UsernameRTX

Vehicle Simulator Car Noclip

May 14th, 2020 (edited)
235
Never
Not a member of Pastebin yet? Sign Up, it unlocks many cool features!
  1. --[[
  2. IronBrew:tm: obfuscation; Version 2.7.2
  3. ]]
  4. return(function(lllIllIIIlIIIlllIIllII,IlIIIIlllIIlIllIlIll,lIllllIllIllIIIIl)local IIIIIIllllllIll=string.char;local lIIllllllIllIlIll=string.sub;local lIlIIlIIll=table.concat;local lIllllIllllIIlllIlIlll=math.ldexp;local IlIllIll=getfenv or function()return _ENV end;local lIlllllIIIlIllIlIlI=select;local lIIlIIlIlllIlIlIIIIIlII=unpack or table.unpack;local IlIIIIlllIIlIllIlIll=tonumber;local lllllIllIllIlIIII='\222\197\197\197\197\198\197\197\197\132\154\244\197\196\197\197\197\243\197\192\197\197\197\128\179\160\171\177\197\193\197\197\197\162\164\168\160\197\207\197\197\197\130\160\177\150\160\183\179\172\166\160\197\212\197\197\197\151\160\181\169\172\166\164\177\160\161\150\177\170\183\164\162\160\197\200\197\197\197\147\160\173\172\166\169\160\128\179\160\171\177\182\197\201\197\197\197\147\160\173\172\166\169\160\151\160\162\160\171\197\207\197\197\197\131\172\183\160\150\160\183\179\160\183\197\193\197\197\197\178\164\172\177\198\197\197\197\197\197\197\37\250\197\194\197\197\197\149\169\164\188\160\183\182\197\206\197\197\197\137\170\166\164\169\149\169\164\188\160\183\197\203\197\197\197\131\172\171\161\149\169\164\188\160\183\182\134\164\183\197\194\197\197\197\135\170\161\188\174\172\177\197\205\197\197\197\134\170\169\169\172\161\160\183\197\194\197\197\197\145\170\176\166\173\160\161\197\194\197\197\197\134\170\171\171\160\166\177\197\204\197\197\197\146\170\183\174\182\181\164\166\160\197\205\197\197\197\147\160\173\172\166\169\160\182\197\194\197\197\197\134\173\164\182\182\172\182\197\206\197\197\197\147\160\173\172\166\169\160\150\160\164\177\197\207\197\197\197\150\172\168\166\173\164\182\182\172\182\197\194\197\197\197\136\170\161\176\169\160\182\197\201\197\197\197\147\160\173\172\166\169\160\150\160\164\177\182\197\206\197\197\197\182\160\164\177\154\181\169\164\188\160\183\197\201\197\197\197\140\171\179\170\174\160\150\160\183\179\160\183\197\199\197\197\197\205\197\197\197\197\192\197\197\197\181\164\172\183\182\197\204\197\197\197\178\170\183\174\182\181\164\166\160\197\205\197\197\197\147\160\173\172\166\169\160\182\197\206\197\197\197\130\160\177\134\173\172\169\161\183\160\171\197\203\197\197\197\131\172\171\161\131\172\183\182\177\134\173\172\169\161\197\192\197\197\197\170\178\171\160\183\197\192\197\197\197\147\164\169\176\160\197\193\197\197\197\139\164\168\160\197\197\197\197\197\211\197\197\197\215\203\197\197\197\196\197\197\197\215\197\197\196\197\199\197\197\197\229\197\197\196\197\196\197\198\197\229\197\197\196\197\196\197\193\197\197\197\197\196\197\199\197\197\197\197\197\197\197\197\197\197\199\197\193\197\197\197\197\214\197\196\197\229\207\197\192\197\193\197\192\197\215\219\197\194\197\195\197\197\197\197\209\197\192\197\194\197\199\197\195\195\197\195\197\200\197\196\197\192\197\193\215\197\197\197\200\197\196\197\229\222\197\195\197\192\197\194\197\197\245\197\194\197\197\197\197\197\229\222\197\194\197\194\197\205\197\195\217\197\195\197\214\197\196\197\194\197\193\215\197\197\197\214\197\196\197\197\232\197\193\197\196\197\197\197\197\198\197\193\197\199\197\197\197\195\239\197\197\197\194\197\196\197\199\197\193\215\197\197\197\194\197\196\197\197\223\197\197\197\196\197\197\197\211\197\197\197\205\197\197\197\205\197\197\197\205\197\197\197\205\197\197\197\205\197\197\197\205\197\197\197\205\197\197\197\204\197\197\197\204\197\197\197\204\197\197\197\207\197\197\197\207\197\197\197\207\197\197\197\206\197\197\197\206\197\197\197\206\197\197\197\206\197\197\197\201\197\197\197\200\197\197\197\205\197\197\197\203\197\197\197\213\197\197\197\195\197\197\197\197\204\197\197\197\178\170\183\174\182\181\164\166\160\197\194\197\197\197\145\160\183\183\164\172\171\197\198\197\197\197\140\182\132\197\193\197\197\197\149\164\183\177\197\207\197\197\197\134\164\171\134\170\169\169\172\161\160\196\197\196\197\197\197\197\206\197\197\197\215\233\197\196\197\196\197\197\197\229\222\197\196\197\196\197\199\197\195\201\197\197\197\207\197\196\197\196\197\193\215\197\197\197\207\197\196\197\229\207\197\196\197\197\197\198\197\215\219\197\198\197\193\197\197\197\197\209\197\196\197\198\197\199\197\195\197\197\196\197\207\197\196\197\197\197\193\215\197\197\197\207\197\196\197\245\244\197\197\197\192\197\195\197\197\223\197\197\197\196\197\197\197\206\197\197\197\214\197\197\197\214\197\197\197\214\197\197\197\214\197\197\197\209\197\197\197\209\197\197\197\209\197\197\197\209\197\197\197\209\197\197\197\208\197\197\197\221\197\197\197\254\197\197\197\215\246\197\197\197\199\197\197\197\215\197\197\197\197\196\197\197\197\215\197\197\197\197\193\197\197\197\229\197\197\197\197\197\197\192\197\215\197\197\199\197\195\197\197\197\197\197\197\197\197\199\197\199\197\229\197\197\197\197\197\197\194\197\229\197\197\197\197\197\197\205\197\215\197\197\197\197\198\197\197\197\215\197\197\197\197\198\197\197\197\229\207\197\197\197\197\197\204\197\215\212\197\199\197\196\197\197\197\197\197\197\197\197\199\197\196\197\215\197\197\197\197\207\197\197\197\215\197\197\196\197\206\197\197\197\197\197\197\197\197\199\197\196\197\215\197\197\197\197\193\197\197\197\229\197\197\197\197\197\197\201\197\229\197\197\197\197\197\197\200\197\197\197\197\196\197\196\197\197\197\195\242\197\199\197\197\197\196\197\199\197\197\204\197\197\197\197\197\197\197\197\204\197\197\197\196\197\197\197\215\253\197\199\197\203\197\197\197\215\197\197\199\197\203\197\197\197\197\197\197\199\197\196\197\199\197\197\197\197\196\197\199\197\197\197\229\197\197\199\197\196\197\202\197\229\197\197\199\197\199\197\213\197\229\197\197\199\197\199\197\212\197\229\197\197\199\197\199\197\215\197\199\227\197\193\197\196\197\197\197\197\211\197\199\197\193\197\196\197\215\197\197\199\197\207\197\197\197\215\197\197\198\197\206\197\197\197\197\197\197\199\197\199\197\196\197\215\197\197\199\197\193\197\197\197\229\197\197\199\197\199\197\192\197\215\197\197\193\197\214\197\197\197\197\197\197\199\197\193\197\199\197\229\197\197\199\197\199\197\209\197\229\197\197\199\197\199\197\199\197\229\222\197\199\197\199\197\208\197\229\213\197\199\197\199\197\211\197\215\197\197\199\197\196\197\197\197\215\197\197\199\197\193\197\197\197\229\197\197\199\197\199\197\192\197\215\197\197\193\197\195\197\197\197\197\197\197\199\197\193\197\199\197\229\197\197\199\197\199\197\210\197\229\197\197\199\197\199\197\221\197\229\197\197\199\197\199\197\220\197\229\197\197\199\197\199\197\223\197\215\235\197\199\197\198\197\197\197\215\252\197\199\197\198\197\197\197\229\197\197\199\197\199\197\222\197\215\197\197\193\197\196\197\197\197\197\197\197\199\197\193\197\196\197\197\197\197\197\197\196\197\197\197\254\197\197\197\196\197\197\197\196\197\197\197\199\197\197\197\199\197\197\197\199\197\197\197\199\197\197\197\199\197\197\197\199\197\197\197\199\197\197\197\198\197\197\197\198\197\197\197\198\197\197\197\198\197\197\197\193\197\197\197\193\197\197\197\193\197\197\197\192\197\197\197\192\197\197\197\192\197\197\197\195\197\197\197\213\197\197\197\213\197\197\197\213\197\197\197\194\197\197\197\212\197\197\197\212\197\197\197\212\197\197\197\215\197\197\197\215\197\197\197\215\197\197\197\215\197\197\197\221\197\197\197\215\197\197\197\220\197\197\197\220\197\197\197\220\197\197\197\223\197\197\197\223\197\197\197\223\197\197\197\223\197\197\197\223\197\197\197\223\197\197\197\223\197\197\197\223\197\197\197\223\197\197\197\222\197\197\197\222\197\197\197\222\197\197\197\222\197\197\197\222\197\197\197\222\197\197\197\222\197\197\197\222\197\197\197\222\197\197\197\217\197\197\197\217\197\197\197\217\197\197\197\217\197\197\197\217\197\197\197';local IlIIIIlllIIlIllIlIll=(bit or bit32);local IllllIIIllllIIlIIII=IlIIIIlllIIlIllIlIll and IlIIIIlllIIlIllIlIll.bxor or function(IlIIIIlllIIlIllIlIll,IlIllIlllll)local IIlIllllIlIlIllIllllllIl,IllllIIIllllIIlIIII,IIIllIlII=1,0,10 while IlIIIIlllIIlIllIlIll>0 and IlIllIlllll>0 do local IIIllIlII,lllIllIIIlIIIlllIIllII=IlIIIIlllIIlIllIlIll%2,IlIllIlllll%2 if IIIllIlII~=lllIllIIIlIIIlllIIllII then IllllIIIllllIIlIIII=IllllIIIllllIIlIIII+IIlIllllIlIlIllIllllllIl end IlIIIIlllIIlIllIlIll,IlIllIlllll,IIlIllllIlIlIllIllllllIl=(IlIIIIlllIIlIllIlIll-IIIllIlII)/2,(IlIllIlllll-lllIllIIIlIIIlllIIllII)/2,IIlIllllIlIlIllIllllllIl*2 end if IlIIIIlllIIlIllIlIll<IlIllIlllll then IlIIIIlllIIlIllIlIll=IlIllIlllll end while IlIIIIlllIIlIllIlIll>0 do local IlIllIlllll=IlIIIIlllIIlIllIlIll%2 if IlIllIlllll>0 then IllllIIIllllIIlIIII=IllllIIIllllIIlIIII+IIlIllllIlIlIllIllllllIl end IlIIIIlllIIlIllIlIll,IIlIllllIlIlIllIllllllIl=(IlIIIIlllIIlIllIlIll-IlIllIlllll)/2,IIlIllllIlIlIllIllllllIl*2 end return IllllIIIllllIIlIIII end local function IIlIllllIlIlIllIllllllIl(IIlIllllIlIlIllIllllllIl,IlIIIIlllIIlIllIlIll,IlIllIlllll)if IlIllIlllll then local IlIIIIlllIIlIllIlIll=(IIlIllllIlIlIllIllllllIl/2^(IlIIIIlllIIlIllIlIll-1))%2^((IlIllIlllll-1)-(IlIIIIlllIIlIllIlIll-1)+1);return IlIIIIlllIIlIllIlIll-IlIIIIlllIIlIllIlIll%1;else local IlIIIIlllIIlIllIlIll=2^(IlIIIIlllIIlIllIlIll-1);return(IIlIllllIlIlIllIllllllIl%(IlIIIIlllIIlIllIlIll+IlIIIIlllIIlIllIlIll)>=IlIIIIlllIIlIllIlIll)and 1 or 0;end;end;local IlIIIIlllIIlIllIlIll=1;local function IlIllIlllll()local lllIllIIIlIIIlllIIllII,IlIllIlllll,IIIllIlII,IIlIllllIlIlIllIllllllIl=lllIllIIIlIIIlllIIllII(lllllIllIllIlIIII,IlIIIIlllIIlIllIlIll,IlIIIIlllIIlIllIlIll+3);lllIllIIIlIIIlllIIllII=IllllIIIllllIIlIIII(lllIllIIIlIIIlllIIllII,197)IlIllIlllll=IllllIIIllllIIlIIII(IlIllIlllll,197)IIIllIlII=IllllIIIllllIIlIIII(IIIllIlII,197)IIlIllllIlIlIllIllllllIl=IllllIIIllllIIlIIII(IIlIllllIlIlIllIllllllIl,197)IlIIIIlllIIlIllIlIll=IlIIIIlllIIlIllIlIll+4;return(IIlIllllIlIlIllIllllllIl*16777216)+(IIIllIlII*65536)+(IlIllIlllll*256)+lllIllIIIlIIIlllIIllII;end;local function lIlIllIll()local IlIllIlllll=IllllIIIllllIIlIIII(lllIllIIIlIIIlllIIllII(lllllIllIllIlIIII,IlIIIIlllIIlIllIlIll,IlIIIIlllIIlIllIlIll),197);IlIIIIlllIIlIllIlIll=IlIIIIlllIIlIllIlIll+1;return IlIllIlllll;end;local function IIIllIlII()local IIlIllllIlIlIllIllllllIl,IlIllIlllll=lllIllIIIlIIIlllIIllII(lllllIllIllIlIIII,IlIIIIlllIIlIllIlIll,IlIIIIlllIIlIllIlIll+2);IIlIllllIlIlIllIllllllIl=IllllIIIllllIIlIIII(IIlIllllIlIlIllIllllllIl,197)IlIllIlllll=IllllIIIllllIIlIIII(IlIllIlllll,197)IlIIIIlllIIlIllIlIll=IlIIIIlllIIlIllIlIll+2;return(IlIllIlllll*256)+IIlIllllIlIlIllIllllllIl;end;local function lIlIllIIllIlIllIIllIllIII()local IllllIIIllllIIlIIII=IlIllIlllll();local IlIIIIlllIIlIllIlIll=IlIllIlllll();local IIIllIlII=1;local IllllIIIllllIIlIIII=(IIlIllllIlIlIllIllllllIl(IlIIIIlllIIlIllIlIll,1,20)*(2^32))+IllllIIIllllIIlIIII;local IlIllIlllll=IIlIllllIlIlIllIllllllIl(IlIIIIlllIIlIllIlIll,21,31);local IlIIIIlllIIlIllIlIll=((-1)^IIlIllllIlIlIllIllllllIl(IlIIIIlllIIlIllIlIll,32));if(IlIllIlllll==0)then if(IllllIIIllllIIlIIII==0)then return IlIIIIlllIIlIllIlIll*0;else IlIllIlllll=1;IIIllIlII=0;end;elseif(IlIllIlllll==2047)then return(IllllIIIllllIIlIIII==0)and(IlIIIIlllIIlIllIlIll*(1/0))or(IlIIIIlllIIlIllIlIll*(0/0));end;return lIllllIllllIIlllIlIlll(IlIIIIlllIIlIllIlIll,IlIllIlllll-1023)*(IIIllIlII+(IllllIIIllllIIlIIII/(2^52)));end;local lIllllIllllIIlllIlIlll=IlIllIlllll;local function llIlIllllIlllIllIIIlIIII(IlIllIlllll)local IIlIllllIlIlIllIllllllIl;if(not IlIllIlllll)then IlIllIlllll=lIllllIllllIIlllIlIlll();if(IlIllIlllll==0)then return'';end;end;IIlIllllIlIlIllIllllllIl=lIIllllllIllIlIll(lllllIllIllIlIIII,IlIIIIlllIIlIllIlIll,IlIIIIlllIIlIllIlIll+IlIllIlllll-1);IlIIIIlllIIlIllIlIll=IlIIIIlllIIlIllIlIll+IlIllIlllll;local IlIllIlllll={}for IlIIIIlllIIlIllIlIll=1,#IIlIllllIlIlIllIllllllIl do IlIllIlllll[IlIIIIlllIIlIllIlIll]=IIIIIIllllllIll(IllllIIIllllIIlIIII(lllIllIIIlIIIlllIIllII(lIIllllllIllIlIll(IIlIllllIlIlIllIllllllIl,IlIIIIlllIIlIllIlIll,IlIIIIlllIIlIllIlIll)),197))end return lIlIIlIIll(IlIllIlllll);end;local IlIIIIlllIIlIllIlIll=IlIllIlllll;local function lIlIIlIIll(...)return{...},lIlllllIIIlIllIlIlI('#',...)end local function IIIIIIllllllIll()local lIIllllllIllIlIll={};local lllIllIIIlIIIlllIIllII={};local lllllIllIllIlIIII={};local lIllllIllllIIlllIlIlll={[#{"1 + 1 = 111";{314;250;259;58};}]=lllIllIIIlIIIlllIIllII,[#{"1 + 1 = 111";{495;457;835;525};"1 + 1 = 111";}]=nil,[#{"1 + 1 = 111";{450;652;476;771};{285;181;673;859};"1 + 1 = 111";}]=lllllIllIllIlIIII,[#{"1 + 1 = 111";}]=lIIllllllIllIlIll,};local IlIIIIlllIIlIllIlIll=IlIllIlllll()local IllllIIIllllIIlIIII={}for IIlIllllIlIlIllIllllllIl=1,IlIIIIlllIIlIllIlIll do local IlIllIlllll=lIlIllIll();local IlIIIIlllIIlIllIlIll;if(IlIllIlllll==1)then IlIIIIlllIIlIllIlIll=(lIlIllIll()~=0);elseif(IlIllIlllll==3)then IlIIIIlllIIlIllIlIll=lIlIllIIllIlIllIIllIllIII();elseif(IlIllIlllll==0)then IlIIIIlllIIlIllIlIll=llIlIllllIlllIllIIIlIIII();end;IllllIIIllllIIlIIII[IIlIllllIlIlIllIllllllIl]=IlIIIIlllIIlIllIlIll;end;lIllllIllllIIlllIlIlll[3]=lIlIllIll();for IlIIIIlllIIlIllIlIll=1,IlIllIlllll()do lllIllIIIlIIIlllIIllII[IlIIIIlllIIlIllIlIll-1]=IIIIIIllllllIll();end;for lllllIllIllIlIIII=1,IlIllIlllll()do local IlIIIIlllIIlIllIlIll=lIlIllIll();if(IIlIllllIlIlIllIllllllIl(IlIIIIlllIIlIllIlIll,1,1)==0)then local lllIllIIIlIIIlllIIllII=IIlIllllIlIlIllIllllllIl(IlIIIIlllIIlIllIlIll,2,3);local lIIlIIlIlllIlIlIIIIIlII=IIlIllllIlIlIllIllllllIl(IlIIIIlllIIlIllIlIll,4,6);local IlIIIIlllIIlIllIlIll={IIIllIlII(),IIIllIlII(),nil,nil};if(lllIllIIIlIIIlllIIllII==0)then IlIIIIlllIIlIllIlIll[#("e6z")]=IIIllIlII();IlIIIIlllIIlIllIlIll[#("97Ej")]=IIIllIlII();elseif(lllIllIIIlIIIlllIIllII==1)then IlIIIIlllIIlIllIlIll[#("oJW")]=IlIllIlllll();elseif(lllIllIIIlIIIlllIIllII==2)then IlIIIIlllIIlIllIlIll[#("fGj")]=IlIllIlllll()-(2^16)elseif(lllIllIIIlIIIlllIIllII==3)then IlIIIIlllIIlIllIlIll[#("pGe")]=IlIllIlllll()-(2^16)IlIIIIlllIIlIllIlIll[#("ABjR")]=IIIllIlII();end;if(IIlIllllIlIlIllIllllllIl(lIIlIIlIlllIlIlIIIIIlII,1,1)==1)then IlIIIIlllIIlIllIlIll[#("cv")]=IllllIIIllllIIlIIII[IlIIIIlllIIlIllIlIll[#{{581;540;620;779};"1 + 1 = 111";}]]end if(IIlIllllIlIlIllIllllllIl(lIIlIIlIlllIlIlIIIIIlII,2,2)==1)then IlIIIIlllIIlIllIlIll[#("Mny")]=IllllIIIllllIIlIIII[IlIIIIlllIIlIllIlIll[#("Zm3")]]end if(IIlIllllIlIlIllIllllllIl(lIIlIIlIlllIlIlIIIIIlII,3,3)==1)then IlIIIIlllIIlIllIlIll[#("qhh6")]=IllllIIIllllIIlIIII[IlIIIIlllIIlIllIlIll[#("hAbi")]]end lIIllllllIllIlIll[lllllIllIllIlIIII]=IlIIIIlllIIlIllIlIll;end end;for IlIIIIlllIIlIllIlIll=1,IlIllIlllll()do lllllIllIllIlIIII[IlIIIIlllIIlIllIlIll]=IlIllIlllll();end;return lIllllIllllIIlllIlIlll;end;local IIlIIllllIlI=pcall local function llIlIllllIlllIllIIIlIIII(lIIllllllIllIlIll,lIllllIllllIIlllIlIlll,lllIllIIIlIIIlllIIllII)lIIllllllIllIlIll=(lIIllllllIllIlIll==true and IIIIIIllllllIll())or lIIllllllIllIlIll;return(function(...)local IlIllIlllll=1;local lIlIllIll=-1;local lIlIllIIllIlIllIIllIllIII={...};local lllllIllIllIlIIII=lIlllllIIIlIllIlIlI('#',...)-1;local IIIllIlII=lIIllllllIllIlIll[#{{865;223;612;85};}];local IllllIIIllllIIlIIII=lIIllllllIllIlIll[#{{194;221;520;117};"1 + 1 = 111";{796;745;448;685};}];local lIlllllIIIlIllIlIlI=lIIllllllIllIlIll[#{"1 + 1 = 111";"1 + 1 = 111";}];local function IIlIIIIllIlIIIlIlIIlllIlI()local IIIIIIllllllIll=lIlIIlIIll local lIlIIlIIll={};local lIIllllllIllIlIll={};local IIlIllllIlIlIllIllllllIl={};for IlIIIIlllIIlIllIlIll=0,lllllIllIllIlIIII do if(IlIIIIlllIIlIllIlIll>=IllllIIIllllIIlIIII)then lIlIIlIIll[IlIIIIlllIIlIllIlIll-IllllIIIllllIIlIIII]=lIlIllIIllIlIllIIllIllIII[IlIIIIlllIIlIllIlIll+1];else IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll]=lIlIllIIllIlIllIIllIllIII[IlIIIIlllIIlIllIlIll+1];end;end;local IlIIIIlllIIlIllIlIll=lllllIllIllIlIIII-IllllIIIllllIIlIIII+1 local IlIIIIlllIIlIllIlIll;local IllllIIIllllIIlIIII;while true do IlIIIIlllIIlIllIlIll=IIIllIlII[IlIllIlllll];IllllIIIllllIIlIIII=IlIIIIlllIIlIllIlIll[#("H")];if IllllIIIllllIIlIIII<=#("BirJjvnZSRuvLNMMNOAfibRRzjVO")then if IllllIIIllllIIlIIII<=#("n75kKRE7qkkV8")then if IllllIIIllllIIlIIII<=#("J5zxSG")then if IllllIIIllllIIlIIII<=#("HJ")then if IllllIIIllllIIlIIII<=#("")then if IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("l6")]]then IlIllIlllll=IlIllIlllll+1;else IlIllIlllll=IlIIIIlllIIlIllIlIll[#("2r4")];end;elseif IllllIIIllllIIlIIII==#("e")then local IlIllIlllll=IlIIIIlllIIlIllIlIll[#("xv")]local IIIllIlII={IIlIllllIlIlIllIllllllIl[IlIllIlllll](lIIlIIlIlllIlIlIIIIIlII(IIlIllllIlIlIllIllllllIl,IlIllIlllll+1,lIlIllIll))};local IllllIIIllllIIlIIII=0;for IlIIIIlllIIlIllIlIll=IlIllIlllll,IlIIIIlllIIlIllIlIll[#("lCC2")]do IllllIIIllllIIlIIII=IllllIIIllllIIlIIII+1;IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll]=IIIllIlII[IllllIIIllllIIlIIII];end else local IlIIIIlllIIlIllIlIll=IlIIIIlllIIlIllIlIll[#("UF")]local IllllIIIllllIIlIIII,IlIllIlllll=IIIIIIllllllIll(IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll](IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll+1]))lIlIllIll=IlIllIlllll+IlIIIIlllIIlIllIlIll-1 local IlIllIlllll=0;for IlIIIIlllIIlIllIlIll=IlIIIIlllIIlIllIlIll,lIlIllIll do IlIllIlllll=IlIllIlllll+1;IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll]=IllllIIIllllIIlIIII[IlIllIlllll];end;end;elseif IllllIIIllllIIlIIII<=#("CLka")then if IllllIIIllllIIlIIII==#("KBF")then do return IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("ZD")]]end else if(IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("IC")]]~=IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#{"1 + 1 = 111";"1 + 1 = 111";{801;868;231;98};"1 + 1 = 111";}]])then IlIllIlllll=IlIllIlllll+1;else IlIllIlllll=IlIIIIlllIIlIllIlIll[#("R11")];end;end;elseif IllllIIIllllIIlIIII==#("Akb5i")then local IllllIIIllllIIlIIII=IlIIIIlllIIlIllIlIll[#("6e")]local IIIllIlII={IIlIllllIlIlIllIllllllIl[IllllIIIllllIIlIIII](lIIlIIlIlllIlIlIIIIIlII(IIlIllllIlIlIllIllllllIl,IllllIIIllllIIlIIII+1,lIlIllIll))};local IlIllIlllll=0;for IlIIIIlllIIlIllIlIll=IllllIIIllllIIlIIII,IlIIIIlllIIlIllIlIll[#("igfP")]do IlIllIlllll=IlIllIlllll+1;IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll]=IIIllIlII[IlIllIlllll];end else local IllllIIIllllIIlIIII=IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("a8G5")]];if IllllIIIllllIIlIIII then IlIllIlllll=IlIllIlllll+1;else IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("9S")]]=IllllIIIllllIIlIIII;IlIllIlllll=IlIIIIlllIIlIllIlIll[#("doa")];end;end;elseif IllllIIIllllIIlIIII<=#("xEotjIhV9")then if IllllIIIllllIIlIIII<=#("chzQzds")then local IlIIIIlllIIlIllIlIll=IlIIIIlllIIlIllIlIll[#("Bq")]IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll](IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll+1])elseif IllllIIIllllIIlIIII==#("rcxgkKlH")then do return IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("N0")]]end else IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("n9")]]=IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("yOx")]];end;elseif IllllIIIllllIIlIIII<=#("ZGovWyukfNJ")then if IllllIIIllllIIlIIII==#("1tZknJCbYt")then local IlIllIlllll=IlIIIIlllIIlIllIlIll[#("LM")];local IllllIIIllllIIlIIII=IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("cBl")]];IIlIllllIlIlIllIllllllIl[IlIllIlllll+1]=IllllIIIllllIIlIIII;IIlIllllIlIlIllIllllllIl[IlIllIlllll]=IllllIIIllllIIlIIII[IlIIIIlllIIlIllIlIll[#("7VWy")]];else IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("QX")]][IlIIIIlllIIlIllIlIll[#("UVn")]]=IlIIIIlllIIlIllIlIll[#("CMb5")];end;elseif IllllIIIllllIIlIIII==#("2GOfqqsPiNJr")then if(IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("Xg")]]~=IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("y8zQ")]])then IlIllIlllll=IlIllIlllll+1;else IlIllIlllll=IlIIIIlllIIlIllIlIll[#("yXm")];end;else lIllllIllllIIlllIlIlll[IlIIIIlllIIlIllIlIll[#("FbD")]]=IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("uv")]];end;elseif IllllIIIllllIIlIIII<=#("VApUeGtBULBTI56aTFkG")then if IllllIIIllllIIlIIII<=#("v0ird3W7ArsbKzXs")then if IllllIIIllllIIlIIII<=#("7sa6i4nxTuvOzh")then local IllllIIIllllIIlIIII;local lllllIllIllIlIIII;local lIIllllllIllIlIll,llIlIllllIlllIllIIIlIIII;local lIllllIllllIIlllIlIlll;local IllllIIIllllIIlIIII;IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("MR")]]=lllIllIIIlIIIlllIIllII[IlIIIIlllIIlIllIlIll[#("dAS")]];IlIllIlllll=IlIllIlllll+1;IlIIIIlllIIlIllIlIll=IIIllIlII[IlIllIlllll];IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("TP")]]=lllIllIIIlIIIlllIIllII[IlIIIIlllIIlIllIlIll[#("OcE")]];IlIllIlllll=IlIllIlllll+1;IlIIIIlllIIlIllIlIll=IIIllIlII[IlIllIlllll];IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("Vg")]]=IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("OYR")]][IlIIIIlllIIlIllIlIll[#("HGLf")]];IlIllIlllll=IlIllIlllll+1;IlIIIIlllIIlIllIlIll=IIIllIlII[IlIllIlllll];IllllIIIllllIIlIIII=IlIIIIlllIIlIllIlIll[#("LY")];lIllllIllllIIlllIlIlll=IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#{"1 + 1 = 111";"1 + 1 = 111";{517;963;261;258};}]];IIlIllllIlIlIllIllllllIl[IllllIIIllllIIlIIII+1]=lIllllIllllIIlllIlIlll;IIlIllllIlIlIllIllllllIl[IllllIIIllllIIlIIII]=lIllllIllllIIlllIlIlll[IlIIIIlllIIlIllIlIll[#("jV7j")]];IlIllIlllll=IlIllIlllll+1;IlIIIIlllIIlIllIlIll=IIIllIlII[IlIllIlllll];IllllIIIllllIIlIIII=IlIIIIlllIIlIllIlIll[#("MU")]lIIllllllIllIlIll,llIlIllllIlllIllIIIlIIII=IIIIIIllllllIll(IIlIllllIlIlIllIllllllIl[IllllIIIllllIIlIIII](IIlIllllIlIlIllIllllllIl[IllllIIIllllIIlIIII+1]))lIlIllIll=llIlIllllIlllIllIIIlIIII+IllllIIIllllIIlIIII-1 lllllIllIllIlIIII=0;for IlIIIIlllIIlIllIlIll=IllllIIIllllIIlIIII,lIlIllIll do lllllIllIllIlIIII=lllllIllIllIlIIII+1;IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll]=lIIllllllIllIlIll[lllllIllIllIlIIII];end;IlIllIlllll=IlIllIlllll+1;IlIIIIlllIIlIllIlIll=IIIllIlII[IlIllIlllll];IllllIIIllllIIlIIII=IlIIIIlllIIlIllIlIll[#("NT")]lIIllllllIllIlIll={IIlIllllIlIlIllIllllllIl[IllllIIIllllIIlIIII](lIIlIIlIlllIlIlIIIIIlII(IIlIllllIlIlIllIllllllIl,IllllIIIllllIIlIIII+1,lIlIllIll))};lllllIllIllIlIIII=0;for IlIIIIlllIIlIllIlIll=IllllIIIllllIIlIIII,IlIIIIlllIIlIllIlIll[#("jcCB")]do lllllIllIllIlIIII=lllllIllIllIlIIII+1;IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll]=lIIllllllIllIlIll[lllllIllIllIlIIII];end IlIllIlllll=IlIllIlllll+1;IlIIIIlllIIlIllIlIll=IIIllIlII[IlIllIlllll];IlIllIlllll=IlIIIIlllIIlIllIlIll[#("1l4")];elseif IllllIIIllllIIlIIII==#("WgAKhCaMHDtthS7")then IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("IH")]]=IlIIIIlllIIlIllIlIll[#("bFp")];else local lIlIllIll;local IllllIIIllllIIlIIII;IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("ao")]]=IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("emv")]][IlIIIIlllIIlIllIlIll[#("i4gK")]];IlIllIlllll=IlIllIlllll+1;IlIIIIlllIIlIllIlIll=IIIllIlII[IlIllIlllll];lllIllIIIlIIIlllIIllII[IlIIIIlllIIlIllIlIll[#("PB0")]]=IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("W1")]];IlIllIlllll=IlIllIlllll+1;IlIIIIlllIIlIllIlIll=IIIllIlII[IlIllIlllll];IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("Qi")]]=lllIllIIIlIIIlllIIllII[IlIIIIlllIIlIllIlIll[#{{697;251;947;321};"1 + 1 = 111";{700;900;370;124};}]];IlIllIlllll=IlIllIlllll+1;IlIIIIlllIIlIllIlIll=IIIllIlII[IlIllIlllll];IllllIIIllllIIlIIII=IlIIIIlllIIlIllIlIll[#("pO")];lIlIllIll=IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("6AI")]];IIlIllllIlIlIllIllllllIl[IllllIIIllllIIlIIII+1]=lIlIllIll;IIlIllllIlIlIllIllllllIl[IllllIIIllllIIlIIII]=lIlIllIll[IlIIIIlllIIlIllIlIll[#("BQdK")]];IlIllIlllll=IlIllIlllll+1;IlIIIIlllIIlIllIlIll=IIIllIlII[IlIllIlllll];IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("5Z")]]=IlIIIIlllIIlIllIlIll[#{{295;857;422;753};{854;828;164;614};{81;777;518;20};}];IlIllIlllll=IlIllIlllll+1;IlIIIIlllIIlIllIlIll=IIIllIlII[IlIllIlllll];IllllIIIllllIIlIIII=IlIIIIlllIIlIllIlIll[#("F4")]IIlIllllIlIlIllIllllllIl[IllllIIIllllIIlIIII]=IIlIllllIlIlIllIllllllIl[IllllIIIllllIIlIIII](lIIlIIlIlllIlIlIIIIIlII(IIlIllllIlIlIllIllllllIl,IllllIIIllllIIlIIII+1,IlIIIIlllIIlIllIlIll[#("dmm")]))IlIllIlllll=IlIllIlllll+1;IlIIIIlllIIlIllIlIll=IIIllIlII[IlIllIlllll];IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("CD")]]=IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("ZoJ")]][IlIIIIlllIIlIllIlIll[#("JoU0")]];IlIllIlllll=IlIllIlllll+1;IlIIIIlllIIlIllIlIll=IIIllIlII[IlIllIlllll];IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("da")]]=IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("ge0")]][IlIIIIlllIIlIllIlIll[#("kRzF")]];IlIllIlllll=IlIllIlllll+1;IlIIIIlllIIlIllIlIll=IIIllIlII[IlIllIlllll];IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("Md")]]=IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("kK2")]][IlIIIIlllIIlIllIlIll[#("EyAu")]];IlIllIlllll=IlIllIlllll+1;IlIIIIlllIIlIllIlIll=IIIllIlII[IlIllIlllll];IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#{{564;796;443;803};"1 + 1 = 111";}]]=IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("QKJ")]][IlIIIIlllIIlIllIlIll[#("mXMV")]];end;elseif IllllIIIllllIIlIIII<=#("jSbI1Glm555tJAsbj3")then if IllllIIIllllIIlIIII>#("E9nkp6QDDZLfPWYm6")then IlIllIlllll=IlIIIIlllIIlIllIlIll[#("7Po")];else local IllllIIIllllIIlIIII;IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("SW")]]=lllIllIIIlIIIlllIIllII[IlIIIIlllIIlIllIlIll[#("v9b")]];IlIllIlllll=IlIllIlllll+1;IlIIIIlllIIlIllIlIll=IIIllIlII[IlIllIlllll];IllllIIIllllIIlIIII=IlIIIIlllIIlIllIlIll[#("VM")]IIlIllllIlIlIllIllllllIl[IllllIIIllllIIlIIII](lIIlIIlIlllIlIlIIIIIlII(IIlIllllIlIlIllIllllllIl,IllllIIIllllIIlIIII+1,IlIIIIlllIIlIllIlIll[#("O4C")]))IlIllIlllll=IlIllIlllll+1;IlIIIIlllIIlIllIlIll=IIIllIlII[IlIllIlllll];IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("C6")]]=lllIllIIIlIIIlllIIllII[IlIIIIlllIIlIllIlIll[#{{593;380;282;663};"1 + 1 = 111";{925;419;730;239};}]];IlIllIlllll=IlIllIlllll+1;IlIIIIlllIIlIllIlIll=IIIllIlII[IlIllIlllll];IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("ke")]]=IlIIIIlllIIlIllIlIll[#("aje")];IlIllIlllll=IlIllIlllll+1;IlIIIIlllIIlIllIlIll=IIIllIlII[IlIllIlllll];IllllIIIllllIIlIIII=IlIIIIlllIIlIllIlIll[#("su")]IIlIllllIlIlIllIllllllIl[IllllIIIllllIIlIIII](IIlIllllIlIlIllIllllllIl[IllllIIIllllIIlIIII+1])IlIllIlllll=IlIllIlllll+1;IlIIIIlllIIlIllIlIll=IIIllIlII[IlIllIlllll];IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("GQ")]]=lllIllIIIlIIIlllIIllII[IlIIIIlllIIlIllIlIll[#("2H5")]];IlIllIlllll=IlIllIlllll+1;IlIIIIlllIIlIllIlIll=IIIllIlII[IlIllIlllll];IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("fi")]]=IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("rqX")]][IlIIIIlllIIlIllIlIll[#("AjLF")]];IlIllIlllll=IlIllIlllll+1;IlIIIIlllIIlIllIlIll=IIIllIlII[IlIllIlllll];IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("vf")]]=IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("Hgu")]][IlIIIIlllIIlIllIlIll[#("E1Y2")]];IlIllIlllll=IlIllIlllll+1;IlIIIIlllIIlIllIlIll=IIIllIlII[IlIllIlllll];for IlIIIIlllIIlIllIlIll=IlIIIIlllIIlIllIlIll[#{"1 + 1 = 111";{23;128;524;666};}],IlIIIIlllIIlIllIlIll[#("zI8")]do IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll]=nil;end;end;elseif IllllIIIllllIIlIIII==#("KHq4mOmHRcgkrjoDEH5")then local lIlIllIll=lIlllllIIIlIllIlIlI[IlIIIIlllIIlIllIlIll[#("7Z1")]];local lIIlIIlIlllIlIlIIIIIlII;local IllllIIIllllIIlIIII={};lIIlIIlIlllIlIlIIIIIlII=lIllllIllIllIIIIl({},{__index=function(IlIllIlllll,IlIIIIlllIIlIllIlIll)local IlIIIIlllIIlIllIlIll=IllllIIIllllIIlIIII[IlIIIIlllIIlIllIlIll];return IlIIIIlllIIlIllIlIll[1][IlIIIIlllIIlIllIlIll[2]];end,__newindex=function(IIlIllllIlIlIllIllllllIl,IlIIIIlllIIlIllIlIll,IlIllIlllll)local IlIIIIlllIIlIllIlIll=IllllIIIllllIIlIIII[IlIIIIlllIIlIllIlIll]IlIIIIlllIIlIllIlIll[1][IlIIIIlllIIlIllIlIll[2]]=IlIllIlllll;end;});for lllIllIIIlIIIlllIIllII=1,IlIIIIlllIIlIllIlIll[#("1CbF")]do IlIllIlllll=IlIllIlllll+1;local IlIIIIlllIIlIllIlIll=IIIllIlII[IlIllIlllll];if IlIIIIlllIIlIllIlIll[#("9")]==9 then IllllIIIllllIIlIIII[lllIllIIIlIIIlllIIllII-1]={IIlIllllIlIlIllIllllllIl,IlIIIIlllIIlIllIlIll[#("niQ")]};else IllllIIIllllIIlIIII[lllIllIIIlIIIlllIIllII-1]={lIllllIllllIIlllIlIlll,IlIIIIlllIIlIllIlIll[#("NXY")]};end;lIIllllllIllIlIll[#lIIllllllIllIlIll+1]=IllllIIIllllIIlIIII;end;IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("ck")]]=llIlIllllIlllIllIIIlIIII(lIlIllIll,lIIlIIlIlllIlIlIIIIIlII,lllIllIIIlIIIlllIIllII);else local IlIllIlllll=IlIIIIlllIIlIllIlIll[#("M0")]IIlIllllIlIlIllIllllllIl[IlIllIlllll]=IIlIllllIlIlIllIllllllIl[IlIllIlllll](lIIlIIlIlllIlIlIIIIIlII(IIlIllllIlIlIllIllllllIl,IlIllIlllll+1,IlIIIIlllIIlIllIlIll[#("FbB")]))end;elseif IllllIIIllllIIlIIII<=#("VLkcTyuZqIVnvPJx8JXK8TpO")then if IllllIIIllllIIlIIII<=#("sIB1lsqrzL8vnlZsxpir3Y")then if IllllIIIllllIIlIIII>#("L1F4UvJcvHRA048epF67d")then local lIlIllIll;local IllllIIIllllIIlIIII;IllllIIIllllIIlIIII=IlIIIIlllIIlIllIlIll[#("KI")]IIlIllllIlIlIllIllllllIl[IllllIIIllllIIlIIII](lIIlIIlIlllIlIlIIIIIlII(IIlIllllIlIlIllIllllllIl,IllllIIIllllIIlIIII+1,IlIIIIlllIIlIllIlIll[#("Fiu")]))IlIllIlllll=IlIllIlllll+1;IlIIIIlllIIlIllIlIll=IIIllIlII[IlIllIlllll];IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("Gk")]]=lllIllIIIlIIIlllIIllII[IlIIIIlllIIlIllIlIll[#("UIf")]];IlIllIlllll=IlIllIlllll+1;IlIIIIlllIIlIllIlIll=IIIllIlII[IlIllIlllll];IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("hc")]]=IlIIIIlllIIlIllIlIll[#{"1 + 1 = 111";"1 + 1 = 111";{165;953;884;575};}];IlIllIlllll=IlIllIlllll+1;IlIIIIlllIIlIllIlIll=IIIllIlII[IlIllIlllll];IllllIIIllllIIlIIII=IlIIIIlllIIlIllIlIll[#("xq")]IIlIllllIlIlIllIllllllIl[IllllIIIllllIIlIIII](IIlIllllIlIlIllIllllllIl[IllllIIIllllIIlIIII+1])IlIllIlllll=IlIllIlllll+1;IlIIIIlllIIlIllIlIll=IIIllIlII[IlIllIlllll];IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("6U")]]=lllIllIIIlIIIlllIIllII[IlIIIIlllIIlIllIlIll[#("KeO")]];IlIllIlllll=IlIllIlllll+1;IlIIIIlllIIlIllIlIll=IIIllIlII[IlIllIlllll];IllllIIIllllIIlIIII=IlIIIIlllIIlIllIlIll[#("Of")];lIlIllIll=IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("vR3")]];IIlIllllIlIlIllIllllllIl[IllllIIIllllIIlIIII+1]=lIlIllIll;IIlIllllIlIlIllIllllllIl[IllllIIIllllIIlIIII]=lIlIllIll[IlIIIIlllIIlIllIlIll[#{{243;311;81;818};{104;706;564;600};"1 + 1 = 111";{130;721;624;505};}]];IlIllIlllll=IlIllIlllll+1;IlIIIIlllIIlIllIlIll=IIIllIlII[IlIllIlllll];IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("hU")]]=IlIIIIlllIIlIllIlIll[#("rol")];IlIllIlllll=IlIllIlllll+1;IlIIIIlllIIlIllIlIll=IIIllIlII[IlIllIlllll];IllllIIIllllIIlIIII=IlIIIIlllIIlIllIlIll[#{"1 + 1 = 111";"1 + 1 = 111";}]IIlIllllIlIlIllIllllllIl[IllllIIIllllIIlIIII]=IIlIllllIlIlIllIllllllIl[IllllIIIllllIIlIIII](lIIlIIlIlllIlIlIIIIIlII(IIlIllllIlIlIllIllllllIl,IllllIIIllllIIlIIII+1,IlIIIIlllIIlIllIlIll[#("1Td")]))IlIllIlllll=IlIllIlllll+1;IlIIIIlllIIlIllIlIll=IIIllIlII[IlIllIlllll];IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("Wi")]]=IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("D70")]][IlIIIIlllIIlIllIlIll[#("DN7E")]];IlIllIlllll=IlIllIlllll+1;IlIIIIlllIIlIllIlIll=IIIllIlII[IlIllIlllll];IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("nA")]]=IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("PX1")]][IlIIIIlllIIlIllIlIll[#("VFVl")]];else local IlIIIIlllIIlIllIlIll=IlIIIIlllIIlIllIlIll[#("9J")]IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll](IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll+1])end;elseif IllllIIIllllIIlIIII>#("aUy7qMDgvDE4Z9QyG50JNZH")then local IlIllIlllll=IlIIIIlllIIlIllIlIll[#("8T")]IIlIllllIlIlIllIllllllIl[IlIllIlllll](lIIlIIlIlllIlIlIIIIIlII(IIlIllllIlIlIllIllllllIl,IlIllIlllll+1,IlIIIIlllIIlIllIlIll[#("mIO")]))else IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("ra")]]=lllIllIIIlIIIlllIIllII[IlIIIIlllIIlIllIlIll[#("TWO")]];end;elseif IllllIIIllllIIlIIII<=#("9zyl2X71Ka1VHWf7Jokn55e9y2")then if IllllIIIllllIIlIIII==#("agE7lmM81nroJGNuZh50U039y")then for IlIIIIlllIIlIllIlIll=IlIIIIlllIIlIllIlIll[#("S8")],IlIIIIlllIIlIllIlIll[#("oiM")]do IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll]=nil;end;else do return end;end;elseif IllllIIIllllIIlIIII>#("sZduzXaY6UfdQI5XnTraLSsKo1D")then if(IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#{{141;401;306;108};{916;434;360;698};}]]==IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("NdsB")]])then IlIllIlllll=IlIllIlllll+1;else IlIllIlllll=IlIIIIlllIIlIllIlIll[#("jLF")];end;else IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("QQ")]]=IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("hpo")]][IlIIIIlllIIlIllIlIll[#("zOpO")]];end;elseif IllllIIIllllIIlIIII<=#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{69;896;197;782};{490;123;50;116};{830;747;142;443};"1 + 1 = 111";{462;339;106;724};"1 + 1 = 111";"1 + 1 = 111";{302;305;437;815};"1 + 1 = 111";{337;883;113;349};"1 + 1 = 111";{828;850;706;171};"1 + 1 = 111";"1 + 1 = 111";{312;687;534;773};{435;614;133;278};"1 + 1 = 111";"1 + 1 = 111";{655;576;58;534};"1 + 1 = 111";{810;190;240;553};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{41;325;447;441};"1 + 1 = 111";"1 + 1 = 111";{271;397;907;53};"1 + 1 = 111";{406;173;143;533};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{647;178;152;576};}then if IllllIIIllllIIlIIII<=#("4XW0jAtEAfgsHdXkEspBArjokWuPpsSWd4p")then if IllllIIIllllIIlIIII<=#("LmBgjMhp2rpEXtPv3BrNNIQyeOngxto")then if IllllIIIllllIIlIIII<=#("X2Kr1irYj4v3G126Ov3MNMrdGdcFy")then IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("Jy")]]=lIllllIllllIIlllIlIlll[IlIIIIlllIIlIllIlIll[#("6LK")]];elseif IllllIIIllllIIlIIII==#{{440;513;448;116};"1 + 1 = 111";{432;16;495;306};"1 + 1 = 111";{349;549;16;472};{182;57;378;696};{542;939;632;951};"1 + 1 = 111";"1 + 1 = 111";{742;718;6;941};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{375;890;492;769};"1 + 1 = 111";{492;779;599;530};{219;667;739;735};"1 + 1 = 111";{612;917;553;202};"1 + 1 = 111";"1 + 1 = 111";{817;890;320;708};"1 + 1 = 111";"1 + 1 = 111";{980;740;817;824};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{55;357;494;598};{606;814;510;864};}then IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IlIIIIlllIIlIllIlIll[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];else local IlIIIIlllIIlIllIlIll=IlIIIIlllIIlIllIlIll[#("6b")]local IllllIIIllllIIlIIII,IlIllIlllll=IIIIIIllllllIll(IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll](IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll+1]))lIlIllIll=IlIllIlllll+IlIIIIlllIIlIllIlIll-1 local IlIllIlllll=0;for IlIIIIlllIIlIllIlIll=IlIIIIlllIIlIllIlIll,lIlIllIll do IlIllIlllll=IlIllIlllll+1;IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll]=IllllIIIllllIIlIIII[IlIllIlllll];end;end;elseif IllllIIIllllIIlIIII<=#("XAjbX03k7lq1iDjiI1TlYSgI2iANFtnLQ")then if IllllIIIllllIIlIIII==#("xdtSz68dZflirjZdcPcNresLiOApPN7Q")then if(IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("lU")]]==IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("s2HW")]])then IlIllIlllll=IlIllIlllll+1;else IlIllIlllll=IlIIIIlllIIlIllIlIll[#("Yy2")];end;else IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#{"1 + 1 = 111";{659;546;200;753};}]]=IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("mx9")]];end;elseif IllllIIIllllIIlIIII>#("EggY0DWnU3axU1pXCrJJdxrUTJVHSymhG6")then IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("lx")]]=llIlIllllIlllIllIIIlIIII(lIlllllIIIlIllIlIlI[IlIIIIlllIIlIllIlIll[#("dEC")]],nil,lllIllIIIlIIIlllIIllII);else local IIIllIlII=IlIIIIlllIIlIllIlIll[#("j7")];local lllIllIIIlIIIlllIIllII=IlIIIIlllIIlIllIlIll[#{{415;381;671;544};"1 + 1 = 111";{560;132;351;761};"1 + 1 = 111";}];local IllllIIIllllIIlIIII=IIIllIlII+2 local IIIllIlII={IIlIllllIlIlIllIllllllIl[IIIllIlII](IIlIllllIlIlIllIllllllIl[IIIllIlII+1],IIlIllllIlIlIllIllllllIl[IllllIIIllllIIlIIII])};for IlIIIIlllIIlIllIlIll=1,lllIllIIIlIIIlllIIllII do IIlIllllIlIlIllIllllllIl[IllllIIIllllIIlIIII+IlIIIIlllIIlIllIlIll]=IIIllIlII[IlIIIIlllIIlIllIlIll];end;local IIIllIlII=IIIllIlII[1]if IIIllIlII then IIlIllllIlIlIllIllllllIl[IllllIIIllllIIlIIII]=IIIllIlII IlIllIlllll=IlIIIIlllIIlIllIlIll[#("KOF")];else IlIllIlllll=IlIllIlllll+1;end;end;elseif IllllIIIllllIIlIIII<=#("dTommpAHlsozWjDnuzgihYxfqRpFxQ20Xememex")then if IllllIIIllllIIlIIII<=#("NZgCEk8xpk1TzYQovj6Fa4kFAyMS7yaqbYFsS")then if IllllIIIllllIIlIIII==#("LgT3pmZjC8z7Tdi2sTOLcfIqz1jKSLtxGBIZ")then lllIllIIIlIIIlllIIllII[IlIIIIlllIIlIllIlIll[#("gFt")]]=IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#{{114;904;976;462};"1 + 1 = 111";}]];else local IlIIIIlllIIlIllIlIll=IlIIIIlllIIlIllIlIll[#{{823;744;434;502};"1 + 1 = 111";}]IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll]=IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll]()end;elseif IllllIIIllllIIlIIII==#("gO8Qp6Nt9P7ijFVOh3FICEydoB0PbBsGsgleQ4")then IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("6S")]]=llIlIllllIlllIllIIIlIIII(lIlllllIIIlIllIlIlI[IlIIIIlllIIlIllIlIll[#("Ccz")]],nil,lllIllIIIlIIIlllIIllII);else local IllllIIIllllIIlIIII=IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("lQMs")]];if IllllIIIllllIIlIIII then IlIllIlllll=IlIllIlllll+1;else IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("2f")]]=IllllIIIllllIIlIIII;IlIllIlllll=IlIIIIlllIIlIllIlIll[#("JKt")];end;end;elseif IllllIIIllllIIlIIII<=#("j46zmlCIfITzHcrtNq5CYf8sJxCZdtR8mhvNGfl1W")then if IllllIIIllllIIlIIII>#("VgrcVDbWJYUD7d6O00UNFW1VmAROYIedP5u1aHL8")then if IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("DP")]]then IlIllIlllll=IlIllIlllll+1;else IlIllIlllll=IlIIIIlllIIlIllIlIll[#("7N6")];end;else IlIllIlllll=IlIIIIlllIIlIllIlIll[#("kAU")];end;elseif IllllIIIllllIIlIIII==#("qV2nTjrR1ouhiy9pHZuWx8bTQXbTeNtoVZnb8HDpz7")then local IllllIIIllllIIlIIII=IlIIIIlllIIlIllIlIll[#{{19;7;688;820};"1 + 1 = 111";}];local lllIllIIIlIIIlllIIllII=IlIIIIlllIIlIllIlIll[#("WmhK")];local IIIllIlII=IllllIIIllllIIlIIII+2 local IllllIIIllllIIlIIII={IIlIllllIlIlIllIllllllIl[IllllIIIllllIIlIIII](IIlIllllIlIlIllIllllllIl[IllllIIIllllIIlIIII+1],IIlIllllIlIlIllIllllllIl[IIIllIlII])};for IlIIIIlllIIlIllIlIll=1,lllIllIIIlIIIlllIIllII do IIlIllllIlIlIllIllllllIl[IIIllIlII+IlIIIIlllIIlIllIlIll]=IllllIIIllllIIlIIII[IlIIIIlllIIlIllIlIll];end;local IllllIIIllllIIlIIII=IllllIIIllllIIlIIII[1]if IllllIIIllllIIlIIII then IIlIllllIlIlIllIllllllIl[IIIllIlII]=IllllIIIllllIIlIIII IlIllIlllll=IlIIIIlllIIlIllIlIll[#("p0v")];else IlIllIlllll=IlIllIlllll+1;end;else IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#{"1 + 1 = 111";{241;876;9;181};}]]=IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("LRV")]][IlIIIIlllIIlIllIlIll[#("9gNq")]];end;elseif IllllIIIllllIIlIIII<=#("sT6HHuLDRpmBsUiH5iIMn4gvtk8r9vfxAbS9UqEyDkN8Iz5rZa")then if IllllIIIllllIIlIIII<=#("h1uTyNLmxxtDuk0aqbjXOOjjdrhY5pRD9Y8FfstxidhbjR")then if IllllIIIllllIIlIIII<=#("YRyOpQn3DRlPfFWrhQ1EGlu58RWOLGi9vatgHLBWW5FY")then IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("Lg")]]=lllIllIIIlIIIlllIIllII[IlIIIIlllIIlIllIlIll[#("XTR")]];elseif IllllIIIllllIIlIIII>#("Nn1xWausnVMvCPI3Kr6JlsflQVGpeSLRHbuD5rZGYRioR")then lllIllIIIlIIIlllIIllII[IlIIIIlllIIlIllIlIll[#("f13")]]=IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("Ek")]];else lIllllIllllIIlllIlIlll[IlIIIIlllIIlIllIlIll[#("qUX")]]=IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#{"1 + 1 = 111";"1 + 1 = 111";}]];end;elseif IllllIIIllllIIlIIII<=#("e523lNIoStiQQaEeoFk5YBtf8sDAUEk1E5QLxkG7irsbuoLY")then if IllllIIIllllIIlIIII==#{{748;329;946;127};"1 + 1 = 111";"1 + 1 = 111";{109;694;532;854};{810;64;470;288};{64;897;635;177};"1 + 1 = 111";"1 + 1 = 111";{565;223;59;787};{797;544;692;528};{69;491;201;172};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{26;304;395;593};"1 + 1 = 111";{841;589;901;948};{734;985;913;918};{886;186;6;124};{137;762;608;73};"1 + 1 = 111";{306;427;377;435};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{794;754;474;340};{497;465;821;11};{350;288;857;334};"1 + 1 = 111";"1 + 1 = 111";{531;45;217;755};{555;887;172;296};"1 + 1 = 111";{73;801;113;792};{677;73;850;171};{723;384;719;310};{197;907;779;627};{946;607;173;505};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{125;591;915;856};{596;597;875;160};}then local IlIllIlllll=IlIIIIlllIIlIllIlIll[#("gH")]IIlIllllIlIlIllIllllllIl[IlIllIlllll](lIIlIIlIlllIlIlIIIIIlII(IIlIllllIlIlIllIllllllIl,IlIllIlllll+1,IlIIIIlllIIlIllIlIll[#("9Dn")]))else IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("lQ")]]=lIllllIllllIIlllIlIlll[IlIIIIlllIIlIllIlIll[#("dy0")]];end;elseif IllllIIIllllIIlIIII>#("e2ddZEjbzO0aAFscllFUDmNEEWr3hXxAVSdBQQ2knaM26RJIR")then do return end;else IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#{{762;490;823;246};"1 + 1 = 111";}]][IlIIIIlllIIlIllIlIll[#("Itu")]]=IlIIIIlllIIlIllIlIll[#{{621;296;955;607};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];end;elseif IllllIIIllllIIlIIII<=#("eAsqu1oJKcmp4MrBoRB1vGttGDLVIWmTmKS6hEymlhfZ87f9KGC2gZ")then if IllllIIIllllIIlIIII<=#("Jg8U2pEbX0Ddu3usVsoPoAEuIxLkbtuNxyi0iTG6Sfs9G4VfpmRJ")then if IllllIIIllllIIlIIII>#("j6jMNmFOt9EFZQ6VFkbXr7jhFZOLF5ZMWVnB9nFHarzfYEQoZuV")then for IlIIIIlllIIlIllIlIll=IlIIIIlllIIlIllIlIll[#{"1 + 1 = 111";{138;511;541;495};}],IlIIIIlllIIlIllIlIll[#("3OD")]do IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll]=nil;end;else local lIlIllIll;local IllllIIIllllIIlIIII;IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("Ys")]]=IlIIIIlllIIlIllIlIll[#("jHp")];IlIllIlllll=IlIllIlllll+1;IlIIIIlllIIlIllIlIll=IIIllIlII[IlIllIlllll];lllIllIIIlIIIlllIIllII[IlIIIIlllIIlIllIlIll[#("qUM")]]=IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("Kd")]];IlIllIlllll=IlIllIlllll+1;IlIIIIlllIIlIllIlIll=IIIllIlII[IlIllIlllll];IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("MF")]]=lllIllIIIlIIIlllIIllII[IlIIIIlllIIlIllIlIll[#("3aG")]];IlIllIlllll=IlIllIlllll+1;IlIIIIlllIIlIllIlIll=IIIllIlII[IlIllIlllll];IllllIIIllllIIlIIII=IlIIIIlllIIlIllIlIll[#("Nc")];lIlIllIll=IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("U71")]];IIlIllllIlIlIllIllllllIl[IllllIIIllllIIlIIII+1]=lIlIllIll;IIlIllllIlIlIllIllllllIl[IllllIIIllllIIlIIII]=lIlIllIll[IlIIIIlllIIlIllIlIll[#("qVDt")]];IlIllIlllll=IlIllIlllll+1;IlIIIIlllIIlIllIlIll=IIIllIlII[IlIllIlllll];IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("sr")]]=IlIIIIlllIIlIllIlIll[#("M71")];IlIllIlllll=IlIllIlllll+1;IlIIIIlllIIlIllIlIll=IIIllIlII[IlIllIlllll];IllllIIIllllIIlIIII=IlIIIIlllIIlIllIlIll[#("Zx")]IIlIllllIlIlIllIllllllIl[IllllIIIllllIIlIIII]=IIlIllllIlIlIllIllllllIl[IllllIIIllllIIlIIII](lIIlIIlIlllIlIlIIIIIlII(IIlIllllIlIlIllIllllllIl,IllllIIIllllIIlIIII+1,IlIIIIlllIIlIllIlIll[#("NTS")]))IlIllIlllll=IlIllIlllll+1;IlIIIIlllIIlIllIlIll=IIIllIlII[IlIllIlllll];IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("QE")]]=IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("1ug")]][IlIIIIlllIIlIllIlIll[#("Kfly")]];IlIllIlllll=IlIllIlllll+1;IlIIIIlllIIlIllIlIll=IIIllIlII[IlIllIlllll];IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#{{981;223;35;538};{854;682;641;646};}]]=IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("zGz")]][IlIIIIlllIIlIllIlIll[#("AKDQ")]];IlIllIlllll=IlIllIlllll+1;IlIIIIlllIIlIllIlIll=IIIllIlII[IlIllIlllll];lllIllIIIlIIIlllIIllII[IlIIIIlllIIlIllIlIll[#("yMY")]]=IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("Tr")]];IlIllIlllll=IlIllIlllll+1;IlIIIIlllIIlIllIlIll=IIIllIlII[IlIllIlllll];IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("aS")]]=lllIllIIIlIIIlllIIllII[IlIIIIlllIIlIllIlIll[#("FcF")]];end;elseif IllllIIIllllIIlIIII==#{{225;732;528;453};{524;81;367;876};"1 + 1 = 111";"1 + 1 = 111";{451;139;405;102};{30;116;372;743};"1 + 1 = 111";{46;986;80;742};"1 + 1 = 111";{506;364;69;903};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{482;122;8;655};{247;3;791;992};{487;328;276;643};"1 + 1 = 111";"1 + 1 = 111";{848;861;340;656};"1 + 1 = 111";{926;607;684;576};"1 + 1 = 111";{233;152;731;66};{461;385;846;471};"1 + 1 = 111";{606;716;267;399};"1 + 1 = 111";{1;853;779;471};"1 + 1 = 111";"1 + 1 = 111";{414;13;50;156};"1 + 1 = 111";"1 + 1 = 111";{803;528;169;471};{949;825;165;748};{528;589;430;484};"1 + 1 = 111";{90;146;668;390};"1 + 1 = 111";{99;987;170;428};"1 + 1 = 111";{901;605;302;282};{281;676;81;618};{217;326;919;824};"1 + 1 = 111";{304;839;762;729};{178;430;957;697};{75;295;643;469};{341;90;970;660};"1 + 1 = 111";{194;492;83;764};"1 + 1 = 111";"1 + 1 = 111";}then local IlIllIlllll=IlIIIIlllIIlIllIlIll[#("aV")]IIlIllllIlIlIllIllllllIl[IlIllIlllll]=IIlIllllIlIlIllIllllllIl[IlIllIlllll](lIIlIIlIlllIlIlIIIIIlII(IIlIllllIlIlIllIllllllIl,IlIllIlllll+1,IlIIIIlllIIlIllIlIll[#("1yS")]))else local IlIIIIlllIIlIllIlIll=IlIIIIlllIIlIllIlIll[#{"1 + 1 = 111";{685;852;181;602};}]IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll]=IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll]()end;elseif IllllIIIllllIIlIIII<=#("xl8KOTTgOjh9nx5S2C0Yj8GQ0IjvpHNCKQBTcLx5nacY8jWIbcUuDVuz")then if IllllIIIllllIIlIIII>#("rTfJy0gHQzI6lQqe5Ki5RSRWMunXr8YvbdU1rv0k6rrVoLZvDqIllD9")then local lIIlIIlIlllIlIlIIIIIlII;local IllllIIIllllIIlIIII;lllIllIIIlIIIlllIIllII[IlIIIIlllIIlIllIlIll[#{{436;377;70;913};{325;669;524;791};{437;534;707;241};}]]=IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("L4")]];IlIllIlllll=IlIllIlllll+1;IlIIIIlllIIlIllIlIll=IIIllIlII[IlIllIlllll];IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("10")]]=lllIllIIIlIIIlllIIllII[IlIIIIlllIIlIllIlIll[#("D4I")]];IlIllIlllll=IlIllIlllll+1;IlIIIIlllIIlIllIlIll=IIIllIlII[IlIllIlllll];IllllIIIllllIIlIIII=IlIIIIlllIIlIllIlIll[#("XD")]IIlIllllIlIlIllIllllllIl[IllllIIIllllIIlIIII]=IIlIllllIlIlIllIllllllIl[IllllIIIllllIIlIIII]()IlIllIlllll=IlIllIlllll+1;IlIIIIlllIIlIllIlIll=IIIllIlII[IlIllIlllll];IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("X2")]]=IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("WQO")]];IlIllIlllll=IlIllIlllll+1;IlIIIIlllIIlIllIlIll=IIIllIlII[IlIllIlllll];IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("Vj")]]=IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("Yc3")]][IlIIIIlllIIlIllIlIll[#("6CaV")]];IlIllIlllll=IlIllIlllll+1;IlIIIIlllIIlIllIlIll=IIIllIlII[IlIllIlllll];IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("ZQ")]]=IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("OhB")]][IlIIIIlllIIlIllIlIll[#("lGPm")]];IlIllIlllll=IlIllIlllll+1;IlIIIIlllIIlIllIlIll=IIIllIlII[IlIllIlllll];IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("pb")]]=IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("LeT")]][IlIIIIlllIIlIllIlIll[#("moqQ")]];IlIllIlllll=IlIllIlllll+1;IlIIIIlllIIlIllIlIll=IIIllIlII[IlIllIlllll];IllllIIIllllIIlIIII=IlIIIIlllIIlIllIlIll[#("f0")];lIIlIIlIlllIlIlIIIIIlII=IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("ig5")]];IIlIllllIlIlIllIllllllIl[IllllIIIllllIIlIIII+1]=lIIlIIlIlllIlIlIIIIIlII;IIlIllllIlIlIllIllllllIl[IllllIIIllllIIlIIII]=lIIlIIlIlllIlIlIIIIIlII[IlIIIIlllIIlIllIlIll[#("3VLP")]];else local lIlIllIll=lIlllllIIIlIllIlIlI[IlIIIIlllIIlIllIlIll[#("CN4")]];local lIIlIIlIlllIlIlIIIIIlII;local IllllIIIllllIIlIIII={};lIIlIIlIlllIlIlIIIIIlII=lIllllIllIllIIIIl({},{__index=function(IlIllIlllll,IlIIIIlllIIlIllIlIll)local IlIIIIlllIIlIllIlIll=IllllIIIllllIIlIIII[IlIIIIlllIIlIllIlIll];return IlIIIIlllIIlIllIlIll[1][IlIIIIlllIIlIllIlIll[2]];end,__newindex=function(IIlIllllIlIlIllIllllllIl,IlIIIIlllIIlIllIlIll,IlIllIlllll)local IlIIIIlllIIlIllIlIll=IllllIIIllllIIlIIII[IlIIIIlllIIlIllIlIll]IlIIIIlllIIlIllIlIll[1][IlIIIIlllIIlIllIlIll[2]]=IlIllIlllll;end;});for lllIllIIIlIIIlllIIllII=1,IlIIIIlllIIlIllIlIll[#("Bnri")]do IlIllIlllll=IlIllIlllll+1;local IlIIIIlllIIlIllIlIll=IIIllIlII[IlIllIlllll];if IlIIIIlllIIlIllIlIll[#("r")]==9 then IllllIIIllllIIlIIII[lllIllIIIlIIIlllIIllII-1]={IIlIllllIlIlIllIllllllIl,IlIIIIlllIIlIllIlIll[#("aPu")]};else IllllIIIllllIIlIIII[lllIllIIIlIIIlllIIllII-1]={lIllllIllllIIlllIlIlll,IlIIIIlllIIlIllIlIll[#("PGa")]};end;lIIllllllIllIlIll[#lIIllllllIllIlIll+1]=IllllIIIllllIIlIIII;end;IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("oM")]]=llIlIllllIlllIllIIIlIIII(lIlIllIll,lIIlIIlIlllIlIlIIIIIlII,lllIllIIIlIIIlllIIllII);end;elseif IllllIIIllllIIlIIII==#("ct7cNtoSKm4i6zWKU89zA5HaG1tbANjJdjZ8yXIMdKkcQQzdE8CnEKkgW")then local lIlIllIll;local IllllIIIllllIIlIIII;IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("ZN")]]=lllIllIIIlIIIlllIIllII[IlIIIIlllIIlIllIlIll[#("7DP")]];IlIllIlllll=IlIllIlllll+1;IlIIIIlllIIlIllIlIll=IIIllIlII[IlIllIlllll];IllllIIIllllIIlIIII=IlIIIIlllIIlIllIlIll[#("43")];lIlIllIll=IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("8y5")]];IIlIllllIlIlIllIllllllIl[IllllIIIllllIIlIIII+1]=lIlIllIll;IIlIllllIlIlIllIllllllIl[IllllIIIllllIIlIIII]=lIlIllIll[IlIIIIlllIIlIllIlIll[#{{820;14;733;857};{195;409;34;605};{428;9;590;702};{80;52;664;19};}]];IlIllIlllll=IlIllIlllll+1;IlIIIIlllIIlIllIlIll=IIIllIlII[IlIllIlllll];IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("Do")]]=lllIllIIIlIIIlllIIllII[IlIIIIlllIIlIllIlIll[#("iJK")]];IlIllIlllll=IlIllIlllll+1;IlIIIIlllIIlIllIlIll=IIIllIlII[IlIllIlllll];IllllIIIllllIIlIIII=IlIIIIlllIIlIllIlIll[#("hY")]IIlIllllIlIlIllIllllllIl[IllllIIIllllIIlIIII](lIIlIIlIlllIlIlIIIIIlII(IIlIllllIlIlIllIllllllIl,IllllIIIllllIIlIIII+1,IlIIIIlllIIlIllIlIll[#("7uD")]))IlIllIlllll=IlIllIlllll+1;IlIIIIlllIIlIllIlIll=IIIllIlII[IlIllIlllll];do return end;else local IlIllIlllll=IlIIIIlllIIlIllIlIll[#("38")];local IllllIIIllllIIlIIII=IIlIllllIlIlIllIllllllIl[IlIIIIlllIIlIllIlIll[#("9IB")]];IIlIllllIlIlIllIllllllIl[IlIllIlllll+1]=IllllIIIllllIIlIIII;IIlIllllIlIlIllIllllllIl[IlIllIlllll]=IllllIIIllllIIlIIII[IlIIIIlllIIlIllIlIll[#{"1 + 1 = 111";"1 + 1 = 111";{855;359;753;666};{85;863;932;302};}]];end;IlIllIlllll=IlIllIlllll+1;end;end;A,B=lIlIIlIIll(IIlIIllllIlI(IIlIIIIllIlIIIlIlIIlllIlI))if not A[1]then local IlIIIIlllIIlIllIlIll=lIIllllllIllIlIll[4][IlIllIlllll]or'?';error('ERROR IN IRONBREW SCRIPT [LINE '..IlIIIIlllIIlIllIlIll..']:'..A[2]);wait(9e9);else return lIIlIIlIlllIlIlIIIIIlII(A,2,B);end;end);end;return llIlIllllIlllIllIIIlIIII(true,{},IlIllIll())();end)(string.byte,table.insert,setmetatable);
RAW Paste Data