56\59\56\42\56\56\58\56\60\56\56\56\56\56\56\56\56\58\56\57\56\56\56\56\56\56\56\56\56\56\24\56\56\56\56\56\56\57\56\24\56\56\56\56\56\56\58\56\24\56\56\56\56\56\56\59\56\42\56\56\58\56\61\56\56\56\56\56\56\56\56\58\56\57\56\56\56\56\56\56\56\56\56\56\24\56\56\56\56\56\56\57\56\24\56\56\56\56\56\56\58\56\24\56\56\56\56\56\56\59\56\42\56\56\58\56\62\56\56\56\56\56\56\56\56\58\56\57\56\56\56\56\56\56\56\56\56\56\24\56\56\56\56\56\56\57\56\24\56\56\56\56\56\56\58\56\24\56\56\56\56\56\56\59\56\42\56\56\58\56\63\56\56\56\56\56\56\56\56\58\56\57\56\56\56\56\56\56\56\56\56\56\24\56\56\56\56\56\56\57\56\24\56\56\56\56\56\56\58\56\24\56\56\56\56\56\56\59\56\42\56\56\58\56\48\56\56\56\56\56\56\56\56\58\56\57\56\56\56\56\56\56\56\56\56\56\24\56\56\56\56\56\56\57\56\24\56\56\56\56\56\56\58\56\24\56\56\56\56\56\56\59\56\42\56\56\58\56\49\56\56\56\56\56\56\56\56\58\56\57\56\56\56\56\56\56\56\56\56\56\24\56\56\56\56\56\56\57\56\24\56\56\56\56\56\56\58\56\24\56\56\56\56\56\56\59\56\42\56\56\58\56\50\56\56\56\56\56\56\56\56\58\56\57\56\56\56\56\56\56\56\56\56\56\24\56\56\56\56\56\56\57\56\24\56\56\56\56\56\56\58\56\24\56\56\56\56\56\56\59\56\42\56\56\58\56\51\56\56\56\56\56\56\56\56\58\56\57\56\56\56\56\56\56\56\56\56\56\24\56\56\56\56\56\56\57\56\24\56\56\56\56\56\56\58\56\24\56\56\56\56\56\56\59\56\42\56\56\58\56\52\56\56\56\56\56\56\56\56\58\56\57\56\56\56\56\56\56\56\56\56\56\24\56\56\56\56\56\56\57\56\24\56\56\56\56\56\56\58\56\24\56\56\56\56\56\56\59\56\42\56\56\58\56\53\56\56\56\56\56\56\56\56\58\56\57\56\56\56\56\56\56\56\56\56\56\24\56\56\56\56\56\56\57\56\24\56\56\56\56\56\56\58\56\24\56\56\56\56\56\56\59\56\42\56\56\58\56\54\56\56\56\56\56\56\56\56\58\56\57\56\42\56\56\56\56\55\56\56\56\42\56\56\57\56\40\56\56\56\56\56\56\56\56\58\56\57\56\56\56\56\56\56\57\56\56\56\56\56\56\56\56\126\56\56\56\110\56\56\56\110\56\56\56\110\56\56\56\110\56\56\56\110\56\56\56\110\56\56\56\111\56\56\56\111\56\56\56\111\56\56\56\111\56\56\56\111\56\56\56\111\56\56\56\96\56\56\56\96\56\56\56\96\56\56\56\96\56\56\56\96\56\56\56\96\56\56\56\97\56\56\56\97\56\56\56\97\56\56\56\97\56\56\56\97\56\56\56\97\56\56\56\98\56\56\56\98\56\56\56\98\56\56\56\98\56\56\56\98\56\56\56\98\56\56\56\99\56\56\56\99\56\56\56\99\56\56\56\99\56\56\56\99\56\56\56\99\56\56\56\100\56\56\56\100\56\56\56\100\56\56\56\100\56\56\56\100\56\56\56\100\56\56\56\101\56\56\56\101\56\56\56\101\56\56\56\101\56\56\56\101\56\56\56\101\56\56\56\102\56\56\56\102\56\56\56\102\56\56\56\102\56\56\56\102\56\56\56\102\56\56\56\103\56\56\56\103\56\56\56\103\56\56\56\103\56\56\56\103\56\56\56\103\56\56\56\88\56\56\56\88\56\56\56\88\56\56\56\88\56\56\56\88\56\56\56\88\56\56\56\89\56\56\56\89\56\56\56\89\56\56\56\90\56\56\56\54\56\56\56\58\60\56\56\56\79\89\81\76\56\56\56\56\56\56\56\200\7\58\61\56\56\56\94\84\89\95\75\58\57\56\56\56\91\58\51\56\56\56\127\93\76\123\80\81\84\92\74\93\86\58\49\56\56\56\123\84\89\75\75\118\89\85\93\58\61\56\56\56\117\87\92\93\84\58\48\56\56\56\117\93\75\80\104\89\74\76\58\54\56\56\56\126\81\86\92\126\81\74\75\76\123\80\81\84\92\58\61\56\56\56\107\85\87\83\93\58\41\56\56\56\94\81\74\93\76\87\77\91\80\81\86\76\93\74\93\75\76\58\49\56\56\56\123\80\89\74\89\91\76\93\74\58\40\56\56\56\112\77\85\89\86\87\81\92\106\87\87\76\104\89\74\76\56\56\56\56\56\56\56\56\56\5\56\56\56\42\44\56\57\56\57\56\56\56\42\12\56\58\56\58\56\56\56\56\27\56\57\56\58\56\58\56\62\98\56\57\56\4\56\57\56\56\56\60\36\56\56\56\4\56\57\56\56\47\56\57\56\56\56\56\56\24\102\56\57\56\57\56\59\56\24\102\56\57\56\57\56\60\56\62\98\56\57\56\56\56\57\56\56\56\60\36\56\56\56\56\56\57\56\56\47\56\57\56\57\56\56\56\24\6\56\57\56\57\56\61\56\56\56\56\57\56\58\56\58\56\42\56\56\58\56\58\56\56\56\56\56\56\59\56\57\56\56\56\42\56\56\60\56\58\56\56\56\60\56\56\58\56\3\56\57\56\56\49\56\62\56\57\56\61\56\24\102\56\62\56\62\56\62\56\30\48\56\62\56\2\56\57\56\63\56\60\36\56\56\56\2\56\57\56\56\49\56\62\56\57\56\61\56\24\6\56\62\56\62\56\61\56\56\56\56\62\56\58\56\58\56\42\56\56\63\56\58\56\56\56\56\56\56\48\56\62\56\56\56\42\56\56\49\56\58\56\56\56\60\56\56\63\56\2\56\57\56\56\49\56\51\56\62\56\50\56\24\102\56\51\56\51\56\62\56\30\48\56\51\56\1\56\57\56\63\56\60\36\56\56\56\1\56\57\56\56\49\56\51\56\62\56\50\56\24\6\56\51\56\51\56\61\56\56\56\56\51\56\58\56\58\56\42\56\56\52\56\58\56\56\56\56\56\56\53\56\51\56\56\56\42\56\56\54\56\58\56\56\56\60\56\56\52\56\1\56\57\56\56\49\56\40\56\51\56\55\56\24\102\56\40\56\40\56\62\56\30\48\56\40\56\0\56\57\56\48\56\60\36\56\56\56\0\56\57\56\56\49\56\40\56\51\56\55\56\24\46\56\40\56\40\56\49\56\42\12\56\42\56\50\56\56\56\56\90\56\40\56\42\56\58\56\62\98\56\40\56\0\56\57\56\56\56\60\36\56\56\56\0\56\57\56\42\44\56\40\56\51\56\56\56\56\82\56\41\56\58\56\56\56\24\56\56\41\56\41\56\52\56\24\56\56\41\56\41\56\53\56\56\56\56\42\56\51\56\55\56\42\56\56\43\56\54\56\56\56\56\56\56\40\56\43\56\57\56\60\114\56\52\56\31\56\57\56\60\114\56\63\56\36\56\57\56\60\114\56\58\56\41\56\57\56\60\36\56\56\56\56\56\57\56\56\24\56\56\56\57\56\56\56\57\56\56\56\56\5\56\56\56\93\56\56\56\93\56\56\56\93\56\56\56\93\56\56\56\93\56\56\56\94\56\56\56\94\56\56\56\94\56\56\56\94\56\56\56\94\56\56\56\95\56\56\56\95\56\56\56\95\56\56\56\80\56\56\56\80\56\56\56\80\56\56\56\80\56\56\56\81\56\56\56\81\56\56\56\81\56\56\56\81\56\56\56\82\56\56\56\82\56\56\56\82\56\56\56\83\56\56\56\83\56\56\56\83\56\56\56\83\56\56\56\84\56\56\56\84\56\56\56\84\56\56\56\84\56\56\56\85\56\56\56\85\56\56\56\85\56\56\56\86\56\56\56\86\56\56\56\86\56\56\56\86\56\56\56\87\56\56\56\87\56\56\56\87\56\56\56\87\56\56\56\72\56\56\56\72\56\56\56\72\56\56\56\72\56\56\56\72\56\56\56\72\56\56\56\73\56\56\56\73\56\56\56\73\56\56\56\73\56\56\56\73\56\56\56\73\56\56\56\73\56\56\56\86\56\56\56\83\56\56\56\80\56\56\56\65\56\56\56\67\56\56\56\62\56\56\56\58\50\56\56\56\104\84\89\65\93\74\92\89\76\89\58\62\56\56\56\85\87\90\81\84\93\58\50\56\56\56\126\81\74\93\107\93\74\78\93\74\58\61\56\56\56\72\74\81\86\76\58\10\56\56\56\99\111\89\74\86\81\86\95\101\24\111\81\84\84\24\118\87\76\24\111\87\74\83\24\113\94\24\12\8\115\24\113\75\24\121\84\74\93\89\92\65\24\106\93\92\93\93\85\93\92\58\42\56\56\56\106\93\91\93\81\78\93\92\24\12\8\115\24\117\87\86\93\65\52\56\56\56\56\39\56\56\56\56\56\56\56\24\56\56\56\56\56\56\57\56\24\56\56\56\56\56\56\58\56\24\56\56\56\56\56\56\59\56\56\56\56\56\56\58\56\57\56\42\56\56\56\56\60\56\56\56\42\56\56\57\56\61\56\56\56\56\56\56\56\56\58\56\57\56\42\56\56\56\56\60\56\56\56\42\56\56\57\56\62\56\56\56\56\56\56\56\56\58\56\57\56\56\56\56\56\56\57\56\56\56\56\56\56\56\56\52\56\56\56\69\56\56\56\69\56\56\56\69\56\56\56\69\56\56\56\69\56\56\56\70\56\56\56\70\56\56\56\70\56\56\56\71\56\56\56\71\56\56\56\71\56\56\56\184\56\56\56\50\56\56\56\58\58\56\56\56\89\78\58\54\56\56\56\126\81\86\92\104\84\89\65\93\74\75\123\89\74\58\63\56\56\56\122\87\92\65\83\81\76\58\52\56\56\56\123\93\86\76\93\74\119\94\117\89\75\75\58\48\56\56\56\121\86\91\80\87\74\93\92\57\57\58\61\56\56\56\72\74\81\86\76\58\40\56\56\56\110\93\80\81\91\84\93\24\121\86\91\80\87\74\93\92\57\56\58\42\56\56\56\110\93\80\81\91\84\93\24\109\86\89\86\91\80\87\74\93\92\33\56\56\56\42\44\56\56\56\57\56\56\56\62\98\56\56\56\54\56\57\56\56\56\60\36\56\56\56\54\56\57\56\42\44\56\56\56\58\56\56\56\56\14\56\56\56\57\56\58\56\56\56\56\56\56\56\56\56\56\56\56\56\56\56\56\56\56\56\24\56\56\56\56\56\56\59\56\24\56\56\56\56\56\56\60\56\8\56\56\56\56\61\56\62\56\42\56\56\56\56\63\56\56\56\42\56\56\57\56\48\56\56\56\56\56\56\56\56\58\56\57\56\60\56\56\56\56\32\56\57\56\42\44\56\56\56\58\56\56\56\56\50\56\56\56\57\56\58\56\56\56\56\56\56\56\56\56\56\56\56\56\56\56\56\56\56\56\24\56\56\56\56\56\56\59\56\24\56\56\56\56\56\56\60\56\8\56\56\56\56\61\56\49\56\42\56\56\56\56\63\56\56\56\42\56\56\57\56\50\56\56\56\56\56\56\56\56\58\56\57\56\56\24\56\56\56\57\56\56\56\56\56\56\56\56\33\56\56\56\186\56\56\56\186\56\56\56\186\56\56\56\187\56\56\56\187\56\56\56\187\56\56\56\188\56\56\56\188\56\56\56\188\56\56\56\188\56\56\56\189\56\56\56\189\56\56\56\189\56\56\56\189\56\56\56\191\56\56\56\191\56\56\56\191\56\56\56\176\56\56\56\176\56\56\56\176\56\56\56\176\56\56\56\177\56\56\56\177\56\56\56\177\56\56\56\179\56\56\56\49\56\56\56\58\58\56\56\56\93\90\58\60\56\56\56\79\89\81\76\58\59\56\56\56\121\103\9\58\53\56\56\56\104\87\84\81\91\93\107\76\89\76\81\87\86\58\49\56\56\56\123\93\84\84\122\84\87\91\83\58\51\56\56\56\125\84\93\91\76\74\81\91\122\87\64\58\61\56\56\56\125\78\93\86\76\58\60\56\56\56\117\89\81\86\58\50\56\56\56\126\81\74\93\107\93\74\78\93\74\37\56\56\56\42\44\56\56\56\57\56\56\56\62\98\56\56\56\36\56\57\56\56\56\60\36\56\56\56\36\56\57\56\42\44\56\56\56\58\56\56\56\56\35\56\56\56\57\56\58\56\62\98\56\56\56\36\56\57\56\56\56\60\36\56\56\56\36\56\57\56\42\44\56\56\56\57\56\56\56\62\98\56\56\56\36\56\57\56\56\56\60\36\56\56\56\36\56\57\56\56\47\56\56\56\56\56\56\56\24\30\56\56\56\56\56\60\56\24\56\56\56\56\56\56\61\56\24\56\56\56\56\56\56\62\56\42\56\56\56\56\59\56\56\56\56\56\56\56\56\56\56\56\56\24\56\56\56\56\56\56\60\56\24\56\56\56\56\56\56\61\56\24\56\56\56\56\56\56\62\56\24\56\56\56\56\56\56\48\56\24\56\56\56\56\56\56\62\56\42\56\56\56\56\63\56\56\56\42\56\56\56\56\63\56\56\56\24\56\56\56\56\56\56\49\56\42\56\56\58\56\59\56\56\56\56\56\56\56\56\58\56\57\56\60\56\56\56\56\59\56\57\56\60\36\56\56\56\36\56\57\56\56\24\56\56\56\57\56\56\56\56\56\56\56\56\37\56\56\56\181\56\56\56\181\56\56\56\181\56\56\56\182\56\56\56\182\56\56\56\182\56\56\56\182\56\56\56\182\56\56\56\182\56\56\56\182\56\56\56\183\56\56\56\183\56\56\56\183\56\56\56\183\56\56\56\183\56\56\56\168\56\56\56\168\56\56\56\168\56\56\56\168\56\56\56\168\56\56\56\168\56\56\56\168\56\56\56\169\56\56\56\169\56\56\56\169\56\56\56\169\56\56\56\169\56\56\56\170\56\56\56\173\56\56\56\53\56\56\56\58\59\56\56\56\74\93\90\58\60\56\56\56\79\89\81\76\58\59\56\56\56\121\103\9\58\60\56\56\56\95\89\85\93\58\50\56\56\56\127\93\76\107\93\74\78\81\91\93\58\49\56\56\56\111\87\74\83\75\72\89\91\93\58\53\56\56\56\104\87\84\81\91\93\107\76\89\76\81\87\86\58\49\56\56\56\123\93\84\84\122\84\87\91\83\58\51\56\56\56\125\84\93\91\76\74\81\91\122\87\64\58\61\56\56\56\125\78\93\86\76\58\60\56\56\56\117\89\81\86\58\41\56\56\56\106\93\72\89\81\74\125\84\93\91\76\74\81\91\122\87\64\58\50\56\56\56\126\81\74\93\107\93\74\78\93\74\27\56\56\56\42\44\56\56\56\57\56\56\56\62\98\56\56\56\26\56\57\56\56\56\60\36\56\56\56\26\56\57\56\42\44\56\56\56\58\56\56\56\56\35\56\56\56\57\56\58\56\62\98\56\56\56\26\56\57\56\56\56\60\36\56\56\56\26\56\57\56\42\44\56\56\56\57\56\56\56\62\98\56\56\56\26\56\57\56\56\56\60\36\56\56\56\26\56\57\56\42\44\56\56\56\60\56\56\56\24\92\56\56\56\56\56\61\56\42\56\56\58\56\62\56\56\56\56\56\56\56\56\58\56\58\56\24\56\56\56\56\56\56\63\56\24\56\56\56\56\56\56\48\56\24\56\56\56\56\56\56\49\56\42\56\56\56\56\59\56\56\56\42\56\56\56\56\60\56\56\56\24\56\56\56\56\56\56\61\56\42\56\56\58\56\62\56\56\56\56\56\56\56\56\58\56\58\56\24\56\56\56\56\56\56\63\56\24\56\56\56\56\56\56\48\56\24\56\56\56\56\56\56\49\56\24\56\56\56\56\56\56\51\56\24\56\56\56\56\56\56\52\56\42\56\56\56\56\50\56\56\56\42\56\56\56\56\50\56\56\56\24\56\56\56\56\56\56\53\56\42\56\56\58\56\59\56\56\56\56\56\56\56\56\58\56\57\56\60\56\56\56\56\59\56\57\56\60\36\56\56\56\26\56\57\56\56\24\56\56\56\57\56\56\56\56\56\56\56\56\27\56\56\56\175\56\56\56\175\56\56\56\175\56\56\56\160\56\56\56\160\56\56\56\160\56\56\56\160\56\56\56\160\56\56\56\160\56\56\56\160\56\56\56\161\56\56\56\161\56\56\56\161\56\56\56\161\56\56\56\161\56\56\56\161\56\56\56\161\56\56\56\161\56\56\56\162\56\56\56\162\56\56\56\162\56\56\56\162\56\56\56\162\56\56\56\162\56\56\56\162\56\56\56\162\56\56\56\162\56\56\56\162\56\56\56\163\56\56\56\163\56\56\56\163\56\56\56\163\56\56\56\163\56\56\56\164\56\56\56\167\56\56\56\189\56\56\56\57\56\56\56\57\56\56\56\57\56\56\56\57\56\56\56\58\56\56\56\58\56\56\56\58\56\56\56\58\56\56\56\59\56\56\56\60\56\56\56\60\56\56\56\60\56\56\56\60\56\56\56\61\56\56\56\61\56\56\56\61\56\56\56\61\56\56\56\62\56\56\56\62\56\56\56\62\56\56\56\62\56\56\56\62\56\56\56\62\56\56\56\62\56\56\56\62\56\56\56\62\56\56\56\62\56\56\56\63\56\56\56\63\56\56\56\63\56\56\56\48\56\56\56\42\56\56\56\42\56\56\56\42\56\56\56\49\56\56\56\43\56\56\56\43\56\56\56\43\56\56\56\43\56\56\56\44\56\56\56\44\56\56\56\44\56\56\56\45\56\56\56\45\56\56\56\45\56\56\56\46\56\56\56\46\56\56\56\36\56\56\56\46\56\56\56\36\56\56\56\37\56\56\56\37\56\56\56\31\56\56\56\31\56\56\56\31\56\56\56\31\56\56\56\37\56\56\56\16\56\56\56\16\56\56\56\10\56\56\56\10\56\56\56\10\56\56\56\10\56\56\56\16\56\56\56\11\56\56\56\11\56\56\56\5\56\56\56\5\56\56\56\5\56\56\56\5\56\56\56\11\56\56\56\6\56\56\56\6\56\56\56\112\56\56\56\112\56\56\56\112\56\56\56\112\56\56\56\6\56\56\56\113\56\56\56\113\56\56\56\114\56\56\56\114\56\56\56\114\56\56\56\114\56\56\56\114\56\56\56\108\56\56\56\108\56\56\56\114\56\56\56\109\56\56\56\109\56\56\56\90\56\56\56\90\56\56\56\109\56\56\56\91\56\56\56\91\56\56\56\91\56\56\56\91\56\56\56\91\56\56\56\92\56\56\56\67\56\56\56\67\56\56\56\67\56\56\56\67\56\56\56\92\56\56\56\68\56\56\56\68\56\56\56\184\56\56\56\184\56\56\56\68\56\56\56\185\56\56\56\185\56\56\56\185\56\56\56\185\56\56\56\185\56\56\56\179\56\56\56\179\56\56\56\185\56\56\56\180\56\56\56\180\56\56\56\180\56\56\56\180\56\56\56\180\56\56\56\173\56\56\56\173\56\56\56\180\56\56\56\174\56\56\56\174\56\56\56\174\56\56\56\174\56\56\56\174\56\56\56\167\56\56\56\174\56\56\56\167\56\56\56';local Ninoo_IllIIlIIIIlI=(bit or bit32);local Ninoo_IIIllIlIlIIlIlllIlll=Ninoo_IllIIlIIIIlI and Ninoo_IllIIlIIIIlI.bxor or function(Ninoo_IllIIlIIIIlI,Ninoo_lIlIllIIllIIl)local Ninoo_IlIllIIlIIIIIlIIIlIII,Ninoo_IIIllIlIlIIlIlllIlll,Ninoo_IllllllllIllllIIIIl=1,0,10 while Ninoo_IllIIlIIIIlI>0 and Ninoo_lIlIllIIllIIl>0 do local Ninoo_IIlIlIIl,Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI%2,Ninoo_lIlIllIIllIIl%2 if Ninoo_IIlIlIIl~=Ninoo_IllllllllIllllIIIIl then Ninoo_IIIllIlIlIIlIlllIlll=Ninoo_IIIllIlIlIIlIlllIlll+Ninoo_IlIllIIlIIIIIlIIIlIII end Ninoo_IllIIlIIIIlI,Ninoo_lIlIllIIllIIl,Ninoo_IlIllIIlIIIIIlIIIlIII=(Ninoo_IllIIlIIIIlI-Ninoo_IIlIlIIl)/2,(Ninoo_lIlIllIIllIIl-Ninoo_IllllllllIllllIIIIl)/2,Ninoo_IlIllIIlIIIIIlIIIlIII*2 end if Ninoo_IllIIlIIIIlI<Ninoo_lIlIllIIllIIl then Ninoo_IllIIlIIIIlI=Ninoo_lIlIllIIllIIl end while Ninoo_IllIIlIIIIlI>0 do local Ninoo_lIlIllIIllIIl=Ninoo_IllIIlIIIIlI%2 if Ninoo_lIlIllIIllIIl>0 then Ninoo_IIIllIlIlIIlIlllIlll=Ninoo_IIIllIlIlIIlIlllIlll+Ninoo_IlIllIIlIIIIIlIIIlIII end Ninoo_IllIIlIIIIlI,Ninoo_IlIllIIlIIIIIlIIIlIII=(Ninoo_IllIIlIIIIlI-Ninoo_lIlIllIIllIIl)/2,Ninoo_IlIllIIlIIIIIlIIIlIII*2 end return Ninoo_IIIllIlIlIIlIlllIlll end local function Ninoo_IlIllIIlIIIIIlIIIlIII(Ninoo_lIlIllIIllIIl,Ninoo_IllIIlIIIIlI,Ninoo_IlIllIIlIIIIIlIIIlIII)if Ninoo_IlIllIIlIIIIIlIIIlIII then local Ninoo_IllIIlIIIIlI=(Ninoo_lIlIllIIllIIl/2^(Ninoo_IllIIlIIIIlI-1))%2^((Ninoo_IlIllIIlIIIIIlIIIlIII-1)-(Ninoo_IllIIlIIIIlI-1)+1);return Ninoo_IllIIlIIIIlI-Ninoo_IllIIlIIIIlI%1;else local Ninoo_IllIIlIIIIlI=2^(Ninoo_IllIIlIIIIlI-1);return(Ninoo_lIlIllIIllIIl%(Ninoo_IllIIlIIIIlI+Ninoo_IllIIlIIIIlI)>=Ninoo_IllIIlIIIIlI)and 1 or 0;end;end;local Ninoo_IllIIlIIIIlI=1;local function Ninoo_lIlIllIIllIIl()local Ninoo_IllllllllIllllIIIIl,Ninoo_IlIllIIlIIIIIlIIIlIII,Ninoo_IIlIlIIl,Ninoo_lIlIllIIllIIl=Ninoo_IIlIlIIl(Ninoo_lIllIllIlIIlIIlII,Ninoo_IllIIlIIIIlI,Ninoo_IllIIlIIIIlI+3);Ninoo_IllllllllIllllIIIIl=Ninoo_IIIllIlIlIIlIlllIlll(Ninoo_IllllllllIllllIIIIl,56)Ninoo_IlIllIIlIIIIIlIIIlIII=Ninoo_IIIllIlIlIIlIlllIlll(Ninoo_IlIllIIlIIIIIlIIIlIII,56)Ninoo_IIlIlIIl=Ninoo_IIIllIlIlIIlIlllIlll(Ninoo_IIlIlIIl,56)Ninoo_lIlIllIIllIIl=Ninoo_IIIllIlIlIIlIlllIlll(Ninoo_lIlIllIIllIIl,56)Ninoo_IllIIlIIIIlI=Ninoo_IllIIlIIIIlI+4;return(Ninoo_lIlIllIIllIIl*16777216)+(Ninoo_IIlIlIIl*65536)+(Ninoo_IlIllIIlIIIIIlIIIlIII*256)+Ninoo_IllllllllIllllIIIIl;end;local function Ninoo_llllIlIIIIIII()local Ninoo_lIlIllIIllIIl=Ninoo_IIIllIlIlIIlIlllIlll(Ninoo_IIlIlIIl(Ninoo_lIllIllIlIIlIIlII,Ninoo_IllIIlIIIIlI,Ninoo_IllIIlIIIIlI),56);Ninoo_IllIIlIIIIlI=Ninoo_IllIIlIIIIlI+1;return Ninoo_lIlIllIIllIIl;end;local function Ninoo_IllllllllIllllIIIIl()local Ninoo_lIlIllIIllIIl,Ninoo_IlIllIIlIIIIIlIIIlIII=Ninoo_IIlIlIIl(Ninoo_lIllIllIlIIlIIlII,Ninoo_IllIIlIIIIlI,Ninoo_IllIIlIIIIlI+2);Ninoo_lIlIllIIllIIl=Ninoo_IIIllIlIlIIlIlllIlll(Ninoo_lIlIllIIllIIl,56)Ninoo_IlIllIIlIIIIIlIIIlIII=Ninoo_IIIllIlIlIIlIlllIlll(Ninoo_IlIllIIlIIIIIlIIIlIII,56)Ninoo_IllIIlIIIIlI=Ninoo_IllIIlIIIIlI+2;return(Ninoo_IlIllIIlIIIIIlIIIlIII*256)+Ninoo_lIlIllIIllIIl;end;local function Ninoo_IlIIllllIlllllllI()local Ninoo_IllIIlIIIIlI=Ninoo_lIlIllIIllIIl();local Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl();local Ninoo_IllllllllIllllIIIIl=1;local Ninoo_IIIllIlIlIIlIlllIlll=(Ninoo_IlIllIIlIIIIIlIIIlIII(Ninoo_lIlIllIIllIIl,1,20)*(2^32))+Ninoo_IllIIlIIIIlI;local Ninoo_IllIIlIIIIlI=Ninoo_IlIllIIlIIIIIlIIIlIII(Ninoo_lIlIllIIllIIl,21,31);local Ninoo_lIlIllIIllIIl=((-1)^Ninoo_IlIllIIlIIIIIlIIIlIII(Ninoo_lIlIllIIllIIl,32));if(Ninoo_IllIIlIIIIlI==0)then if(Ninoo_IIIllIlIlIIlIlllIlll==0)then return Ninoo_lIlIllIIllIIl*0;else Ninoo_IllIIlIIIIlI=1;Ninoo_IllllllllIllllIIIIl=0;end;elseif(Ninoo_IllIIlIIIIlI==2047)then return(Ninoo_IIIllIlIlIIlIlllIlll==0)and(Ninoo_lIlIllIIllIIl*(1/0))or(Ninoo_lIlIllIIllIIl*(0/0));end;return Ninoo_IlllIIIIll(Ninoo_lIlIllIIllIIl,Ninoo_IllIIlIIIIlI-1023)*(Ninoo_IllllllllIllllIIIIl+(Ninoo_IIIllIlIlIIlIlllIlll/(2^52)));end;local Ninoo_IlllIIIIll=Ninoo_lIlIllIIllIIl;local function Ninoo_lIIlIIllIlllIIIllIlIl(Ninoo_lIlIllIIllIIl)local Ninoo_IlIllIIlIIIIIlIIIlIII;if(not Ninoo_lIlIllIIllIIl)then Ninoo_lIlIllIIllIIl=Ninoo_IlllIIIIll();if(Ninoo_lIlIllIIllIIl==0)then return'';end;end;Ninoo_IlIllIIlIIIIIlIIIlIII=Ninoo_IIIIIlIlI(Ninoo_lIllIllIlIIlIIlII,Ninoo_IllIIlIIIIlI,Ninoo_IllIIlIIIIlI+Ninoo_lIlIllIIllIIl-1);Ninoo_IllIIlIIIIlI=Ninoo_IllIIlIIIIlI+Ninoo_lIlIllIIllIIl;local Ninoo_lIlIllIIllIIl={}for Ninoo_IllIIlIIIIlI=1,#Ninoo_IlIllIIlIIIIIlIIIlIII do Ninoo_lIlIllIIllIIl[Ninoo_IllIIlIIIIlI]=Ninoo_lIlIllIllIIlI(Ninoo_IIIllIlIlIIlIlllIlll(Ninoo_IIlIlIIl(Ninoo_IIIIIlIlI(Ninoo_IlIllIIlIIIIIlIIIlIII,Ninoo_IllIIlIIIIlI,Ninoo_IllIIlIIIIlI)),56))end return Ninoo_lIIlIlll(Ninoo_lIlIllIIllIIl);end;local Ninoo_IllIIlIIIIlI=Ninoo_lIlIllIIllIIl;local function Ninoo_IIIlIIIlIIIIllIlIIII(...)return{...},Ninoo_IlIIllIll('#',...)end local function Ninoo_IIIIIlIlI()local Ninoo_lIllIllIlIIlIIlII={};local Ninoo_lIlIllIllIIlI={};local Ninoo_lIIlIlll={};local Ninoo_IlIIllIll={[#{"1 + 1 = 111";"1 + 1 = 111";}]=Ninoo_lIlIllIllIIlI,[#{{274;606;177;994};"1 + 1 = 111";"1 + 1 = 111";}]=nil,[#{{417;794;943;217};"1 + 1 = 111";{644;649;569;381};"1 + 1 = 111";}]=Ninoo_lIIlIlll,[#{"1 + 1 = 111";}]=Ninoo_lIllIllIlIIlIIlII,};local Ninoo_IllIIlIIIIlI=Ninoo_lIlIllIIllIIl()local Ninoo_IIlIlIIl={}for Ninoo_IlIllIIlIIIIIlIIIlIII=1,Ninoo_IllIIlIIIIlI do local Ninoo_lIlIllIIllIIl=Ninoo_llllIlIIIIIII();local Ninoo_IllIIlIIIIlI;if(Ninoo_lIlIllIIllIIl==1)then Ninoo_IllIIlIIIIlI=(Ninoo_llllIlIIIIIII()~=0);elseif(Ninoo_lIlIllIIllIIl==0)then Ninoo_IllIIlIIIIlI=Ninoo_IlIIllllIlllllllI();elseif(Ninoo_lIlIllIIllIIl==2)then Ninoo_IllIIlIIIIlI=Ninoo_lIIlIIllIlllIIIllIlIl();end;Ninoo_IIlIlIIl[Ninoo_IlIllIIlIIIIIlIIIlIII]=Ninoo_IllIIlIIIIlI;end;for Ninoo_IIIIIlIlI=1,Ninoo_lIlIllIIllIIl()do local Ninoo_IllIIlIIIIlI=Ninoo_llllIlIIIIIII();if(Ninoo_IlIllIIlIIIIIlIIIlIII(Ninoo_IllIIlIIIIlI,1,1)==0)then local Ninoo_IIIllIlIlIIlIlllIlll=Ninoo_IlIllIIlIIIIIlIIIlIII(Ninoo_IllIIlIIIIlI,2,3);local Ninoo_IIlllIllIllIlI=Ninoo_IlIllIIlIIIIIlIIIlIII(Ninoo_IllIIlIIIIlI,4,6);local Ninoo_IllIIlIIIIlI={Ninoo_IllllllllIllllIIIIl(),Ninoo_IllllllllIllllIIIIl(),nil,nil};if(Ninoo_IIIllIlIlIIlIlllIlll==0)then Ninoo_IllIIlIIIIlI[#{{802;70;611;482};{786;80;521;323};"1 + 1 = 111";}]=Ninoo_IllllllllIllllIIIIl();Ninoo_IllIIlIIIIlI[#("ZiEc")]=Ninoo_IllllllllIllllIIIIl();elseif(Ninoo_IIIllIlIlIIlIlllIlll==1)then Ninoo_IllIIlIIIIlI[#("7Z2")]=Ninoo_lIlIllIIllIIl();elseif(Ninoo_IIIllIlIlIIlIlllIlll==2)then Ninoo_IllIIlIIIIlI[#{{808;716;422;867};"1 + 1 = 111";{837;87;913;381};}]=Ninoo_lIlIllIIllIIl()-(2^16)elseif(Ninoo_IIIllIlIlIIlIlllIlll==3)then Ninoo_IllIIlIIIIlI[#("VOO")]=Ninoo_lIlIllIIllIIl()-(2^16)Ninoo_IllIIlIIIIlI[#("qxdZ")]=Ninoo_IllllllllIllllIIIIl();end;if(Ninoo_IlIllIIlIIIIIlIIIlIII(Ninoo_IIlllIllIllIlI,1,1)==1)then Ninoo_IllIIlIIIIlI[#("b5")]=Ninoo_IIlIlIIl[Ninoo_IllIIlIIIIlI[#{"1 + 1 = 111";{647;596;517;996};}]]end if(Ninoo_IlIllIIlIIIIIlIIIlIII(Ninoo_IIlllIllIllIlI,2,2)==1)then Ninoo_IllIIlIIIIlI[#("JqI")]=Ninoo_IIlIlIIl[Ninoo_IllIIlIIIIlI[#{{226;214;155;910};{81;655;145;6};"1 + 1 = 111";}]]end if(Ninoo_IlIllIIlIIIIIlIIIlIII(Ninoo_IIlllIllIllIlI,3,3)==1)then Ninoo_IllIIlIIIIlI[#("JBIY")]=Ninoo_IIlIlIIl[Ninoo_IllIIlIIIIlI[#("iHrc")]]end Ninoo_lIllIllIlIIlIIlII[Ninoo_IIIIIlIlI]=Ninoo_IllIIlIIIIlI;end end;Ninoo_IlIIllIll[3]=Ninoo_llllIlIIIIIII();for Ninoo_IllIIlIIIIlI=1,Ninoo_lIlIllIIllIIl()do Ninoo_lIlIllIllIIlI[Ninoo_IllIIlIIIIlI-1]=Ninoo_IIIIIlIlI();end;for Ninoo_IllIIlIIIIlI=1,Ninoo_lIlIllIIllIIl()do Ninoo_lIIlIlll[Ninoo_IllIIlIIIIlI]=Ninoo_lIlIllIIllIIl();end;return Ninoo_IlIIllIll;end;local Ninoo_IlIlllIIIIlIIlII=pcall local function Ninoo_lIIlIlll(Ninoo_lIlIllIllIIlI,Ninoo_lIllIllIlIIlIIlII,Ninoo_IIlIlIIl)Ninoo_lIlIllIllIIlI=(Ninoo_lIlIllIllIIlI==true and Ninoo_IIIIIlIlI())or Ninoo_lIlIllIllIIlI;return(function(...)local Ninoo_lIlIllIIllIIl=1;local Ninoo_llllIlIIIIIII=-1;local Ninoo_lIIlIIllIlllIIIllIlIl={...};local Ninoo_lIIlIIllIIllIIIIlIIII=Ninoo_IlIIllIll('#',...)-1;local Ninoo_IIIllIlIlIIlIlllIlll=Ninoo_lIlIllIllIIlI[#{{27;334;553;590};}];local Ninoo_IllllllllIllllIIIIl=Ninoo_lIlIllIllIIlI[#{"1 + 1 = 111";{796;992;864;683};"1 + 1 = 111";}];local Ninoo_IlIIllllIlllllllI=Ninoo_lIlIllIllIIlI[#{{486;679;439;330};{152;90;884;274};}];local function Ninoo_llIlIlIIlIlIIIIlIIIIIIII()local Ninoo_IIIIIlIlI=Ninoo_IIIlIIIlIIIIllIlIIII local Ninoo_IlIIllIll={};local Ninoo_IlllIIIIll={};local Ninoo_IlIllIIlIIIIIlIIIlIII={};for Ninoo_IllIIlIIIIlI=0,Ninoo_lIIlIIllIIllIIIIlIIII do if(Ninoo_IllIIlIIIIlI>=Ninoo_IllllllllIllllIIIIl)then Ninoo_IlIIllIll[Ninoo_IllIIlIIIIlI-Ninoo_IllllllllIllllIIIIl]=Ninoo_lIIlIIllIlllIIIllIlIl[Ninoo_IllIIlIIIIlI+1];else Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI]=Ninoo_lIIlIIllIlllIIIllIlIl[Ninoo_IllIIlIIIIlI+1];end;end;local Ninoo_lIIlIIllIlllIIIllIlIl=Ninoo_lIIlIIllIIllIIIIlIIII-Ninoo_IllllllllIllllIIIIl+1 local Ninoo_IllIIlIIIIlI;local Ninoo_IllllllllIllllIIIIl;while true do Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("D")];if Ninoo_IllllllllIllllIIIIl<=#("rzthlDlDDBM1tkSdIj9nVRuomkC94sZHpMqigpFrnxloBegKI6KELVM")then if Ninoo_IllllllllIllllIIIIl<=#("ef4bblIkLfMS4K6rOR9zGgYid2C")then if Ninoo_IllllllllIllllIIIIl<=#("Sv5EaQdauEqbY")then if Ninoo_IllllllllIllllIIIIl<=#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{410;510;936;118};}then if Ninoo_IllllllllIllllIIIIl<=#("s0")then if Ninoo_IllllllllIllllIIIIl<=#("")then local Ninoo_IIIllIlIlIIlIlllIlll=Ninoo_IllIIlIIIIlI[#("dy")];local Ninoo_IllllllllIllllIIIIl=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IIIllIlIlIIlIlllIlll]local Ninoo_IIlIlIIl=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IIIllIlIlIIlIlllIlll+2];if(Ninoo_IIlIlIIl>0)then if(Ninoo_IllllllllIllllIIIIl>Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IIIllIlIlIIlIlllIlll+1])then Ninoo_lIlIllIIllIIl=Ninoo_IllIIlIIIIlI[#{{657;164;85;906};{497;274;161;892};"1 + 1 = 111";}];else Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IIIllIlIlIIlIlllIlll+3]=Ninoo_IllllllllIllllIIIIl;end elseif(Ninoo_IllllllllIllllIIIIl<Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IIIllIlIlIIlIlllIlll+1])then Ninoo_lIlIllIIllIIl=Ninoo_IllIIlIIIIlI[#("oGT")];else Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IIIllIlIlIIlIlllIlll+3]=Ninoo_IllllllllIllllIIIIl;end elseif Ninoo_IllllllllIllllIIIIl>#("m")then Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("BR")]]=#Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("DNW")]];else local Ninoo_IIIllIlIlIIlIlllIlll=Ninoo_IllIIlIIIIlI[#("Gz")];local Ninoo_lIlIllIIllIIl=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("goz")]];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IIIllIlIlIIlIlllIlll+1]=Ninoo_lIlIllIIllIIl;Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IIIllIlIlIIlIlllIlll]=Ninoo_lIlIllIIllIIl[Ninoo_IllIIlIIIIlI[#("BHYA")]];end;elseif Ninoo_IllllllllIllllIIIIl<=#{{661;406;932;215};"1 + 1 = 111";{993;1;334;453};{264;885;596;50};}then if Ninoo_IllllllllIllllIIIIl>#("TKD")then local Ninoo_IllIIlIIIIlI=Ninoo_IllIIlIIIIlI[#("jt")];do return Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI](Ninoo_IIlllIllIllIlI(Ninoo_IlIllIIlIIIIIlIIIlIII,Ninoo_IllIIlIIIIlI+1,Ninoo_llllIlIIIIIII))end;else local Ninoo_lIlIllIIllIIl=Ninoo_IllIIlIIIIlI[#("g5")]Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_lIlIllIIllIIl]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_lIlIllIIllIIl](Ninoo_IIlllIllIllIlI(Ninoo_IlIllIIlIIIIIlIIIlIII,Ninoo_lIlIllIIllIIl+1,Ninoo_IllIIlIIIIlI[#("RUX")]))end;elseif Ninoo_IllllllllIllllIIIIl>#("kiRnG")then local Ninoo_IIIllIlIlIIlIlllIlll=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("SNhO")]];if Ninoo_IIIllIlIlIIlIlllIlll then Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;else Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("kO")]]=Ninoo_IIIllIlIlIIlIlllIlll;Ninoo_lIlIllIIllIIl=Ninoo_IllIIlIIIIlI[#("DtE")];end;else Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("ZA")]]=Ninoo_lIIlIlll(Ninoo_IlIIllllIlllllllI[Ninoo_IllIIlIIIIlI[#("dH6")]],nil,Ninoo_IIlIlIIl);end;elseif Ninoo_IllllllllIllllIIIIl<=#("7jA8LFDDQ")then if Ninoo_IllllllllIllllIIIIl<=#("mE9AFbS")then if(Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("Dg")]]==Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("7fcm")]])then Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;else Ninoo_lIlIllIIllIIl=Ninoo_IllIIlIIIIlI[#{"1 + 1 = 111";"1 + 1 = 111";{183;195;696;620};}];end;elseif Ninoo_IllllllllIllllIIIIl>#("MgTIHhro")then Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("1r")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("sgo")]][Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("qXIq")]]];else if(Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("2H")]]==Ninoo_IllIIlIIIIlI[#("O9x6")])then Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;else Ninoo_lIlIllIIllIIl=Ninoo_IllIIlIIIIlI[#("OcZ")];end;end;elseif Ninoo_IllllllllIllllIIIIl<=#("yktRBBduQEX")then if Ninoo_IllllllllIllllIIIIl>#("JFYfs6pKdU")then local Ninoo_IllIIlIIIIlI=Ninoo_IllIIlIIIIlI[#("v6")]Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI](Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI+1])else local Ninoo_IllllllllIllllIIIIl;Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("z6")]Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl]()Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_lIllIllIlIIlIIlII[Ninoo_IllIIlIIIIlI[#("Puh")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("Ur")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("6G")]]=Ninoo_lIllIllIlIIlIIlII[Ninoo_IllIIlIIIIlI[#("2Gb")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("Kt")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("1nt")]][Ninoo_IllIIlIIIIlI[#("8fZH")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("lb")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("kaK")]][Ninoo_IllIIlIIIIlI[#{"1 + 1 = 111";"1 + 1 = 111";{485;674;66;738};"1 + 1 = 111";}]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("Q1")]][Ninoo_IllIIlIIIIlI[#("u7X")]]=Ninoo_IllIIlIIIIlI[#("stdr")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("nG")]]=Ninoo_IIlIlIIl[Ninoo_IllIIlIIIIlI[#("KNk")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("oK")]]=Ninoo_IllIIlIIIIlI[#("H8Z")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("JJ")]Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl](Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl+1])end;elseif Ninoo_IllllllllIllllIIIIl>#("A4LAmzNsQv6e")then local Ninoo_IIIllIlIlIIlIlllIlll=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("NpAb")]];if Ninoo_IIIllIlIlIIlIlllIlll then Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;else Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("EO")]]=Ninoo_IIIllIlIlIIlIlllIlll;Ninoo_lIlIllIIllIIl=Ninoo_IllIIlIIIIlI[#("apQ")];end;else do return end;end;elseif Ninoo_IllllllllIllllIIIIl<=#("x7Vc5eZH5kdL4DnkcOFO")then if Ninoo_IllllllllIllllIIIIl<=#{{107;324;889;93};{696;398;442;214};{352;608;596;659};{343;42;441;80};{805;563;416;930};{232;752;598;619};{9;946;287;28};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{279;95;467;976};"1 + 1 = 111";"1 + 1 = 111";}then if Ninoo_IllllllllIllllIIIIl<=#("P85LFUIYr6zhNS")then local Ninoo_IIIllIlIlIIlIlllIlll=Ninoo_IllIIlIIIIlI[#("yX")];local Ninoo_IllllllllIllllIIIIl=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IIIllIlIlIIlIlllIlll]local Ninoo_IIlIlIIl=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IIIllIlIlIIlIlllIlll+2];if(Ninoo_IIlIlIIl>0)then if(Ninoo_IllllllllIllllIIIIl>Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IIIllIlIlIIlIlllIlll+1])then Ninoo_lIlIllIIllIIl=Ninoo_IllIIlIIIIlI[#("5A9")];else Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IIIllIlIlIIlIlllIlll+3]=Ninoo_IllllllllIllllIIIIl;end elseif(Ninoo_IllllllllIllllIIIIl<Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IIIllIlIlIIlIlllIlll+1])then Ninoo_lIlIllIIllIIl=Ninoo_IllIIlIIIIlI[#("lux")];else Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IIIllIlIlIIlIlllIlll+3]=Ninoo_IllllllllIllllIIIIl;end elseif Ninoo_IllllllllIllllIIIIl==#("BqDj5beiWvY4Aly")then for Ninoo_IllIIlIIIIlI=Ninoo_IllIIlIIIIlI[#("rR")],Ninoo_IllIIlIIIIlI[#("FMo")]do Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI]=nil;end;else local Ninoo_IIlIlIIl;local Ninoo_IllllllllIllllIIIIl;Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("PA")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("s3O")]][Ninoo_IllIIlIIIIlI[#("EzvQ")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("v2")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("HLZ")]][Ninoo_IllIIlIIIIlI[#("v8a5")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("12")]Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl](Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl+1])Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("LQ")]]=Ninoo_IllIIlIIIIlI[#("phX")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("5l")]Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl](Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl+1])Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("Qi")];Ninoo_IIlIlIIl=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl+1]=Ninoo_IIlIlIIl;Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl]=Ninoo_IIlIlIIl[Ninoo_IllIIlIIIIlI[#("Bj2R")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("0k")]]=Ninoo_IllIIlIIIIlI[#("Qbs")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("yl")]Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl](Ninoo_IIlllIllIllIlI(Ninoo_IlIllIIlIIIIIlIIIlIII,Ninoo_IllllllllIllllIIIIl+1,Ninoo_IllIIlIIIIlI[#("HPr")]))Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];for Ninoo_IllIIlIIIIlI=Ninoo_IllIIlIIIIlI[#("fD")],Ninoo_IllIIlIIIIlI[#("bBB")]do Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI]=nil;end;end;elseif Ninoo_IllllllllIllllIIIIl<=#("2909GSAzdqmJ9NeEIk")then if Ninoo_IllllllllIllllIIIIl>#("pplpkLZipRZiN3mHh")then local Ninoo_lIllIllIlIIlIIlII;local Ninoo_IllllllllIllllIIIIl;Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("2m")]]=Ninoo_IIlIlIIl[Ninoo_IllIIlIIIIlI[#("Kpm")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("Y3")];Ninoo_lIllIllIlIIlIIlII=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("zoH")]];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl+1]=Ninoo_lIllIllIlIIlIIlII;Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl]=Ninoo_lIllIllIlIIlIIlII[Ninoo_IllIIlIIIIlI[#("NXKL")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("Jb")]]=Ninoo_IllIIlIIIIlI[#("tID")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("42")]Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl](Ninoo_IIlllIllIllIlI(Ninoo_IlIllIIlIIIIIlIIIlIII,Ninoo_IllllllllIllllIIIIl+1,Ninoo_IllIIlIIIIlI[#("A9A")]))Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("Uy")]]=Ninoo_IIlIlIIl[Ninoo_IllIIlIIIIlI[#("M79")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("D7")];Ninoo_lIllIllIlIIlIIlII=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("UD1")]];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl+1]=Ninoo_lIllIllIlIIlIIlII;Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl]=Ninoo_lIllIllIlIIlIIlII[Ninoo_IllIIlIIIIlI[#("JzFx")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("jI")]]=Ninoo_IllIIlIIIIlI[#("tMA")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("mR")]Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl](Ninoo_IIlllIllIllIlI(Ninoo_IlIllIIlIIIIIlIIIlIII,Ninoo_IllllllllIllllIIIIl+1,Ninoo_IllIIlIIIIlI[#("L4p")]))Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("7B")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#{"1 + 1 = 111";{69;843;75;229};{286;481;469;360};}]][Ninoo_IllIIlIIIIlI[#("6TqJ")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("Nq")]]=Ninoo_IIlIlIIl[Ninoo_IllIIlIIIIlI[#("40N")]];else local Ninoo_lIllIllIlIIlIIlII;local Ninoo_IllllllllIllllIIIIl;Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("Op")]Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl](Ninoo_IIlllIllIllIlI(Ninoo_IlIllIIlIIIIIlIIIlIII,Ninoo_IllllllllIllllIIIIl+1,Ninoo_IllIIlIIIIlI[#("V7K")]))Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("c8")]]=Ninoo_IIlIlIIl[Ninoo_IllIIlIIIIlI[#("J4l")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("rX")]Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl]()Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("5x")];Ninoo_lIllIllIlIIlIIlII=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("pEh")]];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl+1]=Ninoo_lIllIllIlIIlIIlII;Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl]=Ninoo_lIllIllIlIIlIIlII[Ninoo_IllIIlIIIIlI[#("yKv8")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("oW")]]=Ninoo_IllIIlIIIIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("Vg")]]={};Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("N4")]][Ninoo_IllIIlIIIIlI[#("zTO")]]=Ninoo_IllIIlIIIIlI[#("KTjx")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("Z6")]][Ninoo_IllIIlIIIIlI[#("Y3c")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("HyUQ")]];end;elseif Ninoo_IllllllllIllllIIIIl==#("T5S0dgPZFjjrtvpmhER")then if(Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("zQ")]]~=Ninoo_IllIIlIIIIlI[#("iBxG")])then Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;else Ninoo_lIlIllIIllIIl=Ninoo_IllIIlIIIIlI[#("rxo")];end;else Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("10")]]=Ninoo_IIlIlIIl[Ninoo_IllIIlIIIIlI[#("3A2")]];end;elseif Ninoo_IllllllllIllllIIIIl<=#("PyRKkSniKQXg6QZppAmeLvf")then if Ninoo_IllllllllIllllIIIIl<=#("98xD3AWSZxiuoiPu2GpZv")then Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("Y5")]]={};elseif Ninoo_IllllllllIllllIIIIl>#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{591;427;963;796};{883;355;210;6};{807;672;374;709};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{933;924;206;798};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{629;932;430;267};"1 + 1 = 111";"1 + 1 = 111";{879;967;917;563};{540;905;901;837};"1 + 1 = 111";"1 + 1 = 111";}then Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("np")]]=Ninoo_lIllIllIlIIlIIlII[Ninoo_IllIIlIIIIlI[#("uei")]];else local Ninoo_lIlIllIIllIIl=Ninoo_IllIIlIIIIlI[#("oR")];local Ninoo_IIIllIlIlIIlIlllIlll=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("2S4")]];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_lIlIllIIllIIl+1]=Ninoo_IIIllIlIlIIlIlllIlll;Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_lIlIllIIllIIl]=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_IllIIlIIIIlI[#{{266;889;306;62};{980;457;380;967};{104;530;220;848};{42;795;357;61};}]];end;elseif Ninoo_IllllllllIllllIIIIl<=#("FbhU1legqu6NT63DeBnmZcnHD")then if Ninoo_IllllllllIllllIIIIl>#("ipf4qVVfb8Z7zAfmbQOJNYvR")then if(Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("cl")]]==Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("f380")]])then Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;else Ninoo_lIlIllIIllIIl=Ninoo_IllIIlIIIIlI[#("B2y")];end;else local Ninoo_IllIIlIIIIlI=Ninoo_IllIIlIIIIlI[#("ho")]Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI]()end;elseif Ninoo_IllllllllIllllIIIIl==#("OcxSDYLq2dYbvdk2N45OgbYhNb")then local Ninoo_IllllllllIllllIIIIl;Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("r8")]Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl]()Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_lIllIllIlIIlIIlII[Ninoo_IllIIlIIIIlI[#("WlO")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("zm")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("U9")]]=Ninoo_lIllIllIlIIlIIlII[Ninoo_IllIIlIIIIlI[#("K8L")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("9Y")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("m0g")]][Ninoo_IllIIlIIIIlI[#("NSCD")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("EO")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("4k0")]][Ninoo_IllIIlIIIIlI[#("1Y4C")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("jB")]][Ninoo_IllIIlIIIIlI[#("PLO")]]=Ninoo_IllIIlIIIIlI[#("3Om3")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("th")]]=Ninoo_IIlIlIIl[Ninoo_IllIIlIIIIlI[#("LvT")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("Aa")]]=Ninoo_IllIIlIIIIlI[#("zCp")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("OH")]Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl](Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl+1])Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_lIlIllIIllIIl=Ninoo_IllIIlIIIIlI[#("Yov")];else local Ninoo_IllIIlIIIIlI=Ninoo_IllIIlIIIIlI[#("xL")]Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI]()end;elseif Ninoo_IllllllllIllllIIIIl<=#("24xu3zfNTyxJjoQHvqlPNEQ93BdTMoofCqSxGT4Mq")then if Ninoo_IllllllllIllllIIIIl<=#("CFpvVzAFC1Cx4znxCDvvbEirh2GtaNvJyl")then if Ninoo_IllllllllIllllIIIIl<=#{"1 + 1 = 111";{843;462;351;138};"1 + 1 = 111";{668;74;834;388};"1 + 1 = 111";"1 + 1 = 111";{270;298;618;507};{250;698;771;160};"1 + 1 = 111";"1 + 1 = 111";{343;881;446;717};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{698;556;989;847};"1 + 1 = 111";{752;882;466;587};"1 + 1 = 111";{667;286;257;346};"1 + 1 = 111";{894;835;790;989};{245;138;599;451};{684;592;355;366};"1 + 1 = 111";{838;539;353;760};"1 + 1 = 111";}then if Ninoo_IllllllllIllllIIIIl<=#("8SxcO4XRd4RVOcGlk0v4rCWd0UtX")then Ninoo_lIlIllIIllIIl=Ninoo_IllIIlIIIIlI[#("G5O")];elseif Ninoo_IllllllllIllllIIIIl>#("lL72VgP6gGxOJ1FqKulxS6OELKG5t")then do return Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("dS")]]end else local Ninoo_IllIIlIIIIlI=Ninoo_IllIIlIIIIlI[#("Ug")]Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI](Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI+1])end;elseif Ninoo_IllllllllIllllIIIIl<=#("3La71tT2260oeu8pTLqWpAhAcp6ErkKT")then if Ninoo_IllllllllIllllIIIIl==#("4MWOMalISDpGD1sFu15OH5DDK5LxoKR")then local Ninoo_IIlllIllIllIlI;local Ninoo_IllllllllIllllIIIIl;Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("KC")]]=Ninoo_lIllIllIlIIlIIlII[Ninoo_IllIIlIIIIlI[#("SLa")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("id")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("YRK")]][Ninoo_IllIIlIIIIlI[#("lOZ9")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("xn")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("7q2")]][Ninoo_IllIIlIIIIlI[#("GxUF")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("rU")];Ninoo_IIlllIllIllIlI=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("2ST")]];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl+1]=Ninoo_IIlllIllIllIlI;Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl]=Ninoo_IIlllIllIllIlI[Ninoo_IllIIlIIIIlI[#("SVMK")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#{"1 + 1 = 111";{279;59;988;673};}]Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl](Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl+1])Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("mX")]]=Ninoo_IIlIlIIl[Ninoo_IllIIlIIIIlI[#("nHG")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("U2")]]=Ninoo_IllIIlIIIIlI[#("Cqo")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("AU")]Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl](Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl+1])Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("4x")]]=Ninoo_IIlIlIIl[Ninoo_IllIIlIIIIlI[#("T5x")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("P5")]]=Ninoo_IllIIlIIIIlI[#("Ejv")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("MU")]Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl](Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl+1])Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];do return end;else do return end;end;elseif Ninoo_IllllllllIllllIIIIl==#("hMjTlMhKfoI724JyN97tOeg8isdQzYshV")then local Ninoo_IllIIlIIIIlI=Ninoo_IllIIlIIIIlI[#("KK")]Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI](Ninoo_IIlllIllIllIlI(Ninoo_IlIllIIlIIIIIlIIIlIII,Ninoo_IllIIlIIIIlI+1,Ninoo_llllIlIIIIIII))else local Ninoo_IIIllIlIlIIlIlllIlll=Ninoo_IllIIlIIIIlI[#("tk")]local Ninoo_IllllllllIllllIIIIl={Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IIIllIlIlIIlIlllIlll](Ninoo_IIlllIllIllIlI(Ninoo_IlIllIIlIIIIIlIIIlIII,Ninoo_IIIllIlIlIIlIlllIlll+1,Ninoo_llllIlIIIIIII))};local Ninoo_lIlIllIIllIIl=0;for Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll,Ninoo_IllIIlIIIIlI[#("QVtj")]do Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI]=Ninoo_IllllllllIllllIIIIl[Ninoo_lIlIllIIllIIl];end end;elseif Ninoo_IllllllllIllllIIIIl<=#("z1SKtSUuJryGLPvnUpNyRcGkK2IBlr6Am8GSQ")then if Ninoo_IllllllllIllllIIIIl<=#{{778;284;202;71};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{868;408;577;72};"1 + 1 = 111";"1 + 1 = 111";{563;570;462;89};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{228;135;677;882};{971;806;737;439};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{236;728;242;308};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{108;209;995;928};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{150;754;341;440};"1 + 1 = 111";}then local Ninoo_IllIIlIIIIlI=Ninoo_IllIIlIIIIlI[#{"1 + 1 = 111";{437;916;552;78};}]Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI](Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI+1])elseif Ninoo_IllllllllIllllIIIIl>#("YzHRK7jjfan35YXkxhcoeqjpCNsgoRNxCgKX")then local Ninoo_IllIIlIIIIlI=Ninoo_IllIIlIIIIlI[#("ev")];Ninoo_llllIlIIIIIII=Ninoo_IllIIlIIIIlI+Ninoo_lIIlIIllIlllIIIllIlIl-1;for Ninoo_lIlIllIIllIIl=Ninoo_IllIIlIIIIlI,Ninoo_llllIlIIIIIII do local Ninoo_IllIIlIIIIlI=Ninoo_IlIIllIll[Ninoo_lIlIllIIllIIl-Ninoo_IllIIlIIIIlI];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_lIlIllIIllIIl]=Ninoo_IllIIlIIIIlI;end;else local Ninoo_IIlIlIIl;local Ninoo_IllllllllIllllIIIIl;Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("xp")]Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl](Ninoo_IIlllIllIllIlI(Ninoo_IlIllIIlIIIIIlIIIlIII,Ninoo_IllllllllIllllIIIIl+1,Ninoo_IllIIlIIIIlI[#("HTE")]))Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("61")];Ninoo_IIlIlIIl=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#{"1 + 1 = 111";{102;326;165;180};{215;738;60;102};}]];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl+1]=Ninoo_IIlIlIIl;Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl]=Ninoo_IIlIlIIl[Ninoo_IllIIlIIIIlI[#{{994;294;635;177};{9;737;56;44};"1 + 1 = 111";"1 + 1 = 111";}]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("K9")]]=Ninoo_IllIIlIIIIlI[#("WoA")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("Vj")]]={};Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("8n")]][Ninoo_IllIIlIIIIlI[#("JHX")]]=Ninoo_IllIIlIIIIlI[#("uH5t")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("IS")]][Ninoo_IllIIlIIIIlI[#("FHT")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("lD57")]];end;elseif Ninoo_IllllllllIllllIIIIl<=#("O8dqamicCcFY8qAOvsHorp6Od5zx1CYoavTj97e")then if Ninoo_IllllllllIllllIIIIl>#{{538;130;224;786};"1 + 1 = 111";{620;153;543;266};"1 + 1 = 111";{619;602;663;302};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{68;229;299;304};{21;945;170;719};{446;603;329;817};{800;371;342;620};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{811;388;736;917};"1 + 1 = 111";"1 + 1 = 111";{989;47;35;732};{956;144;424;964};{924;134;695;341};"1 + 1 = 111";{909;507;6;151};"1 + 1 = 111";"1 + 1 = 111";{262;653;913;765};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{95;484;710;753};"1 + 1 = 111";"1 + 1 = 111";}then local Ninoo_lIlIllIIllIIl=Ninoo_IllIIlIIIIlI[#("uP")]local Ninoo_IIIllIlIlIIlIlllIlll,Ninoo_IllIIlIIIIlI=Ninoo_IIIIIlIlI(Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_lIlIllIIllIIl](Ninoo_IIlllIllIllIlI(Ninoo_IlIllIIlIIIIIlIIIlIII,Ninoo_lIlIllIIllIIl+1,Ninoo_IllIIlIIIIlI[#("AmO")])))Ninoo_llllIlIIIIIII=Ninoo_IllIIlIIIIlI+Ninoo_lIlIllIIllIIl-1 local Ninoo_IllIIlIIIIlI=0;for Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl,Ninoo_llllIlIIIIIII do Ninoo_IllIIlIIIIlI=Ninoo_IllIIlIIIIlI+1;Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_lIlIllIIllIIl]=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_IllIIlIIIIlI];end;else local Ninoo_llllIlIIIIIII;local Ninoo_IllllllllIllllIIIIl;Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("v1l")]][Ninoo_IllIIlIIIIlI[#("Bd9i")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("X3")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("uLa")]][Ninoo_IllIIlIIIIlI[#("p76Z")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("do")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("43l")]][Ninoo_IllIIlIIIIlI[#("fmuq")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IIlIlIIl[Ninoo_IllIIlIIIIlI[#("nPn")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("kv")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("3I")]]=Ninoo_lIllIllIlIIlIIlII[Ninoo_IllIIlIIIIlI[#("FMP")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("QS")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("1gJ")]][Ninoo_IllIIlIIIIlI[#("hudZ")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#{"1 + 1 = 111";{400;541;53;397};}]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("hpD")]][Ninoo_IllIIlIIIIlI[#("pvND")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("sY")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("AyJ")]][Ninoo_IllIIlIIIIlI[#("9CBt")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("qv")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("fcS")]][Ninoo_IllIIlIIIIlI[#("o0Ox")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("x7")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("IiK")]][Ninoo_IllIIlIIIIlI[#("MWkC")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IIlIlIIl[Ninoo_IllIIlIIIIlI[#("oMn")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("FT")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("W0")]]=Ninoo_IIlIlIIl[Ninoo_IllIIlIIIIlI[#("vP2")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("Bj")];Ninoo_llllIlIIIIIII=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("spD")]];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl+1]=Ninoo_llllIlIIIIIII;Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl]=Ninoo_llllIlIIIIIII[Ninoo_IllIIlIIIIlI[#("19DA")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("rH")]]=Ninoo_IIlIlIIl[Ninoo_IllIIlIIIIlI[#("IBL")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("yL")]Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl](Ninoo_IIlllIllIllIlI(Ninoo_IlIllIIlIIIIIlIIIlIII,Ninoo_IllllllllIllllIIIIl+1,Ninoo_IllIIlIIIIlI[#("s9W")]))Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_lIlIllIIllIIl=Ninoo_IllIIlIIIIlI[#{"1 + 1 = 111";{170;256;690;2};"1 + 1 = 111";}];end;elseif Ninoo_IllllllllIllllIIIIl>#("VP7jivamCZuhKU8opb8vIEN37dRJJuCiPJCB1McP")then local Ninoo_IllllllllIllllIIIIl;Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("sf")]]=Ninoo_IIlIlIIl[Ninoo_IllIIlIIIIlI[#("t2d")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("K1")]Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl]()Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_lIllIllIlIIlIIlII[Ninoo_IllIIlIIIIlI[#("6F5")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("pn")]]=Ninoo_lIllIllIlIIlIIlII[Ninoo_IllIIlIIIIlI[#("cE8")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("1G")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("330")]][Ninoo_IllIIlIIIIlI[#("hlOX")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("QQ")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("yOP")]][Ninoo_IllIIlIIIIlI[#{{152;19;954;704};"1 + 1 = 111";{581;372;236;294};{254;94;974;556};}]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("HQ")]][Ninoo_IllIIlIIIIlI[#("4VV")]]=Ninoo_IllIIlIIIIlI[#("fBGW")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("Rh")]]=Ninoo_lIllIllIlIIlIIlII[Ninoo_IllIIlIIIIlI[#("BDB")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("yp")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("xFc")]][Ninoo_IllIIlIIIIlI[#("YGMy")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("g4")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("nRv")]][Ninoo_IllIIlIIIIlI[#("pI7I")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("95")]][Ninoo_IllIIlIIIIlI[#("LQ3")]]=Ninoo_IllIIlIIIIlI[#("vjLa")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("N7")]]=Ninoo_lIllIllIlIIlIIlII[Ninoo_IllIIlIIIIlI[#("ufW")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("qX")]][Ninoo_IllIIlIIIIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]]=Ninoo_IllIIlIIIIlI[#{"1 + 1 = 111";{859;63;175;398};"1 + 1 = 111";{197;282;586;137};}];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=Ninoo_IIlIlIIl[Ninoo_IllIIlIIIIlI[#("jtQ")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("dG")]]=Ninoo_IllIIlIIIIlI[#("xnM")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("9K")]Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl](Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl+1])else local Ninoo_llllIlIIIIIII;local Ninoo_IllllllllIllllIIIIl;Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("AM")]]=Ninoo_lIllIllIlIIlIIlII[Ninoo_IllIIlIIIIlI[#("hAU")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("D1")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("dxa")]][Ninoo_IllIIlIIIIlI[#("XXOq")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("lM")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("CVb")]][Ninoo_IllIIlIIIIlI[#("ZUNA")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("9l")];Ninoo_llllIlIIIIIII=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("Hy1")]];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl+1]=Ninoo_llllIlIIIIIII;Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl]=Ninoo_llllIlIIIIIII[Ninoo_IllIIlIIIIlI[#("lpzT")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("Bg")]]=Ninoo_IllIIlIIIIlI[#("V1Z")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("ip")]Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl](Ninoo_IIlllIllIllIlI(Ninoo_IlIllIIlIIIIIlIIIlIII,Ninoo_IllllllllIllllIIIIl+1,Ninoo_IllIIlIIIIlI[#("9Rk")]))Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("Fn")]]=Ninoo_lIllIllIlIIlIIlII[Ninoo_IllIIlIIIIlI[#{{889;507;954;34};{530;973;595;67};"1 + 1 = 111";}]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("rA")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#{{423;2;172;234};"1 + 1 = 111";{801;155;931;421};}]][Ninoo_IllIIlIIIIlI[#("uxf3")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("lm")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#{{750;485;515;403};{585;424;813;975};"1 + 1 = 111";}]][Ninoo_IllIIlIIIIlI[#("Jog3")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("aO")];Ninoo_llllIlIIIIIII=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("6zU")]];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl+1]=Ninoo_llllIlIIIIIII;Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl]=Ninoo_llllIlIIIIIII[Ninoo_IllIIlIIIIlI[#("SYe5")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("ey")]]=Ninoo_IllIIlIIIIlI[#("fpM")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("5R")]Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl](Ninoo_IIlllIllIllIlI(Ninoo_IlIllIIlIIIIIlIIIlIII,Ninoo_IllllllllIllllIIIIl+1,Ninoo_IllIIlIIIIlI[#("tk2")]))Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("OG")]]=Ninoo_lIllIllIlIIlIIlII[Ninoo_IllIIlIIIIlI[#("C9T")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("yXJ")]][Ninoo_IllIIlIIIIlI[#("lnEH")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("rq")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("pOy")]][Ninoo_IllIIlIIIIlI[#("b2vX")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("D2")];Ninoo_llllIlIIIIIII=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#{{214;438;604;824};{686;37;667;401};{182;58;241;28};}]];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl+1]=Ninoo_llllIlIIIIIII;Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl]=Ninoo_llllIlIIIIIII[Ninoo_IllIIlIIIIlI[#("G5I3")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("y4")]]=Ninoo_IllIIlIIIIlI[#("5ag")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("tE")]Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl](Ninoo_IIlllIllIllIlI(Ninoo_IlIllIIlIIIIIlIIIlIII,Ninoo_IllllllllIllllIIIIl+1,Ninoo_IllIIlIIIIlI[#("bRV")]))Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("eh")]]=Ninoo_lIllIllIlIIlIIlII[Ninoo_IllIIlIIIIlI[#("g1T")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("7r")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("fDV")]][Ninoo_IllIIlIIIIlI[#("gU2b")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("Hl")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("iNL")]][Ninoo_IllIIlIIIIlI[#("3Xs1")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("x4")];Ninoo_llllIlIIIIIII=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("YtM")]];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl+1]=Ninoo_llllIlIIIIIII;Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl]=Ninoo_llllIlIIIIIII[Ninoo_IllIIlIIIIlI[#("IRUK")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("6G")]]=Ninoo_IllIIlIIIIlI[#("n65")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("5F")]Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl](Ninoo_IIlllIllIllIlI(Ninoo_IlIllIIlIIIIIlIIIlIII,Ninoo_IllllllllIllllIIIIl+1,Ninoo_IllIIlIIIIlI[#("bS9")]))Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("om")]]=Ninoo_lIllIllIlIIlIIlII[Ninoo_IllIIlIIIIlI[#("IRW")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("m9")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("diU")]][Ninoo_IllIIlIIIIlI[#("aPSS")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("qS")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("oxz")]][Ninoo_IllIIlIIIIlI[#("8V1X")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("nN")];Ninoo_llllIlIIIIIII=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("dYu")]];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl+1]=Ninoo_llllIlIIIIIII;Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl]=Ninoo_llllIlIIIIIII[Ninoo_IllIIlIIIIlI[#("Cbsm")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("uV")]]=Ninoo_IllIIlIIIIlI[#("2C3")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("t0")]Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl](Ninoo_IIlllIllIllIlI(Ninoo_IlIllIIlIIIIIlIIIlIII,Ninoo_IllllllllIllllIIIIl+1,Ninoo_IllIIlIIIIlI[#("v2f")]))Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("gQ")]]=Ninoo_lIllIllIlIIlIIlII[Ninoo_IllIIlIIIIlI[#("zYG")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("AW")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#{{806;514;264;888};"1 + 1 = 111";"1 + 1 = 111";}]][Ninoo_IllIIlIIIIlI[#("ORml")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("z5")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("2Lm")]][Ninoo_IllIIlIIIIlI[#("75dj")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("YH")];Ninoo_llllIlIIIIIII=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("RC2")]];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl+1]=Ninoo_llllIlIIIIIII;Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl]=Ninoo_llllIlIIIIIII[Ninoo_IllIIlIIIIlI[#("y4N1")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("VD")]]=Ninoo_IllIIlIIIIlI[#{{520;604;471;5};{274;407;587;545};"1 + 1 = 111";}];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("Gf")]Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl](Ninoo_IIlllIllIllIlI(Ninoo_IlIllIIlIIIIIlIIIlIII,Ninoo_IllllllllIllllIIIIl+1,Ninoo_IllIIlIIIIlI[#("5fo")]))Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("I2")]]=Ninoo_lIllIllIlIIlIIlII[Ninoo_IllIIlIIIIlI[#("Miz")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("dQ")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("YOW")]][Ninoo_IllIIlIIIIlI[#("thW4")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("ss")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("Mj4")]][Ninoo_IllIIlIIIIlI[#("0nZC")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("nb")];Ninoo_llllIlIIIIIII=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("MP9")]];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl+1]=Ninoo_llllIlIIIIIII;Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl]=Ninoo_llllIlIIIIIII[Ninoo_IllIIlIIIIlI[#("v2fc")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("3M")]]=Ninoo_IllIIlIIIIlI[#("c9O")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("0Y")]Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl](Ninoo_IIlllIllIllIlI(Ninoo_IlIllIIlIIIIIlIIIlIII,Ninoo_IllllllllIllllIIIIl+1,Ninoo_IllIIlIIIIlI[#("M6f")]))Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("FY")]]=Ninoo_lIllIllIlIIlIIlII[Ninoo_IllIIlIIIIlI[#("K2D")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("HY")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("rOQ")]][Ninoo_IllIIlIIIIlI[#("1Fgm")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#{{685;626;339;242};"1 + 1 = 111";}]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("KgE")]][Ninoo_IllIIlIIIIlI[#{{519;583;633;62};"1 + 1 = 111";"1 + 1 = 111";{932;676;627;531};}]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("8D")];Ninoo_llllIlIIIIIII=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("eUL")]];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl+1]=Ninoo_llllIlIIIIIII;Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl]=Ninoo_llllIlIIIIIII[Ninoo_IllIIlIIIIlI[#("fLI4")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("uZ")]]=Ninoo_IllIIlIIIIlI[#("YIW")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("MV")]Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl](Ninoo_IIlllIllIllIlI(Ninoo_IlIllIIlIIIIIlIIIlIII,Ninoo_IllllllllIllllIIIIl+1,Ninoo_IllIIlIIIIlI[#("HNy")]))Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("Bc")]]=Ninoo_lIllIllIlIIlIIlII[Ninoo_IllIIlIIIIlI[#("1Zz")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#{{487;733;885;178};{342;675;322;820};}]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("BVX")]][Ninoo_IllIIlIIIIlI[#{{749;624;565;218};"1 + 1 = 111";{730;537;635;792};"1 + 1 = 111";}]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("Rl")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("d89")]][Ninoo_IllIIlIIIIlI[#("tpyG")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("n4")];Ninoo_llllIlIIIIIII=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("lqy")]];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl+1]=Ninoo_llllIlIIIIIII;Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl]=Ninoo_llllIlIIIIIII[Ninoo_IllIIlIIIIlI[#("B1UC")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("R5")]]=Ninoo_IllIIlIIIIlI[#("DMP")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("Mb")]Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl](Ninoo_IIlllIllIllIlI(Ninoo_IlIllIIlIIIIIlIIIlIII,Ninoo_IllllllllIllllIIIIl+1,Ninoo_IllIIlIIIIlI[#("kxR")]))Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("0b")]]=Ninoo_lIllIllIlIIlIIlII[Ninoo_IllIIlIIIIlI[#("zBO")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#{{937;752;72;886};"1 + 1 = 111";}]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#{"1 + 1 = 111";"1 + 1 = 111";{987;639;851;120};}]][Ninoo_IllIIlIIIIlI[#("e0a1")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("xu")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("EpP")]][Ninoo_IllIIlIIIIlI[#("3YB0")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("y3")];Ninoo_llllIlIIIIIII=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("pU1")]];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl+1]=Ninoo_llllIlIIIIIII;Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl]=Ninoo_llllIlIIIIIII[Ninoo_IllIIlIIIIlI[#("ZJW9")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("Eq")]]=Ninoo_IllIIlIIIIlI[#("sYJ")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("QA")]Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl](Ninoo_IIlllIllIllIlI(Ninoo_IlIllIIlIIIIIlIIIlIII,Ninoo_IllllllllIllllIIIIl+1,Ninoo_IllIIlIIIIlI[#{{874;764;858;313};"1 + 1 = 111";{340;488;403;629};}]))Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("YY")]]=Ninoo_lIllIllIlIIlIIlII[Ninoo_IllIIlIIIIlI[#("jXd")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("70")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("72c")]][Ninoo_IllIIlIIIIlI[#("pP4y")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("kI")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("igH")]][Ninoo_IllIIlIIIIlI[#("n2Qy")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("rq")];Ninoo_llllIlIIIIIII=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#{"1 + 1 = 111";{414;975;775;324};"1 + 1 = 111";}]];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl+1]=Ninoo_llllIlIIIIIII;Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl]=Ninoo_llllIlIIIIIII[Ninoo_IllIIlIIIIlI[#("MhLy")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("GS")]]=Ninoo_IllIIlIIIIlI[#("fcB")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("zW")]Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl](Ninoo_IIlllIllIllIlI(Ninoo_IlIllIIlIIIIIlIIIlIII,Ninoo_IllllllllIllllIIIIl+1,Ninoo_IllIIlIIIIlI[#("L5T")]))Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("4v")]]=Ninoo_IIlIlIIl[Ninoo_IllIIlIIIIlI[#("V0n")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("Wt")]]=Ninoo_IllIIlIIIIlI[#("YLH")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("Ns")]Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl](Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl+1])Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];do return end;end;elseif Ninoo_IllllllllIllllIIIIl<=#("dxXnieOqo8crarrbdmeOCOgymDbsIyN9tiFg0QY9dsuxz0Oq")then if Ninoo_IllllllllIllllIIIIl<=#("zXA7aVAqzbQduS0ud72XllyyeLjsT9vZUjjKmbtxf0CP")then if Ninoo_IllllllllIllllIIIIl<=#("6SKEbv3VE7nAc2zLgHzQ1slJpibOGRvTTpi3JYROCd")then do return Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("RT")]]end elseif Ninoo_IllllllllIllllIIIIl>#("l5kki4V8sc9rNGbo3topWMERWUGbrZVnXd9Nf83UUSc")then local Ninoo_IllIIlIIIIlI=Ninoo_IllIIlIIIIlI[#("da")]Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI](Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI+1])else Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("2Y")]][Ninoo_IllIIlIIIIlI[#("zf4")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("9UgU")]];end;elseif Ninoo_IllllllllIllllIIIIl<=#("T8FxIKYtmYDJCEyzyTRDqVFKGzj5BFFeJX7YojESbCa8KA")then if Ninoo_IllllllllIllllIIIIl==#("LKEvabKA7E50iB33StzaOHKjop8CZVG9fnIu6iEc9x9us")then Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("J3")]][Ninoo_IllIIlIIIIlI[#("E79")]]=Ninoo_IllIIlIIIIlI[#("oKR7")];else Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("B3")]]=Ninoo_lIllIllIlIIlIIlII[Ninoo_IllIIlIIIIlI[#("nkt")]];end;elseif Ninoo_IllllllllIllllIIIIl==#("uriIsOlAHeauhVciLm76U52I6JZvbrHp054RtqC1XQREuMa")then local Ninoo_lIIlIlll;local Ninoo_IlllIIIIll,Ninoo_IlIIllIll;local Ninoo_lIlIllIllIIlI;local Ninoo_IllllllllIllllIIIIl;Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("Pe")];Ninoo_lIlIllIllIIlI=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("n1S")]];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl+1]=Ninoo_lIlIllIllIIlI;Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl]=Ninoo_lIlIllIllIIlI[Ninoo_IllIIlIIIIlI[#("pRj3")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#{"1 + 1 = 111";{552;734;739;154};}]]=Ninoo_IIlIlIIl[Ninoo_IllIIlIIIIlI[#("tda")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("zf")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("nf7")]][Ninoo_IllIIlIIIIlI[#("UDy4")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("gW")]]=Ninoo_IllIIlIIIIlI[#("euj")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#{{385;8;491;934};{618;180;681;902};}]]=Ninoo_IllIIlIIIIlI[#("OQQ")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("6t")]]=Ninoo_IllIIlIIIIlI[#("JXL")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("uE")]]=Ninoo_IllIIlIIIIlI[#{{553;981;341;132};"1 + 1 = 111";{213;131;678;300};}];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("4o")]]=Ninoo_IllIIlIIIIlI[#("cZT")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("bN")]]=Ninoo_IllIIlIIIIlI[#("LKF")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("LZ")]]=Ninoo_IllIIlIIIIlI[#("iPc")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("JD")]]=Ninoo_IllIIlIIIIlI[#("LZG")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("ag")]]=Ninoo_IllIIlIIIIlI[#("iPs")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("Ru")]]=Ninoo_IllIIlIIIIlI[#("Y27")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("hs")]]=Ninoo_IllIIlIIIIlI[#("EXK")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("i6")]]=Ninoo_IllIIlIIIIlI[#("pRT")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("D1")]Ninoo_IlllIIIIll,Ninoo_IlIIllIll=Ninoo_IIIIIlIlI(Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl](Ninoo_IIlllIllIllIlI(Ninoo_IlIllIIlIIIIIlIIIlIII,Ninoo_IllllllllIllllIIIIl+1,Ninoo_IllIIlIIIIlI[#("b2Q")])))Ninoo_llllIlIIIIIII=Ninoo_IlIIllIll+Ninoo_IllllllllIllllIIIIl-1 Ninoo_lIIlIlll=0;for Ninoo_IllIIlIIIIlI=Ninoo_IllllllllIllllIIIIl,Ninoo_llllIlIIIIIII do Ninoo_lIIlIlll=Ninoo_lIIlIlll+1;Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI]=Ninoo_IlllIIIIll[Ninoo_lIIlIlll];end;Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("SN")]Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl](Ninoo_IIlllIllIllIlI(Ninoo_IlIllIIlIIIIIlIIIlIII,Ninoo_IllllllllIllllIIIIl+1,Ninoo_llllIlIIIIIII))Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("Og")]]=Ninoo_lIllIllIlIIlIIlII[Ninoo_IllIIlIIIIlI[#("xGO")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("5V")];Ninoo_lIlIllIllIIlI=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("0p8")]];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl+1]=Ninoo_lIlIllIllIIlI;Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl]=Ninoo_lIlIllIllIIlI[Ninoo_IllIIlIIIIlI[#("V7xX")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("Zq")]]=(Ninoo_IllIIlIIIIlI[#("N56")]~=0);Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("pX")]]=Ninoo_IllIIlIIIIlI[#("qr2")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("MH")]]=(Ninoo_IllIIlIIIIlI[#("Z2t")]~=0);Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("Lb")]]=Ninoo_IIlIlIIl[Ninoo_IllIIlIIIIlI[#("1l6")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("oo")]Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl](Ninoo_IIlllIllIllIlI(Ninoo_IlIllIIlIIIIIlIIIlIII,Ninoo_IllllllllIllllIIIIl+1,Ninoo_IllIIlIIIIlI[#("9eP")]))Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_lIlIllIIllIIl=Ninoo_IllIIlIIIIlI[#("50S")];else Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("fm")]]=Ninoo_lIIlIlll(Ninoo_IlIIllllIlllllllI[Ninoo_IllIIlIIIIlI[#("ih5")]],nil,Ninoo_IIlIlIIl);end;elseif Ninoo_IllllllllIllllIIIIl<=#("91WXxxJAzKMUZZzoIVEm0uZtUfienznuIfxjFT2EvFsTPSc8qC5")then if Ninoo_IllllllllIllllIIIIl<=#("iY3ObCcrnElaxrlTDoUY290vcfPcdkXWDOlUmShdRLq2ssxxG")then Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("kV")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("bXs")]];elseif Ninoo_IllllllllIllllIIIIl==#("FbShRi7HM6WancQAHSfCHUgQhrT8cUSsGVQWdu6dWPglrQxol2")then local Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("aJ")];local Ninoo_IIlIlIIl=Ninoo_IllIIlIIIIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{548;467;455;360};}];local Ninoo_IIIllIlIlIIlIlllIlll=Ninoo_IllllllllIllllIIIIl+2 local Ninoo_IllllllllIllllIIIIl={Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl](Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl+1],Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IIIllIlIlIIlIlllIlll])};for Ninoo_IllIIlIIIIlI=1,Ninoo_IIlIlIIl do Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IIIllIlIlIIlIlllIlll+Ninoo_IllIIlIIIIlI]=Ninoo_IllllllllIllllIIIIl[Ninoo_IllIIlIIIIlI];end;local Ninoo_IllllllllIllllIIIIl=Ninoo_IllllllllIllllIIIIl[1]if Ninoo_IllllllllIllllIIIIl then Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IIIllIlIlIIlIlllIlll]=Ninoo_IllllllllIllllIIIIl Ninoo_lIlIllIIllIIl=Ninoo_IllIIlIIIIlI[#("384")];else Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;end;else local Ninoo_IllllllllIllllIIIIl;Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("h3")]]=Ninoo_IIlIlIIl[Ninoo_IllIIlIIIIlI[#("10i")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("t5")]Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl]()Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_lIllIllIlIIlIIlII[Ninoo_IllIIlIIIIlI[#("YKx")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("ce")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("A2")]]=Ninoo_lIllIllIlIIlIIlII[Ninoo_IllIIlIIIIlI[#("JGI")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#{"1 + 1 = 111";{513;494;186;577};}]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("K0F")]][Ninoo_IllIIlIIIIlI[#("Vmcp")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("yG")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("LHe")]][Ninoo_IllIIlIIIIlI[#("eDcj")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("52")]][Ninoo_IllIIlIIIIlI[#("mnL")]]=Ninoo_IllIIlIIIIlI[#("P87n")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("2D")]]=Ninoo_lIllIllIlIIlIIlII[Ninoo_IllIIlIIIIlI[#("vph")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("LI")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#{"1 + 1 = 111";{867;487;40;166};"1 + 1 = 111";}]][Ninoo_IllIIlIIIIlI[#("GTWJ")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("oV")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("ry6")]][Ninoo_IllIIlIIIIlI[#("jTQZ")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("HY")]][Ninoo_IllIIlIIIIlI[#("6RN")]]=Ninoo_IllIIlIIIIlI[#("cytT")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("Ch")]]=Ninoo_lIllIllIlIIlIIlII[Ninoo_IllIIlIIIIlI[#("DJj")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("es")]][Ninoo_IllIIlIIIIlI[#("KUc")]]=Ninoo_IllIIlIIIIlI[#("e7ZN")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("6I")]]=Ninoo_IIlIlIIl[Ninoo_IllIIlIIIIlI[#("rH8")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("JZ")]]=Ninoo_IllIIlIIIIlI[#("3gv")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("43")]Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl](Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl+1])end;elseif Ninoo_IllllllllIllllIIIIl<=#("OreVU5baAA8E1oEEDx4vlWbP1O5zB4FXk8daC951cuHOYko7Yl41q")then if Ninoo_IllllllllIllllIIIIl>#("J2pz3g9NKF5lt3kDcDCdt1py1RA8Lo9NGOzlVdfY1zVbTM0uWujC")then local Ninoo_IllIIlIIIIlI=Ninoo_IllIIlIIIIlI[#("QW")];do return Ninoo_IIlllIllIllIlI(Ninoo_IlIllIIlIIIIIlIIIlIII,Ninoo_IllIIlIIIIlI,Ninoo_llllIlIIIIIII)end;else Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("3e")]]=Ninoo_IllIIlIIIIlI[#("p9L")];end;elseif Ninoo_IllllllllIllllIIIIl>#("nlSN1HmQbcuGrQQE9R9xNl5gnPp0elpeImsCRI3G3iZxAGB6k1XOke")then local Ninoo_lIllIllIlIIlIIlII;local Ninoo_IIlIlIIl;local Ninoo_IIlllIllIllIlI;local Ninoo_IllllllllIllllIIIIl;Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("6p")];Ninoo_IIlllIllIllIlI=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("CvJ")]];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl+1]=Ninoo_IIlllIllIllIlI;Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl]=Ninoo_IIlllIllIllIlI[Ninoo_IllIIlIIIIlI[#("cP3x")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("XT")]Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl](Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl+1])Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("CX")]]=Ninoo_IllIIlIIIIlI[#("oP4")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("v2")]]=#Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("3vZ")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#{"1 + 1 = 111";{372;37;369;547};}]]=Ninoo_IllIIlIIIIlI[#("4Uu")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("Mt")];Ninoo_IIlIlIIl=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl]Ninoo_lIllIllIlIIlIIlII=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl+2];if(Ninoo_lIllIllIlIIlIIlII>0)then if(Ninoo_IIlIlIIl>Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl+1])then Ninoo_lIlIllIIllIIl=Ninoo_IllIIlIIIIlI[#("e7K")];else Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl+3]=Ninoo_IIlIlIIl;end elseif(Ninoo_IIlIlIIl<Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl+1])then Ninoo_lIlIllIIllIIl=Ninoo_IllIIlIIIIlI[#("m6T")];else Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl+3]=Ninoo_IIlIlIIl;end else local Ninoo_IllllllllIllllIIIIl;Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("X9")]Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl]()Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_lIllIllIlIIlIIlII[Ninoo_IllIIlIIIIlI[#{{753;410;104;749};{415;504;123;9};{31;309;40;515};}]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("3s")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("bQ")]]=Ninoo_lIllIllIlIIlIIlII[Ninoo_IllIIlIIIIlI[#("bs4")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("KJ")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("fd2")]][Ninoo_IllIIlIIIIlI[#("rBoI")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("UO")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("avz")]][Ninoo_IllIIlIIIIlI[#("Wajx")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("aG")]][Ninoo_IllIIlIIIIlI[#("ZZr")]]=Ninoo_IllIIlIIIIlI[#("DyeN")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("Cq")]]=Ninoo_IIlIlIIl[Ninoo_IllIIlIIIIlI[#("SeC")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("oF")]]=Ninoo_IllIIlIIIIlI[#("VSJ")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("On")]Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl](Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl+1])Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_lIlIllIIllIIl=Ninoo_IllIIlIIIIlI[#("z9v")];end;elseif Ninoo_IllllllllIllllIIIIl<=#("bqMzmrvM0Wp7fynWBYDDEvIQRotPnyM4DzqlfiRnIG9KkIuI7exZRLsPS5S78QzCkuFQgbRrgo58x8Gj3VS")then if Ninoo_IllllllllIllllIIIIl<=#("bWn2fMDkBUp1hIzZdOC6yfTCPusUAJdn8pBzhMLFIH0x9e0YJRfosVV5cVmVsTU2Qc21h")then if Ninoo_IllllllllIllllIIIIl<=#{{990;665;880;932};"1 + 1 = 111";{534;811;647;827};{920;302;28;952};"1 + 1 = 111";{834;827;867;944};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{752;660;538;595};"1 + 1 = 111";{976;893;413;429};{865;707;980;192};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{516;700;951;995};"1 + 1 = 111";{640;9;190;402};{94;898;491;307};{843;987;390;890};{453;972;714;580};{951;30;627;830};"1 + 1 = 111";{245;586;355;288};{520;862;368;373};"1 + 1 = 111";{486;187;920;223};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{10;48;373;211};{16;423;771;229};{950;125;626;784};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{402;730;452;560};"1 + 1 = 111";{454;894;339;208};"1 + 1 = 111";{978;20;265;60};"1 + 1 = 111";{616;639;866;237};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{295;209;417;444};"1 + 1 = 111";{935;874;456;287};"1 + 1 = 111";{258;396;527;85};"1 + 1 = 111";}then if Ninoo_IllllllllIllllIIIIl<=#("GzFXMTZNIZKYPeYJyqUIZZHMe4QN7MY0zbWmVb5sKoJ0XY8pmOxrtU0Q22")then if Ninoo_IllllllllIllllIIIIl<=#("SdmQ6aTzOrLXvuB7LqQZp5BAsoGHPlgu3tnpyJNZdAu7M0b62WozlcCW")then Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("tH")]][Ninoo_IllIIlIIIIlI[#("MGa")]]=Ninoo_IllIIlIIIIlI[#("cHmB")];elseif Ninoo_IllllllllIllllIIIIl==#("WxRFlTClp4chlKcO1V0KEXCnJP36Rj01BNLl5u2Q2Vv69ZRmmVtqMmi94")then local Ninoo_lIlIllIIllIIl=Ninoo_IllIIlIIIIlI[#("Kd")]local Ninoo_IIIllIlIlIIlIlllIlll,Ninoo_IllIIlIIIIlI=Ninoo_IIIIIlIlI(Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_lIlIllIIllIIl](Ninoo_IIlllIllIllIlI(Ninoo_IlIllIIlIIIIIlIIIlIII,Ninoo_lIlIllIIllIIl+1,Ninoo_IllIIlIIIIlI[#("PTk")])))Ninoo_llllIlIIIIIII=Ninoo_IllIIlIIIIlI+Ninoo_lIlIllIIllIIl-1 local Ninoo_IllIIlIIIIlI=0;for Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl,Ninoo_llllIlIIIIIII do Ninoo_IllIIlIIIIlI=Ninoo_IllIIlIIIIlI+1;Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_lIlIllIIllIIl]=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_IllIIlIIIIlI];end;else local Ninoo_IllllllllIllllIIIIl;Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("bf")]]=Ninoo_IIlIlIIl[Ninoo_IllIIlIIIIlI[#("C1Y")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#{"1 + 1 = 111";{562;244;652;287};}]Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl]()Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_lIllIllIlIIlIIlII[Ninoo_IllIIlIIIIlI[#("1nN")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("XW")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#{{392;148;887;885};{526;180;326;301};}]]=Ninoo_lIllIllIlIIlIIlII[Ninoo_IllIIlIIIIlI[#("JPX")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("tL")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("OXt")]][Ninoo_IllIIlIIIIlI[#("RjtF")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("tv")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("C0A")]][Ninoo_IllIIlIIIIlI[#("RjtY")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("2j")]][Ninoo_IllIIlIIIIlI[#("TMI")]]=Ninoo_IllIIlIIIIlI[#("0ZAX")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=Ninoo_lIllIllIlIIlIIlII[Ninoo_IllIIlIIIIlI[#("RxF")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("Jo")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("udp")]][Ninoo_IllIIlIIIIlI[#("TEi6")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#{{677;334;789;381};{887;765;446;826};}]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#{"1 + 1 = 111";{851;535;705;998};"1 + 1 = 111";}]][Ninoo_IllIIlIIIIlI[#{{897;90;542;613};"1 + 1 = 111";{659;489;727;530};"1 + 1 = 111";}]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("Ga")]][Ninoo_IllIIlIIIIlI[#("pLs")]]=Ninoo_IllIIlIIIIlI[#("Q3lD")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("GS")]]=Ninoo_lIllIllIlIIlIIlII[Ninoo_IllIIlIIIIlI[#("e1T")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("OO")]][Ninoo_IllIIlIIIIlI[#("l81")]]=Ninoo_IllIIlIIIIlI[#("GDD2")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("4P")]]=Ninoo_IIlIlIIl[Ninoo_IllIIlIIIIlI[#("ms2")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("IH")]]=Ninoo_IllIIlIIIIlI[#("t11")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("Hu")]Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl](Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl+1])end;elseif Ninoo_IllllllllIllllIIIIl<=#("5H0GEgdlRI80TH3kSSCGoU8QU6ZJooEMrBAuZxrp2XhinvcXyCFBIzpkJjWI")then if Ninoo_IllllllllIllllIIIIl>#("E6DdxJrhJuuAlNBNZDy4clXUce3kpVPLU8z1Pe1XUQYgjbvVZHURyNorjTa")then if(Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("S9")]]~=Ninoo_IllIIlIIIIlI[#{"1 + 1 = 111";"1 + 1 = 111";{500;500;315;187};"1 + 1 = 111";}])then Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;else Ninoo_lIlIllIIllIIl=Ninoo_IllIIlIIIIlI[#("tSj")];end;else Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("5R")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("Tjy")]][Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("MRua")]]];end;elseif Ninoo_IllllllllIllllIIIIl>#("Qh2YPUQmoJ8VLLjxyQKbShvSb8mgUgS5dJhNYaCAuiHpJ8fXE24Di9KIVjWRH")then local Ninoo_lIllIllIlIIlIIlII;local Ninoo_IIlIlIIl;local Ninoo_IIlllIllIllIlI;local Ninoo_IllllllllIllllIIIIl;Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("Az")];Ninoo_IIlllIllIllIlI=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("ARS")]];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl+1]=Ninoo_IIlllIllIllIlI;Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl]=Ninoo_IIlllIllIllIlI[Ninoo_IllIIlIIIIlI[#("O8qQ")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("MY")]Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl](Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl+1])Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("2g")]]=Ninoo_IllIIlIIIIlI[#("sDC")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#{{296;877;608;386};"1 + 1 = 111";}]]=#Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("H2o")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("SX")]]=Ninoo_IllIIlIIIIlI[#("2Y4")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("QQ")];Ninoo_IIlIlIIl=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl]Ninoo_lIllIllIlIIlIIlII=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl+2];if(Ninoo_lIllIllIlIIlIIlII>0)then if(Ninoo_IIlIlIIl>Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl+1])then Ninoo_lIlIllIIllIIl=Ninoo_IllIIlIIIIlI[#("GQr")];else Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl+3]=Ninoo_IIlIlIIl;end elseif(Ninoo_IIlIlIIl<Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl+1])then Ninoo_lIlIllIIllIIl=Ninoo_IllIIlIIIIlI[#{"1 + 1 = 111";"1 + 1 = 111";{635;495;877;760};}];else Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl+3]=Ninoo_IIlIlIIl;end else local Ninoo_IllIIlIIIIlI=Ninoo_IllIIlIIIIlI[#("U8")];do return Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI](Ninoo_IIlllIllIllIlI(Ninoo_IlIllIIlIIIIIlIIIlIII,Ninoo_IllIIlIIIIlI+1,Ninoo_llllIlIIIIIII))end;end;elseif Ninoo_IllllllllIllllIIIIl<=#("Di1cRcDHIyokRJLgic3AN2lpXe8J1OnV2VQzyGrct6tHo8rb7PbUYh6K6MpNe4P4j")then if Ninoo_IllllllllIllllIIIIl<=#("s52lSMV0fQJPaYW7LmNE6UYgDWqO8zrzxUQviV6z87bqbqLB0htCrPHIhWT5vg2")then local Ninoo_lIlIllIIllIIl=Ninoo_IllIIlIIIIlI[#("If")]local Ninoo_IllllllllIllllIIIIl={Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_lIlIllIIllIIl](Ninoo_IIlllIllIllIlI(Ninoo_IlIllIIlIIIIIlIIIlIII,Ninoo_lIlIllIIllIIl+1,Ninoo_llllIlIIIIIII))};local Ninoo_IIIllIlIlIIlIlllIlll=0;for Ninoo_IllIIlIIIIlI=Ninoo_lIlIllIIllIIl,Ninoo_IllIIlIIIIlI[#("Iypy")]do Ninoo_IIIllIlIlIIlIlllIlll=Ninoo_IIIllIlIlIIlIlllIlll+1;Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI]=Ninoo_IllllllllIllllIIIIl[Ninoo_IIIllIlIlIIlIlllIlll];end elseif Ninoo_IllllllllIllllIIIIl>#("yjrqiAYZpnF9THell0Y0fZhRnhovcad2fu318urAsEmdkHYKSIUGrbLJcKcblDXo")then local Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#{{766;598;238;949};{391;394;188;934};}];local Ninoo_IIlIlIIl=Ninoo_IllIIlIIIIlI[#("Dngt")];local Ninoo_IIIllIlIlIIlIlllIlll=Ninoo_IllllllllIllllIIIIl+2 local Ninoo_IllllllllIllllIIIIl={Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl](Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl+1],Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IIIllIlIlIIlIlllIlll])};for Ninoo_IllIIlIIIIlI=1,Ninoo_IIlIlIIl do Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IIIllIlIlIIlIlllIlll+Ninoo_IllIIlIIIIlI]=Ninoo_IllllllllIllllIIIIl[Ninoo_IllIIlIIIIlI];end;local Ninoo_IllllllllIllllIIIIl=Ninoo_IllllllllIllllIIIIl[1]if Ninoo_IllllllllIllllIIIIl then Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IIIllIlIlIIlIlllIlll]=Ninoo_IllllllllIllllIIIIl Ninoo_lIlIllIIllIIl=Ninoo_IllIIlIIIIlI[#("0PH")];else Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;end;else local Ninoo_IIlIlIIl;local Ninoo_IllllllllIllllIIIIl;Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("C9")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("CYY")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("7L")];Ninoo_llllIlIIIIIII=Ninoo_IllllllllIllllIIIIl+Ninoo_lIIlIIllIlllIIIllIlIl-1;for Ninoo_IllIIlIIIIlI=Ninoo_IllllllllIllllIIIIl,Ninoo_llllIlIIIIIII do Ninoo_IIlIlIIl=Ninoo_IlIIllIll[Ninoo_IllIIlIIIIlI-Ninoo_IllllllllIllllIIIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI]=Ninoo_IIlIlIIl;end;Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("Mg")];do return Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl](Ninoo_IIlllIllIllIlI(Ninoo_IlIllIIlIIIIIlIIIlIII,Ninoo_IllllllllIllllIIIIl+1,Ninoo_llllIlIIIIIII))end;Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("bc")];do return Ninoo_IIlllIllIllIlI(Ninoo_IlIllIIlIIIIIlIIIlIII,Ninoo_IllllllllIllllIIIIl,Ninoo_llllIlIIIIIII)end;Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];do return end;end;elseif Ninoo_IllllllllIllllIIIIl<=#("N4yOnn1IyHMNeHQtPOFqHKdUtZyrqo0Q72INB5Et373E957dxRGZs8Nc1Oty0JrjR5Q")then if Ninoo_IllllllllIllllIIIIl==#("9c2TjkxKQJVy1u4JSbx8oFWWLgEtQUXdpWdtZWPiLdvr35GGPSBQIR6EqficQd36WR")then local Ninoo_IllllllllIllllIIIIl;Ninoo_IIlIlIIl[Ninoo_IllIIlIIIIlI[#("Eot")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("Qc")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("BO")]]=Ninoo_IIlIlIIl[Ninoo_IllIIlIIIIlI[#("p3G")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("VY")]]=Ninoo_IIlIlIIl[Ninoo_IllIIlIIIIlI[#("0br")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("Ub")]Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl](Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl+1])Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IIlIlIIl[Ninoo_IllIIlIIIIlI[#("N86")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("Ek")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("y2")]]=Ninoo_IIlIlIIl[Ninoo_IllIIlIIIIlI[#("YB8")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("GV")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#{{533;449;615;697};"1 + 1 = 111";"1 + 1 = 111";}]][Ninoo_IllIIlIIIIlI[#("Y80B")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IIlIlIIl[Ninoo_IllIIlIIIIlI[#("45h")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("2A")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("v6")]]=Ninoo_IIlIlIIl[Ninoo_IllIIlIIIIlI[#("64z")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("Jf")]]=Ninoo_IIlIlIIl[Ninoo_IllIIlIIIIlI[#("esz")]];else local Ninoo_IllllllllIllllIIIIl;local Ninoo_lIllIllIlIIlIIlII;local Ninoo_lIlIllIllIIlI,Ninoo_IlIIllIll;local Ninoo_lIIlIlll;local Ninoo_IllllllllIllllIIIIl;Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("IO")]]=Ninoo_IIlIlIIl[Ninoo_IllIIlIIIIlI[#("EzC")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("1e")]]=Ninoo_IIlIlIIl[Ninoo_IllIIlIIIIlI[#("jJm")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("6h")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("huk")]][Ninoo_IllIIlIIIIlI[#("yxHT")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("Rf")];Ninoo_lIIlIlll=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("ScU")]];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl+1]=Ninoo_lIIlIlll;Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl]=Ninoo_lIIlIlll[Ninoo_IllIIlIIIIlI[#("MU2U")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("yR")]Ninoo_lIlIllIllIIlI,Ninoo_IlIIllIll=Ninoo_IIIIIlIlI(Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl](Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl+1]))Ninoo_llllIlIIIIIII=Ninoo_IlIIllIll+Ninoo_IllllllllIllllIIIIl-1 Ninoo_lIllIllIlIIlIIlII=0;for Ninoo_IllIIlIIIIlI=Ninoo_IllllllllIllllIIIIl,Ninoo_llllIlIIIIIII do Ninoo_lIllIllIlIIlIIlII=Ninoo_lIllIllIlIIlIIlII+1;Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI]=Ninoo_lIlIllIllIIlI[Ninoo_lIllIllIlIIlIIlII];end;Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("zD")]Ninoo_lIlIllIllIIlI={Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl](Ninoo_IIlllIllIllIlI(Ninoo_IlIllIIlIIIIIlIIIlIII,Ninoo_IllllllllIllllIIIIl+1,Ninoo_llllIlIIIIIII))};Ninoo_lIllIllIlIIlIIlII=0;for Ninoo_IllIIlIIIIlI=Ninoo_IllllllllIllllIIIIl,Ninoo_IllIIlIIIIlI[#("v36H")]do Ninoo_lIllIllIlIIlIIlII=Ninoo_lIllIllIlIIlIIlII+1;Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI]=Ninoo_lIlIllIllIIlI[Ninoo_lIllIllIlIIlIIlII];end Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_lIlIllIIllIIl=Ninoo_IllIIlIIIIlI[#{{774;303;804;964};{749;188;177;644};{698;332;600;523};}];end;elseif Ninoo_IllllllllIllllIIIIl==#("fqKU6voxljE3PK8P8sgGIZKdTOMCIkzGlXBoe8FtstVtWmDDSy5OPlKqQHbrTXZaU8S2")then local Ninoo_IllIIlIIIIlI=Ninoo_IllIIlIIIIlI[#("Ko")];Ninoo_llllIlIIIIIII=Ninoo_IllIIlIIIIlI+Ninoo_lIIlIIllIlllIIIllIlIl-1;for Ninoo_lIlIllIIllIIl=Ninoo_IllIIlIIIIlI,Ninoo_llllIlIIIIIII do local Ninoo_IllIIlIIIIlI=Ninoo_IlIIllIll[Ninoo_lIlIllIIllIIl-Ninoo_IllIIlIIIIlI];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_lIlIllIIllIIl]=Ninoo_IllIIlIIIIlI;end;else local Ninoo_lIIlIlll;local Ninoo_IlIIllIll,Ninoo_IlllIIIIll;local Ninoo_lIlIllIllIIlI;local Ninoo_IllllllllIllllIIIIl;Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("aG")];Ninoo_lIlIllIllIIlI=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("4uK")]];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl+1]=Ninoo_lIlIllIllIIlI;Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl]=Ninoo_lIlIllIllIIlI[Ninoo_IllIIlIIIIlI[#("SNFa")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("eX")]]=Ninoo_IIlIlIIl[Ninoo_IllIIlIIIIlI[#("W2W")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("Ce")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("NJx")]][Ninoo_IllIIlIIIIlI[#("hmeB")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("Tm")]]=Ninoo_IllIIlIIIIlI[#("Kra")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("Zm")]]=Ninoo_IllIIlIIIIlI[#("8v3")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("QM")]]=Ninoo_IllIIlIIIIlI[#("hl2")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#{{165;151;662;21};"1 + 1 = 111";}]]=Ninoo_IllIIlIIIIlI[#("Vq6")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("1Y")]]=Ninoo_IllIIlIIIIlI[#("jz2")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("HF")]]=Ninoo_IllIIlIIIIlI[#("opU")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("j7")]]=Ninoo_IllIIlIIIIlI[#("Yh0")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("l9")]]=Ninoo_IllIIlIIIIlI[#("WqG")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("DH")]]=Ninoo_IllIIlIIIIlI[#("80r")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("xX")]]=Ninoo_IllIIlIIIIlI[#("bvb")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("sF")]]=Ninoo_IllIIlIIIIlI[#("2Va")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#{{299;609;474;376};{990;68;798;30};}]]=Ninoo_IllIIlIIIIlI[#("CaK")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("GI")]Ninoo_IlIIllIll,Ninoo_IlllIIIIll=Ninoo_IIIIIlIlI(Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl](Ninoo_IIlllIllIllIlI(Ninoo_IlIllIIlIIIIIlIIIlIII,Ninoo_IllllllllIllllIIIIl+1,Ninoo_IllIIlIIIIlI[#("63V")])))Ninoo_llllIlIIIIIII=Ninoo_IlllIIIIll+Ninoo_IllllllllIllllIIIIl-1 Ninoo_lIIlIlll=0;for Ninoo_IllIIlIIIIlI=Ninoo_IllllllllIllllIIIIl,Ninoo_llllIlIIIIIII do Ninoo_lIIlIlll=Ninoo_lIIlIlll+1;Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI]=Ninoo_IlIIllIll[Ninoo_lIIlIlll];end;Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("JT")]Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl](Ninoo_IIlllIllIllIlI(Ninoo_IlIllIIlIIIIIlIIIlIII,Ninoo_IllllllllIllllIIIIl+1,Ninoo_llllIlIIIIIII))Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("tW")]]=Ninoo_lIllIllIlIIlIIlII[Ninoo_IllIIlIIIIlI[#("Qdf")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("Ej")];Ninoo_lIlIllIllIIlI=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("I1K")]];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl+1]=Ninoo_lIlIllIllIIlI;Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl]=Ninoo_lIlIllIllIIlI[Ninoo_IllIIlIIIIlI[#("4aAO")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("LH")]]=(Ninoo_IllIIlIIIIlI[#("GLH")]~=0);Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("4s")]]=Ninoo_IllIIlIIIIlI[#("PtL")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("pI")]]=(Ninoo_IllIIlIIIIlI[#("9G2")]~=0);Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("1x")]]=Ninoo_IIlIlIIl[Ninoo_IllIIlIIIIlI[#("xzB")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("qs")]Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl](Ninoo_IIlllIllIllIlI(Ninoo_IlIllIIlIIIIIlIIIlIII,Ninoo_IllllllllIllllIIIIl+1,Ninoo_IllIIlIIIIlI[#("obR")]))Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_lIlIllIIllIIl=Ninoo_IllIIlIIIIlI[#("Iuv")];end;elseif Ninoo_IllllllllIllllIIIIl<=#("TKaXXmndpqGkjTjoV19mjIH6nKGFVKYELs8Y5029vnBpFgKdPV9hSPakcdKmQTsQDcK0Uvt59a16")then if Ninoo_IllllllllIllllIIIIl<=#("rCgaC09LRW6sXV2pPsN4VXDHTstCdhSXddVLEmo3seWpNI6KCQtRobvF9JqiHIHJeioUaqVD")then if Ninoo_IllllllllIllllIIIIl<=#{{535;965;392;839};"1 + 1 = 111";{40;189;539;310};{931;41;335;524};"1 + 1 = 111";{805;277;842;186};"1 + 1 = 111";"1 + 1 = 111";{271;940;737;234};{671;929;502;827};"1 + 1 = 111";{111;167;561;63};{271;446;476;913};"1 + 1 = 111";{938;657;469;875};{540;758;504;3};"1 + 1 = 111";"1 + 1 = 111";{337;852;826;165};{82;475;608;348};{147;987;64;650};"1 + 1 = 111";{515;902;431;398};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{689;96;519;792};{726;99;717;973};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{396;380;775;424};"1 + 1 = 111";{482;114;202;195};"1 + 1 = 111";{90;237;738;728};{878;942;468;70};{61;412;868;816};"1 + 1 = 111";"1 + 1 = 111";{997;978;907;290};{778;790;21;329};"1 + 1 = 111";"1 + 1 = 111";{565;496;192;851};{180;836;792;673};"1 + 1 = 111";{429;244;916;611};"1 + 1 = 111";{448;455;380;548};"1 + 1 = 111";{167;357;989;323};"1 + 1 = 111";{610;674;953;903};{160;574;38;847};"1 + 1 = 111";{520;403;252;84};"1 + 1 = 111";"1 + 1 = 111";{82;412;243;514};"1 + 1 = 111";{400;220;419;297};"1 + 1 = 111";{133;259;458;228};"1 + 1 = 111";}then Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("YE")]]=Ninoo_IIlIlIIl[Ninoo_IllIIlIIIIlI[#("Gs2")]];elseif Ninoo_IllllllllIllllIIIIl==#{{486;916;305;398};{457;512;814;570};"1 + 1 = 111";{124;234;136;700};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{844;931;99;210};{302;440;139;555};"1 + 1 = 111";{382;305;227;197};"1 + 1 = 111";{359;980;514;738};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{615;6;208;769};{786;458;155;129};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{103;215;455;977};{360;739;204;381};{148;890;518;135};{572;148;894;352};{238;673;142;907};"1 + 1 = 111";"1 + 1 = 111";{863;891;765;754};{139;679;366;919};{884;491;414;723};"1 + 1 = 111";{280;82;993;392};{379;230;212;481};{363;360;465;658};"1 + 1 = 111";{96;481;556;689};"1 + 1 = 111";{231;150;750;307};"1 + 1 = 111";{795;527;355;166};{83;921;139;869};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{360;383;486;198};{898;762;506;227};{384;961;391;554};{203;636;530;53};"1 + 1 = 111";{109;404;204;287};{638;921;273;706};{794;382;929;199};"1 + 1 = 111";"1 + 1 = 111";{140;399;190;871};"1 + 1 = 111";{28;411;394;936};{552;120;173;779};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{759;925;703;775};{394;815;997;423};"1 + 1 = 111";}then local Ninoo_lIllIllIlIIlIIlII;local Ninoo_IllllllllIllllIIIIl;Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("Si")]Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl](Ninoo_IIlllIllIllIlI(Ninoo_IlIllIIlIIIIIlIIIlIII,Ninoo_IllllllllIllllIIIIl+1,Ninoo_IllIIlIIIIlI[#("V72")]))Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("Xb")];Ninoo_lIllIllIlIIlIIlII=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("Vk8")]];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl+1]=Ninoo_lIllIllIlIIlIIlII;Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl]=Ninoo_lIllIllIlIIlIIlII[Ninoo_IllIIlIIIIlI[#("N04j")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("mK")]]=Ninoo_IllIIlIIIIlI[#("ojd")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("M1")]]={};Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("d8")]][Ninoo_IllIIlIIIIlI[#("APH")]]=Ninoo_IllIIlIIIIlI[#("qBI0")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("AW")]Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl](Ninoo_IIlllIllIllIlI(Ninoo_IlIllIIlIIIIIlIIIlIII,Ninoo_IllllllllIllllIIIIl+1,Ninoo_IllIIlIIIIlI[#("a70")]))Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("8z")]]=Ninoo_IIlIlIIl[Ninoo_IllIIlIIIIlI[#("MLe")]];else local Ninoo_llllIlIIIIIII=Ninoo_IlIIllllIlllllllI[Ninoo_IllIIlIIIIlI[#("jXt")]];local Ninoo_IIlllIllIllIlI;local Ninoo_IllllllllIllllIIIIl={};Ninoo_IIlllIllIllIlI=Ninoo_lllIlllIlllllIIIlIIlI({},{__index=function(Ninoo_lIlIllIIllIIl,Ninoo_IllIIlIIIIlI)local Ninoo_IllIIlIIIIlI=Ninoo_IllllllllIllllIIIIl[Ninoo_IllIIlIIIIlI];return Ninoo_IllIIlIIIIlI[1][Ninoo_IllIIlIIIIlI[2]];end,__newindex=function(Ninoo_IlIllIIlIIIIIlIIIlIII,Ninoo_IllIIlIIIIlI,Ninoo_lIlIllIIllIIl)local Ninoo_IllIIlIIIIlI=Ninoo_IllllllllIllllIIIIl[Ninoo_IllIIlIIIIlI]Ninoo_IllIIlIIIIlI[1][Ninoo_IllIIlIIIIlI[2]]=Ninoo_lIlIllIIllIIl;end;});for Ninoo_IIlIlIIl=1,Ninoo_IllIIlIIIIlI[#("YGG7")]do Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;local Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];if Ninoo_IllIIlIIIIlI[#("8")]==49 then Ninoo_IllllllllIllllIIIIl[Ninoo_IIlIlIIl-1]={Ninoo_IlIllIIlIIIIIlIIIlIII,Ninoo_IllIIlIIIIlI[#("oOu")]};else Ninoo_IllllllllIllllIIIIl[Ninoo_IIlIlIIl-1]={Ninoo_lIllIllIlIIlIIlII,Ninoo_IllIIlIIIIlI[#("BQj")]};end;Ninoo_IlllIIIIll[#Ninoo_IlllIIIIll+1]=Ninoo_IllllllllIllllIIIIl;end;Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("5E")]]=Ninoo_lIIlIlll(Ninoo_llllIlIIIIIII,Ninoo_IIlllIllIllIlI,Ninoo_IIlIlIIl);end;elseif Ninoo_IllllllllIllllIIIIl<=#("7s7Xv1SAOyEph9HIH2VGgb5kbPEgs0yI5fUPfQTmtmaF8DIB26Mb78D6xWWRyMhY95ubo2D0iJ")then if Ninoo_IllllllllIllllIIIIl>#("4bAlIgdovnxL6MYss4cYRelFdhHl9EV2zVJ56LnKuyVKNtyzBKj6gUFZZ5iAK1o2DFmkd3vSQ")then local Ninoo_IIIllIlIlIIlIlllIlll=Ninoo_IllIIlIIIIlI[#("PP")];local Ninoo_IIlIlIIl=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IIIllIlIlIIlIlllIlll+2];local Ninoo_IllllllllIllllIIIIl=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IIIllIlIlIIlIlllIlll]+Ninoo_IIlIlIIl;Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IIIllIlIlIIlIlllIlll]=Ninoo_IllllllllIllllIIIIl;if(Ninoo_IIlIlIIl>0)then if(Ninoo_IllllllllIllllIIIIl<=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IIIllIlIlIIlIlllIlll+1])then Ninoo_lIlIllIIllIIl=Ninoo_IllIIlIIIIlI[#{"1 + 1 = 111";{396;608;227;599};{856;600;94;513};}];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IIIllIlIlIIlIlllIlll+3]=Ninoo_IllllllllIllllIIIIl;end elseif(Ninoo_IllllllllIllllIIIIl>=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IIIllIlIlIIlIlllIlll+1])then Ninoo_lIlIllIIllIIl=Ninoo_IllIIlIIIIlI[#("Akp")];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IIIllIlIlIIlIlllIlll+3]=Ninoo_IllllllllIllllIIIIl;end else local Ninoo_IIIllIlIlIIlIlllIlll=Ninoo_IllIIlIIIIlI[#("Zs")];local Ninoo_IIlIlIIl=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IIIllIlIlIIlIlllIlll+2];local Ninoo_IllllllllIllllIIIIl=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IIIllIlIlIIlIlllIlll]+Ninoo_IIlIlIIl;Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IIIllIlIlIIlIlllIlll]=Ninoo_IllllllllIllllIIIIl;if(Ninoo_IIlIlIIl>0)then if(Ninoo_IllllllllIllllIIIIl<=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IIIllIlIlIIlIlllIlll+1])then Ninoo_lIlIllIIllIIl=Ninoo_IllIIlIIIIlI[#{{546;56;62;947};"1 + 1 = 111";"1 + 1 = 111";}];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IIIllIlIlIIlIlllIlll+3]=Ninoo_IllllllllIllllIIIIl;end elseif(Ninoo_IllllllllIllllIIIIl>=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IIIllIlIlIIlIlllIlll+1])then Ninoo_lIlIllIIllIIl=Ninoo_IllIIlIIIIlI[#("Y62")];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IIIllIlIlIIlIlllIlll+3]=Ninoo_IllllllllIllllIIIIl;end end;elseif Ninoo_IllllllllIllllIIIIl>#("EttM2TUhVAtYWOqUfbDX9Dj3hihmvInCqOqlGnczQDgZIOTI4sXuo2DbjAEULHWml1Ihyfo28dh")then local Ninoo_lIlIllIIllIIl=Ninoo_IllIIlIIIIlI[#("cF")]Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_lIlIllIIllIIl](Ninoo_IIlllIllIllIlI(Ninoo_IlIllIIlIIIIIlIIIlIII,Ninoo_lIlIllIIllIIl+1,Ninoo_IllIIlIIIIlI[#("CLs")]))else Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("2V")]]=#Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("2va")]];end;elseif Ninoo_IllllllllIllllIIIIl<=#("vuvDzKscU3nylpbfTsXiR3NQfLjZe5xkV5PZebuboTDsOk6idiiPp80CRPyYAD8ZGcNpKlbS8W47Btb")then if Ninoo_IllllllllIllllIIIIl<=#("OaV5WR5WfmhzNGLVVNWMIRJ1hAREd2axNDkzRccZh0kxdMeCkjmYIAy7C4XvaBSmmVVkvmdSL7FRG")then local Ninoo_IllIIlIIIIlI=Ninoo_IllIIlIIIIlI[#{{443;813;700;690};{533;470;551;149};}]local Ninoo_IIIllIlIlIIlIlllIlll,Ninoo_lIlIllIIllIIl=Ninoo_IIIIIlIlI(Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI](Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI+1]))Ninoo_llllIlIIIIIII=Ninoo_lIlIllIIllIIl+Ninoo_IllIIlIIIIlI-1 local Ninoo_lIlIllIIllIIl=0;for Ninoo_IllIIlIIIIlI=Ninoo_IllIIlIIIIlI,Ninoo_llllIlIIIIIII do Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI]=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];end;elseif Ninoo_IllllllllIllllIIIIl>#("XFvos4PmZnfm6XpQYQh7ks13f8gFmL4QBqgsaVhYI95IfjppD4iZJJbEOCiuYk9otzVQQ6PcItAkys")then local Ninoo_lIlIllIIllIIl=Ninoo_IllIIlIIIIlI[#("vR")]Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_lIlIllIIllIIl](Ninoo_IIlllIllIllIlI(Ninoo_IlIllIIlIIIIIlIIIlIII,Ninoo_lIlIllIIllIIl+1,Ninoo_IllIIlIIIIlI[#("0Xb")]))else local Ninoo_IllIIlIIIIlI=Ninoo_IllIIlIIIIlI[#("3N")]Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI](Ninoo_IIlllIllIllIlI(Ninoo_IlIllIIlIIIIIlIIIlIII,Ninoo_IllIIlIIIIlI+1,Ninoo_llllIlIIIIIII))end;elseif Ninoo_IllllllllIllllIIIIl<=#("6S0crCfh2pNOJNXax9RoRyKKGpfqpi0guOlM7hRWnr3BdrgAVtckQegJiqHcxY2TAGt4Bkcos5aAFjGni")then if Ninoo_IllllllllIllllIIIIl>#("G5gPBpHNERLPAAzjaI8m9KqX2VeRd9Vs4Rr6NUfdxXQvNOFKaui7p5Q5PsWPk0JE6sUThDHqD4Zl45jo")then local Ninoo_IllllllllIllllIIIIl;Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("9X")]]=Ninoo_IIlIlIIl[Ninoo_IllIIlIIIIlI[#("ZRS")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("r0")]Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl]()Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_lIllIllIlIIlIIlII[Ninoo_IllIIlIIIIlI[#("GFV")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("I0")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#{{342;933;870;268};{44;471;101;391};}]]=Ninoo_lIllIllIlIIlIIlII[Ninoo_IllIIlIIIIlI[#("3N1")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("Bh")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("v9I")]][Ninoo_IllIIlIIIIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{289;197;399;914};}]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("Vx")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("zBx")]][Ninoo_IllIIlIIIIlI[#("kDZN")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("YK")]][Ninoo_IllIIlIIIIlI[#("VW4")]]=Ninoo_IllIIlIIIIlI[#("krgh")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("4l")]]=Ninoo_lIllIllIlIIlIIlII[Ninoo_IllIIlIIIIlI[#("y9i")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("xK")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("Sfx")]][Ninoo_IllIIlIIIIlI[#("Ltov")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("UM")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("iPp")]][Ninoo_IllIIlIIIIlI[#("G8Wo")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("Eb")]][Ninoo_IllIIlIIIIlI[#("1Ov")]]=Ninoo_IllIIlIIIIlI[#("qfPk")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("TP")]]=Ninoo_lIllIllIlIIlIIlII[Ninoo_IllIIlIIIIlI[#("kKP")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("XI")]][Ninoo_IllIIlIIIIlI[#("T0Y")]]=Ninoo_IllIIlIIIIlI[#{"1 + 1 = 111";{990;64;672;203};"1 + 1 = 111";"1 + 1 = 111";}];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("3E")]]=Ninoo_IIlIlIIl[Ninoo_IllIIlIIIIlI[#("YzJ")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("nj")]]=Ninoo_IllIIlIIIIlI[#("ASZ")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("vz")]Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl](Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl+1])else local Ninoo_IllIIlIIIIlI=Ninoo_IllIIlIIIIlI[#("kL")]local Ninoo_IIIllIlIlIIlIlllIlll,Ninoo_lIlIllIIllIIl=Ninoo_IIIIIlIlI(Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI](Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI+1]))Ninoo_llllIlIIIIIII=Ninoo_lIlIllIIllIIl+Ninoo_IllIIlIIIIlI-1 local Ninoo_lIlIllIIllIIl=0;for Ninoo_IllIIlIIIIlI=Ninoo_IllIIlIIIIlI,Ninoo_llllIlIIIIIII do Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI]=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];end;end;elseif Ninoo_IllllllllIllllIIIIl==#("FQT1Xd8avqt7A2HnmAu3WCHX1FugEbUiIAQj0NioVSWlnsdbr7RFZvEcj59rT1GuHkA9mxyKqfidQuKJCs")then if(Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("Ce")]]==Ninoo_IllIIlIIIIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{206;895;553;209};}])then Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;else Ninoo_lIlIllIIllIIl=Ninoo_IllIIlIIIIlI[#{{507;703;610;352};{215;819;525;421};"1 + 1 = 111";}];end;else Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#{"1 + 1 = 111";{948;758;726;962};}]]=Ninoo_IllIIlIIIIlI[#("xEK")];end;elseif Ninoo_IllllllllIllllIIIIl<=#("Gtotm6Na4N1G3lBPc3dZ5JhoTnAxYuB0Ad9ar1ndJxE6AJo2oQIQyE36m9K9HqmJlaf0lBxkP9pJfkZj8IhhXVC6jcXsroHrj")then if Ninoo_IllllllllIllllIIIIl<=#("VzDyQXsxaznu1bkAa8jeWAJjQiNe3AD8zlABRK2tZAVdTZlVi1oIifiu0tSHkoEK5o6PMUTAg0ovPFA1726cl40tde")then if Ninoo_IllllllllIllllIIIIl<=#("x2ujL6khE2HjyhYBs0WPu30KsrCzazNMHjxIWQOAFy68ASI4yDIDrzpDcV1sFWgfp4MoVqPMlvk771jKUHbI1j")then if Ninoo_IllllllllIllllIIIIl<=#("h33GaZu5Tq0TGgtigY5r5osGkMrJ7UJngKEu2VPX1BBQgiOEAz4U52A3LyuzIV78RNM5M8qviiAEXMzc7XiJ")then local Ninoo_lIllIllIlIIlIIlII;local Ninoo_IllllllllIllllIIIIl;Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("k4")]]=Ninoo_IllIIlIIIIlI[#("qos")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("IY")]Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl](Ninoo_IIlllIllIllIlI(Ninoo_IlIllIIlIIIIIlIIIlIII,Ninoo_IllllllllIllllIIIIl+1,Ninoo_IllIIlIIIIlI[#("UqU")]))Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("yo")]]=Ninoo_IIlIlIIl[Ninoo_IllIIlIIIIlI[#("fei")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("YS")];Ninoo_lIllIllIlIIlIIlII=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("hfg")]];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl+1]=Ninoo_lIllIllIlIIlIIlII;Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl]=Ninoo_lIllIllIlIIlIIlII[Ninoo_IllIIlIIIIlI[#("kaqC")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("E8")]]=Ninoo_IllIIlIIIIlI[#("kpD")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("Y4")]Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl](Ninoo_IIlllIllIllIlI(Ninoo_IlIllIIlIIIIIlIIIlIII,Ninoo_IllllllllIllllIIIIl+1,Ninoo_IllIIlIIIIlI[#("H7m")]))Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("QR")]]=Ninoo_IIlIlIIl[Ninoo_IllIIlIIIIlI[#("0nF")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#{"1 + 1 = 111";{210;334;168;474};}]]=Ninoo_IIlIlIIl[Ninoo_IllIIlIIIIlI[#("sZ6")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("tK")];Ninoo_lIllIllIlIIlIIlII=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("a1I")]];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl+1]=Ninoo_lIllIllIlIIlIIlII;Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl]=Ninoo_lIllIllIlIIlIIlII[Ninoo_IllIIlIIIIlI[#("8uB4")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#{"1 + 1 = 111";{471;880;115;951};}]]=Ninoo_IllIIlIIIIlI[#("Ihi")];elseif Ninoo_IllllllllIllllIIIIl==#("ZsnkLTFApofED9EGS1CiILXC5f98sBUMzh2uyVaoV623uauN5Go6RBsoFWoGUGgYFDeuhjh70mxMS3g5UvdXl")then local Ninoo_IllIIlIIIIlI=Ninoo_IllIIlIIIIlI[#("Xy")];do return Ninoo_IIlllIllIllIlI(Ninoo_IlIllIIlIIIIIlIIIlIII,Ninoo_IllIIlIIIIlI,Ninoo_llllIlIIIIIII)end;else for Ninoo_IllIIlIIIIlI=Ninoo_IllIIlIIIIlI[#("oM")],Ninoo_IllIIlIIIIlI[#("PXt")]do Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI]=nil;end;end;elseif Ninoo_IllllllllIllllIIIIl<=#("58ZNZMGFFpZez259GWyrfEdRHMPtVyCtNRHgGEtGCvSgWOFo9U0rz4TB4igm6lUgXFBSuYEbC20UW642hBtaIk5S")then if Ninoo_IllllllllIllllIIIIl==#("flyxhJpLLtrmX3lqY0Ge8P7onfF2TJMKTUoMgPtsKikNMQuIiUTuzO9Aoijcex2cRSEcOJkjGnE0FuMIU7U80rk")then local Ninoo_IIlIlIIl;local Ninoo_IllllllllIllllIIIIl;Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("mv")]Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl](Ninoo_IIlllIllIllIlI(Ninoo_IlIllIIlIIIIIlIIIlIII,Ninoo_IllllllllIllllIIIIl+1,Ninoo_IllIIlIIIIlI[#("KO4")]))Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("BZ")];Ninoo_IIlIlIIl=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("VYv")]];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl+1]=Ninoo_IIlIlIIl;Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl]=Ninoo_IIlIlIIl[Ninoo_IllIIlIIIIlI[#("Erjj")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("nI")]]=Ninoo_IllIIlIIIIlI[#("aqr")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("mQ")]]={};Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("FO")]][Ninoo_IllIIlIIIIlI[#("b20")]]=Ninoo_IllIIlIIIIlI[#("LGuG")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("6P")]][Ninoo_IllIIlIIIIlI[#("WVC")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("fYPM")]];else Ninoo_lIllIllIlIIlIIlII[Ninoo_IllIIlIIIIlI[#("iBj")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("K6")]];end;elseif Ninoo_IllllllllIllllIIIIl>#{{503;752;481;469};{305;924;395;517};"1 + 1 = 111";{84;689;701;745};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{102;738;933;989};{820;896;892;596};"1 + 1 = 111";"1 + 1 = 111";{174;195;795;70};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{384;878;979;415};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{796;916;562;433};{263;123;550;851};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{184;256;899;800};"1 + 1 = 111";{239;526;231;410};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{878;707;764;852};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{670;652;234;364};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{943;102;617;607};"1 + 1 = 111";"1 + 1 = 111";{759;492;546;446};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{59;627;834;71};{395;594;276;61};"1 + 1 = 111";{821;72;155;191};"1 + 1 = 111";"1 + 1 = 111";{271;488;953;920};{851;256;782;615};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{849;61;613;549};"1 + 1 = 111";"1 + 1 = 111";{891;17;85;130};{978;815;399;817};{289;136;246;135};"1 + 1 = 111";"1 + 1 = 111";{226;760;279;1};"1 + 1 = 111";"1 + 1 = 111";{524;958;811;434};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{100;622;495;406};"1 + 1 = 111";{545;968;535;507};{270;129;166;720};"1 + 1 = 111";"1 + 1 = 111";{875;581;161;286};{40;787;784;945};"1 + 1 = 111";"1 + 1 = 111";}then if Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("fn")]]then Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;else Ninoo_lIlIllIIllIIl=Ninoo_IllIIlIIIIlI[#("IL9")];end;else Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("mb")]]={};end;elseif Ninoo_IllllllllIllllIIIIl<=#("5QXVn0RnC3tHE8Vcv3XbdvaLNleg1aK1usiTKjxvmtgLGUueSCKcTCNKPlibWKvCsCmk0bClGBYTpAe31azAAHh2PIeyb")then if Ninoo_IllllllllIllllIIIIl<=#("KN7PrdHjnQ9yHrO4uphojWk6bVutGr7ejj1lVKibvRWSAba0oVnZqWlXCbNGTmO6T5nyBCiUgf3DaDH9VFfUeiYy7dU")then local Ninoo_llllIlIIIIIII=Ninoo_IlIIllllIlllllllI[Ninoo_IllIIlIIIIlI[#{{904;239;699;297};{327;726;787;475};"1 + 1 = 111";}]];local Ninoo_IIlllIllIllIlI;local Ninoo_IllllllllIllllIIIIl={};Ninoo_IIlllIllIllIlI=Ninoo_lllIlllIlllllIIIlIIlI({},{__index=function(Ninoo_lIlIllIIllIIl,Ninoo_IllIIlIIIIlI)local Ninoo_IllIIlIIIIlI=Ninoo_IllllllllIllllIIIIl[Ninoo_IllIIlIIIIlI];return Ninoo_IllIIlIIIIlI[1][Ninoo_IllIIlIIIIlI[2]];end,__newindex=function(Ninoo_IlIllIIlIIIIIlIIIlIII,Ninoo_IllIIlIIIIlI,Ninoo_lIlIllIIllIIl)local Ninoo_IllIIlIIIIlI=Ninoo_IllllllllIllllIIIIl[Ninoo_IllIIlIIIIlI]Ninoo_IllIIlIIIIlI[1][Ninoo_IllIIlIIIIlI[2]]=Ninoo_lIlIllIIllIIl;end;});for Ninoo_IIlIlIIl=1,Ninoo_IllIIlIIIIlI[#("DkWe")]do Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;local Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];if Ninoo_IllIIlIIIIlI[#("D")]==49 then Ninoo_IllllllllIllllIIIIl[Ninoo_IIlIlIIl-1]={Ninoo_IlIllIIlIIIIIlIIIlIII,Ninoo_IllIIlIIIIlI[#("N10")]};else Ninoo_IllllllllIllllIIIIl[Ninoo_IIlIlIIl-1]={Ninoo_lIllIllIlIIlIIlII,Ninoo_IllIIlIIIIlI[#("sXn")]};end;Ninoo_IlllIIIIll[#Ninoo_IlllIIIIll+1]=Ninoo_IllllllllIllllIIIIl;end;Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("Ya")]]=Ninoo_lIIlIlll(Ninoo_llllIlIIIIIII,Ninoo_IIlllIllIllIlI,Ninoo_IIlIlIIl);elseif Ninoo_IllllllllIllllIIIIl>#("7MricZ9FYMzWMDSk2TX8FOUoh42Lg0AxSzXFYVAkEbljftiLBOFopVot2dbi7yy7mcemQmxhsNFDCLjXVqjDvlg7kENU")then Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("1p")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("DZR")]];else if Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("lL")]]then Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;else Ninoo_lIlIllIIllIIl=Ninoo_IllIIlIIIIlI[#("KnE")];end;end;elseif Ninoo_IllllllllIllllIIIIl<=#("qnfNn6cp55nrx5NpV1q4nxQo5Ma5gclKMyczz0oOgI0v6l8qDRzNvZG4H1SM6hi2TNP83n05NMYPHtrTOUDAOJoW2h2IiMS")then if Ninoo_IllllllllIllllIIIIl>#("A7NsH9yo0D9Tb0xmJ87mPSojz2gVvsXa4ZpJQ8mOvnKkKFVbVP8jPGuRTE4O3M3IQ9ZmLYHKVt0BidJ4heaRtNvzFI0meJ")then local Ninoo_IllIIlIIIIlI=Ninoo_IllIIlIIIIlI[#("Bo")];local Ninoo_lIlIllIIllIIl=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI];for Ninoo_IllIIlIIIIlI=Ninoo_IllIIlIIIIlI+1,Ninoo_llllIlIIIIIII do Ninoo_lIIIIIlIllIlllllIlIlIl(Ninoo_lIlIllIIllIIl,Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI])end;else Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("hb")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("qNW")]][Ninoo_IllIIlIIIIlI[#("jQEj")]];end;elseif Ninoo_IllllllllIllllIIIIl==#("UtbFKPJB7iyzuP3IP49HYMmncOASc7uGmJghgI8oJOcI5oaTM9krfb6hhYD6o0y9Y2lWJVBg5U8kKOrXNRfdWcAkM9asfc9S")then Ninoo_IIlIlIIl[Ninoo_IllIIlIIIIlI[#("vdm")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("Eg")]];else Ninoo_IIlIlIIl[Ninoo_IllIIlIIIIlI[#("FOj")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("z2")]];end;elseif Ninoo_IllllllllIllllIIIIl<=#("dUccok0IevudVIDGPtIUumVDajKVib3Uq4G3pVzGpFSReh1BHWASB7509KbeKeAcCKW1bJq45bF0Fdy2sinvMlts8Q4PTt5kePpFu9A8")then if Ninoo_IllllllllIllllIIIIl<=#("GXACfu6miWC1dBqqE2vPLkLftVZY3IsSp0fy413u7DKIEtbo9n1hes5umtiuGitLDTLnu2xM9aRhLcMaUKYPQlO75VlKSJZZj9fU")then if Ninoo_IllllllllIllllIIIIl<=#("X4h1oieLXUjRiL5tO5qfOsJQW4Al18M71r6QRYBdKvhbc3K83GFdYOeFuBeuS3UYimZ0OoM0EnGskIO3tCruDIimnCvqTfuQMt")then local Ninoo_lIlIllIIllIIl=Ninoo_IllIIlIIIIlI[#("W0")]Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_lIlIllIIllIIl]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_lIlIllIIllIIl](Ninoo_IIlllIllIllIlI(Ninoo_IlIllIIlIIIIIlIIIlIII,Ninoo_lIlIllIIllIIl+1,Ninoo_IllIIlIIIIlI[#("Yr9")]))elseif Ninoo_IllllllllIllllIIIIl==#("0dTtP4PJLiWtWXlbpLzvKdMNm2vgz2ZQ1PYZKiMBY8IeBhKDIefen7sWCfgWIIkSsfCh9vBh97IMFImes2JuXUD3xbyFbZ2pY0V")then local Ninoo_IllIIlIIIIlI=Ninoo_IllIIlIIIIlI[#("mP")];local Ninoo_lIlIllIIllIIl=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI];for Ninoo_IllIIlIIIIlI=Ninoo_IllIIlIIIIlI+1,Ninoo_llllIlIIIIIII do Ninoo_lIIIIIlIllIlllllIlIlIl(Ninoo_lIlIllIIllIIl,Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI])end;else local Ninoo_lIllIllIlIIlIIlII;local Ninoo_IllllllllIllllIIIIl;Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("Uh")];Ninoo_lIllIllIlIIlIIlII=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#{"1 + 1 = 111";"1 + 1 = 111";{55;744;695;217};}]];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl+1]=Ninoo_lIllIllIlIIlIIlII;Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl]=Ninoo_lIllIllIlIIlIIlII[Ninoo_IllIIlIIIIlI[#("FSuh")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("Bo")]]=Ninoo_IllIIlIIIIlI[#("cPn")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("Tz")]Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl](Ninoo_IIlllIllIllIlI(Ninoo_IlIllIIlIIIIIlIIIlIII,Ninoo_IllllllllIllllIIIIl+1,Ninoo_IllIIlIIIIlI[#("H7W")]))Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("vu")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("UAR")]][Ninoo_IllIIlIIIIlI[#("5OU5")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("qs")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("huW")]][Ninoo_IllIIlIIIIlI[#("tI7U")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("jUx")]][Ninoo_IllIIlIIIIlI[#("gghg")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IIlIlIIl[Ninoo_IllIIlIIIIlI[#("PRR")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("GD")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("AL")]]=Ninoo_IIlIlIIl[Ninoo_IllIIlIIIIlI[#("OeR")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("tY")];Ninoo_lIllIllIlIIlIIlII=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("ZMi")]];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl+1]=Ninoo_lIllIllIlIIlIIlII;Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl]=Ninoo_lIllIllIlIIlIIlII[Ninoo_IllIIlIIIIlI[#("xuPu")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("Wc")]]=Ninoo_IllIIlIIIIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("MP")]Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl](Ninoo_IIlllIllIllIlI(Ninoo_IlIllIIlIIIIIlIIIlIII,Ninoo_IllllllllIllllIIIIl+1,Ninoo_IllIIlIIIIlI[#("AYx")]))Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("QC")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("q4z")]][Ninoo_IllIIlIIIIlI[#("YJvM")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("B9")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#{{674;778;855;693};{905;715;531;383};{866;101;346;120};}]][Ninoo_IllIIlIIIIlI[#{{399;534;138;757};{575;707;721;500};{681;547;121;857};"1 + 1 = 111";}]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#{{852;645;777;575};"1 + 1 = 111";}]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("GG5")]][Ninoo_IllIIlIIIIlI[#{{65;131;725;880};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("6i")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("kgF")]][Ninoo_IllIIlIIIIlI[#("BdTg")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("Ei")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("8Jt")]][Ninoo_IllIIlIIIIlI[#("5ncN")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IIlIlIIl[Ninoo_IllIIlIIIIlI[#("qLE")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("xk")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("sR")]]=Ninoo_IIlIlIIl[Ninoo_IllIIlIIIIlI[#("qPW")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("Ut")];Ninoo_lIllIllIlIIlIIlII=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("Ske")]];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl+1]=Ninoo_lIllIllIlIIlIIlII;Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl]=Ninoo_lIllIllIlIIlIIlII[Ninoo_IllIIlIIIIlI[#("dJxb")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("ah")]]=Ninoo_IIlIlIIl[Ninoo_IllIIlIIIIlI[#("y8s")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("P6")]Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl](Ninoo_IIlllIllIllIlI(Ninoo_IlIllIIlIIIIIlIIIlIII,Ninoo_IllllllllIllllIIIIl+1,Ninoo_IllIIlIIIIlI[#("sMR")]))Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_lIlIllIIllIIl=Ninoo_IllIIlIIIIlI[#("cmQ")];end;elseif Ninoo_IllllllllIllllIIIIl<=#("QCEmN7fpARr33cDQ905JMIV786gjerYPW0z0yxR0PmEPTEL9vmq75mThRGoR16li3NhcONrMjf4AefoEuhX1a0TJhqi2i98SauWfxI")then if Ninoo_IllllllllIllllIIIIl==#("T5PY0ssdMrUxUitic3I5xEAEjglzTsihWWd6vb3qYnHKyNoJRmUmYM8pGkOTg4ttiNK7fyXbaqhi6ZgH1MSGJ6sjXYBkyjj34mCVc")then local Ninoo_IIlIlIIl;local Ninoo_IllllllllIllllIIIIl;Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("xT")]Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl](Ninoo_IIlllIllIllIlI(Ninoo_IlIllIIlIIIIIlIIIlIII,Ninoo_IllllllllIllllIIIIl+1,Ninoo_IllIIlIIIIlI[#("Qq0")]))Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("0K")];Ninoo_IIlIlIIl=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("ZqO")]];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl+1]=Ninoo_IIlIlIIl;Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl]=Ninoo_IIlIlIIl[Ninoo_IllIIlIIIIlI[#("jd9D")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("Il")]]=Ninoo_IllIIlIIIIlI[#("E4i")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("AC")]]={};Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]][Ninoo_IllIIlIIIIlI[#("ApY")]]=Ninoo_IllIIlIIIIlI[#("xsi0")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("v0")]][Ninoo_IllIIlIIIIlI[#("eoV")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("HIAO")]];else local Ninoo_lIIlIlll;local Ninoo_IlllIIIIll,Ninoo_IlIIllIll;local Ninoo_lIlIllIllIIlI;local Ninoo_IllllllllIllllIIIIl;Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("KA")];Ninoo_lIlIllIllIIlI=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("CKD")]];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl+1]=Ninoo_lIlIllIllIIlI;Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl]=Ninoo_lIlIllIllIIlI[Ninoo_IllIIlIIIIlI[#("522A")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("Zt")]]=Ninoo_IIlIlIIl[Ninoo_IllIIlIIIIlI[#("YUd")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("y6")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("2GA")]][Ninoo_IllIIlIIIIlI[#("sMIJ")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("8A")]]=Ninoo_IllIIlIIIIlI[#{{490;302;860;347};"1 + 1 = 111";"1 + 1 = 111";}];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("Kz")]]=Ninoo_IllIIlIIIIlI[#{{864;546;578;24};"1 + 1 = 111";{238;96;538;706};}];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("qJ")]]=Ninoo_IllIIlIIIIlI[#("Hn1")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("fO")]]=Ninoo_IllIIlIIIIlI[#("0Nu")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("SY")]]=Ninoo_IllIIlIIIIlI[#{{533;798;245;773};"1 + 1 = 111";{989;346;117;413};}];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("Z3")]]=Ninoo_IllIIlIIIIlI[#("Bu1")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("hC")]]=Ninoo_IllIIlIIIIlI[#{{697;551;882;485};"1 + 1 = 111";"1 + 1 = 111";}];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("dO")]]=Ninoo_IllIIlIIIIlI[#{"1 + 1 = 111";"1 + 1 = 111";{259;820;244;841};}];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("Vf")]]=Ninoo_IllIIlIIIIlI[#("EeT")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("EI")]]=Ninoo_IllIIlIIIIlI[#("YXD")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("RC")]]=Ninoo_IllIIlIIIIlI[#("puX")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("SK")]]=Ninoo_IllIIlIIIIlI[#("T9v")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("NZ")]Ninoo_IlllIIIIll,Ninoo_IlIIllIll=Ninoo_IIIIIlIlI(Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl](Ninoo_IIlllIllIllIlI(Ninoo_IlIllIIlIIIIIlIIIlIII,Ninoo_IllllllllIllllIIIIl+1,Ninoo_IllIIlIIIIlI[#("AbI")])))Ninoo_llllIlIIIIIII=Ninoo_IlIIllIll+Ninoo_IllllllllIllllIIIIl-1 Ninoo_lIIlIlll=0;for Ninoo_IllIIlIIIIlI=Ninoo_IllllllllIllllIIIIl,Ninoo_llllIlIIIIIII do Ninoo_lIIlIlll=Ninoo_lIIlIlll+1;Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI]=Ninoo_IlllIIIIll[Ninoo_lIIlIlll];end;Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#{"1 + 1 = 111";{243;630;382;86};}]Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl](Ninoo_IIlllIllIllIlI(Ninoo_IlIllIIlIIIIIlIIIlIII,Ninoo_IllllllllIllllIIIIl+1,Ninoo_llllIlIIIIIII))Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("dq")]]=Ninoo_lIllIllIlIIlIIlII[Ninoo_IllIIlIIIIlI[#("WMM")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("g1")];Ninoo_lIlIllIllIIlI=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("svm")]];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl+1]=Ninoo_lIlIllIllIIlI;Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl]=Ninoo_lIlIllIllIIlI[Ninoo_IllIIlIIIIlI[#("LHSA")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("2a")]]=(Ninoo_IllIIlIIIIlI[#("T3n")]~=0);Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("Tq")]]=Ninoo_IllIIlIIIIlI[#("o2a")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("s4")]]=(Ninoo_IllIIlIIIIlI[#("3en")]~=0);Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("MY")]]=Ninoo_IIlIlIIl[Ninoo_IllIIlIIIIlI[#{{295;938;191;863};{660;798;113;121};"1 + 1 = 111";}]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("5W")]Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl](Ninoo_IIlllIllIllIlI(Ninoo_IlIllIIlIIIIIlIIIlIII,Ninoo_IllllllllIllllIIIIl+1,Ninoo_IllIIlIIIIlI[#("HNv")]))Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_lIlIllIIllIIl=Ninoo_IllIIlIIIIlI[#("rBP")];end;elseif Ninoo_IllllllllIllllIIIIl>#("EtATlHFZsQdg2FmXVmtAjr6MN0hnoUxvFKizgZUWP7FUgqrPRgCpBNhmxYfvArLJsSMrxXR5CIVmWlFxICGirh41D5bsUyvyx6BzO9s")then Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#{{367;708;849;99};"1 + 1 = 111";}]]=(Ninoo_IllIIlIIIIlI[#("UFm")]~=0);else local Ninoo_lIllIllIlIIlIIlII;local Ninoo_IIlIlIIl;local Ninoo_IIlllIllIllIlI;local Ninoo_IllllllllIllllIIIIl;Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("5a")];Ninoo_IIlllIllIllIlI=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("Di7")]];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl+1]=Ninoo_IIlllIllIllIlI;Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl]=Ninoo_IIlllIllIllIlI[Ninoo_IllIIlIIIIlI[#{"1 + 1 = 111";"1 + 1 = 111";{99;473;21;154};"1 + 1 = 111";}]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("nl")]Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl](Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl+1])Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=Ninoo_IllIIlIIIIlI[#("Lr9")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("3a")]]=#Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("gJ9")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("eO")]]=Ninoo_IllIIlIIIIlI[#("9Kr")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("4M")];Ninoo_IIlIlIIl=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl]Ninoo_lIllIllIlIIlIIlII=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl+2];if(Ninoo_lIllIllIlIIlIIlII>0)then if(Ninoo_IIlIlIIl>Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl+1])then Ninoo_lIlIllIIllIIl=Ninoo_IllIIlIIIIlI[#("XHI")];else Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl+3]=Ninoo_IIlIlIIl;end elseif(Ninoo_IIlIlIIl<Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl+1])then Ninoo_lIlIllIIllIIl=Ninoo_IllIIlIIIIlI[#("eFd")];else Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl+3]=Ninoo_IIlIlIIl;end end;elseif Ninoo_IllllllllIllllIIIIl<=#("zHX314AksSX7VDqlYUZBWzkdlyZ0VgSJjMTVubaIG19cLyM3PpK4k1h9vTREeKAm9oYiTG0XUq54AiDYV6kFGYysEUzLtGD5BXcvKDkjzXj4")then if Ninoo_IllllllllIllllIIIIl<=#("nKnq3Tiz4Ql0GP9gpDoXaDNfgnrVbfSOExqjluAXtGHg1GeYkdjt5g5U6ijQByyZ8IviyZ44cCDE6HoKjEK76zTyBHmdkUv6hRitj5Avio")then if Ninoo_IllllllllIllllIIIIl>#("ENCXA3JG6XA3JY8S1N1UsfHvpz5AndoZRhoV8TWjLnAjSYJFlmITqF8yfgIb8is2ILlCKnUi0RieQyOBZBoaFGJmi0P2kVlC5HLgMg48D")then local Ninoo_IllllllllIllllIIIIl;Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("98")]]=Ninoo_lIllIllIlIIlIIlII[Ninoo_IllIIlIIIIlI[#("ay3")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("iz")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("obF")]][Ninoo_IllIIlIIIIlI[#("ZlVW")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("9b")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("Qjs")]][Ninoo_IllIIlIIIIlI[#("i52z")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#{{535;420;411;295};{333;95;922;319};}]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("gWz")]][Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("xXye")]]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("4d")]]=Ninoo_IllIIlIIIIlI[#("al9")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("al")]Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl](Ninoo_IIlllIllIllIlI(Ninoo_IlIllIIlIIIIIlIIIlIII,Ninoo_IllllllllIllllIIIIl+1,Ninoo_IllIIlIIIIlI[#("OGZ")]))else local Ninoo_lIIlIlll;local Ninoo_IlIIllIll,Ninoo_IlllIIIIll;local Ninoo_lIlIllIllIIlI;local Ninoo_IllllllllIllllIIIIl;Ninoo_IllllllllIllllIIIIl=Ninoo_IllIIlIIIIlI[#("yO")];Ninoo_lIlIllIllIIlI=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("itz")]];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl+1]=Ninoo_lIlIllIllIIlI;Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllllllllIllllIIIIl]=Ninoo_lIlIllIllIIlI[Ninoo_IllIIlIIIIlI[#("lR7v")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("xG")]]=Ninoo_IIlIlIIl[Ninoo_IllIIlIIIIlI[#("6BW")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("ez")]]=Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("frC")]][Ninoo_IllIIlIIIIlI[#("IFBT")]];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("zH")]]=Ninoo_IllIIlIIIIlI[#("zRh")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("fa")]]=Ninoo_IllIIlIIIIlI[#{{139;960;905;186};"1 + 1 = 111";"1 + 1 = 111";}];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("Da")]]=Ninoo_IllIIlIIIIlI[#("rHo")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("bW")]]=Ninoo_IllIIlIIIIlI[#{"1 + 1 = 111";{562;825;770;641};{632;456;934;484};}];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("Io")]]=Ninoo_IllIIlIIIIlI[#("Geb")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1;Ninoo_IllIIlIIIIlI=Ninoo_IIIllIlIlIIlIlllIlll[Ninoo_lIlIllIIllIIl];Ninoo_IlIllIIlIIIIIlIIIlIII[Ninoo_IllIIlIIIIlI[#("cE")]]=Ninoo_IllIIlIIIIlI[#("Jkj")];Ninoo_lIlIllIIllIIl=Ninoo_lIlIllIIllIIl+1