API tools faq
paste
Advertisement
Guest User

Untitled

a guest
Jun 18th, 2018
134
0
Never
Add comment
Not a member of Pastebin yet? Sign Up, it unlocks many cool features!
text 373.43 KB | None | 0 0
raw download clone embed print report
  1. -- Farewell infortality
  2. -- Revamp by ImFrostic, Version 2.81
  3.  
  4. -- Objects
  5.  
  6. local Framelogin = Instance.new("Frame")
  7. local Sumbit = Instance.new("TextLabel")
  8. local Title = Instance.new("TextLabel")
  9. local Username = Instance.new("TextBox")
  10. local Password = Instance.new("TextBox")
  11. local bar1 = Instance.new("Frame")
  12. local bar2 = Instance.new("Frame")
  13. local exit2 = Instance.new("TextButton")
  14. local MainMenu = Instance.new("Frame")
  15. local Credits = Instance.new("TextLabel")
  16. local barrr2 = Instance.new("Frame")
  17. local mexit = Instance.new("TextButton")
  18. local Tec99 = Instance.new("TextButton")
  19. local Rabit = Instance.new("TextButton")
  20. local Gun = Instance.new("TextButton")
  21. local GrabV3 = Instance.new("TextButton")
  22. local Working = Instance.new("TextButton")
  23. local gRABV4 = Instance.new("TextButton")
  24.  
  25. -- Properties
  26.  
  27. Framelogin.Name = "Frame login"
  28. Framelogin.Parent = game.StarterGui.Login
  29. Framelogin.BackgroundColor3 = Color3.new(0.117647, 0.117647, 0.117647)
  30. Framelogin.BorderColor3 = Color3.new(0, 0, 0)
  31. Framelogin.Position = UDim2.new(0.41511938, 0, 0.0889328048, 0)
  32. Framelogin.Size = UDim2.new(0, 301, 0, 385)
  33.  
  34. Sumbit.Name = "Sumbit"
  35. Sumbit.Parent = Framelogin
  36. Sumbit.BackgroundColor3 = Color3.new(0.0588235, 0.0588235, 0.0588235)
  37. Sumbit.BorderColor3 = Color3.new(0, 0, 0)
  38. Sumbit.Position = UDim2.new(0.228554547, 0, 0.788989246, 0)
  39. Sumbit.Size = UDim2.new(0, 124, 0, 50)
  40. Sumbit.Font = Enum.Font.SourceSans
  41. Sumbit.Text = "Login"
  42. Sumbit.TextColor3 = Color3.new(1, 1, 1)
  43. Sumbit.TextScaled = true
  44. Sumbit.TextSize = 14
  45. Sumbit.TextStrokeColor3 = Color3.new(1, 1, 1)
  46. Sumbit.TextWrapped = true
  47. Submit.MouseButton1Down:connect(function()
  48. Framelogin.Visible = false
  49. MainMenu.Visible = true
  50. end)
  51.  
  52.  
  53.  
  54.  
  55. Title.Name = "Title"
  56. Title.Parent = Framelogin
  57. Title.BackgroundColor3 = Color3.new(0.117647, 0.117647, 0.117647)
  58. Title.BorderColor3 = Color3.new(0.117647, 0.117647, 0.117647)
  59. Title.Position = UDim2.new(0.168239444, 0, 0.131281778, 0)
  60. Title.Size = UDim2.new(0, 227, 0, 50)
  61. Title.Font = Enum.Font.SourceSans
  62. Title.Text = "XMAKIRx Gui"
  63. Title.TextColor3 = Color3.new(1, 1, 1)
  64. Title.TextScaled = true
  65. Title.TextSize = 14
  66. Title.TextStrokeColor3 = Color3.new(1, 1, 1)
  67. Title.TextWrapped = true
  68.  
  69. Username.Name = "Username "
  70. Username.Parent = Framelogin
  71. Username.BackgroundColor3 = Color3.new(0.117647, 0.117647, 0.117647)
  72. Username.BorderColor3 = Color3.new(0, 0, 0)
  73. Username.BorderSizePixel = 3
  74. Username.Position = UDim2.new(0.102614135, 0, 0.375550538, 0)
  75. Username.Size = UDim2.new(0, 200, 0, 50)
  76. Username.Font = Enum.Font.SourceSans
  77. Username.PlaceholderColor3 = Color3.new(0.698039, 0.698039, 0.698039)
  78. Username.Text = "Username"
  79. Username.TextColor3 = Color3.new(1, 1, 1)
  80. Username.TextScaled = true
  81. Username.TextSize = 14
  82. Username.TextWrapped = true
  83.  
  84. Password.Name = "Password"
  85. Password.Parent = Framelogin
  86. Password.BackgroundColor3 = Color3.new(0.117647, 0.117647, 0.117647)
  87. Password.BorderColor3 = Color3.new(0, 0, 0)
  88. Password.BorderSizePixel = 3
  89. Password.Position = UDim2.new(0.102764279, 0, 0.569791079, 0)
  90. Password.Size = UDim2.new(0, 200, 0, 50)
  91. Password.Font = Enum.Font.SourceSans
  92. Password.PlaceholderColor3 = Color3.new(0.698039, 0.698039, 0.698039)
  93. Password.Text = "Password"
  94. Password.TextColor3 = Color3.new(1, 1, 1)
  95. Password.TextScaled = true
  96. Password.TextSize = 14
  97. Password.TextWrapped = true
  98.  
  99. bar1.Name = "bar1"
  100. bar1.Parent = Framelogin
  101. bar1.BackgroundColor3 = Color3.new(0.0588235, 0.0588235, 0.0588235)
  102. bar1.BorderSizePixel = 0
  103. bar1.Position = UDim2.new(5.96046448e-08, 0, 0, 0)
  104. bar1.Size = UDim2.new(0, 301, 0, 22)
  105.  
  106. bar2.Name = "bar2"
  107. bar2.Parent = Framelogin
  108. bar2.BackgroundColor3 = Color3.new(0.0588235, 0.0588235, 0.0588235)
  109. bar2.BorderSizePixel = 0
  110. bar2.Position = UDim2.new(0.00113357604, 0, 0.0567502901, 0)
  111. bar2.Size = UDim2.new(0, 301, 0, 22)
  112.  
  113. exit2.Name = "exit2"
  114. exit2.Parent = Framelogin
  115. exit2.BackgroundColor3 = Color3.new(0.117647, 0.117647, 0.117647)
  116. exit2.BorderColor3 = Color3.new(0.117647, 0.117647, 0.117647)
  117. exit2.Position = UDim2.new(0.924215794, 0, 0, 0)
  118. exit2.Size = UDim2.new(0, 23, 0, 25)
  119. exit2.Font = Enum.Font.SourceSans
  120. exit2.Text = "X"
  121. exit2.TextColor3 = Color3.new(1, 1, 1)
  122. exit2.TextSize = 14
  123. exit2.MouseButton1Down:connect(function()
  124. Framelogin.Visible = false
  125. end)
  126.  
  127.  
  128.  
  129.  
  130. MainMenu.Name = "MainMenu"
  131. MainMenu.Parent = Framelogin
  132. MainMenu.BackgroundColor3 = Color3.new(0.117647, 0.117647, 0.117647)
  133. MainMenu.BorderColor3 = Color3.new(0.117647, 0.117647, 0.117647)
  134. MainMenu.Position = UDim2.new(0.175890088, 0, 0.0671936721, 0)
  135. MainMenu.Size = UDim2.new(0, 360, 0, 385)
  136. MainMenu.Visible = false
  137.  
  138. Credits.Name = "Credits"
  139. Credits.Parent = MainMenu
  140. Credits.BackgroundColor3 = Color3.new(0.117647, 0.117647, 0.117647)
  141. Credits.BorderColor3 = Color3.new(0.117647, 0.117647, 0.117647)
  142. Credits.Position = UDim2.new(-0.000574707985, 0, 0.870581567, 0)
  143. Credits.Size = UDim2.new(0, 200, 0, 50)
  144. Credits.Font = Enum.Font.SourceSans
  145. Credits.Text = "Made By | XMAKIRx"
  146. Credits.TextColor3 = Color3.new(1, 1, 1)
  147. Credits.TextScaled = true
  148. Credits.TextSize = 14
  149. Credits.TextWrapped = true
  150. Credits.TextXAlignment = Enum.TextXAlignment.Left
  151.  
  152. barrr2.Name = "barrr2"
  153. barrr2.Parent = MainMenu
  154. barrr2.BackgroundColor3 = Color3.new(0.0588235, 0.0588235, 0.0588235)
  155. barrr2.BorderSizePixel = 0
  156. barrr2.Size = UDim2.new(0, 360, 0, 35)
  157.  
  158. mexit.Name = "mexit"
  159. mexit.Parent = MainMenu
  160. mexit.BackgroundColor3 = Color3.new(0.117647, 0.117647, 0.117647)
  161. mexit.BorderColor3 = Color3.new(0.117647, 0.117647, 0.117647)
  162. mexit.Position = UDim2.new(0.936019063, 0, -4.65661287e-10, 0)
  163. mexit.Size = UDim2.new(0, 23, 0, 25)
  164. mexit.Font = Enum.Font.SourceSans
  165. mexit.Text = "X"
  166. mexit.TextColor3 = Color3.new(1, 1, 1)
  167. mexit.TextSize = 14
  168. mexit.MouseButton1Down:connect(function()
  169. Framelogin.Visible = true
  170. MainMenu.Visible = false
  171. end)
  172.  
  173.  
  174. Tec99.Name = "Tec 99"
  175. Tec99.Parent = MainMenu
  176. Tec99.BackgroundColor3 = Color3.new(0.117647, 0.117647, 0.117647)
  177. Tec99.BorderColor3 = Color3.new(0.117647, 0.117647, 0.117647)
  178. Tec99.Position = UDim2.new(0, 0, 0.106493503, 0)
  179. Tec99.Size = UDim2.new(0, 156, 0, 50)
  180. Tec99.Font = Enum.Font.SourceSans
  181. Tec99.Text = "Tec 99"
  182. Tec99.TextColor3 = Color3.new(1, 1, 1)
  183. Tec99.TextScaled = true
  184. Tec99.TextSize = 14
  185. Tec99.TextStrokeColor3 = Color3.new(1, 1, 1)
  186. Tec99.TextWrapped = true
  187. Tec99.MouseButton1Down:connect(function()
  188.  
  189.  
  190.  
  191.  
  192.  
  193.  
  194. --[[
  195. Smith and Wesson M&P 45, chambered in .45 ACP ammunition.
  196. The standard magazine holds 10 rounds, although magazines that could hold 14 rounds were also made but looked incredibly stupid.
  197. Credit to litozinnamon for the crosshairs and bullethole decals. I used them without permission. Not like I asked him, anyhow.
  198. ]]
  199.  
  200. plr=game:service'Players'.LocalPlayer
  201. ch,char=plr.Character,plr.Character
  202. hum=ch.Humanoid
  203. tor,torso,rootpart,rj=ch.Torso,ch.Torso,ch.HumanoidRootPart,ch.HumanoidRootPart.RootJoint
  204. m,mouse=plr:GetMouse(),plr:GetMouse()
  205. cfn,ang,mr,int=CFrame.new,CFrame.Angles,math.rad,Instance.new
  206. bc=BrickColor.new
  207. head=ch.Head
  208. cam=workspace.CurrentCamera
  209.  
  210. rj.C0=cfn()
  211. rj.C1=cfn()
  212.  
  213. sheathed=false
  214. jammed=false
  215.  
  216.  
  217.  
  218.  
  219.  
  220.  
  221.  
  222.  
  223.  
  224.  
  225.  
  226. local minimumsize = Vector3.new(0.7,0.7,0.7) --Minimumsize for a part to get divided,higher numbers = less detailed and bigger/less bricks
  227. local surface_between_splitted_parts = 'SmoothNoOutlines' --the surface between splitted parts
  228. --local fragmented = workspace:FindFirstChild("Fragmented")
  229. local fragmentable = workspace --all fragmentable objects should be stored in here
  230. local list = {}
  231. local brickcount = 0
  232. --local m = Instance.new("Hint",workspace)
  233. local storage = {}
  234. local fillup = 1000 --it constantly generates new parts until it reaches this number(hacky way to prevent lagspikes if there is a large explosion),change it to 0 if you don´t want it to generate (useless) parts.
  235. local maximumstorage = 2000 --it will recycle parts if the number of parts in the storage doesnt exceed this number
  236. local storage_position = Vector3.new(0,0,5000) --place them somewhere off the map
  237. local stored_partsize = Vector3.new(1,1,1) --make them small
  238. local parts_created_per_frame = 5 --number of parts being created per frame to fill up the storage
  239.  
  240.  
  241. function fragmentate(cframe,size,color,explosion_position,explosion_blastradius,backsurface,bottomsurface,frontsurface,leftsurface,rightsurface,topsurface,transparency,reflectance)
  242. local xi = size.X >= minimumsize.X*(1+explosion_blastradius/16) and 2 or 1 --to reduce the lagg in large explosions we increase minimumsize based on the explosionradius...
  243. local yi = size.Y >= minimumsize.Y*(1+explosion_blastradius/16) and 2 or 1
  244. local zi = size.Z >= minimumsize.Z*(1+explosion_blastradius/16) and 2 or 1
  245. if xi == 1 and yi == 1 and zi == 1 or (cframe.p-explosion_position).magnitude > size.magnitude/2 + explosion_blastradius then --don´t fragmentate parts, that are too small to fragmentate or too far away from the explosion
  246. if xi == 1 and yi == 1 and zi == 1 then return end --optional
  247. if #storage > 0 then
  248. local p = storage[1]
  249. p.BrickColor = color
  250. p.Size = size
  251. p.BackSurface = backsurface
  252. p.BottomSurface = bottomsurface
  253. p.FrontSurface = frontsurface
  254. p.LeftSurface = leftsurface
  255. p.RightSurface = rightsurface
  256. p.TopSurface = topsurface
  257. p.Transparency = transparency
  258. p.CFrame = cframe
  259. p.Reflectance = reflectance
  260. table.remove(storage,1)
  261. else
  262. local p = Instance.new("Part",fragmentable)
  263. p.BrickColor = color
  264. p.FormFactor = "Custom"
  265. p.Size = size
  266. p.BackSurface = backsurface
  267. p.BottomSurface = bottomsurface
  268. p.FrontSurface = frontsurface
  269. p.LeftSurface = leftsurface
  270. p.RightSurface = rightsurface
  271. p.TopSurface = topsurface
  272. p.Transparency = transparency
  273. if p.Transparency>0.285 then
  274. p.Anchored = false
  275. else
  276. p.Anchored=true
  277. p.Material='Wood'
  278. end
  279. p.CFrame = cframe
  280. p.Reflectance = reflectance
  281. end
  282. --p:MakeJoints()
  283. -- m.Text = m.Text+1
  284. return --stop the function
  285. end
  286. local mody = math.random(-125,125)/1000 --some randomization
  287. for y = 1,yi do
  288. if math.random()> 0.5 then
  289. local modx = math.random(-125,125)/1000
  290. for x = 1,xi do
  291. local modz = math.random(-125,125)/1000
  292. for z = 1,zi do --offset = x/xi-0.75+modx)
  293. fragmentate(cframe*CFrame.new(size.X*(xi==1 and 0 or x/xi-0.75+modx),size.Y*(yi==1 and 0 or y/yi-0.75+mody),size.Z*(zi==1 and 0 or z/zi-0.75+modz)), --maths
  294. Vector3.new(xi == 2 and size.X*(1-2*math.abs(x/xi-0.75+modx)) or size.X,yi == 2 and size.Y*(1-2*math.abs(y/yi-0.75+mody)) or size.Y,
  295. zi == 2 and size.Z*(1-2*math.abs(z/zi-0.75+modz)) or size.Z or agent767_was_here),color,explosion_position,explosion_blastradius,
  296. z~=zi and surface_between_splitted_parts or backsurface,y==2 and surface_between_splitted_parts or bottomsurface,
  297. z==2 and surface_between_splitted_parts or frontsurface,x==2 and surface_between_splitted_parts or leftsurface,x~=xi and surface_between_splitted_parts or rightsurface,
  298. y~=yi and surface_between_splitted_parts or topsurface,transparency,reflectance)
  299. end
  300.  
  301. end
  302. else
  303. local modz = math.random(-125,125)/1000
  304. for z = 1,zi do
  305. local modx = math.random(-125,125)/1000
  306. for x = 1,xi do
  307. fragmentate(cframe*CFrame.new(size.X*(xi==1 and 0 or x/xi-0.75+modx),size.Y*(yi==1 and 0 or y/yi-0.75+mody),size.Z*(zi==1 and 0 or z/zi-0.75+modz)),
  308. Vector3.new(xi == 2 and size.X*(1-2*math.abs(x/xi-0.75+modx)) or size.X,yi == 2 and size.Y*(1-2*math.abs(y/yi-0.75+mody)) or size.Y,
  309. zi == 2 and size.Z*(1-2*math.abs(z/zi-0.75+modz)) or size.Z),color,explosion_position,explosion_blastradius,
  310. z~=zi and surface_between_splitted_parts or backsurface,y==2 and surface_between_splitted_parts or bottomsurface,
  311. z==2 and surface_between_splitted_parts or frontsurface,x==2 and surface_between_splitted_parts or leftsurface,x~=xi and surface_between_splitted_parts or rightsurface,
  312. y~=yi and surface_between_splitted_parts or topsurface,transparency,reflectance)
  313. end
  314. end
  315. end
  316. end
  317. end
  318.  
  319. function start_fragmentation(position,radius)
  320. local search = Region3.new(position-Vector3.new(radius,radius,radius)*1.1,position+Vector3.new(radius,radius,radius)*1.1)
  321. repeat
  322. local finish = false
  323. local parts = workspace:FindPartsInRegion3WithIgnoreList(search,list,100) --maximum number of parts that FindPartsInRegion3 can find is 100, so we have to do this to find them all
  324. for i = 1,#parts do
  325. table.insert(list,1,parts[i])
  326. end
  327. finish = true
  328. until #parts < 100 and finish
  329. print(#list)
  330. local t = tick()
  331. for i = 1,#list do
  332. local p = list[i]
  333. if p:IsDescendantOf(fragmentable) and p:GetMass()<3000 and p.Transparency>0.285 and p.Name~='Base' and p:IsDescendantOf(ch)==false then
  334. fragmentate(p.CFrame,p.Size,p.BrickColor,position,radius,p.BackSurface,p.BottomSurface,p.FrontSurface,p.LeftSurface,p.RightSurface,p.TopSurface,p.Transparency,p.Reflectance)
  335. if #storage < maximumstorage and p.Shape == "Block" then --recycle them
  336. p.Anchored = false
  337. p.FormFactor = "Custom"
  338. p.Size = stored_partsize
  339. p.Position = storage_position
  340. table.insert(storage,1,p)
  341. else --storage is full
  342. p:Destroy()
  343. end
  344. -- m.Text = m.Text-1
  345. end
  346. if p:IsDescendantOf(fragmentable) and p:GetMass()<53000 and p.Transparency<0.05 and p.Name~='Base' and tostring(p.Material)=='Enum.Material.Wood' and p:IsDescendantOf(ch)==false then
  347. fragmentate(p.CFrame,p.Size,p.BrickColor,position,radius,p.BackSurface,p.BottomSurface,p.FrontSurface,p.LeftSurface,p.RightSurface,p.TopSurface,p.Transparency,p.Reflectance)
  348. if #storage < maximumstorage and p.Shape == "Block" then --recycle them
  349. p.Anchored = true
  350. p.Material='Wood'
  351. p.FormFactor = "Custom"
  352. p.Size = stored_partsize
  353. p.Position = storage_position
  354. table.insert(storage,1,p)
  355. else --storage is full
  356. p:Destroy()
  357. end
  358. -- m.Text = m.Text-1
  359. end
  360. end
  361. list = {}
  362. -- print(tick()-t)
  363. end
  364.  
  365. --[[
  366. spawn(function()
  367. while wait() do --oh noes,a loop! So inefficient!
  368. if #storage < fillup then
  369. for i = 1, parts_created_per_frame do --creates parts to fill up the storage
  370. local p = Instance.new("Part",fragmentable)
  371. p.Anchored = false
  372. p.FormFactor = "Custom"
  373. p.Size = stored_partsize
  374. p.Position = storage_position
  375. table.insert(storage,1,p)
  376. end
  377. end
  378. end
  379. end)
  380. ]]
  381.  
  382.  
  383.  
  384.  
  385.  
  386.  
  387.  
  388.  
  389.  
  390.  
  391.  
  392.  
  393.  
  394.  
  395.  
  396.  
  397.  
  398.  
  399.  
  400.  
  401.  
  402.  
  403.  
  404. --local blankn=22416261
  405.  
  406. --172121567
  407.  
  408. crosshairs={
  409. {38140824};
  410. {38140833};
  411. {38140839};
  412. {38140843};
  413. {38140852};
  414. {38140910};
  415. {38140915};
  416. {38140923};
  417. {38140928};
  418. {38140931};
  419. {38208259};
  420. {38208275};
  421. {38208284};
  422. {38208303};
  423. {38208310};
  424. {38208325};
  425. {38208330};
  426. {38208352};
  427. {38208359};
  428. {38208377}
  429. }
  430.  
  431. bulletholes={
  432. 172274695;
  433. 172274721
  434. }
  435.  
  436. for _,v in pairs(crosshairs) do
  437. game:service'ContentProvider':Preload('rbxassetid://' .. tostring(v[1]-1))
  438. end
  439.  
  440. currentIco=2
  441. switchIco=function(num)
  442. if num<20 then
  443. else
  444. num=20
  445. end
  446. mouse.Icon='rbxassetid://' .. tostring(crosshairs[num][1]-1)
  447. currentIco=num
  448. end
  449.  
  450. switchIco(currentIco)
  451.  
  452. heldDown=false
  453.  
  454. spreadint=1
  455. --[[Settings]]--
  456. recoil=false -- Set to true for added realism
  457. magCapacity=20 -- How much a magazine can hold at once
  458. magAmmo=20 -- How much ammo is in the mag
  459. crosshairSpread=5
  460. spread=1
  461. pAmmunition=true -- more damage if true
  462.  
  463.  
  464. jamRate=500 -- How often the gun jams(the more the less) (no less than 1)
  465.  
  466. primaryColor='Really black'
  467. secondaryColor='Really black'
  468.  
  469. slideReflectance=0.01
  470. slideMaterial='Plastic'
  471.  
  472. --[[Attachments]]--
  473.  
  474. silencer=true
  475. highCapMag=false -- High capacity magazine
  476. laser=true
  477. automatic=false
  478. grip=true
  479.  
  480.  
  481. getSound=function(id)
  482. game:service'ContentProvider':Preload('rbxassetid'..tostring(id))
  483. local s=int("Sound",ch.Head)
  484. s.SoundId='rbxassetid://' .. tostring(id)
  485. s.Volume=1
  486. return s
  487. end
  488.  
  489. local fireSound=getSound(151997297--[[10209842]])
  490. fireSound.Pitch=1.3
  491. --1.8
  492.  
  493. local releaseSound=getSound(10209813)
  494. releaseSound.Pitch=4
  495.  
  496. local reloadSound=getSound(10209636)
  497. reloadSound.Pitch=3
  498.  
  499. local magazinelockSound=getSound(152206337)
  500. magazinelockSound.Pitch=1.4
  501.  
  502. local slideBackSound=getSound(152206263)
  503. slideBackSound.Pitch=2.5
  504.  
  505. local slideForwardSound=getSound(152206302)
  506. slideForwardSound.Pitch=2.5
  507.  
  508. local emptySound=getSound(2697295)
  509. emptySound.Pitch=5
  510.  
  511. local glassBreakSound=getSound(144884907)
  512.  
  513. local woodImpact=getSound(142082171)
  514.  
  515. local fleshImpact=getSound(144884872)
  516. fleshImpact.Pitch=1.7
  517.  
  518. if ch:findFirstChild("Tec-99") then
  519. ch['Tec-99']:Destroy()
  520. end
  521.  
  522. local tube=int("Model",ch)
  523. tube.Name='Tec-99'
  524. local hopper=Instance.new('HopperBin',plr.Backpack)
  525. hopper.Name=tube.Name
  526. Weld = function(p0,p1,x,y,z,rx,ry,rz,par)--recommend to use this with my weld. use this function only with arm lockers.
  527. p0.Position = p1.Position
  528. local w = Instance.new('Motor',par or p0)
  529. w.Part0 = p1
  530. w.Part1 = p0
  531. w.C0 = CFrame.new(x or 0,y or 0,z or 0)*CFrame.Angles(rx or 0,ry or 0,rz or 0)
  532. w.MaxVelocity = .1
  533. return w
  534. end
  535. function clerp(c1,c2,sp)
  536. local R1,R2,R3 = c1:toEulerAnglesXYZ()
  537. local R21,R22,R23 = c2:toEulerAnglesXYZ()
  538. return CFrame.new(
  539. c1.X + (c2.X-c1.X)*sp,
  540. c1.Y + (c2.Y-c1.Y)*sp,
  541. c1.Z + (c2.Z-c1.Z)*sp)*CFrame.Angles(
  542. R1 + (R21-R1)*sp,
  543. R2 + (R22-R2)*sp,
  544. R3 + (R23-R3)*sp
  545. )
  546. end
  547.  
  548. tweenTable={}
  549. Tween = function(Weld, Stop, Step,a)
  550. ypcall(function()
  551. local func = function()
  552. local Start = Weld.C1
  553. local X1, Y1, Z1 = Start:toEulerAnglesXYZ()
  554. local Stop = Stop
  555. local X2, Y2, Z2 = Stop:toEulerAnglesXYZ()
  556. if not Step then Step=0.1 end
  557. table.insert(tweenTable,{th=0,Weld=Weld,Step=Step,Start=Start,X1=X1,Y1=Y1,Z1=Z1,Stop=Stop,X2=X2,Y2=Y2,Z2=Z2})
  558. end
  559. if a then coroutine.wrap(func)() else func() end
  560. end)
  561. end
  562. weld=function(p0,p1,c0)
  563. local w=Instance.new("Weld",p0)
  564. w.Part0=p0
  565. w.Part1=p1
  566. w.C0=c0
  567. return w
  568. end
  569. cp=function(parent,color,size,anchored,cancollide)
  570. local newp=Instance.new("Part",parent)
  571. newp.TopSurface='SmoothNoOutlines'
  572. newp.BottomSurface='SmoothNoOutlines'
  573. newp.FrontSurface='SmoothNoOutlines'
  574. newp.BackSurface='SmoothNoOutlines'
  575. newp.RightSurface='SmoothNoOutlines'
  576. newp.LeftSurface='SmoothNoOutlines'
  577. newp.FormFactor="Custom"
  578. newp.BrickColor=bc(color)
  579. newp.Size=size
  580. newp.Anchored=anchored
  581. newp.CanCollide=cancollide
  582. newp:BreakJoints()
  583. return newp
  584. end
  585.  
  586. initializeJoints=function()
  587. rabr = cp(tube,'White',Vector3.new(1,1,1),false,false) rabr.Transparency = 1 rabr.Name='Locker'
  588. rabr.Position = torso.Position
  589. rw = Weld(rabr,torso,1.5,.5,0,0,0,0) rw.Parent = tube rw.Name = 'rw'
  590. w = Instance.new("Weld",tube)
  591. w.Part0,w.Part1 = ch['Right Arm'],rabr
  592. w.C1 = CFrame.new(0,-.5,0)
  593. labr = cp(tube,'White',Vector3.new(1,1,1),false,false) labr.Transparency = 1 labr.Name='Locker'
  594. labr.Position = torso.Position
  595. lw = Weld(labr,torso,-1.5,.5,0,0,0,0) lw.Parent = tube lw.Name = 'lw'
  596. ww = Instance.new("Weld",tube)
  597. ww.Part0,ww.Part1 = ch['Left Arm'],labr
  598. ww.C1 = CFrame.new(0,-.5,0)
  599. end
  600.  
  601. initializeJoints()
  602.  
  603. --[[ leg locks
  604. rabl = cp(tube,'White',Vector3.new(1,1,1),false,false) rabl.Transparency = 1 rabl.Name='Locker'
  605. rabl.Position = torso.Position
  606. rwl = Weld(rabl,torso,0.5,-1.5,0,0,0,0) rwl.Parent = tube rwl.Name = 'rwl'
  607. wl = Instance.new("Weld",tube)
  608. wl.Part0,wl.Part1 = ch['Right Leg'],rabl
  609. wl.C1 = CFrame.new(0,-.5,0)
  610. labl = cp(tube,'White',Vector3.new(1,1,1),false,false) labl.Transparency = 1 labl.Name='Locker'
  611. labl.Position = torso.Position
  612. lwl = Weld(labl,torso,-0.5,-1.5,0,0,0,0) lwl.Parent = tube lwl.Name = 'lwl'
  613. wwl = Instance.new("Weld",tube)
  614. wwl.Part0,wwl.Part1 = ch['Left Leg'],labl
  615. wwl.C1 = CFrame.new(0,-.5,0)
  616. ]]
  617. --weld(ch['HumanoidRootPart'],torso,cfn())
  618.  
  619.  
  620. local counter=Instance.new('ScreenGui',plr.PlayerGui)
  621. local frame=Instance.new('Frame',counter)
  622. frame.Size=UDim2.new(0.25,0,0.3,0)
  623.  
  624. frame.Position=UDim2.new(0.1,0,0.4,0)
  625. frame.BackgroundTransparency=1
  626.  
  627. local ammocounter=Instance.new('TextLabel',frame)
  628. ammocounter.Size=UDim2.new(1,0,0.3,0)
  629. ammocounter.Position=UDim2.new(0,0,0.2,0)
  630. ammocounter.BackgroundTransparency=1
  631. ammocounter.TextColor3=BrickColor.new('White').Color
  632. ammocounter.Font='SourceSansBold'
  633. ammocounter.FontSize='Size18'
  634. ammocounter.Text=''
  635. ammocounter.TextXAlignment='Left'
  636.  
  637.  
  638. local bg = Instance.new("BodyGyro",rootpart)
  639. bg.maxTorque = Vector3.new(math.huge,math.huge,math.huge)
  640. bg.P = 10000
  641. bg.D = 100
  642.  
  643.  
  644. cyl=function(prt)
  645. local c=int("CylinderMesh",prt)
  646. return c
  647. end
  648. blo=function(prt)
  649. local c=int("BlockMesh",prt)
  650. return c
  651. end
  652.  
  653. if laser then
  654. aLaser=cp(tube,'Really red',Vector3.new(0.2,0.2,0.2))
  655. aLaser.Transparency=1
  656. cyl(aLaser).Scale=Vector3.new(0.25,1,0.25)
  657. aLaser.Anchored=true
  658. end
  659.  
  660. local handle=cp(tube,primaryColor,Vector3.new(0.2,0.6,0.3))
  661. blo(handle).Scale=Vector3.new(1.15,0.9,1)
  662. local mw=weld(ch['Right Arm'],handle,cfn(-0.4,-1,-0.19)*ang(mr(-101.5),0,0)*cfn()*ang(0,mr(-30),mr(-5)))
  663.  
  664. local framepiece1=cp(tube,primaryColor,Vector3.new(0.2,0.2,0.9))
  665. blo(framepiece1).Scale=Vector3.new(1.15,0.5,1)
  666. weld(handle,framepiece1,cfn(0,0.354,-0.3)*ang(mr(11.5),0,0))
  667.  
  668. local barrel=cp(tube,'Medium stone grey',Vector3.new(0.2,0.2,0.2))
  669. cyl(barrel).Scale=Vector3.new(0.7,1.2,0.7)
  670. weld(framepiece1,barrel,cfn(0,0.15,-0.1)*ang(mr(-90),0,0))
  671.  
  672. local sbarrel=cp(tube,'Really black',Vector3.new(0.2,0.3,0.2))
  673. cyl(sbarrel).Scale=Vector3.new(0.7,1.5,0.7)
  674. weld(barrel,sbarrel,cfn(0,0.35,0))
  675. local hole=cp(tube,'White',Vector3.new(0.2,0.2,0.2))
  676. hole.Transparency=1
  677. weld(sbarrel,hole,cfn(0,0.2,0))
  678. local flash=int('PointLight',hole)
  679. flash.Enabled=false
  680. flash.Range=10
  681. flash.Color=BrickColor.new('Neon orange').Color
  682.  
  683.  
  684. local slide1=cp(tube,secondaryColor,Vector3.new(0.2,0.2,0.4))
  685. slide1.CanCollide=false
  686. blo(slide1).Scale=Vector3.new(0.7,1,1.1)
  687. slideweld1=weld(framepiece1,slide1,cfn(0,0.15,0.23))
  688. slide1.Reflectance=slideReflectance
  689. slide1.Material=slideMaterial
  690.  
  691. local slide2=cp(tube,secondaryColor,Vector3.new(0.2,0.2,0.4))
  692. slide2.CanCollide=false
  693. blo(slide2).Scale=Vector3.new(0.7,1,1.1)
  694. slideweld2=weld(slide1,slide2,cfn(0,0,-0.666))
  695. slide2.Reflectance=slideReflectance
  696. slide2.Material=slideMaterial
  697.  
  698. local slideside1=cp(tube,secondaryColor,Vector3.new(0.2,0.2,1.1))
  699. slideside1.CanCollide=true
  700. blo(slideside1).Scale=Vector3.new(0.25,1,1)
  701. weld(slide1,slideside1,cfn(-0.09,0,-0.335))
  702. slideside1.Reflectance=slideReflectance
  703. slideside1.Material=slideMaterial
  704.  
  705. local slideside2=cp(tube,secondaryColor, Vector3.new(0.2,0.2,0.4))
  706. slideside2.CanCollide=true
  707. blo(slideside2).Scale=Vector3.new(0.25,1,1.1)
  708. weld(slide1,slideside2,cfn(0.09,0,0))
  709. slideside2.Reflectance=slideReflectance
  710. slideside2.Material=slideMaterial
  711.  
  712. local slideside3=cp(tube,secondaryColor, Vector3.new(0.2,0.2,0.3))
  713. slideside3.CanCollide=true
  714. blo(slideside3).Scale=Vector3.new(0.25,0.6,0.78)
  715. weld(slideside2,slideside3,cfn(0,-0.04,-0.335))
  716. slideside3.Reflectance=slideReflectance
  717. slideside3.Material=slideMaterial
  718.  
  719. local slideside4=cp(tube,secondaryColor, Vector3.new(0.2,0.2,0.4))
  720. blo(slideside4).Scale=Vector3.new(0.25,1,1.1)
  721. weld(slide2,slideside4,cfn(0.09,0,0))
  722. slideside4.Reflectance=slideReflectance
  723. slideside4.Material=slideMaterial
  724.  
  725. local mgs=cp(tube,primaryColor,Vector3.new(0.2,0.2,0.2))
  726. blo(mgs).Scale=Vector3.new(1.15,0.425,0.245)
  727. weld(handle,mgs,cfn(0,-0.3,0.125))
  728.  
  729. --[[Trigger]]--
  730. local tp1=cp(tube,primaryColor,Vector3.new(0.2,0.2,0.2))
  731. blo(tp1).Scale=Vector3.new(0.6,0.1,0.8)
  732. weld(framepiece1,tp1,cfn(0,-0.22,0.13))
  733.  
  734. local tp2=cp(tube,primaryColor,Vector3.new(0.2,0.2,0.2))
  735. blo(tp2).Scale=Vector3.new(0.6,0.1,1.19)
  736. weld(framepiece1,tp2,cfn(0,-0.14,-0.0265)*ang(mr(45),0,0))
  737.  
  738. local trigger1=cp(tube,'Really black',Vector3.new(0.2,0.2,0.2))
  739. blo(trigger1).Scale=Vector3.new(0.3,0.4,0.16)
  740. weld(framepiece1,trigger1,cfn(0,-0.07,0.09))
  741.  
  742. local trigger2=cp(tube,'Really black',Vector3.new(0.2,0.2,0.2))
  743. blo(trigger2).Scale=Vector3.new(0.3,0.3,0.16)
  744. weld(trigger1,trigger2,cfn(0,-0.06,-0.015)*ang(mr(30),0,0))
  745.  
  746.  
  747. --[[Magazine]]--
  748.  
  749. local magh=cp(tube,'Really black',Vector3.new(0.2,0.5,0.2))
  750. blo(magh).Scale=Vector3.new(0.6,1,1)
  751. local magweld=weld(handle,magh,cfn(0,-0.025,0))
  752.  
  753. local bottom=cp(tube,'Really black',Vector3.new(0.2,0.2,0.3))
  754. blo(bottom).Scale=Vector3.new(1.15,0.385,0.8)
  755. bottomweld=weld(magh,bottom,cfn(0,-0.28,-0.015))
  756.  
  757. if highCapMag then
  758. magweld:Destroy()
  759. magh.Size=Vector3.new(0.2,0.7,0.2)
  760. magweld=weld(handle,magh,cfn(0,-0.125,0))
  761. bottomweld:Destroy()
  762. bottomweld=weld(magh,bottom,cfn(0,-0.38,-0.015))
  763. magCapacity=magCapacity+23
  764. magAmmo=magAmmo+23
  765. end
  766.  
  767. --[[Sights]]--
  768. local backsight1=cp(tube,'Black',Vector3.new(0.2,0.2,0.2))
  769. blo(backsight1).Scale=Vector3.new(0.3,0.3,0.3)
  770. weld(slide1,backsight1,cfn(0.06,0.1,0.13))
  771. local backsight2=cp(tube,'Black',Vector3.new(0.2,0.2,0.2))
  772. blo(backsight2).Scale=Vector3.new(0.3,0.3,0.3)
  773. weld(slide1,backsight2,cfn(-0.06,0.1,0.13))
  774.  
  775. local frontsight=cp(tube,'Black',Vector3.new(0.2,0.2,0.2))
  776. blo(frontsight).Scale=Vector3.new(0.3,0.3,0.3)
  777. weld(slide1,frontsight,cfn(0,0.1,-0.85))
  778.  
  779. local dot1=cp(tube,'Lime green',Vector3.new(0.2,0.2,0.2))
  780. cyl(dot1).Scale=Vector3.new(0.1,0.31,0.1)
  781. weld(backsight1,dot1,cfn(0,0.014,0)*ang(mr(-90),0,0))
  782.  
  783. local dot2=cp(tube,'Lime green',Vector3.new(0.2,0.2,0.2))
  784. cyl(dot2).Scale=Vector3.new(0.1,0.31,0.1)
  785. weld(backsight2,dot2,cfn(0,0.014,0)*ang(mr(-90),0,0))
  786.  
  787. local dot3=cp(tube,'Lime green',Vector3.new(0.2,0.2,0.2))
  788. cyl(dot3).Scale=Vector3.new(0.1,0.31,0.1)
  789. weld(frontsight,dot3,cfn(0,0.014,0)*ang(mr(-90),0,0))
  790.  
  791. local ba=cp(tube,secondaryColor,Vector3.new(0.2,0.2,0.2))
  792. blo(ba).Scale=Vector3.new(1.15,0.5,1)
  793. weld(framepiece1,ba,cfn(0,0,-0.55))
  794. ba.Reflectance=slideReflectance
  795. ba.Material=slideMaterial
  796.  
  797. local weirdholethatpistolshave=cp(tube,'Really black', Vector3.new(0.2,0.2,0.2))
  798. cyl(weirdholethatpistolshave).Scale=Vector3.new(0.4,1.01,0.4)
  799. weld(ba,weirdholethatpistolshave,cfn(0,0,0)*ang(mr(-90),0,0))
  800.  
  801. --[[Tactical Rails]]--
  802.  
  803. local r1=cp(tube,primaryColor,Vector3.new(0.2,0.2,0.2))
  804. blo(r1).Scale=Vector3.new(1.15,0.2,0.25)
  805. weld(framepiece1,r1,cfn(0,-0.05,-0.17))
  806.  
  807. local r2=cp(tube,primaryColor,Vector3.new(0.2,0.2,0.2))
  808. blo(r2).Scale=Vector3.new(1.15,0.2,0.25)
  809. weld(framepiece1,r2,cfn(0,-0.05,-0.27))
  810.  
  811. local r3=cp(tube,primaryColor,Vector3.new(0.2,0.2,0.2))
  812. blo(r3).Scale=Vector3.new(1.15,0.2,0.25)
  813. weld(framepiece1,r3,cfn(0,-0.05,-0.37))
  814.  
  815. if laser then
  816. local base=cp(tube,primaryColor,Vector3.new(0.2,0.2,0.3))
  817. blo(base).Scale=Vector3.new(1.15,1,1)
  818. weld(r2,base,cfn(0,-0.05,0))
  819. basehole=cp(tube,'White',Vector3.new(0.2,0.2,0.2))
  820. cyl(basehole).Scale=Vector3.new(0.4,0.4,0.4)
  821. weld(base,basehole,cfn(0,0,-0.13)*ang(mr(-90),0,0))
  822. end
  823.  
  824. if silencer then
  825. local sil=cp(tube,'Really black',Vector3.new(0.2,0.3,0.2))
  826. fireSound.SoundId='rbxassetid://153230595'
  827. fireSound.Pitch=1
  828. cyl(sil).Scale=Vector3.new(0.94,1.8,0.94)
  829. weld(hole,sil,cfn(0,0.29,0))
  830. end
  831.  
  832. if grip then
  833. local base=cp(tube,primaryColor,Vector3.new(0.2,0.2,0.3))
  834. blo(base).Scale=Vector3.new(1.15,1,1)
  835. weld(r2,base,cfn(0,-0.05,0))
  836. local hd=cp(tube,primaryColor,Vector3.new(0.2,0.6,0.2))
  837. cyl(hd)
  838. weld(base,hd,cfn(0,-0.3,0))
  839. crosshairSpread=3
  840. spreadint=spreadint-0.3
  841. end
  842.  
  843. --[[Test Functions]]--
  844.  
  845. local debounce=false
  846. local out=false
  847. local bs=false
  848. cockSlide=function() -- hahaha yes i know
  849. slideBackSound:Play()
  850. if magAmmo<1 and out==true and bs==false then
  851. wait()
  852. slideweld1.C0=slideweld1.C0*cfn(0,0,0.22)
  853. else
  854. for i=1,2 do
  855. wait()
  856. slideweld1.C0=slideweld1.C0*cfn(0,0,0.22)
  857. end
  858. end
  859. local ajar=false
  860. if magAmmo==1 then
  861. ajar=true
  862. end
  863. if magAmmo>0 then
  864. createShell()
  865. --magAmmo=magAmmo-1
  866. ammocounter.Text=''
  867. for i=1,magAmmo do
  868. ammocounter.Text=ammocounter.Text .. 'I'
  869. end
  870. end
  871. wait(0.15)
  872. slideForwardSound:Play()
  873. for i=1,2 do
  874. wait()
  875. slideweld1.C0=slideweld1.C0*cfn(0,0,-0.22)
  876. end
  877. if ajar==true then
  878. out=true
  879. slideweld1.C0=cfn(0,0.15,0.23)
  880. slideweld1.C0=slideweld1.C0*cfn(0,0,0.22)
  881. end
  882. end
  883.  
  884. --fx
  885. local firefx=cp(tube,'Neon orange',Vector3.new(0.7,1.1,0.7))
  886. firefx.Transparency=1
  887. local mesh=Instance.new('SpecialMesh',firefx)
  888. mesh.MeshType='Sphere'
  889. firefx.Material='Neon'
  890. weld(hole,firefx,cfn(0,1,0))
  891.  
  892. local smokefx=Instance.new('Smoke',hole)
  893. smokefx.Enabled=false
  894. barrel.CanCollide=true
  895.  
  896.  
  897.  
  898.  
  899. local oc = oc or function(...) return ... end
  900.  
  901. function ragJoint(hit,r,d)
  902. Spawn(oc(function()
  903. d = d or 0
  904. local rpar,r0,r1 = r.Parent,r.Part0,r.Part1
  905. if d > 0 then wait(d) end
  906. local p = hit:Clone()
  907. p:BreakJoints()
  908. p:ClearAllChildren()
  909. p.FormFactor = "Custom"
  910. p.Size = p.Size/2
  911. p.Transparency = 1
  912. p.CanCollide = true
  913. p.Name = "Colliduh"
  914. p.Parent = hit
  915. local w = Instance.new("Weld",p)
  916. w.Part0 = hit
  917. w.Part1 = p
  918. w.C0 = CFrame.new(0,-p.Size.Y/2,0)
  919. local rot = Instance.new("Rotate",rpar)
  920. rot.Name = r.Name
  921. rot.Part0 = r0
  922. rot.Part1 = r1
  923. rot.C0 = r.C0
  924. rot.C1 = r.C1
  925. r0.Velocity = Vector3.new()
  926. r1.Velocity = Vector3.new()
  927. r:Destroy()
  928. end))
  929. end
  930.  
  931.  
  932. createShell=function()
  933. local shell=cp(tube,'Deep orange',Vector3.new(0.2,0.3,0.2))
  934. shell.CanCollide=true
  935. shell.Reflectance=0.3
  936. cyl(shell)
  937. shell.CFrame=barrel.CFrame*ang(mr(-90),0,0)
  938. magAmmo=magAmmo-1
  939. ammocounter.Text=''
  940. for i=1,magAmmo do
  941. ammocounter.Text=ammocounter.Text .. 'I'
  942. end
  943. game.Debris:AddItem(shell,3)
  944. end
  945.  
  946. reloadPistol=function()
  947. local current=magAmmo
  948. Tween(lw,cfn())
  949. Tween(rw,cfn()*ang(mr(-102),0,0))
  950. wait(0.4)
  951. releaseSound:Play()
  952. bottom.Transparency=1
  953. magh.Transparency=1
  954. local mag1=magh:clone()
  955. mag1.Transparency=0
  956. mag1.Weld:Destroy''
  957. local mag2=bottom:clone()
  958. mag2.Transparency=0
  959. mag1:BreakJoints''
  960. mag2:BreakJoints''
  961. local bm1=mag1:clone()
  962. local bm2=mag2:clone()
  963. mag1.Parent=tube
  964. mag2.Parent=tube
  965. mag1.CFrame=magh.CFrame
  966. weld(mag1,mag2,cfn(0,-0.28,-0.015))
  967. magAmmo=0
  968. ammocounter.Text=''
  969. for i=1,magAmmo do
  970. ammocounter.Text=ammocounter.Text .. 'I'
  971. end
  972. wait()
  973. mag1.CanCollide=true
  974. mag2.CanCollide=true
  975. game.Debris:AddItem(mag1,2)
  976. game.Debris:AddItem(mag2,2)
  977. wait(0.1)
  978. Tween(lw,cfn()*ang(mr(25),0,0))
  979. bm1.Parent=tube
  980. bm2.Parent=tube
  981. weld(bm1,bm2,cfn(0,-0.28,-0.015))
  982. local fa=weld(ch['Left Arm'],bm1,cfn(0,-1.1,0)*ang(mr(-90),0,0))
  983. wait(0.1)
  984. Tween(lw,cfn(0,1.4,0)*ang(mr(-109),mr(60),mr(10)),0.07)
  985. wait(0.25)
  986. magazinelockSound:Play()
  987. wait()
  988. -- reloadSound:Play()
  989. fa:Destroy''
  990. bm1:Destroy''
  991. bm2:Destroy''
  992. bottom.Transparency=0
  993. magh.Transparency=0
  994. local totalcap=0
  995. if current<1 then --none in chamber reload
  996. --slideweld1.C0=cfn(0,0,0.45)
  997. Tween(rw,cfn(0,0.7,0)*ang(mr(-90),mr(-30),0))
  998. Tween(lw,cfn(0,0.7,0)*ang(mr(-115),mr(35),0))
  999. wait(0.1)
  1000. spawn(function()
  1001. cockSlide()
  1002. end)
  1003. Tween(lw,cfn(0,0.7,0)*ang(mr(-115),mr(55),0))
  1004. wait(0.3)
  1005. totalcap=magCapacity
  1006. else
  1007. totalcap=magCapacity+1
  1008. end
  1009. magAmmo=totalcap
  1010. out=false
  1011. ammocounter.Text=''
  1012. for i=1,magAmmo do
  1013. ammocounter.Text=ammocounter.Text .. 'I'
  1014. end
  1015. restorePosition()
  1016. end
  1017.  
  1018. firePistol=function()
  1019. switchIco(currentIco+crosshairSpread)
  1020. if not jammed and not out then
  1021. spread=spread+spreadint
  1022. end
  1023. print(spread)
  1024. fireSound.Pitch=math.random(math.random(fireSound.Pitch-0.2,fireSound.Pitch-0.1),math.random(fireSound.Pitch,fireSound.Pitch+0.1))
  1025. if magAmmo>0 and jammed==false then
  1026. local ajar=false
  1027. if magAmmo==1 then
  1028. ajar=true
  1029. end
  1030. user=ch
  1031. local ray = Ray.new(hole.CFrame.p, ((m.Hit.p+Vector3.new(math.random(-spread,spread)/6.35,math.random(-spread,spread)/6.35,math.random(-spread,spread)/6.35) )- hole.CFrame.p).unit*300)
  1032. local hit, position = game.Workspace:FindPartOnRay(ray, user)
  1033. if hit then
  1034. if hit.Transparency>0.285 and hit:GetMass()<3000 and hit.Parent.className~='Hat' then
  1035. local temps=glassBreakSound:clone()
  1036. temps.Parent=hit
  1037. temps.Pitch=math.random(math.random(temps.Pitch-0.2,temps.Pitch-0.1),math.random(temps.Pitch,temps.Pitch+0.1))
  1038. temps:Play''
  1039. start_fragmentation(position,.25)
  1040. end
  1041. if tostring(hit.Material)=='Enum.Material.Wood' and hit.Transparency<0.05 then
  1042. local temps=woodImpact:clone()
  1043. temps.Volume=1
  1044. temps.Pitch=math.random(math.random(temps.Pitch-0.2,temps.Pitch-0.1),math.random(temps.Pitch,temps.Pitch+0.1))
  1045. temps.Parent=hit
  1046. temps:Play''
  1047. start_fragmentation(position,.15)
  1048. end
  1049. ypcall(function()
  1050. if hit and hit.Parent and hit.Parent:findFirstChild'Humanoid' then
  1051. local temps=fleshImpact:clone()
  1052. temps.Parent=hit
  1053. temps:Play()
  1054. if hit.Name~='Head' then
  1055. if pAmmunition==true then
  1056. hit.Parent.Humanoid:TakeDamage(math.random(30,65))
  1057. else
  1058. hit.Parent.Humanoid:TakeDamage(math.random(10,24))
  1059. end
  1060. local guy=hit.Parent
  1061. if guy.Name~='TheDarkRevenant' then
  1062. for i,v in pairs(guy:GetChildren()) do
  1063. if v.className=='Hat' then
  1064. v.Handle:BreakJoints()
  1065. end
  1066. local r = guy.Torso:FindFirstChild(v.Name:gsub("Arm","Shoulder"):gsub("Leg","Hip"))
  1067. if v:IsA("BasePart") and r then
  1068. ragJoint(v,r,.1)
  1069. elseif v:IsA("Humanoid") then
  1070. spawn(function()
  1071. wait(0.5)
  1072. v.PlatformStand = true
  1073. v.Changed:connect(function()
  1074. v.PlatformStand = true
  1075. end)
  1076. end)
  1077. end
  1078. end
  1079. end
  1080.  
  1081. else
  1082. if hit.Parent.Name~='TheDarkRevenant' then
  1083. hit.Parent:BreakJoints()
  1084. end
  1085. end
  1086. end
  1087.  
  1088. if hit.Parent.className=='Hat' then
  1089. hit.CanCollide=true
  1090. hit:BreakJoints()
  1091. hit.Velocity=m.Hit.p*5
  1092. end
  1093. end)
  1094. end
  1095. if m.Target then
  1096. local p = Instance.new("Part")
  1097. p.formFactor = "Custom"
  1098. p.Size = Vector3.new(0.5,0.5,0.5)
  1099. p.Transparency = 1
  1100. p.CanCollide = false
  1101. p.Locked = true
  1102. p.CFrame = CFrame.new(position.x,position.y,position.z)--mouse.Target.CFrame+(mouse.Hit.p-mouse.Target.Position)
  1103. local w = Instance.new("Weld")
  1104. w.Part0 = mouse.Target
  1105. w.Part1 = p
  1106. w.C0 = mouse.Target.CFrame:inverse()
  1107. w.C1 = p.CFrame:inverse()
  1108. w.Parent = p
  1109. local d = Instance.new("Decal")
  1110. d.Parent = p
  1111. d.Face = mouse.TargetSurface
  1112. d.Texture = 'rbxassetid://' .. tostring(bulletholes[math.random(#bulletholes)]-2)
  1113. p.Parent = tube
  1114. game.Debris:AddItem(p,6)
  1115. end
  1116. if recoil==true then
  1117. cam:SetRoll(math.random(-2,2))
  1118. cam:TiltUnits(0.501)
  1119. end
  1120. local th=cp(tube,"Really black",Vector3.new(1,1,1))
  1121. th.CanCollide=false
  1122. th.Anchored=true
  1123. th.CFrame=CFrame.new(position.x,position.y,position.z)
  1124. local spm=Instance.new('SpecialMesh',th)
  1125. spm.MeshType='Sphere'
  1126. spm.Scale=Vector3.new(0.05,0.05,0.05)
  1127. spawn(function()
  1128. for i=1,5 do
  1129. wait()
  1130. spm.Scale=spm.Scale+Vector3.new(0.16,0.16,0.16)
  1131. th.Transparency=th.Transparency+0.2
  1132. end
  1133. th:Destroy()
  1134. end)
  1135. fireSound:Play()
  1136. spawn(function()
  1137. firefx.Transparency=0
  1138. wait()
  1139. firefx.Transparency=1
  1140. end)
  1141. spawn(function()
  1142. flash.Enabled=true
  1143. for i=1,2 do
  1144. wait()
  1145. slideweld1.C0=slideweld1.C0*cfn(0,0,0.22)
  1146. end
  1147. flash.Enabled=false
  1148. createShell()
  1149. for i=1,2 do
  1150. wait()
  1151. slideweld1.C0=slideweld1.C0*cfn(0,0,-0.22)
  1152. end
  1153. slideweld1.C0=cfn(0,0.15,0.23)
  1154. if ajar==true then
  1155. out=true
  1156. slideweld1.C0=cfn(0,0.15,0.23)
  1157. slideweld1.C0=slideweld1.C0*cfn(0,0,0.22)
  1158. end
  1159. end)
  1160. ammocounter.Text=''
  1161. for i=1,magAmmo do
  1162. ammocounter.Text=ammocounter.Text .. 'I'
  1163. end
  1164. wait()
  1165. Tween(rw,cfn(0,0.7,0)*ang(mr(-100),mr(-30),0),0.62)
  1166. if not grip then
  1167. Tween(lw,cfn(0,0.7,0)*ang(mr(-100),mr(30),0),0.62)
  1168. else
  1169. Tween(lw,cfn(0,1.3,0)*ang(mr(-100),mr(30),0),0.62)
  1170. end
  1171. wait(0.065)
  1172. restorePosition(0.3)
  1173. else
  1174. if magAmmo<1 then
  1175. slideweld1.C0=cfn(0,0.15,0.23)
  1176. slideweld1.C0=slideweld1.C0*cfn(0,0,0.22)
  1177. end
  1178. emptySound:Play()
  1179. end
  1180. if math.random(jamRate)==jamRate and magAmmo>0 then
  1181. jammed=true
  1182. end
  1183. end
  1184.  
  1185. debounced=function()
  1186. if sheathed==false and debounce==false then
  1187. return true
  1188. end
  1189. end
  1190.  
  1191. mouse.Button1Down:connect(function()
  1192. if debounced() then
  1193. if automatic==false then
  1194. debounce=true
  1195. firePistol()
  1196. debounce=false
  1197. else
  1198. heldDown=true
  1199. firePistol()
  1200. end
  1201. end
  1202. end)
  1203.  
  1204. mouse.Button1Up:connect(function()
  1205. heldDown=false
  1206. end)
  1207.  
  1208. sheathGun=function()
  1209. ammocounter.Visible=false
  1210. if laser then
  1211. laserEnabled=false
  1212. aLaser.Transparency=1
  1213. end
  1214. Tween(rw,cfn())
  1215. Tween(lw,cfn())
  1216. wait(0.1)
  1217. mw:Destroy''
  1218. mw=nil
  1219. mw=weld(tor,handle,cfn(1.11,-1.09,0)*ang(mr(-111.5),0,0))
  1220. labr:Destroy()
  1221. rabr:Destroy()
  1222. bg.maxTorque=Vector3.new()
  1223. sheathed=true
  1224. end
  1225.  
  1226. unsheathGun=function()
  1227. ammocounter.Visible=true
  1228. mw:Destroy''
  1229. mw=nil
  1230. initializeJoints()
  1231. mw=weld(ch['Right Arm'],handle,cfn(-0.4,-1,-0.19)*ang(mr(-101.5),0,0)*cfn()*ang(0,mr(-30),mr(-5)))
  1232. restorePosition()
  1233. bg.maxTorque = Vector3.new(math.huge,math.huge,math.huge)
  1234. sheathed=false
  1235. end
  1236.  
  1237. laserEnabled=false
  1238.  
  1239. mouse.KeyDown:connect(function(key)
  1240. if key=='r' and debounced() then
  1241. debounce=true
  1242. reloadPistol()
  1243. debounce=false
  1244. elseif key=='f' and debounced() then
  1245. debounce=true
  1246. bs=true
  1247. Tween(rw,cfn(0,0.7,0)*ang(mr(-90),mr(-30),0))
  1248. Tween(lw,cfn(0,0.7,0)*ang(mr(-115),mr(35),0))
  1249. wait(0.1)
  1250. spawn(function()
  1251. cockSlide()
  1252. end)
  1253. Tween(lw,cfn(0,0.7,0)*ang(mr(-115),mr(55),0))
  1254. wait(0.3)
  1255. jammed=false
  1256. restorePosition()
  1257. bs=false
  1258. debounce=false
  1259. elseif key=='l' and debounced() then
  1260. if not laserEnabled then
  1261. laserEnabled=true
  1262. aLaser.Transparency=0.35
  1263. else
  1264. laserEnabled=false
  1265. aLaser.Transparency=1
  1266. end
  1267. end
  1268. end)
  1269.  
  1270. restorePosition=function(speed)
  1271. if not grip then
  1272. Tween(rw,cfn(0,0.7,0)*ang(mr(-90),mr(-30),0),speed)
  1273. Tween(lw,cfn(0,0.7,0)*ang(mr(-90),mr(30),0),speed)
  1274. else
  1275. Tween(rw,cfn(0,0.7,0)*ang(mr(-90),mr(-30),0),speed)
  1276. Tween(lw,cfn(0,1.3,0)*ang(mr(-90),mr(30),0),speed)
  1277. end
  1278. end
  1279.  
  1280. hopper.Selected:connect(function()
  1281. unsheathGun()
  1282. end)
  1283.  
  1284. hopper.Deselected:connect(function()
  1285. sheathGun()
  1286. end)
  1287.  
  1288. game:service'RunService'.RenderStepped:connect(function()
  1289. bg.cframe = CFrame.new(rootpart.Position,mouse.Hit.p*Vector3.new(1,0,1)+rootpart.Position*Vector3.new(0,1,0))
  1290. if laserEnabled==true then
  1291. local user=ch
  1292. local ray = Ray.new(hole.CFrame.p, (m.Hit.p - hole.CFrame.p).unit*300)
  1293. local hit, position = game.Workspace:FindPartOnRay(ray, user)
  1294. local distance = (position - basehole.CFrame.p).magnitude
  1295. aLaser.Size=Vector3.new(0.2,distance,0.2)
  1296. aLaser.CFrame=CFrame.new(position, basehole.CFrame.p) * CFrame.new(0, 0, -distance/2) * ang(mr(-90),0,0)
  1297. end
  1298. for _,v in pairs(tweenTable) do
  1299. if v.Weld.C1==v.Stop then
  1300. table.remove(tweenTable,_)
  1301. else
  1302. if v.th<0.9 then
  1303. v.th=v.th+v.Step
  1304. i=v.th
  1305. v.Weld.C1 = CFrame.new( (v.Start.p.X * (1 - i)) + (v.Stop.p.X * i),
  1306. (v.Start.p.Y * (1 - i)) + (v.Stop.p.Y * i),
  1307. (v.Start.p.Z * (1 - i)) + (v.Stop.p.Z * i)) * CFrame.fromEulerAnglesXYZ(
  1308. (v.X1 * (1 - i)) + (v.X2 * i), (v.Y1 * (1 - i)) + (v.Y2 * i),
  1309. (v.Z1 * (1 - i)) + (v.Z2 * i) )
  1310. else
  1311. v.Weld.C1 = v.Stop
  1312. end
  1313. end
  1314. end
  1315. end)
  1316. for i=1,magAmmo do
  1317. ammocounter.Text=ammocounter.Text .. 'I'
  1318. end
  1319.  
  1320. sheathGun()
  1321.  
  1322. spawn(function()
  1323. while wait(0.07) do
  1324. if heldDown==true then
  1325. spawn(function()
  1326. firePistol()
  1327. end)
  1328. end
  1329. end
  1330. end)
  1331. m.TargetFilter=tube
  1332.  
  1333. while wait(0.03) do
  1334. if spread>1 then
  1335. spread=spread-spreadint/4
  1336. end
  1337. if spread<1 then
  1338. spread=1
  1339. end
  1340. if currentIco>2 then
  1341. switchIco(currentIco-1)
  1342. end
  1343. end
  1344.  
  1345. --hl/https://httpget-inumeration.c9.io/mp45.lua
  1346. --local/game.Players.Conmiro:Destroy''
  1347.  
  1348.  
  1349.  
  1350.  
  1351.  
  1352.  
  1353. end)
  1354.  
  1355.  
  1356. Rabit.Name = "Rabit"
  1357. Rabit.Parent = MainMenu
  1358. Rabit.BackgroundColor3 = Color3.new(0.117647, 0.117647, 0.117647)
  1359. Rabit.BorderColor3 = Color3.new(0.117647, 0.117647, 0.117647)
  1360. Rabit.Position = UDim2.new(0.0194444451, 0, 0.348051935, 0)
  1361. Rabit.Size = UDim2.new(0, 143, 0, 50)
  1362. Rabit.Font = Enum.Font.SourceSans
  1363. Rabit.Text = "Moon Rabit"
  1364. Rabit.TextColor3 = Color3.new(1, 1, 1)
  1365. Rabit.TextScaled = true
  1366. Rabit.TextSize = 14
  1367. Rabit.TextStrokeColor3 = Color3.new(1, 1, 1)
  1368. Rabit.TextWrapped = true
  1369. Rabit.MouseButton1Down:connect(function()
  1370.  
  1371.  
  1372.  
  1373.  
  1374.  
  1375. ------------
  1376. --Lunarine--
  1377. ------------
  1378. --By --
  1379. --CKbackup--
  1380. ------------
  1381.  
  1382. wait(2)
  1383.  
  1384. player = game.Players.LocalPlayer
  1385. chara = player.Character
  1386. debby = game.Debris
  1387. local Mouse = player:GetMouse()
  1388.  
  1389. --Outfit and Weapons--
  1390. New = function(Object, Parent, Name, Data)
  1391. local Object = Instance.new(Object)
  1392. for Index, Value in pairs(Data or {}) do
  1393. Object[Index] = Value
  1394. end
  1395. Object.Parent = Parent
  1396. Object.Name = Name
  1397. return Object
  1398. end
  1399.  
  1400. LeftArm = New("Model",chara,"LeftArm",{})
  1401. MainPart = New("Part",LeftArm,"MainPart",{BrickColor = BrickColor.new("Light blue"),Material = Enum.Material.SmoothPlastic,Size = Vector3.new(1, 2.00000024, 1),CFrame = CFrame.new(4.5, 3.00005722, -4.50000048, -1, 0, 0, 0, 1.00001287, 0, 0, 0, -1.00001287),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.705882, 0.823529, 0.894118),})
  1402. Weld = New("ManualWeld",MainPart,"Weld",{Part0 = MainPart,Part1 = chara["Left Arm"],C0 = CFrame.new(0, 0, 0, -1, 0, 0, 0, 1.00000429, 0, 0, 0, -1.00000429),C1 = CFrame.new(0, 7.62939453e-006, 1.23977661e-005, 1, 0, 0, 0, 1.00000429, 0, 0, 0, 1.00000429),})
  1403. Part = New("Part",LeftArm,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(0.200000003, 0.200000003, 1),CFrame = CFrame.new(4.9000001, 3.90006065, -4.50000048, -1, 0, 0, 0, 1.00001287, 0, 0, 0, -1.00001287),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1404. Mesh = New("BlockMesh",Part,"Mesh",{Scale = Vector3.new(1.00999999, 1.00999999, 1.00999999),})
  1405. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C0 = CFrame.new(0, 0, 0, -1, 0, 0, 0, 1, 0, 0, 0, -1),C1 = CFrame.new(-0.400000095, 0.899991989, 0, -1, 0, 0, 0, 1, 0, 0, 0, -1),})
  1406. Part = New("Part",LeftArm,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(1, 0.200000003, 0.200000003),CFrame = CFrame.new(4.10000086, 2.70005608, -4.50000048, 0, 0, -1, 0, 1.00001287, 0, 1.00001287, 0, 0),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1407. Mesh = New("SpecialMesh",Part,"Mesh",{Scale = Vector3.new(1.00999999, 1.00999999, 1.00999999),MeshType = Enum.MeshType.Wedge,})
  1408. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C0 = CFrame.new(0, 0, 0, 0, 0, 1, 0, 1, -0, -1, 0, 0),C1 = CFrame.new(0.399999142, -0.29999733, 0, -1, 0, 0, 0, 1, 0, 0, 0, -1),})
  1409. Part = New("Part",LeftArm,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(1, 0.200000003, 1),CFrame = CFrame.new(4.5, 2.50004888, -4.50000048, -1, 0, 0, 0, 1.00001287, 0, 0, 0, -1.00001287),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1410. Mesh = New("BlockMesh",Part,"Mesh",{Scale = Vector3.new(1.00999999, 1.00999999, 1.00999999),})
  1411. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C0 = CFrame.new(0, 0, 0, -1, 0, 0, 0, 1, 0, 0, 0, -1),C1 = CFrame.new(0, -0.500001907, 0, -1, 0, 0, 0, 1, 0, 0, 0, -1),})
  1412. Part = New("Part",LeftArm,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(1, 0.400000006, 1),CFrame = CFrame.new(4.30000114, 4.00006056, -4.50000048, -1, 0, 0, 0, 1.00001287, 0, 0, 0, -1.00001287),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1413. Mesh = New("BlockMesh",Part,"Mesh",{Scale = Vector3.new(1.00999999, 1.00999999, 1.00999999),})
  1414. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C0 = CFrame.new(0, 0, 0, -1, 0, 0, 0, 1, 0, 0, 0, -1),C1 = CFrame.new(0.199999094, 0.999990463, 0, -1, 0, 0, 0, 1, 0, 0, 0, -1),})
  1415. Part = New("Part",LeftArm,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(1, 0.200000003, 0.200000003),CFrame = CFrame.new(4.9000001, 4.10006046, -4.50000048, 0, 0, -1, 0, 1.00001287, 0, 1.00001287, 0, 0),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1416. Mesh = New("SpecialMesh",Part,"Mesh",{MeshType = Enum.MeshType.Wedge,})
  1417. Mesh = New("SpecialMesh",Part,"Mesh",{Scale = Vector3.new(1.00999999, 1.00999999, 1.00999999),MeshType = Enum.MeshType.Wedge,})
  1418. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C0 = CFrame.new(0, 0, 0, 0, 0, 1, 0, 1, -0, -1, 0, 0),C1 = CFrame.new(-0.400000095, 1.09998894, 0, -1, 0, 0, 0, 1, 0, 0, 0, -1),})
  1419. Part = New("Part",LeftArm,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(1, 0.400000006, 0.400000006),CFrame = CFrame.new(3.60000014, 4.00006056, -4.50000048, 0, 0, 1, 0, 1.00001287, 0, -1.00001287, 0, 0),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1420. Mesh = New("SpecialMesh",Part,"Mesh",{MeshType = Enum.MeshType.Wedge,})
  1421. Mesh = New("SpecialMesh",Part,"Mesh",{Scale = Vector3.new(1.00999999, 1.00999999, 1.00999999),MeshType = Enum.MeshType.Wedge,})
  1422. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C0 = CFrame.new(0, 0, 0, 0, 0, -1, 0, 1, 0, 1, 0, 0),C1 = CFrame.new(0.899999857, 0.999990463, 0, -1, 0, 0, 0, 1, 0, 0, 0, -1),})
  1423. EnamatePart = New("Part",LeftArm,"EnamatePart",{BrickColor = BrickColor.new("Institutional white"),Material = Enum.Material.SmoothPlastic,Transparency = 1,Transparency = 1,Size = Vector3.new(1, 0.400000036, 1),CFrame = CFrame.new(4.5, 2.00003481, -4.50000906, 1, 0, 0, 0, 1.00001287, 0, 0, 0, 1.00001287),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.972549, 0.972549, 0.972549),})
  1424. Weld = New("ManualWeld",EnamatePart,"Weld",{Part0 = EnamatePart,Part1 = MainPart,C1 = CFrame.new(-2.38418579e-007, -1.00000954, 8.58306885e-006, -1, 0, 0, 0, 1, 0, 0, 0, -1),})
  1425. Part = New("Part",LeftArm,"Part",{BrickColor = BrickColor.new("Fog"),Material = Enum.Material.SmoothPlastic,Size = Vector3.new(1, 0.400000036, 1),CFrame = CFrame.new(4.49999952, 2.20003057, -4.50001335, 1, 0, 0, 0, 1.00002146, 0, 0, 0, 1.00002146),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.780392, 0.831373, 0.894118),})
  1426. Mesh = New("BlockMesh",Part,"Mesh",{Scale = Vector3.new(1.00999999, 1.00999999, 1.00999999),})
  1427. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C0 = CFrame.new(0, 0, 0, 1, 0, 0, 0, 1.00000429, 0, 0, 0, 1.00000429),C1 = CFrame.new(4.76837158e-007, -0.800016403, 1.28746033e-005, -1, 0, 0, 0, 1.00000429, 0, 0, 0, -1.00000429),})
  1428. LeftLeg = New("Model",chara,"LeftLeg",{})
  1429. MainPart = New("Part",LeftLeg,"MainPart",{BrickColor = BrickColor.new("Light blue"),Material = Enum.Material.SmoothPlastic,Size = Vector3.new(1, 2.00000024, 1),CFrame = CFrame.new(5.5, 1.00003695, -4.5, -1, 0, 0, 0, 1.00000501, 0, 0, 0, -1.00000501),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.705882, 0.823529, 0.894118),})
  1430. Weld = New("ManualWeld",MainPart,"Weld",{Part0 = MainPart,Part1 = chara["Left Leg"],C0 = CFrame.new(0, 0, 0, -1, 0, 0, 0, 1.00000572, 0, 0, 0, -1.00000572),C1 = CFrame.new(0, -1.90734863e-006, 1.09672546e-005, 1, 0, 0, 0, 1.00000501, 0, 0, 0, 1.00000501),})
  1431. Part = New("Part",LeftLeg,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(1, 0.200000003, 1),CFrame = CFrame.new(5.5, 0.500034451, -4.5, -1, 0, 0, 0, 1.00000501, 0, 0, 0, -1.00000501),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1432. Mesh = New("BlockMesh",Part,"Mesh",{Scale = Vector3.new(1.00999999, 1.00999999, 1.00999999),})
  1433. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C0 = CFrame.new(0, 0, 0, -1, 0, 0, 0, 1, 0, 0, 0, -1),C1 = CFrame.new(0, -0.5, 0, -1, 0, 0, 0, 1, 0, 0, 0, -1),})
  1434. Part = New("Part",LeftLeg,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(1, 0.200000003, 0.200000003),CFrame = CFrame.new(5.10000229, 0.700036228, -4.5, 0, 0, -1, 0, 1.00000501, 0, 1.00000501, 0, 0),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1435. Mesh = New("SpecialMesh",Part,"Mesh",{Scale = Vector3.new(1.00999999, 1.00999999, 1.00999999),MeshType = Enum.MeshType.Wedge,})
  1436. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C0 = CFrame.new(0, 0, 0, 0, 0, 1, 0, 1, -0, -1, 0, 0),C1 = CFrame.new(0.39999795, -0.299999237, 0, -1, 0, 0, 0, 1, 0, 0, 0, -1),})
  1437. Part = New("Part",LeftLeg,"Part",{BrickColor = BrickColor.new("Fog"),Material = Enum.Material.SmoothPlastic,Size = Vector3.new(1, 0.400000036, 1),CFrame = CFrame.new(5.5, 0.199991405, -4.50000048, 1, 0, 0, 0, 1.00001073, 0, 0, 0, 1.00001073),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.780392, 0.831373, 0.894118),})
  1438. Mesh = New("BlockMesh",Part,"Mesh",{Scale = Vector3.new(1.00999999, 1.00999999, 1.00999999),})
  1439. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C1 = CFrame.new(0, -0.800041556, 4.76837158e-007, -1, 0, 0, 0, 1.00000572, 0, 0, 0, -1.00000572),})
  1440. Chest = New("Model",chara,"Chest",{})
  1441. MainPart = New("Part",Chest,"MainPart",{BrickColor = BrickColor.new("Light blue"),Material = Enum.Material.SmoothPlastic,Size = Vector3.new(2, 2.00000024, 1),CFrame = CFrame.new(6, 3.00006342, -4.50004101, 1, 0, 0, 0, 1.00001383, 5.96046448e-008, 0, -5.96046448e-008, 1.00001383),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.705882, 0.823529, 0.894118),})
  1442. Weld = New("ManualWeld",MainPart,"Weld",{Part0 = MainPart,Part1 = chara.Torso,C0 = CFrame.new(0, 0, 0, 1, 0, 0, 0, 1, -5.96038205e-008, 0, 5.96038205e-008, 1),C1 = CFrame.new(0, 1.28746033e-005, -2.43186951e-005, 1, 0, 0, 0, 1.00000715, -1.19209332e-007, 0, 1.19209332e-007, 1.00000715),})
  1443. Part = New("Part",Chest,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(0.600000024, 0.399999976, 0.200000003),CFrame = CFrame.new(6, 2.16866231, -2.16859388, 5.96039591e-008, -1, 0, 0.707123756, 4.21473736e-008, 0.707122982, -0.707122982, -4.21473274e-008, 0.707123756),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1444. Mesh = New("BlockMesh",Part,"Mesh",{Scale = Vector3.new(1.00999999, 1.00999999, 1.00999999),})
  1445. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C0 = CFrame.new(0, 0, 0, 5.96039591e-008, 0.707110584, -0.707109809, -1, 4.21465884e-008, -4.21465423e-008, 0, 0.707109809, 0.707110584),C1 = CFrame.new(0, -0.831389666, 2.33141494, 1, 0, 0, 0, 1.00000477, -5.96046448e-008, 0, 5.96046448e-008, 1.00000477),})
  1446. Part = New("Part",Chest,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(2, 0.200000003, 1),CFrame = CFrame.new(6, 2.10003901, -4.50004339, 1, 0, 0, 0, 1.00002372, 5.96052345e-008, 0, -5.96052345e-008, 1.00002372),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1447. Mesh = New("BlockMesh",Part,"Mesh",{Scale = Vector3.new(1.00999999, 1.00999999, 1.00999999),})
  1448. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C0 = CFrame.new(0, 0, 0, 1, 0, 0, 0, 1.00000513, -5.96046661e-008, 0, 5.96046661e-008, 1.00000513),C1 = CFrame.new(0, -0.900012016, -2.38418579e-006, 1, 0, 0, 0, 1.00000477, -5.96046448e-008, 0, 5.96046448e-008, 1.00000477),})
  1449. Part = New("Part",Chest,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(0.200000003, 0.200000003, 0.200000003),CFrame = CFrame.new(5.69999981, 3.70007658, -4.90005064, 0, 0, 1, 5.96052345e-008, -1.00002372, 0, 1.00002372, 5.96052345e-008, 0),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1450. Mesh = New("SpecialMesh",Part,"Mesh",{Scale = Vector3.new(1.00999999, 1.00999999, 1.00999999),MeshType = Enum.MeshType.Wedge,})
  1451. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C0 = CFrame.new(0, 0, 0, 0, 5.96046661e-008, 1.00000513, 0, -1.00000513, 5.96046661e-008, 1, 0, 0),C1 = CFrame.new(-0.300000191, 0.700003624, -0.40000391, 1, 0, 0, 0, 1.00000477, -5.96046448e-008, 0, 5.96046448e-008, 1.00000477),})
  1452. Part = New("Part",Chest,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(0.200000003, 0.200000003, 0.600000024),CFrame = CFrame.new(6.5, 3.90008974, -4.50004339, 1, 0, 0, 0, 1.00002372, 5.96052345e-008, 0, -5.96052345e-008, 1.00002372),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1453. Mesh = New("BlockMesh",Part,"Mesh",{Scale = Vector3.new(1.00999999, 1.00999999, 1.00999999),})
  1454. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C0 = CFrame.new(0, 0, 0, 1, 0, 0, 0, 1.00000513, -5.96046661e-008, 0, 5.96046661e-008, 1.00000513),C1 = CFrame.new(0.5, 0.900013924, -2.38418579e-006, 1, 0, 0, 0, 1.00000477, -5.96046448e-008, 0, 5.96046448e-008, 1.00000477),})
  1455. Part = New("Part",Chest,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(0.200000003, 0.200000003, 0.200000003),CFrame = CFrame.new(5.69999981, 3.90008211, -4.90005064, 0, 0, -1, 5.96052345e-008, 1.00002372, 0, 1.00002372, -5.96052345e-008, 0),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1456. Mesh = New("SpecialMesh",Part,"Mesh",{Scale = Vector3.new(1.00999999, 1.00999999, 1.00999999),MeshType = Enum.MeshType.Wedge,})
  1457. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C0 = CFrame.new(0, 0, 0, 0, 5.96046661e-008, 1.00000513, 0, 1.00000513, -5.96046661e-008, -1, 0, 0),C1 = CFrame.new(-0.300000191, 0.900006294, -0.40000391, 1, 0, 0, 0, 1.00000477, -5.96046448e-008, 0, 5.96046448e-008, 1.00000477),})
  1458. Part = New("Part",Chest,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(0.200000003, 0.200000003, 0.200000003),CFrame = CFrame.new(5.50000095, 3.90008783, -4.90005064, 0, 0, 1, 5.96052345e-008, -1.00002372, 0, 1.00002372, 5.96052345e-008, 0),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1459. Mesh = New("SpecialMesh",Part,"Mesh",{Scale = Vector3.new(1.00999999, 1.00999999, 1.00999999),MeshType = Enum.MeshType.Wedge,})
  1460. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C0 = CFrame.new(0, 0, 0, 0, 5.96046661e-008, 1.00000513, 0, -1.00000513, 5.96046661e-008, 1, 0, 0),C1 = CFrame.new(-0.499999046, 0.900012016, -0.40000391, 1, 0, 0, 0, 1.00000477, -5.96046448e-008, 0, 5.96046448e-008, 1.00000477),})
  1461. Part = New("Part",Chest,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(0.200000003, 0.399999857, 0.400000006),CFrame = CFrame.new(5.5999999, 2.52222896, -2.52216196, 0, 0, -1, 0.707122922, 0.707123816, 0, 0.707123816, -0.707122922, 0),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1462. Mesh = New("SpecialMesh",Part,"Mesh",{Scale = Vector3.new(1.00999999, 1.00999999, 1.00999999),MeshType = Enum.MeshType.Wedge,})
  1463. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C0 = CFrame.new(0, 0, 0, 0, 0.707109749, 0.707110643, 0, 0.707110643, -0.707109749, -1, 0, 0),C1 = CFrame.new(-0.400000095, -0.477828026, 1.97785163, 1, 0, 0, 0, 1.00000477, -5.96046448e-008, 0, 5.96046448e-008, 1.00000477),})
  1464. Part = New("Part",Chest,"Part",{BrickColor = BrickColor.new("Light blue"),Material = Enum.Material.SmoothPlastic,Size = Vector3.new(0.200000003, 1.80000007, 2),CFrame = CFrame.new(6.00000906, 1.30002105, -3.70002818, -1.59710094e-008, -7.10542736e-015, -1, 0.500011683, 0.866046011, -7.98569921e-009, 0.866046011, -0.500011683, -1.38316274e-008),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.705882, 0.823529, 0.894118),})
  1465. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C0 = CFrame.new(0, 0, 0, -1.59710094e-008, 0.500002384, 0.866029918, -7.10542736e-015, 0.866029918, -0.500002384, -1, -7.98555089e-009, -1.38313707e-008),C1 = CFrame.new(9.05990601e-006, -1.70001888, 0.800001621, 1, 0, 0, 0, 1.00000477, -5.96046448e-008, 0, 5.96046448e-008, 1.00000477),})
  1466. Part = New("Part",Chest,"Part",{BrickColor = BrickColor.new("Light blue"),Material = Enum.Material.SmoothPlastic,Size = Vector3.new(0.799999893, 1.80000019, 0.200000003),CFrame = CFrame.new(7.30000591, 1.30002677, -4.60004044, 0, -0.500000894, -0.866024911, 5.96052345e-008, 0.866045415, -0.500012755, 1.00002372, -5.16196152e-008, 2.98026706e-008),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.705882, 0.823529, 0.894118),})
  1467. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C0 = CFrame.new(0, 0, 0, 0, 5.96046661e-008, 1.00000513, -0.500000894, 0.866029322, -5.1619125e-008, -0.866024911, -0.500003457, 2.98023863e-008),C1 = CFrame.new(1.30000591, -1.70001316, -0.0999979973, 1, 0, 0, 0, 1.00000477, -5.96046448e-008, 0, 5.96046448e-008, 1.00000477),})
  1468. Part = New("Part",Chest,"Part",{BrickColor = BrickColor.new("Light blue"),Material = Enum.Material.SmoothPlastic,Size = Vector3.new(0.799999893, 1.80000019, 0.200000003),CFrame = CFrame.new(4.70000601, 1.30002677, -4.60004044, 0, 0.499999017, -0.866026223, 5.96052345e-008, 0.866046727, 0.500010848, 1.00002372, -5.16196934e-008, -2.98025569e-008),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.705882, 0.823529, 0.894118),})
  1469. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C0 = CFrame.new(0, 0, 0, 0, 5.96046661e-008, 1.00000513, 0.499999017, 0.866030633, -5.16192031e-008, -0.866026223, 0.50000155, -2.98022744e-008),C1 = CFrame.new(-1.29999399, -1.70001316, -0.0999979973, 1, 0, 0, 0, 1.00000477, -5.96046448e-008, 0, 5.96046448e-008, 1.00000477),})
  1470. Part = New("Part",Chest,"Part",{BrickColor = BrickColor.new("Light blue"),Material = Enum.Material.SmoothPlastic,Size = Vector3.new(0.200000003, 4.4000001, 2),CFrame = CFrame.new(6, 2.38080931, -2.38075256, 0, 0, -1, 0.707109869, 0.707110107, 0, 0.707110107, -0.707109869, 0),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.705882, 0.823529, 0.894118),})
  1471. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C0 = CFrame.new(0, 0, 0, 0, 0.707109869, 0.707110107, 0, 0.707110107, -0.707109869, -1, 0, 0),C1 = CFrame.new(0, -0.619245529, 2.11925912, 1, 0, 0, 0, 1.00000477, -5.96046448e-008, 0, 5.96046448e-008, 1.00000477),})
  1472. Part = New("Part",Chest,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(0.400000006, 1.4000001, 0.200000003),CFrame = CFrame.new(6, 2.90004635, -4.9000144, 1, 0, 0, 0, 1.00001895, 5.96054903e-008, 0, -5.96054903e-008, 1.00001895),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1473. Mesh = New("BlockMesh",Part,"Mesh",{Scale = Vector3.new(1.00999999, 1.00999999, 1.00999999),})
  1474. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C0 = CFrame.new(0, 0, 0, 1, 0, 0, 0, 1.00000513, -5.96046661e-008, 0, 5.96046661e-008, 1.00000513),C1 = CFrame.new(0, -0.10001564, -0.39996767, 1, 0, 0, 0, 1, -5.96038205e-008, 0, 5.96038205e-008, 1),})
  1475. Part = New("Part",Chest,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(0.200000003, 3.60000014, 0.200000003),CFrame = CFrame.new(6, 0.895817995, -0.895722628, 5.96046412e-008, -0.99999994, 0, 0.707120538, 4.21476685e-008, 0.707119763, -0.707119763, -4.21476223e-008, 0.707120538),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1476. Mesh = New("BlockMesh",Part,"Mesh",{Scale = Vector3.new(1.00999999, 1.00999999, 1.00999999),})
  1477. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C0 = CFrame.new(0, 0, 0, 5.96046412e-008, 0.707110763, -0.707109988, -0.99999994, 4.21470858e-008, -4.21470396e-008, 0, 0.707109988, 0.707110763),C1 = CFrame.new(0, -2.10421658, 3.60426831, 1, 0, 0, 0, 1, -5.96038205e-008, 0, 5.96038205e-008, 1),})
  1478. Part = New("Part",Chest,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(0.200000003, 0.400000066, 0.400000006),CFrame = CFrame.new(6.4000001, 2.52221155, -2.52209997, 0, 0, 1, -0.707120538, 0.707119405, 0, -0.707119405, -0.707120538, 0),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1479. Mesh = New("SpecialMesh",Part,"Mesh",{Scale = Vector3.new(1.00999999, 1.00999999, 1.00999999),MeshType = Enum.MeshType.Wedge,})
  1480. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C0 = CFrame.new(0, 0, 0, 0, -0.707110763, -0.70710963, 0, 0.70710963, -0.707110763, 1, 0, 0),C1 = CFrame.new(0.400000095, -0.47784543, 1.97791362, 1, 0, 0, 0, 1, -5.96038205e-008, 0, 5.96038205e-008, 1),})
  1481. Part = New("Part",Chest,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(0.200000003, 1.60000002, 0.200000003),CFrame = CFrame.new(4.47727203, 1.5081805, -1.50808311, 9.39882394e-009, 0.178885445, -0.983869851, 0.707119942, 0.695714474, 0.126493514, 0.707120419, -0.695713997, -0.126493424),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1482. Mesh = New("SpecialMesh",Part,"Mesh",{Scale = Vector3.new(1.00999999, 1.00999999, 1.00999999),MeshType = Enum.MeshType.Wedge,})
  1483. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C0 = CFrame.new(0, 0, 0, 9.39882394e-009, 0.707110167, 0.707110643, 0.178885445, 0.695704877, -0.695704401, -0.983869851, 0.12649177, -0.126491681),C1 = CFrame.new(-1.52272797, -1.49186242, 2.99191642, 1, 0, 0, 0, 1, -5.96038205e-008, 0, 5.96038205e-008, 1),})
  1484. Part = New("Part",Chest,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(0.200000003, 1, 0.400000006),CFrame = CFrame.new(6.80000019, 2.73435283, -2.73424101, 1.98723757e-008, 2.98020062e-008, -1, 0.707119763, 0.70712024, 3.51257512e-008, 0.70712024, -0.707119763, -7.02143277e-009),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1485. Mesh = New("SpecialMesh",Part,"Mesh",{Scale = Vector3.new(1.00999999, 1.00999999, 1.00999999),MeshType = Enum.MeshType.Wedge,})
  1486. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C0 = CFrame.new(0, 0, 0, 1.98723757e-008, 0.707109988, 0.707110465, 2.98020062e-008, 0.707110465, -0.707109988, -1, 3.51252645e-008, -7.02133551e-009),C1 = CFrame.new(0.800000191, -0.265707016, 1.76577568, 1, 0, 0, 0, 1, -5.96038205e-008, 0, 5.96038205e-008, 1),})
  1487. Part = New("Part",Chest,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(0.200000003, 1, 0.400000006),CFrame = CFrame.new(5.19999981, 2.73435235, -2.73424149, 0, 0, 1, -0.707120538, 0.707119405, 0, -0.707119405, -0.707120538, 0),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1488. Mesh = New("SpecialMesh",Part,"Mesh",{Scale = Vector3.new(1.00999999, 1.00999999, 1.00999999),MeshType = Enum.MeshType.Wedge,})
  1489. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C0 = CFrame.new(0, 0, 0, 0, -0.707110763, -0.70710963, 0, 0.70710963, -0.707110763, 1, 0, 0),C1 = CFrame.new(-0.800000191, -0.265707493, 1.7657752, 1, 0, 0, 0, 1, -5.96038205e-008, 0, 5.96038205e-008, 1),})
  1490. Part = New("Part",Chest,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(0.200000003, 1.60000002, 0.200000003),CFrame = CFrame.new(7.52272892, 1.50817478, -1.50807929, -6.16093132e-008, -0.178884313, 0.983862221, -0.707114697, 0.695709288, 0.126492739, -0.707116783, -0.695710361, -0.126493022),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1491. Mesh = New("SpecialMesh",Part,"Mesh",{Scale = Vector3.new(1.00999999, 1.00999999, 1.00999999),MeshType = Enum.MeshType.Wedge,})
  1492. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C0 = CFrame.new(0, 0, 0, -6.16093132e-008, -0.707104921, -0.707107008, -0.178884313, 0.695699692, -0.695700765, 0.983862221, 0.126490995, -0.126491278),C1 = CFrame.new(1.52272892, -1.49186814, 2.99192023, 1, 0, 0, 0, 1, -5.96038205e-008, 0, 5.96038205e-008, 1),})
  1493. Part = New("Part",Chest,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(0.200000033, 1.60000002, 0.200000003),CFrame = CFrame.new(7.25000572, 1.38660395, -4.90001011, 0.866024911, -0.500000834, 0, 0.500010312, 0.866041303, 5.96054903e-008, -2.98027949e-008, -5.16198391e-008, 1.00001895),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1494. Mesh = New("BlockMesh",Part,"Mesh",{Scale = Vector3.new(1.00999999, 1.00999999, 1.00999999),})
  1495. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C0 = CFrame.new(0, 0, 0, 0.866024911, 0.500003397, -2.98023828e-008, -0.500000834, 0.866029322, -5.1619125e-008, 0, 5.96046661e-008, 1.00000513),C1 = CFrame.new(1.25000572, -1.61343718, -0.399963856, 1, 0, 0, 0, 1, -5.96038205e-008, 0, 5.96038205e-008, 1),})
  1496. Part = New("Part",Chest,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(0.200000003, 0.200000003, 0.200000003),CFrame = CFrame.new(6.0999999, 3.700068, -4.9000144, 0, 0, 1, -5.96054903e-008, 1.00001895, 0, -1.00001895, -5.96054903e-008, 0),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1497. Mesh = New("SpecialMesh",Part,"Mesh",{Scale = Vector3.new(1.00999999, 1.00999999, 1.00999999),MeshType = Enum.MeshType.Wedge,})
  1498. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C0 = CFrame.new(0, 0, 0, 0, -5.96046661e-008, -1.00000513, 0, 1.00000513, -5.96046661e-008, 1, 0, 0),C1 = CFrame.new(0.0999999046, 0.699994802, -0.39996767, 1, 0, 0, 0, 1, -5.96038205e-008, 0, 5.96038205e-008, 1),})
  1499. Part = New("Part",Chest,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(0.200000033, 1.60000002, 0.200000003),CFrame = CFrame.new(4.75000572, 1.38660395, -4.90001011, -0.866026044, -0.499998868, 0, 0.500008345, -0.866042435, 5.96054903e-008, -2.98026777e-008, 5.16199066e-008, 1.00001895),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1500. Mesh = New("BlockMesh",Part,"Mesh",{Scale = Vector3.new(1.00999999, 1.00999999, 1.00999999),})
  1501. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C0 = CFrame.new(0, 0, 0, -0.866026044, 0.500001431, -2.98022655e-008, -0.499998868, -0.866030455, 5.16191925e-008, 0, 5.96046661e-008, 1.00000513),C1 = CFrame.new(-1.24999428, -1.61343718, -0.399963856, 1, 0, 0, 0, 1, -5.96038205e-008, 0, 5.96038205e-008, 1),})
  1502. Part = New("Part",Chest,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(0.200000003, 0.200000003, 0.600000024),CFrame = CFrame.new(5.5, 3.9000864, -4.50000381, 1, 0, 0, 0, 1.00001895, 5.96054903e-008, 0, -5.96054903e-008, 1.00001895),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1503. Mesh = New("BlockMesh",Part,"Mesh",{Scale = Vector3.new(1.00999999, 1.00999999, 1.00999999),})
  1504. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C0 = CFrame.new(0, 0, 0, 1, 0, 0, 0, 1.00000513, -5.96046661e-008, 0, 5.96046661e-008, 1.00000513),C1 = CFrame.new(-0.5, 0.900010586, 3.71932983e-005, 1, 0, 0, 0, 1, -5.96038205e-008, 0, 5.96038205e-008, 1),})
  1505. Part = New("Part",Chest,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(0.200000003, 0.200000003, 0.200000003),CFrame = CFrame.new(6.30000019, 3.70007372, -4.9000144, 0, 0, -1, -5.96054903e-008, -1.00001895, 0, -1.00001895, 5.96054903e-008, 0),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1506. Mesh = New("SpecialMesh",Part,"Mesh",{Scale = Vector3.new(1.00999999, 1.00999999, 1.00999999),MeshType = Enum.MeshType.Wedge,})
  1507. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C0 = CFrame.new(0, 0, 0, 0, -5.96046661e-008, -1.00000513, 0, -1.00000513, 5.96046661e-008, -1, 0, 0),C1 = CFrame.new(0.300000191, 0.700000525, -0.39996767, 1, 0, 0, 0, 1, -5.96038205e-008, 0, 5.96038205e-008, 1),})
  1508. Part = New("Part",Chest,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(0.200000003, 0.200000003, 0.200000003),CFrame = CFrame.new(6.30000019, 3.90008068, -4.9000144, 0, 0, 1, -5.96054903e-008, 1.00001895, 0, -1.00001895, -5.96054903e-008, 0),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1509. Mesh = New("SpecialMesh",Part,"Mesh",{Scale = Vector3.new(1.00999999, 1.00999999, 1.00999999),MeshType = Enum.MeshType.Wedge,})
  1510. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C0 = CFrame.new(0, 0, 0, 0, -5.96046661e-008, -1.00000513, 0, 1.00000513, -5.96046661e-008, 1, 0, 0),C1 = CFrame.new(0.300000191, 0.900004864, -0.39996767, 1, 0, 0, 0, 1, -5.96038205e-008, 0, 5.96038205e-008, 1),})
  1511. Part = New("Part",Chest,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(1.20000005, 0.200000003, 0.200000003),CFrame = CFrame.new(6, 3.9000864, -4.09998798, 1, 0, 0, 0, 1.00001895, 5.96054903e-008, 0, -5.96054903e-008, 1.00001895),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1512. Mesh = New("BlockMesh",Part,"Mesh",{Scale = Vector3.new(1.00999999, 1.00999999, 1.00999999),})
  1513. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C0 = CFrame.new(0, 0, 0, 1, 0, 0, 0, 1.00000513, -5.96046661e-008, 0, 5.96046661e-008, 1.00000513),C1 = CFrame.new(0, 0.900010586, 0.400047302, 1, 0, 0, 0, 1, -5.96038205e-008, 0, 5.96038205e-008, 1),})
  1514. Part = New("Part",Chest,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(0.200000003, 0.200000003, 0.200000003),CFrame = CFrame.new(5.90000105, 3.70007181, -4.9000144, 0, 0, -1, 5.96054903e-008, 1.00001895, 0, 1.00001895, -5.96054903e-008, 0),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1515. Mesh = New("SpecialMesh",Part,"Mesh",{Scale = Vector3.new(1.00999999, 1.00999999, 1.00999999),MeshType = Enum.MeshType.Wedge,})
  1516. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C0 = CFrame.new(0, 0, 0, 0, 5.96046661e-008, 1.00000513, 0, 1.00000513, -5.96046661e-008, -1, 0, 0),C1 = CFrame.new(-0.099998951, 0.699998617, -0.39996767, 1, 0, 0, 0, 1, -5.96038205e-008, 0, 5.96038205e-008, 1),})
  1517. Part = New("Part",Chest,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(0.200000003, 0.200000003, 0.200000003),CFrame = CFrame.new(6.5, 3.9000864, -4.9000144, 0, 0, -1, -5.96054903e-008, -1.00001895, 0, -1.00001895, 5.96054903e-008, 0),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1518. Mesh = New("SpecialMesh",Part,"Mesh",{Scale = Vector3.new(1.00999999, 1.00999999, 1.00999999),MeshType = Enum.MeshType.Wedge,})
  1519. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C0 = CFrame.new(0, 0, 0, 0, -5.96046661e-008, -1.00000513, 0, -1.00000513, 5.96046661e-008, -1, 0, 0),C1 = CFrame.new(0.5, 0.900010586, -0.39996767, 1, 0, 0, 0, 1, -5.96038205e-008, 0, 5.96038205e-008, 1),})
  1520. Part = New("Part",Chest,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(0.200000003, 0.200000003, 3.5999999),CFrame = CFrame.new(6.00000906, 0.607151985, -3.29996657, 4.27941371e-009, -1.59710094e-008, 1, 0.866041899, 0.500009298, 4.27950164e-009, -0.500009298, 0.866041899, 1.59713149e-008),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1521. Mesh = New("BlockMesh",Part,"Mesh",{Scale = Vector3.new(1.00999999, 1.00999999, 1.00999999),})
  1522. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C0 = CFrame.new(0, 0, 0, 4.27941371e-009, 0.866029978, -0.500002384, -1.59710094e-008, 0.500002384, 0.866029978, 1, 4.27944258e-009, 1.59710947e-008),C1 = CFrame.new(9.05990601e-006, -2.39287829, 1.20005774, 1, 0, 0, 0, 1, -5.96038205e-008, 0, 5.96038205e-008, 1),})
  1523. Part = New("Part",Chest,"Part",{BrickColor = BrickColor.new("Light blue"),Material = Enum.Material.SmoothPlastic,Size = Vector3.new(0.200000003, 0.200000003, 2),CFrame = CFrame.new(6, 3.90008068, -3.89998055, 0, 0, -1, 5.96054903e-008, 1.00001895, 0, 1.00001895, -5.96054903e-008, 0),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.705882, 0.823529, 0.894118),})
  1524. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C0 = CFrame.new(0, 0, 0, 0, 5.96046661e-008, 1.00000513, 0, 1.00000513, -5.96046661e-008, -1, 0, 0),C1 = CFrame.new(0, 0.900004864, 0.600052118, 1, 0, 0, 0, 1, -5.96038205e-008, 0, 5.96038205e-008, 1),})
  1525. Part = New("Part",Chest,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(0.200000003, 0.200000003, 1.79999995),CFrame = CFrame.new(4.30000687, 0.6071558, -4.09998417, 0.499998927, -0.866026044, 0, 0.866042435, 0.500008404, 5.96054903e-008, -5.16199066e-008, -2.98026812e-008, 1.00001895),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1526. Mesh = New("BlockMesh",Part,"Mesh",{Scale = Vector3.new(1.00999999, 1.00999999, 1.00999999),})
  1527. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C0 = CFrame.new(0, 0, 0, 0.499998927, 0.866030455, -5.16191925e-008, -0.866026044, 0.50000149, -2.98022691e-008, 0, 5.96046661e-008, 1.00000513),C1 = CFrame.new(-1.69999313, -2.39287448, 0.400051117, 1, 0, 0, 0, 1, -5.96038205e-008, 0, 5.96038205e-008, 1),})
  1528. Part = New("Part",Chest,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(0.200000003, 0.200000003, 1.79999995),CFrame = CFrame.new(7.70000648, 0.6071558, -4.09998417, 0.866024911, -0.500000834, 0, 0.500010312, 0.866041303, 5.96054903e-008, -2.98027949e-008, -5.16198391e-008, 1.00001895),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1529. Mesh = New("BlockMesh",Part,"Mesh",{Scale = Vector3.new(1.00999999, 1.00999999, 1.00999999),})
  1530. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C0 = CFrame.new(0, 0, 0, 0.866024911, 0.500003397, -2.98023828e-008, -0.500000834, 0.866029322, -5.1619125e-008, 0, 5.96046661e-008, 1.00000513),C1 = CFrame.new(1.70000648, -2.39287448, 0.400051117, 1, 0, 0, 0, 1, -5.96038205e-008, 0, 5.96038205e-008, 1),})
  1531. Part = New("Part",Chest,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(0.200000003, 0.600000083, 0.799999952),CFrame = CFrame.new(5.4000001, 2.16864324, -2.16853142, 0, 0, 1, 0.707123935, -0.707122922, 0, 0.707122922, 0.707123935, 0),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1532. Mesh = New("SpecialMesh",Part,"Mesh",{Scale = Vector3.new(1.00999999, 1.00999999, 1.00999999),MeshType = Enum.MeshType.Wedge,})
  1533. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C0 = CFrame.new(0, 0, 0, 0, 0.70711416, 0.707113147, 0, -0.707113147, 0.70711416, 1, 0, 0),C1 = CFrame.new(-0.599999905, -0.831408739, 2.3314774, 1, 0, 0, 0, 1, -5.96038205e-008, 0, 5.96038205e-008, 1),})
  1534. Part = New("WedgePart",Chest,"Part",{BrickColor = BrickColor.new("Light blue"),Material = Enum.Material.SmoothPlastic,Size = Vector3.new(0.200000003, 4.4000001, 0.800000012),CFrame = CFrame.new(7.4000001, 2.38079023, -2.38069153, 0, 0, -0.99999994, 0.707119942, 0.707120359, 0, 0.707120359, -0.707119942, 0),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.705882, 0.823529, 0.894118),})
  1535. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C0 = CFrame.new(0, 0, 0, 0, 0.707110167, 0.707110584, 0, 0.707110584, -0.707110167, -0.99999994, 0, 0),C1 = CFrame.new(1.4000001, -0.619264603, 2.11932015, 1, 0, 0, 0, 1, -5.96038205e-008, 0, 5.96038205e-008, 1),})
  1536. Part = New("WedgePart",Chest,"Part",{BrickColor = BrickColor.new("Light blue"),Material = Enum.Material.SmoothPlastic,Size = Vector3.new(0.200000003, 1.79999995, 0.800000012),CFrame = CFrame.new(7.40000916, 1.29999423, -3.69998121, 0, 0, -1.00000024, 0.500009537, 0.866042197, 0, 0.866041958, -0.500009656, 0),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.705882, 0.823529, 0.894118),})
  1537. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C0 = CFrame.new(0, 0, 0, 0, 0.500002623, 0.866030037, 0, 0.866030276, -0.500002742, -1.00000024, 0, 0),C1 = CFrame.new(1.40000916, -1.7000457, 0.80004859, 1, 0, 0, 0, 1, -5.96038205e-008, 0, 5.96038205e-008, 1),})
  1538. Part = New("WedgePart",Chest,"Part",{BrickColor = BrickColor.new("Light blue"),Material = Enum.Material.SmoothPlastic,Size = Vector3.new(0.200000003, 1.79999995, 1),CFrame = CFrame.new(4.70000601, 1.29999804, -3.69996977, -0.866025984, 0.499998987, 0, 0.500008464, 0.866042376, -5.96054903e-008, -2.98026848e-008, -5.1619903e-008, -1.00001895),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.705882, 0.823529, 0.894118),})
  1539. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C0 = CFrame.new(0, 0, 0, -0.866025984, 0.50000155, -2.98022726e-008, 0.499998987, 0.866030395, -5.16191889e-008, 0, -5.96046661e-008, -1.00000513),C1 = CFrame.new(-1.29999399, -1.70004189, 0.800060034, 1, 0, 0, 0, 1, -5.96038205e-008, 0, 5.96038205e-008, 1),})
  1540. Part = New("WedgePart",Chest,"Part",{BrickColor = BrickColor.new("Light blue"),Material = Enum.Material.SmoothPlastic,Size = Vector3.new(0.200000003, 1.79999995, 1),CFrame = CFrame.new(7.30000591, 1.29999804, -3.69996977, -0.866026938, -0.500001907, 0, -0.500011384, 0.866043329, -5.96054903e-008, 2.98028588e-008, -5.16199599e-008, -1.00001895),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.705882, 0.823529, 0.894118),})
  1541. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C0 = CFrame.new(0, 0, 0, -0.866026938, -0.50000447, 2.98024467e-008, -0.500001907, 0.866031349, -5.16192458e-008, 0, -5.96046661e-008, -1.00000513),C1 = CFrame.new(1.30000591, -1.70004189, 0.800060034, 1, 0, 0, 0, 1, -5.96038205e-008, 0, 5.96038205e-008, 1),})
  1542. Part = New("WedgePart",Chest,"Part",{BrickColor = BrickColor.new("Light blue"),Material = Enum.Material.SmoothPlastic,Size = Vector3.new(0.200000003, 4.4000001, 0.800000012),CFrame = CFrame.new(4.5999999, 2.38079023, -2.38069153, 0, 0, 1, -0.707119942, 0.707120538, 0, -0.707120538, -0.707119942, 0),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.705882, 0.823529, 0.894118),})
  1543. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C0 = CFrame.new(0, 0, 0, 0, -0.707110167, -0.707110763, 0, 0.707110763, -0.707110167, 1, 0, 0),C1 = CFrame.new(-1.4000001, -0.619264603, 2.11932015, 1, 0, 0, 0, 1, -5.96038205e-008, 0, 5.96038205e-008, 1),})
  1544. Part = New("WedgePart",Chest,"Part",{BrickColor = BrickColor.new("Light blue"),Material = Enum.Material.SmoothPlastic,Size = Vector3.new(0.200000003, 1.79999995, 0.800000012),CFrame = CFrame.new(4.60000896, 1.29999423, -3.69998121, 0, 0, 1, -0.500009418, 0.86604178, 0, -0.86604178, -0.500009418, 0),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.705882, 0.823529, 0.894118),})
  1545. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C0 = CFrame.new(0, 0, 0, 0, -0.500002503, -0.866029859, 0, 0.866029859, -0.500002503, 1, 0, 0),C1 = CFrame.new(-1.39999104, -1.7000457, 0.80004859, 1, 0, 0, 0, 1, -5.96038205e-008, 0, 5.96038205e-008, 1),})
  1546. Part = New("Part",Chest,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(0.200000003, 0.600000083, 0.800000012),CFrame = CFrame.new(6.5999999, 2.16864347, -2.16853189, 0, 0, -1, -0.707122922, -0.707123935, 0, -0.707123935, 0.707122922, 0),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1547. Mesh = New("SpecialMesh",Part,"Mesh",{Scale = Vector3.new(1.00999999, 1.00999999, 1.00999999),MeshType = Enum.MeshType.Wedge,})
  1548. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C0 = CFrame.new(0, 0, 0, 0, -0.707113147, -0.70711416, 0, -0.70711416, 0.707113147, -1, 0, 0),C1 = CFrame.new(0.599999905, -0.831408501, 2.33147693, 1, 0, 0, 0, 1, -5.96038205e-008, 0, 5.96038205e-008, 1),})
  1549. Part = New("Part",Chest,"Part",{BrickColor = BrickColor.new("Fog"),Material = Enum.Material.SmoothPlastic,Size = Vector3.new(0.200000003, 0.400000006, 0.400000006),CFrame = CFrame.new(6.19999838, 3.80007887, -4.90001774, 0, 0, -1, 0, -1.00002337, 0, -1.00002337, 0, 0),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.780392, 0.831373, 0.894118),})
  1550. Mesh = New("SpecialMesh",Part,"Mesh",{Scale = Vector3.new(1.00999999, 1.00999999, 1.00999999),MeshType = Enum.MeshType.Wedge,})
  1551. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C0 = CFrame.new(0, 0, 0, 0, 0, -1.00000954, 0, -1.00000954, 0, -1, 0, 0),C1 = CFrame.new(0.199998379, 0.800004244, -0.399971008, 1, 0, 0, 0, 1, -5.96038205e-008, 0, 5.96038205e-008, 1),})
  1552. Part = New("Part",Chest,"Part",{BrickColor = BrickColor.new("Fog"),Material = Enum.Material.SmoothPlastic,Size = Vector3.new(0.200000003, 0.400000006, 0.400000006),CFrame = CFrame.new(5.79999971, 3.80007887, -4.90001774, 0, 0, 1, 5.96051848e-008, -1.00001383, 0, 1.00001383, 5.96051848e-008, 0),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.780392, 0.831373, 0.894118),})
  1553. Mesh = New("SpecialMesh",Part,"Mesh",{Scale = Vector3.new(1.00999999, 1.00999999, 1.00999999),MeshType = Enum.MeshType.Wedge,})
  1554. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C0 = CFrame.new(0, 0, 0, 0, 5.96043606e-008, 1, 0, -1, 5.96043606e-008, 1, 0, 0),C1 = CFrame.new(-0.200000286, 0.800004482, -0.399971008, 1, 0, 0, 0, 1, -5.96038205e-008, 0, 5.96038205e-008, 1),})
  1555. FakeHead = New("Model",chara,"FakeHead",{})
  1556. MainPart = New("Part",FakeHead,"MainPart",{BrickColor = BrickColor.new("Fog"),Material = Enum.Material.SmoothPlastic,Size = Vector3.new(2, 1.00000024, 1),CFrame = CFrame.new(6, 4.50005817, -4.5, 1, 0, 0, 0, 1.00000501, 0, 0, 0, 1.00000501),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.780392, 0.831373, 0.894118),})
  1557. Mesh = New("SpecialMesh",MainPart,"Mesh",{Scale = Vector3.new(1.25, 1.25, 1.25),})
  1558. Weld = New("ManualWeld",MainPart,"Weld",{Part0 = MainPart,Part1 = chara.Head,C0 = CFrame.new(0, 0, 0, 1, 0, 0, 0, 1.00000501, 0, 0, 0, 1.00000501),C1 = CFrame.new(0, 1.90734863e-006, 1.09672546e-005, 1, 0, 0, 0, 1.00000501, 0, 0, 0, 1.00000501),})
  1559. Part = New("Part",FakeHead,"Part",{BrickColor = BrickColor.new("Fog"),FormFactor = Enum.FormFactor.Custom,Size = Vector3.new(1.20000005, 1, 0.600000024),CFrame = CFrame.new(6, 5.50007153, -4.69999933, 1, 0, 0, 0, 1.00001001, 0, 0, 0, 1.00001001),CanCollide = false,BottomSurface = Enum.SurfaceType.Smooth,TopSurface = Enum.SurfaceType.Smooth,Color = Color3.new(0.780392, 0.831373, 0.894118),})
  1560. Mesh = New("SpecialMesh",Part,"Mesh",{Scale = Vector3.new(0.800000012, 0.800000012, 0.800000012),MeshId = "http://www.roblox.com/asset/?id=101176852 ",MeshType = Enum.MeshType.FileMesh,})
  1561. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C1 = CFrame.new(0, 1.00000811, -0.199998379, 1, 0, 0, 0, 1.00000501, 0, 0, 0, 1.00000501),})
  1562. Part = New("Part",FakeHead,"Part",{BrickColor = BrickColor.new("Toothpaste"),Material = Enum.Material.Neon,Size = Vector3.new(0.200000003, 0.200000003, 0.400000006),CFrame = CFrame.new(5.89999962, 4.70005989, -5.00000763, -1, 0, 0, 0, 1.00000501, 0, 0, 0, -1.00000501),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0, 1, 1),})
  1563. Mesh = New("SpecialMesh",Part,"Mesh",{Offset = Vector3.new(0.0799999982, 0.0299999993, 0.0399999991),Scale = Vector3.new(0.400000006, 1.5, 0.200000003),MeshType = Enum.MeshType.Sphere,})
  1564. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C0 = CFrame.new(0, 0, 0, -1, 0, 0, 0, 1.00000501, 0, 0, 0, -1.00000501),C1 = CFrame.new(-0.100000381, 0.200000763, -0.500005245, 1, 0, 0, 0, 1.00000501, 0, 0, 0, 1.00000501),})
  1565. Part = New("Part",FakeHead,"Part",{BrickColor = BrickColor.new("Toothpaste"),Material = Enum.Material.Neon,Size = Vector3.new(0.200000003, 0.200000003, 0.400000006),CFrame = CFrame.new(6.0999999, 4.70005989, -5.00000763, 1, 0, 0, 0, 1.00000501, 0, 0, 0, 1.00000501),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0, 1, 1),})
  1566. Mesh = New("SpecialMesh",Part,"Mesh",{Offset = Vector3.new(0.0799999982, 0.0299999993, -0.0399999991),Scale = Vector3.new(0.400000006, 1.5, 0.200000003),MeshType = Enum.MeshType.Sphere,})
  1567. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C0 = CFrame.new(0, 0, 0, 1, 0, 0, 0, 1.00000501, 0, 0, 0, 1.00000501),C1 = CFrame.new(0.0999999046, 0.200000763, -0.500005245, 1, 0, 0, 0, 1.00000501, 0, 0, 0, 1.00000501),})
  1568. Part = New("Part",FakeHead,"Part",{BrickColor = BrickColor.new("Medium red"),Material = Enum.Material.SmoothPlastic,Size = Vector3.new(0.400000006, 0.200000003, 0.400000006),CFrame = CFrame.new(6, 4.50007915, -5.00000763, 1, 0, 0, 0, 1.00000501, 0, 0, 0, 1.00000501),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.854902, 0.52549, 0.478431),})
  1569. Mesh = New("SpecialMesh",Part,"Mesh",{Scale = Vector3.new(0.5, 0.5, 0.699999988),MeshType = Enum.MeshType.Sphere,})
  1570. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C0 = CFrame.new(0, 0, 0, 1, 0, 0, 0, 1.00000501, 0, 0, 0, 1.00000501),C1 = CFrame.new(0, 2.0980835e-005, -0.500005245, 1, 0, 0, 0, 1.00000501, 0, 0, 0, 1.00000501),})
  1571. Halberd = New("Model",chara,"Halberd",{})
  1572. MainPart = New("Part",Halberd,"MainPart",{BrickColor = BrickColor.new("Pastel light blue"),Material = Enum.Material.SmoothPlastic,Size = Vector3.new(0.400000006, 2, 0.200000003),CFrame = CFrame.new(7.5, 2, -4.80002117, 0, 0, -1, -1, 0, 0, 0, 1, 0),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.686275, 0.866667, 1),})
  1573. Mesh = New("CylinderMesh",MainPart,"Mesh",{Scale = Vector3.new(1.00999999, 1.00999999, 1.00999999),})
  1574. Weld = New("ManualWeld",MainPart,"Weld",{Part0 = MainPart,Part1 = chara["Right Arm"],C0 = CFrame.new(0, 0, 0, 0, -1, 0, 0, 0, 1, -1, 0, 0),C1 = CFrame.new(0, -1.00004983, -0.300009251, 1, 0, 0, 0, 1.00000429, 0, 0, 0, 1.00000429),})
  1575. Part = New("Part",Halberd,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(0.200000003, 0.200000003, 0.200000003),CFrame = CFrame.new(7.49998522, 2.0999589, -8.10000324, 1, 0, 0, 0, 1, 0, 0, 0, 1),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1576. Mesh = New("SpecialMesh",Part,"Mesh",{MeshType = Enum.MeshType.Wedge,})
  1577. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C1 = CFrame.new(-0.0999588966, -3.29998207, 1.47819519e-005, 0, -1, 0, 0, 0, 1, -1, 0, 0),})
  1578. Part = New("Part",Halberd,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(0.200000003, 0.200000003, 0.200000003),CFrame = CFrame.new(7.49998522, 1.8999629, -8.10000324, -1, 0, 0, 0, -1, 0, 0, 0, 1),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1579. Mesh = New("SpecialMesh",Part,"Mesh",{MeshType = Enum.MeshType.Wedge,})
  1580. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C0 = CFrame.new(0, 0, 0, -1, 0, 0, 0, -1, 0, 0, 0, 1),C1 = CFrame.new(0.100037098, -3.29998207, 1.47819519e-005, 0, -1, 0, 0, 0, 1, -1, 0, 0),})
  1581. Part = New("Part",Halberd,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(0.200000003, 0.200000003, 1),CFrame = CFrame.new(7.49998522, 2.0999589, -8.90000439, 1, 0, 0, 0, 1, 0, 0, 0, 1),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1582. Mesh = New("SpecialMesh",Part,"Mesh",{MeshType = Enum.MeshType.Wedge,})
  1583. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C1 = CFrame.new(-0.0999588966, -4.09998322, 1.47819519e-005, 0, -1, 0, 0, 0, 1, -1, 0, 0),})
  1584. Part = New("Part",Halberd,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(0.200000003, 0.400000006, 0.400000006),CFrame = CFrame.new(7.49998522, 1.79997587, -8.20000648, 1, 0, 0, 0, -1, 0, 0, 0, -1),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1585. Mesh = New("SpecialMesh",Part,"Mesh",{MeshType = Enum.MeshType.Wedge,})
  1586. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C0 = CFrame.new(0, 0, 0, 1, 0, 0, 0, -1, 0, 0, 0, -1),C1 = CFrame.new(0.200024068, -3.39998531, 1.47819519e-005, 0, -1, 0, 0, 0, 1, -1, 0, 0),})
  1587. Part = New("Part",Halberd,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(0.200000003, 0.200000003, 0.200000003),CFrame = CFrame.new(7.49998522, 1.8999759, -7.90000439, 1, 0, 0, 0, -1, 0, 0, 0, -1),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1588. Mesh = New("SpecialMesh",Part,"Mesh",{MeshType = Enum.MeshType.Wedge,})
  1589. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C0 = CFrame.new(0, 0, 0, 1, 0, 0, 0, -1, 0, 0, 0, -1),C1 = CFrame.new(0.100024104, -3.09998322, 1.47819519e-005, 0, -1, 0, 0, 0, 1, -1, 0, 0),})
  1590. Part = New("Part",Halberd,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(0.200000003, 0.200000003, 1),CFrame = CFrame.new(7.49998522, 1.8999629, -8.90000439, -1, 0, 0, 0, -1, 0, 0, 0, 1),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1591. Mesh = New("SpecialMesh",Part,"Mesh",{MeshType = Enum.MeshType.Wedge,})
  1592. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C0 = CFrame.new(0, 0, 0, -1, 0, 0, 0, -1, 0, 0, 0, 1),C1 = CFrame.new(0.100037098, -4.09998322, 1.47819519e-005, 0, -1, 0, 0, 0, 1, -1, 0, 0),})
  1593. Part = New("Part",Halberd,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(0.200000003, 0.200000003, 0.200000003),CFrame = CFrame.new(7.49998522, 2.09997296, -7.90000439, 1, 0, 0, 0, 1, 0, 0, 0, 1),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1594. Mesh = New("SpecialMesh",Part,"Mesh",{MeshType = Enum.MeshType.Wedge,})
  1595. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C1 = CFrame.new(-0.0999729633, -3.09998322, 1.47819519e-005, 0, -1, 0, 0, 0, 1, -1, 0, 0),})
  1596. Part = New("Part",Halberd,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(0.200000003, 0.400000006, 0.400000006),CFrame = CFrame.new(7.49998522, 2.19997191, -8.20000648, -1, 0, 0, 0, 1, 0, 0, 0, -1),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1597. Mesh = New("SpecialMesh",Part,"Mesh",{MeshType = Enum.MeshType.Wedge,})
  1598. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C0 = CFrame.new(0, 0, 0, -1, 0, 0, 0, 1, 0, 0, 0, -1),C1 = CFrame.new(-0.199971914, -3.39998531, 1.47819519e-005, 0, -1, 0, 0, 0, 1, -1, 0, 0),})
  1599. Part = New("Part",Halberd,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(0.200000003, 0.200000003, 0.200000003),CFrame = CFrame.new(7.49998522, 2.09997296, -7.90000439, -1, 0, 0, 0, 1, 0, 0, 0, -1),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1600. Mesh = New("SpecialMesh",Part,"Mesh",{MeshType = Enum.MeshType.Wedge,})
  1601. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C0 = CFrame.new(0, 0, 0, -1, 0, 0, 0, 1, 0, 0, 0, -1),C1 = CFrame.new(-0.0999729633, -3.09998322, 1.47819519e-005, 0, -1, 0, 0, 0, 1, -1, 0, 0),})
  1602. Part = New("Part",Halberd,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(0.200000003, 0.200000003, 0.200000003),CFrame = CFrame.new(7.49998522, 1.8999759, -7.90000439, -1, 0, 0, 0, -1, 0, 0, 0, 1),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1603. Mesh = New("SpecialMesh",Part,"Mesh",{MeshType = Enum.MeshType.Wedge,})
  1604. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C0 = CFrame.new(0, 0, 0, -1, 0, 0, 0, -1, 0, 0, 0, 1),C1 = CFrame.new(0.100024104, -3.09998322, 1.47819519e-005, 0, -1, 0, 0, 0, 1, -1, 0, 0),})
  1605. Part = New("Part",Halberd,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(0.200000003, 0.200000003, 0.200000003),CFrame = CFrame.new(7.49998522, 1.89998794, -7.70000648, 1, 0, 0, 0, -1, 0, 0, 0, -1),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1606. Mesh = New("SpecialMesh",Part,"Mesh",{MeshType = Enum.MeshType.Wedge,})
  1607. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C0 = CFrame.new(0, 0, 0, 1, 0, 0, 0, -1, 0, 0, 0, -1),C1 = CFrame.new(0.100012064, -2.89998531, 1.47819519e-005, 0, -1, 0, 0, 0, 1, -1, 0, 0),})
  1608. Part = New("Part",Halberd,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(0.200000003, 0.200000003, 0.400000006),CFrame = CFrame.new(7.49999475, 1.899966, -1.80001593, 1, 0, 0, 0, -1, 0, 0, 0, -1),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1609. Mesh = New("SpecialMesh",Part,"Mesh",{MeshType = Enum.MeshType.Wedge,})
  1610. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C0 = CFrame.new(0, 0, 0, 1, 0, 0, 0, -1, 0, 0, 0, -1),C1 = CFrame.new(0.100033998, 3.00000525, 5.24520874e-006, 0, -1, 0, 0, 0, 1, -1, 0, 0),})
  1611. Part = New("Part",Halberd,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(0.200000003, 0.200000003, 0.400000006),CFrame = CFrame.new(7.49999475, 2.0999639, -1.80001593, -1, 0, 0, 0, 1, 0, 0, 0, -1),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1612. Mesh = New("SpecialMesh",Part,"Mesh",{MeshType = Enum.MeshType.Wedge,})
  1613. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C0 = CFrame.new(0, 0, 0, -1, 0, 0, 0, 1, 0, 0, 0, -1),C1 = CFrame.new(-0.0999639034, 3.00000525, 5.24520874e-006, 0, -1, 0, 0, 0, 1, -1, 0, 0),})
  1614. Part = New("Part",Halberd,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(0.200000003, 0.200000003, 0.200000003),CFrame = CFrame.new(7.5, 2.0999999, -2.10002279, 1, 0, 0, 0, 1, 0, 0, 0, 1),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1615. Mesh = New("SpecialMesh",Part,"Mesh",{MeshType = Enum.MeshType.Wedge,})
  1616. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C1 = CFrame.new(-0.0999999046, 2.69999838, 0, 0, -1, 0, 0, 0, 1, -1, 0, 0),})
  1617. Part = New("Part",Halberd,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(0.200000003, 0.200000003, 0.200000003),CFrame = CFrame.new(7.49998522, 2.09998703, -7.70000648, -1, 0, 0, 0, 1, 0, 0, 0, -1),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1618. Mesh = New("SpecialMesh",Part,"Mesh",{MeshType = Enum.MeshType.Wedge,})
  1619. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C0 = CFrame.new(0, 0, 0, -1, 0, 0, 0, 1, 0, 0, 0, -1),C1 = CFrame.new(-0.0999869108, -2.89998531, 1.47819519e-005, 0, -1, 0, 0, 0, 1, -1, 0, 0),})
  1620. Part = New("Part",Halberd,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(0.400000006, 0.200000003, 0.200000003),CFrame = CFrame.new(7.5, 2.00002384, -3.7000227, 0, 0, -1, -1, 0, 0, 0, 1, 0),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1621. Mesh = New("CylinderMesh",Part,"Mesh",{Offset = Vector3.new(0, -0.100000001, 0),Scale = Vector3.new(1.20000005, 0.5, 1.20000005),})
  1622. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C0 = CFrame.new(0, 0, 0, 0, -1, 0, 0, 0, 1, -1, 0, 0),C1 = CFrame.new(-2.39610672e-005, 1.09999847, 0, 0, -1, 0, 0, 0, 1, -1, 0, 0),})
  1623. Part = New("Part",Halberd,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(0.200000003, 0.600000024, 1),CFrame = CFrame.new(7.5, 1.10002398, -7.50001907, 1, 0, 0, 0, -1, 0, 0, 0, -1),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1624. Mesh = New("SpecialMesh",Part,"Mesh",{MeshType = Enum.MeshType.Wedge,})
  1625. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C0 = CFrame.new(0, 0, 0, 1, 0, 0, 0, -1, 0, 0, 0, -1),C1 = CFrame.new(0.899976015, -2.6999979, 0, 0, -1, 0, 0, 0, 1, -1, 0, 0),})
  1626. Part = New("Part",Halberd,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(0.200000003, 0.200000003, 0.200000003),CFrame = CFrame.new(7.5, 1.50002396, -7.10002041, 0, 0, -1, 0, 1, 0, 1, 0, 0),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1627. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C0 = CFrame.new(0, 0, 0, 0, 0, 1, 0, 1, 0, -1, 0, 0),C1 = CFrame.new(0.499976039, -2.29999924, 0, 0, -1, 0, 0, 0, 1, -1, 0, 0),})
  1628. Part = New("Part",Halberd,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(0.400000006, 0.200000003, 0.200000003),CFrame = CFrame.new(7.5, 2, -7.10002041, 0, 0, -1, -1, 0, 0, 0, 1, 0),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1629. Mesh = New("CylinderMesh",Part,"Mesh",{Scale = Vector3.new(1.20000005, 1, 1.20000005),})
  1630. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C0 = CFrame.new(0, 0, 0, 0, -1, 0, 0, 0, 1, -1, 0, 0),C1 = CFrame.new(0, -2.29999924, 0, 0, -1, 0, 0, 0, 1, -1, 0, 0),})
  1631. Part = New("Part",Halberd,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(0.200000003, 0.400000006, 0.200000003),CFrame = CFrame.new(7.5, 1.80002391, -7.10002041, 0, 0, 1, 0, 1, 0, -1, 0, 0),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1632. Mesh = New("CylinderMesh",Part,"Mesh",{})
  1633. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C0 = CFrame.new(0, 0, 0, 0, 0, -1, 0, 1, 0, 1, 0, 0),C1 = CFrame.new(0.199976087, -2.29999924, 0, 0, -1, 0, 0, 0, 1, -1, 0, 0),})
  1634. Part = New("Part",Halberd,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(0.200000003, 0.200000003, 0.200000003),CFrame = CFrame.new(7.5, 1.50002396, -6.90001869, 1, 0, 0, 0, -1, 0, 0, 0, -1),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1635. Mesh = New("SpecialMesh",Part,"Mesh",{MeshType = Enum.MeshType.Wedge,})
  1636. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C0 = CFrame.new(0, 0, 0, 1, 0, 0, 0, -1, 0, 0, 0, -1),C1 = CFrame.new(0.499976039, -2.09999752, 0, 0, -1, 0, 0, 0, 1, -1, 0, 0),})
  1637. Part = New("Part",Halberd,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(0.400000006, 0.200000003, 0.200000003),CFrame = CFrame.new(7.5, 2, -2.30002165, 0, 0, -1, -1, 0, 0, 0, 1, 0),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1638. Mesh = New("CylinderMesh",Part,"Mesh",{Offset = Vector3.new(0, 0.100000001, 0),Scale = Vector3.new(1.20000005, 0.5, 1.20000005),})
  1639. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C0 = CFrame.new(0, 0, 0, 0, -1, 0, 0, 0, 1, -1, 0, 0),C1 = CFrame.new(0, 2.49999952, 0, 0, -1, 0, 0, 0, 1, -1, 0, 0),})
  1640. Part = New("Part",Halberd,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(0.400000006, 0.200000003, 0.200000003),CFrame = CFrame.new(7.5, 2, -2.30002165, 0, 0, -1, -1, 0, 0, 0, 1, 0),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1641. Mesh = New("CylinderMesh",Part,"Mesh",{})
  1642. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C0 = CFrame.new(0, 0, 0, 0, -1, 0, 0, 0, 1, -1, 0, 0),C1 = CFrame.new(0, 2.49999952, 0, 0, -1, 0, 0, 0, 1, -1, 0, 0),})
  1643. Part = New("Part",Halberd,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(0.200000003, 0.200000003, 0.400000006),CFrame = CFrame.new(7.5, 1.30002296, -8.20001888, 1, 0, 0, 0, 1, 0, 0, 0, 1),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1644. Mesh = New("SpecialMesh",Part,"Mesh",{MeshType = Enum.MeshType.Wedge,})
  1645. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C1 = CFrame.new(0.69997704, -3.39999771, 0, 0, -1, 0, 0, 0, 1, -1, 0, 0),})
  1646. Part = New("Part",Halberd,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(0.200000003, 0.200000003, 0.600000024),CFrame = CFrame.new(7.5, 1.50002289, -7.50001907, 1, 0, 0, 0, 1, 0, 0, 0, 1),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1647. Mesh = New("SpecialMesh",Part,"Mesh",{MeshType = Enum.MeshType.Wedge,})
  1648. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C1 = CFrame.new(0.499977052, -2.6999979, 0, 0, -1, 0, 0, 0, 1, -1, 0, 0),})
  1649. Part = New("Part",Halberd,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(0.200000003, 0.400000036, 1.80000007),CFrame = CFrame.new(7.5, 1.00002289, -8.90001869, -1, 0, 0, 0, -1, 0, 0, 0, 1),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1650. Mesh = New("SpecialMesh",Part,"Mesh",{MeshType = Enum.MeshType.Wedge,})
  1651. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C0 = CFrame.new(0, 0, 0, -1, 0, 0, 0, -1, 0, 0, 0, 1),C1 = CFrame.new(0.999977052, -4.09999752, 0, 0, -1, 0, 0, 0, 1, -1, 0, 0),})
  1652. Part = New("Part",Halberd,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(0.400000006, 0.200000003, 0.200000003),CFrame = CFrame.new(7.5, 2.00000095, -5.9000206, 0, 0, -1, -1, 0, 0, 0, 1, 0),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1653. Mesh = New("CylinderMesh",Part,"Mesh",{Offset = Vector3.new(0, 0.100000001, 0),Scale = Vector3.new(1.20000005, 0.5, 1.20000005),})
  1654. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C0 = CFrame.new(0, 0, 0, 0, -1, 0, 0, 0, 1, -1, 0, 0),C1 = CFrame.new(-9.53674316e-007, -1.09999943, 0, 0, -1, 0, 0, 0, 1, -1, 0, 0),})
  1655. Part = New("Part",Halberd,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(0.200000003, 0.200000003, 0.200000003),CFrame = CFrame.new(7.5, 1.90000093, -2.10002279, -1, 0, 0, 0, -1, 0, 0, 0, 1),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1656. Mesh = New("SpecialMesh",Part,"Mesh",{MeshType = Enum.MeshType.Wedge,})
  1657. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C0 = CFrame.new(0, 0, 0, -1, 0, 0, 0, -1, 0, 0, 0, 1),C1 = CFrame.new(0.0999990702, 2.69999838, 0, 0, -1, 0, 0, 0, 1, -1, 0, 0),})
  1658. Part = New("Part",Halberd,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(0.400000006, 0.200000003, 0.200000003),CFrame = CFrame.new(7.5, 2, -2.30002165, 0, 0, -1, -1, 0, 0, 0, 1, 0),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1659. Mesh = New("CylinderMesh",Part,"Mesh",{Offset = Vector3.new(0, -0.100000001, 0),Scale = Vector3.new(1.20000005, 0.5, 1.20000005),})
  1660. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C0 = CFrame.new(0, 0, 0, 0, -1, 0, 0, 0, 1, -1, 0, 0),C1 = CFrame.new(0, 2.49999952, 0, 0, -1, 0, 0, 0, 1, -1, 0, 0),})
  1661. Part = New("Part",Halberd,"Part",{BrickColor = BrickColor.new("Pastel Blue"),Material = Enum.Material.SmoothPlastic,Size = Vector3.new(0.400000006, 5.4000001, 0.200000003),CFrame = CFrame.new(7.5, 2, -5.10002041, 0, 0, -1, -1, 0, 0, 0, 1, 0),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.501961, 0.733333, 0.858824),})
  1662. Mesh = New("CylinderMesh",Part,"Mesh",{})
  1663. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C0 = CFrame.new(0, 0, 0, 0, -1, 0, 0, 0, 1, -1, 0, 0),C1 = CFrame.new(0, -0.299999237, 0, 0, -1, 0, 0, 0, 1, -1, 0, 0),})
  1664. Hitbox = New("Part",Halberd,"Hitbox",{Transparency = 1,Transparency = 1,Size = Vector3.new(0.200000003, 1.60000002, 3.00000024),CFrame = CFrame.new(7.5, 1.60002398, -8.30001926, -1, 0, 0, 0, -1, 0, 0, 0, 1),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,})
  1665. Weld = New("ManualWeld",Hitbox,"Weld",{Part0 = Hitbox,Part1 = MainPart,C0 = CFrame.new(0, 0, 0, -1, 0, 0, 0, -1, 0, 0, 0, 1),C1 = CFrame.new(0.399976075, -3.49999809, 0, 0, -1, 0, 0, 0, 1, -1, 0, 0),})
  1666. Moon = New("Model",chara,"Moon",{})
  1667. MoonPart = New("Part",Moon,"MoonPart",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Transparency = 1,Transparency = 1,Size = Vector3.new(3.00000024, 3, 0.200000003),CFrame = CFrame.new(6.10001802, 9.10006809, -4.50000095, 1, 0, 0, 0, 1, 0, 0, 0, 1),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,})
  1668. Mesh = New("SpecialMesh",MoonPart,"Mesh",{MeshType = Enum.MeshType.Sphere,Scale = Vector3.new(1.2,1.2,18)})
  1669. Part = New("Part",Moon,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(0.200000003, 0.200000003, 0.200000003),CFrame = CFrame.new(4.90001678, 8.30006599, -4.50000191, 0, 0, -1, 0, 1, 0, 1, 0, 0),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1670. Mesh = New("SpecialMesh",Part,"Mesh",{MeshType = Enum.MeshType.Wedge,})
  1671. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MoonPart,C0 = CFrame.new(0, 0, 0, 0, 0, 1, 0, 1, 0, -1, 0, 0),C1 = CFrame.new(-1.20000124, -0.800002098, -9.53674316e-007, 1, 0, 0, 0, 1, 0, 0, 0, 1),})
  1672. Part = New("Part",Moon,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(0.200000003, 0.400000036, 0.400000036),CFrame = CFrame.new(7.20001698, 8.00006676, -4.50000191, 0, 0, -1, 0, -1, 0, -1, 0, 0),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1673. Mesh = New("SpecialMesh",Part,"Mesh",{MeshType = Enum.MeshType.Wedge,})
  1674. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MoonPart,C0 = CFrame.new(0, 0, 0, 0, 0, -1, 0, -1, 0, -1, 0, 0),C1 = CFrame.new(1.09999895, -1.10000134, -9.53674316e-007, 1, 0, 0, 0, 1, 0, 0, 0, 1),})
  1675. Part = New("Part",Moon,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(0.200000003, 0.200000003, 0.200000003),CFrame = CFrame.new(4.90001678, 8.10006618, -4.50000191, 0, 0, 1, 0, -1, 0, 1, 0, 0),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1676. Mesh = New("SpecialMesh",Part,"Mesh",{MeshType = Enum.MeshType.Wedge,})
  1677. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MoonPart,C0 = CFrame.new(0, 0, 0, 0, 0, 1, 0, -1, 0, 1, 0, 0),C1 = CFrame.new(-1.20000124, -1.00000191, -9.53674316e-007, 1, 0, 0, 0, 1, 0, 0, 0, 1),})
  1678. Part = New("Part",Moon,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(0.200000003, 0.800000012, 0.200000003),CFrame = CFrame.new(7.50001717, 8.60006809, -4.50000095, 0, 0, -1, 0, -1, 0, -1, 0, 0),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1679. Mesh = New("SpecialMesh",Part,"Mesh",{MeshType = Enum.MeshType.Wedge,})
  1680. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MoonPart,C0 = CFrame.new(0, 0, 0, 0, 0, -1, 0, -1, 0, -1, 0, 0),C1 = CFrame.new(1.39999914, -0.5, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1),})
  1681. Part = New("Part",Moon,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(0.200000003, 0.200000003, 0.600000143),CFrame = CFrame.new(6.30001783, 8.10006523, -4.50000191, 0, 0, 1, 0, 1, 0, -1, 0, 0),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1682. Mesh = New("SpecialMesh",Part,"Mesh",{MeshType = Enum.MeshType.Wedge,})
  1683. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MoonPart,C0 = CFrame.new(0, 0, 0, 0, 0, -1, 0, 1, 0, 1, 0, 0),C1 = CFrame.new(0.199999809, -1.00000286, -9.53674316e-007, 1, 0, 0, 0, 1, 0, 0, 0, 1),})
  1684. Part = New("Part",Moon,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(0.200000003, 0.600000024, 0.400000006),CFrame = CFrame.new(7.40001726, 9.90007114, -4.50000191, 0, 0, -1, 0, 1, 0, 1, 0, 0),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1685. Mesh = New("SpecialMesh",Part,"Mesh",{MeshType = Enum.MeshType.Wedge,})
  1686. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MoonPart,C0 = CFrame.new(0, 0, 0, 0, 0, 1, 0, 1, 0, -1, 0, 0),C1 = CFrame.new(1.29999924, 0.800003052, -9.53674316e-007, 1, 0, 0, 0, 1, 0, 0, 0, 1),})
  1687. Part = New("Part",Moon,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(0.200000003, 0.400000036, 0.200000003),CFrame = CFrame.new(6.90001678, 8.20006371, -4.50000191, 1, 0, 0, 0, 1, 0, 0, 0, 1),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1688. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MoonPart,C1 = CFrame.new(0.79999876, -0.900004387, -9.53674316e-007, 1, 0, 0, 0, 1, 0, 0, 0, 1),})
  1689. Part = New("Part",Moon,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(0.400000155, 0.200000003, 0.200000003),CFrame = CFrame.new(6.00001669, 7.70006275, -4.50000191, 1, 0, 0, 0, 1, 0, 0, 0, 1),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1690. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MoonPart,C1 = CFrame.new(-0.100001335, -1.40000534, -9.53674316e-007, 1, 0, 0, 0, 1, 0, 0, 0, 1),})
  1691. Part = New("Part",Moon,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(0.600000262, 0.600000024, 0.200000003),CFrame = CFrame.new(7.30001783, 9.30006981, -4.50000191, 1, 0, 0, 0, 1, 0, 0, 0, 1),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1692. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MoonPart,C1 = CFrame.new(1.19999981, 0.200001717, -9.53674316e-007, 1, 0, 0, 0, 1, 0, 0, 0, 1),})
  1693. Part = New("Part",Moon,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(1.80000019, 0.200000003, 0.200000003),CFrame = CFrame.new(6.10001659, 7.90006399, -4.50000191, 1, 0, 0, 0, 1, 0, 0, 0, 1),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1694. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MoonPart,C1 = CFrame.new(-1.43051147e-006, -1.2000041, -9.53674316e-007, 1, 0, 0, 0, 1, 0, 0, 0, 1),})
  1695. Part = New("Part",Moon,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(0.200000003, 0.400000036, 0.600000024),CFrame = CFrame.new(6.90001726, 10.400074, -4.50000191, 0, 0, -1, 0, 1, 0, 1, 0, 0),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1696. Mesh = New("SpecialMesh",Part,"Mesh",{MeshType = Enum.MeshType.Wedge,})
  1697. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MoonPart,C0 = CFrame.new(0, 0, 0, 0, 0, 1, 0, 1, 0, -1, 0, 0),C1 = CFrame.new(0.799999237, 1.30000591, -9.53674316e-007, 1, 0, 0, 0, 1, 0, 0, 0, 1),})
  1698. Part = New("Part",Moon,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(0.200000003, 0.200000003, 0.200000063),CFrame = CFrame.new(6.50001717, 10.3000755, -4.50000191, 0, 0, 1, 0, -1, 0, 1, 0, 0),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1699. Mesh = New("SpecialMesh",Part,"Mesh",{MeshType = Enum.MeshType.Wedge,})
  1700. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MoonPart,C0 = CFrame.new(0, 0, 0, 0, 0, 1, 0, -1, 0, 1, 0, 0),C1 = CFrame.new(0.399999142, 1.20000744, -9.53674316e-007, 1, 0, 0, 0, 1, 0, 0, 0, 1),})
  1701. Part = New("Part",Moon,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(0.200000003, 0.600000024, 0.400000006),CFrame = CFrame.new(6.80001783, 9.90007114, -4.50000191, 0, 0, 1, 0, -1, 0, 1, 0, 0),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1702. Mesh = New("SpecialMesh",Part,"Mesh",{MeshType = Enum.MeshType.Wedge,})
  1703. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MoonPart,C0 = CFrame.new(0, 0, 0, 0, 0, 1, 0, -1, 0, 1, 0, 0),C1 = CFrame.new(0.699999809, 0.800003052, -9.53674316e-007, 1, 0, 0, 0, 1, 0, 0, 0, 1),})
  1704. Part = New("Part",Moon,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(0.200000003, 0.200000003, 0.400000006),CFrame = CFrame.new(5.20001698, 8.10006618, -4.50000095, 0, 0, -1, 0, 1, 0, 1, 0, 0),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1705. Mesh = New("SpecialMesh",Part,"Mesh",{MeshType = Enum.MeshType.Wedge,})
  1706. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MoonPart,C0 = CFrame.new(0, 0, 0, 0, 0, 1, 0, 1, 0, -1, 0, 0),C1 = CFrame.new(-0.900001049, -1.00000191, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1),})
  1707. Part = New("Part",Moon,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(0.200000003, 0.400000036, 0.200000003),CFrame = CFrame.new(6.90001678, 8.60006618, -4.50000191, 0, 0, 1, 0, 1, 0, -1, 0, 0),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1708. Mesh = New("SpecialMesh",Part,"Mesh",{MeshType = Enum.MeshType.Wedge,})
  1709. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MoonPart,C0 = CFrame.new(0, 0, 0, 0, 0, -1, 0, 1, 0, 1, 0, 0),C1 = CFrame.new(0.79999876, -0.500001907, -9.53674316e-007, 1, 0, 0, 0, 1, 0, 0, 0, 1),})
  1710. Part = New("Part",Moon,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(0.200000003, 0.800000012, 0.200000003),CFrame = CFrame.new(6.60001802, 7.70006275, -4.50000095, 0, 1, 0, 0, 0, 1, 1, 0, 0),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1711. Mesh = New("SpecialMesh",Part,"Mesh",{MeshType = Enum.MeshType.Wedge,})
  1712. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MoonPart,C0 = CFrame.new(0, 0, 0, 0, 0, 1, 1, 0, 0, 0, 1, 0),C1 = CFrame.new(0.5, -1.40000534, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1),})
  1713. Part = New("Part",Moon,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(0.200000003, 0.200000003, 0.600000083),CFrame = CFrame.new(6.10001707, 10.5000744, -4.50000191, 0, 0, 1, 0, -1, 0, 1, 0, 0),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1714. Mesh = New("SpecialMesh",Part,"Mesh",{MeshType = Enum.MeshType.Wedge,})
  1715. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MoonPart,C0 = CFrame.new(0, 0, 0, 0, 0, 1, 0, -1, 0, 1, 0, 0),C1 = CFrame.new(-9.53674316e-007, 1.40000629, -9.53674316e-007, 1, 0, 0, 0, 1, 0, 0, 0, 1),})
  1716. Part = New("Part",Moon,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(0.200000003, 0.200000003, 0.600000024),CFrame = CFrame.new(5.50001669, 7.70006514, -4.50000191, 0, 0, 1, 0, -1, 0, 1, 0, 0),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1717. Mesh = New("SpecialMesh",Part,"Mesh",{MeshType = Enum.MeshType.Wedge,})
  1718. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MoonPart,C0 = CFrame.new(0, 0, 0, 0, 0, 1, 0, -1, 0, 1, 0, 0),C1 = CFrame.new(-0.600001335, -1.40000296, -9.53674316e-007, 1, 0, 0, 0, 1, 0, 0, 0, 1),})
  1719. Part = New("Part",Moon,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(0.200000003, 0.200000003, 0.200000003),CFrame = CFrame.new(6.50001717, 10.5000744, -4.50000191, 1, 0, 0, 0, 1, 0, 0, 0, 1),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1720. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MoonPart,C1 = CFrame.new(0.399999142, 1.40000629, -9.53674316e-007, 1, 0, 0, 0, 1, 0, 0, 0, 1),})
  1721. Part = New("Part",Moon,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(0.200000003, 0.200000003, 0.200000003),CFrame = CFrame.new(6.70001698, 8.30006695, -4.50000191, 0, 0, 1, 0, 1, 0, -1, 0, 0),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1722. Mesh = New("SpecialMesh",Part,"Mesh",{MeshType = Enum.MeshType.Wedge,})
  1723. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MoonPart,C0 = CFrame.new(0, 0, 0, 0, 0, -1, 0, 1, 0, 1, 0, 0),C1 = CFrame.new(0.599998951, -0.800001144, -9.53674316e-007, 1, 0, 0, 0, 1, 0, 0, 0, 1),})
  1724. Part = New("Part",Moon,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(0.200000003, 0.200000003, 0.200000003),CFrame = CFrame.new(5.10001659, 7.90006399, -4.50000191, 0, 0, 1, 0, -1, 0, 1, 0, 0),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1725. Mesh = New("SpecialMesh",Part,"Mesh",{MeshType = Enum.MeshType.Wedge,})
  1726. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MoonPart,C0 = CFrame.new(0, 0, 0, 0, 0, 1, 0, -1, 0, 1, 0, 0),C1 = CFrame.new(-1.00000143, -1.2000041, -9.53674316e-007, 1, 0, 0, 0, 1, 0, 0, 0, 1),})
  1727. Part = New("Part",Moon,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(0.200000003, 0.600000024, 0.200000003),CFrame = CFrame.new(7.10001707, 9.90007114, -4.50000191, 1, 0, 0, 0, 1, 0, 0, 0, 1),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1728. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MoonPart,C1 = CFrame.new(0.999999046, 0.800003052, -9.53674316e-007, 1, 0, 0, 0, 1, 0, 0, 0, 1),})
  1729. Part = New("Part",Moon,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(0.400000215, 0.800000012, 0.200000003),CFrame = CFrame.new(7.20001698, 8.60006618, -4.50000191, 1, 0, 0, 0, 1, 0, 0, 0, 1),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1730. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MoonPart,C1 = CFrame.new(1.09999895, -0.500001907, -9.53674316e-007, 1, 0, 0, 0, 1, 0, 0, 0, 1),})
  1731. Part = New("Part",Moon,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(0.200000003, 0.200000003, 0.200000003),CFrame = CFrame.new(6.70001698, 8.10006523, -4.50000191, 1, 0, 0, 0, 1, 0, 0, 0, 1),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1732. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MoonPart,C1 = CFrame.new(0.599998951, -1.00000286, -9.53674316e-007, 1, 0, 0, 0, 1, 0, 0, 0, 1),})
  1733. RightArm = New("Model",chara,"RightArm",{})
  1734. MainPart = New("Part",RightArm,"MainPart",{BrickColor = BrickColor.new("Light blue"),Material = Enum.Material.SmoothPlastic,Size = Vector3.new(1, 2.00000024, 1),CFrame = CFrame.new(7.5, 3.00005794, -4.49999809, 1, 0, 0, 0, 1.00001287, 0, 0, 0, 1.00001287),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.705882, 0.823529, 0.894118),})
  1735. Weld = New("ManualWeld",MainPart,"Weld",{Part0 = MainPart,Part1 = chara["Right Arm"],C0 = CFrame.new(0, 0, 0, 1, 0, 0, 0, 1.00000429, 0, 0, 0, 1.00000429),C1 = CFrame.new(0, 3.81469727e-006, 1.23977661e-005, 1, 0, 0, 0, 1.00000429, 0, 0, 0, 1.00000429),})
  1736. Part = New("Part",RightArm,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(1, 0.200000003, 0.200000003),CFrame = CFrame.new(7.9000001, 2.70005298, -4.49999809, 0, 0, 1, 0, 1.00001287, 0, -1.00001287, 0, 0),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1737. Mesh = New("SpecialMesh",Part,"Mesh",{Scale = Vector3.new(1.00999999, 1.00999999, 1.00999999),MeshType = Enum.MeshType.Wedge,})
  1738. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C0 = CFrame.new(0, 0, 0, 0, 0, -1, 0, 1, 0, 1, 0, 0),C1 = CFrame.new(0.399999946, -0.300001144, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1),})
  1739. Part = New("Part",RightArm,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(1, 0.200000003, 1),CFrame = CFrame.new(7.5, 2.5000515, -4.49999809, 1, 0, 0, 0, 1.00001287, 0, 0, 0, 1.00001287),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1740. Mesh = New("BlockMesh",Part,"Mesh",{Scale = Vector3.new(1.00999999, 1.00999999, 1.00999999),})
  1741. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C1 = CFrame.new(-5.96046448e-008, -0.5, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1),})
  1742. Part = New("Part",RightArm,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(1, 0.400000006, 1),CFrame = CFrame.new(7.69999981, 4.00007057, -4.49999809, 1, 0, 0, 0, 1.00001287, 0, 0, 0, 1.00001287),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1743. Mesh = New("BlockMesh",Part,"Mesh",{Scale = Vector3.new(1.00999999, 1.00999999, 1.00999999),})
  1744. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C1 = CFrame.new(0.199999988, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1),})
  1745. Part = New("Part",RightArm,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(1, 0.400000006, 0.400000006),CFrame = CFrame.new(8.39999962, 4.00007057, -4.49999809, 0, 0, -1, 0, 1.00001287, 0, 1.00001287, 0, 0),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1746. Mesh = New("SpecialMesh",Part,"Mesh",{MeshType = Enum.MeshType.Wedge,})
  1747. Mesh = New("SpecialMesh",Part,"Mesh",{Scale = Vector3.new(1.00999999, 1.00999999, 1.00999999),MeshType = Enum.MeshType.Wedge,})
  1748. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C0 = CFrame.new(0, 0, 0, 0, 0, 1, 0, 1, -0, -1, 0, 0),C1 = CFrame.new(0.899999976, 1, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1),})
  1749. Part = New("Part",RightArm,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(1, 0.200000003, 0.200000003),CFrame = CFrame.new(7.0999999, 4.10007238, -4.49999809, 0, 0, 1, 0, 1.00001287, 0, -1.00001287, 0, 0),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1750. Mesh = New("SpecialMesh",Part,"Mesh",{MeshType = Enum.MeshType.Wedge,})
  1751. Mesh = New("SpecialMesh",Part,"Mesh",{Scale = Vector3.new(1.00999999, 1.00999999, 1.00999999),MeshType = Enum.MeshType.Wedge,})
  1752. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C0 = CFrame.new(0, 0, 0, 0, 0, -1, 0, 1, 0, 1, 0, 0),C1 = CFrame.new(-0.400000095, 1.10000038, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1),})
  1753. Part = New("Part",RightArm,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(0.200000003, 0.200000003, 1),CFrame = CFrame.new(7.0999999, 3.90006924, -4.49999809, 1, 0, 0, 0, 1.00001287, 0, 0, 0, 1.00001287),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1754. Mesh = New("BlockMesh",Part,"Mesh",{Scale = Vector3.new(1.00999999, 1.00999999, 1.00999999),})
  1755. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C1 = CFrame.new(-0.400000036, 0.899999619, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1),})
  1756. Part = New("Part",RightArm,"Part",{BrickColor = BrickColor.new("Fog"),Material = Enum.Material.SmoothPlastic,Size = Vector3.new(1, 0.400000036, 1),CFrame = CFrame.new(7.5, 2.20003915, -4.50001097, 1, 0, 0, 0, 1.00002146, 0, 0, 0, 1.00002146),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.780392, 0.831373, 0.894118),})
  1757. Mesh = New("BlockMesh",Part,"Mesh",{Scale = Vector3.new(1.00999999, 1.00999999, 1.00999999),})
  1758. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C0 = CFrame.new(0, 0, 0, 1, 0, 0, 0, 1.00000429, 0, 0, 0, 1.00000429),C1 = CFrame.new(0, -0.800008535, -1.28746033e-005, 1, 0, 0, 0, 1.00000429, 0, 0, 0, 1.00000429),})
  1759. RightLeg = New("Model",chara,"RightLeg",{})
  1760. MainPart = New("Part",RightLeg,"MainPart",{BrickColor = BrickColor.new("Light blue"),Material = Enum.Material.SmoothPlastic,Size = Vector3.new(1, 2.00000024, 1),CFrame = CFrame.new(6.5, 1.00003695, -4.5, 1, 0, 0, 0, 1.00000501, 0, 0, 0, 1.00000501),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.705882, 0.823529, 0.894118),})
  1761. Weld = New("ManualWeld",MainPart,"Weld",{Part0 = MainPart,Part1 = chara["Right Leg"],C0 = CFrame.new(0, 0, 0, 1, 0, 0, 0, 1.00000572, 0, 0, 0, 1.00000572),C1 = CFrame.new(0, -1.90734863e-006, 1.09672546e-005, 1, 0, 0, 0, 1.00000501, 0, 0, 0, 1.00000501),})
  1762. Part = New("Part",RightLeg,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(1, 0.200000003, 0.200000003),CFrame = CFrame.new(6.9000001, 0.700036228, -4.5, 0, 0, 1, 0, 1.00000501, 0, -1.00000501, 0, 0),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1763. Mesh = New("SpecialMesh",Part,"Mesh",{Scale = Vector3.new(1.00999999, 1.00999999, 1.00999999),MeshType = Enum.MeshType.Wedge,})
  1764. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C0 = CFrame.new(0, 0, 0, 0, 0, -1, 0, 1, 0, 1, 0, 0),C1 = CFrame.new(0.400000095, -0.299999237, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1),})
  1765. Part = New("Part",RightLeg,"Part",{BrickColor = BrickColor.new("Steel blue"),Material = Enum.Material.Neon,Size = Vector3.new(1, 0.200000003, 1),CFrame = CFrame.new(6.5, 0.500034451, -4.5, 1, 0, 0, 0, 1.00000501, 0, 0, 0, 1.00000501),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.321569, 0.486275, 0.682353),})
  1766. Mesh = New("BlockMesh",Part,"Mesh",{Scale = Vector3.new(1.00999999, 1.00999999, 1.00999999),})
  1767. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C1 = CFrame.new(0, -0.5, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1),})
  1768. Part = New("Part",RightLeg,"Part",{BrickColor = BrickColor.new("Fog"),Material = Enum.Material.SmoothPlastic,Size = Vector3.new(1, 0.400000036, 1),CFrame = CFrame.new(6.5, 0.199991465, -4.50000048, 1, 0, 0, 0, 1.00001073, 0, 0, 0, 1.00001073),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.780392, 0.831373, 0.894118),})
  1769. Mesh = New("BlockMesh",Part,"Mesh",{Scale = Vector3.new(1.00999999, 1.00999999, 1.00999999),})
  1770. Weld = New("ManualWeld",Part,"Weld",{Part0 = Part,Part1 = MainPart,C1 = CFrame.new(0, -0.800041497, -4.76837158e-007, 1, 0, 0, 0, 1.00000572, 0, 0, 0, 1.00000572),})
  1771.  
  1772. lap = LeftArm:GetChildren()
  1773. rap = RightArm:GetChildren()
  1774. llp = LeftLeg:GetChildren()
  1775. rlp = RightLeg:GetChildren()
  1776. chp = Chest:GetChildren()
  1777. hdp = FakeHead:GetChildren()
  1778.  
  1779. ch = chara:GetChildren()
  1780. for i = 1, #ch do
  1781. if ch[i].ClassName == "Part" then
  1782. ch[i].Transparency = 1
  1783. if ch[i].Name == "Torso" then
  1784. ch[i].roblox.Transparency = 1
  1785. end
  1786. if ch[i].Name == "Head" then
  1787. ch[i].face.Transparency = 1
  1788. end
  1789. elseif ch[i].ClassName == "Accessory" then
  1790. ch[i]:Destroy()
  1791. end
  1792. end
  1793.  
  1794. Moon:MoveTo(chara.Head.Position + Vector3.new(0,5,0))
  1795. local bodp = Instance.new("BodyPosition",MoonPart)
  1796. bodp.Name = "MoonForce"
  1797. bodp.maxForce = Vector3.new(10000,10000,10000)
  1798. bodp.Position = chara.Head.Position + Vector3.new(0,5,0)
  1799. local gyrp = Instance.new("BodyGyro",MoonPart)
  1800. gyrp.Name = "GyroForce"
  1801. gyrp.CFrame = chara.HumanoidRootPart.CFrame + chara.HumanoidRootPart.CFrame.lookVector
  1802.  
  1803. --Animations--
  1804. function LoadAnim(id)
  1805. local anim = New("Animation",chara,"Animation",{AnimationId = "rbxassetid://"..id})
  1806. local realanim = chara.Humanoid:LoadAnimation(anim)
  1807. return realanim
  1808. end
  1809. HoldA = LoadAnim(69427262)
  1810. Swing1A = LoadAnim(186934658)
  1811. Swing2A = LoadAnim(94160738)
  1812. Swing3A = LoadAnim(186934910)
  1813. Swing4A = LoadAnim(74909528)
  1814. RaiseA = LoadAnim(83994319)
  1815. RiseA = LoadAnim(169638954)
  1816. HoldA:Play()
  1817.  
  1818. --Sounds--
  1819. function LoadSnd(id,loop,vol,pit)
  1820. local snd = New("Sound",chara,"Sound",{SoundId = "rbxassetid://"..id,Looped = loop,Volume = vol,Pitch = pit})
  1821. return snd
  1822. end
  1823. Music = LoadSnd(267871756,true,1,1)
  1824. HitSnd = LoadSnd(566593606,false,1,1)
  1825. ExpSnd = LoadSnd(142070127,false,1,1)
  1826. SlashSnd = LoadSnd(536642316,false,1,1)
  1827. ChargeSnd = LoadSnd(137463716,false,1,1)
  1828. LasSnd = LoadSnd(162246701,false,1,1)
  1829. LasLoopSnd = LoadSnd(162246683,true,1,1)
  1830. BlastSnd = LoadSnd(200633327,false,1,1)
  1831. FlySnd = LoadSnd(169445602,false,1,1)
  1832. BExpSnd = LoadSnd(258057783,false,5,.5)
  1833. Music:Play()
  1834.  
  1835. --Name Tag--
  1836. local naeeym = Instance.new("BillboardGui",chara)
  1837. naeeym.Size = UDim2.new(0,100,0,40)
  1838. naeeym.StudsOffset = Vector3.new(0,2,0)
  1839. naeeym.Adornee = chara.Head
  1840. local tecks = Instance.new("TextLabel",naeeym)
  1841. tecks.BackgroundTransparency = 1
  1842. tecks.BorderSizePixel = 0
  1843. tecks.Text = "Lunarine the Moon Rabbit"
  1844. tecks.Font = "Fantasy"
  1845. tecks.FontSize = "Size24"
  1846. tecks.TextStrokeTransparency = 0
  1847. tecks.TextStrokeColor3 = Color3.new(0,0,0)
  1848. tecks.TextColor3 = BrickColor.new("Baby blue").Color
  1849. tecks.Size = UDim2.new(1,0,0.5,0)
  1850. local htecks = Instance.new("TextLabel",naeeym)
  1851. htecks.BackgroundTransparency = 1
  1852. htecks.BorderSizePixel = 0
  1853. htecks.Text = chara.Humanoid.Health.."/"..chara.Humanoid.MaxHealth
  1854. htecks.Font = "Fantasy"
  1855. htecks.FontSize = "Size24"
  1856. htecks.TextStrokeTransparency = 0
  1857. htecks.TextStrokeColor3 = Color3.new(0,0,0)
  1858. htecks.TextColor3 = BrickColor.new("Baby blue").Color
  1859. htecks.Size = UDim2.new(1,0,0.5,0)
  1860. htecks.Position = UDim2.new(0,0,.5,0)
  1861.  
  1862. --Enamate--
  1863. function Enamate()
  1864. local trace = Instance.new("Part",chara)
  1865. trace.Size = Vector3.new(1,1,1)
  1866. trace.TopSurface = 0
  1867. trace.BottomSurface = 0
  1868. trace.BrickColor = BrickColor.new("Baby blue")
  1869. trace.Material = "Neon"
  1870. trace.CanCollide = false
  1871. trace.Anchored = true
  1872. trace.CFrame = EnamatePart.CFrame * CFrame.fromEulerAnglesXYZ(math.rad(math.random(0,359)),math.rad(math.random(0,359)),math.rad(math.random(0,359)))
  1873. local tracedisp = coroutine.wrap(function()
  1874. for i = 1, 9 do
  1875. wait(.01)
  1876. trace.Transparency = trace.Transparency + .1
  1877. end
  1878. wait(.01)
  1879. trace:Destroy()
  1880. end)
  1881. tracedisp()
  1882. end
  1883. function Enamate2()
  1884. if chara:FindFirstChild("Ring")== nil then
  1885. local angl = CFrame.fromEulerAnglesXYZ(math.rad(math.random(0,359)),math.rad(math.random(0,359)),math.rad(math.random(0,359)))
  1886. local trace = Instance.new("Part",chara)
  1887. trace.Size = Vector3.new(1,1,1)
  1888. trace.Name = "Ring"
  1889. trace.TopSurface = 0
  1890. trace.BottomSurface = 0
  1891. trace.BrickColor = BrickColor.new("Baby blue")
  1892. trace.Material = "Neon"
  1893. trace.CanCollide = false
  1894. trace.Anchored = true
  1895. trace.CFrame = EnamatePart.CFrame * angl
  1896. local tracem = Instance.new("SpecialMesh",trace)
  1897. --tracem.MeshId = "rbxassetid://3270017"
  1898. tracem.MeshType = "Sphere"
  1899. local tracedisp = coroutine.wrap(function()
  1900. for i = 1, 4 do
  1901. wait(.01)
  1902. trace.Transparency = trace.Transparency + .2
  1903. trace.CFrame = EnamatePart.CFrame * angl
  1904. tracem.Scale = tracem.Scale + Vector3.new(.5,.5,.5)
  1905. end
  1906. wait(.01)
  1907. trace:Destroy()
  1908. end)
  1909. tracedisp()
  1910. end
  1911. end
  1912.  
  1913. --Play Sound in Part--
  1914. function PlaySnd(snd,part)
  1915. local sound = snd:Clone()
  1916. sound.PlayOnRemove = true
  1917. sound.Parent = Part
  1918. sound:Destroy()
  1919. end
  1920.  
  1921. --Moon Energy Absorb--
  1922. function EnergyAbsorb(parta)
  1923. local dir = game.Lighting:GetMoonDirection()
  1924. local pos = parta + (dir*500)
  1925. local particle = Instance.new("Part",chara)
  1926. particle.Size = Vector3.new(1,1,1)
  1927. particle.Position = pos
  1928. particle.BrickColor = BrickColor.new("Baby blue")
  1929. particle.Material = "Neon"
  1930. particle.CanCollide = false
  1931. particle.Anchored = true
  1932. particle.CFrame = CFrame.new(pos,parta)
  1933. local mehs = Instance.new("BlockMesh",particle)
  1934. mehs.Scale = Vector3.new(1,1,1000)
  1935. disp = coroutine.wrap(function()
  1936. for i = 1, 4 do
  1937. wait(.01)
  1938. local dir = game.Lighting:GetMoonDirection()
  1939. local pos = parta + (dir*500)
  1940. particle.Position = pos
  1941. particle.CFrame = CFrame.new(pos,parta)
  1942. particle.Transparency = particle.Transparency + .2
  1943. end
  1944. wait(.01)
  1945. particle:Destroy()
  1946. end)
  1947. disp()
  1948. end
  1949.  
  1950. --Moon Aura--
  1951. function MoonOn()
  1952. MoonPart.Transparency = 1
  1953. ChargeSnd:Play()
  1954. for i = 1, 4 do
  1955. EnergyAbsorb(MoonPart.Position)
  1956. wait(.01)
  1957. MoonPart.Transparency = MoonPart.Transparency - .1
  1958. end
  1959. end
  1960. function MoonOff()
  1961. MoonPart.Transparency = .6
  1962. for i = 1, 4 do
  1963. wait(.01)
  1964. MoonPart.Transparency = MoonPart.Transparency + .1
  1965. end
  1966. end
  1967.  
  1968. --Chat Function--
  1969. function chatfunc(text)
  1970. chat = coroutine.wrap(function(ttt)
  1971. if chara:FindFirstChild("TalkingBillBoard")~= nil then
  1972. chara:FindFirstChild("TalkingBillBoard"):destroy()
  1973. end
  1974. local naeeym2 = Instance.new("BillboardGui",chara)
  1975. naeeym2.Size = UDim2.new(0,100,0,40)
  1976. naeeym2.StudsOffset = Vector3.new(0,3,0)
  1977. naeeym2.Adornee = chara.Head
  1978. naeeym2.Name = "TalkingBillBoard"
  1979. local tecks2 = Instance.new("TextLabel",naeeym2)
  1980. tecks2.BackgroundTransparency = 1
  1981. tecks2.BorderSizePixel = 0
  1982. tecks2.Text = text
  1983. tecks2.Font = "Fantasy"
  1984. tecks2.FontSize = "Size24"
  1985. tecks2.TextStrokeTransparency = 0
  1986. tecks2.TextColor3 = Color3.new(1,1,1)
  1987. tecks2.TextStrokeColor3 = Color3.new(0,0,0)
  1988. tecks2.Size = UDim2.new(1,0,0.5,0)
  1989. wait(1)
  1990. for i = 1, 5 do
  1991. wait(.01)
  1992. tecks2.Position = tecks2.Position - UDim2.new(0,0,.05,0)
  1993. tecks2.TextStrokeTransparency = tecks2.TextStrokeTransparency +.2
  1994. tecks2.TextTransparency = tecks2.TextTransparency + .2
  1995. end
  1996. naeeym2:Destroy()
  1997. end)
  1998. chat(text)
  1999. end
  2000.  
  2001. --Damage Function--
  2002. function dealdmg(dude,damage,env,toim)
  2003. hurt = coroutine.wrap(function(dude2,damage2,env2,toim2)
  2004. if dude ~= chara and dude:FindFirstChild("IsHit") == nil then
  2005. finaldmg = damage + math.random(-env,env)
  2006. dude.Humanoid.Health = dude.Humanoid.Health - finaldmg
  2007. local vall = Instance.new("ObjectValue",dude)
  2008. vall.Name = "IsHit"
  2009. debby:AddItem(vall,toim)
  2010. local naeeym2 = Instance.new("BillboardGui",dude)
  2011. naeeym2.Size = UDim2.new(0,100,0,40)
  2012. naeeym2.StudsOffset = Vector3.new(0,3,0)
  2013. naeeym2.Adornee = dude.Head
  2014. naeeym2.Name = "TalkingBillBoard"
  2015. local tecks2 = Instance.new("TextLabel",naeeym2)
  2016. tecks2.BackgroundTransparency = 1
  2017. tecks2.BorderSizePixel = 0
  2018. tecks2.Text = "-"..finaldmg
  2019. tecks2.Font = "Fantasy"
  2020. tecks2.FontSize = "Size24"
  2021. tecks2.TextStrokeTransparency = 0
  2022. tecks2.TextColor3 = Color3.new(1,0.6,0)
  2023. tecks2.TextStrokeColor3 = Color3.new(0,0,0)
  2024. tecks2.Size = UDim2.new(1,0,0.5,0)
  2025. for i = 1, 5 do
  2026. wait(.1)
  2027. tecks2.Position = tecks2.Position - UDim2.new(0,0,.05,0)
  2028. tecks2.TextStrokeTransparency = tecks2.TextStrokeTransparency +.2
  2029. tecks2.TextTransparency = tecks2.TextTransparency + .2
  2030. end
  2031. naeeym2:Destroy()
  2032. end
  2033. end)
  2034. hurt(dude,damage,env,toim)
  2035. end
  2036.  
  2037. --Explode Hitbox--
  2038. function ExHitbox(rad,pos,damage,env,toim)
  2039. local E = Instance.new("Explosion")
  2040. E.Position = pos
  2041. E.Parent = game.Workspace
  2042. E.BlastRadius = rad
  2043. E.BlastPressure = 0
  2044. E.Visible = false
  2045. E.Hit:connect(function(hit)
  2046. if hit.Parent:FindFirstChild("Humanoid")~=nil then
  2047. dealdmg(hit.Parent,damage,env,toim)
  2048. end
  2049. end)
  2050. end
  2051.  
  2052. --Blade Touch--
  2053. function bladehit(hit)
  2054. if bladeactive == true then
  2055. if hit.Parent:FindFirstChild("Humanoid") ~= nil then
  2056. dealdmg(hit.Parent,12,2,.1)
  2057. HitSnd:Play()
  2058. end
  2059. end
  2060. end
  2061. Hitbox.Touched:connect(bladehit)
  2062.  
  2063. --Moon Star--
  2064. function MoonStar()
  2065. del = true
  2066. RaiseA:Play()
  2067. MoonOn()
  2068. for i = 1, 3 do
  2069. wait(.2)
  2070. BlastSnd:Play()
  2071. local missile = Instance.new("Part",game.Workspace)
  2072. Mouse.TargetFilter = missile
  2073. missile.CanCollide = false
  2074. missile.Shape = 0
  2075. missile.Size = Vector3.new(3,3,3)
  2076. missile.Name = "Blast"
  2077. missile.BrickColor = BrickColor.new("Baby blue")
  2078. missile.Material = "Neon"
  2079. missile.BottomSurface = 0
  2080. missile.TopSurface = 0
  2081. missile.CFrame = MoonPart.CFrame
  2082. debby:AddItem(missile,10)
  2083. local mehs = Instance.new("SpecialMesh",missile)
  2084. mehs.MeshType = "Sphere"
  2085. local bodf = Instance.new("BodyForce",missile)
  2086. bodf.Force = Vector3.new(0,game.Workspace.Gravity*missile:GetMass(),0)
  2087. missile.Velocity = (Mouse.Hit.p - MoonPart.Position).unit*50
  2088. missile.Touched:connect(function(hit)
  2089. if missile.Anchored == false and hit.Parent ~= chara and hit.Parent.Parent ~= chara and hit.Name ~= "Blast" and hit.Name ~= "Trace" then
  2090. missile.Anchored = true
  2091. PlaySnd(ExpSnd,missile)
  2092. ExHitbox(10,missile.Position,20,2,.5)
  2093. missile.Anchored = true
  2094. for i = 1, 5 do
  2095. wait(.01)
  2096. missile.Transparency = missile.Transparency + .2
  2097. mehs.Scale = mehs.Scale + Vector3.new(1,1,1)
  2098. end
  2099. end
  2100. end)
  2101. tracer = coroutine.wrap(function()
  2102. while missile.Anchored == false do
  2103. wait(.01)
  2104. local trace = coroutine.wrap(function()
  2105. local tr = Instance.new("Part",game.Workspace)
  2106. tr.Name = "Trace"
  2107. tr.Size = Vector3.new(3,3,3)
  2108. tr.CanCollide = false
  2109. tr.Material = "Neon"
  2110. tr.Anchored = true
  2111. tr.BrickColor = BrickColor.new("Baby blue")
  2112. tr.CFrame = missile.CFrame * CFrame.fromEulerAnglesXYZ(math.rad(math.random(0,359)),math.rad(math.random(0,359)),math.rad(math.random(0,359)))
  2113. for i = 1, 9 do
  2114. wait(.01)
  2115. tr.Transparency = tr.Transparency + .1
  2116. end
  2117. tr:Destroy()
  2118. end)
  2119. trace()
  2120. end
  2121. end)
  2122. tracer()
  2123. end
  2124. wait(.5)
  2125. MoonOff()
  2126. RaiseA:Stop()
  2127. del = false
  2128. end
  2129.  
  2130. --Moon Beam--
  2131. function MoonBeam()
  2132. del = true
  2133. RaiseA:Play()
  2134. MoonOn()
  2135. wait(.5)
  2136. --local EffectPart = Instance.new("Part",game.Workspace)
  2137. --EffectPart.Size = Vector3.new(1,1,1)
  2138. --EffectPart.Anchored = true
  2139. --EffectPart.Transparency = 1
  2140. LasSnd:Play()
  2141. LasLoopSnd:Play()
  2142. for i = 1,50 do
  2143. local P = Instance.new("Part")
  2144. local Place0 = CFrame.new(MoonPart.CFrame.x,MoonPart.CFrame.y,MoonPart.CFrame.z)
  2145. local Place1 = Mouse.Hit
  2146. --EffectPart.CFrame = Place1
  2147. local trace = coroutine.wrap(function()
  2148. local tr = Instance.new("Part",game.Workspace)
  2149. tr.Name = "Trace"
  2150. Mouse.TargetFilter = tr
  2151. tr.Size = Vector3.new(0,0,0)
  2152. tr.CanCollide = false
  2153. tr.Material = "Neon"
  2154. tr.Anchored = true
  2155. tr.BrickColor = BrickColor.new("Baby blue")
  2156. tr.CFrame = Place1 * CFrame.fromEulerAnglesXYZ(math.rad(math.random(0,359)),math.rad(math.random(0,359)),math.rad(math.random(0,359)))
  2157. local trm = Instance.new("BlockMesh",tr)
  2158. for i = 1, 4 do
  2159. wait(.01)
  2160. tr.Transparency = tr.Transparency + .2
  2161. trm.Scale = trm.Scale + Vector3.new(10,10,10)
  2162. end
  2163. tr:Destroy()
  2164. end)
  2165. trace()
  2166. local meshla = Instance.new("BlockMesh", P)
  2167. meshla.Scale = Vector3.new(1,1,1)
  2168. P.formFactor = 0
  2169. P.Size = Vector3.new(1,1,(Place0.p - Place1.p).magnitude)
  2170. P.Name = "Laser"
  2171. P.CFrame = CFrame.new((Place0.p + Place1.p)/2,Place0.p)
  2172. P.Parent = game.Workspace
  2173. P.BrickColor = BrickColor.new("Institutional white")
  2174. P.Material = "Neon"
  2175. P.Anchored = true
  2176. P.CanCollide = false
  2177. P.Locked = true
  2178. P.BottomSurface = "Smooth"
  2179. P.TopSurface = "Smooth"
  2180. ExHitbox(10,Place1.p,20,1,.5)
  2181. wait(0.01)
  2182. P:remove()
  2183. end
  2184. ----
  2185. LasLoopSnd:Stop()
  2186. --EffectPart:Destroy()
  2187. wait(.5)
  2188. MoonOff()
  2189. RaiseA:Stop()
  2190. del = false
  2191. end
  2192.  
  2193. --Moon Pillars--
  2194. function MoonPillars()
  2195. del = true
  2196. ChargeSnd:Play()
  2197. RaiseA:Play()
  2198. wait(.5)
  2199. local num = 10
  2200. for i = 1,5 do
  2201. local cpos = chara.HumanoidRootPart.CFrame+(chara.HumanoidRootPart.CFrame.lookVector*num)
  2202. wait(.1)
  2203. local beam = Instance.new("Part",game.Workspace)
  2204. beam.Size = Vector3.new(0,0,0)
  2205. beam.CFrame = CFrame.new(cpos.x,cpos.y,cpos.z)
  2206. beam.CanCollide = false
  2207. beam.Anchored = true
  2208. beam.BrickColor = BrickColor.new("Baby blue")
  2209. beam.Material = "Neon"
  2210. local mehs = Instance.new("CylinderMesh",beam)
  2211. mehs.Scale = Vector3.new(1,1000,1)
  2212. local trace = Instance.new("Part",game.Workspace)
  2213. trace.Size = Vector3.new(0,0,0)
  2214. trace.CFrame = CFrame.new(cpos.x,cpos.y,cpos.z)
  2215. trace.CanCollide = false
  2216. trace.Anchored = true
  2217. trace.BrickColor = BrickColor.new("Baby blue")
  2218. local tmesh2 = Instance.new("SpecialMesh",trace)
  2219. tmesh2.MeshId = "http://www.roblox.com/asset/?id=20329976"
  2220. tmesh2.Scale = Vector3.new(1,1,1)
  2221. tmesh2.Offset = Vector3.new(0,0,-.125)
  2222. PlaySnd(ExpSnd,beam)
  2223. EnergyAbsorb(beam.CFrame.p)
  2224. ExHitbox(20,beam.Position,25,2,.5)
  2225. tracegrow = coroutine.wrap(function()
  2226. for i = 1, 9 do
  2227. wait(.01)
  2228. beam.Transparency = beam.Transparency + .1
  2229. mehs.Scale = mehs.Scale + Vector3.new(5,5,5)
  2230. trace.Transparency = trace.Transparency + .1
  2231. tmesh2.Scale = tmesh2.Scale + Vector3.new(1,1,1)
  2232. end
  2233. beam:Destroy()
  2234. trace:Destroy()
  2235. end)
  2236. tracegrow()
  2237. num = num + 10
  2238. end
  2239. RaiseA:Stop()
  2240. del = false
  2241. end
  2242.  
  2243. --Cross Explosion--
  2244. function CrossExplosion()
  2245. del = true
  2246. ChargeSnd:Play()
  2247. local spellcircle = Instance.new("Part",chara)
  2248. spellcircle.Anchored = true
  2249. spellcircle.Size = Vector3.new(1,1,1)
  2250. spellcircle.CFrame = chara.Torso.CFrame - Vector3.new(0,2.4,0)
  2251. spellcircle.Transparency = 1
  2252. spellcircle.CanCollide = false
  2253. local blkm = Instance.new("BlockMesh",spellcircle)
  2254. blkm.Scale = Vector3.new(0,1,0)
  2255. local dec = Instance.new("Decal",spellcircle)
  2256. dec.Color3 = Color3.new(1/170,1,1)
  2257. dec.Texture = "rbxassetid://78036587"
  2258. dec.Transparency = 1
  2259. dec.Face = "Top"
  2260. local ptl = Instance.new("PointLight",spellcircle)
  2261. ptl.Range = 0
  2262. ptl.Color = Color3.new(1/170,1,1)
  2263. local bpos = Instance.new("BodyPosition",chara.Torso)
  2264. bpos.Position = chara.Torso.Position + Vector3.new(0,10,0)
  2265. bpos.maxForce = Vector3.new(10000,10000,10000)
  2266. RiseA:Play()
  2267. spellc = coroutine.wrap(function()
  2268. while spellcircle ~= nil do
  2269. wait(.01)
  2270. spellcircle.CFrame = spellcircle.CFrame * CFrame.fromEulerAnglesXYZ(0,math.rad(10),0)
  2271. end
  2272. end)
  2273. spellc()
  2274. for i = 1, 10 do
  2275. wait(.01)
  2276. EnergyAbsorb(spellcircle.Position)
  2277. ptl.Range = ptl.Range + 1
  2278. dec.Transparency = dec.Transparency - .1
  2279. blkm.Scale = blkm.Scale + Vector3.new(3,0,3)
  2280. end
  2281. wait(2)
  2282. local pemit = Instance.new("ParticleEmitter",spellcircle)
  2283. pemit.Color = ColorSequence.new(Color3.new(0.5,1,1))
  2284. pemit.LightEmission = 1
  2285. pemit.Size = NumberSequence.new(10)
  2286. pemit.Texture = "rbxasset://textures/particles/smoke_main.dds"
  2287. pemit.Transparency = NumberSequence.new({NumberSequenceKeypoint.new(0,0),NumberSequenceKeypoint.new(0.9,0),NumberSequenceKeypoint.new(1,1)})
  2288. pemit.Lifetime = NumberRange.new(1)
  2289. pemit.Rate = 10000
  2290. pemit.Speed = NumberRange.new(100)
  2291. LasSnd:Play()
  2292. LasLoopSnd:Play()
  2293. ExHitbox(30,spellcircle.Position,40,10,.5)
  2294. local trace = Instance.new("Part",game.Workspace)
  2295. trace.Size = Vector3.new(0,0,0)
  2296. trace.CFrame = spellcircle.CFrame
  2297. trace.CanCollide = false
  2298. trace.Anchored = true
  2299. trace.BrickColor = BrickColor.new("Medium stone grey")
  2300. local tmesh2 = Instance.new("SpecialMesh",trace)
  2301. tmesh2.MeshId = "http://www.roblox.com/asset/?id=20329976"
  2302. tmesh2.Scale = Vector3.new(5,5,5)
  2303. tmesh2.Offset = Vector3.new(0,0,-.125)
  2304. tracegrow = coroutine.wrap(function()
  2305. for i = 1, 9 do
  2306. wait(.01)
  2307. trace.Transparency = trace.Transparency + .1
  2308. tmesh2.Scale = tmesh2.Scale + Vector3.new(5,5,5)
  2309. end
  2310. trace:Destroy()
  2311. end)
  2312. tracegrow()
  2313. wait(.5)
  2314. local pt1 = Instance.new("Part",chara)
  2315. pt1.Size = Vector3.new(0,0,0)
  2316. pt1.Anchored = true
  2317. pt1.CFrame = spellcircle.CFrame + Vector3.new(0,80,0)
  2318. pt1.Transparency = 1
  2319. local pemit2 = pemit:clone()
  2320. pemit2.Lifetime = NumberRange.new(.3)
  2321. pemit2.EmissionDirection = "Left"
  2322. pemit2.Parent = pt1
  2323. local pemit3 = pemit2:clone()
  2324. pemit3.EmissionDirection = "Right"
  2325. pemit3.Parent = pt1
  2326. wait(.5)
  2327. for i = 1, 20 do
  2328. ExHitbox(30,spellcircle.Position,40,10,.5)
  2329. local trace = Instance.new("Part",game.Workspace)
  2330. trace.Size = Vector3.new(0,0,0)
  2331. trace.CFrame = spellcircle.CFrame
  2332. trace.CanCollide = false
  2333. trace.Anchored = true
  2334. trace.BrickColor = BrickColor.new("Medium stone grey")
  2335. local tmesh2 = Instance.new("SpecialMesh",trace)
  2336. tmesh2.MeshId = "http://www.roblox.com/asset/?id=20329976"
  2337. tmesh2.Scale = Vector3.new(5,5,5)
  2338. tmesh2.Offset = Vector3.new(0,0,-.125)
  2339. for i = 1, 9 do
  2340. wait(.01)
  2341. trace.Transparency = trace.Transparency + .1
  2342. tmesh2.Scale = tmesh2.Scale + Vector3.new(5,5,5)
  2343. end
  2344. trace:Destroy()
  2345. end
  2346. wait(.5)
  2347. LasLoopSnd:Stop()
  2348. pemit.Enabled = false
  2349. pemit2.Enabled = false
  2350. pemit3.Enabled = false
  2351. for i = 1, 10 do
  2352. wait(.01)
  2353. ptl.Range = ptl.Range - 1
  2354. dec.Transparency = dec.Transparency + .1
  2355. blkm.Scale = blkm.Scale - Vector3.new(3,0,3)
  2356. end
  2357. wait(.5)
  2358. spellcircle:Destroy()
  2359. bpos:Destroy()
  2360. RiseA:Stop()
  2361. del = false
  2362. end
  2363.  
  2364. --Lunar Destruction--
  2365. function LunarDestruction()
  2366. del = true
  2367. local spellcircle = Instance.new("Part",chara)
  2368. spellcircle.Anchored = true
  2369. spellcircle.Size = Vector3.new(1,1,1)
  2370. spellcircle.CFrame = chara.Torso.CFrame - Vector3.new(0,2.4,0)
  2371. spellcircle.Transparency = 1
  2372. spellcircle.CanCollide = false
  2373. local blkm = Instance.new("BlockMesh",spellcircle)
  2374. blkm.Scale = Vector3.new(0,1,0)
  2375. local dec = Instance.new("Decal",spellcircle)
  2376. dec.Color3 = Color3.new(1/170,1,1)
  2377. dec.Texture = "rbxassetid://78036587"
  2378. dec.Transparency = 1
  2379. dec.Face = "Top"
  2380. local ptl = Instance.new("PointLight",spellcircle)
  2381. ptl.Range = 0
  2382. ptl.Color = Color3.new(1/170,1,1)
  2383. local bpos = Instance.new("BodyPosition",chara.Torso)
  2384. bpos.Position = chara.Torso.Position + Vector3.new(0,50,0)
  2385. bpos.maxForce = Vector3.new(10000,10000,10000)
  2386. RiseA:Play()
  2387. spellc = coroutine.wrap(function()
  2388. while spellcircle ~= nil do
  2389. wait(.01)
  2390. spellcircle.CFrame = spellcircle.CFrame * CFrame.fromEulerAnglesXYZ(0,math.rad(10),0)
  2391. end
  2392. end)
  2393. spellc()
  2394. for i = 1, 10 do
  2395. wait(.01)
  2396. ptl.Range = ptl.Range + 1
  2397. dec.Transparency = dec.Transparency - .1
  2398. blkm.Scale = blkm.Scale + Vector3.new(10,0,10)
  2399. end
  2400. wait(2)
  2401. local dir = game.Lighting:GetMoonDirection()
  2402. local pos = spellcircle.Position + (dir*1400)
  2403. local particle = Instance.new("Part",chara)
  2404. particle.Transparency = 1
  2405. particle.Size = Vector3.new(1,1,1)
  2406. particle.Position = pos
  2407. particle.BrickColor = BrickColor.new("Baby blue")
  2408. particle.Material = "Neon"
  2409. particle.CanCollide = false
  2410. particle.Anchored = true
  2411. particle.CFrame = CFrame.new(pos,spellcircle.Position)
  2412. local mehs = Instance.new("BlockMesh",particle)
  2413. mehs.Scale = Vector3.new(50,50,3000)
  2414. PlaySnd(ChargeSnd,spellcircle)
  2415. local pemit = Instance.new("ParticleEmitter",particle)
  2416. pemit.Rate = 10000000
  2417. pemit.LightEmission = 1
  2418. pemit.Size = NumberSequence.new({NumberSequenceKeypoint.new(0,20),NumberSequenceKeypoint.new(1,0)})
  2419. pemit.VelocitySpread = 10000
  2420. pemit.Speed = NumberRange.new(200)
  2421. wait(1)
  2422. LasLoopSnd:Play()
  2423. LasSnd:Play()
  2424. particle.Transparency = 0
  2425. for i = 1, 100 do
  2426. ExHitbox(60,spellcircle.Position,50,5,.2)
  2427. wait(.01)
  2428. local trace = coroutine.wrap(function()
  2429. local tr = Instance.new("Part",game.Workspace)
  2430. tr.Name = "Trace"
  2431. tr.Size = Vector3.new(0,0,0)
  2432. tr.CanCollide = false
  2433. tr.Material = "Neon"
  2434. tr.Anchored = true
  2435. tr.BrickColor = BrickColor.new("Baby blue")
  2436. tr.CFrame = spellcircle.CFrame * CFrame.fromEulerAnglesXYZ(math.rad(math.random(0,359)),math.rad(math.random(0,359)),math.rad(math.random(0,359)))
  2437. local trm = Instance.new("BlockMesh",tr)
  2438. for i = 1, 4 do
  2439. wait(.01)
  2440. tr.Transparency = tr.Transparency + .2
  2441. trm.Scale = trm.Scale + Vector3.new(200,200,200)
  2442. end
  2443. tr:Destroy()
  2444. end)
  2445. trace()
  2446. end
  2447. for i = 1, 9 do
  2448. particle.Transparency = particle.Transparency + .1
  2449. wait(.01)
  2450. end
  2451. particle:Destroy()
  2452. LasLoopSnd:Stop()
  2453. for i = 1, 10 do
  2454. wait(.01)
  2455. ptl.Range = ptl.Range - 1
  2456. dec.Transparency = dec.Transparency + .1
  2457. blkm.Scale = blkm.Scale - Vector3.new(10,0,10)
  2458. end
  2459. RiseA:Stop()
  2460. bpos:Destroy()
  2461. spellcircle:Destroy()
  2462. del = false
  2463. end
  2464.  
  2465. --Astral Collision--
  2466. function AstralCollision()
  2467. local origpos = chara.Torso.Position
  2468. local bpos = Instance.new("BodyPosition",chara.Torso)
  2469. bpos.Position = origpos + Vector3.new(0,3000,0)
  2470. bpos.maxForce = Vector3.new(99999,99999,99999)
  2471. RiseA:Play()
  2472. FlySnd:Play()
  2473. local trace = Instance.new("Part",game.Workspace)
  2474. trace.Size = Vector3.new(0,0,0)
  2475. trace.CFrame = chara.HumanoidRootPart.CFrame - Vector3.new(0,2,0)
  2476. trace.CanCollide = false
  2477. trace.Anchored = true
  2478. trace.BrickColor = BrickColor.new("Medium stone grey")
  2479. local tmesh2 = Instance.new("SpecialMesh",trace)
  2480. tmesh2.MeshId = "http://www.roblox.com/asset/?id=20329976"
  2481. tmesh2.Scale = Vector3.new(5,5,5)
  2482. tmesh2.Offset = Vector3.new(0,0,-.125)
  2483. for i = 1, 9 do
  2484. wait(.01)
  2485. trace.Transparency = trace.Transparency + .1
  2486. tmesh2.Scale = tmesh2.Scale + Vector3.new(5,5,5)
  2487. end
  2488. trace:Destroy()
  2489. wait(5)
  2490. local moon = Instance.new("Part",chara)
  2491. moon.Shape = 0
  2492. moon.Size = Vector3.new(1,1,1)
  2493. moon.Material = "Pebble"
  2494. moon.Position = origpos + Vector3.new(0,2000,0)
  2495. local moonmehs = Instance.new("SpecialMesh",moon)
  2496. moonmehs.MeshType = "Sphere"
  2497. moonmehs.Scale = Vector3.new(1000,1000,1000)
  2498. local moonf = Instance.new("BodyPosition",moon)
  2499. moonf.Position = origpos - Vector3.new(0,10,0)
  2500. moonf.maxForce = Vector3.new(100,100,100)
  2501. moon.Touched:connect(function(hit)
  2502. if moon.Anchored == false and hit.Parent ~= chara and hit.Parent.Parent ~= chara then
  2503. moon.Anchored = true
  2504. PlaySnd(BExpSnd,game.Workspace)
  2505. local E = Instance.new("Explosion",game.Workspace)
  2506. E.BlastRadius = 99999999999999999
  2507. E.BlastPressure = 0
  2508. E.Position = origpos
  2509. E.Visible = false
  2510. E.Hit:connect(function(hit)
  2511. if hit.Parent ~= chara and hit.Parent.Parent ~= chara then
  2512. hit:BreakJoints()
  2513. end
  2514. end)
  2515. wait(1)
  2516. bpos.Position = origpos
  2517. for i = 1, 9 do
  2518. wait(.1)
  2519. moon.Transparency = moon.Transparency + .1
  2520. end
  2521. wait(.1)
  2522. moon:Destroy()
  2523. wait(1)
  2524. bpos:Destroy()
  2525. RiseA:Stop()
  2526. end
  2527. end)
  2528. end
  2529.  
  2530. --Keys--
  2531. del = false
  2532. mus = false
  2533. function onKeyDown(key)
  2534. if del == false then
  2535. if key == "z" then
  2536. MoonStar()
  2537. elseif key == "x" then
  2538. MoonBeam()
  2539. elseif key == "c" then
  2540. MoonPillars()
  2541. elseif key == "v" then
  2542. CrossExplosion()
  2543. elseif key == "b" then
  2544. LunarDestruction()
  2545. elseif key == "n" then
  2546. AstralCollision()
  2547. end
  2548. end
  2549. if key == "m" then
  2550. if mus == true then
  2551. Music:Stop()
  2552. mus = false
  2553. elseif mus == false then
  2554. Music:Play()
  2555. mus = true
  2556. end
  2557. end
  2558. end
  2559.  
  2560. --Click--
  2561. combo = 0
  2562. function onButton1Down()
  2563. if del == false then
  2564. if combo == 0 then
  2565. del = true
  2566. SlashSnd.Pitch = 1
  2567. SlashSnd:Play()
  2568. Swing1A:Play()
  2569. bladeactive = true
  2570. wait(.5)
  2571. Swing1A:Stop()
  2572. bladeactive = false
  2573. combo = 1
  2574. del = false
  2575. elseif combo == 1 then
  2576. del = true
  2577. SlashSnd.Pitch = 1.1
  2578. SlashSnd:Play()
  2579. Swing2A:Play()
  2580. bladeactive = true
  2581. wait(.5)
  2582. Swing2A:Stop()
  2583. bladeactive = false
  2584. combo = 2
  2585. del = false
  2586. elseif combo == 2 then
  2587. del = true
  2588. SlashSnd.Pitch = .9
  2589. SlashSnd:Play()
  2590. Swing3A:Play()
  2591. bladeactive = true
  2592. wait(.5)
  2593. Swing3A:Stop()
  2594. bladeactive = false
  2595. combo = 3
  2596. del = false
  2597. elseif combo == 3 then
  2598. del = true
  2599. ExpSnd:Play()
  2600. Swing4A:Play()
  2601. ExHitbox(10,chara.Torso.Position + chara.Torso.CFrame.lookVector*10,20,5,.5)
  2602. local jtrace = Instance.new("Part",game.Workspace)
  2603. jtrace.Size = Vector3.new(1,1,1)
  2604. jtrace.Position = chara.Torso.Position + chara.Torso.CFrame.lookVector*10
  2605. jtrace.CFrame = chara.Torso.CFrame + chara.Torso.CFrame.lookVector*10
  2606. jtrace.Anchored = true
  2607. jtrace.CanCollide = false
  2608. jtrace.Material = "Neon"
  2609. jtrace.BrickColor = BrickColor.new("Baby blue")
  2610. jtrace.Transparency = .3
  2611. local tmesh = Instance.new("SpecialMesh",jtrace)
  2612. tmesh.MeshType = "Sphere"
  2613. tmesh.Scale = Vector3.new(3,3,3)
  2614. local jtrace2 = Instance.new("Part",game.Workspace)
  2615. jtrace2.Size = Vector3.new(0,0,0)
  2616. jtrace2.BrickColor = BrickColor.new("Institutional white")
  2617. jtrace2.Position = chara.Torso.Position + chara.Torso.CFrame.lookVector*10
  2618. jtrace2.CFrame = chara.Torso.CFrame + chara.Torso.CFrame.lookVector*10
  2619. jtrace2.Anchored = true
  2620. jtrace2.Transparency = .3
  2621. local tmesh2 = Instance.new("SpecialMesh",jtrace2)
  2622. tmesh2.MeshId = "http://www.roblox.com/asset/?id=1125478"
  2623. tmesh2.Scale = Vector3.new(5,0,5)
  2624. tracegrow = coroutine.wrap(function()
  2625. for i = 1, 7 do
  2626. wait(.01)
  2627. jtrace.Transparency = jtrace.Transparency + .1
  2628. tmesh.Scale = tmesh.Scale + Vector3.new(2,2,2)
  2629. jtrace2.Transparency = jtrace2.Transparency + .1
  2630. tmesh2.Scale = tmesh2.Scale + Vector3.new(1,.05,1)
  2631. end
  2632. jtrace:Destroy()
  2633. jtrace2:Destroy()
  2634. end)
  2635. tracegrow()
  2636. wait(.5)
  2637. Swing4A:Stop()
  2638. combo = 0
  2639. del = false
  2640. end
  2641. end
  2642. end
  2643.  
  2644. --Mouse Functions--
  2645. if Mouse then
  2646. Mouse.KeyDown:connect(onKeyDown)
  2647. Mouse.Button1Down:connect(onButton1Down)
  2648. end
  2649.  
  2650. --To Night--
  2651. loopnight = coroutine.wrap(function()
  2652. if chara.Humanoid.Health > 1 then
  2653. wait(.1)
  2654. game.Lighting.TimeOfDay = "20:00:00"
  2655. end
  2656. end)
  2657. night = coroutine.wrap(function()
  2658. game.Lighting.TimeOfDay = "12:00:00"
  2659. wait(.1)
  2660. game.Lighting.TimeOfDay = "13:00:00"
  2661. wait(.1)
  2662. game.Lighting.TimeOfDay = "14:00:00"
  2663. wait(.1)
  2664. game.Lighting.TimeOfDay = "15:00:00"
  2665. wait(.1)
  2666. game.Lighting.TimeOfDay = "16:00:00"
  2667. wait(.1)
  2668. game.Lighting.TimeOfDay = "17:00:00"
  2669. wait(.1)
  2670. game.Lighting.TimeOfDay = "18:00:00"
  2671. wait(.1)
  2672. game.Lighting.TimeOfDay = "19:00:00"
  2673. wait(.1)
  2674. game.Lighting.TimeOfDay = "20:00:00"
  2675. wait(.1)
  2676. loopnight()
  2677. end)
  2678. night()
  2679.  
  2680. --DIE--
  2681. chara.Humanoid.Died:connect(function()
  2682. origpos = chara.Torso.Position
  2683. for i = 1, #lap do
  2684. lap[i].Anchored = true
  2685. end
  2686. for i = 1, #rap do
  2687. rap[i].Anchored = true
  2688. end
  2689. for i = 1, #llp do
  2690. llp[i].Anchored = true
  2691. end
  2692. for i = 1, #rlp do
  2693. rlp[i].Anchored = true
  2694. end
  2695. for i = 1, #chp do
  2696. chp[i].Anchored = true
  2697. end
  2698. for i = 1, #hdp do
  2699. hdp[i].Anchored = true
  2700. end
  2701. for i = 1, #ch do
  2702. if ch[i].ClassName == "Part" then
  2703. ch[i].Anchored = true
  2704. end
  2705. end
  2706. wait(.01)
  2707. game.Lighting.TimeOfDay = "20:00:00"
  2708. wait(.01)
  2709. game.Lighting.TimeOfDay = "19:00:00"
  2710. wait(.01)
  2711. game.Lighting.TimeOfDay = "18:00:00"
  2712. wait(.01)
  2713. game.Lighting.TimeOfDay = "17:00:00"
  2714. wait(.01)
  2715. game.Lighting.TimeOfDay = "16:00:00"
  2716. wait(.01)
  2717. game.Lighting.TimeOfDay = "15:00:00"
  2718. wait(.01)
  2719. game.Lighting.TimeOfDay = "14:00:00"
  2720. wait(.01)
  2721. game.Lighting.TimeOfDay = "13:00:00"
  2722. wait(.01)
  2723. game.Lighting.TimeOfDay = "12:00:00"
  2724. end)
  2725.  
  2726. --Loop Function--
  2727. while true do
  2728. if chara.Humanoid.Health > 1 then
  2729. wait(.1)
  2730. Enamate()
  2731. Enamate2()
  2732. chara.Humanoid.MaxHealth = 9999999999999
  2733. chara.Humanoid.Health = chara.Humanoid.Health + 999999999999
  2734. htecks.Text = chara.Humanoid.Health.."/"..chara.Humanoid.MaxHealth
  2735. bodp.Position = chara.Head.Position + Vector3.new(0,5,0)
  2736. gyrp.CFrame = CFrame.new(chara.HumanoidRootPart.Position + (chara.HumanoidRootPart.CFrame.lookVector*5), chara.HumanoidRootPart.Position + (chara.HumanoidRootPart.CFrame.lookVector*10))
  2737. gyrp.maxTorque = Vector3.new(9000,9000,9000)
  2738. for i = 1, #lap do
  2739. lap[i].Anchored = false
  2740. end
  2741. for i = 1, #rap do
  2742. rap[i].Anchored = false
  2743. end
  2744. for i = 1, #llp do
  2745. llp[i].Anchored = false
  2746. end
  2747. for i = 1, #rlp do
  2748. rlp[i].Anchored = false
  2749. end
  2750. for i = 1, #chp do
  2751. chp[i].Anchored = false
  2752. end
  2753. for i = 1, #hdp do
  2754. hdp[i].Anchored = false
  2755. end
  2756. for i = 1, #ch do
  2757. if ch[i].ClassName == "Part" then
  2758. ch[i].Anchored = false
  2759. end
  2760. end
  2761. end
  2762. end
  2763.  
  2764.  
  2765.  
  2766.  
  2767.  
  2768.  
  2769. end)
  2770.  
  2771. Gun.Name = "Gun"
  2772. Gun.Parent = MainMenu
  2773. Gun.BackgroundColor3 = Color3.new(0.117647, 0.117647, 0.117647)
  2774. Gun.BorderColor3 = Color3.new(0.117647, 0.117647, 0.117647)
  2775. Gun.Position = UDim2.new(0.0194444451, 0, 0.61038959, 0)
  2776. Gun.Size = UDim2.new(0, 143, 0, 50)
  2777. Gun.Font = Enum.Font.SourceSans
  2778. Gun.Text = "Ultimate Gun"
  2779. Gun.TextColor3 = Color3.new(1, 1, 1)
  2780. Gun.TextScaled = true
  2781. Gun.TextSize = 14
  2782. Gun.TextStrokeColor3 = Color3.new(1, 1, 1)
  2783. Gun.TextWrapped = true
  2784.  
  2785. GrabV3.Name = "GrabV3"
  2786. GrabV3.Parent = MainMenu
  2787. GrabV3.BackgroundColor3 = Color3.new(0.117647, 0.117647, 0.117647)
  2788. GrabV3.BorderColor3 = Color3.new(0.117647, 0.117647, 0.117647)
  2789. GrabV3.Position = UDim2.new(0.538888931, 0, 0.142857134, 0)
  2790. GrabV3.Size = UDim2.new(0, 143, 0, 50)
  2791. GrabV3.Font = Enum.Font.SourceSans
  2792. GrabV3.Text = "Grab Knife v3 "
  2793. GrabV3.TextColor3 = Color3.new(1, 1, 1)
  2794. GrabV3.TextScaled = true
  2795. GrabV3.TextSize = 14
  2796. GrabV3.TextStrokeColor3 = Color3.new(1, 1, 1)
  2797. GrabV3.TextWrapped = true
  2798.  
  2799. Working.Name = "Working"
  2800. Working.Parent = MainMenu
  2801. Working.BackgroundColor3 = Color3.new(0.117647, 0.117647, 0.117647)
  2802. Working.BorderColor3 = Color3.new(0.117647, 0.117647, 0.117647)
  2803. Working.Position = UDim2.new(0.538888931, 0, 0.631168783, 0)
  2804. Working.Size = UDim2.new(0, 143, 0, 50)
  2805. Working.Font = Enum.Font.SourceSans
  2806. Working.Text = "In proggres"
  2807. Working.TextColor3 = Color3.new(1, 1, 1)
  2808. Working.TextScaled = true
  2809. Working.TextSize = 14
  2810. Working.TextStrokeColor3 = Color3.new(1, 1, 1)
  2811. Working.TextWrapped = true
  2812.  
  2813. gRABV4.Name = "gRABV4"
  2814. gRABV4.Parent = MainMenu
  2815. gRABV4.BackgroundColor3 = Color3.new(0.117647, 0.117647, 0.117647)
  2816. gRABV4.BorderColor3 = Color3.new(0.117647, 0.117647, 0.117647)
  2817. gRABV4.Position = UDim2.new(0.538888931, 0, 0.348051935, 0)
  2818. gRABV4.Size = UDim2.new(0, 143, 0, 50)
  2819. gRABV4.Font = Enum.Font.SourceSans
  2820. gRABV4.Text = "Grab Knife v4"
  2821. gRABV4.TextColor3 = Color3.new(1, 1, 1)
  2822. gRABV4.TextScaled = true
  2823. gRABV4.TextSize = 14
  2824. gRABV4.TextStrokeColor3 = Color3.new(1, 1, 1)
  2825. gRABV4.TextWrapped = true
  2826. gRABV4.MouseButton1Down:connect(function()
  2827.  
  2828.  
  2829.  
  2830.  
  2831.  
  2832.  
  2833.  
  2834.  
  2835.  
  2836.  
  2837. local player = game:GetService('Players').LocalPlayer
  2838. local rightclone = Instance.new('Motor6D')
  2839. rightclone.Name = "Right Shoulder"
  2840. rightclone.C0 = CFrame.new(1, 0.5, 0, 0, 0, 1, 0, 1, 0, -1, -0, -0)
  2841. rightclone.C1 = CFrame.new(-0.5, 0.5, 0, 0, 0, 1, 0, 1, 0, -1, -0, -0)
  2842. local leftclone = Instance.new('Motor6D')
  2843. leftclone.Name = "Left Shoulder"
  2844. leftclone.C0 = CFrame.new(-1, 0.5, 0, -0, -0, -1, 0, 1, 0, 1, 0, 0)
  2845. leftclone.C1 = CFrame.new(0.5, 0.5, 0, -0, -0, -1, 0, 1, 0, 1, 0, 0)
  2846. local leftlegclone = Instance.new('Motor6D')
  2847. leftlegclone.Name = "Left Hip"
  2848. leftlegclone.C0 = CFrame.new(-1, -1, 0, -0, -0, -1, 0, 1, 0, 1, 0, 0)
  2849. leftlegclone.C1 = CFrame.new(-0.5, 1, 0, -0, -0, -1, 0, 1, 0, 1, 0, 0)
  2850. local rightlegclone = Instance.new('Motor6D')
  2851. rightlegclone.Name = "Right Hip"
  2852. rightlegclone.C0 = CFrame.new(1, -1, 0, 0, 0, 1, 0, 1, 0, -1, -0, -0)
  2853. rightlegclone.C1 = CFrame.new(0.5, 1, 0, 0, 0, 1, 0, 1, 0, -1, -0, -0)
  2854. local torsoclone = Instance.new('Motor6D')
  2855. torsoclone.Name = "RootJoint"
  2856. torsoclone.C0 = CFrame.new(0, 0, 0, -1, -0, -0, 0, 0, 1, 0, 1, 0)
  2857. torsoclone.C1 = CFrame.new(0, 0, 0, -1, -0, -0, 0, 0, 1, 0, 1, 0)
  2858. local mouse = player:GetMouse()
  2859. local rag1 = false
  2860. local rag2 = false
  2861. local firsttime = true
  2862. local firsttime2 = true
  2863. local firsttime3 = true
  2864. local firsttime4 = true
  2865. local firsttime5 = true
  2866. local childlock = true
  2867. local math1 = math.random(1,5)
  2868. math1 = math1+(math.random(0,9)/10)
  2869. local math2 = math.random(1,15)
  2870. math2 = math2+(math.random(0,9)/10)
  2871. local math3 = math.random(1,10)
  2872. math3 = math3+(math.random(0,9)/10)
  2873. local math4 = math.random(5,100)
  2874. math4 = math4+(math.random(0,9)/10)
  2875. local answer = (math4+(math1*math3))/(math1*math2)
  2876. answer = math.floor((answer*10)+0.5)
  2877. answer = answer/10
  2878. print([[To be fair, you have to have a very high IQ to understand Rick and Morty.
  2879. The humor is extremely subtle, and without a solid grasp of theoretical physics most of the jokes will go over a typical viewer's head.
  2880. There's also Rick's nihilistic outlook, which is deftly woven into his characterisation -
  2881. his personal philosophy draws heavily from Narodnaya Volya literature, for instance.
  2882. The fans understand this stuff;
  2883. they have the intellectual capacity to truly appreciate the depths of these jokes, to realize that they're not just funny- they say something deep about LIFE.
  2884. As a consequence people who dislike Rick and Morty truly ARE idiots-
  2885. of course they wouldn't appreciate, for instance, the humour in Rick's existencial catchphrase "Wubba Lubba Dub Dub," which itself is a cryptic reference to Turgenev's Russian epic Fathers and Sons.
  2886. I'm smirking right now just imagining one of those addlepated simpletons scratching their heads in confusion as Dan Harmon's genius unfolds itself on their television screens.
  2887. What fools... how I pity them.
  2888. And yes by the way, I DO have a Rick and Morty tattoo.
  2889. And no, you cannot see it.
  2890. It's for the ladies' eyes only-
  2891. And even they have to demonstrate that they're within ]]..answer..[[ IQ points of my own (preferably lower) beforehand.]])
  2892. local rekt = {}
  2893.  
  2894. -- Objects
  2895.  
  2896. local MainGUI = Instance.new("ScreenGui")
  2897. local Customize = Instance.new("TextButton")
  2898. local Frame = Instance.new("Frame")
  2899. local TextLabel = Instance.new("TextLabel")
  2900. local Frame_2 = Instance.new("Frame")
  2901. local Frame_3 = Instance.new("Frame")
  2902. local ImageLabel = Instance.new("ImageLabel")
  2903. local R = Instance.new("TextBox")
  2904. local G = Instance.new("TextBox")
  2905. local B = Instance.new("TextBox")
  2906. local TextLabel_2 = Instance.new("TextLabel")
  2907. local TextLabel_3 = Instance.new("TextLabel")
  2908. local TextLabel_4 = Instance.new("TextLabel")
  2909. local Slider = Instance.new("Frame")
  2910. local Slidee = Instance.new("ImageButton")
  2911. local ChildLock = Instance.new("Frame")
  2912. local TextLabel_5 = Instance.new("TextLabel")
  2913. local mathz = Instance.new("TextLabel")
  2914. local TextBox = Instance.new("TextBox")
  2915. local Black = Instance.new('Frame')
  2916. local fps = Instance.new('TextLabel')
  2917.  
  2918. -- Properties
  2919.  
  2920. MainGUI.Name = "MainGUI"
  2921. MainGUI.ResetOnSpawn = false
  2922. pcall(function()
  2923. MainGUI.Parent = player.PlayerGui
  2924. end)
  2925. pcall(function()
  2926. MainGUI.Parent = game.CoreGui
  2927. game.CoreGui.RobloxGui.Backpack.Hotbar.AnchorPoint = Vector2.new(0.5,0.5)
  2928. game.CoreGui.RobloxGui.Backpack.Hotbar.Position = UDim2.new(0.5,0,0.85,0)
  2929. end)
  2930.  
  2931.  
  2932. Customize.Name = "Customize"
  2933. Customize.Parent = MainGUI
  2934. Customize.BackgroundColor3 = Color3.new(0, 0.776471, 0.282353)
  2935. Customize.BorderSizePixel = 0
  2936. Customize.Position = UDim2.new(0.15, 0, 0.9, 0)
  2937. Customize.Size = UDim2.new(0.699999988, 0, 0.100000001, 0)
  2938. Customize.Font = Enum.Font.SourceSans
  2939. Customize.FontSize = Enum.FontSize.Size14
  2940. Customize.Text = "Customize V4"
  2941. Customize.TextColor3 = Color3.new(1, 1, 1)
  2942. Customize.TextScaled = true
  2943. Customize.TextSize = 14
  2944. Customize.TextWrapped = true
  2945.  
  2946. Frame.Parent = Customize
  2947. Frame.BackgroundColor3 = Color3.new(0.164706, 0.164706, 0.164706)
  2948. Frame.BorderSizePixel = 0
  2949. Frame.Position = UDim2.new(0, 0, 1, 0)
  2950. Frame.Size = UDim2.new(1, 0, 6.5, 0)
  2951.  
  2952. TextLabel.Parent = Frame
  2953. TextLabel.BackgroundColor3 = Color3.new(1, 1, 1)
  2954. TextLabel.BackgroundTransparency = 1
  2955. TextLabel.Position = UDim2.new(0, 0, 0.100000001, 0)
  2956. TextLabel.Size = UDim2.new(0.300000012, 0, 0.200000003, 0)
  2957. TextLabel.Font = Enum.Font.SourceSansLight
  2958. TextLabel.FontSize = Enum.FontSize.Size14
  2959. TextLabel.Text = "Blood Color: [255, 255, 255]"
  2960. TextLabel.TextColor3 = Color3.new(1, 1, 1)
  2961. TextLabel.TextScaled = true
  2962. TextLabel.TextSize = 14
  2963. TextLabel.TextWrapped = true
  2964. TextLabel.TextXAlignment = Enum.TextXAlignment.Right
  2965.  
  2966. Frame_2.Parent = TextLabel
  2967. Frame_2.BackgroundColor3 = Color3.new(0.458824, 0, 0)
  2968. Frame_2.BorderSizePixel = 0
  2969. Frame_2.Position = UDim2.new(1.04999995, 0, 0, 0)
  2970. Frame_2.Size = UDim2.new(1, 0, 1, 0)
  2971. Frame_2.SizeConstraint = Enum.SizeConstraint.RelativeYY
  2972.  
  2973. Frame_3.Parent = Frame
  2974. Frame_3.BackgroundColor3 = Color3.new(1, 1, 1)
  2975. Frame_3.BackgroundTransparency = 1
  2976. Frame_3.BorderSizePixel = 0
  2977. Frame_3.Position = UDim2.new(0.0500000007, 0, 0.449999988, 0)
  2978. Frame_3.Size = UDim2.new(0.5, 0, 0.5, 0)
  2979. Frame_3.SizeConstraint = Enum.SizeConstraint.RelativeYY
  2980.  
  2981. ImageLabel.Parent = Frame_3
  2982. ImageLabel.BackgroundColor3 = Color3.new(1, 1, 1)
  2983. ImageLabel.BackgroundTransparency = 1
  2984. ImageLabel.Size = UDim2.new(1, 0, 1, 0)
  2985. ImageLabel.Image = "rbxassetid://328298876"
  2986.  
  2987. R.Name = "R"
  2988. R.Parent = Frame_3
  2989. R.BackgroundColor3 = Color3.new(0.137255, 0.137255, 0.137255)
  2990. R.BorderSizePixel = 0
  2991. R.Position = UDim2.new(1.39999998, 0, 0, 0)
  2992. R.Size = UDim2.new(0.75, 0, 0.300000012, 0)
  2993. R.Font = Enum.Font.SourceSans
  2994. R.FontSize = Enum.FontSize.Size14
  2995. R.Text = "Input"
  2996. R.TextColor3 = Color3.new(1, 1, 1)
  2997. R.TextScaled = true
  2998. R.TextSize = 14
  2999. R.TextWrapped = true
  3000. R.TextXAlignment = Enum.TextXAlignment.Left
  3001.  
  3002. G.Name = "G"
  3003. G.Parent = Frame_3
  3004. G.BackgroundColor3 = Color3.new(0.137255, 0.137255, 0.137255)
  3005. G.BorderSizePixel = 0
  3006. G.Position = UDim2.new(1.39999998, 0, 0.349999994, 0)
  3007. G.Size = UDim2.new(0.75, 0, 0.300000012, 0)
  3008. G.Font = Enum.Font.SourceSans
  3009. G.FontSize = Enum.FontSize.Size14
  3010. G.Text = "Input"
  3011. G.TextColor3 = Color3.new(1, 1, 1)
  3012. G.TextScaled = true
  3013. G.TextSize = 14
  3014. G.TextWrapped = true
  3015. G.TextXAlignment = Enum.TextXAlignment.Left
  3016.  
  3017. B.Name = "B"
  3018. B.Parent = Frame_3
  3019. B.BackgroundColor3 = Color3.new(0.137255, 0.137255, 0.137255)
  3020. B.BorderSizePixel = 0
  3021. B.Position = UDim2.new(1.39999998, 0, 0.699999988, 0)
  3022. B.Size = UDim2.new(0.75, 0, 0.300000012, 0)
  3023. B.Font = Enum.Font.SourceSans
  3024. B.FontSize = Enum.FontSize.Size14
  3025. B.Text = "Input"
  3026. B.TextColor3 = Color3.new(1, 1, 1)
  3027. B.TextScaled = true
  3028. B.TextSize = 14
  3029. B.TextWrapped = true
  3030. B.TextXAlignment = Enum.TextXAlignment.Left
  3031.  
  3032. TextLabel_2.Parent = Frame_3
  3033. TextLabel_2.BackgroundColor3 = Color3.new(1, 1, 1)
  3034. TextLabel_2.BackgroundTransparency = 1
  3035. TextLabel_2.Position = UDim2.new(1.04999995, 0, 0, 0)
  3036. TextLabel_2.Size = UDim2.new(0.300000012, 0, 0.300000012, 0)
  3037. TextLabel_2.Font = Enum.Font.SourceSansLight
  3038. TextLabel_2.FontSize = Enum.FontSize.Size14
  3039. TextLabel_2.Text = "R"
  3040. TextLabel_2.TextColor3 = Color3.new(1, 1, 1)
  3041. TextLabel_2.TextScaled = true
  3042. TextLabel_2.TextSize = 14
  3043. TextLabel_2.TextWrapped = true
  3044.  
  3045. TextLabel_3.Parent = Frame_3
  3046. TextLabel_3.BackgroundColor3 = Color3.new(1, 1, 1)
  3047. TextLabel_3.BackgroundTransparency = 1
  3048. TextLabel_3.Position = UDim2.new(1.04999995, 0, 0.349999994, 0)
  3049. TextLabel_3.Size = UDim2.new(0.300000012, 0, 0.300000012, 0)
  3050. TextLabel_3.Font = Enum.Font.SourceSansLight
  3051. TextLabel_3.FontSize = Enum.FontSize.Size14
  3052. TextLabel_3.Text = "G"
  3053. TextLabel_3.TextColor3 = Color3.new(1, 1, 1)
  3054. TextLabel_3.TextScaled = true
  3055. TextLabel_3.TextSize = 14
  3056. TextLabel_3.TextWrapped = true
  3057.  
  3058. TextLabel_4.Parent = Frame_3
  3059. TextLabel_4.BackgroundColor3 = Color3.new(1, 1, 1)
  3060. TextLabel_4.BackgroundTransparency = 1
  3061. TextLabel_4.Position = UDim2.new(1.04999995, 0, 0.699999988, 0)
  3062. TextLabel_4.Size = UDim2.new(0.300000012, 0, 0.300000012, 0)
  3063. TextLabel_4.Font = Enum.Font.SourceSansLight
  3064. TextLabel_4.FontSize = Enum.FontSize.Size14
  3065. TextLabel_4.Text = "B"
  3066. TextLabel_4.TextColor3 = Color3.new(1, 1, 1)
  3067. TextLabel_4.TextScaled = true
  3068. TextLabel_4.TextSize = 14
  3069. TextLabel_4.TextWrapped = true
  3070.  
  3071. Slider.Name = "Slider"
  3072. Slider.Parent = Frame
  3073. Slider.BackgroundColor3 = Color3.new(0.121569, 0.121569, 0.121569)
  3074. Slider.Position = UDim2.new(0.0500000007, 0, 0.375, 0)
  3075. Slider.Size = UDim2.new(0.230000004, 0, 0.00999999978, 0)
  3076.  
  3077. Slidee.Name = "Slidee"
  3078. Slidee.Parent = Slider
  3079. Slidee.AnchorPoint = Vector2.new(0.5, 0.5)
  3080. Slidee.BackgroundColor3 = Color3.new(0.0941177, 0.0941177, 0.0941177)
  3081. Slidee.BorderSizePixel = 0
  3082. Slidee.Size = UDim2.new(0.0299999993, 0, 7, 0)
  3083. Slidee.ImageTransparency = 1
  3084.  
  3085. ChildLock.Name = "ChildLock"
  3086. ChildLock.Parent = Frame
  3087. ChildLock.Active = true
  3088. ChildLock.BackgroundColor3 = Color3.new(0, 0, 0)
  3089. ChildLock.BackgroundTransparency = 0.60000002384186
  3090. ChildLock.BorderSizePixel = 0
  3091. ChildLock.Position = UDim2.new(0.600000024, 0, 0, 0)
  3092. ChildLock.Size = UDim2.new(0.400000006, 0, 1, 0)
  3093. ChildLock.ZIndex = 2
  3094.  
  3095. TextLabel_5.Parent = ChildLock
  3096. TextLabel_5.BackgroundColor3 = Color3.new(1, 1, 1)
  3097. TextLabel_5.BackgroundTransparency = 1
  3098. TextLabel_5.BorderSizePixel = 0
  3099. TextLabel_5.Position = UDim2.new(0.125, 0, 0.150000006, 0)
  3100. TextLabel_5.Size = UDim2.new(0.75, 0, 0.200000003, 0)
  3101. TextLabel_5.ZIndex = 3
  3102. TextLabel_5.Font = Enum.Font.SourceSans
  3103. TextLabel_5.FontSize = Enum.FontSize.Size14
  3104. TextLabel_5.Text = "do this math to disable child lock"
  3105. TextLabel_5.TextColor3 = Color3.new(1, 1, 1)
  3106. TextLabel_5.TextScaled = true
  3107. TextLabel_5.TextSize = 14
  3108. TextLabel_5.TextWrapped = true
  3109.  
  3110. mathz.Name = "mathz"
  3111. mathz.Parent = ChildLock
  3112. mathz.BackgroundColor3 = Color3.new(1, 1, 1)
  3113. mathz.BackgroundTransparency = 1
  3114. mathz.Position = UDim2.new(0.125, 0, 0.449999988, 0)
  3115. mathz.Size = UDim2.new(0.75, 0, 0.200000003, 0)
  3116. mathz.ZIndex = 3
  3117. mathz.Font = Enum.Font.SourceSans
  3118. mathz.FontSize = Enum.FontSize.Size14
  3119. mathz.Text = math1.."("..math2.."r - "..math3..") = "..math4
  3120. mathz.TextColor3 = Color3.new(1, 1, 1)
  3121. mathz.TextScaled = true
  3122. mathz.TextSize = 14
  3123. mathz.TextWrapped = true
  3124.  
  3125. fps.Name = "fps"
  3126. fps.Parent = Frame
  3127. fps.BackgroundColor3 = Color3.new(1, 1, 1)
  3128. fps.BackgroundTransparency = 1
  3129. fps.Size = UDim2.new(0.75, 0, 0.05, 0)
  3130. fps.ZIndex = 3
  3131. fps.Font = Enum.Font.SourceSansLight
  3132. fps.FontSize = Enum.FontSize.Size14
  3133. fps.Text = "FPS: N/A"
  3134. fps.TextColor3 = Color3.new(1, 1, 1)
  3135. fps.TextScaled = true
  3136. fps.TextSize = 14
  3137. fps.TextWrapped = true
  3138. fps.TextXAlignment = Enum.TextXAlignment.Left
  3139.  
  3140. TextBox.Parent = ChildLock
  3141. TextBox.BackgroundColor3 = Color3.new(0.137255, 0.137255, 0.137255)
  3142. TextBox.BorderSizePixel = 0
  3143. TextBox.Position = UDim2.new(0.200000003, 0, 0.699999988, 0)
  3144. TextBox.Size = UDim2.new(0.600000024, 0, 0.200000003, 0)
  3145. TextBox.ZIndex = 3
  3146. TextBox.Font = Enum.Font.SourceSans
  3147. TextBox.FontSize = Enum.FontSize.Size14
  3148. TextBox.Text = "Answer (rounded to nearest tenth)"
  3149. TextBox.TextColor3 = Color3.new(1, 1, 1)
  3150. TextBox.TextScaled = true
  3151. TextBox.TextSize = 14
  3152. TextBox.TextWrapped = true
  3153. TextBox.TextXAlignment = Enum.TextXAlignment.Left
  3154.  
  3155. Black.Size = UDim2.new(1,0,1,0)
  3156. Black.BackgroundTransparency = 1
  3157. Black.BorderSizePixel = 0
  3158. Black.BackgroundColor3 = Color3.new(0,0,0)
  3159. Black.Parent = Frame_3
  3160.  
  3161. TextBox.FocusLost:connect(function()
  3162. if TextBox.Text == tostring(answer) or TextBox.Text == "r="..tostring(answer) or TextBox.Text == "r= "..tostring(answer) or TextBox.Text == "r = "..tostring(answer) or TextBox.Text == "r= "..tostring(answer) or TextBox.Text == tostring(answer).."=r" or TextBox.Text == tostring(answer).." =r" or TextBox.Text == tostring(answer).."= r" or TextBox.Text == tostring(answer).." = r" then
  3163. ChildLock:Destroy()
  3164. childlock = false
  3165. notify("Child lock disabled, press B to enable dildo mode.",true)
  3166. end
  3167. end)
  3168.  
  3169. local mousedown = false
  3170. mouse.Button1Down:connect(function()
  3171. mousedown = true
  3172. end)
  3173. mouse.Button1Up:connect(function()
  3174. mousedown = false
  3175. slidee = false
  3176. end)
  3177.  
  3178. Slidee.MouseButton1Down:connect(function()
  3179. slidee = true
  3180. end)
  3181. Slidee.MouseButton1Up:connect(function()
  3182. slidee = false
  3183. end)
  3184.  
  3185. mouse.Move:connect(function()
  3186. if mousedown then
  3187. if mouse.X >= ImageLabel.AbsolutePosition.X and mouse.X <= ImageLabel.AbsolutePosition.X+ ImageLabel.AbsoluteSize.X and mouse.Y >= ImageLabel.AbsolutePosition.Y and mouse.Y <= ImageLabel.AbsolutePosition.Y+ ImageLabel.AbsoluteSize.Y then
  3188. local newX = ImageLabel.AbsoluteSize.X-(mouse.X-ImageLabel.AbsolutePosition.X)
  3189. local newY = ImageLabel.AbsoluteSize.Y-(mouse.Y-ImageLabel.AbsolutePosition.Y)
  3190. local newcolor = Color3.fromHSV(newX/ImageLabel.AbsoluteSize.X,newY/ImageLabel.AbsoluteSize.Y,Black.Transparency)
  3191. Frame_2.BackgroundColor3 = newcolor
  3192. TextLabel.Text = "Blood Color: ["..math.floor(255*newcolor.r)..", "..math.floor(255*newcolor.g)..", "..math.floor(255*newcolor.b).."]"
  3193. end
  3194. end
  3195. if slidee then
  3196. local ree = mouse.X
  3197. if ree < Slider.AbsolutePosition.X then
  3198. ree = Slider.AbsolutePosition.X
  3199. elseif ree > Slider.AbsolutePosition.X+Slider.AbsoluteSize.X then
  3200. ree = Slider.AbsolutePosition.X+Slider.AbsoluteSize.X
  3201. end
  3202. Slidee.Position = UDim2.new(0,ree-Slider.AbsolutePosition.X,0,0)
  3203. Black.Transparency = 1-(Slidee.Position.X.Offset/Slider.AbsoluteSize.X)
  3204. end
  3205. end)
  3206.  
  3207. R.FocusLost:connect(function()
  3208. if R.Text ~= "Input" then
  3209. if tonumber(R.Text) then
  3210. if tonumber(R.Text) > 255 then
  3211. R.Text = "255"
  3212. end
  3213. local newcolor = Color3.new(tonumber(R.Text/255),Frame_2.BackgroundColor3.g,Frame_2.BackgroundColor3.b)
  3214. Frame_2.BackgroundColor3 = newcolor
  3215. TextLabel.Text = "Blood Color: ["..math.floor(255*newcolor.r)..", "..math.floor(255*newcolor.g)..", "..math.floor(255*newcolor.b).."]"
  3216. R.Text = "Input"
  3217. end
  3218. end
  3219. end)
  3220. G.FocusLost:connect(function()
  3221. if G.Text ~= "Input" then
  3222. if tonumber(G.Text) then
  3223. if tonumber(G.Text) > 255 then
  3224. G.Text = "255"
  3225. end
  3226. local newcolor = Color3.new(Frame_2.BackgroundColor3.r,tonumber(G.Text/255),Frame_2.BackgroundColor3.b)
  3227. Frame_2.BackgroundColor3 = newcolor
  3228. TextLabel.Text = "Blood Color: ["..math.floor(255*newcolor.r)..", "..math.floor(255*newcolor.g)..", "..math.floor(255*newcolor.b).."]"
  3229. G.Text = "Input"
  3230. end
  3231. end
  3232. end)
  3233. B.FocusLost:connect(function()
  3234. if B.Text ~= "Input" then
  3235. if tonumber(B.Text) then
  3236. if tonumber(B.Text) > 255 then
  3237. B.Text = "255"
  3238. end
  3239. local newcolor = Color3.new(Frame_2.BackgroundColor3.r,Frame_2.BackgroundColor3.g,tonumber(B.Text/255))
  3240. Frame_2.BackgroundColor3 = newcolor
  3241. TextLabel.Text = "Blood Color: ["..math.floor(255*newcolor.r)..", "..math.floor(255*newcolor.g)..", "..math.floor(255*newcolor.b).."]"
  3242. B.Text = "Input"
  3243. end
  3244. end
  3245. end)
  3246.  
  3247. local open = false
  3248. local opening = false
  3249. Customize.MouseButton1Click:connect(function()
  3250. if opening == false then
  3251. if open == false then
  3252. open = true
  3253. opening = true
  3254. Customize:TweenPosition(UDim2.new(0.15, 0, 0.1, 0),Enum.EasingDirection.Out,Enum.EasingStyle.Quint,1)
  3255. wait(1)
  3256. opening = false
  3257. else
  3258. open = false
  3259. opening = true
  3260. Customize:TweenPosition(UDim2.new(0.15, 0, 0.9, 0),Enum.EasingDirection.Out,Enum.EasingStyle.Quint,1)
  3261. wait(1)
  3262. opening = false
  3263. end
  3264. end
  3265. end)
  3266.  
  3267. Frame_2.BackgroundColor3 = Color3.fromRGB(117,0,0)
  3268.  
  3269. function removewelds(part)
  3270. for i,v in pairs(part:GetChildren()) do
  3271. if v:IsA('Weld') then v:Destroy() end
  3272. end
  3273. end
  3274.  
  3275. function notify(msg,remove)
  3276. local coru= coroutine.wrap(function()
  3277. for i,v in pairs(MainGUI:GetChildren()) do
  3278. if v:IsA('TextLabel') then v:Destroy() end
  3279. end
  3280. if msg then
  3281. local TextLabel = Instance.new("TextLabel")
  3282. local Frame = Instance.new("Frame")
  3283.  
  3284. -- Properties
  3285.  
  3286. TextLabel.Parent = MainGUI
  3287. TextLabel.BackgroundColor3 = Color3.new(0.227451, 0.227451, 0.227451)
  3288. TextLabel.BorderSizePixel = 0
  3289. TextLabel.Position = UDim2.new(0.25, 0, 0.05, -10)
  3290. TextLabel.Size = UDim2.new(0.5, 0, 0.1, 0)
  3291. TextLabel.Font = Enum.Font.SourceSans
  3292. TextLabel.FontSize = Enum.FontSize.Size60
  3293. TextLabel.TextColor3 = Color3.new(1, 1, 1)
  3294. TextLabel.TextSize = 50
  3295. TextLabel.Transparency = 1
  3296. TextLabel.TextScaled = true
  3297. TextLabel.TextYAlignment = Enum.TextYAlignment.Top
  3298. TextLabel.Text = ""
  3299. TextLabel.TextXAlignment = Enum.TextXAlignment.Left
  3300.  
  3301. Frame.Parent = TextLabel
  3302. Frame.BackgroundColor3 = Color3.new(0.192157, 0.192157, 0.192157)
  3303. Frame.BorderSizePixel = 0
  3304. Frame.Transparency = 1
  3305. Frame.Position = UDim2.new(0, 0, 1,0)
  3306. Frame.Size = UDim2.new(1, 0, 0, 5)
  3307. for i=1,10 do
  3308. TextLabel.Transparency = TextLabel.Transparency-0.1
  3309. TextLabel.Position = TextLabel.Position+UDim2.new(0,0,0,1)
  3310. Frame.Transparency = Frame.Transparency-0.1
  3311. wait()
  3312. end
  3313. for i=1,#msg do
  3314. TextLabel.Text = string.sub(msg,1,i)
  3315. wait()
  3316. end
  3317. wait(1)
  3318. if remove ~= true then
  3319. for i=1,10 do
  3320. TextLabel.Transparency = TextLabel.Transparency+0.1
  3321. TextLabel.Position = TextLabel.Position-UDim2.new(0,0,0,1)
  3322. Frame.Transparency = Frame.Transparency+0.1
  3323. wait()
  3324. end
  3325. TextLabel:Destroy()
  3326. end
  3327. end
  3328. end)
  3329. coru()
  3330. end
  3331. if workspace.FilteringEnabled == false then
  3332. if workspace:PGSIsEnabled() then
  3333. notify('Press Z to equip. Created by mustardfoot and Tollonis.',true)
  3334. else
  3335. notify('(this game is really old or something and has the shitty physics so a lot of things wont work sorry) Press Z to equip. Created by mustardfoot and Tollonis.',true)
  3336. end
  3337. else
  3338. notify('LOL this game has filtering enabled so it literally wont work here')
  3339. end
  3340.  
  3341. local handProperties = {
  3342. {"LimitsEnabled", true};
  3343. {"UpperAngle",0};
  3344. {"LowerAngle",0};
  3345. }
  3346. local shinProperties = {
  3347. {"LimitsEnabled", true};
  3348. {"UpperAngle", 0};
  3349. {"LowerAngle", -75};
  3350. }
  3351. local footProperties = {
  3352. {"LimitsEnabled", true};
  3353. {"UpperAngle", 15};
  3354. {"LowerAngle", -45};
  3355. }
  3356.  
  3357. function bleed(frick,OwO)
  3358. while frick.Parent ~= nil and frick.Parent.Parent ~= nil do
  3359. local reeee = coroutine.wrap(function()
  3360. local thing = Instance.new('Part',workspace)
  3361. thing.Size = Vector3.new(0.2,0.2,0.2)
  3362. thing.CFrame = frick.CFrame
  3363. thing.Transparency = 1
  3364. thing.BrickColor = BrickColor.new(Frame_2.BackgroundColor3)
  3365. thing.Material = Enum.Material.SmoothPlastic
  3366. thing.Name = "Blood"
  3367. thing.CanCollide =false
  3368. thing:BreakJoints()
  3369. local rawrxd = Instance.new('BodyForce',thing)
  3370. rawrxd.Force = frick.CFrame.upVector*(math.random()*2)+Vector3.new(math.random(-5, 5)/10,1.5,0)
  3371. local coru = coroutine.wrap(function()
  3372. wait(0.01)
  3373. rawrxd:Destroy()
  3374. end)
  3375. coru()
  3376. local ree = Instance.new('ParticleEmitter',thing)
  3377. if OwO ~= true then
  3378. ree.Color = ColorSequence.new({ColorSequenceKeypoint.new(0,Frame_2.BackgroundColor3),ColorSequenceKeypoint.new(1,Frame_2.BackgroundColor3)})
  3379. else
  3380. ree.Color = ColorSequence.new({ColorSequenceKeypoint.new(0,Color3.new(1,1,1)),ColorSequenceKeypoint.new(1,Color3.new(1,1,1))})
  3381. end
  3382. ree.Size = NumberSequence.new({NumberSequenceKeypoint.new(0,0.1),NumberSequenceKeypoint.new(1,0.1)})
  3383. ree.Texture = 'rbxassetid://867743272'
  3384. ree.Lifetime = NumberRange.new(0.4)
  3385. ree.Rate = 50
  3386. ree.LockedToPart = true
  3387. ree.Speed = NumberRange.new(0, 2)
  3388.  
  3389. thing.Touched:connect(function(tou)
  3390. if tou.Parent and tou.Parent:IsA('Tool') == false and tou.Parent.Parent:FindFirstChildOfClass('Humanoid') == nil and tou.Parent:FindFirstChildOfClass('Humanoid') == nil and tou.Name ~= "Blood" and tou.Parent.Name ~= "Projectile" and tou.Parent.Name ~= "big ass knife" and tou.Parent ~= player.Character and tou.Parent.ClassName ~= "Accessory" and tou.Parent.Name ~= "bitch ass knife" and tou.Parent.Name ~= 'handle' and tou.Name ~= "blade" and tou.Name ~= 'handle' and tou.Name ~= "Projectile" and tou.Parent.Name ~= "Projectile" then
  3391. local pos = Vector3.new(thing.Position.X,(tou.Position.Y+(tou.Size.Y/2))+0.02,thing.Position.Z)
  3392. local Point1 = pos-Vector3.new(0.01,0.01,0.01)
  3393. local Point2 = pos+Vector3.new(0.01,0.01,0.01)
  3394. local Region = Region3.new(Point1,Point2)
  3395. for _,Part in pairs(game.Workspace:FindPartsInRegion3(Region,nil,math.huge)) do
  3396. if Part.Name == "BloodPuddle" then
  3397. tou = Part
  3398. end
  3399. end
  3400. thing:Destroy()
  3401. if tou.Name == "BloodPuddle" then
  3402. if tou.Size.X < 1 then
  3403. pcall(function()
  3404. tou.Sound:Play()
  3405. end)
  3406. end
  3407. local reee = tou.CFrame
  3408. if tou.Transparency > -0.2 then
  3409. tou.Transparency = tou.Transparency -0.1
  3410. end
  3411. if tou.Size.X < 5 then
  3412. tou.Size = tou.Size+Vector3.new(0.1,0,0.1)
  3413. tou.CFrame = reee
  3414. end
  3415. elseif tou.CanCollide == true then
  3416. local bloodlol = Instance.new('Part',workspace)
  3417. local sound = Instance.new('Sound',bloodlol)
  3418. sound.SoundId = 'rbxassetid://685857471'
  3419. sound.Volume = 0.025
  3420. sound:Play()
  3421. bloodlol.Size=Vector3.new(1,0.2,1)
  3422. bloodlol.Name = "BloodPuddle"
  3423. bloodlol.Anchored = true
  3424. bloodlol.CanCollide = false
  3425. bloodlol.Material = Enum.Material.SmoothPlastic
  3426. if OwO ~= true then
  3427. bloodlol.Color = Frame_2.BackgroundColor3
  3428. else
  3429. bloodlol.Color = Color3.new(1,1,1)
  3430. end
  3431. local cyl = Instance.new('CylinderMesh',bloodlol)
  3432. cyl.Scale = Vector3.new(1,0.1,1)
  3433. bloodlol.CFrame = CFrame.new(pos)
  3434. local coru=coroutine.wrap(function()
  3435. while bloodlol.Parent ~= nil do
  3436. if bloodlol.Transparency < 1 then
  3437. bloodlol.Transparency = bloodlol.Transparency+0.05
  3438. else
  3439. bloodlol:Destroy()
  3440. end
  3441. wait(0.1)
  3442. end
  3443. end)
  3444. coru()
  3445. end
  3446. end
  3447. end)
  3448. local coru = coroutine.wrap(function()
  3449. wait(1)
  3450. thing:Destroy()
  3451. end)
  3452. coru()
  3453. end)
  3454. reeee()
  3455. wait()
  3456. end
  3457. end
  3458.  
  3459. function stun(char)
  3460. local found = false
  3461. pcall(function()
  3462. char:FindFirstChildOfClass('Humanoid'):ChangeState(Enum.HumanoidStateType.Physics)
  3463. end)
  3464. for i,v in pairs(rekt) do
  3465. if v == char then
  3466. found = true
  3467. end
  3468. end
  3469. if found == false then
  3470. table.insert(rekt,char)
  3471. end
  3472. end
  3473. function unstun(char)
  3474. for i,v in pairs(rekt) do
  3475. if v == char then
  3476. if v:FindFirstChildOfClass('Humanoid') and v:FindFirstChildOfClass('Humanoid').Health>0 then
  3477. v:FindFirstChildOfClass('Humanoid'):ChangeState(Enum.HumanoidStateType.Running)
  3478. v:FindFirstChildOfClass('Humanoid').PlatformStand = false
  3479. v:FindFirstChildOfClass('Humanoid').Sit = false
  3480. v:FindFirstChildOfClass('Humanoid').Jump = true
  3481. v:FindFirstChildOfClass('Humanoid').JumpPower = 50
  3482. v:FindFirstChildOfClass('Humanoid').WalkSpeed = 16
  3483. v:FindFirstChildOfClass('Humanoid').Name = "Humanoid"
  3484. end
  3485. table.remove(rekt,i)
  3486. end
  3487. end
  3488. end
  3489.  
  3490. function recurse(root,callback,i)
  3491. i= i or 0
  3492. for _,v in pairs(root:GetChildren()) do
  3493. i = i + 1
  3494. callback(i,v)
  3495.  
  3496. if #v:GetChildren() > 0 then
  3497. i = recurse(v,callback,i)
  3498. end
  3499. end
  3500.  
  3501. return i
  3502. end
  3503.  
  3504. function ragdollJoint(character, part0, part1, attachmentName, className, properties)
  3505. if character:FindFirstChild("RagdollConstraint"..part1.Name) == nil then
  3506. if character:FindFirstChild('HumanoidRootPart')then
  3507. character.HumanoidRootPart.CanCollide = false
  3508. end
  3509. for i,v in pairs(character:GetChildren()) do
  3510. if v:IsA("MeshPart") and (v.MeshId == 'http://www.roblox.com/asset/?id=553602991' or v.MeshId == 'http://www.roblox.com/asset/?id=553602977' or v.MeshId == 'http://www.roblox.com/asset/?id=553602987') then
  3511. v.Size = Vector3.new(1,1,1)
  3512. end
  3513. end
  3514. recurse(character, function(_,v)
  3515. if v:IsA("Attachment") and v.Parent.Name ~= "ayybleed" then
  3516. v.Axis = Vector3.new(0, 1, 0)
  3517. v.SecondaryAxis = Vector3.new(0, 0, 1)
  3518. v.Rotation = Vector3.new(0, 0, 0)
  3519. end
  3520. end)
  3521. if part1:FindFirstChildOfClass('Motor6D') then
  3522. part1:FindFirstChildOfClass('Motor6D'):Destroy()
  3523. end
  3524. if attachmentName ~= "NeckAttachment" then
  3525. attachmentName = attachmentName.."RigAttachment"
  3526. end
  3527. local constraint = Instance.new(className.."Constraint")
  3528. constraint.Attachment0 = part0:FindFirstChild(attachmentName)
  3529. constraint.Attachment1 = part1:FindFirstChild(attachmentName)
  3530. constraint.Name = "RagdollConstraint"..part1.Name
  3531. if character:FindFirstChildOfClass('Humanoid').Health > 0 then
  3532. local collidepart = Instance.new('Part',part1)
  3533. collidepart.Size = part1.Size/2
  3534. if string.find(string.lower(part1.Name),"upper") then
  3535. if string.find(string.lower(part1.Name),"leg") then
  3536. collidepart.Size = part1.Size/3
  3537. else
  3538. collidepart.Size = part1.Size/2.5
  3539. end
  3540. end
  3541. collidepart.CanCollide = true
  3542. collidepart.Name = "Collision"
  3543. collidepart.Anchored = false
  3544. collidepart.Transparency = 1
  3545. collidepart.CFrame = part1.CFrame
  3546. collidepart:BreakJoints()
  3547. local attachment0 = Instance.new('Attachment',part1)
  3548. local attachment1 = Instance.new('Attachment',collidepart)
  3549. if attachment0 and attachment1 then
  3550. local constraint = Instance.new("HingeConstraint")
  3551. constraint.Attachment0 = attachment0
  3552. constraint.Attachment1 = attachment1
  3553. constraint.LimitsEnabled = true
  3554. constraint.UpperAngle = 0
  3555. constraint.LowerAngle = 0
  3556. constraint.Parent = character
  3557. end
  3558. if string.find(string.lower(part1.Name),"upper") then
  3559. if string.find(string.lower(part1.Name),"leg") then
  3560. attachment0.Position = Vector3.new(0,0.01,0)
  3561. else
  3562. attachment0.Position = Vector3.new(0,0.25,0)
  3563. end
  3564. else
  3565. attachment0.Position = Vector3.new(0,-0.1,0)
  3566. end
  3567. end
  3568. for _,propertyData in next,properties or {} do
  3569. constraint[propertyData[1]] = propertyData[2]
  3570. end
  3571.  
  3572. constraint.Parent = character
  3573. end
  3574. end
  3575.  
  3576. function R6ragdollJoint(character,limbname,attached,heded)
  3577. pcall(function()
  3578. if limbname == "Right Arm" and character:FindFirstChild("Right Arm") and character:FindFirstChild("Torso") and character.Torso:FindFirstChild("Right ArmRagdollConstraint") == nil and character[limbname]:FindFirstChild("Right ArmRagdollConstraint") == nil then
  3579. local torsoatt = Instance.new('Attachment',character.Torso)
  3580. torsoatt.Name = limbname.."RagdollConstraint"
  3581. torsoatt.Position = Vector3.new(1.45,0.768,-0.009)
  3582. torsoatt.Axis = Vector3.new(1,0,0)
  3583. torsoatt.SecondaryAxis = Vector3.new(0,1,0)
  3584. local limbatt = Instance.new("Attachment",character[limbname])
  3585. limbatt.Position = Vector3.new(-0.086, 0.755, -0.007)
  3586. limbatt.Name = limbname.."RagdollConstraint"
  3587. limbatt.Axis = Vector3.new(1,0,0)
  3588. limbatt.SecondaryAxis = Vector3.new(0,1,0)
  3589. local ballc = Instance.new('BallSocketConstraint',character)
  3590. ballc.Name = "RightArmRagdollRig"
  3591. ballc.Attachment0 = torsoatt
  3592. ballc.Attachment1 = limbatt
  3593. local part1 = character[limbname]
  3594. if character:FindFirstChildOfClass('Humanoid').Health > 0 then
  3595. local collidepart = Instance.new('Part',part1)
  3596. collidepart.Size = part1.Size/1.5
  3597. collidepart.CanCollide = true
  3598. collidepart.Name = "Collision"
  3599. collidepart.Anchored = false
  3600. collidepart.Transparency = 1
  3601. collidepart.CFrame = part1.CFrame
  3602. collidepart:BreakJoints()
  3603. local attachment0 = Instance.new('Attachment',part1)
  3604. local attachment1 = Instance.new('Attachment',collidepart)
  3605. if attachment0 and attachment1 then
  3606. local constraint = Instance.new("HingeConstraint")
  3607. constraint.Attachment0 = attachment0
  3608. constraint.Attachment1 = attachment1
  3609. constraint.LimitsEnabled = true
  3610. constraint.UpperAngle = 0
  3611. constraint.LowerAngle = 0
  3612. constraint.Parent = character
  3613. end
  3614. end
  3615. if character.Torso:FindFirstChild('Right Shoulder') then
  3616. character.Torso:FindFirstChild('Right Shoulder'):Destroy()
  3617. end
  3618. elseif limbname == "Left Arm" and character:FindFirstChild("Left Arm") and character:FindFirstChild("Torso") and character.Torso:FindFirstChild("Left ArmRagdollConstraint") == nil and character[limbname]:FindFirstChild("Left ArmRagdollConstraint") == nil then
  3619. local torsoatt = Instance.new('Attachment',character.Torso)
  3620. torsoatt.Name = limbname.."RagdollConstraint"
  3621. torsoatt.Position = Vector3.new(-1.45,0.768,-0.009)
  3622. torsoatt.Axis = Vector3.new(1,0,0)
  3623. torsoatt.SecondaryAxis = Vector3.new(0,1,0)
  3624. local limbatt = Instance.new("Attachment",character[limbname])
  3625. limbatt.Position = Vector3.new(-0.086, 0.755, -0.007)
  3626. limbatt.Name = limbname.."RagdollConstraint"
  3627. limbatt.Axis = Vector3.new(1,0,0)
  3628. limbatt.SecondaryAxis = Vector3.new(0,1,0)
  3629. local ballc = Instance.new('BallSocketConstraint',character)
  3630. ballc.Name = "LeftArmRagdollRig"
  3631. ballc.Attachment0 = torsoatt
  3632. ballc.Attachment1 = limbatt
  3633. local part1 = character[limbname]
  3634. if character:FindFirstChildOfClass('Humanoid').Health > 0 then
  3635. local collidepart = Instance.new('Part',part1)
  3636. collidepart.Size = part1.Size/1.5
  3637. collidepart.CanCollide = true
  3638. collidepart.Name = "Collision"
  3639. collidepart.Anchored = false
  3640. collidepart.Transparency = 1
  3641. collidepart.CFrame = part1.CFrame
  3642. collidepart:BreakJoints()
  3643. local attachment0 = Instance.new('Attachment',part1)
  3644. local attachment1 = Instance.new('Attachment',collidepart)
  3645. if attachment0 and attachment1 then
  3646. local constraint = Instance.new("HingeConstraint")
  3647. constraint.Attachment0 = attachment0
  3648. constraint.Attachment1 = attachment1
  3649. constraint.LimitsEnabled = true
  3650. constraint.UpperAngle = 0
  3651. constraint.LowerAngle = 0
  3652. constraint.Parent = character
  3653. end
  3654. end
  3655. if character.Torso:FindFirstChild('Left Shoulder') then
  3656. character.Torso:FindFirstChild('Left Shoulder'):Destroy()
  3657. end
  3658. elseif limbname == "Right Leg" and character:FindFirstChild("Right Leg") and character:FindFirstChild("Torso") and character.Torso:FindFirstChild("Right LegRagdollConstraint") == nil and character[limbname]:FindFirstChild("Right LegRagdollConstraint") == nil then
  3659. stun(character)
  3660. local torsoatt = Instance.new('Attachment',character.Torso)
  3661. torsoatt.Name = limbname.."RagdollConstraint"
  3662. torsoatt.Position = Vector3.new(0.45, -1.242, -0.009)
  3663. torsoatt.Axis = Vector3.new(1,0,0)
  3664. torsoatt.SecondaryAxis = Vector3.new(0,1,0)
  3665. local limbatt = Instance.new("Attachment",character[limbname])
  3666. limbatt.Position = Vector3.new(-0.086, 0.755, -0.007)
  3667. limbatt.Name = limbname.."RagdollConstraint"
  3668. limbatt.Axis = Vector3.new(1,0,0)
  3669. limbatt.SecondaryAxis = Vector3.new(0,1,0)
  3670. local ballc = Instance.new('BallSocketConstraint',character)
  3671. ballc.Name = "RightLegRagdollRig"
  3672. ballc.Attachment0 = torsoatt
  3673. ballc.Attachment1 = limbatt
  3674. local part1 = character[limbname]
  3675. if character:FindFirstChildOfClass('Humanoid').Health > 0 then
  3676. local collidepart = Instance.new('Part',part1)
  3677. collidepart.Size = part1.Size/1.5
  3678. collidepart.CanCollide = true
  3679. collidepart.Name = "Collision"
  3680. collidepart.Anchored = false
  3681. collidepart.Transparency = 1
  3682. collidepart.CFrame = part1.CFrame
  3683. collidepart:BreakJoints()
  3684. local attachment0 = Instance.new('Attachment',part1)
  3685. local attachment1 = Instance.new('Attachment',collidepart)
  3686. if attachment0 and attachment1 then
  3687. local constraint = Instance.new("HingeConstraint")
  3688. constraint.Attachment0 = attachment0
  3689. constraint.Attachment1 = attachment1
  3690. constraint.LimitsEnabled = true
  3691. constraint.UpperAngle = 0
  3692. constraint.LowerAngle = 0
  3693. constraint.Parent = character
  3694. end
  3695. end
  3696. if character.Torso:FindFirstChild('Right Hip') then
  3697. character.Torso:FindFirstChild('Right Hip'):Destroy()
  3698. end
  3699. elseif limbname == "Left Leg" and character:FindFirstChild("Left Leg") and character:FindFirstChild("Torso") and character.Torso:FindFirstChild("Left LegRagdollConstraint") == nil and character[limbname]:FindFirstChild("Left LegRagdollConstraint") == nil then
  3700. stun(character)
  3701. local torsoatt = Instance.new('Attachment',character.Torso)
  3702. torsoatt.Name = limbname.."RagdollConstraint"
  3703. torsoatt.Position = Vector3.new(-0.45, -1.242, -0.009)
  3704. torsoatt.Axis = Vector3.new(1,0,0)
  3705. torsoatt.SecondaryAxis = Vector3.new(0,1,0)
  3706. local limbatt = Instance.new("Attachment",character[limbname])
  3707. limbatt.Position = Vector3.new(-0.086, 0.755, -0.007)
  3708. limbatt.Name = limbname.."RagdollConstraint"
  3709. limbatt.Axis = Vector3.new(1,0,0)
  3710. limbatt.SecondaryAxis = Vector3.new(0,1,0)
  3711. local ballc = Instance.new('BallSocketConstraint',character)
  3712. ballc.Name = "LeftLegRagdollRig"
  3713. ballc.Attachment0 = torsoatt
  3714. ballc.Attachment1 = limbatt
  3715. local part1 = character[limbname]
  3716. if character:FindFirstChildOfClass('Humanoid').Health > 0 then
  3717. local collidepart = Instance.new('Part',part1)
  3718. collidepart.Size = part1.Size/1.5
  3719. collidepart.CanCollide = true
  3720. collidepart.Name = "Collision"
  3721. collidepart.Anchored = false
  3722. collidepart.Transparency = 1
  3723. collidepart.CFrame = part1.CFrame
  3724. collidepart:BreakJoints()
  3725. local attachment0 = Instance.new('Attachment',part1)
  3726. local attachment1 = Instance.new('Attachment',collidepart)
  3727. if attachment0 and attachment1 then
  3728. local constraint = Instance.new("HingeConstraint")
  3729. constraint.Attachment0 = attachment0
  3730. constraint.Attachment1 = attachment1
  3731. constraint.LimitsEnabled = true
  3732. constraint.UpperAngle = 0
  3733. constraint.LowerAngle = 0
  3734. constraint.Parent = character
  3735. end
  3736. end
  3737. if character.Torso:FindFirstChild('Left Hip') then
  3738. character.Torso:FindFirstChild('Left Hip'):Destroy()
  3739. end
  3740. elseif limbname == "Head" or limbname == "Torso" and character:FindFirstChild("Head") and character:FindFirstChild("Torso") and character.Head:FindFirstChild("Neck") == nil then
  3741. if character:FindFirstChildOfClass('Humanoid') then
  3742. character:FindFirstChildOfClass('Humanoid').Health = 0
  3743. end
  3744. while character:FindFirstChildOfClass('Humanoid').Health > 0 do wait() end
  3745. if character:FindFirstChild('HumanoidRootPart') then
  3746. character.HumanoidRootPart:Destroy()
  3747. end
  3748. game:GetService('Debris'):AddItem(character,10)
  3749. for _,child in next,character:GetChildren() do
  3750. if child:IsA("Accoutrement") then
  3751. for _,part in next,child:GetChildren() do
  3752. if part:IsA("BasePart") then
  3753. for _,c in pairs(part:GetChildren()) do
  3754. if c:IsA('Weld') then c:Destroy() end
  3755. end
  3756. local attachment1 = part:FindFirstChildOfClass("Attachment")
  3757. local attachment0 = getAttachment0(character,attachment1.Name)
  3758. if attachment0 and attachment1 then
  3759. local constraint = Instance.new("HingeConstraint")
  3760. constraint.Attachment0 = attachment0
  3761. constraint.Attachment1 = attachment1
  3762. constraint.LimitsEnabled = true
  3763. constraint.UpperAngle = 0
  3764. constraint.LowerAngle = 0
  3765. constraint.Parent = character
  3766. end
  3767. end
  3768. end
  3769. end
  3770. end
  3771. for i,v in pairs(character:GetChildren()) do
  3772. if v:IsA('MeshPart') or v:IsA('BasePart') then
  3773. for _,c in pairs(v:GetChildren()) do
  3774. if c.Name == "Collision" then c:Destroy() end
  3775. end
  3776. end
  3777. end
  3778. if character.Torso:FindFirstChild('Neck') then
  3779. character.Torso.Neck:Destroy()
  3780. end
  3781. if character:FindFirstChild('Torso') then
  3782. local collidepart = Instance.new('Part',character.Torso)
  3783. collidepart.Size = character.Torso.Size/1.5
  3784. collidepart.CanCollide = true
  3785. collidepart.Name = "Collision"
  3786. collidepart.Anchored = false
  3787. collidepart.Transparency = 1
  3788. collidepart.CFrame = character.Torso.CFrame
  3789. collidepart:BreakJoints()
  3790. local attachment0 = Instance.new('Attachment',character.Torso)
  3791. local attachment1 = Instance.new('Attachment',collidepart)
  3792. if attachment0 and attachment1 then
  3793. local constraint = Instance.new("HingeConstraint")
  3794. constraint.Attachment0 = attachment0
  3795. constraint.Attachment1 = attachment1
  3796. constraint.LimitsEnabled = true
  3797. constraint.UpperAngle = 0
  3798. constraint.LowerAngle = 0
  3799. constraint.Parent = character
  3800. end
  3801. end
  3802. if character:FindFirstChild('Torso') and character:FindFirstChild('Head') then
  3803. if character.Torso:FindFirstChild('NeckAttachment') == nil then
  3804. local neck = Instance.new('Attachment',character.Torso)
  3805. neck.Name = "NeckAttachment"
  3806. neck.Position = Vector3.new(0, 1, 0)
  3807. end
  3808. ragdollJoint(character,character.Torso, character.Head, "NeckAttachment", "Hinge", {
  3809. {"LimitsEnabled",true};
  3810. {"UpperAngle",50};
  3811. {"LowerAngle",-50};
  3812. })
  3813. end
  3814. if attached ~= false then
  3815. ragdollpart(character, "Right Leg")
  3816. ragdollpart(character, "Left Leg")
  3817. else
  3818. pcall(function()
  3819. local ayybleed = Instance.new('Part',character)
  3820. ayybleed.Size = Vector3.new(character.Torso.Size.X,0.1,character.Torso.Size.Z)
  3821. ayybleed.Transparency = 1
  3822. ayybleed.CanCollide = false
  3823. ayybleed.CFrame = character.Torso.CFrame
  3824. ayybleed:BreakJoints()
  3825. local attachment1 = Instance.new('Attachment',ayybleed)
  3826. attachment1.Position = Vector3.new(0,-character.Torso.Size.Y/2,0)
  3827. attachment1.Orientation = Vector3.new(0, 0, -180)
  3828. local attachment0 = Instance.new('Attachment',character.Torso)
  3829. if attachment0 and attachment1 then
  3830. local constraint = Instance.new("HingeConstraint")
  3831. constraint.Attachment0 = attachment0
  3832. constraint.Attachment1 = attachment1
  3833. constraint.LimitsEnabled = true
  3834. constraint.UpperAngle = 0
  3835. constraint.LowerAngle = 0
  3836. constraint.Parent = character
  3837. end
  3838. local bleedBLEED= coroutine.wrap(function()
  3839. bleed(ayybleed)
  3840. end)
  3841. bleedBLEED()
  3842. end)
  3843. end
  3844. ragdollpart(character, "Right Arm")
  3845. ragdollpart(character, "Left Arm")
  3846. end
  3847. end)
  3848. end
  3849.  
  3850. function getAttachment0(character,attachmentName)
  3851. for _,child in next,character:GetChildren() do
  3852. local attachment = child:FindFirstChild(attachmentName)
  3853. if attachment then
  3854. return attachment
  3855. end
  3856. end
  3857. end
  3858.  
  3859. function ragdollpart(character,partname,attached,heded)
  3860. if heded ~= false then
  3861. local neck = Instance.new('Attachment',character.Head)
  3862. neck.Name = "NeckAttachment"
  3863. neck.Position = Vector3.new(0,-0.5,0)
  3864. else
  3865. local force = Instance.new('BodyForce',character.Head)
  3866. force.Force = Vector3.new(0,500,0)
  3867. game:GetService('Debris'):AddItem(force,0.25)
  3868. pcall(function()
  3869. local asdf = Instance.new('Attachment',character.Head)
  3870. asdf.Position = Vector3.new(0,-character.Head.Size.Y/2,0)
  3871. local last = asdf
  3872. for i=1,14 do
  3873. local bONE = Instance.new('Part',character)
  3874. bONE.BrickColor = BrickColor.new('Institutional white')
  3875. bONE.Size = Vector3.new(0.1,0.1,0.1)
  3876. bONE.CFrame = character.Head.CFrame+(character.Head.CFrame.upVector*-(i/10))
  3877. local lole = Instance.new('Attachment',bONE)
  3878. local hangurself = Instance.new('RopeConstraint',bONE)
  3879. hangurself.Attachment0 = lole
  3880. hangurself.Attachment1 = last
  3881. hangurself.Visible = true
  3882. hangurself.Thickness = 0.05
  3883. hangurself.Color = BrickColor.new('Bright red')
  3884. hangurself.Length = 0.2
  3885. last = lole
  3886. end
  3887. local bleedee = Instance.new('Part',character.Head)
  3888. bleedee.Size = Vector3.new(0.75,0.25,0.75)
  3889. bleedee.CanCollide = false
  3890. bleedee.Color = Frame_2.BackgroundColor3
  3891. bleedee.CFrame = character.Head.CFrame
  3892. local mehs = Instance.new('CylinderMesh',bleedee)
  3893. bleedee:BreakJoints()
  3894. local attachment1 = Instance.new('Attachment',bleedee)
  3895. attachment1.Position = Vector3.new(0,character.Head.Size.Y/2,0)
  3896. attachment1.Orientation = Vector3.new(0,0,180)
  3897. local attachment0 = Instance.new('Attachment',character.Head)
  3898. if attachment0 and attachment1 then
  3899. local constraint = Instance.new("HingeConstraint")
  3900. constraint.Attachment0 = attachment0
  3901. constraint.Attachment1 = attachment1
  3902. constraint.LimitsEnabled = true
  3903. constraint.UpperAngle = 0
  3904. constraint.LowerAngle = 0
  3905. constraint.Parent = character
  3906. end
  3907. spawn(function()
  3908. bleed(bleedee)
  3909. end)
  3910. end)
  3911. local thing = "Torso"
  3912. if character:FindFirstChild(thing) == nil then
  3913. thing = "UpperTorso"
  3914. end
  3915. pcall(function()
  3916. local bleedee = Instance.new('Part',character[thing])
  3917. bleedee.Size = Vector3.new(0.75,0,0.75)
  3918. bleedee.CanCollide = false
  3919. bleedee.Color = Frame_2.BackgroundColor3
  3920. bleedee.CFrame = character[thing].CFrame
  3921. local mehs = Instance.new('CylinderMesh',bleedee)
  3922. bleedee:BreakJoints()
  3923. local attachment1 = Instance.new('Attachment',bleedee)
  3924. attachment1.Position = Vector3.new(0,-character[thing].Size.Y/2,0)
  3925. attachment1.Orientation = Vector3.new(0,0,180)
  3926. local attachment0 = Instance.new('Attachment',character[thing])
  3927. if attachment0 and attachment1 then
  3928. local constraint = Instance.new("HingeConstraint")
  3929. constraint.Attachment0 = attachment0
  3930. constraint.Attachment1 = attachment1
  3931. constraint.LimitsEnabled = true
  3932. constraint.UpperAngle = 0
  3933. constraint.LowerAngle = 0
  3934. constraint.Parent = character
  3935. end
  3936. spawn(function()
  3937. bleed(bleedee)
  3938. end)
  3939. end)
  3940. end
  3941. pcall(function()
  3942. if workspace.PGSPhysicsSolverEnabled == false then
  3943. workspace.PGSPhysicsSolverEnabled = true
  3944. end
  3945. end)
  3946. if partname == "HumanoidRootPart" then
  3947. if character:FindFirstChild('Torso') then
  3948. partname = "Torso"
  3949. else
  3950. partname = "UpperTorso"
  3951. end
  3952. end
  3953. if attached == false then
  3954. if character:FindFirstChild('UpperTorso') then
  3955. pcall(function()
  3956. character.UpperTorso.WaistRigAttachment:Destroy()
  3957. end)
  3958. pcall(function()
  3959. local ayybleed = Instance.new('Part',character)
  3960. ayybleed.Size = Vector3.new(character.UpperTorso.Size.X,0,character.UpperTorso.Size.Z)
  3961. ayybleed.Transparency = 1
  3962. ayybleed.CanCollide = false
  3963. ayybleed.CFrame = character.UpperTorso.CFrame
  3964. ayybleed:BreakJoints()
  3965. ayybleed.Name = "ayybleed"
  3966. local attachment1 = Instance.new('Attachment',ayybleed)
  3967. attachment1.Position = Vector3.new(0,-character.UpperTorso.Size.Y/2,0)
  3968. attachment1.Orientation = Vector3.new(0,0,180)
  3969. local attachment0 = Instance.new('Attachment',character.UpperTorso)
  3970. if attachment0 and attachment1 then
  3971. local constraint = Instance.new("HingeConstraint")
  3972. constraint.Attachment0 = attachment0
  3973. constraint.Attachment1 = attachment1
  3974. constraint.LimitsEnabled = true
  3975. constraint.UpperAngle = 0
  3976. constraint.LowerAngle = 0
  3977. constraint.Parent = character
  3978. end
  3979. local bleedBLEED= coroutine.wrap(function()
  3980. bleed(ayybleed)
  3981. end)
  3982. bleedBLEED()
  3983. end)
  3984. pcall(function()
  3985. local ayybleed = Instance.new('Part',character)
  3986. ayybleed.Size = Vector3.new(character.LowerTorso.Size.X-0.1,0.1,character.LowerTorso.Size.Z-0.1)
  3987. ayybleed.Transparency = 1
  3988. ayybleed.CanCollide = false
  3989. ayybleed.CFrame = character.LowerTorso.CFrame
  3990. ayybleed:BreakJoints()
  3991. ayybleed.Name = "ayybleed"
  3992. local attachment1 = Instance.new('Attachment',ayybleed)
  3993. attachment1.Position = Vector3.new(0,-character.LowerTorso.Size.Y/2,0)
  3994. attachment1.Orientation = Vector3.new(0,0,0)
  3995. local attachment0 = Instance.new('Attachment',character.LowerTorso)
  3996. if attachment0 and attachment1 then
  3997. local constraint = Instance.new("HingeConstraint")
  3998. constraint.Attachment0 = attachment0
  3999. constraint.Attachment1 = attachment1
  4000. constraint.LimitsEnabled = true
  4001. constraint.UpperAngle = 0
  4002. constraint.LowerAngle = 0
  4003. constraint.Parent = character
  4004. end
  4005. local bleedBLEED= coroutine.wrap(function()
  4006. bleed(ayybleed)
  4007. end)
  4008. bleedBLEED()
  4009. end)
  4010. end
  4011. pcall(function()
  4012. local thang = "Torso"
  4013. if character:FindFirstChild('UpperTorso') then
  4014. thang = "UpperTorso"
  4015. end
  4016. local ayybleed = Instance.new('Part',character)
  4017. ayybleed.Size = Vector3.new(character[thang].Size.X-0.1,0.1,character[thang].Size.Z-0.1)
  4018. ayybleed.Color = Frame_2.BackgroundColor3
  4019. ayybleed.Material = Enum.Material.SmoothPlastic
  4020. ayybleed.Name = "ayybleed"
  4021. ayybleed.CanCollide = false
  4022. ayybleed.Transparency = 0
  4023. ayybleed.CFrame = character[thang].CFrame
  4024. ayybleed:BreakJoints()
  4025. local attachment1 = Instance.new('Attachment',ayybleed)
  4026. attachment1.Position = Vector3.new(0,(character[thang].Size.Y/2)-0.045,0)
  4027. attachment1.Orientation = Vector3.new(0,0,0)
  4028. local attachment0 = Instance.new('Attachment',character[thang])
  4029. if attachment0 and attachment1 then
  4030. local constraint = Instance.new("HingeConstraint")
  4031. constraint.Attachment0 = attachment0
  4032. constraint.Attachment1 = attachment1
  4033. constraint.LimitsEnabled = true
  4034. constraint.UpperAngle = 0
  4035. constraint.LowerAngle = 0
  4036. constraint.Parent = character
  4037. end
  4038. end)
  4039. pcall(function()
  4040. local ree = character.LowerTorso
  4041. local thang = "LowerTorso"
  4042. local ayybleed = Instance.new('Part',character)
  4043. ayybleed.Size = Vector3.new(character[thang].Size.X-0.1,0.1,character[thang].Size.Z-0.1)
  4044. ayybleed.Color = Frame_2.BackgroundColor3
  4045. ayybleed.Material = Enum.Material.SmoothPlastic
  4046. ayybleed.Name = "ayybleed"
  4047. ayybleed.CanCollide = false
  4048. ayybleed.Transparency = 0
  4049. ayybleed.CFrame = character[thang].CFrame
  4050. ayybleed:BreakJoints()
  4051. local attachment1 = Instance.new('Attachment',ayybleed)
  4052. attachment1.Position = Vector3.new(0,(-character[thang].Size.Y/2)+0.045,0)
  4053. attachment1.Orientation = Vector3.new(0,0,0)
  4054. local attachment0 = Instance.new('Attachment',character[thang])
  4055. if attachment0 and attachment1 then
  4056. local constraint = Instance.new("HingeConstraint")
  4057. constraint.Attachment0 = attachment0
  4058. constraint.Attachment1 = attachment1
  4059. constraint.LimitsEnabled = true
  4060. constraint.UpperAngle = 0
  4061. constraint.LowerAngle = 0
  4062. constraint.Parent = character
  4063. end
  4064. end)
  4065. pcall(function()
  4066. local ree = character["Right Leg"]
  4067. local thang = "Right Leg"
  4068. local ayybleed = Instance.new('Part',character)
  4069. ayybleed.Size = Vector3.new(character[thang].Size.X-0.1,0.1,character[thang].Size.Z-0.1)
  4070. ayybleed.Color = Frame_2.BackgroundColor3
  4071. ayybleed.Material = Enum.Material.SmoothPlastic
  4072. ayybleed.Name = "ayybleed"
  4073. ayybleed.CanCollide = false
  4074. ayybleed.Transparency = 0
  4075. ayybleed.CFrame = character[thang].CFrame
  4076. ayybleed:BreakJoints()
  4077. local attachment1 = Instance.new('Attachment',ayybleed)
  4078. attachment1.Position = Vector3.new(0,(-character[thang].Size.Y/2)+0.045,0)
  4079. attachment1.Orientation = Vector3.new(0,0,0)
  4080. local attachment0 = Instance.new('Attachment',character[thang])
  4081. if attachment0 and attachment1 then
  4082. local constraint = Instance.new("HingeConstraint")
  4083. constraint.Attachment0 = attachment0
  4084. constraint.Attachment1 = attachment1
  4085. constraint.LimitsEnabled = true
  4086. constraint.UpperAngle = 0
  4087. constraint.LowerAngle = 0
  4088. constraint.Parent = character
  4089. end
  4090. end)
  4091. pcall(function()
  4092. local ree = character["Left Leg"]
  4093. local thang = "Left Leg"
  4094. local ayybleed = Instance.new('Part',character)
  4095. ayybleed.Size = Vector3.new(character[thang].Size.X-0.1,0.1,character[thang].Size.Z-0.1)
  4096. ayybleed.Color = Frame_2.BackgroundColor3
  4097. ayybleed.Material = Enum.Material.SmoothPlastic
  4098. ayybleed.Name = "ayybleed"
  4099. ayybleed.CanCollide = false
  4100. ayybleed.Transparency = 0
  4101. ayybleed.CFrame = character[thang].CFrame
  4102. ayybleed:BreakJoints()
  4103. local attachment1 = Instance.new('Attachment',ayybleed)
  4104. attachment1.Position = Vector3.new(0,(-character[thang].Size.Y/2)+0.045,0)
  4105. attachment1.Orientation = Vector3.new(0,0,0)
  4106. local attachment0 = Instance.new('Attachment',character[thang])
  4107. if attachment0 and attachment1 then
  4108. local constraint = Instance.new("HingeConstraint")
  4109. constraint.Attachment0 = attachment0
  4110. constraint.Attachment1 = attachment1
  4111. constraint.LimitsEnabled = true
  4112. constraint.UpperAngle = 0
  4113. constraint.LowerAngle = 0
  4114. constraint.Parent = character
  4115. end
  4116. end)
  4117. partname="Head"
  4118. end
  4119. if partname == "RightHand" or partname == "RightLowerArm" or partname == "RightUpperArm" then
  4120. if character:FindFirstChild('RightLowerArm') and character:FindFirstChild('RightHand') then
  4121. ragdollJoint(character,character.RightLowerArm, character.RightHand, "RightWrist", "Hinge", handProperties)
  4122. end
  4123. if character:FindFirstChild('UpperTorso') and character:FindFirstChild('RightUpperArm') then
  4124. ragdollJoint(character, character.UpperTorso, character["RightUpperArm"], "RightShoulder", "BallSocket")
  4125. end
  4126. if character:FindFirstChild('RightUpperArm') and character:FindFirstChild('RightLowerArm') then
  4127. ragdollJoint(character, character.RightUpperArm, character.RightLowerArm, "RightElbow", "BallSocket")
  4128. end
  4129. elseif partname == "LeftHand" or partname == "LeftLowerArm" or partname == "LeftUpperArm" then
  4130. if character:FindFirstChild('LeftLowerArm') and character:FindFirstChild('LeftHand') then
  4131. ragdollJoint(character,character.LeftLowerArm, character.LeftHand, "LeftWrist", "Hinge", handProperties)
  4132. end
  4133. if character:FindFirstChild('UpperTorso') and character:FindFirstChild('LeftUpperArm') then
  4134. ragdollJoint(character, character.UpperTorso, character["LeftUpperArm"], "LeftShoulder", "BallSocket")
  4135. end
  4136. if character:FindFirstChild('LeftUpperArm') and character:FindFirstChild('LeftLowerArm') then
  4137. ragdollJoint(character, character.LeftUpperArm, character.LeftLowerArm, "LeftElbow", "BallSocket")
  4138. end
  4139. elseif partname == "RightFoot" or partname == "RightUpperLeg" or partname == "RightLowerLeg" then
  4140. stun(character)
  4141. if character:FindFirstChild('RightUpperLeg') and character:FindFirstChild('RightLowerLeg') then
  4142. ragdollJoint(character,character.RightUpperLeg, character.RightLowerLeg, "RightKnee", "Hinge", shinProperties)
  4143. end
  4144. if character:FindFirstChild('RightLowerLeg') and character:FindFirstChild('RightFoot') then
  4145. ragdollJoint(character,character.RightLowerLeg, character.RightFoot, "RightAnkle", "Hinge", footProperties)
  4146. end
  4147. if character:FindFirstChild('LowerTorso') and character:FindFirstChild('RightUpperLeg') then
  4148. ragdollJoint(character,character.LowerTorso, character.RightUpperLeg, "RightHip", "BallSocket")
  4149. end
  4150. elseif partname == "LeftFoot" or partname == "LeftUpperLeg" or partname == "LeftLowerLeg" then
  4151. stun(character)
  4152. if character:FindFirstChild('LeftUpperLeg') and character:FindFirstChild('LeftLowerLeg') then
  4153. ragdollJoint(character,character.LeftUpperLeg, character.LeftLowerLeg, "LeftKnee", "Hinge", shinProperties)
  4154. end
  4155. if character:FindFirstChild('LeftLowerLeg') and character:FindFirstChild('LeftFoot') then
  4156. ragdollJoint(character,character.LeftLowerLeg, character.LeftFoot, "LeftAnkle", "Hinge", footProperties)
  4157. end
  4158. if character:FindFirstChild('LowerTorso') and character:FindFirstChild('LeftUpperLeg') then
  4159. ragdollJoint(character,character.LowerTorso, character.LeftUpperLeg, "LeftHip", "BallSocket")
  4160. end
  4161. elseif partname == "Head" or partname == "UpperTorso" or partname == "LowerTorso" then
  4162. if character:FindFirstChildOfClass('Humanoid') and character:FindFirstChildOfClass('Humanoid').RigType == Enum.HumanoidRigType.R15 then
  4163. if character:FindFirstChildOfClass('Humanoid') then
  4164. character:FindFirstChildOfClass('Humanoid').Health = 0
  4165. end
  4166. if character:FindFirstChild('HumanoidRootPart') then
  4167. character.HumanoidRootPart:Destroy()
  4168. end
  4169. while character:FindFirstChildOfClass('Humanoid').Health > 0 do wait() end
  4170. game:GetService('Debris'):AddItem(character,10)
  4171. for _,child in next,character:GetChildren() do
  4172. if child:IsA("Accoutrement") then
  4173. for _,part in next,child:GetChildren() do
  4174. if part:IsA("BasePart") then
  4175. for _,c in pairs(part:GetChildren()) do
  4176. if c:IsA('Weld') then c:Destroy() end
  4177. end
  4178. local attachment1 = part:FindFirstChildOfClass("Attachment")
  4179. local attachment0 = getAttachment0(character,attachment1.Name)
  4180. if attachment0 and attachment1 then
  4181. local constraint = Instance.new("HingeConstraint")
  4182. constraint.Attachment0 = attachment0
  4183. constraint.Attachment1 = attachment1
  4184. constraint.LimitsEnabled = true
  4185. constraint.UpperAngle = 0
  4186. constraint.LowerAngle = 0
  4187. constraint.Parent = character
  4188. end
  4189. end
  4190. end
  4191. end
  4192. end
  4193. for i,v in pairs(character:GetChildren()) do
  4194. if v:IsA('MeshPart') or v:IsA('BasePart') then
  4195. for _,c in pairs(v:GetChildren()) do
  4196. if c.Name == "Collision" then c:Destroy() end
  4197. end
  4198. end
  4199. end
  4200. if heded == false then
  4201. pcall(function()
  4202. local asdf = Instance.new('Attachment',character.Head)
  4203. asdf.Position = Vector3.new(0,-character.Head.Size.Y/2,0)
  4204. local last = asdf
  4205. character.Head.Neck:Destroy()
  4206. character.Head.NeckRigAttachment:Destroy()
  4207. character.UpperTorso:FindFirstChild('NeckAttachment'):Destroy()
  4208. end)
  4209. end
  4210. if character:FindFirstChild('UpperTorso') and character:FindFirstChild('LowerTorso') then
  4211. ragdollJoint(character,character.LowerTorso, character.UpperTorso, "Waist", "BallSocket", {
  4212. {"LimitsEnabled",true};
  4213. {"UpperAngle",5};
  4214. {"Radius",5};
  4215. })
  4216. end
  4217. if character:FindFirstChild('UpperTorso') and character:FindFirstChild('Head') then
  4218. ragdollJoint(character,character.UpperTorso, character.Head, "Neck", "Hinge", {
  4219. {"LimitsEnabled",true};
  4220. {"UpperAngle",50};
  4221. {"LowerAngle",-50};
  4222. })
  4223. end
  4224.  
  4225. local handProperties = {
  4226. {"LimitsEnabled", true};
  4227. {"UpperAngle",0};
  4228. {"LowerAngle",0};
  4229. }
  4230. if character:FindFirstChild('LeftLowerArm') and character:FindFirstChild('LeftHand') then
  4231. ragdollJoint(character,character.LeftLowerArm, character.LeftHand, "LeftWrist", "Hinge", handProperties)
  4232. end
  4233. if character:FindFirstChild('RightLowerArm') and character:FindFirstChild('RightHand') then
  4234. ragdollJoint(character,character.RightLowerArm, character.RightHand, "RightWrist", "Hinge", handProperties)
  4235. end
  4236.  
  4237. local shinProperties = {
  4238. {"LimitsEnabled", true};
  4239. {"UpperAngle", 0};
  4240. {"LowerAngle", -75};
  4241. }
  4242. if character:FindFirstChild('LeftUpperLeg') and character:FindFirstChild('LeftLowerLeg') then
  4243. ragdollJoint(character,character.LeftUpperLeg, character.LeftLowerLeg, "LeftKnee", "Hinge", shinProperties)
  4244. end
  4245. if character:FindFirstChild('RightUpperLeg') and character:FindFirstChild('RightLowerLeg') then
  4246. ragdollJoint(character,character.RightUpperLeg, character.RightLowerLeg, "RightKnee", "Hinge", shinProperties)
  4247. end
  4248.  
  4249. local footProperties = {
  4250. {"LimitsEnabled", true};
  4251. {"UpperAngle", 15};
  4252. {"LowerAngle", -45};
  4253. }
  4254. if character:FindFirstChild('LeftLowerLeg') and character:FindFirstChild('LeftFoot') then
  4255. ragdollJoint(character,character.LeftLowerLeg, character.LeftFoot, "LeftAnkle", "Hinge", footProperties)
  4256. end
  4257. if character:FindFirstChild('RightLowerLeg') and character:FindFirstChild('RightFoot') then
  4258. ragdollJoint(character,character.RightLowerLeg, character.RightFoot, "RightAnkle", "Hinge", footProperties)
  4259. end
  4260. if character:FindFirstChild('UpperTorso') and character:FindFirstChild('LeftUpperArm') then
  4261. ragdollJoint(character,character.UpperTorso, character.LeftUpperArm, "LeftShoulder", "BallSocket")
  4262. end
  4263. if character:FindFirstChild('LeftLowerArm') and character:FindFirstChild('LeftUpperArm') then
  4264. ragdollJoint(character,character.LeftUpperArm, character.LeftLowerArm, "LeftElbow", "BallSocket")
  4265. end
  4266. if character:FindFirstChild('UpperTorso') and character:FindFirstChild('RightUpperArm') then
  4267. ragdollJoint(character,character.UpperTorso, character.RightUpperArm, "RightShoulder", "BallSocket")
  4268. end
  4269. if character:FindFirstChild('RightUpperArm') and character:FindFirstChild('RightLowerArm') then
  4270. ragdollJoint(character,character.RightUpperArm, character.RightLowerArm, "RightElbow", "BallSocket")
  4271. end
  4272. if character:FindFirstChild('LowerTorso') and character:FindFirstChild('LeftUpperLeg') then
  4273. ragdollJoint(character,character.LowerTorso, character.LeftUpperLeg, "LeftHip", "BallSocket")
  4274. end
  4275. if character:FindFirstChild('LowerTorso') and character:FindFirstChild('RightUpperLeg') then
  4276. ragdollJoint(character,character.LowerTorso, character.RightUpperLeg, "RightHip", "BallSocket")
  4277. end
  4278. if character:FindFirstChild('HumanoidRootPart') then
  4279. character.HumanoidRootPart:Destroy()
  4280. end
  4281. else
  4282. R6ragdollJoint(character,partname,attached,heded)
  4283. end
  4284. else
  4285. R6ragdollJoint(character,partname,attached,heded)
  4286. end
  4287. end
  4288.  
  4289. function grow(weld,part,endsize,endpos,amntime)
  4290. local start = weld.C1
  4291. local parent = weld.Parent
  4292. local startsize = part.Size
  4293. local particl = Instance.new("ParticleEmitter")
  4294. particl.LightEmission = 3
  4295. particl.Color = ColorSequence.new({ColorSequenceKeypoint.new(0, Color3.fromRGB(42, 0, 255)), ColorSequenceKeypoint.new(0.1, Color3.fromRGB(248, 153, 0)), ColorSequenceKeypoint.new(1, Color3.fromRGB(255, 255, 0))})
  4296. particl.LightInfluence = 0.75
  4297. particl.Size = NumberSequence.new({NumberSequenceKeypoint.new(0, 1), NumberSequenceKeypoint.new(1, 0)})
  4298. particl.Lifetime = NumberRange.new(0.1, 1)
  4299. particl.Rate = 50
  4300. particl.RotSpeed = NumberRange.new(300, 300)
  4301. particl.Speed = NumberRange.new(0, 1)
  4302. particl.SpreadAngle = Vector2.new(90, 90)
  4303. particl.Parent = part
  4304. for i=1,amntime*100 do
  4305. weld.C1 = start:lerp(endpos,i/(amntime*100))
  4306. part.Size = startsize:lerp(endsize,i/(amntime*100))
  4307. weld.Parent = parent
  4308. wait(0.01)
  4309. end
  4310. particl.Enabled = false
  4311. end
  4312. function lerp(weld,startpos,endpos,amntime,longatend)
  4313. local waited = 0
  4314. for i=1,amntime*100 do
  4315. if longatend == true then
  4316. startpos = weld.C0
  4317. end
  4318. weld.C0 = startpos:lerp(endpos,i/(amntime*100))
  4319. wait(0.01)
  4320. waited=waited+0.01
  4321. end
  4322. end
  4323.  
  4324. function spawned()
  4325. local usable = true
  4326. local working = false
  4327. local mode = "kill"
  4328. local equipped = false
  4329. local char = player.Character
  4330. local blademode = "handle"
  4331. local swinging = false
  4332. local gettingeem = false
  4333. local MOAN = false
  4334. local sounding = false
  4335. local SLESH = false
  4336. local goteem = nil
  4337. local grabbing = false
  4338. local grabbed = nil
  4339. local grabweld = nil
  4340. local aidsificating = nil
  4341. player.CharacterAdded:connect(function()
  4342. if usable then
  4343. usable = false
  4344. end
  4345. end)
  4346. if char == nil then return end
  4347. while char:FindFirstChildOfClass('Humanoid') == nil or char:FindFirstChild('Head') == nil do wait() end
  4348. local badass = Instance.new('Sound',char.Head)
  4349. badass.Name = 'Badass'
  4350. badass.EmitterSize = player.CameraMaxZoomDistance+1
  4351. badass.MaxDistance = player.CameraMaxZoomDistance+1
  4352. badass.Volume = 10
  4353. badass.Looped=true
  4354. badass.SoundId = 'rbxassetid://428902535'
  4355. local handle = Instance.new("Part", char)
  4356. handle.BrickColor = BrickColor.new("Really black")
  4357. handle.Material = "Metal"
  4358. handle.CanCollide = false
  4359. handle.Anchored = false
  4360. handle.Shape = "Cylinder"
  4361. handle.Size = Vector3.new(1.1, 0.3, 0.3)
  4362. handle.BackSurface = "SmoothNoOutlines"
  4363. handle.BottomSurface = "SmoothNoOutlines"
  4364. handle.FrontSurface = "SmoothNoOutlines"
  4365. handle.LeftSurface = "SmoothNoOutlines"
  4366. handle.RightSurface = "SmoothNoOutlines"
  4367. handle.TopSurface = "SmoothNoOutlines"
  4368. handle.Name = "handle"
  4369.  
  4370. local hweld = Instance.new("Weld", char.Torso)
  4371. hweld.Part0 = char.Torso
  4372. hweld.Part1 = handle
  4373. hweld.C0 = CFrame.new(1, -0.8, 0) * CFrame.Angles(0, math.rad(90), 0)
  4374.  
  4375. local rdd = false
  4376. function oogabooga()
  4377. if rdd == false then
  4378. rdd = true
  4379. pcall(function()
  4380. ragdollpart(char,"Right Arm")
  4381. ragdollpart(char,"Right Leg")
  4382. ragdollpart(char,"Left Arm")
  4383. ragdollpart(char,"Left Leg")
  4384. end)
  4385. pcall(function()
  4386. ragdollpart(char,"RightUpperArm")
  4387. ragdollpart(char,"RightUpperLeg")
  4388. ragdollpart(char,"LeftUpperArm")
  4389. ragdollpart(char,"LeftUpperLeg")
  4390. end)
  4391. unstun(char)
  4392. for i,v in pairs(char:GetChildren()) do
  4393. v.ChildAdded:connect(function(child)
  4394. if rdd == true then
  4395. if child.Name ~= "Neck" and child.Name ~= "RootJoint" and child.Name ~= "Root" and (child:IsA('Motor6D') or child:IsA('Weld')) then
  4396. if child ~= grabweld then
  4397. spawn(function()
  4398. wait()
  4399. child:Destroy()
  4400. end)
  4401. end
  4402. end
  4403. end
  4404. end)
  4405. if string.find(string.lower(v.Name),'leg') then
  4406. if v:FindFirstChild('Collision') then
  4407. v:FindFirstChild('Collision'):Destroy()
  4408. end
  4409. end
  4410. end
  4411. else
  4412. rdd = false
  4413. for i,v in pairs(char:GetChildren()) do
  4414. if v:IsA('HingeConstraint') or v:IsA('BallSocketConstraint') then
  4415. v:Destroy()
  4416. elseif v:IsA('BasePart') then
  4417. if v:FindFirstChild('Collision') then
  4418. v.Collision:Destroy()
  4419. end
  4420. for a,c in pairs(v:GetChildren()) do
  4421. if string.find(string.lower(c.Name),"ragdoll") then
  4422. c:Destroy()
  4423. end
  4424. end
  4425. end
  4426. end
  4427. pcall(function()
  4428. local ra = rightclone:Clone()
  4429. ra.Parent = char.Torso
  4430. ra.Part0 = char.Torso
  4431. ra.Part1 = char["Right Arm"]
  4432. end)
  4433. pcall(function()
  4434. local la = leftclone:Clone()
  4435. la.Parent = char.Torso
  4436. la.Part0 = char.Torso
  4437. la.Part1 = char["Left Arm"]
  4438. end)
  4439. pcall(function()
  4440. local ll = leftlegclone:Clone()
  4441. ll.Parent = char.Torso
  4442. ll.Part0 = char.Torso
  4443. ll.Part1 = char["Left Leg"]
  4444. end)
  4445. pcall(function()
  4446. local rl = rightlegclone:Clone()
  4447. rl.Parent = char.Torso
  4448. rl.Part0 = char.Torso
  4449. rl.Part1 = char["Right Leg"]
  4450. end)
  4451. end
  4452. end
  4453. function getrid()
  4454. if grabbed then
  4455. release()
  4456. end
  4457. blademode = "handle"
  4458. for _,ree in pairs(handle:GetChildren()) do
  4459. if ree:IsA('BasePart') then
  4460. local part = Instance.new('Part',workspace)
  4461. part.CFrame = ree.CFrame
  4462. part.Anchored = true
  4463. part.CanCollide = false
  4464. part.Size = ree.Size
  4465. part.Transparency = 1
  4466. ree:Destroy()
  4467. local pe2 = Instance.new("ParticleEmitter")
  4468. pe2.Acceleration = Vector3.new(0, 1, 0)
  4469. pe2.Lifetime = NumberRange.new(0.1, 0.2)
  4470. pe2.Speed = NumberRange.new(0.5)
  4471. pe2.Rate = 20000
  4472. pe2.RotSpeed = NumberRange.new(-30, 30)
  4473. pe2.Rotation = NumberRange.new(0, 360)
  4474. pe2.Size = NumberSequence.new({
  4475. NumberSequenceKeypoint.new(0, part.Size.X*2, 0),
  4476. NumberSequenceKeypoint.new(1, part.Size.X*2, 0),
  4477. })
  4478. pe2.Texture = "rbxassetid://244221440"
  4479. pe2.Transparency = NumberSequence.new({
  4480. NumberSequenceKeypoint.new(0, 0.9, 0),
  4481. NumberSequenceKeypoint.new(1, 0.9, 0)
  4482. })
  4483. pe2.ZOffset = 5
  4484. pe2.VelocitySpread = 360
  4485. pe2.Parent = part
  4486. pe2.Enabled = true
  4487. local coru=coroutine.wrap(function()
  4488. wait(0.2)
  4489. pe2.Enabled = false
  4490. game:GetService('Debris'):AddItem(part,0.5)
  4491. end)
  4492. coru()
  4493. else
  4494. ree:Remove()
  4495. end
  4496. end
  4497. end
  4498.  
  4499. function equip()
  4500. equipped = true
  4501. working = true
  4502. if char.Torso:FindFirstChild("Right Shoulder") then
  4503. char.Torso:FindFirstChild("Right Shoulder"):Destroy()
  4504. end
  4505. local weld = Instance.new('Weld', char.Torso)
  4506. weld.Name = "Lerping"
  4507. weld.Part0 = char["Right Arm"]
  4508. weld.Part1 = char.Torso
  4509. weld.C0 = CFrame.new(-1.5, 0, 0) * CFrame.Angles(0, 0, 0)
  4510.  
  4511. lerp(weld,weld.C0,CFrame.new(-1.3, -0.5, 0) * CFrame.Angles(0, 0, math.rad(15)),0.12,true)
  4512.  
  4513. wait(0.1)
  4514.  
  4515. hweld.Part0 = char["Right Arm"]
  4516. hweld.C0 = CFrame.new(0, -1, 0) * CFrame.Angles(math.rad(-180),math.rad(-90), 0)
  4517.  
  4518. lerp(weld,weld.C0,CFrame.new(-1.5, 0, 0) * CFrame.Angles(0, 0, 0),0.08)
  4519.  
  4520. weld:Destroy()
  4521. if rightclone and char:FindFirstChild('Right Arm') and char:FindFirstChild('Torso') then
  4522. local clone = rightclone:Clone()
  4523. clone.Part0 = char.Torso
  4524. clone.Part1 = char["Right Arm"]
  4525. clone.Parent = char.Torso
  4526. end
  4527. working = false
  4528. end
  4529.  
  4530. function unequip()
  4531. getrid(handle)
  4532. equipped = false
  4533. working = true
  4534.  
  4535. if char.Torso:FindFirstChild("Right Shoulder") then
  4536. char.Torso:FindFirstChild("Right Shoulder"):Destroy()
  4537. end
  4538.  
  4539. local weld = Instance.new('Weld', char.Torso)
  4540. weld.Name = "Lerping"
  4541. weld.Part0 = char["Right Arm"]
  4542. weld.Part1 = char.Torso
  4543. weld.C0 = CFrame.new(-1.5, 0, 0) * CFrame.Angles(0, 0, 0)
  4544.  
  4545.  
  4546. lerp(weld,weld.C0,CFrame.new(-1.3, -0.5, 0) * CFrame.Angles(0, 0, math.rad(15)),0.12,true)
  4547.  
  4548. hweld.Part0 = char["Torso"]
  4549. hweld.C0 = CFrame.new(1, -0.8, 0) * CFrame.Angles(0, math.rad(90), 0)
  4550. lerp(weld,weld.C0,CFrame.new(-1.5, 0, 0) * CFrame.Angles(0, 0, 0),0.08,true)
  4551. weld:Destroy()
  4552. if rightclone and char:FindFirstChild('Right Arm') and char:FindFirstChild('Torso') then
  4553. local clone = rightclone:Clone()
  4554. clone.Part0 = char.Torso
  4555. clone.Part1 = char["Right Arm"]
  4556. clone.Parent = char.Torso
  4557. end
  4558. working = false
  4559. end
  4560.  
  4561. function dildo()
  4562. blademode = "dildo"
  4563. working = true
  4564. -- 1 - pink toy
  4565. local obj1 = Instance.new("Model")
  4566. obj1.Name = "pink toy"
  4567. obj1.Parent = handle
  4568.  
  4569. -- 2 - Model
  4570. local obj2 = Instance.new("Model")
  4571. obj2.Parent = obj1
  4572.  
  4573. -- 3 - Part
  4574. local obj3 = Instance.new("Part")
  4575. obj3.CFrame = CFrame.new(Vector3.new(66.8643951, 3.86435986, 7.14990711)) * CFrame.Angles(-3.1415927410126, 0.34906616806984, 2.6179955005646)
  4576. obj3.CanCollide = false
  4577. obj3.TopSurface = Enum.SurfaceType.Smooth
  4578. obj3.BottomSurface = Enum.SurfaceType.Smooth
  4579. obj3.Material = Enum.Material.SmoothPlastic
  4580. obj3.Size = Vector3.new(1.00000024, 1.00000024, 1.00000024)
  4581. obj3.BrickColor = BrickColor.new("Hot pink")
  4582. obj3.Friction = 0.30000001192093
  4583. obj3.Shape = Enum.PartType.Ball
  4584. obj3.Parent = obj2
  4585. obj3.Name = "tip"
  4586.  
  4587. -- 4 - Part
  4588. local obj4 = Instance.new("Part")
  4589. obj4.CFrame = CFrame.new(Vector3.new(67.8275909, 2.08898449, 7.50048351)) * CFrame.Angles(9.1487750708552e-09, -0.34906616806984, -1.0471986532211)
  4590. obj4.CanCollide = false
  4591. obj4.TopSurface = Enum.SurfaceType.Smooth
  4592. obj4.BottomSurface = Enum.SurfaceType.Smooth
  4593. obj4.Material = Enum.Material.SmoothPlastic
  4594. obj4.Size = Vector3.new(4.09999943, 1, 1)
  4595. obj4.BrickColor = BrickColor.new("Hot pink")
  4596. obj4.Friction = 0.30000001192093
  4597. obj4.Shape = Enum.PartType.Cylinder
  4598. obj4.Parent = obj2
  4599.  
  4600. -- 5 - Part
  4601. local obj5 = Instance.new("Part")
  4602. obj5.CFrame = CFrame.new(Vector3.new(66.7104797, 3.86435843, 7.57276678)) * CFrame.Angles(-3.1415927410126, 0.34906616806984, 2.6179955005646)
  4603. obj5.CanCollide = false
  4604. obj5.TopSurface = Enum.SurfaceType.Smooth
  4605. obj5.BottomSurface = Enum.SurfaceType.Smooth
  4606. obj5.Material = Enum.Material.SmoothPlastic
  4607. obj5.Size = Vector3.new(0.25, 0.25, 0.25)
  4608. obj5.BrickColor = BrickColor.new("Hot pink")
  4609. obj5.Friction = 0.30000001192093
  4610. obj5.Shape = Enum.PartType.Ball
  4611. obj5.Parent = obj2
  4612.  
  4613. -- 6 - Part
  4614. local obj6 = Instance.new("Part")
  4615. obj6.CFrame = CFrame.new(Vector3.new(68.6905365, 0.83212769, 8.29345417)) * CFrame.Angles(-3.1415927410126, 0.34906616806984, 2.7925276756287)
  4616. obj6.CanCollide = false
  4617. obj6.TopSurface = Enum.SurfaceType.Smooth
  4618. obj6.BottomSurface = Enum.SurfaceType.Smooth
  4619. obj6.Material = Enum.Material.SmoothPlastic
  4620. obj6.Size = Vector3.new(0.999999762, 0.999999762, 0.999999762)
  4621. obj6.BrickColor = BrickColor.new("Hot pink")
  4622. obj6.Friction = 0.30000001192093
  4623. obj6.Shape = Enum.PartType.Ball
  4624. obj6.Parent = obj2
  4625.  
  4626. -- 7 - Part
  4627. local obj7 = Instance.new("Part")
  4628. obj7.CFrame = CFrame.new(Vector3.new(67.0182953, 3.86435866, 6.72704411)) * CFrame.Angles(-3.1415927410126, 0.34906616806984, 2.6179955005646)
  4629. obj7.CanCollide = false
  4630. obj7.TopSurface = Enum.SurfaceType.Smooth
  4631. obj7.BottomSurface = Enum.SurfaceType.Smooth
  4632. obj7.Material = Enum.Material.SmoothPlastic
  4633. obj7.Size = Vector3.new(0.25, 0.25, 0.25)
  4634. obj7.BrickColor = BrickColor.new("Hot pink")
  4635. obj7.Friction = 0.30000001192093
  4636. obj7.Shape = Enum.PartType.Ball
  4637. obj7.Parent = obj2
  4638.  
  4639. -- 8 - Part
  4640. local obj8 = Instance.new("Part")
  4641. obj8.CFrame = CFrame.new(Vector3.new(68.9983597, 0.832128167, 7.44772816)) * CFrame.Angles(-3.1415927410126, 0.34906616806984, 2.7925276756287)
  4642. obj8.CanCollide = false
  4643. obj8.TopSurface = Enum.SurfaceType.Smooth
  4644. obj8.BottomSurface = Enum.SurfaceType.Smooth
  4645. obj8.Material = Enum.Material.SmoothPlastic
  4646. obj8.Size = Vector3.new(0.999999762, 0.999999762, 0.999999762)
  4647. obj8.BrickColor = BrickColor.new("Hot pink")
  4648. obj8.Friction = 0.30000001192093
  4649. obj8.Shape = Enum.PartType.Ball
  4650. obj8.Parent = obj2
  4651. local fiREPART = obj8
  4652.  
  4653. -- 9 - Part
  4654. local obj9 = Instance.new("Part")
  4655. obj9.CFrame = CFrame.new(Vector3.new(68.8566208, 0.357954353, 7.87501621)) * CFrame.Angles(9.1487750708552e-09, -0.34906616806984, -1.2217314243317)
  4656. obj9.CanCollide = false
  4657. obj9.TopSurface = Enum.SurfaceType.Smooth
  4658. obj9.BottomSurface = Enum.SurfaceType.Smooth
  4659. obj9.Material = Enum.Material.SmoothPlastic
  4660. obj9.Size = Vector3.new(0.0999999791, 1.50000036, 2)
  4661. obj9.BrickColor = BrickColor.new("Hot pink")
  4662. obj9.Friction = 0.30000001192093
  4663. obj9.Shape = Enum.PartType.Cylinder
  4664. obj9.Parent = obj2
  4665.  
  4666. -- 10 - Part
  4667. local obj10 = Instance.new("Part")
  4668. obj10.CFrame = CFrame.new(Vector3.new(66.8069, 3.58244801, 7.60786104)) * CFrame.Angles(-3.1415927410126, 0.34906616806984, 2.6179955005646)
  4669. obj10.CanCollide = false
  4670. obj10.TopSurface = Enum.SurfaceType.Smooth
  4671. obj10.BottomSurface = Enum.SurfaceType.Smooth
  4672. obj10.Material = Enum.Material.SmoothPlastic
  4673. obj10.Size = Vector3.new(0.25, 0.25, 0.25)
  4674. obj10.BrickColor = BrickColor.new("Hot pink")
  4675. obj10.Friction = 0.30000001192093
  4676. obj10.Shape = Enum.PartType.Ball
  4677. obj10.Parent = obj2
  4678.  
  4679. -- 11 - Part
  4680. local obj11 = Instance.new("Part")
  4681. obj11.CFrame = CFrame.new(Vector3.new(67.196106, 3.632447, 6.79175806)) * CFrame.Angles(-3.1415927410126, 0.34906616806984, 2.6179955005646)
  4682. obj11.CanCollide = false
  4683. obj11.TopSurface = Enum.SurfaceType.Smooth
  4684. obj11.BottomSurface = Enum.SurfaceType.Smooth
  4685. obj11.Material = Enum.Material.SmoothPlastic
  4686. obj11.Size = Vector3.new(0.25, 0.25, 0.25)
  4687. obj11.BrickColor = BrickColor.new("Hot pink")
  4688. obj11.Friction = 0.30000001192093
  4689. obj11.Shape = Enum.PartType.Ball
  4690. obj11.Parent = obj2
  4691.  
  4692. -- 12 - Part
  4693. local obj12 = Instance.new("Part")
  4694. obj12.CFrame = CFrame.new(Vector3.new(67.0756683, 3.77002549, 7.63403416)) * CFrame.Angles(-2.4803557395935, 1.123170375824, 2.1302044391632)
  4695. obj12.CanCollide = false
  4696. obj12.TopSurface = Enum.SurfaceType.Smooth
  4697. obj12.BottomSurface = Enum.SurfaceType.Smooth
  4698. obj12.Material = Enum.Material.SmoothPlastic
  4699. obj12.Size = Vector3.new(0.25, 0.25, 0.25)
  4700. obj12.BrickColor = BrickColor.new("Hot pink")
  4701. obj12.Friction = 0.30000001192093
  4702. obj12.Shape = Enum.PartType.Ball
  4703. obj12.Parent = obj2
  4704.  
  4705. -- 13 - Part
  4706. local obj13 = Instance.new("Part")
  4707. obj13.CFrame = CFrame.new(Vector3.new(67.4108353, 3.27276325, 6.88037825)) * CFrame.Angles(-3.058357000351, 0.5446692109108, 2.5818355083466)
  4708. obj13.CanCollide = false
  4709. obj13.TopSurface = Enum.SurfaceType.Smooth
  4710. obj13.BottomSurface = Enum.SurfaceType.Smooth
  4711. obj13.Material = Enum.Material.SmoothPlastic
  4712. obj13.Size = Vector3.new(0.25, 0.25, 0.25)
  4713. obj13.BrickColor = BrickColor.new("Hot pink")
  4714. obj13.Friction = 0.30000001192093
  4715. obj13.Shape = Enum.PartType.Ball
  4716. obj13.Parent = obj2
  4717.  
  4718. -- 14 - Part
  4719. local obj14 = Instance.new("Part")
  4720. obj14.CFrame = CFrame.new(Vector3.new(66.868927, 3.43238807, 6.82578087)) * CFrame.Angles(-2.4803557395935, 1.123170375824, 2.1302044391632)
  4721. obj14.CanCollide = false
  4722. obj14.TopSurface = Enum.SurfaceType.Smooth
  4723. obj14.BottomSurface = Enum.SurfaceType.Smooth
  4724. obj14.Material = Enum.Material.SmoothPlastic
  4725. obj14.Size = Vector3.new(0.25, 0.25, 0.25)
  4726. obj14.BrickColor = BrickColor.new("Hot pink")
  4727. obj14.Friction = 0.30000001192093
  4728. obj14.Shape = Enum.PartType.Ball
  4729. obj14.Parent = obj2
  4730.  
  4731. -- 15 - Part
  4732. local obj15 = Instance.new("Part")
  4733. obj15.CFrame = CFrame.new(Vector3.new(67.1951675, 3.383008, 7.69050598)) * CFrame.Angles(-2.0021269321442, 1.2287007570267, 1.6869416236877)
  4734. obj15.CanCollide = false
  4735. obj15.TopSurface = Enum.SurfaceType.Smooth
  4736. obj15.BottomSurface = Enum.SurfaceType.Smooth
  4737. obj15.Material = Enum.Material.SmoothPlastic
  4738. obj15.Size = Vector3.new(0.25, 0.25, 0.25)
  4739. obj15.BrickColor = BrickColor.new("Hot pink")
  4740. obj15.Friction = 0.30000001192093
  4741. obj15.Shape = Enum.PartType.Ball
  4742. obj15.Parent = obj2
  4743.  
  4744. -- 16 - Part
  4745. local obj16 = Instance.new("Part")
  4746. obj16.CFrame = CFrame.new(Vector3.new(67.50383, 3.46245813, 7.48069429)) * CFrame.Angles(-3.058357000351, 0.5446692109108, 2.5818355083466)
  4747. obj16.CanCollide = false
  4748. obj16.TopSurface = Enum.SurfaceType.Smooth
  4749. obj16.BottomSurface = Enum.SurfaceType.Smooth
  4750. obj16.Material = Enum.Material.SmoothPlastic
  4751. obj16.Size = Vector3.new(0.25, 0.25, 0.25)
  4752. obj16.BrickColor = BrickColor.new("Hot pink")
  4753. obj16.Friction = 0.30000001192093
  4754. obj16.Shape = Enum.PartType.Ball
  4755. obj16.Parent = obj2
  4756.  
  4757. -- 17 - Part
  4758. local obj17 = Instance.new("Part")
  4759. obj17.CFrame = CFrame.new(Vector3.new(66.5551376, 3.4628334, 7.33871651)) * CFrame.Angles(-2.4803557395935, 1.123170375824, 2.1302044391632)
  4760. obj17.CanCollide = false
  4761. obj17.TopSurface = Enum.SurfaceType.Smooth
  4762. obj17.BottomSurface = Enum.SurfaceType.Smooth
  4763. obj17.Material = Enum.Material.SmoothPlastic
  4764. obj17.Size = Vector3.new(0.25, 0.25, 0.25)
  4765. obj17.BrickColor = BrickColor.new("Hot pink")
  4766. obj17.Friction = 0.30000001192093
  4767. obj17.Shape = Enum.PartType.Ball
  4768. obj17.Parent = obj2
  4769.  
  4770. -- 18 - Part
  4771. local obj18 = Instance.new("Part")
  4772. obj18.CFrame = CFrame.new(Vector3.new(67.3677139, 3.83245182, 7.3331027)) * CFrame.Angles(-3.1415927410126, 0.34906616806984, 2.6179955005646)
  4773. obj18.CanCollide = false
  4774. obj18.TopSurface = Enum.SurfaceType.Smooth
  4775. obj18.BottomSurface = Enum.SurfaceType.Smooth
  4776. obj18.Material = Enum.Material.SmoothPlastic
  4777. obj18.Size = Vector3.new(0.25, 0.25, 0.25)
  4778. obj18.BrickColor = BrickColor.new("Hot pink")
  4779. obj18.Friction = 0.30000001192093
  4780. obj18.Shape = Enum.PartType.Ball
  4781. obj18.Parent = obj2
  4782.  
  4783. -- 19 - Part
  4784. local obj19 = Instance.new("Part")
  4785. obj19.CFrame = CFrame.new(Vector3.new(67.4115601, 3.71535063, 7.01420689)) * CFrame.Angles(-2.4803557395935, 1.123170375824, 2.1302044391632)
  4786. obj19.CanCollide = false
  4787. obj19.TopSurface = Enum.SurfaceType.Smooth
  4788. obj19.BottomSurface = Enum.SurfaceType.Smooth
  4789. obj19.Material = Enum.Material.SmoothPlastic
  4790. obj19.Size = Vector3.new(0.25, 0.25, 0.25)
  4791. obj19.BrickColor = BrickColor.new("Hot pink")
  4792. obj19.Friction = 0.30000001192093
  4793. obj19.Shape = Enum.PartType.Ball
  4794. obj19.Parent = obj2
  4795.  
  4796. -- 20 - Part
  4797. local obj20 = Instance.new("Part")
  4798. obj20.CFrame = CFrame.new(Vector3.new(67.6487045, 3.39313889, 7.19381428)) * CFrame.Angles(-2.0021269321442, 1.2287007570267, 1.6869416236877)
  4799. obj20.CanCollide = false
  4800. obj20.TopSurface = Enum.SurfaceType.Smooth
  4801. obj20.BottomSurface = Enum.SurfaceType.Smooth
  4802. obj20.Material = Enum.Material.SmoothPlastic
  4803. obj20.Size = Vector3.new(0.25, 0.25, 0.25)
  4804. obj20.BrickColor = BrickColor.new("Hot pink")
  4805. obj20.Friction = 0.30000001192093
  4806. obj20.Shape = Enum.PartType.Ball
  4807. obj20.Parent = obj2
  4808.  
  4809. -- 21 - Part
  4810. local obj21 = Instance.new("Part")
  4811. obj21.CFrame = CFrame.new(Vector3.new(66.8260422, 4.12417316, 6.81669378)) * CFrame.Angles(-3.1415927410126, 0.34906616806984, 2.6179955005646)
  4812. obj21.CanCollide = false
  4813. obj21.TopSurface = Enum.SurfaceType.Smooth
  4814. obj21.BottomSurface = Enum.SurfaceType.Smooth
  4815. obj21.Material = Enum.Material.SmoothPlastic
  4816. obj21.Size = Vector3.new(0.25, 0.25, 0.25)
  4817. obj21.BrickColor = BrickColor.new("Hot pink")
  4818. obj21.Friction = 0.30000001192093
  4819. obj21.Shape = Enum.PartType.Ball
  4820. obj21.Parent = obj2
  4821.  
  4822. -- 22 - Part
  4823. local obj22 = Instance.new("Part")
  4824. obj22.CFrame = CFrame.new(Vector3.new(67.162117, 3.11433029, 6.8847661)) * CFrame.Angles(-2.0021269321442, 1.2287007570267, 1.6869416236877)
  4825. obj22.CanCollide = false
  4826. obj22.TopSurface = Enum.SurfaceType.Smooth
  4827. obj22.BottomSurface = Enum.SurfaceType.Smooth
  4828. obj22.Material = Enum.Material.SmoothPlastic
  4829. obj22.Size = Vector3.new(0.25, 0.25, 0.25)
  4830. obj22.BrickColor = BrickColor.new("Hot pink")
  4831. obj22.Friction = 0.30000001192093
  4832. obj22.Shape = Enum.PartType.Ball
  4833. obj22.Parent = obj2
  4834.  
  4835. -- 23 - Part
  4836. local obj23 = Instance.new("Part")
  4837. obj23.CFrame = CFrame.new(Vector3.new(66.4981842, 3.63936186, 7.01661682)) * CFrame.Angles(-3.1415927410126, 0.34906616806984, 2.6179955005646)
  4838. obj23.CanCollide = false
  4839. obj23.TopSurface = Enum.SurfaceType.Smooth
  4840. obj23.BottomSurface = Enum.SurfaceType.Smooth
  4841. obj23.Material = Enum.Material.SmoothPlastic
  4842. obj23.Size = Vector3.new(0.25, 0.25, 0.25)
  4843. obj23.BrickColor = BrickColor.new("Hot pink")
  4844. obj23.Friction = 0.30000001192093
  4845. obj23.Shape = Enum.PartType.Ball
  4846. obj23.Parent = obj2
  4847.  
  4848. -- 24 - Part
  4849. local obj24 = Instance.new("Part")
  4850. obj24.CFrame = CFrame.new(Vector3.new(66.6352844, 3.38244724, 7.06651926)) * CFrame.Angles(-3.1415927410126, 0.34906616806984, 2.6179955005646)
  4851. obj24.CanCollide = false
  4852. obj24.TopSurface = Enum.SurfaceType.Smooth
  4853. obj24.BottomSurface = Enum.SurfaceType.Smooth
  4854. obj24.Material = Enum.Material.SmoothPlastic
  4855. obj24.Size = Vector3.new(0.25, 0.25, 0.25)
  4856. obj24.BrickColor = BrickColor.new("Hot pink")
  4857. obj24.Friction = 0.30000001192093
  4858. obj24.Shape = Enum.PartType.Ball
  4859. obj24.Parent = obj2
  4860.  
  4861. -- 25 - Part
  4862. local obj25 = Instance.new("Part")
  4863. obj25.CFrame = CFrame.new(Vector3.new(66.753746, 3.10362744, 7.32704163)) * CFrame.Angles(-2.0021269321442, 1.2287007570267, 1.6869416236877)
  4864. obj25.CanCollide = false
  4865. obj25.TopSurface = Enum.SurfaceType.Smooth
  4866. obj25.BottomSurface = Enum.SurfaceType.Smooth
  4867. obj25.Material = Enum.Material.SmoothPlastic
  4868. obj25.Size = Vector3.new(0.25, 0.25, 0.25)
  4869. obj25.BrickColor = BrickColor.new("Hot pink")
  4870. obj25.Friction = 0.30000001192093
  4871. obj25.Shape = Enum.PartType.Ball
  4872. obj25.Parent = obj2
  4873.  
  4874. -- 26 - Part
  4875. local obj26 = Instance.new("Part")
  4876. obj26.CFrame = CFrame.new(Vector3.new(66.851532, 3.01907969, 7.04717398)) * CFrame.Angles(-3.058357000351, 0.5446692109108, 2.5818355083466)
  4877. obj26.CanCollide = false
  4878. obj26.TopSurface = Enum.SurfaceType.Smooth
  4879. obj26.BottomSurface = Enum.SurfaceType.Smooth
  4880. obj26.Material = Enum.Material.SmoothPlastic
  4881. obj26.Size = Vector3.new(0.25, 0.25, 0.25)
  4882. obj26.BrickColor = BrickColor.new("Hot pink")
  4883. obj26.Friction = 0.30000001192093
  4884. obj26.Shape = Enum.PartType.Ball
  4885. obj26.Parent = obj2
  4886.  
  4887. -- 27 - Part
  4888. local obj27 = Instance.new("Part")
  4889. obj27.CFrame = CFrame.new(Vector3.new(66.944519, 3.20876789, 7.64748764)) * CFrame.Angles(-3.058357000351, 0.5446692109108, 2.5818355083466)
  4890. obj27.CanCollide = false
  4891. obj27.TopSurface = Enum.SurfaceType.Smooth
  4892. obj27.BottomSurface = Enum.SurfaceType.Smooth
  4893. obj27.Material = Enum.Material.SmoothPlastic
  4894. obj27.Size = Vector3.new(0.25, 0.25, 0.25)
  4895. obj27.BrickColor = BrickColor.new("Hot pink")
  4896. obj27.Friction = 0.30000001192093
  4897. obj27.Shape = Enum.PartType.Ball
  4898. obj27.Parent = obj2
  4899.  
  4900. -- 28 - Part
  4901. local obj28 = Instance.new("Part")
  4902. obj28.CFrame = CFrame.new(Vector3.new(67.2306061, 4.08936405, 7.28319883)) * CFrame.Angles(-3.1415927410126, 0.34906616806984, 2.6179955005646)
  4903. obj28.CanCollide = false
  4904. obj28.TopSurface = Enum.SurfaceType.Smooth
  4905. obj28.BottomSurface = Enum.SurfaceType.Smooth
  4906. obj28.Material = Enum.Material.SmoothPlastic
  4907. obj28.Size = Vector3.new(0.25, 0.25, 0.25)
  4908. obj28.BrickColor = BrickColor.new("Hot pink")
  4909. obj28.Friction = 0.30000001192093
  4910. obj28.Shape = Enum.PartType.Ball
  4911. obj28.Parent = obj2
  4912.  
  4913. -- 29 - Part
  4914. local obj29 = Instance.new("Part")
  4915. obj29.CFrame = CFrame.new(Vector3.new(66.5712891, 3.99917173, 6.8835969)) * CFrame.Angles(-3.1415927410126, 0.34906616806984, 2.6179955005646)
  4916. obj29.CanCollide = false
  4917. obj29.TopSurface = Enum.SurfaceType.Smooth
  4918. obj29.BottomSurface = Enum.SurfaceType.Smooth
  4919. obj29.Material = Enum.Material.SmoothPlastic
  4920. obj29.Size = Vector3.new(0.25, 0.25, 0.25)
  4921. obj29.BrickColor = BrickColor.new("Hot pink")
  4922. obj29.Friction = 0.30000001192093
  4923. obj29.Shape = Enum.PartType.Ball
  4924. obj29.Parent = obj2
  4925.  
  4926. -- 30 - Part
  4927. local obj30 = Instance.new("Part")
  4928. obj30.CFrame = CFrame.new(Vector3.new(66.7236328, 4.26077843, 7.20509243)) * CFrame.Angles(-3.1415927410126, 0.34906616806984, 2.6179955005646)
  4929. obj30.CanCollide = false
  4930. obj30.TopSurface = Enum.SurfaceType.Smooth
  4931. obj30.BottomSurface = Enum.SurfaceType.Smooth
  4932. obj30.Material = Enum.Material.SmoothPlastic
  4933. obj30.Size = Vector3.new(0.25, 0.25, 0.25)
  4934. obj30.BrickColor = BrickColor.new("Hot pink")
  4935. obj30.Friction = 0.30000001192093
  4936. obj30.Shape = Enum.PartType.Ball
  4937. obj30.Parent = obj2
  4938.  
  4939. -- 31 - Part
  4940. local obj31 = Instance.new("Part")
  4941. obj31.CFrame = CFrame.new(Vector3.new(66.5950623, 4.16077423, 7.05188084)) * CFrame.Angles(-3.1415927410126, 0.34906616806984, 2.6179955005646)
  4942. obj31.CanCollide = false
  4943. obj31.TopSurface = Enum.SurfaceType.Smooth
  4944. obj31.BottomSurface = Enum.SurfaceType.Smooth
  4945. obj31.Material = Enum.Material.SmoothPlastic
  4946. obj31.Size = Vector3.new(0.25, 0.25, 0.25)
  4947. obj31.BrickColor = BrickColor.new("Hot pink")
  4948. obj31.Friction = 0.30000001192093
  4949. obj31.Shape = Enum.PartType.Ball
  4950. obj31.Parent = obj2
  4951.  
  4952. -- 32 - Part
  4953. local obj32 = Instance.new("Part")
  4954. obj32.CFrame = CFrame.new(Vector3.new(67.0637207, 4.03936481, 7.48850012)) * CFrame.Angles(-3.1415927410126, 0.34906616806984, 2.6179955005646)
  4955. obj32.CanCollide = false
  4956. obj32.TopSurface = Enum.SurfaceType.Smooth
  4957. obj32.BottomSurface = Enum.SurfaceType.Smooth
  4958. obj32.Material = Enum.Material.SmoothPlastic
  4959. obj32.Size = Vector3.new(0.25, 0.25, 0.25)
  4960. obj32.BrickColor = BrickColor.new("Hot pink")
  4961. obj32.Friction = 0.30000001192093
  4962. obj32.Shape = Enum.PartType.Ball
  4963. obj32.Parent = obj2
  4964.  
  4965. -- 33 - Part
  4966. local obj33 = Instance.new("Part")
  4967. obj33.CFrame = CFrame.new(Vector3.new(66.4686813, 3.99917364, 7.16550922)) * CFrame.Angles(-3.1415927410126, 0.34906616806984, 2.6179955005646)
  4968. obj33.CanCollide = false
  4969. obj33.TopSurface = Enum.SurfaceType.Smooth
  4970. obj33.BottomSurface = Enum.SurfaceType.Smooth
  4971. obj33.Material = Enum.Material.SmoothPlastic
  4972. obj33.Size = Vector3.new(0.25, 0.25, 0.25)
  4973. obj33.BrickColor = BrickColor.new("Hot pink")
  4974. obj33.Friction = 0.30000001192093
  4975. obj33.Shape = Enum.PartType.Ball
  4976. obj33.Parent = obj2
  4977.  
  4978. -- 34 - Part
  4979. local obj34 = Instance.new("Part")
  4980. obj34.CFrame = CFrame.new(Vector3.new(66.6615219, 4.14917231, 7.3953228)) * CFrame.Angles(-3.1415927410126, 0.34906616806984, 2.6179955005646)
  4981. obj34.CanCollide = false
  4982. obj34.TopSurface = Enum.SurfaceType.Smooth
  4983. obj34.BottomSurface = Enum.SurfaceType.Smooth
  4984. obj34.Material = Enum.Material.SmoothPlastic
  4985. obj34.Size = Vector3.new(0.25, 0.25, 0.25)
  4986. obj34.BrickColor = BrickColor.new("Hot pink")
  4987. obj34.Friction = 0.30000001192093
  4988. obj34.Shape = Enum.PartType.Ball
  4989. obj34.Parent = obj2
  4990.  
  4991. -- 35 - Part
  4992. local obj35 = Instance.new("Part")
  4993. obj35.CFrame = CFrame.new(Vector3.new(66.8712616, 4.16257238, 7.47166586)) * CFrame.Angles(-3.1415927410126, 0.34906616806984, 2.6179955005646)
  4994. obj35.CanCollide = false
  4995. obj35.TopSurface = Enum.SurfaceType.Smooth
  4996. obj35.BottomSurface = Enum.SurfaceType.Smooth
  4997. obj35.Material = Enum.Material.SmoothPlastic
  4998. obj35.Size = Vector3.new(0.25, 0.25, 0.25)
  4999. obj35.BrickColor = BrickColor.new("Hot pink")
  5000. obj35.Friction = 0.30000001192093
  5001. obj35.Shape = Enum.PartType.Ball
  5002. obj35.Parent = obj2
  5003.  
  5004. -- 36 - Part
  5005. local obj36 = Instance.new("Part")
  5006. obj36.CFrame = CFrame.new(Vector3.new(66.7165604, 3.82596827, 6.77684546)) * CFrame.Angles(-3.1415927410126, 0.34906616806984, 2.6179955005646)
  5007. obj36.CanCollide = false
  5008. obj36.TopSurface = Enum.SurfaceType.Smooth
  5009. obj36.BottomSurface = Enum.SurfaceType.Smooth
  5010. obj36.Material = Enum.Material.SmoothPlastic
  5011. obj36.Size = Vector3.new(0.25, 0.25, 0.25)
  5012. obj36.BrickColor = BrickColor.new("Hot pink")
  5013. obj36.Friction = 0.30000001192093
  5014. obj36.Shape = Enum.PartType.Ball
  5015. obj36.Parent = obj2
  5016.  
  5017. -- 37 - Part
  5018. local obj37 = Instance.new("Part")
  5019. obj37.CFrame = CFrame.new(Vector3.new(66.9846878, 4.27417517, 7.14047909)) * CFrame.Angles(-3.1415927410126, 0.34906616806984, 2.6179955005646)
  5020. obj37.CanCollide = false
  5021. obj37.TopSurface = Enum.SurfaceType.Smooth
  5022. obj37.BottomSurface = Enum.SurfaceType.Smooth
  5023. obj37.Material = Enum.Material.SmoothPlastic
  5024. obj37.Size = Vector3.new(0.25, 0.25, 0.25)
  5025. obj37.BrickColor = BrickColor.new("Hot pink")
  5026. obj37.Friction = 0.30000001192093
  5027. obj37.Shape = Enum.PartType.Ball
  5028. obj37.Parent = obj2
  5029.  
  5030. -- 38 - Part
  5031. local obj38 = Instance.new("Part")
  5032. obj38.CFrame = CFrame.new(Vector3.new(67.1641541, 4.10096312, 6.93975735)) * CFrame.Angles(-3.1415927410126, 0.34906616806984, 2.6179955005646)
  5033. obj38.CanCollide = false
  5034. obj38.TopSurface = Enum.SurfaceType.Smooth
  5035. obj38.BottomSurface = Enum.SurfaceType.Smooth
  5036. obj38.Material = Enum.Material.SmoothPlastic
  5037. obj38.Size = Vector3.new(0.25, 0.25, 0.25)
  5038. obj38.BrickColor = BrickColor.new("Hot pink")
  5039. obj38.Friction = 0.30000001192093
  5040. obj38.Shape = Enum.PartType.Ball
  5041. obj38.Parent = obj2
  5042.  
  5043. -- 39 - Part
  5044. local obj39 = Instance.new("Part")
  5045. obj39.CFrame = CFrame.new(Vector3.new(66.792038, 4.26077843, 7.01715183)) * CFrame.Angles(-3.1415927410126, 0.34906616806984, 2.6179955005646)
  5046. obj39.CanCollide = false
  5047. obj39.TopSurface = Enum.SurfaceType.Smooth
  5048. obj39.BottomSurface = Enum.SurfaceType.Smooth
  5049. obj39.Material = Enum.Material.SmoothPlastic
  5050. obj39.Size = Vector3.new(0.25, 0.25, 0.25)
  5051. obj39.BrickColor = BrickColor.new("Hot pink")
  5052. obj39.Friction = 0.30000001192093
  5053. obj39.Shape = Enum.PartType.Ball
  5054. obj39.Parent = obj2
  5055.  
  5056. -- 40 - Part
  5057. local obj40 = Instance.new("Part")
  5058. obj40.CFrame = CFrame.new(Vector3.new(66.5005493, 3.71436262, 7.38994217)) * CFrame.Angles(-3.1415927410126, 0.34906616806984, 2.6179955005646)
  5059. obj40.CanCollide = false
  5060. obj40.TopSurface = Enum.SurfaceType.Smooth
  5061. obj40.BottomSurface = Enum.SurfaceType.Smooth
  5062. obj40.Material = Enum.Material.SmoothPlastic
  5063. obj40.Size = Vector3.new(0.25, 0.25, 0.25)
  5064. obj40.BrickColor = BrickColor.new("Hot pink")
  5065. obj40.Friction = 0.30000001192093
  5066. obj40.Shape = Enum.PartType.Ball
  5067. obj40.Parent = obj2
  5068.  
  5069. -- 41 - stretches
  5070. local obj41 = Instance.new("Model")
  5071. obj41.Name = "stretches"
  5072. obj41.Parent = obj1
  5073.  
  5074. -- 42 - stretchlol
  5075. local obj42 = Instance.new("Part")
  5076. obj42.CFrame = CFrame.new(Vector3.new(67.162117, 3.13544774, 6.8847661)) * CFrame.Angles(-2.0021269321442, 1.2287007570267, 1.6869416236877)
  5077. obj42.CanCollide = false
  5078. obj42.Transparency = 1
  5079. obj42.TopSurface = Enum.SurfaceType.Smooth
  5080. obj42.BottomSurface = Enum.SurfaceType.Smooth
  5081. obj42.Material = Enum.Material.SmoothPlastic
  5082. obj42.Size = Vector3.new(0.300000012, 0.300000012, 0.300000012)
  5083. obj42.BrickColor = BrickColor.new("Pastel brown")
  5084. obj42.Friction = 0.30000001192093
  5085. obj42.Shape = Enum.PartType.Ball
  5086. obj42.Name = "stretchlol"
  5087. obj42.Parent = obj41
  5088.  
  5089. -- 43 - stretchlol
  5090. local obj43 = Instance.new("Part")
  5091. obj43.CFrame = CFrame.new(Vector3.new(67.1951675, 3.40412855, 7.69050598)) * CFrame.Angles(-2.0021269321442, 1.2287007570267, 1.6869416236877)
  5092. obj43.CanCollide = false
  5093. obj43.Transparency = 1
  5094. obj43.TopSurface = Enum.SurfaceType.Smooth
  5095. obj43.BottomSurface = Enum.SurfaceType.Smooth
  5096. obj43.Material = Enum.Material.SmoothPlastic
  5097. obj43.Size = Vector3.new(0.300000012, 0.300000012, 0.300000012)
  5098. obj43.BrickColor = BrickColor.new("Pastel brown")
  5099. obj43.Friction = 0.30000001192093
  5100. obj43.Shape = Enum.PartType.Ball
  5101. obj43.Name = "stretchlol"
  5102. obj43.Parent = obj41
  5103.  
  5104. -- 44 - stretchlol
  5105. local obj44 = Instance.new("Part")
  5106. obj44.CFrame = CFrame.new(Vector3.new(67.5038223, 3.48357916, 7.48069382)) * CFrame.Angles(-3.058357000351, 0.5446692109108, 2.5818355083466)
  5107. obj44.CanCollide = false
  5108. obj44.Transparency = 1
  5109. obj44.TopSurface = Enum.SurfaceType.Smooth
  5110. obj44.BottomSurface = Enum.SurfaceType.Smooth
  5111. obj44.Material = Enum.Material.SmoothPlastic
  5112. obj44.Size = Vector3.new(0.300000012, 0.300000012, 0.300000012)
  5113. obj44.BrickColor = BrickColor.new("Pastel brown")
  5114. obj44.Friction = 0.30000001192093
  5115. obj44.Shape = Enum.PartType.Ball
  5116. obj44.Name = "stretchlol"
  5117. obj44.Parent = obj41
  5118.  
  5119. -- 45 - stretchlol
  5120. local obj45 = Instance.new("Part")
  5121. obj45.CFrame = CFrame.new(Vector3.new(67.1641541, 4.12207699, 6.93975687)) * CFrame.Angles(-3.1415927410126, 0.34906616806984, 2.6179955005646)
  5122. obj45.CanCollide = false
  5123. obj45.Transparency = 1
  5124. obj45.TopSurface = Enum.SurfaceType.Smooth
  5125. obj45.BottomSurface = Enum.SurfaceType.Smooth
  5126. obj45.Material = Enum.Material.SmoothPlastic
  5127. obj45.Size = Vector3.new(0.300000012, 0.300000012, 0.300000012)
  5128. obj45.BrickColor = BrickColor.new("Pastel brown")
  5129. obj45.Friction = 0.30000001192093
  5130. obj45.Shape = Enum.PartType.Ball
  5131. obj45.Name = "stretchlol"
  5132. obj45.Parent = obj41
  5133.  
  5134. -- 46 - stretchlol
  5135. local obj46 = Instance.new("Part")
  5136. obj46.CFrame = CFrame.new(Vector3.new(66.8712616, 4.18368626, 7.47166586)) * CFrame.Angles(-3.1415927410126, 0.34906616806984, 2.6179955005646)
  5137. obj46.CanCollide = false
  5138. obj46.Transparency = 1
  5139. obj46.TopSurface = Enum.SurfaceType.Smooth
  5140. obj46.BottomSurface = Enum.SurfaceType.Smooth
  5141. obj46.Material = Enum.Material.SmoothPlastic
  5142. obj46.Size = Vector3.new(0.300000012, 0.300000012, 0.300000012)
  5143. obj46.BrickColor = BrickColor.new("Pastel brown")
  5144. obj46.Friction = 0.30000001192093
  5145. obj46.Shape = Enum.PartType.Ball
  5146. obj46.Name = "stretchlol"
  5147. obj46.Parent = obj41
  5148.  
  5149. -- 47 - stretchlol
  5150. local obj47 = Instance.new("Part")
  5151. obj47.CFrame = CFrame.new(Vector3.new(66.8260345, 4.14528561, 6.81669378)) * CFrame.Angles(-3.1415927410126, 0.34906616806984, 2.6179955005646)
  5152. obj47.CanCollide = false
  5153. obj47.Transparency = 1
  5154. obj47.TopSurface = Enum.SurfaceType.Smooth
  5155. obj47.BottomSurface = Enum.SurfaceType.Smooth
  5156. obj47.Material = Enum.Material.SmoothPlastic
  5157. obj47.Size = Vector3.new(0.300000012, 0.300000012, 0.300000012)
  5158. obj47.BrickColor = BrickColor.new("Pastel brown")
  5159. obj47.Friction = 0.30000001192093
  5160. obj47.Shape = Enum.PartType.Ball
  5161. obj47.Name = "stretchlol"
  5162. obj47.Parent = obj41
  5163.  
  5164. -- 48 - stretchlol
  5165. local obj48 = Instance.new("Part")
  5166. obj48.CFrame = CFrame.new(Vector3.new(66.7104797, 3.88547921, 7.57276678)) * CFrame.Angles(-3.1415927410126, 0.34906616806984, 2.6179955005646)
  5167. obj48.CanCollide = false
  5168. obj48.Transparency = 1
  5169. obj48.TopSurface = Enum.SurfaceType.Smooth
  5170. obj48.BottomSurface = Enum.SurfaceType.Smooth
  5171. obj48.Material = Enum.Material.SmoothPlastic
  5172. obj48.Size = Vector3.new(0.300000012, 0.300000012, 0.300000012)
  5173. obj48.BrickColor = BrickColor.new("Pastel brown")
  5174. obj48.Friction = 0.30000001192093
  5175. obj48.Shape = Enum.PartType.Ball
  5176. obj48.Name = "stretchlol"
  5177. obj48.Parent = obj41
  5178.  
  5179. -- 49 - stretchlol
  5180. local obj49 = Instance.new("Part")
  5181. obj49.CFrame = CFrame.new(Vector3.new(67.0637207, 4.06047773, 7.48850012)) * CFrame.Angles(-3.1415927410126, 0.34906616806984, 2.6179955005646)
  5182. obj49.CanCollide = false
  5183. obj49.Transparency = 1
  5184. obj49.TopSurface = Enum.SurfaceType.Smooth
  5185. obj49.BottomSurface = Enum.SurfaceType.Smooth
  5186. obj49.Material = Enum.Material.SmoothPlastic
  5187. obj49.Size = Vector3.new(0.300000012, 0.300000012, 0.300000012)
  5188. obj49.BrickColor = BrickColor.new("Pastel brown")
  5189. obj49.Friction = 0.30000001192093
  5190. obj49.Shape = Enum.PartType.Ball
  5191. obj49.Name = "stretchlol"
  5192. obj49.Parent = obj41
  5193.  
  5194. -- 50 - stretchlol
  5195. local obj50 = Instance.new("Part")
  5196. obj50.CFrame = CFrame.new(Vector3.new(66.7165604, 3.84708691, 6.77684498)) * CFrame.Angles(-3.1415927410126, 0.34906616806984, 2.6179955005646)
  5197. obj50.CanCollide = false
  5198. obj50.Transparency = 1
  5199. obj50.TopSurface = Enum.SurfaceType.Smooth
  5200. obj50.BottomSurface = Enum.SurfaceType.Smooth
  5201. obj50.Material = Enum.Material.SmoothPlastic
  5202. obj50.Size = Vector3.new(0.300000012, 0.300000012, 0.300000012)
  5203. obj50.BrickColor = BrickColor.new("Pastel brown")
  5204. obj50.Friction = 0.30000001192093
  5205. obj50.Shape = Enum.PartType.Ball
  5206. obj50.Name = "stretchlol"
  5207. obj50.Parent = obj41
  5208.  
  5209. -- 51 - stretchlol
  5210. local obj51 = Instance.new("Part")
  5211. obj51.CFrame = CFrame.new(Vector3.new(66.9846878, 4.29528904, 7.14047909)) * CFrame.Angles(-3.1415927410126, 0.34906616806984, 2.6179955005646)
  5212. obj51.CanCollide = false
  5213. obj51.Transparency = 1
  5214. obj51.TopSurface = Enum.SurfaceType.Smooth
  5215. obj51.BottomSurface = Enum.SurfaceType.Smooth
  5216. obj51.Material = Enum.Material.SmoothPlastic
  5217. obj51.Size = Vector3.new(0.300000012, 0.300000012, 0.300000012)
  5218. obj51.BrickColor = BrickColor.new("Pastel brown")
  5219. obj51.Friction = 0.30000001192093
  5220. obj51.Shape = Enum.PartType.Ball
  5221. obj51.Name = "stretchlol"
  5222. obj51.Parent = obj41
  5223.  
  5224. -- 52 - stretchlol
  5225. local obj52 = Instance.new("Part")
  5226. obj52.CFrame = CFrame.new(Vector3.new(66.868927, 3.45350599, 6.82578087)) * CFrame.Angles(-2.4803557395935, 1.123170375824, 2.1302044391632)
  5227. obj52.CanCollide = false
  5228. obj52.Transparency = 1
  5229. obj52.TopSurface = Enum.SurfaceType.Smooth
  5230. obj52.BottomSurface = Enum.SurfaceType.Smooth
  5231. obj52.Material = Enum.Material.SmoothPlastic
  5232. obj52.Size = Vector3.new(0.300000012, 0.300000012, 0.300000012)
  5233. obj52.BrickColor = BrickColor.new("Pastel brown")
  5234. obj52.Friction = 0.30000001192093
  5235. obj52.Shape = Enum.PartType.Ball
  5236. obj52.Name = "stretchlol"
  5237. obj52.Parent = obj41
  5238.  
  5239. -- 53 - stretchlol
  5240. local obj53 = Instance.new("Part")
  5241. obj53.CFrame = CFrame.new(Vector3.new(67.287262, 3.10603261, 7.30382156)) * CFrame.Angles(9.1487750708552e-09, -0.34906616806984, -1.0471986532211)
  5242. obj53.CanCollide = false
  5243. obj53.Transparency = 1
  5244. obj53.TopSurface = Enum.SurfaceType.Smooth
  5245. obj53.BottomSurface = Enum.SurfaceType.Smooth
  5246. obj53.Material = Enum.Material.SmoothPlastic
  5247. obj53.Size = Vector3.new(1.79999995, 1.04999995, 1.04999995)
  5248. obj53.BrickColor = BrickColor.new("Pastel brown")
  5249. obj53.Friction = 0.30000001192093
  5250. obj53.Shape = Enum.PartType.Cylinder
  5251. obj53.Name = "stretchlol"
  5252. obj53.Parent = obj41
  5253.  
  5254. -- 54 - stretchlol
  5255. local obj54 = Instance.new("Part")
  5256. obj54.CFrame = CFrame.new(Vector3.new(66.4686813, 4.02028799, 7.16550922)) * CFrame.Angles(-3.1415927410126, 0.34906616806984, 2.6179955005646)
  5257. obj54.CanCollide = false
  5258. obj54.Transparency = 1
  5259. obj54.TopSurface = Enum.SurfaceType.Smooth
  5260. obj54.BottomSurface = Enum.SurfaceType.Smooth
  5261. obj54.Material = Enum.Material.SmoothPlastic
  5262. obj54.Size = Vector3.new(0.300000012, 0.300000012, 0.300000012)
  5263. obj54.BrickColor = BrickColor.new("Pastel brown")
  5264. obj54.Friction = 0.30000001192093
  5265. obj54.Shape = Enum.PartType.Ball
  5266. obj54.Name = "stretchlol"
  5267. obj54.Parent = obj41
  5268.  
  5269. -- 55 - stretchlol
  5270. local obj55 = Instance.new("Part")
  5271. obj55.CFrame = CFrame.new(Vector3.new(66.6615219, 4.17028332, 7.3953228)) * CFrame.Angles(-3.1415927410126, 0.34906616806984, 2.6179955005646)
  5272. obj55.CanCollide = false
  5273. obj55.Transparency = 1
  5274. obj55.TopSurface = Enum.SurfaceType.Smooth
  5275. obj55.BottomSurface = Enum.SurfaceType.Smooth
  5276. obj55.Material = Enum.Material.SmoothPlastic
  5277. obj55.Size = Vector3.new(0.300000012, 0.300000012, 0.300000012)
  5278. obj55.BrickColor = BrickColor.new("Pastel brown")
  5279. obj55.Friction = 0.30000001192093
  5280. obj55.Shape = Enum.PartType.Ball
  5281. obj55.Name = "stretchlol"
  5282. obj55.Parent = obj41
  5283.  
  5284. -- 56 - stretchlol
  5285. local obj56 = Instance.new("Part")
  5286. obj56.CFrame = CFrame.new(Vector3.new(66.753746, 3.12474751, 7.32704115)) * CFrame.Angles(-2.0021269321442, 1.2287007570267, 1.6869416236877)
  5287. obj56.CanCollide = false
  5288. obj56.Transparency = 1
  5289. obj56.TopSurface = Enum.SurfaceType.Smooth
  5290. obj56.BottomSurface = Enum.SurfaceType.Smooth
  5291. obj56.Material = Enum.Material.SmoothPlastic
  5292. obj56.Size = Vector3.new(0.300000012, 0.300000012, 0.300000012)
  5293. obj56.BrickColor = BrickColor.new("Pastel brown")
  5294. obj56.Friction = 0.30000001192093
  5295. obj56.Shape = Enum.PartType.Ball
  5296. obj56.Name = "stretchlol"
  5297. obj56.Parent = obj41
  5298.  
  5299. -- 57 - stretchlol
  5300. local obj57 = Instance.new("Part")
  5301. obj57.CFrame = CFrame.new(Vector3.new(67.2306061, 4.11047649, 7.28319883)) * CFrame.Angles(-3.1415927410126, 0.34906616806984, 2.6179955005646)
  5302. obj57.CanCollide = false
  5303. obj57.Transparency = 1
  5304. obj57.TopSurface = Enum.SurfaceType.Smooth
  5305. obj57.BottomSurface = Enum.SurfaceType.Smooth
  5306. obj57.Material = Enum.Material.SmoothPlastic
  5307. obj57.Size = Vector3.new(0.300000012, 0.300000012, 0.300000012)
  5308. obj57.BrickColor = BrickColor.new("Pastel brown")
  5309. obj57.Friction = 0.30000001192093
  5310. obj57.Shape = Enum.PartType.Ball
  5311. obj57.Name = "stretchlol"
  5312. obj57.Parent = obj41
  5313.  
  5314. -- 58 - stretchlol
  5315. local obj58 = Instance.new("Part")
  5316. obj58.CFrame = CFrame.new(Vector3.new(67.0756683, 3.79114079, 7.63403416)) * CFrame.Angles(-2.4803557395935, 1.123170375824, 2.1302044391632)
  5317. obj58.CanCollide = false
  5318. obj58.Transparency = 1
  5319. obj58.TopSurface = Enum.SurfaceType.Smooth
  5320. obj58.BottomSurface = Enum.SurfaceType.Smooth
  5321. obj58.Material = Enum.Material.SmoothPlastic
  5322. obj58.Size = Vector3.new(0.300000012, 0.300000012, 0.300000012)
  5323. obj58.BrickColor = BrickColor.new("Pastel brown")
  5324. obj58.Friction = 0.30000001192093
  5325. obj58.Shape = Enum.PartType.Ball
  5326. obj58.Name = "stretchlol"
  5327. obj58.Parent = obj41
  5328.  
  5329. -- 59 - stretchlol
  5330. local obj59 = Instance.new("Part")
  5331. obj59.CFrame = CFrame.new(Vector3.new(66.5005493, 3.73548079, 7.38994217)) * CFrame.Angles(-3.1415927410126, 0.34906616806984, 2.6179955005646)
  5332. obj59.CanCollide = false
  5333. obj59.Transparency = 1
  5334. obj59.TopSurface = Enum.SurfaceType.Smooth
  5335. obj59.BottomSurface = Enum.SurfaceType.Smooth
  5336. obj59.Material = Enum.Material.SmoothPlastic
  5337. obj59.Size = Vector3.new(0.300000012, 0.300000012, 0.300000012)
  5338. obj59.BrickColor = BrickColor.new("Pastel brown")
  5339. obj59.Friction = 0.30000001192093
  5340. obj59.Shape = Enum.PartType.Ball
  5341. obj59.Name = "stretchlol"
  5342. obj59.Parent = obj41
  5343.  
  5344. -- 60 - stretchlol
  5345. local obj60 = Instance.new("Part")
  5346. obj60.CFrame = CFrame.new(Vector3.new(67.6487045, 3.41425848, 7.1938138)) * CFrame.Angles(-2.0021269321442, 1.2287007570267, 1.6869416236877)
  5347. obj60.CanCollide = false
  5348. obj60.Transparency = 1
  5349. obj60.TopSurface = Enum.SurfaceType.Smooth
  5350. obj60.BottomSurface = Enum.SurfaceType.Smooth
  5351. obj60.Material = Enum.Material.SmoothPlastic
  5352. obj60.Size = Vector3.new(0.300000012, 0.300000012, 0.300000012)
  5353. obj60.BrickColor = BrickColor.new("Pastel brown")
  5354. obj60.Friction = 0.30000001192093
  5355. obj60.Shape = Enum.PartType.Ball
  5356. obj60.Name = "stretchlol"
  5357. obj60.Parent = obj41
  5358.  
  5359. -- 61 - stretchlol
  5360. local obj61 = Instance.new("Part")
  5361. obj61.CFrame = CFrame.new(Vector3.new(67.3677139, 3.85357118, 7.33310223)) * CFrame.Angles(-3.1415927410126, 0.34906616806984, 2.6179955005646)
  5362. obj61.CanCollide = false
  5363. obj61.Transparency = 1
  5364. obj61.TopSurface = Enum.SurfaceType.Smooth
  5365. obj61.BottomSurface = Enum.SurfaceType.Smooth
  5366. obj61.Material = Enum.Material.SmoothPlastic
  5367. obj61.Size = Vector3.new(0.300000012, 0.300000012, 0.300000012)
  5368. obj61.BrickColor = BrickColor.new("Pastel brown")
  5369. obj61.Friction = 0.30000001192093
  5370. obj61.Shape = Enum.PartType.Ball
  5371. obj61.Name = "stretchlol"
  5372. obj61.Parent = obj41
  5373.  
  5374. -- 62 - stretchlol
  5375. local obj62 = Instance.new("Part")
  5376. obj62.CFrame = CFrame.new(Vector3.new(66.6352844, 3.40356588, 7.06651878)) * CFrame.Angles(-3.1415927410126, 0.34906616806984, 2.6179955005646)
  5377. obj62.CanCollide = false
  5378. obj62.Transparency = 1
  5379. obj62.TopSurface = Enum.SurfaceType.Smooth
  5380. obj62.BottomSurface = Enum.SurfaceType.Smooth
  5381. obj62.Material = Enum.Material.SmoothPlastic
  5382. obj62.Size = Vector3.new(0.300000012, 0.300000012, 0.300000012)
  5383. obj62.BrickColor = BrickColor.new("Pastel brown")
  5384. obj62.Friction = 0.30000001192093
  5385. obj62.Shape = Enum.PartType.Ball
  5386. obj62.Name = "stretchlol"
  5387. obj62.Parent = obj41
  5388.  
  5389. -- 63 - stretchlol
  5390. local obj63 = Instance.new("Part")
  5391. obj63.CFrame = CFrame.new(Vector3.new(66.7236328, 4.28189754, 7.20509195)) * CFrame.Angles(-3.1415927410126, 0.34906616806984, 2.6179955005646)
  5392. obj63.CanCollide = false
  5393. obj63.Transparency = 1
  5394. obj63.TopSurface = Enum.SurfaceType.Smooth
  5395. obj63.BottomSurface = Enum.SurfaceType.Smooth
  5396. obj63.Material = Enum.Material.SmoothPlastic
  5397. obj63.Size = Vector3.new(0.300000012, 0.300000012, 0.300000012)
  5398. obj63.BrickColor = BrickColor.new("Pastel brown")
  5399. obj63.Friction = 0.30000001192093
  5400. obj63.Shape = Enum.PartType.Ball
  5401. obj63.Name = "stretchlol"
  5402. obj63.Parent = obj41
  5403.  
  5404. -- 64 - stretchlol
  5405. local obj64 = Instance.new("Part")
  5406. obj64.CFrame = CFrame.new(Vector3.new(66.5712891, 4.02028799, 6.8835969)) * CFrame.Angles(-3.1415927410126, 0.34906616806984, 2.6179955005646)
  5407. obj64.CanCollide = false
  5408. obj64.Transparency = 1
  5409. obj64.TopSurface = Enum.SurfaceType.Smooth
  5410. obj64.BottomSurface = Enum.SurfaceType.Smooth
  5411. obj64.Material = Enum.Material.SmoothPlastic
  5412. obj64.Size = Vector3.new(0.300000012, 0.300000012, 0.300000012)
  5413. obj64.BrickColor = BrickColor.new("Pastel brown")
  5414. obj64.Friction = 0.30000001192093
  5415. obj64.Shape = Enum.PartType.Ball
  5416. obj64.Name = "stretchlol"
  5417. obj64.Parent = obj41
  5418.  
  5419. -- 65 - stretchlol
  5420. local obj65 = Instance.new("Part")
  5421. obj65.CFrame = CFrame.new(Vector3.new(66.4981842, 3.66047978, 7.01661682)) * CFrame.Angles(-3.1415927410126, 0.34906616806984, 2.6179955005646)
  5422. obj65.CanCollide = false
  5423. obj65.Transparency = 1
  5424. obj65.TopSurface = Enum.SurfaceType.Smooth
  5425. obj65.BottomSurface = Enum.SurfaceType.Smooth
  5426. obj65.Material = Enum.Material.SmoothPlastic
  5427. obj65.Size = Vector3.new(0.300000012, 0.300000012, 0.300000012)
  5428. obj65.BrickColor = BrickColor.new("Pastel brown")
  5429. obj65.Friction = 0.30000001192093
  5430. obj65.Shape = Enum.PartType.Ball
  5431. obj65.Name = "stretchlol"
  5432. obj65.Parent = obj41
  5433.  
  5434. -- 66 - stretchlol
  5435. local obj66 = Instance.new("Part")
  5436. obj66.CFrame = CFrame.new(Vector3.new(66.7920303, 4.28189754, 7.01715183)) * CFrame.Angles(-3.1415927410126, 0.34906616806984, 2.6179955005646)
  5437. obj66.CanCollide = false
  5438. obj66.Transparency = 1
  5439. obj66.TopSurface = Enum.SurfaceType.Smooth
  5440. obj66.BottomSurface = Enum.SurfaceType.Smooth
  5441. obj66.Material = Enum.Material.SmoothPlastic
  5442. obj66.Size = Vector3.new(0.300000012, 0.300000012, 0.300000012)
  5443. obj66.BrickColor = BrickColor.new("Pastel brown")
  5444. obj66.Friction = 0.30000001192093
  5445. obj66.Shape = Enum.PartType.Ball
  5446. obj66.Name = "stretchlol"
  5447. obj66.Parent = obj41
  5448.  
  5449. -- 67 - stretchlol
  5450. local obj67 = Instance.new("Part")
  5451. obj67.CFrame = CFrame.new(Vector3.new(66.5950623, 4.18188763, 7.05188084)) * CFrame.Angles(-3.1415927410126, 0.34906616806984, 2.6179955005646)
  5452. obj67.CanCollide = false
  5453. obj67.Transparency = 1
  5454. obj67.TopSurface = Enum.SurfaceType.Smooth
  5455. obj67.BottomSurface = Enum.SurfaceType.Smooth
  5456. obj67.Material = Enum.Material.SmoothPlastic
  5457. obj67.Size = Vector3.new(0.300000012, 0.300000012, 0.300000012)
  5458. obj67.BrickColor = BrickColor.new("Pastel brown")
  5459. obj67.Friction = 0.30000001192093
  5460. obj67.Shape = Enum.PartType.Ball
  5461. obj67.Name = "stretchlol"
  5462. obj67.Parent = obj41
  5463.  
  5464. -- 68 - stretchlol
  5465. local obj68 = Instance.new("Part")
  5466. obj68.CFrame = CFrame.new(Vector3.new(67.4115601, 3.73646879, 7.01420689)) * CFrame.Angles(-2.4803557395935, 1.123170375824, 2.1302044391632)
  5467. obj68.CanCollide = false
  5468. obj68.Transparency = 1
  5469. obj68.TopSurface = Enum.SurfaceType.Smooth
  5470. obj68.BottomSurface = Enum.SurfaceType.Smooth
  5471. obj68.Material = Enum.Material.SmoothPlastic
  5472. obj68.Size = Vector3.new(0.300000012, 0.300000012, 0.300000012)
  5473. obj68.BrickColor = BrickColor.new("Pastel brown")
  5474. obj68.Friction = 0.30000001192093
  5475. obj68.Shape = Enum.PartType.Ball
  5476. obj68.Name = "stretchlol"
  5477. obj68.Parent = obj41
  5478.  
  5479. -- 69 - stretchlol
  5480. local obj69 = Instance.new("Part")
  5481. obj69.CFrame = CFrame.new(Vector3.new(66.8643951, 3.88548112, 7.14990711)) * CFrame.Angles(-3.1415927410126, 0.34906616806984, 2.6179955005646)
  5482. obj69.CanCollide = false
  5483. obj69.Transparency = 1
  5484. obj69.TopSurface = Enum.SurfaceType.Smooth
  5485. obj69.BottomSurface = Enum.SurfaceType.Smooth
  5486. obj69.Material = Enum.Material.SmoothPlastic
  5487. obj69.Size = Vector3.new(1.04999995, 1.04999995, 1.04999995)
  5488. obj69.BrickColor = BrickColor.new("Pastel brown")
  5489. obj69.Friction = 0.30000001192093
  5490. obj69.Shape = Enum.PartType.Ball
  5491. obj69.Name = "stretchlol"
  5492. obj69.Parent = obj41
  5493.  
  5494. -- 70 - stretchlol
  5495. local obj70 = Instance.new("Part")
  5496. obj70.CFrame = CFrame.new(Vector3.new(67.4108353, 3.29388237, 6.88037777)) * CFrame.Angles(-3.058357000351, 0.5446692109108, 2.5818355083466)
  5497. obj70.CanCollide = false
  5498. obj70.Transparency = 1
  5499. obj70.TopSurface = Enum.SurfaceType.Smooth
  5500. obj70.BottomSurface = Enum.SurfaceType.Smooth
  5501. obj70.Material = Enum.Material.SmoothPlastic
  5502. obj70.Size = Vector3.new(0.300000012, 0.300000012, 0.300000012)
  5503. obj70.BrickColor = BrickColor.new("Pastel brown")
  5504. obj70.Friction = 0.30000001192093
  5505. obj70.Shape = Enum.PartType.Ball
  5506. obj70.Name = "stretchlol"
  5507. obj70.Parent = obj41
  5508.  
  5509. -- 71 - stretchlol
  5510. local obj71 = Instance.new("Part")
  5511. obj71.CFrame = CFrame.new(Vector3.new(67.1960983, 3.65356374, 6.79175806)) * CFrame.Angles(-3.1415927410126, 0.34906616806984, 2.6179955005646)
  5512. obj71.CanCollide = false
  5513. obj71.Transparency = 1
  5514. obj71.TopSurface = Enum.SurfaceType.Smooth
  5515. obj71.BottomSurface = Enum.SurfaceType.Smooth
  5516. obj71.Material = Enum.Material.SmoothPlastic
  5517. obj71.Size = Vector3.new(0.300000012, 0.300000012, 0.300000012)
  5518. obj71.BrickColor = BrickColor.new("Pastel brown")
  5519. obj71.Friction = 0.30000001192093
  5520. obj71.Shape = Enum.PartType.Ball
  5521. obj71.Name = "stretchlol"
  5522. obj71.Parent = obj41
  5523.  
  5524. -- 72 - stretchlol
  5525. local obj72 = Instance.new("Part")
  5526. obj72.CFrame = CFrame.new(Vector3.new(66.944519, 3.22988653, 7.64748716)) * CFrame.Angles(-3.058357000351, 0.5446692109108, 2.5818355083466)
  5527. obj72.CanCollide = false
  5528. obj72.Transparency = 1
  5529. obj72.TopSurface = Enum.SurfaceType.Smooth
  5530. obj72.BottomSurface = Enum.SurfaceType.Smooth
  5531. obj72.Material = Enum.Material.SmoothPlastic
  5532. obj72.Size = Vector3.new(0.300000012, 0.300000012, 0.300000012)
  5533. obj72.BrickColor = BrickColor.new("Pastel brown")
  5534. obj72.Friction = 0.30000001192093
  5535. obj72.Shape = Enum.PartType.Ball
  5536. obj72.Name = "stretchlol"
  5537. obj72.Parent = obj41
  5538.  
  5539. -- 73 - stretchlol
  5540. local obj73 = Instance.new("Part")
  5541. obj73.CFrame = CFrame.new(Vector3.new(66.851532, 3.04020095, 7.04717398)) * CFrame.Angles(-3.058357000351, 0.5446692109108, 2.5818355083466)
  5542. obj73.CanCollide = false
  5543. obj73.Transparency = 1
  5544. obj73.TopSurface = Enum.SurfaceType.Smooth
  5545. obj73.BottomSurface = Enum.SurfaceType.Smooth
  5546. obj73.Material = Enum.Material.SmoothPlastic
  5547. obj73.Size = Vector3.new(0.300000012, 0.300000012, 0.300000012)
  5548. obj73.BrickColor = BrickColor.new("Pastel brown")
  5549. obj73.Friction = 0.30000001192093
  5550. obj73.Shape = Enum.PartType.Ball
  5551. obj73.Name = "stretchlol"
  5552. obj73.Parent = obj41
  5553.  
  5554. -- 74 - stretchlol
  5555. local obj74 = Instance.new("Part")
  5556. obj74.CFrame = CFrame.new(Vector3.new(66.5551376, 3.48395109, 7.33871603)) * CFrame.Angles(-2.4803557395935, 1.123170375824, 2.1302044391632)
  5557. obj74.CanCollide = false
  5558. obj74.Transparency = 1
  5559. obj74.TopSurface = Enum.SurfaceType.Smooth
  5560. obj74.BottomSurface = Enum.SurfaceType.Smooth
  5561. obj74.Material = Enum.Material.SmoothPlastic
  5562. obj74.Size = Vector3.new(0.300000012, 0.300000012, 0.300000012)
  5563. obj74.BrickColor = BrickColor.new("Pastel brown")
  5564. obj74.Friction = 0.30000001192093
  5565. obj74.Shape = Enum.PartType.Ball
  5566. obj74.Name = "stretchlol"
  5567. obj74.Parent = obj41
  5568.  
  5569. -- 75 - stretchlol
  5570. local obj75 = Instance.new("Part")
  5571. obj75.CFrame = CFrame.new(Vector3.new(66.8069, 3.60357046, 7.60786104)) * CFrame.Angles(-3.1415927410126, 0.34906616806984, 2.6179955005646)
  5572. obj75.CanCollide = false
  5573. obj75.Transparency = 1
  5574. obj75.TopSurface = Enum.SurfaceType.Smooth
  5575. obj75.BottomSurface = Enum.SurfaceType.Smooth
  5576. obj75.Material = Enum.Material.SmoothPlastic
  5577. obj75.Size = Vector3.new(0.300000012, 0.300000012, 0.300000012)
  5578. obj75.BrickColor = BrickColor.new("Pastel brown")
  5579. obj75.Friction = 0.30000001192093
  5580. obj75.Shape = Enum.PartType.Ball
  5581. obj75.Name = "stretchlol"
  5582. obj75.Parent = obj41
  5583.  
  5584. -- 76 - stretchlol
  5585. local obj76 = Instance.new("Part")
  5586. obj76.CFrame = CFrame.new(Vector3.new(67.0182953, 3.88547921, 6.72704411)) * CFrame.Angles(-3.1415927410126, 0.34906616806984, 2.6179955005646)
  5587. obj76.CanCollide = false
  5588. obj76.Transparency = 1
  5589. obj76.TopSurface = Enum.SurfaceType.Smooth
  5590. obj76.BottomSurface = Enum.SurfaceType.Smooth
  5591. obj76.Material = Enum.Material.SmoothPlastic
  5592. obj76.Size = Vector3.new(0.300000012, 0.300000012, 0.300000012)
  5593. obj76.BrickColor = BrickColor.new("Pastel brown")
  5594. obj76.Friction = 0.30000001192093
  5595. obj76.Shape = Enum.PartType.Ball
  5596. obj76.Name = "stretchlol"
  5597. obj76.Parent = obj41
  5598. obj1.PrimaryPart = obj4
  5599.  
  5600. local stretches = obj41:GetChildren()
  5601. for i,v in pairs(stretches) do
  5602. v.Anchored = true
  5603. v.Parent = obj1
  5604. end
  5605. for i,v in pairs(obj2:GetChildren()) do
  5606. v.Anchored = true
  5607. v.Parent = obj1
  5608. end
  5609. obj2:Destroy()
  5610. obj41:Destroy()
  5611.  
  5612. local previous = nil
  5613. for i,v in pairs(obj1:GetChildren()) do
  5614. if v:IsA('BasePart') then
  5615. if previous then
  5616. local weld = Instance.new('Weld',v)
  5617. weld.Part0 = v
  5618. weld.Part1 = previous
  5619. weld.C0 = v.CFrame:inverse() * previous.CFrame
  5620. previous.Anchored = false
  5621. previous.CanCollide = false
  5622. local vee = v
  5623. weld.AncestryChanged:connect(function(mez,par)
  5624. wait()
  5625. weld.Parent = vee
  5626. end)
  5627. end
  5628. previous = v
  5629. end
  5630. end
  5631. previous.Anchored = false
  5632. previous.CanCollide = false
  5633. obj1:SetPrimaryPartCFrame(handle.CFrame*CFrame.Angles(0,math.rad(180),0)+Vector3.new(0,100,0))
  5634. -- 2 - Part
  5635. local ree = Instance.new("Part")
  5636. ree.CFrame = CFrame.new(Vector3.new(50.5, 141, 5.5))
  5637. ree.Transparency = 0.80000001192093
  5638. ree.Material = Enum.Material.Neon
  5639. ree.CFrame = CFrame.new(obj4.Position)
  5640. ree.Size = Vector3.new(5, math.huge, 5)
  5641. ree.BrickColor = BrickColor.new("New Yeller")
  5642. ree.Friction = 0.30000001192093
  5643. ree.Shape = Enum.PartType.Block
  5644. ree.Parent = handle
  5645.  
  5646. -- 3 - Mesh
  5647. local ree2 = Instance.new("CylinderMesh")
  5648. ree2.Parent = ree
  5649. local thing = Instance.new('BodyPosition',obj9)
  5650. local thing2 = Instance.new('BodyPosition',ree)
  5651. thing2.P = 100000
  5652. thing2.MaxForce = Vector3.new(math.huge,math.huge,math.huge)
  5653. thing.MaxForce = Vector3.new(10000,10000,10000)
  5654. for i=1,100 do
  5655. thing2.Position = obj4.Position
  5656. obj1:SetPrimaryPartCFrame(CFrame.new(obj1.PrimaryPart.Position)*CFrame.Angles(math.rad(handle.Orientation.X),math.rad(handle.Orientation.Y),math.rad(handle.Orientation.Z))*CFrame.Angles(0,math.rad(180),0))
  5657. thing.Position = handle.Position+(handle.CFrame.rightVector*0.5)
  5658. wait()
  5659. end
  5660. thing:Destroy()
  5661. local lmfao = Instance.new('Weld',obj4)
  5662. lmfao.C0 = CFrame.new(2.5,0.2,0)*CFrame.Angles(0,math.rad(180),0)
  5663. lmfao.Part0 = obj4
  5664. lmfao.Part1 = handle
  5665. ree:Destroy()
  5666. working = false
  5667. end
  5668.  
  5669. function katanamode()
  5670. blademode = "katana"
  5671. -- 1 - weeb shit
  5672. local weebshit1 = handle
  5673.  
  5674. -- 16 - top cap
  5675. local weebshit16 = Instance.new("Part")
  5676. weebshit16.CFrame = CFrame.new(Vector3.new(206.400146, 11.5499945, 5.00058556)) * CFrame.Angles(-3.1415927410126, 0, 1.5707963705063)
  5677. weebshit16.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  5678. weebshit16.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  5679. weebshit16.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  5680. weebshit16.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  5681. weebshit16.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  5682. weebshit16.Size = Vector3.new(0.1, 0.05,0.05) --0.65, 0.65
  5683. weebshit16.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  5684. weebshit16.Anchored = false
  5685. weebshit16.BrickColor = BrickColor.new("Really black")
  5686. weebshit16.Friction = 0.30000001192093
  5687. weebshit16.Shape = Enum.PartType.Cylinder
  5688. weebshit16.Name = "top cap"
  5689. weebshit16.Parent = weebshit1
  5690. local weld = Instance.new('Weld',weebshit16)
  5691. weld.Part0 = weebshit16
  5692. weld.Part1 = handle
  5693. weld.C1 = CFrame.new(0.6, 0, 0, 1.00000048, 0, 0, 0, 1, 0, 0, 0, 1.00000048)
  5694. --weld,part,endsize,endpos,amntime
  5695. grow(weld,weebshit16,Vector3.new(0.1,0.65,0.65),CFrame.new(0.6, 0, 0, 1.00000048, 0, 0, 0, 1, 0, 0, 0, 1.00000048),0.1)
  5696.  
  5697. -- 8 - blade
  5698. local weebshit8 = Instance.new("Part")
  5699. weebshit8.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  5700. weebshit8.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  5701. weebshit8.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  5702. weebshit8.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  5703. weebshit8.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  5704. weebshit8.Material = Enum.Material.Metal
  5705. weebshit8.Size = Vector3.new(0.23,0.05, 0.1)
  5706. weebshit8.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  5707. weebshit8.Anchored = false
  5708. weebshit8.BrickColor = BrickColor.new("Dark stone grey")
  5709. weebshit8.Friction = 0.30000001192093
  5710. weebshit8.Shape = Enum.PartType.Block
  5711. weebshit8.Name = "blade"
  5712. weebshit8.Parent = weebshit1
  5713. weebshit8:BreakJoints()
  5714. local bld1 = weebshit8
  5715. local weld2 = Instance.new('Weld',weebshit8)
  5716. weld2.Part0 = weebshit8
  5717. weld2.Part1 = handle
  5718. weld2.C1 = CFrame.new(0.75, 0, 0) * CFrame.Angles(math.rad(180), 0, math.rad(-90))
  5719. local coru=coroutine.wrap(function()
  5720. grow(weld2,weebshit8,Vector3.new(0.23,1.17,0.1),CFrame.new(1.25, 0, 0) * CFrame.Angles(math.rad(180), 0, math.rad(-90)),0.05)
  5721. end)
  5722. coru()
  5723.  
  5724. -- 9 - blade
  5725. local weebshit9 = Instance.new("Part")
  5726. weebshit9.CFrame = CFrame.new(Vector3.new(206.475388, 13.3372736, 5.00158167)) * CFrame.Angles(-0, 0, 0.052359949797392)
  5727. weebshit9.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  5728. weebshit9.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  5729. weebshit9.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  5730. weebshit9.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  5731. weebshit9.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  5732. weebshit9.Material = Enum.Material.Metal
  5733. weebshit9.Size = Vector3.new(0.100000009, 0.05, 0.0500000007)
  5734. weebshit9.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  5735. weebshit9.Anchored = false
  5736. weebshit9.BrickColor = BrickColor.new("Pearl")
  5737. weebshit9.Friction = 0.30000001192093
  5738. weebshit9.Shape = Enum.PartType.Block
  5739. weebshit9.Name = "blade"
  5740. weebshit9.Parent = weebshit8
  5741. local bld2 = weebshit9
  5742. local weld3 = Instance.new('Weld',weebshit9)
  5743. weld3.Part0 = weebshit9
  5744. weld3.Part1 = weebshit8
  5745. weld3.C1 = CFrame.new(0.11, 0, 0) * CFrame.Angles(0, 0, 0)
  5746. grow(weld3,weebshit9,Vector3.new(0.100000009, 1.17, 0.0500000007),CFrame.new(0.11, 0, 0) * CFrame.Angles(0, 0, 0),0.05)
  5747. -- 10 - blade
  5748. local weebshit10 = Instance.new("Part")
  5749. weebshit10.CFrame = CFrame.new(Vector3.new(206.26973, 14.458313, 5)) * CFrame.Angles(-0, 0, 0.10472027212381)
  5750. weebshit10.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  5751. weebshit10.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  5752. weebshit10.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  5753. weebshit10.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  5754. weebshit10.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  5755. weebshit10.Material = Enum.Material.Metal
  5756. weebshit10.Size = Vector3.new(0.229999945, 0.05, 0.100000009)
  5757. weebshit10.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  5758. weebshit10.Anchored = false
  5759. weebshit10.BrickColor = BrickColor.new("Dark stone grey")
  5760. weebshit10.Friction = 0.30000001192093
  5761. weebshit10.Shape = Enum.PartType.Block
  5762. weebshit10.Name = "blade"
  5763. weebshit10.Parent = weebshit1
  5764. local weld4 = Instance.new('Weld',weebshit10)
  5765. weld4.Part0 = weebshit10
  5766. weld4.Part1 = weebshit8
  5767. weld4.C1 = CFrame.new(-0.01, 0.55, -1.14440918e-05, 0.998631477, 0.0523363762, -1.25522347e-05, 0.0523363687, -0.998631358, -8.97663813e-06, -1.3056685e-05, 8.01841452e-06, -1.00000095)
  5768. local coru=coroutine.wrap(function()
  5769. grow(weld4,weebshit10,Vector3.new(0.23,1.17,0.1),CFrame.new(-0.0285797119, 1.14634609, -1.14440918e-05, 0.998631477, 0.0523363762, -1.25522347e-05, 0.0523363687, -0.998631358, -8.97663813e-06, -1.3056685e-05, 8.01841452e-06, -1.00000095),0.1)
  5770. end)
  5771. coru()
  5772. -- 11 - blade
  5773. local weebshit11 = Instance.new("Part")
  5774. weebshit11.CFrame = CFrame.new(Vector3.new(206.384079, 14.4703341, 5.00158167)) * CFrame.Angles(-0, 0, 0.10472027212381)
  5775. weebshit11.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  5776. weebshit11.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  5777. weebshit11.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  5778. weebshit11.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  5779. weebshit11.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  5780. weebshit11.Material = Enum.Material.Metal
  5781. weebshit11.Size = Vector3.new(0.100000009, 0.05, 0.0500000007)
  5782. weebshit11.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  5783. weebshit11.Anchored = false
  5784. weebshit11.BrickColor = BrickColor.new("Pearl")
  5785. weebshit11.Friction = 0.30000001192093
  5786. weebshit11.Shape = Enum.PartType.Block
  5787. weebshit11.Name = "blade"
  5788. weebshit11.Parent = weebshit1
  5789. local weld5 = Instance.new('Weld',weebshit10)
  5790. weld5.Part0 = weebshit10
  5791. weld5.Part1 = weebshit11
  5792. weld5.C1 = CFrame.new(0.11, 0, 0) * CFrame.Angles(0, 0, 0)
  5793. grow(weld5,weebshit11,Vector3.new(0.100000009, 1.16999841, 0.0500000007),CFrame.new(-0.11, 0, 0) * CFrame.Angles(0, 0, 0),0.1)
  5794.  
  5795. -- 15 - blade
  5796. local weebshit15 = Instance.new("Part")
  5797. weebshit15.CFrame = CFrame.new(Vector3.new(206.36055, 13.3312511, 5)) * CFrame.Angles(-0, 0, 0.052359949797392)
  5798. weebshit15.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  5799. weebshit15.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  5800. weebshit15.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  5801. weebshit15.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  5802. weebshit15.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  5803. weebshit15.Material = Enum.Material.Metal
  5804. weebshit15.Size = Vector3.new(0.229999945, 0.55, 0.100000009)
  5805. weebshit15.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  5806. weebshit15.Anchored = false
  5807. weebshit15.BrickColor = BrickColor.new("Dark stone grey")
  5808. weebshit15.Friction = 0.30000001192093
  5809. weebshit15.Shape = Enum.PartType.Block
  5810. weebshit15.Name = "blade"
  5811. weebshit15.Parent = weebshit1
  5812. local weld6 = Instance.new('Weld',weebshit15)
  5813. weld6.Part0 = weebshit15
  5814. weld6.Part1 = weebshit10
  5815. weld6.C1 = CFrame.new(-0.01, -0.55, 0, 0.99863112, -0.0523363762, 5.34574838e-07, -0.0523363203, -0.998631358, 9.75034527e-06, 9.04611142e-08, -1.00508332e-05, -1.0000006)
  5816. local coru=coroutine.wrap(function()
  5817. grow(weld6,weebshit15,Vector3.new(0.229999945, 1.17000151, 0.100000009),CFrame.new(-0.0274810791, -1.13038063, 0, 0.99863112, -0.0523363762, 5.34574838e-07, -0.0523363203, -0.998631358, 9.75034527e-06, 9.04611142e-08, -1.00508332e-05, -1.0000006),0.1)
  5818. end)
  5819. coru()
  5820.  
  5821. -- 12 - blade
  5822. local weebshit12 = Instance.new("Part")
  5823. weebshit12.CFrame = CFrame.new(Vector3.new(206.50705, 12.1849957, 5.00158167)) * CFrame.Angles(-0, 0, -0)
  5824. weebshit12.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  5825. weebshit12.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  5826. weebshit12.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  5827. weebshit12.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  5828. weebshit12.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  5829. weebshit12.Material = Enum.Material.Metal
  5830. weebshit12.Size = Vector3.new(0.100000009, 0.05, 0.0500000007)
  5831. weebshit12.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  5832. weebshit12.Anchored = false
  5833. weebshit12.BrickColor = BrickColor.new("Pearl")
  5834. weebshit12.Friction = 0.30000001192093
  5835. weebshit12.Shape = Enum.PartType.Block
  5836. weebshit12.Name = "blade"
  5837. weebshit12.Parent = weebshit1
  5838. local weld7 = Instance.new('Weld',weebshit12)
  5839. weld7.Part0 = weebshit12
  5840. weld7.Part1 = weebshit15
  5841. weld7.C1 = CFrame.new(0.11, 0, 0) * CFrame.Angles(0, 0, 0)
  5842. grow(weld7,weebshit12,Vector3.new(0.100000009, 1.16999841, 0.0500000007),CFrame.new(0.11, 0, 0) * CFrame.Angles(0, 0, 0),0.1)
  5843.  
  5844. -- 14 - blade
  5845. local weebshit14 = Instance.new("Part")
  5846. weebshit14.CFrame = CFrame.new(Vector3.new(206.155365, 15.3628922, 5)) * CFrame.Angles(-0, 0, 0.15708021819592)
  5847. weebshit14.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  5848. weebshit14.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  5849. weebshit14.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  5850. weebshit14.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  5851. weebshit14.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  5852. weebshit14.Material = Enum.Material.Metal
  5853. weebshit14.Size = Vector3.new(0.229999945, 0.05, 0.100000009)
  5854. weebshit14.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  5855. weebshit14.Anchored = false
  5856. weebshit14.BrickColor = BrickColor.new("Dark stone grey")
  5857. weebshit14.Friction = 0.30000001192093
  5858. weebshit14.Shape = Enum.PartType.Block
  5859. weebshit14.Name = "blade"
  5860. weebshit14.Parent = weebshit1
  5861. local weld8 = Instance.new('Weld',weebshit14)
  5862. weld8.Part0 = weebshit14
  5863. weld8.Part1 = weebshit15
  5864. weld8.C1 = CFrame.new(-0.01, 0.45, -1.43051147e-06, 0.99862963, 0.0522801876, -1.10407145e-05, 0.0522794127, 0.998632491, -1.50609173e-06, 8.47656065e-06, 1.7598054e-06, 1)
  5865. local coru=coroutine.wrap(function()
  5866. grow(weld8,weebshit14,Vector3.new(0.229999945, 0.700001657, 0.100000009),CFrame.new(-0.0191650391, 0.911635399, -1.43051147e-06, 0.99862963, 0.0522801876, -1.10407145e-05, 0.0522794127, 0.998632491, -1.50609173e-06, 8.47656065e-06, 1.7598054e-06, 1),0.1)
  5867. end)
  5868. coru()
  5869.  
  5870. -- 13 - blade
  5871. local weebshit13 = Instance.new("Part")
  5872. weebshit13.CFrame = CFrame.new(Vector3.new(206.268967, 15.3808832, 5.00158167)) * CFrame.Angles(-0, 0, 0.15708021819592)
  5873. weebshit13.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  5874. weebshit13.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  5875. weebshit13.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  5876. weebshit13.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  5877. weebshit13.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  5878. weebshit13.Material = Enum.Material.Metal
  5879. weebshit13.Size = Vector3.new(0.100000009, 0.05, 0.0500000007)
  5880. weebshit13.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  5881. weebshit13.Anchored = false
  5882. weebshit13.BrickColor = BrickColor.new("Pearl")
  5883. weebshit13.Friction = 0.30000001192093
  5884. weebshit13.Shape = Enum.PartType.Block
  5885. weebshit13.Name = "blade"
  5886. weebshit13.Parent = weebshit1
  5887. local weld9 = Instance.new('Weld',weebshit13)
  5888. weld9.Part0 = weebshit13
  5889. weld9.Part1 = weebshit14
  5890. weld9.C1 = CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0)
  5891. grow(weld9,weebshit13,Vector3.new(0.100000009, 0.699998796, 0.0500000007),CFrame.new(0.11, 0, 0) * CFrame.Angles(0, 0, 0),0.1)
  5892.  
  5893. -- 18 - blade
  5894. local weebshit18 = Instance.new("WedgePart")
  5895. weebshit18.CFrame = CFrame.new(Vector3.new(206.077118, 15.85674, 5)) * CFrame.Angles(1.5707963705063, -1.4137160778046, 1.5707963705063)
  5896. weebshit18.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  5897. weebshit18.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  5898. weebshit18.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  5899. weebshit18.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  5900. weebshit18.Material = Enum.Material.Metal
  5901. weebshit18.Size = Vector3.new(0.100000009, 0.05, 0.230000108)
  5902. weebshit18.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  5903. weebshit18.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  5904. weebshit18.Anchored = false
  5905. weebshit18.BrickColor = BrickColor.new("Dark stone grey")
  5906. weebshit18.Friction = 0.30000001192093
  5907. weebshit18.Name = "blade"
  5908. weebshit18.Parent = weebshit1
  5909. local weld10 = Instance.new('Weld',weebshit18)
  5910. weld10.Part0 = weebshit18
  5911. weld10.Part1 = weebshit14
  5912. weld10.C1 = CFrame.new(-0.015, 0.299937057, 2.86102295e-06)*CFrame.Angles(0,math.rad(-90),0)
  5913. local coru=coroutine.wrap(function()
  5914. grow(weld10,weebshit18,Vector3.new(0.1, 0.3, 0.23),CFrame.new(0, 0.499937057, 2.86102295e-06)*CFrame.Angles(0,math.rad(-90),0),0.1)
  5915. end)
  5916. coru()
  5917.  
  5918. -- 19 - blade
  5919. local weebshit19 = Instance.new("WedgePart")
  5920. weebshit19.CFrame = CFrame.new(Vector3.new(206.096375, 15.8952179, 5.00177383)) * CFrame.Angles(1.5707963705063, -1.4137160778046, 1.5707963705063)
  5921. weebshit19.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  5922. weebshit19.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  5923. weebshit19.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  5924. weebshit19.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  5925. weebshit19.Material = Enum.Material.Metal
  5926. weebshit19.Size = Vector3.new(0.0500000007, 0.05, 0.280000091)
  5927. weebshit19.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  5928. weebshit19.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  5929. weebshit19.Anchored = false
  5930. weebshit19.BrickColor = BrickColor.new("Pearl")
  5931. weebshit19.Friction = 0.30000001192093
  5932. weebshit19.Name = "blade"
  5933. weebshit19.Parent = weebshit1
  5934. local weld11 = Instance.new('Weld',weebshit19)
  5935. weld11.Part0 = weebshit19
  5936. weld11.Part1 = weebshit18
  5937. weld11.C1 = CFrame.new(0, 0, -0.029) * CFrame.Angles(0, 0, 0)
  5938. local coru=coroutine.wrap(function()
  5939. grow(weld11,weebshit19,Vector3.new(0.05, 0.37, 0.28),CFrame.new(0, 0.011, -0.029) * CFrame.Angles(0, 0, 0),0.1)
  5940. end)
  5941. coru()
  5942. end
  5943.  
  5944. function gunmode()
  5945. working = true
  5946.  
  5947. working = false
  5948. end
  5949.  
  5950. function knifemode()
  5951. blademode = "knife"
  5952. -- 6 - thicc cap
  5953. local obj6 = Instance.new("Part")
  5954. obj6.CFrame = CFrame.new(Vector3.new(202.399948, 10.5999813, 5.00099993)) * CFrame.Angles(-0, 0, 3.5017728805542e-07)
  5955. obj6.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  5956. obj6.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  5957. obj6.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  5958. obj6.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  5959. obj6.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  5960. obj6.Size = Vector3.new(0.3, 0.3, 0.3)
  5961. obj6.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  5962. obj6.Anchored = false
  5963. obj6.BrickColor = BrickColor.new("Really black")
  5964. obj6.Friction = 0.30000001192093
  5965. obj6.Shape = Enum.PartType.Ball
  5966. obj6.Name = "thicc cap"
  5967. obj6.Parent = handle
  5968. local weld2 = Instance.new('Weld',obj6)
  5969. weld2.Part0 = obj6
  5970. weld2.Part1 = handle
  5971. weld2.C0 = CFrame.new(0.4, 0, 0)
  5972. grow(weld2,obj6,Vector3.new(0.3, 0.3, 0.3),CFrame.new(-0.15, 0, 0),0.1)
  5973.  
  5974. -- 8 - thicc top cap
  5975. local obj8 = Instance.new("Part")
  5976. obj8.CFrame = CFrame.new(Vector3.new(202.399963, 11.3000078, 5.00099993)) * CFrame.Angles(-0, 0, 3.5017728805542e-07)
  5977. obj8.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  5978. obj8.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  5979. obj8.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  5980. obj8.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  5981. obj8.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  5982. obj8.Size = Vector3.new(0.3, 0.3, 0.3)
  5983. obj8.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  5984. obj8.Anchored = false
  5985. obj8.BrickColor = BrickColor.new("Really black")
  5986. obj8.Friction = 0.30000001192093
  5987. obj8.Shape = Enum.PartType.Ball
  5988. obj8.Name = "thicc top cap"
  5989. obj8.Parent = handle
  5990. local weld1 = Instance.new('Weld',obj8)
  5991. weld1.Part0 = obj8
  5992. weld1.Part1 = handle
  5993. weld1.C0 = CFrame.new(-0.4, 0, 0)
  5994. grow(weld1,obj8,Vector3.new(0.3, 0.3, 0.3),CFrame.new(0.15, 0, 0),0.1)
  5995. -- 4 - thicc blade
  5996. local obj4 = Instance.new("Part")
  5997. obj4.CFrame = CFrame.new(Vector3.new(202.40007, 12.1600046, 5.00099707)) * CFrame.Angles(-0, 0, -0)
  5998. obj4.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  5999. obj4.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  6000. obj4.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  6001. obj4.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  6002. obj4.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  6003. obj4.Material = Enum.Material.Metal
  6004. obj4.Size = Vector3.new(0.23, 0.1, 0.1)
  6005. obj4.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  6006. obj4.Anchored = false
  6007. obj4.BrickColor = BrickColor.new("Dark stone grey")
  6008. obj4.Friction = 0.30000001192093
  6009. obj4.Shape = Enum.PartType.Block
  6010. obj4.Name = "blade"
  6011. obj4.Parent = handle
  6012. local weld4 = Instance.new('Weld',obj4)
  6013. weld4.Part0 = obj4
  6014. weld4.Part1 = handle
  6015. weld4.C0 = CFrame.new(0, -0.535, 0)*CFrame.Angles(0,0,math.rad(90))
  6016. local coru=coroutine.wrap(function()
  6017. grow(weld4,obj4,Vector3.new(0.23, 1.19, 0.1),CFrame.new(0.5, 0, 0),0.1)
  6018. end)
  6019. coru()
  6020.  
  6021. -- 5 - thicc blade
  6022. local obj5 = Instance.new("Part")
  6023. obj5.CFrame = CFrame.new(Vector3.new(202.507141, 12.1749954, 5.00158167)) * CFrame.Angles(-0, 0, -0)
  6024. obj5.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  6025. obj5.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  6026. obj5.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  6027. obj5.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  6028. obj5.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  6029. obj5.Material = Enum.Material.Metal
  6030. obj5.Size = Vector3.new(0.100000009, 0.1, 0.0500000007)
  6031. obj5.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  6032. obj5.Anchored = false
  6033. obj5.BrickColor = BrickColor.new("Pearl")
  6034. obj5.Friction = 0.30000001192093
  6035. obj5.Shape = Enum.PartType.Block
  6036. obj5.Name = "blade"
  6037. obj5.Parent = handle
  6038. local weld5 = Instance.new('Weld',obj5)
  6039. weld5.Part0 = obj5
  6040. weld5.Part1 = obj4
  6041. weld5.C0 = CFrame.new(0.09, 0, 0)*CFrame.Angles(0,0,0)
  6042. grow(weld5,obj5,Vector3.new(0.1, 1.19, 0.05),CFrame.new(0, 0, 0),0.1)
  6043.  
  6044. -- 3 - thicc blade
  6045. local obj3 = Instance.new("WedgePart")
  6046. obj3.CFrame = CFrame.new(Vector3.new(202.40007, 12.9000006, 5.00099707)) * CFrame.Angles(-0, -1.5707963705063, 0)
  6047. obj3.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  6048. obj3.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  6049. obj3.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  6050. obj3.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  6051. obj3.Material = Enum.Material.Metal
  6052. obj3.Size = Vector3.new(0.1, 0, 0.23)
  6053. obj3.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  6054. obj3.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  6055. obj3.Anchored = false
  6056. obj3.BrickColor = BrickColor.new("Dark stone grey")
  6057. obj3.Friction = 0.30000001192093
  6058. obj3.Name = "blade"
  6059. obj3.Parent = handle
  6060. local weld6 = Instance.new('Weld',obj3)
  6061. weld6.Part0 = obj3
  6062. weld6.Part1 = obj4
  6063. weld6.C0 = CFrame.new(0, -0.595, 0)*CFrame.Angles(math.rad(0),math.rad(270),math.rad(0))
  6064. local coru=coroutine.wrap(function()
  6065. grow(weld6,obj3,Vector3.new(0.1, 0.3, 0.23),CFrame.new(0, 0.15, 0),0.05)
  6066. end)
  6067. coru()
  6068.  
  6069. -- 2 - thicc blade
  6070. local obj2 = Instance.new("WedgePart")
  6071. obj2.CFrame = CFrame.new(Vector3.new(202.423431, 12.9305696, 5.00099707)) * CFrame.Angles(-0, -1.5707963705063, 0)
  6072. obj2.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  6073. obj2.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  6074. obj2.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  6075. obj2.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  6076. obj2.Material = Enum.Material.Metal
  6077. obj2.Size = Vector3.new(0.05, 0, 0.26)
  6078. obj2.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  6079. obj2.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  6080. obj2.Anchored = false
  6081. obj2.BrickColor = BrickColor.new("Lily white")
  6082. obj2.Friction = 0.30000001192093
  6083. obj2.Name = "blade"
  6084. obj2.Parent = handle
  6085. local weld7 = Instance.new('Weld',obj2)
  6086. weld7.Part0 = obj2
  6087. weld7.Part1 = obj4
  6088. weld7.C0 = CFrame.new(0, -0.595, 0)*CFrame.Angles(math.rad(0),math.rad(270),math.rad(0))
  6089. grow(weld7,obj2,Vector3.new(0.05, 0.33, 0.24),CFrame.new(-0.02, 0.165, 0),0.05)
  6090. end
  6091.  
  6092. function raep()
  6093. working = true
  6094. pcall(function()
  6095. local holyshit = Instance.new("Sound", handle)
  6096. holyshit.SoundId = "rbxassetid://345287845"
  6097. holyshit.Volume = 5
  6098. holyshit:Play()
  6099. holyshit.TimePosition = 0.6
  6100. --[[local waitwhatthefuck = Instance.new("Sound", handle)
  6101. waitwhatthefuck.SoundId = "rbxassetid://864314263"
  6102. waitwhatthefuck:Play()]]--
  6103. local coru=coroutine.wrap(function()
  6104. wait(1.95)
  6105. holyshit.TimePosition = 2.8
  6106. end)
  6107. coru()
  6108. local tweld = Instance.new("Weld", char.HumanoidRootPart)
  6109. tweld.Part0 = char.HumanoidRootPart
  6110. tweld.Part1 = char.Torso
  6111. local rweld = Instance.new("Weld", char["Right Arm"])
  6112. rweld.Part0 = char["Torso"]
  6113. rweld.Part1 = char["Right Arm"]
  6114. rweld.C0 = CFrame.new(1.5, 0, 0)
  6115. local lweld = Instance.new("Weld", char["Left Arm"])
  6116. lweld.Part0 = char.Torso
  6117. lweld.Part1 = char["Left Arm"]
  6118. lweld.C0 = CFrame.new(-1.5, 0, 0)
  6119.  
  6120. char.Humanoid.WalkSpeed = 16
  6121.  
  6122. local cor = coroutine.wrap(function()
  6123. lerp(rweld,rweld.C0,CFrame.new(1.75, 0, 0.35) * CFrame.Angles(math.rad(-20), math.rad(0), math.rad(50)),0.2)
  6124. end)
  6125. local cor2 = coroutine.wrap(function()
  6126. lerp(tweld,tweld.C0,CFrame.new(0, -0.25, 0) * CFrame.Angles(math.rad(-15), math.rad(-45), math.rad(0)),0.2)
  6127. end)
  6128. cor()
  6129. cor2()
  6130. lerp(lweld,lweld.C0,CFrame.new(-1.75, 0, -0.35) * CFrame.Angles(math.rad(20), math.rad(0), math.rad(-20)),0.2)
  6131.  
  6132. local particl = Instance.new("ParticleEmitter")
  6133. particl.LightEmission = 3
  6134. particl.Color = ColorSequence.new({ColorSequenceKeypoint.new(0, Color3.fromRGB(42, 0, 255)), ColorSequenceKeypoint.new(0.25, Color3.fromRGB(248, 153, 0)), ColorSequenceKeypoint.new(1, Color3.fromRGB(255, 255, 0))})
  6135. particl.LightInfluence = 0.75
  6136. particl.Size = NumberSequence.new({NumberSequenceKeypoint.new(0, 1), NumberSequenceKeypoint.new(1, 0)})
  6137. particl.Lifetime = NumberRange.new(0.1, 0.5)
  6138. particl.Rate = 50
  6139. particl.RotSpeed = NumberRange.new(300, 300)
  6140. particl.Speed = NumberRange.new(0, 1)
  6141. particl.SpreadAngle = Vector2.new(90, 90)
  6142. particl.Parent = handle
  6143.  
  6144. for i, v in pairs(handle["pink toy"]:GetChildren()) do
  6145. if v:IsA("Part") then
  6146. cooldildo = particl:Clone()
  6147. cooldildo.Parent = v
  6148. end
  6149. end
  6150.  
  6151. particl:Remove()
  6152.  
  6153. wait(1)
  6154. MOAN = true
  6155.  
  6156. char.Humanoid.WalkSpeed = 75
  6157.  
  6158.  
  6159. local cor = coroutine.wrap(function()
  6160. lerp(rweld,rweld.C0,CFrame.new(1.6, 0.5, -0.75) * CFrame.Angles(0, math.rad(55), math.rad(90)),0.06)
  6161. end)
  6162. local cor2 = coroutine.wrap(function()
  6163. lerp(tweld,tweld.C0,CFrame.new(0, 0, 0) * CFrame.Angles(math.rad(0), math.rad(30), math.rad(0)),0.06)
  6164. end)
  6165. local cor3 = coroutine.wrap(function()
  6166. lerp(hweld,hweld.C0,CFrame.new(0, -1, 0) * CFrame.Angles(math.rad(270),math.rad(-90),math.rad(180)), 0.06)
  6167. end)
  6168. cor()
  6169. cor2()
  6170. cor3()
  6171. lerp(lweld,lweld.C0,CFrame.new(-1.75, 0, 0.35) * CFrame.Angles(math.rad(-20), math.rad(0), math.rad(-20)),0.06)
  6172. local omgg = 0
  6173. repeat wait(0.05) omgg = omgg+0.05 until aidsificating ~= nil or omgg > 2
  6174. holyshit:Destroy()
  6175. char.Humanoid.WalkSpeed = 16
  6176. MOAN = false
  6177. if aidsificating == nil then
  6178. for i, v in pairs(handle["pink toy"]:GetChildren()) do
  6179. if v:IsA("Part") then
  6180. v:FindFirstChild("ParticleEmitter"):Destroy()
  6181. end
  6182. end
  6183. local cor = coroutine.wrap(function()
  6184. lerp(rweld,rweld.C0,CFrame.new(1.5, 0, 0) * CFrame.Angles(math.rad(0), math.rad(0), math.rad(0)),0.08)
  6185. end)
  6186. local cor2 = coroutine.wrap(function()
  6187. lerp(tweld,tweld.C0,CFrame.new(0, 0, 0) * CFrame.Angles(math.rad(0), math.rad(0), math.rad(0)),0.08)
  6188. end)
  6189. local cor3 = coroutine.wrap(function()
  6190. lerp(hweld,hweld.C0,CFrame.new(0, -1, 0) * CFrame.Angles(math.rad(-180),math.rad(-90), 0), 0.08)
  6191. end)
  6192. cor()
  6193. cor2()
  6194. cor3()
  6195. lerp(lweld,lweld.C0,CFrame.new(-1.75, 0, 0.35) * CFrame.Angles(math.rad(-20), math.rad(0), math.rad(-20)),0.08)
  6196.  
  6197. lweld:Remove()
  6198. rweld:Remove()
  6199. tweld:Remove()
  6200.  
  6201. if torsoclone and char:FindFirstChild("Torso") and char:FindFirstChild("HumanoidRootPart") then
  6202. local clone = torsoclone:Clone()
  6203. clone.Part0 = char.HumanoidRootPart
  6204. clone.Part1 = char.Torso
  6205. clone.Parent = char.HumanoidRootPart
  6206. end
  6207. if leftclone and char:FindFirstChild('Left Arm') and char:FindFirstChild('Torso') then
  6208. local clone = leftclone:Clone()
  6209. clone.Part0 = char.Torso
  6210. clone.Part1 = char["Left Arm"]
  6211. clone.Parent = char.Torso
  6212. end
  6213. if rightclone and char:FindFirstChild('Right Arm') and char:FindFirstChild('Torso') then
  6214. local clone = rightclone:Clone()
  6215. clone.Part0 = char.Torso
  6216. clone.Part1 = char["Right Arm"]
  6217. clone.Parent = char.Torso
  6218. end
  6219. else
  6220. pcall(function()
  6221. aidsificating.HumanoidRootPart:Destroy()
  6222. end)
  6223. pcall(function()
  6224. ragdollpart(aidsificating,"Right Arm")
  6225. ragdollpart(aidsificating,"Right Leg")
  6226. ragdollpart(aidsificating,"Left Arm")
  6227. ragdollpart(aidsificating,"Left Leg")
  6228. end)
  6229. pcall(function()
  6230. ragdollpart(aidsificating,"RightUpperArm")
  6231. ragdollpart(aidsificating,"RightUpperLeg")
  6232. ragdollpart(aidsificating,"LeftUpperArm")
  6233. ragdollpart(aidsificating,"LeftUpperLeg")
  6234. end)
  6235. pcall(function()
  6236. local weld = Instance.new('Weld',aidsificating.Torso)
  6237. weld.Part0 = aidsificating.Torso
  6238. weld.Part1 = handle
  6239. weld.C0 = CFrame.new(0.2,-2.5,2)*CFrame.Angles(math.rad(135),0,math.rad(-90))
  6240. for i,v in pairs(handle["pink toy"]:GetChildren()) do
  6241. if v:IsA('BasePart') and v.Name == "stretchlol" then
  6242. v.BrickColor = aidsificating.Torso.BrickColor
  6243. v.Transparency = 0
  6244. end
  6245. end
  6246. end)
  6247. pcall(function()
  6248. local weld = Instance.new('Weld',aidsificating.UpperTorso)
  6249. weld.Part0 = aidsificating.UpperTorso
  6250. weld.Part1 = handle
  6251. weld.C0 = CFrame.new(0.2,-2.5,2)*CFrame.Angles(math.rad(135),0,math.rad(-90))
  6252. for i,v in pairs(handle["pink toy"]:GetChildren()) do
  6253. if v:IsA('BasePart') and v.Name == "stretchlol" then
  6254. v.BrickColor = aidsificating.UpperTorso.BrickColor
  6255. v.Transparency = 0
  6256. end
  6257. end
  6258. end)
  6259. lerp(rweld,rweld.C0,CFrame.new(1.6, 1, -0.5) * CFrame.Angles(0, math.rad(55), math.rad(145)),0.06)
  6260. wait(2)
  6261. for i,v in pairs(aidsificating:GetDescendants()) do
  6262. if v:IsA('Weld') then v:Destroy() end
  6263. end
  6264. pcall(function()
  6265. ragdollpart(aidsificating,"Head")
  6266. end)
  6267. pcall(function()
  6268. local thang = "Torso"
  6269. if aidsificating:FindFirstChild('UpperTorso') then
  6270. thang = "UpperTorso"
  6271. end
  6272. local ayybleed = Instance.new('Part',aidsificating)
  6273. ayybleed.Size = Vector3.new(0.2,0.2,0.2)
  6274. ayybleed.BrickColor = BrickColor.new('Maroon')
  6275. ayybleed.Material = Enum.Material.SmoothPlastic
  6276. ayybleed.Name = "ayybleed"
  6277. ayybleed.CanCollide = false
  6278. ayybleed.Transparency = 1
  6279. ayybleed.CFrame = aidsificating[thang].CFrame
  6280. ayybleed:BreakJoints()
  6281. local attachment1 = Instance.new('Attachment',ayybleed)
  6282. attachment1.Position = Vector3.new(0,-1,0)
  6283. attachment1.Orientation = Vector3.new(180, 0, 0)
  6284. local attachment0 = Instance.new('Attachment',aidsificating[thang])
  6285. if attachment0 and attachment1 then
  6286. local constraint = Instance.new("HingeConstraint")
  6287. constraint.Attachment0 = attachment0
  6288. constraint.Attachment1 = attachment1
  6289. constraint.LimitsEnabled = true
  6290. constraint.UpperAngle = 0
  6291. constraint.LowerAngle = 0
  6292. constraint.Parent = aidsificating
  6293. end
  6294. local bleedBLEED= coroutine.wrap(function()
  6295. bleed(ayybleed,true)
  6296. end)
  6297. bleedBLEED()
  6298. end)
  6299. aidsificating = nil
  6300. pcall(function()
  6301. for i,v in pairs(handle["pink toy"]:GetChildren()) do
  6302. if v:IsA('BasePart') and v.Name == "stretchlol" then
  6303. v.Transparency = 1
  6304. end
  6305. end
  6306. end)
  6307. local cor = coroutine.wrap(function()
  6308. lerp(rweld,rweld.C0,CFrame.new(1.6, -0.25, 0.75) * CFrame.Angles(0, math.rad(55), math.rad(145)),0.04)
  6309. end)
  6310. local cor2 = coroutine.wrap(function()
  6311. lerp(tweld,tweld.C0,CFrame.new(0, 0, 0) * CFrame.Angles(math.rad(0), math.rad(-30), math.rad(0)),0.04)
  6312. end)
  6313. cor()
  6314. cor2()
  6315. lerp(lweld,lweld.C0,CFrame.new(-1.75, 0, 0.35) * CFrame.Angles(math.rad(-20), math.rad(0), math.rad(-20)),0.04)
  6316. wait(0.1)
  6317. local cor = coroutine.wrap(function()
  6318. lerp(rweld,rweld.C0,CFrame.new(1.6, -0.5, 1) * CFrame.Angles(0, math.rad(0), math.rad(0)),0.08)
  6319. end)
  6320. local cor2 = coroutine.wrap(function()
  6321. lerp(tweld,tweld.C0,CFrame.new(0, 0, 0) * CFrame.Angles(math.rad(0), math.rad(-30), math.rad(0)),0.08)
  6322. end)
  6323. local cor3 = coroutine.wrap(function()
  6324. lerp(hweld,hweld.C0,CFrame.new(0, -1, 0) * CFrame.Angles(math.rad(-180),math.rad(-90), 0), 0.08)
  6325. end)
  6326. cor()
  6327. cor2()
  6328. cor3()
  6329. lerp(lweld,lweld.C0,CFrame.new(-1.5, 0, 0) * CFrame.Angles(math.rad(0), math.rad(0), math.rad(0)),0.08)
  6330.  
  6331. lweld:Remove()
  6332. rweld:Remove()
  6333. tweld:Remove()
  6334.  
  6335. if torsoclone and char:FindFirstChild("Torso") and char:FindFirstChild("HumanoidRootPart") then
  6336. local clone = torsoclone:Clone()
  6337. clone.Part0 = char.HumanoidRootPart
  6338. clone.Part1 = char.Torso
  6339. clone.Parent = char.HumanoidRootPart
  6340. end
  6341. if leftclone and char:FindFirstChild('Left Arm') and char:FindFirstChild('Torso') then
  6342. local clone = leftclone:Clone()
  6343. clone.Part0 = char.Torso
  6344. clone.Part1 = char["Left Arm"]
  6345. clone.Parent = char.Torso
  6346. end
  6347. if rightclone and char:FindFirstChild('Right Arm') and char:FindFirstChild('Torso') then
  6348. local clone = rightclone:Clone()
  6349. clone.Part0 = char.Torso
  6350. clone.Part1 = char["Right Arm"]
  6351. clone.Parent = char.Torso
  6352. end
  6353. end
  6354. end)
  6355. working = false
  6356. end
  6357.  
  6358. function katanaQ()
  6359. working = true
  6360. swinging = true
  6361. gettingeem = true
  6362. pcall(function()
  6363. local rweld = Instance.new("Weld", char["Right Arm"])
  6364. local tweld = Instance.new("Weld", char.HumanoidRootPart)
  6365. pcall(function()
  6366. rweld.Part0 = char["Torso"]
  6367. rweld.Part1 = char["Right Arm"]
  6368. rweld.C0 = CFrame.new(1.5, 0, 0)
  6369. tweld.Part0 = char.HumanoidRootPart
  6370. tweld.Part1 = char.Torso
  6371. end)
  6372.  
  6373. char:FindFirstChildOfClass('Humanoid').WalkSpeed = 100
  6374.  
  6375. local at1 = Instance.new("Attachment", handle)
  6376. local at2 = Instance.new("Attachment", handle)
  6377. at1.Visible = false
  6378. at1.Position = Vector3.new(5, 0, 0)
  6379. at2.Visible = false
  6380. at2.Position = Vector3.new(1, 0, 0)
  6381.  
  6382. local trail = Instance.new("Trail", handle)
  6383. trail.Color = ColorSequence.new({ColorSequenceKeypoint.new(0, Color3.fromRGB(255, 255, 255)), ColorSequenceKeypoint.new(1, Color3.fromRGB(255, 255, 255))})
  6384. trail.LightEmission = 0.25
  6385. trail.Transparency = NumberSequence.new({NumberSequenceKeypoint.new(0, 0.9), NumberSequenceKeypoint.new(1, 1)})
  6386. trail.Lifetime = 0.10
  6387. trail.MinLength = 0.05
  6388. trail.Attachment0 = at1
  6389. trail.Attachment1 = at2
  6390. local coru=coroutine.wrap(function()
  6391. lerp(rweld,rweld.C0,CFrame.new(1.35, 0.5, -1.2) * CFrame.Angles(0, math.rad(90), math.rad(90)),0.08)
  6392. end)
  6393. coru()
  6394. lerp(hweld,hweld.C0,CFrame.new(0, -1, 0) * CFrame.Angles(math.rad(270),math.rad(-90),math.rad(180)), 0.08)
  6395. local ree=0
  6396. while goteem == nil and ree < 1 do
  6397. wait(0.05)
  6398. ree=ree+0.05
  6399. end
  6400. char:FindFirstChildOfClass('Humanoid').WalkSpeed = 16
  6401. gettingeem = false
  6402. swinging = false
  6403. if goteem then
  6404. wait(2)
  6405. pcall(function()
  6406. local sounn = Instance.new("Sound", goteem.Torso)
  6407. local lipp = math.random(1, 3)
  6408. if lipp == 1 then sounn.SoundId = "rbxassetid://444667844" end
  6409. if lipp == 2 then sounn.SoundId = "rbxassetid://444667824" end
  6410. if lipp == 3 then sounn.SoundId = "rbxassetid://444667859" end
  6411. sounn:Play()
  6412. end)
  6413. ragdollpart(goteem,"Head")
  6414. for i,v in pairs(goteem:GetDescendants()) do
  6415. if v:IsA('Weld') then v:Destroy() end
  6416. end
  6417. goteem = nil
  6418. end
  6419. trail:Destroy()
  6420. at1:Destroy()
  6421. at2:Destroy()
  6422. lerp(hweld,hweld.C0,CFrame.new(0, -1, 0) * CFrame.Angles(math.rad(-180),math.rad(-90), 0), 0.05)
  6423. local cor = coroutine.wrap(function()
  6424. lerp(tweld,tweld.C0,CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),0.08)
  6425. end)
  6426. cor()
  6427. lerp(rweld,rweld.C0,CFrame.new(1.5, 0, 0) * CFrame.Angles(0, math.rad(0), math.rad(0)),0.08)
  6428. rweld:Destroy()
  6429. tweld:Destroy()
  6430. if rightclone and char:FindFirstChild('Right Arm') and char:FindFirstChild('Torso') then
  6431. local clone = rightclone:Clone()
  6432. clone.Part0 = char.Torso
  6433. clone.Part1 = char["Right Arm"]
  6434. clone.Parent = char.Torso
  6435. end
  6436. if torsoclone and char:FindFirstChild('Torso') and char:FindFirstChild('HumanoidRootPart') then
  6437. local clone = torsoclone:Clone()
  6438. clone.Part0 = char.HumanoidRootPart
  6439. clone.Part1 = char.Torso
  6440. clone.Parent = char.HumanoidRootPart
  6441. end
  6442. end)
  6443. swinging = false
  6444. gettingeem = false
  6445. working = false
  6446. end
  6447. local function katanaE()
  6448. working = true
  6449. swinging = true
  6450. SLESH = true
  6451. pcall(function()
  6452. local rweld = Instance.new("Weld", char["Right Arm"])
  6453. local tweld = Instance.new("Weld", char.HumanoidRootPart)
  6454. rweld.Part0 = char["Torso"]
  6455. rweld.Part1 = char["Right Arm"]
  6456. rweld.C0 = CFrame.new(1.5, 0, 0)
  6457. tweld.Part0 = char.HumanoidRootPart
  6458. tweld.Part1 = char.Torso
  6459.  
  6460. char:FindFirstChildOfClass('Humanoid').WalkSpeed = 100
  6461.  
  6462. local at1 = Instance.new("Attachment", handle)
  6463. local at2 = Instance.new("Attachment", handle)
  6464. at1.Visible = false
  6465. at1.Position = Vector3.new(5, 0, 0)
  6466. at2.Visible = false
  6467. at2.Position = Vector3.new(1, 0, 0)
  6468.  
  6469. local trail = Instance.new("Trail", handle)
  6470. trail.Color = ColorSequence.new({ColorSequenceKeypoint.new(0, Color3.fromRGB(255, 255, 255)), ColorSequenceKeypoint.new(1, Color3.fromRGB(255, 255, 255))})
  6471. trail.LightEmission = 0.25
  6472. trail.Transparency = NumberSequence.new({NumberSequenceKeypoint.new(0, 0.9), NumberSequenceKeypoint.new(1, 1)})
  6473. trail.Lifetime = 0.10
  6474. trail.MinLength = 0.05
  6475. trail.Attachment0 = at1
  6476. trail.Attachment1 = at2
  6477. local coru=coroutine.wrap(function()
  6478. lerp(rweld,rweld.C0,CFrame.new(2, 1, 0) * CFrame.Angles(math.rad(0), 0, math.rad(60)),0.08)
  6479. end)
  6480. coru()
  6481. lerp(hweld,hweld.C0,CFrame.new(0, -1, 0) * CFrame.Angles(math.rad(270),math.rad(-270),math.rad(0)), 0.08)
  6482.  
  6483. wait(1)
  6484. char:FindFirstChildOfClass('Humanoid').WalkSpeed = 16
  6485. trail:Destroy()
  6486. at1:Destroy()
  6487. at2:Destroy()
  6488. lerp(hweld,hweld.C0,CFrame.new(0, -1, 0) * CFrame.Angles(math.rad(-180),math.rad(-90), 0), 0.05)
  6489. local cor = coroutine.wrap(function()
  6490. lerp(tweld,tweld.C0,CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),0.08)
  6491. end)
  6492. cor()
  6493. lerp(rweld,rweld.C0,CFrame.new(1.5, 0, 0) * CFrame.Angles(0, math.rad(0), math.rad(0)),0.08)
  6494. rweld:Destroy()
  6495. tweld:Destroy()
  6496. if rightclone and char:FindFirstChild('Right Arm') and char:FindFirstChild('Torso') then
  6497. local clone = rightclone:Clone()
  6498. clone.Part0 = char.Torso
  6499. clone.Part1 = char["Right Arm"]
  6500. clone.Parent = char.Torso
  6501. end
  6502. if torsoclone and char:FindFirstChild('Torso') and char:FindFirstChild('HumanoidRootPart') then
  6503. local clone = torsoclone:Clone()
  6504. clone.Part0 = char.HumanoidRootPart
  6505. clone.Part1 = char.Torso
  6506. clone.Parent = char.HumanoidRootPart
  6507. end
  6508. end)
  6509. swinging = false
  6510. SLESH = false
  6511. working = false
  6512. end
  6513.  
  6514. function begoneTHOUGHT()
  6515. working = true
  6516. pcall(function()
  6517. local thott = Instance.new("Sound", char)
  6518. thott.SoundId = "rbxassetid://949916584"
  6519. thott.Volume = 1
  6520. thott.TimePosition = 0.5
  6521. thott.PlaybackSpeed = 1
  6522. thott.EmitterSize = player.CameraMaxZoomDistance+1
  6523. thott.MaxDistance = player.CameraMaxZoomDistance+1
  6524. thott:Play()
  6525.  
  6526. local rweld = Instance.new("Weld", char["Right Arm"])
  6527. local tweld = Instance.new("Weld", char.HumanoidRootPart)
  6528. rweld.Part0 = char["Torso"]
  6529. rweld.Part1 = char["Right Arm"]
  6530. rweld.C0 = CFrame.new(1.5, 0, 0)
  6531. tweld.Part0 = char.HumanoidRootPart
  6532. tweld.Part1 = char.Torso
  6533.  
  6534. local coru=coroutine.wrap(function()
  6535. lerp(rweld,rweld.C0,CFrame.new(1.5, 0, 0) * CFrame.Angles(math.rad(60), math.rad(0), math.rad(0)),0.25)
  6536. end)
  6537. coru()
  6538. lerp(tweld,tweld.C0,CFrame.new(0, 0, 0) * CFrame.Angles(math.rad(0),math.rad(-45),math.rad(0)), 0.25)
  6539.  
  6540. wait(0.5)
  6541. local thote = Instance.new("Sound", char.Head)
  6542. thote.SoundId = "rbxassetid://358498516"
  6543. thote.Volume = 1
  6544. thote:Play()
  6545.  
  6546.  
  6547.  
  6548. local coru=coroutine.wrap(function()
  6549. lerp(rweld,rweld.C0,CFrame.new(2, 0.5, 0) * CFrame.Angles(math.rad(0), math.rad(0), math.rad(90)),0.04)
  6550. end)
  6551. coru()
  6552. lerp(tweld,tweld.C0,CFrame.new(0, 0, 0) * CFrame.Angles(math.rad(0),math.rad(90),math.rad(0)), 0.04)
  6553. wait(0.04)
  6554. local ree = Instance.new('Part',workspace)
  6555. ree.Shape = Enum.PartType.Cylinder
  6556. ree.CanCollide = false
  6557. ree.Anchored = false
  6558. ree.Size = Vector3.new(0.5,2,2)
  6559. ree.TopSurface = Enum.SurfaceType.Smooth
  6560. ree.BottomSurface = Enum.SurfaceType.Smooth
  6561. ree.Transparency = 0.8
  6562. ree.Material =Enum.Material.Neon
  6563. ree.BrickColor = BrickColor.new('Toothpaste')
  6564. ree.CFrame = handle.CFrame*CFrame.Angles(0,0,math.rad(90))
  6565. ree:BreakJoints()
  6566. local reee = Instance.new("Sound", ree)
  6567. reee.SoundId = "rbxassetid://138677306"
  6568. reee:Play()
  6569. local heck = Instance.new('BodyVelocity',ree)
  6570. heck.Velocity = ree.CFrame.rightVector*50
  6571. heck.MaxForce = Vector3.new(math.huge,math.huge,math.huge)
  6572. local coru=coroutine.wrap(function()
  6573. for i=1,21 do
  6574. local cf = ree.CFrame
  6575. ree.Size = ree.Size+Vector3.new(0,2,2)
  6576. ree.CFrame = cf
  6577. wait()
  6578. end
  6579. for i=1,4 do
  6580. local cf = ree.CFrame
  6581. ree.Size = ree.Size+Vector3.new(0,2,2)
  6582. ree.CFrame = cf
  6583. ree.Transparency = ree.Transparency + 0.05
  6584. wait()
  6585. end
  6586. ree:Destroy()
  6587. end)
  6588. coru()
  6589. ree.Touched:connect(function(hit)
  6590. if hit.Parent and hit.Parent ~= char and hit.Parent:FindFirstChildOfClass('Humanoid') then
  6591. hit.Parent:FindFirstChildOfClass('Humanoid').Health = 100
  6592. ragdollpart(hit.Parent,"Head")
  6593. end
  6594. end)
  6595. wait(0.5)
  6596. local coru=coroutine.wrap(function()
  6597. lerp(rweld,rweld.C0,CFrame.new(1.5, 0, 0) * CFrame.Angles(math.rad(0), math.rad(0), math.rad(0)),0.8)
  6598. end)
  6599. coru()
  6600. lerp(tweld,tweld.C0,CFrame.new(0, 0, 0) * CFrame.Angles(math.rad(0),math.rad(0),math.rad(0)), 0.8)
  6601.  
  6602. rweld:Destroy()
  6603. tweld:Destroy()
  6604. if rightclone and char:FindFirstChild('Right Arm') and char:FindFirstChild('Torso') then
  6605. local clone = rightclone:Clone()
  6606. clone.Part0 = char.Torso
  6607. clone.Part1 = char["Right Arm"]
  6608. clone.Parent = char.Torso
  6609. end
  6610. if torsoclone and char:FindFirstChild('Torso') and char:FindFirstChild('HumanoidRootPart') then
  6611. local clone = torsoclone:Clone()
  6612. clone.Part0 = char.HumanoidRootPart
  6613. clone.Part1 = char.Torso
  6614. clone.Parent = char.HumanoidRootPart
  6615. end
  6616. end)
  6617. working = false
  6618. end
  6619.  
  6620. function katanaswing()
  6621. working = true
  6622. pcall(function()
  6623. local rweld = Instance.new("Weld", char["Right Arm"])
  6624. local lweld = Instance.new("Weld", char["Left Arm"])
  6625. local tweld = Instance.new("Weld", char.HumanoidRootPart)
  6626. rweld.Part0 = char["Torso"]
  6627. rweld.Part1 = char["Right Arm"]
  6628. rweld.C0 = CFrame.new(1.5, 0, 0)
  6629. lweld.Part0 = char.Torso
  6630. lweld.Part1 = char["Left Arm"]
  6631. lweld.C0 = CFrame.new(-1.5, 0, 0)
  6632. tweld.Part0 = char.HumanoidRootPart
  6633. tweld.Part1 = char.Torso
  6634.  
  6635. local cor = coroutine.wrap(function()
  6636. lerp(tweld,tweld.C0,CFrame.new(0, 0, 0) * CFrame.Angles(0, math.rad(45), 0),0.08)
  6637. end)
  6638. cor()
  6639. lerp(rweld,rweld.C0,CFrame.new(1.35, 0.5, -1.2) * CFrame.Angles(0, math.rad(110), math.rad(90)),0.08)
  6640. wait(0.2)
  6641. local at1 = Instance.new("Attachment", handle)
  6642. local at2 = Instance.new("Attachment", handle)
  6643. at1.Visible = false
  6644. at1.Position = Vector3.new(5, 0, 0)
  6645. at2.Visible = false
  6646. at2.Position = Vector3.new(1, 0, 0)
  6647.  
  6648. local trail = Instance.new("Trail", handle)
  6649. trail.Color = ColorSequence.new({ColorSequenceKeypoint.new(0, trail.Parent.Color), ColorSequenceKeypoint.new(1, trail.Parent.Color)})
  6650. trail.LightEmission = 0.25
  6651. trail.Transparency = NumberSequence.new({NumberSequenceKeypoint.new(0, 0.9), NumberSequenceKeypoint.new(1, 1)})
  6652. trail.Lifetime = 0.10
  6653. trail.MinLength = 0.05
  6654. trail.Attachment0 = at1
  6655. trail.Attachment1 = at2
  6656.  
  6657. swinging = true
  6658.  
  6659. local cor = coroutine.wrap(function()
  6660. lerp(tweld,tweld.C0,CFrame.new(0, 0, 0) * CFrame.Angles(0, math.rad(-45), 0),0.04)
  6661. end)
  6662. cor()
  6663. lerp(rweld,rweld.C0,CFrame.new(2, 0.5, 0) * CFrame.Angles(0, math.rad(0), math.rad(90)),0.04)
  6664. wait(0.2)
  6665. swinging = false
  6666. trail:Destroy()
  6667. at1:Destroy()
  6668. at2:Destroy()
  6669. local cor = coroutine.wrap(function()
  6670. lerp(tweld,tweld.C0,CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),0.08)
  6671. end)
  6672. cor()
  6673. lerp(rweld,rweld.C0,CFrame.new(1.5, 0, 0) * CFrame.Angles(0, math.rad(0), math.rad(0)),0.08)
  6674. rweld:Destroy()
  6675. lweld:Destroy()
  6676. tweld:Destroy()
  6677. if rightclone and char:FindFirstChild('Right Arm') and char:FindFirstChild('Torso') then
  6678. local clone = rightclone:Clone()
  6679. clone.Part0 = char.Torso
  6680. clone.Part1 = char["Right Arm"]
  6681. clone.Parent = char.Torso
  6682. end
  6683. if leftclone and char:FindFirstChild('Left Arm') and char:FindFirstChild('Torso') then
  6684. local clone = leftclone:Clone()
  6685. clone.Part0 = char.Torso
  6686. clone.Part1 = char["Left Arm"]
  6687. clone.Parent = char.Torso
  6688. end
  6689. if torsoclone and char:FindFirstChild('Torso') and char:FindFirstChild('HumanoidRootPart') then
  6690. local clone = torsoclone:Clone()
  6691. clone.Part0 = char.HumanoidRootPart
  6692. clone.Part1 = char.Torso
  6693. clone.Parent = char.HumanoidRootPart
  6694. end
  6695. end)
  6696. working = false
  6697. end
  6698.  
  6699. function throw()
  6700. working = true
  6701. pcall(function()
  6702. local rweld = char["Right Arm"]:FindFirstChild("Weld")
  6703. local lweld = char["Left Arm"]:FindFirstChild("Weld")
  6704. local tweld = Instance.new("Weld", char.HumanoidRootPart)
  6705. tweld.Part0 = char.HumanoidRootPart
  6706. tweld.Part1 = char.Torso
  6707. local throwsound = Instance.new("Sound", char.Head)
  6708. throwsound.SoundId = "rbxassetid://711753382"
  6709. throwsound.PlaybackSpeed = 0.75
  6710.  
  6711. local cor = coroutine.wrap(function()
  6712. lerp(tweld,tweld.C0,CFrame.new(0, 0, 0) * CFrame.Angles(0, math.rad(-30), 0),0.04)
  6713. end)
  6714. local cor2 = coroutine.wrap(function()
  6715. lerp(rweld,rweld.C0,CFrame.new(1.5, 0.15, 0.4) * CFrame.Angles(0, math.rad(-30), math.rad(15)),0.04)
  6716. end)
  6717. cor()
  6718. cor2()
  6719. grabweld:Remove()
  6720. throwsound:Play()
  6721.  
  6722. local throwvel = Instance.new("BodyThrust")
  6723. throwvel.Force = Vector3.new(0, 3000, -2000)
  6724. pcall(function()
  6725. throwvel.Parent = grabbed.Torso
  6726. end)
  6727. pcall(function()
  6728. throwvel.Parent = grabbed.UpperTorso
  6729. end)
  6730.  
  6731. lerp(lweld,lweld.C0,CFrame.new(-1.3, 0.7, -1) * CFrame.Angles(0, math.rad(-70), math.rad(-105)),0.04)
  6732. wait(0.15)
  6733. throwvel:Remove()
  6734. local cor = coroutine.wrap(function()
  6735. lerp(lweld,lweld.C0,CFrame.new(-1.5, 0, 0) * CFrame.Angles(0, 0, 0),0.08)
  6736. end)
  6737. local cor2 = coroutine.wrap(function()
  6738. lerp(rweld,rweld.C0,CFrame.new(1.5, 0, 0) * CFrame.Angles(0, 0, 0),0.08)
  6739. end)
  6740. cor()
  6741. cor2()
  6742. lerp(tweld,tweld.C0,CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),0.08)
  6743. lweld:Remove()
  6744. rweld:Remove()
  6745. tweld:Remove()
  6746. if rightclone and char:FindFirstChild('Right Arm') and char:FindFirstChild('Torso') then
  6747. local clone = rightclone:Clone()
  6748. clone.Part0 = char.Torso
  6749. clone.Part1 = char["Right Arm"]
  6750. clone.Parent = char.Torso
  6751. end
  6752. if leftclone and char:FindFirstChild('Left Arm') and char:FindFirstChild('Torso') then
  6753. local clone = leftclone:Clone()
  6754. clone.Part0 = char.Torso
  6755. clone.Part1 = char["Left Arm"]
  6756. clone.Parent = char.Torso
  6757. end
  6758. if torsoclone and char:FindFirstChild('Torso') and char:FindFirstChild('HumanoidRootPart') then
  6759. local clone = torsoclone:Clone()
  6760. clone.Part0 = char.HumanoidRootPart
  6761. clone.Part1 = char.Torso
  6762. clone.Parent = char.HumanoidRootPart
  6763. end
  6764. local lolgrabbed = grabbed
  6765. spawn(function()
  6766. wait(2)
  6767. unstun(lolgrabbed)
  6768. end)
  6769. end)
  6770. grabbed = nil
  6771. working = false
  6772. end
  6773.  
  6774. function whoosh(vroom)
  6775. vroom.Parent = workspace
  6776. vroom.Name = "Projectile"
  6777. vroom.CFrame = CFrame.new(char.Head.CFrame.p,mouse.Hit.p)*CFrame.Angles(math.rad(0),math.rad(90),math.rad(0))
  6778. vroom.Anchored = true
  6779. vroom.Velocity = Vector3.new(0,0,0)
  6780. vroom.RotVelocity = Vector3.new(0,0,0)
  6781. vroom.Anchored = false
  6782. game:GetService('Debris'):AddItem(vroom,10)
  6783. local flyy = Instance.new('BodyVelocity',vroom)
  6784. flyy.Velocity = vroom.CFrame.rightVector*200
  6785. local touched = false
  6786. for i,v in pairs(vroom:GetChildren()) do
  6787. if v:IsA('BasePart') then
  6788. v.Touched:connect(function(hit)
  6789. local pos = vroom.CFrame
  6790. if touched == false then
  6791. if hit and hit.Parent and hit.Transparency ~= 1 and hit.Parent:FindFirstChildOfClass('Humanoid') and hit.Parent~= char then
  6792. touched = true
  6793. local before = hit.Anchored
  6794. vroom.Anchored = true
  6795. vroom.Velocity = Vector3.new(0,0,0)
  6796. vroom.RotVelocity = Vector3.new(0,0,0)
  6797. vroom.CFrame = vroom.CFrame-(vroom.CFrame.rightVector)
  6798. hit.Anchored = true
  6799. flyy:Destroy()
  6800. pcall(function()
  6801. local weld = Instance.new('Weld',hit)
  6802. weld.Part0 = hit
  6803. weld.Part1 = vroom
  6804. weld.C0 = hit.CFrame:toObjectSpace(vroom.CFrame)
  6805. local ayybleed = Instance.new('Part',hit)
  6806. ayybleed.Size = Vector3.new(0.2,0.2,0.2)
  6807. ayybleed.BrickColor = BrickColor.new('Maroon')
  6808. ayybleed.Material = Enum.Material.SmoothPlastic
  6809. ayybleed.Name = "ayybleed"
  6810. ayybleed.CanCollide = false
  6811. ayybleed.Transparency = 1
  6812. ayybleed.CFrame = hit.CFrame
  6813. ayybleed:BreakJoints()
  6814. local attachment1 = Instance.new('Attachment',ayybleed)
  6815. local attachment0 = Instance.new('Attachment',hit)
  6816. for i,v in pairs(vroom:GetChildren()) do
  6817. if v.Name == "blade" and v.Size == Vector3.new(0.23, 1.19, 0.1) then
  6818. v.Name = "REEEE"
  6819. end
  6820. end
  6821. attachment1.Orientation = vroom["REEEE"].Orientation+Vector3.new(90,0,0)
  6822. attachment0.Position = hit.CFrame:toObjectSpace(vroom["REEEE"].CFrame).p-(hit.CFrame:toObjectSpace(vroom["REEEE"].CFrame).upVector)
  6823. if attachment0 and attachment1 then
  6824. local constraint = Instance.new("HingeConstraint")
  6825. constraint.Attachment0 = attachment0
  6826. constraint.Attachment1 = attachment1
  6827. constraint.LimitsEnabled = true
  6828. constraint.UpperAngle = 0
  6829. constraint.LowerAngle = 0
  6830. constraint.Parent = attachment0
  6831. end
  6832. local bleedBLEED= coroutine.wrap(function()
  6833. bleed(ayybleed)
  6834. end)
  6835. bleedBLEED()
  6836. if hit.Name ~= "Head" and hit.Name ~= "UpperTorso" and hit.Name ~= "Torso" and hit.Name ~= "LowerTorso" then
  6837. game:GetService('Debris'):AddItem(ayybleed,7.5)
  6838. end
  6839. end)
  6840. hit.Anchored = before
  6841. vroom.Anchored = false
  6842. vroom.CanCollide = true
  6843. pcall(function()
  6844. vroom:FindFirstChildOfClass('Trail'):Destroy()
  6845. end)
  6846. for i,v in pairs(vroom:GetChildren()) do
  6847. if v:IsA('BasePart') then
  6848. v.CanCollide = true
  6849. end
  6850. end
  6851. if hit.Name == "Head" or hit.Name == "UpperTorso" or hit.Name == "Torso" or hit.Name == "LowerTorso" then
  6852. pcall(function()
  6853. hit.Parent.HumanoidRootPart:Destroy()
  6854. end)
  6855. pcall(function()
  6856. ragdollpart(hit.Parent,"Left Arm")
  6857. ragdollpart(hit.Parent,"Left Leg")
  6858. ragdollpart(hit.Parent,"Right Arm")
  6859. ragdollpart(hit.Parent,"Right Leg")
  6860. end)
  6861. pcall(function()
  6862. ragdollpart(hit.Parent,"LeftUpperLeg")
  6863. ragdollpart(hit.Parent,"RightUpperLeg")
  6864. ragdollpart(hit.Parent,"LeftUpperArm")
  6865. ragdollpart(hit.Parent,"RightUpperArm")
  6866. end)
  6867. spawn(function()
  6868. wait(5)
  6869. ragdollpart(hit.Parent,"Head")
  6870. end)
  6871. else
  6872. pcall(function()
  6873. ragdollpart(hit.Parent,hit.Name)
  6874. end)
  6875. end
  6876. elseif hit and hit.CanCollide == true and hit.Parent and hit.Parent ~= char then
  6877. touched = true
  6878. local before = hit.Anchored
  6879. vroom.Anchored = true
  6880. vroom.Velocity = Vector3.new(0,0,0)
  6881. vroom.RotVelocity = Vector3.new(0,0,0)
  6882. hit.Anchored = true
  6883. flyy:Destroy()
  6884. vroom.CFrame = vroom.CFrame-vroom.CFrame.rightVector
  6885. pcall(function()
  6886. local weld = Instance.new('Weld',hit)
  6887. weld.Part0 = hit
  6888. weld.Part1 = vroom
  6889. weld.C0 = hit.CFrame:toObjectSpace(vroom.CFrame)
  6890. end)
  6891. pcall(function()
  6892. vroom:FindFirstChildOfClass('Trail'):Destroy()
  6893. end)
  6894. hit.Anchored = before
  6895. vroom.Anchored = false
  6896. end
  6897. end
  6898. end)
  6899. end
  6900. end
  6901. end
  6902.  
  6903. function fling()
  6904. working = true
  6905. pcall(function()
  6906. local rweld = Instance.new("Weld", char["Right Arm"])
  6907. local lweld = Instance.new("Weld", char["Left Arm"])
  6908. rweld.Part0 = char["Torso"]
  6909. rweld.Part1 = char["Right Arm"]
  6910. rweld.C0 = CFrame.new(1.5, 0, 0)
  6911. lweld.Part0 = char.Torso
  6912. lweld.Part1 = char["Left Arm"]
  6913. lweld.C0 = CFrame.new(-1.5, 0, 0)
  6914. local tweld = Instance.new("Weld", char.HumanoidRootPart)
  6915. tweld.Part0 = char.HumanoidRootPart
  6916. tweld.Part1 = char.Torso
  6917.  
  6918. local at1 = Instance.new("Attachment", handle)
  6919. local at2 = Instance.new("Attachment", handle)
  6920. at1.Visible = false
  6921. at1.Position = Vector3.new(2, 0, 0)
  6922. at2.Visible = false
  6923. at2.Position = Vector3.new(-0.3, 0, 0)
  6924.  
  6925. local trail = Instance.new("Trail", handle)
  6926. trail.Color = ColorSequence.new({ColorSequenceKeypoint.new(0, Color3.fromRGB(255, 255, 255)), ColorSequenceKeypoint.new(1, Color3.fromRGB(255, 255, 255))})
  6927. trail.LightEmission = 0.25
  6928. trail.Transparency = NumberSequence.new({NumberSequenceKeypoint.new(0, 0.75), NumberSequenceKeypoint.new(1, 1)})
  6929. trail.Lifetime = 0.10
  6930. trail.MinLength = 0.05
  6931. trail.Attachment0 = at1
  6932. trail.Attachment1 = at2
  6933.  
  6934. local cor = coroutine.wrap(function()
  6935. lerp(rweld,rweld.C0,CFrame.new(1.75, 0, 0) * CFrame.Angles(0, math.rad(0), math.rad(45)),0.07)
  6936. end)
  6937. cor()
  6938. lerp(lweld,lweld.C0,CFrame.new(-1.5, 0, -0.5) * CFrame.Angles(math.rad(45), math.rad(0), math.rad(0)),0.07)
  6939.  
  6940. local cor = coroutine.wrap(function()
  6941. lerp(rweld,rweld.C0,CFrame.new(1.75, 1, 0.25) * CFrame.Angles(math.rad(35), math.rad(0), math.rad(150)),0.07)
  6942. end)
  6943. local cor2 = coroutine.wrap(function()
  6944. lerp(tweld,tweld.C0,CFrame.new(0, 0, 0) * CFrame.Angles(0, math.rad(-45), math.rad(0)),0.07)
  6945. end)
  6946. local cor3 = coroutine.wrap(function()
  6947. lerp(hweld,hweld.C0,CFrame.new(0, -2.5, 0) * CFrame.Angles(math.rad(90),math.rad(90), 0),0.12)
  6948. end)
  6949. cor()
  6950. cor2()
  6951. cor3()
  6952. lerp(lweld,lweld.C0,CFrame.new(-1.75, 0.5, -0.5) * CFrame.Angles(math.rad(90), math.rad(0), math.rad(-45)),0.07)
  6953. wait(0.2)
  6954.  
  6955. local cor = coroutine.wrap(function()
  6956. lerp(rweld,rweld.C0,CFrame.new(1.5, 1, 0.25) * CFrame.Angles(math.rad(0), math.rad(0), math.rad(170)),0.03)
  6957. end)
  6958. local cor2 = coroutine.wrap(function()
  6959. lerp(tweld,tweld.C0,CFrame.new(0, 0, 0) * CFrame.Angles(0, math.rad(0), math.rad(0)),0.03)
  6960. end)
  6961. cor()
  6962. cor2()
  6963. lerp(lweld,lweld.C0,CFrame.new(-1, 0, -0.45) * CFrame.Angles(math.rad(45), math.rad(0), math.rad(45)),0.03)
  6964.  
  6965. local cor = coroutine.wrap(function()
  6966. lerp(rweld,rweld.C0,CFrame.new(1.5, 0.5, -0.5) * CFrame.Angles(math.rad(0), math.rad(60), math.rad(90)),0.03)
  6967. end)
  6968. local cor2 = coroutine.wrap(function()
  6969. lerp(tweld,tweld.C0,CFrame.new(0, 0, 0) * CFrame.Angles(0, math.rad(45), math.rad(0)),0.01)
  6970. end)
  6971. cor()
  6972. cor2()
  6973. whoosh(handle:Clone())
  6974. for i, v in pairs(handle:GetChildren()) do
  6975. if v:IsA("Part") then
  6976. v.Transparency = 1
  6977. end
  6978. end
  6979. handle.Transparency = 1
  6980. trail:Remove()
  6981. at1:Remove()
  6982. at2:Remove()
  6983. lerp(lweld,lweld.C0,CFrame.new(-1.5, 0, 0) * CFrame.Angles(math.rad(45), math.rad(0), math.rad(0)),0.01)
  6984. local cor = coroutine.wrap(function()
  6985. lerp(rweld,rweld.C0,CFrame.new(0.5, 0.4, -1) * CFrame.Angles(math.rad(0), math.rad(180), math.rad(75)),0.04)
  6986. end)
  6987. local cor2 = coroutine.wrap(function()
  6988. lerp(tweld,tweld.C0,CFrame.new(0, 0, 0) * CFrame.Angles(0, math.rad(55), math.rad(0)),0.04)
  6989. end)
  6990. cor()
  6991. cor2()
  6992. lerp(lweld,lweld.C0,CFrame.new(-1.5, 0, 0) * CFrame.Angles(math.rad(45), math.rad(0), math.rad(0)),0.04)
  6993. wait(0.2)
  6994.  
  6995. local cor = coroutine.wrap(function()
  6996. lerp(rweld,rweld.C0,CFrame.new(1.5, 0, 0) * CFrame.Angles(math.rad(0), math.rad(0), math.rad(0)),0.07)
  6997. end)
  6998. local cor2 = coroutine.wrap(function()
  6999. lerp(tweld,tweld.C0,CFrame.new(0, 0, 0) * CFrame.Angles(0, math.rad(0), math.rad(0)),0.07)
  7000. end)
  7001. cor()
  7002. cor2()
  7003. lerp(lweld,lweld.C0,CFrame.new(-1.5, 0, 0) * CFrame.Angles(math.rad(0), math.rad(0), math.rad(0)),0.07)
  7004.  
  7005. for i, v in pairs(handle:GetChildren()) do
  7006. if v:IsA("Part") then
  7007. v.Transparency = 0
  7008. end
  7009. end
  7010. handle.Transparency = 0
  7011. hweld.C0 = CFrame.new(0, -1, 0) * CFrame.Angles(math.rad(-180),math.rad(-90), 0)
  7012.  
  7013. lweld:Remove()
  7014. rweld:Remove()
  7015. tweld:Remove()
  7016.  
  7017. if torsoclone and char:FindFirstChild("Torso") and char:FindFirstChild("HumanoidRootPart") then
  7018. local clone = torsoclone:Clone()
  7019. clone.Part0 = char.HumanoidRootPart
  7020. clone.Part1 = char.Torso
  7021. clone.Parent = char.HumanoidRootPart
  7022. end
  7023. if leftclone and char:FindFirstChild('Left Arm') and char:FindFirstChild('Torso') then
  7024. local clone = leftclone:Clone()
  7025. clone.Part0 = char.Torso
  7026. clone.Part1 = char["Left Arm"]
  7027. clone.Parent = char.Torso
  7028. end
  7029. if rightclone and char:FindFirstChild('Right Arm') and char:FindFirstChild('Torso') then
  7030. local clone = rightclone:Clone()
  7031. clone.Part0 = char.Torso
  7032. clone.Part1 = char["Right Arm"]
  7033. clone.Parent = char.Torso
  7034. end
  7035. end)
  7036. working = false
  7037. end
  7038.  
  7039. function kill()
  7040. working = true
  7041. pcall(function()
  7042. local rweld = char["Right Arm"]:FindFirstChild("Weld")
  7043. local lweld = char["Left Arm"]:FindFirstChild("Weld")
  7044. local tweld = Instance.new("Weld", char.HumanoidRootPart)
  7045. tweld.Part0 = char.HumanoidRootPart
  7046. tweld.Part1 = char.Torso
  7047. local killsound = Instance.new("Sound", grabbed.Head)
  7048. killsound.SoundId = "rbxassetid://150315649"
  7049. killsound.PlaybackSpeed = 1.2
  7050. local killsoundac = Instance.new("Sound", grabbed.Head)
  7051. killsoundac.SoundId = "rbxassetid://162194585"
  7052. killsoundac.PlaybackSpeed = 1
  7053. killsoundac.Volume = 1
  7054. local throwsound = Instance.new("Sound", char.Head)
  7055. throwsound.SoundId = "rbxassetid://711753382"
  7056. throwsound.PlaybackSpeed = 0.75
  7057. local chokesound = Instance.new("Sound", grabbed.Head)
  7058. chokesound.SoundId = "rbxassetid://418658161"
  7059. chokesound.TimePosition = 3
  7060. chokesound.PlaybackSpeed = 1
  7061. local bleedsound = Instance.new("Sound", grabbed.Head)
  7062. bleedsound.SoundId = "rbxassetid://244502094"
  7063. bleedsound.PlaybackSpeed = 1.5
  7064. bleedsound.Volume = 1
  7065.  
  7066. pitchun = math.random(9, 12)/10
  7067. pitchdos = math.random(9, 13)/10
  7068.  
  7069. killsound.PlaybackSpeed = pitchun
  7070. killsoundac.PlaybackSpeed = pitchdos
  7071. chokesound.PlaybackSpeed = pitchun
  7072.  
  7073. pcall(function()
  7074. grabbed.HumanoidRootPart:Destroy()
  7075. end)
  7076.  
  7077. lerp(rweld,rweld.C0,CFrame.new(0.5, 0.7, -0.70) * CFrame.Angles(0, math.rad(100), math.rad(105)),0.1)
  7078. wait(0.2)
  7079. lerp(rweld,rweld.C0,CFrame.new(2, 0.5, 0) * CFrame.Angles(0, math.rad(0), math.rad(90)),0.04)
  7080.  
  7081. killsound:Play()
  7082. killsoundac:Play()
  7083. chokesound:Play()
  7084. bleedsound:Play()
  7085.  
  7086. local ayybleed = Instance.new('Part',grabbed)
  7087. ayybleed.Size = Vector3.new(0.2,0.2,0.2)
  7088. ayybleed.BrickColor = BrickColor.new('Maroon')
  7089. ayybleed.Material = Enum.Material.SmoothPlastic
  7090. ayybleed.Name = "ayybleed"
  7091. ayybleed.CanCollide = false
  7092. ayybleed.Transparency = 0.5
  7093. ayybleed.CFrame = grabbed.Head.CFrame
  7094. ayybleed:BreakJoints()
  7095. local attachment1 = Instance.new('Attachment',ayybleed)
  7096. attachment1.Position = Vector3.new(-0.55,0,0)
  7097. attachment1.Orientation = Vector3.new(90, 0, -90)
  7098. local attachment0 = Instance.new('Attachment')
  7099. pcall(function()
  7100. attachment0.Parent = grabbed.Torso
  7101. end)
  7102. pcall(function()
  7103. attachment0.Parent = grabbed.UpperTorso
  7104. end)
  7105. if attachment0 and attachment1 then
  7106. local constraint = Instance.new("HingeConstraint")
  7107. constraint.Attachment0 = attachment0
  7108. constraint.Attachment1 = attachment1
  7109. constraint.LimitsEnabled = true
  7110. constraint.UpperAngle = 0
  7111. constraint.LowerAngle = 0
  7112. pcall(function()
  7113. constraint.Parent = grabbed.Torso
  7114. end)
  7115. pcall(function()
  7116. constraint.Parent = grabbed.UpperTorso
  7117. end)
  7118. end
  7119. local bleedBLEED= coroutine.wrap(function()
  7120. bleed(ayybleed)
  7121. end)
  7122. bleedBLEED()
  7123.  
  7124. wait(0.2)
  7125.  
  7126. local at1 = Instance.new("Attachment", handle)
  7127. local at2 = Instance.new("Attachment", handle)
  7128. at1.Visible = false
  7129. at1.Position = Vector3.new(2, 0, 0)
  7130. at2.Visible = false
  7131. at2.Position = Vector3.new(-0.3, 0, 0)
  7132.  
  7133. local trail = Instance.new("Trail", handle)
  7134. trail.Color = ColorSequence.new({ColorSequenceKeypoint.new(0, Color3.fromRGB(255, 255, 255)), ColorSequenceKeypoint.new(1, Color3.fromRGB(255, 255, 255))})
  7135. trail.LightEmission = 0.25
  7136. trail.Transparency = NumberSequence.new({NumberSequenceKeypoint.new(0, 0.75), NumberSequenceKeypoint.new(1, 1)})
  7137. trail.Lifetime = 0.10
  7138. trail.MinLength = 0.05
  7139. trail.Attachment0 = at1
  7140. trail.Attachment1 = at2
  7141.  
  7142. lerp(rweld,rweld.C0,CFrame.new(1.5, 0.15, 0.4) * CFrame.Angles(0, math.rad(-40), math.rad(15)),0.08)
  7143. lerp(rweld,rweld.C0,CFrame.new(1.5, 0.15, 0.4) * CFrame.Angles(0, math.rad(-30), math.rad(15)),0.1)
  7144. local coru=coroutine.wrap(function()
  7145. lerp(hweld,hweld.C0,CFrame.new(0, -1, 0) * CFrame.Angles(math.rad(0),math.rad(-90), 0), 0.07)
  7146. lerp(hweld,hweld.C0,CFrame.new(0, -1, 0) * CFrame.Angles(math.rad(-180),math.rad(-90), 0), 0.09)
  7147. end)
  7148. coru()
  7149. local cor = coroutine.wrap(function()
  7150. lerp(tweld,tweld.C0,CFrame.new(0, 0, 0) * CFrame.Angles(0, math.rad(-30), 0),0.04)
  7151. end)
  7152. cor()
  7153. grabweld:Remove()
  7154. throwsound:Play()
  7155.  
  7156. local throwvel = Instance.new("BodyThrust")
  7157. throwvel.Force = Vector3.new(0, 3000, -1000)
  7158. pcall(function()
  7159. throwvel.Parent = grabbed.Torso
  7160. end)
  7161. pcall(function()
  7162. throwvel.Parent = grabbed.UpperTorso
  7163. end)
  7164.  
  7165. trail:Remove()
  7166. at1:Remove()
  7167. at2:Remove()
  7168. lerp(lweld,lweld.C0,CFrame.new(-1.3, 0.7, -1) * CFrame.Angles(0, math.rad(-70), math.rad(-105)),0.04)
  7169. pcall(function()
  7170. ragdollpart(grabbed,"Left Arm")
  7171. ragdollpart(grabbed,"Left Leg")
  7172. ragdollpart(grabbed,"Right Arm")
  7173. ragdollpart(grabbed,"Right Leg")
  7174. end)
  7175. pcall(function()
  7176. ragdollpart(grabbed,"LeftUpperLeg")
  7177. ragdollpart(grabbed,"RightUpperLeg")
  7178. ragdollpart(grabbed,"LeftUpperArm")
  7179. ragdollpart(grabbed,"RightUpperArm")
  7180. end)
  7181. wait(0.15)
  7182. throwvel:Remove()
  7183. local cor = coroutine.wrap(function()
  7184. lerp(lweld,lweld.C0,CFrame.new(-1.5, 0, 0) * CFrame.Angles(0, 0, 0),0.08)
  7185. end)
  7186. local cor2 = coroutine.wrap(function()
  7187. lerp(rweld,rweld.C0,CFrame.new(1.5, 0, 0) * CFrame.Angles(0, 0, 0),0.08)
  7188. end)
  7189. cor()
  7190. cor2()
  7191. lerp(tweld,tweld.C0,CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),0.08)
  7192.  
  7193. lweld:Remove()
  7194. rweld:Remove()
  7195. tweld:Remove()
  7196.  
  7197. if torsoclone and char:FindFirstChild("Torso") and char:FindFirstChild("HumanoidRootPart") then
  7198. local clone = torsoclone:Clone()
  7199. clone.Part0 = char.HumanoidRootPart
  7200. clone.Part1 = char.Torso
  7201. clone.Parent = char.HumanoidRootPart
  7202. end
  7203. if leftclone and char:FindFirstChild('Left Arm') and char:FindFirstChild('Torso') then
  7204. local clone = leftclone:Clone()
  7205. clone.Part0 = char.Torso
  7206. clone.Part1 = char["Left Arm"]
  7207. clone.Parent = char.Torso
  7208. end
  7209. if rightclone and char:FindFirstChild('Right Arm') and char:FindFirstChild('Torso') then
  7210. local clone = rightclone:Clone()
  7211. clone.Part0 = char.Torso
  7212. clone.Part1 = char["Right Arm"]
  7213. clone.Parent = char.Torso
  7214. end
  7215. local coru2=coroutine.wrap(function()
  7216. local whyy = grabbed
  7217. local continue = true
  7218. local repeats = 0
  7219. while continue == true do
  7220. local ree = pcall(function()
  7221. if repeats < 20 then
  7222. whyy:FindFirstChildOfClass('Humanoid').Health = whyy:FindFirstChildOfClass('Humanoid').Health-4.9
  7223. repeats = repeats+1
  7224. if whyy:FindFirstChildOfClass('Humanoid').Health <= 0 then
  7225. continue = false
  7226. end
  7227. else
  7228. continue = false
  7229. end
  7230. end)
  7231. if ree == false then
  7232. continue = false
  7233. end
  7234. if continue == true then
  7235. wait(0.2)
  7236. end
  7237. end
  7238. ragdollpart(whyy,"Head")
  7239. end)
  7240. coru2()
  7241. throwsound:Remove()
  7242. killsound:Remove()
  7243. end)
  7244. grabbed = nil
  7245. working = false
  7246. end
  7247.  
  7248. function release()
  7249. working = true
  7250. pcall(function()
  7251. unstun(grabbed)
  7252. grabbed = nil
  7253. grabweld:Destroy()
  7254. removewelds(char["Right Arm"])
  7255. removewelds(char["Left Arm"])
  7256. local rweld = Instance.new("Weld", char["Right Arm"])
  7257. local lweld = Instance.new("Weld", char["Left Arm"])
  7258. rweld.Part0 = char["Torso"]
  7259. rweld.Part1 = char["Right Arm"]
  7260. rweld.C0 = CFrame.new(1, 0.7, -0.75) * CFrame.Angles(0, math.rad(95), math.rad(105))
  7261. lweld.Part0 = char.Torso
  7262. lweld.Part1 = char["Left Arm"]
  7263. lweld.C0 = CFrame.new(-1.25, 0.7, -0.75) * CFrame.Angles(0, math.rad(-140), math.rad(-105))
  7264. local cor = coroutine.wrap(function()
  7265. lerp(rweld,rweld.C0,CFrame.new(1.5, 0, 0) * CFrame.Angles(0, math.rad(0), math.rad(0)),0.08)
  7266. end)
  7267. local cor2 = coroutine.wrap(function()
  7268. lerp(hweld,hweld.C0,CFrame.new(0, -1, 0) * CFrame.Angles(math.rad(-180),math.rad(-90), 0),0.08)
  7269. end)
  7270. cor()
  7271. cor2()
  7272. lerp(lweld,lweld.C0,CFrame.new(-1.5, 0, 0) * CFrame.Angles(0, math.rad(0), math.rad(0)),0.08)
  7273. lweld:Remove()
  7274. rweld:Remove()
  7275. if leftclone and char:FindFirstChild('Left Arm') and char:FindFirstChild('Torso') then
  7276. local clone = leftclone:Clone()
  7277. clone.Part0 = char.Torso
  7278. clone.Part1 = char["Left Arm"]
  7279. clone.Parent = char.Torso
  7280. end
  7281. if rightclone and char:FindFirstChild('Right Arm') and char:FindFirstChild('Torso') then
  7282. local clone = rightclone:Clone()
  7283. clone.Part0 = char.Torso
  7284. clone.Part1 = char["Right Arm"]
  7285. clone.Parent = char.Torso
  7286. end
  7287. end)
  7288. working = false
  7289. end
  7290.  
  7291. function grab()
  7292. working = true
  7293. pcall(function()
  7294. local rweld = Instance.new("Weld", char["Right Arm"])
  7295. local lweld = Instance.new("Weld", char["Left Arm"])
  7296. rweld.Part0 = char["Torso"]
  7297. rweld.Part1 = char["Right Arm"]
  7298. rweld.C0 = CFrame.new(1.5, 0, 0)
  7299. lweld.Part0 = char.Torso
  7300. lweld.Part1 = char["Left Arm"]
  7301. lweld.C0 = CFrame.new(-1.5, 0, 0)
  7302.  
  7303. local at1 = Instance.new("Attachment", handle)
  7304. local at2 = Instance.new("Attachment", handle)
  7305. at1.Visible = false
  7306. at1.Position = Vector3.new(2, 0, 0)
  7307. at2.Visible = false
  7308. at2.Position = Vector3.new(-0.3, 0, 0)
  7309.  
  7310. local trail = Instance.new("Trail", handle)
  7311. trail.Color = ColorSequence.new({ColorSequenceKeypoint.new(0, Color3.fromRGB(255, 255, 255)), ColorSequenceKeypoint.new(1, Color3.fromRGB(255, 255, 255))})
  7312. trail.LightEmission = 0.25
  7313. trail.Transparency = NumberSequence.new({NumberSequenceKeypoint.new(0, 0.75), NumberSequenceKeypoint.new(1, 1)})
  7314. trail.Lifetime = 0.10
  7315. trail.MinLength = 0.05
  7316. trail.Attachment0 = at1
  7317. trail.Attachment1 = at2
  7318.  
  7319. local spinnyshit = coroutine.wrap(function()
  7320. lerp(hweld,hweld.C0,CFrame.new(0, -1, 0) * CFrame.Angles(math.rad(0),math.rad(-90), 0), 0.07)
  7321. lerp(hweld,hweld.C0,CFrame.new(0, -1, 0) * CFrame.Angles(math.rad(0),math.rad(90), 0), 0.07)
  7322. end)
  7323. spinnyshit()
  7324. local cor = coroutine.wrap(function()
  7325. lerp(rweld,rweld.C0,CFrame.new(2, 0.5, 0) * CFrame.Angles(0, math.rad(0), math.rad(90)),0.08)
  7326. end)
  7327. cor()
  7328. lerp(lweld,lweld.C0,CFrame.new(-2, 0.5, 0) * CFrame.Angles(0, math.rad(0), math.rad(-90)),0.08)
  7329. wait(0.15)
  7330. grabbing = true
  7331. local cor = coroutine.wrap(function()
  7332. lerp(rweld,rweld.C0,CFrame.new(1, 0.7, -0.75) * CFrame.Angles(0, math.rad(95), math.rad(105)),0.08)
  7333. end)
  7334. cor()
  7335. lerp(lweld,lweld.C0,CFrame.new(-1.25, 0.7, -0.75) * CFrame.Angles(0, math.rad(-140), math.rad(-105)),0.08)
  7336. at1:Remove()
  7337. at2:Remove()
  7338. trail:Remove()
  7339. wait(0.3)
  7340. grabbing = false
  7341.  
  7342. if grabbed == nil then
  7343. local cor = coroutine.wrap(function()
  7344. lerp(rweld,rweld.C0,CFrame.new(1.5, 0, 0) * CFrame.Angles(0, math.rad(0), math.rad(0)),0.08)
  7345. end)
  7346. local cor2 = coroutine.wrap(function()
  7347. lerp(hweld,hweld.C0,CFrame.new(0, -1, 0) * CFrame.Angles(math.rad(-180),math.rad(-90), 0),0.08)
  7348. end)
  7349. cor()
  7350. cor2()
  7351. lerp(lweld,lweld.C0,CFrame.new(-1.5, 0, 0) * CFrame.Angles(0, math.rad(0), math.rad(0)),0.08)
  7352. lweld:Remove()
  7353. rweld:Remove()
  7354. if leftclone and char:FindFirstChild('Left Arm') and char:FindFirstChild('Torso') then
  7355. local clone = leftclone:Clone()
  7356. clone.Part0 = char.Torso
  7357. clone.Part1 = char["Left Arm"]
  7358. clone.Parent = char.Torso
  7359. end
  7360. if rightclone and char:FindFirstChild('Right Arm') and char:FindFirstChild('Torso') then
  7361. local clone = rightclone:Clone()
  7362. clone.Part0 = char.Torso
  7363. clone.Part1 = char["Right Arm"]
  7364. clone.Parent = char.Torso
  7365. end
  7366. end
  7367. end)
  7368. working = false
  7369. end
  7370.  
  7371. mouse.KeyDown:connect(function(kkk)
  7372. local key = kkk:lower()
  7373. if usable and working == false then
  7374. if key == "z" then
  7375. if equipped == false then
  7376. if firsttime then
  7377. firsttime = false
  7378. notify("Equipped || Press X or C to equip one of two weapons",true)
  7379. else
  7380. notify("Equipped")
  7381. end
  7382. equip()
  7383. else
  7384. notify("Unequipped")
  7385. unequip()
  7386. end
  7387. elseif key == "x" then
  7388. if blademode ~= "katana" and equipped == true then
  7389. getrid(handle)
  7390. if firsttime2 then
  7391. firsttime2 = false
  7392. notify("Katana mode enabled || Press Q, E, or click to perform an action",true)
  7393. else
  7394. notify("Katana mode enabled")
  7395. end
  7396. katanamode()
  7397. elseif blademode == "katana" then
  7398. getrid(handle)
  7399. notify("Katana mode disabled")
  7400. end
  7401. elseif key == "v" then
  7402. if blademode ~= "gun" and equipped == true then
  7403. getrid(handle)
  7404. if firsttime5 then
  7405. firsttime5 = false
  7406. notify("Gun mode enabled || Click to perform an action",true)
  7407. else
  7408. notify("Gun mode enabled")
  7409. end
  7410. gunmode()
  7411. elseif blademode == "gun" then
  7412. getrid(handle)
  7413. notify("Gun mode disabled")
  7414. end
  7415. elseif key == "b" then
  7416. if childlock == false then
  7417. if blademode ~= "dildo" and equipped == true then
  7418. getrid(handle)
  7419. if firsttime4 then
  7420. firsttime4 = false
  7421. notify("Dildo mode enabled || Click to perform an action",true)
  7422. else
  7423. notify("Dildo mode enabled")
  7424. end
  7425. dildo()
  7426. elseif blademode == "dildo" then
  7427. notify("Dildo mode disabled")
  7428. getrid(handle)
  7429. end
  7430. end
  7431. elseif key == "c" then
  7432. if blademode ~= "knife" and equipped == true then
  7433. getrid(handle)
  7434. if firsttime3 then
  7435. firsttime3 = false
  7436. notify("Knife mode enabled || Press F, E, T, or Q to set modes; Click to perform an action",true)
  7437. else
  7438. notify("Knife mode enabled")
  7439. end
  7440. knifemode()
  7441. elseif blademode == "knife" then
  7442. notify("Knife mode disabled")
  7443. getrid(handle)
  7444. end
  7445. elseif key == "q" then
  7446. if blademode == "katana" then
  7447. notify()
  7448. katanaQ()
  7449. elseif blademode == "knife" then
  7450. mode = "release"
  7451. notify("Mode changed to "..mode)
  7452. end
  7453. elseif key == "e" then
  7454. if blademode == "katana" then
  7455. notify()
  7456. katanaE()
  7457. elseif blademode == "knife" then
  7458. mode = "throw"
  7459. notify("Mode changed to "..mode)
  7460. end
  7461. elseif key == "f" then
  7462. if blademode == "handle" then
  7463. notify([[BEGONE
  7464. THOT]])
  7465. begoneTHOUGHT()
  7466. elseif blademode == "knife" then
  7467. mode = "kill"
  7468. notify("Mode changed to "..mode)
  7469. end
  7470. elseif key == "t" then
  7471. if blademode == "knife" then
  7472. mode = "fling"
  7473. notify("Mode changed to "..mode)
  7474. end
  7475. end
  7476. end
  7477. if key == "m" and sounding == false then
  7478. --badass mode
  7479. pcall(function()
  7480. if badass.Playing == false then
  7481. sounding = true
  7482. for i,v in pairs(workspace:GetDescendants()) do
  7483. if v:IsA('Sound') and v~=player.Character.Head.Badass then
  7484. v:Stop()
  7485. end
  7486. end
  7487. badass:Play()
  7488. badass.Volume = 10
  7489. sounding = false
  7490. else
  7491. sounding = true
  7492. for i=1,100 do
  7493. badass.Volume = badass.Volume-0.1
  7494. wait()
  7495. end
  7496. badass.Volume = 0
  7497. badass:Stop()
  7498. sounding = false
  7499. end
  7500. end)
  7501. end
  7502. if key == "r" then
  7503. rag1 = true
  7504. if rag1 == true and rag2 == true then
  7505. oogabooga()
  7506. end
  7507. end
  7508. if key == "g" then
  7509. rag2 = true
  7510. if rag1 == true and rag2 == true then
  7511. oogabooga()
  7512. end
  7513. end
  7514. end)
  7515. mouse.KeyUp:connect(function(key)
  7516. if key == "r" then
  7517. rag1 = false
  7518. end
  7519. if key == "g" then
  7520. rag2 = false
  7521. end
  7522. end)
  7523.  
  7524. handle.ChildAdded:connect(function(child)
  7525. if child:IsA('BasePart') then
  7526. child.CanCollide = false
  7527. if child.Name == "blade" then
  7528. child.Touched:connect(function(hit)
  7529. if blademode == "katana" and swinging then
  7530. if gettingeem then
  7531. if goteem == nil then
  7532. if hit.Parent:FindFirstChildOfClass('Humanoid') and hit.Parent:FindFirstChildOfClass('Humanoid').Health > 0 and hit.Parent ~= char then
  7533. local sounn = Instance.new("Sound", char.Torso)
  7534. local lipp = math.random(1, 3)
  7535. if lipp == 1 then sounn.SoundId = "rbxassetid://444667844" end
  7536. if lipp == 2 then sounn.SoundId = "rbxassetid://444667824" end
  7537. if lipp == 3 then sounn.SoundId = "rbxassetid://444667859" end
  7538. sounn:Play()
  7539. goteem = hit.Parent
  7540. pcall(function()
  7541. goteem.HumanoidRootPart:Destroy()
  7542. end)
  7543. pcall(function()
  7544. ragdollpart(goteem,"Right Arm")
  7545. ragdollpart(goteem,"Right Leg")
  7546. ragdollpart(goteem,"Left Arm")
  7547. ragdollpart(goteem,"Left Leg")
  7548. end)
  7549. pcall(function()
  7550. ragdollpart(goteem,"RightUpperArm")
  7551. ragdollpart(goteem,"RightUpperLeg")
  7552. ragdollpart(goteem,"LeftUpperArm")
  7553. ragdollpart(goteem,"LeftUpperLeg")
  7554. end)
  7555. pcall(function()
  7556. local weld = Instance.new('Weld',goteem.Torso)
  7557. weld.Part0 = goteem.Torso
  7558. weld.Part1 = handle
  7559. weld.C0 = CFrame.new(0,0,2)*CFrame.Angles(math.rad(90),0,math.rad(-90))
  7560. end)
  7561. pcall(function()
  7562. local weld = Instance.new('Weld',goteem.UpperTorso)
  7563. weld.Part0 = goteem.UpperTorso
  7564. weld.Part1 = handle
  7565. weld.C0 = CFrame.new(0,0,2)*CFrame.Angles(math.rad(90),0,math.rad(-90))
  7566. end)
  7567. pcall(function()
  7568. local thang = "Torso"
  7569. if goteem:FindFirstChild('UpperTorso') then
  7570. thang = "UpperTorso"
  7571. end
  7572. local ayybleed = Instance.new('Part',goteem)
  7573. ayybleed.Size = Vector3.new(0.2,0.2,0.2)
  7574. ayybleed.BrickColor = BrickColor.new('Maroon')
  7575. ayybleed.Material = Enum.Material.SmoothPlastic
  7576. ayybleed.Name = "ayybleed"
  7577. ayybleed.CanCollide = false
  7578. ayybleed.Transparency = 1
  7579. ayybleed.CFrame = goteem[thang].CFrame
  7580. ayybleed:BreakJoints()
  7581. local attachment1 = Instance.new('Attachment',ayybleed)
  7582. attachment1.Position = Vector3.new(0,0,0)
  7583. attachment1.Orientation = Vector3.new(-90, 0, -90)
  7584. local attachment0 = Instance.new('Attachment',goteem[thang])
  7585. if attachment0 and attachment1 then
  7586. local constraint = Instance.new("HingeConstraint")
  7587. constraint.Attachment0 = attachment0
  7588. constraint.Attachment1 = attachment1
  7589. constraint.LimitsEnabled = true
  7590. constraint.UpperAngle = 0
  7591. constraint.LowerAngle = 0
  7592. constraint.Parent = goteem
  7593. end
  7594. local bleedBLEED= coroutine.wrap(function()
  7595. bleed(ayybleed)
  7596. end)
  7597. bleedBLEED()
  7598. end)
  7599. end
  7600. end
  7601. elseif SLESH then
  7602.  
  7603. if hit.Parent and hit.Parent:FindFirstChildOfClass('Humanoid') and hit.Parent:FindFirstChildOfClass('Humanoid').Health > 0 and hit.Parent ~= char then
  7604. local sounn = Instance.new("Sound", char.Torso)
  7605. local lipp = math.random(1, 3)
  7606. if lipp == 1 then sounn.SoundId = "rbxassetid://444667844" end
  7607. if lipp == 2 then sounn.SoundId = "rbxassetid://444667824" end
  7608. if lipp == 3 then sounn.SoundId = "rbxassetid://444667859" end
  7609. sounn:Play()
  7610. ragdollpart(hit.Parent,hit.Name,false)
  7611. end
  7612. else
  7613. if hit.Parent:FindFirstChildOfClass('Humanoid') and hit.Parent:FindFirstChildOfClass('Humanoid').Health > 0 and hit.Parent ~= char then
  7614. local sounn = Instance.new("Sound", char.Torso)
  7615. local lipp = math.random(1, 3)
  7616. if lipp == 1 then sounn.SoundId = "rbxassetid://444667844" end
  7617. if lipp == 2 then sounn.SoundId = "rbxassetid://444667824" end
  7618. if lipp == 3 then sounn.SoundId = "rbxassetid://444667859" end
  7619. sounn:Play()
  7620. swinging = false
  7621. ragdollpart(hit.Parent,"Head",true,false)
  7622. end
  7623. end
  7624. elseif blademode == "knife" then
  7625. if grabbing == true and grabbed == nil then
  7626. if hit.Parent:FindFirstChildOfClass('Humanoid') and hit.Parent:FindFirstChildOfClass('Humanoid').Health > 0 and hit.Parent ~= char then
  7627. grabbed = hit.Parent
  7628.  
  7629. stun(grabbed)
  7630.  
  7631. local grabwelds = Instance.new("Weld", char.Torso)
  7632. grabwelds.Part0 = char.Torso
  7633. pcall(function()
  7634. grabwelds.Part1 = grabbed.Torso
  7635. end)
  7636. pcall(function()
  7637. grabwelds.Part1 = grabbed.UpperTorso
  7638. end)
  7639. grabwelds.C0 = CFrame.new(-0.45, 0, -1)
  7640. grabweld = grabwelds
  7641. end
  7642. end
  7643. end
  7644. end)
  7645. end
  7646. elseif child:IsA("Model") then
  7647. child.ChildAdded:connect(function(dildotip)
  7648. if dildotip:IsA('BasePart') then
  7649. dildotip.Touched:connect(function(hit)
  7650. if MOAN == true then
  7651. if hit.Parent:FindFirstChildOfClass('Humanoid') and hit.Parent:FindFirstChildOfClass('Humanoid').Health > 0 and hit.Parent ~= char then
  7652. local sound = Instance.new('Sound',hit.Parent.Head)
  7653. sound.SoundId = 'rbxassetid://959679286'
  7654. sound.Volume = 5
  7655. sound:Play()
  7656. local sound3 = Instance.new("Sound",hit.Parent.Head)
  7657. sound3.Volume = 5.5
  7658. sound3.SoundId = "rbxassetid://702631545"
  7659. sound3:Play()
  7660. pcall(function()
  7661. for i,v in pairs(hit.Parent.Head:GetChildren()) do
  7662. if v:IsA('Decal') then v:Destroy() end
  7663. end
  7664. end)
  7665. pcall(function()
  7666. local ree=Instance.new('Decal',hit.Parent.Head)
  7667. ree.Name = "face"
  7668. ree.Texture = "rbxassetid://996521543"
  7669. end)
  7670. MOAN = false
  7671. aidsificating = hit.Parent
  7672. for i, v in pairs(handle["pink toy"]:GetChildren()) do
  7673. if v:IsA("Part") then
  7674. v:FindFirstChild("ParticleEmitter"):Destroy()
  7675. end
  7676. end
  7677. end
  7678. end
  7679. end)
  7680. end
  7681. end)
  7682. end
  7683. end)
  7684.  
  7685. mouse.Button1Down:connect(function(jew)
  7686. if usable and working == false and equipped then
  7687. if blademode == "katana" then
  7688. notify()
  7689. katanaswing()
  7690. elseif blademode == "knife" then
  7691. notify()
  7692. if grabbed == nil then
  7693. if mode == "fling" then
  7694. fling()
  7695. else
  7696. grab()
  7697. end
  7698. elseif grabbed ~= nil then
  7699. if mode == "kill" then
  7700. kill()
  7701. elseif mode == "throw" then
  7702. throw()
  7703. elseif mode == "release" then
  7704. release()
  7705. end
  7706. end
  7707. elseif blademode == "dildo" then
  7708. raep()
  7709. end
  7710. end
  7711. end)
  7712.  
  7713. end
  7714. spawned()
  7715.  
  7716. player.CharacterAdded:connect(function()
  7717. spawned()
  7718. end)
  7719. local avgs = {}
  7720.  
  7721. game:GetService('RunService').Heartbeat:connect(function(step)
  7722. local ofps = math.floor((60/(step*60))*10)/10
  7723. if #avgs > 100 then
  7724. table.remove(avgs,1)
  7725. end
  7726. table.insert(avgs,#avgs+1,ofps)
  7727. local fpsa = 0
  7728. for i,v in pairs(avgs) do
  7729. fpsa = fpsa+v
  7730. end
  7731. fpsa = math.floor(fpsa/#avgs)
  7732. fps.Text = 'FPS: '..tostring(fpsa)
  7733. end)
  7734.  
  7735. while true do
  7736. for i,v in pairs(rekt) do
  7737. if v.Parent ~= nil then
  7738. if v:FindFirstChildOfClass('Humanoid') and v:FindFirstChildOfClass('Humanoid').Health>0 then
  7739. for a,c in pairs(v:GetChildren()) do
  7740. if c:IsA('Tool') then
  7741. c.ManualActivationOnly = true
  7742. wait()
  7743. if game:GetService('Players'):GetPlayerFromCharacter(v) then
  7744. c.Parent = game:GetService('Players'):GetPlayerFromCharacter(v).Backpack
  7745. c.ManualActivationOnly = false
  7746. end
  7747. end
  7748. end
  7749. v:FindFirstChildOfClass('Humanoid').PlatformStand = true
  7750. v:FindFirstChildOfClass('Humanoid').Sit = false
  7751. v:FindFirstChildOfClass('Humanoid').JumpPower = 0
  7752. v:FindFirstChildOfClass('Humanoid').WalkSpeed = 0
  7753. v:FindFirstChildOfClass('Humanoid').Name = "hecc"
  7754. else
  7755. table.remove(rekt,i)
  7756. end
  7757. else
  7758. table.remove(rekt,i)
  7759. end
  7760. end
  7761. wait()
  7762. end
  7763. end)
  7764. -- Scripts
Advertisement
Add Comment
Please, Sign In to add comment
Advertisement
Public Pastes
Advertisement
We use cookies for various purposes including analytics. By continuing to use Pastebin, you agree to our use of cookies as described in the Cookies Policy.  OK, I Understand
Not a member of Pastebin yet?
Sign Up, it unlocks many cool features!