
a guest Feb 14th, 2012 255 Never
Not a member of Pastebin yet? Sign Up, it unlocks many cool features!
  1. )
  2.         String testSource = "Cl.OC(=O)C1=CC=CC=C1.O=C(CN2CCNCC2)NC3CCCOC3";
  4.         // Another, trickier input: non-consecutive atom numbers in components.
  5.         // String testSource = "Br1.O4CC2=CC=CC=C2.O=CN.C4C.C1C3CCCC(=O)C3.C=O";
  6.         Molecule testMol = MolImporter.importMol(testSource);
RAW Paste Data